diff --git a/.gitattributes b/.gitattributes index 60ac620b85a5b44c6b91dec23a5b8fe3e65ea45e..43fb5da0fa5ab9984623343889f66ec1de8f1a60 100644 --- a/.gitattributes +++ b/.gitattributes @@ -621,3 +621,7 @@ valley/lib/python3.10/site-packages/gradio/templates/cdn/static/img/Duck.glb fil valley/lib/python3.10/site-packages/pandas/core/__pycache__/generic.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text valley/lib/python3.10/site-packages/pandas/core/__pycache__/frame.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text valley/lib/python3.10/site-packages/datasets/__pycache__/iterable_dataset.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text +valley/lib/python3.10/site-packages/numpy/_core/_simd.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text +valley/lib/python3.10/site-packages/numpy/_core/_multiarray_tests.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text +valley/lib/python3.10/site-packages/numpy/_core/_multiarray_umath.cpython-310-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text +valley/lib/python3.10/site-packages/numpy/linalg/__pycache__/_linalg.cpython-310.pyc filter=lfs diff=lfs merge=lfs -text diff --git a/valley/lib/python3.10/site-packages/numpy/_core/__init__.pyi b/valley/lib/python3.10/site-packages/numpy/_core/__init__.pyi new file mode 100644 index 0000000000000000000000000000000000000000..40d9c411b97cf7f9e5df910b7567db9238a61e5d --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/__init__.pyi @@ -0,0 +1,2 @@ +# NOTE: The `np._core` namespace is deliberately kept empty due to it +# being private diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_add_newdocs.py b/valley/lib/python3.10/site-packages/numpy/_core/_add_newdocs.py new file mode 100644 index 0000000000000000000000000000000000000000..3a2bf40d0565598ca44c737e42c0fd903a5b26ce --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_add_newdocs.py @@ -0,0 +1,7089 @@ +""" +This is only meant to add docs to objects defined in C-extension modules. +The purpose is to allow easier editing of the docstrings without +requiring a re-compile. + +NOTE: Many of the methods of ndarray have corresponding functions. + If you update these docstrings, please keep also the ones in + _core/fromnumeric.py, matrixlib/defmatrix.py up-to-date. + +""" + +from numpy._core.function_base import add_newdoc +from numpy._core.overrides import array_function_like_doc + + +############################################################################### +# +# flatiter +# +# flatiter needs a toplevel description +# +############################################################################### + +add_newdoc('numpy._core', 'flatiter', + """ + Flat iterator object to iterate over arrays. + + A `flatiter` iterator is returned by ``x.flat`` for any array `x`. + It allows iterating over the array as if it were a 1-D array, + either in a for-loop or by calling its `next` method. + + Iteration is done in row-major, C-style order (the last + index varying the fastest). The iterator can also be indexed using + basic slicing or advanced indexing. + + See Also + -------- + ndarray.flat : Return a flat iterator over an array. + ndarray.flatten : Returns a flattened copy of an array. + + Notes + ----- + A `flatiter` iterator can not be constructed directly from Python code + by calling the `flatiter` constructor. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2, 3) + >>> fl = x.flat + >>> type(fl) + + >>> for item in fl: + ... print(item) + ... + 0 + 1 + 2 + 3 + 4 + 5 + + >>> fl[2:4] + array([2, 3]) + + """) + +# flatiter attributes + +add_newdoc('numpy._core', 'flatiter', ('base', + """ + A reference to the array that is iterated over. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(5) + >>> fl = x.flat + >>> fl.base is x + True + + """)) + + +add_newdoc('numpy._core', 'flatiter', ('coords', + """ + An N-dimensional tuple of current coordinates. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2, 3) + >>> fl = x.flat + >>> fl.coords + (0, 0) + >>> next(fl) + 0 + >>> fl.coords + (0, 1) + + """)) + + +add_newdoc('numpy._core', 'flatiter', ('index', + """ + Current flat index into the array. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2, 3) + >>> fl = x.flat + >>> fl.index + 0 + >>> next(fl) + 0 + >>> fl.index + 1 + + """)) + +# flatiter functions + +add_newdoc('numpy._core', 'flatiter', ('__array__', + """__array__(type=None) Get array from iterator + + """)) + + +add_newdoc('numpy._core', 'flatiter', ('copy', + """ + copy() + + Get a copy of the iterator as a 1-D array. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2, 3) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> fl = x.flat + >>> fl.copy() + array([0, 1, 2, 3, 4, 5]) + + """)) + + +############################################################################### +# +# nditer +# +############################################################################### + +add_newdoc('numpy._core', 'nditer', + """ + nditer(op, flags=None, op_flags=None, op_dtypes=None, order='K', + casting='safe', op_axes=None, itershape=None, buffersize=0) + + Efficient multi-dimensional iterator object to iterate over arrays. + To get started using this object, see the + :ref:`introductory guide to array iteration `. + + Parameters + ---------- + op : ndarray or sequence of array_like + The array(s) to iterate over. + + flags : sequence of str, optional + Flags to control the behavior of the iterator. + + * ``buffered`` enables buffering when required. + * ``c_index`` causes a C-order index to be tracked. + * ``f_index`` causes a Fortran-order index to be tracked. + * ``multi_index`` causes a multi-index, or a tuple of indices + with one per iteration dimension, to be tracked. + * ``common_dtype`` causes all the operands to be converted to + a common data type, with copying or buffering as necessary. + * ``copy_if_overlap`` causes the iterator to determine if read + operands have overlap with write operands, and make temporary + copies as necessary to avoid overlap. False positives (needless + copying) are possible in some cases. + * ``delay_bufalloc`` delays allocation of the buffers until + a reset() call is made. Allows ``allocate`` operands to + be initialized before their values are copied into the buffers. + * ``external_loop`` causes the ``values`` given to be + one-dimensional arrays with multiple values instead of + zero-dimensional arrays. + * ``grow_inner`` allows the ``value`` array sizes to be made + larger than the buffer size when both ``buffered`` and + ``external_loop`` is used. + * ``ranged`` allows the iterator to be restricted to a sub-range + of the iterindex values. + * ``refs_ok`` enables iteration of reference types, such as + object arrays. + * ``reduce_ok`` enables iteration of ``readwrite`` operands + which are broadcasted, also known as reduction operands. + * ``zerosize_ok`` allows `itersize` to be zero. + op_flags : list of list of str, optional + This is a list of flags for each operand. At minimum, one of + ``readonly``, ``readwrite``, or ``writeonly`` must be specified. + + * ``readonly`` indicates the operand will only be read from. + * ``readwrite`` indicates the operand will be read from and written to. + * ``writeonly`` indicates the operand will only be written to. + * ``no_broadcast`` prevents the operand from being broadcasted. + * ``contig`` forces the operand data to be contiguous. + * ``aligned`` forces the operand data to be aligned. + * ``nbo`` forces the operand data to be in native byte order. + * ``copy`` allows a temporary read-only copy if required. + * ``updateifcopy`` allows a temporary read-write copy if required. + * ``allocate`` causes the array to be allocated if it is None + in the ``op`` parameter. + * ``no_subtype`` prevents an ``allocate`` operand from using a subtype. + * ``arraymask`` indicates that this operand is the mask to use + for selecting elements when writing to operands with the + 'writemasked' flag set. The iterator does not enforce this, + but when writing from a buffer back to the array, it only + copies those elements indicated by this mask. + * ``writemasked`` indicates that only elements where the chosen + ``arraymask`` operand is True will be written to. + * ``overlap_assume_elementwise`` can be used to mark operands that are + accessed only in the iterator order, to allow less conservative + copying when ``copy_if_overlap`` is present. + op_dtypes : dtype or tuple of dtype(s), optional + The required data type(s) of the operands. If copying or buffering + is enabled, the data will be converted to/from their original types. + order : {'C', 'F', 'A', 'K'}, optional + Controls the iteration order. 'C' means C order, 'F' means + Fortran order, 'A' means 'F' order if all the arrays are Fortran + contiguous, 'C' order otherwise, and 'K' means as close to the + order the array elements appear in memory as possible. This also + affects the element memory order of ``allocate`` operands, as they + are allocated to be compatible with iteration order. + Default is 'K'. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur when making a copy + or buffering. Setting this to 'unsafe' is not recommended, + as it can adversely affect accumulations. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + op_axes : list of list of ints, optional + If provided, is a list of ints or None for each operands. + The list of axes for an operand is a mapping from the dimensions + of the iterator to the dimensions of the operand. A value of + -1 can be placed for entries, causing that dimension to be + treated as `newaxis`. + itershape : tuple of ints, optional + The desired shape of the iterator. This allows ``allocate`` operands + with a dimension mapped by op_axes not corresponding to a dimension + of a different operand to get a value not equal to 1 for that + dimension. + buffersize : int, optional + When buffering is enabled, controls the size of the temporary + buffers. Set to 0 for the default value. + + Attributes + ---------- + dtypes : tuple of dtype(s) + The data types of the values provided in `value`. This may be + different from the operand data types if buffering is enabled. + Valid only before the iterator is closed. + finished : bool + Whether the iteration over the operands is finished or not. + has_delayed_bufalloc : bool + If True, the iterator was created with the ``delay_bufalloc`` flag, + and no reset() function was called on it yet. + has_index : bool + If True, the iterator was created with either the ``c_index`` or + the ``f_index`` flag, and the property `index` can be used to + retrieve it. + has_multi_index : bool + If True, the iterator was created with the ``multi_index`` flag, + and the property `multi_index` can be used to retrieve it. + index + When the ``c_index`` or ``f_index`` flag was used, this property + provides access to the index. Raises a ValueError if accessed + and ``has_index`` is False. + iterationneedsapi : bool + Whether iteration requires access to the Python API, for example + if one of the operands is an object array. + iterindex : int + An index which matches the order of iteration. + itersize : int + Size of the iterator. + itviews + Structured view(s) of `operands` in memory, matching the reordered + and optimized iterator access pattern. Valid only before the iterator + is closed. + multi_index + When the ``multi_index`` flag was used, this property + provides access to the index. Raises a ValueError if accessed + accessed and ``has_multi_index`` is False. + ndim : int + The dimensions of the iterator. + nop : int + The number of iterator operands. + operands : tuple of operand(s) + The array(s) to be iterated over. Valid only before the iterator is + closed. + shape : tuple of ints + Shape tuple, the shape of the iterator. + value + Value of ``operands`` at current iteration. Normally, this is a + tuple of array scalars, but if the flag ``external_loop`` is used, + it is a tuple of one dimensional arrays. + + Notes + ----- + `nditer` supersedes `flatiter`. The iterator implementation behind + `nditer` is also exposed by the NumPy C API. + + The Python exposure supplies two iteration interfaces, one which follows + the Python iterator protocol, and another which mirrors the C-style + do-while pattern. The native Python approach is better in most cases, but + if you need the coordinates or index of an iterator, use the C-style pattern. + + Examples + -------- + Here is how we might write an ``iter_add`` function, using the + Python iterator protocol: + + >>> import numpy as np + + >>> def iter_add_py(x, y, out=None): + ... addop = np.add + ... it = np.nditer([x, y, out], [], + ... [['readonly'], ['readonly'], ['writeonly','allocate']]) + ... with it: + ... for (a, b, c) in it: + ... addop(a, b, out=c) + ... return it.operands[2] + + Here is the same function, but following the C-style pattern: + + >>> def iter_add(x, y, out=None): + ... addop = np.add + ... it = np.nditer([x, y, out], [], + ... [['readonly'], ['readonly'], ['writeonly','allocate']]) + ... with it: + ... while not it.finished: + ... addop(it[0], it[1], out=it[2]) + ... it.iternext() + ... return it.operands[2] + + Here is an example outer product function: + + >>> def outer_it(x, y, out=None): + ... mulop = np.multiply + ... it = np.nditer([x, y, out], ['external_loop'], + ... [['readonly'], ['readonly'], ['writeonly', 'allocate']], + ... op_axes=[list(range(x.ndim)) + [-1] * y.ndim, + ... [-1] * x.ndim + list(range(y.ndim)), + ... None]) + ... with it: + ... for (a, b, c) in it: + ... mulop(a, b, out=c) + ... return it.operands[2] + + >>> a = np.arange(2)+1 + >>> b = np.arange(3)+1 + >>> outer_it(a,b) + array([[1, 2, 3], + [2, 4, 6]]) + + Here is an example function which operates like a "lambda" ufunc: + + >>> def luf(lamdaexpr, *args, **kwargs): + ... '''luf(lambdaexpr, op1, ..., opn, out=None, order='K', casting='safe', buffersize=0)''' + ... nargs = len(args) + ... op = (kwargs.get('out',None),) + args + ... it = np.nditer(op, ['buffered','external_loop'], + ... [['writeonly','allocate','no_broadcast']] + + ... [['readonly','nbo','aligned']]*nargs, + ... order=kwargs.get('order','K'), + ... casting=kwargs.get('casting','safe'), + ... buffersize=kwargs.get('buffersize',0)) + ... while not it.finished: + ... it[0] = lamdaexpr(*it[1:]) + ... it.iternext() + ... return it.operands[0] + + >>> a = np.arange(5) + >>> b = np.ones(5) + >>> luf(lambda i,j:i*i + j/2, a, b) + array([ 0.5, 1.5, 4.5, 9.5, 16.5]) + + If operand flags ``"writeonly"`` or ``"readwrite"`` are used the + operands may be views into the original data with the + `WRITEBACKIFCOPY` flag. In this case `nditer` must be used as a + context manager or the `nditer.close` method must be called before + using the result. The temporary data will be written back to the + original data when the :meth:`~object.__exit__` function is called + but not before: + + >>> a = np.arange(6, dtype='i4')[::-2] + >>> with np.nditer(a, [], + ... [['writeonly', 'updateifcopy']], + ... casting='unsafe', + ... op_dtypes=[np.dtype('f4')]) as i: + ... x = i.operands[0] + ... x[:] = [-1, -2, -3] + ... # a still unchanged here + >>> a, x + (array([-1, -2, -3], dtype=int32), array([-1., -2., -3.], dtype=float32)) + + It is important to note that once the iterator is exited, dangling + references (like `x` in the example) may or may not share data with + the original data `a`. If writeback semantics were active, i.e. if + `x.base.flags.writebackifcopy` is `True`, then exiting the iterator + will sever the connection between `x` and `a`, writing to `x` will + no longer write to `a`. If writeback semantics are not active, then + `x.data` will still point at some part of `a.data`, and writing to + one will affect the other. + + Context management and the `close` method appeared in version 1.15.0. + + """) + +# nditer methods + +add_newdoc('numpy._core', 'nditer', ('copy', + """ + copy() + + Get a copy of the iterator in its current state. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(10) + >>> y = x + 1 + >>> it = np.nditer([x, y]) + >>> next(it) + (array(0), array(1)) + >>> it2 = it.copy() + >>> next(it2) + (array(1), array(2)) + + """)) + +add_newdoc('numpy._core', 'nditer', ('operands', + """ + operands[`Slice`] + + The array(s) to be iterated over. Valid only before the iterator is closed. + """)) + +add_newdoc('numpy._core', 'nditer', ('debug_print', + """ + debug_print() + + Print the current state of the `nditer` instance and debug info to stdout. + + """)) + +add_newdoc('numpy._core', 'nditer', ('enable_external_loop', + """ + enable_external_loop() + + When the "external_loop" was not used during construction, but + is desired, this modifies the iterator to behave as if the flag + was specified. + + """)) + +add_newdoc('numpy._core', 'nditer', ('iternext', + """ + iternext() + + Check whether iterations are left, and perform a single internal iteration + without returning the result. Used in the C-style pattern do-while + pattern. For an example, see `nditer`. + + Returns + ------- + iternext : bool + Whether or not there are iterations left. + + """)) + +add_newdoc('numpy._core', 'nditer', ('remove_axis', + """ + remove_axis(i, /) + + Removes axis `i` from the iterator. Requires that the flag "multi_index" + be enabled. + + """)) + +add_newdoc('numpy._core', 'nditer', ('remove_multi_index', + """ + remove_multi_index() + + When the "multi_index" flag was specified, this removes it, allowing + the internal iteration structure to be optimized further. + + """)) + +add_newdoc('numpy._core', 'nditer', ('reset', + """ + reset() + + Reset the iterator to its initial state. + + """)) + +add_newdoc('numpy._core', 'nested_iters', + """ + nested_iters(op, axes, flags=None, op_flags=None, op_dtypes=None, \ + order="K", casting="safe", buffersize=0) + + Create nditers for use in nested loops + + Create a tuple of `nditer` objects which iterate in nested loops over + different axes of the op argument. The first iterator is used in the + outermost loop, the last in the innermost loop. Advancing one will change + the subsequent iterators to point at its new element. + + Parameters + ---------- + op : ndarray or sequence of array_like + The array(s) to iterate over. + + axes : list of list of int + Each item is used as an "op_axes" argument to an nditer + + flags, op_flags, op_dtypes, order, casting, buffersize (optional) + See `nditer` parameters of the same name + + Returns + ------- + iters : tuple of nditer + An nditer for each item in `axes`, outermost first + + See Also + -------- + nditer + + Examples + -------- + + Basic usage. Note how y is the "flattened" version of + [a[:, 0, :], a[:, 1, 0], a[:, 2, :]] since we specified + the first iter's axes as [1] + + >>> import numpy as np + >>> a = np.arange(12).reshape(2, 3, 2) + >>> i, j = np.nested_iters(a, [[1], [0, 2]], flags=["multi_index"]) + >>> for x in i: + ... print(i.multi_index) + ... for y in j: + ... print('', j.multi_index, y) + (0,) + (0, 0) 0 + (0, 1) 1 + (1, 0) 6 + (1, 1) 7 + (1,) + (0, 0) 2 + (0, 1) 3 + (1, 0) 8 + (1, 1) 9 + (2,) + (0, 0) 4 + (0, 1) 5 + (1, 0) 10 + (1, 1) 11 + + """) + +add_newdoc('numpy._core', 'nditer', ('close', + """ + close() + + Resolve all writeback semantics in writeable operands. + + .. versionadded:: 1.15.0 + + See Also + -------- + + :ref:`nditer-context-manager` + + """)) + + +############################################################################### +# +# broadcast +# +############################################################################### + +add_newdoc('numpy._core', 'broadcast', + """ + Produce an object that mimics broadcasting. + + Parameters + ---------- + in1, in2, ... : array_like + Input parameters. + + Returns + ------- + b : broadcast object + Broadcast the input parameters against one another, and + return an object that encapsulates the result. + Amongst others, it has ``shape`` and ``nd`` properties, and + may be used as an iterator. + + See Also + -------- + broadcast_arrays + broadcast_to + broadcast_shapes + + Examples + -------- + + Manually adding two vectors, using broadcasting: + + >>> import numpy as np + >>> x = np.array([[1], [2], [3]]) + >>> y = np.array([4, 5, 6]) + >>> b = np.broadcast(x, y) + + >>> out = np.empty(b.shape) + >>> out.flat = [u+v for (u,v) in b] + >>> out + array([[5., 6., 7.], + [6., 7., 8.], + [7., 8., 9.]]) + + Compare against built-in broadcasting: + + >>> x + y + array([[5, 6, 7], + [6, 7, 8], + [7, 8, 9]]) + + """) + +# attributes + +add_newdoc('numpy._core', 'broadcast', ('index', + """ + current index in broadcasted result + + Examples + -------- + + >>> import numpy as np + >>> x = np.array([[1], [2], [3]]) + >>> y = np.array([4, 5, 6]) + >>> b = np.broadcast(x, y) + >>> b.index + 0 + >>> next(b), next(b), next(b) + ((1, 4), (1, 5), (1, 6)) + >>> b.index + 3 + + """)) + +add_newdoc('numpy._core', 'broadcast', ('iters', + """ + tuple of iterators along ``self``'s "components." + + Returns a tuple of `numpy.flatiter` objects, one for each "component" + of ``self``. + + See Also + -------- + numpy.flatiter + + Examples + -------- + + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> row, col = b.iters + >>> next(row), next(col) + (1, 4) + + """)) + +add_newdoc('numpy._core', 'broadcast', ('ndim', + """ + Number of dimensions of broadcasted result. Alias for `nd`. + + .. versionadded:: 1.12.0 + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.ndim + 2 + + """)) + +add_newdoc('numpy._core', 'broadcast', ('nd', + """ + Number of dimensions of broadcasted result. For code intended for NumPy + 1.12.0 and later the more consistent `ndim` is preferred. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.nd + 2 + + """)) + +add_newdoc('numpy._core', 'broadcast', ('numiter', + """ + Number of iterators possessed by the broadcasted result. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.numiter + 2 + + """)) + +add_newdoc('numpy._core', 'broadcast', ('shape', + """ + Shape of broadcasted result. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.shape + (3, 3) + + """)) + +add_newdoc('numpy._core', 'broadcast', ('size', + """ + Total size of broadcasted result. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.size + 9 + + """)) + +add_newdoc('numpy._core', 'broadcast', ('reset', + """ + reset() + + Reset the broadcasted result's iterator(s). + + Parameters + ---------- + None + + Returns + ------- + None + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> y = np.array([[4], [5], [6]]) + >>> b = np.broadcast(x, y) + >>> b.index + 0 + >>> next(b), next(b), next(b) + ((1, 4), (2, 4), (3, 4)) + >>> b.index + 3 + >>> b.reset() + >>> b.index + 0 + + """)) + +############################################################################### +# +# numpy functions +# +############################################################################### + +add_newdoc('numpy._core.multiarray', 'array', + """ + array(object, dtype=None, *, copy=True, order='K', subok=False, ndmin=0, + like=None) + + Create an array. + + Parameters + ---------- + object : array_like + An array, any object exposing the array interface, an object whose + ``__array__`` method returns an array, or any (nested) sequence. + If object is a scalar, a 0-dimensional array containing object is + returned. + dtype : data-type, optional + The desired data-type for the array. If not given, NumPy will try to use + a default ``dtype`` that can represent the values (by applying promotion + rules when necessary.) + copy : bool, optional + If ``True`` (default), then the array data is copied. If ``None``, + a copy will only be made if ``__array__`` returns a copy, if obj is + a nested sequence, or if a copy is needed to satisfy any of the other + requirements (``dtype``, ``order``, etc.). Note that any copy of + the data is shallow, i.e., for arrays with object dtype, the new + array will point to the same objects. See Examples for `ndarray.copy`. + For ``False`` it raises a ``ValueError`` if a copy cannot be avoided. + Default: ``True``. + order : {'K', 'A', 'C', 'F'}, optional + Specify the memory layout of the array. If object is not an array, the + newly created array will be in C order (row major) unless 'F' is + specified, in which case it will be in Fortran order (column major). + If object is an array the following holds. + + ===== ========= =================================================== + order no copy copy=True + ===== ========= =================================================== + 'K' unchanged F & C order preserved, otherwise most similar order + 'A' unchanged F order if input is F and not C, otherwise C order + 'C' C order C order + 'F' F order F order + ===== ========= =================================================== + + When ``copy=None`` and a copy is made for other reasons, the result is + the same as if ``copy=True``, with some exceptions for 'A', see the + Notes section. The default order is 'K'. + subok : bool, optional + If True, then sub-classes will be passed-through, otherwise + the returned array will be forced to be a base-class array (default). + ndmin : int, optional + Specifies the minimum number of dimensions that the resulting + array should have. Ones will be prepended to the shape as + needed to meet this requirement. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + An array object satisfying the specified requirements. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones_like : Return an array of ones with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full_like : Return a new array with shape of input filled with value. + empty : Return a new uninitialized array. + ones : Return a new array setting values to one. + zeros : Return a new array setting values to zero. + full : Return a new array of given shape filled with value. + copy: Return an array copy of the given object. + + + Notes + ----- + When order is 'A' and ``object`` is an array in neither 'C' nor 'F' order, + and a copy is forced by a change in dtype, then the order of the result is + not necessarily 'C' as expected. This is likely a bug. + + Examples + -------- + >>> import numpy as np + >>> np.array([1, 2, 3]) + array([1, 2, 3]) + + Upcasting: + + >>> np.array([1, 2, 3.0]) + array([ 1., 2., 3.]) + + More than one dimension: + + >>> np.array([[1, 2], [3, 4]]) + array([[1, 2], + [3, 4]]) + + Minimum dimensions 2: + + >>> np.array([1, 2, 3], ndmin=2) + array([[1, 2, 3]]) + + Type provided: + + >>> np.array([1, 2, 3], dtype=complex) + array([ 1.+0.j, 2.+0.j, 3.+0.j]) + + Data-type consisting of more than one element: + + >>> x = np.array([(1,2),(3,4)],dtype=[('a','>> x['a'] + array([1, 3]) + + Creating an array from sub-classes: + + >>> np.array(np.asmatrix('1 2; 3 4')) + array([[1, 2], + [3, 4]]) + + >>> np.array(np.asmatrix('1 2; 3 4'), subok=True) + matrix([[1, 2], + [3, 4]]) + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'asarray', + """ + asarray(a, dtype=None, order=None, *, device=None, copy=None, like=None) + + Convert the input to an array. + + Parameters + ---------- + a : array_like + Input data, in any form that can be converted to an array. This + includes lists, lists of tuples, tuples, tuples of tuples, tuples + of lists and ndarrays. + dtype : data-type, optional + By default, the data-type is inferred from the input data. + order : {'C', 'F', 'A', 'K'}, optional + Memory layout. 'A' and 'K' depend on the order of input array a. + 'C' row-major (C-style), + 'F' column-major (Fortran-style) memory representation. + 'A' (any) means 'F' if `a` is Fortran contiguous, 'C' otherwise + 'K' (keep) preserve input order + Defaults to 'K'. + device : str, optional + The device on which to place the created array. Default: ``None``. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + copy : bool, optional + If ``True``, then the object is copied. If ``None`` then the object is + copied only if needed, i.e. if ``__array__`` returns a copy, if obj + is a nested sequence, or if a copy is needed to satisfy any of + the other requirements (``dtype``, ``order``, etc.). + For ``False`` it raises a ``ValueError`` if a copy cannot be avoided. + Default: ``None``. + + .. versionadded:: 2.0.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array interpretation of ``a``. No copy is performed if the input + is already an ndarray with matching dtype and order. If ``a`` is a + subclass of ndarray, a base class ndarray is returned. + + See Also + -------- + asanyarray : Similar function which passes through subclasses. + ascontiguousarray : Convert input to a contiguous array. + asfortranarray : Convert input to an ndarray with column-major + memory order. + asarray_chkfinite : Similar function which checks input for NaNs and Infs. + fromiter : Create an array from an iterator. + fromfunction : Construct an array by executing a function on grid + positions. + + Examples + -------- + Convert a list into an array: + + >>> a = [1, 2] + >>> import numpy as np + >>> np.asarray(a) + array([1, 2]) + + Existing arrays are not copied: + + >>> a = np.array([1, 2]) + >>> np.asarray(a) is a + True + + If `dtype` is set, array is copied only if dtype does not match: + + >>> a = np.array([1, 2], dtype=np.float32) + >>> np.shares_memory(np.asarray(a, dtype=np.float32), a) + True + >>> np.shares_memory(np.asarray(a, dtype=np.float64), a) + False + + Contrary to `asanyarray`, ndarray subclasses are not passed through: + + >>> issubclass(np.recarray, np.ndarray) + True + >>> a = np.array([(1., 2), (3., 4)], dtype='f4,i4').view(np.recarray) + >>> np.asarray(a) is a + False + >>> np.asanyarray(a) is a + True + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'asanyarray', + """ + asanyarray(a, dtype=None, order=None, *, like=None) + + Convert the input to an ndarray, but pass ndarray subclasses through. + + Parameters + ---------- + a : array_like + Input data, in any form that can be converted to an array. This + includes scalars, lists, lists of tuples, tuples, tuples of tuples, + tuples of lists, and ndarrays. + dtype : data-type, optional + By default, the data-type is inferred from the input data. + order : {'C', 'F', 'A', 'K'}, optional + Memory layout. 'A' and 'K' depend on the order of input array a. + 'C' row-major (C-style), + 'F' column-major (Fortran-style) memory representation. + 'A' (any) means 'F' if `a` is Fortran contiguous, 'C' otherwise + 'K' (keep) preserve input order + Defaults to 'C'. + device : str, optional + The device on which to place the created array. Default: ``None``. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.1.0 + + copy : bool, optional + If ``True``, then the object is copied. If ``None`` then the object is + copied only if needed, i.e. if ``__array__`` returns a copy, if obj + is a nested sequence, or if a copy is needed to satisfy any of + the other requirements (``dtype``, ``order``, etc.). + For ``False`` it raises a ``ValueError`` if a copy cannot be avoided. + Default: ``None``. + + .. versionadded:: 2.1.0 + + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray or an ndarray subclass + Array interpretation of `a`. If `a` is an ndarray or a subclass + of ndarray, it is returned as-is and no copy is performed. + + See Also + -------- + asarray : Similar function which always returns ndarrays. + ascontiguousarray : Convert input to a contiguous array. + asfortranarray : Convert input to an ndarray with column-major + memory order. + asarray_chkfinite : Similar function which checks input for NaNs and + Infs. + fromiter : Create an array from an iterator. + fromfunction : Construct an array by executing a function on grid + positions. + + Examples + -------- + Convert a list into an array: + + >>> a = [1, 2] + >>> import numpy as np + >>> np.asanyarray(a) + array([1, 2]) + + Instances of `ndarray` subclasses are passed through as-is: + + >>> a = np.array([(1., 2), (3., 4)], dtype='f4,i4').view(np.recarray) + >>> np.asanyarray(a) is a + True + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'ascontiguousarray', + """ + ascontiguousarray(a, dtype=None, *, like=None) + + Return a contiguous array (ndim >= 1) in memory (C order). + + Parameters + ---------- + a : array_like + Input array. + dtype : str or dtype object, optional + Data-type of returned array. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Contiguous array of same shape and content as `a`, with type `dtype` + if specified. + + See Also + -------- + asfortranarray : Convert input to an ndarray with column-major + memory order. + require : Return an ndarray that satisfies requirements. + ndarray.flags : Information about the memory layout of the array. + + Examples + -------- + Starting with a Fortran-contiguous array: + + >>> import numpy as np + >>> x = np.ones((2, 3), order='F') + >>> x.flags['F_CONTIGUOUS'] + True + + Calling ``ascontiguousarray`` makes a C-contiguous copy: + + >>> y = np.ascontiguousarray(x) + >>> y.flags['C_CONTIGUOUS'] + True + >>> np.may_share_memory(x, y) + False + + Now, starting with a C-contiguous array: + + >>> x = np.ones((2, 3), order='C') + >>> x.flags['C_CONTIGUOUS'] + True + + Then, calling ``ascontiguousarray`` returns the same object: + + >>> y = np.ascontiguousarray(x) + >>> x is y + True + + Note: This function returns an array with at least one-dimension (1-d) + so it will not preserve 0-d arrays. + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'asfortranarray', + """ + asfortranarray(a, dtype=None, *, like=None) + + Return an array (ndim >= 1) laid out in Fortran order in memory. + + Parameters + ---------- + a : array_like + Input array. + dtype : str or dtype object, optional + By default, the data-type is inferred from the input data. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + The input `a` in Fortran, or column-major, order. + + See Also + -------- + ascontiguousarray : Convert input to a contiguous (C order) array. + asanyarray : Convert input to an ndarray with either row or + column-major memory order. + require : Return an ndarray that satisfies requirements. + ndarray.flags : Information about the memory layout of the array. + + Examples + -------- + Starting with a C-contiguous array: + + >>> import numpy as np + >>> x = np.ones((2, 3), order='C') + >>> x.flags['C_CONTIGUOUS'] + True + + Calling ``asfortranarray`` makes a Fortran-contiguous copy: + + >>> y = np.asfortranarray(x) + >>> y.flags['F_CONTIGUOUS'] + True + >>> np.may_share_memory(x, y) + False + + Now, starting with a Fortran-contiguous array: + + >>> x = np.ones((2, 3), order='F') + >>> x.flags['F_CONTIGUOUS'] + True + + Then, calling ``asfortranarray`` returns the same object: + + >>> y = np.asfortranarray(x) + >>> x is y + True + + Note: This function returns an array with at least one-dimension (1-d) + so it will not preserve 0-d arrays. + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'empty', + """ + empty(shape, dtype=float, order='C', *, device=None, like=None) + + Return a new array of given shape and type, without initializing entries. + + Parameters + ---------- + shape : int or tuple of int + Shape of the empty array, e.g., ``(2, 3)`` or ``2``. + dtype : data-type, optional + Desired output data-type for the array, e.g, `numpy.int8`. Default is + `numpy.float64`. + order : {'C', 'F'}, optional, default: 'C' + Whether to store multi-dimensional data in row-major + (C-style) or column-major (Fortran-style) order in + memory. + device : str, optional + The device on which to place the created array. Default: ``None``. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of uninitialized (arbitrary) data of the given shape, dtype, and + order. Object arrays will be initialized to None. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones : Return a new array setting values to one. + zeros : Return a new array setting values to zero. + full : Return a new array of given shape filled with value. + + Notes + ----- + Unlike other array creation functions (e.g. `zeros`, `ones`, `full`), + `empty` does not initialize the values of the array, and may therefore be + marginally faster. However, the values stored in the newly allocated array + are arbitrary. For reproducible behavior, be sure to set each element of + the array before reading. + + Examples + -------- + >>> import numpy as np + >>> np.empty([2, 2]) + array([[ -9.74499359e+001, 6.69583040e-309], + [ 2.13182611e-314, 3.06959433e-309]]) #uninitialized + + >>> np.empty([2, 2], dtype=int) + array([[-1073741821, -1067949133], + [ 496041986, 19249760]]) #uninitialized + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'scalar', + """ + scalar(dtype, obj) + + Return a new scalar array of the given type initialized with obj. + + This function is meant mainly for pickle support. `dtype` must be a + valid data-type descriptor. If `dtype` corresponds to an object + descriptor, then `obj` can be any object, otherwise `obj` must be a + string. If `obj` is not given, it will be interpreted as None for object + type and as zeros for all other types. + + """) + +add_newdoc('numpy._core.multiarray', 'zeros', + """ + zeros(shape, dtype=float, order='C', *, like=None) + + Return a new array of given shape and type, filled with zeros. + + Parameters + ---------- + shape : int or tuple of ints + Shape of the new array, e.g., ``(2, 3)`` or ``2``. + dtype : data-type, optional + The desired data-type for the array, e.g., `numpy.int8`. Default is + `numpy.float64`. + order : {'C', 'F'}, optional, default: 'C' + Whether to store multi-dimensional data in row-major + (C-style) or column-major (Fortran-style) order in + memory. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of zeros with the given shape, dtype, and order. + + See Also + -------- + zeros_like : Return an array of zeros with shape and type of input. + empty : Return a new uninitialized array. + ones : Return a new array setting values to one. + full : Return a new array of given shape filled with value. + + Examples + -------- + >>> import numpy as np + >>> np.zeros(5) + array([ 0., 0., 0., 0., 0.]) + + >>> np.zeros((5,), dtype=int) + array([0, 0, 0, 0, 0]) + + >>> np.zeros((2, 1)) + array([[ 0.], + [ 0.]]) + + >>> s = (2,2) + >>> np.zeros(s) + array([[ 0., 0.], + [ 0., 0.]]) + + >>> np.zeros((2,), dtype=[('x', 'i4'), ('y', 'i4')]) # custom dtype + array([(0, 0), (0, 0)], + dtype=[('x', '>> import numpy as np + >>> np.fromstring('1 2', dtype=int, sep=' ') + array([1, 2]) + >>> np.fromstring('1, 2', dtype=int, sep=',') + array([1, 2]) + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'compare_chararrays', + """ + compare_chararrays(a1, a2, cmp, rstrip) + + Performs element-wise comparison of two string arrays using the + comparison operator specified by `cmp`. + + Parameters + ---------- + a1, a2 : array_like + Arrays to be compared. + cmp : {"<", "<=", "==", ">=", ">", "!="} + Type of comparison. + rstrip : Boolean + If True, the spaces at the end of Strings are removed before the comparison. + + Returns + ------- + out : ndarray + The output array of type Boolean with the same shape as a and b. + + Raises + ------ + ValueError + If `cmp` is not valid. + TypeError + If at least one of `a` or `b` is a non-string array + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["a", "b", "cde"]) + >>> b = np.array(["a", "a", "dec"]) + >>> np.char.compare_chararrays(a, b, ">", True) + array([False, True, False]) + + """) + +add_newdoc('numpy._core.multiarray', 'fromiter', + """ + fromiter(iter, dtype, count=-1, *, like=None) + + Create a new 1-dimensional array from an iterable object. + + Parameters + ---------- + iter : iterable object + An iterable object providing data for the array. + dtype : data-type + The data-type of the returned array. + + .. versionchanged:: 1.23 + Object and subarray dtypes are now supported (note that the final + result is not 1-D for a subarray dtype). + + count : int, optional + The number of items to read from *iterable*. The default is -1, + which means all data is read. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + The output array. + + Notes + ----- + Specify `count` to improve performance. It allows ``fromiter`` to + pre-allocate the output array, instead of resizing it on demand. + + Examples + -------- + >>> import numpy as np + >>> iterable = (x*x for x in range(5)) + >>> np.fromiter(iterable, float) + array([ 0., 1., 4., 9., 16.]) + + A carefully constructed subarray dtype will lead to higher dimensional + results: + + >>> iterable = ((x+1, x+2) for x in range(5)) + >>> np.fromiter(iterable, dtype=np.dtype((int, 2))) + array([[1, 2], + [2, 3], + [3, 4], + [4, 5], + [5, 6]]) + + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'fromfile', + """ + fromfile(file, dtype=float, count=-1, sep='', offset=0, *, like=None) + + Construct an array from data in a text or binary file. + + A highly efficient way of reading binary data with a known data-type, + as well as parsing simply formatted text files. Data written using the + `tofile` method can be read using this function. + + Parameters + ---------- + file : file or str or Path + Open file object or filename. + + .. versionchanged:: 1.17.0 + `pathlib.Path` objects are now accepted. + + dtype : data-type + Data type of the returned array. + For binary files, it is used to determine the size and byte-order + of the items in the file. + Most builtin numeric types are supported and extension types may be supported. + + .. versionadded:: 1.18.0 + Complex dtypes. + + count : int + Number of items to read. ``-1`` means all items (i.e., the complete + file). + sep : str + Separator between items if file is a text file. + Empty ("") separator means the file should be treated as binary. + Spaces (" ") in the separator match zero or more whitespace characters. + A separator consisting only of spaces must match at least one + whitespace. + offset : int + The offset (in bytes) from the file's current position. Defaults to 0. + Only permitted for binary files. + + .. versionadded:: 1.17.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + See also + -------- + load, save + ndarray.tofile + loadtxt : More flexible way of loading data from a text file. + + Notes + ----- + Do not rely on the combination of `tofile` and `fromfile` for + data storage, as the binary files generated are not platform + independent. In particular, no byte-order or data-type information is + saved. Data can be stored in the platform independent ``.npy`` format + using `save` and `load` instead. + + Examples + -------- + Construct an ndarray: + + >>> import numpy as np + >>> dt = np.dtype([('time', [('min', np.int64), ('sec', np.int64)]), + ... ('temp', float)]) + >>> x = np.zeros((1,), dtype=dt) + >>> x['time']['min'] = 10; x['temp'] = 98.25 + >>> x + array([((10, 0), 98.25)], + dtype=[('time', [('min', '>> import tempfile + >>> fname = tempfile.mkstemp()[1] + >>> x.tofile(fname) + + Read the raw data from disk: + + >>> np.fromfile(fname, dtype=dt) + array([((10, 0), 98.25)], + dtype=[('time', [('min', '>> np.save(fname, x) + >>> np.load(fname + '.npy') + array([((10, 0), 98.25)], + dtype=[('time', [('min', '>> dt = np.dtype(int) + >>> dt = dt.newbyteorder('>') + >>> np.frombuffer(buf, dtype=dt) # doctest: +SKIP + + The data of the resulting array will not be byteswapped, but will be + interpreted correctly. + + This function creates a view into the original object. This should be safe + in general, but it may make sense to copy the result when the original + object is mutable or untrusted. + + Examples + -------- + >>> import numpy as np + >>> s = b'hello world' + >>> np.frombuffer(s, dtype='S1', count=5, offset=6) + array([b'w', b'o', b'r', b'l', b'd'], dtype='|S1') + + >>> np.frombuffer(b'\\x01\\x02', dtype=np.uint8) + array([1, 2], dtype=uint8) + >>> np.frombuffer(b'\\x01\\x02\\x03\\x04\\x05', dtype=np.uint8, count=3) + array([1, 2, 3], dtype=uint8) + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', 'from_dlpack', + """ + from_dlpack(x, /, *, device=None, copy=None) + + Create a NumPy array from an object implementing the ``__dlpack__`` + protocol. Generally, the returned NumPy array is a read-only view + of the input object. See [1]_ and [2]_ for more details. + + Parameters + ---------- + x : object + A Python object that implements the ``__dlpack__`` and + ``__dlpack_device__`` methods. + device : device, optional + Device on which to place the created array. Default: ``None``. + Must be ``"cpu"`` if passed which may allow importing an array + that is not already CPU available. + copy : bool, optional + Boolean indicating whether or not to copy the input. If ``True``, + the copy will be made. If ``False``, the function will never copy, + and will raise ``BufferError`` in case a copy is deemed necessary. + Passing it requests a copy from the exporter who may or may not + implement the capability. + If ``None``, the function will reuse the existing memory buffer if + possible and copy otherwise. Default: ``None``. + + + Returns + ------- + out : ndarray + + References + ---------- + .. [1] Array API documentation, + https://data-apis.org/array-api/latest/design_topics/data_interchange.html#syntax-for-data-interchange-with-dlpack + + .. [2] Python specification for DLPack, + https://dmlc.github.io/dlpack/latest/python_spec.html + + Examples + -------- + >>> import torch # doctest: +SKIP + >>> x = torch.arange(10) # doctest: +SKIP + >>> # create a view of the torch tensor "x" in NumPy + >>> y = np.from_dlpack(x) # doctest: +SKIP + """) + +add_newdoc('numpy._core.multiarray', 'correlate', + """cross_correlate(a,v, mode=0)""") + +add_newdoc('numpy._core.multiarray', 'arange', + """ + arange([start,] stop[, step,], dtype=None, *, device=None, like=None) + + Return evenly spaced values within a given interval. + + ``arange`` can be called with a varying number of positional arguments: + + * ``arange(stop)``: Values are generated within the half-open interval + ``[0, stop)`` (in other words, the interval including `start` but + excluding `stop`). + * ``arange(start, stop)``: Values are generated within the half-open + interval ``[start, stop)``. + * ``arange(start, stop, step)`` Values are generated within the half-open + interval ``[start, stop)``, with spacing between values given by + ``step``. + + For integer arguments the function is roughly equivalent to the Python + built-in :py:class:`range`, but returns an ndarray rather than a ``range`` + instance. + + When using a non-integer step, such as 0.1, it is often better to use + `numpy.linspace`. + + See the Warning sections below for more information. + + Parameters + ---------- + start : integer or real, optional + Start of interval. The interval includes this value. The default + start value is 0. + stop : integer or real + End of interval. The interval does not include this value, except + in some cases where `step` is not an integer and floating point + round-off affects the length of `out`. + step : integer or real, optional + Spacing between values. For any output `out`, this is the distance + between two adjacent values, ``out[i+1] - out[i]``. The default + step size is 1. If `step` is specified as a position argument, + `start` must also be given. + dtype : dtype, optional + The type of the output array. If `dtype` is not given, infer the data + type from the other input arguments. + device : str, optional + The device on which to place the created array. Default: ``None``. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + arange : ndarray + Array of evenly spaced values. + + For floating point arguments, the length of the result is + ``ceil((stop - start)/step)``. Because of floating point overflow, + this rule may result in the last element of `out` being greater + than `stop`. + + Warnings + -------- + The length of the output might not be numerically stable. + + Another stability issue is due to the internal implementation of + `numpy.arange`. + The actual step value used to populate the array is + ``dtype(start + step) - dtype(start)`` and not `step`. Precision loss + can occur here, due to casting or due to using floating points when + `start` is much larger than `step`. This can lead to unexpected + behaviour. For example:: + + >>> np.arange(0, 5, 0.5, dtype=int) + array([0, 0, 0, 0, 0, 0, 0, 0, 0, 0]) + >>> np.arange(-3, 3, 0.5, dtype=int) + array([-3, -2, -1, 0, 1, 2, 3, 4, 5, 6, 7, 8]) + + In such cases, the use of `numpy.linspace` should be preferred. + + The built-in :py:class:`range` generates :std:doc:`Python built-in integers + that have arbitrary size `, while `numpy.arange` + produces `numpy.int32` or `numpy.int64` numbers. This may result in + incorrect results for large integer values:: + + >>> power = 40 + >>> modulo = 10000 + >>> x1 = [(n ** power) % modulo for n in range(8)] + >>> x2 = [(n ** power) % modulo for n in np.arange(8)] + >>> print(x1) + [0, 1, 7776, 8801, 6176, 625, 6576, 4001] # correct + >>> print(x2) + [0, 1, 7776, 7185, 0, 5969, 4816, 3361] # incorrect + + See Also + -------- + numpy.linspace : Evenly spaced numbers with careful handling of endpoints. + numpy.ogrid: Arrays of evenly spaced numbers in N-dimensions. + numpy.mgrid: Grid-shaped arrays of evenly spaced numbers in N-dimensions. + :ref:`how-to-partition` + + Examples + -------- + >>> import numpy as np + >>> np.arange(3) + array([0, 1, 2]) + >>> np.arange(3.0) + array([ 0., 1., 2.]) + >>> np.arange(3,7) + array([3, 4, 5, 6]) + >>> np.arange(3,7,2) + array([3, 5]) + + """.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + )) + +add_newdoc('numpy._core.multiarray', '_get_ndarray_c_version', + """_get_ndarray_c_version() + + Return the compile time NPY_VERSION (formerly called NDARRAY_VERSION) number. + + """) + +add_newdoc('numpy._core.multiarray', '_reconstruct', + """_reconstruct(subtype, shape, dtype) + + Construct an empty array. Used by Pickles. + + """) + +add_newdoc('numpy._core.multiarray', 'promote_types', + """ + promote_types(type1, type2) + + Returns the data type with the smallest size and smallest scalar + kind to which both ``type1`` and ``type2`` may be safely cast. + The returned data type is always considered "canonical", this mainly + means that the promoted dtype will always be in native byte order. + + This function is symmetric, but rarely associative. + + Parameters + ---------- + type1 : dtype or dtype specifier + First data type. + type2 : dtype or dtype specifier + Second data type. + + Returns + ------- + out : dtype + The promoted data type. + + Notes + ----- + Please see `numpy.result_type` for additional information about promotion. + + .. versionadded:: 1.6.0 + + Starting in NumPy 1.9, promote_types function now returns a valid string + length when given an integer or float dtype as one argument and a string + dtype as another argument. Previously it always returned the input string + dtype, even if it wasn't long enough to store the max integer/float value + converted to a string. + + .. versionchanged:: 1.23.0 + + NumPy now supports promotion for more structured dtypes. It will now + remove unnecessary padding from a structure dtype and promote included + fields individually. + + See Also + -------- + result_type, dtype, can_cast + + Examples + -------- + >>> import numpy as np + >>> np.promote_types('f4', 'f8') + dtype('float64') + + >>> np.promote_types('i8', 'f4') + dtype('float64') + + >>> np.promote_types('>i8', '>> np.promote_types('i4', 'S8') + dtype('S11') + + An example of a non-associative case: + + >>> p = np.promote_types + >>> p('S', p('i1', 'u1')) + dtype('S6') + >>> p(p('S', 'i1'), 'u1') + dtype('S4') + + """) + +add_newdoc('numpy._core.multiarray', 'c_einsum', + """ + c_einsum(subscripts, *operands, out=None, dtype=None, order='K', + casting='safe') + + *This documentation shadows that of the native python implementation of the `einsum` function, + except all references and examples related to the `optimize` argument (v 0.12.0) have been removed.* + + Evaluates the Einstein summation convention on the operands. + + Using the Einstein summation convention, many common multi-dimensional, + linear algebraic array operations can be represented in a simple fashion. + In *implicit* mode `einsum` computes these values. + + In *explicit* mode, `einsum` provides further flexibility to compute + other array operations that might not be considered classical Einstein + summation operations, by disabling, or forcing summation over specified + subscript labels. + + See the notes and examples for clarification. + + Parameters + ---------- + subscripts : str + Specifies the subscripts for summation as comma separated list of + subscript labels. An implicit (classical Einstein summation) + calculation is performed unless the explicit indicator '->' is + included as well as subscript labels of the precise output form. + operands : list of array_like + These are the arrays for the operation. + out : ndarray, optional + If provided, the calculation is done into this array. + dtype : {data-type, None}, optional + If provided, forces the calculation to use the data type specified. + Note that you may have to also give a more liberal `casting` + parameter to allow the conversions. Default is None. + order : {'C', 'F', 'A', 'K'}, optional + Controls the memory layout of the output. 'C' means it should + be C contiguous. 'F' means it should be Fortran contiguous, + 'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise. + 'K' means it should be as close to the layout of the inputs as + is possible, including arbitrarily permuted axes. + Default is 'K'. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Setting this to + 'unsafe' is not recommended, as it can adversely affect accumulations. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + + Default is 'safe'. + optimize : {False, True, 'greedy', 'optimal'}, optional + Controls if intermediate optimization should occur. No optimization + will occur if False and True will default to the 'greedy' algorithm. + Also accepts an explicit contraction list from the ``np.einsum_path`` + function. See ``np.einsum_path`` for more details. Defaults to False. + + Returns + ------- + output : ndarray + The calculation based on the Einstein summation convention. + + See Also + -------- + einsum_path, dot, inner, outer, tensordot, linalg.multi_dot + + Notes + ----- + .. versionadded:: 1.6.0 + + The Einstein summation convention can be used to compute + many multi-dimensional, linear algebraic array operations. `einsum` + provides a succinct way of representing these. + + A non-exhaustive list of these operations, + which can be computed by `einsum`, is shown below along with examples: + + * Trace of an array, :py:func:`numpy.trace`. + * Return a diagonal, :py:func:`numpy.diag`. + * Array axis summations, :py:func:`numpy.sum`. + * Transpositions and permutations, :py:func:`numpy.transpose`. + * Matrix multiplication and dot product, :py:func:`numpy.matmul` :py:func:`numpy.dot`. + * Vector inner and outer products, :py:func:`numpy.inner` :py:func:`numpy.outer`. + * Broadcasting, element-wise and scalar multiplication, :py:func:`numpy.multiply`. + * Tensor contractions, :py:func:`numpy.tensordot`. + * Chained array operations, in efficient calculation order, :py:func:`numpy.einsum_path`. + + The subscripts string is a comma-separated list of subscript labels, + where each label refers to a dimension of the corresponding operand. + Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)`` + is equivalent to :py:func:`np.inner(a,b) `. If a label + appears only once, it is not summed, so ``np.einsum('i', a)`` produces a + view of ``a`` with no changes. A further example ``np.einsum('ij,jk', a, b)`` + describes traditional matrix multiplication and is equivalent to + :py:func:`np.matmul(a,b) `. Repeated subscript labels in one + operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent + to :py:func:`np.trace(a) `. + + In *implicit mode*, the chosen subscripts are important + since the axes of the output are reordered alphabetically. This + means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while + ``np.einsum('ji', a)`` takes its transpose. Additionally, + ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while, + ``np.einsum('ij,jh', a, b)`` returns the transpose of the + multiplication since subscript 'h' precedes subscript 'i'. + + In *explicit mode* the output can be directly controlled by + specifying output subscript labels. This requires the + identifier '->' as well as the list of output subscript labels. + This feature increases the flexibility of the function since + summing can be disabled or forced when required. The call + ``np.einsum('i->', a)`` is like :py:func:`np.sum(a) ` + if ``a`` is a 1-D array, and ``np.einsum('ii->i', a)`` + is like :py:func:`np.diag(a) ` if ``a`` is a square 2-D array. + The difference is that `einsum` does not allow broadcasting by default. + Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the + order of the output subscript labels and therefore returns matrix + multiplication, unlike the example above in implicit mode. + + To enable and control broadcasting, use an ellipsis. Default + NumPy-style broadcasting is done by adding an ellipsis + to the left of each term, like ``np.einsum('...ii->...i', a)``. + ``np.einsum('...i->...', a)`` is like + :py:func:`np.sum(a, axis=-1) ` for array ``a`` of any shape. + To take the trace along the first and last axes, + you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix + product with the left-most indices instead of rightmost, one can do + ``np.einsum('ij...,jk...->ik...', a, b)``. + + When there is only one operand, no axes are summed, and no output + parameter is provided, a view into the operand is returned instead + of a new array. Thus, taking the diagonal as ``np.einsum('ii->i', a)`` + produces a view (changed in version 1.10.0). + + `einsum` also provides an alternative way to provide the subscripts + and operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``. + If the output shape is not provided in this format `einsum` will be + calculated in implicit mode, otherwise it will be performed explicitly. + The examples below have corresponding `einsum` calls with the two + parameter methods. + + .. versionadded:: 1.10.0 + + Views returned from einsum are now writeable whenever the input array + is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now + have the same effect as :py:func:`np.swapaxes(a, 0, 2) ` + and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal + of a 2D array. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(25).reshape(5,5) + >>> b = np.arange(5) + >>> c = np.arange(6).reshape(2,3) + + Trace of a matrix: + + >>> np.einsum('ii', a) + 60 + >>> np.einsum(a, [0,0]) + 60 + >>> np.trace(a) + 60 + + Extract the diagonal (requires explicit form): + + >>> np.einsum('ii->i', a) + array([ 0, 6, 12, 18, 24]) + >>> np.einsum(a, [0,0], [0]) + array([ 0, 6, 12, 18, 24]) + >>> np.diag(a) + array([ 0, 6, 12, 18, 24]) + + Sum over an axis (requires explicit form): + + >>> np.einsum('ij->i', a) + array([ 10, 35, 60, 85, 110]) + >>> np.einsum(a, [0,1], [0]) + array([ 10, 35, 60, 85, 110]) + >>> np.sum(a, axis=1) + array([ 10, 35, 60, 85, 110]) + + For higher dimensional arrays summing a single axis can be done with ellipsis: + + >>> np.einsum('...j->...', a) + array([ 10, 35, 60, 85, 110]) + >>> np.einsum(a, [Ellipsis,1], [Ellipsis]) + array([ 10, 35, 60, 85, 110]) + + Compute a matrix transpose, or reorder any number of axes: + + >>> np.einsum('ji', c) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.einsum('ij->ji', c) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.einsum(c, [1,0]) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.transpose(c) + array([[0, 3], + [1, 4], + [2, 5]]) + + Vector inner products: + + >>> np.einsum('i,i', b, b) + 30 + >>> np.einsum(b, [0], b, [0]) + 30 + >>> np.inner(b,b) + 30 + + Matrix vector multiplication: + + >>> np.einsum('ij,j', a, b) + array([ 30, 80, 130, 180, 230]) + >>> np.einsum(a, [0,1], b, [1]) + array([ 30, 80, 130, 180, 230]) + >>> np.dot(a, b) + array([ 30, 80, 130, 180, 230]) + >>> np.einsum('...j,j', a, b) + array([ 30, 80, 130, 180, 230]) + + Broadcasting and scalar multiplication: + + >>> np.einsum('..., ...', 3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.einsum(',ij', 3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.einsum(3, [Ellipsis], c, [Ellipsis]) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.multiply(3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + + Vector outer product: + + >>> np.einsum('i,j', np.arange(2)+1, b) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + >>> np.einsum(np.arange(2)+1, [0], b, [1]) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + >>> np.outer(np.arange(2)+1, b) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + + Tensor contraction: + + >>> a = np.arange(60.).reshape(3,4,5) + >>> b = np.arange(24.).reshape(4,3,2) + >>> np.einsum('ijk,jil->kl', a, b) + array([[ 4400., 4730.], + [ 4532., 4874.], + [ 4664., 5018.], + [ 4796., 5162.], + [ 4928., 5306.]]) + >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3]) + array([[ 4400., 4730.], + [ 4532., 4874.], + [ 4664., 5018.], + [ 4796., 5162.], + [ 4928., 5306.]]) + >>> np.tensordot(a,b, axes=([1,0],[0,1])) + array([[ 4400., 4730.], + [ 4532., 4874.], + [ 4664., 5018.], + [ 4796., 5162.], + [ 4928., 5306.]]) + + Writeable returned arrays (since version 1.10.0): + + >>> a = np.zeros((3, 3)) + >>> np.einsum('ii->i', a)[:] = 1 + >>> a + array([[ 1., 0., 0.], + [ 0., 1., 0.], + [ 0., 0., 1.]]) + + Example of ellipsis use: + + >>> a = np.arange(6).reshape((3,2)) + >>> b = np.arange(12).reshape((4,3)) + >>> np.einsum('ki,jk->ij', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + >>> np.einsum('ki,...k->i...', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + >>> np.einsum('k...,jk', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + + """) + + +############################################################################## +# +# Documentation for ndarray attributes and methods +# +############################################################################## + + +############################################################################## +# +# ndarray object +# +############################################################################## + + +add_newdoc('numpy._core.multiarray', 'ndarray', + """ + ndarray(shape, dtype=float, buffer=None, offset=0, + strides=None, order=None) + + An array object represents a multidimensional, homogeneous array + of fixed-size items. An associated data-type object describes the + format of each element in the array (its byte-order, how many bytes it + occupies in memory, whether it is an integer, a floating point number, + or something else, etc.) + + Arrays should be constructed using `array`, `zeros` or `empty` (refer + to the See Also section below). The parameters given here refer to + a low-level method (`ndarray(...)`) for instantiating an array. + + For more information, refer to the `numpy` module and examine the + methods and attributes of an array. + + Parameters + ---------- + (for the __new__ method; see Notes below) + + shape : tuple of ints + Shape of created array. + dtype : data-type, optional + Any object that can be interpreted as a numpy data type. + buffer : object exposing buffer interface, optional + Used to fill the array with data. + offset : int, optional + Offset of array data in buffer. + strides : tuple of ints, optional + Strides of data in memory. + order : {'C', 'F'}, optional + Row-major (C-style) or column-major (Fortran-style) order. + + Attributes + ---------- + T : ndarray + Transpose of the array. + data : buffer + The array's elements, in memory. + dtype : dtype object + Describes the format of the elements in the array. + flags : dict + Dictionary containing information related to memory use, e.g., + 'C_CONTIGUOUS', 'OWNDATA', 'WRITEABLE', etc. + flat : numpy.flatiter object + Flattened version of the array as an iterator. The iterator + allows assignments, e.g., ``x.flat = 3`` (See `ndarray.flat` for + assignment examples; TODO). + imag : ndarray + Imaginary part of the array. + real : ndarray + Real part of the array. + size : int + Number of elements in the array. + itemsize : int + The memory use of each array element in bytes. + nbytes : int + The total number of bytes required to store the array data, + i.e., ``itemsize * size``. + ndim : int + The array's number of dimensions. + shape : tuple of ints + Shape of the array. + strides : tuple of ints + The step-size required to move from one element to the next in + memory. For example, a contiguous ``(3, 4)`` array of type + ``int16`` in C-order has strides ``(8, 2)``. This implies that + to move from element to element in memory requires jumps of 2 bytes. + To move from row-to-row, one needs to jump 8 bytes at a time + (``2 * 4``). + ctypes : ctypes object + Class containing properties of the array needed for interaction + with ctypes. + base : ndarray + If the array is a view into another array, that array is its `base` + (unless that array is also a view). The `base` array is where the + array data is actually stored. + + See Also + -------- + array : Construct an array. + zeros : Create an array, each element of which is zero. + empty : Create an array, but leave its allocated memory unchanged (i.e., + it contains "garbage"). + dtype : Create a data-type. + numpy.typing.NDArray : An ndarray alias :term:`generic ` + w.r.t. its `dtype.type `. + + Notes + ----- + There are two modes of creating an array using ``__new__``: + + 1. If `buffer` is None, then only `shape`, `dtype`, and `order` + are used. + 2. If `buffer` is an object exposing the buffer interface, then + all keywords are interpreted. + + No ``__init__`` method is needed because the array is fully initialized + after the ``__new__`` method. + + Examples + -------- + These examples illustrate the low-level `ndarray` constructor. Refer + to the `See Also` section above for easier ways of constructing an + ndarray. + + First mode, `buffer` is None: + + >>> import numpy as np + >>> np.ndarray(shape=(2,2), dtype=float, order='F') + array([[0.0e+000, 0.0e+000], # random + [ nan, 2.5e-323]]) + + Second mode: + + >>> np.ndarray((2,), buffer=np.array([1,2,3]), + ... offset=np.int_().itemsize, + ... dtype=int) # offset = 1*itemsize, i.e. skip first element + array([2, 3]) + + """) + + +############################################################################## +# +# ndarray attributes +# +############################################################################## + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array_interface__', + """Array protocol: Python side.""")) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array_priority__', + """Array priority.""")) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array_struct__', + """Array protocol: C-struct side.""")) + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__dlpack__', + """ + a.__dlpack__(*, stream=None, max_version=None, dl_device=None, copy=None) + + DLPack Protocol: Part of the Array API. + + """)) + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__dlpack_device__', + """ + a.__dlpack_device__() + + DLPack Protocol: Part of the Array API. + + """)) + +add_newdoc('numpy._core.multiarray', 'ndarray', ('base', + """ + Base object if memory is from some other object. + + Examples + -------- + The base of an array that owns its memory is None: + + >>> import numpy as np + >>> x = np.array([1,2,3,4]) + >>> x.base is None + True + + Slicing creates a view, whose memory is shared with x: + + >>> y = x[2:] + >>> y.base is x + True + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('ctypes', + """ + An object to simplify the interaction of the array with the ctypes + module. + + This attribute creates an object that makes it easier to use arrays + when calling shared libraries with the ctypes module. The returned + object has, among others, data, shape, and strides attributes (see + Notes below) which themselves return ctypes objects that can be used + as arguments to a shared library. + + Parameters + ---------- + None + + Returns + ------- + c : Python object + Possessing attributes data, shape, strides, etc. + + See Also + -------- + numpy.ctypeslib + + Notes + ----- + Below are the public attributes of this object which were documented + in "Guide to NumPy" (we have omitted undocumented public attributes, + as well as documented private attributes): + + .. autoattribute:: numpy._core._internal._ctypes.data + :noindex: + + .. autoattribute:: numpy._core._internal._ctypes.shape + :noindex: + + .. autoattribute:: numpy._core._internal._ctypes.strides + :noindex: + + .. automethod:: numpy._core._internal._ctypes.data_as + :noindex: + + .. automethod:: numpy._core._internal._ctypes.shape_as + :noindex: + + .. automethod:: numpy._core._internal._ctypes.strides_as + :noindex: + + If the ctypes module is not available, then the ctypes attribute + of array objects still returns something useful, but ctypes objects + are not returned and errors may be raised instead. In particular, + the object will still have the ``as_parameter`` attribute which will + return an integer equal to the data attribute. + + Examples + -------- + >>> import numpy as np + >>> import ctypes + >>> x = np.array([[0, 1], [2, 3]], dtype=np.int32) + >>> x + array([[0, 1], + [2, 3]], dtype=int32) + >>> x.ctypes.data + 31962608 # may vary + >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_uint32)) + <__main__.LP_c_uint object at 0x7ff2fc1fc200> # may vary + >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_uint32)).contents + c_uint(0) + >>> x.ctypes.data_as(ctypes.POINTER(ctypes.c_uint64)).contents + c_ulong(4294967296) + >>> x.ctypes.shape + # may vary + >>> x.ctypes.strides + # may vary + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('data', + """Python buffer object pointing to the start of the array's data.""")) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('dtype', + """ + Data-type of the array's elements. + + .. warning:: + + Setting ``arr.dtype`` is discouraged and may be deprecated in the + future. Setting will replace the ``dtype`` without modifying the + memory (see also `ndarray.view` and `ndarray.astype`). + + Parameters + ---------- + None + + Returns + ------- + d : numpy dtype object + + See Also + -------- + ndarray.astype : Cast the values contained in the array to a new data-type. + ndarray.view : Create a view of the same data but a different data-type. + numpy.dtype + + Examples + -------- + >>> x + array([[0, 1], + [2, 3]]) + >>> x.dtype + dtype('int32') + >>> type(x.dtype) + + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('imag', + """ + The imaginary part of the array. + + Examples + -------- + >>> import numpy as np + >>> x = np.sqrt([1+0j, 0+1j]) + >>> x.imag + array([ 0. , 0.70710678]) + >>> x.imag.dtype + dtype('float64') + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('itemsize', + """ + Length of one array element in bytes. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1,2,3], dtype=np.float64) + >>> x.itemsize + 8 + >>> x = np.array([1,2,3], dtype=np.complex128) + >>> x.itemsize + 16 + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('flags', + """ + Information about the memory layout of the array. + + Attributes + ---------- + C_CONTIGUOUS (C) + The data is in a single, C-style contiguous segment. + F_CONTIGUOUS (F) + The data is in a single, Fortran-style contiguous segment. + OWNDATA (O) + The array owns the memory it uses or borrows it from another object. + WRITEABLE (W) + The data area can be written to. Setting this to False locks + the data, making it read-only. A view (slice, etc.) inherits WRITEABLE + from its base array at creation time, but a view of a writeable + array may be subsequently locked while the base array remains writeable. + (The opposite is not true, in that a view of a locked array may not + be made writeable. However, currently, locking a base object does not + lock any views that already reference it, so under that circumstance it + is possible to alter the contents of a locked array via a previously + created writeable view onto it.) Attempting to change a non-writeable + array raises a RuntimeError exception. + ALIGNED (A) + The data and all elements are aligned appropriately for the hardware. + WRITEBACKIFCOPY (X) + This array is a copy of some other array. The C-API function + PyArray_ResolveWritebackIfCopy must be called before deallocating + to the base array will be updated with the contents of this array. + FNC + F_CONTIGUOUS and not C_CONTIGUOUS. + FORC + F_CONTIGUOUS or C_CONTIGUOUS (one-segment test). + BEHAVED (B) + ALIGNED and WRITEABLE. + CARRAY (CA) + BEHAVED and C_CONTIGUOUS. + FARRAY (FA) + BEHAVED and F_CONTIGUOUS and not C_CONTIGUOUS. + + Notes + ----- + The `flags` object can be accessed dictionary-like (as in ``a.flags['WRITEABLE']``), + or by using lowercased attribute names (as in ``a.flags.writeable``). Short flag + names are only supported in dictionary access. + + Only the WRITEBACKIFCOPY, WRITEABLE, and ALIGNED flags can be + changed by the user, via direct assignment to the attribute or dictionary + entry, or by calling `ndarray.setflags`. + + The array flags cannot be set arbitrarily: + + - WRITEBACKIFCOPY can only be set ``False``. + - ALIGNED can only be set ``True`` if the data is truly aligned. + - WRITEABLE can only be set ``True`` if the array owns its own memory + or the ultimate owner of the memory exposes a writeable buffer + interface or is a string. + + Arrays can be both C-style and Fortran-style contiguous simultaneously. + This is clear for 1-dimensional arrays, but can also be true for higher + dimensional arrays. + + Even for contiguous arrays a stride for a given dimension + ``arr.strides[dim]`` may be *arbitrary* if ``arr.shape[dim] == 1`` + or the array has no elements. + It does *not* generally hold that ``self.strides[-1] == self.itemsize`` + for C-style contiguous arrays or ``self.strides[0] == self.itemsize`` for + Fortran-style contiguous arrays is true. + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('flat', + """ + A 1-D iterator over the array. + + This is a `numpy.flatiter` instance, which acts similarly to, but is not + a subclass of, Python's built-in iterator object. + + See Also + -------- + flatten : Return a copy of the array collapsed into one dimension. + + flatiter + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(1, 7).reshape(2, 3) + >>> x + array([[1, 2, 3], + [4, 5, 6]]) + >>> x.flat[3] + 4 + >>> x.T + array([[1, 4], + [2, 5], + [3, 6]]) + >>> x.T.flat[3] + 5 + >>> type(x.flat) + + + An assignment example: + + >>> x.flat = 3; x + array([[3, 3, 3], + [3, 3, 3]]) + >>> x.flat[[1,4]] = 1; x + array([[3, 1, 3], + [3, 1, 3]]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('nbytes', + """ + Total bytes consumed by the elements of the array. + + Notes + ----- + Does not include memory consumed by non-element attributes of the + array object. + + See Also + -------- + sys.getsizeof + Memory consumed by the object itself without parents in case view. + This does include memory consumed by non-element attributes. + + Examples + -------- + >>> import numpy as np + >>> x = np.zeros((3,5,2), dtype=np.complex128) + >>> x.nbytes + 480 + >>> np.prod(x.shape) * x.itemsize + 480 + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('ndim', + """ + Number of array dimensions. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3]) + >>> x.ndim + 1 + >>> y = np.zeros((2, 3, 4)) + >>> y.ndim + 3 + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('real', + """ + The real part of the array. + + Examples + -------- + >>> import numpy as np + >>> x = np.sqrt([1+0j, 0+1j]) + >>> x.real + array([ 1. , 0.70710678]) + >>> x.real.dtype + dtype('float64') + + See Also + -------- + numpy.real : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('shape', + """ + Tuple of array dimensions. + + The shape property is usually used to get the current shape of an array, + but may also be used to reshape the array in-place by assigning a tuple of + array dimensions to it. As with `numpy.reshape`, one of the new shape + dimensions can be -1, in which case its value is inferred from the size of + the array and the remaining dimensions. Reshaping an array in-place will + fail if a copy is required. + + .. warning:: + + Setting ``arr.shape`` is discouraged and may be deprecated in the + future. Using `ndarray.reshape` is the preferred approach. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3, 4]) + >>> x.shape + (4,) + >>> y = np.zeros((2, 3, 4)) + >>> y.shape + (2, 3, 4) + >>> y.shape = (3, 8) + >>> y + array([[ 0., 0., 0., 0., 0., 0., 0., 0.], + [ 0., 0., 0., 0., 0., 0., 0., 0.], + [ 0., 0., 0., 0., 0., 0., 0., 0.]]) + >>> y.shape = (3, 6) + Traceback (most recent call last): + File "", line 1, in + ValueError: total size of new array must be unchanged + >>> np.zeros((4,2))[::2].shape = (-1,) + Traceback (most recent call last): + File "", line 1, in + AttributeError: Incompatible shape for in-place modification. Use + `.reshape()` to make a copy with the desired shape. + + See Also + -------- + numpy.shape : Equivalent getter function. + numpy.reshape : Function similar to setting ``shape``. + ndarray.reshape : Method similar to setting ``shape``. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('size', + """ + Number of elements in the array. + + Equal to ``np.prod(a.shape)``, i.e., the product of the array's + dimensions. + + Notes + ----- + `a.size` returns a standard arbitrary precision Python integer. This + may not be the case with other methods of obtaining the same value + (like the suggested ``np.prod(a.shape)``, which returns an instance + of ``np.int_``), and may be relevant if the value is used further in + calculations that may overflow a fixed size integer type. + + Examples + -------- + >>> import numpy as np + >>> x = np.zeros((3, 5, 2), dtype=np.complex128) + >>> x.size + 30 + >>> np.prod(x.shape) + 30 + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('strides', + """ + Tuple of bytes to step in each dimension when traversing an array. + + The byte offset of element ``(i[0], i[1], ..., i[n])`` in an array `a` + is:: + + offset = sum(np.array(i) * a.strides) + + A more detailed explanation of strides can be found in + :ref:`arrays.ndarray`. + + .. warning:: + + Setting ``arr.strides`` is discouraged and may be deprecated in the + future. `numpy.lib.stride_tricks.as_strided` should be preferred + to create a new view of the same data in a safer way. + + Notes + ----- + Imagine an array of 32-bit integers (each 4 bytes):: + + x = np.array([[0, 1, 2, 3, 4], + [5, 6, 7, 8, 9]], dtype=np.int32) + + This array is stored in memory as 40 bytes, one after the other + (known as a contiguous block of memory). The strides of an array tell + us how many bytes we have to skip in memory to move to the next position + along a certain axis. For example, we have to skip 4 bytes (1 value) to + move to the next column, but 20 bytes (5 values) to get to the same + position in the next row. As such, the strides for the array `x` will be + ``(20, 4)``. + + See Also + -------- + numpy.lib.stride_tricks.as_strided + + Examples + -------- + >>> import numpy as np + >>> y = np.reshape(np.arange(2*3*4), (2,3,4)) + >>> y + array([[[ 0, 1, 2, 3], + [ 4, 5, 6, 7], + [ 8, 9, 10, 11]], + [[12, 13, 14, 15], + [16, 17, 18, 19], + [20, 21, 22, 23]]]) + >>> y.strides + (48, 16, 4) + >>> y[1,1,1] + 17 + >>> offset=sum(y.strides * np.array((1,1,1))) + >>> offset/y.itemsize + 17 + + >>> x = np.reshape(np.arange(5*6*7*8), (5,6,7,8)).transpose(2,3,1,0) + >>> x.strides + (32, 4, 224, 1344) + >>> i = np.array([3,5,2,2]) + >>> offset = sum(i * x.strides) + >>> x[3,5,2,2] + 813 + >>> offset / x.itemsize + 813 + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('T', + """ + View of the transposed array. + + Same as ``self.transpose()``. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> a + array([[1, 2], + [3, 4]]) + >>> a.T + array([[1, 3], + [2, 4]]) + + >>> a = np.array([1, 2, 3, 4]) + >>> a + array([1, 2, 3, 4]) + >>> a.T + array([1, 2, 3, 4]) + + See Also + -------- + transpose + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('mT', + """ + View of the matrix transposed array. + + The matrix transpose is the transpose of the last two dimensions, even + if the array is of higher dimension. + + .. versionadded:: 2.0 + + Raises + ------ + ValueError + If the array is of dimension less than 2. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> a + array([[1, 2], + [3, 4]]) + >>> a.mT + array([[1, 3], + [2, 4]]) + + >>> a = np.arange(8).reshape((2, 2, 2)) + >>> a + array([[[0, 1], + [2, 3]], + + [[4, 5], + [6, 7]]]) + >>> a.mT + array([[[0, 2], + [1, 3]], + + [[4, 6], + [5, 7]]]) + + """)) +############################################################################## +# +# ndarray methods +# +############################################################################## + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array__', + """ + a.__array__([dtype], *, copy=None) + + For ``dtype`` parameter it returns a new reference to self if + ``dtype`` is not given or it matches array's data type. + A new array of provided data type is returned if ``dtype`` + is different from the current data type of the array. + For ``copy`` parameter it returns a new reference to self if + ``copy=False`` or ``copy=None`` and copying isn't enforced by ``dtype`` + parameter. The method returns a new array for ``copy=True``, regardless of + ``dtype`` parameter. + + A more detailed explanation of the ``__array__`` interface + can be found in :ref:`dunder_array.interface`. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array_finalize__', + """ + a.__array_finalize__(obj, /) + + Present so subclasses can call super. Does nothing. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__array_wrap__', + """ + a.__array_wrap__(array[, context], /) + + Returns a view of `array` with the same type as self. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__copy__', + """ + a.__copy__() + + Used if :func:`copy.copy` is called on an array. Returns a copy of the array. + + Equivalent to ``a.copy(order='K')``. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__class_getitem__', + """ + a.__class_getitem__(item, /) + + Return a parametrized wrapper around the `~numpy.ndarray` type. + + .. versionadded:: 1.22 + + Returns + ------- + alias : types.GenericAlias + A parametrized `~numpy.ndarray` type. + + Examples + -------- + >>> from typing import Any + >>> import numpy as np + + >>> np.ndarray[Any, np.dtype[Any]] + numpy.ndarray[typing.Any, numpy.dtype[typing.Any]] + + See Also + -------- + :pep:`585` : Type hinting generics in standard collections. + numpy.typing.NDArray : An ndarray alias :term:`generic ` + w.r.t. its `dtype.type `. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__deepcopy__', + """ + a.__deepcopy__(memo, /) + + Used if :func:`copy.deepcopy` is called on an array. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__reduce__', + """ + a.__reduce__() + + For pickling. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('__setstate__', + """ + a.__setstate__(state, /) + + For unpickling. + + The `state` argument must be a sequence that contains the following + elements: + + Parameters + ---------- + version : int + optional pickle version. If omitted defaults to 0. + shape : tuple + dtype : data-type + isFortran : bool + rawdata : string or list + a binary string with the data (or a list if 'a' is an object array) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('all', + """ + a.all(axis=None, out=None, keepdims=False, *, where=True) + + Returns True if all elements evaluate to True. + + Refer to `numpy.all` for full documentation. + + See Also + -------- + numpy.all : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('any', + """ + a.any(axis=None, out=None, keepdims=False, *, where=True) + + Returns True if any of the elements of `a` evaluate to True. + + Refer to `numpy.any` for full documentation. + + See Also + -------- + numpy.any : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('argmax', + """ + a.argmax(axis=None, out=None, *, keepdims=False) + + Return indices of the maximum values along the given axis. + + Refer to `numpy.argmax` for full documentation. + + See Also + -------- + numpy.argmax : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('argmin', + """ + a.argmin(axis=None, out=None, *, keepdims=False) + + Return indices of the minimum values along the given axis. + + Refer to `numpy.argmin` for detailed documentation. + + See Also + -------- + numpy.argmin : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('argsort', + """ + a.argsort(axis=-1, kind=None, order=None) + + Returns the indices that would sort this array. + + Refer to `numpy.argsort` for full documentation. + + See Also + -------- + numpy.argsort : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('argpartition', + """ + a.argpartition(kth, axis=-1, kind='introselect', order=None) + + Returns the indices that would partition this array. + + Refer to `numpy.argpartition` for full documentation. + + .. versionadded:: 1.8.0 + + See Also + -------- + numpy.argpartition : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('astype', + """ + a.astype(dtype, order='K', casting='unsafe', subok=True, copy=True) + + Copy of the array, cast to a specified type. + + Parameters + ---------- + dtype : str or dtype + Typecode or data-type to which the array is cast. + order : {'C', 'F', 'A', 'K'}, optional + Controls the memory layout order of the result. + 'C' means C order, 'F' means Fortran order, 'A' + means 'F' order if all the arrays are Fortran contiguous, + 'C' order otherwise, and 'K' means as close to the + order the array elements appear in memory as possible. + Default is 'K'. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'unsafe' + for backwards compatibility. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + subok : bool, optional + If True, then sub-classes will be passed-through (default), otherwise + the returned array will be forced to be a base-class array. + copy : bool, optional + By default, astype always returns a newly allocated array. If this + is set to false, and the `dtype`, `order`, and `subok` + requirements are satisfied, the input array is returned instead + of a copy. + + Returns + ------- + arr_t : ndarray + Unless `copy` is False and the other conditions for returning the input + array are satisfied (see description for `copy` input parameter), `arr_t` + is a new array of the same shape as the input array, with dtype, order + given by `dtype`, `order`. + + Notes + ----- + .. versionchanged:: 1.17.0 + Casting between a simple data type and a structured one is possible only + for "unsafe" casting. Casting to multiple fields is allowed, but + casting from multiple fields is not. + + .. versionchanged:: 1.9.0 + Casting from numeric to string types in 'safe' casting mode requires + that the string dtype length is long enough to store the max + integer/float value converted. + + Raises + ------ + ComplexWarning + When casting from complex to float or int. To avoid this, + one should use ``a.real.astype(t)``. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 2.5]) + >>> x + array([1. , 2. , 2.5]) + + >>> x.astype(int) + array([1, 2, 2]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('byteswap', + """ + a.byteswap(inplace=False) + + Swap the bytes of the array elements + + Toggle between low-endian and big-endian data representation by + returning a byteswapped array, optionally swapped in-place. + Arrays of byte-strings are not swapped. The real and imaginary + parts of a complex number are swapped individually. + + Parameters + ---------- + inplace : bool, optional + If ``True``, swap bytes in-place, default is ``False``. + + Returns + ------- + out : ndarray + The byteswapped array. If `inplace` is ``True``, this is + a view to self. + + Examples + -------- + >>> import numpy as np + >>> A = np.array([1, 256, 8755], dtype=np.int16) + >>> list(map(hex, A)) + ['0x1', '0x100', '0x2233'] + >>> A.byteswap(inplace=True) + array([ 256, 1, 13090], dtype=int16) + >>> list(map(hex, A)) + ['0x100', '0x1', '0x3322'] + + Arrays of byte-strings are not swapped + + >>> A = np.array([b'ceg', b'fac']) + >>> A.byteswap() + array([b'ceg', b'fac'], dtype='|S3') + + ``A.view(A.dtype.newbyteorder()).byteswap()`` produces an array with + the same values but different representation in memory + + >>> A = np.array([1, 2, 3]) + >>> A.view(np.uint8) + array([1, 0, 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 0, 0, 0, 0, 3, 0, 0, 0, 0, 0, + 0, 0], dtype=uint8) + >>> A.view(A.dtype.newbyteorder()).byteswap(inplace=True) + array([1, 2, 3]) + >>> A.view(np.uint8) + array([0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0, 2, 0, 0, 0, 0, 0, 0, + 0, 3], dtype=uint8) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('choose', + """ + a.choose(choices, out=None, mode='raise') + + Use an index array to construct a new array from a set of choices. + + Refer to `numpy.choose` for full documentation. + + See Also + -------- + numpy.choose : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('clip', + """ + a.clip(min=None, max=None, out=None, **kwargs) + + Return an array whose values are limited to ``[min, max]``. + One of max or min must be given. + + Refer to `numpy.clip` for full documentation. + + See Also + -------- + numpy.clip : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('compress', + """ + a.compress(condition, axis=None, out=None) + + Return selected slices of this array along given axis. + + Refer to `numpy.compress` for full documentation. + + See Also + -------- + numpy.compress : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('conj', + """ + a.conj() + + Complex-conjugate all elements. + + Refer to `numpy.conjugate` for full documentation. + + See Also + -------- + numpy.conjugate : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('conjugate', + """ + a.conjugate() + + Return the complex conjugate, element-wise. + + Refer to `numpy.conjugate` for full documentation. + + See Also + -------- + numpy.conjugate : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('copy', + """ + a.copy(order='C') + + Return a copy of the array. + + Parameters + ---------- + order : {'C', 'F', 'A', 'K'}, optional + Controls the memory layout of the copy. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. (Note that this function and :func:`numpy.copy` are very + similar but have different default values for their order= + arguments, and this function always passes sub-classes through.) + + See also + -------- + numpy.copy : Similar function with different default behavior + numpy.copyto + + Notes + ----- + This function is the preferred method for creating an array copy. The + function :func:`numpy.copy` is similar, but it defaults to using order 'K', + and will not pass sub-classes through by default. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[1,2,3],[4,5,6]], order='F') + + >>> y = x.copy() + + >>> x.fill(0) + + >>> x + array([[0, 0, 0], + [0, 0, 0]]) + + >>> y + array([[1, 2, 3], + [4, 5, 6]]) + + >>> y.flags['C_CONTIGUOUS'] + True + + For arrays containing Python objects (e.g. dtype=object), + the copy is a shallow one. The new array will contain the + same object which may lead to surprises if that object can + be modified (is mutable): + + >>> a = np.array([1, 'm', [2, 3, 4]], dtype=object) + >>> b = a.copy() + >>> b[2][0] = 10 + >>> a + array([1, 'm', list([10, 3, 4])], dtype=object) + + To ensure all elements within an ``object`` array are copied, + use `copy.deepcopy`: + + >>> import copy + >>> a = np.array([1, 'm', [2, 3, 4]], dtype=object) + >>> c = copy.deepcopy(a) + >>> c[2][0] = 10 + >>> c + array([1, 'm', list([10, 3, 4])], dtype=object) + >>> a + array([1, 'm', list([2, 3, 4])], dtype=object) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('cumprod', + """ + a.cumprod(axis=None, dtype=None, out=None) + + Return the cumulative product of the elements along the given axis. + + Refer to `numpy.cumprod` for full documentation. + + See Also + -------- + numpy.cumprod : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('cumsum', + """ + a.cumsum(axis=None, dtype=None, out=None) + + Return the cumulative sum of the elements along the given axis. + + Refer to `numpy.cumsum` for full documentation. + + See Also + -------- + numpy.cumsum : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('diagonal', + """ + a.diagonal(offset=0, axis1=0, axis2=1) + + Return specified diagonals. In NumPy 1.9 the returned array is a + read-only view instead of a copy as in previous NumPy versions. In + a future version the read-only restriction will be removed. + + Refer to :func:`numpy.diagonal` for full documentation. + + See Also + -------- + numpy.diagonal : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('dot')) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('dump', + """ + a.dump(file) + + Dump a pickle of the array to the specified file. + The array can be read back with pickle.load or numpy.load. + + Parameters + ---------- + file : str or Path + A string naming the dump file. + + .. versionchanged:: 1.17.0 + `pathlib.Path` objects are now accepted. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('dumps', + """ + a.dumps() + + Returns the pickle of the array as a string. + pickle.loads will convert the string back to an array. + + Parameters + ---------- + None + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('fill', + """ + a.fill(value) + + Fill the array with a scalar value. + + Parameters + ---------- + value : scalar + All elements of `a` will be assigned this value. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([1, 2]) + >>> a.fill(0) + >>> a + array([0, 0]) + >>> a = np.empty(2) + >>> a.fill(1) + >>> a + array([1., 1.]) + + Fill expects a scalar value and always behaves the same as assigning + to a single array element. The following is a rare example where this + distinction is important: + + >>> a = np.array([None, None], dtype=object) + >>> a[0] = np.array(3) + >>> a + array([array(3), None], dtype=object) + >>> a.fill(np.array(3)) + >>> a + array([array(3), array(3)], dtype=object) + + Where other forms of assignments will unpack the array being assigned: + + >>> a[...] = np.array(3) + >>> a + array([3, 3], dtype=object) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('flatten', + """ + a.flatten(order='C') + + Return a copy of the array collapsed into one dimension. + + Parameters + ---------- + order : {'C', 'F', 'A', 'K'}, optional + 'C' means to flatten in row-major (C-style) order. + 'F' means to flatten in column-major (Fortran- + style) order. 'A' means to flatten in column-major + order if `a` is Fortran *contiguous* in memory, + row-major order otherwise. 'K' means to flatten + `a` in the order the elements occur in memory. + The default is 'C'. + + Returns + ------- + y : ndarray + A copy of the input array, flattened to one dimension. + + See Also + -------- + ravel : Return a flattened array. + flat : A 1-D flat iterator over the array. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,2], [3,4]]) + >>> a.flatten() + array([1, 2, 3, 4]) + >>> a.flatten('F') + array([1, 3, 2, 4]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('getfield', + """ + a.getfield(dtype, offset=0) + + Returns a field of the given array as a certain type. + + A field is a view of the array data with a given data-type. The values in + the view are determined by the given type and the offset into the current + array in bytes. The offset needs to be such that the view dtype fits in the + array dtype; for example an array of dtype complex128 has 16-byte elements. + If taking a view with a 32-bit integer (4 bytes), the offset needs to be + between 0 and 12 bytes. + + Parameters + ---------- + dtype : str or dtype + The data type of the view. The dtype size of the view can not be larger + than that of the array itself. + offset : int + Number of bytes to skip before beginning the element view. + + Examples + -------- + >>> import numpy as np + >>> x = np.diag([1.+1.j]*2) + >>> x[1, 1] = 2 + 4.j + >>> x + array([[1.+1.j, 0.+0.j], + [0.+0.j, 2.+4.j]]) + >>> x.getfield(np.float64) + array([[1., 0.], + [0., 2.]]) + + By choosing an offset of 8 bytes we can select the complex part of the + array for our view: + + >>> x.getfield(np.float64, offset=8) + array([[1., 0.], + [0., 4.]]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('item', + """ + a.item(*args) + + Copy an element of an array to a standard Python scalar and return it. + + Parameters + ---------- + \\*args : Arguments (variable number and type) + + * none: in this case, the method only works for arrays + with one element (`a.size == 1`), which element is + copied into a standard Python scalar object and returned. + + * int_type: this argument is interpreted as a flat index into + the array, specifying which element to copy and return. + + * tuple of int_types: functions as does a single int_type argument, + except that the argument is interpreted as an nd-index into the + array. + + Returns + ------- + z : Standard Python scalar object + A copy of the specified element of the array as a suitable + Python scalar + + Notes + ----- + When the data type of `a` is longdouble or clongdouble, item() returns + a scalar array object because there is no available Python scalar that + would not lose information. Void arrays return a buffer object for item(), + unless fields are defined, in which case a tuple is returned. + + `item` is very similar to a[args], except, instead of an array scalar, + a standard Python scalar is returned. This can be useful for speeding up + access to elements of the array and doing arithmetic on elements of the + array using Python's optimized math. + + Examples + -------- + >>> import numpy as np + >>> np.random.seed(123) + >>> x = np.random.randint(9, size=(3, 3)) + >>> x + array([[2, 2, 6], + [1, 3, 6], + [1, 0, 1]]) + >>> x.item(3) + 1 + >>> x.item(7) + 0 + >>> x.item((0, 1)) + 2 + >>> x.item((2, 2)) + 1 + + For an array with object dtype, elements are returned as-is. + + >>> a = np.array([np.int64(1)], dtype=object) + >>> a.item() #return np.int64 + np.int64(1) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('max', + """ + a.max(axis=None, out=None, keepdims=False, initial=, where=True) + + Return the maximum along a given axis. + + Refer to `numpy.amax` for full documentation. + + See Also + -------- + numpy.amax : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('mean', + """ + a.mean(axis=None, dtype=None, out=None, keepdims=False, *, where=True) + + Returns the average of the array elements along given axis. + + Refer to `numpy.mean` for full documentation. + + See Also + -------- + numpy.mean : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('min', + """ + a.min(axis=None, out=None, keepdims=False, initial=, where=True) + + Return the minimum along a given axis. + + Refer to `numpy.amin` for full documentation. + + See Also + -------- + numpy.amin : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('nonzero', + """ + a.nonzero() + + Return the indices of the elements that are non-zero. + + Refer to `numpy.nonzero` for full documentation. + + See Also + -------- + numpy.nonzero : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('prod', + """ + a.prod(axis=None, dtype=None, out=None, keepdims=False, + initial=1, where=True) + + Return the product of the array elements over the given axis + + Refer to `numpy.prod` for full documentation. + + See Also + -------- + numpy.prod : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('put', + """ + a.put(indices, values, mode='raise') + + Set ``a.flat[n] = values[n]`` for all `n` in indices. + + Refer to `numpy.put` for full documentation. + + See Also + -------- + numpy.put : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('ravel', + """ + a.ravel([order]) + + Return a flattened array. + + Refer to `numpy.ravel` for full documentation. + + See Also + -------- + numpy.ravel : equivalent function + + ndarray.flat : a flat iterator on the array. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('repeat', + """ + a.repeat(repeats, axis=None) + + Repeat elements of an array. + + Refer to `numpy.repeat` for full documentation. + + See Also + -------- + numpy.repeat : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('reshape', + """ + a.reshape(shape, /, *, order='C', copy=None) + + Returns an array containing the same data with a new shape. + + Refer to `numpy.reshape` for full documentation. + + See Also + -------- + numpy.reshape : equivalent function + + Notes + ----- + Unlike the free function `numpy.reshape`, this method on `ndarray` allows + the elements of the shape parameter to be passed in as separate arguments. + For example, ``a.reshape(10, 11)`` is equivalent to + ``a.reshape((10, 11))``. + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('resize', + """ + a.resize(new_shape, refcheck=True) + + Change shape and size of array in-place. + + Parameters + ---------- + new_shape : tuple of ints, or `n` ints + Shape of resized array. + refcheck : bool, optional + If False, reference count will not be checked. Default is True. + + Returns + ------- + None + + Raises + ------ + ValueError + If `a` does not own its own data or references or views to it exist, + and the data memory must be changed. + PyPy only: will always raise if the data memory must be changed, since + there is no reliable way to determine if references or views to it + exist. + + SystemError + If the `order` keyword argument is specified. This behaviour is a + bug in NumPy. + + See Also + -------- + resize : Return a new array with the specified shape. + + Notes + ----- + This reallocates space for the data area if necessary. + + Only contiguous arrays (data elements consecutive in memory) can be + resized. + + The purpose of the reference count check is to make sure you + do not use this array as a buffer for another Python object and then + reallocate the memory. However, reference counts can increase in + other ways so if you are sure that you have not shared the memory + for this array with another Python object, then you may safely set + `refcheck` to False. + + Examples + -------- + Shrinking an array: array is flattened (in the order that the data are + stored in memory), resized, and reshaped: + + >>> import numpy as np + + >>> a = np.array([[0, 1], [2, 3]], order='C') + >>> a.resize((2, 1)) + >>> a + array([[0], + [1]]) + + >>> a = np.array([[0, 1], [2, 3]], order='F') + >>> a.resize((2, 1)) + >>> a + array([[0], + [2]]) + + Enlarging an array: as above, but missing entries are filled with zeros: + + >>> b = np.array([[0, 1], [2, 3]]) + >>> b.resize(2, 3) # new_shape parameter doesn't have to be a tuple + >>> b + array([[0, 1, 2], + [3, 0, 0]]) + + Referencing an array prevents resizing... + + >>> c = a + >>> a.resize((1, 1)) + Traceback (most recent call last): + ... + ValueError: cannot resize an array that references or is referenced ... + + Unless `refcheck` is False: + + >>> a.resize((1, 1), refcheck=False) + >>> a + array([[0]]) + >>> c + array([[0]]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('round', + """ + a.round(decimals=0, out=None) + + Return `a` with each element rounded to the given number of decimals. + + Refer to `numpy.around` for full documentation. + + See Also + -------- + numpy.around : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('searchsorted', + """ + a.searchsorted(v, side='left', sorter=None) + + Find indices where elements of v should be inserted in a to maintain order. + + For full documentation, see `numpy.searchsorted` + + See Also + -------- + numpy.searchsorted : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('setfield', + """ + a.setfield(val, dtype, offset=0) + + Put a value into a specified place in a field defined by a data-type. + + Place `val` into `a`'s field defined by `dtype` and beginning `offset` + bytes into the field. + + Parameters + ---------- + val : object + Value to be placed in field. + dtype : dtype object + Data-type of the field in which to place `val`. + offset : int, optional + The number of bytes into the field at which to place `val`. + + Returns + ------- + None + + See Also + -------- + getfield + + Examples + -------- + >>> import numpy as np + >>> x = np.eye(3) + >>> x.getfield(np.float64) + array([[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]]) + >>> x.setfield(3, np.int32) + >>> x.getfield(np.int32) + array([[3, 3, 3], + [3, 3, 3], + [3, 3, 3]], dtype=int32) + >>> x + array([[1.0e+000, 1.5e-323, 1.5e-323], + [1.5e-323, 1.0e+000, 1.5e-323], + [1.5e-323, 1.5e-323, 1.0e+000]]) + >>> x.setfield(np.eye(3), np.int32) + >>> x + array([[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('setflags', + """ + a.setflags(write=None, align=None, uic=None) + + Set array flags WRITEABLE, ALIGNED, WRITEBACKIFCOPY, + respectively. + + These Boolean-valued flags affect how numpy interprets the memory + area used by `a` (see Notes below). The ALIGNED flag can only + be set to True if the data is actually aligned according to the type. + The WRITEBACKIFCOPY flag can never be set + to True. The flag WRITEABLE can only be set to True if the array owns its + own memory, or the ultimate owner of the memory exposes a writeable buffer + interface, or is a string. (The exception for string is made so that + unpickling can be done without copying memory.) + + Parameters + ---------- + write : bool, optional + Describes whether or not `a` can be written to. + align : bool, optional + Describes whether or not `a` is aligned properly for its type. + uic : bool, optional + Describes whether or not `a` is a copy of another "base" array. + + Notes + ----- + Array flags provide information about how the memory area used + for the array is to be interpreted. There are 7 Boolean flags + in use, only three of which can be changed by the user: + WRITEBACKIFCOPY, WRITEABLE, and ALIGNED. + + WRITEABLE (W) the data area can be written to; + + ALIGNED (A) the data and strides are aligned appropriately for the hardware + (as determined by the compiler); + + WRITEBACKIFCOPY (X) this array is a copy of some other array (referenced + by .base). When the C-API function PyArray_ResolveWritebackIfCopy is + called, the base array will be updated with the contents of this array. + + All flags can be accessed using the single (upper case) letter as well + as the full name. + + Examples + -------- + >>> import numpy as np + >>> y = np.array([[3, 1, 7], + ... [2, 0, 0], + ... [8, 5, 9]]) + >>> y + array([[3, 1, 7], + [2, 0, 0], + [8, 5, 9]]) + >>> y.flags + C_CONTIGUOUS : True + F_CONTIGUOUS : False + OWNDATA : True + WRITEABLE : True + ALIGNED : True + WRITEBACKIFCOPY : False + >>> y.setflags(write=0, align=0) + >>> y.flags + C_CONTIGUOUS : True + F_CONTIGUOUS : False + OWNDATA : True + WRITEABLE : False + ALIGNED : False + WRITEBACKIFCOPY : False + >>> y.setflags(uic=1) + Traceback (most recent call last): + File "", line 1, in + ValueError: cannot set WRITEBACKIFCOPY flag to True + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('sort', + """ + a.sort(axis=-1, kind=None, order=None) + + Sort an array in-place. Refer to `numpy.sort` for full documentation. + + Parameters + ---------- + axis : int, optional + Axis along which to sort. Default is -1, which means sort along the + last axis. + kind : {'quicksort', 'mergesort', 'heapsort', 'stable'}, optional + Sorting algorithm. The default is 'quicksort'. Note that both 'stable' + and 'mergesort' use timsort under the covers and, in general, the + actual implementation will vary with datatype. The 'mergesort' option + is retained for backwards compatibility. + + .. versionchanged:: 1.15.0 + The 'stable' option was added. + + order : str or list of str, optional + When `a` is an array with fields defined, this argument specifies + which fields to compare first, second, etc. A single field can + be specified as a string, and not all fields need be specified, + but unspecified fields will still be used, in the order in which + they come up in the dtype, to break ties. + + See Also + -------- + numpy.sort : Return a sorted copy of an array. + numpy.argsort : Indirect sort. + numpy.lexsort : Indirect stable sort on multiple keys. + numpy.searchsorted : Find elements in sorted array. + numpy.partition: Partial sort. + + Notes + ----- + See `numpy.sort` for notes on the different sorting algorithms. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,4], [3,1]]) + >>> a.sort(axis=1) + >>> a + array([[1, 4], + [1, 3]]) + >>> a.sort(axis=0) + >>> a + array([[1, 3], + [1, 4]]) + + Use the `order` keyword to specify a field to use when sorting a + structured array: + + >>> a = np.array([('a', 2), ('c', 1)], dtype=[('x', 'S1'), ('y', int)]) + >>> a.sort(order='y') + >>> a + array([(b'c', 1), (b'a', 2)], + dtype=[('x', 'S1'), ('y', '>> import numpy as np + >>> a = np.array([3, 4, 2, 1]) + >>> a.partition(3) + >>> a + array([2, 1, 3, 4]) # may vary + + >>> a.partition((1, 3)) + >>> a + array([1, 2, 3, 4]) + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('squeeze', + """ + a.squeeze(axis=None) + + Remove axes of length one from `a`. + + Refer to `numpy.squeeze` for full documentation. + + See Also + -------- + numpy.squeeze : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('std', + """ + a.std(axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, where=True) + + Returns the standard deviation of the array elements along given axis. + + Refer to `numpy.std` for full documentation. + + See Also + -------- + numpy.std : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('sum', + """ + a.sum(axis=None, dtype=None, out=None, keepdims=False, initial=0, where=True) + + Return the sum of the array elements over the given axis. + + Refer to `numpy.sum` for full documentation. + + See Also + -------- + numpy.sum : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('swapaxes', + """ + a.swapaxes(axis1, axis2) + + Return a view of the array with `axis1` and `axis2` interchanged. + + Refer to `numpy.swapaxes` for full documentation. + + See Also + -------- + numpy.swapaxes : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('take', + """ + a.take(indices, axis=None, out=None, mode='raise') + + Return an array formed from the elements of `a` at the given indices. + + Refer to `numpy.take` for full documentation. + + See Also + -------- + numpy.take : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('tofile', + """ + a.tofile(fid, sep="", format="%s") + + Write array to a file as text or binary (default). + + Data is always written in 'C' order, independent of the order of `a`. + The data produced by this method can be recovered using the function + fromfile(). + + Parameters + ---------- + fid : file or str or Path + An open file object, or a string containing a filename. + + .. versionchanged:: 1.17.0 + `pathlib.Path` objects are now accepted. + + sep : str + Separator between array items for text output. + If "" (empty), a binary file is written, equivalent to + ``file.write(a.tobytes())``. + format : str + Format string for text file output. + Each entry in the array is formatted to text by first converting + it to the closest Python type, and then using "format" % item. + + Notes + ----- + This is a convenience function for quick storage of array data. + Information on endianness and precision is lost, so this method is not a + good choice for files intended to archive data or transport data between + machines with different endianness. Some of these problems can be overcome + by outputting the data as text files, at the expense of speed and file + size. + + When fid is a file object, array contents are directly written to the + file, bypassing the file object's ``write`` method. As a result, tofile + cannot be used with files objects supporting compression (e.g., GzipFile) + or file-like objects that do not support ``fileno()`` (e.g., BytesIO). + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('tolist', + """ + a.tolist() + + Return the array as an ``a.ndim``-levels deep nested list of Python scalars. + + Return a copy of the array data as a (nested) Python list. + Data items are converted to the nearest compatible builtin Python type, via + the `~numpy.ndarray.item` function. + + If ``a.ndim`` is 0, then since the depth of the nested list is 0, it will + not be a list at all, but a simple Python scalar. + + Parameters + ---------- + none + + Returns + ------- + y : object, or list of object, or list of list of object, or ... + The possibly nested list of array elements. + + Notes + ----- + The array may be recreated via ``a = np.array(a.tolist())``, although this + may sometimes lose precision. + + Examples + -------- + For a 1D array, ``a.tolist()`` is almost the same as ``list(a)``, + except that ``tolist`` changes numpy scalars to Python scalars: + + >>> import numpy as np + >>> a = np.uint32([1, 2]) + >>> a_list = list(a) + >>> a_list + [1, 2] + >>> type(a_list[0]) + + >>> a_tolist = a.tolist() + >>> a_tolist + [1, 2] + >>> type(a_tolist[0]) + + + Additionally, for a 2D array, ``tolist`` applies recursively: + + >>> a = np.array([[1, 2], [3, 4]]) + >>> list(a) + [array([1, 2]), array([3, 4])] + >>> a.tolist() + [[1, 2], [3, 4]] + + The base case for this recursion is a 0D array: + + >>> a = np.array(1) + >>> list(a) + Traceback (most recent call last): + ... + TypeError: iteration over a 0-d array + >>> a.tolist() + 1 + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('tobytes', """ + a.tobytes(order='C') + + Construct Python bytes containing the raw data bytes in the array. + + Constructs Python bytes showing a copy of the raw contents of + data memory. The bytes object is produced in C-order by default. + This behavior is controlled by the ``order`` parameter. + + .. versionadded:: 1.9.0 + + Parameters + ---------- + order : {'C', 'F', 'A'}, optional + Controls the memory layout of the bytes object. 'C' means C-order, + 'F' means F-order, 'A' (short for *Any*) means 'F' if `a` is + Fortran contiguous, 'C' otherwise. Default is 'C'. + + Returns + ------- + s : bytes + Python bytes exhibiting a copy of `a`'s raw data. + + See also + -------- + frombuffer + Inverse of this operation, construct a 1-dimensional array from Python + bytes. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[0, 1], [2, 3]], dtype='>> x.tobytes() + b'\\x00\\x00\\x01\\x00\\x02\\x00\\x03\\x00' + >>> x.tobytes('C') == x.tobytes() + True + >>> x.tobytes('F') + b'\\x00\\x00\\x02\\x00\\x01\\x00\\x03\\x00' + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('tostring', r""" + a.tostring(order='C') + + A compatibility alias for `~ndarray.tobytes`, with exactly the same + behavior. + + Despite its name, it returns :class:`bytes` not :class:`str`\ s. + + .. deprecated:: 1.19.0 + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('trace', + """ + a.trace(offset=0, axis1=0, axis2=1, dtype=None, out=None) + + Return the sum along diagonals of the array. + + Refer to `numpy.trace` for full documentation. + + See Also + -------- + numpy.trace : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('transpose', + """ + a.transpose(*axes) + + Returns a view of the array with axes transposed. + + Refer to `numpy.transpose` for full documentation. + + Parameters + ---------- + axes : None, tuple of ints, or `n` ints + + * None or no argument: reverses the order of the axes. + + * tuple of ints: `i` in the `j`-th place in the tuple means that the + array's `i`-th axis becomes the transposed array's `j`-th axis. + + * `n` ints: same as an n-tuple of the same ints (this form is + intended simply as a "convenience" alternative to the tuple form). + + Returns + ------- + p : ndarray + View of the array with its axes suitably permuted. + + See Also + -------- + transpose : Equivalent function. + ndarray.T : Array property returning the array transposed. + ndarray.reshape : Give a new shape to an array without changing its data. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> a + array([[1, 2], + [3, 4]]) + >>> a.transpose() + array([[1, 3], + [2, 4]]) + >>> a.transpose((1, 0)) + array([[1, 3], + [2, 4]]) + >>> a.transpose(1, 0) + array([[1, 3], + [2, 4]]) + + >>> a = np.array([1, 2, 3, 4]) + >>> a + array([1, 2, 3, 4]) + >>> a.transpose() + array([1, 2, 3, 4]) + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('var', + """ + a.var(axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, where=True) + + Returns the variance of the array elements, along given axis. + + Refer to `numpy.var` for full documentation. + + See Also + -------- + numpy.var : equivalent function + + """)) + + +add_newdoc('numpy._core.multiarray', 'ndarray', ('view', + """ + a.view([dtype][, type]) + + New view of array with the same data. + + .. note:: + Passing None for ``dtype`` is different from omitting the parameter, + since the former invokes ``dtype(None)`` which is an alias for + ``dtype('float64')``. + + Parameters + ---------- + dtype : data-type or ndarray sub-class, optional + Data-type descriptor of the returned view, e.g., float32 or int16. + Omitting it results in the view having the same data-type as `a`. + This argument can also be specified as an ndarray sub-class, which + then specifies the type of the returned object (this is equivalent to + setting the ``type`` parameter). + type : Python type, optional + Type of the returned view, e.g., ndarray or matrix. Again, omission + of the parameter results in type preservation. + + Notes + ----- + ``a.view()`` is used two different ways: + + ``a.view(some_dtype)`` or ``a.view(dtype=some_dtype)`` constructs a view + of the array's memory with a different data-type. This can cause a + reinterpretation of the bytes of memory. + + ``a.view(ndarray_subclass)`` or ``a.view(type=ndarray_subclass)`` just + returns an instance of `ndarray_subclass` that looks at the same array + (same shape, dtype, etc.) This does not cause a reinterpretation of the + memory. + + For ``a.view(some_dtype)``, if ``some_dtype`` has a different number of + bytes per entry than the previous dtype (for example, converting a regular + array to a structured array), then the last axis of ``a`` must be + contiguous. This axis will be resized in the result. + + .. versionchanged:: 1.23.0 + Only the last axis needs to be contiguous. Previously, the entire array + had to be C-contiguous. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([(-1, 2)], dtype=[('a', np.int8), ('b', np.int8)]) + + Viewing array data using a different type and dtype: + + >>> nonneg = np.dtype([("a", np.uint8), ("b", np.uint8)]) + >>> y = x.view(dtype=nonneg, type=np.recarray) + >>> x["a"] + array([-1], dtype=int8) + >>> y.a + array([255], dtype=uint8) + + Creating a view on a structured array so it can be used in calculations + + >>> x = np.array([(1, 2),(3,4)], dtype=[('a', np.int8), ('b', np.int8)]) + >>> xv = x.view(dtype=np.int8).reshape(-1,2) + >>> xv + array([[1, 2], + [3, 4]], dtype=int8) + >>> xv.mean(0) + array([2., 3.]) + + Making changes to the view changes the underlying array + + >>> xv[0,1] = 20 + >>> x + array([(1, 20), (3, 4)], dtype=[('a', 'i1'), ('b', 'i1')]) + + Using a view to convert an array to a recarray: + + >>> z = x.view(np.recarray) + >>> z.a + array([1, 3], dtype=int8) + + Views share data: + + >>> x[0] = (9, 10) + >>> z[0] + np.record((9, 10), dtype=[('a', 'i1'), ('b', 'i1')]) + + Views that change the dtype size (bytes per entry) should normally be + avoided on arrays defined by slices, transposes, fortran-ordering, etc.: + + >>> x = np.array([[1, 2, 3], [4, 5, 6]], dtype=np.int16) + >>> y = x[:, ::2] + >>> y + array([[1, 3], + [4, 6]], dtype=int16) + >>> y.view(dtype=[('width', np.int16), ('length', np.int16)]) + Traceback (most recent call last): + ... + ValueError: To change to a dtype of a different size, the last axis must be contiguous + >>> z = y.copy() + >>> z.view(dtype=[('width', np.int16), ('length', np.int16)]) + array([[(1, 3)], + [(4, 6)]], dtype=[('width', '>> x = np.arange(2 * 3 * 4, dtype=np.int8).reshape(2, 3, 4) + >>> x.transpose(1, 0, 2).view(np.int16) + array([[[ 256, 770], + [3340, 3854]], + + [[1284, 1798], + [4368, 4882]], + + [[2312, 2826], + [5396, 5910]]], dtype=int16) + + """)) + + +############################################################################## +# +# umath functions +# +############################################################################## + +add_newdoc('numpy._core.umath', 'frompyfunc', + """ + frompyfunc(func, /, nin, nout, *[, identity]) + + Takes an arbitrary Python function and returns a NumPy ufunc. + + Can be used, for example, to add broadcasting to a built-in Python + function (see Examples section). + + Parameters + ---------- + func : Python function object + An arbitrary Python function. + nin : int + The number of input arguments. + nout : int + The number of objects returned by `func`. + identity : object, optional + The value to use for the `~numpy.ufunc.identity` attribute of the resulting + object. If specified, this is equivalent to setting the underlying + C ``identity`` field to ``PyUFunc_IdentityValue``. + If omitted, the identity is set to ``PyUFunc_None``. Note that this is + _not_ equivalent to setting the identity to ``None``, which implies the + operation is reorderable. + + Returns + ------- + out : ufunc + Returns a NumPy universal function (``ufunc``) object. + + See Also + -------- + vectorize : Evaluates pyfunc over input arrays using broadcasting rules of numpy. + + Notes + ----- + The returned ufunc always returns PyObject arrays. + + Examples + -------- + Use frompyfunc to add broadcasting to the Python function ``oct``: + + >>> import numpy as np + >>> oct_array = np.frompyfunc(oct, 1, 1) + >>> oct_array(np.array((10, 30, 100))) + array(['0o12', '0o36', '0o144'], dtype=object) + >>> np.array((oct(10), oct(30), oct(100))) # for comparison + array(['0o12', '0o36', '0o144'], dtype='doc is NULL.) + + Parameters + ---------- + ufunc : numpy.ufunc + A ufunc whose current doc is NULL. + new_docstring : string + The new docstring for the ufunc. + + Notes + ----- + This method allocates memory for new_docstring on + the heap. Technically this creates a memory leak, since this + memory will not be reclaimed until the end of the program + even if the ufunc itself is removed. However this will only + be a problem if the user is repeatedly creating ufuncs with + no documentation, adding documentation via add_newdoc_ufunc, + and then throwing away the ufunc. + """) + +add_newdoc('numpy._core.multiarray', 'get_handler_name', + """ + get_handler_name(a: ndarray) -> str,None + + Return the name of the memory handler used by `a`. If not provided, return + the name of the memory handler that will be used to allocate data for the + next `ndarray` in this context. May return None if `a` does not own its + memory, in which case you can traverse ``a.base`` for a memory handler. + """) + +add_newdoc('numpy._core.multiarray', 'get_handler_version', + """ + get_handler_version(a: ndarray) -> int,None + + Return the version of the memory handler used by `a`. If not provided, + return the version of the memory handler that will be used to allocate data + for the next `ndarray` in this context. May return None if `a` does not own + its memory, in which case you can traverse ``a.base`` for a memory handler. + """) + +add_newdoc('numpy._core._multiarray_umath', '_array_converter', + """ + _array_converter(*array_likes) + + Helper to convert one or more objects to arrays. Integrates machinery + to deal with the ``result_type`` and ``__array_wrap__``. + + The reason for this is that e.g. ``result_type`` needs to convert to arrays + to find the ``dtype``. But converting to an array before calling + ``result_type`` would incorrectly "forget" whether it was a Python int, + float, or complex. + """) + +add_newdoc( + 'numpy._core._multiarray_umath', '_array_converter', ('scalar_input', + """ + A tuple which indicates for each input whether it was a scalar that + was coerced to a 0-D array (and was not already an array or something + converted via a protocol like ``__array__()``). + """)) + +add_newdoc('numpy._core._multiarray_umath', '_array_converter', ('as_arrays', + """ + as_arrays(/, subok=True, pyscalars="convert_if_no_array") + + Return the inputs as arrays or scalars. + + Parameters + ---------- + subok : True or False, optional + Whether array subclasses are preserved. + pyscalars : {"convert", "preserve", "convert_if_no_array"}, optional + To allow NEP 50 weak promotion later, it may be desirable to preserve + Python scalars. As default, these are preserved unless all inputs + are Python scalars. "convert" enforces an array return. + """)) + +add_newdoc('numpy._core._multiarray_umath', '_array_converter', ('result_type', + """result_type(/, extra_dtype=None, ensure_inexact=False) + + Find the ``result_type`` just as ``np.result_type`` would, but taking + into account that the original inputs (before converting to an array) may + have been Python scalars with weak promotion. + + Parameters + ---------- + extra_dtype : dtype instance or class + An additional DType or dtype instance to promote (e.g. could be used + to ensure the result precision is at least float32). + ensure_inexact : True or False + When ``True``, ensures a floating point (or complex) result replacing + the ``arr * 1.`` or ``result_type(..., 0.0)`` pattern. + """)) + +add_newdoc('numpy._core._multiarray_umath', '_array_converter', ('wrap', + """ + wrap(arr, /, to_scalar=None) + + Call ``__array_wrap__`` on ``arr`` if ``arr`` is not the same subclass + as the input the ``__array_wrap__`` method was retrieved from. + + Parameters + ---------- + arr : ndarray + The object to be wrapped. Normally an ndarray or subclass, + although for backward compatibility NumPy scalars are also accepted + (these will be converted to a NumPy array before being passed on to + the ``__array_wrap__`` method). + to_scalar : {True, False, None}, optional + When ``True`` will convert a 0-d array to a scalar via ``result[()]`` + (with a fast-path for non-subclasses). If ``False`` the result should + be an array-like (as ``__array_wrap__`` is free to return a non-array). + By default (``None``), a scalar is returned if all inputs were scalar. + """)) + + +add_newdoc('numpy._core.multiarray', '_get_madvise_hugepage', + """ + _get_madvise_hugepage() -> bool + + Get use of ``madvise (2)`` MADV_HUGEPAGE support when + allocating the array data. Returns the currently set value. + See `global_state` for more information. + """) + +add_newdoc('numpy._core.multiarray', '_set_madvise_hugepage', + """ + _set_madvise_hugepage(enabled: bool) -> bool + + Set or unset use of ``madvise (2)`` MADV_HUGEPAGE support when + allocating the array data. Returns the previously set value. + See `global_state` for more information. + """) + + +############################################################################## +# +# Documentation for ufunc attributes and methods +# +############################################################################## + + +############################################################################## +# +# ufunc object +# +############################################################################## + +add_newdoc('numpy._core', 'ufunc', + """ + Functions that operate element by element on whole arrays. + + To see the documentation for a specific ufunc, use `info`. For + example, ``np.info(np.sin)``. Because ufuncs are written in C + (for speed) and linked into Python with NumPy's ufunc facility, + Python's help() function finds this page whenever help() is called + on a ufunc. + + A detailed explanation of ufuncs can be found in the docs for :ref:`ufuncs`. + + **Calling ufuncs:** ``op(*x[, out], where=True, **kwargs)`` + + Apply `op` to the arguments `*x` elementwise, broadcasting the arguments. + + The broadcasting rules are: + + * Dimensions of length 1 may be prepended to either array. + * Arrays may be repeated along dimensions of length 1. + + Parameters + ---------- + *x : array_like + Input arrays. + out : ndarray, None, or tuple of ndarray and None, optional + Alternate array object(s) in which to put the result; if provided, it + must have a shape that the inputs broadcast to. A tuple of arrays + (possible only as a keyword argument) must have length equal to the + number of outputs; use None for uninitialized outputs to be + allocated by the ufunc. + where : array_like, optional + This condition is broadcast over the input. At locations where the + condition is True, the `out` array will be set to the ufunc result. + Elsewhere, the `out` array will retain its original value. + Note that if an uninitialized `out` array is created via the default + ``out=None``, locations within it where the condition is False will + remain uninitialized. + **kwargs + For other keyword-only arguments, see the :ref:`ufunc docs `. + + Returns + ------- + r : ndarray or tuple of ndarray + `r` will have the shape that the arrays in `x` broadcast to; if `out` is + provided, it will be returned. If not, `r` will be allocated and + may contain uninitialized values. If the function has more than one + output, then the result will be a tuple of arrays. + + """) + + +############################################################################## +# +# ufunc attributes +# +############################################################################## + +add_newdoc('numpy._core', 'ufunc', ('identity', + """ + The identity value. + + Data attribute containing the identity element for the ufunc, + if it has one. If it does not, the attribute value is None. + + Examples + -------- + >>> import numpy as np + >>> np.add.identity + 0 + >>> np.multiply.identity + 1 + >>> np.power.identity + 1 + >>> print(np.exp.identity) + None + """)) + +add_newdoc('numpy._core', 'ufunc', ('nargs', + """ + The number of arguments. + + Data attribute containing the number of arguments the ufunc takes, including + optional ones. + + Notes + ----- + Typically this value will be one more than what you might expect + because all ufuncs take the optional "out" argument. + + Examples + -------- + >>> import numpy as np + >>> np.add.nargs + 3 + >>> np.multiply.nargs + 3 + >>> np.power.nargs + 3 + >>> np.exp.nargs + 2 + """)) + +add_newdoc('numpy._core', 'ufunc', ('nin', + """ + The number of inputs. + + Data attribute containing the number of arguments the ufunc treats as input. + + Examples + -------- + >>> import numpy as np + >>> np.add.nin + 2 + >>> np.multiply.nin + 2 + >>> np.power.nin + 2 + >>> np.exp.nin + 1 + """)) + +add_newdoc('numpy._core', 'ufunc', ('nout', + """ + The number of outputs. + + Data attribute containing the number of arguments the ufunc treats as output. + + Notes + ----- + Since all ufuncs can take output arguments, this will always be at least 1. + + Examples + -------- + >>> import numpy as np + >>> np.add.nout + 1 + >>> np.multiply.nout + 1 + >>> np.power.nout + 1 + >>> np.exp.nout + 1 + + """)) + +add_newdoc('numpy._core', 'ufunc', ('ntypes', + """ + The number of types. + + The number of numerical NumPy types - of which there are 18 total - on which + the ufunc can operate. + + See Also + -------- + numpy.ufunc.types + + Examples + -------- + >>> import numpy as np + >>> np.add.ntypes + 18 + >>> np.multiply.ntypes + 18 + >>> np.power.ntypes + 17 + >>> np.exp.ntypes + 7 + >>> np.remainder.ntypes + 14 + + """)) + +add_newdoc('numpy._core', 'ufunc', ('types', + """ + Returns a list with types grouped input->output. + + Data attribute listing the data-type "Domain-Range" groupings the ufunc can + deliver. The data-types are given using the character codes. + + See Also + -------- + numpy.ufunc.ntypes + + Examples + -------- + >>> import numpy as np + >>> np.add.types + ['??->?', 'bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', + 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', + 'GG->G', 'OO->O'] + + >>> np.multiply.types + ['??->?', 'bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', + 'LL->L', 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', + 'GG->G', 'OO->O'] + + >>> np.power.types + ['bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', + 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'FF->F', 'DD->D', 'GG->G', + 'OO->O'] + + >>> np.exp.types + ['f->f', 'd->d', 'g->g', 'F->F', 'D->D', 'G->G', 'O->O'] + + >>> np.remainder.types + ['bb->b', 'BB->B', 'hh->h', 'HH->H', 'ii->i', 'II->I', 'll->l', 'LL->L', + 'qq->q', 'QQ->Q', 'ff->f', 'dd->d', 'gg->g', 'OO->O'] + + """)) + +add_newdoc('numpy._core', 'ufunc', ('signature', + """ + Definition of the core elements a generalized ufunc operates on. + + The signature determines how the dimensions of each input/output array + are split into core and loop dimensions: + + 1. Each dimension in the signature is matched to a dimension of the + corresponding passed-in array, starting from the end of the shape tuple. + 2. Core dimensions assigned to the same label in the signature must have + exactly matching sizes, no broadcasting is performed. + 3. The core dimensions are removed from all inputs and the remaining + dimensions are broadcast together, defining the loop dimensions. + + Notes + ----- + Generalized ufuncs are used internally in many linalg functions, and in + the testing suite; the examples below are taken from these. + For ufuncs that operate on scalars, the signature is None, which is + equivalent to '()' for every argument. + + Examples + -------- + >>> import numpy as np + >>> np.linalg._umath_linalg.det.signature + '(m,m)->()' + >>> np.matmul.signature + '(n?,k),(k,m?)->(n?,m?)' + >>> np.add.signature is None + True # equivalent to '(),()->()' + """)) + +############################################################################## +# +# ufunc methods +# +############################################################################## + +add_newdoc('numpy._core', 'ufunc', ('reduce', + """ + reduce(array, axis=0, dtype=None, out=None, keepdims=False, initial=, where=True) + + Reduces `array`'s dimension by one, by applying ufunc along one axis. + + Let :math:`array.shape = (N_0, ..., N_i, ..., N_{M-1})`. Then + :math:`ufunc.reduce(array, axis=i)[k_0, ..,k_{i-1}, k_{i+1}, .., k_{M-1}]` = + the result of iterating `j` over :math:`range(N_i)`, cumulatively applying + ufunc to each :math:`array[k_0, ..,k_{i-1}, j, k_{i+1}, .., k_{M-1}]`. + For a one-dimensional array, reduce produces results equivalent to: + :: + + r = op.identity # op = ufunc + for i in range(len(A)): + r = op(r, A[i]) + return r + + For example, add.reduce() is equivalent to sum(). + + Parameters + ---------- + array : array_like + The array to act on. + axis : None or int or tuple of ints, optional + Axis or axes along which a reduction is performed. + The default (`axis` = 0) is perform a reduction over the first + dimension of the input array. `axis` may be negative, in + which case it counts from the last to the first axis. + + .. versionadded:: 1.7.0 + + If this is None, a reduction is performed over all the axes. + If this is a tuple of ints, a reduction is performed on multiple + axes, instead of a single axis or all the axes as before. + + For operations which are either not commutative or not associative, + doing a reduction over multiple axes is not well-defined. The + ufuncs do not currently raise an exception in this case, but will + likely do so in the future. + dtype : data-type code, optional + The data type used to perform the operation. Defaults to that of + ``out`` if given, and the data type of ``array`` otherwise (though + upcast to conserve precision for some cases, such as + ``numpy.add.reduce`` for integer or boolean input). + out : ndarray, None, or tuple of ndarray and None, optional + A location into which the result is stored. If not provided or None, + a freshly-allocated array is returned. For consistency with + ``ufunc.__call__``, if given as a keyword, this may be wrapped in a + 1-element tuple. + + .. versionchanged:: 1.13.0 + Tuples are allowed for keyword argument. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the original `array`. + + .. versionadded:: 1.7.0 + initial : scalar, optional + The value with which to start the reduction. + If the ufunc has no identity or the dtype is object, this defaults + to None - otherwise it defaults to ufunc.identity. + If ``None`` is given, the first element of the reduction is used, + and an error is thrown if the reduction is empty. + + .. versionadded:: 1.15.0 + + where : array_like of bool, optional + A boolean array which is broadcasted to match the dimensions + of `array`, and selects elements to include in the reduction. Note + that for ufuncs like ``minimum`` that do not have an identity + defined, one has to pass in also ``initial``. + + .. versionadded:: 1.17.0 + + Returns + ------- + r : ndarray + The reduced array. If `out` was supplied, `r` is a reference to it. + + Examples + -------- + >>> import numpy as np + >>> np.multiply.reduce([2,3,5]) + 30 + + A multi-dimensional array example: + + >>> X = np.arange(8).reshape((2,2,2)) + >>> X + array([[[0, 1], + [2, 3]], + [[4, 5], + [6, 7]]]) + >>> np.add.reduce(X, 0) + array([[ 4, 6], + [ 8, 10]]) + >>> np.add.reduce(X) # confirm: default axis value is 0 + array([[ 4, 6], + [ 8, 10]]) + >>> np.add.reduce(X, 1) + array([[ 2, 4], + [10, 12]]) + >>> np.add.reduce(X, 2) + array([[ 1, 5], + [ 9, 13]]) + + You can use the ``initial`` keyword argument to initialize the reduction + with a different value, and ``where`` to select specific elements to include: + + >>> np.add.reduce([10], initial=5) + 15 + >>> np.add.reduce(np.ones((2, 2, 2)), axis=(0, 2), initial=10) + array([14., 14.]) + >>> a = np.array([10., np.nan, 10]) + >>> np.add.reduce(a, where=~np.isnan(a)) + 20.0 + + Allows reductions of empty arrays where they would normally fail, i.e. + for ufuncs without an identity. + + >>> np.minimum.reduce([], initial=np.inf) + inf + >>> np.minimum.reduce([[1., 2.], [3., 4.]], initial=10., where=[True, False]) + array([ 1., 10.]) + >>> np.minimum.reduce([]) + Traceback (most recent call last): + ... + ValueError: zero-size array to reduction operation minimum which has no identity + """)) + +add_newdoc('numpy._core', 'ufunc', ('accumulate', + """ + accumulate(array, axis=0, dtype=None, out=None) + + Accumulate the result of applying the operator to all elements. + + For a one-dimensional array, accumulate produces results equivalent to:: + + r = np.empty(len(A)) + t = op.identity # op = the ufunc being applied to A's elements + for i in range(len(A)): + t = op(t, A[i]) + r[i] = t + return r + + For example, add.accumulate() is equivalent to np.cumsum(). + + For a multi-dimensional array, accumulate is applied along only one + axis (axis zero by default; see Examples below) so repeated use is + necessary if one wants to accumulate over multiple axes. + + Parameters + ---------- + array : array_like + The array to act on. + axis : int, optional + The axis along which to apply the accumulation; default is zero. + dtype : data-type code, optional + The data-type used to represent the intermediate results. Defaults + to the data-type of the output array if such is provided, or the + data-type of the input array if no output array is provided. + out : ndarray, None, or tuple of ndarray and None, optional + A location into which the result is stored. If not provided or None, + a freshly-allocated array is returned. For consistency with + ``ufunc.__call__``, if given as a keyword, this may be wrapped in a + 1-element tuple. + + .. versionchanged:: 1.13.0 + Tuples are allowed for keyword argument. + + Returns + ------- + r : ndarray + The accumulated values. If `out` was supplied, `r` is a reference to + `out`. + + Examples + -------- + 1-D array examples: + + >>> import numpy as np + >>> np.add.accumulate([2, 3, 5]) + array([ 2, 5, 10]) + >>> np.multiply.accumulate([2, 3, 5]) + array([ 2, 6, 30]) + + 2-D array examples: + + >>> I = np.eye(2) + >>> I + array([[1., 0.], + [0., 1.]]) + + Accumulate along axis 0 (rows), down columns: + + >>> np.add.accumulate(I, 0) + array([[1., 0.], + [1., 1.]]) + >>> np.add.accumulate(I) # no axis specified = axis zero + array([[1., 0.], + [1., 1.]]) + + Accumulate along axis 1 (columns), through rows: + + >>> np.add.accumulate(I, 1) + array([[1., 1.], + [0., 1.]]) + + """)) + +add_newdoc('numpy._core', 'ufunc', ('reduceat', + """ + reduceat(array, indices, axis=0, dtype=None, out=None) + + Performs a (local) reduce with specified slices over a single axis. + + For i in ``range(len(indices))``, `reduceat` computes + ``ufunc.reduce(array[indices[i]:indices[i+1]])``, which becomes the i-th + generalized "row" parallel to `axis` in the final result (i.e., in a + 2-D array, for example, if `axis = 0`, it becomes the i-th row, but if + `axis = 1`, it becomes the i-th column). There are three exceptions to this: + + * when ``i = len(indices) - 1`` (so for the last index), + ``indices[i+1] = array.shape[axis]``. + * if ``indices[i] >= indices[i + 1]``, the i-th generalized "row" is + simply ``array[indices[i]]``. + * if ``indices[i] >= len(array)`` or ``indices[i] < 0``, an error is raised. + + The shape of the output depends on the size of `indices`, and may be + larger than `array` (this happens if ``len(indices) > array.shape[axis]``). + + Parameters + ---------- + array : array_like + The array to act on. + indices : array_like + Paired indices, comma separated (not colon), specifying slices to + reduce. + axis : int, optional + The axis along which to apply the reduceat. + dtype : data-type code, optional + The data type used to perform the operation. Defaults to that of + ``out`` if given, and the data type of ``array`` otherwise (though + upcast to conserve precision for some cases, such as + ``numpy.add.reduce`` for integer or boolean input). + out : ndarray, None, or tuple of ndarray and None, optional + A location into which the result is stored. If not provided or None, + a freshly-allocated array is returned. For consistency with + ``ufunc.__call__``, if given as a keyword, this may be wrapped in a + 1-element tuple. + + .. versionchanged:: 1.13.0 + Tuples are allowed for keyword argument. + + Returns + ------- + r : ndarray + The reduced values. If `out` was supplied, `r` is a reference to + `out`. + + Notes + ----- + A descriptive example: + + If `array` is 1-D, the function `ufunc.accumulate(array)` is the same as + ``ufunc.reduceat(array, indices)[::2]`` where `indices` is + ``range(len(array) - 1)`` with a zero placed + in every other element: + ``indices = zeros(2 * len(array) - 1)``, + ``indices[1::2] = range(1, len(array))``. + + Don't be fooled by this attribute's name: `reduceat(array)` is not + necessarily smaller than `array`. + + Examples + -------- + To take the running sum of four successive values: + + >>> import numpy as np + >>> np.add.reduceat(np.arange(8),[0,4, 1,5, 2,6, 3,7])[::2] + array([ 6, 10, 14, 18]) + + A 2-D example: + + >>> x = np.linspace(0, 15, 16).reshape(4,4) + >>> x + array([[ 0., 1., 2., 3.], + [ 4., 5., 6., 7.], + [ 8., 9., 10., 11.], + [12., 13., 14., 15.]]) + + :: + + # reduce such that the result has the following five rows: + # [row1 + row2 + row3] + # [row4] + # [row2] + # [row3] + # [row1 + row2 + row3 + row4] + + >>> np.add.reduceat(x, [0, 3, 1, 2, 0]) + array([[12., 15., 18., 21.], + [12., 13., 14., 15.], + [ 4., 5., 6., 7.], + [ 8., 9., 10., 11.], + [24., 28., 32., 36.]]) + + :: + + # reduce such that result has the following two columns: + # [col1 * col2 * col3, col4] + + >>> np.multiply.reduceat(x, [0, 3], 1) + array([[ 0., 3.], + [ 120., 7.], + [ 720., 11.], + [2184., 15.]]) + + """)) + +add_newdoc('numpy._core', 'ufunc', ('outer', + r""" + outer(A, B, /, **kwargs) + + Apply the ufunc `op` to all pairs (a, b) with a in `A` and b in `B`. + + Let ``M = A.ndim``, ``N = B.ndim``. Then the result, `C`, of + ``op.outer(A, B)`` is an array of dimension M + N such that: + + .. math:: C[i_0, ..., i_{M-1}, j_0, ..., j_{N-1}] = + op(A[i_0, ..., i_{M-1}], B[j_0, ..., j_{N-1}]) + + For `A` and `B` one-dimensional, this is equivalent to:: + + r = empty(len(A),len(B)) + for i in range(len(A)): + for j in range(len(B)): + r[i,j] = op(A[i], B[j]) # op = ufunc in question + + Parameters + ---------- + A : array_like + First array + B : array_like + Second array + kwargs : any + Arguments to pass on to the ufunc. Typically `dtype` or `out`. + See `ufunc` for a comprehensive overview of all available arguments. + + Returns + ------- + r : ndarray + Output array + + See Also + -------- + numpy.outer : A less powerful version of ``np.multiply.outer`` + that `ravel`\ s all inputs to 1D. This exists + primarily for compatibility with old code. + + tensordot : ``np.tensordot(a, b, axes=((), ()))`` and + ``np.multiply.outer(a, b)`` behave same for all + dimensions of a and b. + + Examples + -------- + >>> np.multiply.outer([1, 2, 3], [4, 5, 6]) + array([[ 4, 5, 6], + [ 8, 10, 12], + [12, 15, 18]]) + + A multi-dimensional example: + + >>> A = np.array([[1, 2, 3], [4, 5, 6]]) + >>> A.shape + (2, 3) + >>> B = np.array([[1, 2, 3, 4]]) + >>> B.shape + (1, 4) + >>> C = np.multiply.outer(A, B) + >>> C.shape; C + (2, 3, 1, 4) + array([[[[ 1, 2, 3, 4]], + [[ 2, 4, 6, 8]], + [[ 3, 6, 9, 12]]], + [[[ 4, 8, 12, 16]], + [[ 5, 10, 15, 20]], + [[ 6, 12, 18, 24]]]]) + + """)) + +add_newdoc('numpy._core', 'ufunc', ('at', + """ + at(a, indices, b=None, /) + + Performs unbuffered in place operation on operand 'a' for elements + specified by 'indices'. For addition ufunc, this method is equivalent to + ``a[indices] += b``, except that results are accumulated for elements that + are indexed more than once. For example, ``a[[0,0]] += 1`` will only + increment the first element once because of buffering, whereas + ``add.at(a, [0,0], 1)`` will increment the first element twice. + + .. versionadded:: 1.8.0 + + Parameters + ---------- + a : array_like + The array to perform in place operation on. + indices : array_like or tuple + Array like index object or slice object for indexing into first + operand. If first operand has multiple dimensions, indices can be a + tuple of array like index objects or slice objects. + b : array_like + Second operand for ufuncs requiring two operands. Operand must be + broadcastable over first operand after indexing or slicing. + + Examples + -------- + Set items 0 and 1 to their negative values: + + >>> import numpy as np + >>> a = np.array([1, 2, 3, 4]) + >>> np.negative.at(a, [0, 1]) + >>> a + array([-1, -2, 3, 4]) + + Increment items 0 and 1, and increment item 2 twice: + + >>> a = np.array([1, 2, 3, 4]) + >>> np.add.at(a, [0, 1, 2, 2], 1) + >>> a + array([2, 3, 5, 4]) + + Add items 0 and 1 in first array to second array, + and store results in first array: + + >>> a = np.array([1, 2, 3, 4]) + >>> b = np.array([1, 2]) + >>> np.add.at(a, [0, 1], b) + >>> a + array([2, 4, 3, 4]) + + """)) + +add_newdoc('numpy._core', 'ufunc', ('resolve_dtypes', + """ + resolve_dtypes(dtypes, *, signature=None, casting=None, reduction=False) + + Find the dtypes NumPy will use for the operation. Both input and + output dtypes are returned and may differ from those provided. + + .. note:: + + This function always applies NEP 50 rules since it is not provided + any actual values. The Python types ``int``, ``float``, and + ``complex`` thus behave weak and should be passed for "untyped" + Python input. + + Parameters + ---------- + dtypes : tuple of dtypes, None, or literal int, float, complex + The input dtypes for each operand. Output operands can be + None, indicating that the dtype must be found. + signature : tuple of DTypes or None, optional + If given, enforces exact DType (classes) of the specific operand. + The ufunc ``dtype`` argument is equivalent to passing a tuple with + only output dtypes set. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + The casting mode when casting is necessary. This is identical to + the ufunc call casting modes. + reduction : boolean + If given, the resolution assumes a reduce operation is happening + which slightly changes the promotion and type resolution rules. + `dtypes` is usually something like ``(None, np.dtype("i2"), None)`` + for reductions (first input is also the output). + + .. note:: + + The default casting mode is "same_kind", however, as of + NumPy 1.24, NumPy uses "unsafe" for reductions. + + Returns + ------- + dtypes : tuple of dtypes + The dtypes which NumPy would use for the calculation. Note that + dtypes may not match the passed in ones (casting is necessary). + + + Examples + -------- + This API requires passing dtypes, define them for convenience: + + >>> import numpy as np + >>> int32 = np.dtype("int32") + >>> float32 = np.dtype("float32") + + The typical ufunc call does not pass an output dtype. `numpy.add` has two + inputs and one output, so leave the output as ``None`` (not provided): + + >>> np.add.resolve_dtypes((int32, float32, None)) + (dtype('float64'), dtype('float64'), dtype('float64')) + + The loop found uses "float64" for all operands (including the output), the + first input would be cast. + + ``resolve_dtypes`` supports "weak" handling for Python scalars by passing + ``int``, ``float``, or ``complex``: + + >>> np.add.resolve_dtypes((float32, float, None)) + (dtype('float32'), dtype('float32'), dtype('float32')) + + Where the Python ``float`` behaves samilar to a Python value ``0.0`` + in a ufunc call. (See :ref:`NEP 50 ` for details.) + + """)) + +add_newdoc('numpy._core', 'ufunc', ('_resolve_dtypes_and_context', + """ + _resolve_dtypes_and_context(dtypes, *, signature=None, casting=None, reduction=False) + + See `numpy.ufunc.resolve_dtypes` for parameter information. This + function is considered *unstable*. You may use it, but the returned + information is NumPy version specific and expected to change. + Large API/ABI changes are not expected, but a new NumPy version is + expected to require updating code using this functionality. + + This function is designed to be used in conjunction with + `numpy.ufunc._get_strided_loop`. The calls are split to mirror the C API + and allow future improvements. + + Returns + ------- + dtypes : tuple of dtypes + call_info : + PyCapsule with all necessary information to get access to low level + C calls. See `numpy.ufunc._get_strided_loop` for more information. + + """)) + +add_newdoc('numpy._core', 'ufunc', ('_get_strided_loop', + """ + _get_strided_loop(call_info, /, *, fixed_strides=None) + + This function fills in the ``call_info`` capsule to include all + information necessary to call the low-level strided loop from NumPy. + + See notes for more information. + + Parameters + ---------- + call_info : PyCapsule + The PyCapsule returned by `numpy.ufunc._resolve_dtypes_and_context`. + fixed_strides : tuple of int or None, optional + A tuple with fixed byte strides of all input arrays. NumPy may use + this information to find specialized loops, so any call must follow + the given stride. Use ``None`` to indicate that the stride is not + known (or not fixed) for all calls. + + Notes + ----- + Together with `numpy.ufunc._resolve_dtypes_and_context` this function + gives low-level access to the NumPy ufunc loops. + The first function does general preparation and returns the required + information. It returns this as a C capsule with the version specific + name ``numpy_1.24_ufunc_call_info``. + The NumPy 1.24 ufunc call info capsule has the following layout:: + + typedef struct { + PyArrayMethod_StridedLoop *strided_loop; + PyArrayMethod_Context *context; + NpyAuxData *auxdata; + + /* Flag information (expected to change) */ + npy_bool requires_pyapi; /* GIL is required by loop */ + + /* Loop doesn't set FPE flags; if not set check FPE flags */ + npy_bool no_floatingpoint_errors; + } ufunc_call_info; + + Note that the first call only fills in the ``context``. The call to + ``_get_strided_loop`` fills in all other data. The main thing to note is + that the new-style loops return 0 on success, -1 on failure. They are + passed context as new first input and ``auxdata`` as (replaced) last. + + Only the ``strided_loop``signature is considered guaranteed stable + for NumPy bug-fix releases. All other API is tied to the experimental + API versioning. + + The reason for the split call is that cast information is required to + decide what the fixed-strides will be. + + NumPy ties the lifetime of the ``auxdata`` information to the capsule. + + """)) + + + +############################################################################## +# +# Documentation for dtype attributes and methods +# +############################################################################## + +############################################################################## +# +# dtype object +# +############################################################################## + +add_newdoc('numpy._core.multiarray', 'dtype', + """ + dtype(dtype, align=False, copy=False, [metadata]) + + Create a data type object. + + A numpy array is homogeneous, and contains elements described by a + dtype object. A dtype object can be constructed from different + combinations of fundamental numeric types. + + Parameters + ---------- + dtype + Object to be converted to a data type object. + align : bool, optional + Add padding to the fields to match what a C compiler would output + for a similar C-struct. Can be ``True`` only if `obj` is a dictionary + or a comma-separated string. If a struct dtype is being created, + this also sets a sticky alignment flag ``isalignedstruct``. + copy : bool, optional + Make a new copy of the data-type object. If ``False``, the result + may just be a reference to a built-in data-type object. + metadata : dict, optional + An optional dictionary with dtype metadata. + + See also + -------- + result_type + + Examples + -------- + Using array-scalar type: + + >>> import numpy as np + >>> np.dtype(np.int16) + dtype('int16') + + Structured type, one field name 'f1', containing int16: + + >>> np.dtype([('f1', np.int16)]) + dtype([('f1', '>> np.dtype([('f1', [('f1', np.int16)])]) + dtype([('f1', [('f1', '>> np.dtype([('f1', np.uint64), ('f2', np.int32)]) + dtype([('f1', '>> np.dtype([('a','f8'),('b','S10')]) + dtype([('a', '>> np.dtype("i4, (2,3)f8") + dtype([('f0', '>> np.dtype([('hello',(np.int64,3)),('world',np.void,10)]) + dtype([('hello', '>> np.dtype((np.int16, {'x':(np.int8,0), 'y':(np.int8,1)})) + dtype((numpy.int16, [('x', 'i1'), ('y', 'i1')])) + + Using dictionaries. Two fields named 'gender' and 'age': + + >>> np.dtype({'names':['gender','age'], 'formats':['S1',np.uint8]}) + dtype([('gender', 'S1'), ('age', 'u1')]) + + Offsets in bytes, here 0 and 25: + + >>> np.dtype({'surname':('S25',0),'age':(np.uint8,25)}) + dtype([('surname', 'S25'), ('age', 'u1')]) + + """) + +############################################################################## +# +# dtype attributes +# +############################################################################## + +add_newdoc('numpy._core.multiarray', 'dtype', ('alignment', + """ + The required alignment (bytes) of this data-type according to the compiler. + + More information is available in the C-API section of the manual. + + Examples + -------- + + >>> import numpy as np + >>> x = np.dtype('i4') + >>> x.alignment + 4 + + >>> x = np.dtype(float) + >>> x.alignment + 8 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('byteorder', + """ + A character indicating the byte-order of this data-type object. + + One of: + + === ============== + '=' native + '<' little-endian + '>' big-endian + '|' not applicable + === ============== + + All built-in data-type objects have byteorder either '=' or '|'. + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype('i2') + >>> dt.byteorder + '=' + >>> # endian is not relevant for 8 bit numbers + >>> np.dtype('i1').byteorder + '|' + >>> # or ASCII strings + >>> np.dtype('S2').byteorder + '|' + >>> # Even if specific code is given, and it is native + >>> # '=' is the byteorder + >>> import sys + >>> sys_is_le = sys.byteorder == 'little' + >>> native_code = '<' if sys_is_le else '>' + >>> swapped_code = '>' if sys_is_le else '<' + >>> dt = np.dtype(native_code + 'i2') + >>> dt.byteorder + '=' + >>> # Swapped code shows up as itself + >>> dt = np.dtype(swapped_code + 'i2') + >>> dt.byteorder == swapped_code + True + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('char', + """A unique character code for each of the 21 different built-in types. + + Examples + -------- + + >>> import numpy as np + >>> x = np.dtype(float) + >>> x.char + 'd' + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('descr', + """ + `__array_interface__` description of the data-type. + + The format is that required by the 'descr' key in the + `__array_interface__` attribute. + + Warning: This attribute exists specifically for `__array_interface__`, + and passing it directly to `numpy.dtype` will not accurately reconstruct + some dtypes (e.g., scalar and subarray dtypes). + + Examples + -------- + + >>> import numpy as np + >>> x = np.dtype(float) + >>> x.descr + [('', '>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) + >>> dt.descr + [('name', '>> import numpy as np + >>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) + >>> print(dt.fields) + {'grades': (dtype(('float64',(2,))), 16), 'name': (dtype('|S16'), 0)} + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('flags', + """ + Bit-flags describing how this data type is to be interpreted. + + Bit-masks are in ``numpy._core.multiarray`` as the constants + `ITEM_HASOBJECT`, `LIST_PICKLE`, `ITEM_IS_POINTER`, `NEEDS_INIT`, + `NEEDS_PYAPI`, `USE_GETITEM`, `USE_SETITEM`. A full explanation + of these flags is in C-API documentation; they are largely useful + for user-defined data-types. + + The following example demonstrates that operations on this particular + dtype requires Python C-API. + + Examples + -------- + + >>> import numpy as np + >>> x = np.dtype([('a', np.int32, 8), ('b', np.float64, 6)]) + >>> x.flags + 16 + >>> np._core.multiarray.NEEDS_PYAPI + 16 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('hasobject', + """ + Boolean indicating whether this dtype contains any reference-counted + objects in any fields or sub-dtypes. + + Recall that what is actually in the ndarray memory representing + the Python object is the memory address of that object (a pointer). + Special handling may be required, and this attribute is useful for + distinguishing data types that may contain arbitrary Python objects + and data-types that won't. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('isbuiltin', + """ + Integer indicating how this dtype relates to the built-in dtypes. + + Read-only. + + = ======================================================================== + 0 if this is a structured array type, with fields + 1 if this is a dtype compiled into numpy (such as ints, floats etc) + 2 if the dtype is for a user-defined numpy type + A user-defined type uses the numpy C-API machinery to extend + numpy to handle a new array type. See + :ref:`user.user-defined-data-types` in the NumPy manual. + = ======================================================================== + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype('i2') + >>> dt.isbuiltin + 1 + >>> dt = np.dtype('f8') + >>> dt.isbuiltin + 1 + >>> dt = np.dtype([('field1', 'f8')]) + >>> dt.isbuiltin + 0 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('isnative', + """ + Boolean indicating whether the byte order of this dtype is native + to the platform. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('isalignedstruct', + """ + Boolean indicating whether the dtype is a struct which maintains + field alignment. This flag is sticky, so when combining multiple + structs together, it is preserved and produces new dtypes which + are also aligned. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('itemsize', + """ + The element size of this data-type object. + + For 18 of the 21 types this number is fixed by the data-type. + For the flexible data-types, this number can be anything. + + Examples + -------- + + >>> import numpy as np + >>> arr = np.array([[1, 2], [3, 4]]) + >>> arr.dtype + dtype('int64') + >>> arr.itemsize + 8 + + >>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) + >>> dt.itemsize + 80 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('kind', + """ + A character code (one of 'biufcmMOSUV') identifying the general kind of data. + + = ====================== + b boolean + i signed integer + u unsigned integer + f floating-point + c complex floating-point + m timedelta + M datetime + O object + S (byte-)string + U Unicode + V void + = ====================== + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype('i4') + >>> dt.kind + 'i' + >>> dt = np.dtype('f8') + >>> dt.kind + 'f' + >>> dt = np.dtype([('field1', 'f8')]) + >>> dt.kind + 'V' + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('metadata', + """ + Either ``None`` or a readonly dictionary of metadata (mappingproxy). + + The metadata field can be set using any dictionary at data-type + creation. NumPy currently has no uniform approach to propagating + metadata; although some array operations preserve it, there is no + guarantee that others will. + + .. warning:: + + Although used in certain projects, this feature was long undocumented + and is not well supported. Some aspects of metadata propagation + are expected to change in the future. + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype(float, metadata={"key": "value"}) + >>> dt.metadata["key"] + 'value' + >>> arr = np.array([1, 2, 3], dtype=dt) + >>> arr.dtype.metadata + mappingproxy({'key': 'value'}) + + Adding arrays with identical datatypes currently preserves the metadata: + + >>> (arr + arr).dtype.metadata + mappingproxy({'key': 'value'}) + + But if the arrays have different dtype metadata, the metadata may be + dropped: + + >>> dt2 = np.dtype(float, metadata={"key2": "value2"}) + >>> arr2 = np.array([3, 2, 1], dtype=dt2) + >>> (arr + arr2).dtype.metadata is None + True # The metadata field is cleared so None is returned + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('name', + """ + A bit-width name for this data-type. + + Un-sized flexible data-type objects do not have this attribute. + + Examples + -------- + + >>> import numpy as np + >>> x = np.dtype(float) + >>> x.name + 'float64' + >>> x = np.dtype([('a', np.int32, 8), ('b', np.float64, 6)]) + >>> x.name + 'void640' + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('names', + """ + Ordered list of field names, or ``None`` if there are no fields. + + The names are ordered according to increasing byte offset. This can be + used, for example, to walk through all of the named fields in offset order. + + Examples + -------- + >>> dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) + >>> dt.names + ('name', 'grades') + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('num', + """ + A unique number for each of the 21 different built-in types. + + These are roughly ordered from least-to-most precision. + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype(str) + >>> dt.num + 19 + + >>> dt = np.dtype(float) + >>> dt.num + 12 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('shape', + """ + Shape tuple of the sub-array if this data type describes a sub-array, + and ``()`` otherwise. + + Examples + -------- + + >>> import numpy as np + >>> dt = np.dtype(('i4', 4)) + >>> dt.shape + (4,) + + >>> dt = np.dtype(('i4', (2, 3))) + >>> dt.shape + (2, 3) + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('ndim', + """ + Number of dimensions of the sub-array if this data type describes a + sub-array, and ``0`` otherwise. + + .. versionadded:: 1.13.0 + + Examples + -------- + >>> import numpy as np + >>> x = np.dtype(float) + >>> x.ndim + 0 + + >>> x = np.dtype((float, 8)) + >>> x.ndim + 1 + + >>> x = np.dtype(('i4', (3, 4))) + >>> x.ndim + 2 + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('str', + """The array-protocol typestring of this data-type object.""")) + +add_newdoc('numpy._core.multiarray', 'dtype', ('subdtype', + """ + Tuple ``(item_dtype, shape)`` if this `dtype` describes a sub-array, and + None otherwise. + + The *shape* is the fixed shape of the sub-array described by this + data type, and *item_dtype* the data type of the array. + + If a field whose dtype object has this attribute is retrieved, + then the extra dimensions implied by *shape* are tacked on to + the end of the retrieved array. + + See Also + -------- + dtype.base + + Examples + -------- + >>> import numpy as np + >>> x = numpy.dtype('8f') + >>> x.subdtype + (dtype('float32'), (8,)) + + >>> x = numpy.dtype('i2') + >>> x.subdtype + >>> + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('base', + """ + Returns dtype for the base element of the subarrays, + regardless of their dimension or shape. + + See Also + -------- + dtype.subdtype + + Examples + -------- + >>> import numpy as np + >>> x = numpy.dtype('8f') + >>> x.base + dtype('float32') + + >>> x = numpy.dtype('i2') + >>> x.base + dtype('int16') + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('type', + """The type object used to instantiate a scalar of this data-type.""")) + +############################################################################## +# +# dtype methods +# +############################################################################## + +add_newdoc('numpy._core.multiarray', 'dtype', ('newbyteorder', + """ + newbyteorder(new_order='S', /) + + Return a new dtype with a different byte order. + + Changes are also made in all fields and sub-arrays of the data type. + + Parameters + ---------- + new_order : string, optional + Byte order to force; a value from the byte order specifications + below. The default value ('S') results in swapping the current + byte order. `new_order` codes can be any of: + + * 'S' - swap dtype from current to opposite endian + * {'<', 'little'} - little endian + * {'>', 'big'} - big endian + * {'=', 'native'} - native order + * {'|', 'I'} - ignore (no change to byte order) + + Returns + ------- + new_dtype : dtype + New dtype object with the given change to the byte order. + + Notes + ----- + Changes are also made in all fields and sub-arrays of the data type. + + Examples + -------- + >>> import sys + >>> sys_is_le = sys.byteorder == 'little' + >>> native_code = '<' if sys_is_le else '>' + >>> swapped_code = '>' if sys_is_le else '<' + >>> import numpy as np + >>> native_dt = np.dtype(native_code+'i2') + >>> swapped_dt = np.dtype(swapped_code+'i2') + >>> native_dt.newbyteorder('S') == swapped_dt + True + >>> native_dt.newbyteorder() == swapped_dt + True + >>> native_dt == swapped_dt.newbyteorder('S') + True + >>> native_dt == swapped_dt.newbyteorder('=') + True + >>> native_dt == swapped_dt.newbyteorder('N') + True + >>> native_dt == native_dt.newbyteorder('|') + True + >>> np.dtype('>> np.dtype('>> np.dtype('>i2') == native_dt.newbyteorder('>') + True + >>> np.dtype('>i2') == native_dt.newbyteorder('B') + True + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('__class_getitem__', + """ + __class_getitem__(item, /) + + Return a parametrized wrapper around the `~numpy.dtype` type. + + .. versionadded:: 1.22 + + Returns + ------- + alias : types.GenericAlias + A parametrized `~numpy.dtype` type. + + Examples + -------- + >>> import numpy as np + + >>> np.dtype[np.int64] + numpy.dtype[numpy.int64] + + See Also + -------- + :pep:`585` : Type hinting generics in standard collections. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('__ge__', + """ + __ge__(value, /) + + Return ``self >= value``. + + Equivalent to ``np.can_cast(value, self, casting="safe")``. + + See Also + -------- + can_cast : Returns True if cast between data types can occur according to + the casting rule. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('__le__', + """ + __le__(value, /) + + Return ``self <= value``. + + Equivalent to ``np.can_cast(self, value, casting="safe")``. + + See Also + -------- + can_cast : Returns True if cast between data types can occur according to + the casting rule. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('__gt__', + """ + __ge__(value, /) + + Return ``self > value``. + + Equivalent to + ``self != value and np.can_cast(value, self, casting="safe")``. + + See Also + -------- + can_cast : Returns True if cast between data types can occur according to + the casting rule. + + """)) + +add_newdoc('numpy._core.multiarray', 'dtype', ('__lt__', + """ + __lt__(value, /) + + Return ``self < value``. + + Equivalent to + ``self != value and np.can_cast(self, value, casting="safe")``. + + See Also + -------- + can_cast : Returns True if cast between data types can occur according to + the casting rule. + + """)) + +############################################################################## +# +# Datetime-related Methods +# +############################################################################## + +add_newdoc('numpy._core.multiarray', 'busdaycalendar', + """ + busdaycalendar(weekmask='1111100', holidays=None) + + A business day calendar object that efficiently stores information + defining valid days for the busday family of functions. + + The default valid days are Monday through Friday ("business days"). + A busdaycalendar object can be specified with any set of weekly + valid days, plus an optional "holiday" dates that always will be invalid. + + Once a busdaycalendar object is created, the weekmask and holidays + cannot be modified. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates, no matter which + weekday they fall upon. Holiday dates may be specified in any + order, and NaT (not-a-time) dates are ignored. This list is + saved in a normalized form that is suited for fast calculations + of valid days. + + Returns + ------- + out : busdaycalendar + A business day calendar object containing the specified + weekmask and holidays values. + + See Also + -------- + is_busday : Returns a boolean array indicating valid days. + busday_offset : Applies an offset counted in valid days. + busday_count : Counts how many valid days are in a half-open date range. + + Attributes + ---------- + weekmask : (copy) seven-element array of bool + holidays : (copy) sorted array of datetime64[D] + + Notes + ----- + Once a busdaycalendar object is created, you cannot modify the + weekmask or holidays. The attributes return copies of internal data. + + Examples + -------- + >>> import numpy as np + >>> # Some important days in July + ... bdd = np.busdaycalendar( + ... holidays=['2011-07-01', '2011-07-04', '2011-07-17']) + >>> # Default is Monday to Friday weekdays + ... bdd.weekmask + array([ True, True, True, True, True, False, False]) + >>> # Any holidays already on the weekend are removed + ... bdd.holidays + array(['2011-07-01', '2011-07-04'], dtype='datetime64[D]') + """) + +add_newdoc('numpy._core.multiarray', 'busdaycalendar', ('weekmask', + """A copy of the seven-element boolean mask indicating valid days.""")) + +add_newdoc('numpy._core.multiarray', 'busdaycalendar', ('holidays', + """A copy of the holiday array indicating additional invalid days.""")) + +add_newdoc('numpy._core.multiarray', 'normalize_axis_index', + """ + normalize_axis_index(axis, ndim, msg_prefix=None) + + Normalizes an axis index, `axis`, such that is a valid positive index into + the shape of array with `ndim` dimensions. Raises an AxisError with an + appropriate message if this is not possible. + + Used internally by all axis-checking logic. + + .. versionadded:: 1.13.0 + + Parameters + ---------- + axis : int + The un-normalized index of the axis. Can be negative + ndim : int + The number of dimensions of the array that `axis` should be normalized + against + msg_prefix : str + A prefix to put before the message, typically the name of the argument + + Returns + ------- + normalized_axis : int + The normalized axis index, such that `0 <= normalized_axis < ndim` + + Raises + ------ + AxisError + If the axis index is invalid, when `-ndim <= axis < ndim` is false. + + Examples + -------- + >>> import numpy as np + >>> from numpy.lib.array_utils import normalize_axis_index + >>> normalize_axis_index(0, ndim=3) + 0 + >>> normalize_axis_index(1, ndim=3) + 1 + >>> normalize_axis_index(-1, ndim=3) + 2 + + >>> normalize_axis_index(3, ndim=3) + Traceback (most recent call last): + ... + numpy.exceptions.AxisError: axis 3 is out of bounds for array ... + >>> normalize_axis_index(-4, ndim=3, msg_prefix='axes_arg') + Traceback (most recent call last): + ... + numpy.exceptions.AxisError: axes_arg: axis -4 is out of bounds ... + """) + +add_newdoc('numpy._core.multiarray', 'datetime_data', + """ + datetime_data(dtype, /) + + Get information about the step size of a date or time type. + + The returned tuple can be passed as the second argument of `numpy.datetime64` and + `numpy.timedelta64`. + + Parameters + ---------- + dtype : dtype + The dtype object, which must be a `datetime64` or `timedelta64` type. + + Returns + ------- + unit : str + The :ref:`datetime unit ` on which this dtype + is based. + count : int + The number of base units in a step. + + Examples + -------- + >>> import numpy as np + >>> dt_25s = np.dtype('timedelta64[25s]') + >>> np.datetime_data(dt_25s) + ('s', 25) + >>> np.array(10, dt_25s).astype('timedelta64[s]') + array(250, dtype='timedelta64[s]') + + The result can be used to construct a datetime that uses the same units + as a timedelta + + >>> np.datetime64('2010', np.datetime_data(dt_25s)) + np.datetime64('2010-01-01T00:00:00','25s') + """) + + +############################################################################## +# +# Documentation for `generic` attributes and methods +# +############################################################################## + +add_newdoc('numpy._core.numerictypes', 'generic', + """ + Base class for numpy scalar types. + + Class from which most (all?) numpy scalar types are derived. For + consistency, exposes the same API as `ndarray`, despite many + consequent attributes being either "get-only," or completely irrelevant. + This is the class from which it is strongly suggested users should derive + custom scalar types. + + """) + +# Attributes + +def refer_to_array_attribute(attr, method=True): + docstring = """ + Scalar {} identical to the corresponding array attribute. + + Please see `ndarray.{}`. + """ + + return attr, docstring.format("method" if method else "attribute", attr) + + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('T', method=False)) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('base', method=False)) + +add_newdoc('numpy._core.numerictypes', 'generic', ('data', + """Pointer to start of data.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('dtype', + """Get array data-descriptor.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('flags', + """The integer value of flags.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('flat', + """A 1-D view of the scalar.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('imag', + """The imaginary part of the scalar.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('itemsize', + """The length of one element in bytes.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('ndim', + """The number of array dimensions.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('real', + """The real part of the scalar.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('shape', + """Tuple of array dimensions.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('size', + """The number of elements in the gentype.""")) + +add_newdoc('numpy._core.numerictypes', 'generic', ('strides', + """Tuple of bytes steps in each dimension.""")) + +# Methods + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('all')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('any')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('argmax')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('argmin')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('argsort')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('astype')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('byteswap')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('choose')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('clip')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('compress')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('conjugate')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('copy')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('cumprod')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('cumsum')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('diagonal')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('dump')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('dumps')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('fill')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('flatten')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('getfield')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('item')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('max')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('mean')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('min')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('nonzero')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('prod')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('put')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('ravel')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('repeat')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('reshape')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('resize')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('round')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('searchsorted')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('setfield')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('setflags')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('sort')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('squeeze')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('std')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('sum')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('swapaxes')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('take')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('tofile')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('tolist')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('tostring')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('trace')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('transpose')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('var')) + +add_newdoc('numpy._core.numerictypes', 'generic', + refer_to_array_attribute('view')) + +add_newdoc('numpy._core.numerictypes', 'number', ('__class_getitem__', + """ + __class_getitem__(item, /) + + Return a parametrized wrapper around the `~numpy.number` type. + + .. versionadded:: 1.22 + + Returns + ------- + alias : types.GenericAlias + A parametrized `~numpy.number` type. + + Examples + -------- + >>> from typing import Any + >>> import numpy as np + + >>> np.signedinteger[Any] + numpy.signedinteger[typing.Any] + + See Also + -------- + :pep:`585` : Type hinting generics in standard collections. + + """)) + +############################################################################## +# +# Documentation for scalar type abstract base classes in type hierarchy +# +############################################################################## + + +add_newdoc('numpy._core.numerictypes', 'number', + """ + Abstract base class of all numeric scalar types. + + """) + +add_newdoc('numpy._core.numerictypes', 'integer', + """ + Abstract base class of all integer scalar types. + + """) + +add_newdoc('numpy._core.numerictypes', 'signedinteger', + """ + Abstract base class of all signed integer scalar types. + + """) + +add_newdoc('numpy._core.numerictypes', 'unsignedinteger', + """ + Abstract base class of all unsigned integer scalar types. + + """) + +add_newdoc('numpy._core.numerictypes', 'inexact', + """ + Abstract base class of all numeric scalar types with a (potentially) + inexact representation of the values in its range, such as + floating-point numbers. + + """) + +add_newdoc('numpy._core.numerictypes', 'floating', + """ + Abstract base class of all floating-point scalar types. + + """) + +add_newdoc('numpy._core.numerictypes', 'complexfloating', + """ + Abstract base class of all complex number scalar types that are made up of + floating-point numbers. + + """) + +add_newdoc('numpy._core.numerictypes', 'flexible', + """ + Abstract base class of all scalar types without predefined length. + The actual size of these types depends on the specific `numpy.dtype` + instantiation. + + """) + +add_newdoc('numpy._core.numerictypes', 'character', + """ + Abstract base class of all character string scalar types. + + """) + +add_newdoc('numpy._core.multiarray', 'StringDType', + """ + StringDType(*, na_object=np._NoValue, coerce=True) + + Create a StringDType instance. + + StringDType can be used to store UTF-8 encoded variable-width strings in + a NumPy array. + + Parameters + ---------- + na_object : object, optional + Object used to represent missing data. If unset, the array will not + use a missing data sentinel. + coerce : bool, optional + Whether or not items in an array-like passed to an array creation + function that are neither a str or str subtype should be coerced to + str. Defaults to True. If set to False, creating a StringDType + array from an array-like containing entries that are not already + strings will raise an error. + + Examples + -------- + + >>> import numpy as np + + >>> from numpy.dtypes import StringDType + >>> np.array(["hello", "world"], dtype=StringDType()) + array(["hello", "world"], dtype=StringDType()) + + >>> arr = np.array(["hello", None, "world"], + ... dtype=StringDType(na_object=None)) + >>> arr + array(["hello", None, "world"], dtype=StringDType(na_object=None)) + >>> arr[1] is None + True + + >>> arr = np.array(["hello", np.nan, "world"], + ... dtype=StringDType(na_object=np.nan)) + >>> np.isnan(arr) + array([False, True, False]) + + >>> np.array([1.2, object(), "hello world"], + ... dtype=StringDType(coerce=True)) + ValueError: StringDType only allows string data when string coercion + is disabled. + + >>> np.array(["hello", "world"], dtype=StringDType(coerce=True)) + array(["hello", "world"], dtype=StringDType(coerce=True)) + """) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_asarray.py b/valley/lib/python3.10/site-packages/numpy/_core/_asarray.py new file mode 100644 index 0000000000000000000000000000000000000000..2908813e7747af1ce10e0c68381547f774cc2c60 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_asarray.py @@ -0,0 +1,135 @@ +""" +Functions in the ``as*array`` family that promote array-likes into arrays. + +`require` fits this category despite its name not matching this pattern. +""" +from .overrides import ( + array_function_dispatch, + set_array_function_like_doc, + set_module, +) +from .multiarray import array, asanyarray + + +__all__ = ["require"] + + +POSSIBLE_FLAGS = { + 'C': 'C', 'C_CONTIGUOUS': 'C', 'CONTIGUOUS': 'C', + 'F': 'F', 'F_CONTIGUOUS': 'F', 'FORTRAN': 'F', + 'A': 'A', 'ALIGNED': 'A', + 'W': 'W', 'WRITEABLE': 'W', + 'O': 'O', 'OWNDATA': 'O', + 'E': 'E', 'ENSUREARRAY': 'E' +} + + +@set_array_function_like_doc +@set_module('numpy') +def require(a, dtype=None, requirements=None, *, like=None): + """ + Return an ndarray of the provided type that satisfies requirements. + + This function is useful to be sure that an array with the correct flags + is returned for passing to compiled code (perhaps through ctypes). + + Parameters + ---------- + a : array_like + The object to be converted to a type-and-requirement-satisfying array. + dtype : data-type + The required data-type. If None preserve the current dtype. If your + application requires the data to be in native byteorder, include + a byteorder specification as a part of the dtype specification. + requirements : str or sequence of str + The requirements list can be any of the following + + * 'F_CONTIGUOUS' ('F') - ensure a Fortran-contiguous array + * 'C_CONTIGUOUS' ('C') - ensure a C-contiguous array + * 'ALIGNED' ('A') - ensure a data-type aligned array + * 'WRITEABLE' ('W') - ensure a writable array + * 'OWNDATA' ('O') - ensure an array that owns its own data + * 'ENSUREARRAY', ('E') - ensure a base array, instead of a subclass + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array with specified requirements and type if given. + + See Also + -------- + asarray : Convert input to an ndarray. + asanyarray : Convert to an ndarray, but pass through ndarray subclasses. + ascontiguousarray : Convert input to a contiguous array. + asfortranarray : Convert input to an ndarray with column-major + memory order. + ndarray.flags : Information about the memory layout of the array. + + Notes + ----- + The returned array will be guaranteed to have the listed requirements + by making a copy if needed. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2,3) + >>> x.flags + C_CONTIGUOUS : True + F_CONTIGUOUS : False + OWNDATA : False + WRITEABLE : True + ALIGNED : True + WRITEBACKIFCOPY : False + + >>> y = np.require(x, dtype=np.float32, requirements=['A', 'O', 'W', 'F']) + >>> y.flags + C_CONTIGUOUS : False + F_CONTIGUOUS : True + OWNDATA : True + WRITEABLE : True + ALIGNED : True + WRITEBACKIFCOPY : False + + """ + if like is not None: + return _require_with_like( + like, + a, + dtype=dtype, + requirements=requirements, + ) + + if not requirements: + return asanyarray(a, dtype=dtype) + + requirements = {POSSIBLE_FLAGS[x.upper()] for x in requirements} + + if 'E' in requirements: + requirements.remove('E') + subok = False + else: + subok = True + + order = 'A' + if requirements >= {'C', 'F'}: + raise ValueError('Cannot specify both "C" and "F" order') + elif 'F' in requirements: + order = 'F' + requirements.remove('F') + elif 'C' in requirements: + order = 'C' + requirements.remove('C') + + arr = array(a, dtype=dtype, order=order, copy=None, subok=subok) + + for prop in requirements: + if not arr.flags[prop]: + return arr.copy(order) + return arr + + +_require_with_like = array_function_dispatch()(require) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_asarray.pyi b/valley/lib/python3.10/site-packages/numpy/_core/_asarray.pyi new file mode 100644 index 0000000000000000000000000000000000000000..5cd49659480e057918265c9c9dc1b7015d250580 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_asarray.pyi @@ -0,0 +1,41 @@ +from collections.abc import Iterable +from typing import Any, TypeVar, overload, Literal + +from numpy._typing import NDArray, DTypeLike, _SupportsArrayFunc + +_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any]) + +_Requirements = Literal[ + "C", "C_CONTIGUOUS", "CONTIGUOUS", + "F", "F_CONTIGUOUS", "FORTRAN", + "A", "ALIGNED", + "W", "WRITEABLE", + "O", "OWNDATA" +] +_E = Literal["E", "ENSUREARRAY"] +_RequirementsWithE = _Requirements | _E + +@overload +def require( + a: _ArrayType, + dtype: None = ..., + requirements: None | _Requirements | Iterable[_Requirements] = ..., + *, + like: _SupportsArrayFunc = ... +) -> _ArrayType: ... +@overload +def require( + a: object, + dtype: DTypeLike = ..., + requirements: _E | Iterable[_RequirementsWithE] = ..., + *, + like: _SupportsArrayFunc = ... +) -> NDArray[Any]: ... +@overload +def require( + a: object, + dtype: DTypeLike = ..., + requirements: None | _Requirements | Iterable[_Requirements] = ..., + *, + like: _SupportsArrayFunc = ... +) -> NDArray[Any]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_dtype_ctypes.py b/valley/lib/python3.10/site-packages/numpy/_core/_dtype_ctypes.py new file mode 100644 index 0000000000000000000000000000000000000000..fef1e0db35f2fcd97269e25ca442b881a8a1a757 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_dtype_ctypes.py @@ -0,0 +1,120 @@ +""" +Conversion from ctypes to dtype. + +In an ideal world, we could achieve this through the PEP3118 buffer protocol, +something like:: + + def dtype_from_ctypes_type(t): + # needed to ensure that the shape of `t` is within memoryview.format + class DummyStruct(ctypes.Structure): + _fields_ = [('a', t)] + + # empty to avoid memory allocation + ctype_0 = (DummyStruct * 0)() + mv = memoryview(ctype_0) + + # convert the struct, and slice back out the field + return _dtype_from_pep3118(mv.format)['a'] + +Unfortunately, this fails because: + +* ctypes cannot handle length-0 arrays with PEP3118 (bpo-32782) +* PEP3118 cannot represent unions, but both numpy and ctypes can +* ctypes cannot handle big-endian structs with PEP3118 (bpo-32780) +""" + +# We delay-import ctypes for distributions that do not include it. +# While this module is not used unless the user passes in ctypes +# members, it is eagerly imported from numpy/_core/__init__.py. +import numpy as np + + +def _from_ctypes_array(t): + return np.dtype((dtype_from_ctypes_type(t._type_), (t._length_,))) + + +def _from_ctypes_structure(t): + for item in t._fields_: + if len(item) > 2: + raise TypeError( + "ctypes bitfields have no dtype equivalent") + + if hasattr(t, "_pack_"): + import ctypes + formats = [] + offsets = [] + names = [] + current_offset = 0 + for fname, ftyp in t._fields_: + names.append(fname) + formats.append(dtype_from_ctypes_type(ftyp)) + # Each type has a default offset, this is platform dependent + # for some types. + effective_pack = min(t._pack_, ctypes.alignment(ftyp)) + current_offset = ( + (current_offset + effective_pack - 1) // effective_pack + ) * effective_pack + offsets.append(current_offset) + current_offset += ctypes.sizeof(ftyp) + + return np.dtype(dict( + formats=formats, + offsets=offsets, + names=names, + itemsize=ctypes.sizeof(t))) + else: + fields = [] + for fname, ftyp in t._fields_: + fields.append((fname, dtype_from_ctypes_type(ftyp))) + + # by default, ctypes structs are aligned + return np.dtype(fields, align=True) + + +def _from_ctypes_scalar(t): + """ + Return the dtype type with endianness included if it's the case + """ + if getattr(t, '__ctype_be__', None) is t: + return np.dtype('>' + t._type_) + elif getattr(t, '__ctype_le__', None) is t: + return np.dtype('<' + t._type_) + else: + return np.dtype(t._type_) + + +def _from_ctypes_union(t): + import ctypes + formats = [] + offsets = [] + names = [] + for fname, ftyp in t._fields_: + names.append(fname) + formats.append(dtype_from_ctypes_type(ftyp)) + offsets.append(0) # Union fields are offset to 0 + + return np.dtype(dict( + formats=formats, + offsets=offsets, + names=names, + itemsize=ctypes.sizeof(t))) + + +def dtype_from_ctypes_type(t): + """ + Construct a dtype object from a ctypes type + """ + import _ctypes + if issubclass(t, _ctypes.Array): + return _from_ctypes_array(t) + elif issubclass(t, _ctypes._Pointer): + raise TypeError("ctypes pointers have no dtype equivalent") + elif issubclass(t, _ctypes.Structure): + return _from_ctypes_structure(t) + elif issubclass(t, _ctypes.Union): + return _from_ctypes_union(t) + elif isinstance(getattr(t, '_type_', None), str): + return _from_ctypes_scalar(t) + else: + raise NotImplementedError( + "Unknown ctypes type {}".format(t.__name__)) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_exceptions.py b/valley/lib/python3.10/site-packages/numpy/_core/_exceptions.py new file mode 100644 index 0000000000000000000000000000000000000000..87d4213a6d42cf090f8db75571244840dd68cd5a --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_exceptions.py @@ -0,0 +1,172 @@ +""" +Various richly-typed exceptions, that also help us deal with string formatting +in python where it's easier. + +By putting the formatting in `__str__`, we also avoid paying the cost for +users who silence the exceptions. +""" +from .._utils import set_module + +def _unpack_tuple(tup): + if len(tup) == 1: + return tup[0] + else: + return tup + + +def _display_as_base(cls): + """ + A decorator that makes an exception class look like its base. + + We use this to hide subclasses that are implementation details - the user + should catch the base type, which is what the traceback will show them. + + Classes decorated with this decorator are subject to removal without a + deprecation warning. + """ + assert issubclass(cls, Exception) + cls.__name__ = cls.__base__.__name__ + return cls + + +class UFuncTypeError(TypeError): + """ Base class for all ufunc exceptions """ + def __init__(self, ufunc): + self.ufunc = ufunc + + +@_display_as_base +class _UFuncNoLoopError(UFuncTypeError): + """ Thrown when a ufunc loop cannot be found """ + def __init__(self, ufunc, dtypes): + super().__init__(ufunc) + self.dtypes = tuple(dtypes) + + def __str__(self): + return ( + "ufunc {!r} did not contain a loop with signature matching types " + "{!r} -> {!r}" + ).format( + self.ufunc.__name__, + _unpack_tuple(self.dtypes[:self.ufunc.nin]), + _unpack_tuple(self.dtypes[self.ufunc.nin:]) + ) + + +@_display_as_base +class _UFuncBinaryResolutionError(_UFuncNoLoopError): + """ Thrown when a binary resolution fails """ + def __init__(self, ufunc, dtypes): + super().__init__(ufunc, dtypes) + assert len(self.dtypes) == 2 + + def __str__(self): + return ( + "ufunc {!r} cannot use operands with types {!r} and {!r}" + ).format( + self.ufunc.__name__, *self.dtypes + ) + + +@_display_as_base +class _UFuncCastingError(UFuncTypeError): + def __init__(self, ufunc, casting, from_, to): + super().__init__(ufunc) + self.casting = casting + self.from_ = from_ + self.to = to + + +@_display_as_base +class _UFuncInputCastingError(_UFuncCastingError): + """ Thrown when a ufunc input cannot be casted """ + def __init__(self, ufunc, casting, from_, to, i): + super().__init__(ufunc, casting, from_, to) + self.in_i = i + + def __str__(self): + # only show the number if more than one input exists + i_str = "{} ".format(self.in_i) if self.ufunc.nin != 1 else "" + return ( + "Cannot cast ufunc {!r} input {}from {!r} to {!r} with casting " + "rule {!r}" + ).format( + self.ufunc.__name__, i_str, self.from_, self.to, self.casting + ) + + +@_display_as_base +class _UFuncOutputCastingError(_UFuncCastingError): + """ Thrown when a ufunc output cannot be casted """ + def __init__(self, ufunc, casting, from_, to, i): + super().__init__(ufunc, casting, from_, to) + self.out_i = i + + def __str__(self): + # only show the number if more than one output exists + i_str = "{} ".format(self.out_i) if self.ufunc.nout != 1 else "" + return ( + "Cannot cast ufunc {!r} output {}from {!r} to {!r} with casting " + "rule {!r}" + ).format( + self.ufunc.__name__, i_str, self.from_, self.to, self.casting + ) + + +@_display_as_base +class _ArrayMemoryError(MemoryError): + """ Thrown when an array cannot be allocated""" + def __init__(self, shape, dtype): + self.shape = shape + self.dtype = dtype + + @property + def _total_size(self): + num_bytes = self.dtype.itemsize + for dim in self.shape: + num_bytes *= dim + return num_bytes + + @staticmethod + def _size_to_string(num_bytes): + """ Convert a number of bytes into a binary size string """ + + # https://en.wikipedia.org/wiki/Binary_prefix + LOG2_STEP = 10 + STEP = 1024 + units = ['bytes', 'KiB', 'MiB', 'GiB', 'TiB', 'PiB', 'EiB'] + + unit_i = max(num_bytes.bit_length() - 1, 1) // LOG2_STEP + unit_val = 1 << (unit_i * LOG2_STEP) + n_units = num_bytes / unit_val + del unit_val + + # ensure we pick a unit that is correct after rounding + if round(n_units) == STEP: + unit_i += 1 + n_units /= STEP + + # deal with sizes so large that we don't have units for them + if unit_i >= len(units): + new_unit_i = len(units) - 1 + n_units *= 1 << ((unit_i - new_unit_i) * LOG2_STEP) + unit_i = new_unit_i + + unit_name = units[unit_i] + # format with a sensible number of digits + if unit_i == 0: + # no decimal point on bytes + return '{:.0f} {}'.format(n_units, unit_name) + elif round(n_units) < 1000: + # 3 significant figures, if none are dropped to the left of the . + return '{:#.3g} {}'.format(n_units, unit_name) + else: + # just give all the digits otherwise + return '{:#.0f} {}'.format(n_units, unit_name) + + def __str__(self): + size_str = self._size_to_string(self._total_size) + return ( + "Unable to allocate {} for an array with shape {} and data type {}" + .format(size_str, self.shape, self.dtype) + ) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_methods.py b/valley/lib/python3.10/site-packages/numpy/_core/_methods.py new file mode 100644 index 0000000000000000000000000000000000000000..388854e664a545bbe7be49427a5996fc36f5d6ce --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_methods.py @@ -0,0 +1,260 @@ +""" +Array methods which are called by both the C-code for the method +and the Python code for the NumPy-namespace function + +""" +import os +import pickle +import warnings +from contextlib import nullcontext + +import numpy as np +from numpy._core import multiarray as mu +from numpy._core import umath as um +from numpy._core.multiarray import asanyarray +from numpy._core import numerictypes as nt +from numpy._core import _exceptions +from numpy._core._ufunc_config import _no_nep50_warning +from numpy._globals import _NoValue + +# save those O(100) nanoseconds! +bool_dt = mu.dtype("bool") +umr_maximum = um.maximum.reduce +umr_minimum = um.minimum.reduce +umr_sum = um.add.reduce +umr_prod = um.multiply.reduce +umr_bitwise_count = um.bitwise_count +umr_any = um.logical_or.reduce +umr_all = um.logical_and.reduce + +# Complex types to -> (2,)float view for fast-path computation in _var() +_complex_to_float = { + nt.dtype(nt.csingle) : nt.dtype(nt.single), + nt.dtype(nt.cdouble) : nt.dtype(nt.double), +} +# Special case for windows: ensure double takes precedence +if nt.dtype(nt.longdouble) != nt.dtype(nt.double): + _complex_to_float.update({ + nt.dtype(nt.clongdouble) : nt.dtype(nt.longdouble), + }) + +# avoid keyword arguments to speed up parsing, saves about 15%-20% for very +# small reductions +def _amax(a, axis=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_maximum(a, axis, None, out, keepdims, initial, where) + +def _amin(a, axis=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_minimum(a, axis, None, out, keepdims, initial, where) + +def _sum(a, axis=None, dtype=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_sum(a, axis, dtype, out, keepdims, initial, where) + +def _prod(a, axis=None, dtype=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_prod(a, axis, dtype, out, keepdims, initial, where) + +def _any(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + # By default, return a boolean for any and all + if dtype is None: + dtype = bool_dt + # Parsing keyword arguments is currently fairly slow, so avoid it for now + if where is True: + return umr_any(a, axis, dtype, out, keepdims) + return umr_any(a, axis, dtype, out, keepdims, where=where) + +def _all(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + # By default, return a boolean for any and all + if dtype is None: + dtype = bool_dt + # Parsing keyword arguments is currently fairly slow, so avoid it for now + if where is True: + return umr_all(a, axis, dtype, out, keepdims) + return umr_all(a, axis, dtype, out, keepdims, where=where) + +def _count_reduce_items(arr, axis, keepdims=False, where=True): + # fast-path for the default case + if where is True: + # no boolean mask given, calculate items according to axis + if axis is None: + axis = tuple(range(arr.ndim)) + elif not isinstance(axis, tuple): + axis = (axis,) + items = 1 + for ax in axis: + items *= arr.shape[mu.normalize_axis_index(ax, arr.ndim)] + items = nt.intp(items) + else: + # TODO: Optimize case when `where` is broadcast along a non-reduction + # axis and full sum is more excessive than needed. + + # guarded to protect circular imports + from numpy.lib._stride_tricks_impl import broadcast_to + # count True values in (potentially broadcasted) boolean mask + items = umr_sum(broadcast_to(where, arr.shape), axis, nt.intp, None, + keepdims) + return items + +def _clip(a, min=None, max=None, out=None, **kwargs): + if a.dtype.kind in "iu": + # If min/max is a Python integer, deal with out-of-bound values here. + # (This enforces NEP 50 rules as no value based promotion is done.) + if type(min) is int and min <= np.iinfo(a.dtype).min: + min = None + if type(max) is int and max >= np.iinfo(a.dtype).max: + max = None + + if min is None and max is None: + # return identity + return um.positive(a, out=out, **kwargs) + elif min is None: + return um.minimum(a, max, out=out, **kwargs) + elif max is None: + return um.maximum(a, min, out=out, **kwargs) + else: + return um.clip(a, min, max, out=out, **kwargs) + +def _mean(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + arr = asanyarray(a) + + is_float16_result = False + + rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where) + if rcount == 0 if where is True else umr_any(rcount == 0, axis=None): + warnings.warn("Mean of empty slice.", RuntimeWarning, stacklevel=2) + + # Cast bool, unsigned int, and int to float64 by default + if dtype is None: + if issubclass(arr.dtype.type, (nt.integer, nt.bool)): + dtype = mu.dtype('f8') + elif issubclass(arr.dtype.type, nt.float16): + dtype = mu.dtype('f4') + is_float16_result = True + + ret = umr_sum(arr, axis, dtype, out, keepdims, where=where) + if isinstance(ret, mu.ndarray): + with _no_nep50_warning(): + ret = um.true_divide( + ret, rcount, out=ret, casting='unsafe', subok=False) + if is_float16_result and out is None: + ret = arr.dtype.type(ret) + elif hasattr(ret, 'dtype'): + if is_float16_result: + ret = arr.dtype.type(ret / rcount) + else: + ret = ret.dtype.type(ret / rcount) + else: + ret = ret / rcount + + return ret + +def _var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, + where=True, mean=None): + arr = asanyarray(a) + + rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where) + # Make this warning show up on top. + if ddof >= rcount if where is True else umr_any(ddof >= rcount, axis=None): + warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning, + stacklevel=2) + + # Cast bool, unsigned int, and int to float64 by default + if dtype is None and issubclass(arr.dtype.type, (nt.integer, nt.bool)): + dtype = mu.dtype('f8') + + if mean is not None: + arrmean = mean + else: + # Compute the mean. + # Note that if dtype is not of inexact type then arraymean will + # not be either. + arrmean = umr_sum(arr, axis, dtype, keepdims=True, where=where) + # The shape of rcount has to match arrmean to not change the shape of + # out in broadcasting. Otherwise, it cannot be stored back to arrmean. + if rcount.ndim == 0: + # fast-path for default case when where is True + div = rcount + else: + # matching rcount to arrmean when where is specified as array + div = rcount.reshape(arrmean.shape) + if isinstance(arrmean, mu.ndarray): + with _no_nep50_warning(): + arrmean = um.true_divide(arrmean, div, out=arrmean, + casting='unsafe', subok=False) + elif hasattr(arrmean, "dtype"): + arrmean = arrmean.dtype.type(arrmean / rcount) + else: + arrmean = arrmean / rcount + + # Compute sum of squared deviations from mean + # Note that x may not be inexact and that we need it to be an array, + # not a scalar. + x = asanyarray(arr - arrmean) + + if issubclass(arr.dtype.type, (nt.floating, nt.integer)): + x = um.multiply(x, x, out=x) + # Fast-paths for built-in complex types + elif x.dtype in _complex_to_float: + xv = x.view(dtype=(_complex_to_float[x.dtype], (2,))) + um.multiply(xv, xv, out=xv) + x = um.add(xv[..., 0], xv[..., 1], out=x.real).real + # Most general case; includes handling object arrays containing imaginary + # numbers and complex types with non-native byteorder + else: + x = um.multiply(x, um.conjugate(x), out=x).real + + ret = umr_sum(x, axis, dtype, out, keepdims=keepdims, where=where) + + # Compute degrees of freedom and make sure it is not negative. + rcount = um.maximum(rcount - ddof, 0) + + # divide by degrees of freedom + if isinstance(ret, mu.ndarray): + with _no_nep50_warning(): + ret = um.true_divide( + ret, rcount, out=ret, casting='unsafe', subok=False) + elif hasattr(ret, 'dtype'): + ret = ret.dtype.type(ret / rcount) + else: + ret = ret / rcount + + return ret + +def _std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, + where=True, mean=None): + ret = _var(a, axis=axis, dtype=dtype, out=out, ddof=ddof, + keepdims=keepdims, where=where, mean=mean) + + if isinstance(ret, mu.ndarray): + ret = um.sqrt(ret, out=ret) + elif hasattr(ret, 'dtype'): + ret = ret.dtype.type(um.sqrt(ret)) + else: + ret = um.sqrt(ret) + + return ret + +def _ptp(a, axis=None, out=None, keepdims=False): + return um.subtract( + umr_maximum(a, axis, None, out, keepdims), + umr_minimum(a, axis, None, None, keepdims), + out + ) + +def _dump(self, file, protocol=2): + if hasattr(file, 'write'): + ctx = nullcontext(file) + else: + ctx = open(os.fspath(file), "wb") + with ctx as f: + pickle.dump(self, f, protocol=protocol) + +def _dumps(self, protocol=2): + return pickle.dumps(self, protocol=protocol) + +def _bitwise_count(a, out=None, *, where=True, casting='same_kind', + order='K', dtype=None, subok=True): + return umr_bitwise_count(a, out, where=where, casting=casting, + order=order, dtype=dtype, subok=subok) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_tests.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_tests.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..3bbc3ce4faee9cca7356a37d9f24c2d9e186a8f7 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_tests.cpython-310-x86_64-linux-gnu.so @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a76ee8c477b72c805b2bb7cec349fa3f8cb5322224104f4fc2709e15fd72af14 +size 178888 diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_umath.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_umath.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..3068707c2e33facfe18b5ef449246a9bf3b90595 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_multiarray_umath.cpython-310-x86_64-linux-gnu.so @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7df9ca89f029c75ee70ba71163854b25c8e580da4ba4850468ab272d2a88dd65 +size 10445089 diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_operand_flag_tests.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_operand_flag_tests.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..d59f49e9b59fa7f7099de3a42f9dc3f64689180f Binary files /dev/null and b/valley/lib/python3.10/site-packages/numpy/_core/_operand_flag_tests.cpython-310-x86_64-linux-gnu.so differ diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_simd.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_simd.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..c89abe23c3385fbcdf2c0a1df30869cee3502a80 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_simd.cpython-310-x86_64-linux-gnu.so @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:49494075a89ff8971bfd46a3302d2296a0a72a822b6851941d5df6617871026f +size 3038216 diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_struct_ufunc_tests.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_struct_ufunc_tests.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..dac814e3caa3b655fd0676c63a4b076899219b1a Binary files /dev/null and b/valley/lib/python3.10/site-packages/numpy/_core/_struct_ufunc_tests.cpython-310-x86_64-linux-gnu.so differ diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_type_aliases.pyi b/valley/lib/python3.10/site-packages/numpy/_core/_type_aliases.pyi new file mode 100644 index 0000000000000000000000000000000000000000..1adaa933239e204b8b2ab77e6512e619c27dd638 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_type_aliases.pyi @@ -0,0 +1,3 @@ +from numpy import generic + +sctypeDict: dict[int | str, type[generic]] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_ufunc_config.py b/valley/lib/python3.10/site-packages/numpy/_core/_ufunc_config.py new file mode 100644 index 0000000000000000000000000000000000000000..d60e7cbbda9709076ad51843b9acafeeef41cf24 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/_ufunc_config.py @@ -0,0 +1,503 @@ +""" +Functions for changing global ufunc configuration + +This provides helpers which wrap `_get_extobj_dict` and `_make_extobj`, and +`_extobj_contextvar` from umath. +""" +import collections.abc +import contextlib +import contextvars +import functools + +from .._utils import set_module +from .umath import _make_extobj, _get_extobj_dict, _extobj_contextvar + +__all__ = [ + "seterr", "geterr", "setbufsize", "getbufsize", "seterrcall", "geterrcall", + "errstate", '_no_nep50_warning' +] + + +@set_module('numpy') +def seterr(all=None, divide=None, over=None, under=None, invalid=None): + """ + Set how floating-point errors are handled. + + Note that operations on integer scalar types (such as `int16`) are + handled like floating point, and are affected by these settings. + + Parameters + ---------- + all : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional + Set treatment for all types of floating-point errors at once: + + - ignore: Take no action when the exception occurs. + - warn: Print a :exc:`RuntimeWarning` (via the Python `warnings` + module). + - raise: Raise a :exc:`FloatingPointError`. + - call: Call a function specified using the `seterrcall` function. + - print: Print a warning directly to ``stdout``. + - log: Record error in a Log object specified by `seterrcall`. + + The default is not to change the current behavior. + divide : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional + Treatment for division by zero. + over : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional + Treatment for floating-point overflow. + under : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional + Treatment for floating-point underflow. + invalid : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional + Treatment for invalid floating-point operation. + + Returns + ------- + old_settings : dict + Dictionary containing the old settings. + + See also + -------- + seterrcall : Set a callback function for the 'call' mode. + geterr, geterrcall, errstate + + Notes + ----- + The floating-point exceptions are defined in the IEEE 754 standard [1]_: + + - Division by zero: infinite result obtained from finite numbers. + - Overflow: result too large to be expressed. + - Underflow: result so close to zero that some precision + was lost. + - Invalid operation: result is not an expressible number, typically + indicates that a NaN was produced. + + .. [1] https://en.wikipedia.org/wiki/IEEE_754 + + Examples + -------- + >>> import numpy as np + >>> orig_settings = np.seterr(all='ignore') # seterr to known value + >>> np.int16(32000) * np.int16(3) + 30464 + >>> np.seterr(over='raise') + {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'} + >>> old_settings = np.seterr(all='warn', over='raise') + >>> np.int16(32000) * np.int16(3) + Traceback (most recent call last): + File "", line 1, in + FloatingPointError: overflow encountered in scalar multiply + + >>> old_settings = np.seterr(all='print') + >>> np.geterr() + {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'} + >>> np.int16(32000) * np.int16(3) + 30464 + >>> np.seterr(**orig_settings) # restore original + {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'} + + """ + + old = _get_extobj_dict() + # The errstate doesn't include call and bufsize, so pop them: + old.pop("call", None) + old.pop("bufsize", None) + + extobj = _make_extobj( + all=all, divide=divide, over=over, under=under, invalid=invalid) + _extobj_contextvar.set(extobj) + return old + + +@set_module('numpy') +def geterr(): + """ + Get the current way of handling floating-point errors. + + Returns + ------- + res : dict + A dictionary with keys "divide", "over", "under", and "invalid", + whose values are from the strings "ignore", "print", "log", "warn", + "raise", and "call". The keys represent possible floating-point + exceptions, and the values define how these exceptions are handled. + + See Also + -------- + geterrcall, seterr, seterrcall + + Notes + ----- + For complete documentation of the types of floating-point exceptions and + treatment options, see `seterr`. + + Examples + -------- + >>> import numpy as np + >>> np.geterr() + {'divide': 'warn', 'over': 'warn', 'under': 'ignore', 'invalid': 'warn'} + >>> np.arange(3.) / np.arange(3.) # doctest: +SKIP + array([nan, 1., 1.]) + RuntimeWarning: invalid value encountered in divide + + >>> oldsettings = np.seterr(all='warn', invalid='raise') + >>> np.geterr() + {'divide': 'warn', 'over': 'warn', 'under': 'warn', 'invalid': 'raise'} + >>> np.arange(3.) / np.arange(3.) + Traceback (most recent call last): + ... + FloatingPointError: invalid value encountered in divide + >>> oldsettings = np.seterr(**oldsettings) # restore original + + """ + res = _get_extobj_dict() + # The "geterr" doesn't include call and bufsize,: + res.pop("call", None) + res.pop("bufsize", None) + return res + + +@set_module('numpy') +def setbufsize(size): + """ + Set the size of the buffer used in ufuncs. + + .. versionchanged:: 2.0 + The scope of setting the buffer is tied to the `numpy.errstate` + context. Exiting a ``with errstate():`` will also restore the bufsize. + + Parameters + ---------- + size : int + Size of buffer. + + Returns + ------- + bufsize : int + Previous size of ufunc buffer in bytes. + + Examples + -------- + When exiting a `numpy.errstate` context manager the bufsize is restored: + + >>> import numpy as np + >>> with np.errstate(): + ... np.setbufsize(4096) + ... print(np.getbufsize()) + ... + 8192 + 4096 + >>> np.getbufsize() + 8192 + + """ + old = _get_extobj_dict()["bufsize"] + extobj = _make_extobj(bufsize=size) + _extobj_contextvar.set(extobj) + return old + + +@set_module('numpy') +def getbufsize(): + """ + Return the size of the buffer used in ufuncs. + + Returns + ------- + getbufsize : int + Size of ufunc buffer in bytes. + + Examples + -------- + >>> import numpy as np + >>> np.getbufsize() + 8192 + + """ + return _get_extobj_dict()["bufsize"] + + +@set_module('numpy') +def seterrcall(func): + """ + Set the floating-point error callback function or log object. + + There are two ways to capture floating-point error messages. The first + is to set the error-handler to 'call', using `seterr`. Then, set + the function to call using this function. + + The second is to set the error-handler to 'log', using `seterr`. + Floating-point errors then trigger a call to the 'write' method of + the provided object. + + Parameters + ---------- + func : callable f(err, flag) or object with write method + Function to call upon floating-point errors ('call'-mode) or + object whose 'write' method is used to log such message ('log'-mode). + + The call function takes two arguments. The first is a string describing + the type of error (such as "divide by zero", "overflow", "underflow", + or "invalid value"), and the second is the status flag. The flag is a + byte, whose four least-significant bits indicate the type of error, one + of "divide", "over", "under", "invalid":: + + [0 0 0 0 divide over under invalid] + + In other words, ``flags = divide + 2*over + 4*under + 8*invalid``. + + If an object is provided, its write method should take one argument, + a string. + + Returns + ------- + h : callable, log instance or None + The old error handler. + + See Also + -------- + seterr, geterr, geterrcall + + Examples + -------- + Callback upon error: + + >>> def err_handler(type, flag): + ... print("Floating point error (%s), with flag %s" % (type, flag)) + ... + + >>> import numpy as np + + >>> orig_handler = np.seterrcall(err_handler) + >>> orig_err = np.seterr(all='call') + + >>> np.array([1, 2, 3]) / 0.0 + Floating point error (divide by zero), with flag 1 + array([inf, inf, inf]) + + >>> np.seterrcall(orig_handler) + + >>> np.seterr(**orig_err) + {'divide': 'call', 'over': 'call', 'under': 'call', 'invalid': 'call'} + + Log error message: + + >>> class Log: + ... def write(self, msg): + ... print("LOG: %s" % msg) + ... + + >>> log = Log() + >>> saved_handler = np.seterrcall(log) + >>> save_err = np.seterr(all='log') + + >>> np.array([1, 2, 3]) / 0.0 + LOG: Warning: divide by zero encountered in divide + array([inf, inf, inf]) + + >>> np.seterrcall(orig_handler) + + >>> np.seterr(**orig_err) + {'divide': 'log', 'over': 'log', 'under': 'log', 'invalid': 'log'} + + """ + old = _get_extobj_dict()["call"] + extobj = _make_extobj(call=func) + _extobj_contextvar.set(extobj) + return old + + +@set_module('numpy') +def geterrcall(): + """ + Return the current callback function used on floating-point errors. + + When the error handling for a floating-point error (one of "divide", + "over", "under", or "invalid") is set to 'call' or 'log', the function + that is called or the log instance that is written to is returned by + `geterrcall`. This function or log instance has been set with + `seterrcall`. + + Returns + ------- + errobj : callable, log instance or None + The current error handler. If no handler was set through `seterrcall`, + ``None`` is returned. + + See Also + -------- + seterrcall, seterr, geterr + + Notes + ----- + For complete documentation of the types of floating-point exceptions and + treatment options, see `seterr`. + + Examples + -------- + >>> import numpy as np + >>> np.geterrcall() # we did not yet set a handler, returns None + + >>> orig_settings = np.seterr(all='call') + >>> def err_handler(type, flag): + ... print("Floating point error (%s), with flag %s" % (type, flag)) + >>> old_handler = np.seterrcall(err_handler) + >>> np.array([1, 2, 3]) / 0.0 + Floating point error (divide by zero), with flag 1 + array([inf, inf, inf]) + + >>> cur_handler = np.geterrcall() + >>> cur_handler is err_handler + True + >>> old_settings = np.seterr(**orig_settings) # restore original + >>> old_handler = np.seterrcall(None) # restore original + + """ + return _get_extobj_dict()["call"] + + +class _unspecified: + pass + + +_Unspecified = _unspecified() + + +@set_module('numpy') +class errstate: + """ + errstate(**kwargs) + + Context manager for floating-point error handling. + + Using an instance of `errstate` as a context manager allows statements in + that context to execute with a known error handling behavior. Upon entering + the context the error handling is set with `seterr` and `seterrcall`, and + upon exiting it is reset to what it was before. + + .. versionchanged:: 1.17.0 + `errstate` is also usable as a function decorator, saving + a level of indentation if an entire function is wrapped. + + .. versionchanged:: 2.0 + `errstate` is now fully thread and asyncio safe, but may not be + entered more than once. + It is not safe to decorate async functions using ``errstate``. + + Parameters + ---------- + kwargs : {divide, over, under, invalid} + Keyword arguments. The valid keywords are the possible floating-point + exceptions. Each keyword should have a string value that defines the + treatment for the particular error. Possible values are + {'ignore', 'warn', 'raise', 'call', 'print', 'log'}. + + See Also + -------- + seterr, geterr, seterrcall, geterrcall + + Notes + ----- + For complete documentation of the types of floating-point exceptions and + treatment options, see `seterr`. + + Examples + -------- + >>> import numpy as np + >>> olderr = np.seterr(all='ignore') # Set error handling to known state. + + >>> np.arange(3) / 0. + array([nan, inf, inf]) + >>> with np.errstate(divide='ignore'): + ... np.arange(3) / 0. + array([nan, inf, inf]) + + >>> np.sqrt(-1) + np.float64(nan) + >>> with np.errstate(invalid='raise'): + ... np.sqrt(-1) + Traceback (most recent call last): + File "", line 2, in + FloatingPointError: invalid value encountered in sqrt + + Outside the context the error handling behavior has not changed: + + >>> np.geterr() + {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'} + >>> olderr = np.seterr(**olderr) # restore original state + + """ + __slots__ = ( + "_call", "_all", "_divide", "_over", "_under", "_invalid", "_token") + + def __init__(self, *, call=_Unspecified, + all=None, divide=None, over=None, under=None, invalid=None): + self._token = None + self._call = call + self._all = all + self._divide = divide + self._over = over + self._under = under + self._invalid = invalid + + def __enter__(self): + # Note that __call__ duplicates much of this logic + if self._token is not None: + raise TypeError("Cannot enter `np.errstate` twice.") + if self._call is _Unspecified: + extobj = _make_extobj( + all=self._all, divide=self._divide, over=self._over, + under=self._under, invalid=self._invalid) + else: + extobj = _make_extobj( + call=self._call, + all=self._all, divide=self._divide, over=self._over, + under=self._under, invalid=self._invalid) + + self._token = _extobj_contextvar.set(extobj) + + def __exit__(self, *exc_info): + _extobj_contextvar.reset(self._token) + + def __call__(self, func): + # We need to customize `__call__` compared to `ContextDecorator` + # because we must store the token per-thread so cannot store it on + # the instance (we could create a new instance for this). + # This duplicates the code from `__enter__`. + @functools.wraps(func) + def inner(*args, **kwargs): + if self._call is _Unspecified: + extobj = _make_extobj( + all=self._all, divide=self._divide, over=self._over, + under=self._under, invalid=self._invalid) + else: + extobj = _make_extobj( + call=self._call, + all=self._all, divide=self._divide, over=self._over, + under=self._under, invalid=self._invalid) + + _token = _extobj_contextvar.set(extobj) + try: + # Call the original, decorated, function: + return func(*args, **kwargs) + finally: + _extobj_contextvar.reset(_token) + + return inner + + +NO_NEP50_WARNING = contextvars.ContextVar("_no_nep50_warning", default=False) + +@set_module('numpy') +@contextlib.contextmanager +def _no_nep50_warning(): + """ + Context manager to disable NEP 50 warnings. This context manager is + only relevant if the NEP 50 warnings are enabled globally (which is not + thread/context safe). + + This warning context manager itself is fully safe, however. + """ + token = NO_NEP50_WARNING.set(True) + try: + yield + finally: + NO_NEP50_WARNING.reset(token) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/_umath_tests.cpython-310-x86_64-linux-gnu.so b/valley/lib/python3.10/site-packages/numpy/_core/_umath_tests.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..70a9651056856e4279991ed37d12cca2d74234af Binary files /dev/null and b/valley/lib/python3.10/site-packages/numpy/_core/_umath_tests.cpython-310-x86_64-linux-gnu.so differ diff --git a/valley/lib/python3.10/site-packages/numpy/_core/arrayprint.py b/valley/lib/python3.10/site-packages/numpy/_core/arrayprint.py new file mode 100644 index 0000000000000000000000000000000000000000..fde0d7d4a16228067d39f2ebb9849e4a170015ca --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/arrayprint.py @@ -0,0 +1,1746 @@ +"""Array printing function + +$Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $ + +""" +__all__ = ["array2string", "array_str", "array_repr", + "set_printoptions", "get_printoptions", "printoptions", + "format_float_positional", "format_float_scientific"] +__docformat__ = 'restructuredtext' + +# +# Written by Konrad Hinsen +# last revision: 1996-3-13 +# modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details) +# and by Perry Greenfield 2000-4-1 for numarray +# and by Travis Oliphant 2005-8-22 for numpy + + +# Note: Both scalartypes.c.src and arrayprint.py implement strs for numpy +# scalars but for different purposes. scalartypes.c.src has str/reprs for when +# the scalar is printed on its own, while arrayprint.py has strs for when +# scalars are printed inside an ndarray. Only the latter strs are currently +# user-customizable. + +import functools +import numbers +import sys +try: + from _thread import get_ident +except ImportError: + from _dummy_thread import get_ident + +import numpy as np +from . import numerictypes as _nt +from .umath import absolute, isinf, isfinite, isnat +from . import multiarray +from .multiarray import (array, dragon4_positional, dragon4_scientific, + datetime_as_string, datetime_data, ndarray) +from .fromnumeric import any +from .numeric import concatenate, asarray, errstate +from .numerictypes import (longlong, intc, int_, float64, complex128, + flexible) +from .overrides import array_function_dispatch, set_module +from .printoptions import format_options +import operator +import warnings +import contextlib + + +def _make_options_dict(precision=None, threshold=None, edgeitems=None, + linewidth=None, suppress=None, nanstr=None, infstr=None, + sign=None, formatter=None, floatmode=None, legacy=None, + override_repr=None): + """ + Make a dictionary out of the non-None arguments, plus conversion of + *legacy* and sanity checks. + """ + + options = {k: v for k, v in list(locals().items()) if v is not None} + + if suppress is not None: + options['suppress'] = bool(suppress) + + modes = ['fixed', 'unique', 'maxprec', 'maxprec_equal'] + if floatmode not in modes + [None]: + raise ValueError("floatmode option must be one of " + + ", ".join('"{}"'.format(m) for m in modes)) + + if sign not in [None, '-', '+', ' ']: + raise ValueError("sign option must be one of ' ', '+', or '-'") + + if legacy == False: + options['legacy'] = sys.maxsize + elif legacy == '1.13': + options['legacy'] = 113 + elif legacy == '1.21': + options['legacy'] = 121 + elif legacy == '1.25': + options['legacy'] = 125 + elif legacy is None: + pass # OK, do nothing. + else: + warnings.warn( + "legacy printing option can currently only be '1.13', '1.21', " + "'1.25', or `False`", stacklevel=3) + + if threshold is not None: + # forbid the bad threshold arg suggested by stack overflow, gh-12351 + if not isinstance(threshold, numbers.Number): + raise TypeError("threshold must be numeric") + if np.isnan(threshold): + raise ValueError("threshold must be non-NAN, try " + "sys.maxsize for untruncated representation") + + if precision is not None: + # forbid the bad precision arg as suggested by issue #18254 + try: + options['precision'] = operator.index(precision) + except TypeError as e: + raise TypeError('precision must be an integer') from e + + return options + + +@set_module('numpy') +def set_printoptions(precision=None, threshold=None, edgeitems=None, + linewidth=None, suppress=None, nanstr=None, + infstr=None, formatter=None, sign=None, floatmode=None, + *, legacy=None, override_repr=None): + """ + Set printing options. + + These options determine the way floating point numbers, arrays and + other NumPy objects are displayed. + + Parameters + ---------- + precision : int or None, optional + Number of digits of precision for floating point output (default 8). + May be None if `floatmode` is not `fixed`, to print as many digits as + necessary to uniquely specify the value. + threshold : int, optional + Total number of array elements which trigger summarization + rather than full repr (default 1000). + To always use the full repr without summarization, pass `sys.maxsize`. + edgeitems : int, optional + Number of array items in summary at beginning and end of + each dimension (default 3). + linewidth : int, optional + The number of characters per line for the purpose of inserting + line breaks (default 75). + suppress : bool, optional + If True, always print floating point numbers using fixed point + notation, in which case numbers equal to zero in the current precision + will print as zero. If False, then scientific notation is used when + absolute value of the smallest number is < 1e-4 or the ratio of the + maximum absolute value to the minimum is > 1e3. The default is False. + nanstr : str, optional + String representation of floating point not-a-number (default nan). + infstr : str, optional + String representation of floating point infinity (default inf). + sign : string, either '-', '+', or ' ', optional + Controls printing of the sign of floating-point types. If '+', always + print the sign of positive values. If ' ', always prints a space + (whitespace character) in the sign position of positive values. If + '-', omit the sign character of positive values. (default '-') + + .. versionchanged:: 2.0 + The sign parameter can now be an integer type, previously + types were floating-point types. + + formatter : dict of callables, optional + If not None, the keys should indicate the type(s) that the respective + formatting function applies to. Callables should return a string. + Types that are not specified (by their corresponding keys) are handled + by the default formatters. Individual types for which a formatter + can be set are: + + - 'bool' + - 'int' + - 'timedelta' : a `numpy.timedelta64` + - 'datetime' : a `numpy.datetime64` + - 'float' + - 'longfloat' : 128-bit floats + - 'complexfloat' + - 'longcomplexfloat' : composed of two 128-bit floats + - 'numpystr' : types `numpy.bytes_` and `numpy.str_` + - 'object' : `np.object_` arrays + + Other keys that can be used to set a group of types at once are: + + - 'all' : sets all types + - 'int_kind' : sets 'int' + - 'float_kind' : sets 'float' and 'longfloat' + - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' + - 'str_kind' : sets 'numpystr' + floatmode : str, optional + Controls the interpretation of the `precision` option for + floating-point types. Can take the following values + (default maxprec_equal): + + * 'fixed': Always print exactly `precision` fractional digits, + even if this would print more or fewer digits than + necessary to specify the value uniquely. + * 'unique': Print the minimum number of fractional digits necessary + to represent each value uniquely. Different elements may + have a different number of digits. The value of the + `precision` option is ignored. + * 'maxprec': Print at most `precision` fractional digits, but if + an element can be uniquely represented with fewer digits + only print it with that many. + * 'maxprec_equal': Print at most `precision` fractional digits, + but if every element in the array can be uniquely + represented with an equal number of fewer digits, use that + many digits for all elements. + legacy : string or `False`, optional + If set to the string ``'1.13'`` enables 1.13 legacy printing mode. This + approximates numpy 1.13 print output by including a space in the sign + position of floats and different behavior for 0d arrays. This also + enables 1.21 legacy printing mode (described below). + + If set to the string ``'1.21'`` enables 1.21 legacy printing mode. This + approximates numpy 1.21 print output of complex structured dtypes + by not inserting spaces after commas that separate fields and after + colons. + + If set to ``'1.25'`` approximates printing of 1.25 which mainly means + that numeric scalars are printed without their type information, e.g. + as ``3.0`` rather than ``np.float64(3.0)``. + + If set to `False`, disables legacy mode. + + Unrecognized strings will be ignored with a warning for forward + compatibility. + + .. versionadded:: 1.14.0 + .. versionchanged:: 1.22.0 + .. versionchanged:: 2.0 + + override_repr: callable, optional + If set a passed function will be used for generating arrays' repr. + Other options will be ignored. + + See Also + -------- + get_printoptions, printoptions, array2string + + Notes + ----- + `formatter` is always reset with a call to `set_printoptions`. + + Use `printoptions` as a context manager to set the values temporarily. + + Examples + -------- + Floating point precision can be set: + + >>> import numpy as np + >>> np.set_printoptions(precision=4) + >>> np.array([1.123456789]) + [1.1235] + + Long arrays can be summarised: + + >>> np.set_printoptions(threshold=5) + >>> np.arange(10) + array([0, 1, 2, ..., 7, 8, 9]) + + Small results can be suppressed: + + >>> eps = np.finfo(float).eps + >>> x = np.arange(4.) + >>> x**2 - (x + eps)**2 + array([-4.9304e-32, -4.4409e-16, 0.0000e+00, 0.0000e+00]) + >>> np.set_printoptions(suppress=True) + >>> x**2 - (x + eps)**2 + array([-0., -0., 0., 0.]) + + A custom formatter can be used to display array elements as desired: + + >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)}) + >>> x = np.arange(3) + >>> x + array([int: 0, int: -1, int: -2]) + >>> np.set_printoptions() # formatter gets reset + >>> x + array([0, 1, 2]) + + To put back the default options, you can use: + + >>> np.set_printoptions(edgeitems=3, infstr='inf', + ... linewidth=75, nanstr='nan', precision=8, + ... suppress=False, threshold=1000, formatter=None) + + Also to temporarily override options, use `printoptions` + as a context manager: + + >>> with np.printoptions(precision=2, suppress=True, threshold=5): + ... np.linspace(0, 10, 10) + array([ 0. , 1.11, 2.22, ..., 7.78, 8.89, 10. ]) + + """ + _set_printoptions(precision, threshold, edgeitems, linewidth, suppress, + nanstr, infstr, formatter, sign, floatmode, + legacy=legacy, override_repr=override_repr) + + +def _set_printoptions(precision=None, threshold=None, edgeitems=None, + linewidth=None, suppress=None, nanstr=None, + infstr=None, formatter=None, sign=None, floatmode=None, + *, legacy=None, override_repr=None): + new_opt = _make_options_dict(precision, threshold, edgeitems, linewidth, + suppress, nanstr, infstr, sign, formatter, + floatmode, legacy) + # formatter and override_repr are always reset + new_opt['formatter'] = formatter + new_opt['override_repr'] = override_repr + + updated_opt = format_options.get() | new_opt + updated_opt.update(new_opt) + + if updated_opt['legacy'] == 113: + updated_opt['sign'] = '-' + + return format_options.set(updated_opt) + + +@set_module('numpy') +def get_printoptions(): + """ + Return the current print options. + + Returns + ------- + print_opts : dict + Dictionary of current print options with keys + + - precision : int + - threshold : int + - edgeitems : int + - linewidth : int + - suppress : bool + - nanstr : str + - infstr : str + - sign : str + - formatter : dict of callables + - floatmode : str + - legacy : str or False + + For a full description of these options, see `set_printoptions`. + + See Also + -------- + set_printoptions, printoptions + + Examples + -------- + >>> import numpy as np + + >>> np.get_printoptions() + {'edgeitems': 3, 'threshold': 1000, ..., 'override_repr': None} + + >>> np.get_printoptions()['linewidth'] + 75 + >>> np.set_printoptions(linewidth=100) + >>> np.get_printoptions()['linewidth'] + 100 + + """ + opts = format_options.get().copy() + opts['legacy'] = { + 113: '1.13', 121: '1.21', 125: '1.25', sys.maxsize: False, + }[opts['legacy']] + return opts + + +def _get_legacy_print_mode(): + """Return the legacy print mode as an int.""" + return format_options.get()['legacy'] + + +@set_module('numpy') +@contextlib.contextmanager +def printoptions(*args, **kwargs): + """Context manager for setting print options. + + Set print options for the scope of the `with` block, and restore the old + options at the end. See `set_printoptions` for the full description of + available options. + + Examples + -------- + >>> import numpy as np + + >>> from numpy.testing import assert_equal + >>> with np.printoptions(precision=2): + ... np.array([2.0]) / 3 + array([0.67]) + + The `as`-clause of the `with`-statement gives the current print options: + + >>> with np.printoptions(precision=2) as opts: + ... assert_equal(opts, np.get_printoptions()) + + See Also + -------- + set_printoptions, get_printoptions + + """ + token = _set_printoptions(*args, **kwargs) + + try: + yield get_printoptions() + finally: + format_options.reset(token) + + +def _leading_trailing(a, edgeitems, index=()): + """ + Keep only the N-D corners (leading and trailing edges) of an array. + + Should be passed a base-class ndarray, since it makes no guarantees about + preserving subclasses. + """ + axis = len(index) + if axis == a.ndim: + return a[index] + + if a.shape[axis] > 2*edgeitems: + return concatenate(( + _leading_trailing(a, edgeitems, index + np.index_exp[:edgeitems]), + _leading_trailing(a, edgeitems, index + np.index_exp[-edgeitems:]) + ), axis=axis) + else: + return _leading_trailing(a, edgeitems, index + np.index_exp[:]) + + +def _object_format(o): + """ Object arrays containing lists should be printed unambiguously """ + if type(o) is list: + fmt = 'list({!r})' + else: + fmt = '{!r}' + return fmt.format(o) + +def repr_format(x): + if isinstance(x, (np.str_, np.bytes_)): + return repr(x.item()) + return repr(x) + +def str_format(x): + if isinstance(x, (np.str_, np.bytes_)): + return str(x.item()) + return str(x) + +def _get_formatdict(data, *, precision, floatmode, suppress, sign, legacy, + formatter, **kwargs): + # note: extra arguments in kwargs are ignored + + # wrapped in lambdas to avoid taking a code path + # with the wrong type of data + formatdict = { + 'bool': lambda: BoolFormat(data), + 'int': lambda: IntegerFormat(data, sign), + 'float': lambda: FloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'longfloat': lambda: FloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'complexfloat': lambda: ComplexFloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'longcomplexfloat': lambda: ComplexFloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'datetime': lambda: DatetimeFormat(data, legacy=legacy), + 'timedelta': lambda: TimedeltaFormat(data), + 'object': lambda: _object_format, + 'void': lambda: str_format, + 'numpystr': lambda: repr_format} + + # we need to wrap values in `formatter` in a lambda, so that the interface + # is the same as the above values. + def indirect(x): + return lambda: x + + if formatter is not None: + fkeys = [k for k in formatter.keys() if formatter[k] is not None] + if 'all' in fkeys: + for key in formatdict.keys(): + formatdict[key] = indirect(formatter['all']) + if 'int_kind' in fkeys: + for key in ['int']: + formatdict[key] = indirect(formatter['int_kind']) + if 'float_kind' in fkeys: + for key in ['float', 'longfloat']: + formatdict[key] = indirect(formatter['float_kind']) + if 'complex_kind' in fkeys: + for key in ['complexfloat', 'longcomplexfloat']: + formatdict[key] = indirect(formatter['complex_kind']) + if 'str_kind' in fkeys: + formatdict['numpystr'] = indirect(formatter['str_kind']) + for key in formatdict.keys(): + if key in fkeys: + formatdict[key] = indirect(formatter[key]) + + return formatdict + +def _get_format_function(data, **options): + """ + find the right formatting function for the dtype_ + """ + dtype_ = data.dtype + dtypeobj = dtype_.type + formatdict = _get_formatdict(data, **options) + if dtypeobj is None: + return formatdict["numpystr"]() + elif issubclass(dtypeobj, _nt.bool): + return formatdict['bool']() + elif issubclass(dtypeobj, _nt.integer): + if issubclass(dtypeobj, _nt.timedelta64): + return formatdict['timedelta']() + else: + return formatdict['int']() + elif issubclass(dtypeobj, _nt.floating): + if issubclass(dtypeobj, _nt.longdouble): + return formatdict['longfloat']() + else: + return formatdict['float']() + elif issubclass(dtypeobj, _nt.complexfloating): + if issubclass(dtypeobj, _nt.clongdouble): + return formatdict['longcomplexfloat']() + else: + return formatdict['complexfloat']() + elif issubclass(dtypeobj, (_nt.str_, _nt.bytes_)): + return formatdict['numpystr']() + elif issubclass(dtypeobj, _nt.datetime64): + return formatdict['datetime']() + elif issubclass(dtypeobj, _nt.object_): + return formatdict['object']() + elif issubclass(dtypeobj, _nt.void): + if dtype_.names is not None: + return StructuredVoidFormat.from_data(data, **options) + else: + return formatdict['void']() + else: + return formatdict['numpystr']() + + +def _recursive_guard(fillvalue='...'): + """ + Like the python 3.2 reprlib.recursive_repr, but forwards *args and **kwargs + + Decorates a function such that if it calls itself with the same first + argument, it returns `fillvalue` instead of recursing. + + Largely copied from reprlib.recursive_repr + """ + + def decorating_function(f): + repr_running = set() + + @functools.wraps(f) + def wrapper(self, *args, **kwargs): + key = id(self), get_ident() + if key in repr_running: + return fillvalue + repr_running.add(key) + try: + return f(self, *args, **kwargs) + finally: + repr_running.discard(key) + + return wrapper + + return decorating_function + + +# gracefully handle recursive calls, when object arrays contain themselves +@_recursive_guard() +def _array2string(a, options, separator=' ', prefix=""): + # The formatter __init__s in _get_format_function cannot deal with + # subclasses yet, and we also need to avoid recursion issues in + # _formatArray with subclasses which return 0d arrays in place of scalars + data = asarray(a) + if a.shape == (): + a = data + + if a.size > options['threshold']: + summary_insert = "..." + data = _leading_trailing(data, options['edgeitems']) + else: + summary_insert = "" + + # find the right formatting function for the array + format_function = _get_format_function(data, **options) + + # skip over "[" + next_line_prefix = " " + # skip over array( + next_line_prefix += " "*len(prefix) + + lst = _formatArray(a, format_function, options['linewidth'], + next_line_prefix, separator, options['edgeitems'], + summary_insert, options['legacy']) + return lst + + +def _array2string_dispatcher( + a, max_line_width=None, precision=None, + suppress_small=None, separator=None, prefix=None, + style=None, formatter=None, threshold=None, + edgeitems=None, sign=None, floatmode=None, suffix=None, + *, legacy=None): + return (a,) + + +@array_function_dispatch(_array2string_dispatcher, module='numpy') +def array2string(a, max_line_width=None, precision=None, + suppress_small=None, separator=' ', prefix="", + style=np._NoValue, formatter=None, threshold=None, + edgeitems=None, sign=None, floatmode=None, suffix="", + *, legacy=None): + """ + Return a string representation of an array. + + Parameters + ---------- + a : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int or None, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + separator : str, optional + Inserted between elements. + prefix : str, optional + suffix : str, optional + The length of the prefix and suffix strings are used to respectively + align and wrap the output. An array is typically printed as:: + + prefix + array2string(a) + suffix + + The output is left-padded by the length of the prefix string, and + wrapping is forced at the column ``max_line_width - len(suffix)``. + It should be noted that the content of prefix and suffix strings are + not included in the output. + style : _NoValue, optional + Has no effect, do not use. + + .. deprecated:: 1.14.0 + formatter : dict of callables, optional + If not None, the keys should indicate the type(s) that the respective + formatting function applies to. Callables should return a string. + Types that are not specified (by their corresponding keys) are handled + by the default formatters. Individual types for which a formatter + can be set are: + + - 'bool' + - 'int' + - 'timedelta' : a `numpy.timedelta64` + - 'datetime' : a `numpy.datetime64` + - 'float' + - 'longfloat' : 128-bit floats + - 'complexfloat' + - 'longcomplexfloat' : composed of two 128-bit floats + - 'void' : type `numpy.void` + - 'numpystr' : types `numpy.bytes_` and `numpy.str_` + + Other keys that can be used to set a group of types at once are: + + - 'all' : sets all types + - 'int_kind' : sets 'int' + - 'float_kind' : sets 'float' and 'longfloat' + - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' + - 'str_kind' : sets 'numpystr' + threshold : int, optional + Total number of array elements which trigger summarization + rather than full repr. + Defaults to ``numpy.get_printoptions()['threshold']``. + edgeitems : int, optional + Number of array items in summary at beginning and end of + each dimension. + Defaults to ``numpy.get_printoptions()['edgeitems']``. + sign : string, either '-', '+', or ' ', optional + Controls printing of the sign of floating-point types. If '+', always + print the sign of positive values. If ' ', always prints a space + (whitespace character) in the sign position of positive values. If + '-', omit the sign character of positive values. + Defaults to ``numpy.get_printoptions()['sign']``. + + .. versionchanged:: 2.0 + The sign parameter can now be an integer type, previously + types were floating-point types. + + floatmode : str, optional + Controls the interpretation of the `precision` option for + floating-point types. + Defaults to ``numpy.get_printoptions()['floatmode']``. + Can take the following values: + + - 'fixed': Always print exactly `precision` fractional digits, + even if this would print more or fewer digits than + necessary to specify the value uniquely. + - 'unique': Print the minimum number of fractional digits necessary + to represent each value uniquely. Different elements may + have a different number of digits. The value of the + `precision` option is ignored. + - 'maxprec': Print at most `precision` fractional digits, but if + an element can be uniquely represented with fewer digits + only print it with that many. + - 'maxprec_equal': Print at most `precision` fractional digits, + but if every element in the array can be uniquely + represented with an equal number of fewer digits, use that + many digits for all elements. + legacy : string or `False`, optional + If set to the string ``'1.13'`` enables 1.13 legacy printing mode. This + approximates numpy 1.13 print output by including a space in the sign + position of floats and different behavior for 0d arrays. If set to + `False`, disables legacy mode. Unrecognized strings will be ignored + with a warning for forward compatibility. + + .. versionadded:: 1.14.0 + + Returns + ------- + array_str : str + String representation of the array. + + Raises + ------ + TypeError + if a callable in `formatter` does not return a string. + + See Also + -------- + array_str, array_repr, set_printoptions, get_printoptions + + Notes + ----- + If a formatter is specified for a certain type, the `precision` keyword is + ignored for that type. + + This is a very flexible function; `array_repr` and `array_str` are using + `array2string` internally so keywords with the same name should work + identically in all three functions. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1e-16,1,2,3]) + >>> np.array2string(x, precision=2, separator=',', + ... suppress_small=True) + '[0.,1.,2.,3.]' + + >>> x = np.arange(3.) + >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) + '[0.00 1.00 2.00]' + + >>> x = np.arange(3) + >>> np.array2string(x, formatter={'int':lambda x: hex(x)}) + '[0x0 0x1 0x2]' + + """ + + overrides = _make_options_dict(precision, threshold, edgeitems, + max_line_width, suppress_small, None, None, + sign, formatter, floatmode, legacy) + options = format_options.get().copy() + options.update(overrides) + + if options['legacy'] <= 113: + if style is np._NoValue: + style = repr + + if a.shape == () and a.dtype.names is None: + return style(a.item()) + elif style is not np._NoValue: + # Deprecation 11-9-2017 v1.14 + warnings.warn("'style' argument is deprecated and no longer functional" + " except in 1.13 'legacy' mode", + DeprecationWarning, stacklevel=2) + + if options['legacy'] > 113: + options['linewidth'] -= len(suffix) + + # treat as a null array if any of shape elements == 0 + if a.size == 0: + return "[]" + + return _array2string(a, options, separator, prefix) + + +def _extendLine(s, line, word, line_width, next_line_prefix, legacy): + needs_wrap = len(line) + len(word) > line_width + if legacy > 113: + # don't wrap lines if it won't help + if len(line) <= len(next_line_prefix): + needs_wrap = False + + if needs_wrap: + s += line.rstrip() + "\n" + line = next_line_prefix + line += word + return s, line + + +def _extendLine_pretty(s, line, word, line_width, next_line_prefix, legacy): + """ + Extends line with nicely formatted (possibly multi-line) string ``word``. + """ + words = word.splitlines() + if len(words) == 1 or legacy <= 113: + return _extendLine(s, line, word, line_width, next_line_prefix, legacy) + + max_word_length = max(len(word) for word in words) + if (len(line) + max_word_length > line_width and + len(line) > len(next_line_prefix)): + s += line.rstrip() + '\n' + line = next_line_prefix + words[0] + indent = next_line_prefix + else: + indent = len(line)*' ' + line += words[0] + + for word in words[1::]: + s += line.rstrip() + '\n' + line = indent + word + + suffix_length = max_word_length - len(words[-1]) + line += suffix_length*' ' + + return s, line + +def _formatArray(a, format_function, line_width, next_line_prefix, + separator, edge_items, summary_insert, legacy): + """formatArray is designed for two modes of operation: + + 1. Full output + + 2. Summarized output + + """ + def recurser(index, hanging_indent, curr_width): + """ + By using this local function, we don't need to recurse with all the + arguments. Since this function is not created recursively, the cost is + not significant + """ + axis = len(index) + axes_left = a.ndim - axis + + if axes_left == 0: + return format_function(a[index]) + + # when recursing, add a space to align with the [ added, and reduce the + # length of the line by 1 + next_hanging_indent = hanging_indent + ' ' + if legacy <= 113: + next_width = curr_width + else: + next_width = curr_width - len(']') + + a_len = a.shape[axis] + show_summary = summary_insert and 2*edge_items < a_len + if show_summary: + leading_items = edge_items + trailing_items = edge_items + else: + leading_items = 0 + trailing_items = a_len + + # stringify the array with the hanging indent on the first line too + s = '' + + # last axis (rows) - wrap elements if they would not fit on one line + if axes_left == 1: + # the length up until the beginning of the separator / bracket + if legacy <= 113: + elem_width = curr_width - len(separator.rstrip()) + else: + elem_width = curr_width - max( + len(separator.rstrip()), len(']') + ) + + line = hanging_indent + for i in range(leading_items): + word = recurser(index + (i,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + line += separator + + if show_summary: + s, line = _extendLine( + s, line, summary_insert, elem_width, hanging_indent, legacy + ) + if legacy <= 113: + line += ", " + else: + line += separator + + for i in range(trailing_items, 1, -1): + word = recurser(index + (-i,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + line += separator + + if legacy <= 113: + # width of the separator is not considered on 1.13 + elem_width = curr_width + word = recurser(index + (-1,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + + s += line + + # other axes - insert newlines between rows + else: + s = '' + line_sep = separator.rstrip() + '\n'*(axes_left - 1) + + for i in range(leading_items): + nested = recurser( + index + (i,), next_hanging_indent, next_width + ) + s += hanging_indent + nested + line_sep + + if show_summary: + if legacy <= 113: + # trailing space, fixed nbr of newlines, + # and fixed separator + s += hanging_indent + summary_insert + ", \n" + else: + s += hanging_indent + summary_insert + line_sep + + for i in range(trailing_items, 1, -1): + nested = recurser(index + (-i,), next_hanging_indent, + next_width) + s += hanging_indent + nested + line_sep + + nested = recurser(index + (-1,), next_hanging_indent, next_width) + s += hanging_indent + nested + + # remove the hanging indent, and wrap in [] + s = '[' + s[len(hanging_indent):] + ']' + return s + + try: + # invoke the recursive part with an initial index and prefix + return recurser(index=(), + hanging_indent=next_line_prefix, + curr_width=line_width) + finally: + # recursive closures have a cyclic reference to themselves, which + # requires gc to collect (gh-10620). To avoid this problem, for + # performance and PyPy friendliness, we break the cycle: + recurser = None + +def _none_or_positive_arg(x, name): + if x is None: + return -1 + if x < 0: + raise ValueError("{} must be >= 0".format(name)) + return x + +class FloatingFormat: + """ Formatter for subtypes of np.floating """ + def __init__(self, data, precision, floatmode, suppress_small, sign=False, + *, legacy=None): + # for backcompatibility, accept bools + if isinstance(sign, bool): + sign = '+' if sign else '-' + + self._legacy = legacy + if self._legacy <= 113: + # when not 0d, legacy does not support '-' + if data.shape != () and sign == '-': + sign = ' ' + + self.floatmode = floatmode + if floatmode == 'unique': + self.precision = None + else: + self.precision = precision + + self.precision = _none_or_positive_arg(self.precision, 'precision') + + self.suppress_small = suppress_small + self.sign = sign + self.exp_format = False + self.large_exponent = False + self.fillFormat(data) + + def fillFormat(self, data): + # only the finite values are used to compute the number of digits + finite_vals = data[isfinite(data)] + + # choose exponential mode based on the non-zero finite values: + abs_non_zero = absolute(finite_vals[finite_vals != 0]) + if len(abs_non_zero) != 0: + max_val = np.max(abs_non_zero) + min_val = np.min(abs_non_zero) + with errstate(over='ignore'): # division can overflow + if max_val >= 1.e8 or (not self.suppress_small and + (min_val < 0.0001 or max_val/min_val > 1000.)): + self.exp_format = True + + # do a first pass of printing all the numbers, to determine sizes + if len(finite_vals) == 0: + self.pad_left = 0 + self.pad_right = 0 + self.trim = '.' + self.exp_size = -1 + self.unique = True + self.min_digits = None + elif self.exp_format: + trim, unique = '.', True + if self.floatmode == 'fixed' or self._legacy <= 113: + trim, unique = 'k', False + strs = (dragon4_scientific(x, precision=self.precision, + unique=unique, trim=trim, sign=self.sign == '+') + for x in finite_vals) + frac_strs, _, exp_strs = zip(*(s.partition('e') for s in strs)) + int_part, frac_part = zip(*(s.split('.') for s in frac_strs)) + self.exp_size = max(len(s) for s in exp_strs) - 1 + + self.trim = 'k' + self.precision = max(len(s) for s in frac_part) + self.min_digits = self.precision + self.unique = unique + + # for back-compat with np 1.13, use 2 spaces & sign and full prec + if self._legacy <= 113: + self.pad_left = 3 + else: + # this should be only 1 or 2. Can be calculated from sign. + self.pad_left = max(len(s) for s in int_part) + # pad_right is only needed for nan length calculation + self.pad_right = self.exp_size + 2 + self.precision + else: + trim, unique = '.', True + if self.floatmode == 'fixed': + trim, unique = 'k', False + strs = (dragon4_positional(x, precision=self.precision, + fractional=True, + unique=unique, trim=trim, + sign=self.sign == '+') + for x in finite_vals) + int_part, frac_part = zip(*(s.split('.') for s in strs)) + if self._legacy <= 113: + self.pad_left = 1 + max(len(s.lstrip('-+')) for s in int_part) + else: + self.pad_left = max(len(s) for s in int_part) + self.pad_right = max(len(s) for s in frac_part) + self.exp_size = -1 + self.unique = unique + + if self.floatmode in ['fixed', 'maxprec_equal']: + self.precision = self.min_digits = self.pad_right + self.trim = 'k' + else: + self.trim = '.' + self.min_digits = 0 + + if self._legacy > 113: + # account for sign = ' ' by adding one to pad_left + if self.sign == ' ' and not any(np.signbit(finite_vals)): + self.pad_left += 1 + + # if there are non-finite values, may need to increase pad_left + if data.size != finite_vals.size: + neginf = self.sign != '-' or any(data[isinf(data)] < 0) + offset = self.pad_right + 1 # +1 for decimal pt + current_options = format_options.get() + self.pad_left = max( + self.pad_left, len(current_options['nanstr']) - offset, + len(current_options['infstr']) + neginf - offset + ) + + def __call__(self, x): + if not np.isfinite(x): + with errstate(invalid='ignore'): + current_options = format_options.get() + if np.isnan(x): + sign = '+' if self.sign == '+' else '' + ret = sign + current_options['nanstr'] + else: # isinf + sign = '-' if x < 0 else '+' if self.sign == '+' else '' + ret = sign + current_options['infstr'] + return ' '*( + self.pad_left + self.pad_right + 1 - len(ret) + ) + ret + + if self.exp_format: + return dragon4_scientific(x, + precision=self.precision, + min_digits=self.min_digits, + unique=self.unique, + trim=self.trim, + sign=self.sign == '+', + pad_left=self.pad_left, + exp_digits=self.exp_size) + else: + return dragon4_positional(x, + precision=self.precision, + min_digits=self.min_digits, + unique=self.unique, + fractional=True, + trim=self.trim, + sign=self.sign == '+', + pad_left=self.pad_left, + pad_right=self.pad_right) + + +@set_module('numpy') +def format_float_scientific(x, precision=None, unique=True, trim='k', + sign=False, pad_left=None, exp_digits=None, + min_digits=None): + """ + Format a floating-point scalar as a decimal string in scientific notation. + + Provides control over rounding, trimming and padding. Uses and assumes + IEEE unbiased rounding. Uses the "Dragon4" algorithm. + + Parameters + ---------- + x : python float or numpy floating scalar + Value to format. + precision : non-negative integer or None, optional + Maximum number of digits to print. May be None if `unique` is + `True`, but must be an integer if unique is `False`. + unique : boolean, optional + If `True`, use a digit-generation strategy which gives the shortest + representation which uniquely identifies the floating-point number from + other values of the same type, by judicious rounding. If `precision` + is given fewer digits than necessary can be printed. If `min_digits` + is given more can be printed, in which cases the last digit is rounded + with unbiased rounding. + If `False`, digits are generated as if printing an infinite-precision + value and stopping after `precision` digits, rounding the remaining + value with unbiased rounding + trim : one of 'k', '.', '0', '-', optional + Controls post-processing trimming of trailing digits, as follows: + + * 'k' : keep trailing zeros, keep decimal point (no trimming) + * '.' : trim all trailing zeros, leave decimal point + * '0' : trim all but the zero before the decimal point. Insert the + zero if it is missing. + * '-' : trim trailing zeros and any trailing decimal point + sign : boolean, optional + Whether to show the sign for positive values. + pad_left : non-negative integer, optional + Pad the left side of the string with whitespace until at least that + many characters are to the left of the decimal point. + exp_digits : non-negative integer, optional + Pad the exponent with zeros until it contains at least this + many digits. If omitted, the exponent will be at least 2 digits. + min_digits : non-negative integer or None, optional + Minimum number of digits to print. This only has an effect for + `unique=True`. In that case more digits than necessary to uniquely + identify the value may be printed and rounded unbiased. + + .. versionadded:: 1.21.0 + + Returns + ------- + rep : string + The string representation of the floating point value + + See Also + -------- + format_float_positional + + Examples + -------- + >>> import numpy as np + >>> np.format_float_scientific(np.float32(np.pi)) + '3.1415927e+00' + >>> s = np.float32(1.23e24) + >>> np.format_float_scientific(s, unique=False, precision=15) + '1.230000071797338e+24' + >>> np.format_float_scientific(s, exp_digits=4) + '1.23e+0024' + """ + precision = _none_or_positive_arg(precision, 'precision') + pad_left = _none_or_positive_arg(pad_left, 'pad_left') + exp_digits = _none_or_positive_arg(exp_digits, 'exp_digits') + min_digits = _none_or_positive_arg(min_digits, 'min_digits') + if min_digits > 0 and precision > 0 and min_digits > precision: + raise ValueError("min_digits must be less than or equal to precision") + return dragon4_scientific(x, precision=precision, unique=unique, + trim=trim, sign=sign, pad_left=pad_left, + exp_digits=exp_digits, min_digits=min_digits) + + +@set_module('numpy') +def format_float_positional(x, precision=None, unique=True, + fractional=True, trim='k', sign=False, + pad_left=None, pad_right=None, min_digits=None): + """ + Format a floating-point scalar as a decimal string in positional notation. + + Provides control over rounding, trimming and padding. Uses and assumes + IEEE unbiased rounding. Uses the "Dragon4" algorithm. + + Parameters + ---------- + x : python float or numpy floating scalar + Value to format. + precision : non-negative integer or None, optional + Maximum number of digits to print. May be None if `unique` is + `True`, but must be an integer if unique is `False`. + unique : boolean, optional + If `True`, use a digit-generation strategy which gives the shortest + representation which uniquely identifies the floating-point number from + other values of the same type, by judicious rounding. If `precision` + is given fewer digits than necessary can be printed, or if `min_digits` + is given more can be printed, in which cases the last digit is rounded + with unbiased rounding. + If `False`, digits are generated as if printing an infinite-precision + value and stopping after `precision` digits, rounding the remaining + value with unbiased rounding + fractional : boolean, optional + If `True`, the cutoffs of `precision` and `min_digits` refer to the + total number of digits after the decimal point, including leading + zeros. + If `False`, `precision` and `min_digits` refer to the total number of + significant digits, before or after the decimal point, ignoring leading + zeros. + trim : one of 'k', '.', '0', '-', optional + Controls post-processing trimming of trailing digits, as follows: + + * 'k' : keep trailing zeros, keep decimal point (no trimming) + * '.' : trim all trailing zeros, leave decimal point + * '0' : trim all but the zero before the decimal point. Insert the + zero if it is missing. + * '-' : trim trailing zeros and any trailing decimal point + sign : boolean, optional + Whether to show the sign for positive values. + pad_left : non-negative integer, optional + Pad the left side of the string with whitespace until at least that + many characters are to the left of the decimal point. + pad_right : non-negative integer, optional + Pad the right side of the string with whitespace until at least that + many characters are to the right of the decimal point. + min_digits : non-negative integer or None, optional + Minimum number of digits to print. Only has an effect if `unique=True` + in which case additional digits past those necessary to uniquely + identify the value may be printed, rounding the last additional digit. + + .. versionadded:: 1.21.0 + + Returns + ------- + rep : string + The string representation of the floating point value + + See Also + -------- + format_float_scientific + + Examples + -------- + >>> import numpy as np + >>> np.format_float_positional(np.float32(np.pi)) + '3.1415927' + >>> np.format_float_positional(np.float16(np.pi)) + '3.14' + >>> np.format_float_positional(np.float16(0.3)) + '0.3' + >>> np.format_float_positional(np.float16(0.3), unique=False, precision=10) + '0.3000488281' + """ + precision = _none_or_positive_arg(precision, 'precision') + pad_left = _none_or_positive_arg(pad_left, 'pad_left') + pad_right = _none_or_positive_arg(pad_right, 'pad_right') + min_digits = _none_or_positive_arg(min_digits, 'min_digits') + if not fractional and precision == 0: + raise ValueError("precision must be greater than 0 if " + "fractional=False") + if min_digits > 0 and precision > 0 and min_digits > precision: + raise ValueError("min_digits must be less than or equal to precision") + return dragon4_positional(x, precision=precision, unique=unique, + fractional=fractional, trim=trim, + sign=sign, pad_left=pad_left, + pad_right=pad_right, min_digits=min_digits) + +class IntegerFormat: + def __init__(self, data, sign='-'): + if data.size > 0: + data_max = np.max(data) + data_min = np.min(data) + data_max_str_len = len(str(data_max)) + if sign == ' ' and data_min < 0: + sign = '-' + if data_max >= 0 and sign in "+ ": + data_max_str_len += 1 + max_str_len = max(data_max_str_len, + len(str(data_min))) + else: + max_str_len = 0 + self.format = f'{{:{sign}{max_str_len}d}}' + + def __call__(self, x): + return self.format.format(x) + +class BoolFormat: + def __init__(self, data, **kwargs): + # add an extra space so " True" and "False" have the same length and + # array elements align nicely when printed, except in 0d arrays + self.truestr = ' True' if data.shape != () else 'True' + + def __call__(self, x): + return self.truestr if x else "False" + + +class ComplexFloatingFormat: + """ Formatter for subtypes of np.complexfloating """ + def __init__(self, x, precision, floatmode, suppress_small, + sign=False, *, legacy=None): + # for backcompatibility, accept bools + if isinstance(sign, bool): + sign = '+' if sign else '-' + + floatmode_real = floatmode_imag = floatmode + if legacy <= 113: + floatmode_real = 'maxprec_equal' + floatmode_imag = 'maxprec' + + self.real_format = FloatingFormat( + x.real, precision, floatmode_real, suppress_small, + sign=sign, legacy=legacy + ) + self.imag_format = FloatingFormat( + x.imag, precision, floatmode_imag, suppress_small, + sign='+', legacy=legacy + ) + + def __call__(self, x): + r = self.real_format(x.real) + i = self.imag_format(x.imag) + + # add the 'j' before the terminal whitespace in i + sp = len(i.rstrip()) + i = i[:sp] + 'j' + i[sp:] + + return r + i + + +class _TimelikeFormat: + def __init__(self, data): + non_nat = data[~isnat(data)] + if len(non_nat) > 0: + # Max str length of non-NaT elements + max_str_len = max(len(self._format_non_nat(np.max(non_nat))), + len(self._format_non_nat(np.min(non_nat)))) + else: + max_str_len = 0 + if len(non_nat) < data.size: + # data contains a NaT + max_str_len = max(max_str_len, 5) + self._format = '%{}s'.format(max_str_len) + self._nat = "'NaT'".rjust(max_str_len) + + def _format_non_nat(self, x): + # override in subclass + raise NotImplementedError + + def __call__(self, x): + if isnat(x): + return self._nat + else: + return self._format % self._format_non_nat(x) + + +class DatetimeFormat(_TimelikeFormat): + def __init__(self, x, unit=None, timezone=None, casting='same_kind', + legacy=False): + # Get the unit from the dtype + if unit is None: + if x.dtype.kind == 'M': + unit = datetime_data(x.dtype)[0] + else: + unit = 's' + + if timezone is None: + timezone = 'naive' + self.timezone = timezone + self.unit = unit + self.casting = casting + self.legacy = legacy + + # must be called after the above are configured + super().__init__(x) + + def __call__(self, x): + if self.legacy <= 113: + return self._format_non_nat(x) + return super().__call__(x) + + def _format_non_nat(self, x): + return "'%s'" % datetime_as_string(x, + unit=self.unit, + timezone=self.timezone, + casting=self.casting) + + +class TimedeltaFormat(_TimelikeFormat): + def _format_non_nat(self, x): + return str(x.astype('i8')) + + +class SubArrayFormat: + def __init__(self, format_function, **options): + self.format_function = format_function + self.threshold = options['threshold'] + self.edge_items = options['edgeitems'] + + def __call__(self, a): + self.summary_insert = "..." if a.size > self.threshold else "" + return self.format_array(a) + + def format_array(self, a): + if np.ndim(a) == 0: + return self.format_function(a) + + if self.summary_insert and a.shape[0] > 2*self.edge_items: + formatted = ( + [self.format_array(a_) for a_ in a[:self.edge_items]] + + [self.summary_insert] + + [self.format_array(a_) for a_ in a[-self.edge_items:]] + ) + else: + formatted = [self.format_array(a_) for a_ in a] + + return "[" + ", ".join(formatted) + "]" + + +class StructuredVoidFormat: + """ + Formatter for structured np.void objects. + + This does not work on structured alias types like + np.dtype(('i4', 'i2,i2')), as alias scalars lose their field information, + and the implementation relies upon np.void.__getitem__. + """ + def __init__(self, format_functions): + self.format_functions = format_functions + + @classmethod + def from_data(cls, data, **options): + """ + This is a second way to initialize StructuredVoidFormat, + using the raw data as input. Added to avoid changing + the signature of __init__. + """ + format_functions = [] + for field_name in data.dtype.names: + format_function = _get_format_function(data[field_name], **options) + if data.dtype[field_name].shape != (): + format_function = SubArrayFormat(format_function, **options) + format_functions.append(format_function) + return cls(format_functions) + + def __call__(self, x): + str_fields = [ + format_function(field) + for field, format_function in zip(x, self.format_functions) + ] + if len(str_fields) == 1: + return "({},)".format(str_fields[0]) + else: + return "({})".format(", ".join(str_fields)) + + +def _void_scalar_to_string(x, is_repr=True): + """ + Implements the repr for structured-void scalars. It is called from the + scalartypes.c.src code, and is placed here because it uses the elementwise + formatters defined above. + """ + options = format_options.get().copy() + + if options["legacy"] <= 125: + return StructuredVoidFormat.from_data(array(x), **options)(x) + + if options.get('formatter') is None: + options['formatter'] = {} + options['formatter'].setdefault('float_kind', str) + val_repr = StructuredVoidFormat.from_data(array(x), **options)(x) + if not is_repr: + return val_repr + cls = type(x) + cls_fqn = cls.__module__.replace("numpy", "np") + "." + cls.__name__ + void_dtype = np.dtype((np.void, x.dtype)) + return f"{cls_fqn}({val_repr}, dtype={void_dtype!s})" + + +_typelessdata = [int_, float64, complex128, _nt.bool] + + +def dtype_is_implied(dtype): + """ + Determine if the given dtype is implied by the representation + of its values. + + Parameters + ---------- + dtype : dtype + Data type + + Returns + ------- + implied : bool + True if the dtype is implied by the representation of its values. + + Examples + -------- + >>> import numpy as np + >>> np._core.arrayprint.dtype_is_implied(int) + True + >>> np.array([1, 2, 3], int) + array([1, 2, 3]) + >>> np._core.arrayprint.dtype_is_implied(np.int8) + False + >>> np.array([1, 2, 3], np.int8) + array([1, 2, 3], dtype=int8) + """ + dtype = np.dtype(dtype) + if format_options.get()['legacy'] <= 113 and dtype.type == np.bool: + return False + + # not just void types can be structured, and names are not part of the repr + if dtype.names is not None: + return False + + # should care about endianness *unless size is 1* (e.g., int8, bool) + if not dtype.isnative: + return False + + return dtype.type in _typelessdata + + +def dtype_short_repr(dtype): + """ + Convert a dtype to a short form which evaluates to the same dtype. + + The intent is roughly that the following holds + + >>> from numpy import * + >>> dt = np.int64([1, 2]).dtype + >>> assert eval(dtype_short_repr(dt)) == dt + """ + if type(dtype).__repr__ != np.dtype.__repr__: + # TODO: Custom repr for user DTypes, logic should likely move. + return repr(dtype) + if dtype.names is not None: + # structured dtypes give a list or tuple repr + return str(dtype) + elif issubclass(dtype.type, flexible): + # handle these separately so they don't give garbage like str256 + return "'%s'" % str(dtype) + + typename = dtype.name + if not dtype.isnative: + # deal with cases like dtype(' 0 + + prefix = class_name + "(" + suffix = ")" if skipdtype else "," + + if (current_options['legacy'] <= 113 and + arr.shape == () and not arr.dtype.names): + lst = repr(arr.item()) + elif arr.size > 0 or arr.shape == (0,): + lst = array2string(arr, max_line_width, precision, suppress_small, + ', ', prefix, suffix=suffix) + else: # show zero-length shape unless it is (0,) + lst = "[], shape=%s" % (repr(arr.shape),) + + arr_str = prefix + lst + suffix + + if skipdtype: + return arr_str + + dtype_str = "dtype={})".format(dtype_short_repr(arr.dtype)) + + # compute whether we should put dtype on a new line: Do so if adding the + # dtype would extend the last line past max_line_width. + # Note: This line gives the correct result even when rfind returns -1. + last_line_len = len(arr_str) - (arr_str.rfind('\n') + 1) + spacer = " " + if current_options['legacy'] <= 113: + if issubclass(arr.dtype.type, flexible): + spacer = '\n' + ' '*len(class_name + "(") + elif last_line_len + len(dtype_str) + 1 > max_line_width: + spacer = '\n' + ' '*len(class_name + "(") + + return arr_str + spacer + dtype_str + + +def _array_repr_dispatcher( + arr, max_line_width=None, precision=None, suppress_small=None): + return (arr,) + + +@array_function_dispatch(_array_repr_dispatcher, module='numpy') +def array_repr(arr, max_line_width=None, precision=None, suppress_small=None): + """ + Return the string representation of an array. + + Parameters + ---------- + arr : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + + Returns + ------- + string : str + The string representation of an array. + + See Also + -------- + array_str, array2string, set_printoptions + + Examples + -------- + >>> import numpy as np + >>> np.array_repr(np.array([1,2])) + 'array([1, 2])' + >>> np.array_repr(np.ma.array([0.])) + 'MaskedArray([0.])' + >>> np.array_repr(np.array([], np.int32)) + 'array([], dtype=int32)' + + >>> x = np.array([1e-6, 4e-7, 2, 3]) + >>> np.array_repr(x, precision=6, suppress_small=True) + 'array([0.000001, 0. , 2. , 3. ])' + + """ + return _array_repr_implementation( + arr, max_line_width, precision, suppress_small) + + +@_recursive_guard() +def _guarded_repr_or_str(v): + if isinstance(v, bytes): + return repr(v) + return str(v) + + +def _array_str_implementation( + a, max_line_width=None, precision=None, suppress_small=None, + array2string=array2string): + """Internal version of array_str() that allows overriding array2string.""" + if (format_options.get()['legacy'] <= 113 and + a.shape == () and not a.dtype.names): + return str(a.item()) + + # the str of 0d arrays is a special case: It should appear like a scalar, + # so floats are not truncated by `precision`, and strings are not wrapped + # in quotes. So we return the str of the scalar value. + if a.shape == (): + # obtain a scalar and call str on it, avoiding problems for subclasses + # for which indexing with () returns a 0d instead of a scalar by using + # ndarray's getindex. Also guard against recursive 0d object arrays. + return _guarded_repr_or_str(np.ndarray.__getitem__(a, ())) + + return array2string(a, max_line_width, precision, suppress_small, ' ', "") + + +def _array_str_dispatcher( + a, max_line_width=None, precision=None, suppress_small=None): + return (a,) + + +@array_function_dispatch(_array_str_dispatcher, module='numpy') +def array_str(a, max_line_width=None, precision=None, suppress_small=None): + """ + Return a string representation of the data in an array. + + The data in the array is returned as a single string. This function is + similar to `array_repr`, the difference being that `array_repr` also + returns information on the kind of array and its data type. + + Parameters + ---------- + a : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + + See Also + -------- + array2string, array_repr, set_printoptions + + Examples + -------- + >>> import numpy as np + >>> np.array_str(np.arange(3)) + '[0 1 2]' + + """ + return _array_str_implementation( + a, max_line_width, precision, suppress_small) + + +# needed if __array_function__ is disabled +_array2string_impl = getattr(array2string, '__wrapped__', array2string) +_default_array_str = functools.partial(_array_str_implementation, + array2string=_array2string_impl) +_default_array_repr = functools.partial(_array_repr_implementation, + array2string=_array2string_impl) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/defchararray.py b/valley/lib/python3.10/site-packages/numpy/_core/defchararray.py new file mode 100644 index 0000000000000000000000000000000000000000..6301556aaaa94ab01dbda1c5da72bf98a7f2ac26 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/defchararray.py @@ -0,0 +1,1402 @@ +""" +This module contains a set of functions for vectorized string +operations and methods. + +.. note:: + The `chararray` class exists for backwards compatibility with + Numarray, it is not recommended for new development. Starting from numpy + 1.4, if one needs arrays of strings, it is recommended to use arrays of + `dtype` `object_`, `bytes_` or `str_`, and use the free functions + in the `numpy.char` module for fast vectorized string operations. + +Some methods will only be available if the corresponding string method is +available in your version of Python. + +The preferred alias for `defchararray` is `numpy.char`. + +""" +import functools + +import numpy as np +from .._utils import set_module +from .numerictypes import bytes_, str_, character +from .numeric import ndarray, array as narray, asarray as asnarray +from numpy._core.multiarray import compare_chararrays +from numpy._core import overrides +from numpy.strings import * +from numpy.strings import ( + multiply as strings_multiply, + partition as strings_partition, + rpartition as strings_rpartition, +) +from numpy._core.strings import ( + _split as split, + _rsplit as rsplit, + _splitlines as splitlines, + _join as join, +) + +__all__ = [ + 'equal', 'not_equal', 'greater_equal', 'less_equal', + 'greater', 'less', 'str_len', 'add', 'multiply', 'mod', 'capitalize', + 'center', 'count', 'decode', 'encode', 'endswith', 'expandtabs', + 'find', 'index', 'isalnum', 'isalpha', 'isdigit', 'islower', 'isspace', + 'istitle', 'isupper', 'join', 'ljust', 'lower', 'lstrip', 'partition', + 'replace', 'rfind', 'rindex', 'rjust', 'rpartition', 'rsplit', + 'rstrip', 'split', 'splitlines', 'startswith', 'strip', 'swapcase', + 'title', 'translate', 'upper', 'zfill', 'isnumeric', 'isdecimal', + 'array', 'asarray', 'compare_chararrays', 'chararray' + ] + + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy.char') + + +def _binary_op_dispatcher(x1, x2): + return (x1, x2) + + +@array_function_dispatch(_binary_op_dispatcher) +def equal(x1, x2): + """ + Return (x1 == x2) element-wise. + + Unlike `numpy.equal`, this comparison is performed by first + stripping whitespace characters from the end of the string. This + behavior is provided for backward-compatibility with numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + Examples + -------- + >>> import numpy as np + >>> y = "aa " + >>> x = "aa" + >>> np.char.equal(x, y) + array(True) + + See Also + -------- + not_equal, greater_equal, less_equal, greater, less + """ + return compare_chararrays(x1, x2, '==', True) + + +@array_function_dispatch(_binary_op_dispatcher) +def not_equal(x1, x2): + """ + Return (x1 != x2) element-wise. + + Unlike `numpy.not_equal`, this comparison is performed by first + stripping whitespace characters from the end of the string. This + behavior is provided for backward-compatibility with numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + See Also + -------- + equal, greater_equal, less_equal, greater, less + + Examples + -------- + >>> import numpy as np + >>> x1 = np.array(['a', 'b', 'c']) + >>> np.char.not_equal(x1, 'b') + array([ True, False, True]) + + """ + return compare_chararrays(x1, x2, '!=', True) + + +@array_function_dispatch(_binary_op_dispatcher) +def greater_equal(x1, x2): + """ + Return (x1 >= x2) element-wise. + + Unlike `numpy.greater_equal`, this comparison is performed by + first stripping whitespace characters from the end of the string. + This behavior is provided for backward-compatibility with + numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + See Also + -------- + equal, not_equal, less_equal, greater, less + + Examples + -------- + >>> import numpy as np + >>> x1 = np.array(['a', 'b', 'c']) + >>> np.char.greater_equal(x1, 'b') + array([False, True, True]) + + """ + return compare_chararrays(x1, x2, '>=', True) + + +@array_function_dispatch(_binary_op_dispatcher) +def less_equal(x1, x2): + """ + Return (x1 <= x2) element-wise. + + Unlike `numpy.less_equal`, this comparison is performed by first + stripping whitespace characters from the end of the string. This + behavior is provided for backward-compatibility with numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + See Also + -------- + equal, not_equal, greater_equal, greater, less + + Examples + -------- + >>> import numpy as np + >>> x1 = np.array(['a', 'b', 'c']) + >>> np.char.less_equal(x1, 'b') + array([ True, True, False]) + + """ + return compare_chararrays(x1, x2, '<=', True) + + +@array_function_dispatch(_binary_op_dispatcher) +def greater(x1, x2): + """ + Return (x1 > x2) element-wise. + + Unlike `numpy.greater`, this comparison is performed by first + stripping whitespace characters from the end of the string. This + behavior is provided for backward-compatibility with numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + See Also + -------- + equal, not_equal, greater_equal, less_equal, less + + Examples + -------- + >>> import numpy as np + >>> x1 = np.array(['a', 'b', 'c']) + >>> np.char.greater(x1, 'b') + array([False, False, True]) + + """ + return compare_chararrays(x1, x2, '>', True) + + +@array_function_dispatch(_binary_op_dispatcher) +def less(x1, x2): + """ + Return (x1 < x2) element-wise. + + Unlike `numpy.greater`, this comparison is performed by first + stripping whitespace characters from the end of the string. This + behavior is provided for backward-compatibility with numarray. + + Parameters + ---------- + x1, x2 : array_like of str or unicode + Input arrays of the same shape. + + Returns + ------- + out : ndarray + Output array of bools. + + See Also + -------- + equal, not_equal, greater_equal, less_equal, greater + + Examples + -------- + >>> import numpy as np + >>> x1 = np.array(['a', 'b', 'c']) + >>> np.char.less(x1, 'b') + array([True, False, False]) + + """ + return compare_chararrays(x1, x2, '<', True) + + +def multiply(a, i): + """ + Return (a * i), that is string multiple concatenation, + element-wise. + + Values in ``i`` of less than 0 are treated as 0 (which yields an + empty string). + + Parameters + ---------- + a : array_like, with `np.bytes_` or `np.str_` dtype + + i : array_like, with any integer dtype + + Returns + ------- + out : ndarray + Output array of str or unicode, depending on input types + + Notes + ----- + This is a thin wrapper around np.strings.multiply that raises + `ValueError` when ``i`` is not an integer. It only + exists for backwards-compatibility. + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["a", "b", "c"]) + >>> np.strings.multiply(a, 3) + array(['aaa', 'bbb', 'ccc'], dtype='>> i = np.array([1, 2, 3]) + >>> np.strings.multiply(a, i) + array(['a', 'bb', 'ccc'], dtype='>> np.strings.multiply(np.array(['a']), i) + array(['a', 'aa', 'aaa'], dtype='>> a = np.array(['a', 'b', 'c', 'd', 'e', 'f']).reshape((2, 3)) + >>> np.strings.multiply(a, 3) + array([['aaa', 'bbb', 'ccc'], + ['ddd', 'eee', 'fff']], dtype='>> np.strings.multiply(a, i) + array([['a', 'bb', 'ccc'], + ['d', 'ee', 'fff']], dtype='>> import numpy as np + >>> x = np.array(["Numpy is nice!"]) + >>> np.char.partition(x, " ") + array([['Numpy', ' ', 'is nice!']], dtype='>> import numpy as np + >>> a = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> np.char.rpartition(a, 'A') + array([['aAaAa', 'A', ''], + [' a', 'A', ' '], + ['abB', 'A', 'Bba']], dtype='= 2`` and ``order='F'``, in which case `strides` + is in "Fortran order". + + Methods + ------- + astype + argsort + copy + count + decode + dump + dumps + encode + endswith + expandtabs + fill + find + flatten + getfield + index + isalnum + isalpha + isdecimal + isdigit + islower + isnumeric + isspace + istitle + isupper + item + join + ljust + lower + lstrip + nonzero + put + ravel + repeat + replace + reshape + resize + rfind + rindex + rjust + rsplit + rstrip + searchsorted + setfield + setflags + sort + split + splitlines + squeeze + startswith + strip + swapaxes + swapcase + take + title + tofile + tolist + tostring + translate + transpose + upper + view + zfill + + Parameters + ---------- + shape : tuple + Shape of the array. + itemsize : int, optional + Length of each array element, in number of characters. Default is 1. + unicode : bool, optional + Are the array elements of type unicode (True) or string (False). + Default is False. + buffer : object exposing the buffer interface or str, optional + Memory address of the start of the array data. Default is None, + in which case a new array is created. + offset : int, optional + Fixed stride displacement from the beginning of an axis? + Default is 0. Needs to be >=0. + strides : array_like of ints, optional + Strides for the array (see `~numpy.ndarray.strides` for + full description). Default is None. + order : {'C', 'F'}, optional + The order in which the array data is stored in memory: 'C' -> + "row major" order (the default), 'F' -> "column major" + (Fortran) order. + + Examples + -------- + >>> import numpy as np + >>> charar = np.char.chararray((3, 3)) + >>> charar[:] = 'a' + >>> charar + chararray([[b'a', b'a', b'a'], + [b'a', b'a', b'a'], + [b'a', b'a', b'a']], dtype='|S1') + + >>> charar = np.char.chararray(charar.shape, itemsize=5) + >>> charar[:] = 'abc' + >>> charar + chararray([[b'abc', b'abc', b'abc'], + [b'abc', b'abc', b'abc'], + [b'abc', b'abc', b'abc']], dtype='|S5') + + """ + def __new__(subtype, shape, itemsize=1, unicode=False, buffer=None, + offset=0, strides=None, order='C'): + if unicode: + dtype = str_ + else: + dtype = bytes_ + + # force itemsize to be a Python int, since using NumPy integer + # types results in itemsize.itemsize being used as the size of + # strings in the new array. + itemsize = int(itemsize) + + if isinstance(buffer, str): + # unicode objects do not have the buffer interface + filler = buffer + buffer = None + else: + filler = None + + if buffer is None: + self = ndarray.__new__(subtype, shape, (dtype, itemsize), + order=order) + else: + self = ndarray.__new__(subtype, shape, (dtype, itemsize), + buffer=buffer, + offset=offset, strides=strides, + order=order) + if filler is not None: + self[...] = filler + + return self + + def __array_wrap__(self, arr, context=None, return_scalar=False): + # When calling a ufunc (and some other functions), we return a + # chararray if the ufunc output is a string-like array, + # or an ndarray otherwise + if arr.dtype.char in "SUbc": + return arr.view(type(self)) + return arr + + def __array_finalize__(self, obj): + # The b is a special case because it is used for reconstructing. + if self.dtype.char not in 'VSUbc': + raise ValueError("Can only create a chararray from string data.") + + def __getitem__(self, obj): + val = ndarray.__getitem__(self, obj) + if isinstance(val, character): + return val.rstrip() + return val + + # IMPLEMENTATION NOTE: Most of the methods of this class are + # direct delegations to the free functions in this module. + # However, those that return an array of strings should instead + # return a chararray, so some extra wrapping is required. + + def __eq__(self, other): + """ + Return (self == other) element-wise. + + See Also + -------- + equal + """ + return equal(self, other) + + def __ne__(self, other): + """ + Return (self != other) element-wise. + + See Also + -------- + not_equal + """ + return not_equal(self, other) + + def __ge__(self, other): + """ + Return (self >= other) element-wise. + + See Also + -------- + greater_equal + """ + return greater_equal(self, other) + + def __le__(self, other): + """ + Return (self <= other) element-wise. + + See Also + -------- + less_equal + """ + return less_equal(self, other) + + def __gt__(self, other): + """ + Return (self > other) element-wise. + + See Also + -------- + greater + """ + return greater(self, other) + + def __lt__(self, other): + """ + Return (self < other) element-wise. + + See Also + -------- + less + """ + return less(self, other) + + def __add__(self, other): + """ + Return (self + other), that is string concatenation, + element-wise for a pair of array_likes of str or unicode. + + See Also + -------- + add + """ + return add(self, other) + + def __radd__(self, other): + """ + Return (other + self), that is string concatenation, + element-wise for a pair of array_likes of `bytes_` or `str_`. + + See Also + -------- + add + """ + return add(other, self) + + def __mul__(self, i): + """ + Return (self * i), that is string multiple concatenation, + element-wise. + + See Also + -------- + multiply + """ + return asarray(multiply(self, i)) + + def __rmul__(self, i): + """ + Return (self * i), that is string multiple concatenation, + element-wise. + + See Also + -------- + multiply + """ + return asarray(multiply(self, i)) + + def __mod__(self, i): + """ + Return (self % i), that is pre-Python 2.6 string formatting + (interpolation), element-wise for a pair of array_likes of `bytes_` + or `str_`. + + See Also + -------- + mod + """ + return asarray(mod(self, i)) + + def __rmod__(self, other): + return NotImplemented + + def argsort(self, axis=-1, kind=None, order=None): + """ + Return the indices that sort the array lexicographically. + + For full documentation see `numpy.argsort`, for which this method is + in fact merely a "thin wrapper." + + Examples + -------- + >>> c = np.array(['a1b c', '1b ca', 'b ca1', 'Ca1b'], 'S5') + >>> c = c.view(np.char.chararray); c + chararray(['a1b c', '1b ca', 'b ca1', 'Ca1b'], + dtype='|S5') + >>> c[c.argsort()] + chararray(['1b ca', 'Ca1b', 'a1b c', 'b ca1'], + dtype='|S5') + + """ + return self.__array__().argsort(axis, kind, order) + argsort.__doc__ = ndarray.argsort.__doc__ + + def capitalize(self): + """ + Return a copy of `self` with only the first character of each element + capitalized. + + See Also + -------- + char.capitalize + + """ + return asarray(capitalize(self)) + + def center(self, width, fillchar=' '): + """ + Return a copy of `self` with its elements centered in a + string of length `width`. + + See Also + -------- + center + """ + return asarray(center(self, width, fillchar)) + + def count(self, sub, start=0, end=None): + """ + Returns an array with the number of non-overlapping occurrences of + substring `sub` in the range [`start`, `end`]. + + See Also + -------- + char.count + + """ + return count(self, sub, start, end) + + def decode(self, encoding=None, errors=None): + """ + Calls ``bytes.decode`` element-wise. + + See Also + -------- + char.decode + + """ + return decode(self, encoding, errors) + + def encode(self, encoding=None, errors=None): + """ + Calls :meth:`str.encode` element-wise. + + See Also + -------- + char.encode + + """ + return encode(self, encoding, errors) + + def endswith(self, suffix, start=0, end=None): + """ + Returns a boolean array which is `True` where the string element + in `self` ends with `suffix`, otherwise `False`. + + See Also + -------- + char.endswith + + """ + return endswith(self, suffix, start, end) + + def expandtabs(self, tabsize=8): + """ + Return a copy of each string element where all tab characters are + replaced by one or more spaces. + + See Also + -------- + char.expandtabs + + """ + return asarray(expandtabs(self, tabsize)) + + def find(self, sub, start=0, end=None): + """ + For each element, return the lowest index in the string where + substring `sub` is found. + + See Also + -------- + char.find + + """ + return find(self, sub, start, end) + + def index(self, sub, start=0, end=None): + """ + Like `find`, but raises :exc:`ValueError` when the substring is not + found. + + See Also + -------- + char.index + + """ + return index(self, sub, start, end) + + def isalnum(self): + """ + Returns true for each element if all characters in the string + are alphanumeric and there is at least one character, false + otherwise. + + See Also + -------- + char.isalnum + + """ + return isalnum(self) + + def isalpha(self): + """ + Returns true for each element if all characters in the string + are alphabetic and there is at least one character, false + otherwise. + + See Also + -------- + char.isalpha + + """ + return isalpha(self) + + def isdigit(self): + """ + Returns true for each element if all characters in the string are + digits and there is at least one character, false otherwise. + + See Also + -------- + char.isdigit + + """ + return isdigit(self) + + def islower(self): + """ + Returns true for each element if all cased characters in the + string are lowercase and there is at least one cased character, + false otherwise. + + See Also + -------- + char.islower + + """ + return islower(self) + + def isspace(self): + """ + Returns true for each element if there are only whitespace + characters in the string and there is at least one character, + false otherwise. + + See Also + -------- + char.isspace + + """ + return isspace(self) + + def istitle(self): + """ + Returns true for each element if the element is a titlecased + string and there is at least one character, false otherwise. + + See Also + -------- + char.istitle + + """ + return istitle(self) + + def isupper(self): + """ + Returns true for each element if all cased characters in the + string are uppercase and there is at least one character, false + otherwise. + + See Also + -------- + char.isupper + + """ + return isupper(self) + + def join(self, seq): + """ + Return a string which is the concatenation of the strings in the + sequence `seq`. + + See Also + -------- + char.join + + """ + return join(self, seq) + + def ljust(self, width, fillchar=' '): + """ + Return an array with the elements of `self` left-justified in a + string of length `width`. + + See Also + -------- + char.ljust + + """ + return asarray(ljust(self, width, fillchar)) + + def lower(self): + """ + Return an array with the elements of `self` converted to + lowercase. + + See Also + -------- + char.lower + + """ + return asarray(lower(self)) + + def lstrip(self, chars=None): + """ + For each element in `self`, return a copy with the leading characters + removed. + + See Also + -------- + char.lstrip + + """ + return lstrip(self, chars) + + def partition(self, sep): + """ + Partition each element in `self` around `sep`. + + See Also + -------- + partition + """ + return asarray(partition(self, sep)) + + def replace(self, old, new, count=None): + """ + For each element in `self`, return a copy of the string with all + occurrences of substring `old` replaced by `new`. + + See Also + -------- + char.replace + + """ + return replace(self, old, new, count if count is not None else -1) + + def rfind(self, sub, start=0, end=None): + """ + For each element in `self`, return the highest index in the string + where substring `sub` is found, such that `sub` is contained + within [`start`, `end`]. + + See Also + -------- + char.rfind + + """ + return rfind(self, sub, start, end) + + def rindex(self, sub, start=0, end=None): + """ + Like `rfind`, but raises :exc:`ValueError` when the substring `sub` is + not found. + + See Also + -------- + char.rindex + + """ + return rindex(self, sub, start, end) + + def rjust(self, width, fillchar=' '): + """ + Return an array with the elements of `self` + right-justified in a string of length `width`. + + See Also + -------- + char.rjust + + """ + return asarray(rjust(self, width, fillchar)) + + def rpartition(self, sep): + """ + Partition each element in `self` around `sep`. + + See Also + -------- + rpartition + """ + return asarray(rpartition(self, sep)) + + def rsplit(self, sep=None, maxsplit=None): + """ + For each element in `self`, return a list of the words in + the string, using `sep` as the delimiter string. + + See Also + -------- + char.rsplit + + """ + return rsplit(self, sep, maxsplit) + + def rstrip(self, chars=None): + """ + For each element in `self`, return a copy with the trailing + characters removed. + + See Also + -------- + char.rstrip + + """ + return rstrip(self, chars) + + def split(self, sep=None, maxsplit=None): + """ + For each element in `self`, return a list of the words in the + string, using `sep` as the delimiter string. + + See Also + -------- + char.split + + """ + return split(self, sep, maxsplit) + + def splitlines(self, keepends=None): + """ + For each element in `self`, return a list of the lines in the + element, breaking at line boundaries. + + See Also + -------- + char.splitlines + + """ + return splitlines(self, keepends) + + def startswith(self, prefix, start=0, end=None): + """ + Returns a boolean array which is `True` where the string element + in `self` starts with `prefix`, otherwise `False`. + + See Also + -------- + char.startswith + + """ + return startswith(self, prefix, start, end) + + def strip(self, chars=None): + """ + For each element in `self`, return a copy with the leading and + trailing characters removed. + + See Also + -------- + char.strip + + """ + return strip(self, chars) + + def swapcase(self): + """ + For each element in `self`, return a copy of the string with + uppercase characters converted to lowercase and vice versa. + + See Also + -------- + char.swapcase + + """ + return asarray(swapcase(self)) + + def title(self): + """ + For each element in `self`, return a titlecased version of the + string: words start with uppercase characters, all remaining cased + characters are lowercase. + + See Also + -------- + char.title + + """ + return asarray(title(self)) + + def translate(self, table, deletechars=None): + """ + For each element in `self`, return a copy of the string where + all characters occurring in the optional argument + `deletechars` are removed, and the remaining characters have + been mapped through the given translation table. + + See Also + -------- + char.translate + + """ + return asarray(translate(self, table, deletechars)) + + def upper(self): + """ + Return an array with the elements of `self` converted to + uppercase. + + See Also + -------- + char.upper + + """ + return asarray(upper(self)) + + def zfill(self, width): + """ + Return the numeric string left-filled with zeros in a string of + length `width`. + + See Also + -------- + char.zfill + + """ + return asarray(zfill(self, width)) + + def isnumeric(self): + """ + For each element in `self`, return True if there are only + numeric characters in the element. + + See Also + -------- + char.isnumeric + + """ + return isnumeric(self) + + def isdecimal(self): + """ + For each element in `self`, return True if there are only + decimal characters in the element. + + See Also + -------- + char.isdecimal + + """ + return isdecimal(self) + + +@set_module("numpy.char") +def array(obj, itemsize=None, copy=True, unicode=None, order=None): + """ + Create a `~numpy.char.chararray`. + + .. note:: + This class is provided for numarray backward-compatibility. + New code (not concerned with numarray compatibility) should use + arrays of type `bytes_` or `str_` and use the free functions + in :mod:`numpy.char` for fast vectorized string operations instead. + + Versus a NumPy array of dtype `bytes_` or `str_`, this + class adds the following functionality: + + 1) values automatically have whitespace removed from the end + when indexed + + 2) comparison operators automatically remove whitespace from the + end when comparing values + + 3) vectorized string operations are provided as methods + (e.g. `chararray.endswith `) + and infix operators (e.g. ``+, *, %``) + + Parameters + ---------- + obj : array of str or unicode-like + + itemsize : int, optional + `itemsize` is the number of characters per scalar in the + resulting array. If `itemsize` is None, and `obj` is an + object array or a Python list, the `itemsize` will be + automatically determined. If `itemsize` is provided and `obj` + is of type str or unicode, then the `obj` string will be + chunked into `itemsize` pieces. + + copy : bool, optional + If true (default), then the object is copied. Otherwise, a copy + will only be made if ``__array__`` returns a copy, if obj is a + nested sequence, or if a copy is needed to satisfy any of the other + requirements (`itemsize`, unicode, `order`, etc.). + + unicode : bool, optional + When true, the resulting `~numpy.char.chararray` can contain Unicode + characters, when false only 8-bit characters. If unicode is + None and `obj` is one of the following: + + - a `~numpy.char.chararray`, + - an ndarray of type :class:`str_` or :class:`bytes_` + - a Python :class:`str` or :class:`bytes` object, + + then the unicode setting of the output array will be + automatically determined. + + order : {'C', 'F', 'A'}, optional + Specify the order of the array. If order is 'C' (default), then the + array will be in C-contiguous order (last-index varies the + fastest). If order is 'F', then the returned array + will be in Fortran-contiguous order (first-index varies the + fastest). If order is 'A', then the returned array may + be in any order (either C-, Fortran-contiguous, or even + discontiguous). + """ + if isinstance(obj, (bytes, str)): + if unicode is None: + if isinstance(obj, str): + unicode = True + else: + unicode = False + + if itemsize is None: + itemsize = len(obj) + shape = len(obj) // itemsize + + return chararray(shape, itemsize=itemsize, unicode=unicode, + buffer=obj, order=order) + + if isinstance(obj, (list, tuple)): + obj = asnarray(obj) + + if isinstance(obj, ndarray) and issubclass(obj.dtype.type, character): + # If we just have a vanilla chararray, create a chararray + # view around it. + if not isinstance(obj, chararray): + obj = obj.view(chararray) + + if itemsize is None: + itemsize = obj.itemsize + # itemsize is in 8-bit chars, so for Unicode, we need + # to divide by the size of a single Unicode character, + # which for NumPy is always 4 + if issubclass(obj.dtype.type, str_): + itemsize //= 4 + + if unicode is None: + if issubclass(obj.dtype.type, str_): + unicode = True + else: + unicode = False + + if unicode: + dtype = str_ + else: + dtype = bytes_ + + if order is not None: + obj = asnarray(obj, order=order) + if (copy or + (itemsize != obj.itemsize) or + (not unicode and isinstance(obj, str_)) or + (unicode and isinstance(obj, bytes_))): + obj = obj.astype((dtype, int(itemsize))) + return obj + + if isinstance(obj, ndarray) and issubclass(obj.dtype.type, object): + if itemsize is None: + # Since no itemsize was specified, convert the input array to + # a list so the ndarray constructor will automatically + # determine the itemsize for us. + obj = obj.tolist() + # Fall through to the default case + + if unicode: + dtype = str_ + else: + dtype = bytes_ + + if itemsize is None: + val = narray(obj, dtype=dtype, order=order, subok=True) + else: + val = narray(obj, dtype=(dtype, itemsize), order=order, subok=True) + return val.view(chararray) + + +@set_module("numpy.char") +def asarray(obj, itemsize=None, unicode=None, order=None): + """ + Convert the input to a `~numpy.char.chararray`, copying the data only if + necessary. + + Versus a NumPy array of dtype `bytes_` or `str_`, this + class adds the following functionality: + + 1) values automatically have whitespace removed from the end + when indexed + + 2) comparison operators automatically remove whitespace from the + end when comparing values + + 3) vectorized string operations are provided as methods + (e.g. `chararray.endswith `) + and infix operators (e.g. ``+``, ``*``, ``%``) + + Parameters + ---------- + obj : array of str or unicode-like + + itemsize : int, optional + `itemsize` is the number of characters per scalar in the + resulting array. If `itemsize` is None, and `obj` is an + object array or a Python list, the `itemsize` will be + automatically determined. If `itemsize` is provided and `obj` + is of type str or unicode, then the `obj` string will be + chunked into `itemsize` pieces. + + unicode : bool, optional + When true, the resulting `~numpy.char.chararray` can contain Unicode + characters, when false only 8-bit characters. If unicode is + None and `obj` is one of the following: + + - a `~numpy.char.chararray`, + - an ndarray of type `str_` or `unicode_` + - a Python str or unicode object, + + then the unicode setting of the output array will be + automatically determined. + + order : {'C', 'F'}, optional + Specify the order of the array. If order is 'C' (default), then the + array will be in C-contiguous order (last-index varies the + fastest). If order is 'F', then the returned array + will be in Fortran-contiguous order (first-index varies the + fastest). + + Examples + -------- + >>> import numpy as np + >>> np.char.asarray(['hello', 'world']) + chararray(['hello', 'world'], dtype=' chararray[Any, dtype[bytes_]]: ... + @overload + def __new__( + subtype, + shape: _ShapeLike, + itemsize: SupportsIndex | SupportsInt = ..., + unicode: L[True] = ..., + buffer: _SupportsBuffer = ..., + offset: SupportsIndex = ..., + strides: _ShapeLike = ..., + order: _OrderKACF = ..., + ) -> chararray[Any, dtype[str_]]: ... + + def __array_finalize__(self, obj: object) -> None: ... + def __mul__(self, other: i_co) -> chararray[Any, _CharDType]: ... + def __rmul__(self, other: i_co) -> chararray[Any, _CharDType]: ... + def __mod__(self, i: Any) -> chararray[Any, _CharDType]: ... + + @overload + def __eq__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __eq__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __ne__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __ne__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __ge__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __ge__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __le__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __le__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __gt__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __gt__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __lt__( + self: _CharArray[str_], + other: U_co, + ) -> NDArray[np.bool]: ... + @overload + def __lt__( + self: _CharArray[bytes_], + other: S_co, + ) -> NDArray[np.bool]: ... + + @overload + def __add__( + self: _CharArray[str_], + other: U_co, + ) -> _CharArray[str_]: ... + @overload + def __add__( + self: _CharArray[bytes_], + other: S_co, + ) -> _CharArray[bytes_]: ... + + @overload + def __radd__( + self: _CharArray[str_], + other: U_co, + ) -> _CharArray[str_]: ... + @overload + def __radd__( + self: _CharArray[bytes_], + other: S_co, + ) -> _CharArray[bytes_]: ... + + @overload + def center( + self: _CharArray[str_], + width: i_co, + fillchar: U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def center( + self: _CharArray[bytes_], + width: i_co, + fillchar: S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def count( + self: _CharArray[str_], + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + @overload + def count( + self: _CharArray[bytes_], + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + + def decode( + self: _CharArray[bytes_], + encoding: None | str = ..., + errors: None | str = ..., + ) -> _CharArray[str_]: ... + + def encode( + self: _CharArray[str_], + encoding: None | str = ..., + errors: None | str = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def endswith( + self: _CharArray[str_], + suffix: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[np.bool]: ... + @overload + def endswith( + self: _CharArray[bytes_], + suffix: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[np.bool]: ... + + def expandtabs( + self, + tabsize: i_co = ..., + ) -> chararray[Any, _CharDType]: ... + + @overload + def find( + self: _CharArray[str_], + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + @overload + def find( + self: _CharArray[bytes_], + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + + @overload + def index( + self: _CharArray[str_], + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + @overload + def index( + self: _CharArray[bytes_], + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + + @overload + def join( + self: _CharArray[str_], + seq: U_co, + ) -> _CharArray[str_]: ... + @overload + def join( + self: _CharArray[bytes_], + seq: S_co, + ) -> _CharArray[bytes_]: ... + + @overload + def ljust( + self: _CharArray[str_], + width: i_co, + fillchar: U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def ljust( + self: _CharArray[bytes_], + width: i_co, + fillchar: S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def lstrip( + self: _CharArray[str_], + chars: None | U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def lstrip( + self: _CharArray[bytes_], + chars: None | S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def partition( + self: _CharArray[str_], + sep: U_co, + ) -> _CharArray[str_]: ... + @overload + def partition( + self: _CharArray[bytes_], + sep: S_co, + ) -> _CharArray[bytes_]: ... + + @overload + def replace( + self: _CharArray[str_], + old: U_co, + new: U_co, + count: None | i_co = ..., + ) -> _CharArray[str_]: ... + @overload + def replace( + self: _CharArray[bytes_], + old: S_co, + new: S_co, + count: None | i_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def rfind( + self: _CharArray[str_], + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + @overload + def rfind( + self: _CharArray[bytes_], + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + + @overload + def rindex( + self: _CharArray[str_], + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + @overload + def rindex( + self: _CharArray[bytes_], + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[int_]: ... + + @overload + def rjust( + self: _CharArray[str_], + width: i_co, + fillchar: U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def rjust( + self: _CharArray[bytes_], + width: i_co, + fillchar: S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def rpartition( + self: _CharArray[str_], + sep: U_co, + ) -> _CharArray[str_]: ... + @overload + def rpartition( + self: _CharArray[bytes_], + sep: S_co, + ) -> _CharArray[bytes_]: ... + + @overload + def rsplit( + self: _CharArray[str_], + sep: None | U_co = ..., + maxsplit: None | i_co = ..., + ) -> NDArray[object_]: ... + @overload + def rsplit( + self: _CharArray[bytes_], + sep: None | S_co = ..., + maxsplit: None | i_co = ..., + ) -> NDArray[object_]: ... + + @overload + def rstrip( + self: _CharArray[str_], + chars: None | U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def rstrip( + self: _CharArray[bytes_], + chars: None | S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def split( + self: _CharArray[str_], + sep: None | U_co = ..., + maxsplit: None | i_co = ..., + ) -> NDArray[object_]: ... + @overload + def split( + self: _CharArray[bytes_], + sep: None | S_co = ..., + maxsplit: None | i_co = ..., + ) -> NDArray[object_]: ... + + def splitlines(self, keepends: None | b_co = ...) -> NDArray[object_]: ... + + @overload + def startswith( + self: _CharArray[str_], + prefix: U_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[np.bool]: ... + @overload + def startswith( + self: _CharArray[bytes_], + prefix: S_co, + start: i_co = ..., + end: None | i_co = ..., + ) -> NDArray[np.bool]: ... + + @overload + def strip( + self: _CharArray[str_], + chars: None | U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def strip( + self: _CharArray[bytes_], + chars: None | S_co = ..., + ) -> _CharArray[bytes_]: ... + + @overload + def translate( + self: _CharArray[str_], + table: U_co, + deletechars: None | U_co = ..., + ) -> _CharArray[str_]: ... + @overload + def translate( + self: _CharArray[bytes_], + table: S_co, + deletechars: None | S_co = ..., + ) -> _CharArray[bytes_]: ... + + def zfill(self, width: _ArrayLikeInt_co) -> chararray[Any, _CharDType]: ... + def capitalize(self) -> chararray[_ShapeType_co, _CharDType]: ... + def title(self) -> chararray[_ShapeType_co, _CharDType]: ... + def swapcase(self) -> chararray[_ShapeType_co, _CharDType]: ... + def lower(self) -> chararray[_ShapeType_co, _CharDType]: ... + def upper(self) -> chararray[_ShapeType_co, _CharDType]: ... + def isalnum(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isalpha(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isdigit(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def islower(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isspace(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def istitle(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isupper(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isnumeric(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + def isdecimal(self) -> ndarray[_ShapeType_co, dtype[np.bool]]: ... + +__all__: list[str] + +# Comparison +@overload +def equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def not_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def not_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def greater_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def greater_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def less_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def less_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def greater(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def greater(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def less(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def less(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +# String operations +@overload +def add(x1: U_co, x2: U_co) -> NDArray[str_]: ... +@overload +def add(x1: S_co, x2: S_co) -> NDArray[bytes_]: ... + +@overload +def multiply(a: U_co, i: i_co) -> NDArray[str_]: ... +@overload +def multiply(a: S_co, i: i_co) -> NDArray[bytes_]: ... + +@overload +def mod(a: U_co, value: Any) -> NDArray[str_]: ... +@overload +def mod(a: S_co, value: Any) -> NDArray[bytes_]: ... + +@overload +def capitalize(a: U_co) -> NDArray[str_]: ... +@overload +def capitalize(a: S_co) -> NDArray[bytes_]: ... + +@overload +def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ... +@overload +def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ... + +def decode( + a: S_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[str_]: ... + +def encode( + a: U_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[bytes_]: ... + +@overload +def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[str_]: ... +@overload +def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[bytes_]: ... + +@overload +def join(sep: U_co, seq: U_co) -> NDArray[str_]: ... +@overload +def join(sep: S_co, seq: S_co) -> NDArray[bytes_]: ... + +@overload +def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ... +@overload +def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ... + +@overload +def lower(a: U_co) -> NDArray[str_]: ... +@overload +def lower(a: S_co) -> NDArray[bytes_]: ... + +@overload +def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def partition(a: U_co, sep: U_co) -> NDArray[str_]: ... +@overload +def partition(a: S_co, sep: S_co) -> NDArray[bytes_]: ... + +@overload +def replace( + a: U_co, + old: U_co, + new: U_co, + count: None | i_co = ..., +) -> NDArray[str_]: ... +@overload +def replace( + a: S_co, + old: S_co, + new: S_co, + count: None | i_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def rjust( + a: U_co, + width: i_co, + fillchar: U_co = ..., +) -> NDArray[str_]: ... +@overload +def rjust( + a: S_co, + width: i_co, + fillchar: S_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def rpartition(a: U_co, sep: U_co) -> NDArray[str_]: ... +@overload +def rpartition(a: S_co, sep: S_co) -> NDArray[bytes_]: ... + +@overload +def rsplit( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... +@overload +def rsplit( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... + +@overload +def rstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def rstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def split( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... +@overload +def split( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... + +@overload +def splitlines(a: U_co, keepends: None | b_co = ...) -> NDArray[object_]: ... +@overload +def splitlines(a: S_co, keepends: None | b_co = ...) -> NDArray[object_]: ... + +@overload +def strip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def strip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def swapcase(a: U_co) -> NDArray[str_]: ... +@overload +def swapcase(a: S_co) -> NDArray[bytes_]: ... + +@overload +def title(a: U_co) -> NDArray[str_]: ... +@overload +def title(a: S_co) -> NDArray[bytes_]: ... + +@overload +def translate( + a: U_co, + table: U_co, + deletechars: None | U_co = ..., +) -> NDArray[str_]: ... +@overload +def translate( + a: S_co, + table: S_co, + deletechars: None | S_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def upper(a: U_co) -> NDArray[str_]: ... +@overload +def upper(a: S_co) -> NDArray[bytes_]: ... + +@overload +def zfill(a: U_co, width: i_co) -> NDArray[str_]: ... +@overload +def zfill(a: S_co, width: i_co) -> NDArray[bytes_]: ... + +# String information +@overload +def count( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def count( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def endswith( + a: U_co, + suffix: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.bool]: ... +@overload +def endswith( + a: S_co, + suffix: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.bool]: ... + +@overload +def find( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def find( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def index( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def index( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +def isalpha(a: U_co | S_co) -> NDArray[np.bool]: ... +def isalnum(a: U_co | S_co) -> NDArray[np.bool]: ... +def isdecimal(a: U_co) -> NDArray[np.bool]: ... +def isdigit(a: U_co | S_co) -> NDArray[np.bool]: ... +def islower(a: U_co | S_co) -> NDArray[np.bool]: ... +def isnumeric(a: U_co) -> NDArray[np.bool]: ... +def isspace(a: U_co | S_co) -> NDArray[np.bool]: ... +def istitle(a: U_co | S_co) -> NDArray[np.bool]: ... +def isupper(a: U_co | S_co) -> NDArray[np.bool]: ... + +@overload +def rfind( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def rfind( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def rindex( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def rindex( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def startswith( + a: U_co, + prefix: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.bool]: ... +@overload +def startswith( + a: S_co, + prefix: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.bool]: ... + +def str_len(A: U_co | S_co) -> NDArray[int_]: ... + +# Overload 1 and 2: str- or bytes-based array-likes +# overload 3: arbitrary object with unicode=False (-> bytes_) +# overload 4: arbitrary object with unicode=True (-> str_) +@overload +def array( + obj: U_co, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... +@overload +def array( + obj: S_co, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def array( + obj: object, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def array( + obj: object, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[True] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... + +@overload +def asarray( + obj: U_co, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... +@overload +def asarray( + obj: S_co, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def asarray( + obj: object, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def asarray( + obj: object, + itemsize: None | int = ..., + unicode: L[True] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.py b/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.py new file mode 100644 index 0000000000000000000000000000000000000000..7aa5f22fe9394869de3868117be3e01d0d673320 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.py @@ -0,0 +1,1505 @@ +""" +Implementation of optimized einsum. + +""" +import itertools +import operator + +from numpy._core.multiarray import c_einsum +from numpy._core.numeric import asanyarray, tensordot +from numpy._core.overrides import array_function_dispatch + +__all__ = ['einsum', 'einsum_path'] + +# importing string for string.ascii_letters would be too slow +# the first import before caching has been measured to take 800 µs (#23777) +einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ' +einsum_symbols_set = set(einsum_symbols) + + +def _flop_count(idx_contraction, inner, num_terms, size_dictionary): + """ + Computes the number of FLOPS in the contraction. + + Parameters + ---------- + idx_contraction : iterable + The indices involved in the contraction + inner : bool + Does this contraction require an inner product? + num_terms : int + The number of terms in a contraction + size_dictionary : dict + The size of each of the indices in idx_contraction + + Returns + ------- + flop_count : int + The total number of FLOPS required for the contraction. + + Examples + -------- + + >>> _flop_count('abc', False, 1, {'a': 2, 'b':3, 'c':5}) + 30 + + >>> _flop_count('abc', True, 2, {'a': 2, 'b':3, 'c':5}) + 60 + + """ + + overall_size = _compute_size_by_dict(idx_contraction, size_dictionary) + op_factor = max(1, num_terms - 1) + if inner: + op_factor += 1 + + return overall_size * op_factor + +def _compute_size_by_dict(indices, idx_dict): + """ + Computes the product of the elements in indices based on the dictionary + idx_dict. + + Parameters + ---------- + indices : iterable + Indices to base the product on. + idx_dict : dictionary + Dictionary of index sizes + + Returns + ------- + ret : int + The resulting product. + + Examples + -------- + >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5}) + 90 + + """ + ret = 1 + for i in indices: + ret *= idx_dict[i] + return ret + + +def _find_contraction(positions, input_sets, output_set): + """ + Finds the contraction for a given set of input and output sets. + + Parameters + ---------- + positions : iterable + Integer positions of terms used in the contraction. + input_sets : list + List of sets that represent the lhs side of the einsum subscript + output_set : set + Set that represents the rhs side of the overall einsum subscript + + Returns + ------- + new_result : set + The indices of the resulting contraction + remaining : list + List of sets that have not been contracted, the new set is appended to + the end of this list + idx_removed : set + Indices removed from the entire contraction + idx_contraction : set + The indices used in the current contraction + + Examples + -------- + + # A simple dot product test case + >>> pos = (0, 1) + >>> isets = [set('ab'), set('bc')] + >>> oset = set('ac') + >>> _find_contraction(pos, isets, oset) + ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'}) + + # A more complex case with additional terms in the contraction + >>> pos = (0, 2) + >>> isets = [set('abd'), set('ac'), set('bdc')] + >>> oset = set('ac') + >>> _find_contraction(pos, isets, oset) + ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'}) + """ + + idx_contract = set() + idx_remain = output_set.copy() + remaining = [] + for ind, value in enumerate(input_sets): + if ind in positions: + idx_contract |= value + else: + remaining.append(value) + idx_remain |= value + + new_result = idx_remain & idx_contract + idx_removed = (idx_contract - new_result) + remaining.append(new_result) + + return (new_result, remaining, idx_removed, idx_contract) + + +def _optimal_path(input_sets, output_set, idx_dict, memory_limit): + """ + Computes all possible pair contractions, sieves the results based + on ``memory_limit`` and returns the lowest cost path. This algorithm + scales factorial with respect to the elements in the list ``input_sets``. + + Parameters + ---------- + input_sets : list + List of sets that represent the lhs side of the einsum subscript + output_set : set + Set that represents the rhs side of the overall einsum subscript + idx_dict : dictionary + Dictionary of index sizes + memory_limit : int + The maximum number of elements in a temporary array + + Returns + ------- + path : list + The optimal contraction order within the memory limit constraint. + + Examples + -------- + >>> isets = [set('abd'), set('ac'), set('bdc')] + >>> oset = set() + >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4} + >>> _optimal_path(isets, oset, idx_sizes, 5000) + [(0, 2), (0, 1)] + """ + + full_results = [(0, [], input_sets)] + for iteration in range(len(input_sets) - 1): + iter_results = [] + + # Compute all unique pairs + for curr in full_results: + cost, positions, remaining = curr + for con in itertools.combinations( + range(len(input_sets) - iteration), 2 + ): + + # Find the contraction + cont = _find_contraction(con, remaining, output_set) + new_result, new_input_sets, idx_removed, idx_contract = cont + + # Sieve the results based on memory_limit + new_size = _compute_size_by_dict(new_result, idx_dict) + if new_size > memory_limit: + continue + + # Build (total_cost, positions, indices_remaining) + total_cost = cost + _flop_count( + idx_contract, idx_removed, len(con), idx_dict + ) + new_pos = positions + [con] + iter_results.append((total_cost, new_pos, new_input_sets)) + + # Update combinatorial list, if we did not find anything return best + # path + remaining contractions + if iter_results: + full_results = iter_results + else: + path = min(full_results, key=lambda x: x[0])[1] + path += [tuple(range(len(input_sets) - iteration))] + return path + + # If we have not found anything return single einsum contraction + if len(full_results) == 0: + return [tuple(range(len(input_sets)))] + + path = min(full_results, key=lambda x: x[0])[1] + return path + +def _parse_possible_contraction( + positions, input_sets, output_set, idx_dict, + memory_limit, path_cost, naive_cost + ): + """Compute the cost (removed size + flops) and resultant indices for + performing the contraction specified by ``positions``. + + Parameters + ---------- + positions : tuple of int + The locations of the proposed tensors to contract. + input_sets : list of sets + The indices found on each tensors. + output_set : set + The output indices of the expression. + idx_dict : dict + Mapping of each index to its size. + memory_limit : int + The total allowed size for an intermediary tensor. + path_cost : int + The contraction cost so far. + naive_cost : int + The cost of the unoptimized expression. + + Returns + ------- + cost : (int, int) + A tuple containing the size of any indices removed, and the flop cost. + positions : tuple of int + The locations of the proposed tensors to contract. + new_input_sets : list of sets + The resulting new list of indices if this proposed contraction + is performed. + + """ + + # Find the contraction + contract = _find_contraction(positions, input_sets, output_set) + idx_result, new_input_sets, idx_removed, idx_contract = contract + + # Sieve the results based on memory_limit + new_size = _compute_size_by_dict(idx_result, idx_dict) + if new_size > memory_limit: + return None + + # Build sort tuple + old_sizes = ( + _compute_size_by_dict(input_sets[p], idx_dict) for p in positions + ) + removed_size = sum(old_sizes) - new_size + + # NB: removed_size used to be just the size of any removed indices i.e.: + # helpers.compute_size_by_dict(idx_removed, idx_dict) + cost = _flop_count(idx_contract, idx_removed, len(positions), idx_dict) + sort = (-removed_size, cost) + + # Sieve based on total cost as well + if (path_cost + cost) > naive_cost: + return None + + # Add contraction to possible choices + return [sort, positions, new_input_sets] + + +def _update_other_results(results, best): + """Update the positions and provisional input_sets of ``results`` + based on performing the contraction result ``best``. Remove any + involving the tensors contracted. + + Parameters + ---------- + results : list + List of contraction results produced by + ``_parse_possible_contraction``. + best : list + The best contraction of ``results`` i.e. the one that + will be performed. + + Returns + ------- + mod_results : list + The list of modified results, updated with outcome of + ``best`` contraction. + """ + + best_con = best[1] + bx, by = best_con + mod_results = [] + + for cost, (x, y), con_sets in results: + + # Ignore results involving tensors just contracted + if x in best_con or y in best_con: + continue + + # Update the input_sets + del con_sets[by - int(by > x) - int(by > y)] + del con_sets[bx - int(bx > x) - int(bx > y)] + con_sets.insert(-1, best[2][-1]) + + # Update the position indices + mod_con = x - int(x > bx) - int(x > by), y - int(y > bx) - int(y > by) + mod_results.append((cost, mod_con, con_sets)) + + return mod_results + +def _greedy_path(input_sets, output_set, idx_dict, memory_limit): + """ + Finds the path by contracting the best pair until the input list is + exhausted. The best pair is found by minimizing the tuple + ``(-prod(indices_removed), cost)``. What this amounts to is prioritizing + matrix multiplication or inner product operations, then Hadamard like + operations, and finally outer operations. Outer products are limited by + ``memory_limit``. This algorithm scales cubically with respect to the + number of elements in the list ``input_sets``. + + Parameters + ---------- + input_sets : list + List of sets that represent the lhs side of the einsum subscript + output_set : set + Set that represents the rhs side of the overall einsum subscript + idx_dict : dictionary + Dictionary of index sizes + memory_limit : int + The maximum number of elements in a temporary array + + Returns + ------- + path : list + The greedy contraction order within the memory limit constraint. + + Examples + -------- + >>> isets = [set('abd'), set('ac'), set('bdc')] + >>> oset = set() + >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4} + >>> _greedy_path(isets, oset, idx_sizes, 5000) + [(0, 2), (0, 1)] + """ + + # Handle trivial cases that leaked through + if len(input_sets) == 1: + return [(0,)] + elif len(input_sets) == 2: + return [(0, 1)] + + # Build up a naive cost + contract = _find_contraction( + range(len(input_sets)), input_sets, output_set + ) + idx_result, new_input_sets, idx_removed, idx_contract = contract + naive_cost = _flop_count( + idx_contract, idx_removed, len(input_sets), idx_dict + ) + + # Initially iterate over all pairs + comb_iter = itertools.combinations(range(len(input_sets)), 2) + known_contractions = [] + + path_cost = 0 + path = [] + + for iteration in range(len(input_sets) - 1): + + # Iterate over all pairs on the first step, only previously + # found pairs on subsequent steps + for positions in comb_iter: + + # Always initially ignore outer products + if input_sets[positions[0]].isdisjoint(input_sets[positions[1]]): + continue + + result = _parse_possible_contraction( + positions, input_sets, output_set, idx_dict, + memory_limit, path_cost, naive_cost + ) + if result is not None: + known_contractions.append(result) + + # If we do not have a inner contraction, rescan pairs + # including outer products + if len(known_contractions) == 0: + + # Then check the outer products + for positions in itertools.combinations( + range(len(input_sets)), 2 + ): + result = _parse_possible_contraction( + positions, input_sets, output_set, idx_dict, + memory_limit, path_cost, naive_cost + ) + if result is not None: + known_contractions.append(result) + + # If we still did not find any remaining contractions, + # default back to einsum like behavior + if len(known_contractions) == 0: + path.append(tuple(range(len(input_sets)))) + break + + # Sort based on first index + best = min(known_contractions, key=lambda x: x[0]) + + # Now propagate as many unused contractions as possible + # to the next iteration + known_contractions = _update_other_results(known_contractions, best) + + # Next iteration only compute contractions with the new tensor + # All other contractions have been accounted for + input_sets = best[2] + new_tensor_pos = len(input_sets) - 1 + comb_iter = ((i, new_tensor_pos) for i in range(new_tensor_pos)) + + # Update path and total cost + path.append(best[1]) + path_cost += best[0][1] + + return path + + +def _can_dot(inputs, result, idx_removed): + """ + Checks if we can use BLAS (np.tensordot) call and its beneficial to do so. + + Parameters + ---------- + inputs : list of str + Specifies the subscripts for summation. + result : str + Resulting summation. + idx_removed : set + Indices that are removed in the summation + + + Returns + ------- + type : bool + Returns true if BLAS should and can be used, else False + + Notes + ----- + If the operations is BLAS level 1 or 2 and is not already aligned + we default back to einsum as the memory movement to copy is more + costly than the operation itself. + + + Examples + -------- + + # Standard GEMM operation + >>> _can_dot(['ij', 'jk'], 'ik', set('j')) + True + + # Can use the standard BLAS, but requires odd data movement + >>> _can_dot(['ijj', 'jk'], 'ik', set('j')) + False + + # DDOT where the memory is not aligned + >>> _can_dot(['ijk', 'ikj'], '', set('ijk')) + False + + """ + + # All `dot` calls remove indices + if len(idx_removed) == 0: + return False + + # BLAS can only handle two operands + if len(inputs) != 2: + return False + + input_left, input_right = inputs + + for c in set(input_left + input_right): + # can't deal with repeated indices on same input or more than 2 total + nl, nr = input_left.count(c), input_right.count(c) + if (nl > 1) or (nr > 1) or (nl + nr > 2): + return False + + # can't do implicit summation or dimension collapse e.g. + # "ab,bc->c" (implicitly sum over 'a') + # "ab,ca->ca" (take diagonal of 'a') + if nl + nr - 1 == int(c in result): + return False + + # Build a few temporaries + set_left = set(input_left) + set_right = set(input_right) + keep_left = set_left - idx_removed + keep_right = set_right - idx_removed + rs = len(idx_removed) + + # At this point we are a DOT, GEMV, or GEMM operation + + # Handle inner products + + # DDOT with aligned data + if input_left == input_right: + return True + + # DDOT without aligned data (better to use einsum) + if set_left == set_right: + return False + + # Handle the 4 possible (aligned) GEMV or GEMM cases + + # GEMM or GEMV no transpose + if input_left[-rs:] == input_right[:rs]: + return True + + # GEMM or GEMV transpose both + if input_left[:rs] == input_right[-rs:]: + return True + + # GEMM or GEMV transpose right + if input_left[-rs:] == input_right[-rs:]: + return True + + # GEMM or GEMV transpose left + if input_left[:rs] == input_right[:rs]: + return True + + # Einsum is faster than GEMV if we have to copy data + if not keep_left or not keep_right: + return False + + # We are a matrix-matrix product, but we need to copy data + return True + + +def _parse_einsum_input(operands): + """ + A reproduction of einsum c side einsum parsing in python. + + Returns + ------- + input_strings : str + Parsed input strings + output_string : str + Parsed output string + operands : list of array_like + The operands to use in the numpy contraction + + Examples + -------- + The operand list is simplified to reduce printing: + + >>> np.random.seed(123) + >>> a = np.random.rand(4, 4) + >>> b = np.random.rand(4, 4, 4) + >>> _parse_einsum_input(('...a,...a->...', a, b)) + ('za,xza', 'xz', [a, b]) # may vary + + >>> _parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0])) + ('za,xza', 'xz', [a, b]) # may vary + """ + + if len(operands) == 0: + raise ValueError("No input operands") + + if isinstance(operands[0], str): + subscripts = operands[0].replace(" ", "") + operands = [asanyarray(v) for v in operands[1:]] + + # Ensure all characters are valid + for s in subscripts: + if s in '.,->': + continue + if s not in einsum_symbols: + raise ValueError("Character %s is not a valid symbol." % s) + + else: + tmp_operands = list(operands) + operand_list = [] + subscript_list = [] + for p in range(len(operands) // 2): + operand_list.append(tmp_operands.pop(0)) + subscript_list.append(tmp_operands.pop(0)) + + output_list = tmp_operands[-1] if len(tmp_operands) else None + operands = [asanyarray(v) for v in operand_list] + subscripts = "" + last = len(subscript_list) - 1 + for num, sub in enumerate(subscript_list): + for s in sub: + if s is Ellipsis: + subscripts += "..." + else: + try: + s = operator.index(s) + except TypeError as e: + raise TypeError( + "For this input type lists must contain " + "either int or Ellipsis" + ) from e + subscripts += einsum_symbols[s] + if num != last: + subscripts += "," + + if output_list is not None: + subscripts += "->" + for s in output_list: + if s is Ellipsis: + subscripts += "..." + else: + try: + s = operator.index(s) + except TypeError as e: + raise TypeError( + "For this input type lists must contain " + "either int or Ellipsis" + ) from e + subscripts += einsum_symbols[s] + # Check for proper "->" + if ("-" in subscripts) or (">" in subscripts): + invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1) + if invalid or (subscripts.count("->") != 1): + raise ValueError("Subscripts can only contain one '->'.") + + # Parse ellipses + if "." in subscripts: + used = subscripts.replace(".", "").replace(",", "").replace("->", "") + unused = list(einsum_symbols_set - set(used)) + ellipse_inds = "".join(unused) + longest = 0 + + if "->" in subscripts: + input_tmp, output_sub = subscripts.split("->") + split_subscripts = input_tmp.split(",") + out_sub = True + else: + split_subscripts = subscripts.split(',') + out_sub = False + + for num, sub in enumerate(split_subscripts): + if "." in sub: + if (sub.count(".") != 3) or (sub.count("...") != 1): + raise ValueError("Invalid Ellipses.") + + # Take into account numerical values + if operands[num].shape == (): + ellipse_count = 0 + else: + ellipse_count = max(operands[num].ndim, 1) + ellipse_count -= (len(sub) - 3) + + if ellipse_count > longest: + longest = ellipse_count + + if ellipse_count < 0: + raise ValueError("Ellipses lengths do not match.") + elif ellipse_count == 0: + split_subscripts[num] = sub.replace('...', '') + else: + rep_inds = ellipse_inds[-ellipse_count:] + split_subscripts[num] = sub.replace('...', rep_inds) + + subscripts = ",".join(split_subscripts) + if longest == 0: + out_ellipse = "" + else: + out_ellipse = ellipse_inds[-longest:] + + if out_sub: + subscripts += "->" + output_sub.replace("...", out_ellipse) + else: + # Special care for outputless ellipses + output_subscript = "" + tmp_subscripts = subscripts.replace(",", "") + for s in sorted(set(tmp_subscripts)): + if s not in (einsum_symbols): + raise ValueError("Character %s is not a valid symbol." % s) + if tmp_subscripts.count(s) == 1: + output_subscript += s + normal_inds = ''.join(sorted(set(output_subscript) - + set(out_ellipse))) + + subscripts += "->" + out_ellipse + normal_inds + + # Build output string if does not exist + if "->" in subscripts: + input_subscripts, output_subscript = subscripts.split("->") + else: + input_subscripts = subscripts + # Build output subscripts + tmp_subscripts = subscripts.replace(",", "") + output_subscript = "" + for s in sorted(set(tmp_subscripts)): + if s not in einsum_symbols: + raise ValueError("Character %s is not a valid symbol." % s) + if tmp_subscripts.count(s) == 1: + output_subscript += s + + # Make sure output subscripts are in the input + for char in output_subscript: + if output_subscript.count(char) != 1: + raise ValueError("Output character %s appeared more than once in " + "the output." % char) + if char not in input_subscripts: + raise ValueError("Output character %s did not appear in the input" + % char) + + # Make sure number operands is equivalent to the number of terms + if len(input_subscripts.split(',')) != len(operands): + raise ValueError("Number of einsum subscripts must be equal to the " + "number of operands.") + + return (input_subscripts, output_subscript, operands) + + +def _einsum_path_dispatcher(*operands, optimize=None, einsum_call=None): + # NOTE: technically, we should only dispatch on array-like arguments, not + # subscripts (given as strings). But separating operands into + # arrays/subscripts is a little tricky/slow (given einsum's two supported + # signatures), so as a practical shortcut we dispatch on everything. + # Strings will be ignored for dispatching since they don't define + # __array_function__. + return operands + + +@array_function_dispatch(_einsum_path_dispatcher, module='numpy') +def einsum_path(*operands, optimize='greedy', einsum_call=False): + """ + einsum_path(subscripts, *operands, optimize='greedy') + + Evaluates the lowest cost contraction order for an einsum expression by + considering the creation of intermediate arrays. + + Parameters + ---------- + subscripts : str + Specifies the subscripts for summation. + *operands : list of array_like + These are the arrays for the operation. + optimize : {bool, list, tuple, 'greedy', 'optimal'} + Choose the type of path. If a tuple is provided, the second argument is + assumed to be the maximum intermediate size created. If only a single + argument is provided the largest input or output array size is used + as a maximum intermediate size. + + * if a list is given that starts with ``einsum_path``, uses this as the + contraction path + * if False no optimization is taken + * if True defaults to the 'greedy' algorithm + * 'optimal' An algorithm that combinatorially explores all possible + ways of contracting the listed tensors and chooses the least costly + path. Scales exponentially with the number of terms in the + contraction. + * 'greedy' An algorithm that chooses the best pair contraction + at each step. Effectively, this algorithm searches the largest inner, + Hadamard, and then outer products at each step. Scales cubically with + the number of terms in the contraction. Equivalent to the 'optimal' + path for most contractions. + + Default is 'greedy'. + + Returns + ------- + path : list of tuples + A list representation of the einsum path. + string_repr : str + A printable representation of the einsum path. + + Notes + ----- + The resulting path indicates which terms of the input contraction should be + contracted first, the result of this contraction is then appended to the + end of the contraction list. This list can then be iterated over until all + intermediate contractions are complete. + + See Also + -------- + einsum, linalg.multi_dot + + Examples + -------- + + We can begin with a chain dot example. In this case, it is optimal to + contract the ``b`` and ``c`` tensors first as represented by the first + element of the path ``(1, 2)``. The resulting tensor is added to the end + of the contraction and the remaining contraction ``(0, 1)`` is then + completed. + + >>> np.random.seed(123) + >>> a = np.random.rand(2, 2) + >>> b = np.random.rand(2, 5) + >>> c = np.random.rand(5, 2) + >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy') + >>> print(path_info[0]) + ['einsum_path', (1, 2), (0, 1)] + >>> print(path_info[1]) + Complete contraction: ij,jk,kl->il # may vary + Naive scaling: 4 + Optimized scaling: 3 + Naive FLOP count: 1.600e+02 + Optimized FLOP count: 5.600e+01 + Theoretical speedup: 2.857 + Largest intermediate: 4.000e+00 elements + ------------------------------------------------------------------------- + scaling current remaining + ------------------------------------------------------------------------- + 3 kl,jk->jl ij,jl->il + 3 jl,ij->il il->il + + + A more complex index transformation example. + + >>> I = np.random.rand(10, 10, 10, 10) + >>> C = np.random.rand(10, 10) + >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C, + ... optimize='greedy') + + >>> print(path_info[0]) + ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)] + >>> print(path_info[1]) + Complete contraction: ea,fb,abcd,gc,hd->efgh # may vary + Naive scaling: 8 + Optimized scaling: 5 + Naive FLOP count: 8.000e+08 + Optimized FLOP count: 8.000e+05 + Theoretical speedup: 1000.000 + Largest intermediate: 1.000e+04 elements + -------------------------------------------------------------------------- + scaling current remaining + -------------------------------------------------------------------------- + 5 abcd,ea->bcde fb,gc,hd,bcde->efgh + 5 bcde,fb->cdef gc,hd,cdef->efgh + 5 cdef,gc->defg hd,defg->efgh + 5 defg,hd->efgh efgh->efgh + """ + + # Figure out what the path really is + path_type = optimize + if path_type is True: + path_type = 'greedy' + if path_type is None: + path_type = False + + explicit_einsum_path = False + memory_limit = None + + # No optimization or a named path algorithm + if (path_type is False) or isinstance(path_type, str): + pass + + # Given an explicit path + elif len(path_type) and (path_type[0] == 'einsum_path'): + explicit_einsum_path = True + + # Path tuple with memory limit + elif ((len(path_type) == 2) and isinstance(path_type[0], str) and + isinstance(path_type[1], (int, float))): + memory_limit = int(path_type[1]) + path_type = path_type[0] + + else: + raise TypeError("Did not understand the path: %s" % str(path_type)) + + # Hidden option, only einsum should call this + einsum_call_arg = einsum_call + + # Python side parsing + input_subscripts, output_subscript, operands = ( + _parse_einsum_input(operands) + ) + + # Build a few useful list and sets + input_list = input_subscripts.split(',') + input_sets = [set(x) for x in input_list] + output_set = set(output_subscript) + indices = set(input_subscripts.replace(',', '')) + + # Get length of each unique dimension and ensure all dimensions are correct + dimension_dict = {} + broadcast_indices = [[] for x in range(len(input_list))] + for tnum, term in enumerate(input_list): + sh = operands[tnum].shape + if len(sh) != len(term): + raise ValueError("Einstein sum subscript %s does not contain the " + "correct number of indices for operand %d." + % (input_subscripts[tnum], tnum)) + for cnum, char in enumerate(term): + dim = sh[cnum] + + # Build out broadcast indices + if dim == 1: + broadcast_indices[tnum].append(char) + + if char in dimension_dict.keys(): + # For broadcasting cases we always want the largest dim size + if dimension_dict[char] == 1: + dimension_dict[char] = dim + elif dim not in (1, dimension_dict[char]): + raise ValueError("Size of label '%s' for operand %d (%d) " + "does not match previous terms (%d)." + % (char, tnum, dimension_dict[char], dim)) + else: + dimension_dict[char] = dim + + # Convert broadcast inds to sets + broadcast_indices = [set(x) for x in broadcast_indices] + + # Compute size of each input array plus the output array + size_list = [_compute_size_by_dict(term, dimension_dict) + for term in input_list + [output_subscript]] + max_size = max(size_list) + + if memory_limit is None: + memory_arg = max_size + else: + memory_arg = memory_limit + + # Compute naive cost + # This isn't quite right, need to look into exactly how einsum does this + inner_product = (sum(len(x) for x in input_sets) - len(indices)) > 0 + naive_cost = _flop_count( + indices, inner_product, len(input_list), dimension_dict + ) + + # Compute the path + if explicit_einsum_path: + path = path_type[1:] + elif ( + (path_type is False) + or (len(input_list) in [1, 2]) + or (indices == output_set) + ): + # Nothing to be optimized, leave it to einsum + path = [tuple(range(len(input_list)))] + elif path_type == "greedy": + path = _greedy_path( + input_sets, output_set, dimension_dict, memory_arg + ) + elif path_type == "optimal": + path = _optimal_path( + input_sets, output_set, dimension_dict, memory_arg + ) + else: + raise KeyError("Path name %s not found", path_type) + + cost_list, scale_list, size_list, contraction_list = [], [], [], [] + + # Build contraction tuple (positions, gemm, einsum_str, remaining) + for cnum, contract_inds in enumerate(path): + # Make sure we remove inds from right to left + contract_inds = tuple(sorted(list(contract_inds), reverse=True)) + + contract = _find_contraction(contract_inds, input_sets, output_set) + out_inds, input_sets, idx_removed, idx_contract = contract + + cost = _flop_count( + idx_contract, idx_removed, len(contract_inds), dimension_dict + ) + cost_list.append(cost) + scale_list.append(len(idx_contract)) + size_list.append(_compute_size_by_dict(out_inds, dimension_dict)) + + bcast = set() + tmp_inputs = [] + for x in contract_inds: + tmp_inputs.append(input_list.pop(x)) + bcast |= broadcast_indices.pop(x) + + new_bcast_inds = bcast - idx_removed + + # If we're broadcasting, nix blas + if not len(idx_removed & bcast): + do_blas = _can_dot(tmp_inputs, out_inds, idx_removed) + else: + do_blas = False + + # Last contraction + if (cnum - len(path)) == -1: + idx_result = output_subscript + else: + sort_result = [(dimension_dict[ind], ind) for ind in out_inds] + idx_result = "".join([x[1] for x in sorted(sort_result)]) + + input_list.append(idx_result) + broadcast_indices.append(new_bcast_inds) + einsum_str = ",".join(tmp_inputs) + "->" + idx_result + + contraction = ( + contract_inds, idx_removed, einsum_str, input_list[:], do_blas + ) + contraction_list.append(contraction) + + opt_cost = sum(cost_list) + 1 + + if len(input_list) != 1: + # Explicit "einsum_path" is usually trusted, but we detect this kind of + # mistake in order to prevent from returning an intermediate value. + raise RuntimeError( + "Invalid einsum_path is specified: {} more operands has to be " + "contracted.".format(len(input_list) - 1)) + + if einsum_call_arg: + return (operands, contraction_list) + + # Return the path along with a nice string representation + overall_contraction = input_subscripts + "->" + output_subscript + header = ("scaling", "current", "remaining") + + speedup = naive_cost / opt_cost + max_i = max(size_list) + + path_print = " Complete contraction: %s\n" % overall_contraction + path_print += " Naive scaling: %d\n" % len(indices) + path_print += " Optimized scaling: %d\n" % max(scale_list) + path_print += " Naive FLOP count: %.3e\n" % naive_cost + path_print += " Optimized FLOP count: %.3e\n" % opt_cost + path_print += " Theoretical speedup: %3.3f\n" % speedup + path_print += " Largest intermediate: %.3e elements\n" % max_i + path_print += "-" * 74 + "\n" + path_print += "%6s %24s %40s\n" % header + path_print += "-" * 74 + + for n, contraction in enumerate(contraction_list): + inds, idx_rm, einsum_str, remaining, blas = contraction + remaining_str = ",".join(remaining) + "->" + output_subscript + path_run = (scale_list[n], einsum_str, remaining_str) + path_print += "\n%4d %24s %40s" % path_run + + path = ['einsum_path'] + path + return (path, path_print) + + +def _einsum_dispatcher(*operands, out=None, optimize=None, **kwargs): + # Arguably we dispatch on more arguments than we really should; see note in + # _einsum_path_dispatcher for why. + yield from operands + yield out + + +# Rewrite einsum to handle different cases +@array_function_dispatch(_einsum_dispatcher, module='numpy') +def einsum(*operands, out=None, optimize=False, **kwargs): + """ + einsum(subscripts, *operands, out=None, dtype=None, order='K', + casting='safe', optimize=False) + + Evaluates the Einstein summation convention on the operands. + + Using the Einstein summation convention, many common multi-dimensional, + linear algebraic array operations can be represented in a simple fashion. + In *implicit* mode `einsum` computes these values. + + In *explicit* mode, `einsum` provides further flexibility to compute + other array operations that might not be considered classical Einstein + summation operations, by disabling, or forcing summation over specified + subscript labels. + + See the notes and examples for clarification. + + Parameters + ---------- + subscripts : str + Specifies the subscripts for summation as comma separated list of + subscript labels. An implicit (classical Einstein summation) + calculation is performed unless the explicit indicator '->' is + included as well as subscript labels of the precise output form. + operands : list of array_like + These are the arrays for the operation. + out : ndarray, optional + If provided, the calculation is done into this array. + dtype : {data-type, None}, optional + If provided, forces the calculation to use the data type specified. + Note that you may have to also give a more liberal `casting` + parameter to allow the conversions. Default is None. + order : {'C', 'F', 'A', 'K'}, optional + Controls the memory layout of the output. 'C' means it should + be C contiguous. 'F' means it should be Fortran contiguous, + 'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise. + 'K' means it should be as close to the layout as the inputs as + is possible, including arbitrarily permuted axes. + Default is 'K'. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Setting this to + 'unsafe' is not recommended, as it can adversely affect accumulations. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + + Default is 'safe'. + optimize : {False, True, 'greedy', 'optimal'}, optional + Controls if intermediate optimization should occur. No optimization + will occur if False and True will default to the 'greedy' algorithm. + Also accepts an explicit contraction list from the ``np.einsum_path`` + function. See ``np.einsum_path`` for more details. Defaults to False. + + Returns + ------- + output : ndarray + The calculation based on the Einstein summation convention. + + See Also + -------- + einsum_path, dot, inner, outer, tensordot, linalg.multi_dot + einsum: + Similar verbose interface is provided by the + `einops `_ package to cover + additional operations: transpose, reshape/flatten, repeat/tile, + squeeze/unsqueeze and reductions. + The `opt_einsum `_ + optimizes contraction order for einsum-like expressions + in backend-agnostic manner. + + Notes + ----- + .. versionadded:: 1.6.0 + + The Einstein summation convention can be used to compute + many multi-dimensional, linear algebraic array operations. `einsum` + provides a succinct way of representing these. + + A non-exhaustive list of these operations, + which can be computed by `einsum`, is shown below along with examples: + + * Trace of an array, :py:func:`numpy.trace`. + * Return a diagonal, :py:func:`numpy.diag`. + * Array axis summations, :py:func:`numpy.sum`. + * Transpositions and permutations, :py:func:`numpy.transpose`. + * Matrix multiplication and dot product, :py:func:`numpy.matmul` + :py:func:`numpy.dot`. + * Vector inner and outer products, :py:func:`numpy.inner` + :py:func:`numpy.outer`. + * Broadcasting, element-wise and scalar multiplication, + :py:func:`numpy.multiply`. + * Tensor contractions, :py:func:`numpy.tensordot`. + * Chained array operations, in efficient calculation order, + :py:func:`numpy.einsum_path`. + + The subscripts string is a comma-separated list of subscript labels, + where each label refers to a dimension of the corresponding operand. + Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)`` + is equivalent to :py:func:`np.inner(a,b) `. If a label + appears only once, it is not summed, so ``np.einsum('i', a)`` + produces a view of ``a`` with no changes. A further example + ``np.einsum('ij,jk', a, b)`` describes traditional matrix multiplication + and is equivalent to :py:func:`np.matmul(a,b) `. + Repeated subscript labels in one operand take the diagonal. + For example, ``np.einsum('ii', a)`` is equivalent to + :py:func:`np.trace(a) `. + + In *implicit mode*, the chosen subscripts are important + since the axes of the output are reordered alphabetically. This + means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while + ``np.einsum('ji', a)`` takes its transpose. Additionally, + ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while, + ``np.einsum('ij,jh', a, b)`` returns the transpose of the + multiplication since subscript 'h' precedes subscript 'i'. + + In *explicit mode* the output can be directly controlled by + specifying output subscript labels. This requires the + identifier '->' as well as the list of output subscript labels. + This feature increases the flexibility of the function since + summing can be disabled or forced when required. The call + ``np.einsum('i->', a)`` is like :py:func:`np.sum(a) ` + if ``a`` is a 1-D array, and ``np.einsum('ii->i', a)`` + is like :py:func:`np.diag(a) ` if ``a`` is a square 2-D array. + The difference is that `einsum` does not allow broadcasting by default. + Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the + order of the output subscript labels and therefore returns matrix + multiplication, unlike the example above in implicit mode. + + To enable and control broadcasting, use an ellipsis. Default + NumPy-style broadcasting is done by adding an ellipsis + to the left of each term, like ``np.einsum('...ii->...i', a)``. + ``np.einsum('...i->...', a)`` is like + :py:func:`np.sum(a, axis=-1) ` for array ``a`` of any shape. + To take the trace along the first and last axes, + you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix + product with the left-most indices instead of rightmost, one can do + ``np.einsum('ij...,jk...->ik...', a, b)``. + + When there is only one operand, no axes are summed, and no output + parameter is provided, a view into the operand is returned instead + of a new array. Thus, taking the diagonal as ``np.einsum('ii->i', a)`` + produces a view (changed in version 1.10.0). + + `einsum` also provides an alternative way to provide the subscripts and + operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``. + If the output shape is not provided in this format `einsum` will be + calculated in implicit mode, otherwise it will be performed explicitly. + The examples below have corresponding `einsum` calls with the two + parameter methods. + + .. versionadded:: 1.10.0 + + Views returned from einsum are now writeable whenever the input array + is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now + have the same effect as :py:func:`np.swapaxes(a, 0, 2) ` + and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal + of a 2D array. + + .. versionadded:: 1.12.0 + + Added the ``optimize`` argument which will optimize the contraction order + of an einsum expression. For a contraction with three or more operands + this can greatly increase the computational efficiency at the cost of + a larger memory footprint during computation. + + Typically a 'greedy' algorithm is applied which empirical tests have shown + returns the optimal path in the majority of cases. In some cases 'optimal' + will return the superlative path through a more expensive, exhaustive + search. For iterative calculations it may be advisable to calculate + the optimal path once and reuse that path by supplying it as an argument. + An example is given below. + + See :py:func:`numpy.einsum_path` for more details. + + Examples + -------- + >>> a = np.arange(25).reshape(5,5) + >>> b = np.arange(5) + >>> c = np.arange(6).reshape(2,3) + + Trace of a matrix: + + >>> np.einsum('ii', a) + 60 + >>> np.einsum(a, [0,0]) + 60 + >>> np.trace(a) + 60 + + Extract the diagonal (requires explicit form): + + >>> np.einsum('ii->i', a) + array([ 0, 6, 12, 18, 24]) + >>> np.einsum(a, [0,0], [0]) + array([ 0, 6, 12, 18, 24]) + >>> np.diag(a) + array([ 0, 6, 12, 18, 24]) + + Sum over an axis (requires explicit form): + + >>> np.einsum('ij->i', a) + array([ 10, 35, 60, 85, 110]) + >>> np.einsum(a, [0,1], [0]) + array([ 10, 35, 60, 85, 110]) + >>> np.sum(a, axis=1) + array([ 10, 35, 60, 85, 110]) + + For higher dimensional arrays summing a single axis can be done + with ellipsis: + + >>> np.einsum('...j->...', a) + array([ 10, 35, 60, 85, 110]) + >>> np.einsum(a, [Ellipsis,1], [Ellipsis]) + array([ 10, 35, 60, 85, 110]) + + Compute a matrix transpose, or reorder any number of axes: + + >>> np.einsum('ji', c) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.einsum('ij->ji', c) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.einsum(c, [1,0]) + array([[0, 3], + [1, 4], + [2, 5]]) + >>> np.transpose(c) + array([[0, 3], + [1, 4], + [2, 5]]) + + Vector inner products: + + >>> np.einsum('i,i', b, b) + 30 + >>> np.einsum(b, [0], b, [0]) + 30 + >>> np.inner(b,b) + 30 + + Matrix vector multiplication: + + >>> np.einsum('ij,j', a, b) + array([ 30, 80, 130, 180, 230]) + >>> np.einsum(a, [0,1], b, [1]) + array([ 30, 80, 130, 180, 230]) + >>> np.dot(a, b) + array([ 30, 80, 130, 180, 230]) + >>> np.einsum('...j,j', a, b) + array([ 30, 80, 130, 180, 230]) + + Broadcasting and scalar multiplication: + + >>> np.einsum('..., ...', 3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.einsum(',ij', 3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.einsum(3, [Ellipsis], c, [Ellipsis]) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + >>> np.multiply(3, c) + array([[ 0, 3, 6], + [ 9, 12, 15]]) + + Vector outer product: + + >>> np.einsum('i,j', np.arange(2)+1, b) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + >>> np.einsum(np.arange(2)+1, [0], b, [1]) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + >>> np.outer(np.arange(2)+1, b) + array([[0, 1, 2, 3, 4], + [0, 2, 4, 6, 8]]) + + Tensor contraction: + + >>> a = np.arange(60.).reshape(3,4,5) + >>> b = np.arange(24.).reshape(4,3,2) + >>> np.einsum('ijk,jil->kl', a, b) + array([[4400., 4730.], + [4532., 4874.], + [4664., 5018.], + [4796., 5162.], + [4928., 5306.]]) + >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3]) + array([[4400., 4730.], + [4532., 4874.], + [4664., 5018.], + [4796., 5162.], + [4928., 5306.]]) + >>> np.tensordot(a,b, axes=([1,0],[0,1])) + array([[4400., 4730.], + [4532., 4874.], + [4664., 5018.], + [4796., 5162.], + [4928., 5306.]]) + + Writeable returned arrays (since version 1.10.0): + + >>> a = np.zeros((3, 3)) + >>> np.einsum('ii->i', a)[:] = 1 + >>> a + array([[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]]) + + Example of ellipsis use: + + >>> a = np.arange(6).reshape((3,2)) + >>> b = np.arange(12).reshape((4,3)) + >>> np.einsum('ki,jk->ij', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + >>> np.einsum('ki,...k->i...', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + >>> np.einsum('k...,jk', a, b) + array([[10, 28, 46, 64], + [13, 40, 67, 94]]) + + Chained array operations. For more complicated contractions, speed ups + might be achieved by repeatedly computing a 'greedy' path or pre-computing + the 'optimal' path and repeatedly applying it, using an `einsum_path` + insertion (since version 1.12.0). Performance improvements can be + particularly significant with larger arrays: + + >>> a = np.ones(64).reshape(2,4,8) + + Basic `einsum`: ~1520ms (benchmarked on 3.1GHz Intel i5.) + + >>> for iteration in range(500): + ... _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a) + + Sub-optimal `einsum` (due to repeated path calculation time): ~330ms + + >>> for iteration in range(500): + ... _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, + ... optimize='optimal') + + Greedy `einsum` (faster optimal path approximation): ~160ms + + >>> for iteration in range(500): + ... _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='greedy') + + Optimal `einsum` (best usage pattern in some use cases): ~110ms + + >>> path = np.einsum_path('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, + ... optimize='optimal')[0] + >>> for iteration in range(500): + ... _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize=path) + + """ + # Special handling if out is specified + specified_out = out is not None + + # If no optimization, run pure einsum + if optimize is False: + if specified_out: + kwargs['out'] = out + return c_einsum(*operands, **kwargs) + + # Check the kwargs to avoid a more cryptic error later, without having to + # repeat default values here + valid_einsum_kwargs = ['dtype', 'order', 'casting'] + unknown_kwargs = [k for (k, v) in kwargs.items() if + k not in valid_einsum_kwargs] + if len(unknown_kwargs): + raise TypeError("Did not understand the following kwargs: %s" + % unknown_kwargs) + + # Build the contraction list and operand + operands, contraction_list = einsum_path(*operands, optimize=optimize, + einsum_call=True) + + # Handle order kwarg for output array, c_einsum allows mixed case + output_order = kwargs.pop('order', 'K') + if output_order.upper() == 'A': + if all(arr.flags.f_contiguous for arr in operands): + output_order = 'F' + else: + output_order = 'C' + + # Start contraction loop + for num, contraction in enumerate(contraction_list): + inds, idx_rm, einsum_str, remaining, blas = contraction + tmp_operands = [operands.pop(x) for x in inds] + + # Do we need to deal with the output? + handle_out = specified_out and ((num + 1) == len(contraction_list)) + + # Call tensordot if still possible + if blas: + # Checks have already been handled + input_str, results_index = einsum_str.split('->') + input_left, input_right = input_str.split(',') + + tensor_result = input_left + input_right + for s in idx_rm: + tensor_result = tensor_result.replace(s, "") + + # Find indices to contract over + left_pos, right_pos = [], [] + for s in sorted(idx_rm): + left_pos.append(input_left.find(s)) + right_pos.append(input_right.find(s)) + + # Contract! + new_view = tensordot( + *tmp_operands, axes=(tuple(left_pos), tuple(right_pos)) + ) + + # Build a new view if needed + if (tensor_result != results_index) or handle_out: + if handle_out: + kwargs["out"] = out + new_view = c_einsum( + tensor_result + '->' + results_index, new_view, **kwargs + ) + + # Call einsum + else: + # If out was specified + if handle_out: + kwargs["out"] = out + + # Do the contraction + new_view = c_einsum(einsum_str, *tmp_operands, **kwargs) + + # Append new items and dereference what we can + operands.append(new_view) + del tmp_operands, new_view + + if specified_out: + return out + else: + return asanyarray(operands[0], order=output_order) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.pyi b/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.pyi new file mode 100644 index 0000000000000000000000000000000000000000..513f0635e35eaedd18bd7d7c73e746de63623ff9 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/einsumfunc.pyi @@ -0,0 +1,183 @@ +from collections.abc import Sequence +from typing import TypeVar, Any, overload, Literal + +import numpy as np +from numpy import number, _OrderKACF +from numpy._typing import ( + NDArray, + _ArrayLikeBool_co, + _ArrayLikeUInt_co, + _ArrayLikeInt_co, + _ArrayLikeFloat_co, + _ArrayLikeComplex_co, + _ArrayLikeObject_co, + _DTypeLikeBool, + _DTypeLikeUInt, + _DTypeLikeInt, + _DTypeLikeFloat, + _DTypeLikeComplex, + _DTypeLikeComplex_co, + _DTypeLikeObject, +) + +_ArrayType = TypeVar( + "_ArrayType", + bound=NDArray[np.bool | number[Any]], +) + +_OptimizeKind = None | bool | Literal["greedy", "optimal"] | Sequence[Any] +_CastingSafe = Literal["no", "equiv", "safe", "same_kind"] +_CastingUnsafe = Literal["unsafe"] + +__all__: list[str] + +# TODO: Properly handle the `casting`-based combinatorics +# TODO: We need to evaluate the content `__subscripts` in order +# to identify whether or an array or scalar is returned. At a cursory +# glance this seems like something that can quite easily be done with +# a mypy plugin. +# Something like `is_scalar = bool(__subscripts.partition("->")[-1])` +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeBool_co, + out: None = ..., + dtype: None | _DTypeLikeBool = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeUInt_co, + out: None = ..., + dtype: None | _DTypeLikeUInt = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeInt_co, + out: None = ..., + dtype: None | _DTypeLikeInt = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeFloat_co, + out: None = ..., + dtype: None | _DTypeLikeFloat = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeComplex_co, + out: None = ..., + dtype: None | _DTypeLikeComplex = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: Any, + casting: _CastingUnsafe, + dtype: None | _DTypeLikeComplex_co = ..., + out: None = ..., + order: _OrderKACF = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeComplex_co, + out: _ArrayType, + dtype: None | _DTypeLikeComplex_co = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> _ArrayType: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: Any, + out: _ArrayType, + casting: _CastingUnsafe, + dtype: None | _DTypeLikeComplex_co = ..., + order: _OrderKACF = ..., + optimize: _OptimizeKind = ..., +) -> _ArrayType: ... + +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeObject_co, + out: None = ..., + dtype: None | _DTypeLikeObject = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: Any, + casting: _CastingUnsafe, + dtype: None | _DTypeLikeObject = ..., + out: None = ..., + order: _OrderKACF = ..., + optimize: _OptimizeKind = ..., +) -> Any: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeObject_co, + out: _ArrayType, + dtype: None | _DTypeLikeObject = ..., + order: _OrderKACF = ..., + casting: _CastingSafe = ..., + optimize: _OptimizeKind = ..., +) -> _ArrayType: ... +@overload +def einsum( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: Any, + out: _ArrayType, + casting: _CastingUnsafe, + dtype: None | _DTypeLikeObject = ..., + order: _OrderKACF = ..., + optimize: _OptimizeKind = ..., +) -> _ArrayType: ... + +# NOTE: `einsum_call` is a hidden kwarg unavailable for public use. +# It is therefore excluded from the signatures below. +# NOTE: In practice the list consists of a `str` (first element) +# and a variable number of integer tuples. +def einsum_path( + subscripts: str | _ArrayLikeInt_co, + /, + *operands: _ArrayLikeComplex_co | _DTypeLikeObject, + optimize: _OptimizeKind = ..., +) -> tuple[list[Any], str]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.py b/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.py new file mode 100644 index 0000000000000000000000000000000000000000..a3d8712764e0f91a20184fcd3bf98dd7bbb0ada4 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.py @@ -0,0 +1,4320 @@ +"""Module containing non-deprecated functions borrowed from Numeric. + +""" +import functools +import types +import warnings + +import numpy as np +from .._utils import set_module +from . import multiarray as mu +from . import overrides +from . import umath as um +from . import numerictypes as nt +from .multiarray import asarray, array, asanyarray, concatenate +from ._multiarray_umath import _array_converter +from . import _methods + +_dt_ = nt.sctype2char + +# functions that are methods +__all__ = [ + 'all', 'amax', 'amin', 'any', 'argmax', + 'argmin', 'argpartition', 'argsort', 'around', 'choose', 'clip', + 'compress', 'cumprod', 'cumsum', 'cumulative_prod', 'cumulative_sum', + 'diagonal', 'mean', 'max', 'min', 'matrix_transpose', + 'ndim', 'nonzero', 'partition', 'prod', 'ptp', 'put', + 'ravel', 'repeat', 'reshape', 'resize', 'round', + 'searchsorted', 'shape', 'size', 'sort', 'squeeze', + 'std', 'sum', 'swapaxes', 'take', 'trace', 'transpose', 'var', +] + +_gentype = types.GeneratorType +# save away Python sum +_sum_ = sum + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy') + + +# functions that are now methods +def _wrapit(obj, method, *args, **kwds): + conv = _array_converter(obj) + # As this already tried the method, subok is maybe quite reasonable here + # but this follows what was done before. TODO: revisit this. + arr, = conv.as_arrays(subok=False) + result = getattr(arr, method)(*args, **kwds) + + return conv.wrap(result, to_scalar=False) + + +def _wrapfunc(obj, method, *args, **kwds): + bound = getattr(obj, method, None) + if bound is None: + return _wrapit(obj, method, *args, **kwds) + + try: + return bound(*args, **kwds) + except TypeError: + # A TypeError occurs if the object does have such a method in its + # class, but its signature is not identical to that of NumPy's. This + # situation has occurred in the case of a downstream library like + # 'pandas'. + # + # Call _wrapit from within the except clause to ensure a potential + # exception has a traceback chain. + return _wrapit(obj, method, *args, **kwds) + + +def _wrapreduction(obj, ufunc, method, axis, dtype, out, **kwargs): + passkwargs = {k: v for k, v in kwargs.items() + if v is not np._NoValue} + + if type(obj) is not mu.ndarray: + try: + reduction = getattr(obj, method) + except AttributeError: + pass + else: + # This branch is needed for reductions like any which don't + # support a dtype. + if dtype is not None: + return reduction(axis=axis, dtype=dtype, out=out, **passkwargs) + else: + return reduction(axis=axis, out=out, **passkwargs) + + return ufunc.reduce(obj, axis, dtype, out, **passkwargs) + + +def _wrapreduction_any_all(obj, ufunc, method, axis, out, **kwargs): + # Same as above function, but dtype is always bool (but never passed on) + passkwargs = {k: v for k, v in kwargs.items() + if v is not np._NoValue} + + if type(obj) is not mu.ndarray: + try: + reduction = getattr(obj, method) + except AttributeError: + pass + else: + return reduction(axis=axis, out=out, **passkwargs) + + return ufunc.reduce(obj, axis, bool, out, **passkwargs) + + +def _take_dispatcher(a, indices, axis=None, out=None, mode=None): + return (a, out) + + +@array_function_dispatch(_take_dispatcher) +def take(a, indices, axis=None, out=None, mode='raise'): + """ + Take elements from an array along an axis. + + When axis is not None, this function does the same thing as "fancy" + indexing (indexing arrays using arrays); however, it can be easier to use + if you need elements along a given axis. A call such as + ``np.take(arr, indices, axis=3)`` is equivalent to + ``arr[:,:,:,indices,...]``. + + Explained without fancy indexing, this is equivalent to the following use + of `ndindex`, which sets each of ``ii``, ``jj``, and ``kk`` to a tuple of + indices:: + + Ni, Nk = a.shape[:axis], a.shape[axis+1:] + Nj = indices.shape + for ii in ndindex(Ni): + for jj in ndindex(Nj): + for kk in ndindex(Nk): + out[ii + jj + kk] = a[ii + (indices[jj],) + kk] + + Parameters + ---------- + a : array_like (Ni..., M, Nk...) + The source array. + indices : array_like (Nj...) + The indices of the values to extract. + + .. versionadded:: 1.8.0 + + Also allow scalars for indices. + axis : int, optional + The axis over which to select values. By default, the flattened + input array is used. + out : ndarray, optional (Ni..., Nj..., Nk...) + If provided, the result will be placed in this array. It should + be of the appropriate shape and dtype. Note that `out` is always + buffered if `mode='raise'`; use other modes for better performance. + mode : {'raise', 'wrap', 'clip'}, optional + Specifies how out-of-bounds indices will behave. + + * 'raise' -- raise an error (default) + * 'wrap' -- wrap around + * 'clip' -- clip to the range + + 'clip' mode means that all indices that are too large are replaced + by the index that addresses the last element along that axis. Note + that this disables indexing with negative numbers. + + Returns + ------- + out : ndarray (Ni..., Nj..., Nk...) + The returned array has the same type as `a`. + + See Also + -------- + compress : Take elements using a boolean mask + ndarray.take : equivalent method + take_along_axis : Take elements by matching the array and the index arrays + + Notes + ----- + + By eliminating the inner loop in the description above, and using `s_` to + build simple slice objects, `take` can be expressed in terms of applying + fancy indexing to each 1-d slice:: + + Ni, Nk = a.shape[:axis], a.shape[axis+1:] + for ii in ndindex(Ni): + for kk in ndindex(Nj): + out[ii + s_[...,] + kk] = a[ii + s_[:,] + kk][indices] + + For this reason, it is equivalent to (but faster than) the following use + of `apply_along_axis`:: + + out = np.apply_along_axis(lambda a_1d: a_1d[indices], axis, a) + + Examples + -------- + >>> import numpy as np + >>> a = [4, 3, 5, 7, 6, 8] + >>> indices = [0, 1, 4] + >>> np.take(a, indices) + array([4, 3, 6]) + + In this example if `a` is an ndarray, "fancy" indexing can be used. + + >>> a = np.array(a) + >>> a[indices] + array([4, 3, 6]) + + If `indices` is not one dimensional, the output also has these dimensions. + + >>> np.take(a, [[0, 1], [2, 3]]) + array([[4, 3], + [5, 7]]) + """ + return _wrapfunc(a, 'take', indices, axis=axis, out=out, mode=mode) + + +def _reshape_dispatcher(a, /, shape=None, order=None, *, newshape=None, + copy=None): + return (a,) + + +@array_function_dispatch(_reshape_dispatcher) +def reshape(a, /, shape=None, order='C', *, newshape=None, copy=None): + """ + Gives a new shape to an array without changing its data. + + Parameters + ---------- + a : array_like + Array to be reshaped. + shape : int or tuple of ints + The new shape should be compatible with the original shape. If + an integer, then the result will be a 1-D array of that length. + One shape dimension can be -1. In this case, the value is + inferred from the length of the array and remaining dimensions. + order : {'C', 'F', 'A'}, optional + Read the elements of ``a`` using this index order, and place the + elements into the reshaped array using this index order. 'C' + means to read / write the elements using C-like index order, + with the last axis index changing fastest, back to the first + axis index changing slowest. 'F' means to read / write the + elements using Fortran-like index order, with the first index + changing fastest, and the last index changing slowest. Note that + the 'C' and 'F' options take no account of the memory layout of + the underlying array, and only refer to the order of indexing. + 'A' means to read / write the elements in Fortran-like index + order if ``a`` is Fortran *contiguous* in memory, C-like order + otherwise. + newshape : int or tuple of ints + .. deprecated:: 2.1 + Replaced by ``shape`` argument. Retained for backward + compatibility. + copy : bool, optional + If ``True``, then the array data is copied. If ``None``, a copy will + only be made if it's required by ``order``. For ``False`` it raises + a ``ValueError`` if a copy cannot be avoided. Default: ``None``. + + Returns + ------- + reshaped_array : ndarray + This will be a new view object if possible; otherwise, it will + be a copy. Note there is no guarantee of the *memory layout* (C- or + Fortran- contiguous) of the returned array. + + See Also + -------- + ndarray.reshape : Equivalent method. + + Notes + ----- + It is not always possible to change the shape of an array without copying + the data. + + The ``order`` keyword gives the index ordering both for *fetching* + the values from ``a``, and then *placing* the values into the output + array. For example, let's say you have an array: + + >>> a = np.arange(6).reshape((3, 2)) + >>> a + array([[0, 1], + [2, 3], + [4, 5]]) + + You can think of reshaping as first raveling the array (using the given + index order), then inserting the elements from the raveled array into the + new array using the same kind of index ordering as was used for the + raveling. + + >>> np.reshape(a, (2, 3)) # C-like index ordering + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.reshape(np.ravel(a), (2, 3)) # equivalent to C ravel then C reshape + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.reshape(a, (2, 3), order='F') # Fortran-like index ordering + array([[0, 4, 3], + [2, 1, 5]]) + >>> np.reshape(np.ravel(a, order='F'), (2, 3), order='F') + array([[0, 4, 3], + [2, 1, 5]]) + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,2,3], [4,5,6]]) + >>> np.reshape(a, 6) + array([1, 2, 3, 4, 5, 6]) + >>> np.reshape(a, 6, order='F') + array([1, 4, 2, 5, 3, 6]) + + >>> np.reshape(a, (3,-1)) # the unspecified value is inferred to be 2 + array([[1, 2], + [3, 4], + [5, 6]]) + """ + if newshape is None and shape is None: + raise TypeError( + "reshape() missing 1 required positional argument: 'shape'") + if newshape is not None: + if shape is not None: + raise TypeError( + "You cannot specify 'newshape' and 'shape' arguments " + "at the same time.") + # Deprecated in NumPy 2.1, 2024-04-18 + warnings.warn( + "`newshape` keyword argument is deprecated, " + "use `shape=...` or pass shape positionally instead. " + "(deprecated in NumPy 2.1)", + DeprecationWarning, + stacklevel=2, + ) + shape = newshape + if copy is not None: + return _wrapfunc(a, 'reshape', shape, order=order, copy=copy) + return _wrapfunc(a, 'reshape', shape, order=order) + + +def _choose_dispatcher(a, choices, out=None, mode=None): + yield a + yield from choices + yield out + + +@array_function_dispatch(_choose_dispatcher) +def choose(a, choices, out=None, mode='raise'): + """ + Construct an array from an index array and a list of arrays to choose from. + + First of all, if confused or uncertain, definitely look at the Examples - + in its full generality, this function is less simple than it might + seem from the following code description (below ndi = + `numpy.lib.index_tricks`): + + ``np.choose(a,c) == np.array([c[a[I]][I] for I in ndi.ndindex(a.shape)])``. + + But this omits some subtleties. Here is a fully general summary: + + Given an "index" array (`a`) of integers and a sequence of ``n`` arrays + (`choices`), `a` and each choice array are first broadcast, as necessary, + to arrays of a common shape; calling these *Ba* and *Bchoices[i], i = + 0,...,n-1* we have that, necessarily, ``Ba.shape == Bchoices[i].shape`` + for each ``i``. Then, a new array with shape ``Ba.shape`` is created as + follows: + + * if ``mode='raise'`` (the default), then, first of all, each element of + ``a`` (and thus ``Ba``) must be in the range ``[0, n-1]``; now, suppose + that ``i`` (in that range) is the value at the ``(j0, j1, ..., jm)`` + position in ``Ba`` - then the value at the same position in the new array + is the value in ``Bchoices[i]`` at that same position; + + * if ``mode='wrap'``, values in `a` (and thus `Ba`) may be any (signed) + integer; modular arithmetic is used to map integers outside the range + `[0, n-1]` back into that range; and then the new array is constructed + as above; + + * if ``mode='clip'``, values in `a` (and thus ``Ba``) may be any (signed) + integer; negative integers are mapped to 0; values greater than ``n-1`` + are mapped to ``n-1``; and then the new array is constructed as above. + + Parameters + ---------- + a : int array + This array must contain integers in ``[0, n-1]``, where ``n`` is the + number of choices, unless ``mode=wrap`` or ``mode=clip``, in which + cases any integers are permissible. + choices : sequence of arrays + Choice arrays. `a` and all of the choices must be broadcastable to the + same shape. If `choices` is itself an array (not recommended), then + its outermost dimension (i.e., the one corresponding to + ``choices.shape[0]``) is taken as defining the "sequence". + out : array, optional + If provided, the result will be inserted into this array. It should + be of the appropriate shape and dtype. Note that `out` is always + buffered if ``mode='raise'``; use other modes for better performance. + mode : {'raise' (default), 'wrap', 'clip'}, optional + Specifies how indices outside ``[0, n-1]`` will be treated: + + * 'raise' : an exception is raised + * 'wrap' : value becomes value mod ``n`` + * 'clip' : values < 0 are mapped to 0, values > n-1 are mapped to n-1 + + Returns + ------- + merged_array : array + The merged result. + + Raises + ------ + ValueError: shape mismatch + If `a` and each choice array are not all broadcastable to the same + shape. + + See Also + -------- + ndarray.choose : equivalent method + numpy.take_along_axis : Preferable if `choices` is an array + + Notes + ----- + To reduce the chance of misinterpretation, even though the following + "abuse" is nominally supported, `choices` should neither be, nor be + thought of as, a single array, i.e., the outermost sequence-like container + should be either a list or a tuple. + + Examples + -------- + + >>> import numpy as np + >>> choices = [[0, 1, 2, 3], [10, 11, 12, 13], + ... [20, 21, 22, 23], [30, 31, 32, 33]] + >>> np.choose([2, 3, 1, 0], choices + ... # the first element of the result will be the first element of the + ... # third (2+1) "array" in choices, namely, 20; the second element + ... # will be the second element of the fourth (3+1) choice array, i.e., + ... # 31, etc. + ... ) + array([20, 31, 12, 3]) + >>> np.choose([2, 4, 1, 0], choices, mode='clip') # 4 goes to 3 (4-1) + array([20, 31, 12, 3]) + >>> # because there are 4 choice arrays + >>> np.choose([2, 4, 1, 0], choices, mode='wrap') # 4 goes to (4 mod 4) + array([20, 1, 12, 3]) + >>> # i.e., 0 + + A couple examples illustrating how choose broadcasts: + + >>> a = [[1, 0, 1], [0, 1, 0], [1, 0, 1]] + >>> choices = [-10, 10] + >>> np.choose(a, choices) + array([[ 10, -10, 10], + [-10, 10, -10], + [ 10, -10, 10]]) + + >>> # With thanks to Anne Archibald + >>> a = np.array([0, 1]).reshape((2,1,1)) + >>> c1 = np.array([1, 2, 3]).reshape((1,3,1)) + >>> c2 = np.array([-1, -2, -3, -4, -5]).reshape((1,1,5)) + >>> np.choose(a, (c1, c2)) # result is 2x3x5, res[0,:,:]=c1, res[1,:,:]=c2 + array([[[ 1, 1, 1, 1, 1], + [ 2, 2, 2, 2, 2], + [ 3, 3, 3, 3, 3]], + [[-1, -2, -3, -4, -5], + [-1, -2, -3, -4, -5], + [-1, -2, -3, -4, -5]]]) + + """ + return _wrapfunc(a, 'choose', choices, out=out, mode=mode) + + +def _repeat_dispatcher(a, repeats, axis=None): + return (a,) + + +@array_function_dispatch(_repeat_dispatcher) +def repeat(a, repeats, axis=None): + """ + Repeat each element of an array after themselves + + Parameters + ---------- + a : array_like + Input array. + repeats : int or array of ints + The number of repetitions for each element. `repeats` is broadcasted + to fit the shape of the given axis. + axis : int, optional + The axis along which to repeat values. By default, use the + flattened input array, and return a flat output array. + + Returns + ------- + repeated_array : ndarray + Output array which has the same shape as `a`, except along + the given axis. + + See Also + -------- + tile : Tile an array. + unique : Find the unique elements of an array. + + Examples + -------- + >>> import numpy as np + >>> np.repeat(3, 4) + array([3, 3, 3, 3]) + >>> x = np.array([[1,2],[3,4]]) + >>> np.repeat(x, 2) + array([1, 1, 2, 2, 3, 3, 4, 4]) + >>> np.repeat(x, 3, axis=1) + array([[1, 1, 1, 2, 2, 2], + [3, 3, 3, 4, 4, 4]]) + >>> np.repeat(x, [1, 2], axis=0) + array([[1, 2], + [3, 4], + [3, 4]]) + + """ + return _wrapfunc(a, 'repeat', repeats, axis=axis) + + +def _put_dispatcher(a, ind, v, mode=None): + return (a, ind, v) + + +@array_function_dispatch(_put_dispatcher) +def put(a, ind, v, mode='raise'): + """ + Replaces specified elements of an array with given values. + + The indexing works on the flattened target array. `put` is roughly + equivalent to: + + :: + + a.flat[ind] = v + + Parameters + ---------- + a : ndarray + Target array. + ind : array_like + Target indices, interpreted as integers. + v : array_like + Values to place in `a` at target indices. If `v` is shorter than + `ind` it will be repeated as necessary. + mode : {'raise', 'wrap', 'clip'}, optional + Specifies how out-of-bounds indices will behave. + + * 'raise' -- raise an error (default) + * 'wrap' -- wrap around + * 'clip' -- clip to the range + + 'clip' mode means that all indices that are too large are replaced + by the index that addresses the last element along that axis. Note + that this disables indexing with negative numbers. In 'raise' mode, + if an exception occurs the target array may still be modified. + + See Also + -------- + putmask, place + put_along_axis : Put elements by matching the array and the index arrays + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(5) + >>> np.put(a, [0, 2], [-44, -55]) + >>> a + array([-44, 1, -55, 3, 4]) + + >>> a = np.arange(5) + >>> np.put(a, 22, -5, mode='clip') + >>> a + array([ 0, 1, 2, 3, -5]) + + """ + try: + put = a.put + except AttributeError as e: + raise TypeError("argument 1 must be numpy.ndarray, " + "not {name}".format(name=type(a).__name__)) from e + + return put(ind, v, mode=mode) + + +def _swapaxes_dispatcher(a, axis1, axis2): + return (a,) + + +@array_function_dispatch(_swapaxes_dispatcher) +def swapaxes(a, axis1, axis2): + """ + Interchange two axes of an array. + + Parameters + ---------- + a : array_like + Input array. + axis1 : int + First axis. + axis2 : int + Second axis. + + Returns + ------- + a_swapped : ndarray + For NumPy >= 1.10.0, if `a` is an ndarray, then a view of `a` is + returned; otherwise a new array is created. For earlier NumPy + versions a view of `a` is returned only if the order of the + axes is changed, otherwise the input array is returned. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[1,2,3]]) + >>> np.swapaxes(x,0,1) + array([[1], + [2], + [3]]) + + >>> x = np.array([[[0,1],[2,3]],[[4,5],[6,7]]]) + >>> x + array([[[0, 1], + [2, 3]], + [[4, 5], + [6, 7]]]) + + >>> np.swapaxes(x,0,2) + array([[[0, 4], + [2, 6]], + [[1, 5], + [3, 7]]]) + + """ + return _wrapfunc(a, 'swapaxes', axis1, axis2) + + +def _transpose_dispatcher(a, axes=None): + return (a,) + + +@array_function_dispatch(_transpose_dispatcher) +def transpose(a, axes=None): + """ + Returns an array with axes transposed. + + For a 1-D array, this returns an unchanged view of the original array, as a + transposed vector is simply the same vector. + To convert a 1-D array into a 2-D column vector, an additional dimension + must be added, e.g., ``np.atleast_2d(a).T`` achieves this, as does + ``a[:, np.newaxis]``. + For a 2-D array, this is the standard matrix transpose. + For an n-D array, if axes are given, their order indicates how the + axes are permuted (see Examples). If axes are not provided, then + ``transpose(a).shape == a.shape[::-1]``. + + Parameters + ---------- + a : array_like + Input array. + axes : tuple or list of ints, optional + If specified, it must be a tuple or list which contains a permutation + of [0,1,...,N-1] where N is the number of axes of `a`. The `i`'th axis + of the returned array will correspond to the axis numbered ``axes[i]`` + of the input. If not specified, defaults to ``range(a.ndim)[::-1]``, + which reverses the order of the axes. + + Returns + ------- + p : ndarray + `a` with its axes permuted. A view is returned whenever possible. + + See Also + -------- + ndarray.transpose : Equivalent method. + moveaxis : Move axes of an array to new positions. + argsort : Return the indices that would sort an array. + + Notes + ----- + Use ``transpose(a, argsort(axes))`` to invert the transposition of tensors + when using the `axes` keyword argument. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> a + array([[1, 2], + [3, 4]]) + >>> np.transpose(a) + array([[1, 3], + [2, 4]]) + + >>> a = np.array([1, 2, 3, 4]) + >>> a + array([1, 2, 3, 4]) + >>> np.transpose(a) + array([1, 2, 3, 4]) + + >>> a = np.ones((1, 2, 3)) + >>> np.transpose(a, (1, 0, 2)).shape + (2, 1, 3) + + >>> a = np.ones((2, 3, 4, 5)) + >>> np.transpose(a).shape + (5, 4, 3, 2) + + """ + return _wrapfunc(a, 'transpose', axes) + + +def _matrix_transpose_dispatcher(x): + return (x,) + +@array_function_dispatch(_matrix_transpose_dispatcher) +def matrix_transpose(x, /): + """ + Transposes a matrix (or a stack of matrices) ``x``. + + This function is Array API compatible. + + Parameters + ---------- + x : array_like + Input array having shape (..., M, N) and whose two innermost + dimensions form ``MxN`` matrices. + + Returns + ------- + out : ndarray + An array containing the transpose for each matrix and having shape + (..., N, M). + + See Also + -------- + transpose : Generic transpose method. + + Examples + -------- + >>> import numpy as np + >>> np.matrix_transpose([[1, 2], [3, 4]]) + array([[1, 3], + [2, 4]]) + + >>> np.matrix_transpose([[[1, 2], [3, 4]], [[5, 6], [7, 8]]]) + array([[[1, 3], + [2, 4]], + [[5, 7], + [6, 8]]]) + + """ + x = asanyarray(x) + if x.ndim < 2: + raise ValueError( + f"Input array must be at least 2-dimensional, but it is {x.ndim}" + ) + return swapaxes(x, -1, -2) + + +def _partition_dispatcher(a, kth, axis=None, kind=None, order=None): + return (a,) + + +@array_function_dispatch(_partition_dispatcher) +def partition(a, kth, axis=-1, kind='introselect', order=None): + """ + Return a partitioned copy of an array. + + Creates a copy of the array and partially sorts it in such a way that + the value of the element in k-th position is in the position it would be + in a sorted array. In the output array, all elements smaller than the k-th + element are located to the left of this element and all equal or greater + are located to its right. The ordering of the elements in the two + partitions on the either side of the k-th element in the output array is + undefined. + + .. versionadded:: 1.8.0 + + Parameters + ---------- + a : array_like + Array to be sorted. + kth : int or sequence of ints + Element index to partition by. The k-th value of the element + will be in its final sorted position and all smaller elements + will be moved before it and all equal or greater elements behind + it. The order of all elements in the partitions is undefined. If + provided with a sequence of k-th it will partition all elements + indexed by k-th of them into their sorted position at once. + + .. deprecated:: 1.22.0 + Passing booleans as index is deprecated. + axis : int or None, optional + Axis along which to sort. If None, the array is flattened before + sorting. The default is -1, which sorts along the last axis. + kind : {'introselect'}, optional + Selection algorithm. Default is 'introselect'. + order : str or list of str, optional + When `a` is an array with fields defined, this argument + specifies which fields to compare first, second, etc. A single + field can be specified as a string. Not all fields need be + specified, but unspecified fields will still be used, in the + order in which they come up in the dtype, to break ties. + + Returns + ------- + partitioned_array : ndarray + Array of the same type and shape as `a`. + + See Also + -------- + ndarray.partition : Method to sort an array in-place. + argpartition : Indirect partition. + sort : Full sorting + + Notes + ----- + The various selection algorithms are characterized by their average + speed, worst case performance, work space size, and whether they are + stable. A stable sort keeps items with the same key in the same + relative order. The available algorithms have the following + properties: + + ================= ======= ============= ============ ======= + kind speed worst case work space stable + ================= ======= ============= ============ ======= + 'introselect' 1 O(n) 0 no + ================= ======= ============= ============ ======= + + All the partition algorithms make temporary copies of the data when + partitioning along any but the last axis. Consequently, + partitioning along the last axis is faster and uses less space than + partitioning along any other axis. + + The sort order for complex numbers is lexicographic. If both the + real and imaginary parts are non-nan then the order is determined by + the real parts except when they are equal, in which case the order + is determined by the imaginary parts. + + The sort order of ``np.nan`` is bigger than ``np.inf``. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([7, 1, 7, 7, 1, 5, 7, 2, 3, 2, 6, 2, 3, 0]) + >>> p = np.partition(a, 4) + >>> p + array([0, 1, 2, 1, 2, 5, 2, 3, 3, 6, 7, 7, 7, 7]) # may vary + + ``p[4]`` is 2; all elements in ``p[:4]`` are less than or equal + to ``p[4]``, and all elements in ``p[5:]`` are greater than or + equal to ``p[4]``. The partition is:: + + [0, 1, 2, 1], [2], [5, 2, 3, 3, 6, 7, 7, 7, 7] + + The next example shows the use of multiple values passed to `kth`. + + >>> p2 = np.partition(a, (4, 8)) + >>> p2 + array([0, 1, 2, 1, 2, 3, 3, 2, 5, 6, 7, 7, 7, 7]) + + ``p2[4]`` is 2 and ``p2[8]`` is 5. All elements in ``p2[:4]`` + are less than or equal to ``p2[4]``, all elements in ``p2[5:8]`` + are greater than or equal to ``p2[4]`` and less than or equal to + ``p2[8]``, and all elements in ``p2[9:]`` are greater than or + equal to ``p2[8]``. The partition is:: + + [0, 1, 2, 1], [2], [3, 3, 2], [5], [6, 7, 7, 7, 7] + """ + if axis is None: + # flatten returns (1, N) for np.matrix, so always use the last axis + a = asanyarray(a).flatten() + axis = -1 + else: + a = asanyarray(a).copy(order="K") + a.partition(kth, axis=axis, kind=kind, order=order) + return a + + +def _argpartition_dispatcher(a, kth, axis=None, kind=None, order=None): + return (a,) + + +@array_function_dispatch(_argpartition_dispatcher) +def argpartition(a, kth, axis=-1, kind='introselect', order=None): + """ + Perform an indirect partition along the given axis using the + algorithm specified by the `kind` keyword. It returns an array of + indices of the same shape as `a` that index data along the given + axis in partitioned order. + + .. versionadded:: 1.8.0 + + Parameters + ---------- + a : array_like + Array to sort. + kth : int or sequence of ints + Element index to partition by. The k-th element will be in its + final sorted position and all smaller elements will be moved + before it and all larger elements behind it. The order of all + elements in the partitions is undefined. If provided with a + sequence of k-th it will partition all of them into their sorted + position at once. + + .. deprecated:: 1.22.0 + Passing booleans as index is deprecated. + axis : int or None, optional + Axis along which to sort. The default is -1 (the last axis). If + None, the flattened array is used. + kind : {'introselect'}, optional + Selection algorithm. Default is 'introselect' + order : str or list of str, optional + When `a` is an array with fields defined, this argument + specifies which fields to compare first, second, etc. A single + field can be specified as a string, and not all fields need be + specified, but unspecified fields will still be used, in the + order in which they come up in the dtype, to break ties. + + Returns + ------- + index_array : ndarray, int + Array of indices that partition `a` along the specified axis. + If `a` is one-dimensional, ``a[index_array]`` yields a partitioned `a`. + More generally, ``np.take_along_axis(a, index_array, axis=axis)`` + always yields the partitioned `a`, irrespective of dimensionality. + + See Also + -------- + partition : Describes partition algorithms used. + ndarray.partition : Inplace partition. + argsort : Full indirect sort. + take_along_axis : Apply ``index_array`` from argpartition + to an array as if by calling partition. + + Notes + ----- + The returned indices are not guaranteed to be sorted according to + the values. Furthermore, the default selection algorithm ``introselect`` + is unstable, and hence the returned indices are not guaranteed + to be the earliest/latest occurrence of the element. + + `argpartition` works for real/complex inputs with nan values, + see `partition` for notes on the enhanced sort order and + different selection algorithms. + + Examples + -------- + One dimensional array: + + >>> import numpy as np + >>> x = np.array([3, 4, 2, 1]) + >>> x[np.argpartition(x, 3)] + array([2, 1, 3, 4]) # may vary + >>> x[np.argpartition(x, (1, 3))] + array([1, 2, 3, 4]) # may vary + + >>> x = [3, 4, 2, 1] + >>> np.array(x)[np.argpartition(x, 3)] + array([2, 1, 3, 4]) # may vary + + Multi-dimensional array: + + >>> x = np.array([[3, 4, 2], [1, 3, 1]]) + >>> index_array = np.argpartition(x, kth=1, axis=-1) + >>> # below is the same as np.partition(x, kth=1) + >>> np.take_along_axis(x, index_array, axis=-1) + array([[2, 3, 4], + [1, 1, 3]]) + + """ + return _wrapfunc(a, 'argpartition', kth, axis=axis, kind=kind, order=order) + + +def _sort_dispatcher(a, axis=None, kind=None, order=None, *, stable=None): + return (a,) + + +@array_function_dispatch(_sort_dispatcher) +def sort(a, axis=-1, kind=None, order=None, *, stable=None): + """ + Return a sorted copy of an array. + + Parameters + ---------- + a : array_like + Array to be sorted. + axis : int or None, optional + Axis along which to sort. If None, the array is flattened before + sorting. The default is -1, which sorts along the last axis. + kind : {'quicksort', 'mergesort', 'heapsort', 'stable'}, optional + Sorting algorithm. The default is 'quicksort'. Note that both 'stable' + and 'mergesort' use timsort or radix sort under the covers and, + in general, the actual implementation will vary with data type. + The 'mergesort' option is retained for backwards compatibility. + + .. versionchanged:: 1.15.0. + The 'stable' option was added. + + order : str or list of str, optional + When `a` is an array with fields defined, this argument specifies + which fields to compare first, second, etc. A single field can + be specified as a string, and not all fields need be specified, + but unspecified fields will still be used, in the order in which + they come up in the dtype, to break ties. + stable : bool, optional + Sort stability. If ``True``, the returned array will maintain + the relative order of ``a`` values which compare as equal. + If ``False`` or ``None``, this is not guaranteed. Internally, + this option selects ``kind='stable'``. Default: ``None``. + + .. versionadded:: 2.0.0 + + Returns + ------- + sorted_array : ndarray + Array of the same type and shape as `a`. + + See Also + -------- + ndarray.sort : Method to sort an array in-place. + argsort : Indirect sort. + lexsort : Indirect stable sort on multiple keys. + searchsorted : Find elements in a sorted array. + partition : Partial sort. + + Notes + ----- + The various sorting algorithms are characterized by their average speed, + worst case performance, work space size, and whether they are stable. A + stable sort keeps items with the same key in the same relative + order. The four algorithms implemented in NumPy have the following + properties: + + =========== ======= ============= ============ ======== + kind speed worst case work space stable + =========== ======= ============= ============ ======== + 'quicksort' 1 O(n^2) 0 no + 'heapsort' 3 O(n*log(n)) 0 no + 'mergesort' 2 O(n*log(n)) ~n/2 yes + 'timsort' 2 O(n*log(n)) ~n/2 yes + =========== ======= ============= ============ ======== + + .. note:: The datatype determines which of 'mergesort' or 'timsort' + is actually used, even if 'mergesort' is specified. User selection + at a finer scale is not currently available. + + For performance, ``sort`` makes a temporary copy if needed to make the data + `contiguous `_ + in memory along the sort axis. For even better performance and reduced + memory consumption, ensure that the array is already contiguous along the + sort axis. + + The sort order for complex numbers is lexicographic. If both the real + and imaginary parts are non-nan then the order is determined by the + real parts except when they are equal, in which case the order is + determined by the imaginary parts. + + Previous to numpy 1.4.0 sorting real and complex arrays containing nan + values led to undefined behaviour. In numpy versions >= 1.4.0 nan + values are sorted to the end. The extended sort order is: + + * Real: [R, nan] + * Complex: [R + Rj, R + nanj, nan + Rj, nan + nanj] + + where R is a non-nan real value. Complex values with the same nan + placements are sorted according to the non-nan part if it exists. + Non-nan values are sorted as before. + + .. versionadded:: 1.12.0 + + quicksort has been changed to: + `introsort `_. + When sorting does not make enough progress it switches to + `heapsort `_. + This implementation makes quicksort O(n*log(n)) in the worst case. + + 'stable' automatically chooses the best stable sorting algorithm + for the data type being sorted. + It, along with 'mergesort' is currently mapped to + `timsort `_ + or `radix sort `_ + depending on the data type. + API forward compatibility currently limits the + ability to select the implementation and it is hardwired for the different + data types. + + .. versionadded:: 1.17.0 + + Timsort is added for better performance on already or nearly + sorted data. On random data timsort is almost identical to + mergesort. It is now used for stable sort while quicksort is still the + default sort if none is chosen. For timsort details, refer to + `CPython listsort.txt + `_ + 'mergesort' and 'stable' are mapped to radix sort for integer data types. + Radix sort is an O(n) sort instead of O(n log n). + + .. versionchanged:: 1.18.0 + + NaT now sorts to the end of arrays for consistency with NaN. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,4],[3,1]]) + >>> np.sort(a) # sort along the last axis + array([[1, 4], + [1, 3]]) + >>> np.sort(a, axis=None) # sort the flattened array + array([1, 1, 3, 4]) + >>> np.sort(a, axis=0) # sort along the first axis + array([[1, 1], + [3, 4]]) + + Use the `order` keyword to specify a field to use when sorting a + structured array: + + >>> dtype = [('name', 'S10'), ('height', float), ('age', int)] + >>> values = [('Arthur', 1.8, 41), ('Lancelot', 1.9, 38), + ... ('Galahad', 1.7, 38)] + >>> a = np.array(values, dtype=dtype) # create a structured array + >>> np.sort(a, order='height') # doctest: +SKIP + array([('Galahad', 1.7, 38), ('Arthur', 1.8, 41), + ('Lancelot', 1.8999999999999999, 38)], + dtype=[('name', '|S10'), ('height', '>> np.sort(a, order=['age', 'height']) # doctest: +SKIP + array([('Galahad', 1.7, 38), ('Lancelot', 1.8999999999999999, 38), + ('Arthur', 1.8, 41)], + dtype=[('name', '|S10'), ('height', '>> import numpy as np + >>> x = np.array([3, 1, 2]) + >>> np.argsort(x) + array([1, 2, 0]) + + Two-dimensional array: + + >>> x = np.array([[0, 3], [2, 2]]) + >>> x + array([[0, 3], + [2, 2]]) + + >>> ind = np.argsort(x, axis=0) # sorts along first axis (down) + >>> ind + array([[0, 1], + [1, 0]]) + >>> np.take_along_axis(x, ind, axis=0) # same as np.sort(x, axis=0) + array([[0, 2], + [2, 3]]) + + >>> ind = np.argsort(x, axis=1) # sorts along last axis (across) + >>> ind + array([[0, 1], + [0, 1]]) + >>> np.take_along_axis(x, ind, axis=1) # same as np.sort(x, axis=1) + array([[0, 3], + [2, 2]]) + + Indices of the sorted elements of a N-dimensional array: + + >>> ind = np.unravel_index(np.argsort(x, axis=None), x.shape) + >>> ind + (array([0, 1, 1, 0]), array([0, 0, 1, 1])) + >>> x[ind] # same as np.sort(x, axis=None) + array([0, 2, 2, 3]) + + Sorting with keys: + + >>> x = np.array([(1, 0), (0, 1)], dtype=[('x', '>> x + array([(1, 0), (0, 1)], + dtype=[('x', '>> np.argsort(x, order=('x','y')) + array([1, 0]) + + >>> np.argsort(x, order=('y','x')) + array([0, 1]) + + """ + return _wrapfunc( + a, 'argsort', axis=axis, kind=kind, order=order, stable=stable + ) + +def _argmax_dispatcher(a, axis=None, out=None, *, keepdims=np._NoValue): + return (a, out) + + +@array_function_dispatch(_argmax_dispatcher) +def argmax(a, axis=None, out=None, *, keepdims=np._NoValue): + """ + Returns the indices of the maximum values along an axis. + + Parameters + ---------- + a : array_like + Input array. + axis : int, optional + By default, the index is into the flattened array, otherwise + along the specified axis. + out : array, optional + If provided, the result will be inserted into this array. It should + be of the appropriate shape and dtype. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the array. + + .. versionadded:: 1.22.0 + + Returns + ------- + index_array : ndarray of ints + Array of indices into the array. It has the same shape as ``a.shape`` + with the dimension along `axis` removed. If `keepdims` is set to True, + then the size of `axis` will be 1 with the resulting array having same + shape as ``a.shape``. + + See Also + -------- + ndarray.argmax, argmin + amax : The maximum value along a given axis. + unravel_index : Convert a flat index into an index tuple. + take_along_axis : Apply ``np.expand_dims(index_array, axis)`` + from argmax to an array as if by calling max. + + Notes + ----- + In case of multiple occurrences of the maximum values, the indices + corresponding to the first occurrence are returned. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(6).reshape(2,3) + 10 + >>> a + array([[10, 11, 12], + [13, 14, 15]]) + >>> np.argmax(a) + 5 + >>> np.argmax(a, axis=0) + array([1, 1, 1]) + >>> np.argmax(a, axis=1) + array([2, 2]) + + Indexes of the maximal elements of a N-dimensional array: + + >>> ind = np.unravel_index(np.argmax(a, axis=None), a.shape) + >>> ind + (1, 2) + >>> a[ind] + 15 + + >>> b = np.arange(6) + >>> b[1] = 5 + >>> b + array([0, 5, 2, 3, 4, 5]) + >>> np.argmax(b) # Only the first occurrence is returned. + 1 + + >>> x = np.array([[4,2,3], [1,0,3]]) + >>> index_array = np.argmax(x, axis=-1) + >>> # Same as np.amax(x, axis=-1, keepdims=True) + >>> np.take_along_axis(x, np.expand_dims(index_array, axis=-1), axis=-1) + array([[4], + [3]]) + >>> # Same as np.amax(x, axis=-1) + >>> np.take_along_axis(x, np.expand_dims(index_array, axis=-1), + ... axis=-1).squeeze(axis=-1) + array([4, 3]) + + Setting `keepdims` to `True`, + + >>> x = np.arange(24).reshape((2, 3, 4)) + >>> res = np.argmax(x, axis=1, keepdims=True) + >>> res.shape + (2, 1, 4) + """ + kwds = {'keepdims': keepdims} if keepdims is not np._NoValue else {} + return _wrapfunc(a, 'argmax', axis=axis, out=out, **kwds) + + +def _argmin_dispatcher(a, axis=None, out=None, *, keepdims=np._NoValue): + return (a, out) + + +@array_function_dispatch(_argmin_dispatcher) +def argmin(a, axis=None, out=None, *, keepdims=np._NoValue): + """ + Returns the indices of the minimum values along an axis. + + Parameters + ---------- + a : array_like + Input array. + axis : int, optional + By default, the index is into the flattened array, otherwise + along the specified axis. + out : array, optional + If provided, the result will be inserted into this array. It should + be of the appropriate shape and dtype. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the array. + + .. versionadded:: 1.22.0 + + Returns + ------- + index_array : ndarray of ints + Array of indices into the array. It has the same shape as `a.shape` + with the dimension along `axis` removed. If `keepdims` is set to True, + then the size of `axis` will be 1 with the resulting array having same + shape as `a.shape`. + + See Also + -------- + ndarray.argmin, argmax + amin : The minimum value along a given axis. + unravel_index : Convert a flat index into an index tuple. + take_along_axis : Apply ``np.expand_dims(index_array, axis)`` + from argmin to an array as if by calling min. + + Notes + ----- + In case of multiple occurrences of the minimum values, the indices + corresponding to the first occurrence are returned. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(6).reshape(2,3) + 10 + >>> a + array([[10, 11, 12], + [13, 14, 15]]) + >>> np.argmin(a) + 0 + >>> np.argmin(a, axis=0) + array([0, 0, 0]) + >>> np.argmin(a, axis=1) + array([0, 0]) + + Indices of the minimum elements of a N-dimensional array: + + >>> ind = np.unravel_index(np.argmin(a, axis=None), a.shape) + >>> ind + (0, 0) + >>> a[ind] + 10 + + >>> b = np.arange(6) + 10 + >>> b[4] = 10 + >>> b + array([10, 11, 12, 13, 10, 15]) + >>> np.argmin(b) # Only the first occurrence is returned. + 0 + + >>> x = np.array([[4,2,3], [1,0,3]]) + >>> index_array = np.argmin(x, axis=-1) + >>> # Same as np.amin(x, axis=-1, keepdims=True) + >>> np.take_along_axis(x, np.expand_dims(index_array, axis=-1), axis=-1) + array([[2], + [0]]) + >>> # Same as np.amax(x, axis=-1) + >>> np.take_along_axis(x, np.expand_dims(index_array, axis=-1), + ... axis=-1).squeeze(axis=-1) + array([2, 0]) + + Setting `keepdims` to `True`, + + >>> x = np.arange(24).reshape((2, 3, 4)) + >>> res = np.argmin(x, axis=1, keepdims=True) + >>> res.shape + (2, 1, 4) + """ + kwds = {'keepdims': keepdims} if keepdims is not np._NoValue else {} + return _wrapfunc(a, 'argmin', axis=axis, out=out, **kwds) + + +def _searchsorted_dispatcher(a, v, side=None, sorter=None): + return (a, v, sorter) + + +@array_function_dispatch(_searchsorted_dispatcher) +def searchsorted(a, v, side='left', sorter=None): + """ + Find indices where elements should be inserted to maintain order. + + Find the indices into a sorted array `a` such that, if the + corresponding elements in `v` were inserted before the indices, the + order of `a` would be preserved. + + Assuming that `a` is sorted: + + ====== ============================ + `side` returned index `i` satisfies + ====== ============================ + left ``a[i-1] < v <= a[i]`` + right ``a[i-1] <= v < a[i]`` + ====== ============================ + + Parameters + ---------- + a : 1-D array_like + Input array. If `sorter` is None, then it must be sorted in + ascending order, otherwise `sorter` must be an array of indices + that sort it. + v : array_like + Values to insert into `a`. + side : {'left', 'right'}, optional + If 'left', the index of the first suitable location found is given. + If 'right', return the last such index. If there is no suitable + index, return either 0 or N (where N is the length of `a`). + sorter : 1-D array_like, optional + Optional array of integer indices that sort array a into ascending + order. They are typically the result of argsort. + + .. versionadded:: 1.7.0 + + Returns + ------- + indices : int or array of ints + Array of insertion points with the same shape as `v`, + or an integer if `v` is a scalar. + + See Also + -------- + sort : Return a sorted copy of an array. + histogram : Produce histogram from 1-D data. + + Notes + ----- + Binary search is used to find the required insertion points. + + As of NumPy 1.4.0 `searchsorted` works with real/complex arrays containing + `nan` values. The enhanced sort order is documented in `sort`. + + This function uses the same algorithm as the builtin python + `bisect.bisect_left` (``side='left'``) and `bisect.bisect_right` + (``side='right'``) functions, which is also vectorized + in the `v` argument. + + Examples + -------- + >>> import numpy as np + >>> np.searchsorted([11,12,13,14,15], 13) + 2 + >>> np.searchsorted([11,12,13,14,15], 13, side='right') + 3 + >>> np.searchsorted([11,12,13,14,15], [-10, 20, 12, 13]) + array([0, 5, 1, 2]) + + """ + return _wrapfunc(a, 'searchsorted', v, side=side, sorter=sorter) + + +def _resize_dispatcher(a, new_shape): + return (a,) + + +@array_function_dispatch(_resize_dispatcher) +def resize(a, new_shape): + """ + Return a new array with the specified shape. + + If the new array is larger than the original array, then the new + array is filled with repeated copies of `a`. Note that this behavior + is different from a.resize(new_shape) which fills with zeros instead + of repeated copies of `a`. + + Parameters + ---------- + a : array_like + Array to be resized. + + new_shape : int or tuple of int + Shape of resized array. + + Returns + ------- + reshaped_array : ndarray + The new array is formed from the data in the old array, repeated + if necessary to fill out the required number of elements. The + data are repeated iterating over the array in C-order. + + See Also + -------- + numpy.reshape : Reshape an array without changing the total size. + numpy.pad : Enlarge and pad an array. + numpy.repeat : Repeat elements of an array. + ndarray.resize : resize an array in-place. + + Notes + ----- + When the total size of the array does not change `~numpy.reshape` should + be used. In most other cases either indexing (to reduce the size) + or padding (to increase the size) may be a more appropriate solution. + + Warning: This functionality does **not** consider axes separately, + i.e. it does not apply interpolation/extrapolation. + It fills the return array with the required number of elements, iterating + over `a` in C-order, disregarding axes (and cycling back from the start if + the new shape is larger). This functionality is therefore not suitable to + resize images, or data where each axis represents a separate and distinct + entity. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[0,1],[2,3]]) + >>> np.resize(a,(2,3)) + array([[0, 1, 2], + [3, 0, 1]]) + >>> np.resize(a,(1,4)) + array([[0, 1, 2, 3]]) + >>> np.resize(a,(2,4)) + array([[0, 1, 2, 3], + [0, 1, 2, 3]]) + + """ + if isinstance(new_shape, (int, nt.integer)): + new_shape = (new_shape,) + + a = ravel(a) + + new_size = 1 + for dim_length in new_shape: + new_size *= dim_length + if dim_length < 0: + raise ValueError( + 'all elements of `new_shape` must be non-negative' + ) + + if a.size == 0 or new_size == 0: + # First case must zero fill. The second would have repeats == 0. + return np.zeros_like(a, shape=new_shape) + + repeats = -(-new_size // a.size) # ceil division + a = concatenate((a,) * repeats)[:new_size] + + return reshape(a, new_shape) + + +def _squeeze_dispatcher(a, axis=None): + return (a,) + + +@array_function_dispatch(_squeeze_dispatcher) +def squeeze(a, axis=None): + """ + Remove axes of length one from `a`. + + Parameters + ---------- + a : array_like + Input data. + axis : None or int or tuple of ints, optional + .. versionadded:: 1.7.0 + + Selects a subset of the entries of length one in the + shape. If an axis is selected with shape entry greater than + one, an error is raised. + + Returns + ------- + squeezed : ndarray + The input array, but with all or a subset of the + dimensions of length 1 removed. This is always `a` itself + or a view into `a`. Note that if all axes are squeezed, + the result is a 0d array and not a scalar. + + Raises + ------ + ValueError + If `axis` is not None, and an axis being squeezed is not of length 1 + + See Also + -------- + expand_dims : The inverse operation, adding entries of length one + reshape : Insert, remove, and combine dimensions, and resize existing ones + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[[0], [1], [2]]]) + >>> x.shape + (1, 3, 1) + >>> np.squeeze(x).shape + (3,) + >>> np.squeeze(x, axis=0).shape + (3, 1) + >>> np.squeeze(x, axis=1).shape + Traceback (most recent call last): + ... + ValueError: cannot select an axis to squeeze out which has size + not equal to one + >>> np.squeeze(x, axis=2).shape + (1, 3) + >>> x = np.array([[1234]]) + >>> x.shape + (1, 1) + >>> np.squeeze(x) + array(1234) # 0d array + >>> np.squeeze(x).shape + () + >>> np.squeeze(x)[()] + 1234 + + """ + try: + squeeze = a.squeeze + except AttributeError: + return _wrapit(a, 'squeeze', axis=axis) + if axis is None: + return squeeze() + else: + return squeeze(axis=axis) + + +def _diagonal_dispatcher(a, offset=None, axis1=None, axis2=None): + return (a,) + + +@array_function_dispatch(_diagonal_dispatcher) +def diagonal(a, offset=0, axis1=0, axis2=1): + """ + Return specified diagonals. + + If `a` is 2-D, returns the diagonal of `a` with the given offset, + i.e., the collection of elements of the form ``a[i, i+offset]``. If + `a` has more than two dimensions, then the axes specified by `axis1` + and `axis2` are used to determine the 2-D sub-array whose diagonal is + returned. The shape of the resulting array can be determined by + removing `axis1` and `axis2` and appending an index to the right equal + to the size of the resulting diagonals. + + In versions of NumPy prior to 1.7, this function always returned a new, + independent array containing a copy of the values in the diagonal. + + In NumPy 1.7 and 1.8, it continues to return a copy of the diagonal, + but depending on this fact is deprecated. Writing to the resulting + array continues to work as it used to, but a FutureWarning is issued. + + Starting in NumPy 1.9 it returns a read-only view on the original array. + Attempting to write to the resulting array will produce an error. + + In some future release, it will return a read/write view and writing to + the returned array will alter your original array. The returned array + will have the same type as the input array. + + If you don't write to the array returned by this function, then you can + just ignore all of the above. + + If you depend on the current behavior, then we suggest copying the + returned array explicitly, i.e., use ``np.diagonal(a).copy()`` instead + of just ``np.diagonal(a)``. This will work with both past and future + versions of NumPy. + + Parameters + ---------- + a : array_like + Array from which the diagonals are taken. + offset : int, optional + Offset of the diagonal from the main diagonal. Can be positive or + negative. Defaults to main diagonal (0). + axis1 : int, optional + Axis to be used as the first axis of the 2-D sub-arrays from which + the diagonals should be taken. Defaults to first axis (0). + axis2 : int, optional + Axis to be used as the second axis of the 2-D sub-arrays from + which the diagonals should be taken. Defaults to second axis (1). + + Returns + ------- + array_of_diagonals : ndarray + If `a` is 2-D, then a 1-D array containing the diagonal and of the + same type as `a` is returned unless `a` is a `matrix`, in which case + a 1-D array rather than a (2-D) `matrix` is returned in order to + maintain backward compatibility. + + If ``a.ndim > 2``, then the dimensions specified by `axis1` and `axis2` + are removed, and a new axis inserted at the end corresponding to the + diagonal. + + Raises + ------ + ValueError + If the dimension of `a` is less than 2. + + See Also + -------- + diag : MATLAB work-a-like for 1-D and 2-D arrays. + diagflat : Create diagonal arrays. + trace : Sum along diagonals. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(4).reshape(2,2) + >>> a + array([[0, 1], + [2, 3]]) + >>> a.diagonal() + array([0, 3]) + >>> a.diagonal(1) + array([1]) + + A 3-D example: + + >>> a = np.arange(8).reshape(2,2,2); a + array([[[0, 1], + [2, 3]], + [[4, 5], + [6, 7]]]) + >>> a.diagonal(0, # Main diagonals of two arrays created by skipping + ... 0, # across the outer(left)-most axis last and + ... 1) # the "middle" (row) axis first. + array([[0, 6], + [1, 7]]) + + The sub-arrays whose main diagonals we just obtained; note that each + corresponds to fixing the right-most (column) axis, and that the + diagonals are "packed" in rows. + + >>> a[:,:,0] # main diagonal is [0 6] + array([[0, 2], + [4, 6]]) + >>> a[:,:,1] # main diagonal is [1 7] + array([[1, 3], + [5, 7]]) + + The anti-diagonal can be obtained by reversing the order of elements + using either `numpy.flipud` or `numpy.fliplr`. + + >>> a = np.arange(9).reshape(3, 3) + >>> a + array([[0, 1, 2], + [3, 4, 5], + [6, 7, 8]]) + >>> np.fliplr(a).diagonal() # Horizontal flip + array([2, 4, 6]) + >>> np.flipud(a).diagonal() # Vertical flip + array([6, 4, 2]) + + Note that the order in which the diagonal is retrieved varies depending + on the flip function. + """ + if isinstance(a, np.matrix): + # Make diagonal of matrix 1-D to preserve backward compatibility. + return asarray(a).diagonal(offset=offset, axis1=axis1, axis2=axis2) + else: + return asanyarray(a).diagonal(offset=offset, axis1=axis1, axis2=axis2) + + +def _trace_dispatcher( + a, offset=None, axis1=None, axis2=None, dtype=None, out=None): + return (a, out) + + +@array_function_dispatch(_trace_dispatcher) +def trace(a, offset=0, axis1=0, axis2=1, dtype=None, out=None): + """ + Return the sum along diagonals of the array. + + If `a` is 2-D, the sum along its diagonal with the given offset + is returned, i.e., the sum of elements ``a[i,i+offset]`` for all i. + + If `a` has more than two dimensions, then the axes specified by axis1 and + axis2 are used to determine the 2-D sub-arrays whose traces are returned. + The shape of the resulting array is the same as that of `a` with `axis1` + and `axis2` removed. + + Parameters + ---------- + a : array_like + Input array, from which the diagonals are taken. + offset : int, optional + Offset of the diagonal from the main diagonal. Can be both positive + and negative. Defaults to 0. + axis1, axis2 : int, optional + Axes to be used as the first and second axis of the 2-D sub-arrays + from which the diagonals should be taken. Defaults are the first two + axes of `a`. + dtype : dtype, optional + Determines the data-type of the returned array and of the accumulator + where the elements are summed. If dtype has the value None and `a` is + of integer type of precision less than the default integer + precision, then the default integer precision is used. Otherwise, + the precision is the same as that of `a`. + out : ndarray, optional + Array into which the output is placed. Its type is preserved and + it must be of the right shape to hold the output. + + Returns + ------- + sum_along_diagonals : ndarray + If `a` is 2-D, the sum along the diagonal is returned. If `a` has + larger dimensions, then an array of sums along diagonals is returned. + + See Also + -------- + diag, diagonal, diagflat + + Examples + -------- + >>> import numpy as np + >>> np.trace(np.eye(3)) + 3.0 + >>> a = np.arange(8).reshape((2,2,2)) + >>> np.trace(a) + array([6, 8]) + + >>> a = np.arange(24).reshape((2,2,2,3)) + >>> np.trace(a).shape + (2, 3) + + """ + if isinstance(a, np.matrix): + # Get trace of matrix via an array to preserve backward compatibility. + return asarray(a).trace( + offset=offset, axis1=axis1, axis2=axis2, dtype=dtype, out=out + ) + else: + return asanyarray(a).trace( + offset=offset, axis1=axis1, axis2=axis2, dtype=dtype, out=out + ) + + +def _ravel_dispatcher(a, order=None): + return (a,) + + +@array_function_dispatch(_ravel_dispatcher) +def ravel(a, order='C'): + """Return a contiguous flattened array. + + A 1-D array, containing the elements of the input, is returned. A copy is + made only if needed. + + As of NumPy 1.10, the returned array will have the same type as the input + array. (for example, a masked array will be returned for a masked array + input) + + Parameters + ---------- + a : array_like + Input array. The elements in `a` are read in the order specified by + `order`, and packed as a 1-D array. + order : {'C','F', 'A', 'K'}, optional + + The elements of `a` are read using this index order. 'C' means + to index the elements in row-major, C-style order, + with the last axis index changing fastest, back to the first + axis index changing slowest. 'F' means to index the elements + in column-major, Fortran-style order, with the + first index changing fastest, and the last index changing + slowest. Note that the 'C' and 'F' options take no account of + the memory layout of the underlying array, and only refer to + the order of axis indexing. 'A' means to read the elements in + Fortran-like index order if `a` is Fortran *contiguous* in + memory, C-like order otherwise. 'K' means to read the + elements in the order they occur in memory, except for + reversing the data when strides are negative. By default, 'C' + index order is used. + + Returns + ------- + y : array_like + y is a contiguous 1-D array of the same subtype as `a`, + with shape ``(a.size,)``. + Note that matrices are special cased for backward compatibility, + if `a` is a matrix, then y is a 1-D ndarray. + + See Also + -------- + ndarray.flat : 1-D iterator over an array. + ndarray.flatten : 1-D array copy of the elements of an array + in row-major order. + ndarray.reshape : Change the shape of an array without changing its data. + + Notes + ----- + In row-major, C-style order, in two dimensions, the row index + varies the slowest, and the column index the quickest. This can + be generalized to multiple dimensions, where row-major order + implies that the index along the first axis varies slowest, and + the index along the last quickest. The opposite holds for + column-major, Fortran-style index ordering. + + When a view is desired in as many cases as possible, ``arr.reshape(-1)`` + may be preferable. However, ``ravel`` supports ``K`` in the optional + ``order`` argument while ``reshape`` does not. + + Examples + -------- + It is equivalent to ``reshape(-1, order=order)``. + + >>> import numpy as np + >>> x = np.array([[1, 2, 3], [4, 5, 6]]) + >>> np.ravel(x) + array([1, 2, 3, 4, 5, 6]) + + >>> x.reshape(-1) + array([1, 2, 3, 4, 5, 6]) + + >>> np.ravel(x, order='F') + array([1, 4, 2, 5, 3, 6]) + + When ``order`` is 'A', it will preserve the array's 'C' or 'F' ordering: + + >>> np.ravel(x.T) + array([1, 4, 2, 5, 3, 6]) + >>> np.ravel(x.T, order='A') + array([1, 2, 3, 4, 5, 6]) + + When ``order`` is 'K', it will preserve orderings that are neither 'C' + nor 'F', but won't reverse axes: + + >>> a = np.arange(3)[::-1]; a + array([2, 1, 0]) + >>> a.ravel(order='C') + array([2, 1, 0]) + >>> a.ravel(order='K') + array([2, 1, 0]) + + >>> a = np.arange(12).reshape(2,3,2).swapaxes(1,2); a + array([[[ 0, 2, 4], + [ 1, 3, 5]], + [[ 6, 8, 10], + [ 7, 9, 11]]]) + >>> a.ravel(order='C') + array([ 0, 2, 4, 1, 3, 5, 6, 8, 10, 7, 9, 11]) + >>> a.ravel(order='K') + array([ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) + + """ + if isinstance(a, np.matrix): + return asarray(a).ravel(order=order) + else: + return asanyarray(a).ravel(order=order) + + +def _nonzero_dispatcher(a): + return (a,) + + +@array_function_dispatch(_nonzero_dispatcher) +def nonzero(a): + """ + Return the indices of the elements that are non-zero. + + Returns a tuple of arrays, one for each dimension of `a`, + containing the indices of the non-zero elements in that + dimension. The values in `a` are always tested and returned in + row-major, C-style order. + + To group the indices by element, rather than dimension, use `argwhere`, + which returns a row for each non-zero element. + + .. note:: + + When called on a zero-d array or scalar, ``nonzero(a)`` is treated + as ``nonzero(atleast_1d(a))``. + + .. deprecated:: 1.17.0 + + Use `atleast_1d` explicitly if this behavior is deliberate. + + Parameters + ---------- + a : array_like + Input array. + + Returns + ------- + tuple_of_arrays : tuple + Indices of elements that are non-zero. + + See Also + -------- + flatnonzero : + Return indices that are non-zero in the flattened version of the input + array. + ndarray.nonzero : + Equivalent ndarray method. + count_nonzero : + Counts the number of non-zero elements in the input array. + + Notes + ----- + While the nonzero values can be obtained with ``a[nonzero(a)]``, it is + recommended to use ``x[x.astype(bool)]`` or ``x[x != 0]`` instead, which + will correctly handle 0-d arrays. + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[3, 0, 0], [0, 4, 0], [5, 6, 0]]) + >>> x + array([[3, 0, 0], + [0, 4, 0], + [5, 6, 0]]) + >>> np.nonzero(x) + (array([0, 1, 2, 2]), array([0, 1, 0, 1])) + + >>> x[np.nonzero(x)] + array([3, 4, 5, 6]) + >>> np.transpose(np.nonzero(x)) + array([[0, 0], + [1, 1], + [2, 0], + [2, 1]]) + + A common use for ``nonzero`` is to find the indices of an array, where + a condition is True. Given an array `a`, the condition `a` > 3 is a + boolean array and since False is interpreted as 0, np.nonzero(a > 3) + yields the indices of the `a` where the condition is true. + + >>> a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) + >>> a > 3 + array([[False, False, False], + [ True, True, True], + [ True, True, True]]) + >>> np.nonzero(a > 3) + (array([1, 1, 1, 2, 2, 2]), array([0, 1, 2, 0, 1, 2])) + + Using this result to index `a` is equivalent to using the mask directly: + + >>> a[np.nonzero(a > 3)] + array([4, 5, 6, 7, 8, 9]) + >>> a[a > 3] # prefer this spelling + array([4, 5, 6, 7, 8, 9]) + + ``nonzero`` can also be called as a method of the array. + + >>> (a > 3).nonzero() + (array([1, 1, 1, 2, 2, 2]), array([0, 1, 2, 0, 1, 2])) + + """ + return _wrapfunc(a, 'nonzero') + + +def _shape_dispatcher(a): + return (a,) + + +@array_function_dispatch(_shape_dispatcher) +def shape(a): + """ + Return the shape of an array. + + Parameters + ---------- + a : array_like + Input array. + + Returns + ------- + shape : tuple of ints + The elements of the shape tuple give the lengths of the + corresponding array dimensions. + + See Also + -------- + len : ``len(a)`` is equivalent to ``np.shape(a)[0]`` for N-D arrays with + ``N>=1``. + ndarray.shape : Equivalent array method. + + Examples + -------- + >>> import numpy as np + >>> np.shape(np.eye(3)) + (3, 3) + >>> np.shape([[1, 3]]) + (1, 2) + >>> np.shape([0]) + (1,) + >>> np.shape(0) + () + + >>> a = np.array([(1, 2), (3, 4), (5, 6)], + ... dtype=[('x', 'i4'), ('y', 'i4')]) + >>> np.shape(a) + (3,) + >>> a.shape + (3,) + + """ + try: + result = a.shape + except AttributeError: + result = asarray(a).shape + return result + + +def _compress_dispatcher(condition, a, axis=None, out=None): + return (condition, a, out) + + +@array_function_dispatch(_compress_dispatcher) +def compress(condition, a, axis=None, out=None): + """ + Return selected slices of an array along given axis. + + When working along a given axis, a slice along that axis is returned in + `output` for each index where `condition` evaluates to True. When + working on a 1-D array, `compress` is equivalent to `extract`. + + Parameters + ---------- + condition : 1-D array of bools + Array that selects which entries to return. If len(condition) + is less than the size of `a` along the given axis, then output is + truncated to the length of the condition array. + a : array_like + Array from which to extract a part. + axis : int, optional + Axis along which to take slices. If None (default), work on the + flattened array. + out : ndarray, optional + Output array. Its type is preserved and it must be of the right + shape to hold the output. + + Returns + ------- + compressed_array : ndarray + A copy of `a` without the slices along axis for which `condition` + is false. + + See Also + -------- + take, choose, diag, diagonal, select + ndarray.compress : Equivalent method in ndarray + extract : Equivalent method when working on 1-D arrays + :ref:`ufuncs-output-type` + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4], [5, 6]]) + >>> a + array([[1, 2], + [3, 4], + [5, 6]]) + >>> np.compress([0, 1], a, axis=0) + array([[3, 4]]) + >>> np.compress([False, True, True], a, axis=0) + array([[3, 4], + [5, 6]]) + >>> np.compress([False, True], a, axis=1) + array([[2], + [4], + [6]]) + + Working on the flattened array does not return slices along an axis but + selects elements. + + >>> np.compress([False, True], a) + array([2]) + + """ + return _wrapfunc(a, 'compress', condition, axis=axis, out=out) + + +def _clip_dispatcher(a, a_min=None, a_max=None, out=None, *, min=None, + max=None, **kwargs): + return (a, a_min, a_max, out, min, max) + + +@array_function_dispatch(_clip_dispatcher) +def clip(a, a_min=np._NoValue, a_max=np._NoValue, out=None, *, + min=np._NoValue, max=np._NoValue, **kwargs): + """ + Clip (limit) the values in an array. + + Given an interval, values outside the interval are clipped to + the interval edges. For example, if an interval of ``[0, 1]`` + is specified, values smaller than 0 become 0, and values larger + than 1 become 1. + + Equivalent to but faster than ``np.minimum(a_max, np.maximum(a, a_min))``. + + No check is performed to ensure ``a_min < a_max``. + + Parameters + ---------- + a : array_like + Array containing elements to clip. + a_min, a_max : array_like or None + Minimum and maximum value. If ``None``, clipping is not performed on + the corresponding edge. If both ``a_min`` and ``a_max`` are ``None``, + the elements of the returned array stay the same. Both are broadcasted + against ``a``. + out : ndarray, optional + The results will be placed in this array. It may be the input + array for in-place clipping. `out` must be of the right shape + to hold the output. Its type is preserved. + min, max : array_like or None + Array API compatible alternatives for ``a_min`` and ``a_max`` + arguments. Either ``a_min`` and ``a_max`` or ``min`` and ``max`` + can be passed at the same time. Default: ``None``. + + .. versionadded:: 2.1.0 + **kwargs + For other keyword-only arguments, see the + :ref:`ufunc docs `. + + .. versionadded:: 1.17.0 + + Returns + ------- + clipped_array : ndarray + An array with the elements of `a`, but where values + < `a_min` are replaced with `a_min`, and those > `a_max` + with `a_max`. + + See Also + -------- + :ref:`ufuncs-output-type` + + Notes + ----- + When `a_min` is greater than `a_max`, `clip` returns an + array in which all values are equal to `a_max`, + as shown in the second example. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(10) + >>> a + array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) + >>> np.clip(a, 1, 8) + array([1, 1, 2, 3, 4, 5, 6, 7, 8, 8]) + >>> np.clip(a, 8, 1) + array([1, 1, 1, 1, 1, 1, 1, 1, 1, 1]) + >>> np.clip(a, 3, 6, out=a) + array([3, 3, 3, 3, 4, 5, 6, 6, 6, 6]) + >>> a + array([3, 3, 3, 3, 4, 5, 6, 6, 6, 6]) + >>> a = np.arange(10) + >>> a + array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) + >>> np.clip(a, [3, 4, 1, 1, 1, 4, 4, 4, 4, 4], 8) + array([3, 4, 2, 3, 4, 5, 6, 7, 8, 8]) + + """ + if a_min is np._NoValue and a_max is np._NoValue: + a_min = None if min is np._NoValue else min + a_max = None if max is np._NoValue else max + elif a_min is np._NoValue: + raise TypeError("clip() missing 1 required positional " + "argument: 'a_min'") + elif a_max is np._NoValue: + raise TypeError("clip() missing 1 required positional " + "argument: 'a_max'") + elif min is not np._NoValue or max is not np._NoValue: + raise ValueError("Passing `min` or `max` keyword argument when " + "`a_min` and `a_max` are provided is forbidden.") + + return _wrapfunc(a, 'clip', a_min, a_max, out=out, **kwargs) + + +def _sum_dispatcher(a, axis=None, dtype=None, out=None, keepdims=None, + initial=None, where=None): + return (a, out) + + +@array_function_dispatch(_sum_dispatcher) +def sum(a, axis=None, dtype=None, out=None, keepdims=np._NoValue, + initial=np._NoValue, where=np._NoValue): + """ + Sum of array elements over a given axis. + + Parameters + ---------- + a : array_like + Elements to sum. + axis : None or int or tuple of ints, optional + Axis or axes along which a sum is performed. The default, + axis=None, will sum all of the elements of the input array. If + axis is negative it counts from the last to the first axis. + + .. versionadded:: 1.7.0 + + If axis is a tuple of ints, a sum is performed on all of the axes + specified in the tuple instead of a single axis or all the axes as + before. + dtype : dtype, optional + The type of the returned array and of the accumulator in which the + elements are summed. The dtype of `a` is used by default unless `a` + has an integer dtype of less precision than the default platform + integer. In that case, if `a` is signed then the platform integer + is used while if `a` is unsigned then an unsigned integer of the + same precision as the platform integer is used. + out : ndarray, optional + Alternative output array in which to place the result. It must have + the same shape as the expected output, but the type of the output + values will be cast if necessary. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `sum` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + initial : scalar, optional + Starting value for the sum. See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.15.0 + + where : array_like of bool, optional + Elements to include in the sum. See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.17.0 + + Returns + ------- + sum_along_axis : ndarray + An array with the same shape as `a`, with the specified + axis removed. If `a` is a 0-d array, or if `axis` is None, a scalar + is returned. If an output array is specified, a reference to + `out` is returned. + + See Also + -------- + ndarray.sum : Equivalent method. + add: ``numpy.add.reduce`` equivalent function. + cumsum : Cumulative sum of array elements. + trapezoid : Integration of array values using composite trapezoidal rule. + + mean, average + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. + + The sum of an empty array is the neutral element 0: + + >>> np.sum([]) + 0.0 + + For floating point numbers the numerical precision of sum (and + ``np.add.reduce``) is in general limited by directly adding each number + individually to the result causing rounding errors in every step. + However, often numpy will use a numerically better approach (partial + pairwise summation) leading to improved precision in many use-cases. + This improved precision is always provided when no ``axis`` is given. + When ``axis`` is given, it will depend on which axis is summed. + Technically, to provide the best speed possible, the improved precision + is only used when the summation is along the fast axis in memory. + Note that the exact precision may vary depending on other parameters. + In contrast to NumPy, Python's ``math.fsum`` function uses a slower but + more precise approach to summation. + Especially when summing a large number of lower precision floating point + numbers, such as ``float32``, numerical errors can become significant. + In such cases it can be advisable to use `dtype="float64"` to use a higher + precision for the output. + + Examples + -------- + >>> import numpy as np + >>> np.sum([0.5, 1.5]) + 2.0 + >>> np.sum([0.5, 0.7, 0.2, 1.5], dtype=np.int32) + 1 + >>> np.sum([[0, 1], [0, 5]]) + 6 + >>> np.sum([[0, 1], [0, 5]], axis=0) + array([0, 6]) + >>> np.sum([[0, 1], [0, 5]], axis=1) + array([1, 5]) + >>> np.sum([[0, 1], [np.nan, 5]], where=[False, True], axis=1) + array([1., 5.]) + + If the accumulator is too small, overflow occurs: + + >>> np.ones(128, dtype=np.int8).sum(dtype=np.int8) + -128 + + You can also start the sum with a value other than zero: + + >>> np.sum([10], initial=5) + 15 + """ + if isinstance(a, _gentype): + # 2018-02-25, 1.15.0 + warnings.warn( + "Calling np.sum(generator) is deprecated, and in the future will " + "give a different result. Use np.sum(np.fromiter(generator)) or " + "the python sum builtin instead.", + DeprecationWarning, stacklevel=2 + ) + + res = _sum_(a) + if out is not None: + out[...] = res + return out + return res + + return _wrapreduction( + a, np.add, 'sum', axis, dtype, out, + keepdims=keepdims, initial=initial, where=where + ) + + +def _any_dispatcher(a, axis=None, out=None, keepdims=None, *, + where=np._NoValue): + return (a, where, out) + + +@array_function_dispatch(_any_dispatcher) +def any(a, axis=None, out=None, keepdims=np._NoValue, *, where=np._NoValue): + """ + Test whether any array element along a given axis evaluates to True. + + Returns single boolean if `axis` is ``None`` + + Parameters + ---------- + a : array_like + Input array or object that can be converted to an array. + axis : None or int or tuple of ints, optional + Axis or axes along which a logical OR reduction is performed. + The default (``axis=None``) is to perform a logical OR over all + the dimensions of the input array. `axis` may be negative, in + which case it counts from the last to the first axis. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, a reduction is performed on multiple + axes, instead of a single axis or all the axes as before. + out : ndarray, optional + Alternate output array in which to place the result. It must have + the same shape as the expected output and its type is preserved + (e.g., if it is of type float, then it will remain so, returning + 1.0 for True and 0.0 for False, regardless of the type of `a`). + See :ref:`ufuncs-output-type` for more details. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `any` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + where : array_like of bool, optional + Elements to include in checking for any `True` values. + See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.20.0 + + Returns + ------- + any : bool or ndarray + A new boolean or `ndarray` is returned unless `out` is specified, + in which case a reference to `out` is returned. + + See Also + -------- + ndarray.any : equivalent method + + all : Test whether all elements along a given axis evaluate to True. + + Notes + ----- + Not a Number (NaN), positive infinity and negative infinity evaluate + to `True` because these are not equal to zero. + + .. versionchanged:: 2.0 + Before NumPy 2.0, ``any`` did not return booleans for object dtype + input arrays. + This behavior is still available via ``np.logical_or.reduce``. + + Examples + -------- + >>> import numpy as np + >>> np.any([[True, False], [True, True]]) + True + + >>> np.any([[True, False, True ], + ... [False, False, False]], axis=0) + array([ True, False, True]) + + >>> np.any([-1, 0, 5]) + True + + >>> np.any([[np.nan], [np.inf]], axis=1, keepdims=True) + array([[ True], + [ True]]) + + >>> np.any([[True, False], [False, False]], where=[[False], [True]]) + False + + >>> a = np.array([[1, 0, 0], + ... [0, 0, 1], + ... [0, 0, 0]]) + >>> np.any(a, axis=0) + array([ True, False, True]) + >>> np.any(a, axis=1) + array([ True, True, False]) + + >>> o=np.array(False) + >>> z=np.any([-1, 4, 5], out=o) + >>> z, o + (array(True), array(True)) + >>> # Check now that z is a reference to o + >>> z is o + True + >>> id(z), id(o) # identity of z and o # doctest: +SKIP + (191614240, 191614240) + + """ + return _wrapreduction_any_all(a, np.logical_or, 'any', axis, out, + keepdims=keepdims, where=where) + + +def _all_dispatcher(a, axis=None, out=None, keepdims=None, *, + where=None): + return (a, where, out) + + +@array_function_dispatch(_all_dispatcher) +def all(a, axis=None, out=None, keepdims=np._NoValue, *, where=np._NoValue): + """ + Test whether all array elements along a given axis evaluate to True. + + Parameters + ---------- + a : array_like + Input array or object that can be converted to an array. + axis : None or int or tuple of ints, optional + Axis or axes along which a logical AND reduction is performed. + The default (``axis=None``) is to perform a logical AND over all + the dimensions of the input array. `axis` may be negative, in + which case it counts from the last to the first axis. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, a reduction is performed on multiple + axes, instead of a single axis or all the axes as before. + out : ndarray, optional + Alternate output array in which to place the result. + It must have the same shape as the expected output and its + type is preserved (e.g., if ``dtype(out)`` is float, the result + will consist of 0.0's and 1.0's). See :ref:`ufuncs-output-type` + for more details. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `all` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + where : array_like of bool, optional + Elements to include in checking for all `True` values. + See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.20.0 + + Returns + ------- + all : ndarray, bool + A new boolean or array is returned unless `out` is specified, + in which case a reference to `out` is returned. + + See Also + -------- + ndarray.all : equivalent method + + any : Test whether any element along a given axis evaluates to True. + + Notes + ----- + Not a Number (NaN), positive infinity and negative infinity + evaluate to `True` because these are not equal to zero. + + .. versionchanged:: 2.0 + Before NumPy 2.0, ``all`` did not return booleans for object dtype + input arrays. + This behavior is still available via ``np.logical_and.reduce``. + + Examples + -------- + >>> import numpy as np + >>> np.all([[True,False],[True,True]]) + False + + >>> np.all([[True,False],[True,True]], axis=0) + array([ True, False]) + + >>> np.all([-1, 4, 5]) + True + + >>> np.all([1.0, np.nan]) + True + + >>> np.all([[True, True], [False, True]], where=[[True], [False]]) + True + + >>> o=np.array(False) + >>> z=np.all([-1, 4, 5], out=o) + >>> id(z), id(o), z + (28293632, 28293632, array(True)) # may vary + + """ + return _wrapreduction_any_all(a, np.logical_and, 'all', axis, out, + keepdims=keepdims, where=where) + + +def _cumulative_func(x, func, axis, dtype, out, include_initial): + x = np.atleast_1d(x) + x_ndim = x.ndim + if axis is None: + if x_ndim >= 2: + raise ValueError("For arrays which have more than one dimension " + "``axis`` argument is required.") + axis = 0 + + if out is not None and include_initial: + item = [slice(None)] * x_ndim + item[axis] = slice(1, None) + func.accumulate(x, axis=axis, dtype=dtype, out=out[tuple(item)]) + item[axis] = 0 + out[tuple(item)] = func.identity + return out + + res = func.accumulate(x, axis=axis, dtype=dtype, out=out) + if include_initial: + initial_shape = list(x.shape) + initial_shape[axis] = 1 + res = np.concat( + [np.full_like(res, func.identity, shape=initial_shape), res], + axis=axis, + ) + + return res + + +def _cumulative_prod_dispatcher(x, /, *, axis=None, dtype=None, out=None, + include_initial=None): + return (x, out) + + +@array_function_dispatch(_cumulative_prod_dispatcher) +def cumulative_prod(x, /, *, axis=None, dtype=None, out=None, + include_initial=False): + """ + Return the cumulative product of elements along a given axis. + + This function is an Array API compatible alternative to `numpy.cumprod`. + + Parameters + ---------- + x : array_like + Input array. + axis : int, optional + Axis along which the cumulative product is computed. The default + (None) is only allowed for one-dimensional arrays. For arrays + with more than one dimension ``axis`` is required. + dtype : dtype, optional + Type of the returned array, as well as of the accumulator in which + the elements are multiplied. If ``dtype`` is not specified, it + defaults to the dtype of ``x``, unless ``x`` has an integer dtype + with a precision less than that of the default platform integer. + In that case, the default platform integer is used instead. + out : ndarray, optional + Alternative output array in which to place the result. It must + have the same shape and buffer length as the expected output + but the type of the resulting values will be cast if necessary. + See :ref:`ufuncs-output-type` for more details. + include_initial : bool, optional + Boolean indicating whether to include the initial value (ones) as + the first value in the output. With ``include_initial=True`` + the shape of the output is different than the shape of the input. + Default: ``False``. + + Returns + ------- + cumulative_prod_along_axis : ndarray + A new array holding the result is returned unless ``out`` is + specified, in which case a reference to ``out`` is returned. The + result has the same shape as ``x`` if ``include_initial=False``. + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. + + Examples + -------- + >>> a = np.array([1, 2, 3]) + >>> np.cumulative_prod(a) # intermediate results 1, 1*2 + ... # total product 1*2*3 = 6 + array([1, 2, 6]) + >>> a = np.array([1, 2, 3, 4, 5, 6]) + >>> np.cumulative_prod(a, dtype=float) # specify type of output + array([ 1., 2., 6., 24., 120., 720.]) + + The cumulative product for each column (i.e., over the rows) of ``b``: + + >>> b = np.array([[1, 2, 3], [4, 5, 6]]) + >>> np.cumulative_prod(b, axis=0) + array([[ 1, 2, 3], + [ 4, 10, 18]]) + + The cumulative product for each row (i.e. over the columns) of ``b``: + + >>> np.cumulative_prod(b, axis=1) + array([[ 1, 2, 6], + [ 4, 20, 120]]) + + """ + return _cumulative_func(x, um.multiply, axis, dtype, out, include_initial) + + +def _cumulative_sum_dispatcher(x, /, *, axis=None, dtype=None, out=None, + include_initial=None): + return (x, out) + + +@array_function_dispatch(_cumulative_sum_dispatcher) +def cumulative_sum(x, /, *, axis=None, dtype=None, out=None, + include_initial=False): + """ + Return the cumulative sum of the elements along a given axis. + + This function is an Array API compatible alternative to `numpy.cumsum`. + + Parameters + ---------- + x : array_like + Input array. + axis : int, optional + Axis along which the cumulative sum is computed. The default + (None) is only allowed for one-dimensional arrays. For arrays + with more than one dimension ``axis`` is required. + dtype : dtype, optional + Type of the returned array and of the accumulator in which the + elements are summed. If ``dtype`` is not specified, it defaults + to the dtype of ``x``, unless ``x`` has an integer dtype with + a precision less than that of the default platform integer. + In that case, the default platform integer is used. + out : ndarray, optional + Alternative output array in which to place the result. It must + have the same shape and buffer length as the expected output + but the type will be cast if necessary. See :ref:`ufuncs-output-type` + for more details. + include_initial : bool, optional + Boolean indicating whether to include the initial value (ones) as + the first value in the output. With ``include_initial=True`` + the shape of the output is different than the shape of the input. + Default: ``False``. + + Returns + ------- + cumulative_sum_along_axis : ndarray + A new array holding the result is returned unless ``out`` is + specified, in which case a reference to ``out`` is returned. The + result has the same shape as ``x`` if ``include_initial=False``. + + See Also + -------- + sum : Sum array elements. + trapezoid : Integration of array values using composite trapezoidal rule. + diff : Calculate the n-th discrete difference along given axis. + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. + + ``cumulative_sum(a)[-1]`` may not be equal to ``sum(a)`` for + floating-point values since ``sum`` may use a pairwise summation routine, + reducing the roundoff-error. See `sum` for more information. + + Examples + -------- + >>> a = np.array([1, 2, 3, 4, 5, 6]) + >>> a + array([1, 2, 3, 4, 5, 6]) + >>> np.cumulative_sum(a) + array([ 1, 3, 6, 10, 15, 21]) + >>> np.cumulative_sum(a, dtype=float) # specifies type of output value(s) + array([ 1., 3., 6., 10., 15., 21.]) + + >>> b = np.array([[1, 2, 3], [4, 5, 6]]) + >>> np.cumulative_sum(b,axis=0) # sum over rows for each of the 3 columns + array([[1, 2, 3], + [5, 7, 9]]) + >>> np.cumulative_sum(b,axis=1) # sum over columns for each of the 2 rows + array([[ 1, 3, 6], + [ 4, 9, 15]]) + + ``cumulative_sum(c)[-1]`` may not be equal to ``sum(c)`` + + >>> c = np.array([1, 2e-9, 3e-9] * 1000000) + >>> np.cumulative_sum(c)[-1] + 1000000.0050045159 + >>> c.sum() + 1000000.0050000029 + + """ + return _cumulative_func(x, um.add, axis, dtype, out, include_initial) + + +def _cumsum_dispatcher(a, axis=None, dtype=None, out=None): + return (a, out) + + +@array_function_dispatch(_cumsum_dispatcher) +def cumsum(a, axis=None, dtype=None, out=None): + """ + Return the cumulative sum of the elements along a given axis. + + Parameters + ---------- + a : array_like + Input array. + axis : int, optional + Axis along which the cumulative sum is computed. The default + (None) is to compute the cumsum over the flattened array. + dtype : dtype, optional + Type of the returned array and of the accumulator in which the + elements are summed. If `dtype` is not specified, it defaults + to the dtype of `a`, unless `a` has an integer dtype with a + precision less than that of the default platform integer. In + that case, the default platform integer is used. + out : ndarray, optional + Alternative output array in which to place the result. It must + have the same shape and buffer length as the expected output + but the type will be cast if necessary. See :ref:`ufuncs-output-type` + for more details. + + Returns + ------- + cumsum_along_axis : ndarray. + A new array holding the result is returned unless `out` is + specified, in which case a reference to `out` is returned. The + result has the same size as `a`, and the same shape as `a` if + `axis` is not None or `a` is a 1-d array. + + See Also + -------- + cumulative_sum : Array API compatible alternative for ``cumsum``. + sum : Sum array elements. + trapezoid : Integration of array values using composite trapezoidal rule. + diff : Calculate the n-th discrete difference along given axis. + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. + + ``cumsum(a)[-1]`` may not be equal to ``sum(a)`` for floating-point + values since ``sum`` may use a pairwise summation routine, reducing + the roundoff-error. See `sum` for more information. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,2,3], [4,5,6]]) + >>> a + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.cumsum(a) + array([ 1, 3, 6, 10, 15, 21]) + >>> np.cumsum(a, dtype=float) # specifies type of output value(s) + array([ 1., 3., 6., 10., 15., 21.]) + + >>> np.cumsum(a,axis=0) # sum over rows for each of the 3 columns + array([[1, 2, 3], + [5, 7, 9]]) + >>> np.cumsum(a,axis=1) # sum over columns for each of the 2 rows + array([[ 1, 3, 6], + [ 4, 9, 15]]) + + ``cumsum(b)[-1]`` may not be equal to ``sum(b)`` + + >>> b = np.array([1, 2e-9, 3e-9] * 1000000) + >>> b.cumsum()[-1] + 1000000.0050045159 + >>> b.sum() + 1000000.0050000029 + + """ + return _wrapfunc(a, 'cumsum', axis=axis, dtype=dtype, out=out) + + +def _ptp_dispatcher(a, axis=None, out=None, keepdims=None): + return (a, out) + + +@array_function_dispatch(_ptp_dispatcher) +def ptp(a, axis=None, out=None, keepdims=np._NoValue): + """ + Range of values (maximum - minimum) along an axis. + + The name of the function comes from the acronym for 'peak to peak'. + + .. warning:: + `ptp` preserves the data type of the array. This means the + return value for an input of signed integers with n bits + (e.g. `numpy.int8`, `numpy.int16`, etc) is also a signed integer + with n bits. In that case, peak-to-peak values greater than + ``2**(n-1)-1`` will be returned as negative values. An example + with a work-around is shown below. + + Parameters + ---------- + a : array_like + Input values. + axis : None or int or tuple of ints, optional + Axis along which to find the peaks. By default, flatten the + array. `axis` may be negative, in + which case it counts from the last to the first axis. + + .. versionadded:: 1.15.0 + + If this is a tuple of ints, a reduction is performed on multiple + axes, instead of a single axis or all the axes as before. + out : array_like + Alternative output array in which to place the result. It must + have the same shape and buffer length as the expected output, + but the type of the output values will be cast if necessary. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `ptp` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + Returns + ------- + ptp : ndarray or scalar + The range of a given array - `scalar` if array is one-dimensional + or a new array holding the result along the given axis + + Examples + -------- + >>> import numpy as np + >>> x = np.array([[4, 9, 2, 10], + ... [6, 9, 7, 12]]) + + >>> np.ptp(x, axis=1) + array([8, 6]) + + >>> np.ptp(x, axis=0) + array([2, 0, 5, 2]) + + >>> np.ptp(x) + 10 + + This example shows that a negative value can be returned when + the input is an array of signed integers. + + >>> y = np.array([[1, 127], + ... [0, 127], + ... [-1, 127], + ... [-2, 127]], dtype=np.int8) + >>> np.ptp(y, axis=1) + array([ 126, 127, -128, -127], dtype=int8) + + A work-around is to use the `view()` method to view the result as + unsigned integers with the same bit width: + + >>> np.ptp(y, axis=1).view(np.uint8) + array([126, 127, 128, 129], dtype=uint8) + + """ + kwargs = {} + if keepdims is not np._NoValue: + kwargs['keepdims'] = keepdims + return _methods._ptp(a, axis=axis, out=out, **kwargs) + + +def _max_dispatcher(a, axis=None, out=None, keepdims=None, initial=None, + where=None): + return (a, out) + + +@array_function_dispatch(_max_dispatcher) +@set_module('numpy') +def max(a, axis=None, out=None, keepdims=np._NoValue, initial=np._NoValue, + where=np._NoValue): + """ + Return the maximum of an array or maximum along an axis. + + Parameters + ---------- + a : array_like + Input data. + axis : None or int or tuple of ints, optional + Axis or axes along which to operate. By default, flattened input is + used. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, the maximum is selected over multiple axes, + instead of a single axis or all the axes as before. + out : ndarray, optional + Alternative output array in which to place the result. Must + be of the same shape and buffer length as the expected output. + See :ref:`ufuncs-output-type` for more details. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the ``max`` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + initial : scalar, optional + The minimum value of an output element. Must be present to allow + computation on empty slice. See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.15.0 + + where : array_like of bool, optional + Elements to compare for the maximum. See `~numpy.ufunc.reduce` + for details. + + .. versionadded:: 1.17.0 + + Returns + ------- + max : ndarray or scalar + Maximum of `a`. If `axis` is None, the result is a scalar value. + If `axis` is an int, the result is an array of dimension + ``a.ndim - 1``. If `axis` is a tuple, the result is an array of + dimension ``a.ndim - len(axis)``. + + See Also + -------- + amin : + The minimum value of an array along a given axis, propagating any NaNs. + nanmax : + The maximum value of an array along a given axis, ignoring any NaNs. + maximum : + Element-wise maximum of two arrays, propagating any NaNs. + fmax : + Element-wise maximum of two arrays, ignoring any NaNs. + argmax : + Return the indices of the maximum values. + + nanmin, minimum, fmin + + Notes + ----- + NaN values are propagated, that is if at least one item is NaN, the + corresponding max value will be NaN as well. To ignore NaN values + (MATLAB behavior), please use nanmax. + + Don't use `~numpy.max` for element-wise comparison of 2 arrays; when + ``a.shape[0]`` is 2, ``maximum(a[0], a[1])`` is faster than + ``max(a, axis=0)``. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(4).reshape((2,2)) + >>> a + array([[0, 1], + [2, 3]]) + >>> np.max(a) # Maximum of the flattened array + 3 + >>> np.max(a, axis=0) # Maxima along the first axis + array([2, 3]) + >>> np.max(a, axis=1) # Maxima along the second axis + array([1, 3]) + >>> np.max(a, where=[False, True], initial=-1, axis=0) + array([-1, 3]) + >>> b = np.arange(5, dtype=float) + >>> b[2] = np.nan + >>> np.max(b) + np.float64(nan) + >>> np.max(b, where=~np.isnan(b), initial=-1) + 4.0 + >>> np.nanmax(b) + 4.0 + + You can use an initial value to compute the maximum of an empty slice, or + to initialize it to a different value: + + >>> np.max([[-50], [10]], axis=-1, initial=0) + array([ 0, 10]) + + Notice that the initial value is used as one of the elements for which the + maximum is determined, unlike for the default argument Python's max + function, which is only used for empty iterables. + + >>> np.max([5], initial=6) + 6 + >>> max([5], default=6) + 5 + """ + return _wrapreduction(a, np.maximum, 'max', axis, None, out, + keepdims=keepdims, initial=initial, where=where) + + +@array_function_dispatch(_max_dispatcher) +def amax(a, axis=None, out=None, keepdims=np._NoValue, initial=np._NoValue, + where=np._NoValue): + """ + Return the maximum of an array or maximum along an axis. + + `amax` is an alias of `~numpy.max`. + + See Also + -------- + max : alias of this function + ndarray.max : equivalent method + """ + return _wrapreduction(a, np.maximum, 'max', axis, None, out, + keepdims=keepdims, initial=initial, where=where) + + +def _min_dispatcher(a, axis=None, out=None, keepdims=None, initial=None, + where=None): + return (a, out) + + +@array_function_dispatch(_min_dispatcher) +def min(a, axis=None, out=None, keepdims=np._NoValue, initial=np._NoValue, + where=np._NoValue): + """ + Return the minimum of an array or minimum along an axis. + + Parameters + ---------- + a : array_like + Input data. + axis : None or int or tuple of ints, optional + Axis or axes along which to operate. By default, flattened input is + used. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, the minimum is selected over multiple axes, + instead of a single axis or all the axes as before. + out : ndarray, optional + Alternative output array in which to place the result. Must + be of the same shape and buffer length as the expected output. + See :ref:`ufuncs-output-type` for more details. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the ``min`` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + initial : scalar, optional + The maximum value of an output element. Must be present to allow + computation on empty slice. See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.15.0 + + where : array_like of bool, optional + Elements to compare for the minimum. See `~numpy.ufunc.reduce` + for details. + + .. versionadded:: 1.17.0 + + Returns + ------- + min : ndarray or scalar + Minimum of `a`. If `axis` is None, the result is a scalar value. + If `axis` is an int, the result is an array of dimension + ``a.ndim - 1``. If `axis` is a tuple, the result is an array of + dimension ``a.ndim - len(axis)``. + + See Also + -------- + amax : + The maximum value of an array along a given axis, propagating any NaNs. + nanmin : + The minimum value of an array along a given axis, ignoring any NaNs. + minimum : + Element-wise minimum of two arrays, propagating any NaNs. + fmin : + Element-wise minimum of two arrays, ignoring any NaNs. + argmin : + Return the indices of the minimum values. + + nanmax, maximum, fmax + + Notes + ----- + NaN values are propagated, that is if at least one item is NaN, the + corresponding min value will be NaN as well. To ignore NaN values + (MATLAB behavior), please use nanmin. + + Don't use `~numpy.min` for element-wise comparison of 2 arrays; when + ``a.shape[0]`` is 2, ``minimum(a[0], a[1])`` is faster than + ``min(a, axis=0)``. + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(4).reshape((2,2)) + >>> a + array([[0, 1], + [2, 3]]) + >>> np.min(a) # Minimum of the flattened array + 0 + >>> np.min(a, axis=0) # Minima along the first axis + array([0, 1]) + >>> np.min(a, axis=1) # Minima along the second axis + array([0, 2]) + >>> np.min(a, where=[False, True], initial=10, axis=0) + array([10, 1]) + + >>> b = np.arange(5, dtype=float) + >>> b[2] = np.nan + >>> np.min(b) + np.float64(nan) + >>> np.min(b, where=~np.isnan(b), initial=10) + 0.0 + >>> np.nanmin(b) + 0.0 + + >>> np.min([[-50], [10]], axis=-1, initial=0) + array([-50, 0]) + + Notice that the initial value is used as one of the elements for which the + minimum is determined, unlike for the default argument Python's max + function, which is only used for empty iterables. + + Notice that this isn't the same as Python's ``default`` argument. + + >>> np.min([6], initial=5) + 5 + >>> min([6], default=5) + 6 + """ + return _wrapreduction(a, np.minimum, 'min', axis, None, out, + keepdims=keepdims, initial=initial, where=where) + + +@array_function_dispatch(_min_dispatcher) +def amin(a, axis=None, out=None, keepdims=np._NoValue, initial=np._NoValue, + where=np._NoValue): + """ + Return the minimum of an array or minimum along an axis. + + `amin` is an alias of `~numpy.min`. + + See Also + -------- + min : alias of this function + ndarray.min : equivalent method + """ + return _wrapreduction(a, np.minimum, 'min', axis, None, out, + keepdims=keepdims, initial=initial, where=where) + + +def _prod_dispatcher(a, axis=None, dtype=None, out=None, keepdims=None, + initial=None, where=None): + return (a, out) + + +@array_function_dispatch(_prod_dispatcher) +def prod(a, axis=None, dtype=None, out=None, keepdims=np._NoValue, + initial=np._NoValue, where=np._NoValue): + """ + Return the product of array elements over a given axis. + + Parameters + ---------- + a : array_like + Input data. + axis : None or int or tuple of ints, optional + Axis or axes along which a product is performed. The default, + axis=None, will calculate the product of all the elements in the + input array. If axis is negative it counts from the last to the + first axis. + + .. versionadded:: 1.7.0 + + If axis is a tuple of ints, a product is performed on all of the + axes specified in the tuple instead of a single axis or all the + axes as before. + dtype : dtype, optional + The type of the returned array, as well as of the accumulator in + which the elements are multiplied. The dtype of `a` is used by + default unless `a` has an integer dtype of less precision than the + default platform integer. In that case, if `a` is signed then the + platform integer is used while if `a` is unsigned then an unsigned + integer of the same precision as the platform integer is used. + out : ndarray, optional + Alternative output array in which to place the result. It must have + the same shape as the expected output, but the type of the output + values will be cast if necessary. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left in the + result as dimensions with size one. With this option, the result + will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `prod` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + initial : scalar, optional + The starting value for this product. See `~numpy.ufunc.reduce` + for details. + + .. versionadded:: 1.15.0 + + where : array_like of bool, optional + Elements to include in the product. See `~numpy.ufunc.reduce` + for details. + + .. versionadded:: 1.17.0 + + Returns + ------- + product_along_axis : ndarray, see `dtype` parameter above. + An array shaped as `a` but with the specified axis removed. + Returns a reference to `out` if specified. + + See Also + -------- + ndarray.prod : equivalent method + :ref:`ufuncs-output-type` + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. That means that, on a 32-bit platform: + + >>> x = np.array([536870910, 536870910, 536870910, 536870910]) + >>> np.prod(x) + 16 # may vary + + The product of an empty array is the neutral element 1: + + >>> np.prod([]) + 1.0 + + Examples + -------- + By default, calculate the product of all elements: + + >>> import numpy as np + >>> np.prod([1.,2.]) + 2.0 + + Even when the input array is two-dimensional: + + >>> a = np.array([[1., 2.], [3., 4.]]) + >>> np.prod(a) + 24.0 + + But we can also specify the axis over which to multiply: + + >>> np.prod(a, axis=1) + array([ 2., 12.]) + >>> np.prod(a, axis=0) + array([3., 8.]) + + Or select specific elements to include: + + >>> np.prod([1., np.nan, 3.], where=[True, False, True]) + 3.0 + + If the type of `x` is unsigned, then the output type is + the unsigned platform integer: + + >>> x = np.array([1, 2, 3], dtype=np.uint8) + >>> np.prod(x).dtype == np.uint + True + + If `x` is of a signed integer type, then the output type + is the default platform integer: + + >>> x = np.array([1, 2, 3], dtype=np.int8) + >>> np.prod(x).dtype == int + True + + You can also start the product with a value other than one: + + >>> np.prod([1, 2], initial=5) + 10 + """ + return _wrapreduction(a, np.multiply, 'prod', axis, dtype, out, + keepdims=keepdims, initial=initial, where=where) + + +def _cumprod_dispatcher(a, axis=None, dtype=None, out=None): + return (a, out) + + +@array_function_dispatch(_cumprod_dispatcher) +def cumprod(a, axis=None, dtype=None, out=None): + """ + Return the cumulative product of elements along a given axis. + + Parameters + ---------- + a : array_like + Input array. + axis : int, optional + Axis along which the cumulative product is computed. By default + the input is flattened. + dtype : dtype, optional + Type of the returned array, as well as of the accumulator in which + the elements are multiplied. If *dtype* is not specified, it + defaults to the dtype of `a`, unless `a` has an integer dtype with + a precision less than that of the default platform integer. In + that case, the default platform integer is used instead. + out : ndarray, optional + Alternative output array in which to place the result. It must + have the same shape and buffer length as the expected output + but the type of the resulting values will be cast if necessary. + + Returns + ------- + cumprod : ndarray + A new array holding the result is returned unless `out` is + specified, in which case a reference to out is returned. + + See Also + -------- + cumulative_prod : Array API compatible alternative for ``cumprod``. + :ref:`ufuncs-output-type` + + Notes + ----- + Arithmetic is modular when using integer types, and no error is + raised on overflow. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([1,2,3]) + >>> np.cumprod(a) # intermediate results 1, 1*2 + ... # total product 1*2*3 = 6 + array([1, 2, 6]) + >>> a = np.array([[1, 2, 3], [4, 5, 6]]) + >>> np.cumprod(a, dtype=float) # specify type of output + array([ 1., 2., 6., 24., 120., 720.]) + + The cumulative product for each column (i.e., over the rows) of `a`: + + >>> np.cumprod(a, axis=0) + array([[ 1, 2, 3], + [ 4, 10, 18]]) + + The cumulative product for each row (i.e. over the columns) of `a`: + + >>> np.cumprod(a,axis=1) + array([[ 1, 2, 6], + [ 4, 20, 120]]) + + """ + return _wrapfunc(a, 'cumprod', axis=axis, dtype=dtype, out=out) + + +def _ndim_dispatcher(a): + return (a,) + + +@array_function_dispatch(_ndim_dispatcher) +def ndim(a): + """ + Return the number of dimensions of an array. + + Parameters + ---------- + a : array_like + Input array. If it is not already an ndarray, a conversion is + attempted. + + Returns + ------- + number_of_dimensions : int + The number of dimensions in `a`. Scalars are zero-dimensional. + + See Also + -------- + ndarray.ndim : equivalent method + shape : dimensions of array + ndarray.shape : dimensions of array + + Examples + -------- + >>> import numpy as np + >>> np.ndim([[1,2,3],[4,5,6]]) + 2 + >>> np.ndim(np.array([[1,2,3],[4,5,6]])) + 2 + >>> np.ndim(1) + 0 + + """ + try: + return a.ndim + except AttributeError: + return asarray(a).ndim + + +def _size_dispatcher(a, axis=None): + return (a,) + + +@array_function_dispatch(_size_dispatcher) +def size(a, axis=None): + """ + Return the number of elements along a given axis. + + Parameters + ---------- + a : array_like + Input data. + axis : int, optional + Axis along which the elements are counted. By default, give + the total number of elements. + + Returns + ------- + element_count : int + Number of elements along the specified axis. + + See Also + -------- + shape : dimensions of array + ndarray.shape : dimensions of array + ndarray.size : number of elements in array + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1,2,3],[4,5,6]]) + >>> np.size(a) + 6 + >>> np.size(a,1) + 3 + >>> np.size(a,0) + 2 + + """ + if axis is None: + try: + return a.size + except AttributeError: + return asarray(a).size + else: + try: + return a.shape[axis] + except AttributeError: + return asarray(a).shape[axis] + + +def _round_dispatcher(a, decimals=None, out=None): + return (a, out) + + +@array_function_dispatch(_round_dispatcher) +def round(a, decimals=0, out=None): + """ + Evenly round to the given number of decimals. + + Parameters + ---------- + a : array_like + Input data. + decimals : int, optional + Number of decimal places to round to (default: 0). If + decimals is negative, it specifies the number of positions to + the left of the decimal point. + out : ndarray, optional + Alternative output array in which to place the result. It must have + the same shape as the expected output, but the type of the output + values will be cast if necessary. See :ref:`ufuncs-output-type` + for more details. + + Returns + ------- + rounded_array : ndarray + An array of the same type as `a`, containing the rounded values. + Unless `out` was specified, a new array is created. A reference to + the result is returned. + + The real and imaginary parts of complex numbers are rounded + separately. The result of rounding a float is a float. + + See Also + -------- + ndarray.round : equivalent method + around : an alias for this function + ceil, fix, floor, rint, trunc + + + Notes + ----- + For values exactly halfway between rounded decimal values, NumPy + rounds to the nearest even value. Thus 1.5 and 2.5 round to 2.0, + -0.5 and 0.5 round to 0.0, etc. + + ``np.round`` uses a fast but sometimes inexact algorithm to round + floating-point datatypes. For positive `decimals` it is equivalent to + ``np.true_divide(np.rint(a * 10**decimals), 10**decimals)``, which has + error due to the inexact representation of decimal fractions in the IEEE + floating point standard [1]_ and errors introduced when scaling by powers + of ten. For instance, note the extra "1" in the following: + + >>> np.round(56294995342131.5, 3) + 56294995342131.51 + + If your goal is to print such values with a fixed number of decimals, it is + preferable to use numpy's float printing routines to limit the number of + printed decimals: + + >>> np.format_float_positional(56294995342131.5, precision=3) + '56294995342131.5' + + The float printing routines use an accurate but much more computationally + demanding algorithm to compute the number of digits after the decimal + point. + + Alternatively, Python's builtin `round` function uses a more accurate + but slower algorithm for 64-bit floating point values: + + >>> round(56294995342131.5, 3) + 56294995342131.5 + >>> np.round(16.055, 2), round(16.055, 2) # equals 16.0549999999999997 + (16.06, 16.05) + + + References + ---------- + .. [1] "Lecture Notes on the Status of IEEE 754", William Kahan, + https://people.eecs.berkeley.edu/~wkahan/ieee754status/IEEE754.PDF + + Examples + -------- + >>> import numpy as np + >>> np.round([0.37, 1.64]) + array([0., 2.]) + >>> np.round([0.37, 1.64], decimals=1) + array([0.4, 1.6]) + >>> np.round([.5, 1.5, 2.5, 3.5, 4.5]) # rounds to nearest even value + array([0., 2., 2., 4., 4.]) + >>> np.round([1,2,3,11], decimals=1) # ndarray of ints is returned + array([ 1, 2, 3, 11]) + >>> np.round([1,2,3,11], decimals=-1) + array([ 0, 0, 0, 10]) + + """ + return _wrapfunc(a, 'round', decimals=decimals, out=out) + + +@array_function_dispatch(_round_dispatcher) +def around(a, decimals=0, out=None): + """ + Round an array to the given number of decimals. + + `around` is an alias of `~numpy.round`. + + See Also + -------- + ndarray.round : equivalent method + round : alias for this function + ceil, fix, floor, rint, trunc + + """ + return _wrapfunc(a, 'round', decimals=decimals, out=out) + + +def _mean_dispatcher(a, axis=None, dtype=None, out=None, keepdims=None, *, + where=None): + return (a, where, out) + + +@array_function_dispatch(_mean_dispatcher) +def mean(a, axis=None, dtype=None, out=None, keepdims=np._NoValue, *, + where=np._NoValue): + """ + Compute the arithmetic mean along the specified axis. + + Returns the average of the array elements. The average is taken over + the flattened array by default, otherwise over the specified axis. + `float64` intermediate and return values are used for integer inputs. + + Parameters + ---------- + a : array_like + Array containing numbers whose mean is desired. If `a` is not an + array, a conversion is attempted. + axis : None or int or tuple of ints, optional + Axis or axes along which the means are computed. The default is to + compute the mean of the flattened array. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, a mean is performed over multiple axes, + instead of a single axis or all the axes as before. + dtype : data-type, optional + Type to use in computing the mean. For integer inputs, the default + is `float64`; for floating point inputs, it is the same as the + input dtype. + out : ndarray, optional + Alternate output array in which to place the result. The default + is ``None``; if provided, it must have the same shape as the + expected output, but the type will be cast if necessary. + See :ref:`ufuncs-output-type` for more details. + See :ref:`ufuncs-output-type` for more details. + + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `mean` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + + where : array_like of bool, optional + Elements to include in the mean. See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.20.0 + + Returns + ------- + m : ndarray, see dtype parameter above + If `out=None`, returns a new array containing the mean values, + otherwise a reference to the output array is returned. + + See Also + -------- + average : Weighted average + std, var, nanmean, nanstd, nanvar + + Notes + ----- + The arithmetic mean is the sum of the elements along the axis divided + by the number of elements. + + Note that for floating-point input, the mean is computed using the + same precision the input has. Depending on the input data, this can + cause the results to be inaccurate, especially for `float32` (see + example below). Specifying a higher-precision accumulator using the + `dtype` keyword can alleviate this issue. + + By default, `float16` results are computed using `float32` intermediates + for extra precision. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> np.mean(a) + 2.5 + >>> np.mean(a, axis=0) + array([2., 3.]) + >>> np.mean(a, axis=1) + array([1.5, 3.5]) + + In single precision, `mean` can be inaccurate: + + >>> a = np.zeros((2, 512*512), dtype=np.float32) + >>> a[0, :] = 1.0 + >>> a[1, :] = 0.1 + >>> np.mean(a) + 0.54999924 + + Computing the mean in float64 is more accurate: + + >>> np.mean(a, dtype=np.float64) + 0.55000000074505806 # may vary + + Specifying a where argument: + + >>> a = np.array([[5, 9, 13], [14, 10, 12], [11, 15, 19]]) + >>> np.mean(a) + 12.0 + >>> np.mean(a, where=[[True], [False], [False]]) + 9.0 + + """ + kwargs = {} + if keepdims is not np._NoValue: + kwargs['keepdims'] = keepdims + if where is not np._NoValue: + kwargs['where'] = where + if type(a) is not mu.ndarray: + try: + mean = a.mean + except AttributeError: + pass + else: + return mean(axis=axis, dtype=dtype, out=out, **kwargs) + + return _methods._mean(a, axis=axis, dtype=dtype, + out=out, **kwargs) + + +def _std_dispatcher(a, axis=None, dtype=None, out=None, ddof=None, + keepdims=None, *, where=None, mean=None, correction=None): + return (a, where, out, mean) + + +@array_function_dispatch(_std_dispatcher) +def std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=np._NoValue, *, + where=np._NoValue, mean=np._NoValue, correction=np._NoValue): + r""" + Compute the standard deviation along the specified axis. + + Returns the standard deviation, a measure of the spread of a distribution, + of the array elements. The standard deviation is computed for the + flattened array by default, otherwise over the specified axis. + + Parameters + ---------- + a : array_like + Calculate the standard deviation of these values. + axis : None or int or tuple of ints, optional + Axis or axes along which the standard deviation is computed. The + default is to compute the standard deviation of the flattened array. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, a standard deviation is performed over + multiple axes, instead of a single axis or all the axes as before. + dtype : dtype, optional + Type to use in computing the standard deviation. For arrays of + integer type the default is float64, for arrays of float types it is + the same as the array type. + out : ndarray, optional + Alternative output array in which to place the result. It must have + the same shape as the expected output but the type (of the calculated + values) will be cast if necessary. + See :ref:`ufuncs-output-type` for more details. + ddof : {int, float}, optional + Means Delta Degrees of Freedom. The divisor used in calculations + is ``N - ddof``, where ``N`` represents the number of elements. + By default `ddof` is zero. See Notes for details about use of `ddof`. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `std` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + where : array_like of bool, optional + Elements to include in the standard deviation. + See `~numpy.ufunc.reduce` for details. + + .. versionadded:: 1.20.0 + + mean : array_like, optional + Provide the mean to prevent its recalculation. The mean should have + a shape as if it was calculated with ``keepdims=True``. + The axis for the calculation of the mean should be the same as used in + the call to this std function. + + .. versionadded:: 1.26.0 + + correction : {int, float}, optional + Array API compatible name for the ``ddof`` parameter. Only one of them + can be provided at the same time. + + .. versionadded:: 2.0.0 + + Returns + ------- + standard_deviation : ndarray, see dtype parameter above. + If `out` is None, return a new array containing the standard deviation, + otherwise return a reference to the output array. + + See Also + -------- + var, mean, nanmean, nanstd, nanvar + :ref:`ufuncs-output-type` + + Notes + ----- + There are several common variants of the array standard deviation + calculation. Assuming the input `a` is a one-dimensional NumPy array + and ``mean`` is either provided as an argument or computed as + ``a.mean()``, NumPy computes the standard deviation of an array as:: + + N = len(a) + d2 = abs(a - mean)**2 # abs is for complex `a` + var = d2.sum() / (N - ddof) # note use of `ddof` + std = var**0.5 + + Different values of the argument `ddof` are useful in different + contexts. NumPy's default ``ddof=0`` corresponds with the expression: + + .. math:: + + \sqrt{\frac{\sum_i{|a_i - \bar{a}|^2 }}{N}} + + which is sometimes called the "population standard deviation" in the field + of statistics because it applies the definition of standard deviation to + `a` as if `a` were a complete population of possible observations. + + Many other libraries define the standard deviation of an array + differently, e.g.: + + .. math:: + + \sqrt{\frac{\sum_i{|a_i - \bar{a}|^2 }}{N - 1}} + + In statistics, the resulting quantity is sometimed called the "sample + standard deviation" because if `a` is a random sample from a larger + population, this calculation provides the square root of an unbiased + estimate of the variance of the population. The use of :math:`N-1` in the + denominator is often called "Bessel's correction" because it corrects for + bias (toward lower values) in the variance estimate introduced when the + sample mean of `a` is used in place of the true mean of the population. + The resulting estimate of the standard deviation is still biased, but less + than it would have been without the correction. For this quantity, use + ``ddof=1``. + + Note that, for complex numbers, `std` takes the absolute + value before squaring, so that the result is always real and nonnegative. + + For floating-point input, the standard deviation is computed using the same + precision the input has. Depending on the input data, this can cause + the results to be inaccurate, especially for float32 (see example below). + Specifying a higher-accuracy accumulator using the `dtype` keyword can + alleviate this issue. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> np.std(a) + 1.1180339887498949 # may vary + >>> np.std(a, axis=0) + array([1., 1.]) + >>> np.std(a, axis=1) + array([0.5, 0.5]) + + In single precision, std() can be inaccurate: + + >>> a = np.zeros((2, 512*512), dtype=np.float32) + >>> a[0, :] = 1.0 + >>> a[1, :] = 0.1 + >>> np.std(a) + 0.45000005 + + Computing the standard deviation in float64 is more accurate: + + >>> np.std(a, dtype=np.float64) + 0.44999999925494177 # may vary + + Specifying a where argument: + + >>> a = np.array([[14, 8, 11, 10], [7, 9, 10, 11], [10, 15, 5, 10]]) + >>> np.std(a) + 2.614064523559687 # may vary + >>> np.std(a, where=[[True], [True], [False]]) + 2.0 + + Using the mean keyword to save computation time: + + >>> import numpy as np + >>> from timeit import timeit + >>> a = np.array([[14, 8, 11, 10], [7, 9, 10, 11], [10, 15, 5, 10]]) + >>> mean = np.mean(a, axis=1, keepdims=True) + >>> + >>> g = globals() + >>> n = 10000 + >>> t1 = timeit("std = np.std(a, axis=1, mean=mean)", globals=g, number=n) + >>> t2 = timeit("std = np.std(a, axis=1)", globals=g, number=n) + >>> print(f'Percentage execution time saved {100*(t2-t1)/t2:.0f}%') + #doctest: +SKIP + Percentage execution time saved 30% + + """ + kwargs = {} + if keepdims is not np._NoValue: + kwargs['keepdims'] = keepdims + if where is not np._NoValue: + kwargs['where'] = where + if mean is not np._NoValue: + kwargs['mean'] = mean + + if correction != np._NoValue: + if ddof != 0: + raise ValueError( + "ddof and correction can't be provided simultaneously." + ) + else: + ddof = correction + + if type(a) is not mu.ndarray: + try: + std = a.std + except AttributeError: + pass + else: + return std(axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs) + + return _methods._std(a, axis=axis, dtype=dtype, out=out, ddof=ddof, + **kwargs) + + +def _var_dispatcher(a, axis=None, dtype=None, out=None, ddof=None, + keepdims=None, *, where=None, mean=None, correction=None): + return (a, where, out, mean) + + +@array_function_dispatch(_var_dispatcher) +def var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=np._NoValue, *, + where=np._NoValue, mean=np._NoValue, correction=np._NoValue): + r""" + Compute the variance along the specified axis. + + Returns the variance of the array elements, a measure of the spread of a + distribution. The variance is computed for the flattened array by + default, otherwise over the specified axis. + + Parameters + ---------- + a : array_like + Array containing numbers whose variance is desired. If `a` is not an + array, a conversion is attempted. + axis : None or int or tuple of ints, optional + Axis or axes along which the variance is computed. The default is to + compute the variance of the flattened array. + + .. versionadded:: 1.7.0 + + If this is a tuple of ints, a variance is performed over multiple axes, + instead of a single axis or all the axes as before. + dtype : data-type, optional + Type to use in computing the variance. For arrays of integer type + the default is `float64`; for arrays of float types it is the same as + the array type. + out : ndarray, optional + Alternate output array in which to place the result. It must have + the same shape as the expected output, but the type is cast if + necessary. + ddof : {int, float}, optional + "Delta Degrees of Freedom": the divisor used in the calculation is + ``N - ddof``, where ``N`` represents the number of elements. By + default `ddof` is zero. See notes for details about use of `ddof`. + keepdims : bool, optional + If this is set to True, the axes which are reduced are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + If the default value is passed, then `keepdims` will not be + passed through to the `var` method of sub-classes of + `ndarray`, however any non-default value will be. If the + sub-class' method does not implement `keepdims` any + exceptions will be raised. + where : array_like of bool, optional + Elements to include in the variance. See `~numpy.ufunc.reduce` for + details. + + .. versionadded:: 1.20.0 + + mean : array like, optional + Provide the mean to prevent its recalculation. The mean should have + a shape as if it was calculated with ``keepdims=True``. + The axis for the calculation of the mean should be the same as used in + the call to this var function. + + .. versionadded:: 1.26.0 + + correction : {int, float}, optional + Array API compatible name for the ``ddof`` parameter. Only one of them + can be provided at the same time. + + .. versionadded:: 2.0.0 + + Returns + ------- + variance : ndarray, see dtype parameter above + If ``out=None``, returns a new array containing the variance; + otherwise, a reference to the output array is returned. + + See Also + -------- + std, mean, nanmean, nanstd, nanvar + :ref:`ufuncs-output-type` + + Notes + ----- + There are several common variants of the array variance calculation. + Assuming the input `a` is a one-dimensional NumPy array and ``mean`` is + either provided as an argument or computed as ``a.mean()``, NumPy + computes the variance of an array as:: + + N = len(a) + d2 = abs(a - mean)**2 # abs is for complex `a` + var = d2.sum() / (N - ddof) # note use of `ddof` + + Different values of the argument `ddof` are useful in different + contexts. NumPy's default ``ddof=0`` corresponds with the expression: + + .. math:: + + \frac{\sum_i{|a_i - \bar{a}|^2 }}{N} + + which is sometimes called the "population variance" in the field of + statistics because it applies the definition of variance to `a` as if `a` + were a complete population of possible observations. + + Many other libraries define the variance of an array differently, e.g.: + + .. math:: + + \frac{\sum_i{|a_i - \bar{a}|^2}}{N - 1} + + In statistics, the resulting quantity is sometimed called the "sample + variance" because if `a` is a random sample from a larger population, + this calculation provides an unbiased estimate of the variance of the + population. The use of :math:`N-1` in the denominator is often called + "Bessel's correction" because it corrects for bias (toward lower values) + in the variance estimate introduced when the sample mean of `a` is used + in place of the true mean of the population. For this quantity, use + ``ddof=1``. + + Note that for complex numbers, the absolute value is taken before + squaring, so that the result is always real and nonnegative. + + For floating-point input, the variance is computed using the same + precision the input has. Depending on the input data, this can cause + the results to be inaccurate, especially for `float32` (see example + below). Specifying a higher-accuracy accumulator using the ``dtype`` + keyword can alleviate this issue. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> np.var(a) + 1.25 + >>> np.var(a, axis=0) + array([1., 1.]) + >>> np.var(a, axis=1) + array([0.25, 0.25]) + + In single precision, var() can be inaccurate: + + >>> a = np.zeros((2, 512*512), dtype=np.float32) + >>> a[0, :] = 1.0 + >>> a[1, :] = 0.1 + >>> np.var(a) + 0.20250003 + + Computing the variance in float64 is more accurate: + + >>> np.var(a, dtype=np.float64) + 0.20249999932944759 # may vary + >>> ((1-0.55)**2 + (0.1-0.55)**2)/2 + 0.2025 + + Specifying a where argument: + + >>> a = np.array([[14, 8, 11, 10], [7, 9, 10, 11], [10, 15, 5, 10]]) + >>> np.var(a) + 6.833333333333333 # may vary + >>> np.var(a, where=[[True], [True], [False]]) + 4.0 + + Using the mean keyword to save computation time: + + >>> import numpy as np + >>> from timeit import timeit + >>> + >>> a = np.array([[14, 8, 11, 10], [7, 9, 10, 11], [10, 15, 5, 10]]) + >>> mean = np.mean(a, axis=1, keepdims=True) + >>> + >>> g = globals() + >>> n = 10000 + >>> t1 = timeit("var = np.var(a, axis=1, mean=mean)", globals=g, number=n) + >>> t2 = timeit("var = np.var(a, axis=1)", globals=g, number=n) + >>> print(f'Percentage execution time saved {100*(t2-t1)/t2:.0f}%') + #doctest: +SKIP + Percentage execution time saved 32% + + """ + kwargs = {} + if keepdims is not np._NoValue: + kwargs['keepdims'] = keepdims + if where is not np._NoValue: + kwargs['where'] = where + if mean is not np._NoValue: + kwargs['mean'] = mean + + if correction != np._NoValue: + if ddof != 0: + raise ValueError( + "ddof and correction can't be provided simultaneously." + ) + else: + ddof = correction + + if type(a) is not mu.ndarray: + try: + var = a.var + + except AttributeError: + pass + else: + return var(axis=axis, dtype=dtype, out=out, ddof=ddof, **kwargs) + + return _methods._var(a, axis=axis, dtype=dtype, out=out, ddof=ddof, + **kwargs) + diff --git a/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.pyi b/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.pyi new file mode 100644 index 0000000000000000000000000000000000000000..08e791789c82742905e6c516a406cc4aeefa63bb --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/fromnumeric.pyi @@ -0,0 +1,1245 @@ +from collections.abc import Sequence +from typing import Any, overload, TypeVar, Literal, SupportsIndex + +import numpy as np +from numpy import ( + number, + uint64, + int_, + int64, + intp, + float16, + floating, + complexfloating, + object_, + generic, + _OrderKACF, + _OrderACF, + _ModeKind, + _PartitionKind, + _SortKind, + _SortSide, + _CastingKind, +) +from numpy._typing import ( + DTypeLike, + _DTypeLike, + ArrayLike, + _ArrayLike, + NDArray, + _ShapeLike, + _Shape, + _ArrayLikeBool_co, + _ArrayLikeUInt_co, + _ArrayLikeInt_co, + _ArrayLikeFloat_co, + _ArrayLikeComplex_co, + _ArrayLikeObject_co, + _IntLike_co, + _BoolLike_co, + _ComplexLike_co, + _NumberLike_co, + _ScalarLike_co, +) + +_SCT = TypeVar("_SCT", bound=generic) +_SCT_uifcO = TypeVar("_SCT_uifcO", bound=number[Any] | object_) +_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any]) + +__all__: list[str] + +@overload +def take( + a: _ArrayLike[_SCT], + indices: _IntLike_co, + axis: None = ..., + out: None = ..., + mode: _ModeKind = ..., +) -> _SCT: ... +@overload +def take( + a: ArrayLike, + indices: _IntLike_co, + axis: None | SupportsIndex = ..., + out: None = ..., + mode: _ModeKind = ..., +) -> Any: ... +@overload +def take( + a: _ArrayLike[_SCT], + indices: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + out: None = ..., + mode: _ModeKind = ..., +) -> NDArray[_SCT]: ... +@overload +def take( + a: ArrayLike, + indices: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + out: None = ..., + mode: _ModeKind = ..., +) -> NDArray[Any]: ... +@overload +def take( + a: ArrayLike, + indices: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + out: _ArrayType = ..., + mode: _ModeKind = ..., +) -> _ArrayType: ... + +@overload +def reshape( + a: _ArrayLike[_SCT], + /, + shape: _ShapeLike = ..., + order: _OrderACF = ..., + *, + newshape: _ShapeLike = ..., + copy: None | bool = ..., +) -> NDArray[_SCT]: ... +@overload +def reshape( + a: ArrayLike, + /, + shape: _ShapeLike = ..., + order: _OrderACF = ..., + *, + newshape: _ShapeLike = ..., + copy: None | bool = ..., +) -> NDArray[Any]: ... + +@overload +def choose( + a: _IntLike_co, + choices: ArrayLike, + out: None = ..., + mode: _ModeKind = ..., +) -> Any: ... +@overload +def choose( + a: _ArrayLikeInt_co, + choices: _ArrayLike[_SCT], + out: None = ..., + mode: _ModeKind = ..., +) -> NDArray[_SCT]: ... +@overload +def choose( + a: _ArrayLikeInt_co, + choices: ArrayLike, + out: None = ..., + mode: _ModeKind = ..., +) -> NDArray[Any]: ... +@overload +def choose( + a: _ArrayLikeInt_co, + choices: ArrayLike, + out: _ArrayType = ..., + mode: _ModeKind = ..., +) -> _ArrayType: ... + +@overload +def repeat( + a: _ArrayLike[_SCT], + repeats: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., +) -> NDArray[_SCT]: ... +@overload +def repeat( + a: ArrayLike, + repeats: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., +) -> NDArray[Any]: ... + +def put( + a: NDArray[Any], + ind: _ArrayLikeInt_co, + v: ArrayLike, + mode: _ModeKind = ..., +) -> None: ... + +@overload +def swapaxes( + a: _ArrayLike[_SCT], + axis1: SupportsIndex, + axis2: SupportsIndex, +) -> NDArray[_SCT]: ... +@overload +def swapaxes( + a: ArrayLike, + axis1: SupportsIndex, + axis2: SupportsIndex, +) -> NDArray[Any]: ... + +@overload +def transpose( + a: _ArrayLike[_SCT], + axes: None | _ShapeLike = ... +) -> NDArray[_SCT]: ... +@overload +def transpose( + a: ArrayLike, + axes: None | _ShapeLike = ... +) -> NDArray[Any]: ... + +@overload +def matrix_transpose(x: _ArrayLike[_SCT]) -> NDArray[_SCT]: ... +@overload +def matrix_transpose(x: ArrayLike) -> NDArray[Any]: ... + +@overload +def partition( + a: _ArrayLike[_SCT], + kth: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + kind: _PartitionKind = ..., + order: None | str | Sequence[str] = ..., +) -> NDArray[_SCT]: ... +@overload +def partition( + a: ArrayLike, + kth: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + kind: _PartitionKind = ..., + order: None | str | Sequence[str] = ..., +) -> NDArray[Any]: ... + +def argpartition( + a: ArrayLike, + kth: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + kind: _PartitionKind = ..., + order: None | str | Sequence[str] = ..., +) -> NDArray[intp]: ... + +@overload +def sort( + a: _ArrayLike[_SCT], + axis: None | SupportsIndex = ..., + kind: None | _SortKind = ..., + order: None | str | Sequence[str] = ..., + *, + stable: None | bool = ..., +) -> NDArray[_SCT]: ... +@overload +def sort( + a: ArrayLike, + axis: None | SupportsIndex = ..., + kind: None | _SortKind = ..., + order: None | str | Sequence[str] = ..., + *, + stable: None | bool = ..., +) -> NDArray[Any]: ... + +def argsort( + a: ArrayLike, + axis: None | SupportsIndex = ..., + kind: None | _SortKind = ..., + order: None | str | Sequence[str] = ..., + *, + stable: None | bool = ..., +) -> NDArray[intp]: ... + +@overload +def argmax( + a: ArrayLike, + axis: None = ..., + out: None = ..., + *, + keepdims: Literal[False] = ..., +) -> intp: ... +@overload +def argmax( + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + keepdims: bool = ..., +) -> Any: ... +@overload +def argmax( + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: _ArrayType = ..., + *, + keepdims: bool = ..., +) -> _ArrayType: ... + +@overload +def argmin( + a: ArrayLike, + axis: None = ..., + out: None = ..., + *, + keepdims: Literal[False] = ..., +) -> intp: ... +@overload +def argmin( + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + keepdims: bool = ..., +) -> Any: ... +@overload +def argmin( + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: _ArrayType = ..., + *, + keepdims: bool = ..., +) -> _ArrayType: ... + +@overload +def searchsorted( + a: ArrayLike, + v: _ScalarLike_co, + side: _SortSide = ..., + sorter: None | _ArrayLikeInt_co = ..., # 1D int array +) -> intp: ... +@overload +def searchsorted( + a: ArrayLike, + v: ArrayLike, + side: _SortSide = ..., + sorter: None | _ArrayLikeInt_co = ..., # 1D int array +) -> NDArray[intp]: ... + +@overload +def resize( + a: _ArrayLike[_SCT], + new_shape: _ShapeLike, +) -> NDArray[_SCT]: ... +@overload +def resize( + a: ArrayLike, + new_shape: _ShapeLike, +) -> NDArray[Any]: ... + +@overload +def squeeze( + a: _SCT, + axis: None | _ShapeLike = ..., +) -> _SCT: ... +@overload +def squeeze( + a: _ArrayLike[_SCT], + axis: None | _ShapeLike = ..., +) -> NDArray[_SCT]: ... +@overload +def squeeze( + a: ArrayLike, + axis: None | _ShapeLike = ..., +) -> NDArray[Any]: ... + +@overload +def diagonal( + a: _ArrayLike[_SCT], + offset: SupportsIndex = ..., + axis1: SupportsIndex = ..., + axis2: SupportsIndex = ..., # >= 2D array +) -> NDArray[_SCT]: ... +@overload +def diagonal( + a: ArrayLike, + offset: SupportsIndex = ..., + axis1: SupportsIndex = ..., + axis2: SupportsIndex = ..., # >= 2D array +) -> NDArray[Any]: ... + +@overload +def trace( + a: ArrayLike, # >= 2D array + offset: SupportsIndex = ..., + axis1: SupportsIndex = ..., + axis2: SupportsIndex = ..., + dtype: DTypeLike = ..., + out: None = ..., +) -> Any: ... +@overload +def trace( + a: ArrayLike, # >= 2D array + offset: SupportsIndex = ..., + axis1: SupportsIndex = ..., + axis2: SupportsIndex = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def ravel(a: _ArrayLike[_SCT], order: _OrderKACF = ...) -> NDArray[_SCT]: ... +@overload +def ravel(a: ArrayLike, order: _OrderKACF = ...) -> NDArray[Any]: ... + +def nonzero(a: ArrayLike) -> tuple[NDArray[intp], ...]: ... + +def shape(a: ArrayLike) -> _Shape: ... + +@overload +def compress( + condition: _ArrayLikeBool_co, # 1D bool array + a: _ArrayLike[_SCT], + axis: None | SupportsIndex = ..., + out: None = ..., +) -> NDArray[_SCT]: ... +@overload +def compress( + condition: _ArrayLikeBool_co, # 1D bool array + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: None = ..., +) -> NDArray[Any]: ... +@overload +def compress( + condition: _ArrayLikeBool_co, # 1D bool array + a: ArrayLike, + axis: None | SupportsIndex = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def clip( + a: _SCT, + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: None = ..., + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: None = ..., + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> _SCT: ... +@overload +def clip( + a: _ScalarLike_co, + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: None = ..., + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: None = ..., + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> Any: ... +@overload +def clip( + a: _ArrayLike[_SCT], + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: None = ..., + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: None = ..., + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> NDArray[_SCT]: ... +@overload +def clip( + a: ArrayLike, + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: None = ..., + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: None = ..., + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> NDArray[Any]: ... +@overload +def clip( + a: ArrayLike, + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: _ArrayType = ..., + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: DTypeLike, + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> Any: ... +@overload +def clip( + a: ArrayLike, + a_min: None | ArrayLike, + a_max: None | ArrayLike, + out: _ArrayType, + *, + min: None | ArrayLike = ..., + max: None | ArrayLike = ..., + dtype: DTypeLike = ..., + where: None | _ArrayLikeBool_co = ..., + order: _OrderKACF = ..., + subok: bool = ..., + signature: str | tuple[None | str, ...] = ..., + casting: _CastingKind = ..., +) -> _ArrayType: ... + +@overload +def sum( + a: _ArrayLike[_SCT], + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _SCT: ... +@overload +def sum( + a: ArrayLike, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def sum( + a: ArrayLike, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def all( + a: ArrayLike, + axis: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> np.bool: ... +@overload +def all( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: None = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def all( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def any( + a: ArrayLike, + axis: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> np.bool: ... +@overload +def any( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: None = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def any( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def cumsum( + a: _ArrayLike[_SCT], + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[_SCT]: ... +@overload +def cumsum( + a: ArrayLike, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[Any]: ... +@overload +def cumsum( + a: ArrayLike, + axis: None | SupportsIndex = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., +) -> NDArray[_SCT]: ... +@overload +def cumsum( + a: ArrayLike, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: None = ..., +) -> NDArray[Any]: ... +@overload +def cumsum( + a: ArrayLike, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def cumulative_sum( + x: _ArrayLike[_SCT], + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[_SCT]: ... +@overload +def cumulative_sum( + x: ArrayLike, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[Any]: ... +@overload +def cumulative_sum( + x: ArrayLike, + /, + *, + axis: None | SupportsIndex = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[_SCT]: ... +@overload +def cumulative_sum( + x: ArrayLike, + /, + *, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[Any]: ... +@overload +def cumulative_sum( + x: ArrayLike, + /, + *, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + include_initial: bool = ..., +) -> _ArrayType: ... + +@overload +def ptp( + a: _ArrayLike[_SCT], + axis: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., +) -> _SCT: ... +@overload +def ptp( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: None = ..., + keepdims: bool = ..., +) -> Any: ... +@overload +def ptp( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., +) -> _ArrayType: ... + +@overload +def amax( + a: _ArrayLike[_SCT], + axis: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _SCT: ... +@overload +def amax( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def amax( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def amin( + a: _ArrayLike[_SCT], + axis: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _SCT: ... +@overload +def amin( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def amin( + a: ArrayLike, + axis: None | _ShapeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +# TODO: `np.prod()``: For object arrays `initial` does not necessarily +# have to be a numerical scalar. +# The only requirement is that it is compatible +# with the `.__mul__()` method(s) of the passed array's elements. + +# Note that the same situation holds for all wrappers around +# `np.ufunc.reduce`, e.g. `np.sum()` (`.__add__()`). +@overload +def prod( + a: _ArrayLikeBool_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> int_: ... +@overload +def prod( + a: _ArrayLikeUInt_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> uint64: ... +@overload +def prod( + a: _ArrayLikeInt_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> int64: ... +@overload +def prod( + a: _ArrayLikeFloat_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> floating[Any]: ... +@overload +def prod( + a: _ArrayLikeComplex_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> complexfloating[Any, Any]: ... +@overload +def prod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def prod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + keepdims: Literal[False] = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _SCT: ... +@overload +def prod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None | DTypeLike = ..., + out: None = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def prod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None | DTypeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + initial: _NumberLike_co = ..., + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def cumprod( + a: _ArrayLikeBool_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[int_]: ... +@overload +def cumprod( + a: _ArrayLikeUInt_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[uint64]: ... +@overload +def cumprod( + a: _ArrayLikeInt_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[int64]: ... +@overload +def cumprod( + a: _ArrayLikeFloat_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[floating[Any]]: ... +@overload +def cumprod( + a: _ArrayLikeComplex_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def cumprod( + a: _ArrayLikeObject_co, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., +) -> NDArray[object_]: ... +@overload +def cumprod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | SupportsIndex = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., +) -> NDArray[_SCT]: ... +@overload +def cumprod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: None = ..., +) -> NDArray[Any]: ... +@overload +def cumprod( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def cumulative_prod( + x: _ArrayLikeBool_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[int_]: ... +@overload +def cumulative_prod( + x: _ArrayLikeUInt_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[uint64]: ... +@overload +def cumulative_prod( + x: _ArrayLikeInt_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[int64]: ... +@overload +def cumulative_prod( + x: _ArrayLikeFloat_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[floating[Any]]: ... +@overload +def cumulative_prod( + x: _ArrayLikeComplex_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def cumulative_prod( + x: _ArrayLikeObject_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: None = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[object_]: ... +@overload +def cumulative_prod( + x: _ArrayLikeComplex_co | _ArrayLikeObject_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[_SCT]: ... +@overload +def cumulative_prod( + x: _ArrayLikeComplex_co | _ArrayLikeObject_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: None = ..., + include_initial: bool = ..., +) -> NDArray[Any]: ... +@overload +def cumulative_prod( + x: _ArrayLikeComplex_co | _ArrayLikeObject_co, + /, + *, + axis: None | SupportsIndex = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + include_initial: bool = ..., +) -> _ArrayType: ... + +def ndim(a: ArrayLike) -> int: ... + +def size(a: ArrayLike, axis: None | int = ...) -> int: ... + +@overload +def around( + a: _BoolLike_co, + decimals: SupportsIndex = ..., + out: None = ..., +) -> float16: ... +@overload +def around( + a: _SCT_uifcO, + decimals: SupportsIndex = ..., + out: None = ..., +) -> _SCT_uifcO: ... +@overload +def around( + a: _ComplexLike_co | object_, + decimals: SupportsIndex = ..., + out: None = ..., +) -> Any: ... +@overload +def around( + a: _ArrayLikeBool_co, + decimals: SupportsIndex = ..., + out: None = ..., +) -> NDArray[float16]: ... +@overload +def around( + a: _ArrayLike[_SCT_uifcO], + decimals: SupportsIndex = ..., + out: None = ..., +) -> NDArray[_SCT_uifcO]: ... +@overload +def around( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + decimals: SupportsIndex = ..., + out: None = ..., +) -> NDArray[Any]: ... +@overload +def around( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + decimals: SupportsIndex = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def mean( + a: _ArrayLikeFloat_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> floating[Any]: ... +@overload +def mean( + a: _ArrayLikeComplex_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> complexfloating[Any, Any]: ... +@overload +def mean( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None = ..., + out: None = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def mean( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> _SCT: ... +@overload +def mean( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: None = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> Any: ... +@overload +def mean( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., +) -> _ArrayType: ... + +@overload +def std( + a: _ArrayLikeComplex_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co = ..., + correction: int | float = ..., +) -> floating[Any]: ... +@overload +def std( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> Any: ... +@overload +def std( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> _SCT: ... +@overload +def std( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> Any: ... +@overload +def std( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> _ArrayType: ... + +@overload +def var( + a: _ArrayLikeComplex_co, + axis: None = ..., + dtype: None = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co = ..., + correction: int | float = ..., +) -> floating[Any]: ... +@overload +def var( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: None = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> Any: ... +@overload +def var( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None = ..., + dtype: _DTypeLike[_SCT] = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: Literal[False] = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> _SCT: ... +@overload +def var( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: None = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> Any: ... +@overload +def var( + a: _ArrayLikeComplex_co | _ArrayLikeObject_co, + axis: None | _ShapeLike = ..., + dtype: DTypeLike = ..., + out: _ArrayType = ..., + ddof: int | float = ..., + keepdims: bool = ..., + *, + where: _ArrayLikeBool_co = ..., + mean: _ArrayLikeComplex_co | _ArrayLikeObject_co = ..., + correction: int | float = ..., +) -> _ArrayType: ... + +max = amax +min = amin +round = around diff --git a/valley/lib/python3.10/site-packages/numpy/_core/function_base.py b/valley/lib/python3.10/site-packages/numpy/_core/function_base.py new file mode 100644 index 0000000000000000000000000000000000000000..0e98196f2922fbafd615637d57fdbc08daf8c35e --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/function_base.py @@ -0,0 +1,562 @@ +import functools +import warnings +import operator +import types + +import numpy as np +from . import numeric as _nx +from .numeric import result_type, nan, asanyarray, ndim +from numpy._core.multiarray import add_docstring +from numpy._core._multiarray_umath import _array_converter +from numpy._core import overrides + +__all__ = ['logspace', 'linspace', 'geomspace'] + + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy') + + +def _linspace_dispatcher(start, stop, num=None, endpoint=None, retstep=None, + dtype=None, axis=None, *, device=None): + return (start, stop) + + +@array_function_dispatch(_linspace_dispatcher) +def linspace(start, stop, num=50, endpoint=True, retstep=False, dtype=None, + axis=0, *, device=None): + """ + Return evenly spaced numbers over a specified interval. + + Returns `num` evenly spaced samples, calculated over the + interval [`start`, `stop`]. + + The endpoint of the interval can optionally be excluded. + + .. versionchanged:: 1.16.0 + Non-scalar `start` and `stop` are now supported. + + .. versionchanged:: 1.20.0 + Values are rounded towards ``-inf`` instead of ``0`` when an + integer ``dtype`` is specified. The old behavior can + still be obtained with ``np.linspace(start, stop, num).astype(int)`` + + Parameters + ---------- + start : array_like + The starting value of the sequence. + stop : array_like + The end value of the sequence, unless `endpoint` is set to False. + In that case, the sequence consists of all but the last of ``num + 1`` + evenly spaced samples, so that `stop` is excluded. Note that the step + size changes when `endpoint` is False. + num : int, optional + Number of samples to generate. Default is 50. Must be non-negative. + endpoint : bool, optional + If True, `stop` is the last sample. Otherwise, it is not included. + Default is True. + retstep : bool, optional + If True, return (`samples`, `step`), where `step` is the spacing + between samples. + dtype : dtype, optional + The type of the output array. If `dtype` is not given, the data type + is inferred from `start` and `stop`. The inferred dtype will never be + an integer; `float` is chosen even if the arguments would produce an + array of integers. + + .. versionadded:: 1.9.0 + axis : int, optional + The axis in the result to store the samples. Relevant only if start + or stop are array-like. By default (0), the samples will be along a + new axis inserted at the beginning. Use -1 to get an axis at the end. + + .. versionadded:: 1.16.0 + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + + Returns + ------- + samples : ndarray + There are `num` equally spaced samples in the closed interval + ``[start, stop]`` or the half-open interval ``[start, stop)`` + (depending on whether `endpoint` is True or False). + step : float, optional + Only returned if `retstep` is True + + Size of spacing between samples. + + + See Also + -------- + arange : Similar to `linspace`, but uses a step size (instead of the + number of samples). + geomspace : Similar to `linspace`, but with numbers spaced evenly on a log + scale (a geometric progression). + logspace : Similar to `geomspace`, but with the end points specified as + logarithms. + :ref:`how-to-partition` + + Examples + -------- + >>> import numpy as np + >>> np.linspace(2.0, 3.0, num=5) + array([2. , 2.25, 2.5 , 2.75, 3. ]) + >>> np.linspace(2.0, 3.0, num=5, endpoint=False) + array([2. , 2.2, 2.4, 2.6, 2.8]) + >>> np.linspace(2.0, 3.0, num=5, retstep=True) + (array([2. , 2.25, 2.5 , 2.75, 3. ]), 0.25) + + Graphical illustration: + + >>> import matplotlib.pyplot as plt + >>> N = 8 + >>> y = np.zeros(N) + >>> x1 = np.linspace(0, 10, N, endpoint=True) + >>> x2 = np.linspace(0, 10, N, endpoint=False) + >>> plt.plot(x1, y, 'o') + [] + >>> plt.plot(x2, y + 0.5, 'o') + [] + >>> plt.ylim([-0.5, 1]) + (-0.5, 1) + >>> plt.show() + + """ + num = operator.index(num) + if num < 0: + raise ValueError( + "Number of samples, %s, must be non-negative." % num + ) + div = (num - 1) if endpoint else num + + conv = _array_converter(start, stop) + start, stop = conv.as_arrays() + dt = conv.result_type(ensure_inexact=True) + + if dtype is None: + dtype = dt + integer_dtype = False + else: + integer_dtype = _nx.issubdtype(dtype, _nx.integer) + + # Use `dtype=type(dt)` to enforce a floating point evaluation: + delta = np.subtract(stop, start, dtype=type(dt)) + y = _nx.arange( + 0, num, dtype=dt, device=device + ).reshape((-1,) + (1,) * ndim(delta)) + + # In-place multiplication y *= delta/div is faster, but prevents + # the multiplicant from overriding what class is produced, and thus + # prevents, e.g. use of Quantities, see gh-7142. Hence, we multiply + # in place only for standard scalar types. + if div > 0: + _mult_inplace = _nx.isscalar(delta) + step = delta / div + any_step_zero = ( + step == 0 if _mult_inplace else _nx.asanyarray(step == 0).any()) + if any_step_zero: + # Special handling for denormal numbers, gh-5437 + y /= div + if _mult_inplace: + y *= delta + else: + y = y * delta + else: + if _mult_inplace: + y *= step + else: + y = y * step + else: + # sequences with 0 items or 1 item with endpoint=True (i.e. div <= 0) + # have an undefined step + step = nan + # Multiply with delta to allow possible override of output class. + y = y * delta + + y += start + + if endpoint and num > 1: + y[-1, ...] = stop + + if axis != 0: + y = _nx.moveaxis(y, 0, axis) + + if integer_dtype: + _nx.floor(y, out=y) + + y = conv.wrap(y.astype(dtype, copy=False)) + if retstep: + return y, step + else: + return y + + +def _logspace_dispatcher(start, stop, num=None, endpoint=None, base=None, + dtype=None, axis=None): + return (start, stop, base) + + +@array_function_dispatch(_logspace_dispatcher) +def logspace(start, stop, num=50, endpoint=True, base=10.0, dtype=None, + axis=0): + """ + Return numbers spaced evenly on a log scale. + + In linear space, the sequence starts at ``base ** start`` + (`base` to the power of `start`) and ends with ``base ** stop`` + (see `endpoint` below). + + .. versionchanged:: 1.16.0 + Non-scalar `start` and `stop` are now supported. + + .. versionchanged:: 1.25.0 + Non-scalar 'base` is now supported + + Parameters + ---------- + start : array_like + ``base ** start`` is the starting value of the sequence. + stop : array_like + ``base ** stop`` is the final value of the sequence, unless `endpoint` + is False. In that case, ``num + 1`` values are spaced over the + interval in log-space, of which all but the last (a sequence of + length `num`) are returned. + num : integer, optional + Number of samples to generate. Default is 50. + endpoint : boolean, optional + If true, `stop` is the last sample. Otherwise, it is not included. + Default is True. + base : array_like, optional + The base of the log space. The step size between the elements in + ``ln(samples) / ln(base)`` (or ``log_base(samples)``) is uniform. + Default is 10.0. + dtype : dtype + The type of the output array. If `dtype` is not given, the data type + is inferred from `start` and `stop`. The inferred type will never be + an integer; `float` is chosen even if the arguments would produce an + array of integers. + axis : int, optional + The axis in the result to store the samples. Relevant only if start, + stop, or base are array-like. By default (0), the samples will be + along a new axis inserted at the beginning. Use -1 to get an axis at + the end. + + .. versionadded:: 1.16.0 + + + Returns + ------- + samples : ndarray + `num` samples, equally spaced on a log scale. + + See Also + -------- + arange : Similar to linspace, with the step size specified instead of the + number of samples. Note that, when used with a float endpoint, the + endpoint may or may not be included. + linspace : Similar to logspace, but with the samples uniformly distributed + in linear space, instead of log space. + geomspace : Similar to logspace, but with endpoints specified directly. + :ref:`how-to-partition` + + Notes + ----- + If base is a scalar, logspace is equivalent to the code + + >>> y = np.linspace(start, stop, num=num, endpoint=endpoint) + ... # doctest: +SKIP + >>> power(base, y).astype(dtype) + ... # doctest: +SKIP + + Examples + -------- + >>> import numpy as np + >>> np.logspace(2.0, 3.0, num=4) + array([ 100. , 215.443469 , 464.15888336, 1000. ]) + >>> np.logspace(2.0, 3.0, num=4, endpoint=False) + array([100. , 177.827941 , 316.22776602, 562.34132519]) + >>> np.logspace(2.0, 3.0, num=4, base=2.0) + array([4. , 5.0396842 , 6.34960421, 8. ]) + >>> np.logspace(2.0, 3.0, num=4, base=[2.0, 3.0], axis=-1) + array([[ 4. , 5.0396842 , 6.34960421, 8. ], + [ 9. , 12.98024613, 18.72075441, 27. ]]) + + Graphical illustration: + + >>> import matplotlib.pyplot as plt + >>> N = 10 + >>> x1 = np.logspace(0.1, 1, N, endpoint=True) + >>> x2 = np.logspace(0.1, 1, N, endpoint=False) + >>> y = np.zeros(N) + >>> plt.plot(x1, y, 'o') + [] + >>> plt.plot(x2, y + 0.5, 'o') + [] + >>> plt.ylim([-0.5, 1]) + (-0.5, 1) + >>> plt.show() + + """ + if not isinstance(base, (float, int)) and np.ndim(base): + # If base is non-scalar, broadcast it with the others, since it + # may influence how axis is interpreted. + ndmax = np.broadcast(start, stop, base).ndim + start, stop, base = ( + np.array(a, copy=None, subok=True, ndmin=ndmax) + for a in (start, stop, base) + ) + base = np.expand_dims(base, axis=axis) + y = linspace(start, stop, num=num, endpoint=endpoint, axis=axis) + if dtype is None: + return _nx.power(base, y) + return _nx.power(base, y).astype(dtype, copy=False) + + +def _geomspace_dispatcher(start, stop, num=None, endpoint=None, dtype=None, + axis=None): + return (start, stop) + + +@array_function_dispatch(_geomspace_dispatcher) +def geomspace(start, stop, num=50, endpoint=True, dtype=None, axis=0): + """ + Return numbers spaced evenly on a log scale (a geometric progression). + + This is similar to `logspace`, but with endpoints specified directly. + Each output sample is a constant multiple of the previous. + + .. versionchanged:: 1.16.0 + Non-scalar `start` and `stop` are now supported. + + Parameters + ---------- + start : array_like + The starting value of the sequence. + stop : array_like + The final value of the sequence, unless `endpoint` is False. + In that case, ``num + 1`` values are spaced over the + interval in log-space, of which all but the last (a sequence of + length `num`) are returned. + num : integer, optional + Number of samples to generate. Default is 50. + endpoint : boolean, optional + If true, `stop` is the last sample. Otherwise, it is not included. + Default is True. + dtype : dtype + The type of the output array. If `dtype` is not given, the data type + is inferred from `start` and `stop`. The inferred dtype will never be + an integer; `float` is chosen even if the arguments would produce an + array of integers. + axis : int, optional + The axis in the result to store the samples. Relevant only if start + or stop are array-like. By default (0), the samples will be along a + new axis inserted at the beginning. Use -1 to get an axis at the end. + + .. versionadded:: 1.16.0 + + Returns + ------- + samples : ndarray + `num` samples, equally spaced on a log scale. + + See Also + -------- + logspace : Similar to geomspace, but with endpoints specified using log + and base. + linspace : Similar to geomspace, but with arithmetic instead of geometric + progression. + arange : Similar to linspace, with the step size specified instead of the + number of samples. + :ref:`how-to-partition` + + Notes + ----- + If the inputs or dtype are complex, the output will follow a logarithmic + spiral in the complex plane. (There are an infinite number of spirals + passing through two points; the output will follow the shortest such path.) + + Examples + -------- + >>> import numpy as np + >>> np.geomspace(1, 1000, num=4) + array([ 1., 10., 100., 1000.]) + >>> np.geomspace(1, 1000, num=3, endpoint=False) + array([ 1., 10., 100.]) + >>> np.geomspace(1, 1000, num=4, endpoint=False) + array([ 1. , 5.62341325, 31.6227766 , 177.827941 ]) + >>> np.geomspace(1, 256, num=9) + array([ 1., 2., 4., 8., 16., 32., 64., 128., 256.]) + + Note that the above may not produce exact integers: + + >>> np.geomspace(1, 256, num=9, dtype=int) + array([ 1, 2, 4, 7, 16, 32, 63, 127, 256]) + >>> np.around(np.geomspace(1, 256, num=9)).astype(int) + array([ 1, 2, 4, 8, 16, 32, 64, 128, 256]) + + Negative, decreasing, and complex inputs are allowed: + + >>> np.geomspace(1000, 1, num=4) + array([1000., 100., 10., 1.]) + >>> np.geomspace(-1000, -1, num=4) + array([-1000., -100., -10., -1.]) + >>> np.geomspace(1j, 1000j, num=4) # Straight line + array([0. +1.j, 0. +10.j, 0. +100.j, 0.+1000.j]) + >>> np.geomspace(-1+0j, 1+0j, num=5) # Circle + array([-1.00000000e+00+1.22464680e-16j, -7.07106781e-01+7.07106781e-01j, + 6.12323400e-17+1.00000000e+00j, 7.07106781e-01+7.07106781e-01j, + 1.00000000e+00+0.00000000e+00j]) + + Graphical illustration of `endpoint` parameter: + + >>> import matplotlib.pyplot as plt + >>> N = 10 + >>> y = np.zeros(N) + >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=True), y + 1, 'o') + [] + >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=False), y + 2, 'o') + [] + >>> plt.axis([0.5, 2000, 0, 3]) + [0.5, 2000, 0, 3] + >>> plt.grid(True, color='0.7', linestyle='-', which='both', axis='both') + >>> plt.show() + + """ + start = asanyarray(start) + stop = asanyarray(stop) + if _nx.any(start == 0) or _nx.any(stop == 0): + raise ValueError('Geometric sequence cannot include zero') + + dt = result_type(start, stop, float(num), _nx.zeros((), dtype)) + if dtype is None: + dtype = dt + else: + # complex to dtype('complex128'), for instance + dtype = _nx.dtype(dtype) + + # Promote both arguments to the same dtype in case, for instance, one is + # complex and another is negative and log would produce NaN otherwise. + # Copy since we may change things in-place further down. + start = start.astype(dt, copy=True) + stop = stop.astype(dt, copy=True) + + # Allow negative real values and ensure a consistent result for complex + # (including avoiding negligible real or imaginary parts in output) by + # rotating start to positive real, calculating, then undoing rotation. + out_sign = _nx.sign(start) + start /= out_sign + stop = stop / out_sign + + log_start = _nx.log10(start) + log_stop = _nx.log10(stop) + result = logspace(log_start, log_stop, num=num, + endpoint=endpoint, base=10.0, dtype=dt) + + # Make sure the endpoints match the start and stop arguments. This is + # necessary because np.exp(np.log(x)) is not necessarily equal to x. + if num > 0: + result[0] = start + if num > 1 and endpoint: + result[-1] = stop + + result *= out_sign + + if axis != 0: + result = _nx.moveaxis(result, 0, axis) + + return result.astype(dtype, copy=False) + + +def _needs_add_docstring(obj): + """ + Returns true if the only way to set the docstring of `obj` from python is + via add_docstring. + + This function errs on the side of being overly conservative. + """ + Py_TPFLAGS_HEAPTYPE = 1 << 9 + + if isinstance(obj, (types.FunctionType, types.MethodType, property)): + return False + + if isinstance(obj, type) and obj.__flags__ & Py_TPFLAGS_HEAPTYPE: + return False + + return True + + +def _add_docstring(obj, doc, warn_on_python): + if warn_on_python and not _needs_add_docstring(obj): + warnings.warn( + "add_newdoc was used on a pure-python object {}. " + "Prefer to attach it directly to the source." + .format(obj), + UserWarning, + stacklevel=3) + try: + add_docstring(obj, doc) + except Exception: + pass + + +def add_newdoc(place, obj, doc, warn_on_python=True): + """ + Add documentation to an existing object, typically one defined in C + + The purpose is to allow easier editing of the docstrings without requiring + a re-compile. This exists primarily for internal use within numpy itself. + + Parameters + ---------- + place : str + The absolute name of the module to import from + obj : str or None + The name of the object to add documentation to, typically a class or + function name. + doc : {str, Tuple[str, str], List[Tuple[str, str]]} + If a string, the documentation to apply to `obj` + + If a tuple, then the first element is interpreted as an attribute + of `obj` and the second as the docstring to apply - + ``(method, docstring)`` + + If a list, then each element of the list should be a tuple of length + two - ``[(method1, docstring1), (method2, docstring2), ...]`` + warn_on_python : bool + If True, the default, emit `UserWarning` if this is used to attach + documentation to a pure-python object. + + Notes + ----- + This routine never raises an error if the docstring can't be written, but + will raise an error if the object being documented does not exist. + + This routine cannot modify read-only docstrings, as appear + in new-style classes or built-in functions. Because this + routine never raises an error the caller must check manually + that the docstrings were changed. + + Since this function grabs the ``char *`` from a c-level str object and puts + it into the ``tp_doc`` slot of the type of `obj`, it violates a number of + C-API best-practices, by: + + - modifying a `PyTypeObject` after calling `PyType_Ready` + - calling `Py_INCREF` on the str and losing the reference, so the str + will never be released + + If possible it should be avoided. + """ + new = getattr(__import__(place, globals(), {}, [obj]), obj) + if isinstance(doc, str): + _add_docstring(new, doc.strip(), warn_on_python) + elif isinstance(doc, tuple): + attr, docstring = doc + _add_docstring(getattr(new, attr), docstring.strip(), warn_on_python) + elif isinstance(doc, list): + for attr, docstring in doc: + _add_docstring( + getattr(new, attr), docstring.strip(), warn_on_python + ) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/function_base.pyi b/valley/lib/python3.10/site-packages/numpy/_core/function_base.pyi new file mode 100644 index 0000000000000000000000000000000000000000..59c3d6b4ea2cc9425ffe474ec9bd0d113bfd3a78 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/function_base.pyi @@ -0,0 +1,202 @@ +from typing import ( + Literal as L, + overload, + Any, + SupportsIndex, + TypeVar, +) + +from numpy import floating, complexfloating, generic +from numpy._typing import ( + NDArray, + DTypeLike, + _DTypeLike, + _ArrayLikeFloat_co, + _ArrayLikeComplex_co, +) + +_SCT = TypeVar("_SCT", bound=generic) + +__all__: list[str] + +@overload +def linspace( + start: _ArrayLikeFloat_co, + stop: _ArrayLikeFloat_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[False] = ..., + dtype: None = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[floating[Any]]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[False] = ..., + dtype: None = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[False] = ..., + dtype: _DTypeLike[_SCT] = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[False] = ..., + dtype: DTypeLike = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... +@overload +def linspace( + start: _ArrayLikeFloat_co, + stop: _ArrayLikeFloat_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[True] = ..., + dtype: None = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> tuple[NDArray[floating[Any]], floating[Any]]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[True] = ..., + dtype: None = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> tuple[NDArray[complexfloating[Any, Any]], complexfloating[Any, Any]]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[True] = ..., + dtype: _DTypeLike[_SCT] = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> tuple[NDArray[_SCT], _SCT]: ... +@overload +def linspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + retstep: L[True] = ..., + dtype: DTypeLike = ..., + axis: SupportsIndex = ..., + *, + device: None | L["cpu"] = ..., +) -> tuple[NDArray[Any], Any]: ... + +@overload +def logspace( + start: _ArrayLikeFloat_co, + stop: _ArrayLikeFloat_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + base: _ArrayLikeFloat_co = ..., + dtype: None = ..., + axis: SupportsIndex = ..., +) -> NDArray[floating[Any]]: ... +@overload +def logspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + base: _ArrayLikeComplex_co = ..., + dtype: None = ..., + axis: SupportsIndex = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def logspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + base: _ArrayLikeComplex_co = ..., + dtype: _DTypeLike[_SCT] = ..., + axis: SupportsIndex = ..., +) -> NDArray[_SCT]: ... +@overload +def logspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + base: _ArrayLikeComplex_co = ..., + dtype: DTypeLike = ..., + axis: SupportsIndex = ..., +) -> NDArray[Any]: ... + +@overload +def geomspace( + start: _ArrayLikeFloat_co, + stop: _ArrayLikeFloat_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + dtype: None = ..., + axis: SupportsIndex = ..., +) -> NDArray[floating[Any]]: ... +@overload +def geomspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + dtype: None = ..., + axis: SupportsIndex = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def geomspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + dtype: _DTypeLike[_SCT] = ..., + axis: SupportsIndex = ..., +) -> NDArray[_SCT]: ... +@overload +def geomspace( + start: _ArrayLikeComplex_co, + stop: _ArrayLikeComplex_co, + num: SupportsIndex = ..., + endpoint: bool = ..., + dtype: DTypeLike = ..., + axis: SupportsIndex = ..., +) -> NDArray[Any]: ... + +def add_newdoc( + place: str, + obj: str, + doc: str | tuple[str, str] | list[tuple[str, str]], + warn_on_python: bool = ..., +) -> None: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/getlimits.pyi b/valley/lib/python3.10/site-packages/numpy/_core/getlimits.pyi new file mode 100644 index 0000000000000000000000000000000000000000..da5e3c23ea724bfeca0d83ff2550febe1aade2f0 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/getlimits.pyi @@ -0,0 +1,6 @@ +from numpy import ( + finfo as finfo, + iinfo as iinfo, +) + +__all__: list[str] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/memmap.pyi b/valley/lib/python3.10/site-packages/numpy/_core/memmap.pyi new file mode 100644 index 0000000000000000000000000000000000000000..03c6b772dcd52c87bb958329f5acecd0ed8c1092 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/memmap.pyi @@ -0,0 +1,3 @@ +from numpy import memmap as memmap + +__all__: list[str] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/multiarray.py b/valley/lib/python3.10/site-packages/numpy/_core/multiarray.py new file mode 100644 index 0000000000000000000000000000000000000000..e2ca115b3728da36fb71400c2a169c854b0af87a --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/multiarray.py @@ -0,0 +1,1772 @@ +""" +Create the numpy._core.multiarray namespace for backward compatibility. +In v1.16 the multiarray and umath c-extension modules were merged into +a single _multiarray_umath extension module. So we replicate the old +namespace by importing from the extension module. + +""" + +import functools +from . import overrides +from . import _multiarray_umath +from ._multiarray_umath import * # noqa: F403 +# These imports are needed for backward compatibility, +# do not change them. issue gh-15518 +# _get_ndarray_c_version is semi-public, on purpose not added to __all__ +from ._multiarray_umath import ( + _flagdict, from_dlpack, _place, _reconstruct, + _vec_string, _ARRAY_API, _monotonicity, _get_ndarray_c_version, + _get_madvise_hugepage, _set_madvise_hugepage, + _get_promotion_state, _set_promotion_state + ) + +__all__ = [ + '_ARRAY_API', 'ALLOW_THREADS', 'BUFSIZE', 'CLIP', 'DATETIMEUNITS', + 'ITEM_HASOBJECT', 'ITEM_IS_POINTER', 'LIST_PICKLE', 'MAXDIMS', + 'MAY_SHARE_BOUNDS', 'MAY_SHARE_EXACT', 'NEEDS_INIT', 'NEEDS_PYAPI', + 'RAISE', 'USE_GETITEM', 'USE_SETITEM', 'WRAP', + '_flagdict', 'from_dlpack', '_place', '_reconstruct', '_vec_string', + '_monotonicity', 'add_docstring', 'arange', 'array', 'asarray', + 'asanyarray', 'ascontiguousarray', 'asfortranarray', 'bincount', + 'broadcast', 'busday_count', 'busday_offset', 'busdaycalendar', 'can_cast', + 'compare_chararrays', 'concatenate', 'copyto', 'correlate', 'correlate2', + 'count_nonzero', 'c_einsum', 'datetime_as_string', 'datetime_data', + 'dot', 'dragon4_positional', 'dragon4_scientific', 'dtype', + 'empty', 'empty_like', 'error', 'flagsobj', 'flatiter', 'format_longfloat', + 'frombuffer', 'fromfile', 'fromiter', 'fromstring', + 'get_handler_name', 'get_handler_version', 'inner', 'interp', + 'interp_complex', 'is_busday', 'lexsort', 'matmul', 'vecdot', + 'may_share_memory', 'min_scalar_type', 'ndarray', 'nditer', 'nested_iters', + 'normalize_axis_index', 'packbits', 'promote_types', 'putmask', + 'ravel_multi_index', 'result_type', 'scalar', 'set_datetimeparse_function', + 'set_typeDict', 'shares_memory', 'typeinfo', + 'unpackbits', 'unravel_index', 'vdot', 'where', 'zeros', + '_get_promotion_state', '_set_promotion_state'] + +# For backward compatibility, make sure pickle imports +# these functions from here +_reconstruct.__module__ = 'numpy._core.multiarray' +scalar.__module__ = 'numpy._core.multiarray' + + +from_dlpack.__module__ = 'numpy' +arange.__module__ = 'numpy' +array.__module__ = 'numpy' +asarray.__module__ = 'numpy' +asanyarray.__module__ = 'numpy' +ascontiguousarray.__module__ = 'numpy' +asfortranarray.__module__ = 'numpy' +datetime_data.__module__ = 'numpy' +empty.__module__ = 'numpy' +frombuffer.__module__ = 'numpy' +fromfile.__module__ = 'numpy' +fromiter.__module__ = 'numpy' +frompyfunc.__module__ = 'numpy' +fromstring.__module__ = 'numpy' +may_share_memory.__module__ = 'numpy' +nested_iters.__module__ = 'numpy' +promote_types.__module__ = 'numpy' +zeros.__module__ = 'numpy' +_get_promotion_state.__module__ = 'numpy' +_set_promotion_state.__module__ = 'numpy' +normalize_axis_index.__module__ = 'numpy.lib.array_utils' + + +# We can't verify dispatcher signatures because NumPy's C functions don't +# support introspection. +array_function_from_c_func_and_dispatcher = functools.partial( + overrides.array_function_from_dispatcher, + module='numpy', docs_from_dispatcher=True, verify=False) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.empty_like) +def empty_like( + prototype, dtype=None, order=None, subok=None, shape=None, *, device=None +): + """ + empty_like(prototype, dtype=None, order='K', subok=True, shape=None, *, + device=None) + + Return a new array with the same shape and type as a given array. + + Parameters + ---------- + prototype : array_like + The shape and data-type of `prototype` define these same attributes + of the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `prototype` is Fortran + contiguous, 'C' otherwise. 'K' means match the layout of `prototype` + as closely as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `prototype`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + + Returns + ------- + out : ndarray + Array of uninitialized (arbitrary) data with the same + shape and type as `prototype`. + + See Also + -------- + ones_like : Return an array of ones with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full_like : Return a new array with shape of input filled with value. + empty : Return a new uninitialized array. + + Notes + ----- + Unlike other array creation functions (e.g. `zeros_like`, `ones_like`, + `full_like`), `empty_like` does not initialize the values of the array, + and may therefore be marginally faster. However, the values stored in the + newly allocated array are arbitrary. For reproducible behavior, be sure + to set each element of the array before reading. + + Examples + -------- + >>> import numpy as np + >>> a = ([1,2,3], [4,5,6]) # a is array-like + >>> np.empty_like(a) + array([[-1073741821, -1073741821, 3], # uninitialized + [ 0, 0, -1073741821]]) + >>> a = np.array([[1., 2., 3.],[4.,5.,6.]]) + >>> np.empty_like(a) + array([[ -2.00000715e+000, 1.48219694e-323, -2.00000572e+000], # uninitialized + [ 4.38791518e-305, -2.00000715e+000, 4.17269252e-309]]) + + """ # NOQA + return (prototype,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.concatenate) +def concatenate(arrays, axis=None, out=None, *, dtype=None, casting=None): + """ + concatenate( + (a1, a2, ...), + axis=0, + out=None, + dtype=None, + casting="same_kind" + ) + + Join a sequence of arrays along an existing axis. + + Parameters + ---------- + a1, a2, ... : sequence of array_like + The arrays must have the same shape, except in the dimension + corresponding to `axis` (the first, by default). + axis : int, optional + The axis along which the arrays will be joined. If axis is None, + arrays are flattened before use. Default is 0. + out : ndarray, optional + If provided, the destination to place the result. The shape must be + correct, matching that of what concatenate would have returned if no + out argument were specified. + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.20.0 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + For a description of the options, please see :term:`casting`. + + .. versionadded:: 1.20.0 + + Returns + ------- + res : ndarray + The concatenated array. + + See Also + -------- + ma.concatenate : Concatenate function that preserves input masks. + array_split : Split an array into multiple sub-arrays of equal or + near-equal size. + split : Split array into a list of multiple sub-arrays of equal size. + hsplit : Split array into multiple sub-arrays horizontally (column wise). + vsplit : Split array into multiple sub-arrays vertically (row wise). + dsplit : Split array into multiple sub-arrays along the 3rd axis (depth). + stack : Stack a sequence of arrays along a new axis. + block : Assemble arrays from blocks. + hstack : Stack arrays in sequence horizontally (column wise). + vstack : Stack arrays in sequence vertically (row wise). + dstack : Stack arrays in sequence depth wise (along third dimension). + column_stack : Stack 1-D arrays as columns into a 2-D array. + + Notes + ----- + When one or more of the arrays to be concatenated is a MaskedArray, + this function will return a MaskedArray object instead of an ndarray, + but the input masks are *not* preserved. In cases where a MaskedArray + is expected as input, use the ma.concatenate function from the masked + array module instead. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[1, 2], [3, 4]]) + >>> b = np.array([[5, 6]]) + >>> np.concatenate((a, b), axis=0) + array([[1, 2], + [3, 4], + [5, 6]]) + >>> np.concatenate((a, b.T), axis=1) + array([[1, 2, 5], + [3, 4, 6]]) + >>> np.concatenate((a, b), axis=None) + array([1, 2, 3, 4, 5, 6]) + + This function will not preserve masking of MaskedArray inputs. + + >>> a = np.ma.arange(3) + >>> a[1] = np.ma.masked + >>> b = np.arange(2, 5) + >>> a + masked_array(data=[0, --, 2], + mask=[False, True, False], + fill_value=999999) + >>> b + array([2, 3, 4]) + >>> np.concatenate([a, b]) + masked_array(data=[0, 1, 2, 2, 3, 4], + mask=False, + fill_value=999999) + >>> np.ma.concatenate([a, b]) + masked_array(data=[0, --, 2, 2, 3, 4], + mask=[False, True, False, False, False, False], + fill_value=999999) + + """ + if out is not None: + # optimize for the typical case where only arrays is provided + arrays = list(arrays) + arrays.append(out) + return arrays + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.inner) +def inner(a, b): + """ + inner(a, b, /) + + Inner product of two arrays. + + Ordinary inner product of vectors for 1-D arrays (without complex + conjugation), in higher dimensions a sum product over the last axes. + + Parameters + ---------- + a, b : array_like + If `a` and `b` are nonscalar, their last dimensions must match. + + Returns + ------- + out : ndarray + If `a` and `b` are both + scalars or both 1-D arrays then a scalar is returned; otherwise + an array is returned. + ``out.shape = (*a.shape[:-1], *b.shape[:-1])`` + + Raises + ------ + ValueError + If both `a` and `b` are nonscalar and their last dimensions have + different sizes. + + See Also + -------- + tensordot : Sum products over arbitrary axes. + dot : Generalised matrix product, using second last dimension of `b`. + einsum : Einstein summation convention. + + Notes + ----- + For vectors (1-D arrays) it computes the ordinary inner-product:: + + np.inner(a, b) = sum(a[:]*b[:]) + + More generally, if ``ndim(a) = r > 0`` and ``ndim(b) = s > 0``:: + + np.inner(a, b) = np.tensordot(a, b, axes=(-1,-1)) + + or explicitly:: + + np.inner(a, b)[i0,...,ir-2,j0,...,js-2] + = sum(a[i0,...,ir-2,:]*b[j0,...,js-2,:]) + + In addition `a` or `b` may be scalars, in which case:: + + np.inner(a,b) = a*b + + Examples + -------- + Ordinary inner product for vectors: + + >>> import numpy as np + >>> a = np.array([1,2,3]) + >>> b = np.array([0,1,0]) + >>> np.inner(a, b) + 2 + + Some multidimensional examples: + + >>> a = np.arange(24).reshape((2,3,4)) + >>> b = np.arange(4) + >>> c = np.inner(a, b) + >>> c.shape + (2, 3) + >>> c + array([[ 14, 38, 62], + [ 86, 110, 134]]) + + >>> a = np.arange(2).reshape((1,1,2)) + >>> b = np.arange(6).reshape((3,2)) + >>> c = np.inner(a, b) + >>> c.shape + (1, 1, 3) + >>> c + array([[[1, 3, 5]]]) + + An example where `b` is a scalar: + + >>> np.inner(np.eye(2), 7) + array([[7., 0.], + [0., 7.]]) + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.where) +def where(condition, x=None, y=None): + """ + where(condition, [x, y], /) + + Return elements chosen from `x` or `y` depending on `condition`. + + .. note:: + When only `condition` is provided, this function is a shorthand for + ``np.asarray(condition).nonzero()``. Using `nonzero` directly should be + preferred, as it behaves correctly for subclasses. The rest of this + documentation covers only the case where all three arguments are + provided. + + Parameters + ---------- + condition : array_like, bool + Where True, yield `x`, otherwise yield `y`. + x, y : array_like + Values from which to choose. `x`, `y` and `condition` need to be + broadcastable to some shape. + + Returns + ------- + out : ndarray + An array with elements from `x` where `condition` is True, and elements + from `y` elsewhere. + + See Also + -------- + choose + nonzero : The function that is called when x and y are omitted + + Notes + ----- + If all the arrays are 1-D, `where` is equivalent to:: + + [xv if c else yv + for c, xv, yv in zip(condition, x, y)] + + Examples + -------- + >>> import numpy as np + >>> a = np.arange(10) + >>> a + array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) + >>> np.where(a < 5, a, 10*a) + array([ 0, 1, 2, 3, 4, 50, 60, 70, 80, 90]) + + This can be used on multidimensional arrays too: + + >>> np.where([[True, False], [True, True]], + ... [[1, 2], [3, 4]], + ... [[9, 8], [7, 6]]) + array([[1, 8], + [3, 4]]) + + The shapes of x, y, and the condition are broadcast together: + + >>> x, y = np.ogrid[:3, :4] + >>> np.where(x < y, x, 10 + y) # both x and 10+y are broadcast + array([[10, 0, 0, 0], + [10, 11, 1, 1], + [10, 11, 12, 2]]) + + >>> a = np.array([[0, 1, 2], + ... [0, 2, 4], + ... [0, 3, 6]]) + >>> np.where(a < 4, a, -1) # -1 is broadcast + array([[ 0, 1, 2], + [ 0, 2, -1], + [ 0, 3, -1]]) + """ + return (condition, x, y) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.lexsort) +def lexsort(keys, axis=None): + """ + lexsort(keys, axis=-1) + + Perform an indirect stable sort using a sequence of keys. + + Given multiple sorting keys, lexsort returns an array of integer indices + that describes the sort order by multiple keys. The last key in the + sequence is used for the primary sort order, ties are broken by the + second-to-last key, and so on. + + Parameters + ---------- + keys : (k, m, n, ...) array-like + The `k` keys to be sorted. The *last* key (e.g, the last + row if `keys` is a 2D array) is the primary sort key. + Each element of `keys` along the zeroth axis must be + an array-like object of the same shape. + axis : int, optional + Axis to be indirectly sorted. By default, sort over the last axis + of each sequence. Separate slices along `axis` sorted over + independently; see last example. + + Returns + ------- + indices : (m, n, ...) ndarray of ints + Array of indices that sort the keys along the specified axis. + + See Also + -------- + argsort : Indirect sort. + ndarray.sort : In-place sort. + sort : Return a sorted copy of an array. + + Examples + -------- + Sort names: first by surname, then by name. + + >>> import numpy as np + >>> surnames = ('Hertz', 'Galilei', 'Hertz') + >>> first_names = ('Heinrich', 'Galileo', 'Gustav') + >>> ind = np.lexsort((first_names, surnames)) + >>> ind + array([1, 2, 0]) + + >>> [surnames[i] + ", " + first_names[i] for i in ind] + ['Galilei, Galileo', 'Hertz, Gustav', 'Hertz, Heinrich'] + + Sort according to two numerical keys, first by elements + of ``a``, then breaking ties according to elements of ``b``: + + >>> a = [1, 5, 1, 4, 3, 4, 4] # First sequence + >>> b = [9, 4, 0, 4, 0, 2, 1] # Second sequence + >>> ind = np.lexsort((b, a)) # Sort by `a`, then by `b` + >>> ind + array([2, 0, 4, 6, 5, 3, 1]) + >>> [(a[i], b[i]) for i in ind] + [(1, 0), (1, 9), (3, 0), (4, 1), (4, 2), (4, 4), (5, 4)] + + Compare against `argsort`, which would sort each key independently. + + >>> np.argsort((b, a), kind='stable') + array([[2, 4, 6, 5, 1, 3, 0], + [0, 2, 4, 3, 5, 6, 1]]) + + To sort lexicographically with `argsort`, we would need to provide a + structured array. + + >>> x = np.array([(ai, bi) for ai, bi in zip(a, b)], + ... dtype = np.dtype([('x', int), ('y', int)])) + >>> np.argsort(x) # or np.argsort(x, order=('x', 'y')) + array([2, 0, 4, 6, 5, 3, 1]) + + The zeroth axis of `keys` always corresponds with the sequence of keys, + so 2D arrays are treated just like other sequences of keys. + + >>> arr = np.asarray([b, a]) + >>> ind2 = np.lexsort(arr) + >>> np.testing.assert_equal(ind2, ind) + + Accordingly, the `axis` parameter refers to an axis of *each* key, not of + the `keys` argument itself. For instance, the array ``arr`` is treated as + a sequence of two 1-D keys, so specifying ``axis=0`` is equivalent to + using the default axis, ``axis=-1``. + + >>> np.testing.assert_equal(np.lexsort(arr, axis=0), + ... np.lexsort(arr, axis=-1)) + + For higher-dimensional arrays, the axis parameter begins to matter. The + resulting array has the same shape as each key, and the values are what + we would expect if `lexsort` were performed on corresponding slices + of the keys independently. For instance, + + >>> x = [[1, 2, 3, 4], + ... [4, 3, 2, 1], + ... [2, 1, 4, 3]] + >>> y = [[2, 2, 1, 1], + ... [1, 2, 1, 2], + ... [1, 1, 2, 1]] + >>> np.lexsort((x, y), axis=1) + array([[2, 3, 0, 1], + [2, 0, 3, 1], + [1, 0, 3, 2]]) + + Each row of the result is what we would expect if we were to perform + `lexsort` on the corresponding row of the keys: + + >>> for i in range(3): + ... print(np.lexsort((x[i], y[i]))) + [2 3 0 1] + [2 0 3 1] + [1 0 3 2] + + """ + if isinstance(keys, tuple): + return keys + else: + return (keys,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.can_cast) +def can_cast(from_, to, casting=None): + """ + can_cast(from_, to, casting='safe') + + Returns True if cast between data types can occur according to the + casting rule. + + Parameters + ---------- + from_ : dtype, dtype specifier, NumPy scalar, or array + Data type, NumPy scalar, or array to cast from. + to : dtype or dtype specifier + Data type to cast to. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + + Returns + ------- + out : bool + True if cast can occur according to the casting rule. + + Notes + ----- + .. versionchanged:: 1.17.0 + Casting between a simple data type and a structured one is possible only + for "unsafe" casting. Casting to multiple fields is allowed, but + casting from multiple fields is not. + + .. versionchanged:: 1.9.0 + Casting from numeric to string types in 'safe' casting mode requires + that the string dtype length is long enough to store the maximum + integer/float value converted. + + .. versionchanged:: 2.0 + This function does not support Python scalars anymore and does not + apply any value-based logic for 0-D arrays and NumPy scalars. + + See also + -------- + dtype, result_type + + Examples + -------- + Basic examples + + >>> import numpy as np + >>> np.can_cast(np.int32, np.int64) + True + >>> np.can_cast(np.float64, complex) + True + >>> np.can_cast(complex, float) + False + + >>> np.can_cast('i8', 'f8') + True + >>> np.can_cast('i8', 'f4') + False + >>> np.can_cast('i4', 'S4') + False + + """ + return (from_,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.min_scalar_type) +def min_scalar_type(a): + """ + min_scalar_type(a, /) + + For scalar ``a``, returns the data type with the smallest size + and smallest scalar kind which can hold its value. For non-scalar + array ``a``, returns the vector's dtype unmodified. + + Floating point values are not demoted to integers, + and complex values are not demoted to floats. + + Parameters + ---------- + a : scalar or array_like + The value whose minimal data type is to be found. + + Returns + ------- + out : dtype + The minimal data type. + + Notes + ----- + .. versionadded:: 1.6.0 + + See Also + -------- + result_type, promote_types, dtype, can_cast + + Examples + -------- + >>> import numpy as np + >>> np.min_scalar_type(10) + dtype('uint8') + + >>> np.min_scalar_type(-260) + dtype('int16') + + >>> np.min_scalar_type(3.1) + dtype('float16') + + >>> np.min_scalar_type(1e50) + dtype('float64') + + >>> np.min_scalar_type(np.arange(4,dtype='f8')) + dtype('float64') + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.result_type) +def result_type(*arrays_and_dtypes): + """ + result_type(*arrays_and_dtypes) + + Returns the type that results from applying the NumPy + type promotion rules to the arguments. + + Type promotion in NumPy works similarly to the rules in languages + like C++, with some slight differences. When both scalars and + arrays are used, the array's type takes precedence and the actual value + of the scalar is taken into account. + + For example, calculating 3*a, where a is an array of 32-bit floats, + intuitively should result in a 32-bit float output. If the 3 is a + 32-bit integer, the NumPy rules indicate it can't convert losslessly + into a 32-bit float, so a 64-bit float should be the result type. + By examining the value of the constant, '3', we see that it fits in + an 8-bit integer, which can be cast losslessly into the 32-bit float. + + Parameters + ---------- + arrays_and_dtypes : list of arrays and dtypes + The operands of some operation whose result type is needed. + + Returns + ------- + out : dtype + The result type. + + See also + -------- + dtype, promote_types, min_scalar_type, can_cast + + Notes + ----- + .. versionadded:: 1.6.0 + + The specific algorithm used is as follows. + + Categories are determined by first checking which of boolean, + integer (int/uint), or floating point (float/complex) the maximum + kind of all the arrays and the scalars are. + + If there are only scalars or the maximum category of the scalars + is higher than the maximum category of the arrays, + the data types are combined with :func:`promote_types` + to produce the return value. + + Otherwise, `min_scalar_type` is called on each scalar, and + the resulting data types are all combined with :func:`promote_types` + to produce the return value. + + The set of int values is not a subset of the uint values for types + with the same number of bits, something not reflected in + :func:`min_scalar_type`, but handled as a special case in `result_type`. + + Examples + -------- + >>> import numpy as np + >>> np.result_type(3, np.arange(7, dtype='i1')) + dtype('int8') + + >>> np.result_type('i4', 'c8') + dtype('complex128') + + >>> np.result_type(3.0, -2) + dtype('float64') + + """ + return arrays_and_dtypes + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.dot) +def dot(a, b, out=None): + """ + dot(a, b, out=None) + + Dot product of two arrays. Specifically, + + - If both `a` and `b` are 1-D arrays, it is inner product of vectors + (without complex conjugation). + + - If both `a` and `b` are 2-D arrays, it is matrix multiplication, + but using :func:`matmul` or ``a @ b`` is preferred. + + - If either `a` or `b` is 0-D (scalar), it is equivalent to + :func:`multiply` and using ``numpy.multiply(a, b)`` or ``a * b`` is + preferred. + + - If `a` is an N-D array and `b` is a 1-D array, it is a sum product over + the last axis of `a` and `b`. + + - If `a` is an N-D array and `b` is an M-D array (where ``M>=2``), it is a + sum product over the last axis of `a` and the second-to-last axis of + `b`:: + + dot(a, b)[i,j,k,m] = sum(a[i,j,:] * b[k,:,m]) + + It uses an optimized BLAS library when possible (see `numpy.linalg`). + + Parameters + ---------- + a : array_like + First argument. + b : array_like + Second argument. + out : ndarray, optional + Output argument. This must have the exact kind that would be returned + if it was not used. In particular, it must have the right type, must be + C-contiguous, and its dtype must be the dtype that would be returned + for `dot(a,b)`. This is a performance feature. Therefore, if these + conditions are not met, an exception is raised, instead of attempting + to be flexible. + + Returns + ------- + output : ndarray + Returns the dot product of `a` and `b`. If `a` and `b` are both + scalars or both 1-D arrays then a scalar is returned; otherwise + an array is returned. + If `out` is given, then it is returned. + + Raises + ------ + ValueError + If the last dimension of `a` is not the same size as + the second-to-last dimension of `b`. + + See Also + -------- + vdot : Complex-conjugating dot product. + tensordot : Sum products over arbitrary axes. + einsum : Einstein summation convention. + matmul : '@' operator as method with out parameter. + linalg.multi_dot : Chained dot product. + + Examples + -------- + >>> import numpy as np + >>> np.dot(3, 4) + 12 + + Neither argument is complex-conjugated: + + >>> np.dot([2j, 3j], [2j, 3j]) + (-13+0j) + + For 2-D arrays it is the matrix product: + + >>> a = [[1, 0], [0, 1]] + >>> b = [[4, 1], [2, 2]] + >>> np.dot(a, b) + array([[4, 1], + [2, 2]]) + + >>> a = np.arange(3*4*5*6).reshape((3,4,5,6)) + >>> b = np.arange(3*4*5*6)[::-1].reshape((5,4,6,3)) + >>> np.dot(a, b)[2,3,2,1,2,2] + 499128 + >>> sum(a[2,3,2,:] * b[1,2,:,2]) + 499128 + + """ + return (a, b, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.vdot) +def vdot(a, b): + """ + vdot(a, b, /) + + Return the dot product of two vectors. + + The vdot(`a`, `b`) function handles complex numbers differently than + dot(`a`, `b`). If the first argument is complex the complex conjugate + of the first argument is used for the calculation of the dot product. + + Note that `vdot` handles multidimensional arrays differently than `dot`: + it does *not* perform a matrix product, but flattens input arguments + to 1-D vectors first. Consequently, it should only be used for vectors. + + Parameters + ---------- + a : array_like + If `a` is complex the complex conjugate is taken before calculation + of the dot product. + b : array_like + Second argument to the dot product. + + Returns + ------- + output : ndarray + Dot product of `a` and `b`. Can be an int, float, or + complex depending on the types of `a` and `b`. + + See Also + -------- + dot : Return the dot product without using the complex conjugate of the + first argument. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([1+2j,3+4j]) + >>> b = np.array([5+6j,7+8j]) + >>> np.vdot(a, b) + (70-8j) + >>> np.vdot(b, a) + (70+8j) + + Note that higher-dimensional arrays are flattened! + + >>> a = np.array([[1, 4], [5, 6]]) + >>> b = np.array([[4, 1], [2, 2]]) + >>> np.vdot(a, b) + 30 + >>> np.vdot(b, a) + 30 + >>> 1*4 + 4*1 + 5*2 + 6*2 + 30 + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.bincount) +def bincount(x, weights=None, minlength=None): + """ + bincount(x, /, weights=None, minlength=0) + + Count number of occurrences of each value in array of non-negative ints. + + The number of bins (of size 1) is one larger than the largest value in + `x`. If `minlength` is specified, there will be at least this number + of bins in the output array (though it will be longer if necessary, + depending on the contents of `x`). + Each bin gives the number of occurrences of its index value in `x`. + If `weights` is specified the input array is weighted by it, i.e. if a + value ``n`` is found at position ``i``, ``out[n] += weight[i]`` instead + of ``out[n] += 1``. + + Parameters + ---------- + x : array_like, 1 dimension, nonnegative ints + Input array. + weights : array_like, optional + Weights, array of the same shape as `x`. + minlength : int, optional + A minimum number of bins for the output array. + + .. versionadded:: 1.6.0 + + Returns + ------- + out : ndarray of ints + The result of binning the input array. + The length of `out` is equal to ``np.amax(x)+1``. + + Raises + ------ + ValueError + If the input is not 1-dimensional, or contains elements with negative + values, or if `minlength` is negative. + TypeError + If the type of the input is float or complex. + + See Also + -------- + histogram, digitize, unique + + Examples + -------- + >>> import numpy as np + >>> np.bincount(np.arange(5)) + array([1, 1, 1, 1, 1]) + >>> np.bincount(np.array([0, 1, 1, 3, 2, 1, 7])) + array([1, 3, 1, 1, 0, 0, 0, 1]) + + >>> x = np.array([0, 1, 1, 3, 2, 1, 7, 23]) + >>> np.bincount(x).size == np.amax(x)+1 + True + + The input array needs to be of integer dtype, otherwise a + TypeError is raised: + + >>> np.bincount(np.arange(5, dtype=float)) + Traceback (most recent call last): + ... + TypeError: Cannot cast array data from dtype('float64') to dtype('int64') + according to the rule 'safe' + + A possible use of ``bincount`` is to perform sums over + variable-size chunks of an array, using the ``weights`` keyword. + + >>> w = np.array([0.3, 0.5, 0.2, 0.7, 1., -0.6]) # weights + >>> x = np.array([0, 1, 1, 2, 2, 2]) + >>> np.bincount(x, weights=w) + array([ 0.3, 0.7, 1.1]) + + """ + return (x, weights) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.ravel_multi_index) +def ravel_multi_index(multi_index, dims, mode=None, order=None): + """ + ravel_multi_index(multi_index, dims, mode='raise', order='C') + + Converts a tuple of index arrays into an array of flat + indices, applying boundary modes to the multi-index. + + Parameters + ---------- + multi_index : tuple of array_like + A tuple of integer arrays, one array for each dimension. + dims : tuple of ints + The shape of array into which the indices from ``multi_index`` apply. + mode : {'raise', 'wrap', 'clip'}, optional + Specifies how out-of-bounds indices are handled. Can specify + either one mode or a tuple of modes, one mode per index. + + * 'raise' -- raise an error (default) + * 'wrap' -- wrap around + * 'clip' -- clip to the range + + In 'clip' mode, a negative index which would normally + wrap will clip to 0 instead. + order : {'C', 'F'}, optional + Determines whether the multi-index should be viewed as + indexing in row-major (C-style) or column-major + (Fortran-style) order. + + Returns + ------- + raveled_indices : ndarray + An array of indices into the flattened version of an array + of dimensions ``dims``. + + See Also + -------- + unravel_index + + Notes + ----- + .. versionadded:: 1.6.0 + + Examples + -------- + >>> import numpy as np + >>> arr = np.array([[3,6,6],[4,5,1]]) + >>> np.ravel_multi_index(arr, (7,6)) + array([22, 41, 37]) + >>> np.ravel_multi_index(arr, (7,6), order='F') + array([31, 41, 13]) + >>> np.ravel_multi_index(arr, (4,6), mode='clip') + array([22, 23, 19]) + >>> np.ravel_multi_index(arr, (4,4), mode=('clip','wrap')) + array([12, 13, 13]) + + >>> np.ravel_multi_index((3,1,4,1), (6,7,8,9)) + 1621 + """ + return multi_index + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.unravel_index) +def unravel_index(indices, shape=None, order=None): + """ + unravel_index(indices, shape, order='C') + + Converts a flat index or array of flat indices into a tuple + of coordinate arrays. + + Parameters + ---------- + indices : array_like + An integer array whose elements are indices into the flattened + version of an array of dimensions ``shape``. Before version 1.6.0, + this function accepted just one index value. + shape : tuple of ints + The shape of the array to use for unraveling ``indices``. + + .. versionchanged:: 1.16.0 + Renamed from ``dims`` to ``shape``. + + order : {'C', 'F'}, optional + Determines whether the indices should be viewed as indexing in + row-major (C-style) or column-major (Fortran-style) order. + + .. versionadded:: 1.6.0 + + Returns + ------- + unraveled_coords : tuple of ndarray + Each array in the tuple has the same shape as the ``indices`` + array. + + See Also + -------- + ravel_multi_index + + Examples + -------- + >>> import numpy as np + >>> np.unravel_index([22, 41, 37], (7,6)) + (array([3, 6, 6]), array([4, 5, 1])) + >>> np.unravel_index([31, 41, 13], (7,6), order='F') + (array([3, 6, 6]), array([4, 5, 1])) + + >>> np.unravel_index(1621, (6,7,8,9)) + (3, 1, 4, 1) + + """ + return (indices,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.copyto) +def copyto(dst, src, casting=None, where=None): + """ + copyto(dst, src, casting='same_kind', where=True) + + Copies values from one array to another, broadcasting as necessary. + + Raises a TypeError if the `casting` rule is violated, and if + `where` is provided, it selects which elements to copy. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dst : ndarray + The array into which values are copied. + src : array_like + The array from which values are copied. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur when copying. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + where : array_like of bool, optional + A boolean array which is broadcasted to match the dimensions + of `dst`, and selects elements to copy from `src` to `dst` + wherever it contains the value True. + + Examples + -------- + >>> import numpy as np + >>> A = np.array([4, 5, 6]) + >>> B = [1, 2, 3] + >>> np.copyto(A, B) + >>> A + array([1, 2, 3]) + + >>> A = np.array([[1, 2, 3], [4, 5, 6]]) + >>> B = [[4, 5, 6], [7, 8, 9]] + >>> np.copyto(A, B) + >>> A + array([[4, 5, 6], + [7, 8, 9]]) + + """ + return (dst, src, where) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.putmask) +def putmask(a, /, mask, values): + """ + putmask(a, mask, values) + + Changes elements of an array based on conditional and input values. + + Sets ``a.flat[n] = values[n]`` for each n where ``mask.flat[n]==True``. + + If `values` is not the same size as `a` and `mask` then it will repeat. + This gives behavior different from ``a[mask] = values``. + + Parameters + ---------- + a : ndarray + Target array. + mask : array_like + Boolean mask array. It has to be the same shape as `a`. + values : array_like + Values to put into `a` where `mask` is True. If `values` is smaller + than `a` it will be repeated. + + See Also + -------- + place, put, take, copyto + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2, 3) + >>> np.putmask(x, x>2, x**2) + >>> x + array([[ 0, 1, 2], + [ 9, 16, 25]]) + + If `values` is smaller than `a` it is repeated: + + >>> x = np.arange(5) + >>> np.putmask(x, x>1, [-33, -44]) + >>> x + array([ 0, 1, -33, -44, -33]) + + """ + return (a, mask, values) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.packbits) +def packbits(a, axis=None, bitorder='big'): + """ + packbits(a, /, axis=None, bitorder='big') + + Packs the elements of a binary-valued array into bits in a uint8 array. + + The result is padded to full bytes by inserting zero bits at the end. + + Parameters + ---------- + a : array_like + An array of integers or booleans whose elements should be packed to + bits. + axis : int, optional + The dimension over which bit-packing is done. + ``None`` implies packing the flattened array. + bitorder : {'big', 'little'}, optional + The order of the input bits. 'big' will mimic bin(val), + ``[0, 0, 0, 0, 0, 0, 1, 1] => 3 = 0b00000011``, 'little' will + reverse the order so ``[1, 1, 0, 0, 0, 0, 0, 0] => 3``. + Defaults to 'big'. + + .. versionadded:: 1.17.0 + + Returns + ------- + packed : ndarray + Array of type uint8 whose elements represent bits corresponding to the + logical (0 or nonzero) value of the input elements. The shape of + `packed` has the same number of dimensions as the input (unless `axis` + is None, in which case the output is 1-D). + + See Also + -------- + unpackbits: Unpacks elements of a uint8 array into a binary-valued output + array. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[[1,0,1], + ... [0,1,0]], + ... [[1,1,0], + ... [0,0,1]]]) + >>> b = np.packbits(a, axis=-1) + >>> b + array([[[160], + [ 64]], + [[192], + [ 32]]], dtype=uint8) + + Note that in binary 160 = 1010 0000, 64 = 0100 0000, 192 = 1100 0000, + and 32 = 0010 0000. + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.unpackbits) +def unpackbits(a, axis=None, count=None, bitorder='big'): + """ + unpackbits(a, /, axis=None, count=None, bitorder='big') + + Unpacks elements of a uint8 array into a binary-valued output array. + + Each element of `a` represents a bit-field that should be unpacked + into a binary-valued output array. The shape of the output array is + either 1-D (if `axis` is ``None``) or the same shape as the input + array with unpacking done along the axis specified. + + Parameters + ---------- + a : ndarray, uint8 type + Input array. + axis : int, optional + The dimension over which bit-unpacking is done. + ``None`` implies unpacking the flattened array. + count : int or None, optional + The number of elements to unpack along `axis`, provided as a way + of undoing the effect of packing a size that is not a multiple + of eight. A non-negative number means to only unpack `count` + bits. A negative number means to trim off that many bits from + the end. ``None`` means to unpack the entire array (the + default). Counts larger than the available number of bits will + add zero padding to the output. Negative counts must not + exceed the available number of bits. + + .. versionadded:: 1.17.0 + + bitorder : {'big', 'little'}, optional + The order of the returned bits. 'big' will mimic bin(val), + ``3 = 0b00000011 => [0, 0, 0, 0, 0, 0, 1, 1]``, 'little' will reverse + the order to ``[1, 1, 0, 0, 0, 0, 0, 0]``. + Defaults to 'big'. + + .. versionadded:: 1.17.0 + + Returns + ------- + unpacked : ndarray, uint8 type + The elements are binary-valued (0 or 1). + + See Also + -------- + packbits : Packs the elements of a binary-valued array into bits in + a uint8 array. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([[2], [7], [23]], dtype=np.uint8) + >>> a + array([[ 2], + [ 7], + [23]], dtype=uint8) + >>> b = np.unpackbits(a, axis=1) + >>> b + array([[0, 0, 0, 0, 0, 0, 1, 0], + [0, 0, 0, 0, 0, 1, 1, 1], + [0, 0, 0, 1, 0, 1, 1, 1]], dtype=uint8) + >>> c = np.unpackbits(a, axis=1, count=-3) + >>> c + array([[0, 0, 0, 0, 0], + [0, 0, 0, 0, 0], + [0, 0, 0, 1, 0]], dtype=uint8) + + >>> p = np.packbits(b, axis=0) + >>> np.unpackbits(p, axis=0) + array([[0, 0, 0, 0, 0, 0, 1, 0], + [0, 0, 0, 0, 0, 1, 1, 1], + [0, 0, 0, 1, 0, 1, 1, 1], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0]], dtype=uint8) + >>> np.array_equal(b, np.unpackbits(p, axis=0, count=b.shape[0])) + True + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.shares_memory) +def shares_memory(a, b, max_work=None): + """ + shares_memory(a, b, /, max_work=None) + + Determine if two arrays share memory. + + .. warning:: + + This function can be exponentially slow for some inputs, unless + `max_work` is set to zero or a positive integer. + If in doubt, use `numpy.may_share_memory` instead. + + Parameters + ---------- + a, b : ndarray + Input arrays + max_work : int, optional + Effort to spend on solving the overlap problem (maximum number + of candidate solutions to consider). The following special + values are recognized: + + max_work=-1 (default) + The problem is solved exactly. In this case, the function returns + True only if there is an element shared between the arrays. Finding + the exact solution may take extremely long in some cases. + max_work=0 + Only the memory bounds of a and b are checked. + This is equivalent to using ``may_share_memory()``. + + Raises + ------ + numpy.exceptions.TooHardError + Exceeded max_work. + + Returns + ------- + out : bool + + See Also + -------- + may_share_memory + + Examples + -------- + >>> import numpy as np + >>> x = np.array([1, 2, 3, 4]) + >>> np.shares_memory(x, np.array([5, 6, 7])) + False + >>> np.shares_memory(x[::2], x) + True + >>> np.shares_memory(x[::2], x[1::2]) + False + + Checking whether two arrays share memory is NP-complete, and + runtime may increase exponentially in the number of + dimensions. Hence, `max_work` should generally be set to a finite + number, as it is possible to construct examples that take + extremely long to run: + + >>> from numpy.lib.stride_tricks import as_strided + >>> x = np.zeros([192163377], dtype=np.int8) + >>> x1 = as_strided( + ... x, strides=(36674, 61119, 85569), shape=(1049, 1049, 1049)) + >>> x2 = as_strided( + ... x[64023025:], strides=(12223, 12224, 1), shape=(1049, 1049, 1)) + >>> np.shares_memory(x1, x2, max_work=1000) + Traceback (most recent call last): + ... + numpy.exceptions.TooHardError: Exceeded max_work + + Running ``np.shares_memory(x1, x2)`` without `max_work` set takes + around 1 minute for this case. It is possible to find problems + that take still significantly longer. + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.may_share_memory) +def may_share_memory(a, b, max_work=None): + """ + may_share_memory(a, b, /, max_work=None) + + Determine if two arrays might share memory + + A return of True does not necessarily mean that the two arrays + share any element. It just means that they *might*. + + Only the memory bounds of a and b are checked by default. + + Parameters + ---------- + a, b : ndarray + Input arrays + max_work : int, optional + Effort to spend on solving the overlap problem. See + `shares_memory` for details. Default for ``may_share_memory`` + is to do a bounds check. + + Returns + ------- + out : bool + + See Also + -------- + shares_memory + + Examples + -------- + >>> import numpy as np + >>> np.may_share_memory(np.array([1,2]), np.array([5,8,9])) + False + >>> x = np.zeros([3, 4]) + >>> np.may_share_memory(x[:,0], x[:,1]) + True + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.is_busday) +def is_busday(dates, weekmask=None, holidays=None, busdaycal=None, out=None): + """ + is_busday( + dates, + weekmask='1111100', + holidays=None, + busdaycal=None, + out=None + ) + + Calculates which of the given dates are valid days, and which are not. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dates : array_like of datetime64[D] + The array of dates to process. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of bool, optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of bool + An array with the same shape as ``dates``, containing True for + each valid day, and False for each invalid day. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + busday_offset : Applies an offset counted in valid days. + busday_count : Counts how many valid days are in a half-open date range. + + Examples + -------- + >>> import numpy as np + >>> # The weekdays are Friday, Saturday, and Monday + ... np.is_busday(['2011-07-01', '2011-07-02', '2011-07-18'], + ... holidays=['2011-07-01', '2011-07-04', '2011-07-17']) + array([False, False, True]) + """ + return (dates, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_offset) +def busday_offset(dates, offsets, roll=None, weekmask=None, holidays=None, + busdaycal=None, out=None): + """ + busday_offset( + dates, + offsets, + roll='raise', + weekmask='1111100', + holidays=None, + busdaycal=None, + out=None + ) + + First adjusts the date to fall on a valid day according to + the ``roll`` rule, then applies offsets to the given dates + counted in valid days. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dates : array_like of datetime64[D] + The array of dates to process. + offsets : array_like of int + The array of offsets, which is broadcast with ``dates``. + roll : {'raise', 'nat', 'forward', 'following', 'backward', 'preceding', \ + 'modifiedfollowing', 'modifiedpreceding'}, optional + How to treat dates that do not fall on a valid day. The default + is 'raise'. + + * 'raise' means to raise an exception for an invalid day. + * 'nat' means to return a NaT (not-a-time) for an invalid day. + * 'forward' and 'following' mean to take the first valid day + later in time. + * 'backward' and 'preceding' mean to take the first valid day + earlier in time. + * 'modifiedfollowing' means to take the first valid day + later in time unless it is across a Month boundary, in which + case to take the first valid day earlier in time. + * 'modifiedpreceding' means to take the first valid day + earlier in time unless it is across a Month boundary, in which + case to take the first valid day later in time. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of datetime64[D], optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of datetime64[D] + An array with a shape from broadcasting ``dates`` and ``offsets`` + together, containing the dates with offsets applied. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + is_busday : Returns a boolean array indicating valid days. + busday_count : Counts how many valid days are in a half-open date range. + + Examples + -------- + >>> import numpy as np + >>> # First business day in October 2011 (not accounting for holidays) + ... np.busday_offset('2011-10', 0, roll='forward') + np.datetime64('2011-10-03') + >>> # Last business day in February 2012 (not accounting for holidays) + ... np.busday_offset('2012-03', -1, roll='forward') + np.datetime64('2012-02-29') + >>> # Third Wednesday in January 2011 + ... np.busday_offset('2011-01', 2, roll='forward', weekmask='Wed') + np.datetime64('2011-01-19') + >>> # 2012 Mother's Day in Canada and the U.S. + ... np.busday_offset('2012-05', 1, roll='forward', weekmask='Sun') + np.datetime64('2012-05-13') + + >>> # First business day on or after a date + ... np.busday_offset('2011-03-20', 0, roll='forward') + np.datetime64('2011-03-21') + >>> np.busday_offset('2011-03-22', 0, roll='forward') + np.datetime64('2011-03-22') + >>> # First business day after a date + ... np.busday_offset('2011-03-20', 1, roll='backward') + np.datetime64('2011-03-21') + >>> np.busday_offset('2011-03-22', 1, roll='backward') + np.datetime64('2011-03-23') + """ + return (dates, offsets, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_count) +def busday_count(begindates, enddates, weekmask=None, holidays=None, + busdaycal=None, out=None): + """ + busday_count( + begindates, + enddates, + weekmask='1111100', + holidays=[], + busdaycal=None, + out=None + ) + + Counts the number of valid days between `begindates` and + `enddates`, not including the day of `enddates`. + + If ``enddates`` specifies a date value that is earlier than the + corresponding ``begindates`` date value, the count will be negative. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + begindates : array_like of datetime64[D] + The array of the first dates for counting. + enddates : array_like of datetime64[D] + The array of the end dates for counting, which are excluded + from the count themselves. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of int, optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of int + An array with a shape from broadcasting ``begindates`` and ``enddates`` + together, containing the number of valid days between + the begin and end dates. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + is_busday : Returns a boolean array indicating valid days. + busday_offset : Applies an offset counted in valid days. + + Examples + -------- + >>> import numpy as np + >>> # Number of weekdays in January 2011 + ... np.busday_count('2011-01', '2011-02') + 21 + >>> # Number of weekdays in 2011 + >>> np.busday_count('2011', '2012') + 260 + >>> # Number of Saturdays in 2011 + ... np.busday_count('2011', '2012', weekmask='Sat') + 53 + """ + return (begindates, enddates, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher( + _multiarray_umath.datetime_as_string) +def datetime_as_string(arr, unit=None, timezone=None, casting=None): + """ + datetime_as_string(arr, unit=None, timezone='naive', casting='same_kind') + + Convert an array of datetimes into an array of strings. + + Parameters + ---------- + arr : array_like of datetime64 + The array of UTC timestamps to format. + unit : str + One of None, 'auto', or + a :ref:`datetime unit `. + timezone : {'naive', 'UTC', 'local'} or tzinfo + Timezone information to use when displaying the datetime. If 'UTC', + end with a Z to indicate UTC time. If 'local', convert to the local + timezone first, and suffix with a +-#### timezone offset. If a tzinfo + object, then do as with 'local', but use the specified timezone. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'} + Casting to allow when changing between datetime units. + + Returns + ------- + str_arr : ndarray + An array of strings the same shape as `arr`. + + Examples + -------- + >>> import numpy as np + >>> import pytz + >>> d = np.arange('2002-10-27T04:30', 4*60, 60, dtype='M8[m]') + >>> d + array(['2002-10-27T04:30', '2002-10-27T05:30', '2002-10-27T06:30', + '2002-10-27T07:30'], dtype='datetime64[m]') + + Setting the timezone to UTC shows the same information, but with a Z suffix + + >>> np.datetime_as_string(d, timezone='UTC') + array(['2002-10-27T04:30Z', '2002-10-27T05:30Z', '2002-10-27T06:30Z', + '2002-10-27T07:30Z'], dtype='>> np.datetime_as_string(d, timezone=pytz.timezone('US/Eastern')) + array(['2002-10-27T00:30-0400', '2002-10-27T01:30-0400', + '2002-10-27T01:30-0500', '2002-10-27T02:30-0500'], dtype='>> np.datetime_as_string(d, unit='h') + array(['2002-10-27T04', '2002-10-27T05', '2002-10-27T06', '2002-10-27T07'], + dtype='>> np.datetime_as_string(d, unit='s') + array(['2002-10-27T04:30:00', '2002-10-27T05:30:00', '2002-10-27T06:30:00', + '2002-10-27T07:30:00'], dtype='>> np.datetime_as_string(d, unit='h', casting='safe') + Traceback (most recent call last): + ... + TypeError: Cannot create a datetime string as units 'h' from a NumPy + datetime with units 'm' according to the rule 'safe' + """ + return (arr,) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/numeric.py b/valley/lib/python3.10/site-packages/numpy/_core/numeric.py new file mode 100644 index 0000000000000000000000000000000000000000..1f3f1c20dbd18f4c1fc2dbbffaa84e2ab72d4f2d --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/numeric.py @@ -0,0 +1,2729 @@ +import functools +import itertools +import operator +import sys +import warnings +import numbers +import builtins +import math + +import numpy as np +from . import multiarray +from . import numerictypes as nt +from .multiarray import ( + ALLOW_THREADS, BUFSIZE, CLIP, MAXDIMS, MAY_SHARE_BOUNDS, MAY_SHARE_EXACT, + RAISE, WRAP, arange, array, asarray, asanyarray, ascontiguousarray, + asfortranarray, broadcast, can_cast, concatenate, copyto, dot, dtype, + empty, empty_like, flatiter, frombuffer, from_dlpack, fromfile, fromiter, + fromstring, inner, lexsort, matmul, may_share_memory, min_scalar_type, + ndarray, nditer, nested_iters, promote_types, putmask, result_type, + shares_memory, vdot, where, zeros, normalize_axis_index, + _get_promotion_state, _set_promotion_state, vecdot +) + +from . import overrides +from . import umath +from . import shape_base +from .overrides import set_array_function_like_doc, set_module +from .umath import (multiply, invert, sin, PINF, NAN) +from . import numerictypes +from ..exceptions import AxisError +from ._ufunc_config import errstate, _no_nep50_warning + +bitwise_not = invert +ufunc = type(sin) +newaxis = None + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy') + + +__all__ = [ + 'newaxis', 'ndarray', 'flatiter', 'nditer', 'nested_iters', 'ufunc', + 'arange', 'array', 'asarray', 'asanyarray', 'ascontiguousarray', + 'asfortranarray', 'zeros', 'count_nonzero', 'empty', 'broadcast', 'dtype', + 'fromstring', 'fromfile', 'frombuffer', 'from_dlpack', 'where', + 'argwhere', 'copyto', 'concatenate', 'lexsort', 'astype', + 'can_cast', 'promote_types', 'min_scalar_type', + 'result_type', 'isfortran', 'empty_like', 'zeros_like', 'ones_like', + 'correlate', 'convolve', 'inner', 'dot', 'outer', 'vdot', 'roll', + 'rollaxis', 'moveaxis', 'cross', 'tensordot', 'little_endian', + 'fromiter', 'array_equal', 'array_equiv', 'indices', 'fromfunction', + 'isclose', 'isscalar', 'binary_repr', 'base_repr', 'ones', + 'identity', 'allclose', 'putmask', + 'flatnonzero', 'inf', 'nan', 'False_', 'True_', 'bitwise_not', + 'full', 'full_like', 'matmul', 'vecdot', 'shares_memory', + 'may_share_memory', '_get_promotion_state', '_set_promotion_state'] + + +def _zeros_like_dispatcher( + a, dtype=None, order=None, subok=None, shape=None, *, device=None +): + return (a,) + + +@array_function_dispatch(_zeros_like_dispatcher) +def zeros_like( + a, dtype=None, order='K', subok=True, shape=None, *, device=None +): + """ + Return an array of zeros with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + + Returns + ------- + out : ndarray + Array of zeros with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones_like : Return an array of ones with shape and type of input. + full_like : Return a new array with shape of input filled with value. + zeros : Return a new array setting values to zero. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6) + >>> x = x.reshape((2, 3)) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.zeros_like(x) + array([[0, 0, 0], + [0, 0, 0]]) + + >>> y = np.arange(3, dtype=float) + >>> y + array([0., 1., 2.]) + >>> np.zeros_like(y) + array([0., 0., 0.]) + + """ + res = empty_like( + a, dtype=dtype, order=order, subok=subok, shape=shape, device=device + ) + # needed instead of a 0 to get same result as zeros for string dtypes + z = zeros(1, dtype=res.dtype) + multiarray.copyto(res, z, casting='unsafe') + return res + + +@set_array_function_like_doc +@set_module('numpy') +def ones(shape, dtype=None, order='C', *, device=None, like=None): + """ + Return a new array of given shape and type, filled with ones. + + Parameters + ---------- + shape : int or sequence of ints + Shape of the new array, e.g., ``(2, 3)`` or ``2``. + dtype : data-type, optional + The desired data-type for the array, e.g., `numpy.int8`. Default is + `numpy.float64`. + order : {'C', 'F'}, optional, default: C + Whether to store multi-dimensional data in row-major + (C-style) or column-major (Fortran-style) order in + memory. + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of ones with the given shape, dtype, and order. + + See Also + -------- + ones_like : Return an array of ones with shape and type of input. + empty : Return a new uninitialized array. + zeros : Return a new array setting values to zero. + full : Return a new array of given shape filled with value. + + Examples + -------- + >>> import numpy as np + >>> np.ones(5) + array([1., 1., 1., 1., 1.]) + + >>> np.ones((5,), dtype=int) + array([1, 1, 1, 1, 1]) + + >>> np.ones((2, 1)) + array([[1.], + [1.]]) + + >>> s = (2,2) + >>> np.ones(s) + array([[1., 1.], + [1., 1.]]) + + """ + if like is not None: + return _ones_with_like( + like, shape, dtype=dtype, order=order, device=device + ) + + a = empty(shape, dtype, order, device=device) + multiarray.copyto(a, 1, casting='unsafe') + return a + + +_ones_with_like = array_function_dispatch()(ones) + + +def _ones_like_dispatcher( + a, dtype=None, order=None, subok=None, shape=None, *, device=None +): + return (a,) + + +@array_function_dispatch(_ones_like_dispatcher) +def ones_like( + a, dtype=None, order='K', subok=True, shape=None, *, device=None +): + """ + Return an array of ones with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + + Returns + ------- + out : ndarray + Array of ones with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full_like : Return a new array with shape of input filled with value. + ones : Return a new array setting values to one. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6) + >>> x = x.reshape((2, 3)) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.ones_like(x) + array([[1, 1, 1], + [1, 1, 1]]) + + >>> y = np.arange(3, dtype=float) + >>> y + array([0., 1., 2.]) + >>> np.ones_like(y) + array([1., 1., 1.]) + + """ + res = empty_like( + a, dtype=dtype, order=order, subok=subok, shape=shape, device=device + ) + multiarray.copyto(res, 1, casting='unsafe') + return res + + +def _full_dispatcher( + shape, fill_value, dtype=None, order=None, *, device=None, like=None +): + return(like,) + + +@set_array_function_like_doc +@set_module('numpy') +def full(shape, fill_value, dtype=None, order='C', *, device=None, like=None): + """ + Return a new array of given shape and type, filled with `fill_value`. + + Parameters + ---------- + shape : int or sequence of ints + Shape of the new array, e.g., ``(2, 3)`` or ``2``. + fill_value : scalar or array_like + Fill value. + dtype : data-type, optional + The desired data-type for the array The default, None, means + ``np.array(fill_value).dtype``. + order : {'C', 'F'}, optional + Whether to store multidimensional data in C- or Fortran-contiguous + (row- or column-wise) order in memory. + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of `fill_value` with the given shape, dtype, and order. + + See Also + -------- + full_like : Return a new array with shape of input filled with value. + empty : Return a new uninitialized array. + ones : Return a new array setting values to one. + zeros : Return a new array setting values to zero. + + Examples + -------- + >>> import numpy as np + >>> np.full((2, 2), np.inf) + array([[inf, inf], + [inf, inf]]) + >>> np.full((2, 2), 10) + array([[10, 10], + [10, 10]]) + + >>> np.full((2, 2), [1, 2]) + array([[1, 2], + [1, 2]]) + + """ + if like is not None: + return _full_with_like( + like, shape, fill_value, dtype=dtype, order=order, device=device + ) + + if dtype is None: + fill_value = asarray(fill_value) + dtype = fill_value.dtype + a = empty(shape, dtype, order, device=device) + multiarray.copyto(a, fill_value, casting='unsafe') + return a + + +_full_with_like = array_function_dispatch()(full) + + +def _full_like_dispatcher( + a, fill_value, dtype=None, order=None, subok=None, shape=None, + *, device=None +): + return (a,) + + +@array_function_dispatch(_full_like_dispatcher) +def full_like( + a, fill_value, dtype=None, order='K', subok=True, shape=None, + *, device=None +): + """ + Return a full array with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + fill_value : array_like + Fill value. + dtype : data-type, optional + Overrides the data type of the result. + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + device : str, optional + The device on which to place the created array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.0.0 + + Returns + ------- + out : ndarray + Array of `fill_value` with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones_like : Return an array of ones with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full : Return a new array of given shape filled with value. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6, dtype=int) + >>> np.full_like(x, 1) + array([1, 1, 1, 1, 1, 1]) + >>> np.full_like(x, 0.1) + array([0, 0, 0, 0, 0, 0]) + >>> np.full_like(x, 0.1, dtype=np.double) + array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) + >>> np.full_like(x, np.nan, dtype=np.double) + array([nan, nan, nan, nan, nan, nan]) + + >>> y = np.arange(6, dtype=np.double) + >>> np.full_like(y, 0.1) + array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) + + >>> y = np.zeros([2, 2, 3], dtype=int) + >>> np.full_like(y, [0, 0, 255]) + array([[[ 0, 0, 255], + [ 0, 0, 255]], + [[ 0, 0, 255], + [ 0, 0, 255]]]) + """ + res = empty_like( + a, dtype=dtype, order=order, subok=subok, shape=shape, device=device + ) + multiarray.copyto(res, fill_value, casting='unsafe') + return res + + +def _count_nonzero_dispatcher(a, axis=None, *, keepdims=None): + return (a,) + + +@array_function_dispatch(_count_nonzero_dispatcher) +def count_nonzero(a, axis=None, *, keepdims=False): + """ + Counts the number of non-zero values in the array ``a``. + + The word "non-zero" is in reference to the Python 2.x + built-in method ``__nonzero__()`` (renamed ``__bool__()`` + in Python 3.x) of Python objects that tests an object's + "truthfulness". For example, any number is considered + truthful if it is nonzero, whereas any string is considered + truthful if it is not the empty string. Thus, this function + (recursively) counts how many elements in ``a`` (and in + sub-arrays thereof) have their ``__nonzero__()`` or ``__bool__()`` + method evaluated to ``True``. + + Parameters + ---------- + a : array_like + The array for which to count non-zeros. + axis : int or tuple, optional + Axis or tuple of axes along which to count non-zeros. + Default is None, meaning that non-zeros will be counted + along a flattened version of ``a``. + + .. versionadded:: 1.12.0 + + keepdims : bool, optional + If this is set to True, the axes that are counted are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + .. versionadded:: 1.19.0 + + Returns + ------- + count : int or array of int + Number of non-zero values in the array along a given axis. + Otherwise, the total number of non-zero values in the array + is returned. + + See Also + -------- + nonzero : Return the coordinates of all the non-zero values. + + Examples + -------- + >>> import numpy as np + >>> np.count_nonzero(np.eye(4)) + 4 + >>> a = np.array([[0, 1, 7, 0], + ... [3, 0, 2, 19]]) + >>> np.count_nonzero(a) + 5 + >>> np.count_nonzero(a, axis=0) + array([1, 1, 2, 1]) + >>> np.count_nonzero(a, axis=1) + array([2, 3]) + >>> np.count_nonzero(a, axis=1, keepdims=True) + array([[2], + [3]]) + """ + if axis is None and not keepdims: + return multiarray.count_nonzero(a) + + a = asanyarray(a) + + # TODO: this works around .astype(bool) not working properly (gh-9847) + if np.issubdtype(a.dtype, np.character): + a_bool = a != a.dtype.type() + else: + a_bool = a.astype(np.bool, copy=False) + + return a_bool.sum(axis=axis, dtype=np.intp, keepdims=keepdims) + + +@set_module('numpy') +def isfortran(a): + """ + Check if the array is Fortran contiguous but *not* C contiguous. + + This function is obsolete. If you only want to check if an array is Fortran + contiguous use ``a.flags.f_contiguous`` instead. + + Parameters + ---------- + a : ndarray + Input array. + + Returns + ------- + isfortran : bool + Returns True if the array is Fortran contiguous but *not* C contiguous. + + + Examples + -------- + + np.array allows to specify whether the array is written in C-contiguous + order (last index varies the fastest), or FORTRAN-contiguous order in + memory (first index varies the fastest). + + >>> import numpy as np + >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') + >>> a + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(a) + False + + >>> b = np.array([[1, 2, 3], [4, 5, 6]], order='F') + >>> b + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(b) + True + + + The transpose of a C-ordered array is a FORTRAN-ordered array. + + >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') + >>> a + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(a) + False + >>> b = a.T + >>> b + array([[1, 4], + [2, 5], + [3, 6]]) + >>> np.isfortran(b) + True + + C-ordered arrays evaluate as False even if they are also FORTRAN-ordered. + + >>> np.isfortran(np.array([1, 2], order='F')) + False + + """ + return a.flags.fnc + + +def _argwhere_dispatcher(a): + return (a,) + + +@array_function_dispatch(_argwhere_dispatcher) +def argwhere(a): + """ + Find the indices of array elements that are non-zero, grouped by element. + + Parameters + ---------- + a : array_like + Input data. + + Returns + ------- + index_array : (N, a.ndim) ndarray + Indices of elements that are non-zero. Indices are grouped by element. + This array will have shape ``(N, a.ndim)`` where ``N`` is the number of + non-zero items. + + See Also + -------- + where, nonzero + + Notes + ----- + ``np.argwhere(a)`` is almost the same as ``np.transpose(np.nonzero(a))``, + but produces a result of the correct shape for a 0D array. + + The output of ``argwhere`` is not suitable for indexing arrays. + For this purpose use ``nonzero(a)`` instead. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(6).reshape(2,3) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.argwhere(x>1) + array([[0, 2], + [1, 0], + [1, 1], + [1, 2]]) + + """ + # nonzero does not behave well on 0d, so promote to 1d + if np.ndim(a) == 0: + a = shape_base.atleast_1d(a) + # then remove the added dimension + return argwhere(a)[:, :0] + return transpose(nonzero(a)) + + +def _flatnonzero_dispatcher(a): + return (a,) + + +@array_function_dispatch(_flatnonzero_dispatcher) +def flatnonzero(a): + """ + Return indices that are non-zero in the flattened version of a. + + This is equivalent to ``np.nonzero(np.ravel(a))[0]``. + + Parameters + ---------- + a : array_like + Input data. + + Returns + ------- + res : ndarray + Output array, containing the indices of the elements of ``a.ravel()`` + that are non-zero. + + See Also + -------- + nonzero : Return the indices of the non-zero elements of the input array. + ravel : Return a 1-D array containing the elements of the input array. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(-2, 3) + >>> x + array([-2, -1, 0, 1, 2]) + >>> np.flatnonzero(x) + array([0, 1, 3, 4]) + + Use the indices of the non-zero elements as an index array to extract + these elements: + + >>> x.ravel()[np.flatnonzero(x)] + array([-2, -1, 1, 2]) + + """ + return np.nonzero(np.ravel(a))[0] + + +def _correlate_dispatcher(a, v, mode=None): + return (a, v) + + +@array_function_dispatch(_correlate_dispatcher) +def correlate(a, v, mode='valid'): + r""" + Cross-correlation of two 1-dimensional sequences. + + This function computes the correlation as generally defined in signal + processing texts [1]_: + + .. math:: c_k = \sum_n a_{n+k} \cdot \overline{v}_n + + with a and v sequences being zero-padded where necessary and + :math:`\overline v` denoting complex conjugation. + + Parameters + ---------- + a, v : array_like + Input sequences. + mode : {'valid', 'same', 'full'}, optional + Refer to the `convolve` docstring. Note that the default + is 'valid', unlike `convolve`, which uses 'full'. + + Returns + ------- + out : ndarray + Discrete cross-correlation of `a` and `v`. + + See Also + -------- + convolve : Discrete, linear convolution of two one-dimensional sequences. + scipy.signal.correlate : uses FFT which has superior performance + on large arrays. + + Notes + ----- + The definition of correlation above is not unique and sometimes + correlation may be defined differently. Another common definition is [1]_: + + .. math:: c'_k = \sum_n a_{n} \cdot \overline{v_{n+k}} + + which is related to :math:`c_k` by :math:`c'_k = c_{-k}`. + + `numpy.correlate` may perform slowly in large arrays (i.e. n = 1e5) + because it does not use the FFT to compute the convolution; in that case, + `scipy.signal.correlate` might be preferable. + + References + ---------- + .. [1] Wikipedia, "Cross-correlation", + https://en.wikipedia.org/wiki/Cross-correlation + + Examples + -------- + >>> import numpy as np + >>> np.correlate([1, 2, 3], [0, 1, 0.5]) + array([3.5]) + >>> np.correlate([1, 2, 3], [0, 1, 0.5], "same") + array([2. , 3.5, 3. ]) + >>> np.correlate([1, 2, 3], [0, 1, 0.5], "full") + array([0.5, 2. , 3.5, 3. , 0. ]) + + Using complex sequences: + + >>> np.correlate([1+1j, 2, 3-1j], [0, 1, 0.5j], 'full') + array([ 0.5-0.5j, 1.0+0.j , 1.5-1.5j, 3.0-1.j , 0.0+0.j ]) + + Note that you get the time reversed, complex conjugated result + (:math:`\overline{c_{-k}}`) when the two input sequences a and v change + places: + + >>> np.correlate([0, 1, 0.5j], [1+1j, 2, 3-1j], 'full') + array([ 0.0+0.j , 3.0+1.j , 1.5+1.5j, 1.0+0.j , 0.5+0.5j]) + + """ + return multiarray.correlate2(a, v, mode) + + +def _convolve_dispatcher(a, v, mode=None): + return (a, v) + + +@array_function_dispatch(_convolve_dispatcher) +def convolve(a, v, mode='full'): + """ + Returns the discrete, linear convolution of two one-dimensional sequences. + + The convolution operator is often seen in signal processing, where it + models the effect of a linear time-invariant system on a signal [1]_. In + probability theory, the sum of two independent random variables is + distributed according to the convolution of their individual + distributions. + + If `v` is longer than `a`, the arrays are swapped before computation. + + Parameters + ---------- + a : (N,) array_like + First one-dimensional input array. + v : (M,) array_like + Second one-dimensional input array. + mode : {'full', 'valid', 'same'}, optional + 'full': + By default, mode is 'full'. This returns the convolution + at each point of overlap, with an output shape of (N+M-1,). At + the end-points of the convolution, the signals do not overlap + completely, and boundary effects may be seen. + + 'same': + Mode 'same' returns output of length ``max(M, N)``. Boundary + effects are still visible. + + 'valid': + Mode 'valid' returns output of length + ``max(M, N) - min(M, N) + 1``. The convolution product is only given + for points where the signals overlap completely. Values outside + the signal boundary have no effect. + + Returns + ------- + out : ndarray + Discrete, linear convolution of `a` and `v`. + + See Also + -------- + scipy.signal.fftconvolve : Convolve two arrays using the Fast Fourier + Transform. + scipy.linalg.toeplitz : Used to construct the convolution operator. + polymul : Polynomial multiplication. Same output as convolve, but also + accepts poly1d objects as input. + + Notes + ----- + The discrete convolution operation is defined as + + .. math:: (a * v)_n = \\sum_{m = -\\infty}^{\\infty} a_m v_{n - m} + + It can be shown that a convolution :math:`x(t) * y(t)` in time/space + is equivalent to the multiplication :math:`X(f) Y(f)` in the Fourier + domain, after appropriate padding (padding is necessary to prevent + circular convolution). Since multiplication is more efficient (faster) + than convolution, the function `scipy.signal.fftconvolve` exploits the + FFT to calculate the convolution of large data-sets. + + References + ---------- + .. [1] Wikipedia, "Convolution", + https://en.wikipedia.org/wiki/Convolution + + Examples + -------- + Note how the convolution operator flips the second array + before "sliding" the two across one another: + + >>> import numpy as np + >>> np.convolve([1, 2, 3], [0, 1, 0.5]) + array([0. , 1. , 2.5, 4. , 1.5]) + + Only return the middle values of the convolution. + Contains boundary effects, where zeros are taken + into account: + + >>> np.convolve([1,2,3],[0,1,0.5], 'same') + array([1. , 2.5, 4. ]) + + The two arrays are of the same length, so there + is only one position where they completely overlap: + + >>> np.convolve([1,2,3],[0,1,0.5], 'valid') + array([2.5]) + + """ + a, v = array(a, copy=None, ndmin=1), array(v, copy=None, ndmin=1) + if (len(v) > len(a)): + a, v = v, a + if len(a) == 0: + raise ValueError('a cannot be empty') + if len(v) == 0: + raise ValueError('v cannot be empty') + return multiarray.correlate(a, v[::-1], mode) + + +def _outer_dispatcher(a, b, out=None): + return (a, b, out) + + +@array_function_dispatch(_outer_dispatcher) +def outer(a, b, out=None): + """ + Compute the outer product of two vectors. + + Given two vectors `a` and `b` of length ``M`` and ``N``, respectively, + the outer product [1]_ is:: + + [[a_0*b_0 a_0*b_1 ... a_0*b_{N-1} ] + [a_1*b_0 . + [ ... . + [a_{M-1}*b_0 a_{M-1}*b_{N-1} ]] + + Parameters + ---------- + a : (M,) array_like + First input vector. Input is flattened if + not already 1-dimensional. + b : (N,) array_like + Second input vector. Input is flattened if + not already 1-dimensional. + out : (M, N) ndarray, optional + A location where the result is stored + + .. versionadded:: 1.9.0 + + Returns + ------- + out : (M, N) ndarray + ``out[i, j] = a[i] * b[j]`` + + See also + -------- + inner + einsum : ``einsum('i,j->ij', a.ravel(), b.ravel())`` is the equivalent. + ufunc.outer : A generalization to dimensions other than 1D and other + operations. ``np.multiply.outer(a.ravel(), b.ravel())`` + is the equivalent. + linalg.outer : An Array API compatible variation of ``np.outer``, + which accepts 1-dimensional inputs only. + tensordot : ``np.tensordot(a.ravel(), b.ravel(), axes=((), ()))`` + is the equivalent. + + References + ---------- + .. [1] G. H. Golub and C. F. Van Loan, *Matrix Computations*, 3rd + ed., Baltimore, MD, Johns Hopkins University Press, 1996, + pg. 8. + + Examples + -------- + Make a (*very* coarse) grid for computing a Mandelbrot set: + + >>> import numpy as np + >>> rl = np.outer(np.ones((5,)), np.linspace(-2, 2, 5)) + >>> rl + array([[-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.]]) + >>> im = np.outer(1j*np.linspace(2, -2, 5), np.ones((5,))) + >>> im + array([[0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j], + [0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j], + [0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j], + [0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j], + [0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j]]) + >>> grid = rl + im + >>> grid + array([[-2.+2.j, -1.+2.j, 0.+2.j, 1.+2.j, 2.+2.j], + [-2.+1.j, -1.+1.j, 0.+1.j, 1.+1.j, 2.+1.j], + [-2.+0.j, -1.+0.j, 0.+0.j, 1.+0.j, 2.+0.j], + [-2.-1.j, -1.-1.j, 0.-1.j, 1.-1.j, 2.-1.j], + [-2.-2.j, -1.-2.j, 0.-2.j, 1.-2.j, 2.-2.j]]) + + An example using a "vector" of letters: + + >>> x = np.array(['a', 'b', 'c'], dtype=object) + >>> np.outer(x, [1, 2, 3]) + array([['a', 'aa', 'aaa'], + ['b', 'bb', 'bbb'], + ['c', 'cc', 'ccc']], dtype=object) + + """ + a = asarray(a) + b = asarray(b) + return multiply(a.ravel()[:, newaxis], b.ravel()[newaxis, :], out) + + +def _tensordot_dispatcher(a, b, axes=None): + return (a, b) + + +@array_function_dispatch(_tensordot_dispatcher) +def tensordot(a, b, axes=2): + """ + Compute tensor dot product along specified axes. + + Given two tensors, `a` and `b`, and an array_like object containing + two array_like objects, ``(a_axes, b_axes)``, sum the products of + `a`'s and `b`'s elements (components) over the axes specified by + ``a_axes`` and ``b_axes``. The third argument can be a single non-negative + integer_like scalar, ``N``; if it is such, then the last ``N`` dimensions + of `a` and the first ``N`` dimensions of `b` are summed over. + + Parameters + ---------- + a, b : array_like + Tensors to "dot". + + axes : int or (2,) array_like + * integer_like + If an int N, sum over the last N axes of `a` and the first N axes + of `b` in order. The sizes of the corresponding axes must match. + * (2,) array_like + Or, a list of axes to be summed over, first sequence applying to `a`, + second to `b`. Both elements array_like must be of the same length. + + Returns + ------- + output : ndarray + The tensor dot product of the input. + + See Also + -------- + dot, einsum + + Notes + ----- + Three common use cases are: + + * ``axes = 0`` : tensor product :math:`a\\otimes b` + * ``axes = 1`` : tensor dot product :math:`a\\cdot b` + * ``axes = 2`` : (default) tensor double contraction :math:`a:b` + + When `axes` is a positive integer ``N``, the operation starts with + axis ``-N`` of `a` and axis ``0`` of `b`, and it continues through + axis ``-1`` of `a` and axis ``N-1`` of `b` (inclusive). + + When there is more than one axis to sum over - and they are not the last + (first) axes of `a` (`b`) - the argument `axes` should consist of + two sequences of the same length, with the first axis to sum over given + first in both sequences, the second axis second, and so forth. + + The shape of the result consists of the non-contracted axes of the + first tensor, followed by the non-contracted axes of the second. + + Examples + -------- + A "traditional" example: + + >>> import numpy as np + >>> a = np.arange(60.).reshape(3,4,5) + >>> b = np.arange(24.).reshape(4,3,2) + >>> c = np.tensordot(a,b, axes=([1,0],[0,1])) + >>> c.shape + (5, 2) + >>> c + array([[4400., 4730.], + [4532., 4874.], + [4664., 5018.], + [4796., 5162.], + [4928., 5306.]]) + >>> # A slower but equivalent way of computing the same... + >>> d = np.zeros((5,2)) + >>> for i in range(5): + ... for j in range(2): + ... for k in range(3): + ... for n in range(4): + ... d[i,j] += a[k,n,i] * b[n,k,j] + >>> c == d + array([[ True, True], + [ True, True], + [ True, True], + [ True, True], + [ True, True]]) + + An extended example taking advantage of the overloading of + and \\*: + + >>> a = np.array(range(1, 9)) + >>> a.shape = (2, 2, 2) + >>> A = np.array(('a', 'b', 'c', 'd'), dtype=object) + >>> A.shape = (2, 2) + >>> a; A + array([[[1, 2], + [3, 4]], + [[5, 6], + [7, 8]]]) + array([['a', 'b'], + ['c', 'd']], dtype=object) + + >>> np.tensordot(a, A) # third argument default is 2 for double-contraction + array(['abbcccdddd', 'aaaaabbbbbbcccccccdddddddd'], dtype=object) + + >>> np.tensordot(a, A, 1) + array([[['acc', 'bdd'], + ['aaacccc', 'bbbdddd']], + [['aaaaacccccc', 'bbbbbdddddd'], + ['aaaaaaacccccccc', 'bbbbbbbdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, 0) # tensor product (result too long to incl.) + array([[[[['a', 'b'], + ['c', 'd']], + ... + + >>> np.tensordot(a, A, (0, 1)) + array([[['abbbbb', 'cddddd'], + ['aabbbbbb', 'ccdddddd']], + [['aaabbbbbbb', 'cccddddddd'], + ['aaaabbbbbbbb', 'ccccdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, (2, 1)) + array([[['abb', 'cdd'], + ['aaabbbb', 'cccdddd']], + [['aaaaabbbbbb', 'cccccdddddd'], + ['aaaaaaabbbbbbbb', 'cccccccdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, ((0, 1), (0, 1))) + array(['abbbcccccddddddd', 'aabbbbccccccdddddddd'], dtype=object) + + >>> np.tensordot(a, A, ((2, 1), (1, 0))) + array(['acccbbdddd', 'aaaaacccccccbbbbbbdddddddd'], dtype=object) + + """ + try: + iter(axes) + except Exception: + axes_a = list(range(-axes, 0)) + axes_b = list(range(0, axes)) + else: + axes_a, axes_b = axes + try: + na = len(axes_a) + axes_a = list(axes_a) + except TypeError: + axes_a = [axes_a] + na = 1 + try: + nb = len(axes_b) + axes_b = list(axes_b) + except TypeError: + axes_b = [axes_b] + nb = 1 + + a, b = asarray(a), asarray(b) + as_ = a.shape + nda = a.ndim + bs = b.shape + ndb = b.ndim + equal = True + if na != nb: + equal = False + else: + for k in range(na): + if as_[axes_a[k]] != bs[axes_b[k]]: + equal = False + break + if axes_a[k] < 0: + axes_a[k] += nda + if axes_b[k] < 0: + axes_b[k] += ndb + if not equal: + raise ValueError("shape-mismatch for sum") + + # Move the axes to sum over to the end of "a" + # and to the front of "b" + notin = [k for k in range(nda) if k not in axes_a] + newaxes_a = notin + axes_a + N2 = math.prod(as_[axis] for axis in axes_a) + newshape_a = (math.prod([as_[ax] for ax in notin]), N2) + olda = [as_[axis] for axis in notin] + + notin = [k for k in range(ndb) if k not in axes_b] + newaxes_b = axes_b + notin + N2 = math.prod(bs[axis] for axis in axes_b) + newshape_b = (N2, math.prod([bs[ax] for ax in notin])) + oldb = [bs[axis] for axis in notin] + + at = a.transpose(newaxes_a).reshape(newshape_a) + bt = b.transpose(newaxes_b).reshape(newshape_b) + res = dot(at, bt) + return res.reshape(olda + oldb) + + +def _roll_dispatcher(a, shift, axis=None): + return (a,) + + +@array_function_dispatch(_roll_dispatcher) +def roll(a, shift, axis=None): + """ + Roll array elements along a given axis. + + Elements that roll beyond the last position are re-introduced at + the first. + + Parameters + ---------- + a : array_like + Input array. + shift : int or tuple of ints + The number of places by which elements are shifted. If a tuple, + then `axis` must be a tuple of the same size, and each of the + given axes is shifted by the corresponding number. If an int + while `axis` is a tuple of ints, then the same value is used for + all given axes. + axis : int or tuple of ints, optional + Axis or axes along which elements are shifted. By default, the + array is flattened before shifting, after which the original + shape is restored. + + Returns + ------- + res : ndarray + Output array, with the same shape as `a`. + + See Also + -------- + rollaxis : Roll the specified axis backwards, until it lies in a + given position. + + Notes + ----- + .. versionadded:: 1.12.0 + + Supports rolling over multiple dimensions simultaneously. + + Examples + -------- + >>> import numpy as np + >>> x = np.arange(10) + >>> np.roll(x, 2) + array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7]) + >>> np.roll(x, -2) + array([2, 3, 4, 5, 6, 7, 8, 9, 0, 1]) + + >>> x2 = np.reshape(x, (2, 5)) + >>> x2 + array([[0, 1, 2, 3, 4], + [5, 6, 7, 8, 9]]) + >>> np.roll(x2, 1) + array([[9, 0, 1, 2, 3], + [4, 5, 6, 7, 8]]) + >>> np.roll(x2, -1) + array([[1, 2, 3, 4, 5], + [6, 7, 8, 9, 0]]) + >>> np.roll(x2, 1, axis=0) + array([[5, 6, 7, 8, 9], + [0, 1, 2, 3, 4]]) + >>> np.roll(x2, -1, axis=0) + array([[5, 6, 7, 8, 9], + [0, 1, 2, 3, 4]]) + >>> np.roll(x2, 1, axis=1) + array([[4, 0, 1, 2, 3], + [9, 5, 6, 7, 8]]) + >>> np.roll(x2, -1, axis=1) + array([[1, 2, 3, 4, 0], + [6, 7, 8, 9, 5]]) + >>> np.roll(x2, (1, 1), axis=(1, 0)) + array([[9, 5, 6, 7, 8], + [4, 0, 1, 2, 3]]) + >>> np.roll(x2, (2, 1), axis=(1, 0)) + array([[8, 9, 5, 6, 7], + [3, 4, 0, 1, 2]]) + + """ + a = asanyarray(a) + if axis is None: + return roll(a.ravel(), shift, 0).reshape(a.shape) + + else: + axis = normalize_axis_tuple(axis, a.ndim, allow_duplicate=True) + broadcasted = broadcast(shift, axis) + if broadcasted.ndim > 1: + raise ValueError( + "'shift' and 'axis' should be scalars or 1D sequences") + shifts = {ax: 0 for ax in range(a.ndim)} + for sh, ax in broadcasted: + shifts[ax] += sh + + rolls = [((slice(None), slice(None)),)] * a.ndim + for ax, offset in shifts.items(): + offset %= a.shape[ax] or 1 # If `a` is empty, nothing matters. + if offset: + # (original, result), (original, result) + rolls[ax] = ((slice(None, -offset), slice(offset, None)), + (slice(-offset, None), slice(None, offset))) + + result = empty_like(a) + for indices in itertools.product(*rolls): + arr_index, res_index = zip(*indices) + result[res_index] = a[arr_index] + + return result + + +def _rollaxis_dispatcher(a, axis, start=None): + return (a,) + + +@array_function_dispatch(_rollaxis_dispatcher) +def rollaxis(a, axis, start=0): + """ + Roll the specified axis backwards, until it lies in a given position. + + This function continues to be supported for backward compatibility, but you + should prefer `moveaxis`. The `moveaxis` function was added in NumPy + 1.11. + + Parameters + ---------- + a : ndarray + Input array. + axis : int + The axis to be rolled. The positions of the other axes do not + change relative to one another. + start : int, optional + When ``start <= axis``, the axis is rolled back until it lies in + this position. When ``start > axis``, the axis is rolled until it + lies before this position. The default, 0, results in a "complete" + roll. The following table describes how negative values of ``start`` + are interpreted: + + .. table:: + :align: left + + +-------------------+----------------------+ + | ``start`` | Normalized ``start`` | + +===================+======================+ + | ``-(arr.ndim+1)`` | raise ``AxisError`` | + +-------------------+----------------------+ + | ``-arr.ndim`` | 0 | + +-------------------+----------------------+ + | |vdots| | |vdots| | + +-------------------+----------------------+ + | ``-1`` | ``arr.ndim-1`` | + +-------------------+----------------------+ + | ``0`` | ``0`` | + +-------------------+----------------------+ + | |vdots| | |vdots| | + +-------------------+----------------------+ + | ``arr.ndim`` | ``arr.ndim`` | + +-------------------+----------------------+ + | ``arr.ndim + 1`` | raise ``AxisError`` | + +-------------------+----------------------+ + + .. |vdots| unicode:: U+22EE .. Vertical Ellipsis + + Returns + ------- + res : ndarray + For NumPy >= 1.10.0 a view of `a` is always returned. For earlier + NumPy versions a view of `a` is returned only if the order of the + axes is changed, otherwise the input array is returned. + + See Also + -------- + moveaxis : Move array axes to new positions. + roll : Roll the elements of an array by a number of positions along a + given axis. + + Examples + -------- + >>> import numpy as np + >>> a = np.ones((3,4,5,6)) + >>> np.rollaxis(a, 3, 1).shape + (3, 6, 4, 5) + >>> np.rollaxis(a, 2).shape + (5, 3, 4, 6) + >>> np.rollaxis(a, 1, 4).shape + (3, 5, 6, 4) + + """ + n = a.ndim + axis = normalize_axis_index(axis, n) + if start < 0: + start += n + msg = "'%s' arg requires %d <= %s < %d, but %d was passed in" + if not (0 <= start < n + 1): + raise AxisError(msg % ('start', -n, 'start', n + 1, start)) + if axis < start: + # it's been removed + start -= 1 + if axis == start: + return a[...] + axes = list(range(0, n)) + axes.remove(axis) + axes.insert(start, axis) + return a.transpose(axes) + + +@set_module("numpy.lib.array_utils") +def normalize_axis_tuple(axis, ndim, argname=None, allow_duplicate=False): + """ + Normalizes an axis argument into a tuple of non-negative integer axes. + + This handles shorthands such as ``1`` and converts them to ``(1,)``, + as well as performing the handling of negative indices covered by + `normalize_axis_index`. + + By default, this forbids axes from being specified multiple times. + + Used internally by multi-axis-checking logic. + + .. versionadded:: 1.13.0 + + Parameters + ---------- + axis : int, iterable of int + The un-normalized index or indices of the axis. + ndim : int + The number of dimensions of the array that `axis` should be normalized + against. + argname : str, optional + A prefix to put before the error message, typically the name of the + argument. + allow_duplicate : bool, optional + If False, the default, disallow an axis from being specified twice. + + Returns + ------- + normalized_axes : tuple of int + The normalized axis index, such that `0 <= normalized_axis < ndim` + + Raises + ------ + AxisError + If any axis provided is out of range + ValueError + If an axis is repeated + + See also + -------- + normalize_axis_index : normalizing a single scalar axis + """ + # Optimization to speed-up the most common cases. + if type(axis) not in (tuple, list): + try: + axis = [operator.index(axis)] + except TypeError: + pass + # Going via an iterator directly is slower than via list comprehension. + axis = tuple([normalize_axis_index(ax, ndim, argname) for ax in axis]) + if not allow_duplicate and len(set(axis)) != len(axis): + if argname: + raise ValueError('repeated axis in `{}` argument'.format(argname)) + else: + raise ValueError('repeated axis') + return axis + + +def _moveaxis_dispatcher(a, source, destination): + return (a,) + + +@array_function_dispatch(_moveaxis_dispatcher) +def moveaxis(a, source, destination): + """ + Move axes of an array to new positions. + + Other axes remain in their original order. + + .. versionadded:: 1.11.0 + + Parameters + ---------- + a : np.ndarray + The array whose axes should be reordered. + source : int or sequence of int + Original positions of the axes to move. These must be unique. + destination : int or sequence of int + Destination positions for each of the original axes. These must also be + unique. + + Returns + ------- + result : np.ndarray + Array with moved axes. This array is a view of the input array. + + See Also + -------- + transpose : Permute the dimensions of an array. + swapaxes : Interchange two axes of an array. + + Examples + -------- + >>> import numpy as np + >>> x = np.zeros((3, 4, 5)) + >>> np.moveaxis(x, 0, -1).shape + (4, 5, 3) + >>> np.moveaxis(x, -1, 0).shape + (5, 3, 4) + + These all achieve the same result: + + >>> np.transpose(x).shape + (5, 4, 3) + >>> np.swapaxes(x, 0, -1).shape + (5, 4, 3) + >>> np.moveaxis(x, [0, 1], [-1, -2]).shape + (5, 4, 3) + >>> np.moveaxis(x, [0, 1, 2], [-1, -2, -3]).shape + (5, 4, 3) + + """ + try: + # allow duck-array types if they define transpose + transpose = a.transpose + except AttributeError: + a = asarray(a) + transpose = a.transpose + + source = normalize_axis_tuple(source, a.ndim, 'source') + destination = normalize_axis_tuple(destination, a.ndim, 'destination') + if len(source) != len(destination): + raise ValueError('`source` and `destination` arguments must have ' + 'the same number of elements') + + order = [n for n in range(a.ndim) if n not in source] + + for dest, src in sorted(zip(destination, source)): + order.insert(dest, src) + + result = transpose(order) + return result + + +def _cross_dispatcher(a, b, axisa=None, axisb=None, axisc=None, axis=None): + return (a, b) + + +@array_function_dispatch(_cross_dispatcher) +def cross(a, b, axisa=-1, axisb=-1, axisc=-1, axis=None): + """ + Return the cross product of two (arrays of) vectors. + + The cross product of `a` and `b` in :math:`R^3` is a vector perpendicular + to both `a` and `b`. If `a` and `b` are arrays of vectors, the vectors + are defined by the last axis of `a` and `b` by default, and these axes + can have dimensions 2 or 3. Where the dimension of either `a` or `b` is + 2, the third component of the input vector is assumed to be zero and the + cross product calculated accordingly. In cases where both input vectors + have dimension 2, the z-component of the cross product is returned. + + Parameters + ---------- + a : array_like + Components of the first vector(s). + b : array_like + Components of the second vector(s). + axisa : int, optional + Axis of `a` that defines the vector(s). By default, the last axis. + axisb : int, optional + Axis of `b` that defines the vector(s). By default, the last axis. + axisc : int, optional + Axis of `c` containing the cross product vector(s). Ignored if + both input vectors have dimension 2, as the return is scalar. + By default, the last axis. + axis : int, optional + If defined, the axis of `a`, `b` and `c` that defines the vector(s) + and cross product(s). Overrides `axisa`, `axisb` and `axisc`. + + Returns + ------- + c : ndarray + Vector cross product(s). + + Raises + ------ + ValueError + When the dimension of the vector(s) in `a` and/or `b` does not + equal 2 or 3. + + See Also + -------- + inner : Inner product + outer : Outer product. + linalg.cross : An Array API compatible variation of ``np.cross``, + which accepts (arrays of) 3-element vectors only. + ix_ : Construct index arrays. + + Notes + ----- + .. versionadded:: 1.9.0 + + Supports full broadcasting of the inputs. + + Dimension-2 input arrays were deprecated in 2.0.0. If you do need this + functionality, you can use:: + + def cross2d(x, y): + return x[..., 0] * y[..., 1] - x[..., 1] * y[..., 0] + + Examples + -------- + Vector cross-product. + + >>> import numpy as np + >>> x = [1, 2, 3] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([-3, 6, -3]) + + One vector with dimension 2. + + >>> x = [1, 2] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([12, -6, -3]) + + Equivalently: + + >>> x = [1, 2, 0] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([12, -6, -3]) + + Both vectors with dimension 2. + + >>> x = [1,2] + >>> y = [4,5] + >>> np.cross(x, y) + array(-3) + + Multiple vector cross-products. Note that the direction of the cross + product vector is defined by the *right-hand rule*. + + >>> x = np.array([[1,2,3], [4,5,6]]) + >>> y = np.array([[4,5,6], [1,2,3]]) + >>> np.cross(x, y) + array([[-3, 6, -3], + [ 3, -6, 3]]) + + The orientation of `c` can be changed using the `axisc` keyword. + + >>> np.cross(x, y, axisc=0) + array([[-3, 3], + [ 6, -6], + [-3, 3]]) + + Change the vector definition of `x` and `y` using `axisa` and `axisb`. + + >>> x = np.array([[1,2,3], [4,5,6], [7, 8, 9]]) + >>> y = np.array([[7, 8, 9], [4,5,6], [1,2,3]]) + >>> np.cross(x, y) + array([[ -6, 12, -6], + [ 0, 0, 0], + [ 6, -12, 6]]) + >>> np.cross(x, y, axisa=0, axisb=0) + array([[-24, 48, -24], + [-30, 60, -30], + [-36, 72, -36]]) + + """ + if axis is not None: + axisa, axisb, axisc = (axis,) * 3 + a = asarray(a) + b = asarray(b) + + if (a.ndim < 1) or (b.ndim < 1): + raise ValueError("At least one array has zero dimension") + + # Check axisa and axisb are within bounds + axisa = normalize_axis_index(axisa, a.ndim, msg_prefix='axisa') + axisb = normalize_axis_index(axisb, b.ndim, msg_prefix='axisb') + + # Move working axis to the end of the shape + a = moveaxis(a, axisa, -1) + b = moveaxis(b, axisb, -1) + msg = ("incompatible dimensions for cross product\n" + "(dimension must be 2 or 3)") + if a.shape[-1] not in (2, 3) or b.shape[-1] not in (2, 3): + raise ValueError(msg) + if a.shape[-1] == 2 or b.shape[-1] == 2: + # Deprecated in NumPy 2.0, 2023-09-26 + warnings.warn( + "Arrays of 2-dimensional vectors are deprecated. Use arrays of " + "3-dimensional vectors instead. (deprecated in NumPy 2.0)", + DeprecationWarning, stacklevel=2 + ) + + # Create the output array + shape = broadcast(a[..., 0], b[..., 0]).shape + if a.shape[-1] == 3 or b.shape[-1] == 3: + shape += (3,) + # Check axisc is within bounds + axisc = normalize_axis_index(axisc, len(shape), msg_prefix='axisc') + dtype = promote_types(a.dtype, b.dtype) + cp = empty(shape, dtype) + + # recast arrays as dtype + a = a.astype(dtype) + b = b.astype(dtype) + + # create local aliases for readability + a0 = a[..., 0] + a1 = a[..., 1] + if a.shape[-1] == 3: + a2 = a[..., 2] + b0 = b[..., 0] + b1 = b[..., 1] + if b.shape[-1] == 3: + b2 = b[..., 2] + if cp.ndim != 0 and cp.shape[-1] == 3: + cp0 = cp[..., 0] + cp1 = cp[..., 1] + cp2 = cp[..., 2] + + if a.shape[-1] == 2: + if b.shape[-1] == 2: + # a0 * b1 - a1 * b0 + multiply(a0, b1, out=cp) + cp -= a1 * b0 + return cp + else: + assert b.shape[-1] == 3 + # cp0 = a1 * b2 - 0 (a2 = 0) + # cp1 = 0 - a0 * b2 (a2 = 0) + # cp2 = a0 * b1 - a1 * b0 + multiply(a1, b2, out=cp0) + multiply(a0, b2, out=cp1) + negative(cp1, out=cp1) + multiply(a0, b1, out=cp2) + cp2 -= a1 * b0 + else: + assert a.shape[-1] == 3 + if b.shape[-1] == 3: + # cp0 = a1 * b2 - a2 * b1 + # cp1 = a2 * b0 - a0 * b2 + # cp2 = a0 * b1 - a1 * b0 + multiply(a1, b2, out=cp0) + tmp = array(a2 * b1) + cp0 -= tmp + multiply(a2, b0, out=cp1) + multiply(a0, b2, out=tmp) + cp1 -= tmp + multiply(a0, b1, out=cp2) + multiply(a1, b0, out=tmp) + cp2 -= tmp + else: + assert b.shape[-1] == 2 + # cp0 = 0 - a2 * b1 (b2 = 0) + # cp1 = a2 * b0 - 0 (b2 = 0) + # cp2 = a0 * b1 - a1 * b0 + multiply(a2, b1, out=cp0) + negative(cp0, out=cp0) + multiply(a2, b0, out=cp1) + multiply(a0, b1, out=cp2) + cp2 -= a1 * b0 + + return moveaxis(cp, -1, axisc) + + +little_endian = (sys.byteorder == 'little') + + +@set_module('numpy') +def indices(dimensions, dtype=int, sparse=False): + """ + Return an array representing the indices of a grid. + + Compute an array where the subarrays contain index values 0, 1, ... + varying only along the corresponding axis. + + Parameters + ---------- + dimensions : sequence of ints + The shape of the grid. + dtype : dtype, optional + Data type of the result. + sparse : boolean, optional + Return a sparse representation of the grid instead of a dense + representation. Default is False. + + .. versionadded:: 1.17 + + Returns + ------- + grid : one ndarray or tuple of ndarrays + If sparse is False: + Returns one array of grid indices, + ``grid.shape = (len(dimensions),) + tuple(dimensions)``. + If sparse is True: + Returns a tuple of arrays, with + ``grid[i].shape = (1, ..., 1, dimensions[i], 1, ..., 1)`` with + dimensions[i] in the ith place + + See Also + -------- + mgrid, ogrid, meshgrid + + Notes + ----- + The output shape in the dense case is obtained by prepending the number + of dimensions in front of the tuple of dimensions, i.e. if `dimensions` + is a tuple ``(r0, ..., rN-1)`` of length ``N``, the output shape is + ``(N, r0, ..., rN-1)``. + + The subarrays ``grid[k]`` contains the N-D array of indices along the + ``k-th`` axis. Explicitly:: + + grid[k, i0, i1, ..., iN-1] = ik + + Examples + -------- + >>> import numpy as np + >>> grid = np.indices((2, 3)) + >>> grid.shape + (2, 2, 3) + >>> grid[0] # row indices + array([[0, 0, 0], + [1, 1, 1]]) + >>> grid[1] # column indices + array([[0, 1, 2], + [0, 1, 2]]) + + The indices can be used as an index into an array. + + >>> x = np.arange(20).reshape(5, 4) + >>> row, col = np.indices((2, 3)) + >>> x[row, col] + array([[0, 1, 2], + [4, 5, 6]]) + + Note that it would be more straightforward in the above example to + extract the required elements directly with ``x[:2, :3]``. + + If sparse is set to true, the grid will be returned in a sparse + representation. + + >>> i, j = np.indices((2, 3), sparse=True) + >>> i.shape + (2, 1) + >>> j.shape + (1, 3) + >>> i # row indices + array([[0], + [1]]) + >>> j # column indices + array([[0, 1, 2]]) + + """ + dimensions = tuple(dimensions) + N = len(dimensions) + shape = (1,)*N + if sparse: + res = tuple() + else: + res = empty((N,)+dimensions, dtype=dtype) + for i, dim in enumerate(dimensions): + idx = arange(dim, dtype=dtype).reshape( + shape[:i] + (dim,) + shape[i+1:] + ) + if sparse: + res = res + (idx,) + else: + res[i] = idx + return res + + +@set_array_function_like_doc +@set_module('numpy') +def fromfunction(function, shape, *, dtype=float, like=None, **kwargs): + """ + Construct an array by executing a function over each coordinate. + + The resulting array therefore has a value ``fn(x, y, z)`` at + coordinate ``(x, y, z)``. + + Parameters + ---------- + function : callable + The function is called with N parameters, where N is the rank of + `shape`. Each parameter represents the coordinates of the array + varying along a specific axis. For example, if `shape` + were ``(2, 2)``, then the parameters would be + ``array([[0, 0], [1, 1]])`` and ``array([[0, 1], [0, 1]])`` + shape : (N,) tuple of ints + Shape of the output array, which also determines the shape of + the coordinate arrays passed to `function`. + dtype : data-type, optional + Data-type of the coordinate arrays passed to `function`. + By default, `dtype` is float. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + fromfunction : any + The result of the call to `function` is passed back directly. + Therefore the shape of `fromfunction` is completely determined by + `function`. If `function` returns a scalar value, the shape of + `fromfunction` would not match the `shape` parameter. + + See Also + -------- + indices, meshgrid + + Notes + ----- + Keywords other than `dtype` and `like` are passed to `function`. + + Examples + -------- + >>> import numpy as np + >>> np.fromfunction(lambda i, j: i, (2, 2), dtype=float) + array([[0., 0.], + [1., 1.]]) + + >>> np.fromfunction(lambda i, j: j, (2, 2), dtype=float) + array([[0., 1.], + [0., 1.]]) + + >>> np.fromfunction(lambda i, j: i == j, (3, 3), dtype=int) + array([[ True, False, False], + [False, True, False], + [False, False, True]]) + + >>> np.fromfunction(lambda i, j: i + j, (3, 3), dtype=int) + array([[0, 1, 2], + [1, 2, 3], + [2, 3, 4]]) + + """ + if like is not None: + return _fromfunction_with_like( + like, function, shape, dtype=dtype, **kwargs) + + args = indices(shape, dtype=dtype) + return function(*args, **kwargs) + + +_fromfunction_with_like = array_function_dispatch()(fromfunction) + + +def _frombuffer(buf, dtype, shape, order): + return frombuffer(buf, dtype=dtype).reshape(shape, order=order) + + +@set_module('numpy') +def isscalar(element): + """ + Returns True if the type of `element` is a scalar type. + + Parameters + ---------- + element : any + Input argument, can be of any type and shape. + + Returns + ------- + val : bool + True if `element` is a scalar type, False if it is not. + + See Also + -------- + ndim : Get the number of dimensions of an array + + Notes + ----- + If you need a stricter way to identify a *numerical* scalar, use + ``isinstance(x, numbers.Number)``, as that returns ``False`` for most + non-numerical elements such as strings. + + In most cases ``np.ndim(x) == 0`` should be used instead of this function, + as that will also return true for 0d arrays. This is how numpy overloads + functions in the style of the ``dx`` arguments to `gradient` and + the ``bins`` argument to `histogram`. Some key differences: + + +------------------------------------+---------------+-------------------+ + | x |``isscalar(x)``|``np.ndim(x) == 0``| + +====================================+===============+===================+ + | PEP 3141 numeric objects | ``True`` | ``True`` | + | (including builtins) | | | + +------------------------------------+---------------+-------------------+ + | builtin string and buffer objects | ``True`` | ``True`` | + +------------------------------------+---------------+-------------------+ + | other builtin objects, like | ``False`` | ``True`` | + | `pathlib.Path`, `Exception`, | | | + | the result of `re.compile` | | | + +------------------------------------+---------------+-------------------+ + | third-party objects like | ``False`` | ``True`` | + | `matplotlib.figure.Figure` | | | + +------------------------------------+---------------+-------------------+ + | zero-dimensional numpy arrays | ``False`` | ``True`` | + +------------------------------------+---------------+-------------------+ + | other numpy arrays | ``False`` | ``False`` | + +------------------------------------+---------------+-------------------+ + | `list`, `tuple`, and other | ``False`` | ``False`` | + | sequence objects | | | + +------------------------------------+---------------+-------------------+ + + Examples + -------- + >>> import numpy as np + + >>> np.isscalar(3.1) + True + + >>> np.isscalar(np.array(3.1)) + False + + >>> np.isscalar([3.1]) + False + + >>> np.isscalar(False) + True + + >>> np.isscalar('numpy') + True + + NumPy supports PEP 3141 numbers: + + >>> from fractions import Fraction + >>> np.isscalar(Fraction(5, 17)) + True + >>> from numbers import Number + >>> np.isscalar(Number()) + True + + """ + return (isinstance(element, generic) + or type(element) in ScalarType + or isinstance(element, numbers.Number)) + + +@set_module('numpy') +def binary_repr(num, width=None): + """ + Return the binary representation of the input number as a string. + + For negative numbers, if width is not given, a minus sign is added to the + front. If width is given, the two's complement of the number is + returned, with respect to that width. + + In a two's-complement system negative numbers are represented by the two's + complement of the absolute value. This is the most common method of + representing signed integers on computers [1]_. A N-bit two's-complement + system can represent every integer in the range + :math:`-2^{N-1}` to :math:`+2^{N-1}-1`. + + Parameters + ---------- + num : int + Only an integer decimal number can be used. + width : int, optional + The length of the returned string if `num` is positive, or the length + of the two's complement if `num` is negative, provided that `width` is + at least a sufficient number of bits for `num` to be represented in + the designated form. If the `width` value is insufficient, an error is + raised. + + Returns + ------- + bin : str + Binary representation of `num` or two's complement of `num`. + + See Also + -------- + base_repr: Return a string representation of a number in the given base + system. + bin: Python's built-in binary representation generator of an integer. + + Notes + ----- + `binary_repr` is equivalent to using `base_repr` with base 2, but about 25x + faster. + + References + ---------- + .. [1] Wikipedia, "Two's complement", + https://en.wikipedia.org/wiki/Two's_complement + + Examples + -------- + >>> import numpy as np + >>> np.binary_repr(3) + '11' + >>> np.binary_repr(-3) + '-11' + >>> np.binary_repr(3, width=4) + '0011' + + The two's complement is returned when the input number is negative and + width is specified: + + >>> np.binary_repr(-3, width=3) + '101' + >>> np.binary_repr(-3, width=5) + '11101' + + """ + def err_if_insufficient(width, binwidth): + if width is not None and width < binwidth: + raise ValueError( + f"Insufficient bit {width=} provided for {binwidth=}" + ) + + # Ensure that num is a Python integer to avoid overflow or unwanted + # casts to floating point. + num = operator.index(num) + + if num == 0: + return '0' * (width or 1) + + elif num > 0: + binary = bin(num)[2:] + binwidth = len(binary) + outwidth = (binwidth if width is None + else builtins.max(binwidth, width)) + err_if_insufficient(width, binwidth) + return binary.zfill(outwidth) + + else: + if width is None: + return '-' + bin(-num)[2:] + + else: + poswidth = len(bin(-num)[2:]) + + # See gh-8679: remove extra digit + # for numbers at boundaries. + if 2**(poswidth - 1) == -num: + poswidth -= 1 + + twocomp = 2**(poswidth + 1) + num + binary = bin(twocomp)[2:] + binwidth = len(binary) + + outwidth = builtins.max(binwidth, width) + err_if_insufficient(width, binwidth) + return '1' * (outwidth - binwidth) + binary + + +@set_module('numpy') +def base_repr(number, base=2, padding=0): + """ + Return a string representation of a number in the given base system. + + Parameters + ---------- + number : int + The value to convert. Positive and negative values are handled. + base : int, optional + Convert `number` to the `base` number system. The valid range is 2-36, + the default value is 2. + padding : int, optional + Number of zeros padded on the left. Default is 0 (no padding). + + Returns + ------- + out : str + String representation of `number` in `base` system. + + See Also + -------- + binary_repr : Faster version of `base_repr` for base 2. + + Examples + -------- + >>> import numpy as np + >>> np.base_repr(5) + '101' + >>> np.base_repr(6, 5) + '11' + >>> np.base_repr(7, base=5, padding=3) + '00012' + + >>> np.base_repr(10, base=16) + 'A' + >>> np.base_repr(32, base=16) + '20' + + """ + digits = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ' + if base > len(digits): + raise ValueError("Bases greater than 36 not handled in base_repr.") + elif base < 2: + raise ValueError("Bases less than 2 not handled in base_repr.") + + num = abs(int(number)) + res = [] + while num: + res.append(digits[num % base]) + num //= base + if padding: + res.append('0' * padding) + if number < 0: + res.append('-') + return ''.join(reversed(res or '0')) + + +# These are all essentially abbreviations +# These might wind up in a special abbreviations module + + +def _maketup(descr, val): + dt = dtype(descr) + # Place val in all scalar tuples: + fields = dt.fields + if fields is None: + return val + else: + res = [_maketup(fields[name][0], val) for name in dt.names] + return tuple(res) + + +@set_array_function_like_doc +@set_module('numpy') +def identity(n, dtype=None, *, like=None): + """ + Return the identity array. + + The identity array is a square array with ones on + the main diagonal. + + Parameters + ---------- + n : int + Number of rows (and columns) in `n` x `n` output. + dtype : data-type, optional + Data-type of the output. Defaults to ``float``. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + `n` x `n` array with its main diagonal set to one, + and all other elements 0. + + Examples + -------- + >>> import numpy as np + >>> np.identity(3) + array([[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]]) + + """ + if like is not None: + return _identity_with_like(like, n, dtype=dtype) + + from numpy import eye + return eye(n, dtype=dtype, like=like) + + +_identity_with_like = array_function_dispatch()(identity) + + +def _allclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None): + return (a, b, rtol, atol) + + +@array_function_dispatch(_allclose_dispatcher) +def allclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): + """ + Returns True if two arrays are element-wise equal within a tolerance. + + The tolerance values are positive, typically very small numbers. The + relative difference (`rtol` * abs(`b`)) and the absolute difference + `atol` are added together to compare against the absolute difference + between `a` and `b`. + + .. warning:: The default `atol` is not appropriate for comparing numbers + with magnitudes much smaller than one (see Notes). + + NaNs are treated as equal if they are in the same place and if + ``equal_nan=True``. Infs are treated as equal if they are in the same + place and of the same sign in both arrays. + + Parameters + ---------- + a, b : array_like + Input arrays to compare. + rtol : array_like + The relative tolerance parameter (see Notes). + atol : array_like + The absolute tolerance parameter (see Notes). + equal_nan : bool + Whether to compare NaN's as equal. If True, NaN's in `a` will be + considered equal to NaN's in `b` in the output array. + + .. versionadded:: 1.10.0 + + Returns + ------- + allclose : bool + Returns True if the two arrays are equal within the given + tolerance; False otherwise. + + See Also + -------- + isclose, all, any, equal + + Notes + ----- + If the following equation is element-wise True, then allclose returns + True.:: + + absolute(a - b) <= (atol + rtol * absolute(b)) + + The above equation is not symmetric in `a` and `b`, so that + ``allclose(a, b)`` might be different from ``allclose(b, a)`` in + some rare cases. + + The default value of `atol` is not appropriate when the reference value + `b` has magnitude smaller than one. For example, it is unlikely that + ``a = 1e-9`` and ``b = 2e-9`` should be considered "close", yet + ``allclose(1e-9, 2e-9)`` is ``True`` with default settings. Be sure + to select `atol` for the use case at hand, especially for defining the + threshold below which a non-zero value in `a` will be considered "close" + to a very small or zero value in `b`. + + The comparison of `a` and `b` uses standard broadcasting, which + means that `a` and `b` need not have the same shape in order for + ``allclose(a, b)`` to evaluate to True. The same is true for + `equal` but not `array_equal`. + + `allclose` is not defined for non-numeric data types. + `bool` is considered a numeric data-type for this purpose. + + Examples + -------- + >>> import numpy as np + >>> np.allclose([1e10,1e-7], [1.00001e10,1e-8]) + False + + >>> np.allclose([1e10,1e-8], [1.00001e10,1e-9]) + True + + >>> np.allclose([1e10,1e-8], [1.0001e10,1e-9]) + False + + >>> np.allclose([1.0, np.nan], [1.0, np.nan]) + False + + >>> np.allclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) + True + + + """ + res = all(isclose(a, b, rtol=rtol, atol=atol, equal_nan=equal_nan)) + return builtins.bool(res) + + +def _isclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None): + return (a, b, rtol, atol) + + +@array_function_dispatch(_isclose_dispatcher) +def isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): + """ + Returns a boolean array where two arrays are element-wise equal within a + tolerance. + + The tolerance values are positive, typically very small numbers. The + relative difference (`rtol` * abs(`b`)) and the absolute difference + `atol` are added together to compare against the absolute difference + between `a` and `b`. + + .. warning:: The default `atol` is not appropriate for comparing numbers + with magnitudes much smaller than one (see Notes). + + Parameters + ---------- + a, b : array_like + Input arrays to compare. + rtol : array_like + The relative tolerance parameter (see Notes). + atol : array_like + The absolute tolerance parameter (see Notes). + equal_nan : bool + Whether to compare NaN's as equal. If True, NaN's in `a` will be + considered equal to NaN's in `b` in the output array. + + Returns + ------- + y : array_like + Returns a boolean array of where `a` and `b` are equal within the + given tolerance. If both `a` and `b` are scalars, returns a single + boolean value. + + See Also + -------- + allclose + math.isclose + + Notes + ----- + .. versionadded:: 1.7.0 + + For finite values, isclose uses the following equation to test whether + two floating point values are equivalent.:: + + absolute(a - b) <= (atol + rtol * absolute(b)) + + Unlike the built-in `math.isclose`, the above equation is not symmetric + in `a` and `b` -- it assumes `b` is the reference value -- so that + `isclose(a, b)` might be different from `isclose(b, a)`. + + The default value of `atol` is not appropriate when the reference value + `b` has magnitude smaller than one. For example, it is unlikely that + ``a = 1e-9`` and ``b = 2e-9`` should be considered "close", yet + ``isclose(1e-9, 2e-9)`` is ``True`` with default settings. Be sure + to select `atol` for the use case at hand, especially for defining the + threshold below which a non-zero value in `a` will be considered "close" + to a very small or zero value in `b`. + + `isclose` is not defined for non-numeric data types. + :class:`bool` is considered a numeric data-type for this purpose. + + Examples + -------- + >>> import numpy as np + >>> np.isclose([1e10,1e-7], [1.00001e10,1e-8]) + array([ True, False]) + + >>> np.isclose([1e10,1e-8], [1.00001e10,1e-9]) + array([ True, True]) + + >>> np.isclose([1e10,1e-8], [1.0001e10,1e-9]) + array([False, True]) + + >>> np.isclose([1.0, np.nan], [1.0, np.nan]) + array([ True, False]) + + >>> np.isclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) + array([ True, True]) + + >>> np.isclose([1e-8, 1e-7], [0.0, 0.0]) + array([ True, False]) + + >>> np.isclose([1e-100, 1e-7], [0.0, 0.0], atol=0.0) + array([False, False]) + + >>> np.isclose([1e-10, 1e-10], [1e-20, 0.0]) + array([ True, True]) + + >>> np.isclose([1e-10, 1e-10], [1e-20, 0.999999e-10], atol=0.0) + array([False, True]) + + """ + # Turn all but python scalars into arrays. + x, y, atol, rtol = ( + a if isinstance(a, (int, float, complex)) else asanyarray(a) + for a in (a, b, atol, rtol)) + + # Make sure y is an inexact type to avoid bad behavior on abs(MIN_INT). + # This will cause casting of x later. Also, make sure to allow subclasses + # (e.g., for numpy.ma). + # NOTE: We explicitly allow timedelta, which used to work. This could + # possibly be deprecated. See also gh-18286. + # timedelta works if `atol` is an integer or also a timedelta. + # Although, the default tolerances are unlikely to be useful + if (dtype := getattr(y, "dtype", None)) is not None and dtype.kind != "m": + dt = multiarray.result_type(y, 1.) + y = asanyarray(y, dtype=dt) + elif isinstance(y, int): + y = float(y) + + with errstate(invalid='ignore'), _no_nep50_warning(): + result = (less_equal(abs(x-y), atol + rtol * abs(y)) + & isfinite(y) + | (x == y)) + if equal_nan: + result |= isnan(x) & isnan(y) + + return result[()] # Flatten 0d arrays to scalars + + +def _array_equal_dispatcher(a1, a2, equal_nan=None): + return (a1, a2) + + +_no_nan_types = { + # should use np.dtype.BoolDType, but as of writing + # that fails the reloading test. + type(dtype(nt.bool)), + type(dtype(nt.int8)), + type(dtype(nt.int16)), + type(dtype(nt.int32)), + type(dtype(nt.int64)), +} + + +def _dtype_cannot_hold_nan(dtype): + return type(dtype) in _no_nan_types + + +@array_function_dispatch(_array_equal_dispatcher) +def array_equal(a1, a2, equal_nan=False): + """ + True if two arrays have the same shape and elements, False otherwise. + + Parameters + ---------- + a1, a2 : array_like + Input arrays. + equal_nan : bool + Whether to compare NaN's as equal. If the dtype of a1 and a2 is + complex, values will be considered equal if either the real or the + imaginary component of a given value is ``nan``. + + .. versionadded:: 1.19.0 + + Returns + ------- + b : bool + Returns True if the arrays are equal. + + See Also + -------- + allclose: Returns True if two arrays are element-wise equal within a + tolerance. + array_equiv: Returns True if input arrays are shape consistent and all + elements equal. + + Examples + -------- + >>> import numpy as np + + >>> np.array_equal([1, 2], [1, 2]) + True + + >>> np.array_equal(np.array([1, 2]), np.array([1, 2])) + True + + >>> np.array_equal([1, 2], [1, 2, 3]) + False + + >>> np.array_equal([1, 2], [1, 4]) + False + + >>> a = np.array([1, np.nan]) + >>> np.array_equal(a, a) + False + + >>> np.array_equal(a, a, equal_nan=True) + True + + When ``equal_nan`` is True, complex values with nan components are + considered equal if either the real *or* the imaginary components are nan. + + >>> a = np.array([1 + 1j]) + >>> b = a.copy() + >>> a.real = np.nan + >>> b.imag = np.nan + >>> np.array_equal(a, b, equal_nan=True) + True + """ + try: + a1, a2 = asarray(a1), asarray(a2) + except Exception: + return False + if a1.shape != a2.shape: + return False + if not equal_nan: + return builtins.bool((asanyarray(a1 == a2)).all()) + + if a1 is a2: + # nan will compare equal so an array will compare equal to itself. + return True + + cannot_have_nan = (_dtype_cannot_hold_nan(a1.dtype) + and _dtype_cannot_hold_nan(a2.dtype)) + if cannot_have_nan: + return builtins.bool(asarray(a1 == a2).all()) + + # Handling NaN values if equal_nan is True + a1nan, a2nan = isnan(a1), isnan(a2) + # NaN's occur at different locations + if not (a1nan == a2nan).all(): + return False + # Shapes of a1, a2 and masks are guaranteed to be consistent by this point + return builtins.bool((a1[~a1nan] == a2[~a1nan]).all()) + + +def _array_equiv_dispatcher(a1, a2): + return (a1, a2) + + +@array_function_dispatch(_array_equiv_dispatcher) +def array_equiv(a1, a2): + """ + Returns True if input arrays are shape consistent and all elements equal. + + Shape consistent means they are either the same shape, or one input array + can be broadcasted to create the same shape as the other one. + + Parameters + ---------- + a1, a2 : array_like + Input arrays. + + Returns + ------- + out : bool + True if equivalent, False otherwise. + + Examples + -------- + >>> import numpy as np + >>> np.array_equiv([1, 2], [1, 2]) + True + >>> np.array_equiv([1, 2], [1, 3]) + False + + Showing the shape equivalence: + + >>> np.array_equiv([1, 2], [[1, 2], [1, 2]]) + True + >>> np.array_equiv([1, 2], [[1, 2, 1, 2], [1, 2, 1, 2]]) + False + + >>> np.array_equiv([1, 2], [[1, 2], [1, 3]]) + False + + """ + try: + a1, a2 = asarray(a1), asarray(a2) + except Exception: + return False + try: + multiarray.broadcast(a1, a2) + except Exception: + return False + + return builtins.bool(asanyarray(a1 == a2).all()) + + +def _astype_dispatcher(x, dtype, /, *, copy=None, device=None): + return (x, dtype) + + +@array_function_dispatch(_astype_dispatcher) +def astype(x, dtype, /, *, copy=True, device=None): + """ + Copies an array to a specified data type. + + This function is an Array API compatible alternative to + `numpy.ndarray.astype`. + + Parameters + ---------- + x : ndarray + Input NumPy array to cast. ``array_likes`` are explicitly not + supported here. + dtype : dtype + Data type of the result. + copy : bool, optional + Specifies whether to copy an array when the specified dtype matches + the data type of the input array ``x``. If ``True``, a newly allocated + array must always be returned. If ``False`` and the specified dtype + matches the data type of the input array, the input array must be + returned; otherwise, a newly allocated array must be returned. + Defaults to ``True``. + device : str, optional + The device on which to place the returned array. Default: None. + For Array-API interoperability only, so must be ``"cpu"`` if passed. + + .. versionadded:: 2.1.0 + + Returns + ------- + out : ndarray + An array having the specified data type. + + See Also + -------- + ndarray.astype + + Examples + -------- + >>> import numpy as np + >>> arr = np.array([1, 2, 3]); arr + array([1, 2, 3]) + >>> np.astype(arr, np.float64) + array([1., 2., 3.]) + + Non-copy case: + + >>> arr = np.array([1, 2, 3]) + >>> arr_noncpy = np.astype(arr, arr.dtype, copy=False) + >>> np.shares_memory(arr, arr_noncpy) + True + + """ + if not (isinstance(x, np.ndarray) or isscalar(x)): + raise TypeError( + "Input should be a NumPy array or scalar. " + f"It is a {type(x)} instead." + ) + if device is not None and device != "cpu": + raise ValueError( + 'Device not understood. Only "cpu" is allowed, but received:' + f' {device}' + ) + return x.astype(dtype, copy=copy) + + +inf = PINF +nan = NAN +False_ = nt.bool(False) +True_ = nt.bool(True) + + +def extend_all(module): + existing = set(__all__) + mall = getattr(module, '__all__') + for a in mall: + if a not in existing: + __all__.append(a) + + +from .umath import * +from .numerictypes import * +from . import fromnumeric +from .fromnumeric import * +from . import arrayprint +from .arrayprint import * +from . import _asarray +from ._asarray import * +from . import _ufunc_config +from ._ufunc_config import * +extend_all(fromnumeric) +extend_all(umath) +extend_all(numerictypes) +extend_all(arrayprint) +extend_all(_asarray) +extend_all(_ufunc_config) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/numeric.pyi b/valley/lib/python3.10/site-packages/numpy/_core/numeric.pyi new file mode 100644 index 0000000000000000000000000000000000000000..f25c6258f2d0188c920fef4d3f8220c0f08e3b55 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/numeric.pyi @@ -0,0 +1,707 @@ +from collections.abc import Callable, Sequence +from typing import ( + Any, + overload, + TypeVar, + Literal as L, + SupportsAbs, + SupportsIndex, + NoReturn, + TypeGuard, +) + +import numpy as np +from numpy import ( + generic, + unsignedinteger, + signedinteger, + floating, + complexfloating, + int_, + intp, + float64, + timedelta64, + object_, + _OrderKACF, + _OrderCF, +) + +from numpy._typing import ( + ArrayLike, + NDArray, + DTypeLike, + _ShapeLike, + _DTypeLike, + _ArrayLike, + _SupportsArrayFunc, + _ScalarLike_co, + _ArrayLikeBool_co, + _ArrayLikeUInt_co, + _ArrayLikeInt_co, + _ArrayLikeFloat_co, + _ArrayLikeComplex_co, + _ArrayLikeTD64_co, + _ArrayLikeObject_co, + _ArrayLikeUnknown, +) + +_T = TypeVar("_T") +_SCT = TypeVar("_SCT", bound=generic) +_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any]) + +_CorrelateMode = L["valid", "same", "full"] + +__all__: list[str] + +@overload +def zeros_like( + a: _ArrayType, + dtype: None = ..., + order: _OrderKACF = ..., + subok: L[True] = ..., + shape: None = ..., + *, + device: None | L["cpu"] = ..., +) -> _ArrayType: ... +@overload +def zeros_like( + a: _ArrayLike[_SCT], + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def zeros_like( + a: object, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... +@overload +def zeros_like( + a: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def zeros_like( + a: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... + +@overload +def ones( + shape: _ShapeLike, + dtype: None = ..., + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def ones( + shape: _ShapeLike, + dtype: _DTypeLike[_SCT], + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def ones( + shape: _ShapeLike, + dtype: DTypeLike, + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def ones_like( + a: _ArrayType, + dtype: None = ..., + order: _OrderKACF = ..., + subok: L[True] = ..., + shape: None = ..., + *, + device: None | L["cpu"] = ..., +) -> _ArrayType: ... +@overload +def ones_like( + a: _ArrayLike[_SCT], + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def ones_like( + a: object, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... +@overload +def ones_like( + a: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def ones_like( + a: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... + +@overload +def full( + shape: _ShapeLike, + fill_value: Any, + dtype: None = ..., + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def full( + shape: _ShapeLike, + fill_value: Any, + dtype: _DTypeLike[_SCT], + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def full( + shape: _ShapeLike, + fill_value: Any, + dtype: DTypeLike, + order: _OrderCF = ..., + *, + device: None | L["cpu"] = ..., + like: _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def full_like( + a: _ArrayType, + fill_value: Any, + dtype: None = ..., + order: _OrderKACF = ..., + subok: L[True] = ..., + shape: None = ..., + *, + device: None | L["cpu"] = ..., +) -> _ArrayType: ... +@overload +def full_like( + a: _ArrayLike[_SCT], + fill_value: Any, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def full_like( + a: object, + fill_value: Any, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... +@overload +def full_like( + a: Any, + fill_value: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def full_like( + a: Any, + fill_value: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike= ..., + *, + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... + +@overload +def count_nonzero( + a: ArrayLike, + axis: None = ..., + *, + keepdims: L[False] = ..., +) -> int: ... +@overload +def count_nonzero( + a: ArrayLike, + axis: _ShapeLike = ..., + *, + keepdims: bool = ..., +) -> Any: ... # TODO: np.intp or ndarray[np.intp] + +def isfortran(a: NDArray[Any] | generic) -> bool: ... + +def argwhere(a: ArrayLike) -> NDArray[intp]: ... + +def flatnonzero(a: ArrayLike) -> NDArray[intp]: ... + +@overload +def correlate( + a: _ArrayLikeUnknown, + v: _ArrayLikeUnknown, + mode: _CorrelateMode = ..., +) -> NDArray[Any]: ... +@overload +def correlate( + a: _ArrayLikeBool_co, + v: _ArrayLikeBool_co, + mode: _CorrelateMode = ..., +) -> NDArray[np.bool]: ... +@overload +def correlate( + a: _ArrayLikeUInt_co, + v: _ArrayLikeUInt_co, + mode: _CorrelateMode = ..., +) -> NDArray[unsignedinteger[Any]]: ... +@overload +def correlate( + a: _ArrayLikeInt_co, + v: _ArrayLikeInt_co, + mode: _CorrelateMode = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def correlate( + a: _ArrayLikeFloat_co, + v: _ArrayLikeFloat_co, + mode: _CorrelateMode = ..., +) -> NDArray[floating[Any]]: ... +@overload +def correlate( + a: _ArrayLikeComplex_co, + v: _ArrayLikeComplex_co, + mode: _CorrelateMode = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def correlate( + a: _ArrayLikeTD64_co, + v: _ArrayLikeTD64_co, + mode: _CorrelateMode = ..., +) -> NDArray[timedelta64]: ... +@overload +def correlate( + a: _ArrayLikeObject_co, + v: _ArrayLikeObject_co, + mode: _CorrelateMode = ..., +) -> NDArray[object_]: ... + +@overload +def convolve( + a: _ArrayLikeUnknown, + v: _ArrayLikeUnknown, + mode: _CorrelateMode = ..., +) -> NDArray[Any]: ... +@overload +def convolve( + a: _ArrayLikeBool_co, + v: _ArrayLikeBool_co, + mode: _CorrelateMode = ..., +) -> NDArray[np.bool]: ... +@overload +def convolve( + a: _ArrayLikeUInt_co, + v: _ArrayLikeUInt_co, + mode: _CorrelateMode = ..., +) -> NDArray[unsignedinteger[Any]]: ... +@overload +def convolve( + a: _ArrayLikeInt_co, + v: _ArrayLikeInt_co, + mode: _CorrelateMode = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def convolve( + a: _ArrayLikeFloat_co, + v: _ArrayLikeFloat_co, + mode: _CorrelateMode = ..., +) -> NDArray[floating[Any]]: ... +@overload +def convolve( + a: _ArrayLikeComplex_co, + v: _ArrayLikeComplex_co, + mode: _CorrelateMode = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def convolve( + a: _ArrayLikeTD64_co, + v: _ArrayLikeTD64_co, + mode: _CorrelateMode = ..., +) -> NDArray[timedelta64]: ... +@overload +def convolve( + a: _ArrayLikeObject_co, + v: _ArrayLikeObject_co, + mode: _CorrelateMode = ..., +) -> NDArray[object_]: ... + +@overload +def outer( + a: _ArrayLikeUnknown, + b: _ArrayLikeUnknown, + out: None = ..., +) -> NDArray[Any]: ... +@overload +def outer( + a: _ArrayLikeBool_co, + b: _ArrayLikeBool_co, + out: None = ..., +) -> NDArray[np.bool]: ... +@overload +def outer( + a: _ArrayLikeUInt_co, + b: _ArrayLikeUInt_co, + out: None = ..., +) -> NDArray[unsignedinteger[Any]]: ... +@overload +def outer( + a: _ArrayLikeInt_co, + b: _ArrayLikeInt_co, + out: None = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def outer( + a: _ArrayLikeFloat_co, + b: _ArrayLikeFloat_co, + out: None = ..., +) -> NDArray[floating[Any]]: ... +@overload +def outer( + a: _ArrayLikeComplex_co, + b: _ArrayLikeComplex_co, + out: None = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def outer( + a: _ArrayLikeTD64_co, + b: _ArrayLikeTD64_co, + out: None = ..., +) -> NDArray[timedelta64]: ... +@overload +def outer( + a: _ArrayLikeObject_co, + b: _ArrayLikeObject_co, + out: None = ..., +) -> NDArray[object_]: ... +@overload +def outer( + a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co, + b: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co, + out: _ArrayType, +) -> _ArrayType: ... + +@overload +def tensordot( + a: _ArrayLikeUnknown, + b: _ArrayLikeUnknown, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[Any]: ... +@overload +def tensordot( + a: _ArrayLikeBool_co, + b: _ArrayLikeBool_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[np.bool]: ... +@overload +def tensordot( + a: _ArrayLikeUInt_co, + b: _ArrayLikeUInt_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[unsignedinteger[Any]]: ... +@overload +def tensordot( + a: _ArrayLikeInt_co, + b: _ArrayLikeInt_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def tensordot( + a: _ArrayLikeFloat_co, + b: _ArrayLikeFloat_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[floating[Any]]: ... +@overload +def tensordot( + a: _ArrayLikeComplex_co, + b: _ArrayLikeComplex_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def tensordot( + a: _ArrayLikeTD64_co, + b: _ArrayLikeTD64_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[timedelta64]: ... +@overload +def tensordot( + a: _ArrayLikeObject_co, + b: _ArrayLikeObject_co, + axes: int | tuple[_ShapeLike, _ShapeLike] = ..., +) -> NDArray[object_]: ... + +@overload +def roll( + a: _ArrayLike[_SCT], + shift: _ShapeLike, + axis: None | _ShapeLike = ..., +) -> NDArray[_SCT]: ... +@overload +def roll( + a: ArrayLike, + shift: _ShapeLike, + axis: None | _ShapeLike = ..., +) -> NDArray[Any]: ... + +def rollaxis( + a: NDArray[_SCT], + axis: int, + start: int = ..., +) -> NDArray[_SCT]: ... + +def moveaxis( + a: NDArray[_SCT], + source: _ShapeLike, + destination: _ShapeLike, +) -> NDArray[_SCT]: ... + +@overload +def cross( + x1: _ArrayLikeUnknown, + x2: _ArrayLikeUnknown, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[Any]: ... +@overload +def cross( + x1: _ArrayLikeBool_co, + x2: _ArrayLikeBool_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NoReturn: ... +@overload +def cross( + x1: _ArrayLikeUInt_co, + x2: _ArrayLikeUInt_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[unsignedinteger[Any]]: ... +@overload +def cross( + x1: _ArrayLikeInt_co, + x2: _ArrayLikeInt_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def cross( + x1: _ArrayLikeFloat_co, + x2: _ArrayLikeFloat_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[floating[Any]]: ... +@overload +def cross( + x1: _ArrayLikeComplex_co, + x2: _ArrayLikeComplex_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[complexfloating[Any, Any]]: ... +@overload +def cross( + x1: _ArrayLikeObject_co, + x2: _ArrayLikeObject_co, + axisa: int = ..., + axisb: int = ..., + axisc: int = ..., + axis: None | int = ..., +) -> NDArray[object_]: ... + +@overload +def indices( + dimensions: Sequence[int], + dtype: type[int] = ..., + sparse: L[False] = ..., +) -> NDArray[int_]: ... +@overload +def indices( + dimensions: Sequence[int], + dtype: type[int] = ..., + sparse: L[True] = ..., +) -> tuple[NDArray[int_], ...]: ... +@overload +def indices( + dimensions: Sequence[int], + dtype: _DTypeLike[_SCT], + sparse: L[False] = ..., +) -> NDArray[_SCT]: ... +@overload +def indices( + dimensions: Sequence[int], + dtype: _DTypeLike[_SCT], + sparse: L[True], +) -> tuple[NDArray[_SCT], ...]: ... +@overload +def indices( + dimensions: Sequence[int], + dtype: DTypeLike, + sparse: L[False] = ..., +) -> NDArray[Any]: ... +@overload +def indices( + dimensions: Sequence[int], + dtype: DTypeLike, + sparse: L[True], +) -> tuple[NDArray[Any], ...]: ... + +def fromfunction( + function: Callable[..., _T], + shape: Sequence[int], + *, + dtype: DTypeLike = ..., + like: _SupportsArrayFunc = ..., + **kwargs: Any, +) -> _T: ... + +def isscalar(element: object) -> TypeGuard[ + generic | bool | int | float | complex | str | bytes | memoryview +]: ... + +def binary_repr(num: SupportsIndex, width: None | int = ...) -> str: ... + +def base_repr( + number: SupportsAbs[float], + base: float = ..., + padding: SupportsIndex = ..., +) -> str: ... + +@overload +def identity( + n: int, + dtype: None = ..., + *, + like: _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def identity( + n: int, + dtype: _DTypeLike[_SCT], + *, + like: _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def identity( + n: int, + dtype: DTypeLike, + *, + like: _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +def allclose( + a: ArrayLike, + b: ArrayLike, + rtol: ArrayLike = ..., + atol: ArrayLike = ..., + equal_nan: bool = ..., +) -> bool: ... + +@overload +def isclose( + a: _ScalarLike_co, + b: _ScalarLike_co, + rtol: ArrayLike = ..., + atol: ArrayLike = ..., + equal_nan: bool = ..., +) -> np.bool: ... +@overload +def isclose( + a: ArrayLike, + b: ArrayLike, + rtol: ArrayLike = ..., + atol: ArrayLike = ..., + equal_nan: bool = ..., +) -> NDArray[np.bool]: ... + +def array_equal(a1: ArrayLike, a2: ArrayLike, equal_nan: bool = ...) -> bool: ... + +def array_equiv(a1: ArrayLike, a2: ArrayLike) -> bool: ... + +@overload +def astype( + x: NDArray[Any], + dtype: _DTypeLike[_SCT], + copy: bool = ..., + device: None | L["cpu"] = ..., +) -> NDArray[_SCT]: ... +@overload +def astype( + x: NDArray[Any], + dtype: DTypeLike, + copy: bool = ..., + device: None | L["cpu"] = ..., +) -> NDArray[Any]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.py b/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.py new file mode 100644 index 0000000000000000000000000000000000000000..d736aecd5a3531b4cf1bbeced9bf0a07948cc3c7 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.py @@ -0,0 +1,629 @@ +""" +numerictypes: Define the numeric type objects + +This module is designed so "from numerictypes import \\*" is safe. +Exported symbols include: + + Dictionary with all registered number types (including aliases): + sctypeDict + + Type objects (not all will be available, depends on platform): + see variable sctypes for which ones you have + + Bit-width names + + int8 int16 int32 int64 int128 + uint8 uint16 uint32 uint64 uint128 + float16 float32 float64 float96 float128 float256 + complex32 complex64 complex128 complex192 complex256 complex512 + datetime64 timedelta64 + + c-based names + + bool + + object_ + + void, str_ + + byte, ubyte, + short, ushort + intc, uintc, + intp, uintp, + int_, uint, + longlong, ulonglong, + + single, csingle, + double, cdouble, + longdouble, clongdouble, + + As part of the type-hierarchy: xx -- is bit-width + + generic + +-> bool (kind=b) + +-> number + | +-> integer + | | +-> signedinteger (intxx) (kind=i) + | | | byte + | | | short + | | | intc + | | | intp + | | | int_ + | | | longlong + | | \\-> unsignedinteger (uintxx) (kind=u) + | | ubyte + | | ushort + | | uintc + | | uintp + | | uint + | | ulonglong + | +-> inexact + | +-> floating (floatxx) (kind=f) + | | half + | | single + | | double + | | longdouble + | \\-> complexfloating (complexxx) (kind=c) + | csingle + | cdouble + | clongdouble + +-> flexible + | +-> character + | | bytes_ (kind=S) + | | str_ (kind=U) + | | + | \\-> void (kind=V) + \\-> object_ (not used much) (kind=O) + +""" +import numbers +import warnings + +from . import multiarray as ma +from .multiarray import ( + ndarray, array, dtype, datetime_data, datetime_as_string, + busday_offset, busday_count, is_busday, busdaycalendar + ) +from .._utils import set_module + +# we add more at the bottom +__all__ = [ + 'ScalarType', 'typecodes', 'issubdtype', 'datetime_data', + 'datetime_as_string', 'busday_offset', 'busday_count', + 'is_busday', 'busdaycalendar', 'isdtype' +] + +# we don't need all these imports, but we need to keep them for compatibility +# for users using np._core.numerictypes.UPPER_TABLE +from ._string_helpers import ( + english_lower, english_upper, english_capitalize, LOWER_TABLE, UPPER_TABLE +) + +from ._type_aliases import ( + sctypeDict, allTypes, sctypes +) +from ._dtype import _kind_name + +# we don't export these for import *, but we do want them accessible +# as numerictypes.bool, etc. +from builtins import bool, int, float, complex, object, str, bytes + + +# We use this later +generic = allTypes['generic'] + +genericTypeRank = ['bool', 'int8', 'uint8', 'int16', 'uint16', + 'int32', 'uint32', 'int64', 'uint64', 'int128', + 'uint128', 'float16', + 'float32', 'float64', 'float80', 'float96', 'float128', + 'float256', + 'complex32', 'complex64', 'complex128', 'complex160', + 'complex192', 'complex256', 'complex512', 'object'] + +@set_module('numpy') +def maximum_sctype(t): + """ + Return the scalar type of highest precision of the same kind as the input. + + .. deprecated:: 2.0 + Use an explicit dtype like int64 or float64 instead. + + Parameters + ---------- + t : dtype or dtype specifier + The input data type. This can be a `dtype` object or an object that + is convertible to a `dtype`. + + Returns + ------- + out : dtype + The highest precision data type of the same kind (`dtype.kind`) as `t`. + + See Also + -------- + obj2sctype, mintypecode, sctype2char + dtype + + Examples + -------- + >>> from numpy._core.numerictypes import maximum_sctype + >>> maximum_sctype(int) + + >>> maximum_sctype(np.uint8) + + >>> maximum_sctype(complex) + # may vary + + >>> maximum_sctype(str) + + + >>> maximum_sctype('i2') + + >>> maximum_sctype('f4') + # may vary + + """ + + # Deprecated in NumPy 2.0, 2023-07-11 + warnings.warn( + "`maximum_sctype` is deprecated. Use an explicit dtype like int64 " + "or float64 instead. (deprecated in NumPy 2.0)", + DeprecationWarning, + stacklevel=2 + ) + + g = obj2sctype(t) + if g is None: + return t + t = g + base = _kind_name(dtype(t)) + if base in sctypes: + return sctypes[base][-1] + else: + return t + + +@set_module('numpy') +def issctype(rep): + """ + Determines whether the given object represents a scalar data-type. + + Parameters + ---------- + rep : any + If `rep` is an instance of a scalar dtype, True is returned. If not, + False is returned. + + Returns + ------- + out : bool + Boolean result of check whether `rep` is a scalar dtype. + + See Also + -------- + issubsctype, issubdtype, obj2sctype, sctype2char + + Examples + -------- + >>> from numpy._core.numerictypes import issctype + >>> issctype(np.int32) + True + >>> issctype(list) + False + >>> issctype(1.1) + False + + Strings are also a scalar type: + + >>> issctype(np.dtype('str')) + True + + """ + if not isinstance(rep, (type, dtype)): + return False + try: + res = obj2sctype(rep) + if res and res != object_: + return True + else: + return False + except Exception: + return False + + +@set_module('numpy') +def obj2sctype(rep, default=None): + """ + Return the scalar dtype or NumPy equivalent of Python type of an object. + + Parameters + ---------- + rep : any + The object of which the type is returned. + default : any, optional + If given, this is returned for objects whose types can not be + determined. If not given, None is returned for those objects. + + Returns + ------- + dtype : dtype or Python type + The data type of `rep`. + + See Also + -------- + sctype2char, issctype, issubsctype, issubdtype + + Examples + -------- + >>> from numpy._core.numerictypes import obj2sctype + >>> obj2sctype(np.int32) + + >>> obj2sctype(np.array([1., 2.])) + + >>> obj2sctype(np.array([1.j])) + + + >>> obj2sctype(dict) + + >>> obj2sctype('string') + + >>> obj2sctype(1, default=list) + + + """ + # prevent abstract classes being upcast + if isinstance(rep, type) and issubclass(rep, generic): + return rep + # extract dtype from arrays + if isinstance(rep, ndarray): + return rep.dtype.type + # fall back on dtype to convert + try: + res = dtype(rep) + except Exception: + return default + else: + return res.type + + +@set_module('numpy') +def issubclass_(arg1, arg2): + """ + Determine if a class is a subclass of a second class. + + `issubclass_` is equivalent to the Python built-in ``issubclass``, + except that it returns False instead of raising a TypeError if one + of the arguments is not a class. + + Parameters + ---------- + arg1 : class + Input class. True is returned if `arg1` is a subclass of `arg2`. + arg2 : class or tuple of classes. + Input class. If a tuple of classes, True is returned if `arg1` is a + subclass of any of the tuple elements. + + Returns + ------- + out : bool + Whether `arg1` is a subclass of `arg2` or not. + + See Also + -------- + issubsctype, issubdtype, issctype + + Examples + -------- + >>> np.issubclass_(np.int32, int) + False + >>> np.issubclass_(np.int32, float) + False + >>> np.issubclass_(np.float64, float) + True + + """ + try: + return issubclass(arg1, arg2) + except TypeError: + return False + + +@set_module('numpy') +def issubsctype(arg1, arg2): + """ + Determine if the first argument is a subclass of the second argument. + + Parameters + ---------- + arg1, arg2 : dtype or dtype specifier + Data-types. + + Returns + ------- + out : bool + The result. + + See Also + -------- + issctype, issubdtype, obj2sctype + + Examples + -------- + >>> from numpy._core import issubsctype + >>> issubsctype('S8', str) + False + >>> issubsctype(np.array([1]), int) + True + >>> issubsctype(np.array([1]), float) + False + + """ + return issubclass(obj2sctype(arg1), obj2sctype(arg2)) + + +class _PreprocessDTypeError(Exception): + pass + + +def _preprocess_dtype(dtype): + """ + Preprocess dtype argument by: + 1. fetching type from a data type + 2. verifying that types are built-in NumPy dtypes + """ + if isinstance(dtype, ma.dtype): + dtype = dtype.type + if isinstance(dtype, ndarray) or dtype not in allTypes.values(): + raise _PreprocessDTypeError() + return dtype + + +@set_module('numpy') +def isdtype(dtype, kind): + """ + Determine if a provided dtype is of a specified data type ``kind``. + + This function only supports built-in NumPy's data types. + Third-party dtypes are not yet supported. + + Parameters + ---------- + dtype : dtype + The input dtype. + kind : dtype or str or tuple of dtypes/strs. + dtype or dtype kind. Allowed dtype kinds are: + * ``'bool'`` : boolean kind + * ``'signed integer'`` : signed integer data types + * ``'unsigned integer'`` : unsigned integer data types + * ``'integral'`` : integer data types + * ``'real floating'`` : real-valued floating-point data types + * ``'complex floating'`` : complex floating-point data types + * ``'numeric'`` : numeric data types + + Returns + ------- + out : bool + + See Also + -------- + issubdtype + + Examples + -------- + >>> import numpy as np + >>> np.isdtype(np.float32, np.float64) + False + >>> np.isdtype(np.float32, "real floating") + True + >>> np.isdtype(np.complex128, ("real floating", "complex floating")) + True + + """ + try: + dtype = _preprocess_dtype(dtype) + except _PreprocessDTypeError: + raise TypeError( + "dtype argument must be a NumPy dtype, " + f"but it is a {type(dtype)}." + ) from None + + input_kinds = kind if isinstance(kind, tuple) else (kind,) + + processed_kinds = set() + + for kind in input_kinds: + if kind == "bool": + processed_kinds.add(allTypes["bool"]) + elif kind == "signed integer": + processed_kinds.update(sctypes["int"]) + elif kind == "unsigned integer": + processed_kinds.update(sctypes["uint"]) + elif kind == "integral": + processed_kinds.update(sctypes["int"] + sctypes["uint"]) + elif kind == "real floating": + processed_kinds.update(sctypes["float"]) + elif kind == "complex floating": + processed_kinds.update(sctypes["complex"]) + elif kind == "numeric": + processed_kinds.update( + sctypes["int"] + sctypes["uint"] + + sctypes["float"] + sctypes["complex"] + ) + elif isinstance(kind, str): + raise ValueError( + "kind argument is a string, but" + f" {repr(kind)} is not a known kind name." + ) + else: + try: + kind = _preprocess_dtype(kind) + except _PreprocessDTypeError: + raise TypeError( + "kind argument must be comprised of " + "NumPy dtypes or strings only, " + f"but is a {type(kind)}." + ) from None + processed_kinds.add(kind) + + return dtype in processed_kinds + + +@set_module('numpy') +def issubdtype(arg1, arg2): + r""" + Returns True if first argument is a typecode lower/equal in type hierarchy. + + This is like the builtin :func:`issubclass`, but for `dtype`\ s. + + Parameters + ---------- + arg1, arg2 : dtype_like + `dtype` or object coercible to one + + Returns + ------- + out : bool + + See Also + -------- + :ref:`arrays.scalars` : Overview of the numpy type hierarchy. + + Examples + -------- + `issubdtype` can be used to check the type of arrays: + + >>> ints = np.array([1, 2, 3], dtype=np.int32) + >>> np.issubdtype(ints.dtype, np.integer) + True + >>> np.issubdtype(ints.dtype, np.floating) + False + + >>> floats = np.array([1, 2, 3], dtype=np.float32) + >>> np.issubdtype(floats.dtype, np.integer) + False + >>> np.issubdtype(floats.dtype, np.floating) + True + + Similar types of different sizes are not subdtypes of each other: + + >>> np.issubdtype(np.float64, np.float32) + False + >>> np.issubdtype(np.float32, np.float64) + False + + but both are subtypes of `floating`: + + >>> np.issubdtype(np.float64, np.floating) + True + >>> np.issubdtype(np.float32, np.floating) + True + + For convenience, dtype-like objects are allowed too: + + >>> np.issubdtype('S1', np.bytes_) + True + >>> np.issubdtype('i4', np.signedinteger) + True + + """ + if not issubclass_(arg1, generic): + arg1 = dtype(arg1).type + if not issubclass_(arg2, generic): + arg2 = dtype(arg2).type + + return issubclass(arg1, arg2) + + +@set_module('numpy') +def sctype2char(sctype): + """ + Return the string representation of a scalar dtype. + + Parameters + ---------- + sctype : scalar dtype or object + If a scalar dtype, the corresponding string character is + returned. If an object, `sctype2char` tries to infer its scalar type + and then return the corresponding string character. + + Returns + ------- + typechar : str + The string character corresponding to the scalar type. + + Raises + ------ + ValueError + If `sctype` is an object for which the type can not be inferred. + + See Also + -------- + obj2sctype, issctype, issubsctype, mintypecode + + Examples + -------- + >>> from numpy._core.numerictypes import sctype2char + >>> for sctype in [np.int32, np.double, np.cdouble, np.bytes_, np.ndarray]: + ... print(sctype2char(sctype)) + l # may vary + d + D + S + O + + >>> x = np.array([1., 2-1.j]) + >>> sctype2char(x) + 'D' + >>> sctype2char(list) + 'O' + + """ + sctype = obj2sctype(sctype) + if sctype is None: + raise ValueError("unrecognized type") + if sctype not in sctypeDict.values(): + # for compatibility + raise KeyError(sctype) + return dtype(sctype).char + + +def _scalar_type_key(typ): + """A ``key`` function for `sorted`.""" + dt = dtype(typ) + return (dt.kind.lower(), dt.itemsize) + + +ScalarType = [int, float, complex, bool, bytes, str, memoryview] +ScalarType += sorted(set(sctypeDict.values()), key=_scalar_type_key) +ScalarType = tuple(ScalarType) + + +# Now add the types we've determined to this module +for key in allTypes: + globals()[key] = allTypes[key] + __all__.append(key) + +del key + +typecodes = {'Character': 'c', + 'Integer': 'bhilqnp', + 'UnsignedInteger': 'BHILQNP', + 'Float': 'efdg', + 'Complex': 'FDG', + 'AllInteger': 'bBhHiIlLqQnNpP', + 'AllFloat': 'efdgFDG', + 'Datetime': 'Mm', + 'All': '?bhilqnpBHILQNPefdgFDGSUVOMm'} + +# backwards compatibility --- deprecated name +# Formal deprecation: Numpy 1.20.0, 2020-10-19 (see numpy/__init__.py) +typeDict = sctypeDict + +def _register_types(): + numbers.Integral.register(integer) + numbers.Complex.register(inexact) + numbers.Real.register(floating) + numbers.Number.register(number) + + +_register_types() diff --git a/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.pyi b/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.pyi new file mode 100644 index 0000000000000000000000000000000000000000..b177dc55a6b617843da494df00847e9fb46314e9 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/numerictypes.pyi @@ -0,0 +1,99 @@ +from typing import ( + Literal as L, + Any, + TypeVar, + TypedDict, +) + +import numpy as np +from numpy import ( + dtype, + generic, + ubyte, + ushort, + uintc, + ulong, + ulonglong, + byte, + short, + intc, + long, + longlong, + half, + single, + double, + longdouble, + csingle, + cdouble, + clongdouble, + datetime64, + timedelta64, + object_, + str_, + bytes_, + void, +) + +from numpy._core._type_aliases import ( + sctypeDict as sctypeDict, +) + +from numpy._typing import DTypeLike + +_T = TypeVar("_T") +_SCT = TypeVar("_SCT", bound=generic) + +class _TypeCodes(TypedDict): + Character: L['c'] + Integer: L['bhilqnp'] + UnsignedInteger: L['BHILQNP'] + Float: L['efdg'] + Complex: L['FDG'] + AllInteger: L['bBhHiIlLqQnNpP'] + AllFloat: L['efdgFDG'] + Datetime: L['Mm'] + All: L['?bhilqnpBHILQNPefdgFDGSUVOMm'] + +__all__: list[str] + +def isdtype( + dtype: dtype[Any] | type[Any], + kind: DTypeLike | tuple[DTypeLike, ...] +) -> bool: ... + +def issubdtype(arg1: DTypeLike, arg2: DTypeLike) -> bool: ... + +typecodes: _TypeCodes +ScalarType: tuple[ + type[int], + type[float], + type[complex], + type[bool], + type[bytes], + type[str], + type[memoryview], + type[np.bool], + type[csingle], + type[cdouble], + type[clongdouble], + type[half], + type[single], + type[double], + type[longdouble], + type[byte], + type[short], + type[intc], + type[long], + type[longlong], + type[timedelta64], + type[datetime64], + type[object_], + type[bytes_], + type[str_], + type[ubyte], + type[ushort], + type[uintc], + type[ulong], + type[ulonglong], + type[void], +] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/overrides.py b/valley/lib/python3.10/site-packages/numpy/_core/overrides.py new file mode 100644 index 0000000000000000000000000000000000000000..6bb57c3dbf9a77d77bce4c7571553edf00f95559 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/overrides.py @@ -0,0 +1,181 @@ +"""Implementation of __array_function__ overrides from NEP-18.""" +import collections +import functools +import os + +from .._utils import set_module +from .._utils._inspect import getargspec +from numpy._core._multiarray_umath import ( + add_docstring, _get_implementing_args, _ArrayFunctionDispatcher) + + +ARRAY_FUNCTIONS = set() + +array_function_like_doc = ( + """like : array_like, optional + Reference object to allow the creation of arrays which are not + NumPy arrays. If an array-like passed in as ``like`` supports + the ``__array_function__`` protocol, the result will be defined + by it. In this case, it ensures the creation of an array object + compatible with that passed in via this argument.""" +) + +def set_array_function_like_doc(public_api): + if public_api.__doc__ is not None: + public_api.__doc__ = public_api.__doc__.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + ) + return public_api + + +add_docstring( + _ArrayFunctionDispatcher, + """ + Class to wrap functions with checks for __array_function__ overrides. + + All arguments are required, and can only be passed by position. + + Parameters + ---------- + dispatcher : function or None + The dispatcher function that returns a single sequence-like object + of all arguments relevant. It must have the same signature (except + the default values) as the actual implementation. + If ``None``, this is a ``like=`` dispatcher and the + ``_ArrayFunctionDispatcher`` must be called with ``like`` as the + first (additional and positional) argument. + implementation : function + Function that implements the operation on NumPy arrays without + overrides. Arguments passed calling the ``_ArrayFunctionDispatcher`` + will be forwarded to this (and the ``dispatcher``) as if using + ``*args, **kwargs``. + + Attributes + ---------- + _implementation : function + The original implementation passed in. + """) + + +# exposed for testing purposes; used internally by _ArrayFunctionDispatcher +add_docstring( + _get_implementing_args, + """ + Collect arguments on which to call __array_function__. + + Parameters + ---------- + relevant_args : iterable of array-like + Iterable of possibly array-like arguments to check for + __array_function__ methods. + + Returns + ------- + Sequence of arguments with __array_function__ methods, in the order in + which they should be called. + """) + + +ArgSpec = collections.namedtuple('ArgSpec', 'args varargs keywords defaults') + + +def verify_matching_signatures(implementation, dispatcher): + """Verify that a dispatcher function has the right signature.""" + implementation_spec = ArgSpec(*getargspec(implementation)) + dispatcher_spec = ArgSpec(*getargspec(dispatcher)) + + if (implementation_spec.args != dispatcher_spec.args or + implementation_spec.varargs != dispatcher_spec.varargs or + implementation_spec.keywords != dispatcher_spec.keywords or + (bool(implementation_spec.defaults) != + bool(dispatcher_spec.defaults)) or + (implementation_spec.defaults is not None and + len(implementation_spec.defaults) != + len(dispatcher_spec.defaults))): + raise RuntimeError('implementation and dispatcher for %s have ' + 'different function signatures' % implementation) + + if implementation_spec.defaults is not None: + if dispatcher_spec.defaults != (None,) * len(dispatcher_spec.defaults): + raise RuntimeError('dispatcher functions can only use None for ' + 'default argument values') + + +def array_function_dispatch(dispatcher=None, module=None, verify=True, + docs_from_dispatcher=False): + """Decorator for adding dispatch with the __array_function__ protocol. + + See NEP-18 for example usage. + + Parameters + ---------- + dispatcher : callable or None + Function that when called like ``dispatcher(*args, **kwargs)`` with + arguments from the NumPy function call returns an iterable of + array-like arguments to check for ``__array_function__``. + + If `None`, the first argument is used as the single `like=` argument + and not passed on. A function implementing `like=` must call its + dispatcher with `like` as the first non-keyword argument. + module : str, optional + __module__ attribute to set on new function, e.g., ``module='numpy'``. + By default, module is copied from the decorated function. + verify : bool, optional + If True, verify the that the signature of the dispatcher and decorated + function signatures match exactly: all required and optional arguments + should appear in order with the same names, but the default values for + all optional arguments should be ``None``. Only disable verification + if the dispatcher's signature needs to deviate for some particular + reason, e.g., because the function has a signature like + ``func(*args, **kwargs)``. + docs_from_dispatcher : bool, optional + If True, copy docs from the dispatcher function onto the dispatched + function, rather than from the implementation. This is useful for + functions defined in C, which otherwise don't have docstrings. + + Returns + ------- + Function suitable for decorating the implementation of a NumPy function. + + """ + def decorator(implementation): + if verify: + if dispatcher is not None: + verify_matching_signatures(implementation, dispatcher) + else: + # Using __code__ directly similar to verify_matching_signature + co = implementation.__code__ + last_arg = co.co_argcount + co.co_kwonlyargcount - 1 + last_arg = co.co_varnames[last_arg] + if last_arg != "like" or co.co_kwonlyargcount == 0: + raise RuntimeError( + "__array_function__ expects `like=` to be the last " + "argument and a keyword-only argument. " + f"{implementation} does not seem to comply.") + + if docs_from_dispatcher: + add_docstring(implementation, dispatcher.__doc__) + + public_api = _ArrayFunctionDispatcher(dispatcher, implementation) + public_api = functools.wraps(implementation)(public_api) + + if module is not None: + public_api.__module__ = module + + ARRAY_FUNCTIONS.add(public_api) + + return public_api + + return decorator + + +def array_function_from_dispatcher( + implementation, module=None, verify=True, docs_from_dispatcher=True): + """Like array_function_dispatcher, but with function arguments flipped.""" + + def decorator(dispatcher): + return array_function_dispatch( + dispatcher, module, verify=verify, + docs_from_dispatcher=docs_from_dispatcher)(implementation) + return decorator diff --git a/valley/lib/python3.10/site-packages/numpy/_core/records.py b/valley/lib/python3.10/site-packages/numpy/_core/records.py new file mode 100644 index 0000000000000000000000000000000000000000..1f92500aed6e823133043e9b3a0d8058e148b487 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/records.py @@ -0,0 +1,1091 @@ +""" +This module contains a set of functions for record arrays. +""" +import os +import warnings +from collections import Counter +from contextlib import nullcontext + +from .._utils import set_module +from . import numeric as sb +from . import numerictypes as nt +from .arrayprint import _get_legacy_print_mode + +# All of the functions allow formats to be a dtype +__all__ = [ + 'record', 'recarray', 'format_parser', 'fromarrays', 'fromrecords', + 'fromstring', 'fromfile', 'array', 'find_duplicate', +] + + +ndarray = sb.ndarray + +_byteorderconv = {'b': '>', + 'l': '<', + 'n': '=', + 'B': '>', + 'L': '<', + 'N': '=', + 'S': 's', + 's': 's', + '>': '>', + '<': '<', + '=': '=', + '|': '|', + 'I': '|', + 'i': '|'} + +# formats regular expression +# allows multidimensional spec with a tuple syntax in front +# of the letter code '(2,3)f4' and ' ( 2 , 3 ) f4 ' +# are equally allowed + +numfmt = nt.sctypeDict + + +@set_module('numpy.rec') +def find_duplicate(list): + """Find duplication in a list, return a list of duplicated elements""" + return [ + item + for item, counts in Counter(list).items() + if counts > 1 + ] + + +@set_module('numpy.rec') +class format_parser: + """ + Class to convert formats, names, titles description to a dtype. + + After constructing the format_parser object, the dtype attribute is + the converted data-type: + ``dtype = format_parser(formats, names, titles).dtype`` + + Attributes + ---------- + dtype : dtype + The converted data-type. + + Parameters + ---------- + formats : str or list of str + The format description, either specified as a string with + comma-separated format descriptions in the form ``'f8, i4, S5'``, or + a list of format description strings in the form + ``['f8', 'i4', 'S5']``. + names : str or list/tuple of str + The field names, either specified as a comma-separated string in the + form ``'col1, col2, col3'``, or as a list or tuple of strings in the + form ``['col1', 'col2', 'col3']``. + An empty list can be used, in that case default field names + ('f0', 'f1', ...) are used. + titles : sequence + Sequence of title strings. An empty list can be used to leave titles + out. + aligned : bool, optional + If True, align the fields by padding as the C-compiler would. + Default is False. + byteorder : str, optional + If specified, all the fields will be changed to the + provided byte-order. Otherwise, the default byte-order is + used. For all available string specifiers, see `dtype.newbyteorder`. + + See Also + -------- + numpy.dtype, numpy.typename + + Examples + -------- + >>> import numpy as np + >>> np.rec.format_parser(['>> np.rec.format_parser(['f8', 'i4', 'a5'], ['col1', 'col2', 'col3'], + ... []).dtype + dtype([('col1', '>> np.rec.format_parser([' len(titles): + self._titles += [None] * (self._nfields - len(titles)) + + def _createdtype(self, byteorder): + dtype = sb.dtype({ + 'names': self._names, + 'formats': self._f_formats, + 'offsets': self._offsets, + 'titles': self._titles, + }) + if byteorder is not None: + byteorder = _byteorderconv[byteorder[0]] + dtype = dtype.newbyteorder(byteorder) + + self.dtype = dtype + + +class record(nt.void): + """A data-type scalar that allows field access as attribute lookup. + """ + + # manually set name and module so that this class's type shows up + # as numpy.record when printed + __name__ = 'record' + __module__ = 'numpy' + + def __repr__(self): + if _get_legacy_print_mode() <= 113: + return self.__str__() + return super().__repr__() + + def __str__(self): + if _get_legacy_print_mode() <= 113: + return str(self.item()) + return super().__str__() + + def __getattribute__(self, attr): + if attr in ('setfield', 'getfield', 'dtype'): + return nt.void.__getattribute__(self, attr) + try: + return nt.void.__getattribute__(self, attr) + except AttributeError: + pass + fielddict = nt.void.__getattribute__(self, 'dtype').fields + res = fielddict.get(attr, None) + if res: + obj = self.getfield(*res[:2]) + # if it has fields return a record, + # otherwise return the object + try: + dt = obj.dtype + except AttributeError: + #happens if field is Object type + return obj + if dt.names is not None: + return obj.view((self.__class__, obj.dtype)) + return obj + else: + raise AttributeError("'record' object has no " + "attribute '%s'" % attr) + + def __setattr__(self, attr, val): + if attr in ('setfield', 'getfield', 'dtype'): + raise AttributeError("Cannot set '%s' attribute" % attr) + fielddict = nt.void.__getattribute__(self, 'dtype').fields + res = fielddict.get(attr, None) + if res: + return self.setfield(val, *res[:2]) + else: + if getattr(self, attr, None): + return nt.void.__setattr__(self, attr, val) + else: + raise AttributeError("'record' object has no " + "attribute '%s'" % attr) + + def __getitem__(self, indx): + obj = nt.void.__getitem__(self, indx) + + # copy behavior of record.__getattribute__, + if isinstance(obj, nt.void) and obj.dtype.names is not None: + return obj.view((self.__class__, obj.dtype)) + else: + # return a single element + return obj + + def pprint(self): + """Pretty-print all fields.""" + # pretty-print all fields + names = self.dtype.names + maxlen = max(len(name) for name in names) + fmt = '%% %ds: %%s' % maxlen + rows = [fmt % (name, getattr(self, name)) for name in names] + return "\n".join(rows) + +# The recarray is almost identical to a standard array (which supports +# named fields already) The biggest difference is that it can use +# attribute-lookup to find the fields and it is constructed using +# a record. + +# If byteorder is given it forces a particular byteorder on all +# the fields (and any subfields) + + +@set_module("numpy.rec") +class recarray(ndarray): + """Construct an ndarray that allows field access using attributes. + + Arrays may have a data-types containing fields, analogous + to columns in a spread sheet. An example is ``[(x, int), (y, float)]``, + where each entry in the array is a pair of ``(int, float)``. Normally, + these attributes are accessed using dictionary lookups such as ``arr['x']`` + and ``arr['y']``. Record arrays allow the fields to be accessed as members + of the array, using ``arr.x`` and ``arr.y``. + + Parameters + ---------- + shape : tuple + Shape of output array. + dtype : data-type, optional + The desired data-type. By default, the data-type is determined + from `formats`, `names`, `titles`, `aligned` and `byteorder`. + formats : list of data-types, optional + A list containing the data-types for the different columns, e.g. + ``['i4', 'f8', 'i4']``. `formats` does *not* support the new + convention of using types directly, i.e. ``(int, float, int)``. + Note that `formats` must be a list, not a tuple. + Given that `formats` is somewhat limited, we recommend specifying + `dtype` instead. + names : tuple of str, optional + The name of each column, e.g. ``('x', 'y', 'z')``. + buf : buffer, optional + By default, a new array is created of the given shape and data-type. + If `buf` is specified and is an object exposing the buffer interface, + the array will use the memory from the existing buffer. In this case, + the `offset` and `strides` keywords are available. + + Other Parameters + ---------------- + titles : tuple of str, optional + Aliases for column names. For example, if `names` were + ``('x', 'y', 'z')`` and `titles` is + ``('x_coordinate', 'y_coordinate', 'z_coordinate')``, then + ``arr['x']`` is equivalent to both ``arr.x`` and ``arr.x_coordinate``. + byteorder : {'<', '>', '='}, optional + Byte-order for all fields. + aligned : bool, optional + Align the fields in memory as the C-compiler would. + strides : tuple of ints, optional + Buffer (`buf`) is interpreted according to these strides (strides + define how many bytes each array element, row, column, etc. + occupy in memory). + offset : int, optional + Start reading buffer (`buf`) from this offset onwards. + order : {'C', 'F'}, optional + Row-major (C-style) or column-major (Fortran-style) order. + + Returns + ------- + rec : recarray + Empty array of the given shape and type. + + See Also + -------- + numpy.rec.fromrecords : Construct a record array from data. + numpy.record : fundamental data-type for `recarray`. + numpy.rec.format_parser : determine data-type from formats, names, titles. + + Notes + ----- + This constructor can be compared to ``empty``: it creates a new record + array but does not fill it with data. To create a record array from data, + use one of the following methods: + + 1. Create a standard ndarray and convert it to a record array, + using ``arr.view(np.recarray)`` + 2. Use the `buf` keyword. + 3. Use `np.rec.fromrecords`. + + Examples + -------- + Create an array with two fields, ``x`` and ``y``: + + >>> import numpy as np + >>> x = np.array([(1.0, 2), (3.0, 4)], dtype=[('x', '>> x + array([(1., 2), (3., 4)], dtype=[('x', '>> x['x'] + array([1., 3.]) + + View the array as a record array: + + >>> x = x.view(np.recarray) + + >>> x.x + array([1., 3.]) + + >>> x.y + array([2, 4]) + + Create a new, empty record array: + + >>> np.recarray((2,), + ... dtype=[('x', int), ('y', float), ('z', int)]) #doctest: +SKIP + rec.array([(-1073741821, 1.2249118382103472e-301, 24547520), + (3471280, 1.2134086255804012e-316, 0)], + dtype=[('x', ' 0 or self.shape == (0,): + lst = sb.array2string( + self, separator=', ', prefix=prefix, suffix=',') + else: + # show zero-length shape unless it is (0,) + lst = "[], shape=%s" % (repr(self.shape),) + + lf = '\n'+' '*len(prefix) + if _get_legacy_print_mode() <= 113: + lf = ' ' + lf # trailing space + return fmt % (lst, lf, repr_dtype) + + def field(self, attr, val=None): + if isinstance(attr, int): + names = ndarray.__getattribute__(self, 'dtype').names + attr = names[attr] + + fielddict = ndarray.__getattribute__(self, 'dtype').fields + + res = fielddict[attr][:2] + + if val is None: + obj = self.getfield(*res) + if obj.dtype.names is not None: + return obj + return obj.view(ndarray) + else: + return self.setfield(val, *res) + + +def _deprecate_shape_0_as_None(shape): + if shape == 0: + warnings.warn( + "Passing `shape=0` to have the shape be inferred is deprecated, " + "and in future will be equivalent to `shape=(0,)`. To infer " + "the shape and suppress this warning, pass `shape=None` instead.", + FutureWarning, stacklevel=3) + return None + else: + return shape + + +@set_module("numpy.rec") +def fromarrays(arrayList, dtype=None, shape=None, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + """Create a record array from a (flat) list of arrays + + Parameters + ---------- + arrayList : list or tuple + List of array-like objects (such as lists, tuples, + and ndarrays). + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + Shape of the resulting array. If not provided, inferred from + ``arrayList[0]``. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.rec.format_parser` to construct a dtype. See that function for + detailed documentation. + + Returns + ------- + np.recarray + Record array consisting of given arrayList columns. + + Examples + -------- + >>> x1=np.array([1,2,3,4]) + >>> x2=np.array(['a','dd','xyz','12']) + >>> x3=np.array([1.1,2,3,4]) + >>> r = np.rec.fromarrays([x1,x2,x3],names='a,b,c') + >>> print(r[1]) + (2, 'dd', 2.0) # may vary + >>> x1[1]=34 + >>> r.a + array([1, 2, 3, 4]) + + >>> x1 = np.array([1, 2, 3, 4]) + >>> x2 = np.array(['a', 'dd', 'xyz', '12']) + >>> x3 = np.array([1.1, 2, 3,4]) + >>> r = np.rec.fromarrays( + ... [x1, x2, x3], + ... dtype=np.dtype([('a', np.int32), ('b', 'S3'), ('c', np.float32)])) + >>> r + rec.array([(1, b'a', 1.1), (2, b'dd', 2. ), (3, b'xyz', 3. ), + (4, b'12', 4. )], + dtype=[('a', ' 0: + shape = shape[:-nn] + + _array = recarray(shape, descr) + + # populate the record array (makes a copy) + for k, obj in enumerate(arrayList): + nn = descr[k].ndim + testshape = obj.shape[:obj.ndim - nn] + name = _names[k] + if testshape != shape: + raise ValueError(f'array-shape mismatch in array {k} ("{name}")') + + _array[name] = obj + + return _array + + +@set_module("numpy.rec") +def fromrecords(recList, dtype=None, shape=None, formats=None, names=None, + titles=None, aligned=False, byteorder=None): + """Create a recarray from a list of records in text form. + + Parameters + ---------- + recList : sequence + data in the same field may be heterogeneous - they will be promoted + to the highest data type. + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + shape of each array. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + + If both `formats` and `dtype` are None, then this will auto-detect + formats. Use list of tuples rather than list of lists for faster + processing. + + Returns + ------- + np.recarray + record array consisting of given recList rows. + + Examples + -------- + >>> r=np.rec.fromrecords([(456,'dbe',1.2),(2,'de',1.3)], + ... names='col1,col2,col3') + >>> print(r[0]) + (456, 'dbe', 1.2) + >>> r.col1 + array([456, 2]) + >>> r.col2 + array(['dbe', 'de'], dtype='>> import pickle + >>> pickle.loads(pickle.dumps(r)) + rec.array([(456, 'dbe', 1.2), ( 2, 'de', 1.3)], + dtype=[('col1', ' 1: + raise ValueError("Can only deal with 1-d array.") + _array = recarray(shape, descr) + for k in range(_array.size): + _array[k] = tuple(recList[k]) + # list of lists instead of list of tuples ? + # 2018-02-07, 1.14.1 + warnings.warn( + "fromrecords expected a list of tuples, may have received a list " + "of lists instead. In the future that will raise an error", + FutureWarning, stacklevel=2) + return _array + else: + if shape is not None and retval.shape != shape: + retval.shape = shape + + res = retval.view(recarray) + + return res + + +@set_module("numpy.rec") +def fromstring(datastring, dtype=None, shape=None, offset=0, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + r"""Create a record array from binary data + + Note that despite the name of this function it does not accept `str` + instances. + + Parameters + ---------- + datastring : bytes-like + Buffer of binary data + dtype : data-type, optional + Valid dtype for all arrays + shape : int or tuple of ints, optional + Shape of each array. + offset : int, optional + Position in the buffer to start reading from. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + + + Returns + ------- + np.recarray + Record array view into the data in datastring. This will be readonly + if `datastring` is readonly. + + See Also + -------- + numpy.frombuffer + + Examples + -------- + >>> a = b'\x01\x02\x03abc' + >>> np.rec.fromstring(a, dtype='u1,u1,u1,S3') + rec.array([(1, 2, 3, b'abc')], + dtype=[('f0', 'u1'), ('f1', 'u1'), ('f2', 'u1'), ('f3', 'S3')]) + + >>> grades_dtype = [('Name', (np.str_, 10)), ('Marks', np.float64), + ... ('GradeLevel', np.int32)] + >>> grades_array = np.array([('Sam', 33.3, 3), ('Mike', 44.4, 5), + ... ('Aadi', 66.6, 6)], dtype=grades_dtype) + >>> np.rec.fromstring(grades_array.tobytes(), dtype=grades_dtype) + rec.array([('Sam', 33.3, 3), ('Mike', 44.4, 5), ('Aadi', 66.6, 6)], + dtype=[('Name', '>> s = '\x01\x02\x03abc' + >>> np.rec.fromstring(s, dtype='u1,u1,u1,S3') + Traceback (most recent call last): + ... + TypeError: a bytes-like object is required, not 'str' + """ + + if dtype is None and formats is None: + raise TypeError("fromstring() needs a 'dtype' or 'formats' argument") + + if dtype is not None: + descr = sb.dtype(dtype) + else: + descr = format_parser(formats, names, titles, aligned, byteorder).dtype + + itemsize = descr.itemsize + + # NumPy 1.19.0, 2020-01-01 + shape = _deprecate_shape_0_as_None(shape) + + if shape in (None, -1): + shape = (len(datastring) - offset) // itemsize + + _array = recarray(shape, descr, buf=datastring, offset=offset) + return _array + +def get_remaining_size(fd): + pos = fd.tell() + try: + fd.seek(0, 2) + return fd.tell() - pos + finally: + fd.seek(pos, 0) + + +@set_module("numpy.rec") +def fromfile(fd, dtype=None, shape=None, offset=0, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + """Create an array from binary file data + + Parameters + ---------- + fd : str or file type + If file is a string or a path-like object then that file is opened, + else it is assumed to be a file object. The file object must + support random access (i.e. it must have tell and seek methods). + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + shape of each array. + offset : int, optional + Position in the file to start reading from. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation + + Returns + ------- + np.recarray + record array consisting of data enclosed in file. + + Examples + -------- + >>> from tempfile import TemporaryFile + >>> a = np.empty(10,dtype='f8,i4,a5') + >>> a[5] = (0.5,10,'abcde') + >>> + >>> fd=TemporaryFile() + >>> a = a.view(a.dtype.newbyteorder('<')) + >>> a.tofile(fd) + >>> + >>> _ = fd.seek(0) + >>> r=np.rec.fromfile(fd, formats='f8,i4,a5', shape=10, + ... byteorder='<') + >>> print(r[5]) + (0.5, 10, b'abcde') + >>> r.shape + (10,) + """ + + if dtype is None and formats is None: + raise TypeError("fromfile() needs a 'dtype' or 'formats' argument") + + # NumPy 1.19.0, 2020-01-01 + shape = _deprecate_shape_0_as_None(shape) + + if shape is None: + shape = (-1,) + elif isinstance(shape, int): + shape = (shape,) + + if hasattr(fd, 'readinto'): + # GH issue 2504. fd supports io.RawIOBase or io.BufferedIOBase + # interface. Example of fd: gzip, BytesIO, BufferedReader + # file already opened + ctx = nullcontext(fd) + else: + # open file + ctx = open(os.fspath(fd), 'rb') + + with ctx as fd: + if offset > 0: + fd.seek(offset, 1) + size = get_remaining_size(fd) + + if dtype is not None: + descr = sb.dtype(dtype) + else: + descr = format_parser( + formats, names, titles, aligned, byteorder + ).dtype + + itemsize = descr.itemsize + + shapeprod = sb.array(shape).prod(dtype=nt.intp) + shapesize = shapeprod * itemsize + if shapesize < 0: + shape = list(shape) + shape[shape.index(-1)] = size // -shapesize + shape = tuple(shape) + shapeprod = sb.array(shape).prod(dtype=nt.intp) + + nbytes = shapeprod * itemsize + + if nbytes > size: + raise ValueError( + "Not enough bytes left in file for specified " + "shape and type." + ) + + # create the array + _array = recarray(shape, descr) + nbytesread = fd.readinto(_array.data) + if nbytesread != nbytes: + raise OSError("Didn't read as many bytes as expected") + + return _array + + +@set_module("numpy.rec") +def array(obj, dtype=None, shape=None, offset=0, strides=None, formats=None, + names=None, titles=None, aligned=False, byteorder=None, copy=True): + """ + Construct a record array from a wide-variety of objects. + + A general-purpose record array constructor that dispatches to the + appropriate `recarray` creation function based on the inputs (see Notes). + + Parameters + ---------- + obj : any + Input object. See Notes for details on how various input types are + treated. + dtype : data-type, optional + Valid dtype for array. + shape : int or tuple of ints, optional + Shape of each array. + offset : int, optional + Position in the file or buffer to start reading from. + strides : tuple of ints, optional + Buffer (`buf`) is interpreted according to these strides (strides + define how many bytes each array element, row, column, etc. + occupy in memory). + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + copy : bool, optional + Whether to copy the input object (True), or to use a reference instead. + This option only applies when the input is an ndarray or recarray. + Defaults to True. + + Returns + ------- + np.recarray + Record array created from the specified object. + + Notes + ----- + If `obj` is ``None``, then call the `~numpy.recarray` constructor. If + `obj` is a string, then call the `fromstring` constructor. If `obj` is a + list or a tuple, then if the first object is an `~numpy.ndarray`, call + `fromarrays`, otherwise call `fromrecords`. If `obj` is a + `~numpy.recarray`, then make a copy of the data in the recarray + (if ``copy=True``) and use the new formats, names, and titles. If `obj` + is a file, then call `fromfile`. Finally, if obj is an `ndarray`, then + return ``obj.view(recarray)``, making a copy of the data if ``copy=True``. + + Examples + -------- + >>> a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) + >>> a + array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + + >>> np.rec.array(a) + rec.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]], + dtype=int64) + + >>> b = [(1, 1), (2, 4), (3, 9)] + >>> c = np.rec.array(b, formats = ['i2', 'f2'], names = ('x', 'y')) + >>> c + rec.array([(1, 1.), (2, 4.), (3, 9.)], + dtype=[('x', '>> c.x + array([1, 2, 3], dtype=int16) + + >>> c.y + array([1., 4., 9.], dtype=float16) + + >>> r = np.rec.array(['abc','def'], names=['col1','col2']) + >>> print(r.col1) + abc + + >>> r.col1 + array('abc', dtype='>> r.col2 + array('def', dtype=' object: ... + def tell(self, /) -> int: ... + def readinto(self, buffer: memoryview, /) -> int: ... + +class record(void): + def __getattribute__(self, attr: str) -> Any: ... + def __setattr__(self, attr: str, val: ArrayLike) -> None: ... + def pprint(self) -> str: ... + @overload + def __getitem__(self, key: str | SupportsIndex) -> Any: ... + @overload + def __getitem__(self, key: list[str]) -> record: ... + +class recarray(ndarray[_ShapeType_co, _DType_co]): + # NOTE: While not strictly mandatory, we're demanding here that arguments + # for the `format_parser`- and `dtype`-based dtype constructors are + # mutually exclusive + @overload + def __new__( + subtype, + shape: _ShapeLike, + dtype: None = ..., + buf: None | _SupportsBuffer = ..., + offset: SupportsIndex = ..., + strides: None | _ShapeLike = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + byteorder: None | _ByteOrder = ..., + aligned: bool = ..., + order: _OrderKACF = ..., + ) -> recarray[Any, dtype[record]]: ... + @overload + def __new__( + subtype, + shape: _ShapeLike, + dtype: DTypeLike, + buf: None | _SupportsBuffer = ..., + offset: SupportsIndex = ..., + strides: None | _ShapeLike = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + byteorder: None = ..., + aligned: Literal[False] = ..., + order: _OrderKACF = ..., + ) -> recarray[Any, dtype[Any]]: ... + def __array_finalize__(self, obj: object) -> None: ... + def __getattribute__(self, attr: str) -> Any: ... + def __setattr__(self, attr: str, val: ArrayLike) -> None: ... + @overload + def __getitem__(self, indx: ( + SupportsIndex + | _ArrayLikeInt_co + | tuple[SupportsIndex | _ArrayLikeInt_co, ...] + )) -> Any: ... + @overload + def __getitem__(self: recarray[Any, dtype[void]], indx: ( + None + | slice + | ellipsis + | SupportsIndex + | _ArrayLikeInt_co + | tuple[None | slice | ellipsis | _ArrayLikeInt_co | SupportsIndex, ...] + )) -> recarray[Any, _DType_co]: ... + @overload + def __getitem__(self, indx: ( + None + | slice + | ellipsis + | SupportsIndex + | _ArrayLikeInt_co + | tuple[None | slice | ellipsis | _ArrayLikeInt_co | SupportsIndex, ...] + )) -> ndarray[Any, _DType_co]: ... + @overload + def __getitem__(self, indx: str) -> NDArray[Any]: ... + @overload + def __getitem__(self, indx: list[str]) -> recarray[_ShapeType_co, dtype[record]]: ... + @overload + def field(self, attr: int | str, val: None = ...) -> Any: ... + @overload + def field(self, attr: int | str, val: ArrayLike) -> None: ... + +class format_parser: + dtype: dtype[void] + def __init__( + self, + formats: DTypeLike, + names: None | str | Sequence[str], + titles: None | str | Sequence[str], + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., + ) -> None: ... + +__all__: list[str] + +@overload +def fromarrays( + arrayList: Iterable[ArrayLike], + dtype: DTypeLike = ..., + shape: None | _ShapeLike = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., +) -> _RecArray[Any]: ... +@overload +def fromarrays( + arrayList: Iterable[ArrayLike], + dtype: None = ..., + shape: None | _ShapeLike = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., +) -> _RecArray[record]: ... + +@overload +def fromrecords( + recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]], + dtype: DTypeLike = ..., + shape: None | _ShapeLike = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., +) -> _RecArray[record]: ... +@overload +def fromrecords( + recList: _ArrayLikeVoid_co | tuple[Any, ...] | _NestedSequence[tuple[Any, ...]], + dtype: None = ..., + shape: None | _ShapeLike = ..., + *, + formats: DTypeLike = ..., + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., +) -> _RecArray[record]: ... + +@overload +def fromstring( + datastring: _SupportsBuffer, + dtype: DTypeLike, + shape: None | _ShapeLike = ..., + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., +) -> _RecArray[record]: ... +@overload +def fromstring( + datastring: _SupportsBuffer, + dtype: None = ..., + shape: None | _ShapeLike = ..., + offset: int = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., +) -> _RecArray[record]: ... + +@overload +def fromfile( + fd: str | bytes | os.PathLike[str] | os.PathLike[bytes] | _SupportsReadInto, + dtype: DTypeLike, + shape: None | _ShapeLike = ..., + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., +) -> _RecArray[Any]: ... +@overload +def fromfile( + fd: str | bytes | os.PathLike[str] | os.PathLike[bytes] | _SupportsReadInto, + dtype: None = ..., + shape: None | _ShapeLike = ..., + offset: int = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., +) -> _RecArray[record]: ... + +@overload +def array( + obj: _SCT | NDArray[_SCT], + dtype: None = ..., + shape: None | _ShapeLike = ..., + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., + copy: bool = ..., +) -> _RecArray[_SCT]: ... +@overload +def array( + obj: ArrayLike, + dtype: DTypeLike, + shape: None | _ShapeLike = ..., + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., + copy: bool = ..., +) -> _RecArray[Any]: ... +@overload +def array( + obj: ArrayLike, + dtype: None = ..., + shape: None | _ShapeLike = ..., + offset: int = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., + copy: bool = ..., +) -> _RecArray[record]: ... +@overload +def array( + obj: None, + dtype: DTypeLike, + shape: _ShapeLike, + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., + copy: bool = ..., +) -> _RecArray[Any]: ... +@overload +def array( + obj: None, + dtype: None = ..., + *, + shape: _ShapeLike, + offset: int = ..., + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., + copy: bool = ..., +) -> _RecArray[record]: ... +@overload +def array( + obj: _SupportsReadInto, + dtype: DTypeLike, + shape: None | _ShapeLike = ..., + offset: int = ..., + formats: None = ..., + names: None = ..., + titles: None = ..., + aligned: bool = ..., + byteorder: None = ..., + copy: bool = ..., +) -> _RecArray[Any]: ... +@overload +def array( + obj: _SupportsReadInto, + dtype: None = ..., + shape: None | _ShapeLike = ..., + offset: int = ..., + *, + formats: DTypeLike, + names: None | str | Sequence[str] = ..., + titles: None | str | Sequence[str] = ..., + aligned: bool = ..., + byteorder: None | _ByteOrder = ..., + copy: bool = ..., +) -> _RecArray[record]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/shape_base.py b/valley/lib/python3.10/site-packages/numpy/_core/shape_base.py new file mode 100644 index 0000000000000000000000000000000000000000..ebee4c0611965768e80f3871a7b8d8ef9ad62055 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/shape_base.py @@ -0,0 +1,1004 @@ +__all__ = ['atleast_1d', 'atleast_2d', 'atleast_3d', 'block', 'hstack', + 'stack', 'unstack', 'vstack'] + +import functools +import itertools +import operator +import warnings + +from . import numeric as _nx +from . import overrides +from .multiarray import array, asanyarray, normalize_axis_index +from . import fromnumeric as _from_nx + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy') + + +def _atleast_1d_dispatcher(*arys): + return arys + + +@array_function_dispatch(_atleast_1d_dispatcher) +def atleast_1d(*arys): + """ + Convert inputs to arrays with at least one dimension. + + Scalar inputs are converted to 1-dimensional arrays, whilst + higher-dimensional inputs are preserved. + + Parameters + ---------- + arys1, arys2, ... : array_like + One or more input arrays. + + Returns + ------- + ret : ndarray + An array, or tuple of arrays, each with ``a.ndim >= 1``. + Copies are made only if necessary. + + See Also + -------- + atleast_2d, atleast_3d + + Examples + -------- + >>> import numpy as np + >>> np.atleast_1d(1.0) + array([1.]) + + >>> x = np.arange(9.0).reshape(3,3) + >>> np.atleast_1d(x) + array([[0., 1., 2.], + [3., 4., 5.], + [6., 7., 8.]]) + >>> np.atleast_1d(x) is x + True + + >>> np.atleast_1d(1, [3, 4]) + (array([1]), array([3, 4])) + + """ + if len(arys) == 1: + result = asanyarray(arys[0]) + if result.ndim == 0: + result = result.reshape(1) + return result + res = [] + for ary in arys: + result = asanyarray(ary) + if result.ndim == 0: + result = result.reshape(1) + res.append(result) + return tuple(res) + + +def _atleast_2d_dispatcher(*arys): + return arys + + +@array_function_dispatch(_atleast_2d_dispatcher) +def atleast_2d(*arys): + """ + View inputs as arrays with at least two dimensions. + + Parameters + ---------- + arys1, arys2, ... : array_like + One or more array-like sequences. Non-array inputs are converted + to arrays. Arrays that already have two or more dimensions are + preserved. + + Returns + ------- + res, res2, ... : ndarray + An array, or tuple of arrays, each with ``a.ndim >= 2``. + Copies are avoided where possible, and views with two or more + dimensions are returned. + + See Also + -------- + atleast_1d, atleast_3d + + Examples + -------- + >>> import numpy as np + >>> np.atleast_2d(3.0) + array([[3.]]) + + >>> x = np.arange(3.0) + >>> np.atleast_2d(x) + array([[0., 1., 2.]]) + >>> np.atleast_2d(x).base is x + True + + >>> np.atleast_2d(1, [1, 2], [[1, 2]]) + (array([[1]]), array([[1, 2]]), array([[1, 2]])) + + """ + res = [] + for ary in arys: + ary = asanyarray(ary) + if ary.ndim == 0: + result = ary.reshape(1, 1) + elif ary.ndim == 1: + result = ary[_nx.newaxis, :] + else: + result = ary + res.append(result) + if len(res) == 1: + return res[0] + else: + return tuple(res) + + +def _atleast_3d_dispatcher(*arys): + return arys + + +@array_function_dispatch(_atleast_3d_dispatcher) +def atleast_3d(*arys): + """ + View inputs as arrays with at least three dimensions. + + Parameters + ---------- + arys1, arys2, ... : array_like + One or more array-like sequences. Non-array inputs are converted to + arrays. Arrays that already have three or more dimensions are + preserved. + + Returns + ------- + res1, res2, ... : ndarray + An array, or tuple of arrays, each with ``a.ndim >= 3``. Copies are + avoided where possible, and views with three or more dimensions are + returned. For example, a 1-D array of shape ``(N,)`` becomes a view + of shape ``(1, N, 1)``, and a 2-D array of shape ``(M, N)`` becomes a + view of shape ``(M, N, 1)``. + + See Also + -------- + atleast_1d, atleast_2d + + Examples + -------- + >>> import numpy as np + >>> np.atleast_3d(3.0) + array([[[3.]]]) + + >>> x = np.arange(3.0) + >>> np.atleast_3d(x).shape + (1, 3, 1) + + >>> x = np.arange(12.0).reshape(4,3) + >>> np.atleast_3d(x).shape + (4, 3, 1) + >>> np.atleast_3d(x).base is x.base # x is a reshape, so not base itself + True + + >>> for arr in np.atleast_3d([1, 2], [[1, 2]], [[[1, 2]]]): + ... print(arr, arr.shape) # doctest: +SKIP + ... + [[[1] + [2]]] (1, 2, 1) + [[[1] + [2]]] (1, 2, 1) + [[[1 2]]] (1, 1, 2) + + """ + res = [] + for ary in arys: + ary = asanyarray(ary) + if ary.ndim == 0: + result = ary.reshape(1, 1, 1) + elif ary.ndim == 1: + result = ary[_nx.newaxis, :, _nx.newaxis] + elif ary.ndim == 2: + result = ary[:, :, _nx.newaxis] + else: + result = ary + res.append(result) + if len(res) == 1: + return res[0] + else: + return tuple(res) + + +def _arrays_for_stack_dispatcher(arrays): + if not hasattr(arrays, "__getitem__"): + raise TypeError('arrays to stack must be passed as a "sequence" type ' + 'such as list or tuple.') + + return tuple(arrays) + + +def _vhstack_dispatcher(tup, *, dtype=None, casting=None): + return _arrays_for_stack_dispatcher(tup) + + +@array_function_dispatch(_vhstack_dispatcher) +def vstack(tup, *, dtype=None, casting="same_kind"): + """ + Stack arrays in sequence vertically (row wise). + + This is equivalent to concatenation along the first axis after 1-D arrays + of shape `(N,)` have been reshaped to `(1,N)`. Rebuilds arrays divided by + `vsplit`. + + This function makes most sense for arrays with up to 3 dimensions. For + instance, for pixel-data with a height (first axis), width (second axis), + and r/g/b channels (third axis). The functions `concatenate`, `stack` and + `block` provide more general stacking and concatenation operations. + + Parameters + ---------- + tup : sequence of ndarrays + The arrays must have the same shape along all but the first axis. + 1-D arrays must have the same length. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + Returns + ------- + stacked : ndarray + The array formed by stacking the given arrays, will be at least 2-D. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + block : Assemble an nd-array from nested lists of blocks. + hstack : Stack arrays in sequence horizontally (column wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + vsplit : Split an array into multiple sub-arrays vertically (row-wise). + unstack : Split an array into a tuple of sub-arrays along an axis. + + Examples + -------- + >>> import numpy as np + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.vstack((a,b)) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> a = np.array([[1], [2], [3]]) + >>> b = np.array([[4], [5], [6]]) + >>> np.vstack((a,b)) + array([[1], + [2], + [3], + [4], + [5], + [6]]) + + """ + arrs = atleast_2d(*tup) + if not isinstance(arrs, tuple): + arrs = (arrs,) + return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting) + + +@array_function_dispatch(_vhstack_dispatcher) +def hstack(tup, *, dtype=None, casting="same_kind"): + """ + Stack arrays in sequence horizontally (column wise). + + This is equivalent to concatenation along the second axis, except for 1-D + arrays where it concatenates along the first axis. Rebuilds arrays divided + by `hsplit`. + + This function makes most sense for arrays with up to 3 dimensions. For + instance, for pixel-data with a height (first axis), width (second axis), + and r/g/b channels (third axis). The functions `concatenate`, `stack` and + `block` provide more general stacking and concatenation operations. + + Parameters + ---------- + tup : sequence of ndarrays + The arrays must have the same shape along all but the second axis, + except 1-D arrays which can be any length. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + Returns + ------- + stacked : ndarray + The array formed by stacking the given arrays. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + block : Assemble an nd-array from nested lists of blocks. + vstack : Stack arrays in sequence vertically (row wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + hsplit : Split an array into multiple sub-arrays + horizontally (column-wise). + unstack : Split an array into a tuple of sub-arrays along an axis. + + Examples + -------- + >>> import numpy as np + >>> a = np.array((1,2,3)) + >>> b = np.array((4,5,6)) + >>> np.hstack((a,b)) + array([1, 2, 3, 4, 5, 6]) + >>> a = np.array([[1],[2],[3]]) + >>> b = np.array([[4],[5],[6]]) + >>> np.hstack((a,b)) + array([[1, 4], + [2, 5], + [3, 6]]) + + """ + arrs = atleast_1d(*tup) + if not isinstance(arrs, tuple): + arrs = (arrs,) + # As a special case, dimension 0 of 1-dimensional arrays is "horizontal" + if arrs and arrs[0].ndim == 1: + return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting) + else: + return _nx.concatenate(arrs, 1, dtype=dtype, casting=casting) + + +def _stack_dispatcher(arrays, axis=None, out=None, *, + dtype=None, casting=None): + arrays = _arrays_for_stack_dispatcher(arrays) + if out is not None: + # optimize for the typical case where only arrays is provided + arrays = list(arrays) + arrays.append(out) + return arrays + + +@array_function_dispatch(_stack_dispatcher) +def stack(arrays, axis=0, out=None, *, dtype=None, casting="same_kind"): + """ + Join a sequence of arrays along a new axis. + + The ``axis`` parameter specifies the index of the new axis in the + dimensions of the result. For example, if ``axis=0`` it will be the first + dimension and if ``axis=-1`` it will be the last dimension. + + .. versionadded:: 1.10.0 + + Parameters + ---------- + arrays : sequence of array_like + Each array must have the same shape. + + axis : int, optional + The axis in the result array along which the input arrays are stacked. + + out : ndarray, optional + If provided, the destination to place the result. The shape must be + correct, matching that of what stack would have returned if no + out argument were specified. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + + Returns + ------- + stacked : ndarray + The stacked array has one more dimension than the input arrays. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + block : Assemble an nd-array from nested lists of blocks. + split : Split array into a list of multiple sub-arrays of equal size. + unstack : Split an array into a tuple of sub-arrays along an axis. + + Examples + -------- + >>> import numpy as np + >>> rng = np.random.default_rng() + >>> arrays = [rng.normal(size=(3,4)) for _ in range(10)] + >>> np.stack(arrays, axis=0).shape + (10, 3, 4) + + >>> np.stack(arrays, axis=1).shape + (3, 10, 4) + + >>> np.stack(arrays, axis=2).shape + (3, 4, 10) + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.stack((a, b)) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> np.stack((a, b), axis=-1) + array([[1, 4], + [2, 5], + [3, 6]]) + + """ + arrays = [asanyarray(arr) for arr in arrays] + if not arrays: + raise ValueError('need at least one array to stack') + + shapes = {arr.shape for arr in arrays} + if len(shapes) != 1: + raise ValueError('all input arrays must have the same shape') + + result_ndim = arrays[0].ndim + 1 + axis = normalize_axis_index(axis, result_ndim) + + sl = (slice(None),) * axis + (_nx.newaxis,) + expanded_arrays = [arr[sl] for arr in arrays] + return _nx.concatenate(expanded_arrays, axis=axis, out=out, + dtype=dtype, casting=casting) + +def _unstack_dispatcher(x, /, *, axis=None): + return (x,) + +@array_function_dispatch(_unstack_dispatcher) +def unstack(x, /, *, axis=0): + """ + Split an array into a sequence of arrays along the given axis. + + The ``axis`` parameter specifies the dimension along which the array will + be split. For example, if ``axis=0`` (the default) it will be the first + dimension and if ``axis=-1`` it will be the last dimension. + + The result is a tuple of arrays split along ``axis``. + + .. versionadded:: 2.1.0 + + Parameters + ---------- + x : ndarray + The array to be unstacked. + axis : int, optional + Axis along which the array will be split. Default: ``0``. + + Returns + ------- + unstacked : tuple of ndarrays + The unstacked arrays. + + See Also + -------- + stack : Join a sequence of arrays along a new axis. + concatenate : Join a sequence of arrays along an existing axis. + block : Assemble an nd-array from nested lists of blocks. + split : Split array into a list of multiple sub-arrays of equal size. + + Notes + ----- + ``unstack`` serves as the reverse operation of :py:func:`stack`, i.e., + ``stack(unstack(x, axis=axis), axis=axis) == x``. + + This function is equivalent to ``tuple(np.moveaxis(x, axis, 0))``, since + iterating on an array iterates along the first axis. + + Examples + -------- + >>> arr = np.arange(24).reshape((2, 3, 4)) + >>> np.unstack(arr) + (array([[ 0, 1, 2, 3], + [ 4, 5, 6, 7], + [ 8, 9, 10, 11]]), + array([[12, 13, 14, 15], + [16, 17, 18, 19], + [20, 21, 22, 23]])) + >>> np.unstack(arr, axis=1) + (array([[ 0, 1, 2, 3], + [12, 13, 14, 15]]), + array([[ 4, 5, 6, 7], + [16, 17, 18, 19]]), + array([[ 8, 9, 10, 11], + [20, 21, 22, 23]])) + >>> arr2 = np.stack(np.unstack(arr, axis=1), axis=1) + >>> arr2.shape + (2, 3, 4) + >>> np.all(arr == arr2) + np.True_ + + """ + if x.ndim == 0: + raise ValueError("Input array must be at least 1-d.") + return tuple(_nx.moveaxis(x, axis, 0)) + +# Internal functions to eliminate the overhead of repeated dispatch in one of +# the two possible paths inside np.block. +# Use getattr to protect against __array_function__ being disabled. +_size = getattr(_from_nx.size, '__wrapped__', _from_nx.size) +_ndim = getattr(_from_nx.ndim, '__wrapped__', _from_nx.ndim) +_concatenate = getattr(_from_nx.concatenate, + '__wrapped__', _from_nx.concatenate) + + +def _block_format_index(index): + """ + Convert a list of indices ``[0, 1, 2]`` into ``"arrays[0][1][2]"``. + """ + idx_str = ''.join('[{}]'.format(i) for i in index if i is not None) + return 'arrays' + idx_str + + +def _block_check_depths_match(arrays, parent_index=[]): + """ + Recursive function checking that the depths of nested lists in `arrays` + all match. Mismatch raises a ValueError as described in the block + docstring below. + + The entire index (rather than just the depth) needs to be calculated + for each innermost list, in case an error needs to be raised, so that + the index of the offending list can be printed as part of the error. + + Parameters + ---------- + arrays : nested list of arrays + The arrays to check + parent_index : list of int + The full index of `arrays` within the nested lists passed to + `_block_check_depths_match` at the top of the recursion. + + Returns + ------- + first_index : list of int + The full index of an element from the bottom of the nesting in + `arrays`. If any element at the bottom is an empty list, this will + refer to it, and the last index along the empty axis will be None. + max_arr_ndim : int + The maximum of the ndims of the arrays nested in `arrays`. + final_size: int + The number of elements in the final array. This is used the motivate + the choice of algorithm used using benchmarking wisdom. + + """ + if type(arrays) is tuple: + # not strictly necessary, but saves us from: + # - more than one way to do things - no point treating tuples like + # lists + # - horribly confusing behaviour that results when tuples are + # treated like ndarray + raise TypeError( + '{} is a tuple. ' + 'Only lists can be used to arrange blocks, and np.block does ' + 'not allow implicit conversion from tuple to ndarray.'.format( + _block_format_index(parent_index) + ) + ) + elif type(arrays) is list and len(arrays) > 0: + idxs_ndims = (_block_check_depths_match(arr, parent_index + [i]) + for i, arr in enumerate(arrays)) + + first_index, max_arr_ndim, final_size = next(idxs_ndims) + for index, ndim, size in idxs_ndims: + final_size += size + if ndim > max_arr_ndim: + max_arr_ndim = ndim + if len(index) != len(first_index): + raise ValueError( + "List depths are mismatched. First element was at depth " + "{}, but there is an element at depth {} ({})".format( + len(first_index), + len(index), + _block_format_index(index) + ) + ) + # propagate our flag that indicates an empty list at the bottom + if index[-1] is None: + first_index = index + + return first_index, max_arr_ndim, final_size + elif type(arrays) is list and len(arrays) == 0: + # We've 'bottomed out' on an empty list + return parent_index + [None], 0, 0 + else: + # We've 'bottomed out' - arrays is either a scalar or an array + size = _size(arrays) + return parent_index, _ndim(arrays), size + + +def _atleast_nd(a, ndim): + # Ensures `a` has at least `ndim` dimensions by prepending + # ones to `a.shape` as necessary + return array(a, ndmin=ndim, copy=None, subok=True) + + +def _accumulate(values): + return list(itertools.accumulate(values)) + + +def _concatenate_shapes(shapes, axis): + """Given array shapes, return the resulting shape and slices prefixes. + + These help in nested concatenation. + + Returns + ------- + shape: tuple of int + This tuple satisfies:: + + shape, _ = _concatenate_shapes([arr.shape for shape in arrs], axis) + shape == concatenate(arrs, axis).shape + + slice_prefixes: tuple of (slice(start, end), ) + For a list of arrays being concatenated, this returns the slice + in the larger array at axis that needs to be sliced into. + + For example, the following holds:: + + ret = concatenate([a, b, c], axis) + _, (sl_a, sl_b, sl_c) = concatenate_slices([a, b, c], axis) + + ret[(slice(None),) * axis + sl_a] == a + ret[(slice(None),) * axis + sl_b] == b + ret[(slice(None),) * axis + sl_c] == c + + These are called slice prefixes since they are used in the recursive + blocking algorithm to compute the left-most slices during the + recursion. Therefore, they must be prepended to rest of the slice + that was computed deeper in the recursion. + + These are returned as tuples to ensure that they can quickly be added + to existing slice tuple without creating a new tuple every time. + + """ + # Cache a result that will be reused. + shape_at_axis = [shape[axis] for shape in shapes] + + # Take a shape, any shape + first_shape = shapes[0] + first_shape_pre = first_shape[:axis] + first_shape_post = first_shape[axis+1:] + + if any(shape[:axis] != first_shape_pre or + shape[axis+1:] != first_shape_post for shape in shapes): + raise ValueError( + 'Mismatched array shapes in block along axis {}.'.format(axis)) + + shape = (first_shape_pre + (sum(shape_at_axis),) + first_shape[axis+1:]) + + offsets_at_axis = _accumulate(shape_at_axis) + slice_prefixes = [(slice(start, end),) + for start, end in zip([0] + offsets_at_axis, + offsets_at_axis)] + return shape, slice_prefixes + + +def _block_info_recursion(arrays, max_depth, result_ndim, depth=0): + """ + Returns the shape of the final array, along with a list + of slices and a list of arrays that can be used for assignment inside the + new array + + Parameters + ---------- + arrays : nested list of arrays + The arrays to check + max_depth : list of int + The number of nested lists + result_ndim : int + The number of dimensions in thefinal array. + + Returns + ------- + shape : tuple of int + The shape that the final array will take on. + slices: list of tuple of slices + The slices into the full array required for assignment. These are + required to be prepended with ``(Ellipsis, )`` to obtain to correct + final index. + arrays: list of ndarray + The data to assign to each slice of the full array + + """ + if depth < max_depth: + shapes, slices, arrays = zip( + *[_block_info_recursion(arr, max_depth, result_ndim, depth+1) + for arr in arrays]) + + axis = result_ndim - max_depth + depth + shape, slice_prefixes = _concatenate_shapes(shapes, axis) + + # Prepend the slice prefix and flatten the slices + slices = [slice_prefix + the_slice + for slice_prefix, inner_slices in zip(slice_prefixes, slices) + for the_slice in inner_slices] + + # Flatten the array list + arrays = functools.reduce(operator.add, arrays) + + return shape, slices, arrays + else: + # We've 'bottomed out' - arrays is either a scalar or an array + # type(arrays) is not list + # Return the slice and the array inside a list to be consistent with + # the recursive case. + arr = _atleast_nd(arrays, result_ndim) + return arr.shape, [()], [arr] + + +def _block(arrays, max_depth, result_ndim, depth=0): + """ + Internal implementation of block based on repeated concatenation. + `arrays` is the argument passed to + block. `max_depth` is the depth of nested lists within `arrays` and + `result_ndim` is the greatest of the dimensions of the arrays in + `arrays` and the depth of the lists in `arrays` (see block docstring + for details). + """ + if depth < max_depth: + arrs = [_block(arr, max_depth, result_ndim, depth+1) + for arr in arrays] + return _concatenate(arrs, axis=-(max_depth-depth)) + else: + # We've 'bottomed out' - arrays is either a scalar or an array + # type(arrays) is not list + return _atleast_nd(arrays, result_ndim) + + +def _block_dispatcher(arrays): + # Use type(...) is list to match the behavior of np.block(), which special + # cases list specifically rather than allowing for generic iterables or + # tuple. Also, we know that list.__array_function__ will never exist. + if type(arrays) is list: + for subarrays in arrays: + yield from _block_dispatcher(subarrays) + else: + yield arrays + + +@array_function_dispatch(_block_dispatcher) +def block(arrays): + """ + Assemble an nd-array from nested lists of blocks. + + Blocks in the innermost lists are concatenated (see `concatenate`) along + the last dimension (-1), then these are concatenated along the + second-last dimension (-2), and so on until the outermost list is reached. + + Blocks can be of any dimension, but will not be broadcasted using + the normal rules. Instead, leading axes of size 1 are inserted, + to make ``block.ndim`` the same for all blocks. This is primarily useful + for working with scalars, and means that code like ``np.block([v, 1])`` + is valid, where ``v.ndim == 1``. + + When the nested list is two levels deep, this allows block matrices to be + constructed from their components. + + .. versionadded:: 1.13.0 + + Parameters + ---------- + arrays : nested list of array_like or scalars (but not tuples) + If passed a single ndarray or scalar (a nested list of depth 0), this + is returned unmodified (and not copied). + + Elements shapes must match along the appropriate axes (without + broadcasting), but leading 1s will be prepended to the shape as + necessary to make the dimensions match. + + Returns + ------- + block_array : ndarray + The array assembled from the given blocks. + + The dimensionality of the output is equal to the greatest of: + + * the dimensionality of all the inputs + * the depth to which the input list is nested + + Raises + ------ + ValueError + * If list depths are mismatched - for instance, ``[[a, b], c]`` is + illegal, and should be spelt ``[[a, b], [c]]`` + * If lists are empty - for instance, ``[[a, b], []]`` + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + vstack : Stack arrays in sequence vertically (row wise). + hstack : Stack arrays in sequence horizontally (column wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + vsplit : Split an array into multiple sub-arrays vertically (row-wise). + unstack : Split an array into a tuple of sub-arrays along an axis. + + Notes + ----- + + When called with only scalars, ``np.block`` is equivalent to an ndarray + call. So ``np.block([[1, 2], [3, 4]])`` is equivalent to + ``np.array([[1, 2], [3, 4]])``. + + This function does not enforce that the blocks lie on a fixed grid. + ``np.block([[a, b], [c, d]])`` is not restricted to arrays of the form:: + + AAAbb + AAAbb + cccDD + + But is also allowed to produce, for some ``a, b, c, d``:: + + AAAbb + AAAbb + cDDDD + + Since concatenation happens along the last axis first, `block` is *not* + capable of producing the following directly:: + + AAAbb + cccbb + cccDD + + Matlab's "square bracket stacking", ``[A, B, ...; p, q, ...]``, is + equivalent to ``np.block([[A, B, ...], [p, q, ...]])``. + + Examples + -------- + The most common use of this function is to build a block matrix: + + >>> import numpy as np + >>> A = np.eye(2) * 2 + >>> B = np.eye(3) * 3 + >>> np.block([ + ... [A, np.zeros((2, 3))], + ... [np.ones((3, 2)), B ] + ... ]) + array([[2., 0., 0., 0., 0.], + [0., 2., 0., 0., 0.], + [1., 1., 3., 0., 0.], + [1., 1., 0., 3., 0.], + [1., 1., 0., 0., 3.]]) + + With a list of depth 1, `block` can be used as `hstack`: + + >>> np.block([1, 2, 3]) # hstack([1, 2, 3]) + array([1, 2, 3]) + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.block([a, b, 10]) # hstack([a, b, 10]) + array([ 1, 2, 3, 4, 5, 6, 10]) + + >>> A = np.ones((2, 2), int) + >>> B = 2 * A + >>> np.block([A, B]) # hstack([A, B]) + array([[1, 1, 2, 2], + [1, 1, 2, 2]]) + + With a list of depth 2, `block` can be used in place of `vstack`: + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.block([[a], [b]]) # vstack([a, b]) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> A = np.ones((2, 2), int) + >>> B = 2 * A + >>> np.block([[A], [B]]) # vstack([A, B]) + array([[1, 1], + [1, 1], + [2, 2], + [2, 2]]) + + It can also be used in place of `atleast_1d` and `atleast_2d`: + + >>> a = np.array(0) + >>> b = np.array([1]) + >>> np.block([a]) # atleast_1d(a) + array([0]) + >>> np.block([b]) # atleast_1d(b) + array([1]) + + >>> np.block([[a]]) # atleast_2d(a) + array([[0]]) + >>> np.block([[b]]) # atleast_2d(b) + array([[1]]) + + + """ + arrays, list_ndim, result_ndim, final_size = _block_setup(arrays) + + # It was found through benchmarking that making an array of final size + # around 256x256 was faster by straight concatenation on a + # i7-7700HQ processor and dual channel ram 2400MHz. + # It didn't seem to matter heavily on the dtype used. + # + # A 2D array using repeated concatenation requires 2 copies of the array. + # + # The fastest algorithm will depend on the ratio of CPU power to memory + # speed. + # One can monitor the results of the benchmark + # https://pv.github.io/numpy-bench/#bench_shape_base.Block2D.time_block2d + # to tune this parameter until a C version of the `_block_info_recursion` + # algorithm is implemented which would likely be faster than the python + # version. + if list_ndim * final_size > (2 * 512 * 512): + return _block_slicing(arrays, list_ndim, result_ndim) + else: + return _block_concatenate(arrays, list_ndim, result_ndim) + + +# These helper functions are mostly used for testing. +# They allow us to write tests that directly call `_block_slicing` +# or `_block_concatenate` without blocking large arrays to force the wisdom +# to trigger the desired path. +def _block_setup(arrays): + """ + Returns + (`arrays`, list_ndim, result_ndim, final_size) + """ + bottom_index, arr_ndim, final_size = _block_check_depths_match(arrays) + list_ndim = len(bottom_index) + if bottom_index and bottom_index[-1] is None: + raise ValueError( + 'List at {} cannot be empty'.format( + _block_format_index(bottom_index) + ) + ) + result_ndim = max(arr_ndim, list_ndim) + return arrays, list_ndim, result_ndim, final_size + + +def _block_slicing(arrays, list_ndim, result_ndim): + shape, slices, arrays = _block_info_recursion( + arrays, list_ndim, result_ndim) + dtype = _nx.result_type(*[arr.dtype for arr in arrays]) + + # Test preferring F only in the case that all input arrays are F + F_order = all(arr.flags['F_CONTIGUOUS'] for arr in arrays) + C_order = all(arr.flags['C_CONTIGUOUS'] for arr in arrays) + order = 'F' if F_order and not C_order else 'C' + result = _nx.empty(shape=shape, dtype=dtype, order=order) + # Note: In a c implementation, the function + # PyArray_CreateMultiSortedStridePerm could be used for more advanced + # guessing of the desired order. + + for the_slice, arr in zip(slices, arrays): + result[(Ellipsis,) + the_slice] = arr + return result + + +def _block_concatenate(arrays, list_ndim, result_ndim): + result = _block(arrays, list_ndim, result_ndim) + if list_ndim == 0: + # Catch an edge case where _block returns a view because + # `arrays` is a single numpy array and not a list of numpy arrays. + # This might copy scalars or lists twice, but this isn't a likely + # usecase for those interested in performance + result = result.copy() + return result diff --git a/valley/lib/python3.10/site-packages/numpy/_core/shape_base.pyi b/valley/lib/python3.10/site-packages/numpy/_core/shape_base.pyi new file mode 100644 index 0000000000000000000000000000000000000000..627dbba06c199b71d0e96c5505caad2737a3a4ab --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/shape_base.pyi @@ -0,0 +1,138 @@ +from collections.abc import Sequence +from typing import TypeVar, overload, Any, SupportsIndex + +from numpy import generic, _CastingKind +from numpy._typing import ( + NDArray, + ArrayLike, + DTypeLike, + _ArrayLike, + _DTypeLike, +) + +_SCT = TypeVar("_SCT", bound=generic) +_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any]) + +__all__: list[str] + +@overload +def atleast_1d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ... +@overload +def atleast_1d(arys: ArrayLike, /) -> NDArray[Any]: ... +@overload +def atleast_1d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ... + +@overload +def atleast_2d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ... +@overload +def atleast_2d(arys: ArrayLike, /) -> NDArray[Any]: ... +@overload +def atleast_2d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ... + +@overload +def atleast_3d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ... +@overload +def atleast_3d(arys: ArrayLike, /) -> NDArray[Any]: ... +@overload +def atleast_3d(*arys: ArrayLike) -> tuple[NDArray[Any], ...]: ... + +@overload +def vstack( + tup: Sequence[_ArrayLike[_SCT]], + *, + dtype: None = ..., + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def vstack( + tup: Sequence[ArrayLike], + *, + dtype: _DTypeLike[_SCT], + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def vstack( + tup: Sequence[ArrayLike], + *, + dtype: DTypeLike = ..., + casting: _CastingKind = ... +) -> NDArray[Any]: ... + +@overload +def hstack( + tup: Sequence[_ArrayLike[_SCT]], + *, + dtype: None = ..., + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def hstack( + tup: Sequence[ArrayLike], + *, + dtype: _DTypeLike[_SCT], + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def hstack( + tup: Sequence[ArrayLike], + *, + dtype: DTypeLike = ..., + casting: _CastingKind = ... +) -> NDArray[Any]: ... + +@overload +def stack( + arrays: Sequence[_ArrayLike[_SCT]], + axis: SupportsIndex = ..., + out: None = ..., + *, + dtype: None = ..., + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def stack( + arrays: Sequence[ArrayLike], + axis: SupportsIndex = ..., + out: None = ..., + *, + dtype: _DTypeLike[_SCT], + casting: _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def stack( + arrays: Sequence[ArrayLike], + axis: SupportsIndex = ..., + out: None = ..., + *, + dtype: DTypeLike = ..., + casting: _CastingKind = ... +) -> NDArray[Any]: ... +@overload +def stack( + arrays: Sequence[ArrayLike], + axis: SupportsIndex = ..., + out: _ArrayType = ..., + *, + dtype: DTypeLike = ..., + casting: _CastingKind = ... +) -> _ArrayType: ... + +@overload +def unstack( + array: _ArrayLike[_SCT], + /, + *, + axis: int = ..., +) -> tuple[NDArray[_SCT], ...]: ... +@overload +def unstack( + array: ArrayLike, + /, + *, + axis: int = ..., +) -> tuple[NDArray[Any], ...]: ... + +@overload +def block(arrays: _ArrayLike[_SCT]) -> NDArray[_SCT]: ... +@overload +def block(arrays: ArrayLike) -> NDArray[Any]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/strings.py b/valley/lib/python3.10/site-packages/numpy/_core/strings.py new file mode 100644 index 0000000000000000000000000000000000000000..0820411840eadad1746f641c23b36a33042c0cc0 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/strings.py @@ -0,0 +1,1560 @@ +""" +This module contains a set of functions for vectorized string +operations. +""" + +import sys +import numpy as np +from numpy import ( + equal, not_equal, less, less_equal, greater, greater_equal, + add, multiply as _multiply_ufunc, +) +from numpy._core.multiarray import _vec_string +from numpy._core.umath import ( + isalpha, + isdigit, + isspace, + isalnum, + islower, + isupper, + istitle, + isdecimal, + isnumeric, + str_len, + find as _find_ufunc, + rfind as _rfind_ufunc, + index as _index_ufunc, + rindex as _rindex_ufunc, + count as _count_ufunc, + startswith as _startswith_ufunc, + endswith as _endswith_ufunc, + _lstrip_whitespace, + _lstrip_chars, + _rstrip_whitespace, + _rstrip_chars, + _strip_whitespace, + _strip_chars, + _replace, + _expandtabs_length, + _expandtabs, + _center, + _ljust, + _rjust, + _zfill, + _partition, + _partition_index, + _rpartition, + _rpartition_index, +) + + +__all__ = [ + # UFuncs + "equal", "not_equal", "less", "less_equal", "greater", "greater_equal", + "add", "multiply", "isalpha", "isdigit", "isspace", "isalnum", "islower", + "isupper", "istitle", "isdecimal", "isnumeric", "str_len", "find", + "rfind", "index", "rindex", "count", "startswith", "endswith", "lstrip", + "rstrip", "strip", "replace", "expandtabs", "center", "ljust", "rjust", + "zfill", "partition", "rpartition", + + # _vec_string - Will gradually become ufuncs as well + "upper", "lower", "swapcase", "capitalize", "title", + + # _vec_string - Will probably not become ufuncs + "mod", "decode", "encode", "translate", + + # Removed from namespace until behavior has been crystallized + # "join", "split", "rsplit", "splitlines", +] + + +MAX = np.iinfo(np.int64).max + + +def _get_num_chars(a): + """ + Helper function that returns the number of characters per field in + a string or unicode array. This is to abstract out the fact that + for a unicode array this is itemsize / 4. + """ + if issubclass(a.dtype.type, np.str_): + return a.itemsize // 4 + return a.itemsize + + +def _to_bytes_or_str_array(result, output_dtype_like): + """ + Helper function to cast a result back into an array + with the appropriate dtype if an object array must be used + as an intermediary. + """ + output_dtype_like = np.asarray(output_dtype_like) + if result.size == 0: + # Calling asarray & tolist in an empty array would result + # in losing shape information + return result.astype(output_dtype_like.dtype) + ret = np.asarray(result.tolist()) + if isinstance(output_dtype_like.dtype, np.dtypes.StringDType): + return ret.astype(type(output_dtype_like.dtype)) + return ret.astype(type(output_dtype_like.dtype)(_get_num_chars(ret))) + + +def _clean_args(*args): + """ + Helper function for delegating arguments to Python string + functions. + + Many of the Python string operations that have optional arguments + do not use 'None' to indicate a default value. In these cases, + we need to remove all None arguments, and those following them. + """ + newargs = [] + for chk in args: + if chk is None: + break + newargs.append(chk) + return newargs + + +def multiply(a, i): + """ + Return (a * i), that is string multiple concatenation, + element-wise. + + Values in ``i`` of less than 0 are treated as 0 (which yields an + empty string). + + Parameters + ---------- + a : array_like, with ``StringDType``, ``bytes_`` or ``str_`` dtype + + i : array_like, with any integer dtype + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["a", "b", "c"]) + >>> np.strings.multiply(a, 3) + array(['aaa', 'bbb', 'ccc'], dtype='>> i = np.array([1, 2, 3]) + >>> np.strings.multiply(a, i) + array(['a', 'bb', 'ccc'], dtype='>> np.strings.multiply(np.array(['a']), i) + array(['a', 'aa', 'aaa'], dtype='>> a = np.array(['a', 'b', 'c', 'd', 'e', 'f']).reshape((2, 3)) + >>> np.strings.multiply(a, 3) + array([['aaa', 'bbb', 'ccc'], + ['ddd', 'eee', 'fff']], dtype='>> np.strings.multiply(a, i) + array([['a', 'bb', 'ccc'], + ['d', 'ee', 'fff']], dtype=' sys.maxsize / np.maximum(i, 1)): + raise MemoryError("repeated string is too long") + + buffersizes = a_len * i + out_dtype = f"{a.dtype.char}{buffersizes.max()}" + out = np.empty_like(a, shape=buffersizes.shape, dtype=out_dtype) + return _multiply_ufunc(a, i, out=out) + + +def mod(a, values): + """ + Return (a % i), that is pre-Python 2.6 string formatting + (interpolation), element-wise for a pair of array_likes of str + or unicode. + + Parameters + ---------- + a : array_like, with `np.bytes_` or `np.str_` dtype + + values : array_like of values + These values will be element-wise interpolated into the string. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["NumPy is a %s library"]) + >>> np.strings.mod(a, values=["Python"]) + array(['NumPy is a Python library'], dtype='>> a = np.array([b'%d bytes', b'%d bits']) + >>> values = np.array([8, 64]) + >>> np.strings.mod(a, values) + array([b'8 bytes', b'64 bits'], dtype='|S7') + + """ + return _to_bytes_or_str_array( + _vec_string(a, np.object_, '__mod__', (values,)), a) + + +def find(a, sub, start=0, end=None): + """ + For each element, return the lowest index in the string where + substring ``sub`` is found, such that ``sub`` is contained in the + range [``start``, ``end``). + + Parameters + ---------- + a : array_like, with ``StringDType``, ``bytes_`` or ``str_`` dtype + + sub : array_like, with `np.bytes_` or `np.str_` dtype + The substring to search for. + + start, end : array_like, with any integer dtype + The range to look in, interpreted as in slice notation. + + Returns + ------- + y : ndarray + Output array of ints + + See Also + -------- + str.find + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["NumPy is a Python library"]) + >>> np.strings.find(a, "Python") + array([11]) + + """ + end = end if end is not None else MAX + return _find_ufunc(a, sub, start, end) + + +def rfind(a, sub, start=0, end=None): + """ + For each element, return the highest index in the string where + substring ``sub`` is found, such that ``sub`` is contained in the + range [``start``, ``end``). + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + sub : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + The substring to search for. + + start, end : array_like, with any integer dtype + The range to look in, interpreted as in slice notation. + + Returns + ------- + y : ndarray + Output array of ints + + See Also + -------- + str.rfind + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["Computer Science"]) + >>> np.strings.rfind(a, "Science", start=0, end=None) + array([9]) + >>> np.strings.rfind(a, "Science", start=0, end=8) + array([-1]) + >>> b = np.array(["Computer Science", "Science"]) + >>> np.strings.rfind(b, "Science", start=0, end=None) + array([9, 0]) + + """ + end = end if end is not None else MAX + return _rfind_ufunc(a, sub, start, end) + + +def index(a, sub, start=0, end=None): + """ + Like `find`, but raises :exc:`ValueError` when the substring is not found. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + sub : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + start, end : array_like, with any integer dtype, optional + + Returns + ------- + out : ndarray + Output array of ints. + + See Also + -------- + find, str.index + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["Computer Science"]) + >>> np.strings.index(a, "Science", start=0, end=None) + array([9]) + + """ + end = end if end is not None else MAX + return _index_ufunc(a, sub, start, end) + + +def rindex(a, sub, start=0, end=None): + """ + Like `rfind`, but raises :exc:`ValueError` when the substring `sub` is + not found. + + Parameters + ---------- + a : array-like, with `np.bytes_` or `np.str_` dtype + + sub : array-like, with `np.bytes_` or `np.str_` dtype + + start, end : array-like, with any integer dtype, optional + + Returns + ------- + out : ndarray + Output array of ints. + + See Also + -------- + rfind, str.rindex + + Examples + -------- + >>> a = np.array(["Computer Science"]) + >>> np.strings.rindex(a, "Science", start=0, end=None) + array([9]) + + """ + end = end if end is not None else MAX + return _rindex_ufunc(a, sub, start, end) + + +def count(a, sub, start=0, end=None): + """ + Returns an array with the number of non-overlapping occurrences of + substring ``sub`` in the range [``start``, ``end``). + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + sub : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + The substring to search for. + + start, end : array_like, with any integer dtype + The range to look in, interpreted as in slice notation. + + Returns + ------- + y : ndarray + Output array of ints + + See Also + -------- + str.count + + Examples + -------- + >>> import numpy as np + >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> c + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> np.strings.count(c, 'A') + array([3, 1, 1]) + >>> np.strings.count(c, 'aA') + array([3, 1, 0]) + >>> np.strings.count(c, 'A', start=1, end=4) + array([2, 1, 1]) + >>> np.strings.count(c, 'A', start=1, end=3) + array([1, 0, 0]) + + """ + end = end if end is not None else MAX + return _count_ufunc(a, sub, start, end) + + +def startswith(a, prefix, start=0, end=None): + """ + Returns a boolean array which is `True` where the string element + in ``a`` starts with ``prefix``, otherwise `False`. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + prefix : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + start, end : array_like, with any integer dtype + With ``start``, test beginning at that position. With ``end``, + stop comparing at that position. + + Returns + ------- + out : ndarray + Output array of bools + + See Also + -------- + str.startswith + + Examples + -------- + >>> import numpy as np + >>> s = np.array(['foo', 'bar']) + >>> s + array(['foo', 'bar'], dtype='>> np.strings.startswith(s, 'fo') + array([True, False]) + >>> np.strings.startswith(s, 'o', start=1, end=2) + array([True, False]) + + """ + end = end if end is not None else MAX + return _startswith_ufunc(a, prefix, start, end) + + +def endswith(a, suffix, start=0, end=None): + """ + Returns a boolean array which is `True` where the string element + in ``a`` ends with ``suffix``, otherwise `False`. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + suffix : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + start, end : array_like, with any integer dtype + With ``start``, test beginning at that position. With ``end``, + stop comparing at that position. + + Returns + ------- + out : ndarray + Output array of bools + + See Also + -------- + str.endswith + + Examples + -------- + >>> import numpy as np + >>> s = np.array(['foo', 'bar']) + >>> s + array(['foo', 'bar'], dtype='>> np.strings.endswith(s, 'ar') + array([False, True]) + >>> np.strings.endswith(s, 'a', start=1, end=2) + array([False, True]) + + """ + end = end if end is not None else MAX + return _endswith_ufunc(a, suffix, start, end) + + +def decode(a, encoding=None, errors=None): + r""" + Calls :meth:`bytes.decode` element-wise. + + The set of available codecs comes from the Python standard library, + and may be extended at runtime. For more information, see the + :mod:`codecs` module. + + Parameters + ---------- + a : array_like, with ``bytes_`` dtype + + encoding : str, optional + The name of an encoding + + errors : str, optional + Specifies how to handle encoding errors + + Returns + ------- + out : ndarray + + See Also + -------- + :py:meth:`bytes.decode` + + Notes + ----- + The type of the result will depend on the encoding specified. + + Examples + -------- + >>> import numpy as np + >>> c = np.array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@', + ... b'\x81\x82\xc2\xc1\xc2\x82\x81']) + >>> c + array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@', + b'\x81\x82\xc2\xc1\xc2\x82\x81'], dtype='|S7') + >>> np.strings.decode(c, encoding='cp037') + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> import numpy as np + >>> a = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> np.strings.encode(a, encoding='cp037') + array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@', + b'\x81\x82\xc2\xc1\xc2\x82\x81'], dtype='|S7') + + """ + return _to_bytes_or_str_array( + _vec_string(a, np.object_, 'encode', _clean_args(encoding, errors)), + np.bytes_(b'')) + + +def expandtabs(a, tabsize=8): + """ + Return a copy of each string element where all tab characters are + replaced by one or more spaces. + + Calls :meth:`str.expandtabs` element-wise. + + Return a copy of each string element where all tab characters are + replaced by one or more spaces, depending on the current column + and the given `tabsize`. The column number is reset to zero after + each newline occurring in the string. This doesn't understand other + non-printing characters or escape sequences. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + Input array + tabsize : int, optional + Replace tabs with `tabsize` number of spaces. If not given defaults + to 8 spaces. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input type + + See Also + -------- + str.expandtabs + + Examples + -------- + >>> import numpy as np + >>> a = np.array(['\t\tHello\tworld']) + >>> np.strings.expandtabs(a, tabsize=4) # doctest: +SKIP + array([' Hello world'], dtype='>> import numpy as np + >>> c = np.array(['a1b2','1b2a','b2a1','2a1b']); c + array(['a1b2', '1b2a', 'b2a1', '2a1b'], dtype='>> np.strings.center(c, width=9) + array([' a1b2 ', ' 1b2a ', ' b2a1 ', ' 2a1b '], dtype='>> np.strings.center(c, width=9, fillchar='*') + array(['***a1b2**', '***1b2a**', '***b2a1**', '***2a1b**'], dtype='>> np.strings.center(c, width=1) + array(['a1b2', '1b2a', 'b2a1', '2a1b'], dtype='>> import numpy as np + >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> np.strings.ljust(c, width=3) + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> np.strings.ljust(c, width=9) + array(['aAaAaA ', ' aA ', 'abBABba '], dtype='>> import numpy as np + >>> a = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> np.strings.rjust(a, width=3) + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> np.strings.rjust(a, width=9) + array([' aAaAaA', ' aA ', ' abBABba'], dtype='>> import numpy as np + >>> np.strings.zfill(['1', '-1', '+1'], 3) + array(['001', '-01', '+01'], dtype='>> import numpy as np + >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> c + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> np.strings.lstrip(c, 'a') + array(['AaAaA', ' aA ', 'bBABba'], dtype='>> np.strings.lstrip(c, 'A') # leaves c unchanged + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> (np.strings.lstrip(c, ' ') == np.strings.lstrip(c, '')).all() + np.False_ + >>> (np.strings.lstrip(c, ' ') == np.strings.lstrip(c)).all() + np.True_ + + """ + if chars is None: + return _lstrip_whitespace(a) + return _lstrip_chars(a, chars) + + +def rstrip(a, chars=None): + """ + For each element in `a`, return a copy with the trailing characters + removed. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + chars : scalar with the same dtype as ``a``, optional + The ``chars`` argument is a string specifying the set of + characters to be removed. If ``None``, the ``chars`` + argument defaults to removing whitespace. The ``chars`` argument + is not a prefix or suffix; rather, all combinations of its + values are stripped. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + See Also + -------- + str.rstrip + + Examples + -------- + >>> import numpy as np + >>> c = np.array(['aAaAaA', 'abBABba']) + >>> c + array(['aAaAaA', 'abBABba'], dtype='>> np.strings.rstrip(c, 'a') + array(['aAaAaA', 'abBABb'], dtype='>> np.strings.rstrip(c, 'A') + array(['aAaAa', 'abBABba'], dtype='>> import numpy as np + >>> c = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> c + array(['aAaAaA', ' aA ', 'abBABba'], dtype='>> np.strings.strip(c) + array(['aAaAaA', 'aA', 'abBABba'], dtype='>> np.strings.strip(c, 'a') + array(['AaAaA', ' aA ', 'bBABb'], dtype='>> np.strings.strip(c, 'A') + array(['aAaAa', ' aA ', 'abBABba'], dtype='>> import numpy as np + >>> c = np.array(['a1b c', '1bca', 'bca1']); c + array(['a1b c', '1bca', 'bca1'], dtype='>> np.strings.upper(c) + array(['A1B C', '1BCA', 'BCA1'], dtype='>> import numpy as np + >>> c = np.array(['A1B C', '1BCA', 'BCA1']); c + array(['A1B C', '1BCA', 'BCA1'], dtype='>> np.strings.lower(c) + array(['a1b c', '1bca', 'bca1'], dtype='>> import numpy as np + >>> c=np.array(['a1B c','1b Ca','b Ca1','cA1b'],'S5'); c + array(['a1B c', '1b Ca', 'b Ca1', 'cA1b'], + dtype='|S5') + >>> np.strings.swapcase(c) + array(['A1b C', '1B cA', 'B cA1', 'Ca1B'], + dtype='|S5') + + """ + a_arr = np.asarray(a) + return _vec_string(a_arr, a_arr.dtype, 'swapcase') + + +def capitalize(a): + """ + Return a copy of ``a`` with only the first character of each element + capitalized. + + Calls :meth:`str.capitalize` element-wise. + + For byte strings, this method is locale-dependent. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + Input array of strings to capitalize. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + See Also + -------- + str.capitalize + + Examples + -------- + >>> import numpy as np + >>> c = np.array(['a1b2','1b2a','b2a1','2a1b'],'S4'); c + array(['a1b2', '1b2a', 'b2a1', '2a1b'], + dtype='|S4') + >>> np.strings.capitalize(c) + array(['A1b2', '1b2a', 'B2a1', '2a1b'], + dtype='|S4') + + """ + a_arr = np.asarray(a) + return _vec_string(a_arr, a_arr.dtype, 'capitalize') + + +def title(a): + """ + Return element-wise title cased version of string or unicode. + + Title case words start with uppercase characters, all remaining cased + characters are lowercase. + + Calls :meth:`str.title` element-wise. + + For 8-bit strings, this method is locale-dependent. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + Input array. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + See Also + -------- + str.title + + Examples + -------- + >>> import numpy as np + >>> c=np.array(['a1b c','1b ca','b ca1','ca1b'],'S5'); c + array(['a1b c', '1b ca', 'b ca1', 'ca1b'], + dtype='|S5') + >>> np.strings.title(c) + array(['A1B C', '1B Ca', 'B Ca1', 'Ca1B'], + dtype='|S5') + + """ + a_arr = np.asarray(a) + return _vec_string(a_arr, a_arr.dtype, 'title') + + +def replace(a, old, new, count=-1): + """ + For each element in ``a``, return a copy of the string with + occurrences of substring ``old`` replaced by ``new``. + + Parameters + ---------- + a : array_like, with ``bytes_`` or ``str_`` dtype + + old, new : array_like, with ``bytes_`` or ``str_`` dtype + + count : array_like, with ``int_`` dtype + If the optional argument ``count`` is given, only the first + ``count`` occurrences are replaced. + + Returns + ------- + out : ndarray + Output array of ``StringDType``, ``bytes_`` or ``str_`` dtype, + depending on input types + + See Also + -------- + str.replace + + Examples + -------- + >>> import numpy as np + >>> a = np.array(["That is a mango", "Monkeys eat mangos"]) + >>> np.strings.replace(a, 'mango', 'banana') + array(['That is a banana', 'Monkeys eat bananas'], dtype='>> a = np.array(["The dish is fresh", "This is it"]) + >>> np.strings.replace(a, 'is', 'was') + array(['The dwash was fresh', 'Thwas was it'], dtype='>> import numpy as np + >>> np.strings.join('-', 'osd') # doctest: +SKIP + array('o-s-d', dtype='>> np.strings.join(['-', '.'], ['ghc', 'osd']) # doctest: +SKIP + array(['g-h-c', 'o.s.d'], dtype='>> import numpy as np + >>> x = np.array("Numpy is nice!") + >>> np.strings.split(x, " ") # doctest: +SKIP + array(list(['Numpy', 'is', 'nice!']), dtype=object) # doctest: +SKIP + + >>> np.strings.split(x, " ", 1) # doctest: +SKIP + array(list(['Numpy', 'is nice!']), dtype=object) # doctest: +SKIP + + See Also + -------- + str.split, rsplit + + """ + # This will return an array of lists of different sizes, so we + # leave it as an object array + return _vec_string( + a, np.object_, 'split', [sep] + _clean_args(maxsplit)) + + +def _rsplit(a, sep=None, maxsplit=None): + """ + For each element in `a`, return a list of the words in the + string, using `sep` as the delimiter string. + + Calls :meth:`str.rsplit` element-wise. + + Except for splitting from the right, `rsplit` + behaves like `split`. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + sep : str or unicode, optional + If `sep` is not specified or None, any whitespace string + is a separator. + maxsplit : int, optional + If `maxsplit` is given, at most `maxsplit` splits are done, + the rightmost ones. + + Returns + ------- + out : ndarray + Array of list objects + + See Also + -------- + str.rsplit, split + + Examples + -------- + >>> import numpy as np + >>> a = np.array(['aAaAaA', 'abBABba']) + >>> np.strings.rsplit(a, 'A') # doctest: +SKIP + array([list(['a', 'a', 'a', '']), # doctest: +SKIP + list(['abB', 'Bba'])], dtype=object) # doctest: +SKIP + + """ + # This will return an array of lists of different sizes, so we + # leave it as an object array + return _vec_string( + a, np.object_, 'rsplit', [sep] + _clean_args(maxsplit)) + + +def _splitlines(a, keepends=None): + """ + For each element in `a`, return a list of the lines in the + element, breaking at line boundaries. + + Calls :meth:`str.splitlines` element-wise. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + + keepends : bool, optional + Line breaks are not included in the resulting list unless + keepends is given and true. + + Returns + ------- + out : ndarray + Array of list objects + + See Also + -------- + str.splitlines + + """ + return _vec_string( + a, np.object_, 'splitlines', _clean_args(keepends)) + + +def partition(a, sep): + """ + Partition each element in ``a`` around ``sep``. + + For each element in ``a``, split the element at the first + occurrence of ``sep``, and return a 3-tuple containing the part + before the separator, the separator itself, and the part after + the separator. If the separator is not found, the first item of + the tuple will contain the whole string, and the second and third + ones will be the empty string. + + Parameters + ---------- + a : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + Input array + sep : array-like, with ``StringDType``, ``bytes_``, or ``str_`` dtype + Separator to split each string element in ``a``. + + Returns + ------- + out : 3-tuple: + - array with ``StringDType``, ``bytes_`` or ``str_`` dtype with the + part before the separator + - array with ``StringDType``, ``bytes_`` or ``str_`` dtype with the + separator + - array with ``StringDType``, ``bytes_`` or ``str_`` dtype with the + part after the separator + + See Also + -------- + str.partition + + Examples + -------- + >>> import numpy as np + >>> x = np.array(["Numpy is nice!"]) + >>> np.strings.partition(x, " ") + (array(['Numpy'], dtype='>> import numpy as np + >>> a = np.array(['aAaAaA', ' aA ', 'abBABba']) + >>> np.strings.rpartition(a, 'A') + (array(['aAaAa', ' a', 'abB'], dtype='>> import numpy as np + >>> a = np.array(['a1b c', '1bca', 'bca1']) + >>> table = a[0].maketrans('abc', '123') + >>> deletechars = ' ' + >>> np.char.translate(a, table, deletechars) + array(['112 3', '1231', '2311'], dtype=' NDArray[np.bool]: ... +@overload +def equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def not_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def not_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def greater_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def greater_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def less_equal(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def less_equal(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def greater(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def greater(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def less(x1: U_co, x2: U_co) -> NDArray[np.bool]: ... +@overload +def less(x1: S_co, x2: S_co) -> NDArray[np.bool]: ... + +@overload +def add(x1: U_co, x2: U_co) -> NDArray[np.str_]: ... +@overload +def add(x1: S_co, x2: S_co) -> NDArray[np.bytes_]: ... + +@overload +def multiply(a: U_co, i: i_co) -> NDArray[np.str_]: ... +@overload +def multiply(a: S_co, i: i_co) -> NDArray[np.bytes_]: ... + +@overload +def mod(a: U_co, value: Any) -> NDArray[np.str_]: ... +@overload +def mod(a: S_co, value: Any) -> NDArray[np.bytes_]: ... + +def isalpha(x: U_co | S_co) -> NDArray[np.bool]: ... +def isalnum(a: U_co | S_co) -> NDArray[np.bool]: ... +def isdigit(x: U_co | S_co) -> NDArray[np.bool]: ... +def isspace(x: U_co | S_co) -> NDArray[np.bool]: ... +def isdecimal(x: U_co) -> NDArray[np.bool]: ... +def isnumeric(x: U_co) -> NDArray[np.bool]: ... +def islower(a: U_co | S_co) -> NDArray[np.bool]: ... +def istitle(a: U_co | S_co) -> NDArray[np.bool]: ... +def isupper(a: U_co | S_co) -> NDArray[np.bool]: ... + +def str_len(x: U_co | S_co) -> NDArray[np.int_]: ... + +@overload +def find( + a: U_co, + sub: U_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... +@overload +def find( + a: S_co, + sub: S_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... + +@overload +def rfind( + a: U_co, + sub: U_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... +@overload +def rfind( + a: S_co, + sub: S_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... + +@overload +def index( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.int_]: ... +@overload +def index( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.int_]: ... + +@overload +def rindex( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.int_]: ... +@overload +def rindex( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[np.int_]: ... + +@overload +def count( + a: U_co, + sub: U_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... +@overload +def count( + a: S_co, + sub: S_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.int_]: ... + +@overload +def startswith( + a: U_co, + prefix: U_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.bool]: ... +@overload +def startswith( + a: S_co, + prefix: S_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.bool]: ... + +@overload +def endswith( + a: U_co, + suffix: U_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.bool]: ... +@overload +def endswith( + a: S_co, + suffix: S_co, + start: i_co = ..., + end: i_co | None = ..., +) -> NDArray[np.bool]: ... + +def decode( + a: S_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[np.str_]: ... + +def encode( + a: U_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[np.bytes_]: ... + +@overload +def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[np.str_]: ... +@overload +def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[np.str_]: ... +@overload +def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[np.str_]: ... +@overload +def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def rjust( + a: U_co, + width: i_co, + fillchar: U_co = ..., +) -> NDArray[np.str_]: ... +@overload +def rjust( + a: S_co, + width: i_co, + fillchar: S_co = ..., +) -> NDArray[np.bytes_]: ... + +@overload +def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[np.str_]: ... +@overload +def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def rstrip(a: U_co, char: None | U_co = ...) -> NDArray[np.str_]: ... +@overload +def rstrip(a: S_co, char: None | S_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def strip(a: U_co, chars: None | U_co = ...) -> NDArray[np.str_]: ... +@overload +def strip(a: S_co, chars: None | S_co = ...) -> NDArray[np.bytes_]: ... + +@overload +def zfill(a: U_co, width: i_co) -> NDArray[np.str_]: ... +@overload +def zfill(a: S_co, width: i_co) -> NDArray[np.bytes_]: ... + +@overload +def upper(a: U_co) -> NDArray[np.str_]: ... +@overload +def upper(a: S_co) -> NDArray[np.bytes_]: ... + +@overload +def lower(a: U_co) -> NDArray[np.str_]: ... +@overload +def lower(a: S_co) -> NDArray[np.bytes_]: ... + +@overload +def swapcase(a: U_co) -> NDArray[np.str_]: ... +@overload +def swapcase(a: S_co) -> NDArray[np.bytes_]: ... + +@overload +def capitalize(a: U_co) -> NDArray[np.str_]: ... +@overload +def capitalize(a: S_co) -> NDArray[np.bytes_]: ... + +@overload +def title(a: U_co) -> NDArray[np.str_]: ... +@overload +def title(a: S_co) -> NDArray[np.bytes_]: ... + +@overload +def replace( + a: U_co, + old: U_co, + new: U_co, + count: i_co = ..., +) -> NDArray[np.str_]: ... +@overload +def replace( + a: S_co, + old: S_co, + new: S_co, + count: i_co = ..., +) -> NDArray[np.bytes_]: ... + +@overload +def join(sep: U_co, seq: U_co) -> NDArray[np.str_]: ... +@overload +def join(sep: S_co, seq: S_co) -> NDArray[np.bytes_]: ... + +@overload +def split( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[np.object_]: ... +@overload +def split( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[np.object_]: ... + +@overload +def rsplit( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[np.object_]: ... +@overload +def rsplit( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[np.object_]: ... + +@overload +def splitlines(a: U_co, keepends: None | b_co = ...) -> NDArray[np.object_]: ... +@overload +def splitlines(a: S_co, keepends: None | b_co = ...) -> NDArray[np.object_]: ... + +@overload +def partition(a: U_co, sep: U_co) -> NDArray[np.str_]: ... +@overload +def partition(a: S_co, sep: S_co) -> NDArray[np.bytes_]: ... + +@overload +def rpartition(a: U_co, sep: U_co) -> NDArray[np.str_]: ... +@overload +def rpartition(a: S_co, sep: S_co) -> NDArray[np.bytes_]: ... + +@overload +def translate( + a: U_co, + table: U_co, + deletechars: None | U_co = ..., +) -> NDArray[np.str_]: ... +@overload +def translate( + a: S_co, + table: S_co, + deletechars: None | S_co = ..., +) -> NDArray[np.bytes_]: ... diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/_locales.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/_locales.py new file mode 100644 index 0000000000000000000000000000000000000000..b1dc55a9b2dc616de400f778a5f668a8431a2689 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/_locales.py @@ -0,0 +1,74 @@ +"""Provide class for testing in French locale + +""" +import sys +import locale + +import pytest + +__ALL__ = ['CommaDecimalPointLocale'] + + +def find_comma_decimal_point_locale(): + """See if platform has a decimal point as comma locale. + + Find a locale that uses a comma instead of a period as the + decimal point. + + Returns + ------- + old_locale: str + Locale when the function was called. + new_locale: {str, None) + First French locale found, None if none found. + + """ + if sys.platform == 'win32': + locales = ['FRENCH'] + else: + locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8'] + + old_locale = locale.getlocale(locale.LC_NUMERIC) + new_locale = None + try: + for loc in locales: + try: + locale.setlocale(locale.LC_NUMERIC, loc) + new_locale = loc + break + except locale.Error: + pass + finally: + locale.setlocale(locale.LC_NUMERIC, locale=old_locale) + return old_locale, new_locale + + +class CommaDecimalPointLocale: + """Sets LC_NUMERIC to a locale with comma as decimal point. + + Classes derived from this class have setup and teardown methods that run + tests with locale.LC_NUMERIC set to a locale where commas (',') are used as + the decimal point instead of periods ('.'). On exit the locale is restored + to the initial locale. It also serves as context manager with the same + effect. If no such locale is available, the test is skipped. + + .. versionadded:: 1.15.0 + + """ + (cur_locale, tst_locale) = find_comma_decimal_point_locale() + + def setup_method(self): + if self.tst_locale is None: + pytest.skip("No French locale available") + locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale) + + def teardown_method(self): + locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale) + + def __enter__(self): + if self.tst_locale is None: + pytest.skip("No French locale available") + locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale) + + def __exit__(self, type, value, traceback): + locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test__exceptions.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test__exceptions.py new file mode 100644 index 0000000000000000000000000000000000000000..fe792c8e37da46310b26322f19f9d45caf7b1765 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test__exceptions.py @@ -0,0 +1,89 @@ +""" +Tests of the ._exceptions module. Primarily for exercising the __str__ methods. +""" + +import pickle + +import pytest +import numpy as np +from numpy.exceptions import AxisError + +_ArrayMemoryError = np._core._exceptions._ArrayMemoryError +_UFuncNoLoopError = np._core._exceptions._UFuncNoLoopError + +class TestArrayMemoryError: + def test_pickling(self): + """ Test that _ArrayMemoryError can be pickled """ + error = _ArrayMemoryError((1023,), np.dtype(np.uint8)) + res = pickle.loads(pickle.dumps(error)) + assert res._total_size == error._total_size + + def test_str(self): + e = _ArrayMemoryError((1023,), np.dtype(np.uint8)) + str(e) # not crashing is enough + + # testing these properties is easier than testing the full string repr + def test__size_to_string(self): + """ Test e._size_to_string """ + f = _ArrayMemoryError._size_to_string + Ki = 1024 + assert f(0) == '0 bytes' + assert f(1) == '1 bytes' + assert f(1023) == '1023 bytes' + assert f(Ki) == '1.00 KiB' + assert f(Ki+1) == '1.00 KiB' + assert f(10*Ki) == '10.0 KiB' + assert f(int(999.4*Ki)) == '999. KiB' + assert f(int(1023.4*Ki)) == '1023. KiB' + assert f(int(1023.5*Ki)) == '1.00 MiB' + assert f(Ki*Ki) == '1.00 MiB' + + # 1023.9999 Mib should round to 1 GiB + assert f(int(Ki*Ki*Ki*0.9999)) == '1.00 GiB' + assert f(Ki*Ki*Ki*Ki*Ki*Ki) == '1.00 EiB' + # larger than sys.maxsize, adding larger prefixes isn't going to help + # anyway. + assert f(Ki*Ki*Ki*Ki*Ki*Ki*123456) == '123456. EiB' + + def test__total_size(self): + """ Test e._total_size """ + e = _ArrayMemoryError((1,), np.dtype(np.uint8)) + assert e._total_size == 1 + + e = _ArrayMemoryError((2, 4), np.dtype((np.uint64, 16))) + assert e._total_size == 1024 + + +class TestUFuncNoLoopError: + def test_pickling(self): + """ Test that _UFuncNoLoopError can be pickled """ + assert isinstance(pickle.dumps(_UFuncNoLoopError), bytes) + + +@pytest.mark.parametrize("args", [ + (2, 1, None), + (2, 1, "test_prefix"), + ("test message",), +]) +class TestAxisError: + def test_attr(self, args): + """Validate attribute types.""" + exc = AxisError(*args) + if len(args) == 1: + assert exc.axis is None + assert exc.ndim is None + else: + axis, ndim, *_ = args + assert exc.axis == axis + assert exc.ndim == ndim + + def test_pickling(self, args): + """Test that `AxisError` can be pickled.""" + exc = AxisError(*args) + exc2 = pickle.loads(pickle.dumps(exc)) + + assert type(exc) is type(exc2) + for name in ("axis", "ndim", "args"): + attr1 = getattr(exc, name) + attr2 = getattr(exc2, name) + assert attr1 == attr2, name diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_api.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_api.py new file mode 100644 index 0000000000000000000000000000000000000000..1ac7a49b361066eea56cb2f78adbacd65ed6df77 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_api.py @@ -0,0 +1,616 @@ +import sys + +import numpy as np +import numpy._core.umath as ncu +from numpy._core._rational_tests import rational +import pytest +from numpy.testing import ( + assert_, assert_equal, assert_array_equal, assert_raises, assert_warns, + HAS_REFCOUNT + ) + + +def test_array_array(): + tobj = type(object) + ones11 = np.ones((1, 1), np.float64) + tndarray = type(ones11) + # Test is_ndarray + assert_equal(np.array(ones11, dtype=np.float64), ones11) + if HAS_REFCOUNT: + old_refcount = sys.getrefcount(tndarray) + np.array(ones11) + assert_equal(old_refcount, sys.getrefcount(tndarray)) + + # test None + assert_equal(np.array(None, dtype=np.float64), + np.array(np.nan, dtype=np.float64)) + if HAS_REFCOUNT: + old_refcount = sys.getrefcount(tobj) + np.array(None, dtype=np.float64) + assert_equal(old_refcount, sys.getrefcount(tobj)) + + # test scalar + assert_equal(np.array(1.0, dtype=np.float64), + np.ones((), dtype=np.float64)) + if HAS_REFCOUNT: + old_refcount = sys.getrefcount(np.float64) + np.array(np.array(1.0, dtype=np.float64), dtype=np.float64) + assert_equal(old_refcount, sys.getrefcount(np.float64)) + + # test string + S2 = np.dtype((bytes, 2)) + S3 = np.dtype((bytes, 3)) + S5 = np.dtype((bytes, 5)) + assert_equal(np.array(b"1.0", dtype=np.float64), + np.ones((), dtype=np.float64)) + assert_equal(np.array(b"1.0").dtype, S3) + assert_equal(np.array(b"1.0", dtype=bytes).dtype, S3) + assert_equal(np.array(b"1.0", dtype=S2), np.array(b"1.")) + assert_equal(np.array(b"1", dtype=S5), np.ones((), dtype=S5)) + + # test string + U2 = np.dtype((str, 2)) + U3 = np.dtype((str, 3)) + U5 = np.dtype((str, 5)) + assert_equal(np.array("1.0", dtype=np.float64), + np.ones((), dtype=np.float64)) + assert_equal(np.array("1.0").dtype, U3) + assert_equal(np.array("1.0", dtype=str).dtype, U3) + assert_equal(np.array("1.0", dtype=U2), np.array(str("1."))) + assert_equal(np.array("1", dtype=U5), np.ones((), dtype=U5)) + + builtins = getattr(__builtins__, '__dict__', __builtins__) + assert_(hasattr(builtins, 'get')) + + # test memoryview + dat = np.array(memoryview(b'1.0'), dtype=np.float64) + assert_equal(dat, [49.0, 46.0, 48.0]) + assert_(dat.dtype.type is np.float64) + + dat = np.array(memoryview(b'1.0')) + assert_equal(dat, [49, 46, 48]) + assert_(dat.dtype.type is np.uint8) + + # test array interface + a = np.array(100.0, dtype=np.float64) + o = type("o", (object,), + dict(__array_interface__=a.__array_interface__)) + assert_equal(np.array(o, dtype=np.float64), a) + + # test array_struct interface + a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')], + dtype=[('f0', int), ('f1', float), ('f2', str)]) + o = type("o", (object,), + dict(__array_struct__=a.__array_struct__)) + ## wasn't what I expected... is np.array(o) supposed to equal a ? + ## instead we get a array([...], dtype=">V18") + assert_equal(bytes(np.array(o).data), bytes(a.data)) + + # test array + def custom__array__(self, dtype=None, copy=None): + return np.array(100.0, dtype=dtype, copy=copy) + + o = type("o", (object,), dict(__array__=custom__array__))() + assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64)) + + # test recursion + nested = 1.5 + for i in range(ncu.MAXDIMS): + nested = [nested] + + # no error + np.array(nested) + + # Exceeds recursion limit + assert_raises(ValueError, np.array, [nested], dtype=np.float64) + + # Try with lists... + # float32 + assert_equal(np.array([None] * 10, dtype=np.float32), + np.full((10,), np.nan, dtype=np.float32)) + assert_equal(np.array([[None]] * 10, dtype=np.float32), + np.full((10, 1), np.nan, dtype=np.float32)) + assert_equal(np.array([[None] * 10], dtype=np.float32), + np.full((1, 10), np.nan, dtype=np.float32)) + assert_equal(np.array([[None] * 10] * 10, dtype=np.float32), + np.full((10, 10), np.nan, dtype=np.float32)) + # float64 + assert_equal(np.array([None] * 10, dtype=np.float64), + np.full((10,), np.nan, dtype=np.float64)) + assert_equal(np.array([[None]] * 10, dtype=np.float64), + np.full((10, 1), np.nan, dtype=np.float64)) + assert_equal(np.array([[None] * 10], dtype=np.float64), + np.full((1, 10), np.nan, dtype=np.float64)) + assert_equal(np.array([[None] * 10] * 10, dtype=np.float64), + np.full((10, 10), np.nan, dtype=np.float64)) + + assert_equal(np.array([1.0] * 10, dtype=np.float64), + np.ones((10,), dtype=np.float64)) + assert_equal(np.array([[1.0]] * 10, dtype=np.float64), + np.ones((10, 1), dtype=np.float64)) + assert_equal(np.array([[1.0] * 10], dtype=np.float64), + np.ones((1, 10), dtype=np.float64)) + assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64), + np.ones((10, 10), dtype=np.float64)) + + # Try with tuples + assert_equal(np.array((None,) * 10, dtype=np.float64), + np.full((10,), np.nan, dtype=np.float64)) + assert_equal(np.array([(None,)] * 10, dtype=np.float64), + np.full((10, 1), np.nan, dtype=np.float64)) + assert_equal(np.array([(None,) * 10], dtype=np.float64), + np.full((1, 10), np.nan, dtype=np.float64)) + assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64), + np.full((10, 10), np.nan, dtype=np.float64)) + + assert_equal(np.array((1.0,) * 10, dtype=np.float64), + np.ones((10,), dtype=np.float64)) + assert_equal(np.array([(1.0,)] * 10, dtype=np.float64), + np.ones((10, 1), dtype=np.float64)) + assert_equal(np.array([(1.0,) * 10], dtype=np.float64), + np.ones((1, 10), dtype=np.float64)) + assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64), + np.ones((10, 10), dtype=np.float64)) + +@pytest.mark.parametrize("array", [True, False]) +def test_array_impossible_casts(array): + # All builtin types can be forcibly cast, at least theoretically, + # but user dtypes cannot necessarily. + rt = rational(1, 2) + if array: + rt = np.array(rt) + with assert_raises(TypeError): + np.array(rt, dtype="M8") + + +def test_array_astype(): + a = np.arange(6, dtype='f4').reshape(2, 3) + # Default behavior: allows unsafe casts, keeps memory layout, + # always copies. + b = a.astype('i4') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('i4')) + assert_equal(a.strides, b.strides) + b = a.T.astype('i4') + assert_equal(a.T, b) + assert_equal(b.dtype, np.dtype('i4')) + assert_equal(a.T.strides, b.strides) + b = a.astype('f4') + assert_equal(a, b) + assert_(not (a is b)) + + # copy=False parameter skips a copy + b = a.astype('f4', copy=False) + assert_(a is b) + + # order parameter allows overriding of the memory layout, + # forcing a copy if the layout is wrong + b = a.astype('f4', order='F', copy=False) + assert_equal(a, b) + assert_(not (a is b)) + assert_(b.flags.f_contiguous) + + b = a.astype('f4', order='C', copy=False) + assert_equal(a, b) + assert_(a is b) + assert_(b.flags.c_contiguous) + + # casting parameter allows catching bad casts + b = a.astype('c8', casting='safe') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('c8')) + + assert_raises(TypeError, a.astype, 'i4', casting='safe') + + # subok=False passes through a non-subclassed array + b = a.astype('f4', subok=0, copy=False) + assert_(a is b) + + class MyNDArray(np.ndarray): + pass + + a = np.array([[0, 1, 2], [3, 4, 5]], dtype='f4').view(MyNDArray) + + # subok=True passes through a subclass + b = a.astype('f4', subok=True, copy=False) + assert_(a is b) + + # subok=True is default, and creates a subtype on a cast + b = a.astype('i4', copy=False) + assert_equal(a, b) + assert_equal(type(b), MyNDArray) + + # subok=False never returns a subclass + b = a.astype('f4', subok=False, copy=False) + assert_equal(a, b) + assert_(not (a is b)) + assert_(type(b) is not MyNDArray) + + # Make sure converting from string object to fixed length string + # does not truncate. + a = np.array([b'a'*100], dtype='O') + b = a.astype('S') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('S100')) + a = np.array(['a'*100], dtype='O') + b = a.astype('U') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('U100')) + + # Same test as above but for strings shorter than 64 characters + a = np.array([b'a'*10], dtype='O') + b = a.astype('S') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('S10')) + a = np.array(['a'*10], dtype='O') + b = a.astype('U') + assert_equal(a, b) + assert_equal(b.dtype, np.dtype('U10')) + + a = np.array(123456789012345678901234567890, dtype='O').astype('S') + assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) + a = np.array(123456789012345678901234567890, dtype='O').astype('U') + assert_array_equal(a, np.array('1234567890' * 3, dtype='U30')) + + a = np.array([123456789012345678901234567890], dtype='O').astype('S') + assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) + a = np.array([123456789012345678901234567890], dtype='O').astype('U') + assert_array_equal(a, np.array('1234567890' * 3, dtype='U30')) + + a = np.array(123456789012345678901234567890, dtype='S') + assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30')) + a = np.array(123456789012345678901234567890, dtype='U') + assert_array_equal(a, np.array('1234567890' * 3, dtype='U30')) + + a = np.array('a\u0140', dtype='U') + b = np.ndarray(buffer=a, dtype='uint32', shape=2) + assert_(b.size == 2) + + a = np.array([1000], dtype='i4') + assert_raises(TypeError, a.astype, 'S1', casting='safe') + + a = np.array(1000, dtype='i4') + assert_raises(TypeError, a.astype, 'U1', casting='safe') + + # gh-24023 + assert_raises(TypeError, a.astype) + +@pytest.mark.parametrize("dt", ["S", "U"]) +def test_array_astype_to_string_discovery_empty(dt): + # See also gh-19085 + arr = np.array([""], dtype=object) + # Note, the itemsize is the `0 -> 1` logic, which should change. + # The important part the test is rather that it does not error. + assert arr.astype(dt).dtype.itemsize == np.dtype(f"{dt}1").itemsize + + # check the same thing for `np.can_cast` (since it accepts arrays) + assert np.can_cast(arr, dt, casting="unsafe") + assert not np.can_cast(arr, dt, casting="same_kind") + # as well as for the object as a descriptor: + assert np.can_cast("O", dt, casting="unsafe") + +@pytest.mark.parametrize("dt", ["d", "f", "S13", "U32"]) +def test_array_astype_to_void(dt): + dt = np.dtype(dt) + arr = np.array([], dtype=dt) + assert arr.astype("V").dtype.itemsize == dt.itemsize + +def test_object_array_astype_to_void(): + # This is different to `test_array_astype_to_void` as object arrays + # are inspected. The default void is "V8" (8 is the length of double) + arr = np.array([], dtype="O").astype("V") + assert arr.dtype == "V8" + +@pytest.mark.parametrize("t", + np._core.sctypes['uint'] + + np._core.sctypes['int'] + + np._core.sctypes['float'] +) +def test_array_astype_warning(t): + # test ComplexWarning when casting from complex to float or int + a = np.array(10, dtype=np.complex128) + assert_warns(np.exceptions.ComplexWarning, a.astype, t) + +@pytest.mark.parametrize(["dtype", "out_dtype"], + [(np.bytes_, np.bool), + (np.str_, np.bool), + (np.dtype("S10,S9"), np.dtype("?,?")), + # The following also checks unaligned unicode access: + (np.dtype("S7,U9"), np.dtype("?,?"))]) +def test_string_to_boolean_cast(dtype, out_dtype): + # Only the last two (empty) strings are falsy (the `\0` is stripped): + arr = np.array( + ["10", "10\0\0\0", "0\0\0", "0", "False", " ", "", "\0"], + dtype=dtype) + expected = np.array( + [True, True, True, True, True, True, False, False], + dtype=out_dtype) + assert_array_equal(arr.astype(out_dtype), expected) + # As it's similar, check that nonzero behaves the same (structs are + # nonzero if all entries are) + assert_array_equal(np.nonzero(arr), np.nonzero(expected)) + +@pytest.mark.parametrize("str_type", [str, bytes, np.str_]) +@pytest.mark.parametrize("scalar_type", + [np.complex64, np.complex128, np.clongdouble]) +def test_string_to_complex_cast(str_type, scalar_type): + value = scalar_type(b"1+3j") + assert scalar_type(value) == 1+3j + assert np.array([value], dtype=object).astype(scalar_type)[()] == 1+3j + assert np.array(value).astype(scalar_type)[()] == 1+3j + arr = np.zeros(1, dtype=scalar_type) + arr[0] = value + assert arr[0] == 1+3j + +@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"]) +def test_none_to_nan_cast(dtype): + # Note that at the time of writing this test, the scalar constructors + # reject None + arr = np.zeros(1, dtype=dtype) + arr[0] = None + assert np.isnan(arr)[0] + assert np.isnan(np.array(None, dtype=dtype))[()] + assert np.isnan(np.array([None], dtype=dtype))[0] + assert np.isnan(np.array(None).astype(dtype))[()] + +def test_copyto_fromscalar(): + a = np.arange(6, dtype='f4').reshape(2, 3) + + # Simple copy + np.copyto(a, 1.5) + assert_equal(a, 1.5) + np.copyto(a.T, 2.5) + assert_equal(a, 2.5) + + # Where-masked copy + mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?') + np.copyto(a, 3.5, where=mask) + assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]]) + mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?') + np.copyto(a.T, 4.5, where=mask) + assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]]) + +def test_copyto(): + a = np.arange(6, dtype='i4').reshape(2, 3) + + # Simple copy + np.copyto(a, [[3, 1, 5], [6, 2, 1]]) + assert_equal(a, [[3, 1, 5], [6, 2, 1]]) + + # Overlapping copy should work + np.copyto(a[:, :2], a[::-1, 1::-1]) + assert_equal(a, [[2, 6, 5], [1, 3, 1]]) + + # Defaults to 'same_kind' casting + assert_raises(TypeError, np.copyto, a, 1.5) + + # Force a copy with 'unsafe' casting, truncating 1.5 to 1 + np.copyto(a, 1.5, casting='unsafe') + assert_equal(a, 1) + + # Copying with a mask + np.copyto(a, 3, where=[True, False, True]) + assert_equal(a, [[3, 1, 3], [3, 1, 3]]) + + # Casting rule still applies with a mask + assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True]) + + # Lists of integer 0's and 1's is ok too + np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]]) + assert_equal(a, [[3, 4, 4], [4, 1, 3]]) + + # Overlapping copy with mask should work + np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]]) + assert_equal(a, [[3, 4, 4], [4, 3, 3]]) + + # 'dst' must be an array + assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4]) + + +def test_copyto_cast_safety(): + with pytest.raises(TypeError): + np.copyto(np.arange(3), 3., casting="safe") + + # Can put integer and float scalars safely (and equiv): + np.copyto(np.arange(3), 3, casting="equiv") + np.copyto(np.arange(3.), 3., casting="equiv") + # And also with less precision safely: + np.copyto(np.arange(3, dtype="uint8"), 3, casting="safe") + np.copyto(np.arange(3., dtype="float32"), 3., casting="safe") + + # But not equiv: + with pytest.raises(TypeError): + np.copyto(np.arange(3, dtype="uint8"), 3, casting="equiv") + + with pytest.raises(TypeError): + np.copyto(np.arange(3., dtype="float32"), 3., casting="equiv") + + # As a special thing, object is equiv currently: + np.copyto(np.arange(3, dtype=object), 3, casting="equiv") + + # The following raises an overflow error/gives a warning but not + # type error (due to casting), though: + with pytest.raises(OverflowError): + np.copyto(np.arange(3), 2**80, casting="safe") + + with pytest.warns(RuntimeWarning): + np.copyto(np.arange(3, dtype=np.float32), 2e300, casting="safe") + + +def test_copyto_permut(): + # test explicit overflow case + pad = 500 + l = [True] * pad + [True, True, True, True] + r = np.zeros(len(l)-pad) + d = np.ones(len(l)-pad) + mask = np.array(l)[pad:] + np.copyto(r, d, where=mask[::-1]) + + # test all permutation of possible masks, 9 should be sufficient for + # current 4 byte unrolled code + power = 9 + d = np.ones(power) + for i in range(2**power): + r = np.zeros(power) + l = [(i & x) != 0 for x in range(power)] + mask = np.array(l) + np.copyto(r, d, where=mask) + assert_array_equal(r == 1, l) + assert_equal(r.sum(), sum(l)) + + r = np.zeros(power) + np.copyto(r, d, where=mask[::-1]) + assert_array_equal(r == 1, l[::-1]) + assert_equal(r.sum(), sum(l)) + + r = np.zeros(power) + np.copyto(r[::2], d[::2], where=mask[::2]) + assert_array_equal(r[::2] == 1, l[::2]) + assert_equal(r[::2].sum(), sum(l[::2])) + + r = np.zeros(power) + np.copyto(r[::2], d[::2], where=mask[::-2]) + assert_array_equal(r[::2] == 1, l[::-2]) + assert_equal(r[::2].sum(), sum(l[::-2])) + + for c in [0xFF, 0x7F, 0x02, 0x10]: + r = np.zeros(power) + mask = np.array(l) + imask = np.array(l).view(np.uint8) + imask[mask != 0] = c + np.copyto(r, d, where=mask) + assert_array_equal(r == 1, l) + assert_equal(r.sum(), sum(l)) + + r = np.zeros(power) + np.copyto(r, d, where=True) + assert_equal(r.sum(), r.size) + r = np.ones(power) + d = np.zeros(power) + np.copyto(r, d, where=False) + assert_equal(r.sum(), r.size) + +def test_copy_order(): + a = np.arange(24).reshape(2, 1, 3, 4) + b = a.copy(order='F') + c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3) + + def check_copy_result(x, y, ccontig, fcontig, strides=False): + assert_(not (x is y)) + assert_equal(x, y) + assert_equal(res.flags.c_contiguous, ccontig) + assert_equal(res.flags.f_contiguous, fcontig) + + # Validate the initial state of a, b, and c + assert_(a.flags.c_contiguous) + assert_(not a.flags.f_contiguous) + assert_(not b.flags.c_contiguous) + assert_(b.flags.f_contiguous) + assert_(not c.flags.c_contiguous) + assert_(not c.flags.f_contiguous) + + # Copy with order='C' + res = a.copy(order='C') + check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) + res = b.copy(order='C') + check_copy_result(res, b, ccontig=True, fcontig=False, strides=False) + res = c.copy(order='C') + check_copy_result(res, c, ccontig=True, fcontig=False, strides=False) + res = np.copy(a, order='C') + check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) + res = np.copy(b, order='C') + check_copy_result(res, b, ccontig=True, fcontig=False, strides=False) + res = np.copy(c, order='C') + check_copy_result(res, c, ccontig=True, fcontig=False, strides=False) + + # Copy with order='F' + res = a.copy(order='F') + check_copy_result(res, a, ccontig=False, fcontig=True, strides=False) + res = b.copy(order='F') + check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) + res = c.copy(order='F') + check_copy_result(res, c, ccontig=False, fcontig=True, strides=False) + res = np.copy(a, order='F') + check_copy_result(res, a, ccontig=False, fcontig=True, strides=False) + res = np.copy(b, order='F') + check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) + res = np.copy(c, order='F') + check_copy_result(res, c, ccontig=False, fcontig=True, strides=False) + + # Copy with order='K' + res = a.copy(order='K') + check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) + res = b.copy(order='K') + check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) + res = c.copy(order='K') + check_copy_result(res, c, ccontig=False, fcontig=False, strides=True) + res = np.copy(a, order='K') + check_copy_result(res, a, ccontig=True, fcontig=False, strides=True) + res = np.copy(b, order='K') + check_copy_result(res, b, ccontig=False, fcontig=True, strides=True) + res = np.copy(c, order='K') + check_copy_result(res, c, ccontig=False, fcontig=False, strides=True) + +def test_contiguous_flags(): + a = np.ones((4, 4, 1))[::2,:,:] + a.strides = a.strides[:2] + (-123,) + b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4) + + def check_contig(a, ccontig, fcontig): + assert_(a.flags.c_contiguous == ccontig) + assert_(a.flags.f_contiguous == fcontig) + + # Check if new arrays are correct: + check_contig(a, False, False) + check_contig(b, False, False) + check_contig(np.empty((2, 2, 0, 2, 2)), True, True) + check_contig(np.array([[[1], [2]]], order='F'), True, True) + check_contig(np.empty((2, 2)), True, False) + check_contig(np.empty((2, 2), order='F'), False, True) + + # Check that np.array creates correct contiguous flags: + check_contig(np.array(a, copy=None), False, False) + check_contig(np.array(a, copy=None, order='C'), True, False) + check_contig(np.array(a, ndmin=4, copy=None, order='F'), False, True) + + # Check slicing update of flags and : + check_contig(a[0], True, True) + check_contig(a[None, ::4, ..., None], True, True) + check_contig(b[0, 0, ...], False, True) + check_contig(b[:, :, 0:0, :, :], True, True) + + # Test ravel and squeeze. + check_contig(a.ravel(), True, True) + check_contig(np.ones((1, 3, 1)).squeeze(), True, True) + +def test_broadcast_arrays(): + # Test user defined dtypes + a = np.array([(1, 2, 3)], dtype='u4,u4,u4') + b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4') + result = np.broadcast_arrays(a, b) + assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4')) + assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')) + +@pytest.mark.parametrize(["shape", "fill_value", "expected_output"], + [((2, 2), [5.0, 6.0], np.array([[5.0, 6.0], [5.0, 6.0]])), + ((3, 2), [1.0, 2.0], np.array([[1.0, 2.0], [1.0, 2.0], [1.0, 2.0]]))]) +def test_full_from_list(shape, fill_value, expected_output): + output = np.full(shape, fill_value) + assert_equal(output, expected_output) + +def test_astype_copyflag(): + # test the various copyflag options + arr = np.arange(10, dtype=np.intp) + + res_true = arr.astype(np.intp, copy=True) + assert not np.shares_memory(arr, res_true) + + res_false = arr.astype(np.intp, copy=False) + assert np.shares_memory(arr, res_false) + + res_false_float = arr.astype(np.float64, copy=False) + assert not np.shares_memory(arr, res_false_float) + + # _CopyMode enum isn't allowed + assert_raises(ValueError, arr.astype, np.float64, + copy=np._CopyMode.NEVER) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_argparse.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_argparse.py new file mode 100644 index 0000000000000000000000000000000000000000..ededced3b9fee9f8615ae49c6a8b8d38626154ae --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_argparse.py @@ -0,0 +1,90 @@ +""" +Tests for the private NumPy argument parsing functionality. +They mainly exists to ensure good test coverage without having to try the +weirder cases on actual numpy functions but test them in one place. + +The test function is defined in C to be equivalent to (errors may not always +match exactly, and could be adjusted): + + def func(arg1, /, arg2, *, arg3): + i = integer(arg1) # reproducing the 'i' parsing in Python. + return None +""" + +import threading + +import pytest + +import numpy as np +from numpy._core._multiarray_tests import ( + argparse_example_function as func, + threaded_argparse_example_function as thread_func, +) +from numpy.testing import IS_WASM + + +@pytest.mark.skipif(IS_WASM, reason="wasm doesn't have support for threads") +def test_thread_safe_argparse_cache(): + b = threading.Barrier(8) + + def call_thread_func(): + b.wait() + thread_func(arg1=3, arg2=None) + + tasks = [threading.Thread(target=call_thread_func) for _ in range(8)] + [t.start() for t in tasks] + [t.join() for t in tasks] + + +def test_invalid_integers(): + with pytest.raises(TypeError, + match="integer argument expected, got float"): + func(1.) + with pytest.raises(OverflowError): + func(2**100) + + +def test_missing_arguments(): + with pytest.raises(TypeError, + match="missing required positional argument 0"): + func() + with pytest.raises(TypeError, + match="missing required positional argument 0"): + func(arg2=1, arg3=4) + with pytest.raises(TypeError, + match=r"missing required argument \'arg2\' \(pos 1\)"): + func(1, arg3=5) + + +def test_too_many_positional(): + # the second argument is positional but can be passed as keyword. + with pytest.raises(TypeError, + match="takes from 2 to 3 positional arguments but 4 were given"): + func(1, 2, 3, 4) + + +def test_multiple_values(): + with pytest.raises(TypeError, + match=r"given by name \('arg2'\) and position \(position 1\)"): + func(1, 2, arg2=3) + + +def test_string_fallbacks(): + # We can (currently?) use numpy strings to test the "slow" fallbacks + # that should normally not be taken due to string interning. + arg2 = np.str_("arg2") + missing_arg = np.str_("missing_arg") + func(1, **{arg2: 3}) + with pytest.raises(TypeError, + match="got an unexpected keyword argument 'missing_arg'"): + func(2, **{missing_arg: 3}) + + +def test_too_many_arguments_method_forwarding(): + # Not directly related to the standard argument parsing, but we sometimes + # forward methods to Python: arr.mean() calls np._core._methods._mean() + # This adds code coverage for this `npy_forward_method`. + arr = np.arange(3) + args = range(1000) + with pytest.raises(TypeError): + arr.mean(*args) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_api_info.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_api_info.py new file mode 100644 index 0000000000000000000000000000000000000000..154b3837325d570190c3f98d29827e7e9a63051c --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_api_info.py @@ -0,0 +1,112 @@ +import numpy as np +import pytest + +info = np.__array_namespace_info__() + + +def test_capabilities(): + caps = info.capabilities() + assert caps["boolean indexing"] == True + assert caps["data-dependent shapes"] == True + + # This will be added in the 2024.12 release of the array API standard. + + # assert caps["max rank"] == 64 + # np.zeros((1,)*64) + # with pytest.raises(ValueError): + # np.zeros((1,)*65) + + +def test_default_device(): + assert info.default_device() == "cpu" == np.asarray(0).device + + +def test_default_dtypes(): + dtypes = info.default_dtypes() + assert dtypes["real floating"] == np.float64 == np.asarray(0.0).dtype + assert dtypes["complex floating"] == np.complex128 == \ + np.asarray(0.0j).dtype + assert dtypes["integral"] == np.intp == np.asarray(0).dtype + assert dtypes["indexing"] == np.intp == np.argmax(np.zeros(10)).dtype + + with pytest.raises(ValueError, match="Device not understood"): + info.default_dtypes(device="gpu") + + +def test_dtypes_all(): + dtypes = info.dtypes() + assert dtypes == { + "bool": np.bool_, + "int8": np.int8, + "int16": np.int16, + "int32": np.int32, + "int64": np.int64, + "uint8": np.uint8, + "uint16": np.uint16, + "uint32": np.uint32, + "uint64": np.uint64, + "float32": np.float32, + "float64": np.float64, + "complex64": np.complex64, + "complex128": np.complex128, + } + + +dtype_categories = { + "bool": {"bool": np.bool_}, + "signed integer": { + "int8": np.int8, + "int16": np.int16, + "int32": np.int32, + "int64": np.int64, + }, + "unsigned integer": { + "uint8": np.uint8, + "uint16": np.uint16, + "uint32": np.uint32, + "uint64": np.uint64, + }, + "integral": ("signed integer", "unsigned integer"), + "real floating": {"float32": np.float32, "float64": np.float64}, + "complex floating": {"complex64": np.complex64, "complex128": + np.complex128}, + "numeric": ("integral", "real floating", "complex floating"), +} + + +@pytest.mark.parametrize("kind", dtype_categories) +def test_dtypes_kind(kind): + expected = dtype_categories[kind] + if isinstance(expected, tuple): + assert info.dtypes(kind=kind) == info.dtypes(kind=expected) + else: + assert info.dtypes(kind=kind) == expected + + +def test_dtypes_tuple(): + dtypes = info.dtypes(kind=("bool", "integral")) + assert dtypes == { + "bool": np.bool_, + "int8": np.int8, + "int16": np.int16, + "int32": np.int32, + "int64": np.int64, + "uint8": np.uint8, + "uint16": np.uint16, + "uint32": np.uint32, + "uint64": np.uint64, + } + + +def test_dtypes_invalid_kind(): + with pytest.raises(ValueError, match="unsupported kind"): + info.dtypes(kind="invalid") + + +def test_dtypes_invalid_device(): + with pytest.raises(ValueError, match="Device not understood"): + info.dtypes(device="gpu") + + +def test_devices(): + assert info.devices() == ["cpu"] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_coercion.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_coercion.py new file mode 100644 index 0000000000000000000000000000000000000000..c2172d40d81ec739d32973d92fe8079b7d224058 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_array_coercion.py @@ -0,0 +1,911 @@ +""" +Tests for array coercion, mainly through testing `np.array` results directly. +Note that other such tests exist, e.g., in `test_api.py` and many corner-cases +are tested (sometimes indirectly) elsewhere. +""" + +from itertools import permutations, product + +import pytest +from pytest import param + +import numpy as np +import numpy._core._multiarray_umath as ncu +from numpy._core._rational_tests import rational + +from numpy.testing import ( + assert_array_equal, assert_warns, IS_PYPY) + + +def arraylikes(): + """ + Generator for functions converting an array into various array-likes. + If full is True (default) it includes array-likes not capable of handling + all dtypes. + """ + # base array: + def ndarray(a): + return a + + yield param(ndarray, id="ndarray") + + # subclass: + class MyArr(np.ndarray): + pass + + def subclass(a): + return a.view(MyArr) + + yield subclass + + class _SequenceLike: + # Older NumPy versions, sometimes cared whether a protocol array was + # also _SequenceLike. This shouldn't matter, but keep it for now + # for __array__ and not the others. + def __len__(self): + raise TypeError + + def __getitem__(self): + raise TypeError + + # Array-interface + class ArrayDunder(_SequenceLike): + def __init__(self, a): + self.a = a + + def __array__(self, dtype=None, copy=None): + if dtype is None: + return self.a + return self.a.astype(dtype) + + yield param(ArrayDunder, id="__array__") + + # memory-view + yield param(memoryview, id="memoryview") + + # Array-interface + class ArrayInterface: + def __init__(self, a): + self.a = a # need to hold on to keep interface valid + self.__array_interface__ = a.__array_interface__ + + yield param(ArrayInterface, id="__array_interface__") + + # Array-Struct + class ArrayStruct: + def __init__(self, a): + self.a = a # need to hold on to keep struct valid + self.__array_struct__ = a.__array_struct__ + + yield param(ArrayStruct, id="__array_struct__") + + +def scalar_instances(times=True, extended_precision=True, user_dtype=True): + # Hard-coded list of scalar instances. + # Floats: + yield param(np.sqrt(np.float16(5)), id="float16") + yield param(np.sqrt(np.float32(5)), id="float32") + yield param(np.sqrt(np.float64(5)), id="float64") + if extended_precision: + yield param(np.sqrt(np.longdouble(5)), id="longdouble") + + # Complex: + yield param(np.sqrt(np.complex64(2+3j)), id="complex64") + yield param(np.sqrt(np.complex128(2+3j)), id="complex128") + if extended_precision: + yield param(np.sqrt(np.clongdouble(2+3j)), id="clongdouble") + + # Bool: + # XFAIL: Bool should be added, but has some bad properties when it + # comes to strings, see also gh-9875 + # yield param(np.bool(0), id="bool") + + # Integers: + yield param(np.int8(2), id="int8") + yield param(np.int16(2), id="int16") + yield param(np.int32(2), id="int32") + yield param(np.int64(2), id="int64") + + yield param(np.uint8(2), id="uint8") + yield param(np.uint16(2), id="uint16") + yield param(np.uint32(2), id="uint32") + yield param(np.uint64(2), id="uint64") + + # Rational: + if user_dtype: + yield param(rational(1, 2), id="rational") + + # Cannot create a structured void scalar directly: + structured = np.array([(1, 3)], "i,i")[0] + assert isinstance(structured, np.void) + assert structured.dtype == np.dtype("i,i") + yield param(structured, id="structured") + + if times: + # Datetimes and timedelta + yield param(np.timedelta64(2), id="timedelta64[generic]") + yield param(np.timedelta64(23, "s"), id="timedelta64[s]") + yield param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)") + + yield param(np.datetime64("NaT"), id="datetime64[generic](NaT)") + yield param(np.datetime64("2020-06-07 12:43", "ms"), id="datetime64[ms]") + + # Strings and unstructured void: + yield param(np.bytes_(b"1234"), id="bytes") + yield param(np.str_("2345"), id="unicode") + yield param(np.void(b"4321"), id="unstructured_void") + + +def is_parametric_dtype(dtype): + """Returns True if the dtype is a parametric legacy dtype (itemsize + is 0, or a datetime without units) + """ + if dtype.itemsize == 0: + return True + if issubclass(dtype.type, (np.datetime64, np.timedelta64)): + if dtype.name.endswith("64"): + # Generic time units + return True + return False + + +class TestStringDiscovery: + @pytest.mark.parametrize("obj", + [object(), 1.2, 10**43, None, "string"], + ids=["object", "1.2", "10**43", "None", "string"]) + def test_basic_stringlength(self, obj): + length = len(str(obj)) + expected = np.dtype(f"S{length}") + + assert np.array(obj, dtype="S").dtype == expected + assert np.array([obj], dtype="S").dtype == expected + + # A nested array is also discovered correctly + arr = np.array(obj, dtype="O") + assert np.array(arr, dtype="S").dtype == expected + # Also if we use the dtype class + assert np.array(arr, dtype=type(expected)).dtype == expected + # Check that .astype() behaves identical + assert arr.astype("S").dtype == expected + # The DType class is accepted by `.astype()` + assert arr.astype(type(np.dtype("S"))).dtype == expected + + @pytest.mark.parametrize("obj", + [object(), 1.2, 10**43, None, "string"], + ids=["object", "1.2", "10**43", "None", "string"]) + def test_nested_arrays_stringlength(self, obj): + length = len(str(obj)) + expected = np.dtype(f"S{length}") + arr = np.array(obj, dtype="O") + assert np.array([arr, arr], dtype="S").dtype == expected + + @pytest.mark.parametrize("arraylike", arraylikes()) + def test_unpack_first_level(self, arraylike): + # We unpack exactly one level of array likes + obj = np.array([None]) + obj[0] = np.array(1.2) + # the length of the included item, not of the float dtype + length = len(str(obj[0])) + expected = np.dtype(f"S{length}") + + obj = arraylike(obj) + # casting to string usually calls str(obj) + arr = np.array([obj], dtype="S") + assert arr.shape == (1, 1) + assert arr.dtype == expected + + +class TestScalarDiscovery: + def test_void_special_case(self): + # Void dtypes with structures discover tuples as elements + arr = np.array((1, 2, 3), dtype="i,i,i") + assert arr.shape == () + arr = np.array([(1, 2, 3)], dtype="i,i,i") + assert arr.shape == (1,) + + def test_char_special_case(self): + arr = np.array("string", dtype="c") + assert arr.shape == (6,) + assert arr.dtype.char == "c" + arr = np.array(["string"], dtype="c") + assert arr.shape == (1, 6) + assert arr.dtype.char == "c" + + def test_char_special_case_deep(self): + # Check that the character special case errors correctly if the + # array is too deep: + nested = ["string"] # 2 dimensions (due to string being sequence) + for i in range(ncu.MAXDIMS - 2): + nested = [nested] + + arr = np.array(nested, dtype='c') + assert arr.shape == (1,) * (ncu.MAXDIMS - 1) + (6,) + with pytest.raises(ValueError): + np.array([nested], dtype="c") + + def test_unknown_object(self): + arr = np.array(object()) + assert arr.shape == () + assert arr.dtype == np.dtype("O") + + @pytest.mark.parametrize("scalar", scalar_instances()) + def test_scalar(self, scalar): + arr = np.array(scalar) + assert arr.shape == () + assert arr.dtype == scalar.dtype + + arr = np.array([[scalar, scalar]]) + assert arr.shape == (1, 2) + assert arr.dtype == scalar.dtype + + # Additionally to string this test also runs into a corner case + # with datetime promotion (the difference is the promotion order). + @pytest.mark.filterwarnings("ignore:Promotion of numbers:FutureWarning") + def test_scalar_promotion(self): + for sc1, sc2 in product(scalar_instances(), scalar_instances()): + sc1, sc2 = sc1.values[0], sc2.values[0] + # test all combinations: + try: + arr = np.array([sc1, sc2]) + except (TypeError, ValueError): + # The promotion between two times can fail + # XFAIL (ValueError): Some object casts are currently undefined + continue + assert arr.shape == (2,) + try: + dt1, dt2 = sc1.dtype, sc2.dtype + expected_dtype = np.promote_types(dt1, dt2) + assert arr.dtype == expected_dtype + except TypeError as e: + # Will currently always go to object dtype + assert arr.dtype == np.dtype("O") + + @pytest.mark.parametrize("scalar", scalar_instances()) + def test_scalar_coercion(self, scalar): + # This tests various scalar coercion paths, mainly for the numerical + # types. It includes some paths not directly related to `np.array`. + if isinstance(scalar, np.inexact): + # Ensure we have a full-precision number if available + scalar = type(scalar)((scalar * 2)**0.5) + + if type(scalar) is rational: + # Rational generally fails due to a missing cast. In the future + # object casts should automatically be defined based on `setitem`. + pytest.xfail("Rational to object cast is undefined currently.") + + # Use casting from object: + arr = np.array(scalar, dtype=object).astype(scalar.dtype) + + # Test various ways to create an array containing this scalar: + arr1 = np.array(scalar).reshape(1) + arr2 = np.array([scalar]) + arr3 = np.empty(1, dtype=scalar.dtype) + arr3[0] = scalar + arr4 = np.empty(1, dtype=scalar.dtype) + arr4[:] = [scalar] + # All of these methods should yield the same results + assert_array_equal(arr, arr1) + assert_array_equal(arr, arr2) + assert_array_equal(arr, arr3) + assert_array_equal(arr, arr4) + + @pytest.mark.xfail(IS_PYPY, reason="`int(np.complex128(3))` fails on PyPy") + @pytest.mark.filterwarnings("ignore::numpy.exceptions.ComplexWarning") + @pytest.mark.parametrize("cast_to", scalar_instances()) + def test_scalar_coercion_same_as_cast_and_assignment(self, cast_to): + """ + Test that in most cases: + * `np.array(scalar, dtype=dtype)` + * `np.empty((), dtype=dtype)[()] = scalar` + * `np.array(scalar).astype(dtype)` + should behave the same. The only exceptions are parametric dtypes + (mainly datetime/timedelta without unit) and void without fields. + """ + dtype = cast_to.dtype # use to parametrize only the target dtype + + for scalar in scalar_instances(times=False): + scalar = scalar.values[0] + + if dtype.type == np.void: + if scalar.dtype.fields is not None and dtype.fields is None: + # Here, coercion to "V6" works, but the cast fails. + # Since the types are identical, SETITEM takes care of + # this, but has different rules than the cast. + with pytest.raises(TypeError): + np.array(scalar).astype(dtype) + np.array(scalar, dtype=dtype) + np.array([scalar], dtype=dtype) + continue + + # The main test, we first try to use casting and if it succeeds + # continue below testing that things are the same, otherwise + # test that the alternative paths at least also fail. + try: + cast = np.array(scalar).astype(dtype) + except (TypeError, ValueError, RuntimeError): + # coercion should also raise (error type may change) + with pytest.raises(Exception): + np.array(scalar, dtype=dtype) + + if (isinstance(scalar, rational) and + np.issubdtype(dtype, np.signedinteger)): + return + + with pytest.raises(Exception): + np.array([scalar], dtype=dtype) + # assignment should also raise + res = np.zeros((), dtype=dtype) + with pytest.raises(Exception): + res[()] = scalar + + return + + # Non error path: + arr = np.array(scalar, dtype=dtype) + assert_array_equal(arr, cast) + # assignment behaves the same + ass = np.zeros((), dtype=dtype) + ass[()] = scalar + assert_array_equal(ass, cast) + + @pytest.mark.parametrize("pyscalar", [10, 10.32, 10.14j, 10**100]) + def test_pyscalar_subclasses(self, pyscalar): + """NumPy arrays are read/write which means that anything but invariant + behaviour is on thin ice. However, we currently are happy to discover + subclasses of Python float, int, complex the same as the base classes. + This should potentially be deprecated. + """ + class MyScalar(type(pyscalar)): + pass + + res = np.array(MyScalar(pyscalar)) + expected = np.array(pyscalar) + assert_array_equal(res, expected) + + @pytest.mark.parametrize("dtype_char", np.typecodes["All"]) + def test_default_dtype_instance(self, dtype_char): + if dtype_char in "SU": + dtype = np.dtype(dtype_char + "1") + elif dtype_char == "V": + # Legacy behaviour was to use V8. The reason was float64 being the + # default dtype and that having 8 bytes. + dtype = np.dtype("V8") + else: + dtype = np.dtype(dtype_char) + + discovered_dtype, _ = ncu._discover_array_parameters([], type(dtype)) + + assert discovered_dtype == dtype + assert discovered_dtype.itemsize == dtype.itemsize + + @pytest.mark.parametrize("dtype", np.typecodes["Integer"]) + @pytest.mark.parametrize(["scalar", "error"], + [(np.float64(np.nan), ValueError), + (np.array(-1).astype(np.ulonglong)[()], OverflowError)]) + def test_scalar_to_int_coerce_does_not_cast(self, dtype, scalar, error): + """ + Signed integers are currently different in that they do not cast other + NumPy scalar, but instead use scalar.__int__(). The hardcoded + exception to this rule is `np.array(scalar, dtype=integer)`. + """ + dtype = np.dtype(dtype) + + # This is a special case using casting logic. It warns for the NaN + # but allows the cast (giving undefined behaviour). + with np.errstate(invalid="ignore"): + coerced = np.array(scalar, dtype=dtype) + cast = np.array(scalar).astype(dtype) + assert_array_equal(coerced, cast) + + # However these fail: + with pytest.raises(error): + np.array([scalar], dtype=dtype) + with pytest.raises(error): + cast[()] = scalar + + +class TestTimeScalars: + @pytest.mark.parametrize("dtype", [np.int64, np.float32]) + @pytest.mark.parametrize("scalar", + [param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)"), + param(np.timedelta64(123, "s"), id="timedelta64[s]"), + param(np.datetime64("NaT", "generic"), id="datetime64[generic](NaT)"), + param(np.datetime64(1, "D"), id="datetime64[D]")],) + def test_coercion_basic(self, dtype, scalar): + # Note the `[scalar]` is there because np.array(scalar) uses stricter + # `scalar.__int__()` rules for backward compatibility right now. + arr = np.array(scalar, dtype=dtype) + cast = np.array(scalar).astype(dtype) + assert_array_equal(arr, cast) + + ass = np.ones((), dtype=dtype) + if issubclass(dtype, np.integer): + with pytest.raises(TypeError): + # raises, as would np.array([scalar], dtype=dtype), this is + # conversion from times, but behaviour of integers. + ass[()] = scalar + else: + ass[()] = scalar + assert_array_equal(ass, cast) + + @pytest.mark.parametrize("dtype", [np.int64, np.float32]) + @pytest.mark.parametrize("scalar", + [param(np.timedelta64(123, "ns"), id="timedelta64[ns]"), + param(np.timedelta64(12, "generic"), id="timedelta64[generic]")]) + def test_coercion_timedelta_convert_to_number(self, dtype, scalar): + # Only "ns" and "generic" timedeltas can be converted to numbers + # so these are slightly special. + arr = np.array(scalar, dtype=dtype) + cast = np.array(scalar).astype(dtype) + ass = np.ones((), dtype=dtype) + ass[()] = scalar # raises, as would np.array([scalar], dtype=dtype) + + assert_array_equal(arr, cast) + assert_array_equal(cast, cast) + + @pytest.mark.parametrize("dtype", ["S6", "U6"]) + @pytest.mark.parametrize(["val", "unit"], + [param(123, "s", id="[s]"), param(123, "D", id="[D]")]) + def test_coercion_assignment_datetime(self, val, unit, dtype): + # String from datetime64 assignment is currently special cased to + # never use casting. This is because casting will error in this + # case, and traditionally in most cases the behaviour is maintained + # like this. (`np.array(scalar, dtype="U6")` would have failed before) + # TODO: This discrepancy _should_ be resolved, either by relaxing the + # cast, or by deprecating the first part. + scalar = np.datetime64(val, unit) + dtype = np.dtype(dtype) + cut_string = dtype.type(str(scalar)[:6]) + + arr = np.array(scalar, dtype=dtype) + assert arr[()] == cut_string + ass = np.ones((), dtype=dtype) + ass[()] = scalar + assert ass[()] == cut_string + + with pytest.raises(RuntimeError): + # However, unlike the above assignment using `str(scalar)[:6]` + # due to being handled by the string DType and not be casting + # the explicit cast fails: + np.array(scalar).astype(dtype) + + + @pytest.mark.parametrize(["val", "unit"], + [param(123, "s", id="[s]"), param(123, "D", id="[D]")]) + def test_coercion_assignment_timedelta(self, val, unit): + scalar = np.timedelta64(val, unit) + + # Unlike datetime64, timedelta allows the unsafe cast: + np.array(scalar, dtype="S6") + cast = np.array(scalar).astype("S6") + ass = np.ones((), dtype="S6") + ass[()] = scalar + expected = scalar.astype("S")[:6] + assert cast[()] == expected + assert ass[()] == expected + +class TestNested: + def test_nested_simple(self): + initial = [1.2] + nested = initial + for i in range(ncu.MAXDIMS - 1): + nested = [nested] + + arr = np.array(nested, dtype="float64") + assert arr.shape == (1,) * ncu.MAXDIMS + with pytest.raises(ValueError): + np.array([nested], dtype="float64") + + with pytest.raises(ValueError, match=".*would exceed the maximum"): + np.array([nested]) # user must ask for `object` explicitly + + arr = np.array([nested], dtype=object) + assert arr.dtype == np.dtype("O") + assert arr.shape == (1,) * ncu.MAXDIMS + assert arr.item() is initial + + def test_pathological_self_containing(self): + # Test that this also works for two nested sequences + l = [] + l.append(l) + arr = np.array([l, l, l], dtype=object) + assert arr.shape == (3,) + (1,) * (ncu.MAXDIMS - 1) + + # Also check a ragged case: + arr = np.array([l, [None], l], dtype=object) + assert arr.shape == (3, 1) + + @pytest.mark.parametrize("arraylike", arraylikes()) + def test_nested_arraylikes(self, arraylike): + # We try storing an array like into an array, but the array-like + # will have too many dimensions. This means the shape discovery + # decides that the array-like must be treated as an object (a special + # case of ragged discovery). The result will be an array with one + # dimension less than the maximum dimensions, and the array being + # assigned to it (which does work for object or if `float(arraylike)` + # works). + initial = arraylike(np.ones((1, 1))) + + nested = initial + for i in range(ncu.MAXDIMS - 1): + nested = [nested] + + with pytest.raises(ValueError, match=".*would exceed the maximum"): + # It will refuse to assign the array into + np.array(nested, dtype="float64") + + # If this is object, we end up assigning a (1, 1) array into (1,) + # (due to running out of dimensions), this is currently supported but + # a special case which is not ideal. + arr = np.array(nested, dtype=object) + assert arr.shape == (1,) * ncu.MAXDIMS + assert arr.item() == np.array(initial).item() + + @pytest.mark.parametrize("arraylike", arraylikes()) + def test_uneven_depth_ragged(self, arraylike): + arr = np.arange(4).reshape((2, 2)) + arr = arraylike(arr) + + # Array is ragged in the second dimension already: + out = np.array([arr, [arr]], dtype=object) + assert out.shape == (2,) + assert out[0] is arr + assert type(out[1]) is list + + # Array is ragged in the third dimension: + with pytest.raises(ValueError): + # This is a broadcast error during assignment, because + # the array shape would be (2, 2, 2) but `arr[0, 0] = arr` fails. + np.array([arr, [arr, arr]], dtype=object) + + def test_empty_sequence(self): + arr = np.array([[], [1], [[1]]], dtype=object) + assert arr.shape == (3,) + + # The empty sequence stops further dimension discovery, so the + # result shape will be (0,) which leads to an error during: + with pytest.raises(ValueError): + np.array([[], np.empty((0, 1))], dtype=object) + + def test_array_of_different_depths(self): + # When multiple arrays (or array-likes) are included in a + # sequences and have different depth, we currently discover + # as many dimensions as they share. (see also gh-17224) + arr = np.zeros((3, 2)) + mismatch_first_dim = np.zeros((1, 2)) + mismatch_second_dim = np.zeros((3, 3)) + + dtype, shape = ncu._discover_array_parameters( + [arr, mismatch_second_dim], dtype=np.dtype("O")) + assert shape == (2, 3) + + dtype, shape = ncu._discover_array_parameters( + [arr, mismatch_first_dim], dtype=np.dtype("O")) + assert shape == (2,) + # The second case is currently supported because the arrays + # can be stored as objects: + res = np.asarray([arr, mismatch_first_dim], dtype=np.dtype("O")) + assert res[0] is arr + assert res[1] is mismatch_first_dim + + +class TestBadSequences: + # These are tests for bad objects passed into `np.array`, in general + # these have undefined behaviour. In the old code they partially worked + # when now they will fail. We could (and maybe should) create a copy + # of all sequences to be safe against bad-actors. + + def test_growing_list(self): + # List to coerce, `mylist` will append to it during coercion + obj = [] + class mylist(list): + def __len__(self): + obj.append([1, 2]) + return super().__len__() + + obj.append(mylist([1, 2])) + + with pytest.raises(RuntimeError): + np.array(obj) + + # Note: We do not test a shrinking list. These do very evil things + # and the only way to fix them would be to copy all sequences. + # (which may be a real option in the future). + + def test_mutated_list(self): + # List to coerce, `mylist` will mutate the first element + obj = [] + class mylist(list): + def __len__(self): + obj[0] = [2, 3] # replace with a different list. + return super().__len__() + + obj.append([2, 3]) + obj.append(mylist([1, 2])) + # Does not crash: + np.array(obj) + + def test_replace_0d_array(self): + # List to coerce, `mylist` will mutate the first element + obj = [] + class baditem: + def __len__(self): + obj[0][0] = 2 # replace with a different list. + raise ValueError("not actually a sequence!") + + def __getitem__(self): + pass + + # Runs into a corner case in the new code, the `array(2)` is cached + # so replacing it invalidates the cache. + obj.append([np.array(2), baditem()]) + with pytest.raises(RuntimeError): + np.array(obj) + + +class TestArrayLikes: + @pytest.mark.parametrize("arraylike", arraylikes()) + def test_0d_object_special_case(self, arraylike): + arr = np.array(0.) + obj = arraylike(arr) + # A single array-like is always converted: + res = np.array(obj, dtype=object) + assert_array_equal(arr, res) + + # But a single 0-D nested array-like never: + res = np.array([obj], dtype=object) + assert res[0] is obj + + @pytest.mark.parametrize("arraylike", arraylikes()) + @pytest.mark.parametrize("arr", [np.array(0.), np.arange(4)]) + def test_object_assignment_special_case(self, arraylike, arr): + obj = arraylike(arr) + empty = np.arange(1, dtype=object) + empty[:] = [obj] + assert empty[0] is obj + + def test_0d_generic_special_case(self): + class ArraySubclass(np.ndarray): + def __float__(self): + raise TypeError("e.g. quantities raise on this") + + arr = np.array(0.) + obj = arr.view(ArraySubclass) + res = np.array(obj) + # The subclass is simply cast: + assert_array_equal(arr, res) + + # If the 0-D array-like is included, __float__ is currently + # guaranteed to be used. We may want to change that, quantities + # and masked arrays half make use of this. + with pytest.raises(TypeError): + np.array([obj]) + + # The same holds for memoryview: + obj = memoryview(arr) + res = np.array(obj) + assert_array_equal(arr, res) + with pytest.raises(ValueError): + # The error type does not matter much here. + np.array([obj]) + + def test_arraylike_classes(self): + # The classes of array-likes should generally be acceptable to be + # stored inside a numpy (object) array. This tests all of the + # special attributes (since all are checked during coercion). + arr = np.array(np.int64) + assert arr[()] is np.int64 + arr = np.array([np.int64]) + assert arr[0] is np.int64 + + # This also works for properties/unbound methods: + class ArrayLike: + @property + def __array_interface__(self): + pass + + @property + def __array_struct__(self): + pass + + def __array__(self, dtype=None, copy=None): + pass + + arr = np.array(ArrayLike) + assert arr[()] is ArrayLike + arr = np.array([ArrayLike]) + assert arr[0] is ArrayLike + + @pytest.mark.skipif( + np.dtype(np.intp).itemsize < 8, reason="Needs 64bit platform") + def test_too_large_array_error_paths(self): + """Test the error paths, including for memory leaks""" + arr = np.array(0, dtype="uint8") + # Guarantees that a contiguous copy won't work: + arr = np.broadcast_to(arr, 2**62) + + for i in range(5): + # repeat, to ensure caching cannot have an effect: + with pytest.raises(MemoryError): + np.array(arr) + with pytest.raises(MemoryError): + np.array([arr]) + + @pytest.mark.parametrize("attribute", + ["__array_interface__", "__array__", "__array_struct__"]) + @pytest.mark.parametrize("error", [RecursionError, MemoryError]) + def test_bad_array_like_attributes(self, attribute, error): + # RecursionError and MemoryError are considered fatal. All errors + # (except AttributeError) should probably be raised in the future, + # but shapely made use of it, so it will require a deprecation. + + class BadInterface: + def __getattr__(self, attr): + if attr == attribute: + raise error + super().__getattr__(attr) + + with pytest.raises(error): + np.array(BadInterface()) + + @pytest.mark.parametrize("error", [RecursionError, MemoryError]) + def test_bad_array_like_bad_length(self, error): + # RecursionError and MemoryError are considered "critical" in + # sequences. We could expand this more generally though. (NumPy 1.20) + class BadSequence: + def __len__(self): + raise error + def __getitem__(self): + # must have getitem to be a Sequence + return 1 + + with pytest.raises(error): + np.array(BadSequence()) + + def test_array_interface_descr_optional(self): + # The descr should be optional regresion test for gh-27249 + arr = np.ones(10, dtype="V10") + iface = arr.__array_interface__ + iface.pop("descr") + + class MyClass: + __array_interface__ = iface + + assert_array_equal(np.asarray(MyClass), arr) + + +class TestAsArray: + """Test expected behaviors of ``asarray``.""" + + def test_dtype_identity(self): + """Confirm the intended behavior for *dtype* kwarg. + + The result of ``asarray()`` should have the dtype provided through the + keyword argument, when used. This forces unique array handles to be + produced for unique np.dtype objects, but (for equivalent dtypes), the + underlying data (the base object) is shared with the original array + object. + + Ref https://github.com/numpy/numpy/issues/1468 + """ + int_array = np.array([1, 2, 3], dtype='i') + assert np.asarray(int_array) is int_array + + # The character code resolves to the singleton dtype object provided + # by the numpy package. + assert np.asarray(int_array, dtype='i') is int_array + + # Derive a dtype from n.dtype('i'), but add a metadata object to force + # the dtype to be distinct. + unequal_type = np.dtype('i', metadata={'spam': True}) + annotated_int_array = np.asarray(int_array, dtype=unequal_type) + assert annotated_int_array is not int_array + assert annotated_int_array.base is int_array + # Create an equivalent descriptor with a new and distinct dtype + # instance. + equivalent_requirement = np.dtype('i', metadata={'spam': True}) + annotated_int_array_alt = np.asarray(annotated_int_array, + dtype=equivalent_requirement) + assert unequal_type == equivalent_requirement + assert unequal_type is not equivalent_requirement + assert annotated_int_array_alt is not annotated_int_array + assert annotated_int_array_alt.dtype is equivalent_requirement + + # Check the same logic for a pair of C types whose equivalence may vary + # between computing environments. + # Find an equivalent pair. + integer_type_codes = ('i', 'l', 'q') + integer_dtypes = [np.dtype(code) for code in integer_type_codes] + typeA = None + typeB = None + for typeA, typeB in permutations(integer_dtypes, r=2): + if typeA == typeB: + assert typeA is not typeB + break + assert isinstance(typeA, np.dtype) and isinstance(typeB, np.dtype) + + # These ``asarray()`` calls may produce a new view or a copy, + # but never the same object. + long_int_array = np.asarray(int_array, dtype='l') + long_long_int_array = np.asarray(int_array, dtype='q') + assert long_int_array is not int_array + assert long_long_int_array is not int_array + assert np.asarray(long_int_array, dtype='q') is not long_int_array + array_a = np.asarray(int_array, dtype=typeA) + assert typeA == typeB + assert typeA is not typeB + assert array_a.dtype is typeA + assert array_a is not np.asarray(array_a, dtype=typeB) + assert np.asarray(array_a, dtype=typeB).dtype is typeB + assert array_a is np.asarray(array_a, dtype=typeB).base + + +class TestSpecialAttributeLookupFailure: + # An exception was raised while fetching the attribute + + class WeirdArrayLike: + @property + def __array__(self, dtype=None, copy=None): + raise RuntimeError("oops!") + + class WeirdArrayInterface: + @property + def __array_interface__(self): + raise RuntimeError("oops!") + + def test_deprecated(self): + with pytest.raises(RuntimeError): + np.array(self.WeirdArrayLike()) + with pytest.raises(RuntimeError): + np.array(self.WeirdArrayInterface()) + + +def test_subarray_from_array_construction(): + # Arrays are more complex, since they "broadcast" on success: + arr = np.array([1, 2]) + + res = arr.astype("2i") + assert_array_equal(res, [[1, 1], [2, 2]]) + + res = np.array(arr, dtype="(2,)i") + + assert_array_equal(res, [[1, 1], [2, 2]]) + + res = np.array([[(1,), (2,)], arr], dtype="2i") + assert_array_equal(res, [[[1, 1], [2, 2]], [[1, 1], [2, 2]]]) + + # Also try a multi-dimensional example: + arr = np.arange(5 * 2).reshape(5, 2) + expected = np.broadcast_to(arr[:, :, np.newaxis, np.newaxis], (5, 2, 2, 2)) + + res = arr.astype("(2,2)f") + assert_array_equal(res, expected) + + res = np.array(arr, dtype="(2,2)f") + assert_array_equal(res, expected) + + +def test_empty_string(): + # Empty strings are unfortunately often converted to S1 and we need to + # make sure we are filling the S1 and not the (possibly) detected S0 + # result. This should likely just return S0 and if not maybe the decision + # to return S1 should be moved. + res = np.array([""] * 10, dtype="S") + assert_array_equal(res, np.array("\0", "S1")) + assert res.dtype == "S1" + + arr = np.array([""] * 10, dtype=object) + + res = arr.astype("S") + assert_array_equal(res, b"") + assert res.dtype == "S1" + + res = np.array(arr, dtype="S") + assert_array_equal(res, b"") + # TODO: This is arguably weird/wrong, but seems old: + assert res.dtype == f"S{np.dtype('O').itemsize}" + + res = np.array([[""] * 10, arr], dtype="S") + assert_array_equal(res, b"") + assert res.shape == (2, 10) + assert res.dtype == "S1" diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_arrayprint.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_arrayprint.py new file mode 100644 index 0000000000000000000000000000000000000000..e2305c974147f679d0aba051dd65291bfa01c527 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_arrayprint.py @@ -0,0 +1,1260 @@ +import sys +import gc +from hypothesis import given +from hypothesis.extra import numpy as hynp +import pytest + +import numpy as np +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_warns, HAS_REFCOUNT, + assert_raises_regex, IS_WASM + ) +from numpy.testing._private.utils import run_threaded +from numpy._core.arrayprint import _typelessdata +import textwrap + +class TestArrayRepr: + def test_nan_inf(self): + x = np.array([np.nan, np.inf]) + assert_equal(repr(x), 'array([nan, inf])') + + def test_subclass(self): + class sub(np.ndarray): pass + + # one dimensional + x1d = np.array([1, 2]).view(sub) + assert_equal(repr(x1d), 'sub([1, 2])') + + # two dimensional + x2d = np.array([[1, 2], [3, 4]]).view(sub) + assert_equal(repr(x2d), + 'sub([[1, 2],\n' + ' [3, 4]])') + + # two dimensional with flexible dtype + xstruct = np.ones((2,2), dtype=[('a', ' 1) + y = sub(None) + x[()] = y + y[()] = x + assert_equal(repr(x), + 'sub(sub(sub(..., dtype=object), dtype=object), dtype=object)') + assert_equal(str(x), '...') + x[()] = 0 # resolve circular references for garbage collector + + # nested 0d-subclass-object + x = sub(None) + x[()] = sub(None) + assert_equal(repr(x), 'sub(sub(None, dtype=object), dtype=object)') + assert_equal(str(x), 'None') + + # gh-10663 + class DuckCounter(np.ndarray): + def __getitem__(self, item): + result = super().__getitem__(item) + if not isinstance(result, DuckCounter): + result = result[...].view(DuckCounter) + return result + + def to_string(self): + return {0: 'zero', 1: 'one', 2: 'two'}.get(self.item(), 'many') + + def __str__(self): + if self.shape == (): + return self.to_string() + else: + fmt = {'all': lambda x: x.to_string()} + return np.array2string(self, formatter=fmt) + + dc = np.arange(5).view(DuckCounter) + assert_equal(str(dc), "[zero one two many many]") + assert_equal(str(dc[0]), "zero") + + def test_self_containing(self): + arr0d = np.array(None) + arr0d[()] = arr0d + assert_equal(repr(arr0d), + 'array(array(..., dtype=object), dtype=object)') + arr0d[()] = 0 # resolve recursion for garbage collector + + arr1d = np.array([None, None]) + arr1d[1] = arr1d + assert_equal(repr(arr1d), + 'array([None, array(..., dtype=object)], dtype=object)') + arr1d[1] = 0 # resolve recursion for garbage collector + + first = np.array(None) + second = np.array(None) + first[()] = second + second[()] = first + assert_equal(repr(first), + 'array(array(array(..., dtype=object), dtype=object), dtype=object)') + first[()] = 0 # resolve circular references for garbage collector + + def test_containing_list(self): + # printing square brackets directly would be ambiguuous + arr1d = np.array([None, None]) + arr1d[0] = [1, 2] + arr1d[1] = [3] + assert_equal(repr(arr1d), + 'array([list([1, 2]), list([3])], dtype=object)') + + def test_void_scalar_recursion(self): + # gh-9345 + repr(np.void(b'test')) # RecursionError ? + + def test_fieldless_structured(self): + # gh-10366 + no_fields = np.dtype([]) + arr_no_fields = np.empty(4, dtype=no_fields) + assert_equal(repr(arr_no_fields), 'array([(), (), (), ()], dtype=[])') + + +class TestComplexArray: + def test_str(self): + rvals = [0, 1, -1, np.inf, -np.inf, np.nan] + cvals = [complex(rp, ip) for rp in rvals for ip in rvals] + dtypes = [np.complex64, np.cdouble, np.clongdouble] + actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes] + wanted = [ + '[0.+0.j]', '[0.+0.j]', '[0.+0.j]', + '[0.+1.j]', '[0.+1.j]', '[0.+1.j]', + '[0.-1.j]', '[0.-1.j]', '[0.-1.j]', + '[0.+infj]', '[0.+infj]', '[0.+infj]', + '[0.-infj]', '[0.-infj]', '[0.-infj]', + '[0.+nanj]', '[0.+nanj]', '[0.+nanj]', + '[1.+0.j]', '[1.+0.j]', '[1.+0.j]', + '[1.+1.j]', '[1.+1.j]', '[1.+1.j]', + '[1.-1.j]', '[1.-1.j]', '[1.-1.j]', + '[1.+infj]', '[1.+infj]', '[1.+infj]', + '[1.-infj]', '[1.-infj]', '[1.-infj]', + '[1.+nanj]', '[1.+nanj]', '[1.+nanj]', + '[-1.+0.j]', '[-1.+0.j]', '[-1.+0.j]', + '[-1.+1.j]', '[-1.+1.j]', '[-1.+1.j]', + '[-1.-1.j]', '[-1.-1.j]', '[-1.-1.j]', + '[-1.+infj]', '[-1.+infj]', '[-1.+infj]', + '[-1.-infj]', '[-1.-infj]', '[-1.-infj]', + '[-1.+nanj]', '[-1.+nanj]', '[-1.+nanj]', + '[inf+0.j]', '[inf+0.j]', '[inf+0.j]', + '[inf+1.j]', '[inf+1.j]', '[inf+1.j]', + '[inf-1.j]', '[inf-1.j]', '[inf-1.j]', + '[inf+infj]', '[inf+infj]', '[inf+infj]', + '[inf-infj]', '[inf-infj]', '[inf-infj]', + '[inf+nanj]', '[inf+nanj]', '[inf+nanj]', + '[-inf+0.j]', '[-inf+0.j]', '[-inf+0.j]', + '[-inf+1.j]', '[-inf+1.j]', '[-inf+1.j]', + '[-inf-1.j]', '[-inf-1.j]', '[-inf-1.j]', + '[-inf+infj]', '[-inf+infj]', '[-inf+infj]', + '[-inf-infj]', '[-inf-infj]', '[-inf-infj]', + '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]', + '[nan+0.j]', '[nan+0.j]', '[nan+0.j]', + '[nan+1.j]', '[nan+1.j]', '[nan+1.j]', + '[nan-1.j]', '[nan-1.j]', '[nan-1.j]', + '[nan+infj]', '[nan+infj]', '[nan+infj]', + '[nan-infj]', '[nan-infj]', '[nan-infj]', + '[nan+nanj]', '[nan+nanj]', '[nan+nanj]'] + + for res, val in zip(actual, wanted): + assert_equal(res, val) + +class TestArray2String: + def test_basic(self): + """Basic test of array2string.""" + a = np.arange(3) + assert_(np.array2string(a) == '[0 1 2]') + assert_(np.array2string(a, max_line_width=4, legacy='1.13') == '[0 1\n 2]') + assert_(np.array2string(a, max_line_width=4) == '[0\n 1\n 2]') + + def test_unexpected_kwarg(self): + # ensure than an appropriate TypeError + # is raised when array2string receives + # an unexpected kwarg + + with assert_raises_regex(TypeError, 'nonsense'): + np.array2string(np.array([1, 2, 3]), + nonsense=None) + + def test_format_function(self): + """Test custom format function for each element in array.""" + def _format_function(x): + if np.abs(x) < 1: + return '.' + elif np.abs(x) < 2: + return 'o' + else: + return 'O' + + x = np.arange(3) + x_hex = "[0x0 0x1 0x2]" + x_oct = "[0o0 0o1 0o2]" + assert_(np.array2string(x, formatter={'all':_format_function}) == + "[. o O]") + assert_(np.array2string(x, formatter={'int_kind':_format_function}) == + "[. o O]") + assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) == + "[0.0000 1.0000 2.0000]") + assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}), + x_hex) + assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}), + x_oct) + + x = np.arange(3.) + assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) == + "[0.00 1.00 2.00]") + assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) == + "[0.00 1.00 2.00]") + + s = np.array(['abc', 'def']) + assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) == + '[abcabc defdef]') + + def test_structure_format_mixed(self): + dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))]) + x = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt) + assert_equal(np.array2string(x), + "[('Sarah', [8., 7.]) ('John', [6., 7.])]") + + np.set_printoptions(legacy='1.13') + try: + # for issue #5692 + A = np.zeros(shape=10, dtype=[("A", "M8[s]")]) + A[5:].fill(np.datetime64('NaT')) + assert_equal( + np.array2string(A), + textwrap.dedent("""\ + [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) + ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('NaT',) ('NaT',) + ('NaT',) ('NaT',) ('NaT',)]""") + ) + finally: + np.set_printoptions(legacy=False) + + # same again, but with non-legacy behavior + assert_equal( + np.array2string(A), + textwrap.dedent("""\ + [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) + ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) + ('1970-01-01T00:00:00',) ( 'NaT',) + ( 'NaT',) ( 'NaT',) + ( 'NaT',) ( 'NaT',)]""") + ) + + # and again, with timedeltas + A = np.full(10, 123456, dtype=[("A", "m8[s]")]) + A[5:].fill(np.datetime64('NaT')) + assert_equal( + np.array2string(A), + textwrap.dedent("""\ + [(123456,) (123456,) (123456,) (123456,) (123456,) ( 'NaT',) ( 'NaT',) + ( 'NaT',) ( 'NaT',) ( 'NaT',)]""") + ) + + def test_structure_format_int(self): + # See #8160 + struct_int = np.array([([1, -1],), ([123, 1],)], + dtype=[('B', 'i4', 2)]) + assert_equal(np.array2string(struct_int), + "[([ 1, -1],) ([123, 1],)]") + struct_2dint = np.array([([[0, 1], [2, 3]],), ([[12, 0], [0, 0]],)], + dtype=[('B', 'i4', (2, 2))]) + assert_equal(np.array2string(struct_2dint), + "[([[ 0, 1], [ 2, 3]],) ([[12, 0], [ 0, 0]],)]") + + def test_structure_format_float(self): + # See #8172 + array_scalar = np.array( + (1., 2.1234567890123456789, 3.), dtype=('f8,f8,f8')) + assert_equal(np.array2string(array_scalar), "(1., 2.12345679, 3.)") + + def test_unstructured_void_repr(self): + a = np.array([27, 91, 50, 75, 7, 65, 10, 8, + 27, 91, 51, 49,109, 82,101,100], dtype='u1').view('V8') + assert_equal(repr(a[0]), + r"np.void(b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08')") + assert_equal(str(a[0]), r"b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'") + assert_equal(repr(a), + r"array([b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'," "\n" + r" b'\x1B\x5B\x33\x31\x6D\x52\x65\x64'], dtype='|V8')") + + assert_equal(eval(repr(a), vars(np)), a) + assert_equal(eval(repr(a[0]), dict(np=np)), a[0]) + + def test_edgeitems_kwarg(self): + # previously the global print options would be taken over the kwarg + arr = np.zeros(3, int) + assert_equal( + np.array2string(arr, edgeitems=1, threshold=0), + "[0 ... 0]" + ) + + def test_summarize_1d(self): + A = np.arange(1001) + strA = '[ 0 1 2 ... 998 999 1000]' + assert_equal(str(A), strA) + + reprA = 'array([ 0, 1, 2, ..., 998, 999, 1000])' + assert_equal(repr(A), reprA) + + def test_summarize_2d(self): + A = np.arange(1002).reshape(2, 501) + strA = '[[ 0 1 2 ... 498 499 500]\n' \ + ' [ 501 502 503 ... 999 1000 1001]]' + assert_equal(str(A), strA) + + reprA = 'array([[ 0, 1, 2, ..., 498, 499, 500],\n' \ + ' [ 501, 502, 503, ..., 999, 1000, 1001]])' + assert_equal(repr(A), reprA) + + def test_summarize_structure(self): + A = (np.arange(2002, dtype="i8", (2, 1001))]) + strB = "[([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)]" + assert_equal(str(B), strB) + + reprB = ( + "array([([[1, 1, 1, ..., 1, 1, 1], [1, 1, 1, ..., 1, 1, 1]],)],\n" + " dtype=[('i', '>i8', (2, 1001))])" + ) + assert_equal(repr(B), reprB) + + C = (np.arange(22, dtype=" 1: + # if the type is >1 byte, the non-native endian version + # must show endianness. + assert non_native_repr != native_repr + assert f"dtype='{non_native_dtype.byteorder}" in non_native_repr + + def test_linewidth_repr(self): + a = np.full(7, fill_value=2) + np.set_printoptions(linewidth=17) + assert_equal( + repr(a), + textwrap.dedent("""\ + array([2, 2, 2, + 2, 2, 2, + 2])""") + ) + np.set_printoptions(linewidth=17, legacy='1.13') + assert_equal( + repr(a), + textwrap.dedent("""\ + array([2, 2, 2, + 2, 2, 2, 2])""") + ) + + a = np.full(8, fill_value=2) + + np.set_printoptions(linewidth=18, legacy=False) + assert_equal( + repr(a), + textwrap.dedent("""\ + array([2, 2, 2, + 2, 2, 2, + 2, 2])""") + ) + + np.set_printoptions(linewidth=18, legacy='1.13') + assert_equal( + repr(a), + textwrap.dedent("""\ + array([2, 2, 2, 2, + 2, 2, 2, 2])""") + ) + + def test_linewidth_str(self): + a = np.full(18, fill_value=2) + np.set_printoptions(linewidth=18) + assert_equal( + str(a), + textwrap.dedent("""\ + [2 2 2 2 2 2 2 2 + 2 2 2 2 2 2 2 2 + 2 2]""") + ) + np.set_printoptions(linewidth=18, legacy='1.13') + assert_equal( + str(a), + textwrap.dedent("""\ + [2 2 2 2 2 2 2 2 2 + 2 2 2 2 2 2 2 2 2]""") + ) + + def test_edgeitems(self): + np.set_printoptions(edgeitems=1, threshold=1) + a = np.arange(27).reshape((3, 3, 3)) + assert_equal( + repr(a), + textwrap.dedent("""\ + array([[[ 0, ..., 2], + ..., + [ 6, ..., 8]], + + ..., + + [[18, ..., 20], + ..., + [24, ..., 26]]])""") + ) + + b = np.zeros((3, 3, 1, 1)) + assert_equal( + repr(b), + textwrap.dedent("""\ + array([[[[0.]], + + ..., + + [[0.]]], + + + ..., + + + [[[0.]], + + ..., + + [[0.]]]])""") + ) + + # 1.13 had extra trailing spaces, and was missing newlines + np.set_printoptions(legacy='1.13') + + assert_equal( + repr(a), + textwrap.dedent("""\ + array([[[ 0, ..., 2], + ..., + [ 6, ..., 8]], + + ..., + [[18, ..., 20], + ..., + [24, ..., 26]]])""") + ) + + assert_equal( + repr(b), + textwrap.dedent("""\ + array([[[[ 0.]], + + ..., + [[ 0.]]], + + + ..., + [[[ 0.]], + + ..., + [[ 0.]]]])""") + ) + + def test_edgeitems_structured(self): + np.set_printoptions(edgeitems=1, threshold=1) + A = np.arange(5*2*3, dtype="f4')])"), + (np.void(b'a'), r"void(b'\x61')", r"np.void(b'\x61')"), + ]) +def test_scalar_repr_special(scalar, legacy_repr, representation): + # Test NEP 51 scalar repr (and legacy option) for numeric types + assert repr(scalar) == representation + + with np.printoptions(legacy="1.25"): + assert repr(scalar) == legacy_repr + +def test_scalar_void_float_str(): + # Note that based on this currently we do not print the same as a tuple + # would, since the tuple would include the repr() inside for floats, but + # we do not do that. + scalar = np.void((1.0, 2.0), dtype=[('f0', 'f4')]) + assert str(scalar) == "(1.0, 2.0)" + +@pytest.mark.skipif(IS_WASM, reason="wasm doesn't support asyncio") +@pytest.mark.skipif(sys.version_info < (3, 11), + reason="asyncio.barrier was added in Python 3.11") +def test_printoptions_asyncio_safe(): + asyncio = pytest.importorskip("asyncio") + + b = asyncio.Barrier(2) + + async def legacy_113(): + np.set_printoptions(legacy='1.13', precision=12) + await b.wait() + po = np.get_printoptions() + assert po['legacy'] == '1.13' + assert po['precision'] == 12 + orig_linewidth = po['linewidth'] + with np.printoptions(linewidth=34, legacy='1.21'): + po = np.get_printoptions() + assert po['legacy'] == '1.21' + assert po['precision'] == 12 + assert po['linewidth'] == 34 + po = np.get_printoptions() + assert po['linewidth'] == orig_linewidth + assert po['legacy'] == '1.13' + assert po['precision'] == 12 + + async def legacy_125(): + np.set_printoptions(legacy='1.25', precision=7) + await b.wait() + po = np.get_printoptions() + assert po['legacy'] == '1.25' + assert po['precision'] == 7 + orig_linewidth = po['linewidth'] + with np.printoptions(linewidth=6, legacy='1.13'): + po = np.get_printoptions() + assert po['legacy'] == '1.13' + assert po['precision'] == 7 + assert po['linewidth'] == 6 + po = np.get_printoptions() + assert po['linewidth'] == orig_linewidth + assert po['legacy'] == '1.25' + assert po['precision'] == 7 + + async def main(): + await asyncio.gather(legacy_125(), legacy_125()) + + loop = asyncio.new_event_loop() + asyncio.run(main()) + loop.close() + +@pytest.mark.skipif(IS_WASM, reason="wasm doesn't support threads") +def test_multithreaded_array_printing(): + # the dragon4 implementation uses a static scratch space for performance + # reasons this test makes sure it is set up in a thread-safe manner + + run_threaded(TestPrintOptions().test_floatmode, 500) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_casting_floatingpoint_errors.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_casting_floatingpoint_errors.py new file mode 100644 index 0000000000000000000000000000000000000000..d448b94d979812aaf2220b770d9e8c246b9d4c16 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_casting_floatingpoint_errors.py @@ -0,0 +1,154 @@ +import pytest +from pytest import param +from numpy.testing import IS_WASM +import numpy as np + + +def values_and_dtypes(): + """ + Generate value+dtype pairs that generate floating point errors during + casts. The invalid casts to integers will generate "invalid" value + warnings, the float casts all generate "overflow". + + (The Python int/float paths don't need to get tested in all the same + situations, but it does not hurt.) + """ + # Casting to float16: + yield param(70000, "float16", id="int-to-f2") + yield param("70000", "float16", id="str-to-f2") + yield param(70000.0, "float16", id="float-to-f2") + yield param(np.longdouble(70000.), "float16", id="longdouble-to-f2") + yield param(np.float64(70000.), "float16", id="double-to-f2") + yield param(np.float32(70000.), "float16", id="float-to-f2") + # Casting to float32: + yield param(10**100, "float32", id="int-to-f4") + yield param(1e100, "float32", id="float-to-f2") + yield param(np.longdouble(1e300), "float32", id="longdouble-to-f2") + yield param(np.float64(1e300), "float32", id="double-to-f2") + # Casting to float64: + # If longdouble is double-double, its max can be rounded down to the double + # max. So we correct the double spacing (a bit weird, admittedly): + max_ld = np.finfo(np.longdouble).max + spacing = np.spacing(np.nextafter(np.finfo("f8").max, 0)) + if max_ld - spacing > np.finfo("f8").max: + yield param(np.finfo(np.longdouble).max, "float64", + id="longdouble-to-f8") + + # Cast to complex32: + yield param(2e300, "complex64", id="float-to-c8") + yield param(2e300+0j, "complex64", id="complex-to-c8") + yield param(2e300j, "complex64", id="complex-to-c8") + yield param(np.longdouble(2e300), "complex64", id="longdouble-to-c8") + + # Invalid float to integer casts: + with np.errstate(over="ignore"): + for to_dt in np.typecodes["AllInteger"]: + for value in [np.inf, np.nan]: + for from_dt in np.typecodes["AllFloat"]: + from_dt = np.dtype(from_dt) + from_val = from_dt.type(value) + + yield param(from_val, to_dt, id=f"{from_val}-to-{to_dt}") + + +def check_operations(dtype, value): + """ + There are many dedicated paths in NumPy which cast and should check for + floating point errors which occurred during those casts. + """ + if dtype.kind != 'i': + # These assignments use the stricter setitem logic: + def assignment(): + arr = np.empty(3, dtype=dtype) + arr[0] = value + + yield assignment + + def fill(): + arr = np.empty(3, dtype=dtype) + arr.fill(value) + + yield fill + + def copyto_scalar(): + arr = np.empty(3, dtype=dtype) + np.copyto(arr, value, casting="unsafe") + + yield copyto_scalar + + def copyto(): + arr = np.empty(3, dtype=dtype) + np.copyto(arr, np.array([value, value, value]), casting="unsafe") + + yield copyto + + def copyto_scalar_masked(): + arr = np.empty(3, dtype=dtype) + np.copyto(arr, value, casting="unsafe", + where=[True, False, True]) + + yield copyto_scalar_masked + + def copyto_masked(): + arr = np.empty(3, dtype=dtype) + np.copyto(arr, np.array([value, value, value]), casting="unsafe", + where=[True, False, True]) + + yield copyto_masked + + def direct_cast(): + np.array([value, value, value]).astype(dtype) + + yield direct_cast + + def direct_cast_nd_strided(): + arr = np.full((5, 5, 5), fill_value=value)[:, ::2, :] + arr.astype(dtype) + + yield direct_cast_nd_strided + + def boolean_array_assignment(): + arr = np.empty(3, dtype=dtype) + arr[[True, False, True]] = np.array([value, value]) + + yield boolean_array_assignment + + def integer_array_assignment(): + arr = np.empty(3, dtype=dtype) + values = np.array([value, value]) + + arr[[0, 1]] = values + + yield integer_array_assignment + + def integer_array_assignment_with_subspace(): + arr = np.empty((5, 3), dtype=dtype) + values = np.array([value, value, value]) + + arr[[0, 2]] = values + + yield integer_array_assignment_with_subspace + + def flat_assignment(): + arr = np.empty((3,), dtype=dtype) + values = np.array([value, value, value]) + arr.flat[:] = values + + yield flat_assignment + +@pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support") +@pytest.mark.parametrize(["value", "dtype"], values_and_dtypes()) +@pytest.mark.filterwarnings("ignore::numpy.exceptions.ComplexWarning") +def test_floatingpoint_errors_casting(dtype, value): + dtype = np.dtype(dtype) + for operation in check_operations(dtype, value): + dtype = np.dtype(dtype) + + match = "invalid" if dtype.kind in 'iu' else "overflow" + with pytest.warns(RuntimeWarning, match=match): + operation() + + with np.errstate(all="raise"): + with pytest.raises(FloatingPointError, match=match): + operation() + diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_conversion_utils.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_conversion_utils.py new file mode 100644 index 0000000000000000000000000000000000000000..51676320fa0dafcbcf095d7cc02f20e91ac21e16 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_conversion_utils.py @@ -0,0 +1,209 @@ +""" +Tests for numpy/_core/src/multiarray/conversion_utils.c +""" +import re +import sys + +import pytest + +import numpy as np +import numpy._core._multiarray_tests as mt +from numpy._core.multiarray import CLIP, WRAP, RAISE +from numpy.testing import assert_warns, IS_PYPY + + +class StringConverterTestCase: + allow_bytes = True + case_insensitive = True + exact_match = False + warn = True + + def _check_value_error(self, val): + pattern = r'\(got {}\)'.format(re.escape(repr(val))) + with pytest.raises(ValueError, match=pattern) as exc: + self.conv(val) + + def _check_conv_assert_warn(self, val, expected): + if self.warn: + with assert_warns(DeprecationWarning) as exc: + assert self.conv(val) == expected + else: + assert self.conv(val) == expected + + def _check(self, val, expected): + """Takes valid non-deprecated inputs for converters, + runs converters on inputs, checks correctness of outputs, + warnings and errors""" + assert self.conv(val) == expected + + if self.allow_bytes: + assert self.conv(val.encode('ascii')) == expected + else: + with pytest.raises(TypeError): + self.conv(val.encode('ascii')) + + if len(val) != 1: + if self.exact_match: + self._check_value_error(val[:1]) + self._check_value_error(val + '\0') + else: + self._check_conv_assert_warn(val[:1], expected) + + if self.case_insensitive: + if val != val.lower(): + self._check_conv_assert_warn(val.lower(), expected) + if val != val.upper(): + self._check_conv_assert_warn(val.upper(), expected) + else: + if val != val.lower(): + self._check_value_error(val.lower()) + if val != val.upper(): + self._check_value_error(val.upper()) + + def test_wrong_type(self): + # common cases which apply to all the below + with pytest.raises(TypeError): + self.conv({}) + with pytest.raises(TypeError): + self.conv([]) + + def test_wrong_value(self): + # nonsense strings + self._check_value_error('') + self._check_value_error('\N{greek small letter pi}') + + if self.allow_bytes: + self._check_value_error(b'') + # bytes which can't be converted to strings via utf8 + self._check_value_error(b"\xFF") + if self.exact_match: + self._check_value_error("there's no way this is supported") + + +class TestByteorderConverter(StringConverterTestCase): + """ Tests of PyArray_ByteorderConverter """ + conv = mt.run_byteorder_converter + warn = False + + def test_valid(self): + for s in ['big', '>']: + self._check(s, 'NPY_BIG') + for s in ['little', '<']: + self._check(s, 'NPY_LITTLE') + for s in ['native', '=']: + self._check(s, 'NPY_NATIVE') + for s in ['ignore', '|']: + self._check(s, 'NPY_IGNORE') + for s in ['swap']: + self._check(s, 'NPY_SWAP') + + +class TestSortkindConverter(StringConverterTestCase): + """ Tests of PyArray_SortkindConverter """ + conv = mt.run_sortkind_converter + warn = False + + def test_valid(self): + self._check('quicksort', 'NPY_QUICKSORT') + self._check('heapsort', 'NPY_HEAPSORT') + self._check('mergesort', 'NPY_STABLESORT') # alias + self._check('stable', 'NPY_STABLESORT') + + +class TestSelectkindConverter(StringConverterTestCase): + """ Tests of PyArray_SelectkindConverter """ + conv = mt.run_selectkind_converter + case_insensitive = False + exact_match = True + + def test_valid(self): + self._check('introselect', 'NPY_INTROSELECT') + + +class TestSearchsideConverter(StringConverterTestCase): + """ Tests of PyArray_SearchsideConverter """ + conv = mt.run_searchside_converter + def test_valid(self): + self._check('left', 'NPY_SEARCHLEFT') + self._check('right', 'NPY_SEARCHRIGHT') + + +class TestOrderConverter(StringConverterTestCase): + """ Tests of PyArray_OrderConverter """ + conv = mt.run_order_converter + warn = False + + def test_valid(self): + self._check('c', 'NPY_CORDER') + self._check('f', 'NPY_FORTRANORDER') + self._check('a', 'NPY_ANYORDER') + self._check('k', 'NPY_KEEPORDER') + + def test_flatten_invalid_order(self): + # invalid after gh-14596 + with pytest.raises(ValueError): + self.conv('Z') + for order in [False, True, 0, 8]: + with pytest.raises(TypeError): + self.conv(order) + + +class TestClipmodeConverter(StringConverterTestCase): + """ Tests of PyArray_ClipmodeConverter """ + conv = mt.run_clipmode_converter + def test_valid(self): + self._check('clip', 'NPY_CLIP') + self._check('wrap', 'NPY_WRAP') + self._check('raise', 'NPY_RAISE') + + # integer values allowed here + assert self.conv(CLIP) == 'NPY_CLIP' + assert self.conv(WRAP) == 'NPY_WRAP' + assert self.conv(RAISE) == 'NPY_RAISE' + + +class TestCastingConverter(StringConverterTestCase): + """ Tests of PyArray_CastingConverter """ + conv = mt.run_casting_converter + case_insensitive = False + exact_match = True + + def test_valid(self): + self._check("no", "NPY_NO_CASTING") + self._check("equiv", "NPY_EQUIV_CASTING") + self._check("safe", "NPY_SAFE_CASTING") + self._check("same_kind", "NPY_SAME_KIND_CASTING") + self._check("unsafe", "NPY_UNSAFE_CASTING") + + +class TestIntpConverter: + """ Tests of PyArray_IntpConverter """ + conv = mt.run_intp_converter + + def test_basic(self): + assert self.conv(1) == (1,) + assert self.conv((1, 2)) == (1, 2) + assert self.conv([1, 2]) == (1, 2) + assert self.conv(()) == () + + def test_none(self): + # once the warning expires, this will raise TypeError + with pytest.warns(DeprecationWarning): + assert self.conv(None) == () + + @pytest.mark.skipif(IS_PYPY and sys.implementation.version <= (7, 3, 8), + reason="PyPy bug in error formatting") + def test_float(self): + with pytest.raises(TypeError): + self.conv(1.0) + with pytest.raises(TypeError): + self.conv([1, 1.0]) + + def test_too_large(self): + with pytest.raises(ValueError): + self.conv(2**64) + + def test_too_many_dims(self): + assert self.conv([1]*64) == (1,)*64 + with pytest.raises(ValueError): + self.conv([1]*65) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_custom_dtypes.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_custom_dtypes.py new file mode 100644 index 0000000000000000000000000000000000000000..e8acb450516be2c1090f292c5b371e081a0e8de6 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_custom_dtypes.py @@ -0,0 +1,312 @@ +import sys +from tempfile import NamedTemporaryFile + +import pytest + +import numpy as np +from numpy.testing import assert_array_equal +from numpy._core._multiarray_umath import ( + _discover_array_parameters as discover_array_params, _get_sfloat_dtype) + + +SF = _get_sfloat_dtype() + + +class TestSFloat: + def _get_array(self, scaling, aligned=True): + if not aligned: + a = np.empty(3*8 + 1, dtype=np.uint8)[1:] + a = a.view(np.float64) + a[:] = [1., 2., 3.] + else: + a = np.array([1., 2., 3.]) + + a *= 1./scaling # the casting code also uses the reciprocal. + return a.view(SF(scaling)) + + def test_sfloat_rescaled(self): + sf = SF(1.) + sf2 = sf.scaled_by(2.) + assert sf2.get_scaling() == 2. + sf6 = sf2.scaled_by(3.) + assert sf6.get_scaling() == 6. + + def test_class_discovery(self): + # This does not test much, since we always discover the scaling as 1. + # But most of NumPy (when writing) does not understand DType classes + dt, _ = discover_array_params([1., 2., 3.], dtype=SF) + assert dt == SF(1.) + + @pytest.mark.parametrize("scaling", [1., -1., 2.]) + def test_scaled_float_from_floats(self, scaling): + a = np.array([1., 2., 3.], dtype=SF(scaling)) + + assert a.dtype.get_scaling() == scaling + assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.]) + + def test_repr(self): + # Check the repr, mainly to cover the code paths: + assert repr(SF(scaling=1.)) == "_ScaledFloatTestDType(scaling=1.0)" + + def test_dtype_name(self): + assert SF(1.).name == "_ScaledFloatTestDType64" + + def test_sfloat_structured_dtype_printing(self): + dt = np.dtype([("id", int), ("value", SF(0.5))]) + # repr of structured dtypes need special handling because the + # implementation bypasses the object repr + assert "('value', '_ScaledFloatTestDType64')" in repr(dt) + + @pytest.mark.parametrize("scaling", [1., -1., 2.]) + def test_sfloat_from_float(self, scaling): + a = np.array([1., 2., 3.]).astype(dtype=SF(scaling)) + + assert a.dtype.get_scaling() == scaling + assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.]) + + @pytest.mark.parametrize("aligned", [True, False]) + @pytest.mark.parametrize("scaling", [1., -1., 2.]) + def test_sfloat_getitem(self, aligned, scaling): + a = self._get_array(1., aligned) + assert a.tolist() == [1., 2., 3.] + + @pytest.mark.parametrize("aligned", [True, False]) + def test_sfloat_casts(self, aligned): + a = self._get_array(1., aligned) + + assert np.can_cast(a, SF(-1.), casting="equiv") + assert not np.can_cast(a, SF(-1.), casting="no") + na = a.astype(SF(-1.)) + assert_array_equal(-1 * na.view(np.float64), a.view(np.float64)) + + assert np.can_cast(a, SF(2.), casting="same_kind") + assert not np.can_cast(a, SF(2.), casting="safe") + a2 = a.astype(SF(2.)) + assert_array_equal(2 * a2.view(np.float64), a.view(np.float64)) + + @pytest.mark.parametrize("aligned", [True, False]) + def test_sfloat_cast_internal_errors(self, aligned): + a = self._get_array(2e300, aligned) + + with pytest.raises(TypeError, + match="error raised inside the core-loop: non-finite factor!"): + a.astype(SF(2e-300)) + + def test_sfloat_promotion(self): + assert np.result_type(SF(2.), SF(3.)) == SF(3.) + assert np.result_type(SF(3.), SF(2.)) == SF(3.) + # Float64 -> SF(1.) and then promotes normally, so both of this work: + assert np.result_type(SF(3.), np.float64) == SF(3.) + assert np.result_type(np.float64, SF(0.5)) == SF(1.) + + # Test an undefined promotion: + with pytest.raises(TypeError): + np.result_type(SF(1.), np.int64) + + def test_basic_multiply(self): + a = self._get_array(2.) + b = self._get_array(4.) + + res = a * b + # multiplies dtype scaling and content separately: + assert res.dtype.get_scaling() == 8. + expected_view = a.view(np.float64) * b.view(np.float64) + assert_array_equal(res.view(np.float64), expected_view) + + def test_possible_and_impossible_reduce(self): + # For reductions to work, the first and last operand must have the + # same dtype. For this parametric DType that is not necessarily true. + a = self._get_array(2.) + # Addition reductin works (as of writing requires to pass initial + # because setting a scaled-float from the default `0` fails). + res = np.add.reduce(a, initial=0.) + assert res == a.astype(np.float64).sum() + + # But each multiplication changes the factor, so a reduction is not + # possible (the relaxed version of the old refusal to handle any + # flexible dtype). + with pytest.raises(TypeError, + match="the resolved dtypes are not compatible"): + np.multiply.reduce(a) + + def test_basic_ufunc_at(self): + float_a = np.array([1., 2., 3.]) + b = self._get_array(2.) + + float_b = b.view(np.float64).copy() + np.multiply.at(float_b, [1, 1, 1], float_a) + np.multiply.at(b, [1, 1, 1], float_a) + + assert_array_equal(b.view(np.float64), float_b) + + def test_basic_multiply_promotion(self): + float_a = np.array([1., 2., 3.]) + b = self._get_array(2.) + + res1 = float_a * b + res2 = b * float_a + + # one factor is one, so we get the factor of b: + assert res1.dtype == res2.dtype == b.dtype + expected_view = float_a * b.view(np.float64) + assert_array_equal(res1.view(np.float64), expected_view) + assert_array_equal(res2.view(np.float64), expected_view) + + # Check that promotion works when `out` is used: + np.multiply(b, float_a, out=res2) + with pytest.raises(TypeError): + # The promoter accepts this (maybe it should not), but the SFloat + # result cannot be cast to integer: + np.multiply(b, float_a, out=np.arange(3)) + + def test_basic_addition(self): + a = self._get_array(2.) + b = self._get_array(4.) + + res = a + b + # addition uses the type promotion rules for the result: + assert res.dtype == np.result_type(a.dtype, b.dtype) + expected_view = (a.astype(res.dtype).view(np.float64) + + b.astype(res.dtype).view(np.float64)) + assert_array_equal(res.view(np.float64), expected_view) + + def test_addition_cast_safety(self): + """The addition method is special for the scaled float, because it + includes the "cast" between different factors, thus cast-safety + is influenced by the implementation. + """ + a = self._get_array(2.) + b = self._get_array(-2.) + c = self._get_array(3.) + + # sign change is "equiv": + np.add(a, b, casting="equiv") + with pytest.raises(TypeError): + np.add(a, b, casting="no") + + # Different factor is "same_kind" (default) so check that "safe" fails + with pytest.raises(TypeError): + np.add(a, c, casting="safe") + + # Check that casting the output fails also (done by the ufunc here) + with pytest.raises(TypeError): + np.add(a, a, out=c, casting="safe") + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or, np.logical_xor]) + def test_logical_ufuncs_casts_to_bool(self, ufunc): + a = self._get_array(2.) + a[0] = 0. # make sure first element is considered False. + + float_equiv = a.astype(float) + expected = ufunc(float_equiv, float_equiv) + res = ufunc(a, a) + assert_array_equal(res, expected) + + # also check that the same works for reductions: + expected = ufunc.reduce(float_equiv) + res = ufunc.reduce(a) + assert_array_equal(res, expected) + + # The output casting does not match the bool, bool -> bool loop: + with pytest.raises(TypeError): + ufunc(a, a, out=np.empty(a.shape, dtype=int), casting="equiv") + + def test_wrapped_and_wrapped_reductions(self): + a = self._get_array(2.) + float_equiv = a.astype(float) + + expected = np.hypot(float_equiv, float_equiv) + res = np.hypot(a, a) + assert res.dtype == a.dtype + res_float = res.view(np.float64) * 2 + assert_array_equal(res_float, expected) + + # Also check reduction (keepdims, due to incorrect getitem) + res = np.hypot.reduce(a, keepdims=True) + assert res.dtype == a.dtype + expected = np.hypot.reduce(float_equiv, keepdims=True) + assert res.view(np.float64) * 2 == expected + + def test_astype_class(self): + # Very simple test that we accept `.astype()` also on the class. + # ScaledFloat always returns the default descriptor, but it does + # check the relevant code paths. + arr = np.array([1., 2., 3.], dtype=object) + + res = arr.astype(SF) # passing the class class + expected = arr.astype(SF(1.)) # above will have discovered 1. scaling + assert_array_equal(res.view(np.float64), expected.view(np.float64)) + + def test_creation_class(self): + # passing in a dtype class should return + # the default descriptor + arr1 = np.array([1., 2., 3.], dtype=SF) + assert arr1.dtype == SF(1.) + arr2 = np.array([1., 2., 3.], dtype=SF(1.)) + assert_array_equal(arr1.view(np.float64), arr2.view(np.float64)) + assert arr1.dtype == arr2.dtype + + assert np.empty(3, dtype=SF).dtype == SF(1.) + assert np.empty_like(arr1, dtype=SF).dtype == SF(1.) + assert np.zeros(3, dtype=SF).dtype == SF(1.) + assert np.zeros_like(arr1, dtype=SF).dtype == SF(1.) + + def test_np_save_load(self): + # this monkeypatch is needed because pickle + # uses the repr of a type to reconstruct it + np._ScaledFloatTestDType = SF + + arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0)) + + # adapted from RoundtripTest.roundtrip in np.save tests + with NamedTemporaryFile("wb", delete=False, suffix=".npz") as f: + with pytest.warns(UserWarning) as record: + np.savez(f.name, arr) + + assert len(record) == 1 + + with np.load(f.name, allow_pickle=True) as data: + larr = data["arr_0"] + assert_array_equal(arr.view(np.float64), larr.view(np.float64)) + assert larr.dtype == arr.dtype == SF(1.0) + + del np._ScaledFloatTestDType + + def test_flatiter(self): + arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0)) + + for i, val in enumerate(arr.flat): + assert arr[i] == val + + @pytest.mark.parametrize( + "index", [ + [1, 2], ..., slice(None, 2, None), + np.array([True, True, False]), np.array([0, 1]) + ], ids=["int_list", "ellipsis", "slice", "bool_array", "int_array"]) + def test_flatiter_index(self, index): + arr = np.array([1.0, 2.0, 3.0], dtype=SF(1.0)) + np.testing.assert_array_equal( + arr[index].view(np.float64), arr.flat[index].view(np.float64)) + + arr2 = arr.copy() + arr[index] = 5.0 + arr2.flat[index] = 5.0 + np.testing.assert_array_equal( + arr.view(np.float64), arr2.view(np.float64)) + +def test_type_pickle(): + # can't actually unpickle, but we can pickle (if in namespace) + import pickle + + np._ScaledFloatTestDType = SF + + s = pickle.dumps(SF) + res = pickle.loads(s) + assert res is SF + + del np._ScaledFloatTestDType + + +def test_is_numeric(): + assert SF._is_numeric diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_datetime.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_datetime.py new file mode 100644 index 0000000000000000000000000000000000000000..70a294796a0dc867fbd90a44ef08f48e7a255ce7 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_datetime.py @@ -0,0 +1,2596 @@ +import datetime +import pickle + +import pytest + +import numpy +import numpy as np +from numpy.testing import ( + IS_WASM, + assert_, assert_equal, assert_raises, assert_warns, suppress_warnings, + assert_raises_regex, assert_array_equal, + ) + +# Use pytz to test out various time zones if available +try: + from pytz import timezone as tz + _has_pytz = True +except ImportError: + _has_pytz = False + +try: + RecursionError +except NameError: + RecursionError = RuntimeError # python < 3.5 + + +class TestDateTime: + + def test_string(self): + msg = "no explicit representation of timezones available for " \ + "np.datetime64" + with pytest.warns(UserWarning, match=msg): + np.datetime64('2000-01-01T00+01') + + def test_datetime(self): + msg = "no explicit representation of timezones available for " \ + "np.datetime64" + with pytest.warns(UserWarning, match=msg): + t0 = np.datetime64('2023-06-09T12:18:40Z', 'ns') + + t0 = np.datetime64('2023-06-09T12:18:40', 'ns') + + def test_datetime_dtype_creation(self): + for unit in ['Y', 'M', 'W', 'D', + 'h', 'm', 's', 'ms', 'us', + 'μs', # alias for us + 'ns', 'ps', 'fs', 'as']: + dt1 = np.dtype('M8[750%s]' % unit) + assert_(dt1 == np.dtype('datetime64[750%s]' % unit)) + dt2 = np.dtype('m8[%s]' % unit) + assert_(dt2 == np.dtype('timedelta64[%s]' % unit)) + + # Generic units shouldn't add [] to the end + assert_equal(str(np.dtype("M8")), "datetime64") + + # Should be possible to specify the endianness + assert_equal(np.dtype("=M8"), np.dtype("M8")) + assert_equal(np.dtype("=M8[s]"), np.dtype("M8[s]")) + assert_(np.dtype(">M8") == np.dtype("M8") or + np.dtype("M8[D]") == np.dtype("M8[D]") or + np.dtype("M8") != np.dtype("m8") == np.dtype("m8") or + np.dtype("m8[D]") == np.dtype("m8[D]") or + np.dtype("m8") != np.dtype(" Scalars + assert_equal(np.datetime64(b, '[s]'), np.datetime64('NaT', '[s]')) + assert_equal(np.datetime64(b, '[ms]'), np.datetime64('NaT', '[ms]')) + assert_equal(np.datetime64(b, '[M]'), np.datetime64('NaT', '[M]')) + assert_equal(np.datetime64(b, '[Y]'), np.datetime64('NaT', '[Y]')) + assert_equal(np.datetime64(b, '[W]'), np.datetime64('NaT', '[W]')) + + # Arrays -> Scalars + assert_equal(np.datetime64(a, '[s]'), np.datetime64('NaT', '[s]')) + assert_equal(np.datetime64(a, '[ms]'), np.datetime64('NaT', '[ms]')) + assert_equal(np.datetime64(a, '[M]'), np.datetime64('NaT', '[M]')) + assert_equal(np.datetime64(a, '[Y]'), np.datetime64('NaT', '[Y]')) + assert_equal(np.datetime64(a, '[W]'), np.datetime64('NaT', '[W]')) + + # NaN -> NaT + nan = np.array([np.nan] * 8 + [0]) + fnan = nan.astype('f') + lnan = nan.astype('g') + cnan = nan.astype('D') + cfnan = nan.astype('F') + clnan = nan.astype('G') + hnan = nan.astype(np.half) + + nat = np.array([np.datetime64('NaT')] * 8 + [np.datetime64(0, 'D')]) + assert_equal(nan.astype('M8[ns]'), nat) + assert_equal(fnan.astype('M8[ns]'), nat) + assert_equal(lnan.astype('M8[ns]'), nat) + assert_equal(cnan.astype('M8[ns]'), nat) + assert_equal(cfnan.astype('M8[ns]'), nat) + assert_equal(clnan.astype('M8[ns]'), nat) + assert_equal(hnan.astype('M8[ns]'), nat) + + nat = np.array([np.timedelta64('NaT')] * 8 + [np.timedelta64(0)]) + assert_equal(nan.astype('timedelta64[ns]'), nat) + assert_equal(fnan.astype('timedelta64[ns]'), nat) + assert_equal(lnan.astype('timedelta64[ns]'), nat) + assert_equal(cnan.astype('timedelta64[ns]'), nat) + assert_equal(cfnan.astype('timedelta64[ns]'), nat) + assert_equal(clnan.astype('timedelta64[ns]'), nat) + assert_equal(hnan.astype('timedelta64[ns]'), nat) + + def test_days_creation(self): + assert_equal(np.array('1599', dtype='M8[D]').astype('i8'), + (1600-1970)*365 - (1972-1600)/4 + 3 - 365) + assert_equal(np.array('1600', dtype='M8[D]').astype('i8'), + (1600-1970)*365 - (1972-1600)/4 + 3) + assert_equal(np.array('1601', dtype='M8[D]').astype('i8'), + (1600-1970)*365 - (1972-1600)/4 + 3 + 366) + assert_equal(np.array('1900', dtype='M8[D]').astype('i8'), + (1900-1970)*365 - (1970-1900)//4) + assert_equal(np.array('1901', dtype='M8[D]').astype('i8'), + (1900-1970)*365 - (1970-1900)//4 + 365) + assert_equal(np.array('1967', dtype='M8[D]').astype('i8'), -3*365 - 1) + assert_equal(np.array('1968', dtype='M8[D]').astype('i8'), -2*365 - 1) + assert_equal(np.array('1969', dtype='M8[D]').astype('i8'), -1*365) + assert_equal(np.array('1970', dtype='M8[D]').astype('i8'), 0*365) + assert_equal(np.array('1971', dtype='M8[D]').astype('i8'), 1*365) + assert_equal(np.array('1972', dtype='M8[D]').astype('i8'), 2*365) + assert_equal(np.array('1973', dtype='M8[D]').astype('i8'), 3*365 + 1) + assert_equal(np.array('1974', dtype='M8[D]').astype('i8'), 4*365 + 1) + assert_equal(np.array('2000', dtype='M8[D]').astype('i8'), + (2000 - 1970)*365 + (2000 - 1972)//4) + assert_equal(np.array('2001', dtype='M8[D]').astype('i8'), + (2000 - 1970)*365 + (2000 - 1972)//4 + 366) + assert_equal(np.array('2400', dtype='M8[D]').astype('i8'), + (2400 - 1970)*365 + (2400 - 1972)//4 - 3) + assert_equal(np.array('2401', dtype='M8[D]').astype('i8'), + (2400 - 1970)*365 + (2400 - 1972)//4 - 3 + 366) + + assert_equal(np.array('1600-02-29', dtype='M8[D]').astype('i8'), + (1600-1970)*365 - (1972-1600)//4 + 3 + 31 + 28) + assert_equal(np.array('1600-03-01', dtype='M8[D]').astype('i8'), + (1600-1970)*365 - (1972-1600)//4 + 3 + 31 + 29) + assert_equal(np.array('2000-02-29', dtype='M8[D]').astype('i8'), + (2000 - 1970)*365 + (2000 - 1972)//4 + 31 + 28) + assert_equal(np.array('2000-03-01', dtype='M8[D]').astype('i8'), + (2000 - 1970)*365 + (2000 - 1972)//4 + 31 + 29) + assert_equal(np.array('2001-03-22', dtype='M8[D]').astype('i8'), + (2000 - 1970)*365 + (2000 - 1972)//4 + 366 + 31 + 28 + 21) + + def test_days_to_pydate(self): + assert_equal(np.array('1599', dtype='M8[D]').astype('O'), + datetime.date(1599, 1, 1)) + assert_equal(np.array('1600', dtype='M8[D]').astype('O'), + datetime.date(1600, 1, 1)) + assert_equal(np.array('1601', dtype='M8[D]').astype('O'), + datetime.date(1601, 1, 1)) + assert_equal(np.array('1900', dtype='M8[D]').astype('O'), + datetime.date(1900, 1, 1)) + assert_equal(np.array('1901', dtype='M8[D]').astype('O'), + datetime.date(1901, 1, 1)) + assert_equal(np.array('2000', dtype='M8[D]').astype('O'), + datetime.date(2000, 1, 1)) + assert_equal(np.array('2001', dtype='M8[D]').astype('O'), + datetime.date(2001, 1, 1)) + assert_equal(np.array('1600-02-29', dtype='M8[D]').astype('O'), + datetime.date(1600, 2, 29)) + assert_equal(np.array('1600-03-01', dtype='M8[D]').astype('O'), + datetime.date(1600, 3, 1)) + assert_equal(np.array('2001-03-22', dtype='M8[D]').astype('O'), + datetime.date(2001, 3, 22)) + + def test_dtype_comparison(self): + assert_(not (np.dtype('M8[us]') == np.dtype('M8[ms]'))) + assert_(np.dtype('M8[us]') != np.dtype('M8[ms]')) + assert_(np.dtype('M8[2D]') != np.dtype('M8[D]')) + assert_(np.dtype('M8[D]') != np.dtype('M8[2D]')) + + def test_pydatetime_creation(self): + a = np.array(['1960-03-12', datetime.date(1960, 3, 12)], dtype='M8[D]') + assert_equal(a[0], a[1]) + a = np.array(['1999-12-31', datetime.date(1999, 12, 31)], dtype='M8[D]') + assert_equal(a[0], a[1]) + a = np.array(['2000-01-01', datetime.date(2000, 1, 1)], dtype='M8[D]') + assert_equal(a[0], a[1]) + # Will fail if the date changes during the exact right moment + a = np.array(['today', datetime.date.today()], dtype='M8[D]') + assert_equal(a[0], a[1]) + # datetime.datetime.now() returns local time, not UTC + #a = np.array(['now', datetime.datetime.now()], dtype='M8[s]') + #assert_equal(a[0], a[1]) + + # we can give a datetime.date time units + assert_equal(np.array(datetime.date(1960, 3, 12), dtype='M8[s]'), + np.array(np.datetime64('1960-03-12T00:00:00'))) + + def test_datetime_string_conversion(self): + a = ['2011-03-16', '1920-01-01', '2013-05-19'] + str_a = np.array(a, dtype='S') + uni_a = np.array(a, dtype='U') + dt_a = np.array(a, dtype='M') + + # String to datetime + assert_equal(dt_a, str_a.astype('M')) + assert_equal(dt_a.dtype, str_a.astype('M').dtype) + dt_b = np.empty_like(dt_a) + dt_b[...] = str_a + assert_equal(dt_a, dt_b) + + # Datetime to string + assert_equal(str_a, dt_a.astype('S0')) + str_b = np.empty_like(str_a) + str_b[...] = dt_a + assert_equal(str_a, str_b) + + # Unicode to datetime + assert_equal(dt_a, uni_a.astype('M')) + assert_equal(dt_a.dtype, uni_a.astype('M').dtype) + dt_b = np.empty_like(dt_a) + dt_b[...] = uni_a + assert_equal(dt_a, dt_b) + + # Datetime to unicode + assert_equal(uni_a, dt_a.astype('U')) + uni_b = np.empty_like(uni_a) + uni_b[...] = dt_a + assert_equal(uni_a, uni_b) + + # Datetime to long string - gh-9712 + assert_equal(str_a, dt_a.astype((np.bytes_, 128))) + str_b = np.empty(str_a.shape, dtype=(np.bytes_, 128)) + str_b[...] = dt_a + assert_equal(str_a, str_b) + + @pytest.mark.parametrize("time_dtype", ["m8[D]", "M8[Y]"]) + def test_time_byteswapping(self, time_dtype): + times = np.array(["2017", "NaT"], dtype=time_dtype) + times_swapped = times.astype(times.dtype.newbyteorder()) + assert_array_equal(times, times_swapped) + + unswapped = times_swapped.view(np.dtype("int64").newbyteorder()) + assert_array_equal(unswapped, times.view(np.int64)) + + @pytest.mark.parametrize(["time1", "time2"], + [("M8[s]", "M8[D]"), ("m8[s]", "m8[ns]")]) + def test_time_byteswapped_cast(self, time1, time2): + dtype1 = np.dtype(time1) + dtype2 = np.dtype(time2) + times = np.array(["2017", "NaT"], dtype=dtype1) + expected = times.astype(dtype2) + + # Test that every byte-swapping combination also returns the same + # results (previous tests check that this comparison works fine). + res = times.astype(dtype1.newbyteorder()).astype(dtype2) + assert_array_equal(res, expected) + res = times.astype(dtype2.newbyteorder()) + assert_array_equal(res, expected) + res = times.astype(dtype1.newbyteorder()).astype(dtype2.newbyteorder()) + assert_array_equal(res, expected) + + @pytest.mark.parametrize("time_dtype", ["m8[D]", "M8[Y]"]) + @pytest.mark.parametrize("str_dtype", ["U", "S"]) + def test_datetime_conversions_byteorders(self, str_dtype, time_dtype): + times = np.array(["2017", "NaT"], dtype=time_dtype) + # Unfortunately, timedelta does not roundtrip: + from_strings = np.array(["2017", "NaT"], dtype=str_dtype) + to_strings = times.astype(str_dtype) # assume this is correct + + # Check that conversion from times to string works if src is swapped: + times_swapped = times.astype(times.dtype.newbyteorder()) + res = times_swapped.astype(str_dtype) + assert_array_equal(res, to_strings) + # And also if both are swapped: + res = times_swapped.astype(to_strings.dtype.newbyteorder()) + assert_array_equal(res, to_strings) + # only destination is swapped: + res = times.astype(to_strings.dtype.newbyteorder()) + assert_array_equal(res, to_strings) + + # Check that conversion from string to times works if src is swapped: + from_strings_swapped = from_strings.astype( + from_strings.dtype.newbyteorder()) + res = from_strings_swapped.astype(time_dtype) + assert_array_equal(res, times) + # And if both are swapped: + res = from_strings_swapped.astype(times.dtype.newbyteorder()) + assert_array_equal(res, times) + # Only destination is swapped: + res = from_strings.astype(times.dtype.newbyteorder()) + assert_array_equal(res, times) + + def test_datetime_array_str(self): + a = np.array(['2011-03-16', '1920-01-01', '2013-05-19'], dtype='M') + assert_equal(str(a), "['2011-03-16' '1920-01-01' '2013-05-19']") + + a = np.array(['2011-03-16T13:55', '1920-01-01T03:12'], dtype='M') + assert_equal(np.array2string(a, separator=', ', + formatter={'datetime': lambda x: + "'%s'" % np.datetime_as_string(x, timezone='UTC')}), + "['2011-03-16T13:55Z', '1920-01-01T03:12Z']") + + # Check that one NaT doesn't corrupt subsequent entries + a = np.array(['2010', 'NaT', '2030']).astype('M') + assert_equal(str(a), "['2010' 'NaT' '2030']") + + def test_timedelta_array_str(self): + a = np.array([-1, 0, 100], dtype='m') + assert_equal(str(a), "[ -1 0 100]") + a = np.array(['NaT', 'NaT'], dtype='m') + assert_equal(str(a), "['NaT' 'NaT']") + # Check right-alignment with NaTs + a = np.array([-1, 'NaT', 0], dtype='m') + assert_equal(str(a), "[ -1 'NaT' 0]") + a = np.array([-1, 'NaT', 1234567], dtype='m') + assert_equal(str(a), "[ -1 'NaT' 1234567]") + + # Test with other byteorder: + a = np.array([-1, 'NaT', 1234567], dtype='>m') + assert_equal(str(a), "[ -1 'NaT' 1234567]") + a = np.array([-1, 'NaT', 1234567], dtype=''\np4\nNNNI-1\nI-1\nI0\n((dp5\n(S'us'\np6\n" + \ + b"I1\nI1\nI1\ntp7\ntp8\ntp9\nb." + assert_equal(pickle.loads(pkl), np.dtype('>M8[us]')) + + def test_setstate(self): + "Verify that datetime dtype __setstate__ can handle bad arguments" + dt = np.dtype('>M8[us]') + assert_raises(ValueError, dt.__setstate__, (4, '>', None, None, None, -1, -1, 0, 1)) + assert_(dt.__reduce__()[2] == np.dtype('>M8[us]').__reduce__()[2]) + assert_raises(TypeError, dt.__setstate__, (4, '>', None, None, None, -1, -1, 0, ({}, 'xxx'))) + assert_(dt.__reduce__()[2] == np.dtype('>M8[us]').__reduce__()[2]) + + def test_dtype_promotion(self): + # datetime datetime computes the metadata gcd + # timedelta timedelta computes the metadata gcd + for mM in ['m', 'M']: + assert_equal( + np.promote_types(np.dtype(mM+'8[2Y]'), np.dtype(mM+'8[2Y]')), + np.dtype(mM+'8[2Y]')) + assert_equal( + np.promote_types(np.dtype(mM+'8[12Y]'), np.dtype(mM+'8[15Y]')), + np.dtype(mM+'8[3Y]')) + assert_equal( + np.promote_types(np.dtype(mM+'8[62M]'), np.dtype(mM+'8[24M]')), + np.dtype(mM+'8[2M]')) + assert_equal( + np.promote_types(np.dtype(mM+'8[1W]'), np.dtype(mM+'8[2D]')), + np.dtype(mM+'8[1D]')) + assert_equal( + np.promote_types(np.dtype(mM+'8[W]'), np.dtype(mM+'8[13s]')), + np.dtype(mM+'8[s]')) + assert_equal( + np.promote_types(np.dtype(mM+'8[13W]'), np.dtype(mM+'8[49s]')), + np.dtype(mM+'8[7s]')) + # timedelta timedelta raises when there is no reasonable gcd + assert_raises(TypeError, np.promote_types, + np.dtype('m8[Y]'), np.dtype('m8[D]')) + assert_raises(TypeError, np.promote_types, + np.dtype('m8[M]'), np.dtype('m8[W]')) + # timedelta and float cannot be safely cast with each other + assert_raises(TypeError, np.promote_types, "float32", "m8") + assert_raises(TypeError, np.promote_types, "m8", "float32") + assert_raises(TypeError, np.promote_types, "uint64", "m8") + assert_raises(TypeError, np.promote_types, "m8", "uint64") + + # timedelta timedelta may overflow with big unit ranges + assert_raises(OverflowError, np.promote_types, + np.dtype('m8[W]'), np.dtype('m8[fs]')) + assert_raises(OverflowError, np.promote_types, + np.dtype('m8[s]'), np.dtype('m8[as]')) + + def test_cast_overflow(self): + # gh-4486 + def cast(): + numpy.datetime64("1971-01-01 00:00:00.000000000000000").astype("datetime64[%s]', + 'timedelta64[%s]']) + def test_isfinite_isinf_isnan_units(self, unit, dstr): + '''check isfinite, isinf, isnan for all units of M, m dtypes + ''' + arr_val = [123, -321, "NaT"] + arr = np.array(arr_val, dtype= dstr % unit) + pos = np.array([True, True, False]) + neg = np.array([False, False, True]) + false = np.array([False, False, False]) + assert_equal(np.isfinite(arr), pos) + assert_equal(np.isinf(arr), false) + assert_equal(np.isnan(arr), neg) + + def test_assert_equal(self): + assert_raises(AssertionError, assert_equal, + np.datetime64('nat'), np.timedelta64('nat')) + + def test_corecursive_input(self): + # construct a co-recursive list + a, b = [], [] + a.append(b) + b.append(a) + obj_arr = np.array([None]) + obj_arr[0] = a + + # At some point this caused a stack overflow (gh-11154). Now raises + # ValueError since the nested list cannot be converted to a datetime. + assert_raises(ValueError, obj_arr.astype, 'M8') + assert_raises(ValueError, obj_arr.astype, 'm8') + + @pytest.mark.parametrize("shape", [(), (1,)]) + def test_discovery_from_object_array(self, shape): + arr = np.array("2020-10-10", dtype=object).reshape(shape) + res = np.array("2020-10-10", dtype="M8").reshape(shape) + assert res.dtype == np.dtype("M8[D]") + assert_equal(arr.astype("M8"), res) + arr[...] = np.bytes_("2020-10-10") # try a numpy string type + assert_equal(arr.astype("M8"), res) + arr = arr.astype("S") + assert_equal(arr.astype("S").astype("M8"), res) + + @pytest.mark.parametrize("time_unit", [ + "Y", "M", "W", "D", "h", "m", "s", "ms", "us", "ns", "ps", "fs", "as", + # compound units + "10D", "2M", + ]) + def test_limit_symmetry(self, time_unit): + """ + Dates should have symmetric limits around the unix epoch at +/-np.int64 + """ + epoch = np.datetime64(0, time_unit) + latest = np.datetime64(np.iinfo(np.int64).max, time_unit) + earliest = np.datetime64(-np.iinfo(np.int64).max, time_unit) + + # above should not have overflowed + assert earliest < epoch < latest + + @pytest.mark.parametrize("time_unit", [ + "Y", "M", + pytest.param("W", marks=pytest.mark.xfail(reason="gh-13197")), + "D", "h", "m", + "s", "ms", "us", "ns", "ps", "fs", "as", + pytest.param("10D", marks=pytest.mark.xfail(reason="similar to gh-13197")), + ]) + @pytest.mark.parametrize("sign", [-1, 1]) + def test_limit_str_roundtrip(self, time_unit, sign): + """ + Limits should roundtrip when converted to strings. + + This tests the conversion to and from npy_datetimestruct. + """ + # TODO: add absolute (gold standard) time span limit strings + limit = np.datetime64(np.iinfo(np.int64).max * sign, time_unit) + + # Convert to string and back. Explicit unit needed since the day and + # week reprs are not distinguishable. + limit_via_str = np.datetime64(str(limit), time_unit) + assert limit_via_str == limit + + +class TestDateTimeData: + + def test_basic(self): + a = np.array(['1980-03-23'], dtype=np.datetime64) + assert_equal(np.datetime_data(a.dtype), ('D', 1)) + + def test_bytes(self): + # byte units are converted to unicode + dt = np.datetime64('2000', (b'ms', 5)) + assert np.datetime_data(dt.dtype) == ('ms', 5) + + dt = np.datetime64('2000', b'5ms') + assert np.datetime_data(dt.dtype) == ('ms', 5) + + def test_non_ascii(self): + # μs is normalized to μ + dt = np.datetime64('2000', ('μs', 5)) + assert np.datetime_data(dt.dtype) == ('us', 5) + + dt = np.datetime64('2000', '5μs') + assert np.datetime_data(dt.dtype) == ('us', 5) + + +def test_comparisons_return_not_implemented(): + # GH#17017 + + class custom: + __array_priority__ = 10000 + + obj = custom() + + dt = np.datetime64('2000', 'ns') + td = dt - dt + + for item in [dt, td]: + assert item.__eq__(obj) is NotImplemented + assert item.__ne__(obj) is NotImplemented + assert item.__le__(obj) is NotImplemented + assert item.__lt__(obj) is NotImplemented + assert item.__ge__(obj) is NotImplemented + assert item.__gt__(obj) is NotImplemented diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_dlpack.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_dlpack.py new file mode 100644 index 0000000000000000000000000000000000000000..d9205912124ec848ab8b4c1a6ee8ab22006ac7b9 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_dlpack.py @@ -0,0 +1,178 @@ +import sys +import pytest + +import numpy as np +from numpy.testing import assert_array_equal, IS_PYPY + + +def new_and_old_dlpack(): + yield np.arange(5) + + class OldDLPack(np.ndarray): + # Support only the "old" version + def __dlpack__(self, stream=None): + return super().__dlpack__(stream=None) + + yield np.arange(5).view(OldDLPack) + + +class TestDLPack: + @pytest.mark.skipif(IS_PYPY, reason="PyPy can't get refcounts.") + @pytest.mark.parametrize("max_version", [(0, 0), None, (1, 0), (100, 3)]) + def test_dunder_dlpack_refcount(self, max_version): + x = np.arange(5) + y = x.__dlpack__(max_version=max_version) + assert sys.getrefcount(x) == 3 + del y + assert sys.getrefcount(x) == 2 + + def test_dunder_dlpack_stream(self): + x = np.arange(5) + x.__dlpack__(stream=None) + + with pytest.raises(RuntimeError): + x.__dlpack__(stream=1) + + def test_dunder_dlpack_copy(self): + # Checks the argument parsing of __dlpack__ explicitly. + # Honoring the flag is tested in the from_dlpack round-tripping test. + x = np.arange(5) + x.__dlpack__(copy=True) + x.__dlpack__(copy=None) + x.__dlpack__(copy=False) + + with pytest.raises(ValueError): + # NOTE: The copy converter should be stricter, but not just here. + x.__dlpack__(copy=np.array([1, 2, 3])) + + def test_strides_not_multiple_of_itemsize(self): + dt = np.dtype([('int', np.int32), ('char', np.int8)]) + y = np.zeros((5,), dtype=dt) + z = y['int'] + + with pytest.raises(BufferError): + np.from_dlpack(z) + + @pytest.mark.skipif(IS_PYPY, reason="PyPy can't get refcounts.") + @pytest.mark.parametrize("arr", new_and_old_dlpack()) + def test_from_dlpack_refcount(self, arr): + arr = arr.copy() + y = np.from_dlpack(arr) + assert sys.getrefcount(arr) == 3 + del y + assert sys.getrefcount(arr) == 2 + + @pytest.mark.parametrize("dtype", [ + np.bool, + np.int8, np.int16, np.int32, np.int64, + np.uint8, np.uint16, np.uint32, np.uint64, + np.float16, np.float32, np.float64, + np.complex64, np.complex128 + ]) + @pytest.mark.parametrize("arr", new_and_old_dlpack()) + def test_dtype_passthrough(self, arr, dtype): + x = arr.astype(dtype) + y = np.from_dlpack(x) + + assert y.dtype == x.dtype + assert_array_equal(x, y) + + def test_invalid_dtype(self): + x = np.asarray(np.datetime64('2021-05-27')) + + with pytest.raises(BufferError): + np.from_dlpack(x) + + def test_invalid_byte_swapping(self): + dt = np.dtype('=i8').newbyteorder() + x = np.arange(5, dtype=dt) + + with pytest.raises(BufferError): + np.from_dlpack(x) + + def test_non_contiguous(self): + x = np.arange(25).reshape((5, 5)) + + y1 = x[0] + assert_array_equal(y1, np.from_dlpack(y1)) + + y2 = x[:, 0] + assert_array_equal(y2, np.from_dlpack(y2)) + + y3 = x[1, :] + assert_array_equal(y3, np.from_dlpack(y3)) + + y4 = x[1] + assert_array_equal(y4, np.from_dlpack(y4)) + + y5 = np.diagonal(x).copy() + assert_array_equal(y5, np.from_dlpack(y5)) + + @pytest.mark.parametrize("ndim", range(33)) + def test_higher_dims(self, ndim): + shape = (1,) * ndim + x = np.zeros(shape, dtype=np.float64) + + assert shape == np.from_dlpack(x).shape + + def test_dlpack_device(self): + x = np.arange(5) + assert x.__dlpack_device__() == (1, 0) + y = np.from_dlpack(x) + assert y.__dlpack_device__() == (1, 0) + z = y[::2] + assert z.__dlpack_device__() == (1, 0) + + def dlpack_deleter_exception(self, max_version): + x = np.arange(5) + _ = x.__dlpack__(max_version=max_version) + raise RuntimeError + + @pytest.mark.parametrize("max_version", [None, (1, 0)]) + def test_dlpack_destructor_exception(self, max_version): + with pytest.raises(RuntimeError): + self.dlpack_deleter_exception(max_version=max_version) + + def test_readonly(self): + x = np.arange(5) + x.flags.writeable = False + # Raises without max_version + with pytest.raises(BufferError): + x.__dlpack__() + + # But works fine if we try with version + y = np.from_dlpack(x) + assert not y.flags.writeable + + def test_ndim0(self): + x = np.array(1.0) + y = np.from_dlpack(x) + assert_array_equal(x, y) + + def test_size1dims_arrays(self): + x = np.ndarray(dtype='f8', shape=(10, 5, 1), strides=(8, 80, 4), + buffer=np.ones(1000, dtype=np.uint8), order='F') + y = np.from_dlpack(x) + assert_array_equal(x, y) + + def test_copy(self): + x = np.arange(5) + + y = np.from_dlpack(x) + assert np.may_share_memory(x, y) + y = np.from_dlpack(x, copy=False) + assert np.may_share_memory(x, y) + y = np.from_dlpack(x, copy=True) + assert not np.may_share_memory(x, y) + + def test_device(self): + x = np.arange(5) + # requesting (1, 0), i.e. CPU device works in both calls: + x.__dlpack__(dl_device=(1, 0)) + np.from_dlpack(x, device="cpu") + np.from_dlpack(x, device=None) + + with pytest.raises(ValueError): + x.__dlpack__(dl_device=(10, 0)) + with pytest.raises(ValueError): + np.from_dlpack(x, device="gpu") diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_errstate.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_errstate.py new file mode 100644 index 0000000000000000000000000000000000000000..bd6b8b8caec3bc004d7482a9cd63150709c048be --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_errstate.py @@ -0,0 +1,129 @@ +import pytest +import sysconfig + +import numpy as np +from numpy.testing import assert_, assert_raises, IS_WASM + +# The floating point emulation on ARM EABI systems lacking a hardware FPU is +# known to be buggy. This is an attempt to identify these hosts. It may not +# catch all possible cases, but it catches the known cases of gh-413 and +# gh-15562. +hosttype = sysconfig.get_config_var('HOST_GNU_TYPE') +arm_softfloat = False if hosttype is None else hosttype.endswith('gnueabi') + +class TestErrstate: + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.skipif(arm_softfloat, + reason='platform/cpu issue with FPU (gh-413,-15562)') + def test_invalid(self): + with np.errstate(all='raise', under='ignore'): + a = -np.arange(3) + # This should work + with np.errstate(invalid='ignore'): + np.sqrt(a) + # While this should fail! + with assert_raises(FloatingPointError): + np.sqrt(a) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.skipif(arm_softfloat, + reason='platform/cpu issue with FPU (gh-15562)') + def test_divide(self): + with np.errstate(all='raise', under='ignore'): + a = -np.arange(3) + # This should work + with np.errstate(divide='ignore'): + a // 0 + # While this should fail! + with assert_raises(FloatingPointError): + a // 0 + # As should this, see gh-15562 + with assert_raises(FloatingPointError): + a // a + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.skipif(arm_softfloat, + reason='platform/cpu issue with FPU (gh-15562)') + def test_errcall(self): + count = 0 + def foo(*args): + nonlocal count + count += 1 + + olderrcall = np.geterrcall() + with np.errstate(call=foo): + assert np.geterrcall() is foo + with np.errstate(call=None): + assert np.geterrcall() is None + assert np.geterrcall() is olderrcall + assert count == 0 + + with np.errstate(call=foo, invalid="call"): + np.array(np.inf) - np.array(np.inf) + + assert count == 1 + + def test_errstate_decorator(self): + @np.errstate(all='ignore') + def foo(): + a = -np.arange(3) + a // 0 + + foo() + + def test_errstate_enter_once(self): + errstate = np.errstate(invalid="warn") + with errstate: + pass + + # The errstate context cannot be entered twice as that would not be + # thread-safe + with pytest.raises(TypeError, + match="Cannot enter `np.errstate` twice"): + with errstate: + pass + + @pytest.mark.skipif(IS_WASM, reason="wasm doesn't support asyncio") + def test_asyncio_safe(self): + # asyncio may not always work, lets assume its fine if missing + # Pyodide/wasm doesn't support it. If this test makes problems, + # it should just be skipped liberally (or run differently). + asyncio = pytest.importorskip("asyncio") + + @np.errstate(invalid="ignore") + def decorated(): + # Decorated non-async function (it is not safe to decorate an + # async one) + assert np.geterr()["invalid"] == "ignore" + + async def func1(): + decorated() + await asyncio.sleep(0.1) + decorated() + + async def func2(): + with np.errstate(invalid="raise"): + assert np.geterr()["invalid"] == "raise" + await asyncio.sleep(0.125) + assert np.geterr()["invalid"] == "raise" + + # for good sport, a third one with yet another state: + async def func3(): + with np.errstate(invalid="print"): + assert np.geterr()["invalid"] == "print" + await asyncio.sleep(0.11) + assert np.geterr()["invalid"] == "print" + + async def main(): + # simply run all three function multiple times: + await asyncio.gather( + func1(), func2(), func3(), func1(), func2(), func3(), + func1(), func2(), func3(), func1(), func2(), func3()) + + loop = asyncio.new_event_loop() + with np.errstate(invalid="warn"): + asyncio.run(main()) + assert np.geterr()["invalid"] == "warn" + + assert np.geterr()["invalid"] == "warn" # the default + loop.close() diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_extint128.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_extint128.py new file mode 100644 index 0000000000000000000000000000000000000000..bd97cc20c016ff912a80f6b2f0f79037061d9dcb --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_extint128.py @@ -0,0 +1,219 @@ +import itertools +import contextlib +import operator +import pytest + +import numpy as np +import numpy._core._multiarray_tests as mt + +from numpy.testing import assert_raises, assert_equal + + +INT64_MAX = np.iinfo(np.int64).max +INT64_MIN = np.iinfo(np.int64).min +INT64_MID = 2**32 + +# int128 is not two's complement, the sign bit is separate +INT128_MAX = 2**128 - 1 +INT128_MIN = -INT128_MAX +INT128_MID = 2**64 + +INT64_VALUES = ( + [INT64_MIN + j for j in range(20)] + + [INT64_MAX - j for j in range(20)] + + [INT64_MID + j for j in range(-20, 20)] + + [2*INT64_MID + j for j in range(-20, 20)] + + [INT64_MID//2 + j for j in range(-20, 20)] + + list(range(-70, 70)) +) + +INT128_VALUES = ( + [INT128_MIN + j for j in range(20)] + + [INT128_MAX - j for j in range(20)] + + [INT128_MID + j for j in range(-20, 20)] + + [2*INT128_MID + j for j in range(-20, 20)] + + [INT128_MID//2 + j for j in range(-20, 20)] + + list(range(-70, 70)) + + [False] # negative zero +) + +INT64_POS_VALUES = [x for x in INT64_VALUES if x > 0] + + +@contextlib.contextmanager +def exc_iter(*args): + """ + Iterate over Cartesian product of *args, and if an exception is raised, + add information of the current iterate. + """ + + value = [None] + + def iterate(): + for v in itertools.product(*args): + value[0] = v + yield v + + try: + yield iterate() + except Exception: + import traceback + msg = "At: %r\n%s" % (repr(value[0]), + traceback.format_exc()) + raise AssertionError(msg) + + +def test_safe_binop(): + # Test checked arithmetic routines + + ops = [ + (operator.add, 1), + (operator.sub, 2), + (operator.mul, 3) + ] + + with exc_iter(ops, INT64_VALUES, INT64_VALUES) as it: + for xop, a, b in it: + pyop, op = xop + c = pyop(a, b) + + if not (INT64_MIN <= c <= INT64_MAX): + assert_raises(OverflowError, mt.extint_safe_binop, a, b, op) + else: + d = mt.extint_safe_binop(a, b, op) + if c != d: + # assert_equal is slow + assert_equal(d, c) + + +def test_to_128(): + with exc_iter(INT64_VALUES) as it: + for a, in it: + b = mt.extint_to_128(a) + if a != b: + assert_equal(b, a) + + +def test_to_64(): + with exc_iter(INT128_VALUES) as it: + for a, in it: + if not (INT64_MIN <= a <= INT64_MAX): + assert_raises(OverflowError, mt.extint_to_64, a) + else: + b = mt.extint_to_64(a) + if a != b: + assert_equal(b, a) + + +def test_mul_64_64(): + with exc_iter(INT64_VALUES, INT64_VALUES) as it: + for a, b in it: + c = a * b + d = mt.extint_mul_64_64(a, b) + if c != d: + assert_equal(d, c) + + +def test_add_128(): + with exc_iter(INT128_VALUES, INT128_VALUES) as it: + for a, b in it: + c = a + b + if not (INT128_MIN <= c <= INT128_MAX): + assert_raises(OverflowError, mt.extint_add_128, a, b) + else: + d = mt.extint_add_128(a, b) + if c != d: + assert_equal(d, c) + + +def test_sub_128(): + with exc_iter(INT128_VALUES, INT128_VALUES) as it: + for a, b in it: + c = a - b + if not (INT128_MIN <= c <= INT128_MAX): + assert_raises(OverflowError, mt.extint_sub_128, a, b) + else: + d = mt.extint_sub_128(a, b) + if c != d: + assert_equal(d, c) + + +def test_neg_128(): + with exc_iter(INT128_VALUES) as it: + for a, in it: + b = -a + c = mt.extint_neg_128(a) + if b != c: + assert_equal(c, b) + + +def test_shl_128(): + with exc_iter(INT128_VALUES) as it: + for a, in it: + if a < 0: + b = -(((-a) << 1) & (2**128-1)) + else: + b = (a << 1) & (2**128-1) + c = mt.extint_shl_128(a) + if b != c: + assert_equal(c, b) + + +def test_shr_128(): + with exc_iter(INT128_VALUES) as it: + for a, in it: + if a < 0: + b = -((-a) >> 1) + else: + b = a >> 1 + c = mt.extint_shr_128(a) + if b != c: + assert_equal(c, b) + + +def test_gt_128(): + with exc_iter(INT128_VALUES, INT128_VALUES) as it: + for a, b in it: + c = a > b + d = mt.extint_gt_128(a, b) + if c != d: + assert_equal(d, c) + + +@pytest.mark.slow +def test_divmod_128_64(): + with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: + for a, b in it: + if a >= 0: + c, cr = divmod(a, b) + else: + c, cr = divmod(-a, b) + c = -c + cr = -cr + + d, dr = mt.extint_divmod_128_64(a, b) + + if c != d or d != dr or b*d + dr != a: + assert_equal(d, c) + assert_equal(dr, cr) + assert_equal(b*d + dr, a) + + +def test_floordiv_128_64(): + with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: + for a, b in it: + c = a // b + d = mt.extint_floordiv_128_64(a, b) + + if c != d: + assert_equal(d, c) + + +def test_ceildiv_128_64(): + with exc_iter(INT128_VALUES, INT64_POS_VALUES) as it: + for a, b in it: + c = (a + b - 1) // b + d = mt.extint_ceildiv_128_64(a, b) + + if c != d: + assert_equal(d, c) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_getlimits.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_getlimits.py new file mode 100644 index 0000000000000000000000000000000000000000..8378bad193915b6b85199a35844237545efa87bb --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_getlimits.py @@ -0,0 +1,194 @@ +""" Test functions for limits module. + +""" +import warnings +import numpy as np +import pytest +from numpy._core import finfo, iinfo +from numpy import half, single, double, longdouble +from numpy.testing import assert_equal, assert_, assert_raises +from numpy._core.getlimits import _discovered_machar, _float_ma + +################################################## + +class TestPythonFloat: + def test_singleton(self): + ftype = finfo(float) + ftype2 = finfo(float) + assert_equal(id(ftype), id(ftype2)) + +class TestHalf: + def test_singleton(self): + ftype = finfo(half) + ftype2 = finfo(half) + assert_equal(id(ftype), id(ftype2)) + +class TestSingle: + def test_singleton(self): + ftype = finfo(single) + ftype2 = finfo(single) + assert_equal(id(ftype), id(ftype2)) + +class TestDouble: + def test_singleton(self): + ftype = finfo(double) + ftype2 = finfo(double) + assert_equal(id(ftype), id(ftype2)) + +class TestLongdouble: + def test_singleton(self): + ftype = finfo(longdouble) + ftype2 = finfo(longdouble) + assert_equal(id(ftype), id(ftype2)) + +def assert_finfo_equal(f1, f2): + # assert two finfo instances have the same attributes + for attr in ('bits', 'eps', 'epsneg', 'iexp', 'machep', + 'max', 'maxexp', 'min', 'minexp', 'negep', 'nexp', + 'nmant', 'precision', 'resolution', 'tiny', + 'smallest_normal', 'smallest_subnormal'): + assert_equal(getattr(f1, attr), getattr(f2, attr), + f'finfo instances {f1} and {f2} differ on {attr}') + +def assert_iinfo_equal(i1, i2): + # assert two iinfo instances have the same attributes + for attr in ('bits', 'min', 'max'): + assert_equal(getattr(i1, attr), getattr(i2, attr), + f'iinfo instances {i1} and {i2} differ on {attr}') + +class TestFinfo: + def test_basic(self): + dts = list(zip(['f2', 'f4', 'f8', 'c8', 'c16'], + [np.float16, np.float32, np.float64, np.complex64, + np.complex128])) + for dt1, dt2 in dts: + assert_finfo_equal(finfo(dt1), finfo(dt2)) + + assert_raises(ValueError, finfo, 'i4') + + def test_regression_gh23108(self): + # np.float32(1.0) and np.float64(1.0) have the same hash and are + # equal under the == operator + f1 = np.finfo(np.float32(1.0)) + f2 = np.finfo(np.float64(1.0)) + assert f1 != f2 + + def test_regression_gh23867(self): + class NonHashableWithDtype: + __hash__ = None + dtype = np.dtype('float32') + + x = NonHashableWithDtype() + assert np.finfo(x) == np.finfo(x.dtype) + + +class TestIinfo: + def test_basic(self): + dts = list(zip(['i1', 'i2', 'i4', 'i8', + 'u1', 'u2', 'u4', 'u8'], + [np.int8, np.int16, np.int32, np.int64, + np.uint8, np.uint16, np.uint32, np.uint64])) + for dt1, dt2 in dts: + assert_iinfo_equal(iinfo(dt1), iinfo(dt2)) + + assert_raises(ValueError, iinfo, 'f4') + + def test_unsigned_max(self): + types = np._core.sctypes['uint'] + for T in types: + with np.errstate(over="ignore"): + max_calculated = T(0) - T(1) + assert_equal(iinfo(T).max, max_calculated) + +class TestRepr: + def test_iinfo_repr(self): + expected = "iinfo(min=-32768, max=32767, dtype=int16)" + assert_equal(repr(np.iinfo(np.int16)), expected) + + def test_finfo_repr(self): + expected = "finfo(resolution=1e-06, min=-3.4028235e+38," + \ + " max=3.4028235e+38, dtype=float32)" + assert_equal(repr(np.finfo(np.float32)), expected) + + +def test_instances(): + # Test the finfo and iinfo results on numeric instances agree with + # the results on the corresponding types + + for c in [int, np.int16, np.int32, np.int64]: + class_iinfo = iinfo(c) + instance_iinfo = iinfo(c(12)) + + assert_iinfo_equal(class_iinfo, instance_iinfo) + + for c in [float, np.float16, np.float32, np.float64]: + class_finfo = finfo(c) + instance_finfo = finfo(c(1.2)) + assert_finfo_equal(class_finfo, instance_finfo) + + with pytest.raises(ValueError): + iinfo(10.) + + with pytest.raises(ValueError): + iinfo('hi') + + with pytest.raises(ValueError): + finfo(np.int64(1)) + + +def assert_ma_equal(discovered, ma_like): + # Check MachAr-like objects same as calculated MachAr instances + for key, value in discovered.__dict__.items(): + assert_equal(value, getattr(ma_like, key)) + if hasattr(value, 'shape'): + assert_equal(value.shape, getattr(ma_like, key).shape) + assert_equal(value.dtype, getattr(ma_like, key).dtype) + + +def test_known_types(): + # Test we are correctly compiling parameters for known types + for ftype, ma_like in ((np.float16, _float_ma[16]), + (np.float32, _float_ma[32]), + (np.float64, _float_ma[64])): + assert_ma_equal(_discovered_machar(ftype), ma_like) + # Suppress warning for broken discovery of double double on PPC + with np.errstate(all='ignore'): + ld_ma = _discovered_machar(np.longdouble) + bytes = np.dtype(np.longdouble).itemsize + if (ld_ma.it, ld_ma.maxexp) == (63, 16384) and bytes in (12, 16): + # 80-bit extended precision + assert_ma_equal(ld_ma, _float_ma[80]) + elif (ld_ma.it, ld_ma.maxexp) == (112, 16384) and bytes == 16: + # IEE 754 128-bit + assert_ma_equal(ld_ma, _float_ma[128]) + + +def test_subnormal_warning(): + """Test that the subnormal is zero warning is not being raised.""" + with np.errstate(all='ignore'): + ld_ma = _discovered_machar(np.longdouble) + bytes = np.dtype(np.longdouble).itemsize + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter('always') + if (ld_ma.it, ld_ma.maxexp) == (63, 16384) and bytes in (12, 16): + # 80-bit extended precision + ld_ma.smallest_subnormal + assert len(w) == 0 + elif (ld_ma.it, ld_ma.maxexp) == (112, 16384) and bytes == 16: + # IEE 754 128-bit + ld_ma.smallest_subnormal + assert len(w) == 0 + else: + # Double double + ld_ma.smallest_subnormal + # This test may fail on some platforms + assert len(w) == 0 + + +def test_plausible_finfo(): + # Assert that finfo returns reasonable results for all types + for ftype in np._core.sctypes['float'] + np._core.sctypes['complex']: + info = np.finfo(ftype) + assert_(info.nmant > 1) + assert_(info.minexp < -1) + assert_(info.maxexp > 1) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_half.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_half.py new file mode 100644 index 0000000000000000000000000000000000000000..fbc1bf6a0a6dd0c82b8c62968407e9c959a582f8 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_half.py @@ -0,0 +1,572 @@ +import platform +import pytest + +import numpy as np +from numpy import uint16, float16, float32, float64 +from numpy.testing import assert_, assert_equal, _OLD_PROMOTION, IS_WASM + + +def assert_raises_fpe(strmatch, callable, *args, **kwargs): + try: + callable(*args, **kwargs) + except FloatingPointError as exc: + assert_(str(exc).find(strmatch) >= 0, + "Did not raise floating point %s error" % strmatch) + else: + assert_(False, + "Did not raise floating point %s error" % strmatch) + +class TestHalf: + def setup_method(self): + # An array of all possible float16 values + self.all_f16 = np.arange(0x10000, dtype=uint16) + self.all_f16.dtype = float16 + + # NaN value can cause an invalid FP exception if HW is been used + with np.errstate(invalid='ignore'): + self.all_f32 = np.array(self.all_f16, dtype=float32) + self.all_f64 = np.array(self.all_f16, dtype=float64) + + # An array of all non-NaN float16 values, in sorted order + self.nonan_f16 = np.concatenate( + (np.arange(0xfc00, 0x7fff, -1, dtype=uint16), + np.arange(0x0000, 0x7c01, 1, dtype=uint16))) + self.nonan_f16.dtype = float16 + self.nonan_f32 = np.array(self.nonan_f16, dtype=float32) + self.nonan_f64 = np.array(self.nonan_f16, dtype=float64) + + # An array of all finite float16 values, in sorted order + self.finite_f16 = self.nonan_f16[1:-1] + self.finite_f32 = self.nonan_f32[1:-1] + self.finite_f64 = self.nonan_f64[1:-1] + + def test_half_conversions(self): + """Checks that all 16-bit values survive conversion + to/from 32-bit and 64-bit float""" + # Because the underlying routines preserve the NaN bits, every + # value is preserved when converting to/from other floats. + + # Convert from float32 back to float16 + with np.errstate(invalid='ignore'): + b = np.array(self.all_f32, dtype=float16) + # avoid testing NaNs due to differ bits wither Q/SNaNs + b_nn = b == b + assert_equal(self.all_f16[b_nn].view(dtype=uint16), + b[b_nn].view(dtype=uint16)) + + # Convert from float64 back to float16 + with np.errstate(invalid='ignore'): + b = np.array(self.all_f64, dtype=float16) + b_nn = b == b + assert_equal(self.all_f16[b_nn].view(dtype=uint16), + b[b_nn].view(dtype=uint16)) + + # Convert float16 to longdouble and back + # This doesn't necessarily preserve the extra NaN bits, + # so exclude NaNs. + a_ld = np.array(self.nonan_f16, dtype=np.longdouble) + b = np.array(a_ld, dtype=float16) + assert_equal(self.nonan_f16.view(dtype=uint16), + b.view(dtype=uint16)) + + # Check the range for which all integers can be represented + i_int = np.arange(-2048, 2049) + i_f16 = np.array(i_int, dtype=float16) + j = np.array(i_f16, dtype=int) + assert_equal(i_int, j) + + @pytest.mark.parametrize("string_dt", ["S", "U"]) + def test_half_conversion_to_string(self, string_dt): + # Currently uses S/U32 (which is sufficient for float32) + expected_dt = np.dtype(f"{string_dt}32") + assert np.promote_types(np.float16, string_dt) == expected_dt + assert np.promote_types(string_dt, np.float16) == expected_dt + + arr = np.ones(3, dtype=np.float16).astype(string_dt) + assert arr.dtype == expected_dt + + @pytest.mark.parametrize("string_dt", ["S", "U"]) + def test_half_conversion_from_string(self, string_dt): + string = np.array("3.1416", dtype=string_dt) + assert string.astype(np.float16) == np.array(3.1416, dtype=np.float16) + + @pytest.mark.parametrize("offset", [None, "up", "down"]) + @pytest.mark.parametrize("shift", [None, "up", "down"]) + @pytest.mark.parametrize("float_t", [np.float32, np.float64]) + @np._no_nep50_warning() + def test_half_conversion_rounding(self, float_t, shift, offset): + # Assumes that round to even is used during casting. + max_pattern = np.float16(np.finfo(np.float16).max).view(np.uint16) + + # Test all (positive) finite numbers, denormals are most interesting + # however: + f16s_patterns = np.arange(0, max_pattern+1, dtype=np.uint16) + f16s_float = f16s_patterns.view(np.float16).astype(float_t) + + # Shift the values by half a bit up or a down (or do not shift), + if shift == "up": + f16s_float = 0.5 * (f16s_float[:-1] + f16s_float[1:])[1:] + elif shift == "down": + f16s_float = 0.5 * (f16s_float[:-1] + f16s_float[1:])[:-1] + else: + f16s_float = f16s_float[1:-1] + + # Increase the float by a minimal value: + if offset == "up": + f16s_float = np.nextafter(f16s_float, float_t(np.inf)) + elif offset == "down": + f16s_float = np.nextafter(f16s_float, float_t(-np.inf)) + + # Convert back to float16 and its bit pattern: + res_patterns = f16s_float.astype(np.float16).view(np.uint16) + + # The above calculations tries the original values, or the exact + # mid points between the float16 values. It then further offsets them + # by as little as possible. If no offset occurs, "round to even" + # logic will be necessary, an arbitrarily small offset should cause + # normal up/down rounding always. + + # Calculate the expected pattern: + cmp_patterns = f16s_patterns[1:-1].copy() + + if shift == "down" and offset != "up": + shift_pattern = -1 + elif shift == "up" and offset != "down": + shift_pattern = 1 + else: + # There cannot be a shift, either shift is None, so all rounding + # will go back to original, or shift is reduced by offset too much. + shift_pattern = 0 + + # If rounding occurs, is it normal rounding or round to even? + if offset is None: + # Round to even occurs, modify only non-even, cast to allow + (-1) + cmp_patterns[0::2].view(np.int16)[...] += shift_pattern + else: + cmp_patterns.view(np.int16)[...] += shift_pattern + + assert_equal(res_patterns, cmp_patterns) + + @pytest.mark.parametrize(["float_t", "uint_t", "bits"], + [(np.float32, np.uint32, 23), + (np.float64, np.uint64, 52)]) + def test_half_conversion_denormal_round_even(self, float_t, uint_t, bits): + # Test specifically that all bits are considered when deciding + # whether round to even should occur (i.e. no bits are lost at the + # end. Compare also gh-12721. The most bits can get lost for the + # smallest denormal: + smallest_value = np.uint16(1).view(np.float16).astype(float_t) + assert smallest_value == 2**-24 + + # Will be rounded to zero based on round to even rule: + rounded_to_zero = smallest_value / float_t(2) + assert rounded_to_zero.astype(np.float16) == 0 + + # The significand will be all 0 for the float_t, test that we do not + # lose the lower ones of these: + for i in range(bits): + # slightly increasing the value should make it round up: + larger_pattern = rounded_to_zero.view(uint_t) | uint_t(1 << i) + larger_value = larger_pattern.view(float_t) + assert larger_value.astype(np.float16) == smallest_value + + def test_nans_infs(self): + with np.errstate(all='ignore'): + # Check some of the ufuncs + assert_equal(np.isnan(self.all_f16), np.isnan(self.all_f32)) + assert_equal(np.isinf(self.all_f16), np.isinf(self.all_f32)) + assert_equal(np.isfinite(self.all_f16), np.isfinite(self.all_f32)) + assert_equal(np.signbit(self.all_f16), np.signbit(self.all_f32)) + assert_equal(np.spacing(float16(65504)), np.inf) + + # Check comparisons of all values with NaN + nan = float16(np.nan) + + assert_(not (self.all_f16 == nan).any()) + assert_(not (nan == self.all_f16).any()) + + assert_((self.all_f16 != nan).all()) + assert_((nan != self.all_f16).all()) + + assert_(not (self.all_f16 < nan).any()) + assert_(not (nan < self.all_f16).any()) + + assert_(not (self.all_f16 <= nan).any()) + assert_(not (nan <= self.all_f16).any()) + + assert_(not (self.all_f16 > nan).any()) + assert_(not (nan > self.all_f16).any()) + + assert_(not (self.all_f16 >= nan).any()) + assert_(not (nan >= self.all_f16).any()) + + def test_half_values(self): + """Confirms a small number of known half values""" + a = np.array([1.0, -1.0, + 2.0, -2.0, + 0.0999755859375, 0.333251953125, # 1/10, 1/3 + 65504, -65504, # Maximum magnitude + 2.0**(-14), -2.0**(-14), # Minimum normal + 2.0**(-24), -2.0**(-24), # Minimum subnormal + 0, -1/1e1000, # Signed zeros + np.inf, -np.inf]) + b = np.array([0x3c00, 0xbc00, + 0x4000, 0xc000, + 0x2e66, 0x3555, + 0x7bff, 0xfbff, + 0x0400, 0x8400, + 0x0001, 0x8001, + 0x0000, 0x8000, + 0x7c00, 0xfc00], dtype=uint16) + b.dtype = float16 + assert_equal(a, b) + + def test_half_rounding(self): + """Checks that rounding when converting to half is correct""" + a = np.array([2.0**-25 + 2.0**-35, # Rounds to minimum subnormal + 2.0**-25, # Underflows to zero (nearest even mode) + 2.0**-26, # Underflows to zero + 1.0+2.0**-11 + 2.0**-16, # rounds to 1.0+2**(-10) + 1.0+2.0**-11, # rounds to 1.0 (nearest even mode) + 1.0+2.0**-12, # rounds to 1.0 + 65519, # rounds to 65504 + 65520], # rounds to inf + dtype=float64) + rounded = [2.0**-24, + 0.0, + 0.0, + 1.0+2.0**(-10), + 1.0, + 1.0, + 65504, + np.inf] + + # Check float64->float16 rounding + with np.errstate(over="ignore"): + b = np.array(a, dtype=float16) + assert_equal(b, rounded) + + # Check float32->float16 rounding + a = np.array(a, dtype=float32) + with np.errstate(over="ignore"): + b = np.array(a, dtype=float16) + assert_equal(b, rounded) + + def test_half_correctness(self): + """Take every finite float16, and check the casting functions with + a manual conversion.""" + + # Create an array of all finite float16s + a_bits = self.finite_f16.view(dtype=uint16) + + # Convert to 64-bit float manually + a_sgn = (-1.0)**((a_bits & 0x8000) >> 15) + a_exp = np.array((a_bits & 0x7c00) >> 10, dtype=np.int32) - 15 + a_man = (a_bits & 0x03ff) * 2.0**(-10) + # Implicit bit of normalized floats + a_man[a_exp != -15] += 1 + # Denormalized exponent is -14 + a_exp[a_exp == -15] = -14 + + a_manual = a_sgn * a_man * 2.0**a_exp + + a32_fail = np.nonzero(self.finite_f32 != a_manual)[0] + if len(a32_fail) != 0: + bad_index = a32_fail[0] + assert_equal(self.finite_f32, a_manual, + "First non-equal is half value 0x%x -> %g != %g" % + (a_bits[bad_index], + self.finite_f32[bad_index], + a_manual[bad_index])) + + a64_fail = np.nonzero(self.finite_f64 != a_manual)[0] + if len(a64_fail) != 0: + bad_index = a64_fail[0] + assert_equal(self.finite_f64, a_manual, + "First non-equal is half value 0x%x -> %g != %g" % + (a_bits[bad_index], + self.finite_f64[bad_index], + a_manual[bad_index])) + + def test_half_ordering(self): + """Make sure comparisons are working right""" + + # All non-NaN float16 values in reverse order + a = self.nonan_f16[::-1].copy() + + # 32-bit float copy + b = np.array(a, dtype=float32) + + # Should sort the same + a.sort() + b.sort() + assert_equal(a, b) + + # Comparisons should work + assert_((a[:-1] <= a[1:]).all()) + assert_(not (a[:-1] > a[1:]).any()) + assert_((a[1:] >= a[:-1]).all()) + assert_(not (a[1:] < a[:-1]).any()) + # All != except for +/-0 + assert_equal(np.nonzero(a[:-1] < a[1:])[0].size, a.size-2) + assert_equal(np.nonzero(a[1:] > a[:-1])[0].size, a.size-2) + + def test_half_funcs(self): + """Test the various ArrFuncs""" + + # fill + assert_equal(np.arange(10, dtype=float16), + np.arange(10, dtype=float32)) + + # fillwithscalar + a = np.zeros((5,), dtype=float16) + a.fill(1) + assert_equal(a, np.ones((5,), dtype=float16)) + + # nonzero and copyswap + a = np.array([0, 0, -1, -1/1e20, 0, 2.0**-24, 7.629e-6], dtype=float16) + assert_equal(a.nonzero()[0], + [2, 5, 6]) + a = a.byteswap() + a = a.view(a.dtype.newbyteorder()) + assert_equal(a.nonzero()[0], + [2, 5, 6]) + + # dot + a = np.arange(0, 10, 0.5, dtype=float16) + b = np.ones((20,), dtype=float16) + assert_equal(np.dot(a, b), + 95) + + # argmax + a = np.array([0, -np.inf, -2, 0.5, 12.55, 7.3, 2.1, 12.4], dtype=float16) + assert_equal(a.argmax(), + 4) + a = np.array([0, -np.inf, -2, np.inf, 12.55, np.nan, 2.1, 12.4], dtype=float16) + assert_equal(a.argmax(), + 5) + + # getitem + a = np.arange(10, dtype=float16) + for i in range(10): + assert_equal(a.item(i), i) + + def test_spacing_nextafter(self): + """Test np.spacing and np.nextafter""" + # All non-negative finite #'s + a = np.arange(0x7c00, dtype=uint16) + hinf = np.array((np.inf,), dtype=float16) + hnan = np.array((np.nan,), dtype=float16) + a_f16 = a.view(dtype=float16) + + assert_equal(np.spacing(a_f16[:-1]), a_f16[1:]-a_f16[:-1]) + + assert_equal(np.nextafter(a_f16[:-1], hinf), a_f16[1:]) + assert_equal(np.nextafter(a_f16[0], -hinf), -a_f16[1]) + assert_equal(np.nextafter(a_f16[1:], -hinf), a_f16[:-1]) + + assert_equal(np.nextafter(hinf, a_f16), a_f16[-1]) + assert_equal(np.nextafter(-hinf, a_f16), -a_f16[-1]) + + assert_equal(np.nextafter(hinf, hinf), hinf) + assert_equal(np.nextafter(hinf, -hinf), a_f16[-1]) + assert_equal(np.nextafter(-hinf, hinf), -a_f16[-1]) + assert_equal(np.nextafter(-hinf, -hinf), -hinf) + + assert_equal(np.nextafter(a_f16, hnan), hnan[0]) + assert_equal(np.nextafter(hnan, a_f16), hnan[0]) + + assert_equal(np.nextafter(hnan, hnan), hnan) + assert_equal(np.nextafter(hinf, hnan), hnan) + assert_equal(np.nextafter(hnan, hinf), hnan) + + # switch to negatives + a |= 0x8000 + + assert_equal(np.spacing(a_f16[0]), np.spacing(a_f16[1])) + assert_equal(np.spacing(a_f16[1:]), a_f16[:-1]-a_f16[1:]) + + assert_equal(np.nextafter(a_f16[0], hinf), -a_f16[1]) + assert_equal(np.nextafter(a_f16[1:], hinf), a_f16[:-1]) + assert_equal(np.nextafter(a_f16[:-1], -hinf), a_f16[1:]) + + assert_equal(np.nextafter(hinf, a_f16), -a_f16[-1]) + assert_equal(np.nextafter(-hinf, a_f16), a_f16[-1]) + + assert_equal(np.nextafter(a_f16, hnan), hnan[0]) + assert_equal(np.nextafter(hnan, a_f16), hnan[0]) + + def test_half_ufuncs(self): + """Test the various ufuncs""" + + a = np.array([0, 1, 2, 4, 2], dtype=float16) + b = np.array([-2, 5, 1, 4, 3], dtype=float16) + c = np.array([0, -1, -np.inf, np.nan, 6], dtype=float16) + + assert_equal(np.add(a, b), [-2, 6, 3, 8, 5]) + assert_equal(np.subtract(a, b), [2, -4, 1, 0, -1]) + assert_equal(np.multiply(a, b), [0, 5, 2, 16, 6]) + assert_equal(np.divide(a, b), [0, 0.199951171875, 2, 1, 0.66650390625]) + + assert_equal(np.equal(a, b), [False, False, False, True, False]) + assert_equal(np.not_equal(a, b), [True, True, True, False, True]) + assert_equal(np.less(a, b), [False, True, False, False, True]) + assert_equal(np.less_equal(a, b), [False, True, False, True, True]) + assert_equal(np.greater(a, b), [True, False, True, False, False]) + assert_equal(np.greater_equal(a, b), [True, False, True, True, False]) + assert_equal(np.logical_and(a, b), [False, True, True, True, True]) + assert_equal(np.logical_or(a, b), [True, True, True, True, True]) + assert_equal(np.logical_xor(a, b), [True, False, False, False, False]) + assert_equal(np.logical_not(a), [True, False, False, False, False]) + + assert_equal(np.isnan(c), [False, False, False, True, False]) + assert_equal(np.isinf(c), [False, False, True, False, False]) + assert_equal(np.isfinite(c), [True, True, False, False, True]) + assert_equal(np.signbit(b), [True, False, False, False, False]) + + assert_equal(np.copysign(b, a), [2, 5, 1, 4, 3]) + + assert_equal(np.maximum(a, b), [0, 5, 2, 4, 3]) + + x = np.maximum(b, c) + assert_(np.isnan(x[3])) + x[3] = 0 + assert_equal(x, [0, 5, 1, 0, 6]) + + assert_equal(np.minimum(a, b), [-2, 1, 1, 4, 2]) + + x = np.minimum(b, c) + assert_(np.isnan(x[3])) + x[3] = 0 + assert_equal(x, [-2, -1, -np.inf, 0, 3]) + + assert_equal(np.fmax(a, b), [0, 5, 2, 4, 3]) + assert_equal(np.fmax(b, c), [0, 5, 1, 4, 6]) + assert_equal(np.fmin(a, b), [-2, 1, 1, 4, 2]) + assert_equal(np.fmin(b, c), [-2, -1, -np.inf, 4, 3]) + + assert_equal(np.floor_divide(a, b), [0, 0, 2, 1, 0]) + assert_equal(np.remainder(a, b), [0, 1, 0, 0, 2]) + assert_equal(np.divmod(a, b), ([0, 0, 2, 1, 0], [0, 1, 0, 0, 2])) + assert_equal(np.square(b), [4, 25, 1, 16, 9]) + assert_equal(np.reciprocal(b), [-0.5, 0.199951171875, 1, 0.25, 0.333251953125]) + assert_equal(np.ones_like(b), [1, 1, 1, 1, 1]) + assert_equal(np.conjugate(b), b) + assert_equal(np.absolute(b), [2, 5, 1, 4, 3]) + assert_equal(np.negative(b), [2, -5, -1, -4, -3]) + assert_equal(np.positive(b), b) + assert_equal(np.sign(b), [-1, 1, 1, 1, 1]) + assert_equal(np.modf(b), ([0, 0, 0, 0, 0], b)) + assert_equal(np.frexp(b), ([-0.5, 0.625, 0.5, 0.5, 0.75], [2, 3, 1, 3, 2])) + assert_equal(np.ldexp(b, [0, 1, 2, 4, 2]), [-2, 10, 4, 64, 12]) + + @np._no_nep50_warning() + def test_half_coercion(self, weak_promotion): + """Test that half gets coerced properly with the other types""" + a16 = np.array((1,), dtype=float16) + a32 = np.array((1,), dtype=float32) + b16 = float16(1) + b32 = float32(1) + + assert np.power(a16, 2).dtype == float16 + assert np.power(a16, 2.0).dtype == float16 + assert np.power(a16, b16).dtype == float16 + expected_dt = float32 if weak_promotion else float16 + assert np.power(a16, b32).dtype == expected_dt + assert np.power(a16, a16).dtype == float16 + assert np.power(a16, a32).dtype == float32 + + expected_dt = float16 if weak_promotion else float64 + assert np.power(b16, 2).dtype == expected_dt + assert np.power(b16, 2.0).dtype == expected_dt + assert np.power(b16, b16).dtype, float16 + assert np.power(b16, b32).dtype, float32 + assert np.power(b16, a16).dtype, float16 + assert np.power(b16, a32).dtype, float32 + + assert np.power(a32, a16).dtype == float32 + assert np.power(a32, b16).dtype == float32 + expected_dt = float32 if weak_promotion else float16 + assert np.power(b32, a16).dtype == expected_dt + assert np.power(b32, b16).dtype == float32 + + @pytest.mark.skipif(platform.machine() == "armv5tel", + reason="See gh-413.") + @pytest.mark.skipif(IS_WASM, + reason="fp exceptions don't work in wasm.") + def test_half_fpe(self): + with np.errstate(all='raise'): + sx16 = np.array((1e-4,), dtype=float16) + bx16 = np.array((1e4,), dtype=float16) + sy16 = float16(1e-4) + by16 = float16(1e4) + + # Underflow errors + assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sx16) + assert_raises_fpe('underflow', lambda a, b:a*b, sx16, sy16) + assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sx16) + assert_raises_fpe('underflow', lambda a, b:a*b, sy16, sy16) + assert_raises_fpe('underflow', lambda a, b:a/b, sx16, bx16) + assert_raises_fpe('underflow', lambda a, b:a/b, sx16, by16) + assert_raises_fpe('underflow', lambda a, b:a/b, sy16, bx16) + assert_raises_fpe('underflow', lambda a, b:a/b, sy16, by16) + assert_raises_fpe('underflow', lambda a, b:a/b, + float16(2.**-14), float16(2**11)) + assert_raises_fpe('underflow', lambda a, b:a/b, + float16(-2.**-14), float16(2**11)) + assert_raises_fpe('underflow', lambda a, b:a/b, + float16(2.**-14+2**-24), float16(2)) + assert_raises_fpe('underflow', lambda a, b:a/b, + float16(-2.**-14-2**-24), float16(2)) + assert_raises_fpe('underflow', lambda a, b:a/b, + float16(2.**-14+2**-23), float16(4)) + + # Overflow errors + assert_raises_fpe('overflow', lambda a, b:a*b, bx16, bx16) + assert_raises_fpe('overflow', lambda a, b:a*b, bx16, by16) + assert_raises_fpe('overflow', lambda a, b:a*b, by16, bx16) + assert_raises_fpe('overflow', lambda a, b:a*b, by16, by16) + assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sx16) + assert_raises_fpe('overflow', lambda a, b:a/b, bx16, sy16) + assert_raises_fpe('overflow', lambda a, b:a/b, by16, sx16) + assert_raises_fpe('overflow', lambda a, b:a/b, by16, sy16) + assert_raises_fpe('overflow', lambda a, b:a+b, + float16(65504), float16(17)) + assert_raises_fpe('overflow', lambda a, b:a-b, + float16(-65504), float16(17)) + assert_raises_fpe('overflow', np.nextafter, float16(65504), float16(np.inf)) + assert_raises_fpe('overflow', np.nextafter, float16(-65504), float16(-np.inf)) + assert_raises_fpe('overflow', np.spacing, float16(65504)) + + # Invalid value errors + assert_raises_fpe('invalid', np.divide, float16(np.inf), float16(np.inf)) + assert_raises_fpe('invalid', np.spacing, float16(np.inf)) + assert_raises_fpe('invalid', np.spacing, float16(np.nan)) + + # These should not raise + float16(65472)+float16(32) + float16(2**-13)/float16(2) + float16(2**-14)/float16(2**10) + np.spacing(float16(-65504)) + np.nextafter(float16(65504), float16(-np.inf)) + np.nextafter(float16(-65504), float16(np.inf)) + np.nextafter(float16(np.inf), float16(0)) + np.nextafter(float16(-np.inf), float16(0)) + np.nextafter(float16(0), float16(np.nan)) + np.nextafter(float16(np.nan), float16(0)) + float16(2**-14)/float16(2**10) + float16(-2**-14)/float16(2**10) + float16(2**-14+2**-23)/float16(2) + float16(-2**-14-2**-23)/float16(2) + + def test_half_array_interface(self): + """Test that half is compatible with __array_interface__""" + class Dummy: + pass + + a = np.ones((1,), dtype=float16) + b = Dummy() + b.__array_interface__ = a.__array_interface__ + c = np.array(b) + assert_(c.dtype == float16) + assert_equal(a, c) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_hashtable.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_hashtable.py new file mode 100644 index 0000000000000000000000000000000000000000..41da06be3f2b5010dceebcebd77fdaf458be3e08 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_hashtable.py @@ -0,0 +1,35 @@ +import pytest + +import random +from numpy._core._multiarray_tests import identityhash_tester + + +@pytest.mark.parametrize("key_length", [1, 3, 6]) +@pytest.mark.parametrize("length", [1, 16, 2000]) +def test_identity_hashtable(key_length, length): + # use a 30 object pool for everything (duplicates will happen) + pool = [object() for i in range(20)] + keys_vals = [] + for i in range(length): + keys = tuple(random.choices(pool, k=key_length)) + keys_vals.append((keys, random.choice(pool))) + + dictionary = dict(keys_vals) + + # add a random item at the end: + keys_vals.append(random.choice(keys_vals)) + # the expected one could be different with duplicates: + expected = dictionary[keys_vals[-1][0]] + + res = identityhash_tester(key_length, keys_vals, replace=True) + assert res is expected + + if length == 1: + return + + # add a new item with a key that is already used and a new value, this + # should error if replace is False, see gh-26690 + new_key = (keys_vals[1][0], object()) + keys_vals[0] = new_key + with pytest.raises(RuntimeError): + identityhash_tester(key_length, keys_vals) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexerrors.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexerrors.py new file mode 100644 index 0000000000000000000000000000000000000000..c1faa9555813a649662e8809df7c9c552c28ee48 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexerrors.py @@ -0,0 +1,124 @@ +import numpy as np +from numpy.testing import ( + assert_raises, assert_raises_regex, + ) + + +class TestIndexErrors: + '''Tests to exercise indexerrors not covered by other tests.''' + + def test_arraytypes_fasttake(self): + 'take from a 0-length dimension' + x = np.empty((2, 3, 0, 4)) + assert_raises(IndexError, x.take, [0], axis=2) + assert_raises(IndexError, x.take, [1], axis=2) + assert_raises(IndexError, x.take, [0], axis=2, mode='wrap') + assert_raises(IndexError, x.take, [0], axis=2, mode='clip') + + def test_take_from_object(self): + # Check exception taking from object array + d = np.zeros(5, dtype=object) + assert_raises(IndexError, d.take, [6]) + + # Check exception taking from 0-d array + d = np.zeros((5, 0), dtype=object) + assert_raises(IndexError, d.take, [1], axis=1) + assert_raises(IndexError, d.take, [0], axis=1) + assert_raises(IndexError, d.take, [0]) + assert_raises(IndexError, d.take, [0], mode='wrap') + assert_raises(IndexError, d.take, [0], mode='clip') + + def test_multiindex_exceptions(self): + a = np.empty(5, dtype=object) + assert_raises(IndexError, a.item, 20) + a = np.empty((5, 0), dtype=object) + assert_raises(IndexError, a.item, (0, 0)) + + def test_put_exceptions(self): + a = np.zeros((5, 5)) + assert_raises(IndexError, a.put, 100, 0) + a = np.zeros((5, 5), dtype=object) + assert_raises(IndexError, a.put, 100, 0) + a = np.zeros((5, 5, 0)) + assert_raises(IndexError, a.put, 100, 0) + a = np.zeros((5, 5, 0), dtype=object) + assert_raises(IndexError, a.put, 100, 0) + + def test_iterators_exceptions(self): + "cases in iterators.c" + def assign(obj, ind, val): + obj[ind] = val + + a = np.zeros([1, 2, 3]) + assert_raises(IndexError, lambda: a[0, 5, None, 2]) + assert_raises(IndexError, lambda: a[0, 5, 0, 2]) + assert_raises(IndexError, lambda: assign(a, (0, 5, None, 2), 1)) + assert_raises(IndexError, lambda: assign(a, (0, 5, 0, 2), 1)) + + a = np.zeros([1, 0, 3]) + assert_raises(IndexError, lambda: a[0, 0, None, 2]) + assert_raises(IndexError, lambda: assign(a, (0, 0, None, 2), 1)) + + a = np.zeros([1, 2, 3]) + assert_raises(IndexError, lambda: a.flat[10]) + assert_raises(IndexError, lambda: assign(a.flat, 10, 5)) + a = np.zeros([1, 0, 3]) + assert_raises(IndexError, lambda: a.flat[10]) + assert_raises(IndexError, lambda: assign(a.flat, 10, 5)) + + a = np.zeros([1, 2, 3]) + assert_raises(IndexError, lambda: a.flat[np.array(10)]) + assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5)) + a = np.zeros([1, 0, 3]) + assert_raises(IndexError, lambda: a.flat[np.array(10)]) + assert_raises(IndexError, lambda: assign(a.flat, np.array(10), 5)) + + a = np.zeros([1, 2, 3]) + assert_raises(IndexError, lambda: a.flat[np.array([10])]) + assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5)) + a = np.zeros([1, 0, 3]) + assert_raises(IndexError, lambda: a.flat[np.array([10])]) + assert_raises(IndexError, lambda: assign(a.flat, np.array([10]), 5)) + + def test_mapping(self): + "cases from mapping.c" + + def assign(obj, ind, val): + obj[ind] = val + + a = np.zeros((0, 10)) + assert_raises(IndexError, lambda: a[12]) + + a = np.zeros((3, 5)) + assert_raises(IndexError, lambda: a[(10, 20)]) + assert_raises(IndexError, lambda: assign(a, (10, 20), 1)) + a = np.zeros((3, 0)) + assert_raises(IndexError, lambda: a[(1, 0)]) + assert_raises(IndexError, lambda: assign(a, (1, 0), 1)) + + a = np.zeros((10,)) + assert_raises(IndexError, lambda: assign(a, 10, 1)) + a = np.zeros((0,)) + assert_raises(IndexError, lambda: assign(a, 10, 1)) + + a = np.zeros((3, 5)) + assert_raises(IndexError, lambda: a[(1, [1, 20])]) + assert_raises(IndexError, lambda: assign(a, (1, [1, 20]), 1)) + a = np.zeros((3, 0)) + assert_raises(IndexError, lambda: a[(1, [0, 1])]) + assert_raises(IndexError, lambda: assign(a, (1, [0, 1]), 1)) + + def test_mapping_error_message(self): + a = np.zeros((3, 5)) + index = (1, 2, 3, 4, 5) + assert_raises_regex( + IndexError, + "too many indices for array: " + "array is 2-dimensional, but 5 were indexed", + lambda: a[index]) + + def test_methods(self): + "cases from methods.c" + + a = np.zeros((3, 3)) + assert_raises(IndexError, lambda: a.item(100)) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexing.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexing.py new file mode 100644 index 0000000000000000000000000000000000000000..686caf9c78223108df02a12aefaac9ee8bd54737 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_indexing.py @@ -0,0 +1,1440 @@ +import sys +import warnings +import functools +import operator + +import pytest + +import numpy as np +from numpy._core._multiarray_tests import array_indexing +from itertools import product +from numpy.exceptions import ComplexWarning, VisibleDeprecationWarning +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_raises_regex, + assert_array_equal, assert_warns, HAS_REFCOUNT, IS_WASM + ) + + +class TestIndexing: + def test_index_no_floats(self): + a = np.array([[[5]]]) + + assert_raises(IndexError, lambda: a[0.0]) + assert_raises(IndexError, lambda: a[0, 0.0]) + assert_raises(IndexError, lambda: a[0.0, 0]) + assert_raises(IndexError, lambda: a[0.0,:]) + assert_raises(IndexError, lambda: a[:, 0.0]) + assert_raises(IndexError, lambda: a[:, 0.0,:]) + assert_raises(IndexError, lambda: a[0.0,:,:]) + assert_raises(IndexError, lambda: a[0, 0, 0.0]) + assert_raises(IndexError, lambda: a[0.0, 0, 0]) + assert_raises(IndexError, lambda: a[0, 0.0, 0]) + assert_raises(IndexError, lambda: a[-1.4]) + assert_raises(IndexError, lambda: a[0, -1.4]) + assert_raises(IndexError, lambda: a[-1.4, 0]) + assert_raises(IndexError, lambda: a[-1.4,:]) + assert_raises(IndexError, lambda: a[:, -1.4]) + assert_raises(IndexError, lambda: a[:, -1.4,:]) + assert_raises(IndexError, lambda: a[-1.4,:,:]) + assert_raises(IndexError, lambda: a[0, 0, -1.4]) + assert_raises(IndexError, lambda: a[-1.4, 0, 0]) + assert_raises(IndexError, lambda: a[0, -1.4, 0]) + assert_raises(IndexError, lambda: a[0.0:, 0.0]) + assert_raises(IndexError, lambda: a[0.0:, 0.0,:]) + + def test_slicing_no_floats(self): + a = np.array([[5]]) + + # start as float. + assert_raises(TypeError, lambda: a[0.0:]) + assert_raises(TypeError, lambda: a[0:, 0.0:2]) + assert_raises(TypeError, lambda: a[0.0::2, :0]) + assert_raises(TypeError, lambda: a[0.0:1:2,:]) + assert_raises(TypeError, lambda: a[:, 0.0:]) + # stop as float. + assert_raises(TypeError, lambda: a[:0.0]) + assert_raises(TypeError, lambda: a[:0, 1:2.0]) + assert_raises(TypeError, lambda: a[:0.0:2, :0]) + assert_raises(TypeError, lambda: a[:0.0,:]) + assert_raises(TypeError, lambda: a[:, 0:4.0:2]) + # step as float. + assert_raises(TypeError, lambda: a[::1.0]) + assert_raises(TypeError, lambda: a[0:, :2:2.0]) + assert_raises(TypeError, lambda: a[1::4.0, :0]) + assert_raises(TypeError, lambda: a[::5.0,:]) + assert_raises(TypeError, lambda: a[:, 0:4:2.0]) + # mixed. + assert_raises(TypeError, lambda: a[1.0:2:2.0]) + assert_raises(TypeError, lambda: a[1.0::2.0]) + assert_raises(TypeError, lambda: a[0:, :2.0:2.0]) + assert_raises(TypeError, lambda: a[1.0:1:4.0, :0]) + assert_raises(TypeError, lambda: a[1.0:5.0:5.0,:]) + assert_raises(TypeError, lambda: a[:, 0.4:4.0:2.0]) + # should still get the DeprecationWarning if step = 0. + assert_raises(TypeError, lambda: a[::0.0]) + + def test_index_no_array_to_index(self): + # No non-scalar arrays. + a = np.array([[[1]]]) + + assert_raises(TypeError, lambda: a[a:a:a]) + + def test_none_index(self): + # `None` index adds newaxis + a = np.array([1, 2, 3]) + assert_equal(a[None], a[np.newaxis]) + assert_equal(a[None].ndim, a.ndim + 1) + + def test_empty_tuple_index(self): + # Empty tuple index creates a view + a = np.array([1, 2, 3]) + assert_equal(a[()], a) + assert_(a[()].base is a) + a = np.array(0) + assert_(isinstance(a[()], np.int_)) + + def test_void_scalar_empty_tuple(self): + s = np.zeros((), dtype='V4') + assert_equal(s[()].dtype, s.dtype) + assert_equal(s[()], s) + assert_equal(type(s[...]), np.ndarray) + + def test_same_kind_index_casting(self): + # Indexes should be cast with same-kind and not safe, even if that + # is somewhat unsafe. So test various different code paths. + index = np.arange(5) + u_index = index.astype(np.uintp) + arr = np.arange(10) + + assert_array_equal(arr[index], arr[u_index]) + arr[u_index] = np.arange(5) + assert_array_equal(arr, np.arange(10)) + + arr = np.arange(10).reshape(5, 2) + assert_array_equal(arr[index], arr[u_index]) + + arr[u_index] = np.arange(5)[:,None] + assert_array_equal(arr, np.arange(5)[:,None].repeat(2, axis=1)) + + arr = np.arange(25).reshape(5, 5) + assert_array_equal(arr[u_index, u_index], arr[index, index]) + + def test_empty_fancy_index(self): + # Empty list index creates an empty array + # with the same dtype (but with weird shape) + a = np.array([1, 2, 3]) + assert_equal(a[[]], []) + assert_equal(a[[]].dtype, a.dtype) + + b = np.array([], dtype=np.intp) + assert_equal(a[[]], []) + assert_equal(a[[]].dtype, a.dtype) + + b = np.array([]) + assert_raises(IndexError, a.__getitem__, b) + + def test_gh_26542(self): + a = np.array([0, 1, 2]) + idx = np.array([2, 1, 0]) + a[idx] = a + expected = np.array([2, 1, 0]) + assert_equal(a, expected) + + def test_gh_26542_2d(self): + a = np.array([[0, 1, 2]]) + idx_row = np.zeros(3, dtype=int) + idx_col = np.array([2, 1, 0]) + a[idx_row, idx_col] = a + expected = np.array([[2, 1, 0]]) + assert_equal(a, expected) + + def test_gh_26542_index_overlap(self): + arr = np.arange(100) + expected_vals = np.copy(arr[:-10]) + arr[10:] = arr[:-10] + actual_vals = arr[10:] + assert_equal(actual_vals, expected_vals) + + def test_ellipsis_index(self): + a = np.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + assert_(a[...] is not a) + assert_equal(a[...], a) + # `a[...]` was `a` in numpy <1.9. + assert_(a[...].base is a) + + # Slicing with ellipsis can skip an + # arbitrary number of dimensions + assert_equal(a[0, ...], a[0]) + assert_equal(a[0, ...], a[0,:]) + assert_equal(a[..., 0], a[:, 0]) + + # Slicing with ellipsis always results + # in an array, not a scalar + assert_equal(a[0, ..., 1], np.array(2)) + + # Assignment with `(Ellipsis,)` on 0-d arrays + b = np.array(1) + b[(Ellipsis,)] = 2 + assert_equal(b, 2) + + def test_single_int_index(self): + # Single integer index selects one row + a = np.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + + assert_equal(a[0], [1, 2, 3]) + assert_equal(a[-1], [7, 8, 9]) + + # Index out of bounds produces IndexError + assert_raises(IndexError, a.__getitem__, 1 << 30) + # Index overflow produces IndexError + assert_raises(IndexError, a.__getitem__, 1 << 64) + + def test_single_bool_index(self): + # Single boolean index + a = np.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + + assert_equal(a[np.array(True)], a[None]) + assert_equal(a[np.array(False)], a[None][0:0]) + + def test_boolean_shape_mismatch(self): + arr = np.ones((5, 4, 3)) + + index = np.array([True]) + assert_raises(IndexError, arr.__getitem__, index) + + index = np.array([False] * 6) + assert_raises(IndexError, arr.__getitem__, index) + + index = np.zeros((4, 4), dtype=bool) + assert_raises(IndexError, arr.__getitem__, index) + + assert_raises(IndexError, arr.__getitem__, (slice(None), index)) + + def test_boolean_indexing_onedim(self): + # Indexing a 2-dimensional array with + # boolean array of length one + a = np.array([[ 0., 0., 0.]]) + b = np.array([ True], dtype=bool) + assert_equal(a[b], a) + # boolean assignment + a[b] = 1. + assert_equal(a, [[1., 1., 1.]]) + + def test_boolean_assignment_value_mismatch(self): + # A boolean assignment should fail when the shape of the values + # cannot be broadcast to the subscription. (see also gh-3458) + a = np.arange(4) + + def f(a, v): + a[a > -1] = v + + assert_raises(ValueError, f, a, []) + assert_raises(ValueError, f, a, [1, 2, 3]) + assert_raises(ValueError, f, a[:1], [1, 2, 3]) + + def test_boolean_assignment_needs_api(self): + # See also gh-7666 + # This caused a segfault on Python 2 due to the GIL not being + # held when the iterator does not need it, but the transfer function + # does + arr = np.zeros(1000) + indx = np.zeros(1000, dtype=bool) + indx[:100] = True + arr[indx] = np.ones(100, dtype=object) + + expected = np.zeros(1000) + expected[:100] = 1 + assert_array_equal(arr, expected) + + def test_boolean_indexing_twodim(self): + # Indexing a 2-dimensional array with + # 2-dimensional boolean array + a = np.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + b = np.array([[ True, False, True], + [False, True, False], + [ True, False, True]]) + assert_equal(a[b], [1, 3, 5, 7, 9]) + assert_equal(a[b[1]], [[4, 5, 6]]) + assert_equal(a[b[0]], a[b[2]]) + + # boolean assignment + a[b] = 0 + assert_equal(a, [[0, 2, 0], + [4, 0, 6], + [0, 8, 0]]) + + def test_boolean_indexing_list(self): + # Regression test for #13715. It's a use-after-free bug which the + # test won't directly catch, but it will show up in valgrind. + a = np.array([1, 2, 3]) + b = [True, False, True] + # Two variants of the test because the first takes a fast path + assert_equal(a[b], [1, 3]) + assert_equal(a[None, b], [[1, 3]]) + + def test_reverse_strides_and_subspace_bufferinit(self): + # This tests that the strides are not reversed for simple and + # subspace fancy indexing. + a = np.ones(5) + b = np.zeros(5, dtype=np.intp)[::-1] + c = np.arange(5)[::-1] + + a[b] = c + # If the strides are not reversed, the 0 in the arange comes last. + assert_equal(a[0], 0) + + # This also tests that the subspace buffer is initialized: + a = np.ones((5, 2)) + c = np.arange(10).reshape(5, 2)[::-1] + a[b, :] = c + assert_equal(a[0], [0, 1]) + + def test_reversed_strides_result_allocation(self): + # Test a bug when calculating the output strides for a result array + # when the subspace size was 1 (and test other cases as well) + a = np.arange(10)[:, None] + i = np.arange(10)[::-1] + assert_array_equal(a[i], a[i.copy('C')]) + + a = np.arange(20).reshape(-1, 2) + + def test_uncontiguous_subspace_assignment(self): + # During development there was a bug activating a skip logic + # based on ndim instead of size. + a = np.full((3, 4, 2), -1) + b = np.full((3, 4, 2), -1) + + a[[0, 1]] = np.arange(2 * 4 * 2).reshape(2, 4, 2).T + b[[0, 1]] = np.arange(2 * 4 * 2).reshape(2, 4, 2).T.copy() + + assert_equal(a, b) + + def test_too_many_fancy_indices_special_case(self): + # Just documents behaviour, this is a small limitation. + a = np.ones((1,) * 64) # 64 is NPY_MAXDIMS + assert_raises(IndexError, a.__getitem__, (np.array([0]),) * 64) + + def test_scalar_array_bool(self): + # NumPy bools can be used as boolean index (python ones as of yet not) + a = np.array(1) + assert_equal(a[np.bool(True)], a[np.array(True)]) + assert_equal(a[np.bool(False)], a[np.array(False)]) + + # After deprecating bools as integers: + #a = np.array([0,1,2]) + #assert_equal(a[True, :], a[None, :]) + #assert_equal(a[:, True], a[:, None]) + # + #assert_(not np.may_share_memory(a, a[True, :])) + + def test_everything_returns_views(self): + # Before `...` would return a itself. + a = np.arange(5) + + assert_(a is not a[()]) + assert_(a is not a[...]) + assert_(a is not a[:]) + + def test_broaderrors_indexing(self): + a = np.zeros((5, 5)) + assert_raises(IndexError, a.__getitem__, ([0, 1], [0, 1, 2])) + assert_raises(IndexError, a.__setitem__, ([0, 1], [0, 1, 2]), 0) + + def test_trivial_fancy_out_of_bounds(self): + a = np.zeros(5) + ind = np.ones(20, dtype=np.intp) + ind[-1] = 10 + assert_raises(IndexError, a.__getitem__, ind) + assert_raises(IndexError, a.__setitem__, ind, 0) + ind = np.ones(20, dtype=np.intp) + ind[0] = 11 + assert_raises(IndexError, a.__getitem__, ind) + assert_raises(IndexError, a.__setitem__, ind, 0) + + def test_trivial_fancy_not_possible(self): + # Test that the fast path for trivial assignment is not incorrectly + # used when the index is not contiguous or 1D, see also gh-11467. + a = np.arange(6) + idx = np.arange(6, dtype=np.intp).reshape(2, 1, 3)[:, :, 0] + assert_array_equal(a[idx], idx) + + # this case must not go into the fast path, note that idx is + # a non-contiuguous none 1D array here. + a[idx] = -1 + res = np.arange(6) + res[0] = -1 + res[3] = -1 + assert_array_equal(a, res) + + def test_nonbaseclass_values(self): + class SubClass(np.ndarray): + def __array_finalize__(self, old): + # Have array finalize do funny things + self.fill(99) + + a = np.zeros((5, 5)) + s = a.copy().view(type=SubClass) + s.fill(1) + + a[[0, 1, 2, 3, 4], :] = s + assert_((a == 1).all()) + + # Subspace is last, so transposing might want to finalize + a[:, [0, 1, 2, 3, 4]] = s + assert_((a == 1).all()) + + a.fill(0) + a[...] = s + assert_((a == 1).all()) + + def test_array_like_values(self): + # Similar to the above test, but use a memoryview instead + a = np.zeros((5, 5)) + s = np.arange(25, dtype=np.float64).reshape(5, 5) + + a[[0, 1, 2, 3, 4], :] = memoryview(s) + assert_array_equal(a, s) + + a[:, [0, 1, 2, 3, 4]] = memoryview(s) + assert_array_equal(a, s) + + a[...] = memoryview(s) + assert_array_equal(a, s) + + def test_subclass_writeable(self): + d = np.rec.array([('NGC1001', 11), ('NGC1002', 1.), ('NGC1003', 1.)], + dtype=[('target', 'S20'), ('V_mag', '>f4')]) + ind = np.array([False, True, True], dtype=bool) + assert_(d[ind].flags.writeable) + ind = np.array([0, 1]) + assert_(d[ind].flags.writeable) + assert_(d[...].flags.writeable) + assert_(d[0].flags.writeable) + + def test_memory_order(self): + # This is not necessary to preserve. Memory layouts for + # more complex indices are not as simple. + a = np.arange(10) + b = np.arange(10).reshape(5,2).T + assert_(a[b].flags.f_contiguous) + + # Takes a different implementation branch: + a = a.reshape(-1, 1) + assert_(a[b, 0].flags.f_contiguous) + + def test_scalar_return_type(self): + # Full scalar indices should return scalars and object + # arrays should not call PyArray_Return on their items + class Zero: + # The most basic valid indexing + def __index__(self): + return 0 + + z = Zero() + + class ArrayLike: + # Simple array, should behave like the array + def __array__(self, dtype=None, copy=None): + return np.array(0) + + a = np.zeros(()) + assert_(isinstance(a[()], np.float64)) + a = np.zeros(1) + assert_(isinstance(a[z], np.float64)) + a = np.zeros((1, 1)) + assert_(isinstance(a[z, np.array(0)], np.float64)) + assert_(isinstance(a[z, ArrayLike()], np.float64)) + + # And object arrays do not call it too often: + b = np.array(0) + a = np.array(0, dtype=object) + a[()] = b + assert_(isinstance(a[()], np.ndarray)) + a = np.array([b, None]) + assert_(isinstance(a[z], np.ndarray)) + a = np.array([[b, None]]) + assert_(isinstance(a[z, np.array(0)], np.ndarray)) + assert_(isinstance(a[z, ArrayLike()], np.ndarray)) + + def test_small_regressions(self): + # Reference count of intp for index checks + a = np.array([0]) + if HAS_REFCOUNT: + refcount = sys.getrefcount(np.dtype(np.intp)) + # item setting always checks indices in separate function: + a[np.array([0], dtype=np.intp)] = 1 + a[np.array([0], dtype=np.uint8)] = 1 + assert_raises(IndexError, a.__setitem__, + np.array([1], dtype=np.intp), 1) + assert_raises(IndexError, a.__setitem__, + np.array([1], dtype=np.uint8), 1) + + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(np.dtype(np.intp)), refcount) + + def test_unaligned(self): + v = (np.zeros(64, dtype=np.int8) + ord('a'))[1:-7] + d = v.view(np.dtype("S8")) + # unaligned source + x = (np.zeros(16, dtype=np.int8) + ord('a'))[1:-7] + x = x.view(np.dtype("S8")) + x[...] = np.array("b" * 8, dtype="S") + b = np.arange(d.size) + #trivial + assert_equal(d[b], d) + d[b] = x + # nontrivial + # unaligned index array + b = np.zeros(d.size + 1).view(np.int8)[1:-(np.intp(0).itemsize - 1)] + b = b.view(np.intp)[:d.size] + b[...] = np.arange(d.size) + assert_equal(d[b.astype(np.int16)], d) + d[b.astype(np.int16)] = x + # boolean + d[b % 2 == 0] + d[b % 2 == 0] = x[::2] + + def test_tuple_subclass(self): + arr = np.ones((5, 5)) + + # A tuple subclass should also be an nd-index + class TupleSubclass(tuple): + pass + index = ([1], [1]) + index = TupleSubclass(index) + assert_(arr[index].shape == (1,)) + # Unlike the non nd-index: + assert_(arr[index,].shape != (1,)) + + def test_broken_sequence_not_nd_index(self): + # See gh-5063: + # If we have an object which claims to be a sequence, but fails + # on item getting, this should not be converted to an nd-index (tuple) + # If this object happens to be a valid index otherwise, it should work + # This object here is very dubious and probably bad though: + class SequenceLike: + def __index__(self): + return 0 + + def __len__(self): + return 1 + + def __getitem__(self, item): + raise IndexError('Not possible') + + arr = np.arange(10) + assert_array_equal(arr[SequenceLike()], arr[SequenceLike(),]) + + # also test that field indexing does not segfault + # for a similar reason, by indexing a structured array + arr = np.zeros((1,), dtype=[('f1', 'i8'), ('f2', 'i8')]) + assert_array_equal(arr[SequenceLike()], arr[SequenceLike(),]) + + def test_indexing_array_weird_strides(self): + # See also gh-6221 + # the shapes used here come from the issue and create the correct + # size for the iterator buffering size. + x = np.ones(10) + x2 = np.ones((10, 2)) + ind = np.arange(10)[:, None, None, None] + ind = np.broadcast_to(ind, (10, 55, 4, 4)) + + # single advanced index case + assert_array_equal(x[ind], x[ind.copy()]) + # higher dimensional advanced index + zind = np.zeros(4, dtype=np.intp) + assert_array_equal(x2[ind, zind], x2[ind.copy(), zind]) + + def test_indexing_array_negative_strides(self): + # From gh-8264, + # core dumps if negative strides are used in iteration + arro = np.zeros((4, 4)) + arr = arro[::-1, ::-1] + + slices = (slice(None), [0, 1, 2, 3]) + arr[slices] = 10 + assert_array_equal(arr, 10.) + + def test_character_assignment(self): + # This is an example a function going through CopyObject which + # used to have an untested special path for scalars + # (the character special dtype case, should be deprecated probably) + arr = np.zeros((1, 5), dtype="c") + arr[0] = np.str_("asdfg") # must assign as a sequence + assert_array_equal(arr[0], np.array("asdfg", dtype="c")) + assert arr[0, 1] == b"s" # make sure not all were set to "a" for both + + @pytest.mark.parametrize("index", + [True, False, np.array([0])]) + @pytest.mark.parametrize("num", [64, 80]) + @pytest.mark.parametrize("original_ndim", [1, 64]) + def test_too_many_advanced_indices(self, index, num, original_ndim): + # These are limitations based on the number of arguments we can process. + # For `num=32` (and all boolean cases), the result is actually define; + # but the use of NpyIter (NPY_MAXARGS) limits it for technical reasons. + arr = np.ones((1,) * original_ndim) + with pytest.raises(IndexError): + arr[(index,) * num] + with pytest.raises(IndexError): + arr[(index,) * num] = 1. + + @pytest.mark.skipif(IS_WASM, reason="no threading") + def test_structured_advanced_indexing(self): + # Test that copyswap(n) used by integer array indexing is threadsafe + # for structured datatypes, see gh-15387. This test can behave randomly. + from concurrent.futures import ThreadPoolExecutor + + # Create a deeply nested dtype to make a failure more likely: + dt = np.dtype([("", "f8")]) + dt = np.dtype([("", dt)] * 2) + dt = np.dtype([("", dt)] * 2) + # The array should be large enough to likely run into threading issues + arr = np.random.uniform(size=(6000, 8)).view(dt)[:, 0] + + rng = np.random.default_rng() + def func(arr): + indx = rng.integers(0, len(arr), size=6000, dtype=np.intp) + arr[indx] + + tpe = ThreadPoolExecutor(max_workers=8) + futures = [tpe.submit(func, arr) for _ in range(10)] + for f in futures: + f.result() + + assert arr.dtype is dt + + def test_nontuple_ndindex(self): + a = np.arange(25).reshape((5, 5)) + assert_equal(a[[0, 1]], np.array([a[0], a[1]])) + assert_equal(a[[0, 1], [0, 1]], np.array([0, 6])) + assert_raises(IndexError, a.__getitem__, [slice(None)]) + + +class TestFieldIndexing: + def test_scalar_return_type(self): + # Field access on an array should return an array, even if it + # is 0-d. + a = np.zeros((), [('a','f8')]) + assert_(isinstance(a['a'], np.ndarray)) + assert_(isinstance(a[['a']], np.ndarray)) + + +class TestBroadcastedAssignments: + def assign(self, a, ind, val): + a[ind] = val + return a + + def test_prepending_ones(self): + a = np.zeros((3, 2)) + + a[...] = np.ones((1, 3, 2)) + # Fancy with subspace with and without transpose + a[[0, 1, 2], :] = np.ones((1, 3, 2)) + a[:, [0, 1]] = np.ones((1, 3, 2)) + # Fancy without subspace (with broadcasting) + a[[[0], [1], [2]], [0, 1]] = np.ones((1, 3, 2)) + + def test_prepend_not_one(self): + assign = self.assign + s_ = np.s_ + a = np.zeros(5) + + # Too large and not only ones. + assert_raises(ValueError, assign, a, s_[...], np.ones((2, 1))) + assert_raises(ValueError, assign, a, s_[[1, 2, 3],], np.ones((2, 1))) + assert_raises(ValueError, assign, a, s_[[[1], [2]],], np.ones((2,2,1))) + + def test_simple_broadcasting_errors(self): + assign = self.assign + s_ = np.s_ + a = np.zeros((5, 1)) + + assert_raises(ValueError, assign, a, s_[...], np.zeros((5, 2))) + assert_raises(ValueError, assign, a, s_[...], np.zeros((5, 0))) + assert_raises(ValueError, assign, a, s_[:, [0]], np.zeros((5, 2))) + assert_raises(ValueError, assign, a, s_[:, [0]], np.zeros((5, 0))) + assert_raises(ValueError, assign, a, s_[[0], :], np.zeros((2, 1))) + + @pytest.mark.parametrize("index", [ + (..., [1, 2], slice(None)), + ([0, 1], ..., 0), + (..., [1, 2], [1, 2])]) + def test_broadcast_error_reports_correct_shape(self, index): + values = np.zeros((100, 100)) # will never broadcast below + + arr = np.zeros((3, 4, 5, 6, 7)) + # We currently report without any spaces (could be changed) + shape_str = str(arr[index].shape).replace(" ", "") + + with pytest.raises(ValueError) as e: + arr[index] = values + + assert str(e.value).endswith(shape_str) + + def test_index_is_larger(self): + # Simple case of fancy index broadcasting of the index. + a = np.zeros((5, 5)) + a[[[0], [1], [2]], [0, 1, 2]] = [2, 3, 4] + + assert_((a[:3, :3] == [2, 3, 4]).all()) + + def test_broadcast_subspace(self): + a = np.zeros((100, 100)) + v = np.arange(100)[:,None] + b = np.arange(100)[::-1] + a[b] = v + assert_((a[::-1] == v).all()) + + +class TestSubclasses: + def test_basic(self): + # Test that indexing in various ways produces SubClass instances, + # and that the base is set up correctly: the original subclass + # instance for views, and a new ndarray for advanced/boolean indexing + # where a copy was made (latter a regression test for gh-11983). + class SubClass(np.ndarray): + pass + + a = np.arange(5) + s = a.view(SubClass) + s_slice = s[:3] + assert_(type(s_slice) is SubClass) + assert_(s_slice.base is s) + assert_array_equal(s_slice, a[:3]) + + s_fancy = s[[0, 1, 2]] + assert_(type(s_fancy) is SubClass) + assert_(s_fancy.base is not s) + assert_(type(s_fancy.base) is np.ndarray) + assert_array_equal(s_fancy, a[[0, 1, 2]]) + assert_array_equal(s_fancy.base, a[[0, 1, 2]]) + + s_bool = s[s > 0] + assert_(type(s_bool) is SubClass) + assert_(s_bool.base is not s) + assert_(type(s_bool.base) is np.ndarray) + assert_array_equal(s_bool, a[a > 0]) + assert_array_equal(s_bool.base, a[a > 0]) + + def test_fancy_on_read_only(self): + # Test that fancy indexing on read-only SubClass does not make a + # read-only copy (gh-14132) + class SubClass(np.ndarray): + pass + + a = np.arange(5) + s = a.view(SubClass) + s.flags.writeable = False + s_fancy = s[[0, 1, 2]] + assert_(s_fancy.flags.writeable) + + + def test_finalize_gets_full_info(self): + # Array finalize should be called on the filled array. + class SubClass(np.ndarray): + def __array_finalize__(self, old): + self.finalize_status = np.array(self) + self.old = old + + s = np.arange(10).view(SubClass) + new_s = s[:3] + assert_array_equal(new_s.finalize_status, new_s) + assert_array_equal(new_s.old, s) + + new_s = s[[0,1,2,3]] + assert_array_equal(new_s.finalize_status, new_s) + assert_array_equal(new_s.old, s) + + new_s = s[s > 0] + assert_array_equal(new_s.finalize_status, new_s) + assert_array_equal(new_s.old, s) + + +class TestFancyIndexingCast: + def test_boolean_index_cast_assign(self): + # Setup the boolean index and float arrays. + shape = (8, 63) + bool_index = np.zeros(shape).astype(bool) + bool_index[0, 1] = True + zero_array = np.zeros(shape) + + # Assigning float is fine. + zero_array[bool_index] = np.array([1]) + assert_equal(zero_array[0, 1], 1) + + # Fancy indexing works, although we get a cast warning. + assert_warns(ComplexWarning, + zero_array.__setitem__, ([0], [1]), np.array([2 + 1j])) + assert_equal(zero_array[0, 1], 2) # No complex part + + # Cast complex to float, throwing away the imaginary portion. + assert_warns(ComplexWarning, + zero_array.__setitem__, bool_index, np.array([1j])) + assert_equal(zero_array[0, 1], 0) + +class TestFancyIndexingEquivalence: + def test_object_assign(self): + # Check that the field and object special case using copyto is active. + # The right hand side cannot be converted to an array here. + a = np.arange(5, dtype=object) + b = a.copy() + a[:3] = [1, (1,2), 3] + b[[0, 1, 2]] = [1, (1,2), 3] + assert_array_equal(a, b) + + # test same for subspace fancy indexing + b = np.arange(5, dtype=object)[None, :] + b[[0], :3] = [[1, (1,2), 3]] + assert_array_equal(a, b[0]) + + # Check that swapping of axes works. + # There was a bug that made the later assignment throw a ValueError + # do to an incorrectly transposed temporary right hand side (gh-5714) + b = b.T + b[:3, [0]] = [[1], [(1,2)], [3]] + assert_array_equal(a, b[:, 0]) + + # Another test for the memory order of the subspace + arr = np.ones((3, 4, 5), dtype=object) + # Equivalent slicing assignment for comparison + cmp_arr = arr.copy() + cmp_arr[:1, ...] = [[[1], [2], [3], [4]]] + arr[[0], ...] = [[[1], [2], [3], [4]]] + assert_array_equal(arr, cmp_arr) + arr = arr.copy('F') + arr[[0], ...] = [[[1], [2], [3], [4]]] + assert_array_equal(arr, cmp_arr) + + def test_cast_equivalence(self): + # Yes, normal slicing uses unsafe casting. + a = np.arange(5) + b = a.copy() + + a[:3] = np.array(['2', '-3', '-1']) + b[[0, 2, 1]] = np.array(['2', '-1', '-3']) + assert_array_equal(a, b) + + # test the same for subspace fancy indexing + b = np.arange(5)[None, :] + b[[0], :3] = np.array([['2', '-3', '-1']]) + assert_array_equal(a, b[0]) + + +class TestMultiIndexingAutomated: + """ + These tests use code to mimic the C-Code indexing for selection. + + NOTE: + + * This still lacks tests for complex item setting. + * If you change behavior of indexing, you might want to modify + these tests to try more combinations. + * Behavior was written to match numpy version 1.8. (though a + first version matched 1.7.) + * Only tuple indices are supported by the mimicking code. + (and tested as of writing this) + * Error types should match most of the time as long as there + is only one error. For multiple errors, what gets raised + will usually not be the same one. They are *not* tested. + + Update 2016-11-30: It is probably not worth maintaining this test + indefinitely and it can be dropped if maintenance becomes a burden. + + """ + + def setup_method(self): + self.a = np.arange(np.prod([3, 1, 5, 6])).reshape(3, 1, 5, 6) + self.b = np.empty((3, 0, 5, 6)) + self.complex_indices = ['skip', Ellipsis, + 0, + # Boolean indices, up to 3-d for some special cases of eating up + # dimensions, also need to test all False + np.array([True, False, False]), + np.array([[True, False], [False, True]]), + np.array([[[False, False], [False, False]]]), + # Some slices: + slice(-5, 5, 2), + slice(1, 1, 100), + slice(4, -1, -2), + slice(None, None, -3), + # Some Fancy indexes: + np.empty((0, 1, 1), dtype=np.intp), # empty and can be broadcast + np.array([0, 1, -2]), + np.array([[2], [0], [1]]), + np.array([[0, -1], [0, 1]], dtype=np.dtype('intp').newbyteorder()), + np.array([2, -1], dtype=np.int8), + np.zeros([1]*31, dtype=int), # trigger too large array. + np.array([0., 1.])] # invalid datatype + # Some simpler indices that still cover a bit more + self.simple_indices = [Ellipsis, None, -1, [1], np.array([True]), + 'skip'] + # Very simple ones to fill the rest: + self.fill_indices = [slice(None, None), 0] + + def _get_multi_index(self, arr, indices): + """Mimic multi dimensional indexing. + + Parameters + ---------- + arr : ndarray + Array to be indexed. + indices : tuple of index objects + + Returns + ------- + out : ndarray + An array equivalent to the indexing operation (but always a copy). + `arr[indices]` should be identical. + no_copy : bool + Whether the indexing operation requires a copy. If this is `True`, + `np.may_share_memory(arr, arr[indices])` should be `True` (with + some exceptions for scalars and possibly 0-d arrays). + + Notes + ----- + While the function may mostly match the errors of normal indexing this + is generally not the case. + """ + in_indices = list(indices) + indices = [] + # if False, this is a fancy or boolean index + no_copy = True + # number of fancy/scalar indexes that are not consecutive + num_fancy = 0 + # number of dimensions indexed by a "fancy" index + fancy_dim = 0 + # NOTE: This is a funny twist (and probably OK to change). + # The boolean array has illegal indexes, but this is + # allowed if the broadcast fancy-indices are 0-sized. + # This variable is to catch that case. + error_unless_broadcast_to_empty = False + + # We need to handle Ellipsis and make arrays from indices, also + # check if this is fancy indexing (set no_copy). + ndim = 0 + ellipsis_pos = None # define here mostly to replace all but first. + for i, indx in enumerate(in_indices): + if indx is None: + continue + if isinstance(indx, np.ndarray) and indx.dtype == bool: + no_copy = False + if indx.ndim == 0: + raise IndexError + # boolean indices can have higher dimensions + ndim += indx.ndim + fancy_dim += indx.ndim + continue + if indx is Ellipsis: + if ellipsis_pos is None: + ellipsis_pos = i + continue # do not increment ndim counter + raise IndexError + if isinstance(indx, slice): + ndim += 1 + continue + if not isinstance(indx, np.ndarray): + # This could be open for changes in numpy. + # numpy should maybe raise an error if casting to intp + # is not safe. It rejects np.array([1., 2.]) but not + # [1., 2.] as index (same for ie. np.take). + # (Note the importance of empty lists if changing this here) + try: + indx = np.array(indx, dtype=np.intp) + except ValueError: + raise IndexError + in_indices[i] = indx + elif indx.dtype.kind != 'b' and indx.dtype.kind != 'i': + raise IndexError('arrays used as indices must be of ' + 'integer (or boolean) type') + if indx.ndim != 0: + no_copy = False + ndim += 1 + fancy_dim += 1 + + if arr.ndim - ndim < 0: + # we can't take more dimensions then we have, not even for 0-d + # arrays. since a[()] makes sense, but not a[(),]. We will + # raise an error later on, unless a broadcasting error occurs + # first. + raise IndexError + + if ndim == 0 and None not in in_indices: + # Well we have no indexes or one Ellipsis. This is legal. + return arr.copy(), no_copy + + if ellipsis_pos is not None: + in_indices[ellipsis_pos:ellipsis_pos+1] = ([slice(None, None)] * + (arr.ndim - ndim)) + + for ax, indx in enumerate(in_indices): + if isinstance(indx, slice): + # convert to an index array + indx = np.arange(*indx.indices(arr.shape[ax])) + indices.append(['s', indx]) + continue + elif indx is None: + # this is like taking a slice with one element from a new axis: + indices.append(['n', np.array([0], dtype=np.intp)]) + arr = arr.reshape(arr.shape[:ax] + (1,) + arr.shape[ax:]) + continue + if isinstance(indx, np.ndarray) and indx.dtype == bool: + if indx.shape != arr.shape[ax:ax+indx.ndim]: + raise IndexError + + try: + flat_indx = np.ravel_multi_index(np.nonzero(indx), + arr.shape[ax:ax+indx.ndim], mode='raise') + except Exception: + error_unless_broadcast_to_empty = True + # fill with 0s instead, and raise error later + flat_indx = np.array([0]*indx.sum(), dtype=np.intp) + # concatenate axis into a single one: + if indx.ndim != 0: + arr = arr.reshape(arr.shape[:ax] + + (np.prod(arr.shape[ax:ax+indx.ndim]),) + + arr.shape[ax+indx.ndim:]) + indx = flat_indx + else: + # This could be changed, a 0-d boolean index can + # make sense (even outside the 0-d indexed array case) + # Note that originally this is could be interpreted as + # integer in the full integer special case. + raise IndexError + else: + # If the index is a singleton, the bounds check is done + # before the broadcasting. This used to be different in <1.9 + if indx.ndim == 0: + if indx >= arr.shape[ax] or indx < -arr.shape[ax]: + raise IndexError + if indx.ndim == 0: + # The index is a scalar. This used to be two fold, but if + # fancy indexing was active, the check was done later, + # possibly after broadcasting it away (1.7. or earlier). + # Now it is always done. + if indx >= arr.shape[ax] or indx < - arr.shape[ax]: + raise IndexError + if (len(indices) > 0 and + indices[-1][0] == 'f' and + ax != ellipsis_pos): + # NOTE: There could still have been a 0-sized Ellipsis + # between them. Checked that with ellipsis_pos. + indices[-1].append(indx) + else: + # We have a fancy index that is not after an existing one. + # NOTE: A 0-d array triggers this as well, while one may + # expect it to not trigger it, since a scalar would not be + # considered fancy indexing. + num_fancy += 1 + indices.append(['f', indx]) + + if num_fancy > 1 and not no_copy: + # We have to flush the fancy indexes left + new_indices = indices[:] + axes = list(range(arr.ndim)) + fancy_axes = [] + new_indices.insert(0, ['f']) + ni = 0 + ai = 0 + for indx in indices: + ni += 1 + if indx[0] == 'f': + new_indices[0].extend(indx[1:]) + del new_indices[ni] + ni -= 1 + for ax in range(ai, ai + len(indx[1:])): + fancy_axes.append(ax) + axes.remove(ax) + ai += len(indx) - 1 # axis we are at + indices = new_indices + # and now we need to transpose arr: + arr = arr.transpose(*(fancy_axes + axes)) + + # We only have one 'f' index now and arr is transposed accordingly. + # Now handle newaxis by reshaping... + ax = 0 + for indx in indices: + if indx[0] == 'f': + if len(indx) == 1: + continue + # First of all, reshape arr to combine fancy axes into one: + orig_shape = arr.shape + orig_slice = orig_shape[ax:ax + len(indx[1:])] + arr = arr.reshape(arr.shape[:ax] + + (np.prod(orig_slice).astype(int),) + + arr.shape[ax + len(indx[1:]):]) + + # Check if broadcasting works + res = np.broadcast(*indx[1:]) + # unfortunately the indices might be out of bounds. So check + # that first, and use mode='wrap' then. However only if + # there are any indices... + if res.size != 0: + if error_unless_broadcast_to_empty: + raise IndexError + for _indx, _size in zip(indx[1:], orig_slice): + if _indx.size == 0: + continue + if np.any(_indx >= _size) or np.any(_indx < -_size): + raise IndexError + if len(indx[1:]) == len(orig_slice): + if np.prod(orig_slice) == 0: + # Work around for a crash or IndexError with 'wrap' + # in some 0-sized cases. + try: + mi = np.ravel_multi_index(indx[1:], orig_slice, + mode='raise') + except Exception: + # This happens with 0-sized orig_slice (sometimes?) + # here it is a ValueError, but indexing gives a: + raise IndexError('invalid index into 0-sized') + else: + mi = np.ravel_multi_index(indx[1:], orig_slice, + mode='wrap') + else: + # Maybe never happens... + raise ValueError + arr = arr.take(mi.ravel(), axis=ax) + try: + arr = arr.reshape(arr.shape[:ax] + + mi.shape + + arr.shape[ax+1:]) + except ValueError: + # too many dimensions, probably + raise IndexError + ax += mi.ndim + continue + + # If we are here, we have a 1D array for take: + arr = arr.take(indx[1], axis=ax) + ax += 1 + + return arr, no_copy + + def _check_multi_index(self, arr, index): + """Check a multi index item getting and simple setting. + + Parameters + ---------- + arr : ndarray + Array to be indexed, must be a reshaped arange. + index : tuple of indexing objects + Index being tested. + """ + # Test item getting + try: + mimic_get, no_copy = self._get_multi_index(arr, index) + except Exception as e: + if HAS_REFCOUNT: + prev_refcount = sys.getrefcount(arr) + assert_raises(type(e), arr.__getitem__, index) + assert_raises(type(e), arr.__setitem__, index, 0) + if HAS_REFCOUNT: + assert_equal(prev_refcount, sys.getrefcount(arr)) + return + + self._compare_index_result(arr, index, mimic_get, no_copy) + + def _check_single_index(self, arr, index): + """Check a single index item getting and simple setting. + + Parameters + ---------- + arr : ndarray + Array to be indexed, must be an arange. + index : indexing object + Index being tested. Must be a single index and not a tuple + of indexing objects (see also `_check_multi_index`). + """ + try: + mimic_get, no_copy = self._get_multi_index(arr, (index,)) + except Exception as e: + if HAS_REFCOUNT: + prev_refcount = sys.getrefcount(arr) + assert_raises(type(e), arr.__getitem__, index) + assert_raises(type(e), arr.__setitem__, index, 0) + if HAS_REFCOUNT: + assert_equal(prev_refcount, sys.getrefcount(arr)) + return + + self._compare_index_result(arr, index, mimic_get, no_copy) + + def _compare_index_result(self, arr, index, mimic_get, no_copy): + """Compare mimicked result to indexing result. + """ + arr = arr.copy() + indexed_arr = arr[index] + assert_array_equal(indexed_arr, mimic_get) + # Check if we got a view, unless its a 0-sized or 0-d array. + # (then its not a view, and that does not matter) + if indexed_arr.size != 0 and indexed_arr.ndim != 0: + assert_(np.may_share_memory(indexed_arr, arr) == no_copy) + # Check reference count of the original array + if HAS_REFCOUNT: + if no_copy: + # refcount increases by one: + assert_equal(sys.getrefcount(arr), 3) + else: + assert_equal(sys.getrefcount(arr), 2) + + # Test non-broadcast setitem: + b = arr.copy() + b[index] = mimic_get + 1000 + if b.size == 0: + return # nothing to compare here... + if no_copy and indexed_arr.ndim != 0: + # change indexed_arr in-place to manipulate original: + indexed_arr += 1000 + assert_array_equal(arr, b) + return + # Use the fact that the array is originally an arange: + arr.flat[indexed_arr.ravel()] += 1000 + assert_array_equal(arr, b) + + def test_boolean(self): + a = np.array(5) + assert_equal(a[np.array(True)], 5) + a[np.array(True)] = 1 + assert_equal(a, 1) + # NOTE: This is different from normal broadcasting, as + # arr[boolean_array] works like in a multi index. Which means + # it is aligned to the left. This is probably correct for + # consistency with arr[boolean_array,] also no broadcasting + # is done at all + self._check_multi_index( + self.a, (np.zeros_like(self.a, dtype=bool),)) + self._check_multi_index( + self.a, (np.zeros_like(self.a, dtype=bool)[..., 0],)) + self._check_multi_index( + self.a, (np.zeros_like(self.a, dtype=bool)[None, ...],)) + + def test_multidim(self): + # Automatically test combinations with complex indexes on 2nd (or 1st) + # spot and the simple ones in one other spot. + with warnings.catch_warnings(): + # This is so that np.array(True) is not accepted in a full integer + # index, when running the file separately. + warnings.filterwarnings('error', '', DeprecationWarning) + warnings.filterwarnings('error', '', VisibleDeprecationWarning) + + def isskip(idx): + return isinstance(idx, str) and idx == "skip" + + for simple_pos in [0, 2, 3]: + tocheck = [self.fill_indices, self.complex_indices, + self.fill_indices, self.fill_indices] + tocheck[simple_pos] = self.simple_indices + for index in product(*tocheck): + index = tuple(i for i in index if not isskip(i)) + self._check_multi_index(self.a, index) + self._check_multi_index(self.b, index) + + # Check very simple item getting: + self._check_multi_index(self.a, (0, 0, 0, 0)) + self._check_multi_index(self.b, (0, 0, 0, 0)) + # Also check (simple cases of) too many indices: + assert_raises(IndexError, self.a.__getitem__, (0, 0, 0, 0, 0)) + assert_raises(IndexError, self.a.__setitem__, (0, 0, 0, 0, 0), 0) + assert_raises(IndexError, self.a.__getitem__, (0, 0, [1], 0, 0)) + assert_raises(IndexError, self.a.__setitem__, (0, 0, [1], 0, 0), 0) + + def test_1d(self): + a = np.arange(10) + for index in self.complex_indices: + self._check_single_index(a, index) + +class TestFloatNonIntegerArgument: + """ + These test that ``TypeError`` is raised when you try to use + non-integers as arguments to for indexing and slicing e.g. ``a[0.0:5]`` + and ``a[0.5]``, or other functions like ``array.reshape(1., -1)``. + + """ + def test_valid_indexing(self): + # These should raise no errors. + a = np.array([[[5]]]) + + a[np.array([0])] + a[[0, 0]] + a[:, [0, 0]] + a[:, 0,:] + a[:,:,:] + + def test_valid_slicing(self): + # These should raise no errors. + a = np.array([[[5]]]) + + a[::] + a[0:] + a[:2] + a[0:2] + a[::2] + a[1::2] + a[:2:2] + a[1:2:2] + + def test_non_integer_argument_errors(self): + a = np.array([[5]]) + + assert_raises(TypeError, np.reshape, a, (1., 1., -1)) + assert_raises(TypeError, np.reshape, a, (np.array(1.), -1)) + assert_raises(TypeError, np.take, a, [0], 1.) + assert_raises(TypeError, np.take, a, [0], np.float64(1.)) + + def test_non_integer_sequence_multiplication(self): + # NumPy scalar sequence multiply should not work with non-integers + def mult(a, b): + return a * b + + assert_raises(TypeError, mult, [1], np.float64(3)) + # following should be OK + mult([1], np.int_(3)) + + def test_reduce_axis_float_index(self): + d = np.zeros((3,3,3)) + assert_raises(TypeError, np.min, d, 0.5) + assert_raises(TypeError, np.min, d, (0.5, 1)) + assert_raises(TypeError, np.min, d, (1, 2.2)) + assert_raises(TypeError, np.min, d, (.2, 1.2)) + + +class TestBooleanIndexing: + # Using a boolean as integer argument/indexing is an error. + def test_bool_as_int_argument_errors(self): + a = np.array([[[1]]]) + + assert_raises(TypeError, np.reshape, a, (True, -1)) + assert_raises(TypeError, np.reshape, a, (np.bool(True), -1)) + # Note that operator.index(np.array(True)) does not work, a boolean + # array is thus also deprecated, but not with the same message: + assert_raises(TypeError, operator.index, np.array(True)) + assert_warns(DeprecationWarning, operator.index, np.True_) + assert_raises(TypeError, np.take, args=(a, [0], False)) + + def test_boolean_indexing_weirdness(self): + # Weird boolean indexing things + a = np.ones((2, 3, 4)) + assert a[False, True, ...].shape == (0, 2, 3, 4) + assert a[True, [0, 1], True, True, [1], [[2]]].shape == (1, 2) + assert_raises(IndexError, lambda: a[False, [0, 1], ...]) + + def test_boolean_indexing_fast_path(self): + # These used to either give the wrong error, or incorrectly give no + # error. + a = np.ones((3, 3)) + + # This used to incorrectly work (and give an array of shape (0,)) + idx1 = np.array([[False]*9]) + assert_raises_regex(IndexError, + "boolean index did not match indexed array along axis 0; " + "size of axis is 3 but size of corresponding boolean axis is 1", + lambda: a[idx1]) + + # This used to incorrectly give a ValueError: operands could not be broadcast together + idx2 = np.array([[False]*8 + [True]]) + assert_raises_regex(IndexError, + "boolean index did not match indexed array along axis 0; " + "size of axis is 3 but size of corresponding boolean axis is 1", + lambda: a[idx2]) + + # This is the same as it used to be. The above two should work like this. + idx3 = np.array([[False]*10]) + assert_raises_regex(IndexError, + "boolean index did not match indexed array along axis 0; " + "size of axis is 3 but size of corresponding boolean axis is 1", + lambda: a[idx3]) + + # This used to give ValueError: non-broadcastable operand + a = np.ones((1, 1, 2)) + idx = np.array([[[True], [False]]]) + assert_raises_regex(IndexError, + "boolean index did not match indexed array along axis 1; " + "size of axis is 1 but size of corresponding boolean axis is 2", + lambda: a[idx]) + + +class TestArrayToIndexDeprecation: + """Creating an index from array not 0-D is an error. + + """ + def test_array_to_index_error(self): + # so no exception is expected. The raising is effectively tested above. + a = np.array([[[1]]]) + + assert_raises(TypeError, operator.index, np.array([1])) + assert_raises(TypeError, np.reshape, a, (a, -1)) + assert_raises(TypeError, np.take, a, [0], a) + + +class TestNonIntegerArrayLike: + """Tests that array_likes only valid if can safely cast to integer. + + For instance, lists give IndexError when they cannot be safely cast to + an integer. + + """ + def test_basic(self): + a = np.arange(10) + + assert_raises(IndexError, a.__getitem__, [0.5, 1.5]) + assert_raises(IndexError, a.__getitem__, (['1', '2'],)) + + # The following is valid + a.__getitem__([]) + + +class TestMultipleEllipsisError: + """An index can only have a single ellipsis. + + """ + def test_basic(self): + a = np.arange(10) + assert_raises(IndexError, lambda: a[..., ...]) + assert_raises(IndexError, a.__getitem__, ((Ellipsis,) * 2,)) + assert_raises(IndexError, a.__getitem__, ((Ellipsis,) * 3,)) + + +class TestCApiAccess: + def test_getitem(self): + subscript = functools.partial(array_indexing, 0) + + # 0-d arrays don't work: + assert_raises(IndexError, subscript, np.ones(()), 0) + # Out of bound values: + assert_raises(IndexError, subscript, np.ones(10), 11) + assert_raises(IndexError, subscript, np.ones(10), -11) + assert_raises(IndexError, subscript, np.ones((10, 10)), 11) + assert_raises(IndexError, subscript, np.ones((10, 10)), -11) + + a = np.arange(10) + assert_array_equal(a[4], subscript(a, 4)) + a = a.reshape(5, 2) + assert_array_equal(a[-4], subscript(a, -4)) + + def test_setitem(self): + assign = functools.partial(array_indexing, 1) + + # Deletion is impossible: + assert_raises(ValueError, assign, np.ones(10), 0) + # 0-d arrays don't work: + assert_raises(IndexError, assign, np.ones(()), 0, 0) + # Out of bound values: + assert_raises(IndexError, assign, np.ones(10), 11, 0) + assert_raises(IndexError, assign, np.ones(10), -11, 0) + assert_raises(IndexError, assign, np.ones((10, 10)), 11, 0) + assert_raises(IndexError, assign, np.ones((10, 10)), -11, 0) + + a = np.arange(10) + assign(a, 4, 10) + assert_(a[4] == 10) + + a = a.reshape(5, 2) + assign(a, 4, 10) + assert_array_equal(a[-1], [10, 10]) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_item_selection.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_item_selection.py new file mode 100644 index 0000000000000000000000000000000000000000..5660ef583edb52824494efb4d444d10ad2be5b6a --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_item_selection.py @@ -0,0 +1,165 @@ +import sys + +import pytest + +import numpy as np +from numpy.testing import ( + assert_, assert_raises, assert_array_equal, HAS_REFCOUNT + ) + + +class TestTake: + def test_simple(self): + a = [[1, 2], [3, 4]] + a_str = [[b'1', b'2'], [b'3', b'4']] + modes = ['raise', 'wrap', 'clip'] + indices = [-1, 4] + index_arrays = [np.empty(0, dtype=np.intp), + np.empty(tuple(), dtype=np.intp), + np.empty((1, 1), dtype=np.intp)] + real_indices = {'raise': {-1: 1, 4: IndexError}, + 'wrap': {-1: 1, 4: 0}, + 'clip': {-1: 0, 4: 1}} + # Currently all types but object, use the same function generation. + # So it should not be necessary to test all. However test also a non + # refcounted struct on top of object, which has a size that hits the + # default (non-specialized) path. + types = int, object, np.dtype([('', 'i2', 3)]) + for t in types: + # ta works, even if the array may be odd if buffer interface is used + ta = np.array(a if np.issubdtype(t, np.number) else a_str, dtype=t) + tresult = list(ta.T.copy()) + for index_array in index_arrays: + if index_array.size != 0: + tresult[0].shape = (2,) + index_array.shape + tresult[1].shape = (2,) + index_array.shape + for mode in modes: + for index in indices: + real_index = real_indices[mode][index] + if real_index is IndexError and index_array.size != 0: + index_array.put(0, index) + assert_raises(IndexError, ta.take, index_array, + mode=mode, axis=1) + elif index_array.size != 0: + index_array.put(0, index) + res = ta.take(index_array, mode=mode, axis=1) + assert_array_equal(res, tresult[real_index]) + else: + res = ta.take(index_array, mode=mode, axis=1) + assert_(res.shape == (2,) + index_array.shape) + + def test_refcounting(self): + objects = [object() for i in range(10)] + for mode in ('raise', 'clip', 'wrap'): + a = np.array(objects) + b = np.array([2, 2, 4, 5, 3, 5]) + a.take(b, out=a[:6], mode=mode) + del a + if HAS_REFCOUNT: + assert_(all(sys.getrefcount(o) == 3 for o in objects)) + # not contiguous, example: + a = np.array(objects * 2)[::2] + a.take(b, out=a[:6], mode=mode) + del a + if HAS_REFCOUNT: + assert_(all(sys.getrefcount(o) == 3 for o in objects)) + + def test_unicode_mode(self): + d = np.arange(10) + k = b'\xc3\xa4'.decode("UTF8") + assert_raises(ValueError, d.take, 5, mode=k) + + def test_empty_partition(self): + # In reference to github issue #6530 + a_original = np.array([0, 2, 4, 6, 8, 10]) + a = a_original.copy() + + # An empty partition should be a successful no-op + a.partition(np.array([], dtype=np.int16)) + + assert_array_equal(a, a_original) + + def test_empty_argpartition(self): + # In reference to github issue #6530 + a = np.array([0, 2, 4, 6, 8, 10]) + a = a.argpartition(np.array([], dtype=np.int16)) + + b = np.array([0, 1, 2, 3, 4, 5]) + assert_array_equal(a, b) + + +class TestPutMask: + @pytest.mark.parametrize("dtype", list(np.typecodes["All"]) + ["i,O"]) + def test_simple(self, dtype): + if dtype.lower() == "m": + dtype += "8[ns]" + + # putmask is weird and doesn't care about value length (even shorter) + vals = np.arange(1001).astype(dtype=dtype) + + mask = np.random.randint(2, size=1000).astype(bool) + # Use vals.dtype in case of flexible dtype (i.e. string) + arr = np.zeros(1000, dtype=vals.dtype) + zeros = arr.copy() + + np.putmask(arr, mask, vals) + assert_array_equal(arr[mask], vals[:len(mask)][mask]) + assert_array_equal(arr[~mask], zeros[~mask]) + + @pytest.mark.parametrize("dtype", list(np.typecodes["All"])[1:] + ["i,O"]) + @pytest.mark.parametrize("mode", ["raise", "wrap", "clip"]) + def test_empty(self, dtype, mode): + arr = np.zeros(1000, dtype=dtype) + arr_copy = arr.copy() + mask = np.random.randint(2, size=1000).astype(bool) + + # Allowing empty values like this is weird... + np.put(arr, mask, []) + assert_array_equal(arr, arr_copy) + + +class TestPut: + @pytest.mark.parametrize("dtype", list(np.typecodes["All"])[1:] + ["i,O"]) + @pytest.mark.parametrize("mode", ["raise", "wrap", "clip"]) + def test_simple(self, dtype, mode): + if dtype.lower() == "m": + dtype += "8[ns]" + + # put is weird and doesn't care about value length (even shorter) + vals = np.arange(1001).astype(dtype=dtype) + + # Use vals.dtype in case of flexible dtype (i.e. string) + arr = np.zeros(1000, dtype=vals.dtype) + zeros = arr.copy() + + if mode == "clip": + # Special because 0 and -1 value are "reserved" for clip test + indx = np.random.permutation(len(arr) - 2)[:-500] + 1 + + indx[-1] = 0 + indx[-2] = len(arr) - 1 + indx_put = indx.copy() + indx_put[-1] = -1389 + indx_put[-2] = 1321 + else: + # Avoid duplicates (for simplicity) and fill half only + indx = np.random.permutation(len(arr) - 3)[:-500] + indx_put = indx + if mode == "wrap": + indx_put = indx_put + len(arr) + + np.put(arr, indx_put, vals, mode=mode) + assert_array_equal(arr[indx], vals[:len(indx)]) + untouched = np.ones(len(arr), dtype=bool) + untouched[indx] = False + assert_array_equal(arr[untouched], zeros[:untouched.sum()]) + + @pytest.mark.parametrize("dtype", list(np.typecodes["All"])[1:] + ["i,O"]) + @pytest.mark.parametrize("mode", ["raise", "wrap", "clip"]) + def test_empty(self, dtype, mode): + arr = np.zeros(1000, dtype=dtype) + arr_copy = arr.copy() + + # Allowing empty values like this is weird... + np.put(arr, [1, 2, 3], []) + assert_array_equal(arr, arr_copy) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_limited_api.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_limited_api.py new file mode 100644 index 0000000000000000000000000000000000000000..5a23b49171a0c267b864e4e2c22c6dfecce59aeb --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_limited_api.py @@ -0,0 +1,91 @@ +import os +import shutil +import subprocess +import sys +import sysconfig +import pytest + +from numpy.testing import IS_WASM, IS_PYPY, NOGIL_BUILD, IS_EDITABLE + +# This import is copied from random.tests.test_extending +try: + import cython + from Cython.Compiler.Version import version as cython_version +except ImportError: + cython = None +else: + from numpy._utils import _pep440 + + # Note: keep in sync with the one in pyproject.toml + required_version = "3.0.6" + if _pep440.parse(cython_version) < _pep440.Version(required_version): + # too old or wrong cython, skip the test + cython = None + +pytestmark = pytest.mark.skipif(cython is None, reason="requires cython") + + +if IS_EDITABLE: + pytest.skip( + "Editable install doesn't support tests with a compile step", + allow_module_level=True + ) + + +@pytest.fixture(scope='module') +def install_temp(tmpdir_factory): + # Based in part on test_cython from random.tests.test_extending + if IS_WASM: + pytest.skip("No subprocess") + + srcdir = os.path.join(os.path.dirname(__file__), 'examples', 'limited_api') + build_dir = tmpdir_factory.mktemp("limited_api") / "build" + os.makedirs(build_dir, exist_ok=True) + try: + subprocess.check_call(["meson", "--version"]) + except FileNotFoundError: + pytest.skip("No usable 'meson' found") + if sys.platform == "win32": + subprocess.check_call(["meson", "setup", + "--werror", + "--buildtype=release", + "--vsenv", str(srcdir)], + cwd=build_dir, + ) + else: + subprocess.check_call(["meson", "setup", "--werror", str(srcdir)], + cwd=build_dir + ) + try: + subprocess.check_call( + ["meson", "compile", "-vv"], cwd=build_dir) + except subprocess.CalledProcessError as p: + print(f"{p.stdout=}") + print(f"{p.stderr=}") + raise + + sys.path.append(str(build_dir)) + + + +@pytest.mark.skipif(IS_WASM, reason="Can't start subprocess") +@pytest.mark.xfail( + sysconfig.get_config_var("Py_DEBUG"), + reason=( + "Py_LIMITED_API is incompatible with Py_DEBUG, Py_TRACE_REFS, " + "and Py_REF_DEBUG" + ), +) +@pytest.mark.xfail( + NOGIL_BUILD, + reason="Py_GIL_DISABLED builds do not currently support the limited API", +) +@pytest.mark.skipif(IS_PYPY, reason="no support for limited API in PyPy") +def test_limited_api(install_temp): + """Test building a third-party C extension with the limited API + and building a cython extension with the limited API + """ + + import limited_api1 # Earliest (3.6) + import limited_api_latest # Latest version (current Python) + import limited_api2 # cython diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_longdouble.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_longdouble.py new file mode 100644 index 0000000000000000000000000000000000000000..a7ad5c9e57916976c395a083171236f70ce9d338 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_longdouble.py @@ -0,0 +1,395 @@ +import warnings +import platform +import pytest + +import numpy as np +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_warns, assert_array_equal, + temppath, IS_MUSL + ) +from numpy._core.tests._locales import CommaDecimalPointLocale + + +LD_INFO = np.finfo(np.longdouble) +longdouble_longer_than_double = (LD_INFO.eps < np.finfo(np.double).eps) + + +_o = 1 + LD_INFO.eps +string_to_longdouble_inaccurate = (_o != np.longdouble(str(_o))) +del _o + + +def test_scalar_extraction(): + """Confirm that extracting a value doesn't convert to python float""" + o = 1 + LD_INFO.eps + a = np.array([o, o, o]) + assert_equal(a[1], o) + + +# Conversions string -> long double + +# 0.1 not exactly representable in base 2 floating point. +repr_precision = len(repr(np.longdouble(0.1))) +# +2 from macro block starting around line 842 in scalartypes.c.src. + + +@pytest.mark.skipif(IS_MUSL, + reason="test flaky on musllinux") +@pytest.mark.skipif(LD_INFO.precision + 2 >= repr_precision, + reason="repr precision not enough to show eps") +def test_str_roundtrip(): + # We will only see eps in repr if within printing precision. + o = 1 + LD_INFO.eps + assert_equal(np.longdouble(str(o)), o, "str was %s" % str(o)) + + +@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l") +def test_str_roundtrip_bytes(): + o = 1 + LD_INFO.eps + assert_equal(np.longdouble(str(o).encode("ascii")), o) + + +@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l") +@pytest.mark.parametrize("strtype", (np.str_, np.bytes_, str, bytes)) +def test_array_and_stringlike_roundtrip(strtype): + """ + Test that string representations of long-double roundtrip both + for array casting and scalar coercion, see also gh-15608. + """ + o = 1 + LD_INFO.eps + + if strtype in (np.bytes_, bytes): + o_str = strtype(str(o).encode("ascii")) + else: + o_str = strtype(str(o)) + + # Test that `o` is correctly coerced from the string-like + assert o == np.longdouble(o_str) + + # Test that arrays also roundtrip correctly: + o_strarr = np.asarray([o] * 3, dtype=strtype) + assert (o == o_strarr.astype(np.longdouble)).all() + + # And array coercion and casting to string give the same as scalar repr: + assert (o_strarr == o_str).all() + assert (np.asarray([o] * 3).astype(strtype) == o_str).all() + + +def test_bogus_string(): + assert_raises(ValueError, np.longdouble, "spam") + assert_raises(ValueError, np.longdouble, "1.0 flub") + + +@pytest.mark.skipif(string_to_longdouble_inaccurate, reason="Need strtold_l") +def test_fromstring(): + o = 1 + LD_INFO.eps + s = (" " + str(o))*5 + a = np.array([o]*5) + assert_equal(np.fromstring(s, sep=" ", dtype=np.longdouble), a, + err_msg="reading '%s'" % s) + + +def test_fromstring_complex(): + for ctype in ["complex", "cdouble"]: + # Check spacing between separator + assert_equal(np.fromstring("1, 2 , 3 ,4", sep=",", dtype=ctype), + np.array([1., 2., 3., 4.])) + # Real component not specified + assert_equal(np.fromstring("1j, -2j, 3j, 4e1j", sep=",", dtype=ctype), + np.array([1.j, -2.j, 3.j, 40.j])) + # Both components specified + assert_equal(np.fromstring("1+1j,2-2j, -3+3j, -4e1+4j", sep=",", dtype=ctype), + np.array([1. + 1.j, 2. - 2.j, - 3. + 3.j, - 40. + 4j])) + # Spaces at wrong places + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1+2 j,3", dtype=ctype, sep=","), + np.array([1.])) + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1+ 2j,3", dtype=ctype, sep=","), + np.array([1.])) + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1 +2j,3", dtype=ctype, sep=","), + np.array([1.])) + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1+j", dtype=ctype, sep=","), + np.array([1.])) + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1+", dtype=ctype, sep=","), + np.array([1.])) + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1j+1", dtype=ctype, sep=","), + np.array([1j])) + + +def test_fromstring_bogus(): + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1. 2. 3. flop 4.", dtype=float, sep=" "), + np.array([1., 2., 3.])) + + +def test_fromstring_empty(): + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("xxxxx", sep="x"), + np.array([])) + + +def test_fromstring_missing(): + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1xx3x4x5x6", sep="x"), + np.array([1])) + + +class TestFileBased: + + ldbl = 1 + LD_INFO.eps + tgt = np.array([ldbl]*5) + out = ''.join([str(t) + '\n' for t in tgt]) + + def test_fromfile_bogus(self): + with temppath() as path: + with open(path, 'w') as f: + f.write("1. 2. 3. flop 4.\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=float, sep=" ") + assert_equal(res, np.array([1., 2., 3.])) + + def test_fromfile_complex(self): + for ctype in ["complex", "cdouble"]: + # Check spacing between separator and only real component specified + with temppath() as path: + with open(path, 'w') as f: + f.write("1, 2 , 3 ,4\n") + + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1., 2., 3., 4.])) + + # Real component not specified + with temppath() as path: + with open(path, 'w') as f: + f.write("1j, -2j, 3j, 4e1j\n") + + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.j, -2.j, 3.j, 40.j])) + + # Both components specified + with temppath() as path: + with open(path, 'w') as f: + f.write("1+1j,2-2j, -3+3j, -4e1+4j\n") + + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1. + 1.j, 2. - 2.j, - 3. + 3.j, - 40. + 4j])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1+2 j,3\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1+ 2j,3\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1 +2j,3\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1+j\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1+\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.])) + + # Spaces at wrong places + with temppath() as path: + with open(path, 'w') as f: + f.write("1j+1\n") + + with assert_warns(DeprecationWarning): + res = np.fromfile(path, dtype=ctype, sep=",") + assert_equal(res, np.array([1.j])) + + + + @pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") + def test_fromfile(self): + with temppath() as path: + with open(path, 'w') as f: + f.write(self.out) + res = np.fromfile(path, dtype=np.longdouble, sep="\n") + assert_equal(res, self.tgt) + + @pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") + def test_genfromtxt(self): + with temppath() as path: + with open(path, 'w') as f: + f.write(self.out) + res = np.genfromtxt(path, dtype=np.longdouble) + assert_equal(res, self.tgt) + + @pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") + def test_loadtxt(self): + with temppath() as path: + with open(path, 'w') as f: + f.write(self.out) + res = np.loadtxt(path, dtype=np.longdouble) + assert_equal(res, self.tgt) + + @pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") + def test_tofile_roundtrip(self): + with temppath() as path: + self.tgt.tofile(path, sep=" ") + res = np.fromfile(path, dtype=np.longdouble, sep=" ") + assert_equal(res, self.tgt) + + +# Conversions long double -> string + + +def test_str_exact(): + o = 1 + LD_INFO.eps + assert_(str(o) != '1') + + +@pytest.mark.skipif(longdouble_longer_than_double, reason="BUG #2376") +@pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") +def test_format(): + o = 1 + LD_INFO.eps + assert_("{0:.40g}".format(o) != '1') + + +@pytest.mark.skipif(longdouble_longer_than_double, reason="BUG #2376") +@pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") +def test_percent(): + o = 1 + LD_INFO.eps + assert_("%.40g" % o != '1') + + +@pytest.mark.skipif(longdouble_longer_than_double, + reason="array repr problem") +@pytest.mark.skipif(string_to_longdouble_inaccurate, + reason="Need strtold_l") +def test_array_repr(): + o = 1 + LD_INFO.eps + a = np.array([o]) + b = np.array([1], dtype=np.longdouble) + if not np.all(a != b): + raise ValueError("precision loss creating arrays") + assert_(repr(a) != repr(b)) + +# +# Locale tests: scalar types formatting should be independent of the locale +# + +class TestCommaDecimalPointLocale(CommaDecimalPointLocale): + + def test_str_roundtrip_foreign(self): + o = 1.5 + assert_equal(o, np.longdouble(str(o))) + + def test_fromstring_foreign_repr(self): + f = 1.234 + a = np.fromstring(repr(f), dtype=float, sep=" ") + assert_equal(a[0], f) + + def test_fromstring_best_effort_float(self): + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1,234", dtype=float, sep=" "), + np.array([1.])) + + def test_fromstring_best_effort(self): + with assert_warns(DeprecationWarning): + assert_equal(np.fromstring("1,234", dtype=np.longdouble, sep=" "), + np.array([1.])) + + def test_fromstring_foreign(self): + s = "1.234" + a = np.fromstring(s, dtype=np.longdouble, sep=" ") + assert_equal(a[0], np.longdouble(s)) + + def test_fromstring_foreign_sep(self): + a = np.array([1, 2, 3, 4]) + b = np.fromstring("1,2,3,4,", dtype=np.longdouble, sep=",") + assert_array_equal(a, b) + + def test_fromstring_foreign_value(self): + with assert_warns(DeprecationWarning): + b = np.fromstring("1,234", dtype=np.longdouble, sep=" ") + assert_array_equal(b[0], 1) + + +@pytest.mark.parametrize("int_val", [ + # cases discussed in gh-10723 + # and gh-9968 + 2 ** 1024, 0]) +def test_longdouble_from_int(int_val): + # for issue gh-9968 + str_val = str(int_val) + # we'll expect a RuntimeWarning on platforms + # with np.longdouble equivalent to np.double + # for large integer input + with warnings.catch_warnings(record=True) as w: + warnings.filterwarnings('always', '', RuntimeWarning) + # can be inf==inf on some platforms + assert np.longdouble(int_val) == np.longdouble(str_val) + # we can't directly compare the int and + # max longdouble value on all platforms + if np.allclose(np.finfo(np.longdouble).max, + np.finfo(np.double).max) and w: + assert w[0].category is RuntimeWarning + +@pytest.mark.parametrize("bool_val", [ + True, False]) +def test_longdouble_from_bool(bool_val): + assert np.longdouble(bool_val) == np.longdouble(int(bool_val)) + + +@pytest.mark.skipif( + not (IS_MUSL and platform.machine() == "x86_64"), + reason="only need to run on musllinux_x86_64" +) +def test_musllinux_x86_64_signature(): + # this test may fail if you're emulating musllinux_x86_64 on a different + # architecture, but should pass natively. + known_sigs = [b'\xcd\xcc\xcc\xcc\xcc\xcc\xcc\xcc\xfb\xbf'] + sig = (np.longdouble(-1.0) / np.longdouble(10.0)) + sig = sig.view(sig.dtype.newbyteorder('<')).tobytes()[:10] + assert sig in known_sigs + + +def test_eps_positive(): + # np.finfo('g').eps should be positive on all platforms. If this isn't true + # then something may have gone wrong with the MachArLike, e.g. if + # np._core.getlimits._discovered_machar didn't work properly + assert np.finfo(np.longdouble).eps > 0. diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_machar.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_machar.py new file mode 100644 index 0000000000000000000000000000000000000000..c7f677075dcac04cd1d2202bbcac5076ceabb703 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_machar.py @@ -0,0 +1,30 @@ +""" +Test machar. Given recent changes to hardcode type data, we might want to get +rid of both MachAr and this test at some point. + +""" +from numpy._core._machar import MachAr +import numpy._core.numerictypes as ntypes +from numpy import errstate, array + + +class TestMachAr: + def _run_machar_highprec(self): + # Instantiate MachAr instance with high enough precision to cause + # underflow + try: + hiprec = ntypes.float96 + MachAr(lambda v: array(v, hiprec)) + except AttributeError: + # Fixme, this needs to raise a 'skip' exception. + "Skipping test: no ntypes.float96 available on this platform." + + def test_underlow(self): + # Regression test for #759: + # instantiating MachAr for dtype = np.float96 raises spurious warning. + with errstate(all='raise'): + try: + self._run_machar_highprec() + except FloatingPointError as e: + msg = "Caught %s exception, should not have been raised." % e + raise AssertionError(msg) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_memmap.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_memmap.py new file mode 100644 index 0000000000000000000000000000000000000000..9603e8316e1db8cd37f03740a80fe5c864d3a1dc --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_memmap.py @@ -0,0 +1,221 @@ +import sys +import os +import mmap +import pytest +from pathlib import Path +from tempfile import NamedTemporaryFile, TemporaryFile + +from numpy import ( + memmap, sum, average, prod, ndarray, isscalar, add, subtract, multiply) + +from numpy import arange, allclose, asarray +from numpy.testing import ( + assert_, assert_equal, assert_array_equal, suppress_warnings, IS_PYPY, + break_cycles + ) + +class TestMemmap: + def setup_method(self): + self.tmpfp = NamedTemporaryFile(prefix='mmap') + self.shape = (3, 4) + self.dtype = 'float32' + self.data = arange(12, dtype=self.dtype) + self.data.resize(self.shape) + + def teardown_method(self): + self.tmpfp.close() + self.data = None + if IS_PYPY: + break_cycles() + break_cycles() + + def test_roundtrip(self): + # Write data to file + fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + fp[:] = self.data[:] + del fp # Test __del__ machinery, which handles cleanup + + # Read data back from file + newfp = memmap(self.tmpfp, dtype=self.dtype, mode='r', + shape=self.shape) + assert_(allclose(self.data, newfp)) + assert_array_equal(self.data, newfp) + assert_equal(newfp.flags.writeable, False) + + def test_open_with_filename(self, tmp_path): + tmpname = tmp_path / 'mmap' + fp = memmap(tmpname, dtype=self.dtype, mode='w+', + shape=self.shape) + fp[:] = self.data[:] + del fp + + def test_unnamed_file(self): + with TemporaryFile() as f: + fp = memmap(f, dtype=self.dtype, shape=self.shape) + del fp + + def test_attributes(self): + offset = 1 + mode = "w+" + fp = memmap(self.tmpfp, dtype=self.dtype, mode=mode, + shape=self.shape, offset=offset) + assert_equal(offset, fp.offset) + assert_equal(mode, fp.mode) + del fp + + def test_filename(self, tmp_path): + tmpname = tmp_path / "mmap" + fp = memmap(tmpname, dtype=self.dtype, mode='w+', + shape=self.shape) + abspath = Path(os.path.abspath(tmpname)) + fp[:] = self.data[:] + assert_equal(abspath, fp.filename) + b = fp[:1] + assert_equal(abspath, b.filename) + del b + del fp + + def test_path(self, tmp_path): + tmpname = tmp_path / "mmap" + fp = memmap(Path(tmpname), dtype=self.dtype, mode='w+', + shape=self.shape) + # os.path.realpath does not resolve symlinks on Windows + # see: https://bugs.python.org/issue9949 + # use Path.resolve, just as memmap class does internally + abspath = str(Path(tmpname).resolve()) + fp[:] = self.data[:] + assert_equal(abspath, str(fp.filename.resolve())) + b = fp[:1] + assert_equal(abspath, str(b.filename.resolve())) + del b + del fp + + def test_filename_fileobj(self): + fp = memmap(self.tmpfp, dtype=self.dtype, mode="w+", + shape=self.shape) + assert_equal(fp.filename, self.tmpfp.name) + + @pytest.mark.skipif(sys.platform == 'gnu0', + reason="Known to fail on hurd") + def test_flush(self): + fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + fp[:] = self.data[:] + assert_equal(fp[0], self.data[0]) + fp.flush() + + def test_del(self): + # Make sure a view does not delete the underlying mmap + fp_base = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + fp_base[0] = 5 + fp_view = fp_base[0:1] + assert_equal(fp_view[0], 5) + del fp_view + # Should still be able to access and assign values after + # deleting the view + assert_equal(fp_base[0], 5) + fp_base[0] = 6 + assert_equal(fp_base[0], 6) + + def test_arithmetic_drops_references(self): + fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + tmp = (fp + 10) + if isinstance(tmp, memmap): + assert_(tmp._mmap is not fp._mmap) + + def test_indexing_drops_references(self): + fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + tmp = fp[(1, 2), (2, 3)] + if isinstance(tmp, memmap): + assert_(tmp._mmap is not fp._mmap) + + def test_slicing_keeps_references(self): + fp = memmap(self.tmpfp, dtype=self.dtype, mode='w+', + shape=self.shape) + assert_(fp[:2, :2]._mmap is fp._mmap) + + def test_view(self): + fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) + new1 = fp.view() + new2 = new1.view() + assert_(new1.base is fp) + assert_(new2.base is fp) + new_array = asarray(fp) + assert_(new_array.base is fp) + + def test_ufunc_return_ndarray(self): + fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) + fp[:] = self.data + + with suppress_warnings() as sup: + sup.filter(FutureWarning, "np.average currently does not preserve") + for unary_op in [sum, average, prod]: + result = unary_op(fp) + assert_(isscalar(result)) + assert_(result.__class__ is self.data[0, 0].__class__) + + assert_(unary_op(fp, axis=0).__class__ is ndarray) + assert_(unary_op(fp, axis=1).__class__ is ndarray) + + for binary_op in [add, subtract, multiply]: + assert_(binary_op(fp, self.data).__class__ is ndarray) + assert_(binary_op(self.data, fp).__class__ is ndarray) + assert_(binary_op(fp, fp).__class__ is ndarray) + + fp += 1 + assert(fp.__class__ is memmap) + add(fp, 1, out=fp) + assert(fp.__class__ is memmap) + + def test_getitem(self): + fp = memmap(self.tmpfp, dtype=self.dtype, shape=self.shape) + fp[:] = self.data + + assert_(fp[1:, :-1].__class__ is memmap) + # Fancy indexing returns a copy that is not memmapped + assert_(fp[[0, 1]].__class__ is ndarray) + + def test_memmap_subclass(self): + class MemmapSubClass(memmap): + pass + + fp = MemmapSubClass(self.tmpfp, dtype=self.dtype, shape=self.shape) + fp[:] = self.data + + # We keep previous behavior for subclasses of memmap, i.e. the + # ufunc and __getitem__ output is never turned into a ndarray + assert_(sum(fp, axis=0).__class__ is MemmapSubClass) + assert_(sum(fp).__class__ is MemmapSubClass) + assert_(fp[1:, :-1].__class__ is MemmapSubClass) + assert(fp[[0, 1]].__class__ is MemmapSubClass) + + def test_mmap_offset_greater_than_allocation_granularity(self): + size = 5 * mmap.ALLOCATIONGRANULARITY + offset = mmap.ALLOCATIONGRANULARITY + 1 + fp = memmap(self.tmpfp, shape=size, mode='w+', offset=offset) + assert_(fp.offset == offset) + + def test_no_shape(self): + self.tmpfp.write(b'a'*16) + mm = memmap(self.tmpfp, dtype='float64') + assert_equal(mm.shape, (2,)) + + def test_empty_array(self): + # gh-12653 + with pytest.raises(ValueError, match='empty file'): + memmap(self.tmpfp, shape=(0,4), mode='w+') + + self.tmpfp.write(b'\0') + + # ok now the file is not empty + memmap(self.tmpfp, shape=(0,4), mode='w+') + + def test_shape_type(self): + memmap(self.tmpfp, shape=3, mode='w+') + memmap(self.tmpfp, shape=self.shape, mode='w+') + memmap(self.tmpfp, shape=list(self.shape), mode='w+') + memmap(self.tmpfp, shape=asarray(self.shape), mode='w+') diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_multiarray.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_multiarray.py new file mode 100644 index 0000000000000000000000000000000000000000..0bc9fea9c96037e5d045c63123ca9a9ab6dc4dab --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_multiarray.py @@ -0,0 +1,10341 @@ +from __future__ import annotations + +import collections.abc +import tempfile +import sys +import warnings +import operator +import io +import itertools +import functools +import ctypes +import os +import gc +import re +import weakref +import pytest +from contextlib import contextmanager +import pickle +import pathlib +import builtins +from decimal import Decimal +import mmap + +import numpy as np +import numpy._core._multiarray_tests as _multiarray_tests +from numpy._core._rational_tests import rational +from numpy.exceptions import AxisError, ComplexWarning +from numpy.testing import ( + assert_, assert_raises, assert_warns, assert_equal, assert_almost_equal, + assert_array_equal, assert_raises_regex, assert_array_almost_equal, + assert_allclose, IS_PYPY, IS_WASM, IS_PYSTON, HAS_REFCOUNT, + assert_array_less, runstring, temppath, suppress_warnings, break_cycles, + _SUPPORTS_SVE, assert_array_compare, + ) +from numpy.testing._private.utils import requires_memory, _no_tracing +from numpy._core.tests._locales import CommaDecimalPointLocale +from numpy.lib.recfunctions import repack_fields +from numpy._core.multiarray import _get_ndarray_c_version, dot + +# Need to test an object that does not fully implement math interface +from datetime import timedelta, datetime + + +def assert_arg_sorted(arr, arg): + # resulting array should be sorted and arg values should be unique + assert_equal(arr[arg], np.sort(arr)) + assert_equal(np.sort(arg), np.arange(len(arg))) + + +def assert_arr_partitioned(kth, k, arr_part): + assert_equal(arr_part[k], kth) + assert_array_compare(operator.__le__, arr_part[:k], kth) + assert_array_compare(operator.__ge__, arr_part[k:], kth) + + +def _aligned_zeros(shape, dtype=float, order="C", align=None): + """ + Allocate a new ndarray with aligned memory. + + The ndarray is guaranteed *not* aligned to twice the requested alignment. + Eg, if align=4, guarantees it is not aligned to 8. If align=None uses + dtype.alignment.""" + dtype = np.dtype(dtype) + if dtype == np.dtype(object): + # Can't do this, fall back to standard allocation (which + # should always be sufficiently aligned) + if align is not None: + raise ValueError("object array alignment not supported") + return np.zeros(shape, dtype=dtype, order=order) + if align is None: + align = dtype.alignment + if not hasattr(shape, '__len__'): + shape = (shape,) + size = functools.reduce(operator.mul, shape) * dtype.itemsize + buf = np.empty(size + 2*align + 1, np.uint8) + + ptr = buf.__array_interface__['data'][0] + offset = ptr % align + if offset != 0: + offset = align - offset + if (ptr % (2*align)) == 0: + offset += align + + # Note: slices producing 0-size arrays do not necessarily change + # data pointer --- so we use and allocate size+1 + buf = buf[offset:offset+size+1][:-1] + buf.fill(0) + data = np.ndarray(shape, dtype, buf, order=order) + return data + + +class TestFlags: + def setup_method(self): + self.a = np.arange(10) + + def test_writeable(self): + mydict = locals() + self.a.flags.writeable = False + assert_raises(ValueError, runstring, 'self.a[0] = 3', mydict) + self.a.flags.writeable = True + self.a[0] = 5 + self.a[0] = 0 + + def test_writeable_any_base(self): + # Ensure that any base being writeable is sufficient to change flag; + # this is especially interesting for arrays from an array interface. + arr = np.arange(10) + + class subclass(np.ndarray): + pass + + # Create subclass so base will not be collapsed, this is OK to change + view1 = arr.view(subclass) + view2 = view1[...] + arr.flags.writeable = False + view2.flags.writeable = False + view2.flags.writeable = True # Can be set to True again. + + arr = np.arange(10) + + class frominterface: + def __init__(self, arr): + self.arr = arr + self.__array_interface__ = arr.__array_interface__ + + view1 = np.asarray(frominterface) + view2 = view1[...] + view2.flags.writeable = False + view2.flags.writeable = True + + view1.flags.writeable = False + view2.flags.writeable = False + with assert_raises(ValueError): + # Must assume not writeable, since only base is not: + view2.flags.writeable = True + + def test_writeable_from_readonly(self): + # gh-9440 - make sure fromstring, from buffer on readonly buffers + # set writeable False + data = b'\x00' * 100 + vals = np.frombuffer(data, 'B') + assert_raises(ValueError, vals.setflags, write=True) + types = np.dtype( [('vals', 'u1'), ('res3', 'S4')] ) + values = np._core.records.fromstring(data, types) + vals = values['vals'] + assert_raises(ValueError, vals.setflags, write=True) + + def test_writeable_from_buffer(self): + data = bytearray(b'\x00' * 100) + vals = np.frombuffer(data, 'B') + assert_(vals.flags.writeable) + vals.setflags(write=False) + assert_(vals.flags.writeable is False) + vals.setflags(write=True) + assert_(vals.flags.writeable) + types = np.dtype( [('vals', 'u1'), ('res3', 'S4')] ) + values = np._core.records.fromstring(data, types) + vals = values['vals'] + assert_(vals.flags.writeable) + vals.setflags(write=False) + assert_(vals.flags.writeable is False) + vals.setflags(write=True) + assert_(vals.flags.writeable) + + @pytest.mark.skipif(IS_PYPY, reason="PyPy always copies") + def test_writeable_pickle(self): + import pickle + # Small arrays will be copied without setting base. + # See condition for using PyArray_SetBaseObject in + # array_setstate. + a = np.arange(1000) + for v in range(pickle.HIGHEST_PROTOCOL): + vals = pickle.loads(pickle.dumps(a, v)) + assert_(vals.flags.writeable) + assert_(isinstance(vals.base, bytes)) + + def test_writeable_from_c_data(self): + # Test that the writeable flag can be changed for an array wrapping + # low level C-data, but not owning its data. + # Also see that this is deprecated to change from python. + from numpy._core._multiarray_tests import get_c_wrapping_array + + arr_writeable = get_c_wrapping_array(True) + assert not arr_writeable.flags.owndata + assert arr_writeable.flags.writeable + view = arr_writeable[...] + + # Toggling the writeable flag works on the view: + view.flags.writeable = False + assert not view.flags.writeable + view.flags.writeable = True + assert view.flags.writeable + # Flag can be unset on the arr_writeable: + arr_writeable.flags.writeable = False + + arr_readonly = get_c_wrapping_array(False) + assert not arr_readonly.flags.owndata + assert not arr_readonly.flags.writeable + + for arr in [arr_writeable, arr_readonly]: + view = arr[...] + view.flags.writeable = False # make sure it is readonly + arr.flags.writeable = False + assert not arr.flags.writeable + + with assert_raises(ValueError): + view.flags.writeable = True + + with warnings.catch_warnings(): + warnings.simplefilter("error", DeprecationWarning) + with assert_raises(DeprecationWarning): + arr.flags.writeable = True + + with assert_warns(DeprecationWarning): + arr.flags.writeable = True + + def test_warnonwrite(self): + a = np.arange(10) + a.flags._warn_on_write = True + with warnings.catch_warnings(record=True) as w: + warnings.filterwarnings('always') + a[1] = 10 + a[2] = 10 + # only warn once + assert_(len(w) == 1) + + @pytest.mark.parametrize(["flag", "flag_value", "writeable"], + [("writeable", True, True), + # Delete _warn_on_write after deprecation and simplify + # the parameterization: + ("_warn_on_write", True, False), + ("writeable", False, False)]) + def test_readonly_flag_protocols(self, flag, flag_value, writeable): + a = np.arange(10) + setattr(a.flags, flag, flag_value) + + class MyArr: + __array_struct__ = a.__array_struct__ + + assert memoryview(a).readonly is not writeable + assert a.__array_interface__['data'][1] is not writeable + assert np.asarray(MyArr()).flags.writeable is writeable + + def test_otherflags(self): + assert_equal(self.a.flags.carray, True) + assert_equal(self.a.flags['C'], True) + assert_equal(self.a.flags.farray, False) + assert_equal(self.a.flags.behaved, True) + assert_equal(self.a.flags.fnc, False) + assert_equal(self.a.flags.forc, True) + assert_equal(self.a.flags.owndata, True) + assert_equal(self.a.flags.writeable, True) + assert_equal(self.a.flags.aligned, True) + assert_equal(self.a.flags.writebackifcopy, False) + assert_equal(self.a.flags['X'], False) + assert_equal(self.a.flags['WRITEBACKIFCOPY'], False) + + def test_string_align(self): + a = np.zeros(4, dtype=np.dtype('|S4')) + assert_(a.flags.aligned) + # not power of two are accessed byte-wise and thus considered aligned + a = np.zeros(5, dtype=np.dtype('|S4')) + assert_(a.flags.aligned) + + def test_void_align(self): + a = np.zeros(4, dtype=np.dtype([("a", "i4"), ("b", "i4")])) + assert_(a.flags.aligned) + + @pytest.mark.parametrize("row_size", [5, 1 << 16]) + @pytest.mark.parametrize("row_count", [1, 5]) + @pytest.mark.parametrize("ndmin", [0, 1, 2]) + def test_xcontiguous_load_txt(self, row_size, row_count, ndmin): + s = io.StringIO('\n'.join(['1.0 ' * row_size] * row_count)) + a = np.loadtxt(s, ndmin=ndmin) + + assert a.flags.c_contiguous + x = [i for i in a.shape if i != 1] + assert a.flags.f_contiguous == (len(x) <= 1) + + +class TestHash: + # see #3793 + def test_int(self): + for st, ut, s in [(np.int8, np.uint8, 8), + (np.int16, np.uint16, 16), + (np.int32, np.uint32, 32), + (np.int64, np.uint64, 64)]: + for i in range(1, s): + assert_equal(hash(st(-2**i)), hash(-2**i), + err_msg="%r: -2**%d" % (st, i)) + assert_equal(hash(st(2**(i - 1))), hash(2**(i - 1)), + err_msg="%r: 2**%d" % (st, i - 1)) + assert_equal(hash(st(2**i - 1)), hash(2**i - 1), + err_msg="%r: 2**%d - 1" % (st, i)) + + i = max(i - 1, 1) + assert_equal(hash(ut(2**(i - 1))), hash(2**(i - 1)), + err_msg="%r: 2**%d" % (ut, i - 1)) + assert_equal(hash(ut(2**i - 1)), hash(2**i - 1), + err_msg="%r: 2**%d - 1" % (ut, i)) + + +class TestAttributes: + def setup_method(self): + self.one = np.arange(10) + self.two = np.arange(20).reshape(4, 5) + self.three = np.arange(60, dtype=np.float64).reshape(2, 5, 6) + + def test_attributes(self): + assert_equal(self.one.shape, (10,)) + assert_equal(self.two.shape, (4, 5)) + assert_equal(self.three.shape, (2, 5, 6)) + self.three.shape = (10, 3, 2) + assert_equal(self.three.shape, (10, 3, 2)) + self.three.shape = (2, 5, 6) + assert_equal(self.one.strides, (self.one.itemsize,)) + num = self.two.itemsize + assert_equal(self.two.strides, (5*num, num)) + num = self.three.itemsize + assert_equal(self.three.strides, (30*num, 6*num, num)) + assert_equal(self.one.ndim, 1) + assert_equal(self.two.ndim, 2) + assert_equal(self.three.ndim, 3) + num = self.two.itemsize + assert_equal(self.two.size, 20) + assert_equal(self.two.nbytes, 20*num) + assert_equal(self.two.itemsize, self.two.dtype.itemsize) + assert_equal(self.two.base, np.arange(20)) + + def test_dtypeattr(self): + assert_equal(self.one.dtype, np.dtype(np.int_)) + assert_equal(self.three.dtype, np.dtype(np.float64)) + assert_equal(self.one.dtype.char, np.dtype(int).char) + assert self.one.dtype.char in "lq" + assert_equal(self.three.dtype.char, 'd') + assert_(self.three.dtype.str[0] in '<>') + assert_equal(self.one.dtype.str[1], 'i') + assert_equal(self.three.dtype.str[1], 'f') + + def test_int_subclassing(self): + # Regression test for https://github.com/numpy/numpy/pull/3526 + + numpy_int = np.int_(0) + + # int_ doesn't inherit from Python int, because it's not fixed-width + assert_(not isinstance(numpy_int, int)) + + def test_stridesattr(self): + x = self.one + + def make_array(size, offset, strides): + return np.ndarray(size, buffer=x, dtype=int, + offset=offset*x.itemsize, + strides=strides*x.itemsize) + + assert_equal(make_array(4, 4, -1), np.array([4, 3, 2, 1])) + assert_raises(ValueError, make_array, 4, 4, -2) + assert_raises(ValueError, make_array, 4, 2, -1) + assert_raises(ValueError, make_array, 8, 3, 1) + assert_equal(make_array(8, 3, 0), np.array([3]*8)) + # Check behavior reported in gh-2503: + assert_raises(ValueError, make_array, (2, 3), 5, np.array([-2, -3])) + make_array(0, 0, 10) + + def test_set_stridesattr(self): + x = self.one + + def make_array(size, offset, strides): + try: + r = np.ndarray([size], dtype=int, buffer=x, + offset=offset*x.itemsize) + except Exception as e: + raise RuntimeError(e) + r.strides = strides = strides*x.itemsize + return r + + assert_equal(make_array(4, 4, -1), np.array([4, 3, 2, 1])) + assert_equal(make_array(7, 3, 1), np.array([3, 4, 5, 6, 7, 8, 9])) + assert_raises(ValueError, make_array, 4, 4, -2) + assert_raises(ValueError, make_array, 4, 2, -1) + assert_raises(RuntimeError, make_array, 8, 3, 1) + # Check that the true extent of the array is used. + # Test relies on as_strided base not exposing a buffer. + x = np.lib.stride_tricks.as_strided(np.arange(1), (10, 10), (0, 0)) + + def set_strides(arr, strides): + arr.strides = strides + + assert_raises(ValueError, set_strides, x, (10*x.itemsize, x.itemsize)) + + # Test for offset calculations: + x = np.lib.stride_tricks.as_strided(np.arange(10, dtype=np.int8)[-1], + shape=(10,), strides=(-1,)) + assert_raises(ValueError, set_strides, x[::-1], -1) + a = x[::-1] + a.strides = 1 + a[::2].strides = 2 + + # test 0d + arr_0d = np.array(0) + arr_0d.strides = () + assert_raises(TypeError, set_strides, arr_0d, None) + + def test_fill(self): + for t in "?bhilqpBHILQPfdgFDGO": + x = np.empty((3, 2, 1), t) + y = np.empty((3, 2, 1), t) + x.fill(1) + y[...] = 1 + assert_equal(x, y) + + def test_fill_max_uint64(self): + x = np.empty((3, 2, 1), dtype=np.uint64) + y = np.empty((3, 2, 1), dtype=np.uint64) + value = 2**64 - 1 + y[...] = value + x.fill(value) + assert_array_equal(x, y) + + def test_fill_struct_array(self): + # Filling from a scalar + x = np.array([(0, 0.0), (1, 1.0)], dtype='i4,f8') + x.fill(x[0]) + assert_equal(x['f1'][1], x['f1'][0]) + # Filling from a tuple that can be converted + # to a scalar + x = np.zeros(2, dtype=[('a', 'f8'), ('b', 'i4')]) + x.fill((3.5, -2)) + assert_array_equal(x['a'], [3.5, 3.5]) + assert_array_equal(x['b'], [-2, -2]) + + def test_fill_readonly(self): + # gh-22922 + a = np.zeros(11) + a.setflags(write=False) + with pytest.raises(ValueError, match=".*read-only"): + a.fill(0) + + def test_fill_subarrays(self): + # NOTE: + # This is also a regression test for a crash with PYTHONMALLOC=debug + + dtype = np.dtype("2i4')) + assert_(np.dtype([('a', 'i4')])) + + def test_structured_non_void(self): + fields = [('a', 'i8'), ('b', 'f8')]) + assert_equal(a == b, [False, True]) + assert_equal(a != b, [True, False]) + + a = np.array([(5, 42), (10, 1)], dtype=[('a', '>f8'), ('b', 'i8')]) + assert_equal(a == b, [False, True]) + assert_equal(a != b, [True, False]) + + # Including with embedded subarray dtype (although subarray comparison + # itself may still be a bit weird and compare the raw data) + a = np.array([(5, 42), (10, 1)], dtype=[('a', '10>f8'), ('b', '5i8')]) + assert_equal(a == b, [False, True]) + assert_equal(a != b, [True, False]) + + @pytest.mark.parametrize("op", [ + operator.eq, lambda x, y: operator.eq(y, x), + operator.ne, lambda x, y: operator.ne(y, x)]) + def test_void_comparison_failures(self, op): + # In principle, one could decide to return an array of False for some + # if comparisons are impossible. But right now we return TypeError + # when "void" dtype are involved. + x = np.zeros(3, dtype=[('a', 'i1')]) + y = np.zeros(3) + # Cannot compare non-structured to structured: + with pytest.raises(TypeError): + op(x, y) + + # Added title prevents promotion, but casts are OK: + y = np.zeros(3, dtype=[(('title', 'a'), 'i1')]) + assert np.can_cast(y.dtype, x.dtype) + with pytest.raises(TypeError): + op(x, y) + + x = np.zeros(3, dtype="V7") + y = np.zeros(3, dtype="V8") + with pytest.raises(TypeError): + op(x, y) + + def test_casting(self): + # Check that casting a structured array to change its byte order + # works + a = np.array([(1,)], dtype=[('a', 'i4')], casting='unsafe')) + b = a.astype([('a', '>i4')]) + a_tmp = a.byteswap() + a_tmp = a_tmp.view(a_tmp.dtype.newbyteorder()) + assert_equal(b, a_tmp) + assert_equal(a['a'][0], b['a'][0]) + + # Check that equality comparison works on structured arrays if + # they are 'equiv'-castable + a = np.array([(5, 42), (10, 1)], dtype=[('a', '>i4'), ('b', 'f8')]) + assert_(np.can_cast(a.dtype, b.dtype, casting='equiv')) + assert_equal(a == b, [True, True]) + + # Check that 'equiv' casting can change byte order + assert_(np.can_cast(a.dtype, b.dtype, casting='equiv')) + c = a.astype(b.dtype, casting='equiv') + assert_equal(a == c, [True, True]) + + # Check that 'safe' casting can change byte order and up-cast + # fields + t = [('a', 'f8')] + assert_(np.can_cast(a.dtype, t, casting='safe')) + c = a.astype(t, casting='safe') + assert_equal((c == np.array([(5, 42), (10, 1)], dtype=t)), + [True, True]) + + # Check that 'same_kind' casting can change byte order and + # change field widths within a "kind" + t = [('a', 'f4')] + assert_(np.can_cast(a.dtype, t, casting='same_kind')) + c = a.astype(t, casting='same_kind') + assert_equal((c == np.array([(5, 42), (10, 1)], dtype=t)), + [True, True]) + + # Check that casting fails if the casting rule should fail on + # any of the fields + t = [('a', '>i8'), ('b', 'i2'), ('b', 'i8'), ('b', 'i4')] + assert_(not np.can_cast(a.dtype, t, casting=casting)) + t = [('a', '>i4'), ('b', 'i8") + ab = np.array([(1, 2)], dtype=[A, B]) + ba = np.array([(1, 2)], dtype=[B, A]) + assert_raises(TypeError, np.concatenate, ab, ba) + assert_raises(TypeError, np.result_type, ab.dtype, ba.dtype) + assert_raises(TypeError, np.promote_types, ab.dtype, ba.dtype) + + # dtypes with same field names/order but different memory offsets + # and byte-order are promotable to packed nbo. + assert_equal(np.promote_types(ab.dtype, ba[['a', 'b']].dtype), + repack_fields(ab.dtype.newbyteorder('N'))) + + # gh-13667 + # dtypes with different fieldnames but castable field types are castable + assert_equal(np.can_cast(ab.dtype, ba.dtype), True) + assert_equal(ab.astype(ba.dtype).dtype, ba.dtype) + assert_equal(np.can_cast('f8,i8', [('f0', 'f8'), ('f1', 'i8')]), True) + assert_equal(np.can_cast('f8,i8', [('f1', 'f8'), ('f0', 'i8')]), True) + assert_equal(np.can_cast('f8,i8', [('f1', 'i8'), ('f0', 'f8')]), False) + assert_equal(np.can_cast('f8,i8', [('f1', 'i8'), ('f0', 'f8')], + casting='unsafe'), True) + + ab[:] = ba # make sure assignment still works + + # tests of type-promotion of corresponding fields + dt1 = np.dtype([("", "i4")]) + dt2 = np.dtype([("", "i8")]) + assert_equal(np.promote_types(dt1, dt2), np.dtype([('f0', 'i8')])) + assert_equal(np.promote_types(dt2, dt1), np.dtype([('f0', 'i8')])) + assert_raises(TypeError, np.promote_types, dt1, np.dtype([("", "V3")])) + assert_equal(np.promote_types('i4,f8', 'i8,f4'), + np.dtype([('f0', 'i8'), ('f1', 'f8')])) + # test nested case + dt1nest = np.dtype([("", dt1)]) + dt2nest = np.dtype([("", dt2)]) + assert_equal(np.promote_types(dt1nest, dt2nest), + np.dtype([('f0', np.dtype([('f0', 'i8')]))])) + + # note that offsets are lost when promoting: + dt = np.dtype({'names': ['x'], 'formats': ['i4'], 'offsets': [8]}) + a = np.ones(3, dtype=dt) + assert_equal(np.concatenate([a, a]).dtype, np.dtype([('x', 'i4')])) + + @pytest.mark.parametrize("dtype_dict", [ + dict(names=["a", "b"], formats=["i4", "f"], itemsize=100), + dict(names=["a", "b"], formats=["i4", "f"], + offsets=[0, 12])]) + @pytest.mark.parametrize("align", [True, False]) + def test_structured_promotion_packs(self, dtype_dict, align): + # Structured dtypes are packed when promoted (we consider the packed + # form to be "canonical"), so tere is no extra padding. + dtype = np.dtype(dtype_dict, align=align) + # Remove non "canonical" dtype options: + dtype_dict.pop("itemsize", None) + dtype_dict.pop("offsets", None) + expected = np.dtype(dtype_dict, align=align) + + res = np.promote_types(dtype, dtype) + assert res.itemsize == expected.itemsize + assert res.fields == expected.fields + + # But the "expected" one, should just be returned unchanged: + res = np.promote_types(expected, expected) + assert res is expected + + def test_structured_asarray_is_view(self): + # A scalar viewing an array preserves its view even when creating a + # new array. This test documents behaviour, it may not be the best + # desired behaviour. + arr = np.array([1], dtype="i,i") + scalar = arr[0] + assert not scalar.flags.owndata # view into the array + assert np.asarray(scalar).base is scalar + # But never when a dtype is passed in: + assert np.asarray(scalar, dtype=scalar.dtype).base is None + # A scalar which owns its data does not have this property. + # It is not easy to create one, one method is to use pickle: + scalar = pickle.loads(pickle.dumps(scalar)) + assert scalar.flags.owndata + assert np.asarray(scalar).base is None + +class TestBool: + def test_test_interning(self): + a0 = np.bool(0) + b0 = np.bool(False) + assert_(a0 is b0) + a1 = np.bool(1) + b1 = np.bool(True) + assert_(a1 is b1) + assert_(np.array([True])[0] is a1) + assert_(np.array(True)[()] is a1) + + def test_sum(self): + d = np.ones(101, dtype=bool) + assert_equal(d.sum(), d.size) + assert_equal(d[::2].sum(), d[::2].size) + assert_equal(d[::-2].sum(), d[::-2].size) + + d = np.frombuffer(b'\xff\xff' * 100, dtype=bool) + assert_equal(d.sum(), d.size) + assert_equal(d[::2].sum(), d[::2].size) + assert_equal(d[::-2].sum(), d[::-2].size) + + def check_count_nonzero(self, power, length): + powers = [2 ** i for i in range(length)] + for i in range(2**power): + l = [(i & x) != 0 for x in powers] + a = np.array(l, dtype=bool) + c = builtins.sum(l) + assert_equal(np.count_nonzero(a), c) + av = a.view(np.uint8) + av *= 3 + assert_equal(np.count_nonzero(a), c) + av *= 4 + assert_equal(np.count_nonzero(a), c) + av[av != 0] = 0xFF + assert_equal(np.count_nonzero(a), c) + + def test_count_nonzero(self): + # check all 12 bit combinations in a length 17 array + # covers most cases of the 16 byte unrolled code + self.check_count_nonzero(12, 17) + + @pytest.mark.slow + def test_count_nonzero_all(self): + # check all combinations in a length 17 array + # covers all cases of the 16 byte unrolled code + self.check_count_nonzero(17, 17) + + def test_count_nonzero_unaligned(self): + # prevent mistakes as e.g. gh-4060 + for o in range(7): + a = np.zeros((18,), dtype=bool)[o+1:] + a[:o] = True + assert_equal(np.count_nonzero(a), builtins.sum(a.tolist())) + a = np.ones((18,), dtype=bool)[o+1:] + a[:o] = False + assert_equal(np.count_nonzero(a), builtins.sum(a.tolist())) + + def _test_cast_from_flexible(self, dtype): + # empty string -> false + for n in range(3): + v = np.array(b'', (dtype, n)) + assert_equal(bool(v), False) + assert_equal(bool(v[()]), False) + assert_equal(v.astype(bool), False) + assert_(isinstance(v.astype(bool), np.ndarray)) + assert_(v[()].astype(bool) is np.False_) + + # anything else -> true + for n in range(1, 4): + for val in [b'a', b'0', b' ']: + v = np.array(val, (dtype, n)) + assert_equal(bool(v), True) + assert_equal(bool(v[()]), True) + assert_equal(v.astype(bool), True) + assert_(isinstance(v.astype(bool), np.ndarray)) + assert_(v[()].astype(bool) is np.True_) + + def test_cast_from_void(self): + self._test_cast_from_flexible(np.void) + + @pytest.mark.xfail(reason="See gh-9847") + def test_cast_from_unicode(self): + self._test_cast_from_flexible(np.str_) + + @pytest.mark.xfail(reason="See gh-9847") + def test_cast_from_bytes(self): + self._test_cast_from_flexible(np.bytes_) + + +class TestZeroSizeFlexible: + @staticmethod + def _zeros(shape, dtype=str): + dtype = np.dtype(dtype) + if dtype == np.void: + return np.zeros(shape, dtype=(dtype, 0)) + + # not constructable directly + dtype = np.dtype([('x', dtype, 0)]) + return np.zeros(shape, dtype=dtype)['x'] + + def test_create(self): + zs = self._zeros(10, bytes) + assert_equal(zs.itemsize, 0) + zs = self._zeros(10, np.void) + assert_equal(zs.itemsize, 0) + zs = self._zeros(10, str) + assert_equal(zs.itemsize, 0) + + def _test_sort_partition(self, name, kinds, **kwargs): + # Previously, these would all hang + for dt in [bytes, np.void, str]: + zs = self._zeros(10, dt) + sort_method = getattr(zs, name) + sort_func = getattr(np, name) + for kind in kinds: + sort_method(kind=kind, **kwargs) + sort_func(zs, kind=kind, **kwargs) + + def test_sort(self): + self._test_sort_partition('sort', kinds='qhs') + + def test_argsort(self): + self._test_sort_partition('argsort', kinds='qhs') + + def test_partition(self): + self._test_sort_partition('partition', kinds=['introselect'], kth=2) + + def test_argpartition(self): + self._test_sort_partition('argpartition', kinds=['introselect'], kth=2) + + def test_resize(self): + # previously an error + for dt in [bytes, np.void, str]: + zs = self._zeros(10, dt) + zs.resize(25) + zs.resize((10, 10)) + + def test_view(self): + for dt in [bytes, np.void, str]: + zs = self._zeros(10, dt) + + # viewing as itself should be allowed + assert_equal(zs.view(dt).dtype, np.dtype(dt)) + + # viewing as any non-empty type gives an empty result + assert_equal(zs.view((dt, 1)).shape, (0,)) + + def test_dumps(self): + zs = self._zeros(10, int) + assert_equal(zs, pickle.loads(zs.dumps())) + + def test_pickle(self): + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + for dt in [bytes, np.void, str]: + zs = self._zeros(10, dt) + p = pickle.dumps(zs, protocol=proto) + zs2 = pickle.loads(p) + + assert_equal(zs.dtype, zs2.dtype) + + def test_pickle_empty(self): + """Checking if an empty array pickled and un-pickled will not cause a + segmentation fault""" + arr = np.array([]).reshape(999999, 0) + pk_dmp = pickle.dumps(arr) + pk_load = pickle.loads(pk_dmp) + + assert pk_load.size == 0 + + @pytest.mark.skipif(pickle.HIGHEST_PROTOCOL < 5, + reason="requires pickle protocol 5") + def test_pickle_with_buffercallback(self): + array = np.arange(10) + buffers = [] + bytes_string = pickle.dumps(array, buffer_callback=buffers.append, + protocol=5) + array_from_buffer = pickle.loads(bytes_string, buffers=buffers) + # when using pickle protocol 5 with buffer callbacks, + # array_from_buffer is reconstructed from a buffer holding a view + # to the initial array's data, so modifying an element in array + # should modify it in array_from_buffer too. + array[0] = -1 + assert array_from_buffer[0] == -1, array_from_buffer[0] + + +class TestMethods: + + sort_kinds = ['quicksort', 'heapsort', 'stable'] + + def test_all_where(self): + a = np.array([[True, False, True], + [False, False, False], + [True, True, True]]) + wh_full = np.array([[True, False, True], + [False, False, False], + [True, False, True]]) + wh_lower = np.array([[False], + [False], + [True]]) + for _ax in [0, None]: + assert_equal(a.all(axis=_ax, where=wh_lower), + np.all(a[wh_lower[:,0],:], axis=_ax)) + assert_equal(np.all(a, axis=_ax, where=wh_lower), + a[wh_lower[:,0],:].all(axis=_ax)) + + assert_equal(a.all(where=wh_full), True) + assert_equal(np.all(a, where=wh_full), True) + assert_equal(a.all(where=False), True) + assert_equal(np.all(a, where=False), True) + + def test_any_where(self): + a = np.array([[True, False, True], + [False, False, False], + [True, True, True]]) + wh_full = np.array([[False, True, False], + [True, True, True], + [False, False, False]]) + wh_middle = np.array([[False], + [True], + [False]]) + for _ax in [0, None]: + assert_equal(a.any(axis=_ax, where=wh_middle), + np.any(a[wh_middle[:,0],:], axis=_ax)) + assert_equal(np.any(a, axis=_ax, where=wh_middle), + a[wh_middle[:,0],:].any(axis=_ax)) + assert_equal(a.any(where=wh_full), False) + assert_equal(np.any(a, where=wh_full), False) + assert_equal(a.any(where=False), False) + assert_equal(np.any(a, where=False), False) + + @pytest.mark.parametrize("dtype", + ["i8", "U10", "object", "datetime64[ms]"]) + def test_any_and_all_result_dtype(self, dtype): + arr = np.ones(3, dtype=dtype) + assert arr.any().dtype == np.bool + assert arr.all().dtype == np.bool + + def test_any_and_all_object_dtype(self): + # (seberg) Not sure we should even allow dtype here, but it is. + arr = np.ones(3, dtype=object) + # keepdims to prevent getting a scalar. + assert arr.any(dtype=object, keepdims=True).dtype == object + assert arr.all(dtype=object, keepdims=True).dtype == object + + def test_compress(self): + tgt = [[5, 6, 7, 8, 9]] + arr = np.arange(10).reshape(2, 5) + out = arr.compress([0, 1], axis=0) + assert_equal(out, tgt) + + tgt = [[1, 3], [6, 8]] + out = arr.compress([0, 1, 0, 1, 0], axis=1) + assert_equal(out, tgt) + + tgt = [[1], [6]] + arr = np.arange(10).reshape(2, 5) + out = arr.compress([0, 1], axis=1) + assert_equal(out, tgt) + + arr = np.arange(10).reshape(2, 5) + out = arr.compress([0, 1]) + assert_equal(out, 1) + + def test_choose(self): + x = 2*np.ones((3,), dtype=int) + y = 3*np.ones((3,), dtype=int) + x2 = 2*np.ones((2, 3), dtype=int) + y2 = 3*np.ones((2, 3), dtype=int) + ind = np.array([0, 0, 1]) + + A = ind.choose((x, y)) + assert_equal(A, [2, 2, 3]) + + A = ind.choose((x2, y2)) + assert_equal(A, [[2, 2, 3], [2, 2, 3]]) + + A = ind.choose((x, y2)) + assert_equal(A, [[2, 2, 3], [2, 2, 3]]) + + oned = np.ones(1) + # gh-12031, caused SEGFAULT + assert_raises(TypeError, oned.choose,np.void(0), [oned]) + + out = np.array(0) + ret = np.choose(np.array(1), [10, 20, 30], out=out) + assert out is ret + assert_equal(out[()], 20) + + # gh-6272 check overlap on out + x = np.arange(5) + y = np.choose([0,0,0], [x[:3], x[:3], x[:3]], out=x[1:4], mode='wrap') + assert_equal(y, np.array([0, 1, 2])) + + def test_prod(self): + ba = [1, 2, 10, 11, 6, 5, 4] + ba2 = [[1, 2, 3, 4], [5, 6, 7, 9], [10, 3, 4, 5]] + + for ctype in [np.int16, np.uint16, np.int32, np.uint32, + np.float32, np.float64, np.complex64, np.complex128]: + a = np.array(ba, ctype) + a2 = np.array(ba2, ctype) + if ctype in ['1', 'b']: + assert_raises(ArithmeticError, a.prod) + assert_raises(ArithmeticError, a2.prod, axis=1) + else: + assert_equal(a.prod(axis=0), 26400) + assert_array_equal(a2.prod(axis=0), + np.array([50, 36, 84, 180], ctype)) + assert_array_equal(a2.prod(axis=-1), + np.array([24, 1890, 600], ctype)) + + @pytest.mark.parametrize('dtype', [None, object]) + def test_repeat(self, dtype): + m = np.array([1, 2, 3, 4, 5, 6], dtype=dtype) + m_rect = m.reshape((2, 3)) + + A = m.repeat([1, 3, 2, 1, 1, 2]) + assert_equal(A, [1, 2, 2, 2, 3, + 3, 4, 5, 6, 6]) + + A = m.repeat(2) + assert_equal(A, [1, 1, 2, 2, 3, 3, + 4, 4, 5, 5, 6, 6]) + + A = m_rect.repeat([2, 1], axis=0) + assert_equal(A, [[1, 2, 3], + [1, 2, 3], + [4, 5, 6]]) + + A = m_rect.repeat([1, 3, 2], axis=1) + assert_equal(A, [[1, 2, 2, 2, 3, 3], + [4, 5, 5, 5, 6, 6]]) + + A = m_rect.repeat(2, axis=0) + assert_equal(A, [[1, 2, 3], + [1, 2, 3], + [4, 5, 6], + [4, 5, 6]]) + + A = m_rect.repeat(2, axis=1) + assert_equal(A, [[1, 1, 2, 2, 3, 3], + [4, 4, 5, 5, 6, 6]]) + + def test_reshape(self): + arr = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9], [10, 11, 12]]) + + tgt = [[1, 2, 3, 4, 5, 6], [7, 8, 9, 10, 11, 12]] + assert_equal(arr.reshape(2, 6), tgt) + + tgt = [[1, 2, 3, 4], [5, 6, 7, 8], [9, 10, 11, 12]] + assert_equal(arr.reshape(3, 4), tgt) + + tgt = [[1, 10, 8, 6], [4, 2, 11, 9], [7, 5, 3, 12]] + assert_equal(arr.reshape((3, 4), order='F'), tgt) + + tgt = [[1, 4, 7, 10], [2, 5, 8, 11], [3, 6, 9, 12]] + assert_equal(arr.T.reshape((3, 4), order='C'), tgt) + + def test_round(self): + def check_round(arr, expected, *round_args): + assert_equal(arr.round(*round_args), expected) + # With output array + out = np.zeros_like(arr) + res = arr.round(*round_args, out=out) + assert_equal(out, expected) + assert out is res + + check_round(np.array([1.2, 1.5]), [1, 2]) + check_round(np.array(1.5), 2) + check_round(np.array([12.2, 15.5]), [10, 20], -1) + check_round(np.array([12.15, 15.51]), [12.2, 15.5], 1) + # Complex rounding + check_round(np.array([4.5 + 1.5j]), [4 + 2j]) + check_round(np.array([12.5 + 15.5j]), [10 + 20j], -1) + + def test_squeeze(self): + a = np.array([[[1], [2], [3]]]) + assert_equal(a.squeeze(), [1, 2, 3]) + assert_equal(a.squeeze(axis=(0,)), [[1], [2], [3]]) + assert_raises(ValueError, a.squeeze, axis=(1,)) + assert_equal(a.squeeze(axis=(2,)), [[1, 2, 3]]) + + def test_transpose(self): + a = np.array([[1, 2], [3, 4]]) + assert_equal(a.transpose(), [[1, 3], [2, 4]]) + assert_raises(ValueError, lambda: a.transpose(0)) + assert_raises(ValueError, lambda: a.transpose(0, 0)) + assert_raises(ValueError, lambda: a.transpose(0, 1, 2)) + + def test_sort(self): + # test ordering for floats and complex containing nans. It is only + # necessary to check the less-than comparison, so sorts that + # only follow the insertion sort path are sufficient. We only + # test doubles and complex doubles as the logic is the same. + + # check doubles + msg = "Test real sort order with nans" + a = np.array([np.nan, 1, 0]) + b = np.sort(a) + assert_equal(b, a[::-1], msg) + # check complex + msg = "Test complex sort order with nans" + a = np.zeros(9, dtype=np.complex128) + a.real += [np.nan, np.nan, np.nan, 1, 0, 1, 1, 0, 0] + a.imag += [np.nan, 1, 0, np.nan, np.nan, 1, 0, 1, 0] + b = np.sort(a) + assert_equal(b, a[::-1], msg) + + with assert_raises_regex( + ValueError, + "kind` and `stable` parameters can't be provided at the same time" + ): + np.sort(a, kind="stable", stable=True) + + # all c scalar sorts use the same code with different types + # so it suffices to run a quick check with one type. The number + # of sorted items must be greater than ~50 to check the actual + # algorithm because quick and merge sort fall over to insertion + # sort for small arrays. + + @pytest.mark.parametrize('dtype', [np.uint8, np.uint16, np.uint32, np.uint64, + np.float16, np.float32, np.float64, + np.longdouble]) + def test_sort_unsigned(self, dtype): + a = np.arange(101, dtype=dtype) + b = a[::-1].copy() + for kind in self.sort_kinds: + msg = "scalar sort, kind=%s" % kind + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + c = b.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + @pytest.mark.parametrize('dtype', + [np.int8, np.int16, np.int32, np.int64, np.float16, + np.float32, np.float64, np.longdouble]) + def test_sort_signed(self, dtype): + a = np.arange(-50, 51, dtype=dtype) + b = a[::-1].copy() + for kind in self.sort_kinds: + msg = "scalar sort, kind=%s" % (kind) + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + c = b.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + @pytest.mark.parametrize('dtype', [np.float32, np.float64, np.longdouble]) + @pytest.mark.parametrize('part', ['real', 'imag']) + def test_sort_complex(self, part, dtype): + # test complex sorts. These use the same code as the scalars + # but the compare function differs. + cdtype = { + np.single: np.csingle, + np.double: np.cdouble, + np.longdouble: np.clongdouble, + }[dtype] + a = np.arange(-50, 51, dtype=dtype) + b = a[::-1].copy() + ai = (a * (1+1j)).astype(cdtype) + bi = (b * (1+1j)).astype(cdtype) + setattr(ai, part, 1) + setattr(bi, part, 1) + for kind in self.sort_kinds: + msg = "complex sort, %s part == 1, kind=%s" % (part, kind) + c = ai.copy() + c.sort(kind=kind) + assert_equal(c, ai, msg) + c = bi.copy() + c.sort(kind=kind) + assert_equal(c, ai, msg) + + def test_sort_complex_byte_swapping(self): + # test sorting of complex arrays requiring byte-swapping, gh-5441 + for endianness in '<>': + for dt in np.typecodes['Complex']: + arr = np.array([1+3.j, 2+2.j, 3+1.j], dtype=endianness + dt) + c = arr.copy() + c.sort() + msg = 'byte-swapped complex sort, dtype={0}'.format(dt) + assert_equal(c, arr, msg) + + @pytest.mark.parametrize('dtype', [np.bytes_, np.str_]) + def test_sort_string(self, dtype): + # np.array will perform the encoding to bytes for us in the bytes test + a = np.array(['aaaaaaaa' + chr(i) for i in range(101)], dtype=dtype) + b = a[::-1].copy() + for kind in self.sort_kinds: + msg = "kind=%s" % kind + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + c = b.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + def test_sort_object(self): + # test object array sorts. + a = np.empty((101,), dtype=object) + a[:] = list(range(101)) + b = a[::-1] + for kind in ['q', 'h', 'm']: + msg = "kind=%s" % kind + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + c = b.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + @pytest.mark.parametrize("dt", [ + np.dtype([('f', float), ('i', int)]), + np.dtype([('f', float), ('i', object)])]) + @pytest.mark.parametrize("step", [1, 2]) + def test_sort_structured(self, dt, step): + # test record array sorts. + a = np.array([(i, i) for i in range(101*step)], dtype=dt) + b = a[::-1] + for kind in ['q', 'h', 'm']: + msg = "kind=%s" % kind + c = a.copy()[::step] + indx = c.argsort(kind=kind) + c.sort(kind=kind) + assert_equal(c, a[::step], msg) + assert_equal(a[::step][indx], a[::step], msg) + c = b.copy()[::step] + indx = c.argsort(kind=kind) + c.sort(kind=kind) + assert_equal(c, a[step-1::step], msg) + assert_equal(b[::step][indx], a[step-1::step], msg) + + @pytest.mark.parametrize('dtype', ['datetime64[D]', 'timedelta64[D]']) + def test_sort_time(self, dtype): + # test datetime64 and timedelta64 sorts. + a = np.arange(0, 101, dtype=dtype) + b = a[::-1] + for kind in ['q', 'h', 'm']: + msg = "kind=%s" % kind + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + c = b.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + def test_sort_axis(self): + # check axis handling. This should be the same for all type + # specific sorts, so we only check it for one type and one kind + a = np.array([[3, 2], [1, 0]]) + b = np.array([[1, 0], [3, 2]]) + c = np.array([[2, 3], [0, 1]]) + d = a.copy() + d.sort(axis=0) + assert_equal(d, b, "test sort with axis=0") + d = a.copy() + d.sort(axis=1) + assert_equal(d, c, "test sort with axis=1") + d = a.copy() + d.sort() + assert_equal(d, c, "test sort with default axis") + + def test_sort_size_0(self): + # check axis handling for multidimensional empty arrays + a = np.array([]) + a.shape = (3, 2, 1, 0) + for axis in range(-a.ndim, a.ndim): + msg = 'test empty array sort with axis={0}'.format(axis) + assert_equal(np.sort(a, axis=axis), a, msg) + msg = 'test empty array sort with axis=None' + assert_equal(np.sort(a, axis=None), a.ravel(), msg) + + def test_sort_bad_ordering(self): + # test generic class with bogus ordering, + # should not segfault. + class Boom: + def __lt__(self, other): + return True + + a = np.array([Boom()] * 100, dtype=object) + for kind in self.sort_kinds: + msg = "kind=%s" % kind + c = a.copy() + c.sort(kind=kind) + assert_equal(c, a, msg) + + def test_void_sort(self): + # gh-8210 - previously segfaulted + for i in range(4): + rand = np.random.randint(256, size=4000, dtype=np.uint8) + arr = rand.view('V4') + arr[::-1].sort() + + dt = np.dtype([('val', 'i4', (1,))]) + for i in range(4): + rand = np.random.randint(256, size=4000, dtype=np.uint8) + arr = rand.view(dt) + arr[::-1].sort() + + def test_sort_raises(self): + #gh-9404 + arr = np.array([0, datetime.now(), 1], dtype=object) + for kind in self.sort_kinds: + assert_raises(TypeError, arr.sort, kind=kind) + #gh-3879 + class Raiser: + def raises_anything(*args, **kwargs): + raise TypeError("SOMETHING ERRORED") + __eq__ = __ne__ = __lt__ = __gt__ = __ge__ = __le__ = raises_anything + arr = np.array([[Raiser(), n] for n in range(10)]).reshape(-1) + np.random.shuffle(arr) + for kind in self.sort_kinds: + assert_raises(TypeError, arr.sort, kind=kind) + + def test_sort_degraded(self): + # test degraded dataset would take minutes to run with normal qsort + d = np.arange(1000000) + do = d.copy() + x = d + # create a median of 3 killer where each median is the sorted second + # last element of the quicksort partition + while x.size > 3: + mid = x.size // 2 + x[mid], x[-2] = x[-2], x[mid] + x = x[:-2] + + assert_equal(np.sort(d), do) + assert_equal(d[np.argsort(d)], do) + + def test_copy(self): + def assert_fortran(arr): + assert_(arr.flags.fortran) + assert_(arr.flags.f_contiguous) + assert_(not arr.flags.c_contiguous) + + def assert_c(arr): + assert_(not arr.flags.fortran) + assert_(not arr.flags.f_contiguous) + assert_(arr.flags.c_contiguous) + + a = np.empty((2, 2), order='F') + # Test copying a Fortran array + assert_c(a.copy()) + assert_c(a.copy('C')) + assert_fortran(a.copy('F')) + assert_fortran(a.copy('A')) + + # Now test starting with a C array. + a = np.empty((2, 2), order='C') + assert_c(a.copy()) + assert_c(a.copy('C')) + assert_fortran(a.copy('F')) + assert_c(a.copy('A')) + + @pytest.mark.parametrize("dtype", ['O', np.int32, 'i,O']) + def test__deepcopy__(self, dtype): + # Force the entry of NULLs into array + a = np.empty(4, dtype=dtype) + ctypes.memset(a.ctypes.data, 0, a.nbytes) + + # Ensure no error is raised, see gh-21833 + b = a.__deepcopy__({}) + + a[0] = 42 + with pytest.raises(AssertionError): + assert_array_equal(a, b) + + def test__deepcopy__catches_failure(self): + class MyObj: + def __deepcopy__(self, *args, **kwargs): + raise RuntimeError + + arr = np.array([1, MyObj(), 3], dtype='O') + with pytest.raises(RuntimeError): + arr.__deepcopy__({}) + + def test_sort_order(self): + # Test sorting an array with fields + x1 = np.array([21, 32, 14]) + x2 = np.array(['my', 'first', 'name']) + x3 = np.array([3.1, 4.5, 6.2]) + r = np.rec.fromarrays([x1, x2, x3], names='id,word,number') + + r.sort(order=['id']) + assert_equal(r.id, np.array([14, 21, 32])) + assert_equal(r.word, np.array(['name', 'my', 'first'])) + assert_equal(r.number, np.array([6.2, 3.1, 4.5])) + + r.sort(order=['word']) + assert_equal(r.id, np.array([32, 21, 14])) + assert_equal(r.word, np.array(['first', 'my', 'name'])) + assert_equal(r.number, np.array([4.5, 3.1, 6.2])) + + r.sort(order=['number']) + assert_equal(r.id, np.array([21, 32, 14])) + assert_equal(r.word, np.array(['my', 'first', 'name'])) + assert_equal(r.number, np.array([3.1, 4.5, 6.2])) + + assert_raises_regex(ValueError, 'duplicate', + lambda: r.sort(order=['id', 'id'])) + + if sys.byteorder == 'little': + strtype = '>i2' + else: + strtype = '': + for dt in np.typecodes['Complex']: + arr = np.array([1+3.j, 2+2.j, 3+1.j], dtype=endianness + dt) + msg = 'byte-swapped complex argsort, dtype={0}'.format(dt) + assert_equal(arr.argsort(), + np.arange(len(arr), dtype=np.intp), msg) + + # test string argsorts. + s = 'aaaaaaaa' + a = np.array([s + chr(i) for i in range(101)]) + b = a[::-1].copy() + r = np.arange(101) + rr = r[::-1] + for kind in self.sort_kinds: + msg = "string argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # test unicode argsorts. + s = 'aaaaaaaa' + a = np.array([s + chr(i) for i in range(101)], dtype=np.str_) + b = a[::-1] + r = np.arange(101) + rr = r[::-1] + for kind in self.sort_kinds: + msg = "unicode argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # test object array argsorts. + a = np.empty((101,), dtype=object) + a[:] = list(range(101)) + b = a[::-1] + r = np.arange(101) + rr = r[::-1] + for kind in self.sort_kinds: + msg = "object argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # test structured array argsorts. + dt = np.dtype([('f', float), ('i', int)]) + a = np.array([(i, i) for i in range(101)], dtype=dt) + b = a[::-1] + r = np.arange(101) + rr = r[::-1] + for kind in self.sort_kinds: + msg = "structured array argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # test datetime64 argsorts. + a = np.arange(0, 101, dtype='datetime64[D]') + b = a[::-1] + r = np.arange(101) + rr = r[::-1] + for kind in ['q', 'h', 'm']: + msg = "datetime64 argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # test timedelta64 argsorts. + a = np.arange(0, 101, dtype='timedelta64[D]') + b = a[::-1] + r = np.arange(101) + rr = r[::-1] + for kind in ['q', 'h', 'm']: + msg = "timedelta64 argsort, kind=%s" % kind + assert_equal(a.copy().argsort(kind=kind), r, msg) + assert_equal(b.copy().argsort(kind=kind), rr, msg) + + # check axis handling. This should be the same for all type + # specific argsorts, so we only check it for one type and one kind + a = np.array([[3, 2], [1, 0]]) + b = np.array([[1, 1], [0, 0]]) + c = np.array([[1, 0], [1, 0]]) + assert_equal(a.copy().argsort(axis=0), b) + assert_equal(a.copy().argsort(axis=1), c) + assert_equal(a.copy().argsort(), c) + + # check axis handling for multidimensional empty arrays + a = np.array([]) + a.shape = (3, 2, 1, 0) + for axis in range(-a.ndim, a.ndim): + msg = 'test empty array argsort with axis={0}'.format(axis) + assert_equal(np.argsort(a, axis=axis), + np.zeros_like(a, dtype=np.intp), msg) + msg = 'test empty array argsort with axis=None' + assert_equal(np.argsort(a, axis=None), + np.zeros_like(a.ravel(), dtype=np.intp), msg) + + # check that stable argsorts are stable + r = np.arange(100) + # scalars + a = np.zeros(100) + assert_equal(a.argsort(kind='m'), r) + # complex + a = np.zeros(100, dtype=complex) + assert_equal(a.argsort(kind='m'), r) + # string + a = np.array(['aaaaaaaaa' for i in range(100)]) + assert_equal(a.argsort(kind='m'), r) + # unicode + a = np.array(['aaaaaaaaa' for i in range(100)], dtype=np.str_) + assert_equal(a.argsort(kind='m'), r) + + with assert_raises_regex( + ValueError, + "kind` and `stable` parameters can't be provided at the same time" + ): + np.argsort(a, kind="stable", stable=True) + + def test_sort_unicode_kind(self): + d = np.arange(10) + k = b'\xc3\xa4'.decode("UTF8") + assert_raises(ValueError, d.sort, kind=k) + assert_raises(ValueError, d.argsort, kind=k) + + @pytest.mark.parametrize('a', [ + np.array([0, 1, np.nan], dtype=np.float16), + np.array([0, 1, np.nan], dtype=np.float32), + np.array([0, 1, np.nan]), + ]) + def test_searchsorted_floats(self, a): + # test for floats arrays containing nans. Explicitly test + # half, single, and double precision floats to verify that + # the NaN-handling is correct. + msg = "Test real (%s) searchsorted with nans, side='l'" % a.dtype + b = a.searchsorted(a, side='left') + assert_equal(b, np.arange(3), msg) + msg = "Test real (%s) searchsorted with nans, side='r'" % a.dtype + b = a.searchsorted(a, side='right') + assert_equal(b, np.arange(1, 4), msg) + # check keyword arguments + a.searchsorted(v=1) + x = np.array([0, 1, np.nan], dtype='float32') + y = np.searchsorted(x, x[-1]) + assert_equal(y, 2) + + def test_searchsorted_complex(self): + # test for complex arrays containing nans. + # The search sorted routines use the compare functions for the + # array type, so this checks if that is consistent with the sort + # order. + # check double complex + a = np.zeros(9, dtype=np.complex128) + a.real += [0, 0, 1, 1, 0, 1, np.nan, np.nan, np.nan] + a.imag += [0, 1, 0, 1, np.nan, np.nan, 0, 1, np.nan] + msg = "Test complex searchsorted with nans, side='l'" + b = a.searchsorted(a, side='left') + assert_equal(b, np.arange(9), msg) + msg = "Test complex searchsorted with nans, side='r'" + b = a.searchsorted(a, side='right') + assert_equal(b, np.arange(1, 10), msg) + msg = "Test searchsorted with little endian, side='l'" + a = np.array([0, 128], dtype=' p[:, i]).all(), + msg="%d: %r < %r" % (i, p[:, i], p[:, i + 1:].T)) + for row in range(p.shape[0]): + self.assert_partitioned(p[row], [i]) + self.assert_partitioned(parg[row], [i]) + + p = np.partition(d0, i, axis=0, kind=k) + parg = d0[np.argpartition(d0, i, axis=0, kind=k), + np.arange(d0.shape[1])[None, :]] + aae(p[i, :], np.array([i] * d1.shape[0], dtype=dt)) + # array_less does not seem to work right + at((p[:i, :] <= p[i, :]).all(), + msg="%d: %r <= %r" % (i, p[i, :], p[:i, :])) + at((p[i + 1:, :] > p[i, :]).all(), + msg="%d: %r < %r" % (i, p[i, :], p[:, i + 1:])) + for col in range(p.shape[1]): + self.assert_partitioned(p[:, col], [i]) + self.assert_partitioned(parg[:, col], [i]) + + # check inplace + dc = d.copy() + dc.partition(i, kind=k) + assert_equal(dc, np.partition(d, i, kind=k)) + dc = d0.copy() + dc.partition(i, axis=0, kind=k) + assert_equal(dc, np.partition(d0, i, axis=0, kind=k)) + dc = d1.copy() + dc.partition(i, axis=1, kind=k) + assert_equal(dc, np.partition(d1, i, axis=1, kind=k)) + + def assert_partitioned(self, d, kth): + prev = 0 + for k in np.sort(kth): + assert_array_compare(operator.__le__, d[prev:k], d[k], + err_msg='kth %d' % k) + assert_((d[k:] >= d[k]).all(), + msg="kth %d, %r not greater equal %r" % (k, d[k:], d[k])) + prev = k + 1 + + def test_partition_iterative(self): + d = np.arange(17) + kth = (0, 1, 2, 429, 231) + assert_raises(ValueError, d.partition, kth) + assert_raises(ValueError, d.argpartition, kth) + d = np.arange(10).reshape((2, 5)) + assert_raises(ValueError, d.partition, kth, axis=0) + assert_raises(ValueError, d.partition, kth, axis=1) + assert_raises(ValueError, np.partition, d, kth, axis=1) + assert_raises(ValueError, np.partition, d, kth, axis=None) + + d = np.array([3, 4, 2, 1]) + p = np.partition(d, (0, 3)) + self.assert_partitioned(p, (0, 3)) + self.assert_partitioned(d[np.argpartition(d, (0, 3))], (0, 3)) + + assert_array_equal(p, np.partition(d, (-3, -1))) + assert_array_equal(p, d[np.argpartition(d, (-3, -1))]) + + d = np.arange(17) + np.random.shuffle(d) + d.partition(range(d.size)) + assert_array_equal(np.arange(17), d) + np.random.shuffle(d) + assert_array_equal(np.arange(17), d[d.argpartition(range(d.size))]) + + # test unsorted kth + d = np.arange(17) + np.random.shuffle(d) + keys = np.array([1, 3, 8, -2]) + np.random.shuffle(d) + p = np.partition(d, keys) + self.assert_partitioned(p, keys) + p = d[np.argpartition(d, keys)] + self.assert_partitioned(p, keys) + np.random.shuffle(keys) + assert_array_equal(np.partition(d, keys), p) + assert_array_equal(d[np.argpartition(d, keys)], p) + + # equal kth + d = np.arange(20)[::-1] + self.assert_partitioned(np.partition(d, [5]*4), [5]) + self.assert_partitioned(np.partition(d, [5]*4 + [6, 13]), + [5]*4 + [6, 13]) + self.assert_partitioned(d[np.argpartition(d, [5]*4)], [5]) + self.assert_partitioned(d[np.argpartition(d, [5]*4 + [6, 13])], + [5]*4 + [6, 13]) + + d = np.arange(12) + np.random.shuffle(d) + d1 = np.tile(np.arange(12), (4, 1)) + map(np.random.shuffle, d1) + d0 = np.transpose(d1) + + kth = (1, 6, 7, -1) + p = np.partition(d1, kth, axis=1) + pa = d1[np.arange(d1.shape[0])[:, None], + d1.argpartition(kth, axis=1)] + assert_array_equal(p, pa) + for i in range(d1.shape[0]): + self.assert_partitioned(p[i,:], kth) + p = np.partition(d0, kth, axis=0) + pa = d0[np.argpartition(d0, kth, axis=0), + np.arange(d0.shape[1])[None,:]] + assert_array_equal(p, pa) + for i in range(d0.shape[1]): + self.assert_partitioned(p[:, i], kth) + + def test_partition_cdtype(self): + d = np.array([('Galahad', 1.7, 38), ('Arthur', 1.8, 41), + ('Lancelot', 1.9, 38)], + dtype=[('name', '|S10'), ('height', ' (numpy ufunc, has_in_place_version, preferred_dtype) + ops = { + 'add': (np.add, True, float), + 'sub': (np.subtract, True, float), + 'mul': (np.multiply, True, float), + 'truediv': (np.true_divide, True, float), + 'floordiv': (np.floor_divide, True, float), + 'mod': (np.remainder, True, float), + 'divmod': (np.divmod, False, float), + 'pow': (np.power, True, int), + 'lshift': (np.left_shift, True, int), + 'rshift': (np.right_shift, True, int), + 'and': (np.bitwise_and, True, int), + 'xor': (np.bitwise_xor, True, int), + 'or': (np.bitwise_or, True, int), + 'matmul': (np.matmul, True, float), + # 'ge': (np.less_equal, False), + # 'gt': (np.less, False), + # 'le': (np.greater_equal, False), + # 'lt': (np.greater, False), + # 'eq': (np.equal, False), + # 'ne': (np.not_equal, False), + } + + class Coerced(Exception): + pass + + def array_impl(self): + raise Coerced + + def op_impl(self, other): + return "forward" + + def rop_impl(self, other): + return "reverse" + + def iop_impl(self, other): + return "in-place" + + def array_ufunc_impl(self, ufunc, method, *args, **kwargs): + return ("__array_ufunc__", ufunc, method, args, kwargs) + + # Create an object with the given base, in the given module, with a + # bunch of placeholder __op__ methods, and optionally a + # __array_ufunc__ and __array_priority__. + def make_obj(base, array_priority=False, array_ufunc=False, + alleged_module="__main__"): + class_namespace = {"__array__": array_impl} + if array_priority is not False: + class_namespace["__array_priority__"] = array_priority + for op in ops: + class_namespace["__{0}__".format(op)] = op_impl + class_namespace["__r{0}__".format(op)] = rop_impl + class_namespace["__i{0}__".format(op)] = iop_impl + if array_ufunc is not False: + class_namespace["__array_ufunc__"] = array_ufunc + eval_namespace = {"base": base, + "class_namespace": class_namespace, + "__name__": alleged_module, + } + MyType = eval("type('MyType', (base,), class_namespace)", + eval_namespace) + if issubclass(MyType, np.ndarray): + # Use this range to avoid special case weirdnesses around + # divide-by-0, pow(x, 2), overflow due to pow(big, big), etc. + return np.arange(3, 7).reshape(2, 2).view(MyType) + else: + return MyType() + + def check(obj, binop_override_expected, ufunc_override_expected, + inplace_override_expected, check_scalar=True): + for op, (ufunc, has_inplace, dtype) in ops.items(): + err_msg = ('op: %s, ufunc: %s, has_inplace: %s, dtype: %s' + % (op, ufunc, has_inplace, dtype)) + check_objs = [np.arange(3, 7, dtype=dtype).reshape(2, 2)] + if check_scalar: + check_objs.append(check_objs[0][0]) + for arr in check_objs: + arr_method = getattr(arr, "__{0}__".format(op)) + + def first_out_arg(result): + if op == "divmod": + assert_(isinstance(result, tuple)) + return result[0] + else: + return result + + # arr __op__ obj + if binop_override_expected: + assert_equal(arr_method(obj), NotImplemented, err_msg) + elif ufunc_override_expected: + assert_equal(arr_method(obj)[0], "__array_ufunc__", + err_msg) + else: + if (isinstance(obj, np.ndarray) and + (type(obj).__array_ufunc__ is + np.ndarray.__array_ufunc__)): + # __array__ gets ignored + res = first_out_arg(arr_method(obj)) + assert_(res.__class__ is obj.__class__, err_msg) + else: + assert_raises((TypeError, Coerced), + arr_method, obj, err_msg=err_msg) + # obj __op__ arr + arr_rmethod = getattr(arr, "__r{0}__".format(op)) + if ufunc_override_expected: + res = arr_rmethod(obj) + assert_equal(res[0], "__array_ufunc__", + err_msg=err_msg) + assert_equal(res[1], ufunc, err_msg=err_msg) + else: + if (isinstance(obj, np.ndarray) and + (type(obj).__array_ufunc__ is + np.ndarray.__array_ufunc__)): + # __array__ gets ignored + res = first_out_arg(arr_rmethod(obj)) + assert_(res.__class__ is obj.__class__, err_msg) + else: + # __array_ufunc__ = "asdf" creates a TypeError + assert_raises((TypeError, Coerced), + arr_rmethod, obj, err_msg=err_msg) + + # arr __iop__ obj + # array scalars don't have in-place operators + if has_inplace and isinstance(arr, np.ndarray): + arr_imethod = getattr(arr, "__i{0}__".format(op)) + if inplace_override_expected: + assert_equal(arr_method(obj), NotImplemented, + err_msg=err_msg) + elif ufunc_override_expected: + res = arr_imethod(obj) + assert_equal(res[0], "__array_ufunc__", err_msg) + assert_equal(res[1], ufunc, err_msg) + assert_(type(res[-1]["out"]) is tuple, err_msg) + assert_(res[-1]["out"][0] is arr, err_msg) + else: + if (isinstance(obj, np.ndarray) and + (type(obj).__array_ufunc__ is + np.ndarray.__array_ufunc__)): + # __array__ gets ignored + assert_(arr_imethod(obj) is arr, err_msg) + else: + assert_raises((TypeError, Coerced), + arr_imethod, obj, + err_msg=err_msg) + + op_fn = getattr(operator, op, None) + if op_fn is None: + op_fn = getattr(operator, op + "_", None) + if op_fn is None: + op_fn = getattr(builtins, op) + assert_equal(op_fn(obj, arr), "forward", err_msg) + if not isinstance(obj, np.ndarray): + if binop_override_expected: + assert_equal(op_fn(arr, obj), "reverse", err_msg) + elif ufunc_override_expected: + assert_equal(op_fn(arr, obj)[0], "__array_ufunc__", + err_msg) + if ufunc_override_expected: + assert_equal(ufunc(obj, arr)[0], "__array_ufunc__", + err_msg) + + # No array priority, no array_ufunc -> nothing called + check(make_obj(object), False, False, False) + # Negative array priority, no array_ufunc -> nothing called + # (has to be very negative, because scalar priority is -1000000.0) + check(make_obj(object, array_priority=-2**30), False, False, False) + # Positive array priority, no array_ufunc -> binops and iops only + check(make_obj(object, array_priority=1), True, False, True) + # ndarray ignores array_priority for ndarray subclasses + check(make_obj(np.ndarray, array_priority=1), False, False, False, + check_scalar=False) + # Positive array_priority and array_ufunc -> array_ufunc only + check(make_obj(object, array_priority=1, + array_ufunc=array_ufunc_impl), False, True, False) + check(make_obj(np.ndarray, array_priority=1, + array_ufunc=array_ufunc_impl), False, True, False) + # array_ufunc set to None -> defer binops only + check(make_obj(object, array_ufunc=None), True, False, False) + check(make_obj(np.ndarray, array_ufunc=None), True, False, False, + check_scalar=False) + + @pytest.mark.parametrize("priority", [None, "runtime error"]) + def test_ufunc_binop_bad_array_priority(self, priority): + # Mainly checks that this does not crash. The second array has a lower + # priority than -1 ("error value"). If the __radd__ actually exists, + # bad things can happen (I think via the scalar paths). + # In principle both of these can probably just be errors in the future. + class BadPriority: + @property + def __array_priority__(self): + if priority == "runtime error": + raise RuntimeError("RuntimeError in __array_priority__!") + return priority + + def __radd__(self, other): + return "result" + + class LowPriority(np.ndarray): + __array_priority__ = -1000 + + # Priority failure uses the same as scalars (smaller -1000). So the + # LowPriority wins with 'result' for each element (inner operation). + res = np.arange(3).view(LowPriority) + BadPriority() + assert res.shape == (3,) + assert res[0] == 'result' + + @pytest.mark.parametrize("scalar", [ + np.longdouble(1), np.timedelta64(120, 'm')]) + @pytest.mark.parametrize("op", [operator.add, operator.xor]) + def test_scalar_binop_guarantees_ufunc(self, scalar, op): + # Test that __array_ufunc__ will always cause ufunc use even when + # we have to protect some other calls from recursing (see gh-26904). + class SomeClass: + def __array_ufunc__(self, ufunc, method, *inputs, **kw): + return "result" + + assert SomeClass() + scalar == "result" + assert scalar + SomeClass() == "result" + + def test_ufunc_override_normalize_signature(self): + # gh-5674 + class SomeClass: + def __array_ufunc__(self, ufunc, method, *inputs, **kw): + return kw + + a = SomeClass() + kw = np.add(a, [1]) + assert_('sig' not in kw and 'signature' not in kw) + kw = np.add(a, [1], sig='ii->i') + assert_('sig' not in kw and 'signature' in kw) + assert_equal(kw['signature'], 'ii->i') + kw = np.add(a, [1], signature='ii->i') + assert_('sig' not in kw and 'signature' in kw) + assert_equal(kw['signature'], 'ii->i') + + def test_array_ufunc_index(self): + # Check that index is set appropriately, also if only an output + # is passed on (latter is another regression tests for github bug 4753) + # This also checks implicitly that 'out' is always a tuple. + class CheckIndex: + def __array_ufunc__(self, ufunc, method, *inputs, **kw): + for i, a in enumerate(inputs): + if a is self: + return i + # calls below mean we must be in an output. + for j, a in enumerate(kw['out']): + if a is self: + return (j,) + + a = CheckIndex() + dummy = np.arange(2.) + # 1 input, 1 output + assert_equal(np.sin(a), 0) + assert_equal(np.sin(dummy, a), (0,)) + assert_equal(np.sin(dummy, out=a), (0,)) + assert_equal(np.sin(dummy, out=(a,)), (0,)) + assert_equal(np.sin(a, a), 0) + assert_equal(np.sin(a, out=a), 0) + assert_equal(np.sin(a, out=(a,)), 0) + # 1 input, 2 outputs + assert_equal(np.modf(dummy, a), (0,)) + assert_equal(np.modf(dummy, None, a), (1,)) + assert_equal(np.modf(dummy, dummy, a), (1,)) + assert_equal(np.modf(dummy, out=(a, None)), (0,)) + assert_equal(np.modf(dummy, out=(a, dummy)), (0,)) + assert_equal(np.modf(dummy, out=(None, a)), (1,)) + assert_equal(np.modf(dummy, out=(dummy, a)), (1,)) + assert_equal(np.modf(a, out=(dummy, a)), 0) + with assert_raises(TypeError): + # Out argument must be tuple, since there are multiple outputs + np.modf(dummy, out=a) + + assert_raises(ValueError, np.modf, dummy, out=(a,)) + + # 2 inputs, 1 output + assert_equal(np.add(a, dummy), 0) + assert_equal(np.add(dummy, a), 1) + assert_equal(np.add(dummy, dummy, a), (0,)) + assert_equal(np.add(dummy, a, a), 1) + assert_equal(np.add(dummy, dummy, out=a), (0,)) + assert_equal(np.add(dummy, dummy, out=(a,)), (0,)) + assert_equal(np.add(a, dummy, out=a), 0) + + def test_out_override(self): + # regression test for github bug 4753 + class OutClass(np.ndarray): + def __array_ufunc__(self, ufunc, method, *inputs, **kw): + if 'out' in kw: + tmp_kw = kw.copy() + tmp_kw.pop('out') + func = getattr(ufunc, method) + kw['out'][0][...] = func(*inputs, **tmp_kw) + + A = np.array([0]).view(OutClass) + B = np.array([5]) + C = np.array([6]) + np.multiply(C, B, A) + assert_equal(A[0], 30) + assert_(isinstance(A, OutClass)) + A[0] = 0 + np.multiply(C, B, out=A) + assert_equal(A[0], 30) + assert_(isinstance(A, OutClass)) + + def test_pow_override_with_errors(self): + # regression test for gh-9112 + class PowerOnly(np.ndarray): + def __array_ufunc__(self, ufunc, method, *inputs, **kw): + if ufunc is not np.power: + raise NotImplementedError + return "POWER!" + # explicit cast to float, to ensure the fast power path is taken. + a = np.array(5., dtype=np.float64).view(PowerOnly) + assert_equal(a ** 2.5, "POWER!") + with assert_raises(NotImplementedError): + a ** 0.5 + with assert_raises(NotImplementedError): + a ** 0 + with assert_raises(NotImplementedError): + a ** 1 + with assert_raises(NotImplementedError): + a ** -1 + with assert_raises(NotImplementedError): + a ** 2 + + def test_pow_array_object_dtype(self): + # test pow on arrays of object dtype + class SomeClass: + def __init__(self, num=None): + self.num = num + + # want to ensure a fast pow path is not taken + def __mul__(self, other): + raise AssertionError('__mul__ should not be called') + + def __div__(self, other): + raise AssertionError('__div__ should not be called') + + def __pow__(self, exp): + return SomeClass(num=self.num ** exp) + + def __eq__(self, other): + if isinstance(other, SomeClass): + return self.num == other.num + + __rpow__ = __pow__ + + def pow_for(exp, arr): + return np.array([x ** exp for x in arr]) + + obj_arr = np.array([SomeClass(1), SomeClass(2), SomeClass(3)]) + + assert_equal(obj_arr ** 0.5, pow_for(0.5, obj_arr)) + assert_equal(obj_arr ** 0, pow_for(0, obj_arr)) + assert_equal(obj_arr ** 1, pow_for(1, obj_arr)) + assert_equal(obj_arr ** -1, pow_for(-1, obj_arr)) + assert_equal(obj_arr ** 2, pow_for(2, obj_arr)) + + def test_pos_array_ufunc_override(self): + class A(np.ndarray): + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return getattr(ufunc, method)(*[i.view(np.ndarray) for + i in inputs], **kwargs) + tst = np.array('foo').view(A) + with assert_raises(TypeError): + +tst + + +class TestTemporaryElide: + # elision is only triggered on relatively large arrays + + def test_extension_incref_elide(self): + # test extension (e.g. cython) calling PyNumber_* slots without + # increasing the reference counts + # + # def incref_elide(a): + # d = input.copy() # refcount 1 + # return d, d + d # PyNumber_Add without increasing refcount + from numpy._core._multiarray_tests import incref_elide + d = np.ones(100000) + orig, res = incref_elide(d) + d + d + # the return original should not be changed to an inplace operation + assert_array_equal(orig, d) + assert_array_equal(res, d + d) + + def test_extension_incref_elide_stack(self): + # scanning if the refcount == 1 object is on the python stack to check + # that we are called directly from python is flawed as object may still + # be above the stack pointer and we have no access to the top of it + # + # def incref_elide_l(d): + # return l[4] + l[4] # PyNumber_Add without increasing refcount + from numpy._core._multiarray_tests import incref_elide_l + # padding with 1 makes sure the object on the stack is not overwritten + l = [1, 1, 1, 1, np.ones(100000)] + res = incref_elide_l(l) + # the return original should not be changed to an inplace operation + assert_array_equal(l[4], np.ones(100000)) + assert_array_equal(res, l[4] + l[4]) + + def test_temporary_with_cast(self): + # check that we don't elide into a temporary which would need casting + d = np.ones(200000, dtype=np.int64) + r = ((d + d) + np.array(2**222, dtype='O')) + assert_equal(r.dtype, np.dtype('O')) + + r = ((d + d) / 2) + assert_equal(r.dtype, np.dtype('f8')) + + r = np.true_divide((d + d), 2) + assert_equal(r.dtype, np.dtype('f8')) + + r = ((d + d) / 2.) + assert_equal(r.dtype, np.dtype('f8')) + + r = ((d + d) // 2) + assert_equal(r.dtype, np.dtype(np.int64)) + + # commutative elision into the astype result + f = np.ones(100000, dtype=np.float32) + assert_equal(((f + f) + f.astype(np.float64)).dtype, np.dtype('f8')) + + # no elision into lower type + d = f.astype(np.float64) + assert_equal(((f + f) + d).dtype, d.dtype) + l = np.ones(100000, dtype=np.longdouble) + assert_equal(((d + d) + l).dtype, l.dtype) + + # test unary abs with different output dtype + for dt in (np.complex64, np.complex128, np.clongdouble): + c = np.ones(100000, dtype=dt) + r = abs(c * 2.0) + assert_equal(r.dtype, np.dtype('f%d' % (c.itemsize // 2))) + + def test_elide_broadcast(self): + # test no elision on broadcast to higher dimension + # only triggers elision code path in debug mode as triggering it in + # normal mode needs 256kb large matching dimension, so a lot of memory + d = np.ones((2000, 1), dtype=int) + b = np.ones((2000), dtype=bool) + r = (1 - d) + b + assert_equal(r, 1) + assert_equal(r.shape, (2000, 2000)) + + def test_elide_scalar(self): + # check inplace op does not create ndarray from scalars + a = np.bool() + assert_(type(~(a & a)) is np.bool) + + def test_elide_scalar_readonly(self): + # The imaginary part of a real array is readonly. This needs to go + # through fast_scalar_power which is only called for powers of + # +1, -1, 0, 0.5, and 2, so use 2. Also need valid refcount for + # elision which can be gotten for the imaginary part of a real + # array. Should not error. + a = np.empty(100000, dtype=np.float64) + a.imag ** 2 + + def test_elide_readonly(self): + # don't try to elide readonly temporaries + r = np.asarray(np.broadcast_to(np.zeros(1), 100000).flat) * 0.0 + assert_equal(r, 0) + + def test_elide_updateifcopy(self): + a = np.ones(2**20)[::2] + b = a.flat.__array__() + 1 + del b + assert_equal(a, 1) + + +class TestCAPI: + def test_IsPythonScalar(self): + from numpy._core._multiarray_tests import IsPythonScalar + assert_(IsPythonScalar(b'foobar')) + assert_(IsPythonScalar(1)) + assert_(IsPythonScalar(2**80)) + assert_(IsPythonScalar(2.)) + assert_(IsPythonScalar("a")) + + @pytest.mark.parametrize("converter", + [_multiarray_tests.run_scalar_intp_converter, + _multiarray_tests.run_scalar_intp_from_sequence]) + def test_intp_sequence_converters(self, converter): + # Test simple values (-1 is special for error return paths) + assert converter(10) == (10,) + assert converter(-1) == (-1,) + # A 0-D array looks a bit like a sequence but must take the integer + # path: + assert converter(np.array(123)) == (123,) + # Test simple sequences (intp_from_sequence only supports length 1): + assert converter((10,)) == (10,) + assert converter(np.array([11])) == (11,) + + @pytest.mark.parametrize("converter", + [_multiarray_tests.run_scalar_intp_converter, + _multiarray_tests.run_scalar_intp_from_sequence]) + @pytest.mark.skipif(IS_PYPY and sys.implementation.version <= (7, 3, 8), + reason="PyPy bug in error formatting") + def test_intp_sequence_converters_errors(self, converter): + with pytest.raises(TypeError, + match="expected a sequence of integers or a single integer, "): + converter(object()) + with pytest.raises(TypeError, + match="expected a sequence of integers or a single integer, " + "got '32.0'"): + converter(32.) + with pytest.raises(TypeError, + match="'float' object cannot be interpreted as an integer"): + converter([32.]) + with pytest.raises(ValueError, + match="Maximum allowed dimension"): + # These converters currently convert overflows to a ValueError + converter(2**64) + + +class TestSubscripting: + def test_test_zero_rank(self): + x = np.array([1, 2, 3]) + assert_(isinstance(x[0], np.int_)) + assert_(type(x[0, ...]) is np.ndarray) + + +class TestPickling: + @pytest.mark.skipif(pickle.HIGHEST_PROTOCOL >= 5, + reason=('this tests the error messages when trying to' + 'protocol 5 although it is not available')) + def test_correct_protocol5_error_message(self): + array = np.arange(10) + + def test_record_array_with_object_dtype(self): + my_object = object() + + arr_with_object = np.array( + [(my_object, 1, 2.0)], + dtype=[('a', object), ('b', int), ('c', float)]) + arr_without_object = np.array( + [('xxx', 1, 2.0)], + dtype=[('a', str), ('b', int), ('c', float)]) + + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + depickled_arr_with_object = pickle.loads( + pickle.dumps(arr_with_object, protocol=proto)) + depickled_arr_without_object = pickle.loads( + pickle.dumps(arr_without_object, protocol=proto)) + + assert_equal(arr_with_object.dtype, + depickled_arr_with_object.dtype) + assert_equal(arr_without_object.dtype, + depickled_arr_without_object.dtype) + + @pytest.mark.skipif(pickle.HIGHEST_PROTOCOL < 5, + reason="requires pickle protocol 5") + def test_f_contiguous_array(self): + f_contiguous_array = np.array([[1, 2, 3], [4, 5, 6]], order='F') + buffers = [] + + # When using pickle protocol 5, Fortran-contiguous arrays can be + # serialized using out-of-band buffers + bytes_string = pickle.dumps(f_contiguous_array, protocol=5, + buffer_callback=buffers.append) + + assert len(buffers) > 0 + + depickled_f_contiguous_array = pickle.loads(bytes_string, + buffers=buffers) + + assert_equal(f_contiguous_array, depickled_f_contiguous_array) + + def test_non_contiguous_array(self): + non_contiguous_array = np.arange(12).reshape(3, 4)[:, :2] + assert not non_contiguous_array.flags.c_contiguous + assert not non_contiguous_array.flags.f_contiguous + + # make sure non-contiguous arrays can be pickled-depickled + # using any protocol + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + depickled_non_contiguous_array = pickle.loads( + pickle.dumps(non_contiguous_array, protocol=proto)) + + assert_equal(non_contiguous_array, depickled_non_contiguous_array) + + def test_roundtrip(self): + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + carray = np.array([[2, 9], [7, 0], [3, 8]]) + DATA = [ + carray, + np.transpose(carray), + np.array([('xxx', 1, 2.0)], dtype=[('a', (str, 3)), ('b', int), + ('c', float)]) + ] + + refs = [weakref.ref(a) for a in DATA] + for a in DATA: + assert_equal( + a, pickle.loads(pickle.dumps(a, protocol=proto)), + err_msg="%r" % a) + del a, DATA, carray + break_cycles() + # check for reference leaks (gh-12793) + for ref in refs: + assert ref() is None + + def _loads(self, obj): + return pickle.loads(obj, encoding='latin1') + + # version 0 pickles, using protocol=2 to pickle + # version 0 doesn't have a version field + def test_version0_int8(self): + s = b"\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x04\x85cnumpy\ndtype\nq\x04U\x02i1K\x00K\x01\x87Rq\x05(U\x01|NNJ\xff\xff\xff\xffJ\xff\xff\xff\xfftb\x89U\x04\x01\x02\x03\x04tb." # noqa + a = np.array([1, 2, 3, 4], dtype=np.int8) + p = self._loads(s) + assert_equal(a, p) + + def test_version0_float32(self): + s = b"\x80\x02cnumpy.core._internal\n_reconstruct\nq\x01cnumpy\nndarray\nq\x02K\x00\x85U\x01b\x87Rq\x03(K\x04\x85cnumpy\ndtype\nq\x04U\x02f4K\x00K\x01\x87Rq\x05(U\x01= g2, [g1[i] >= g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 < g2, [g1[i] < g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 > g2, [g1[i] > g2[i] for i in [0, 1, 2]]) + + def test_mixed(self): + g1 = np.array(["spam", "spa", "spammer", "and eggs"]) + g2 = "spam" + assert_array_equal(g1 == g2, [x == g2 for x in g1]) + assert_array_equal(g1 != g2, [x != g2 for x in g1]) + assert_array_equal(g1 < g2, [x < g2 for x in g1]) + assert_array_equal(g1 > g2, [x > g2 for x in g1]) + assert_array_equal(g1 <= g2, [x <= g2 for x in g1]) + assert_array_equal(g1 >= g2, [x >= g2 for x in g1]) + + def test_unicode(self): + g1 = np.array(["This", "is", "example"]) + g2 = np.array(["This", "was", "example"]) + assert_array_equal(g1 == g2, [g1[i] == g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 != g2, [g1[i] != g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 <= g2, [g1[i] <= g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 >= g2, [g1[i] >= g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 < g2, [g1[i] < g2[i] for i in [0, 1, 2]]) + assert_array_equal(g1 > g2, [g1[i] > g2[i] for i in [0, 1, 2]]) + +class TestArgmaxArgminCommon: + + sizes = [(), (3,), (3, 2), (2, 3), + (3, 3), (2, 3, 4), (4, 3, 2), + (1, 2, 3, 4), (2, 3, 4, 1), + (3, 4, 1, 2), (4, 1, 2, 3), + (64,), (128,), (256,)] + + @pytest.mark.parametrize("size, axis", itertools.chain(*[[(size, axis) + for axis in list(range(-len(size), len(size))) + [None]] + for size in sizes])) + @pytest.mark.parametrize('method', [np.argmax, np.argmin]) + def test_np_argmin_argmax_keepdims(self, size, axis, method): + + arr = np.random.normal(size=size) + + # contiguous arrays + if axis is None: + new_shape = [1 for _ in range(len(size))] + else: + new_shape = list(size) + new_shape[axis] = 1 + new_shape = tuple(new_shape) + + _res_orig = method(arr, axis=axis) + res_orig = _res_orig.reshape(new_shape) + res = method(arr, axis=axis, keepdims=True) + assert_equal(res, res_orig) + assert_(res.shape == new_shape) + outarray = np.empty(res.shape, dtype=res.dtype) + res1 = method(arr, axis=axis, out=outarray, + keepdims=True) + assert_(res1 is outarray) + assert_equal(res, outarray) + + if len(size) > 0: + wrong_shape = list(new_shape) + if axis is not None: + wrong_shape[axis] = 2 + else: + wrong_shape[0] = 2 + wrong_outarray = np.empty(wrong_shape, dtype=res.dtype) + with pytest.raises(ValueError): + method(arr.T, axis=axis, + out=wrong_outarray, keepdims=True) + + # non-contiguous arrays + if axis is None: + new_shape = [1 for _ in range(len(size))] + else: + new_shape = list(size)[::-1] + new_shape[axis] = 1 + new_shape = tuple(new_shape) + + _res_orig = method(arr.T, axis=axis) + res_orig = _res_orig.reshape(new_shape) + res = method(arr.T, axis=axis, keepdims=True) + assert_equal(res, res_orig) + assert_(res.shape == new_shape) + outarray = np.empty(new_shape[::-1], dtype=res.dtype) + outarray = outarray.T + res1 = method(arr.T, axis=axis, out=outarray, + keepdims=True) + assert_(res1 is outarray) + assert_equal(res, outarray) + + if len(size) > 0: + # one dimension lesser for non-zero sized + # array should raise an error + with pytest.raises(ValueError): + method(arr[0], axis=axis, + out=outarray, keepdims=True) + + if len(size) > 0: + wrong_shape = list(new_shape) + if axis is not None: + wrong_shape[axis] = 2 + else: + wrong_shape[0] = 2 + wrong_outarray = np.empty(wrong_shape, dtype=res.dtype) + with pytest.raises(ValueError): + method(arr.T, axis=axis, + out=wrong_outarray, keepdims=True) + + @pytest.mark.parametrize('method', ['max', 'min']) + def test_all(self, method): + a = np.random.normal(0, 1, (4, 5, 6, 7, 8)) + arg_method = getattr(a, 'arg' + method) + val_method = getattr(a, method) + for i in range(a.ndim): + a_maxmin = val_method(i) + aarg_maxmin = arg_method(i) + axes = list(range(a.ndim)) + axes.remove(i) + assert_(np.all(a_maxmin == aarg_maxmin.choose( + *a.transpose(i, *axes)))) + + @pytest.mark.parametrize('method', ['argmax', 'argmin']) + def test_output_shape(self, method): + # see also gh-616 + a = np.ones((10, 5)) + arg_method = getattr(a, method) + # Check some simple shape mismatches + out = np.ones(11, dtype=np.int_) + assert_raises(ValueError, arg_method, -1, out) + + out = np.ones((2, 5), dtype=np.int_) + assert_raises(ValueError, arg_method, -1, out) + + # these could be relaxed possibly (used to allow even the previous) + out = np.ones((1, 10), dtype=np.int_) + assert_raises(ValueError, arg_method, -1, out) + + out = np.ones(10, dtype=np.int_) + arg_method(-1, out=out) + assert_equal(out, arg_method(-1)) + + @pytest.mark.parametrize('ndim', [0, 1]) + @pytest.mark.parametrize('method', ['argmax', 'argmin']) + def test_ret_is_out(self, ndim, method): + a = np.ones((4,) + (256,)*ndim) + arg_method = getattr(a, method) + out = np.empty((256,)*ndim, dtype=np.intp) + ret = arg_method(axis=0, out=out) + assert ret is out + + @pytest.mark.parametrize('np_array, method, idx, val', + [(np.zeros, 'argmax', 5942, "as"), + (np.ones, 'argmin', 6001, "0")]) + def test_unicode(self, np_array, method, idx, val): + d = np_array(6031, dtype='= cmin)) + assert_(np.all(x <= cmax)) + + def _clip_type(self, type_group, array_max, + clip_min, clip_max, inplace=False, + expected_min=None, expected_max=None): + if expected_min is None: + expected_min = clip_min + if expected_max is None: + expected_max = clip_max + + for T in np._core.sctypes[type_group]: + if sys.byteorder == 'little': + byte_orders = ['=', '>'] + else: + byte_orders = ['<', '='] + + for byteorder in byte_orders: + dtype = np.dtype(T).newbyteorder(byteorder) + + x = (np.random.random(1000) * array_max).astype(dtype) + if inplace: + # The tests that call us pass clip_min and clip_max that + # might not fit in the destination dtype. They were written + # assuming the previous unsafe casting, which now must be + # passed explicitly to avoid a warning. + x.clip(clip_min, clip_max, x, casting='unsafe') + else: + x = x.clip(clip_min, clip_max) + byteorder = '=' + + if x.dtype.byteorder == '|': + byteorder = '|' + assert_equal(x.dtype.byteorder, byteorder) + self._check_range(x, expected_min, expected_max) + return x + + def test_basic(self): + for inplace in [False, True]: + self._clip_type( + 'float', 1024, -12.8, 100.2, inplace=inplace) + self._clip_type( + 'float', 1024, 0, 0, inplace=inplace) + + self._clip_type( + 'int', 1024, -120, 100, inplace=inplace) + self._clip_type( + 'int', 1024, 0, 0, inplace=inplace) + + self._clip_type( + 'uint', 1024, 0, 0, inplace=inplace) + self._clip_type( + 'uint', 1024, 10, 100, inplace=inplace) + + @pytest.mark.parametrize("inplace", [False, True]) + def test_int_out_of_range(self, inplace): + # Simple check for out-of-bound integers, also testing the in-place + # path. + x = (np.random.random(1000) * 255).astype("uint8") + out = np.empty_like(x) + res = x.clip(-1, 300, out=out if inplace else None) + assert res is out or not inplace + assert (res == x).all() + + res = x.clip(-1, 50, out=out if inplace else None) + assert res is out or not inplace + assert (res <= 50).all() + assert (res[x <= 50] == x[x <= 50]).all() + + res = x.clip(100, 1000, out=out if inplace else None) + assert res is out or not inplace + assert (res >= 100).all() + assert (res[x >= 100] == x[x >= 100]).all() + + def test_record_array(self): + rec = np.array([(-5, 2.0, 3.0), (5.0, 4.0, 3.0)], + dtype=[('x', '= 3)) + x = val.clip(min=3) + assert_(np.all(x >= 3)) + x = val.clip(max=4) + assert_(np.all(x <= 4)) + + def test_nan(self): + input_arr = np.array([-2., np.nan, 0.5, 3., 0.25, np.nan]) + result = input_arr.clip(-1, 1) + expected = np.array([-1., np.nan, 0.5, 1., 0.25, np.nan]) + assert_array_equal(result, expected) + + +class TestCompress: + def test_axis(self): + tgt = [[5, 6, 7, 8, 9]] + arr = np.arange(10).reshape(2, 5) + out = np.compress([0, 1], arr, axis=0) + assert_equal(out, tgt) + + tgt = [[1, 3], [6, 8]] + out = np.compress([0, 1, 0, 1, 0], arr, axis=1) + assert_equal(out, tgt) + + def test_truncate(self): + tgt = [[1], [6]] + arr = np.arange(10).reshape(2, 5) + out = np.compress([0, 1], arr, axis=1) + assert_equal(out, tgt) + + def test_flatten(self): + arr = np.arange(10).reshape(2, 5) + out = np.compress([0, 1], arr) + assert_equal(out, 1) + + +class TestPutmask: + def tst_basic(self, x, T, mask, val): + np.putmask(x, mask, val) + assert_equal(x[mask], np.array(val, T)) + + def test_ip_types(self): + unchecked_types = [bytes, str, np.void] + + x = np.random.random(1000)*100 + mask = x < 40 + + for val in [-100, 0, 15]: + for types in np._core.sctypes.values(): + for T in types: + if T not in unchecked_types: + if val < 0 and np.dtype(T).kind == "u": + val = np.iinfo(T).max - 99 + self.tst_basic(x.copy().astype(T), T, mask, val) + + # Also test string of a length which uses an untypical length + dt = np.dtype("S3") + self.tst_basic(x.astype(dt), dt.type, mask, dt.type(val)[:3]) + + def test_mask_size(self): + assert_raises(ValueError, np.putmask, np.array([1, 2, 3]), [True], 5) + + @pytest.mark.parametrize('dtype', ('>i4', 'f8'), ('z', '= 2, 3) + + def test_kwargs(self): + x = np.array([0, 0]) + np.putmask(x, [0, 1], [-1, -2]) + assert_array_equal(x, [0, -2]) + + x = np.array([0, 0]) + np.putmask(x, mask=[0, 1], values=[-1, -2]) + assert_array_equal(x, [0, -2]) + + x = np.array([0, 0]) + np.putmask(x, values=[-1, -2], mask=[0, 1]) + assert_array_equal(x, [0, -2]) + + with pytest.raises(TypeError): + np.putmask(a=x, values=[-1, -2], mask=[0, 1]) + + +class TestTake: + def tst_basic(self, x): + ind = list(range(x.shape[0])) + assert_array_equal(x.take(ind, axis=0), x) + + def test_ip_types(self): + unchecked_types = [bytes, str, np.void] + + x = np.random.random(24)*100 + x.shape = 2, 3, 4 + for types in np._core.sctypes.values(): + for T in types: + if T not in unchecked_types: + self.tst_basic(x.copy().astype(T)) + + # Also test string of a length which uses an untypical length + self.tst_basic(x.astype("S3")) + + def test_raise(self): + x = np.random.random(24)*100 + x.shape = 2, 3, 4 + assert_raises(IndexError, x.take, [0, 1, 2], axis=0) + assert_raises(IndexError, x.take, [-3], axis=0) + assert_array_equal(x.take([-1], axis=0)[0], x[1]) + + def test_clip(self): + x = np.random.random(24)*100 + x.shape = 2, 3, 4 + assert_array_equal(x.take([-1], axis=0, mode='clip')[0], x[0]) + assert_array_equal(x.take([2], axis=0, mode='clip')[0], x[1]) + + def test_wrap(self): + x = np.random.random(24)*100 + x.shape = 2, 3, 4 + assert_array_equal(x.take([-1], axis=0, mode='wrap')[0], x[1]) + assert_array_equal(x.take([2], axis=0, mode='wrap')[0], x[0]) + assert_array_equal(x.take([3], axis=0, mode='wrap')[0], x[1]) + + @pytest.mark.parametrize('dtype', ('>i4', 'f8'), ('z', ' 16MB + d = np.zeros(4 * 1024 ** 2) + d.tofile(tmp_filename) + assert_equal(os.path.getsize(tmp_filename), d.nbytes) + assert_array_equal(d, np.fromfile(tmp_filename)) + # check offset + with open(tmp_filename, "r+b") as f: + f.seek(d.nbytes) + d.tofile(f) + assert_equal(os.path.getsize(tmp_filename), d.nbytes * 2) + # check append mode (gh-8329) + open(tmp_filename, "w").close() # delete file contents + with open(tmp_filename, "ab") as f: + d.tofile(f) + assert_array_equal(d, np.fromfile(tmp_filename)) + with open(tmp_filename, "ab") as f: + d.tofile(f) + assert_equal(os.path.getsize(tmp_filename), d.nbytes * 2) + + def test_io_open_buffered_fromfile(self, x, tmp_filename): + # gh-6632 + x.tofile(tmp_filename) + with open(tmp_filename, 'rb', buffering=-1) as f: + y = np.fromfile(f, dtype=x.dtype) + assert_array_equal(y, x.flat) + + def test_file_position_after_fromfile(self, tmp_filename): + # gh-4118 + sizes = [io.DEFAULT_BUFFER_SIZE//8, + io.DEFAULT_BUFFER_SIZE, + io.DEFAULT_BUFFER_SIZE*8] + + for size in sizes: + with open(tmp_filename, 'wb') as f: + f.seek(size-1) + f.write(b'\0') + + for mode in ['rb', 'r+b']: + err_msg = "%d %s" % (size, mode) + + with open(tmp_filename, mode) as f: + f.read(2) + np.fromfile(f, dtype=np.float64, count=1) + pos = f.tell() + assert_equal(pos, 10, err_msg=err_msg) + + def test_file_position_after_tofile(self, tmp_filename): + # gh-4118 + sizes = [io.DEFAULT_BUFFER_SIZE//8, + io.DEFAULT_BUFFER_SIZE, + io.DEFAULT_BUFFER_SIZE*8] + + for size in sizes: + err_msg = "%d" % (size,) + + with open(tmp_filename, 'wb') as f: + f.seek(size-1) + f.write(b'\0') + f.seek(10) + f.write(b'12') + np.array([0], dtype=np.float64).tofile(f) + pos = f.tell() + assert_equal(pos, 10 + 2 + 8, err_msg=err_msg) + + with open(tmp_filename, 'r+b') as f: + f.read(2) + f.seek(0, 1) # seek between read&write required by ANSI C + np.array([0], dtype=np.float64).tofile(f) + pos = f.tell() + assert_equal(pos, 10, err_msg=err_msg) + + def test_load_object_array_fromfile(self, tmp_filename): + # gh-12300 + with open(tmp_filename, 'w') as f: + # Ensure we have a file with consistent contents + pass + + with open(tmp_filename, 'rb') as f: + assert_raises_regex(ValueError, "Cannot read into object array", + np.fromfile, f, dtype=object) + + assert_raises_regex(ValueError, "Cannot read into object array", + np.fromfile, tmp_filename, dtype=object) + + def test_fromfile_offset(self, x, tmp_filename): + with open(tmp_filename, 'wb') as f: + x.tofile(f) + + with open(tmp_filename, 'rb') as f: + y = np.fromfile(f, dtype=x.dtype, offset=0) + assert_array_equal(y, x.flat) + + with open(tmp_filename, 'rb') as f: + count_items = len(x.flat) // 8 + offset_items = len(x.flat) // 4 + offset_bytes = x.dtype.itemsize * offset_items + y = np.fromfile( + f, dtype=x.dtype, count=count_items, offset=offset_bytes + ) + assert_array_equal( + y, x.flat[offset_items:offset_items+count_items] + ) + + # subsequent seeks should stack + offset_bytes = x.dtype.itemsize + z = np.fromfile(f, dtype=x.dtype, offset=offset_bytes) + assert_array_equal(z, x.flat[offset_items+count_items+1:]) + + with open(tmp_filename, 'wb') as f: + x.tofile(f, sep=",") + + with open(tmp_filename, 'rb') as f: + assert_raises_regex( + TypeError, + "'offset' argument only permitted for binary files", + np.fromfile, tmp_filename, dtype=x.dtype, + sep=",", offset=1) + + @pytest.mark.skipif(IS_PYPY, reason="bug in PyPy's PyNumber_AsSsize_t") + def test_fromfile_bad_dup(self, x, tmp_filename): + def dup_str(fd): + return 'abc' + + def dup_bigint(fd): + return 2**68 + + old_dup = os.dup + try: + with open(tmp_filename, 'wb') as f: + x.tofile(f) + for dup, exc in ((dup_str, TypeError), (dup_bigint, OSError)): + os.dup = dup + assert_raises(exc, np.fromfile, f) + finally: + os.dup = old_dup + + def _check_from(self, s, value, filename, **kw): + if 'sep' not in kw: + y = np.frombuffer(s, **kw) + else: + y = np.fromstring(s, **kw) + assert_array_equal(y, value) + + with open(filename, 'wb') as f: + f.write(s) + y = np.fromfile(filename, **kw) + assert_array_equal(y, value) + + @pytest.fixture(params=["period", "comma"]) + def decimal_sep_localization(self, request): + """ + Including this fixture in a test will automatically + execute it with both types of decimal separator. + + So:: + + def test_decimal(decimal_sep_localization): + pass + + is equivalent to the following two tests:: + + def test_decimal_period_separator(): + pass + + def test_decimal_comma_separator(): + with CommaDecimalPointLocale(): + pass + """ + if request.param == "period": + yield + elif request.param == "comma": + with CommaDecimalPointLocale(): + yield + else: + assert False, request.param + + def test_nan(self, tmp_filename, decimal_sep_localization): + self._check_from( + b"nan +nan -nan NaN nan(foo) +NaN(BAR) -NAN(q_u_u_x_)", + [np.nan, np.nan, np.nan, np.nan, np.nan, np.nan, np.nan], + tmp_filename, + sep=' ') + + def test_inf(self, tmp_filename, decimal_sep_localization): + self._check_from( + b"inf +inf -inf infinity -Infinity iNfInItY -inF", + [np.inf, np.inf, -np.inf, np.inf, -np.inf, np.inf, -np.inf], + tmp_filename, + sep=' ') + + def test_numbers(self, tmp_filename, decimal_sep_localization): + self._check_from( + b"1.234 -1.234 .3 .3e55 -123133.1231e+133", + [1.234, -1.234, .3, .3e55, -123133.1231e+133], + tmp_filename, + sep=' ') + + def test_binary(self, tmp_filename): + self._check_from( + b'\x00\x00\x80?\x00\x00\x00@\x00\x00@@\x00\x00\x80@', + np.array([1, 2, 3, 4]), + tmp_filename, + dtype='']) + @pytest.mark.parametrize('dtype', [float, int, complex]) + def test_basic(self, byteorder, dtype): + dt = np.dtype(dtype).newbyteorder(byteorder) + x = (np.random.random((4, 7)) * 5).astype(dt) + buf = x.tobytes() + assert_array_equal(np.frombuffer(buf, dtype=dt), x.flat) + + @pytest.mark.parametrize("obj", [np.arange(10), b"12345678"]) + def test_array_base(self, obj): + # Objects (including NumPy arrays), which do not use the + # `release_buffer` slot should be directly used as a base object. + # See also gh-21612 + new = np.frombuffer(obj) + assert new.base is obj + + def test_empty(self): + assert_array_equal(np.frombuffer(b''), np.array([])) + + @pytest.mark.skipif(IS_PYPY, + reason="PyPy's memoryview currently does not track exports. See: " + "https://foss.heptapod.net/pypy/pypy/-/issues/3724") + def test_mmap_close(self): + # The old buffer protocol was not safe for some things that the new + # one is. But `frombuffer` always used the old one for a long time. + # Checks that it is safe with the new one (using memoryviews) + with tempfile.TemporaryFile(mode='wb') as tmp: + tmp.write(b"asdf") + tmp.flush() + mm = mmap.mmap(tmp.fileno(), 0) + arr = np.frombuffer(mm, dtype=np.uint8) + with pytest.raises(BufferError): + mm.close() # cannot close while array uses the buffer + del arr + mm.close() + +class TestFlat: + def setup_method(self): + a0 = np.arange(20.0) + a = a0.reshape(4, 5) + a0.shape = (4, 5) + a.flags.writeable = False + self.a = a + self.b = a[::2, ::2] + self.a0 = a0 + self.b0 = a0[::2, ::2] + + def test_contiguous(self): + testpassed = False + try: + self.a.flat[12] = 100.0 + except ValueError: + testpassed = True + assert_(testpassed) + assert_(self.a.flat[12] == 12.0) + + def test_discontiguous(self): + testpassed = False + try: + self.b.flat[4] = 100.0 + except ValueError: + testpassed = True + assert_(testpassed) + assert_(self.b.flat[4] == 12.0) + + def test___array__(self): + c = self.a.flat.__array__() + d = self.b.flat.__array__() + e = self.a0.flat.__array__() + f = self.b0.flat.__array__() + + assert_(c.flags.writeable is False) + assert_(d.flags.writeable is False) + assert_(e.flags.writeable is True) + assert_(f.flags.writeable is False) + assert_(c.flags.writebackifcopy is False) + assert_(d.flags.writebackifcopy is False) + assert_(e.flags.writebackifcopy is False) + assert_(f.flags.writebackifcopy is False) + + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_refcount(self): + # includes regression test for reference count error gh-13165 + inds = [np.intp(0), np.array([True]*self.a.size), np.array([0]), None] + indtype = np.dtype(np.intp) + rc_indtype = sys.getrefcount(indtype) + for ind in inds: + rc_ind = sys.getrefcount(ind) + for _ in range(100): + try: + self.a.flat[ind] + except IndexError: + pass + assert_(abs(sys.getrefcount(ind) - rc_ind) < 50) + assert_(abs(sys.getrefcount(indtype) - rc_indtype) < 50) + + def test_index_getset(self): + it = np.arange(10).reshape(2, 1, 5).flat + with pytest.raises(AttributeError): + it.index = 10 + + for _ in it: + pass + # Check the value of `.index` is updated correctly (see also gh-19153) + # If the type was incorrect, this would show up on big-endian machines + assert it.index == it.base.size + + def test_maxdims(self): + # The flat iterator and thus attribute is currently unfortunately + # limited to only 32 dimensions (after bumping it to 64 for 2.0) + a = np.ones((1,) * 64) + + with pytest.raises(RuntimeError, + match=".*32 dimensions but the array has 64"): + a.flat + + +class TestResize: + + @_no_tracing + def test_basic(self): + x = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) + if IS_PYPY: + x.resize((5, 5), refcheck=False) + else: + x.resize((5, 5)) + assert_array_equal(x.flat[:9], + np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]).flat) + assert_array_equal(x[9:].flat, 0) + + def test_check_reference(self): + x = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) + y = x + assert_raises(ValueError, x.resize, (5, 1)) + del y # avoid pyflakes unused variable warning. + + @_no_tracing + def test_int_shape(self): + x = np.eye(3) + if IS_PYPY: + x.resize(3, refcheck=False) + else: + x.resize(3) + assert_array_equal(x, np.eye(3)[0,:]) + + def test_none_shape(self): + x = np.eye(3) + x.resize(None) + assert_array_equal(x, np.eye(3)) + x.resize() + assert_array_equal(x, np.eye(3)) + + def test_0d_shape(self): + # to it multiple times to test it does not break alloc cache gh-9216 + for i in range(10): + x = np.empty((1,)) + x.resize(()) + assert_equal(x.shape, ()) + assert_equal(x.size, 1) + x = np.empty(()) + x.resize((1,)) + assert_equal(x.shape, (1,)) + assert_equal(x.size, 1) + + def test_invalid_arguments(self): + assert_raises(TypeError, np.eye(3).resize, 'hi') + assert_raises(ValueError, np.eye(3).resize, -1) + assert_raises(TypeError, np.eye(3).resize, order=1) + assert_raises(TypeError, np.eye(3).resize, refcheck='hi') + + @_no_tracing + def test_freeform_shape(self): + x = np.eye(3) + if IS_PYPY: + x.resize(3, 2, 1, refcheck=False) + else: + x.resize(3, 2, 1) + assert_(x.shape == (3, 2, 1)) + + @_no_tracing + def test_zeros_appended(self): + x = np.eye(3) + if IS_PYPY: + x.resize(2, 3, 3, refcheck=False) + else: + x.resize(2, 3, 3) + assert_array_equal(x[0], np.eye(3)) + assert_array_equal(x[1], np.zeros((3, 3))) + + @_no_tracing + def test_obj_obj(self): + # check memory is initialized on resize, gh-4857 + a = np.ones(10, dtype=[('k', object, 2)]) + if IS_PYPY: + a.resize(15, refcheck=False) + else: + a.resize(15,) + assert_equal(a.shape, (15,)) + assert_array_equal(a['k'][-5:], 0) + assert_array_equal(a['k'][:-5], 1) + + def test_empty_view(self): + # check that sizes containing a zero don't trigger a reallocate for + # already empty arrays + x = np.zeros((10, 0), int) + x_view = x[...] + x_view.resize((0, 10)) + x_view.resize((0, 100)) + + def test_check_weakref(self): + x = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1]]) + xref = weakref.ref(x) + assert_raises(ValueError, x.resize, (5, 1)) + del xref # avoid pyflakes unused variable warning. + + +class TestRecord: + def test_field_rename(self): + dt = np.dtype([('f', float), ('i', int)]) + dt.names = ['p', 'q'] + assert_equal(dt.names, ['p', 'q']) + + def test_multiple_field_name_occurrence(self): + def test_dtype_init(): + np.dtype([("A", "f8"), ("B", "f8"), ("A", "f8")]) + + # Error raised when multiple fields have the same name + assert_raises(ValueError, test_dtype_init) + + def test_bytes_fields(self): + # Bytes are not allowed in field names and not recognized in titles + # on Py3 + assert_raises(TypeError, np.dtype, [(b'a', int)]) + assert_raises(TypeError, np.dtype, [(('b', b'a'), int)]) + + dt = np.dtype([((b'a', 'b'), int)]) + assert_raises(TypeError, dt.__getitem__, b'a') + + x = np.array([(1,), (2,), (3,)], dtype=dt) + assert_raises(IndexError, x.__getitem__, b'a') + + y = x[0] + assert_raises(IndexError, y.__getitem__, b'a') + + def test_multiple_field_name_unicode(self): + def test_dtype_unicode(): + np.dtype([("\u20B9", "f8"), ("B", "f8"), ("\u20B9", "f8")]) + + # Error raised when multiple fields have the same name(unicode included) + assert_raises(ValueError, test_dtype_unicode) + + def test_fromarrays_unicode(self): + # A single name string provided to fromarrays() is allowed to be unicode + # on both Python 2 and 3: + x = np._core.records.fromarrays( + [[0], [1]], names='a,b', formats='i4,i4') + assert_equal(x['a'][0], 0) + assert_equal(x['b'][0], 1) + + def test_unicode_order(self): + # Test that we can sort with order as a unicode field name in both Python 2 and + # 3: + name = 'b' + x = np.array([1, 3, 2], dtype=[(name, int)]) + x.sort(order=name) + assert_equal(x['b'], np.array([1, 2, 3])) + + def test_field_names(self): + # Test unicode and 8-bit / byte strings can be used + a = np.zeros((1,), dtype=[('f1', 'i4'), + ('f2', 'i4'), + ('f3', [('sf1', 'i4')])]) + # byte string indexing fails gracefully + assert_raises(IndexError, a.__setitem__, b'f1', 1) + assert_raises(IndexError, a.__getitem__, b'f1') + assert_raises(IndexError, a['f1'].__setitem__, b'sf1', 1) + assert_raises(IndexError, a['f1'].__getitem__, b'sf1') + b = a.copy() + fn1 = str('f1') + b[fn1] = 1 + assert_equal(b[fn1], 1) + fnn = str('not at all') + assert_raises(ValueError, b.__setitem__, fnn, 1) + assert_raises(ValueError, b.__getitem__, fnn) + b[0][fn1] = 2 + assert_equal(b[fn1], 2) + # Subfield + assert_raises(ValueError, b[0].__setitem__, fnn, 1) + assert_raises(ValueError, b[0].__getitem__, fnn) + # Subfield + fn3 = str('f3') + sfn1 = str('sf1') + b[fn3][sfn1] = 1 + assert_equal(b[fn3][sfn1], 1) + assert_raises(ValueError, b[fn3].__setitem__, fnn, 1) + assert_raises(ValueError, b[fn3].__getitem__, fnn) + # multiple subfields + fn2 = str('f2') + b[fn2] = 3 + + assert_equal(b[['f1', 'f2']][0].tolist(), (2, 3)) + assert_equal(b[['f2', 'f1']][0].tolist(), (3, 2)) + assert_equal(b[['f1', 'f3']][0].tolist(), (2, (1,))) + + # non-ascii unicode field indexing is well behaved + assert_raises(ValueError, a.__setitem__, '\u03e0', 1) + assert_raises(ValueError, a.__getitem__, '\u03e0') + + def test_record_hash(self): + a = np.array([(1, 2), (1, 2)], dtype='i1,i2') + a.flags.writeable = False + b = np.array([(1, 2), (3, 4)], dtype=[('num1', 'i1'), ('num2', 'i2')]) + b.flags.writeable = False + c = np.array([(1, 2), (3, 4)], dtype='i1,i2') + c.flags.writeable = False + assert_(hash(a[0]) == hash(a[1])) + assert_(hash(a[0]) == hash(b[0])) + assert_(hash(a[0]) != hash(b[1])) + assert_(hash(c[0]) == hash(a[0]) and c[0] == a[0]) + + def test_record_no_hash(self): + a = np.array([(1, 2), (1, 2)], dtype='i1,i2') + assert_raises(TypeError, hash, a[0]) + + def test_empty_structure_creation(self): + # make sure these do not raise errors (gh-5631) + np.array([()], dtype={'names': [], 'formats': [], + 'offsets': [], 'itemsize': 12}) + np.array([(), (), (), (), ()], dtype={'names': [], 'formats': [], + 'offsets': [], 'itemsize': 12}) + + def test_multifield_indexing_view(self): + a = np.ones(3, dtype=[('a', 'i4'), ('b', 'f4'), ('c', 'u4')]) + v = a[['a', 'c']] + assert_(v.base is a) + assert_(v.dtype == np.dtype({'names': ['a', 'c'], + 'formats': ['i4', 'u4'], + 'offsets': [0, 8]})) + v[:] = (4,5) + assert_equal(a[0].item(), (4, 1, 5)) + +class TestView: + def test_basic(self): + x = np.array([(1, 2, 3, 4), (5, 6, 7, 8)], + dtype=[('r', np.int8), ('g', np.int8), + ('b', np.int8), ('a', np.int8)]) + # We must be specific about the endianness here: + y = x.view(dtype=' 0) + assert_(issubclass(w[0].category, RuntimeWarning)) + + def test_empty(self): + A = np.zeros((0, 3)) + for f in self.funcs: + for axis in [0, None]: + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter('always') + assert_(np.isnan(f(A, axis=axis)).all()) + assert_(len(w) > 0) + assert_(issubclass(w[0].category, RuntimeWarning)) + for axis in [1]: + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter('always') + assert_equal(f(A, axis=axis), np.zeros([])) + + def test_mean_values(self): + for mat in [self.rmat, self.cmat, self.omat]: + for axis in [0, 1]: + tgt = mat.sum(axis=axis) + res = _mean(mat, axis=axis) * mat.shape[axis] + assert_almost_equal(res, tgt) + for axis in [None]: + tgt = mat.sum(axis=axis) + res = _mean(mat, axis=axis) * np.prod(mat.shape) + assert_almost_equal(res, tgt) + + def test_mean_float16(self): + # This fail if the sum inside mean is done in float16 instead + # of float32. + assert_(_mean(np.ones(100000, dtype='float16')) == 1) + + def test_mean_axis_error(self): + # Ensure that AxisError is raised instead of IndexError when axis is + # out of bounds, see gh-15817. + with assert_raises(np.exceptions.AxisError): + np.arange(10).mean(axis=2) + + def test_mean_where(self): + a = np.arange(16).reshape((4, 4)) + wh_full = np.array([[False, True, False, True], + [True, False, True, False], + [True, True, False, False], + [False, False, True, True]]) + wh_partial = np.array([[False], + [True], + [True], + [False]]) + _cases = [(1, True, [1.5, 5.5, 9.5, 13.5]), + (0, wh_full, [6., 5., 10., 9.]), + (1, wh_full, [2., 5., 8.5, 14.5]), + (0, wh_partial, [6., 7., 8., 9.])] + for _ax, _wh, _res in _cases: + assert_allclose(a.mean(axis=_ax, where=_wh), + np.array(_res)) + assert_allclose(np.mean(a, axis=_ax, where=_wh), + np.array(_res)) + + a3d = np.arange(16).reshape((2, 2, 4)) + _wh_partial = np.array([False, True, True, False]) + _res = [[1.5, 5.5], [9.5, 13.5]] + assert_allclose(a3d.mean(axis=2, where=_wh_partial), + np.array(_res)) + assert_allclose(np.mean(a3d, axis=2, where=_wh_partial), + np.array(_res)) + + with pytest.warns(RuntimeWarning) as w: + assert_allclose(a.mean(axis=1, where=wh_partial), + np.array([np.nan, 5.5, 9.5, np.nan])) + with pytest.warns(RuntimeWarning) as w: + assert_equal(a.mean(where=False), np.nan) + with pytest.warns(RuntimeWarning) as w: + assert_equal(np.mean(a, where=False), np.nan) + + def test_var_values(self): + for mat in [self.rmat, self.cmat, self.omat]: + for axis in [0, 1, None]: + msqr = _mean(mat * mat.conj(), axis=axis) + mean = _mean(mat, axis=axis) + tgt = msqr - mean * mean.conjugate() + res = _var(mat, axis=axis) + assert_almost_equal(res, tgt) + + @pytest.mark.parametrize(('complex_dtype', 'ndec'), ( + ('complex64', 6), + ('complex128', 7), + ('clongdouble', 7), + )) + def test_var_complex_values(self, complex_dtype, ndec): + # Test fast-paths for every builtin complex type + for axis in [0, 1, None]: + mat = self.cmat.copy().astype(complex_dtype) + msqr = _mean(mat * mat.conj(), axis=axis) + mean = _mean(mat, axis=axis) + tgt = msqr - mean * mean.conjugate() + res = _var(mat, axis=axis) + assert_almost_equal(res, tgt, decimal=ndec) + + def test_var_dimensions(self): + # _var paths for complex number introduce additions on views that + # increase dimensions. Ensure this generalizes to higher dims + mat = np.stack([self.cmat]*3) + for axis in [0, 1, 2, -1, None]: + msqr = _mean(mat * mat.conj(), axis=axis) + mean = _mean(mat, axis=axis) + tgt = msqr - mean * mean.conjugate() + res = _var(mat, axis=axis) + assert_almost_equal(res, tgt) + + def test_var_complex_byteorder(self): + # Test that var fast-path does not cause failures for complex arrays + # with non-native byteorder + cmat = self.cmat.copy().astype('complex128') + cmat_swapped = cmat.astype(cmat.dtype.newbyteorder()) + assert_almost_equal(cmat.var(), cmat_swapped.var()) + + def test_var_axis_error(self): + # Ensure that AxisError is raised instead of IndexError when axis is + # out of bounds, see gh-15817. + with assert_raises(np.exceptions.AxisError): + np.arange(10).var(axis=2) + + def test_var_where(self): + a = np.arange(25).reshape((5, 5)) + wh_full = np.array([[False, True, False, True, True], + [True, False, True, True, False], + [True, True, False, False, True], + [False, True, True, False, True], + [True, False, True, True, False]]) + wh_partial = np.array([[False], + [True], + [True], + [False], + [True]]) + _cases = [(0, True, [50., 50., 50., 50., 50.]), + (1, True, [2., 2., 2., 2., 2.])] + for _ax, _wh, _res in _cases: + assert_allclose(a.var(axis=_ax, where=_wh), + np.array(_res)) + assert_allclose(np.var(a, axis=_ax, where=_wh), + np.array(_res)) + + a3d = np.arange(16).reshape((2, 2, 4)) + _wh_partial = np.array([False, True, True, False]) + _res = [[0.25, 0.25], [0.25, 0.25]] + assert_allclose(a3d.var(axis=2, where=_wh_partial), + np.array(_res)) + assert_allclose(np.var(a3d, axis=2, where=_wh_partial), + np.array(_res)) + + assert_allclose(np.var(a, axis=1, where=wh_full), + np.var(a[wh_full].reshape((5, 3)), axis=1)) + assert_allclose(np.var(a, axis=0, where=wh_partial), + np.var(a[wh_partial[:,0]], axis=0)) + with pytest.warns(RuntimeWarning) as w: + assert_equal(a.var(where=False), np.nan) + with pytest.warns(RuntimeWarning) as w: + assert_equal(np.var(a, where=False), np.nan) + + def test_std_values(self): + for mat in [self.rmat, self.cmat, self.omat]: + for axis in [0, 1, None]: + tgt = np.sqrt(_var(mat, axis=axis)) + res = _std(mat, axis=axis) + assert_almost_equal(res, tgt) + + def test_std_where(self): + a = np.arange(25).reshape((5,5))[::-1] + whf = np.array([[False, True, False, True, True], + [True, False, True, False, True], + [True, True, False, True, False], + [True, False, True, True, False], + [False, True, False, True, True]]) + whp = np.array([[False], + [False], + [True], + [True], + [False]]) + _cases = [ + (0, True, 7.07106781*np.ones(5)), + (1, True, 1.41421356*np.ones(5)), + (0, whf, + np.array([4.0824829 , 8.16496581, 5., 7.39509973, 8.49836586])), + (0, whp, 2.5*np.ones(5)) + ] + for _ax, _wh, _res in _cases: + assert_allclose(a.std(axis=_ax, where=_wh), _res) + assert_allclose(np.std(a, axis=_ax, where=_wh), _res) + + a3d = np.arange(16).reshape((2, 2, 4)) + _wh_partial = np.array([False, True, True, False]) + _res = [[0.5, 0.5], [0.5, 0.5]] + assert_allclose(a3d.std(axis=2, where=_wh_partial), + np.array(_res)) + assert_allclose(np.std(a3d, axis=2, where=_wh_partial), + np.array(_res)) + + assert_allclose(a.std(axis=1, where=whf), + np.std(a[whf].reshape((5,3)), axis=1)) + assert_allclose(np.std(a, axis=1, where=whf), + (a[whf].reshape((5,3))).std(axis=1)) + assert_allclose(a.std(axis=0, where=whp), + np.std(a[whp[:,0]], axis=0)) + assert_allclose(np.std(a, axis=0, where=whp), + (a[whp[:,0]]).std(axis=0)) + with pytest.warns(RuntimeWarning) as w: + assert_equal(a.std(where=False), np.nan) + with pytest.warns(RuntimeWarning) as w: + assert_equal(np.std(a, where=False), np.nan) + + def test_subclass(self): + class TestArray(np.ndarray): + def __new__(cls, data, info): + result = np.array(data) + result = result.view(cls) + result.info = info + return result + + def __array_finalize__(self, obj): + self.info = getattr(obj, "info", '') + + dat = TestArray([[1, 2, 3, 4], [5, 6, 7, 8]], 'jubba') + res = dat.mean(1) + assert_(res.info == dat.info) + res = dat.std(1) + assert_(res.info == dat.info) + res = dat.var(1) + assert_(res.info == dat.info) + + +class TestVdot: + def test_basic(self): + dt_numeric = np.typecodes['AllFloat'] + np.typecodes['AllInteger'] + dt_complex = np.typecodes['Complex'] + + # test real + a = np.eye(3) + for dt in dt_numeric + 'O': + b = a.astype(dt) + res = np.vdot(b, b) + assert_(np.isscalar(res)) + assert_equal(np.vdot(b, b), 3) + + # test complex + a = np.eye(3) * 1j + for dt in dt_complex + 'O': + b = a.astype(dt) + res = np.vdot(b, b) + assert_(np.isscalar(res)) + assert_equal(np.vdot(b, b), 3) + + # test boolean + b = np.eye(3, dtype=bool) + res = np.vdot(b, b) + assert_(np.isscalar(res)) + assert_equal(np.vdot(b, b), True) + + def test_vdot_array_order(self): + a = np.array([[1, 2], [3, 4]], order='C') + b = np.array([[1, 2], [3, 4]], order='F') + res = np.vdot(a, a) + + # integer arrays are exact + assert_equal(np.vdot(a, b), res) + assert_equal(np.vdot(b, a), res) + assert_equal(np.vdot(b, b), res) + + def test_vdot_uncontiguous(self): + for size in [2, 1000]: + # Different sizes match different branches in vdot. + a = np.zeros((size, 2, 2)) + b = np.zeros((size, 2, 2)) + a[:, 0, 0] = np.arange(size) + b[:, 0, 0] = np.arange(size) + 1 + # Make a and b uncontiguous: + a = a[..., 0] + b = b[..., 0] + + assert_equal(np.vdot(a, b), + np.vdot(a.flatten(), b.flatten())) + assert_equal(np.vdot(a, b.copy()), + np.vdot(a.flatten(), b.flatten())) + assert_equal(np.vdot(a.copy(), b), + np.vdot(a.flatten(), b.flatten())) + assert_equal(np.vdot(a.copy('F'), b), + np.vdot(a.flatten(), b.flatten())) + assert_equal(np.vdot(a, b.copy('F')), + np.vdot(a.flatten(), b.flatten())) + + +class TestDot: + def setup_method(self): + np.random.seed(128) + self.A = np.random.rand(4, 2) + self.b1 = np.random.rand(2, 1) + self.b2 = np.random.rand(2) + self.b3 = np.random.rand(1, 2) + self.b4 = np.random.rand(4) + self.N = 7 + + def test_dotmatmat(self): + A = self.A + res = np.dot(A.transpose(), A) + tgt = np.array([[1.45046013, 0.86323640], + [0.86323640, 0.84934569]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotmatvec(self): + A, b1 = self.A, self.b1 + res = np.dot(A, b1) + tgt = np.array([[0.32114320], [0.04889721], + [0.15696029], [0.33612621]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotmatvec2(self): + A, b2 = self.A, self.b2 + res = np.dot(A, b2) + tgt = np.array([0.29677940, 0.04518649, 0.14468333, 0.31039293]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecmat(self): + A, b4 = self.A, self.b4 + res = np.dot(b4, A) + tgt = np.array([1.23495091, 1.12222648]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecmat2(self): + b3, A = self.b3, self.A + res = np.dot(b3, A.transpose()) + tgt = np.array([[0.58793804, 0.08957460, 0.30605758, 0.62716383]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecmat3(self): + A, b4 = self.A, self.b4 + res = np.dot(A.transpose(), b4) + tgt = np.array([1.23495091, 1.12222648]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecvecouter(self): + b1, b3 = self.b1, self.b3 + res = np.dot(b1, b3) + tgt = np.array([[0.20128610, 0.08400440], [0.07190947, 0.03001058]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecvecinner(self): + b1, b3 = self.b1, self.b3 + res = np.dot(b3, b1) + tgt = np.array([[ 0.23129668]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotcolumnvect1(self): + b1 = np.ones((3, 1)) + b2 = [5.3] + res = np.dot(b1, b2) + tgt = np.array([5.3, 5.3, 5.3]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotcolumnvect2(self): + b1 = np.ones((3, 1)).transpose() + b2 = [6.2] + res = np.dot(b2, b1) + tgt = np.array([6.2, 6.2, 6.2]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecscalar(self): + np.random.seed(100) + b1 = np.random.rand(1, 1) + b2 = np.random.rand(1, 4) + res = np.dot(b1, b2) + tgt = np.array([[0.15126730, 0.23068496, 0.45905553, 0.00256425]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_dotvecscalar2(self): + np.random.seed(100) + b1 = np.random.rand(4, 1) + b2 = np.random.rand(1, 1) + res = np.dot(b1, b2) + tgt = np.array([[0.00256425],[0.00131359],[0.00200324],[ 0.00398638]]) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_all(self): + dims = [(), (1,), (1, 1)] + dout = [(), (1,), (1, 1), (1,), (), (1,), (1, 1), (1,), (1, 1)] + for dim, (dim1, dim2) in zip(dout, itertools.product(dims, dims)): + b1 = np.zeros(dim1) + b2 = np.zeros(dim2) + res = np.dot(b1, b2) + tgt = np.zeros(dim) + assert_(res.shape == tgt.shape) + assert_almost_equal(res, tgt, decimal=self.N) + + def test_vecobject(self): + class Vec: + def __init__(self, sequence=None): + if sequence is None: + sequence = [] + self.array = np.array(sequence) + + def __add__(self, other): + out = Vec() + out.array = self.array + other.array + return out + + def __sub__(self, other): + out = Vec() + out.array = self.array - other.array + return out + + def __mul__(self, other): # with scalar + out = Vec(self.array.copy()) + out.array *= other + return out + + def __rmul__(self, other): + return self*other + + U_non_cont = np.transpose([[1., 1.], [1., 2.]]) + U_cont = np.ascontiguousarray(U_non_cont) + x = np.array([Vec([1., 0.]), Vec([0., 1.])]) + zeros = np.array([Vec([0., 0.]), Vec([0., 0.])]) + zeros_test = np.dot(U_cont, x) - np.dot(U_non_cont, x) + assert_equal(zeros[0].array, zeros_test[0].array) + assert_equal(zeros[1].array, zeros_test[1].array) + + def test_dot_2args(self): + + a = np.array([[1, 2], [3, 4]], dtype=float) + b = np.array([[1, 0], [1, 1]], dtype=float) + c = np.array([[3, 2], [7, 4]], dtype=float) + + d = dot(a, b) + assert_allclose(c, d) + + def test_dot_3args(self): + + np.random.seed(22) + f = np.random.random_sample((1024, 16)) + v = np.random.random_sample((16, 32)) + + r = np.empty((1024, 32)) + for i in range(12): + dot(f, v, r) + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(r), 2) + r2 = dot(f, v, out=None) + assert_array_equal(r2, r) + assert_(r is dot(f, v, out=r)) + + v = v[:, 0].copy() # v.shape == (16,) + r = r[:, 0].copy() # r.shape == (1024,) + r2 = dot(f, v) + assert_(r is dot(f, v, r)) + assert_array_equal(r2, r) + + def test_dot_3args_errors(self): + + np.random.seed(22) + f = np.random.random_sample((1024, 16)) + v = np.random.random_sample((16, 32)) + + r = np.empty((1024, 31)) + assert_raises(ValueError, dot, f, v, r) + + r = np.empty((1024,)) + assert_raises(ValueError, dot, f, v, r) + + r = np.empty((32,)) + assert_raises(ValueError, dot, f, v, r) + + r = np.empty((32, 1024)) + assert_raises(ValueError, dot, f, v, r) + assert_raises(ValueError, dot, f, v, r.T) + + r = np.empty((1024, 64)) + assert_raises(ValueError, dot, f, v, r[:, ::2]) + assert_raises(ValueError, dot, f, v, r[:, :32]) + + r = np.empty((1024, 32), dtype=np.float32) + assert_raises(ValueError, dot, f, v, r) + + r = np.empty((1024, 32), dtype=int) + assert_raises(ValueError, dot, f, v, r) + + def test_dot_out_result(self): + x = np.ones((), dtype=np.float16) + y = np.ones((5,), dtype=np.float16) + z = np.zeros((5,), dtype=np.float16) + res = x.dot(y, out=z) + assert np.array_equal(res, y) + assert np.array_equal(z, y) + + def test_dot_out_aliasing(self): + x = np.ones((), dtype=np.float16) + y = np.ones((5,), dtype=np.float16) + z = np.zeros((5,), dtype=np.float16) + res = x.dot(y, out=z) + z[0] = 2 + assert np.array_equal(res, z) + + def test_dot_array_order(self): + a = np.array([[1, 2], [3, 4]], order='C') + b = np.array([[1, 2], [3, 4]], order='F') + res = np.dot(a, a) + + # integer arrays are exact + assert_equal(np.dot(a, b), res) + assert_equal(np.dot(b, a), res) + assert_equal(np.dot(b, b), res) + + def test_accelerate_framework_sgemv_fix(self): + + def aligned_array(shape, align, dtype, order='C'): + d = dtype(0) + N = np.prod(shape) + tmp = np.zeros(N * d.nbytes + align, dtype=np.uint8) + address = tmp.__array_interface__["data"][0] + for offset in range(align): + if (address + offset) % align == 0: + break + tmp = tmp[offset:offset+N*d.nbytes].view(dtype=dtype) + return tmp.reshape(shape, order=order) + + def as_aligned(arr, align, dtype, order='C'): + aligned = aligned_array(arr.shape, align, dtype, order) + aligned[:] = arr[:] + return aligned + + def assert_dot_close(A, X, desired): + assert_allclose(np.dot(A, X), desired, rtol=1e-5, atol=1e-7) + + m = aligned_array(100, 15, np.float32) + s = aligned_array((100, 100), 15, np.float32) + np.dot(s, m) # this will always segfault if the bug is present + + testdata = itertools.product((15, 32), (10000,), (200, 89), ('C', 'F')) + for align, m, n, a_order in testdata: + # Calculation in double precision + A_d = np.random.rand(m, n) + X_d = np.random.rand(n) + desired = np.dot(A_d, X_d) + # Calculation with aligned single precision + A_f = as_aligned(A_d, align, np.float32, order=a_order) + X_f = as_aligned(X_d, align, np.float32) + assert_dot_close(A_f, X_f, desired) + # Strided A rows + A_d_2 = A_d[::2] + desired = np.dot(A_d_2, X_d) + A_f_2 = A_f[::2] + assert_dot_close(A_f_2, X_f, desired) + # Strided A columns, strided X vector + A_d_22 = A_d_2[:, ::2] + X_d_2 = X_d[::2] + desired = np.dot(A_d_22, X_d_2) + A_f_22 = A_f_2[:, ::2] + X_f_2 = X_f[::2] + assert_dot_close(A_f_22, X_f_2, desired) + # Check the strides are as expected + if a_order == 'F': + assert_equal(A_f_22.strides, (8, 8 * m)) + else: + assert_equal(A_f_22.strides, (8 * n, 8)) + assert_equal(X_f_2.strides, (8,)) + # Strides in A rows + cols only + X_f_2c = as_aligned(X_f_2, align, np.float32) + assert_dot_close(A_f_22, X_f_2c, desired) + # Strides just in A cols + A_d_12 = A_d[:, ::2] + desired = np.dot(A_d_12, X_d_2) + A_f_12 = A_f[:, ::2] + assert_dot_close(A_f_12, X_f_2c, desired) + # Strides in A cols and X + assert_dot_close(A_f_12, X_f_2, desired) + + @pytest.mark.slow + @pytest.mark.parametrize("dtype", [np.float64, np.complex128]) + @requires_memory(free_bytes=18e9) # complex case needs 18GiB+ + def test_huge_vectordot(self, dtype): + # Large vector multiplications are chunked with 32bit BLAS + # Test that the chunking does the right thing, see also gh-22262 + data = np.ones(2**30+100, dtype=dtype) + res = np.dot(data, data) + assert res == 2**30+100 + + def test_dtype_discovery_fails(self): + # See gh-14247, error checking was missing for failed dtype discovery + class BadObject: + def __array__(self, dtype=None, copy=None): + raise TypeError("just this tiny mint leaf") + + with pytest.raises(TypeError): + np.dot(BadObject(), BadObject()) + + with pytest.raises(TypeError): + np.dot(3.0, BadObject()) + + +class MatmulCommon: + """Common tests for '@' operator and numpy.matmul. + + """ + # Should work with these types. Will want to add + # "O" at some point + types = "?bhilqBHILQefdgFDGO" + + def test_exceptions(self): + dims = [ + ((1,), (2,)), # mismatched vector vector + ((2, 1,), (2,)), # mismatched matrix vector + ((2,), (1, 2)), # mismatched vector matrix + ((1, 2), (3, 1)), # mismatched matrix matrix + ((1,), ()), # vector scalar + ((), (1)), # scalar vector + ((1, 1), ()), # matrix scalar + ((), (1, 1)), # scalar matrix + ((2, 2, 1), (3, 1, 2)), # cannot broadcast + ] + + for dt, (dm1, dm2) in itertools.product(self.types, dims): + a = np.ones(dm1, dtype=dt) + b = np.ones(dm2, dtype=dt) + assert_raises(ValueError, self.matmul, a, b) + + def test_shapes(self): + dims = [ + ((1, 1), (2, 1, 1)), # broadcast first argument + ((2, 1, 1), (1, 1)), # broadcast second argument + ((2, 1, 1), (2, 1, 1)), # matrix stack sizes match + ] + + for dt, (dm1, dm2) in itertools.product(self.types, dims): + a = np.ones(dm1, dtype=dt) + b = np.ones(dm2, dtype=dt) + res = self.matmul(a, b) + assert_(res.shape == (2, 1, 1)) + + # vector vector returns scalars. + for dt in self.types: + a = np.ones((2,), dtype=dt) + b = np.ones((2,), dtype=dt) + c = self.matmul(a, b) + assert_(np.array(c).shape == ()) + + def test_result_types(self): + mat = np.ones((1,1)) + vec = np.ones((1,)) + for dt in self.types: + m = mat.astype(dt) + v = vec.astype(dt) + for arg in [(m, v), (v, m), (m, m)]: + res = self.matmul(*arg) + assert_(res.dtype == dt) + + # vector vector returns scalars + if dt != "O": + res = self.matmul(v, v) + assert_(type(res) is np.dtype(dt).type) + + def test_scalar_output(self): + vec1 = np.array([2]) + vec2 = np.array([3, 4]).reshape(1, -1) + tgt = np.array([6, 8]) + for dt in self.types[1:]: + v1 = vec1.astype(dt) + v2 = vec2.astype(dt) + res = self.matmul(v1, v2) + assert_equal(res, tgt) + res = self.matmul(v2.T, v1) + assert_equal(res, tgt) + + # boolean type + vec = np.array([True, True], dtype='?').reshape(1, -1) + res = self.matmul(vec[:, 0], vec) + assert_equal(res, True) + + def test_vector_vector_values(self): + vec1 = np.array([1, 2]) + vec2 = np.array([3, 4]).reshape(-1, 1) + tgt1 = np.array([11]) + tgt2 = np.array([[3, 6], [4, 8]]) + for dt in self.types[1:]: + v1 = vec1.astype(dt) + v2 = vec2.astype(dt) + res = self.matmul(v1, v2) + assert_equal(res, tgt1) + # no broadcast, we must make v1 into a 2d ndarray + res = self.matmul(v2, v1.reshape(1, -1)) + assert_equal(res, tgt2) + + # boolean type + vec = np.array([True, True], dtype='?') + res = self.matmul(vec, vec) + assert_equal(res, True) + + def test_vector_matrix_values(self): + vec = np.array([1, 2]) + mat1 = np.array([[1, 2], [3, 4]]) + mat2 = np.stack([mat1]*2, axis=0) + tgt1 = np.array([7, 10]) + tgt2 = np.stack([tgt1]*2, axis=0) + for dt in self.types[1:]: + v = vec.astype(dt) + m1 = mat1.astype(dt) + m2 = mat2.astype(dt) + res = self.matmul(v, m1) + assert_equal(res, tgt1) + res = self.matmul(v, m2) + assert_equal(res, tgt2) + + # boolean type + vec = np.array([True, False]) + mat1 = np.array([[True, False], [False, True]]) + mat2 = np.stack([mat1]*2, axis=0) + tgt1 = np.array([True, False]) + tgt2 = np.stack([tgt1]*2, axis=0) + + res = self.matmul(vec, mat1) + assert_equal(res, tgt1) + res = self.matmul(vec, mat2) + assert_equal(res, tgt2) + + def test_matrix_vector_values(self): + vec = np.array([1, 2]) + mat1 = np.array([[1, 2], [3, 4]]) + mat2 = np.stack([mat1]*2, axis=0) + tgt1 = np.array([5, 11]) + tgt2 = np.stack([tgt1]*2, axis=0) + for dt in self.types[1:]: + v = vec.astype(dt) + m1 = mat1.astype(dt) + m2 = mat2.astype(dt) + res = self.matmul(m1, v) + assert_equal(res, tgt1) + res = self.matmul(m2, v) + assert_equal(res, tgt2) + + # boolean type + vec = np.array([True, False]) + mat1 = np.array([[True, False], [False, True]]) + mat2 = np.stack([mat1]*2, axis=0) + tgt1 = np.array([True, False]) + tgt2 = np.stack([tgt1]*2, axis=0) + + res = self.matmul(vec, mat1) + assert_equal(res, tgt1) + res = self.matmul(vec, mat2) + assert_equal(res, tgt2) + + def test_matrix_matrix_values(self): + mat1 = np.array([[1, 2], [3, 4]]) + mat2 = np.array([[1, 0], [1, 1]]) + mat12 = np.stack([mat1, mat2], axis=0) + mat21 = np.stack([mat2, mat1], axis=0) + tgt11 = np.array([[7, 10], [15, 22]]) + tgt12 = np.array([[3, 2], [7, 4]]) + tgt21 = np.array([[1, 2], [4, 6]]) + tgt12_21 = np.stack([tgt12, tgt21], axis=0) + tgt11_12 = np.stack((tgt11, tgt12), axis=0) + tgt11_21 = np.stack((tgt11, tgt21), axis=0) + for dt in self.types[1:]: + m1 = mat1.astype(dt) + m2 = mat2.astype(dt) + m12 = mat12.astype(dt) + m21 = mat21.astype(dt) + + # matrix @ matrix + res = self.matmul(m1, m2) + assert_equal(res, tgt12) + res = self.matmul(m2, m1) + assert_equal(res, tgt21) + + # stacked @ matrix + res = self.matmul(m12, m1) + assert_equal(res, tgt11_21) + + # matrix @ stacked + res = self.matmul(m1, m12) + assert_equal(res, tgt11_12) + + # stacked @ stacked + res = self.matmul(m12, m21) + assert_equal(res, tgt12_21) + + # boolean type + m1 = np.array([[1, 1], [0, 0]], dtype=np.bool) + m2 = np.array([[1, 0], [1, 1]], dtype=np.bool) + m12 = np.stack([m1, m2], axis=0) + m21 = np.stack([m2, m1], axis=0) + tgt11 = m1 + tgt12 = m1 + tgt21 = np.array([[1, 1], [1, 1]], dtype=np.bool) + tgt12_21 = np.stack([tgt12, tgt21], axis=0) + tgt11_12 = np.stack((tgt11, tgt12), axis=0) + tgt11_21 = np.stack((tgt11, tgt21), axis=0) + + # matrix @ matrix + res = self.matmul(m1, m2) + assert_equal(res, tgt12) + res = self.matmul(m2, m1) + assert_equal(res, tgt21) + + # stacked @ matrix + res = self.matmul(m12, m1) + assert_equal(res, tgt11_21) + + # matrix @ stacked + res = self.matmul(m1, m12) + assert_equal(res, tgt11_12) + + # stacked @ stacked + res = self.matmul(m12, m21) + assert_equal(res, tgt12_21) + + +class TestMatmul(MatmulCommon): + matmul = np.matmul + + def test_out_arg(self): + a = np.ones((5, 2), dtype=float) + b = np.array([[1, 3], [5, 7]], dtype=float) + tgt = np.dot(a, b) + + # test as positional argument + msg = "out positional argument" + out = np.zeros((5, 2), dtype=float) + self.matmul(a, b, out) + assert_array_equal(out, tgt, err_msg=msg) + + # test as keyword argument + msg = "out keyword argument" + out = np.zeros((5, 2), dtype=float) + self.matmul(a, b, out=out) + assert_array_equal(out, tgt, err_msg=msg) + + # test out with not allowed type cast (safe casting) + msg = "Cannot cast ufunc .* output" + out = np.zeros((5, 2), dtype=np.int32) + assert_raises_regex(TypeError, msg, self.matmul, a, b, out=out) + + # test out with type upcast to complex + out = np.zeros((5, 2), dtype=np.complex128) + c = self.matmul(a, b, out=out) + assert_(c is out) + with suppress_warnings() as sup: + sup.filter(ComplexWarning, '') + c = c.astype(tgt.dtype) + assert_array_equal(c, tgt) + + def test_empty_out(self): + # Check that the output cannot be broadcast, so that it cannot be + # size zero when the outer dimensions (iterator size) has size zero. + arr = np.ones((0, 1, 1)) + out = np.ones((1, 1, 1)) + assert self.matmul(arr, arr).shape == (0, 1, 1) + + with pytest.raises(ValueError, match=r"non-broadcastable"): + self.matmul(arr, arr, out=out) + + def test_out_contiguous(self): + a = np.ones((5, 2), dtype=float) + b = np.array([[1, 3], [5, 7]], dtype=float) + v = np.array([1, 3], dtype=float) + tgt = np.dot(a, b) + tgt_mv = np.dot(a, v) + + # test out non-contiguous + out = np.ones((5, 2, 2), dtype=float) + c = self.matmul(a, b, out=out[..., 0]) + assert c.base is out + assert_array_equal(c, tgt) + c = self.matmul(a, v, out=out[:, 0, 0]) + assert_array_equal(c, tgt_mv) + c = self.matmul(v, a.T, out=out[:, 0, 0]) + assert_array_equal(c, tgt_mv) + + # test out contiguous in only last dim + out = np.ones((10, 2), dtype=float) + c = self.matmul(a, b, out=out[::2, :]) + assert_array_equal(c, tgt) + + # test transposes of out, args + out = np.ones((5, 2), dtype=float) + c = self.matmul(b.T, a.T, out=out.T) + assert_array_equal(out, tgt) + + m1 = np.arange(15.).reshape(5, 3) + m2 = np.arange(21.).reshape(3, 7) + m3 = np.arange(30.).reshape(5, 6)[:, ::2] # non-contiguous + vc = np.arange(10.) + vr = np.arange(6.) + m0 = np.zeros((3, 0)) + @pytest.mark.parametrize('args', ( + # matrix-matrix + (m1, m2), (m2.T, m1.T), (m2.T.copy(), m1.T), (m2.T, m1.T.copy()), + # matrix-matrix-transpose, contiguous and non + (m1, m1.T), (m1.T, m1), (m1, m3.T), (m3, m1.T), + (m3, m3.T), (m3.T, m3), + # matrix-matrix non-contiguous + (m3, m2), (m2.T, m3.T), (m2.T.copy(), m3.T), + # vector-matrix, matrix-vector, contiguous + (m1, vr[:3]), (vc[:5], m1), (m1.T, vc[:5]), (vr[:3], m1.T), + # vector-matrix, matrix-vector, vector non-contiguous + (m1, vr[::2]), (vc[::2], m1), (m1.T, vc[::2]), (vr[::2], m1.T), + # vector-matrix, matrix-vector, matrix non-contiguous + (m3, vr[:3]), (vc[:5], m3), (m3.T, vc[:5]), (vr[:3], m3.T), + # vector-matrix, matrix-vector, both non-contiguous + (m3, vr[::2]), (vc[::2], m3), (m3.T, vc[::2]), (vr[::2], m3.T), + # size == 0 + (m0, m0.T), (m0.T, m0), (m1, m0), (m0.T, m1.T), + )) + def test_dot_equivalent(self, args): + r1 = np.matmul(*args) + r2 = np.dot(*args) + assert_equal(r1, r2) + + r3 = np.matmul(args[0].copy(), args[1].copy()) + assert_equal(r1, r3) + + def test_matmul_object(self): + import fractions + + f = np.vectorize(fractions.Fraction) + def random_ints(): + return np.random.randint(1, 1000, size=(10, 3, 3)) + M1 = f(random_ints(), random_ints()) + M2 = f(random_ints(), random_ints()) + + M3 = self.matmul(M1, M2) + + [N1, N2, N3] = [a.astype(float) for a in [M1, M2, M3]] + + assert_allclose(N3, self.matmul(N1, N2)) + + def test_matmul_object_type_scalar(self): + from fractions import Fraction as F + v = np.array([F(2,3), F(5,7)]) + res = self.matmul(v, v) + assert_(type(res) is F) + + def test_matmul_empty(self): + a = np.empty((3, 0), dtype=object) + b = np.empty((0, 3), dtype=object) + c = np.zeros((3, 3)) + assert_array_equal(np.matmul(a, b), c) + + def test_matmul_exception_multiply(self): + # test that matmul fails if `__mul__` is missing + class add_not_multiply: + def __add__(self, other): + return self + a = np.full((3,3), add_not_multiply()) + with assert_raises(TypeError): + b = np.matmul(a, a) + + def test_matmul_exception_add(self): + # test that matmul fails if `__add__` is missing + class multiply_not_add: + def __mul__(self, other): + return self + a = np.full((3,3), multiply_not_add()) + with assert_raises(TypeError): + b = np.matmul(a, a) + + def test_matmul_bool(self): + # gh-14439 + a = np.array([[1, 0],[1, 1]], dtype=bool) + assert np.max(a.view(np.uint8)) == 1 + b = np.matmul(a, a) + # matmul with boolean output should always be 0, 1 + assert np.max(b.view(np.uint8)) == 1 + + rg = np.random.default_rng(np.random.PCG64(43)) + d = rg.integers(2, size=4*5, dtype=np.int8) + d = d.reshape(4, 5) > 0 + out1 = np.matmul(d, d.reshape(5, 4)) + out2 = np.dot(d, d.reshape(5, 4)) + assert_equal(out1, out2) + + c = np.matmul(np.zeros((2, 0), dtype=bool), np.zeros(0, dtype=bool)) + assert not np.any(c) + + +class TestMatmulOperator(MatmulCommon): + import operator + matmul = operator.matmul + + def test_array_priority_override(self): + + class A: + __array_priority__ = 1000 + + def __matmul__(self, other): + return "A" + + def __rmatmul__(self, other): + return "A" + + a = A() + b = np.ones(2) + assert_equal(self.matmul(a, b), "A") + assert_equal(self.matmul(b, a), "A") + + def test_matmul_raises(self): + assert_raises(TypeError, self.matmul, np.int8(5), np.int8(5)) + assert_raises(TypeError, self.matmul, np.void(b'abc'), np.void(b'abc')) + assert_raises(TypeError, self.matmul, np.arange(10), np.void(b'abc')) + + +class TestMatmulInplace: + DTYPES = {} + for i in MatmulCommon.types: + for j in MatmulCommon.types: + if np.can_cast(j, i): + DTYPES[f"{i}-{j}"] = (np.dtype(i), np.dtype(j)) + + @pytest.mark.parametrize("dtype1,dtype2", DTYPES.values(), ids=DTYPES) + def test_basic(self, dtype1: np.dtype, dtype2: np.dtype) -> None: + a = np.arange(10).reshape(5, 2).astype(dtype1) + a_id = id(a) + b = np.ones((2, 2), dtype=dtype2) + + ref = a @ b + a @= b + + assert id(a) == a_id + assert a.dtype == dtype1 + assert a.shape == (5, 2) + if dtype1.kind in "fc": + np.testing.assert_allclose(a, ref) + else: + np.testing.assert_array_equal(a, ref) + + SHAPES = { + "2d_large": ((10**5, 10), (10, 10)), + "3d_large": ((10**4, 10, 10), (1, 10, 10)), + "1d": ((3,), (3,)), + "2d_1d": ((3, 3), (3,)), + "1d_2d": ((3,), (3, 3)), + "2d_broadcast": ((3, 3), (3, 1)), + "2d_broadcast_reverse": ((1, 3), (3, 3)), + "3d_broadcast1": ((3, 3, 3), (1, 3, 1)), + "3d_broadcast2": ((3, 3, 3), (1, 3, 3)), + "3d_broadcast3": ((3, 3, 3), (3, 3, 1)), + "3d_broadcast_reverse1": ((1, 3, 3), (3, 3, 3)), + "3d_broadcast_reverse2": ((3, 1, 3), (3, 3, 3)), + "3d_broadcast_reverse3": ((1, 1, 3), (3, 3, 3)), + } + + @pytest.mark.parametrize("a_shape,b_shape", SHAPES.values(), ids=SHAPES) + def test_shapes(self, a_shape: tuple[int, ...], b_shape: tuple[int, ...]): + a_size = np.prod(a_shape) + a = np.arange(a_size).reshape(a_shape).astype(np.float64) + a_id = id(a) + + b_size = np.prod(b_shape) + b = np.arange(b_size).reshape(b_shape) + + ref = a @ b + if ref.shape != a_shape: + with pytest.raises(ValueError): + a @= b + return + else: + a @= b + + assert id(a) == a_id + assert a.dtype.type == np.float64 + assert a.shape == a_shape + np.testing.assert_allclose(a, ref) + + +def test_matmul_axes(): + a = np.arange(3*4*5).reshape(3, 4, 5) + c = np.matmul(a, a, axes=[(-2, -1), (-1, -2), (1, 2)]) + assert c.shape == (3, 4, 4) + d = np.matmul(a, a, axes=[(-2, -1), (-1, -2), (0, 1)]) + assert d.shape == (4, 4, 3) + e = np.swapaxes(d, 0, 2) + assert_array_equal(e, c) + f = np.matmul(a, np.arange(3), axes=[(1, 0), (0), (0)]) + assert f.shape == (4, 5) + + +class TestInner: + + def test_inner_type_mismatch(self): + c = 1. + A = np.array((1,1), dtype='i,i') + + assert_raises(TypeError, np.inner, c, A) + assert_raises(TypeError, np.inner, A, c) + + def test_inner_scalar_and_vector(self): + for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': + sca = np.array(3, dtype=dt)[()] + vec = np.array([1, 2], dtype=dt) + desired = np.array([3, 6], dtype=dt) + assert_equal(np.inner(vec, sca), desired) + assert_equal(np.inner(sca, vec), desired) + + def test_vecself(self): + # Ticket 844. + # Inner product of a vector with itself segfaults or give + # meaningless result + a = np.zeros(shape=(1, 80), dtype=np.float64) + p = np.inner(a, a) + assert_almost_equal(p, 0, decimal=14) + + def test_inner_product_with_various_contiguities(self): + # github issue 6532 + for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': + # check an inner product involving a matrix transpose + A = np.array([[1, 2], [3, 4]], dtype=dt) + B = np.array([[1, 3], [2, 4]], dtype=dt) + C = np.array([1, 1], dtype=dt) + desired = np.array([4, 6], dtype=dt) + assert_equal(np.inner(A.T, C), desired) + assert_equal(np.inner(C, A.T), desired) + assert_equal(np.inner(B, C), desired) + assert_equal(np.inner(C, B), desired) + # check a matrix product + desired = np.array([[7, 10], [15, 22]], dtype=dt) + assert_equal(np.inner(A, B), desired) + # check the syrk vs. gemm paths + desired = np.array([[5, 11], [11, 25]], dtype=dt) + assert_equal(np.inner(A, A), desired) + assert_equal(np.inner(A, A.copy()), desired) + # check an inner product involving an aliased and reversed view + a = np.arange(5).astype(dt) + b = a[::-1] + desired = np.array(10, dtype=dt).item() + assert_equal(np.inner(b, a), desired) + + def test_3d_tensor(self): + for dt in np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + '?': + a = np.arange(24).reshape(2,3,4).astype(dt) + b = np.arange(24, 48).reshape(2,3,4).astype(dt) + desired = np.array( + [[[[ 158, 182, 206], + [ 230, 254, 278]], + + [[ 566, 654, 742], + [ 830, 918, 1006]], + + [[ 974, 1126, 1278], + [1430, 1582, 1734]]], + + [[[1382, 1598, 1814], + [2030, 2246, 2462]], + + [[1790, 2070, 2350], + [2630, 2910, 3190]], + + [[2198, 2542, 2886], + [3230, 3574, 3918]]]] + ).astype(dt) + assert_equal(np.inner(a, b), desired) + assert_equal(np.inner(b, a).transpose(2,3,0,1), desired) + + +class TestChoose: + def setup_method(self): + self.x = 2*np.ones((3,), dtype=int) + self.y = 3*np.ones((3,), dtype=int) + self.x2 = 2*np.ones((2, 3), dtype=int) + self.y2 = 3*np.ones((2, 3), dtype=int) + self.ind = [0, 0, 1] + + def test_basic(self): + A = np.choose(self.ind, (self.x, self.y)) + assert_equal(A, [2, 2, 3]) + + def test_broadcast1(self): + A = np.choose(self.ind, (self.x2, self.y2)) + assert_equal(A, [[2, 2, 3], [2, 2, 3]]) + + def test_broadcast2(self): + A = np.choose(self.ind, (self.x, self.y2)) + assert_equal(A, [[2, 2, 3], [2, 2, 3]]) + + @pytest.mark.parametrize("ops", + [(1000, np.array([1], dtype=np.uint8)), + (-1, np.array([1], dtype=np.uint8)), + (1., np.float32(3)), + (1., np.array([3], dtype=np.float32))],) + def test_output_dtype(self, ops): + expected_dt = np.result_type(*ops) + assert(np.choose([0], ops).dtype == expected_dt) + + def test_dimension_and_args_limit(self): + # Maxdims for the legacy iterator is 32, but the maximum number + # of arguments is actually larger (a itself also counts here) + a = np.ones((1,) * 32, dtype=np.intp) + res = a.choose([0, a] + [2] * 61) + with pytest.raises(ValueError, + match="Need at least 0 and at most 64 array objects"): + a.choose([0, a] + [2] * 62) + + assert_array_equal(res, a) + # Choose is unfortunately limited to 32 dims as of NumPy 2.0 + a = np.ones((1,) * 60, dtype=np.intp) + with pytest.raises(RuntimeError, + match=".*32 dimensions but the array has 60"): + a.choose([a, a]) + + +class TestRepeat: + def setup_method(self): + self.m = np.array([1, 2, 3, 4, 5, 6]) + self.m_rect = self.m.reshape((2, 3)) + + def test_basic(self): + A = np.repeat(self.m, [1, 3, 2, 1, 1, 2]) + assert_equal(A, [1, 2, 2, 2, 3, + 3, 4, 5, 6, 6]) + + def test_broadcast1(self): + A = np.repeat(self.m, 2) + assert_equal(A, [1, 1, 2, 2, 3, 3, + 4, 4, 5, 5, 6, 6]) + + def test_axis_spec(self): + A = np.repeat(self.m_rect, [2, 1], axis=0) + assert_equal(A, [[1, 2, 3], + [1, 2, 3], + [4, 5, 6]]) + + A = np.repeat(self.m_rect, [1, 3, 2], axis=1) + assert_equal(A, [[1, 2, 2, 2, 3, 3], + [4, 5, 5, 5, 6, 6]]) + + def test_broadcast2(self): + A = np.repeat(self.m_rect, 2, axis=0) + assert_equal(A, [[1, 2, 3], + [1, 2, 3], + [4, 5, 6], + [4, 5, 6]]) + + A = np.repeat(self.m_rect, 2, axis=1) + assert_equal(A, [[1, 1, 2, 2, 3, 3], + [4, 4, 5, 5, 6, 6]]) + + +# TODO: test for multidimensional +NEIGH_MODE = {'zero': 0, 'one': 1, 'constant': 2, 'circular': 3, 'mirror': 4} + + +@pytest.mark.parametrize('dt', [float, Decimal], ids=['float', 'object']) +class TestNeighborhoodIter: + # Simple, 2d tests + def test_simple2d(self, dt): + # Test zero and one padding for simple data type + x = np.array([[0, 1], [2, 3]], dtype=dt) + r = [np.array([[0, 0, 0], [0, 0, 1]], dtype=dt), + np.array([[0, 0, 0], [0, 1, 0]], dtype=dt), + np.array([[0, 0, 1], [0, 2, 3]], dtype=dt), + np.array([[0, 1, 0], [2, 3, 0]], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 0, -1, 1], x[0], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + r = [np.array([[1, 1, 1], [1, 0, 1]], dtype=dt), + np.array([[1, 1, 1], [0, 1, 1]], dtype=dt), + np.array([[1, 0, 1], [1, 2, 3]], dtype=dt), + np.array([[0, 1, 1], [2, 3, 1]], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 0, -1, 1], x[0], NEIGH_MODE['one']) + assert_array_equal(l, r) + + r = [np.array([[4, 4, 4], [4, 0, 1]], dtype=dt), + np.array([[4, 4, 4], [0, 1, 4]], dtype=dt), + np.array([[4, 0, 1], [4, 2, 3]], dtype=dt), + np.array([[0, 1, 4], [2, 3, 4]], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 0, -1, 1], 4, NEIGH_MODE['constant']) + assert_array_equal(l, r) + + # Test with start in the middle + r = [np.array([[4, 0, 1], [4, 2, 3]], dtype=dt), + np.array([[0, 1, 4], [2, 3, 4]], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 0, -1, 1], 4, NEIGH_MODE['constant'], 2) + assert_array_equal(l, r) + + def test_mirror2d(self, dt): + x = np.array([[0, 1], [2, 3]], dtype=dt) + r = [np.array([[0, 0, 1], [0, 0, 1]], dtype=dt), + np.array([[0, 1, 1], [0, 1, 1]], dtype=dt), + np.array([[0, 0, 1], [2, 2, 3]], dtype=dt), + np.array([[0, 1, 1], [2, 3, 3]], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 0, -1, 1], x[0], NEIGH_MODE['mirror']) + assert_array_equal(l, r) + + # Simple, 1d tests + def test_simple(self, dt): + # Test padding with constant values + x = np.linspace(1, 5, 5).astype(dt) + r = [[0, 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, 0]] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 1], x[0], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + r = [[1, 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, 1]] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 1], x[0], NEIGH_MODE['one']) + assert_array_equal(l, r) + + r = [[x[4], 1, 2], [1, 2, 3], [2, 3, 4], [3, 4, 5], [4, 5, x[4]]] + l = _multiarray_tests.test_neighborhood_iterator( + x, [-1, 1], x[4], NEIGH_MODE['constant']) + assert_array_equal(l, r) + + # Test mirror modes + def test_mirror(self, dt): + x = np.linspace(1, 5, 5).astype(dt) + r = np.array([[2, 1, 1, 2, 3], [1, 1, 2, 3, 4], [1, 2, 3, 4, 5], + [2, 3, 4, 5, 5], [3, 4, 5, 5, 4]], dtype=dt) + l = _multiarray_tests.test_neighborhood_iterator( + x, [-2, 2], x[1], NEIGH_MODE['mirror']) + assert_([i.dtype == dt for i in l]) + assert_array_equal(l, r) + + # Circular mode + def test_circular(self, dt): + x = np.linspace(1, 5, 5).astype(dt) + r = np.array([[4, 5, 1, 2, 3], [5, 1, 2, 3, 4], [1, 2, 3, 4, 5], + [2, 3, 4, 5, 1], [3, 4, 5, 1, 2]], dtype=dt) + l = _multiarray_tests.test_neighborhood_iterator( + x, [-2, 2], x[0], NEIGH_MODE['circular']) + assert_array_equal(l, r) + + +# Test stacking neighborhood iterators +class TestStackedNeighborhoodIter: + # Simple, 1d test: stacking 2 constant-padded neigh iterators + def test_simple_const(self): + dt = np.float64 + # Test zero and one padding for simple data type + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([0], dtype=dt), + np.array([0], dtype=dt), + np.array([1], dtype=dt), + np.array([2], dtype=dt), + np.array([3], dtype=dt), + np.array([0], dtype=dt), + np.array([0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-2, 4], NEIGH_MODE['zero'], [0, 0], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + r = [np.array([1, 0, 1], dtype=dt), + np.array([0, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 0], dtype=dt), + np.array([3, 0, 1], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [-1, 1], NEIGH_MODE['one']) + assert_array_equal(l, r) + + # 2nd simple, 1d test: stacking 2 neigh iterators, mixing const padding and + # mirror padding + def test_simple_mirror(self): + dt = np.float64 + # Stacking zero on top of mirror + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([0, 1, 1], dtype=dt), + np.array([1, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 3], dtype=dt), + np.array([3, 3, 0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['mirror'], [-1, 1], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([1, 0, 0], dtype=dt), + np.array([0, 0, 1], dtype=dt), + np.array([0, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [-2, 0], NEIGH_MODE['mirror']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero: 2nd + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([0, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 0], dtype=dt), + np.array([3, 0, 0], dtype=dt), + np.array([0, 0, 3], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [0, 2], NEIGH_MODE['mirror']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero: 3rd + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([1, 0, 0, 1, 2], dtype=dt), + np.array([0, 0, 1, 2, 3], dtype=dt), + np.array([0, 1, 2, 3, 0], dtype=dt), + np.array([1, 2, 3, 0, 0], dtype=dt), + np.array([2, 3, 0, 0, 3], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [-2, 2], NEIGH_MODE['mirror']) + assert_array_equal(l, r) + + # 3rd simple, 1d test: stacking 2 neigh iterators, mixing const padding and + # circular padding + def test_simple_circular(self): + dt = np.float64 + # Stacking zero on top of mirror + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([0, 3, 1], dtype=dt), + np.array([3, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 1], dtype=dt), + np.array([3, 1, 0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['circular'], [-1, 1], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([3, 0, 0], dtype=dt), + np.array([0, 0, 1], dtype=dt), + np.array([0, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [-2, 0], NEIGH_MODE['circular']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero: 2nd + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([0, 1, 2], dtype=dt), + np.array([1, 2, 3], dtype=dt), + np.array([2, 3, 0], dtype=dt), + np.array([3, 0, 0], dtype=dt), + np.array([0, 0, 1], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [0, 2], NEIGH_MODE['circular']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero: 3rd + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([3, 0, 0, 1, 2], dtype=dt), + np.array([0, 0, 1, 2, 3], dtype=dt), + np.array([0, 1, 2, 3, 0], dtype=dt), + np.array([1, 2, 3, 0, 0], dtype=dt), + np.array([2, 3, 0, 0, 1], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [-1, 3], NEIGH_MODE['zero'], [-2, 2], NEIGH_MODE['circular']) + assert_array_equal(l, r) + + # 4th simple, 1d test: stacking 2 neigh iterators, but with lower iterator + # being strictly within the array + def test_simple_strict_within(self): + dt = np.float64 + # Stacking zero on top of zero, first neighborhood strictly inside the + # array + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([1, 2, 3, 0], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['zero']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero, first neighborhood strictly inside the + # array + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([1, 2, 3, 3], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['mirror']) + assert_array_equal(l, r) + + # Stacking mirror on top of zero, first neighborhood strictly inside the + # array + x = np.array([1, 2, 3], dtype=dt) + r = [np.array([1, 2, 3, 1], dtype=dt)] + l = _multiarray_tests.test_neighborhood_iterator_oob( + x, [1, 1], NEIGH_MODE['zero'], [-1, 2], NEIGH_MODE['circular']) + assert_array_equal(l, r) + +class TestWarnings: + + def test_complex_warning(self): + x = np.array([1, 2]) + y = np.array([1-2j, 1+2j]) + + with warnings.catch_warnings(): + warnings.simplefilter("error", ComplexWarning) + assert_raises(ComplexWarning, x.__setitem__, slice(None), y) + assert_equal(x, [1, 2]) + + +class TestMinScalarType: + + def test_usigned_shortshort(self): + dt = np.min_scalar_type(2**8-1) + wanted = np.dtype('uint8') + assert_equal(wanted, dt) + + def test_usigned_short(self): + dt = np.min_scalar_type(2**16-1) + wanted = np.dtype('uint16') + assert_equal(wanted, dt) + + def test_usigned_int(self): + dt = np.min_scalar_type(2**32-1) + wanted = np.dtype('uint32') + assert_equal(wanted, dt) + + def test_usigned_longlong(self): + dt = np.min_scalar_type(2**63-1) + wanted = np.dtype('uint64') + assert_equal(wanted, dt) + + def test_object(self): + dt = np.min_scalar_type(2**64) + wanted = np.dtype('O') + assert_equal(wanted, dt) + + +from numpy._core._internal import _dtype_from_pep3118 + + +class TestPEP3118Dtype: + def _check(self, spec, wanted): + dt = np.dtype(wanted) + actual = _dtype_from_pep3118(spec) + assert_equal(actual, dt, + err_msg="spec %r != dtype %r" % (spec, wanted)) + + def test_native_padding(self): + align = np.dtype('i').alignment + for j in range(8): + if j == 0: + s = 'bi' + else: + s = 'b%dxi' % j + self._check('@'+s, {'f0': ('i1', 0), + 'f1': ('i', align*(1 + j//align))}) + self._check('='+s, {'f0': ('i1', 0), + 'f1': ('i', 1+j)}) + + def test_native_padding_2(self): + # Native padding should work also for structs and sub-arrays + self._check('x3T{xi}', {'f0': (({'f0': ('i', 4)}, (3,)), 4)}) + self._check('^x3T{xi}', {'f0': (({'f0': ('i', 1)}, (3,)), 1)}) + + def test_trailing_padding(self): + # Trailing padding should be included, *and*, the item size + # should match the alignment if in aligned mode + align = np.dtype('i').alignment + size = np.dtype('i').itemsize + + def aligned(n): + return align*(1 + (n-1)//align) + + base = dict(formats=['i'], names=['f0']) + + self._check('ix', dict(itemsize=aligned(size + 1), **base)) + self._check('ixx', dict(itemsize=aligned(size + 2), **base)) + self._check('ixxx', dict(itemsize=aligned(size + 3), **base)) + self._check('ixxxx', dict(itemsize=aligned(size + 4), **base)) + self._check('i7x', dict(itemsize=aligned(size + 7), **base)) + + self._check('^ix', dict(itemsize=size + 1, **base)) + self._check('^ixx', dict(itemsize=size + 2, **base)) + self._check('^ixxx', dict(itemsize=size + 3, **base)) + self._check('^ixxxx', dict(itemsize=size + 4, **base)) + self._check('^i7x', dict(itemsize=size + 7, **base)) + + def test_native_padding_3(self): + dt = np.dtype( + [('a', 'b'), ('b', 'i'), + ('sub', np.dtype('b,i')), ('c', 'i')], + align=True) + self._check("T{b:a:xxxi:b:T{b:f0:=i:f1:}:sub:xxxi:c:}", dt) + + dt = np.dtype( + [('a', 'b'), ('b', 'i'), ('c', 'b'), ('d', 'b'), + ('e', 'b'), ('sub', np.dtype('b,i', align=True))]) + self._check("T{b:a:=i:b:b:c:b:d:b:e:T{b:f0:xxxi:f1:}:sub:}", dt) + + def test_padding_with_array_inside_struct(self): + dt = np.dtype( + [('a', 'b'), ('b', 'i'), ('c', 'b', (3,)), + ('d', 'i')], + align=True) + self._check("T{b:a:xxxi:b:3b:c:xi:d:}", dt) + + def test_byteorder_inside_struct(self): + # The byte order after @T{=i} should be '=', not '@'. + # Check this by noting the absence of native alignment. + self._check('@T{^i}xi', {'f0': ({'f0': ('i', 0)}, 0), + 'f1': ('i', 5)}) + + def test_intra_padding(self): + # Natively aligned sub-arrays may require some internal padding + align = np.dtype('i').alignment + size = np.dtype('i').itemsize + + def aligned(n): + return (align*(1 + (n-1)//align)) + + self._check('(3)T{ix}', (dict( + names=['f0'], + formats=['i'], + offsets=[0], + itemsize=aligned(size + 1) + ), (3,))) + + def test_char_vs_string(self): + dt = np.dtype('c') + self._check('c', dt) + + dt = np.dtype([('f0', 'S1', (4,)), ('f1', 'S4')]) + self._check('4c4s', dt) + + def test_field_order(self): + # gh-9053 - previously, we relied on dictionary key order + self._check("(0)I:a:f:b:", [('a', 'I', (0,)), ('b', 'f')]) + self._check("(0)I:b:f:a:", [('b', 'I', (0,)), ('a', 'f')]) + + def test_unnamed_fields(self): + self._check('ii', [('f0', 'i'), ('f1', 'i')]) + self._check('ii:f0:', [('f1', 'i'), ('f0', 'i')]) + + self._check('i', 'i') + self._check('i:f0:', [('f0', 'i')]) + + +class TestNewBufferProtocol: + """ Test PEP3118 buffers """ + + def _check_roundtrip(self, obj): + obj = np.asarray(obj) + x = memoryview(obj) + y = np.asarray(x) + y2 = np.array(x) + assert_(not y.flags.owndata) + assert_(y2.flags.owndata) + + assert_equal(y.dtype, obj.dtype) + assert_equal(y.shape, obj.shape) + assert_array_equal(obj, y) + + assert_equal(y2.dtype, obj.dtype) + assert_equal(y2.shape, obj.shape) + assert_array_equal(obj, y2) + + def test_roundtrip(self): + x = np.array([1, 2, 3, 4, 5], dtype='i4') + self._check_roundtrip(x) + + x = np.array([[1, 2], [3, 4]], dtype=np.float64) + self._check_roundtrip(x) + + x = np.zeros((3, 3, 3), dtype=np.float32)[:, 0,:] + self._check_roundtrip(x) + + dt = [('a', 'b'), + ('b', 'h'), + ('c', 'i'), + ('d', 'l'), + ('dx', 'q'), + ('e', 'B'), + ('f', 'H'), + ('g', 'I'), + ('h', 'L'), + ('hx', 'Q'), + ('i', np.single), + ('j', np.double), + ('k', np.longdouble), + ('ix', np.csingle), + ('jx', np.cdouble), + ('kx', np.clongdouble), + ('l', 'S4'), + ('m', 'U4'), + ('n', 'V3'), + ('o', '?'), + ('p', np.half), + ] + x = np.array( + [(1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + b'aaaa', 'bbbb', b'xxx', True, 1.0)], + dtype=dt) + self._check_roundtrip(x) + + x = np.array(([[1, 2], [3, 4]],), dtype=[('a', (int, (2, 2)))]) + self._check_roundtrip(x) + + x = np.array([1, 2, 3], dtype='>i2') + self._check_roundtrip(x) + + x = np.array([1, 2, 3], dtype='') + x = np.zeros(4, dtype=dt) + self._check_roundtrip(x) + + def test_roundtrip_scalar(self): + # Issue #4015. + self._check_roundtrip(0) + + def test_invalid_buffer_format(self): + # datetime64 cannot be used fully in a buffer yet + # Should be fixed in the next Numpy major release + dt = np.dtype([('a', 'uint16'), ('b', 'M8[s]')]) + a = np.empty(3, dt) + assert_raises((ValueError, BufferError), memoryview, a) + assert_raises((ValueError, BufferError), memoryview, np.array((3), 'M8[D]')) + + def test_export_simple_1d(self): + x = np.array([1, 2, 3, 4, 5], dtype='i') + y = memoryview(x) + assert_equal(y.format, 'i') + assert_equal(y.shape, (5,)) + assert_equal(y.ndim, 1) + assert_equal(y.strides, (4,)) + assert_equal(y.suboffsets, ()) + assert_equal(y.itemsize, 4) + + def test_export_simple_nd(self): + x = np.array([[1, 2], [3, 4]], dtype=np.float64) + y = memoryview(x) + assert_equal(y.format, 'd') + assert_equal(y.shape, (2, 2)) + assert_equal(y.ndim, 2) + assert_equal(y.strides, (16, 8)) + assert_equal(y.suboffsets, ()) + assert_equal(y.itemsize, 8) + + def test_export_discontiguous(self): + x = np.zeros((3, 3, 3), dtype=np.float32)[:, 0,:] + y = memoryview(x) + assert_equal(y.format, 'f') + assert_equal(y.shape, (3, 3)) + assert_equal(y.ndim, 2) + assert_equal(y.strides, (36, 4)) + assert_equal(y.suboffsets, ()) + assert_equal(y.itemsize, 4) + + def test_export_record(self): + dt = [('a', 'b'), + ('b', 'h'), + ('c', 'i'), + ('d', 'l'), + ('dx', 'q'), + ('e', 'B'), + ('f', 'H'), + ('g', 'I'), + ('h', 'L'), + ('hx', 'Q'), + ('i', np.single), + ('j', np.double), + ('k', np.longdouble), + ('ix', np.csingle), + ('jx', np.cdouble), + ('kx', np.clongdouble), + ('l', 'S4'), + ('m', 'U4'), + ('n', 'V3'), + ('o', '?'), + ('p', np.half), + ] + x = np.array( + [(1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, + b'aaaa', 'bbbb', b' ', True, 1.0)], + dtype=dt) + y = memoryview(x) + assert_equal(y.shape, (1,)) + assert_equal(y.ndim, 1) + assert_equal(y.suboffsets, ()) + + sz = sum([np.dtype(b).itemsize for a, b in dt]) + if np.dtype('l').itemsize == 4: + assert_equal(y.format, 'T{b:a:=h:b:i:c:l:d:q:dx:B:e:@H:f:=I:g:L:h:Q:hx:f:i:d:j:^g:k:=Zf:ix:Zd:jx:^Zg:kx:4s:l:=4w:m:3x:n:?:o:@e:p:}') + else: + assert_equal(y.format, 'T{b:a:=h:b:i:c:q:d:q:dx:B:e:@H:f:=I:g:Q:h:Q:hx:f:i:d:j:^g:k:=Zf:ix:Zd:jx:^Zg:kx:4s:l:=4w:m:3x:n:?:o:@e:p:}') + assert_equal(y.strides, (sz,)) + assert_equal(y.itemsize, sz) + + def test_export_subarray(self): + x = np.array(([[1, 2], [3, 4]],), dtype=[('a', ('i', (2, 2)))]) + y = memoryview(x) + assert_equal(y.format, 'T{(2,2)i:a:}') + assert_equal(y.shape, ()) + assert_equal(y.ndim, 0) + assert_equal(y.strides, ()) + assert_equal(y.suboffsets, ()) + assert_equal(y.itemsize, 16) + + def test_export_endian(self): + x = np.array([1, 2, 3], dtype='>i') + y = memoryview(x) + if sys.byteorder == 'little': + assert_equal(y.format, '>i') + else: + assert_equal(y.format, 'i') + + x = np.array([1, 2, 3], dtype=' np.array(0, dtype=dt1), "type %s failed" % (dt1,)) + assert_(not 1 < np.array(0, dtype=dt1), "type %s failed" % (dt1,)) + + for dt2 in np.typecodes['AllInteger']: + assert_(np.array(1, dtype=dt1) > np.array(0, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1) < np.array(0, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + + # Unsigned integers + for dt1 in 'BHILQP': + assert_(-1 < np.array(1, dtype=dt1), "type %s failed" % (dt1,)) + assert_(not -1 > np.array(1, dtype=dt1), "type %s failed" % (dt1,)) + assert_(-1 != np.array(1, dtype=dt1), "type %s failed" % (dt1,)) + + # Unsigned vs signed + for dt2 in 'bhilqp': + assert_(np.array(1, dtype=dt1) > np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1) < np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + assert_(np.array(1, dtype=dt1) != np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + + # Signed integers and floats + for dt1 in 'bhlqp' + np.typecodes['Float']: + assert_(1 > np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) + assert_(not 1 < np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) + assert_(-1 == np.array(-1, dtype=dt1), "type %s failed" % (dt1,)) + + for dt2 in 'bhlqp' + np.typecodes['Float']: + assert_(np.array(1, dtype=dt1) > np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1) < np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + assert_(np.array(-1, dtype=dt1) == np.array(-1, dtype=dt2), + "type %s and %s failed" % (dt1, dt2)) + + def test_to_bool_scalar(self): + assert_equal(bool(np.array([False])), False) + assert_equal(bool(np.array([True])), True) + assert_equal(bool(np.array([[42]])), True) + assert_raises(ValueError, bool, np.array([1, 2])) + + class NotConvertible: + def __bool__(self): + raise NotImplementedError + + assert_raises(NotImplementedError, bool, np.array(NotConvertible())) + assert_raises(NotImplementedError, bool, np.array([NotConvertible()])) + if IS_PYSTON: + pytest.skip("Pyston disables recursion checking") + + self_containing = np.array([None]) + self_containing[0] = self_containing + + Error = RecursionError + + assert_raises(Error, bool, self_containing) # previously stack overflow + self_containing[0] = None # resolve circular reference + + def test_to_int_scalar(self): + # gh-9972 means that these aren't always the same + int_funcs = (int, lambda x: x.__int__()) + for int_func in int_funcs: + assert_equal(int_func(np.array(0)), 0) + with assert_warns(DeprecationWarning): + assert_equal(int_func(np.array([1])), 1) + with assert_warns(DeprecationWarning): + assert_equal(int_func(np.array([[42]])), 42) + assert_raises(TypeError, int_func, np.array([1, 2])) + + # gh-9972 + assert_equal(4, int_func(np.array('4'))) + assert_equal(5, int_func(np.bytes_(b'5'))) + assert_equal(6, int_func(np.str_('6'))) + + # The delegation of int() to __trunc__ was deprecated in + # Python 3.11. + if sys.version_info < (3, 11): + class HasTrunc: + def __trunc__(self): + return 3 + assert_equal(3, int_func(np.array(HasTrunc()))) + with assert_warns(DeprecationWarning): + assert_equal(3, int_func(np.array([HasTrunc()]))) + else: + pass + + class NotConvertible: + def __int__(self): + raise NotImplementedError + assert_raises(NotImplementedError, + int_func, np.array(NotConvertible())) + with assert_warns(DeprecationWarning): + assert_raises(NotImplementedError, + int_func, np.array([NotConvertible()])) + + +class TestWhere: + def test_basic(self): + dts = [bool, np.int16, np.int32, np.int64, np.double, np.complex128, + np.longdouble, np.clongdouble] + for dt in dts: + c = np.ones(53, dtype=bool) + assert_equal(np.where( c, dt(0), dt(1)), dt(0)) + assert_equal(np.where(~c, dt(0), dt(1)), dt(1)) + assert_equal(np.where(True, dt(0), dt(1)), dt(0)) + assert_equal(np.where(False, dt(0), dt(1)), dt(1)) + d = np.ones_like(c).astype(dt) + e = np.zeros_like(d) + r = d.astype(dt) + c[7] = False + r[7] = e[7] + assert_equal(np.where(c, e, e), e) + assert_equal(np.where(c, d, e), r) + assert_equal(np.where(c, d, e[0]), r) + assert_equal(np.where(c, d[0], e), r) + assert_equal(np.where(c[::2], d[::2], e[::2]), r[::2]) + assert_equal(np.where(c[1::2], d[1::2], e[1::2]), r[1::2]) + assert_equal(np.where(c[::3], d[::3], e[::3]), r[::3]) + assert_equal(np.where(c[1::3], d[1::3], e[1::3]), r[1::3]) + assert_equal(np.where(c[::-2], d[::-2], e[::-2]), r[::-2]) + assert_equal(np.where(c[::-3], d[::-3], e[::-3]), r[::-3]) + assert_equal(np.where(c[1::-3], d[1::-3], e[1::-3]), r[1::-3]) + + @pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support") + def test_exotic(self): + # object + assert_array_equal(np.where(True, None, None), np.array(None)) + # zero sized + m = np.array([], dtype=bool).reshape(0, 3) + b = np.array([], dtype=np.float64).reshape(0, 3) + assert_array_equal(np.where(m, 0, b), np.array([]).reshape(0, 3)) + + # object cast + d = np.array([-1.34, -0.16, -0.54, -0.31, -0.08, -0.95, 0.000, 0.313, + 0.547, -0.18, 0.876, 0.236, 1.969, 0.310, 0.699, 1.013, + 1.267, 0.229, -1.39, 0.487]) + nan = float('NaN') + e = np.array(['5z', '0l', nan, 'Wz', nan, nan, 'Xq', 'cs', nan, nan, + 'QN', nan, nan, 'Fd', nan, nan, 'kp', nan, '36', 'i1'], + dtype=object) + m = np.array([0, 0, 1, 0, 1, 1, 0, 0, 1, 1, + 0, 1, 1, 0, 1, 1, 0, 1, 0, 0], dtype=bool) + + r = e[:] + r[np.where(m)] = d[np.where(m)] + assert_array_equal(np.where(m, d, e), r) + + r = e[:] + r[np.where(~m)] = d[np.where(~m)] + assert_array_equal(np.where(m, e, d), r) + + assert_array_equal(np.where(m, e, e), e) + + # minimal dtype result with NaN scalar (e.g required by pandas) + d = np.array([1., 2.], dtype=np.float32) + e = float('NaN') + assert_equal(np.where(True, d, e).dtype, np.float32) + e = float('Infinity') + assert_equal(np.where(True, d, e).dtype, np.float32) + e = float('-Infinity') + assert_equal(np.where(True, d, e).dtype, np.float32) + # With NEP 50 adopted, the float will overflow here: + e = float(1e150) + with pytest.warns(RuntimeWarning, match="overflow"): + res = np.where(True, d, e) + assert res.dtype == np.float32 + + def test_ndim(self): + c = [True, False] + a = np.zeros((2, 25)) + b = np.ones((2, 25)) + r = np.where(np.array(c)[:,np.newaxis], a, b) + assert_array_equal(r[0], a[0]) + assert_array_equal(r[1], b[0]) + + a = a.T + b = b.T + r = np.where(c, a, b) + assert_array_equal(r[:,0], a[:,0]) + assert_array_equal(r[:,1], b[:,0]) + + def test_dtype_mix(self): + c = np.array([False, True, False, False, False, False, True, False, + False, False, True, False]) + a = np.uint32(1) + b = np.array([5., 0., 3., 2., -1., -4., 0., -10., 10., 1., 0., 3.], + dtype=np.float64) + r = np.array([5., 1., 3., 2., -1., -4., 1., -10., 10., 1., 1., 3.], + dtype=np.float64) + assert_equal(np.where(c, a, b), r) + + a = a.astype(np.float32) + b = b.astype(np.int64) + assert_equal(np.where(c, a, b), r) + + # non bool mask + c = c.astype(int) + c[c != 0] = 34242324 + assert_equal(np.where(c, a, b), r) + # invert + tmpmask = c != 0 + c[c == 0] = 41247212 + c[tmpmask] = 0 + assert_equal(np.where(c, b, a), r) + + def test_foreign(self): + c = np.array([False, True, False, False, False, False, True, False, + False, False, True, False]) + r = np.array([5., 1., 3., 2., -1., -4., 1., -10., 10., 1., 1., 3.], + dtype=np.float64) + a = np.ones(1, dtype='>i4') + b = np.array([5., 0., 3., 2., -1., -4., 0., -10., 10., 1., 0., 3.], + dtype=np.float64) + assert_equal(np.where(c, a, b), r) + + b = b.astype('>f8') + assert_equal(np.where(c, a, b), r) + + a = a.astype('i4') + assert_equal(np.where(c, a, b), r) + + def test_error(self): + c = [True, True] + a = np.ones((4, 5)) + b = np.ones((5, 5)) + assert_raises(ValueError, np.where, c, a, a) + assert_raises(ValueError, np.where, c[0], a, b) + + def test_string(self): + # gh-4778 check strings are properly filled with nulls + a = np.array("abc") + b = np.array("x" * 753) + assert_equal(np.where(True, a, b), "abc") + assert_equal(np.where(False, b, a), "abc") + + # check native datatype sized strings + a = np.array("abcd") + b = np.array("x" * 8) + assert_equal(np.where(True, a, b), "abcd") + assert_equal(np.where(False, b, a), "abcd") + + def test_empty_result(self): + # pass empty where result through an assignment which reads the data of + # empty arrays, error detectable with valgrind, see gh-8922 + x = np.zeros((1, 1)) + ibad = np.vstack(np.where(x == 99.)) + assert_array_equal(ibad, + np.atleast_2d(np.array([[],[]], dtype=np.intp))) + + def test_largedim(self): + # invalid read regression gh-9304 + shape = [10, 2, 3, 4, 5, 6] + np.random.seed(2) + array = np.random.rand(*shape) + + for i in range(10): + benchmark = array.nonzero() + result = array.nonzero() + assert_array_equal(benchmark, result) + + def test_kwargs(self): + a = np.zeros(1) + with assert_raises(TypeError): + np.where(a, x=a, y=a) + + +if not IS_PYPY: + # sys.getsizeof() is not valid on PyPy + class TestSizeOf: + + def test_empty_array(self): + x = np.array([]) + assert_(sys.getsizeof(x) > 0) + + def check_array(self, dtype): + elem_size = dtype(0).itemsize + + for length in [10, 50, 100, 500]: + x = np.arange(length, dtype=dtype) + assert_(sys.getsizeof(x) > length * elem_size) + + def test_array_int32(self): + self.check_array(np.int32) + + def test_array_int64(self): + self.check_array(np.int64) + + def test_array_float32(self): + self.check_array(np.float32) + + def test_array_float64(self): + self.check_array(np.float64) + + def test_view(self): + d = np.ones(100) + assert_(sys.getsizeof(d[...]) < sys.getsizeof(d)) + + def test_reshape(self): + d = np.ones(100) + assert_(sys.getsizeof(d) < sys.getsizeof(d.reshape(100, 1, 1).copy())) + + @_no_tracing + def test_resize(self): + d = np.ones(100) + old = sys.getsizeof(d) + d.resize(50) + assert_(old > sys.getsizeof(d)) + d.resize(150) + assert_(old < sys.getsizeof(d)) + + @pytest.mark.parametrize("dtype", ["u4,f4", "u4,O"]) + def test_resize_structured(self, dtype): + a = np.array([(0, 0.0) for i in range(5)], dtype=dtype) + a.resize(1000) + assert_array_equal(a, np.zeros(1000, dtype=dtype)) + + def test_error(self): + d = np.ones(100) + assert_raises(TypeError, d.__sizeof__, "a") + + +class TestHashing: + + def test_arrays_not_hashable(self): + x = np.ones(3) + assert_raises(TypeError, hash, x) + + def test_collections_hashable(self): + x = np.array([]) + assert_(not isinstance(x, collections.abc.Hashable)) + + +class TestArrayPriority: + # This will go away when __array_priority__ is settled, meanwhile + # it serves to check unintended changes. + op = operator + binary_ops = [ + op.pow, op.add, op.sub, op.mul, op.floordiv, op.truediv, op.mod, + op.and_, op.or_, op.xor, op.lshift, op.rshift, op.mod, op.gt, + op.ge, op.lt, op.le, op.ne, op.eq + ] + + class Foo(np.ndarray): + __array_priority__ = 100. + + def __new__(cls, *args, **kwargs): + return np.array(*args, **kwargs).view(cls) + + class Bar(np.ndarray): + __array_priority__ = 101. + + def __new__(cls, *args, **kwargs): + return np.array(*args, **kwargs).view(cls) + + class Other: + __array_priority__ = 1000. + + def _all(self, other): + return self.__class__() + + __add__ = __radd__ = _all + __sub__ = __rsub__ = _all + __mul__ = __rmul__ = _all + __pow__ = __rpow__ = _all + __div__ = __rdiv__ = _all + __mod__ = __rmod__ = _all + __truediv__ = __rtruediv__ = _all + __floordiv__ = __rfloordiv__ = _all + __and__ = __rand__ = _all + __xor__ = __rxor__ = _all + __or__ = __ror__ = _all + __lshift__ = __rlshift__ = _all + __rshift__ = __rrshift__ = _all + __eq__ = _all + __ne__ = _all + __gt__ = _all + __ge__ = _all + __lt__ = _all + __le__ = _all + + def test_ndarray_subclass(self): + a = np.array([1, 2]) + b = self.Bar([1, 2]) + for f in self.binary_ops: + msg = repr(f) + assert_(isinstance(f(a, b), self.Bar), msg) + assert_(isinstance(f(b, a), self.Bar), msg) + + def test_ndarray_other(self): + a = np.array([1, 2]) + b = self.Other() + for f in self.binary_ops: + msg = repr(f) + assert_(isinstance(f(a, b), self.Other), msg) + assert_(isinstance(f(b, a), self.Other), msg) + + def test_subclass_subclass(self): + a = self.Foo([1, 2]) + b = self.Bar([1, 2]) + for f in self.binary_ops: + msg = repr(f) + assert_(isinstance(f(a, b), self.Bar), msg) + assert_(isinstance(f(b, a), self.Bar), msg) + + def test_subclass_other(self): + a = self.Foo([1, 2]) + b = self.Other() + for f in self.binary_ops: + msg = repr(f) + assert_(isinstance(f(a, b), self.Other), msg) + assert_(isinstance(f(b, a), self.Other), msg) + + +class TestBytestringArrayNonzero: + + def test_empty_bstring_array_is_falsey(self): + assert_(not np.array([''], dtype=str)) + + def test_whitespace_bstring_array_is_truthy(self): + a = np.array(['spam'], dtype=str) + a[0] = ' \0\0' + assert_(a) + + def test_all_null_bstring_array_is_falsey(self): + a = np.array(['spam'], dtype=str) + a[0] = '\0\0\0\0' + assert_(not a) + + def test_null_inside_bstring_array_is_truthy(self): + a = np.array(['spam'], dtype=str) + a[0] = ' \0 \0' + assert_(a) + + +class TestUnicodeEncoding: + """ + Tests for encoding related bugs, such as UCS2 vs UCS4, round-tripping + issues, etc + """ + def test_round_trip(self): + """ Tests that GETITEM, SETITEM, and PyArray_Scalar roundtrip """ + # gh-15363 + arr = np.zeros(shape=(), dtype="U1") + for i in range(1, sys.maxunicode + 1): + expected = chr(i) + arr[()] = expected + assert arr[()] == expected + assert arr.item() == expected + + def test_assign_scalar(self): + # gh-3258 + l = np.array(['aa', 'bb']) + l[:] = np.str_('cc') + assert_equal(l, ['cc', 'cc']) + + def test_fill_scalar(self): + # gh-7227 + l = np.array(['aa', 'bb']) + l.fill(np.str_('cc')) + assert_equal(l, ['cc', 'cc']) + + +class TestUnicodeArrayNonzero: + + def test_empty_ustring_array_is_falsey(self): + assert_(not np.array([''], dtype=np.str_)) + + def test_whitespace_ustring_array_is_truthy(self): + a = np.array(['eggs'], dtype=np.str_) + a[0] = ' \0\0' + assert_(a) + + def test_all_null_ustring_array_is_falsey(self): + a = np.array(['eggs'], dtype=np.str_) + a[0] = '\0\0\0\0' + assert_(not a) + + def test_null_inside_ustring_array_is_truthy(self): + a = np.array(['eggs'], dtype=np.str_) + a[0] = ' \0 \0' + assert_(a) + + +class TestFormat: + + def test_0d(self): + a = np.array(np.pi) + assert_equal('{:0.3g}'.format(a), '3.14') + assert_equal('{:0.3g}'.format(a[()]), '3.14') + + def test_1d_no_format(self): + a = np.array([np.pi]) + assert_equal('{}'.format(a), str(a)) + + def test_1d_format(self): + # until gh-5543, ensure that the behaviour matches what it used to be + a = np.array([np.pi]) + assert_raises(TypeError, '{:30}'.format, a) + + +from numpy.testing import IS_PYPY + + +class TestCTypes: + + def test_ctypes_is_available(self): + test_arr = np.array([[1, 2, 3], [4, 5, 6]]) + + assert_equal(ctypes, test_arr.ctypes._ctypes) + assert_equal(tuple(test_arr.ctypes.shape), (2, 3)) + + def test_ctypes_is_not_available(self): + from numpy._core import _internal + _internal.ctypes = None + try: + test_arr = np.array([[1, 2, 3], [4, 5, 6]]) + + assert_(isinstance(test_arr.ctypes._ctypes, + _internal._missing_ctypes)) + assert_equal(tuple(test_arr.ctypes.shape), (2, 3)) + finally: + _internal.ctypes = ctypes + + def _make_readonly(x): + x.flags.writeable = False + return x + + @pytest.mark.parametrize('arr', [ + np.array([1, 2, 3]), + np.array([['one', 'two'], ['three', 'four']]), + np.array((1, 2), dtype='i4,i4'), + np.zeros((2,), dtype= + np.dtype(dict( + formats=['2, [44, 55]) + assert_equal(a, np.array([[0, 44], [1, 55], [2, 44]])) + # hit one of the failing paths + assert_raises(ValueError, np.place, a, a>20, []) + + def test_put_noncontiguous(self): + a = np.arange(6).reshape(2, 3).T # force non-c-contiguous + np.put(a, [0, 2], [44, 55]) + assert_equal(a, np.array([[44, 3], [55, 4], [2, 5]])) + + def test_putmask_noncontiguous(self): + a = np.arange(6).reshape(2, 3).T # force non-c-contiguous + # uses arr_putmask + np.putmask(a, a>2, a**2) + assert_equal(a, np.array([[0, 9], [1, 16], [2, 25]])) + + def test_take_mode_raise(self): + a = np.arange(6, dtype='int') + out = np.empty(2, dtype='int') + np.take(a, [0, 2], out=out, mode='raise') + assert_equal(out, np.array([0, 2])) + + def test_choose_mod_raise(self): + a = np.array([[1, 0, 1], [0, 1, 0], [1, 0, 1]]) + out = np.empty((3,3), dtype='int') + choices = [-10, 10] + np.choose(a, choices, out=out, mode='raise') + assert_equal(out, np.array([[ 10, -10, 10], + [-10, 10, -10], + [ 10, -10, 10]])) + + def test_flatiter__array__(self): + a = np.arange(9).reshape(3, 3) + b = a.T.flat + c = b.__array__() + # triggers the WRITEBACKIFCOPY resolution, assuming refcount semantics + del c + + def test_dot_out(self): + # if HAVE_CBLAS, will use WRITEBACKIFCOPY + a = np.arange(9, dtype=float).reshape(3, 3) + b = np.dot(a, a, out=a) + assert_equal(b, np.array([[15, 18, 21], [42, 54, 66], [69, 90, 111]])) + + def test_view_assign(self): + from numpy._core._multiarray_tests import ( + npy_create_writebackifcopy, npy_resolve + ) + + arr = np.arange(9).reshape(3, 3).T + arr_wb = npy_create_writebackifcopy(arr) + assert_(arr_wb.flags.writebackifcopy) + assert_(arr_wb.base is arr) + arr_wb[...] = -100 + npy_resolve(arr_wb) + # arr changes after resolve, even though we assigned to arr_wb + assert_equal(arr, -100) + # after resolve, the two arrays no longer reference each other + assert_(arr_wb.ctypes.data != 0) + assert_equal(arr_wb.base, None) + # assigning to arr_wb does not get transferred to arr + arr_wb[...] = 100 + assert_equal(arr, -100) + + @pytest.mark.leaks_references( + reason="increments self in dealloc; ignore since deprecated path.") + def test_dealloc_warning(self): + with suppress_warnings() as sup: + sup.record(RuntimeWarning) + arr = np.arange(9).reshape(3, 3) + v = arr.T + _multiarray_tests.npy_abuse_writebackifcopy(v) + assert len(sup.log) == 1 + + def test_view_discard_refcount(self): + from numpy._core._multiarray_tests import ( + npy_create_writebackifcopy, npy_discard + ) + + arr = np.arange(9).reshape(3, 3).T + orig = arr.copy() + if HAS_REFCOUNT: + arr_cnt = sys.getrefcount(arr) + arr_wb = npy_create_writebackifcopy(arr) + assert_(arr_wb.flags.writebackifcopy) + assert_(arr_wb.base is arr) + arr_wb[...] = -100 + npy_discard(arr_wb) + # arr remains unchanged after discard + assert_equal(arr, orig) + # after discard, the two arrays no longer reference each other + assert_(arr_wb.ctypes.data != 0) + assert_equal(arr_wb.base, None) + if HAS_REFCOUNT: + assert_equal(arr_cnt, sys.getrefcount(arr)) + # assigning to arr_wb does not get transferred to arr + arr_wb[...] = 100 + assert_equal(arr, orig) + + +class TestArange: + def test_infinite(self): + assert_raises_regex( + ValueError, "size exceeded", + np.arange, 0, np.inf + ) + + def test_nan_step(self): + assert_raises_regex( + ValueError, "cannot compute length", + np.arange, 0, 1, np.nan + ) + + def test_zero_step(self): + assert_raises(ZeroDivisionError, np.arange, 0, 10, 0) + assert_raises(ZeroDivisionError, np.arange, 0.0, 10.0, 0.0) + + # empty range + assert_raises(ZeroDivisionError, np.arange, 0, 0, 0) + assert_raises(ZeroDivisionError, np.arange, 0.0, 0.0, 0.0) + + def test_require_range(self): + assert_raises(TypeError, np.arange) + assert_raises(TypeError, np.arange, step=3) + assert_raises(TypeError, np.arange, dtype='int64') + assert_raises(TypeError, np.arange, start=4) + + def test_start_stop_kwarg(self): + keyword_stop = np.arange(stop=3) + keyword_zerotostop = np.arange(0, stop=3) + keyword_start_stop = np.arange(start=3, stop=9) + + assert len(keyword_stop) == 3 + assert len(keyword_zerotostop) == 3 + assert len(keyword_start_stop) == 6 + assert_array_equal(keyword_stop, keyword_zerotostop) + + def test_arange_booleans(self): + # Arange makes some sense for booleans and works up to length 2. + # But it is weird since `arange(2, 4, dtype=bool)` works. + # Arguably, much or all of this could be deprecated/removed. + res = np.arange(False, dtype=bool) + assert_array_equal(res, np.array([], dtype="bool")) + + res = np.arange(True, dtype="bool") + assert_array_equal(res, [False]) + + res = np.arange(2, dtype="bool") + assert_array_equal(res, [False, True]) + + # This case is especially weird, but drops out without special case: + res = np.arange(6, 8, dtype="bool") + assert_array_equal(res, [True, True]) + + with pytest.raises(TypeError): + np.arange(3, dtype="bool") + + @pytest.mark.parametrize("dtype", ["S3", "U", "5i"]) + def test_rejects_bad_dtypes(self, dtype): + dtype = np.dtype(dtype) + DType_name = re.escape(str(type(dtype))) + with pytest.raises(TypeError, + match=rf"arange\(\) not supported for inputs .* {DType_name}"): + np.arange(2, dtype=dtype) + + def test_rejects_strings(self): + # Explicitly test error for strings which may call "b" - "a": + DType_name = re.escape(str(type(np.array("a").dtype))) + with pytest.raises(TypeError, + match=rf"arange\(\) not supported for inputs .* {DType_name}"): + np.arange("a", "b") + + def test_byteswapped(self): + res_be = np.arange(1, 1000, dtype=">i4") + res_le = np.arange(1, 1000, dtype="i4" + assert res_le.dtype == " arr2 + + +@pytest.mark.parametrize("op", [ + operator.eq, operator.ne, operator.le, operator.lt, operator.ge, + operator.gt]) +def test_comparisons_forwards_error(op): + class NotArray: + def __array__(self, dtype=None, copy=None): + raise TypeError("run you fools") + + with pytest.raises(TypeError, match="run you fools"): + op(np.arange(2), NotArray()) + + with pytest.raises(TypeError, match="run you fools"): + op(NotArray(), np.arange(2)) + + +def test_richcompare_scalar_boolean_singleton_return(): + # These are currently guaranteed to be the boolean singletons, but maybe + # returning NumPy booleans would also be OK: + assert (np.array(0) == "a") is False + assert (np.array(0) != "a") is True + assert (np.int16(0) == "a") is False + assert (np.int16(0) != "a") is True + + +@pytest.mark.parametrize("op", [ + operator.eq, operator.ne, operator.le, operator.lt, operator.ge, + operator.gt]) +def test_ragged_comparison_fails(op): + # This needs to convert the internal array to True/False, which fails: + a = np.array([1, np.array([1, 2, 3])], dtype=object) + b = np.array([1, np.array([1, 2, 3])], dtype=object) + + with pytest.raises(ValueError, match="The truth value.*ambiguous"): + op(a, b) + + +@pytest.mark.parametrize( + ["fun", "npfun"], + [ + (_multiarray_tests.npy_cabs, np.absolute), + (_multiarray_tests.npy_carg, np.angle) + ] +) +@pytest.mark.parametrize("x", [1, np.inf, -np.inf, np.nan]) +@pytest.mark.parametrize("y", [1, np.inf, -np.inf, np.nan]) +@pytest.mark.parametrize("test_dtype", np.complexfloating.__subclasses__()) +def test_npymath_complex(fun, npfun, x, y, test_dtype): + # Smoketest npymath functions + z = test_dtype(complex(x, y)) + with np.errstate(invalid='ignore'): + # Fallback implementations may emit a warning for +-inf (see gh-24876): + # RuntimeWarning: invalid value encountered in absolute + got = fun(z) + expected = npfun(z) + assert_allclose(got, expected) + + +def test_npymath_real(): + # Smoketest npymath functions + from numpy._core._multiarray_tests import ( + npy_log10, npy_cosh, npy_sinh, npy_tan, npy_tanh) + + funcs = {npy_log10: np.log10, + npy_cosh: np.cosh, + npy_sinh: np.sinh, + npy_tan: np.tan, + npy_tanh: np.tanh} + vals = (1, np.inf, -np.inf, np.nan) + types = (np.float32, np.float64, np.longdouble) + + with np.errstate(all='ignore'): + for fun, npfun in funcs.items(): + for x, t in itertools.product(vals, types): + z = t(x) + got = fun(z) + expected = npfun(z) + assert_allclose(got, expected) + +def test_uintalignment_and_alignment(): + # alignment code needs to satisfy these requirements: + # 1. numpy structs match C struct layout + # 2. ufuncs/casting is safe wrt to aligned access + # 3. copy code is safe wrt to "uint alidned" access + # + # Complex types are the main problem, whose alignment may not be the same + # as their "uint alignment". + # + # This test might only fail on certain platforms, where uint64 alignment is + # not equal to complex64 alignment. The second 2 tests will only fail + # for DEBUG=1. + + d1 = np.dtype('u1,c8', align=True) + d2 = np.dtype('u4,c8', align=True) + d3 = np.dtype({'names': ['a', 'b'], 'formats': ['u1', d1]}, align=True) + + assert_equal(np.zeros(1, dtype=d1)['f1'].flags['ALIGNED'], True) + assert_equal(np.zeros(1, dtype=d2)['f1'].flags['ALIGNED'], True) + assert_equal(np.zeros(1, dtype='u1,c8')['f1'].flags['ALIGNED'], False) + + # check that C struct matches numpy struct size + s = _multiarray_tests.get_struct_alignments() + for d, (alignment, size) in zip([d1,d2,d3], s): + assert_equal(d.alignment, alignment) + assert_equal(d.itemsize, size) + + # check that ufuncs don't complain in debug mode + # (this is probably OK if the aligned flag is true above) + src = np.zeros((2,2), dtype=d1)['f1'] # 4-byte aligned, often + np.exp(src) # assert fails? + + # check that copy code doesn't complain in debug mode + dst = np.zeros((2,2), dtype='c8') + dst[:,1] = src[:,1] # assert in lowlevel_strided_loops fails? + +class TestAlignment: + # adapted from scipy._lib.tests.test__util.test__aligned_zeros + # Checks that unusual memory alignments don't trip up numpy. + + def check(self, shape, dtype, order, align): + err_msg = repr((shape, dtype, order, align)) + x = _aligned_zeros(shape, dtype, order, align=align) + if align is None: + align = np.dtype(dtype).alignment + assert_equal(x.__array_interface__['data'][0] % align, 0) + if hasattr(shape, '__len__'): + assert_equal(x.shape, shape, err_msg) + else: + assert_equal(x.shape, (shape,), err_msg) + assert_equal(x.dtype, dtype) + if order == "C": + assert_(x.flags.c_contiguous, err_msg) + elif order == "F": + if x.size > 0: + assert_(x.flags.f_contiguous, err_msg) + elif order is None: + assert_(x.flags.c_contiguous, err_msg) + else: + raise ValueError() + + def test_various_alignments(self): + for align in [1, 2, 3, 4, 8, 12, 16, 32, 64, None]: + for n in [0, 1, 3, 11]: + for order in ["C", "F", None]: + for dtype in list(np.typecodes["All"]) + ['i4,i4,i4']: + if dtype == 'O': + # object dtype can't be misaligned + continue + for shape in [n, (1, 2, 3, n)]: + self.check(shape, np.dtype(dtype), order, align) + + def test_strided_loop_alignments(self): + # particularly test that complex64 and float128 use right alignment + # code-paths, since these are particularly problematic. It is useful to + # turn on USE_DEBUG for this test, so lowlevel-loop asserts are run. + for align in [1, 2, 4, 8, 12, 16, None]: + xf64 = _aligned_zeros(3, np.float64) + + xc64 = _aligned_zeros(3, np.complex64, align=align) + xf128 = _aligned_zeros(3, np.longdouble, align=align) + + # test casting, both to and from misaligned + with suppress_warnings() as sup: + sup.filter(ComplexWarning, "Casting complex values") + xc64.astype('f8') + xf64.astype(np.complex64) + test = xc64 + xf64 + + xf128.astype('f8') + xf64.astype(np.longdouble) + test = xf128 + xf64 + + test = xf128 + xc64 + + # test copy, both to and from misaligned + # contig copy + xf64[:] = xf64.copy() + xc64[:] = xc64.copy() + xf128[:] = xf128.copy() + # strided copy + xf64[::2] = xf64[::2].copy() + xc64[::2] = xc64[::2].copy() + xf128[::2] = xf128[::2].copy() + +def test_getfield(): + a = np.arange(32, dtype='uint16') + if sys.byteorder == 'little': + i = 0 + j = 1 + else: + i = 1 + j = 0 + b = a.getfield('int8', i) + assert_equal(b, a) + b = a.getfield('int8', j) + assert_equal(b, 0) + pytest.raises(ValueError, a.getfield, 'uint8', -1) + pytest.raises(ValueError, a.getfield, 'uint8', 16) + pytest.raises(ValueError, a.getfield, 'uint64', 0) + + +class TestViewDtype: + """ + Verify that making a view of a non-contiguous array works as expected. + """ + def test_smaller_dtype_multiple(self): + # x is non-contiguous + x = np.arange(10, dtype=' rc_a) + assert_(sys.getrefcount(dt) > rc_dt) + # del 'it' + it = None + assert_equal(sys.getrefcount(a), rc_a) + assert_equal(sys.getrefcount(dt), rc_dt) + + # With a copy + a = arange(6, dtype='f4') + dt = np.dtype('f4') + rc_a = sys.getrefcount(a) + rc_dt = sys.getrefcount(dt) + it = nditer(a, [], + [['readwrite']], + op_dtypes=[dt]) + rc2_a = sys.getrefcount(a) + rc2_dt = sys.getrefcount(dt) + it2 = it.copy() + assert_(sys.getrefcount(a) > rc2_a) + if sys.version_info < (3, 13): + # np.dtype('f4') is immortal after Python 3.13 + assert_(sys.getrefcount(dt) > rc2_dt) + it = None + assert_equal(sys.getrefcount(a), rc2_a) + assert_equal(sys.getrefcount(dt), rc2_dt) + it2 = None + assert_equal(sys.getrefcount(a), rc_a) + assert_equal(sys.getrefcount(dt), rc_dt) + + del it2 # avoid pyflakes unused variable warning + +def test_iter_best_order(): + # The iterator should always find the iteration order + # with increasing memory addresses + + # Test the ordering for 1-D to 5-D shapes + for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: + a = arange(np.prod(shape)) + # Test each combination of positive and negative strides + for dirs in range(2**len(shape)): + dirs_index = [slice(None)]*len(shape) + for bit in range(len(shape)): + if ((2**bit) & dirs): + dirs_index[bit] = slice(None, None, -1) + dirs_index = tuple(dirs_index) + + aview = a.reshape(shape)[dirs_index] + # C-order + i = nditer(aview, [], [['readonly']]) + assert_equal([x for x in i], a) + # Fortran-order + i = nditer(aview.T, [], [['readonly']]) + assert_equal([x for x in i], a) + # Other order + if len(shape) > 2: + i = nditer(aview.swapaxes(0, 1), [], [['readonly']]) + assert_equal([x for x in i], a) + +def test_iter_c_order(): + # Test forcing C order + + # Test the ordering for 1-D to 5-D shapes + for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: + a = arange(np.prod(shape)) + # Test each combination of positive and negative strides + for dirs in range(2**len(shape)): + dirs_index = [slice(None)]*len(shape) + for bit in range(len(shape)): + if ((2**bit) & dirs): + dirs_index[bit] = slice(None, None, -1) + dirs_index = tuple(dirs_index) + + aview = a.reshape(shape)[dirs_index] + # C-order + i = nditer(aview, order='C') + assert_equal([x for x in i], aview.ravel(order='C')) + # Fortran-order + i = nditer(aview.T, order='C') + assert_equal([x for x in i], aview.T.ravel(order='C')) + # Other order + if len(shape) > 2: + i = nditer(aview.swapaxes(0, 1), order='C') + assert_equal([x for x in i], + aview.swapaxes(0, 1).ravel(order='C')) + +def test_iter_f_order(): + # Test forcing F order + + # Test the ordering for 1-D to 5-D shapes + for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: + a = arange(np.prod(shape)) + # Test each combination of positive and negative strides + for dirs in range(2**len(shape)): + dirs_index = [slice(None)]*len(shape) + for bit in range(len(shape)): + if ((2**bit) & dirs): + dirs_index[bit] = slice(None, None, -1) + dirs_index = tuple(dirs_index) + + aview = a.reshape(shape)[dirs_index] + # C-order + i = nditer(aview, order='F') + assert_equal([x for x in i], aview.ravel(order='F')) + # Fortran-order + i = nditer(aview.T, order='F') + assert_equal([x for x in i], aview.T.ravel(order='F')) + # Other order + if len(shape) > 2: + i = nditer(aview.swapaxes(0, 1), order='F') + assert_equal([x for x in i], + aview.swapaxes(0, 1).ravel(order='F')) + +def test_iter_c_or_f_order(): + # Test forcing any contiguous (C or F) order + + # Test the ordering for 1-D to 5-D shapes + for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: + a = arange(np.prod(shape)) + # Test each combination of positive and negative strides + for dirs in range(2**len(shape)): + dirs_index = [slice(None)]*len(shape) + for bit in range(len(shape)): + if ((2**bit) & dirs): + dirs_index[bit] = slice(None, None, -1) + dirs_index = tuple(dirs_index) + + aview = a.reshape(shape)[dirs_index] + # C-order + i = nditer(aview, order='A') + assert_equal([x for x in i], aview.ravel(order='A')) + # Fortran-order + i = nditer(aview.T, order='A') + assert_equal([x for x in i], aview.T.ravel(order='A')) + # Other order + if len(shape) > 2: + i = nditer(aview.swapaxes(0, 1), order='A') + assert_equal([x for x in i], + aview.swapaxes(0, 1).ravel(order='A')) + +def test_nditer_multi_index_set(): + # Test the multi_index set + a = np.arange(6).reshape(2, 3) + it = np.nditer(a, flags=['multi_index']) + + # Removes the iteration on two first elements of a[0] + it.multi_index = (0, 2,) + + assert_equal([i for i in it], [2, 3, 4, 5]) + +@pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") +def test_nditer_multi_index_set_refcount(): + # Test if the reference count on index variable is decreased + + index = 0 + i = np.nditer(np.array([111, 222, 333, 444]), flags=['multi_index']) + + start_count = sys.getrefcount(index) + i.multi_index = (index,) + end_count = sys.getrefcount(index) + + assert_equal(start_count, end_count) + +def test_iter_best_order_multi_index_1d(): + # The multi-indices should be correct with any reordering + + a = arange(4) + # 1D order + i = nditer(a, ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(0,), (1,), (2,), (3,)]) + # 1D reversed order + i = nditer(a[::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(3,), (2,), (1,), (0,)]) + +def test_iter_best_order_multi_index_2d(): + # The multi-indices should be correct with any reordering + + a = arange(6) + # 2D C-order + i = nditer(a.reshape(2, 3), ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(0, 0), (0, 1), (0, 2), (1, 0), (1, 1), (1, 2)]) + # 2D Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F'), ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(0, 0), (1, 0), (0, 1), (1, 1), (0, 2), (1, 2)]) + # 2D reversed C-order + i = nditer(a.reshape(2, 3)[::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(1, 0), (1, 1), (1, 2), (0, 0), (0, 1), (0, 2)]) + i = nditer(a.reshape(2, 3)[:, ::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(0, 2), (0, 1), (0, 0), (1, 2), (1, 1), (1, 0)]) + i = nditer(a.reshape(2, 3)[::-1, ::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(1, 2), (1, 1), (1, 0), (0, 2), (0, 1), (0, 0)]) + # 2D reversed Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F')[::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(1, 0), (0, 0), (1, 1), (0, 1), (1, 2), (0, 2)]) + i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], + ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(0, 2), (1, 2), (0, 1), (1, 1), (0, 0), (1, 0)]) + i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], + ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), [(1, 2), (0, 2), (1, 1), (0, 1), (1, 0), (0, 0)]) + +def test_iter_best_order_multi_index_3d(): + # The multi-indices should be correct with any reordering + + a = arange(12) + # 3D C-order + i = nditer(a.reshape(2, 3, 2), ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 0, 0), (0, 0, 1), (0, 1, 0), (0, 1, 1), (0, 2, 0), (0, 2, 1), + (1, 0, 0), (1, 0, 1), (1, 1, 0), (1, 1, 1), (1, 2, 0), (1, 2, 1)]) + # 3D Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F'), ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 0, 0), (1, 0, 0), (0, 1, 0), (1, 1, 0), (0, 2, 0), (1, 2, 0), + (0, 0, 1), (1, 0, 1), (0, 1, 1), (1, 1, 1), (0, 2, 1), (1, 2, 1)]) + # 3D reversed C-order + i = nditer(a.reshape(2, 3, 2)[::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(1, 0, 0), (1, 0, 1), (1, 1, 0), (1, 1, 1), (1, 2, 0), (1, 2, 1), + (0, 0, 0), (0, 0, 1), (0, 1, 0), (0, 1, 1), (0, 2, 0), (0, 2, 1)]) + i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 2, 0), (0, 2, 1), (0, 1, 0), (0, 1, 1), (0, 0, 0), (0, 0, 1), + (1, 2, 0), (1, 2, 1), (1, 1, 0), (1, 1, 1), (1, 0, 0), (1, 0, 1)]) + i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 0, 1), (0, 0, 0), (0, 1, 1), (0, 1, 0), (0, 2, 1), (0, 2, 0), + (1, 0, 1), (1, 0, 0), (1, 1, 1), (1, 1, 0), (1, 2, 1), (1, 2, 0)]) + # 3D reversed Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], + ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(1, 0, 0), (0, 0, 0), (1, 1, 0), (0, 1, 0), (1, 2, 0), (0, 2, 0), + (1, 0, 1), (0, 0, 1), (1, 1, 1), (0, 1, 1), (1, 2, 1), (0, 2, 1)]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], + ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 2, 0), (1, 2, 0), (0, 1, 0), (1, 1, 0), (0, 0, 0), (1, 0, 0), + (0, 2, 1), (1, 2, 1), (0, 1, 1), (1, 1, 1), (0, 0, 1), (1, 0, 1)]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], + ['multi_index'], [['readonly']]) + assert_equal(iter_multi_index(i), + [(0, 0, 1), (1, 0, 1), (0, 1, 1), (1, 1, 1), (0, 2, 1), (1, 2, 1), + (0, 0, 0), (1, 0, 0), (0, 1, 0), (1, 1, 0), (0, 2, 0), (1, 2, 0)]) + +def test_iter_best_order_c_index_1d(): + # The C index should be correct with any reordering + + a = arange(4) + # 1D order + i = nditer(a, ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 1, 2, 3]) + # 1D reversed order + i = nditer(a[::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [3, 2, 1, 0]) + +def test_iter_best_order_c_index_2d(): + # The C index should be correct with any reordering + + a = arange(6) + # 2D C-order + i = nditer(a.reshape(2, 3), ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5]) + # 2D Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F'), + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 3, 1, 4, 2, 5]) + # 2D reversed C-order + i = nditer(a.reshape(2, 3)[::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [3, 4, 5, 0, 1, 2]) + i = nditer(a.reshape(2, 3)[:, ::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [2, 1, 0, 5, 4, 3]) + i = nditer(a.reshape(2, 3)[::-1, ::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [5, 4, 3, 2, 1, 0]) + # 2D reversed Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F')[::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [3, 0, 4, 1, 5, 2]) + i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [2, 5, 1, 4, 0, 3]) + i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), [5, 2, 4, 1, 3, 0]) + +def test_iter_best_order_c_index_3d(): + # The C index should be correct with any reordering + + a = arange(12) + # 3D C-order + i = nditer(a.reshape(2, 3, 2), ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) + # 3D Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F'), + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [0, 6, 2, 8, 4, 10, 1, 7, 3, 9, 5, 11]) + # 3D reversed C-order + i = nditer(a.reshape(2, 3, 2)[::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [6, 7, 8, 9, 10, 11, 0, 1, 2, 3, 4, 5]) + i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [4, 5, 2, 3, 0, 1, 10, 11, 8, 9, 6, 7]) + i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [1, 0, 3, 2, 5, 4, 7, 6, 9, 8, 11, 10]) + # 3D reversed Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [6, 0, 8, 2, 10, 4, 7, 1, 9, 3, 11, 5]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [4, 10, 2, 8, 0, 6, 5, 11, 3, 9, 1, 7]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], + ['c_index'], [['readonly']]) + assert_equal(iter_indices(i), + [1, 7, 3, 9, 5, 11, 0, 6, 2, 8, 4, 10]) + +def test_iter_best_order_f_index_1d(): + # The Fortran index should be correct with any reordering + + a = arange(4) + # 1D order + i = nditer(a, ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 1, 2, 3]) + # 1D reversed order + i = nditer(a[::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [3, 2, 1, 0]) + +def test_iter_best_order_f_index_2d(): + # The Fortran index should be correct with any reordering + + a = arange(6) + # 2D C-order + i = nditer(a.reshape(2, 3), ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 2, 4, 1, 3, 5]) + # 2D Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F'), + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [0, 1, 2, 3, 4, 5]) + # 2D reversed C-order + i = nditer(a.reshape(2, 3)[::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [1, 3, 5, 0, 2, 4]) + i = nditer(a.reshape(2, 3)[:, ::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [4, 2, 0, 5, 3, 1]) + i = nditer(a.reshape(2, 3)[::-1, ::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [5, 3, 1, 4, 2, 0]) + # 2D reversed Fortran-order + i = nditer(a.reshape(2, 3).copy(order='F')[::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [1, 0, 3, 2, 5, 4]) + i = nditer(a.reshape(2, 3).copy(order='F')[:, ::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [4, 5, 2, 3, 0, 1]) + i = nditer(a.reshape(2, 3).copy(order='F')[::-1, ::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), [5, 4, 3, 2, 1, 0]) + +def test_iter_best_order_f_index_3d(): + # The Fortran index should be correct with any reordering + + a = arange(12) + # 3D C-order + i = nditer(a.reshape(2, 3, 2), ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [0, 6, 2, 8, 4, 10, 1, 7, 3, 9, 5, 11]) + # 3D Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F'), + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) + # 3D reversed C-order + i = nditer(a.reshape(2, 3, 2)[::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [1, 7, 3, 9, 5, 11, 0, 6, 2, 8, 4, 10]) + i = nditer(a.reshape(2, 3, 2)[:, ::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [4, 10, 2, 8, 0, 6, 5, 11, 3, 9, 1, 7]) + i = nditer(a.reshape(2, 3, 2)[:,:, ::-1], ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [6, 0, 8, 2, 10, 4, 7, 1, 9, 3, 11, 5]) + # 3D reversed Fortran-order + i = nditer(a.reshape(2, 3, 2).copy(order='F')[::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [1, 0, 3, 2, 5, 4, 7, 6, 9, 8, 11, 10]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:, ::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [4, 5, 2, 3, 0, 1, 10, 11, 8, 9, 6, 7]) + i = nditer(a.reshape(2, 3, 2).copy(order='F')[:,:, ::-1], + ['f_index'], [['readonly']]) + assert_equal(iter_indices(i), + [6, 7, 8, 9, 10, 11, 0, 1, 2, 3, 4, 5]) + +def test_iter_no_inner_full_coalesce(): + # Check no_inner iterators which coalesce into a single inner loop + + for shape in [(5,), (3, 4), (2, 3, 4), (2, 3, 4, 3), (2, 3, 2, 2, 3)]: + size = np.prod(shape) + a = arange(size) + # Test each combination of forward and backwards indexing + for dirs in range(2**len(shape)): + dirs_index = [slice(None)]*len(shape) + for bit in range(len(shape)): + if ((2**bit) & dirs): + dirs_index[bit] = slice(None, None, -1) + dirs_index = tuple(dirs_index) + + aview = a.reshape(shape)[dirs_index] + # C-order + i = nditer(aview, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 1) + assert_equal(i[0].shape, (size,)) + # Fortran-order + i = nditer(aview.T, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 1) + assert_equal(i[0].shape, (size,)) + # Other order + if len(shape) > 2: + i = nditer(aview.swapaxes(0, 1), + ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 1) + assert_equal(i[0].shape, (size,)) + +def test_iter_no_inner_dim_coalescing(): + # Check no_inner iterators whose dimensions may not coalesce completely + + # Skipping the last element in a dimension prevents coalescing + # with the next-bigger dimension + a = arange(24).reshape(2, 3, 4)[:,:, :-1] + i = nditer(a, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 2) + assert_equal(i[0].shape, (3,)) + a = arange(24).reshape(2, 3, 4)[:, :-1,:] + i = nditer(a, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 2) + assert_equal(i[0].shape, (8,)) + a = arange(24).reshape(2, 3, 4)[:-1,:,:] + i = nditer(a, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 1) + assert_equal(i[0].shape, (12,)) + + # Even with lots of 1-sized dimensions, should still coalesce + a = arange(24).reshape(1, 1, 2, 1, 1, 3, 1, 1, 4, 1, 1) + i = nditer(a, ['external_loop'], [['readonly']]) + assert_equal(i.ndim, 1) + assert_equal(i[0].shape, (24,)) + +def test_iter_dim_coalescing(): + # Check that the correct number of dimensions are coalesced + + # Tracking a multi-index disables coalescing + a = arange(24).reshape(2, 3, 4) + i = nditer(a, ['multi_index'], [['readonly']]) + assert_equal(i.ndim, 3) + + # A tracked index can allow coalescing if it's compatible with the array + a3d = arange(24).reshape(2, 3, 4) + i = nditer(a3d, ['c_index'], [['readonly']]) + assert_equal(i.ndim, 1) + i = nditer(a3d.swapaxes(0, 1), ['c_index'], [['readonly']]) + assert_equal(i.ndim, 3) + i = nditer(a3d.T, ['c_index'], [['readonly']]) + assert_equal(i.ndim, 3) + i = nditer(a3d.T, ['f_index'], [['readonly']]) + assert_equal(i.ndim, 1) + i = nditer(a3d.T.swapaxes(0, 1), ['f_index'], [['readonly']]) + assert_equal(i.ndim, 3) + + # When C or F order is forced, coalescing may still occur + a3d = arange(24).reshape(2, 3, 4) + i = nditer(a3d, order='C') + assert_equal(i.ndim, 1) + i = nditer(a3d.T, order='C') + assert_equal(i.ndim, 3) + i = nditer(a3d, order='F') + assert_equal(i.ndim, 3) + i = nditer(a3d.T, order='F') + assert_equal(i.ndim, 1) + i = nditer(a3d, order='A') + assert_equal(i.ndim, 1) + i = nditer(a3d.T, order='A') + assert_equal(i.ndim, 1) + +def test_iter_broadcasting(): + # Standard NumPy broadcasting rules + + # 1D with scalar + i = nditer([arange(6), np.int32(2)], ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 6) + assert_equal(i.shape, (6,)) + + # 2D with scalar + i = nditer([arange(6).reshape(2, 3), np.int32(2)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 6) + assert_equal(i.shape, (2, 3)) + # 2D with 1D + i = nditer([arange(6).reshape(2, 3), arange(3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 6) + assert_equal(i.shape, (2, 3)) + i = nditer([arange(2).reshape(2, 1), arange(3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 6) + assert_equal(i.shape, (2, 3)) + # 2D with 2D + i = nditer([arange(2).reshape(2, 1), arange(3).reshape(1, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 6) + assert_equal(i.shape, (2, 3)) + + # 3D with scalar + i = nditer([np.int32(2), arange(24).reshape(4, 2, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + # 3D with 1D + i = nditer([arange(3), arange(24).reshape(4, 2, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + i = nditer([arange(3), arange(8).reshape(4, 2, 1)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + # 3D with 2D + i = nditer([arange(6).reshape(2, 3), arange(24).reshape(4, 2, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + i = nditer([arange(2).reshape(2, 1), arange(24).reshape(4, 2, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + i = nditer([arange(3).reshape(1, 3), arange(8).reshape(4, 2, 1)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + # 3D with 3D + i = nditer([arange(2).reshape(1, 2, 1), arange(3).reshape(1, 1, 3), + arange(4).reshape(4, 1, 1)], + ['multi_index'], [['readonly']]*3) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + i = nditer([arange(6).reshape(1, 2, 3), arange(4).reshape(4, 1, 1)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + i = nditer([arange(24).reshape(4, 2, 3), arange(12).reshape(4, 1, 3)], + ['multi_index'], [['readonly']]*2) + assert_equal(i.itersize, 24) + assert_equal(i.shape, (4, 2, 3)) + +def test_iter_itershape(): + # Check that allocated outputs work with a specified shape + a = np.arange(6, dtype='i2').reshape(2, 3) + i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], + op_axes=[[0, 1, None], None], + itershape=(-1, -1, 4)) + assert_equal(i.operands[1].shape, (2, 3, 4)) + assert_equal(i.operands[1].strides, (24, 8, 2)) + + i = nditer([a.T, None], [], [['readonly'], ['writeonly', 'allocate']], + op_axes=[[0, 1, None], None], + itershape=(-1, -1, 4)) + assert_equal(i.operands[1].shape, (3, 2, 4)) + assert_equal(i.operands[1].strides, (8, 24, 2)) + + i = nditer([a.T, None], [], [['readonly'], ['writeonly', 'allocate']], + order='F', + op_axes=[[0, 1, None], None], + itershape=(-1, -1, 4)) + assert_equal(i.operands[1].shape, (3, 2, 4)) + assert_equal(i.operands[1].strides, (2, 6, 12)) + + # If we specify 1 in the itershape, it shouldn't allow broadcasting + # of that dimension to a bigger value + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['writeonly', 'allocate']], + op_axes=[[0, 1, None], None], + itershape=(-1, 1, 4)) + # Test bug that for no op_axes but itershape, they are NULLed correctly + i = np.nditer([np.ones(2), None, None], itershape=(2,)) + +def test_iter_broadcasting_errors(): + # Check that errors are thrown for bad broadcasting shapes + + # 1D with 1D + assert_raises(ValueError, nditer, [arange(2), arange(3)], + [], [['readonly']]*2) + # 2D with 1D + assert_raises(ValueError, nditer, + [arange(6).reshape(2, 3), arange(2)], + [], [['readonly']]*2) + # 2D with 2D + assert_raises(ValueError, nditer, + [arange(6).reshape(2, 3), arange(9).reshape(3, 3)], + [], [['readonly']]*2) + assert_raises(ValueError, nditer, + [arange(6).reshape(2, 3), arange(4).reshape(2, 2)], + [], [['readonly']]*2) + # 3D with 3D + assert_raises(ValueError, nditer, + [arange(36).reshape(3, 3, 4), arange(24).reshape(2, 3, 4)], + [], [['readonly']]*2) + assert_raises(ValueError, nditer, + [arange(8).reshape(2, 4, 1), arange(24).reshape(2, 3, 4)], + [], [['readonly']]*2) + + # Verify that the error message mentions the right shapes + try: + nditer([arange(2).reshape(1, 2, 1), + arange(3).reshape(1, 3), + arange(6).reshape(2, 3)], + [], + [['readonly'], ['readonly'], ['writeonly', 'no_broadcast']]) + raise AssertionError('Should have raised a broadcast error') + except ValueError as e: + msg = str(e) + # The message should contain the shape of the 3rd operand + assert_(msg.find('(2,3)') >= 0, + 'Message "%s" doesn\'t contain operand shape (2,3)' % msg) + # The message should contain the broadcast shape + assert_(msg.find('(1,2,3)') >= 0, + 'Message "%s" doesn\'t contain broadcast shape (1,2,3)' % msg) + + try: + nditer([arange(6).reshape(2, 3), arange(2)], + [], + [['readonly'], ['readonly']], + op_axes=[[0, 1], [0, np.newaxis]], + itershape=(4, 3)) + raise AssertionError('Should have raised a broadcast error') + except ValueError as e: + msg = str(e) + # The message should contain "shape->remappedshape" for each operand + assert_(msg.find('(2,3)->(2,3)') >= 0, + 'Message "%s" doesn\'t contain operand shape (2,3)->(2,3)' % msg) + assert_(msg.find('(2,)->(2,newaxis)') >= 0, + ('Message "%s" doesn\'t contain remapped operand shape' + + '(2,)->(2,newaxis)') % msg) + # The message should contain the itershape parameter + assert_(msg.find('(4,3)') >= 0, + 'Message "%s" doesn\'t contain itershape parameter (4,3)' % msg) + + try: + nditer([np.zeros((2, 1, 1)), np.zeros((2,))], + [], + [['writeonly', 'no_broadcast'], ['readonly']]) + raise AssertionError('Should have raised a broadcast error') + except ValueError as e: + msg = str(e) + # The message should contain the shape of the bad operand + assert_(msg.find('(2,1,1)') >= 0, + 'Message "%s" doesn\'t contain operand shape (2,1,1)' % msg) + # The message should contain the broadcast shape + assert_(msg.find('(2,1,2)') >= 0, + 'Message "%s" doesn\'t contain the broadcast shape (2,1,2)' % msg) + +def test_iter_flags_errors(): + # Check that bad combinations of flags produce errors + + a = arange(6) + + # Not enough operands + assert_raises(ValueError, nditer, [], [], []) + # Too many operands + assert_raises(ValueError, nditer, [a]*100, [], [['readonly']]*100) + # Bad global flag + assert_raises(ValueError, nditer, [a], ['bad flag'], [['readonly']]) + # Bad op flag + assert_raises(ValueError, nditer, [a], [], [['readonly', 'bad flag']]) + # Bad order parameter + assert_raises(ValueError, nditer, [a], [], [['readonly']], order='G') + # Bad casting parameter + assert_raises(ValueError, nditer, [a], [], [['readonly']], casting='noon') + # op_flags must match ops + assert_raises(ValueError, nditer, [a]*3, [], [['readonly']]*2) + # Cannot track both a C and an F index + assert_raises(ValueError, nditer, a, + ['c_index', 'f_index'], [['readonly']]) + # Inner iteration and multi-indices/indices are incompatible + assert_raises(ValueError, nditer, a, + ['external_loop', 'multi_index'], [['readonly']]) + assert_raises(ValueError, nditer, a, + ['external_loop', 'c_index'], [['readonly']]) + assert_raises(ValueError, nditer, a, + ['external_loop', 'f_index'], [['readonly']]) + # Must specify exactly one of readwrite/readonly/writeonly per operand + assert_raises(ValueError, nditer, a, [], [[]]) + assert_raises(ValueError, nditer, a, [], [['readonly', 'writeonly']]) + assert_raises(ValueError, nditer, a, [], [['readonly', 'readwrite']]) + assert_raises(ValueError, nditer, a, [], [['writeonly', 'readwrite']]) + assert_raises(ValueError, nditer, a, + [], [['readonly', 'writeonly', 'readwrite']]) + # Python scalars are always readonly + assert_raises(TypeError, nditer, 1.5, [], [['writeonly']]) + assert_raises(TypeError, nditer, 1.5, [], [['readwrite']]) + # Array scalars are always readonly + assert_raises(TypeError, nditer, np.int32(1), [], [['writeonly']]) + assert_raises(TypeError, nditer, np.int32(1), [], [['readwrite']]) + # Check readonly array + a.flags.writeable = False + assert_raises(ValueError, nditer, a, [], [['writeonly']]) + assert_raises(ValueError, nditer, a, [], [['readwrite']]) + a.flags.writeable = True + # Multi-indices available only with the multi_index flag + i = nditer(arange(6), [], [['readonly']]) + assert_raises(ValueError, lambda i:i.multi_index, i) + # Index available only with an index flag + assert_raises(ValueError, lambda i:i.index, i) + # GotoCoords and GotoIndex incompatible with buffering or no_inner + + def assign_multi_index(i): + i.multi_index = (0,) + + def assign_index(i): + i.index = 0 + + def assign_iterindex(i): + i.iterindex = 0 + + def assign_iterrange(i): + i.iterrange = (0, 1) + i = nditer(arange(6), ['external_loop']) + assert_raises(ValueError, assign_multi_index, i) + assert_raises(ValueError, assign_index, i) + assert_raises(ValueError, assign_iterindex, i) + assert_raises(ValueError, assign_iterrange, i) + i = nditer(arange(6), ['buffered']) + assert_raises(ValueError, assign_multi_index, i) + assert_raises(ValueError, assign_index, i) + assert_raises(ValueError, assign_iterrange, i) + # Can't iterate if size is zero + assert_raises(ValueError, nditer, np.array([])) + +def test_iter_slice(): + a, b, c = np.arange(3), np.arange(3), np.arange(3.) + i = nditer([a, b, c], [], ['readwrite']) + with i: + i[0:2] = (3, 3) + assert_equal(a, [3, 1, 2]) + assert_equal(b, [3, 1, 2]) + assert_equal(c, [0, 1, 2]) + i[1] = 12 + assert_equal(i[0:2], [3, 12]) + +def test_iter_assign_mapping(): + a = np.arange(24, dtype='f8').reshape(2, 3, 4).T + it = np.nditer(a, [], [['readwrite', 'updateifcopy']], + casting='same_kind', op_dtypes=[np.dtype('f4')]) + with it: + it.operands[0][...] = 3 + it.operands[0][...] = 14 + assert_equal(a, 14) + it = np.nditer(a, [], [['readwrite', 'updateifcopy']], + casting='same_kind', op_dtypes=[np.dtype('f4')]) + with it: + x = it.operands[0][-1:1] + x[...] = 14 + it.operands[0][...] = -1234 + assert_equal(a, -1234) + # check for no warnings on dealloc + x = None + it = None + +def test_iter_nbo_align_contig(): + # Check that byte order, alignment, and contig changes work + + # Byte order change by requesting a specific dtype + a = np.arange(6, dtype='f4') + au = a.byteswap() + au = au.view(au.dtype.newbyteorder()) + assert_(a.dtype.byteorder != au.dtype.byteorder) + i = nditer(au, [], [['readwrite', 'updateifcopy']], + casting='equiv', + op_dtypes=[np.dtype('f4')]) + with i: + # context manager triggers WRITEBACKIFCOPY on i at exit + assert_equal(i.dtypes[0].byteorder, a.dtype.byteorder) + assert_equal(i.operands[0].dtype.byteorder, a.dtype.byteorder) + assert_equal(i.operands[0], a) + i.operands[0][:] = 2 + assert_equal(au, [2]*6) + del i # should not raise a warning + # Byte order change by requesting NBO + a = np.arange(6, dtype='f4') + au = a.byteswap() + au = au.view(au.dtype.newbyteorder()) + assert_(a.dtype.byteorder != au.dtype.byteorder) + with nditer(au, [], [['readwrite', 'updateifcopy', 'nbo']], + casting='equiv') as i: + # context manager triggers UPDATEIFCOPY on i at exit + assert_equal(i.dtypes[0].byteorder, a.dtype.byteorder) + assert_equal(i.operands[0].dtype.byteorder, a.dtype.byteorder) + assert_equal(i.operands[0], a) + i.operands[0][:] = 12345 + i.operands[0][:] = 2 + assert_equal(au, [2]*6) + + # Unaligned input + a = np.zeros((6*4+1,), dtype='i1')[1:] + a.dtype = 'f4' + a[:] = np.arange(6, dtype='f4') + assert_(not a.flags.aligned) + # Without 'aligned', shouldn't copy + i = nditer(a, [], [['readonly']]) + assert_(not i.operands[0].flags.aligned) + assert_equal(i.operands[0], a) + # With 'aligned', should make a copy + with nditer(a, [], [['readwrite', 'updateifcopy', 'aligned']]) as i: + assert_(i.operands[0].flags.aligned) + # context manager triggers UPDATEIFCOPY on i at exit + assert_equal(i.operands[0], a) + i.operands[0][:] = 3 + assert_equal(a, [3]*6) + + # Discontiguous input + a = arange(12) + # If it is contiguous, shouldn't copy + i = nditer(a[:6], [], [['readonly']]) + assert_(i.operands[0].flags.contiguous) + assert_equal(i.operands[0], a[:6]) + # If it isn't contiguous, should buffer + i = nditer(a[::2], ['buffered', 'external_loop'], + [['readonly', 'contig']], + buffersize=10) + assert_(i[0].flags.contiguous) + assert_equal(i[0], a[::2]) + +def test_iter_array_cast(): + # Check that arrays are cast as requested + + # No cast 'f4' -> 'f4' + a = np.arange(6, dtype='f4').reshape(2, 3) + i = nditer(a, [], [['readwrite']], op_dtypes=[np.dtype('f4')]) + with i: + assert_equal(i.operands[0], a) + assert_equal(i.operands[0].dtype, np.dtype('f4')) + + # Byte-order cast ' '>f4' + a = np.arange(6, dtype='f4')]) as i: + assert_equal(i.operands[0], a) + assert_equal(i.operands[0].dtype, np.dtype('>f4')) + + # Safe case 'f4' -> 'f8' + a = np.arange(24, dtype='f4').reshape(2, 3, 4).swapaxes(1, 2) + i = nditer(a, [], [['readonly', 'copy']], + casting='safe', + op_dtypes=[np.dtype('f8')]) + assert_equal(i.operands[0], a) + assert_equal(i.operands[0].dtype, np.dtype('f8')) + # The memory layout of the temporary should match a (a is (48,4,16)) + # except negative strides get flipped to positive strides. + assert_equal(i.operands[0].strides, (96, 8, 32)) + a = a[::-1,:, ::-1] + i = nditer(a, [], [['readonly', 'copy']], + casting='safe', + op_dtypes=[np.dtype('f8')]) + assert_equal(i.operands[0], a) + assert_equal(i.operands[0].dtype, np.dtype('f8')) + assert_equal(i.operands[0].strides, (96, 8, 32)) + + # Same-kind cast 'f8' -> 'f4' -> 'f8' + a = np.arange(24, dtype='f8').reshape(2, 3, 4).T + with nditer(a, [], + [['readwrite', 'updateifcopy']], + casting='same_kind', + op_dtypes=[np.dtype('f4')]) as i: + assert_equal(i.operands[0], a) + assert_equal(i.operands[0].dtype, np.dtype('f4')) + assert_equal(i.operands[0].strides, (4, 16, 48)) + # Check that WRITEBACKIFCOPY is activated at exit + i.operands[0][2, 1, 1] = -12.5 + assert_(a[2, 1, 1] != -12.5) + assert_equal(a[2, 1, 1], -12.5) + + a = np.arange(6, dtype='i4')[::-2] + with nditer(a, [], + [['writeonly', 'updateifcopy']], + casting='unsafe', + op_dtypes=[np.dtype('f4')]) as i: + assert_equal(i.operands[0].dtype, np.dtype('f4')) + # Even though the stride was negative in 'a', it + # becomes positive in the temporary + assert_equal(i.operands[0].strides, (4,)) + i.operands[0][:] = [1, 2, 3] + assert_equal(a, [1, 2, 3]) + +def test_iter_array_cast_errors(): + # Check that invalid casts are caught + + # Need to enable copying for casts to occur + assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], + [['readonly']], op_dtypes=[np.dtype('f8')]) + # Also need to allow casting for casts to occur + assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], + [['readonly', 'copy']], casting='no', + op_dtypes=[np.dtype('f8')]) + assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], + [['readonly', 'copy']], casting='equiv', + op_dtypes=[np.dtype('f8')]) + assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], + [['writeonly', 'updateifcopy']], + casting='no', + op_dtypes=[np.dtype('f4')]) + assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], + [['writeonly', 'updateifcopy']], + casting='equiv', + op_dtypes=[np.dtype('f4')]) + # ' '>f4' should not work with casting='no' + assert_raises(TypeError, nditer, arange(2, dtype='f4')]) + # 'f4' -> 'f8' is a safe cast, but 'f8' -> 'f4' isn't + assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], + [['readwrite', 'updateifcopy']], + casting='safe', + op_dtypes=[np.dtype('f8')]) + assert_raises(TypeError, nditer, arange(2, dtype='f8'), [], + [['readwrite', 'updateifcopy']], + casting='safe', + op_dtypes=[np.dtype('f4')]) + # 'f4' -> 'i4' is neither a safe nor a same-kind cast + assert_raises(TypeError, nditer, arange(2, dtype='f4'), [], + [['readonly', 'copy']], + casting='same_kind', + op_dtypes=[np.dtype('i4')]) + assert_raises(TypeError, nditer, arange(2, dtype='i4'), [], + [['writeonly', 'updateifcopy']], + casting='same_kind', + op_dtypes=[np.dtype('f4')]) + +def test_iter_scalar_cast(): + # Check that scalars are cast as requested + + # No cast 'f4' -> 'f4' + i = nditer(np.float32(2.5), [], [['readonly']], + op_dtypes=[np.dtype('f4')]) + assert_equal(i.dtypes[0], np.dtype('f4')) + assert_equal(i.value.dtype, np.dtype('f4')) + assert_equal(i.value, 2.5) + # Safe cast 'f4' -> 'f8' + i = nditer(np.float32(2.5), [], + [['readonly', 'copy']], + casting='safe', + op_dtypes=[np.dtype('f8')]) + assert_equal(i.dtypes[0], np.dtype('f8')) + assert_equal(i.value.dtype, np.dtype('f8')) + assert_equal(i.value, 2.5) + # Same-kind cast 'f8' -> 'f4' + i = nditer(np.float64(2.5), [], + [['readonly', 'copy']], + casting='same_kind', + op_dtypes=[np.dtype('f4')]) + assert_equal(i.dtypes[0], np.dtype('f4')) + assert_equal(i.value.dtype, np.dtype('f4')) + assert_equal(i.value, 2.5) + # Unsafe cast 'f8' -> 'i4' + i = nditer(np.float64(3.0), [], + [['readonly', 'copy']], + casting='unsafe', + op_dtypes=[np.dtype('i4')]) + assert_equal(i.dtypes[0], np.dtype('i4')) + assert_equal(i.value.dtype, np.dtype('i4')) + assert_equal(i.value, 3) + # Readonly scalars may be cast even without setting COPY or BUFFERED + i = nditer(3, [], [['readonly']], op_dtypes=[np.dtype('f8')]) + assert_equal(i[0].dtype, np.dtype('f8')) + assert_equal(i[0], 3.) + +def test_iter_scalar_cast_errors(): + # Check that invalid casts are caught + + # Need to allow copying/buffering for write casts of scalars to occur + assert_raises(TypeError, nditer, np.float32(2), [], + [['readwrite']], op_dtypes=[np.dtype('f8')]) + assert_raises(TypeError, nditer, 2.5, [], + [['readwrite']], op_dtypes=[np.dtype('f4')]) + # 'f8' -> 'f4' isn't a safe cast if the value would overflow + assert_raises(TypeError, nditer, np.float64(1e60), [], + [['readonly']], + casting='safe', + op_dtypes=[np.dtype('f4')]) + # 'f4' -> 'i4' is neither a safe nor a same-kind cast + assert_raises(TypeError, nditer, np.float32(2), [], + [['readonly']], + casting='same_kind', + op_dtypes=[np.dtype('i4')]) + +def test_iter_object_arrays_basic(): + # Check that object arrays work + + obj = {'a':3,'b':'d'} + a = np.array([[1, 2, 3], None, obj, None], dtype='O') + if HAS_REFCOUNT: + rc = sys.getrefcount(obj) + + # Need to allow references for object arrays + assert_raises(TypeError, nditer, a) + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(obj), rc) + + i = nditer(a, ['refs_ok'], ['readonly']) + vals = [x_[()] for x_ in i] + assert_equal(np.array(vals, dtype='O'), a) + vals, i, x = [None]*3 + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(obj), rc) + + i = nditer(a.reshape(2, 2).T, ['refs_ok', 'buffered'], + ['readonly'], order='C') + assert_(i.iterationneedsapi) + vals = [x_[()] for x_ in i] + assert_equal(np.array(vals, dtype='O'), a.reshape(2, 2).ravel(order='F')) + vals, i, x = [None]*3 + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(obj), rc) + + i = nditer(a.reshape(2, 2).T, ['refs_ok', 'buffered'], + ['readwrite'], order='C') + with i: + for x in i: + x[...] = None + vals, i, x = [None]*3 + if HAS_REFCOUNT: + assert_(sys.getrefcount(obj) == rc-1) + assert_equal(a, np.array([None]*4, dtype='O')) + +def test_iter_object_arrays_conversions(): + # Conversions to/from objects + a = np.arange(6, dtype='O') + i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], + casting='unsafe', op_dtypes='i4') + with i: + for x in i: + x[...] += 1 + assert_equal(a, np.arange(6)+1) + + a = np.arange(6, dtype='i4') + i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], + casting='unsafe', op_dtypes='O') + with i: + for x in i: + x[...] += 1 + assert_equal(a, np.arange(6)+1) + + # Non-contiguous object array + a = np.zeros((6,), dtype=[('p', 'i1'), ('a', 'O')]) + a = a['a'] + a[:] = np.arange(6) + i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], + casting='unsafe', op_dtypes='i4') + with i: + for x in i: + x[...] += 1 + assert_equal(a, np.arange(6)+1) + + #Non-contiguous value array + a = np.zeros((6,), dtype=[('p', 'i1'), ('a', 'i4')]) + a = a['a'] + a[:] = np.arange(6) + 98172488 + i = nditer(a, ['refs_ok', 'buffered'], ['readwrite'], + casting='unsafe', op_dtypes='O') + with i: + ob = i[0][()] + if HAS_REFCOUNT: + rc = sys.getrefcount(ob) + for x in i: + x[...] += 1 + if HAS_REFCOUNT: + assert_(sys.getrefcount(ob) == rc-1) + assert_equal(a, np.arange(6)+98172489) + +def test_iter_common_dtype(): + # Check that the iterator finds a common data type correctly + # (some checks are somewhat duplicate after adopting NEP 50) + + i = nditer([array([3], dtype='f4'), array([0], dtype='f8')], + ['common_dtype'], + [['readonly', 'copy']]*2, + casting='safe') + assert_equal(i.dtypes[0], np.dtype('f8')) + assert_equal(i.dtypes[1], np.dtype('f8')) + i = nditer([array([3], dtype='i4'), array([0], dtype='f4')], + ['common_dtype'], + [['readonly', 'copy']]*2, + casting='safe') + assert_equal(i.dtypes[0], np.dtype('f8')) + assert_equal(i.dtypes[1], np.dtype('f8')) + i = nditer([array([3], dtype='f4'), array(0, dtype='f8')], + ['common_dtype'], + [['readonly', 'copy']]*2, + casting='same_kind') + assert_equal(i.dtypes[0], np.dtype('f8')) + assert_equal(i.dtypes[1], np.dtype('f8')) + i = nditer([array([3], dtype='u4'), array(0, dtype='i4')], + ['common_dtype'], + [['readonly', 'copy']]*2, + casting='safe') + assert_equal(i.dtypes[0], np.dtype('i8')) + assert_equal(i.dtypes[1], np.dtype('i8')) + i = nditer([array([3], dtype='u4'), array(-12, dtype='i4')], + ['common_dtype'], + [['readonly', 'copy']]*2, + casting='safe') + assert_equal(i.dtypes[0], np.dtype('i8')) + assert_equal(i.dtypes[1], np.dtype('i8')) + i = nditer([array([3], dtype='u4'), array(-12, dtype='i4'), + array([2j], dtype='c8'), array([9], dtype='f8')], + ['common_dtype'], + [['readonly', 'copy']]*4, + casting='safe') + assert_equal(i.dtypes[0], np.dtype('c16')) + assert_equal(i.dtypes[1], np.dtype('c16')) + assert_equal(i.dtypes[2], np.dtype('c16')) + assert_equal(i.dtypes[3], np.dtype('c16')) + assert_equal(i.value, (3, -12, 2j, 9)) + + # When allocating outputs, other outputs aren't factored in + i = nditer([array([3], dtype='i4'), None, array([2j], dtype='c16')], [], + [['readonly', 'copy'], + ['writeonly', 'allocate'], + ['writeonly']], + casting='safe') + assert_equal(i.dtypes[0], np.dtype('i4')) + assert_equal(i.dtypes[1], np.dtype('i4')) + assert_equal(i.dtypes[2], np.dtype('c16')) + # But, if common data types are requested, they are + i = nditer([array([3], dtype='i4'), None, array([2j], dtype='c16')], + ['common_dtype'], + [['readonly', 'copy'], + ['writeonly', 'allocate'], + ['writeonly']], + casting='safe') + assert_equal(i.dtypes[0], np.dtype('c16')) + assert_equal(i.dtypes[1], np.dtype('c16')) + assert_equal(i.dtypes[2], np.dtype('c16')) + +def test_iter_copy_if_overlap(): + # Ensure the iterator makes copies on read/write overlap, if requested + + # Copy not needed, 1 op + for flag in ['readonly', 'writeonly', 'readwrite']: + a = arange(10) + i = nditer([a], ['copy_if_overlap'], [[flag]]) + with i: + assert_(i.operands[0] is a) + + # Copy needed, 2 ops, read-write overlap + x = arange(10) + a = x[1:] + b = x[:-1] + with nditer([a, b], ['copy_if_overlap'], [['readonly'], ['readwrite']]) as i: + assert_(not np.shares_memory(*i.operands)) + + # Copy not needed with elementwise, 2 ops, exactly same arrays + x = arange(10) + a = x + b = x + i = nditer([a, b], ['copy_if_overlap'], [['readonly', 'overlap_assume_elementwise'], + ['readwrite', 'overlap_assume_elementwise']]) + with i: + assert_(i.operands[0] is a and i.operands[1] is b) + with nditer([a, b], ['copy_if_overlap'], [['readonly'], ['readwrite']]) as i: + assert_(i.operands[0] is a and not np.shares_memory(i.operands[1], b)) + + # Copy not needed, 2 ops, no overlap + x = arange(10) + a = x[::2] + b = x[1::2] + i = nditer([a, b], ['copy_if_overlap'], [['readonly'], ['writeonly']]) + assert_(i.operands[0] is a and i.operands[1] is b) + + # Copy needed, 2 ops, read-write overlap + x = arange(4, dtype=np.int8) + a = x[3:] + b = x.view(np.int32)[:1] + with nditer([a, b], ['copy_if_overlap'], [['readonly'], ['writeonly']]) as i: + assert_(not np.shares_memory(*i.operands)) + + # Copy needed, 3 ops, read-write overlap + for flag in ['writeonly', 'readwrite']: + x = np.ones([10, 10]) + a = x + b = x.T + c = x + with nditer([a, b, c], ['copy_if_overlap'], + [['readonly'], ['readonly'], [flag]]) as i: + a2, b2, c2 = i.operands + assert_(not np.shares_memory(a2, c2)) + assert_(not np.shares_memory(b2, c2)) + + # Copy not needed, 3 ops, read-only overlap + x = np.ones([10, 10]) + a = x + b = x.T + c = x + i = nditer([a, b, c], ['copy_if_overlap'], + [['readonly'], ['readonly'], ['readonly']]) + a2, b2, c2 = i.operands + assert_(a is a2) + assert_(b is b2) + assert_(c is c2) + + # Copy not needed, 3 ops, read-only overlap + x = np.ones([10, 10]) + a = x + b = np.ones([10, 10]) + c = x.T + i = nditer([a, b, c], ['copy_if_overlap'], + [['readonly'], ['writeonly'], ['readonly']]) + a2, b2, c2 = i.operands + assert_(a is a2) + assert_(b is b2) + assert_(c is c2) + + # Copy not needed, 3 ops, write-only overlap + x = np.arange(7) + a = x[:3] + b = x[3:6] + c = x[4:7] + i = nditer([a, b, c], ['copy_if_overlap'], + [['readonly'], ['writeonly'], ['writeonly']]) + a2, b2, c2 = i.operands + assert_(a is a2) + assert_(b is b2) + assert_(c is c2) + +def test_iter_op_axes(): + # Check that custom axes work + + # Reverse the axes + a = arange(6).reshape(2, 3) + i = nditer([a, a.T], [], [['readonly']]*2, op_axes=[[0, 1], [1, 0]]) + assert_(all([x == y for (x, y) in i])) + a = arange(24).reshape(2, 3, 4) + i = nditer([a.T, a], [], [['readonly']]*2, op_axes=[[2, 1, 0], None]) + assert_(all([x == y for (x, y) in i])) + + # Broadcast 1D to any dimension + a = arange(1, 31).reshape(2, 3, 5) + b = arange(1, 3) + i = nditer([a, b], [], [['readonly']]*2, op_axes=[None, [0, -1, -1]]) + assert_equal([x*y for (x, y) in i], (a*b.reshape(2, 1, 1)).ravel()) + b = arange(1, 4) + i = nditer([a, b], [], [['readonly']]*2, op_axes=[None, [-1, 0, -1]]) + assert_equal([x*y for (x, y) in i], (a*b.reshape(1, 3, 1)).ravel()) + b = arange(1, 6) + i = nditer([a, b], [], [['readonly']]*2, + op_axes=[None, [np.newaxis, np.newaxis, 0]]) + assert_equal([x*y for (x, y) in i], (a*b.reshape(1, 1, 5)).ravel()) + + # Inner product-style broadcasting + a = arange(24).reshape(2, 3, 4) + b = arange(40).reshape(5, 2, 4) + i = nditer([a, b], ['multi_index'], [['readonly']]*2, + op_axes=[[0, 1, -1, -1], [-1, -1, 0, 1]]) + assert_equal(i.shape, (2, 3, 5, 2)) + + # Matrix product-style broadcasting + a = arange(12).reshape(3, 4) + b = arange(20).reshape(4, 5) + i = nditer([a, b], ['multi_index'], [['readonly']]*2, + op_axes=[[0, -1], [-1, 1]]) + assert_equal(i.shape, (3, 5)) + +def test_iter_op_axes_errors(): + # Check that custom axes throws errors for bad inputs + + # Wrong number of items in op_axes + a = arange(6).reshape(2, 3) + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0], [1], [0]]) + # Out of bounds items in op_axes + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[2, 1], [0, 1]]) + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0, 1], [2, -1]]) + # Duplicate items in op_axes + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0, 0], [0, 1]]) + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0, 1], [1, 1]]) + + # Different sized arrays in op_axes + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0, 1], [0, 1, 0]]) + + # Non-broadcastable dimensions in the result + assert_raises(ValueError, nditer, [a, a], [], [['readonly']]*2, + op_axes=[[0, 1], [1, 0]]) + +def test_iter_copy(): + # Check that copying the iterator works correctly + a = arange(24).reshape(2, 3, 4) + + # Simple iterator + i = nditer(a) + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + i.iterindex = 3 + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + # Buffered iterator + i = nditer(a, ['buffered', 'ranged'], order='F', buffersize=3) + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + i.iterindex = 3 + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + i.iterrange = (3, 9) + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + i.iterrange = (2, 18) + next(i) + next(i) + j = i.copy() + assert_equal([x[()] for x in i], [x[()] for x in j]) + + # Casting iterator + with nditer(a, ['buffered'], order='F', casting='unsafe', + op_dtypes='f8', buffersize=5) as i: + j = i.copy() + assert_equal([x[()] for x in j], a.ravel(order='F')) + + a = arange(24, dtype=' unstructured (any to object), and many other + # casts, which cause this to require all steps in the casting machinery + # one level down as well as the iterator copy (which uses NpyAuxData clone) + in_dtype = np.dtype([("a", np.dtype("i,")), + ("b", np.dtype(">i,d,S17,>d,3f,O,i1"))]) + out_dtype = np.dtype([("a", np.dtype("O")), + ("b", np.dtype(">i,>i,S17,>d,>U3,3d,i1,O"))]) + arr = np.ones(1000, dtype=in_dtype) + + it = np.nditer((arr,), ["buffered", "external_loop", "refs_ok"], + op_dtypes=[out_dtype], casting="unsafe") + it_copy = it.copy() + + res1 = next(it) + del it + res2 = next(it_copy) + del it_copy + + expected = arr["a"].astype(out_dtype["a"]) + assert_array_equal(res1["a"], expected) + assert_array_equal(res2["a"], expected) + + for field in in_dtype["b"].names: + # Note that the .base avoids the subarray field + expected = arr["b"][field].astype(out_dtype["b"][field].base) + assert_array_equal(res1["b"][field], expected) + assert_array_equal(res2["b"][field], expected) + + +def test_iter_copy_casts_structured2(): + # Similar to the above, this is a fairly arcane test to cover internals + in_dtype = np.dtype([("a", np.dtype("O,O")), + ("b", np.dtype("5O,3O,(1,)O,(1,)i,(1,)O"))]) + out_dtype = np.dtype([("a", np.dtype("O")), + ("b", np.dtype("O,3i,4O,4O,4i"))]) + + arr = np.ones(1, dtype=in_dtype) + it = np.nditer((arr,), ["buffered", "external_loop", "refs_ok"], + op_dtypes=[out_dtype], casting="unsafe") + it_copy = it.copy() + + res1 = next(it) + del it + res2 = next(it_copy) + del it_copy + + # Array of two structured scalars: + for res in res1, res2: + # Cast to tuple by getitem, which may be weird and changeable?: + assert type(res["a"][0]) == tuple + assert res["a"][0] == (1, 1) + + for res in res1, res2: + assert_array_equal(res["b"]["f0"][0], np.ones(5, dtype=object)) + assert_array_equal(res["b"]["f1"], np.ones((1, 3), dtype="i")) + assert res["b"]["f2"].shape == (1, 4) + assert_array_equal(res["b"]["f2"][0], np.ones(4, dtype=object)) + assert_array_equal(res["b"]["f3"][0], np.ones(4, dtype=object)) + assert_array_equal(res["b"]["f3"][0], np.ones(4, dtype="i")) + + +def test_iter_allocate_output_simple(): + # Check that the iterator will properly allocate outputs + + # Simple case + a = arange(6) + i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')]) + assert_equal(i.operands[1].shape, a.shape) + assert_equal(i.operands[1].dtype, np.dtype('f4')) + +def test_iter_allocate_output_buffered_readwrite(): + # Allocated output with buffering + delay_bufalloc + + a = arange(6) + i = nditer([a, None], ['buffered', 'delay_bufalloc'], + [['readonly'], ['allocate', 'readwrite']]) + with i: + i.operands[1][:] = 1 + i.reset() + for x in i: + x[1][...] += x[0][...] + assert_equal(i.operands[1], a+1) + +def test_iter_allocate_output_itorder(): + # The allocated output should match the iteration order + + # C-order input, best iteration order + a = arange(6, dtype='i4').reshape(2, 3) + i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')]) + assert_equal(i.operands[1].shape, a.shape) + assert_equal(i.operands[1].strides, a.strides) + assert_equal(i.operands[1].dtype, np.dtype('f4')) + # F-order input, best iteration order + a = arange(24, dtype='i4').reshape(2, 3, 4).T + i = nditer([a, None], [], [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')]) + assert_equal(i.operands[1].shape, a.shape) + assert_equal(i.operands[1].strides, a.strides) + assert_equal(i.operands[1].dtype, np.dtype('f4')) + # Non-contiguous input, C iteration order + a = arange(24, dtype='i4').reshape(2, 3, 4).swapaxes(0, 1) + i = nditer([a, None], [], + [['readonly'], ['writeonly', 'allocate']], + order='C', + op_dtypes=[None, np.dtype('f4')]) + assert_equal(i.operands[1].shape, a.shape) + assert_equal(i.operands[1].strides, (32, 16, 4)) + assert_equal(i.operands[1].dtype, np.dtype('f4')) + +def test_iter_allocate_output_opaxes(): + # Specifying op_axes should work + + a = arange(24, dtype='i4').reshape(2, 3, 4) + i = nditer([None, a], [], [['writeonly', 'allocate'], ['readonly']], + op_dtypes=[np.dtype('u4'), None], + op_axes=[[1, 2, 0], None]) + assert_equal(i.operands[0].shape, (4, 2, 3)) + assert_equal(i.operands[0].strides, (4, 48, 16)) + assert_equal(i.operands[0].dtype, np.dtype('u4')) + +def test_iter_allocate_output_types_promotion(): + # Check type promotion of automatic outputs (this was more interesting + # before NEP 50...) + + i = nditer([array([3], dtype='f4'), array([0], dtype='f8'), None], [], + [['readonly']]*2+[['writeonly', 'allocate']]) + assert_equal(i.dtypes[2], np.dtype('f8')) + i = nditer([array([3], dtype='i4'), array([0], dtype='f4'), None], [], + [['readonly']]*2+[['writeonly', 'allocate']]) + assert_equal(i.dtypes[2], np.dtype('f8')) + i = nditer([array([3], dtype='f4'), array(0, dtype='f8'), None], [], + [['readonly']]*2+[['writeonly', 'allocate']]) + assert_equal(i.dtypes[2], np.dtype('f8')) + i = nditer([array([3], dtype='u4'), array(0, dtype='i4'), None], [], + [['readonly']]*2+[['writeonly', 'allocate']]) + assert_equal(i.dtypes[2], np.dtype('i8')) + i = nditer([array([3], dtype='u4'), array(-12, dtype='i4'), None], [], + [['readonly']]*2+[['writeonly', 'allocate']]) + assert_equal(i.dtypes[2], np.dtype('i8')) + +def test_iter_allocate_output_types_byte_order(): + # Verify the rules for byte order changes + + # When there's just one input, the output type exactly matches + a = array([3], dtype='u4') + a = a.view(a.dtype.newbyteorder()) + i = nditer([a, None], [], + [['readonly'], ['writeonly', 'allocate']]) + assert_equal(i.dtypes[0], i.dtypes[1]) + # With two or more inputs, the output type is in native byte order + i = nditer([a, a, None], [], + [['readonly'], ['readonly'], ['writeonly', 'allocate']]) + assert_(i.dtypes[0] != i.dtypes[2]) + assert_equal(i.dtypes[0].newbyteorder('='), i.dtypes[2]) + +def test_iter_allocate_output_types_scalar(): + # If the inputs are all scalars, the output should be a scalar + + i = nditer([None, 1, 2.3, np.float32(12), np.complex128(3)], [], + [['writeonly', 'allocate']] + [['readonly']]*4) + assert_equal(i.operands[0].dtype, np.dtype('complex128')) + assert_equal(i.operands[0].ndim, 0) + +def test_iter_allocate_output_subtype(): + # Make sure that the subtype with priority wins + class MyNDArray(np.ndarray): + __array_priority__ = 15 + + # subclass vs ndarray + a = np.array([[1, 2], [3, 4]]).view(MyNDArray) + b = np.arange(4).reshape(2, 2).T + i = nditer([a, b, None], [], + [['readonly'], ['readonly'], ['writeonly', 'allocate']]) + assert_equal(type(a), type(i.operands[2])) + assert_(type(b) is not type(i.operands[2])) + assert_equal(i.operands[2].shape, (2, 2)) + + # If subtypes are disabled, we should get back an ndarray. + i = nditer([a, b, None], [], + [['readonly'], ['readonly'], + ['writeonly', 'allocate', 'no_subtype']]) + assert_equal(type(b), type(i.operands[2])) + assert_(type(a) is not type(i.operands[2])) + assert_equal(i.operands[2].shape, (2, 2)) + +def test_iter_allocate_output_errors(): + # Check that the iterator will throw errors for bad output allocations + + # Need an input if no output data type is specified + a = arange(6) + assert_raises(TypeError, nditer, [a, None], [], + [['writeonly'], ['writeonly', 'allocate']]) + # Allocated output should be flagged for writing + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['allocate', 'readonly']]) + # Allocated output can't have buffering without delayed bufalloc + assert_raises(ValueError, nditer, [a, None], ['buffered'], + ['allocate', 'readwrite']) + # Must specify dtype if there are no inputs (cannot promote existing ones; + # maybe this should use the 'f4' here, but it does not historically.) + assert_raises(TypeError, nditer, [None, None], [], + [['writeonly', 'allocate'], + ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')]) + # If using op_axes, must specify all the axes + a = arange(24, dtype='i4').reshape(2, 3, 4) + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')], + op_axes=[None, [0, np.newaxis, 1]]) + # If using op_axes, the axes must be within bounds + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')], + op_axes=[None, [0, 3, 1]]) + # If using op_axes, there can't be duplicates + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['writeonly', 'allocate']], + op_dtypes=[None, np.dtype('f4')], + op_axes=[None, [0, 2, 1, 0]]) + # Not all axes may be specified if a reduction. If there is a hole + # in op_axes, this is an error. + a = arange(24, dtype='i4').reshape(2, 3, 4) + assert_raises(ValueError, nditer, [a, None], ["reduce_ok"], + [['readonly'], ['readwrite', 'allocate']], + op_dtypes=[None, np.dtype('f4')], + op_axes=[None, [0, np.newaxis, 2]]) + +def test_all_allocated(): + # When no output and no shape is given, `()` is used as shape. + i = np.nditer([None], op_dtypes=["int64"]) + assert i.operands[0].shape == () + assert i.dtypes == (np.dtype("int64"),) + + i = np.nditer([None], op_dtypes=["int64"], itershape=(2, 3, 4)) + assert i.operands[0].shape == (2, 3, 4) + +def test_iter_remove_axis(): + a = arange(24).reshape(2, 3, 4) + + i = nditer(a, ['multi_index']) + i.remove_axis(1) + assert_equal([x for x in i], a[:, 0,:].ravel()) + + a = a[::-1,:,:] + i = nditer(a, ['multi_index']) + i.remove_axis(0) + assert_equal([x for x in i], a[0,:,:].ravel()) + +def test_iter_remove_multi_index_inner_loop(): + # Check that removing multi-index support works + + a = arange(24).reshape(2, 3, 4) + + i = nditer(a, ['multi_index']) + assert_equal(i.ndim, 3) + assert_equal(i.shape, (2, 3, 4)) + assert_equal(i.itviews[0].shape, (2, 3, 4)) + + # Removing the multi-index tracking causes all dimensions to coalesce + before = [x for x in i] + i.remove_multi_index() + after = [x for x in i] + + assert_equal(before, after) + assert_equal(i.ndim, 1) + assert_raises(ValueError, lambda i:i.shape, i) + assert_equal(i.itviews[0].shape, (24,)) + + # Removing the inner loop means there's just one iteration + i.reset() + assert_equal(i.itersize, 24) + assert_equal(i[0].shape, tuple()) + i.enable_external_loop() + assert_equal(i.itersize, 24) + assert_equal(i[0].shape, (24,)) + assert_equal(i.value, arange(24)) + +def test_iter_iterindex(): + # Make sure iterindex works + + buffersize = 5 + a = arange(24).reshape(4, 3, 2) + for flags in ([], ['buffered']): + i = nditer(a, flags, buffersize=buffersize) + assert_equal(iter_iterindices(i), list(range(24))) + i.iterindex = 2 + assert_equal(iter_iterindices(i), list(range(2, 24))) + + i = nditer(a, flags, order='F', buffersize=buffersize) + assert_equal(iter_iterindices(i), list(range(24))) + i.iterindex = 5 + assert_equal(iter_iterindices(i), list(range(5, 24))) + + i = nditer(a[::-1], flags, order='F', buffersize=buffersize) + assert_equal(iter_iterindices(i), list(range(24))) + i.iterindex = 9 + assert_equal(iter_iterindices(i), list(range(9, 24))) + + i = nditer(a[::-1, ::-1], flags, order='C', buffersize=buffersize) + assert_equal(iter_iterindices(i), list(range(24))) + i.iterindex = 13 + assert_equal(iter_iterindices(i), list(range(13, 24))) + + i = nditer(a[::1, ::-1], flags, buffersize=buffersize) + assert_equal(iter_iterindices(i), list(range(24))) + i.iterindex = 23 + assert_equal(iter_iterindices(i), list(range(23, 24))) + i.reset() + i.iterindex = 2 + assert_equal(iter_iterindices(i), list(range(2, 24))) + +def test_iter_iterrange(): + # Make sure getting and resetting the iterrange works + + buffersize = 5 + a = arange(24, dtype='i4').reshape(4, 3, 2) + a_fort = a.ravel(order='F') + + i = nditer(a, ['ranged'], ['readonly'], order='F', + buffersize=buffersize) + assert_equal(i.iterrange, (0, 24)) + assert_equal([x[()] for x in i], a_fort) + for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: + i.iterrange = r + assert_equal(i.iterrange, r) + assert_equal([x[()] for x in i], a_fort[r[0]:r[1]]) + + i = nditer(a, ['ranged', 'buffered'], ['readonly'], order='F', + op_dtypes='f8', buffersize=buffersize) + assert_equal(i.iterrange, (0, 24)) + assert_equal([x[()] for x in i], a_fort) + for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: + i.iterrange = r + assert_equal(i.iterrange, r) + assert_equal([x[()] for x in i], a_fort[r[0]:r[1]]) + + def get_array(i): + val = np.array([], dtype='f8') + for x in i: + val = np.concatenate((val, x)) + return val + + i = nditer(a, ['ranged', 'buffered', 'external_loop'], + ['readonly'], order='F', + op_dtypes='f8', buffersize=buffersize) + assert_equal(i.iterrange, (0, 24)) + assert_equal(get_array(i), a_fort) + for r in [(0, 24), (1, 2), (3, 24), (5, 5), (0, 20), (23, 24)]: + i.iterrange = r + assert_equal(i.iterrange, r) + assert_equal(get_array(i), a_fort[r[0]:r[1]]) + +def test_iter_buffering(): + # Test buffering with several buffer sizes and types + arrays = [] + # F-order swapped array + _tmp = np.arange(24, dtype='c16').reshape(2, 3, 4).T + _tmp = _tmp.view(_tmp.dtype.newbyteorder()).byteswap() + arrays.append(_tmp) + # Contiguous 1-dimensional array + arrays.append(np.arange(10, dtype='f4')) + # Unaligned array + a = np.zeros((4*16+1,), dtype='i1')[1:] + a.dtype = 'i4' + a[:] = np.arange(16, dtype='i4') + arrays.append(a) + # 4-D F-order array + arrays.append(np.arange(120, dtype='i4').reshape(5, 3, 2, 4).T) + for a in arrays: + for buffersize in (1, 2, 3, 5, 8, 11, 16, 1024): + vals = [] + i = nditer(a, ['buffered', 'external_loop'], + [['readonly', 'nbo', 'aligned']], + order='C', + casting='equiv', + buffersize=buffersize) + while not i.finished: + assert_(i[0].size <= buffersize) + vals.append(i[0].copy()) + i.iternext() + assert_equal(np.concatenate(vals), a.ravel(order='C')) + +def test_iter_write_buffering(): + # Test that buffering of writes is working + + # F-order swapped array + a = np.arange(24).reshape(2, 3, 4).T + a = a.view(a.dtype.newbyteorder()).byteswap() + i = nditer(a, ['buffered'], + [['readwrite', 'nbo', 'aligned']], + casting='equiv', + order='C', + buffersize=16) + x = 0 + with i: + while not i.finished: + i[0] = x + x += 1 + i.iternext() + assert_equal(a.ravel(order='C'), np.arange(24)) + +def test_iter_buffering_delayed_alloc(): + # Test that delaying buffer allocation works + + a = np.arange(6) + b = np.arange(1, dtype='f4') + i = nditer([a, b], ['buffered', 'delay_bufalloc', 'multi_index', 'reduce_ok'], + ['readwrite'], + casting='unsafe', + op_dtypes='f4') + assert_(i.has_delayed_bufalloc) + assert_raises(ValueError, lambda i:i.multi_index, i) + assert_raises(ValueError, lambda i:i[0], i) + assert_raises(ValueError, lambda i:i[0:2], i) + + def assign_iter(i): + i[0] = 0 + assert_raises(ValueError, assign_iter, i) + + i.reset() + assert_(not i.has_delayed_bufalloc) + assert_equal(i.multi_index, (0,)) + with i: + assert_equal(i[0], 0) + i[1] = 1 + assert_equal(i[0:2], [0, 1]) + assert_equal([[x[0][()], x[1][()]] for x in i], list(zip(range(6), [1]*6))) + +def test_iter_buffered_cast_simple(): + # Test that buffering can handle a simple cast + + a = np.arange(10, dtype='f4') + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('f8')], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + + assert_equal(a, 2*np.arange(10, dtype='f4')) + +def test_iter_buffered_cast_byteswapped(): + # Test that buffering can handle a cast which requires swap->cast->swap + + a = np.arange(10, dtype='f4') + a = a.view(a.dtype.newbyteorder()).byteswap() + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('f8').newbyteorder()], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + + assert_equal(a, 2*np.arange(10, dtype='f4')) + + with suppress_warnings() as sup: + sup.filter(np.exceptions.ComplexWarning) + + a = np.arange(10, dtype='f8') + a = a.view(a.dtype.newbyteorder()).byteswap() + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='unsafe', + op_dtypes=[np.dtype('c8').newbyteorder()], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + + assert_equal(a, 2*np.arange(10, dtype='f8')) + +def test_iter_buffered_cast_byteswapped_complex(): + # Test that buffering can handle a cast which requires swap->cast->copy + + a = np.arange(10, dtype='c8') + a = a.view(a.dtype.newbyteorder()).byteswap() + a += 2j + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('c16')], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + assert_equal(a, 2*np.arange(10, dtype='c8') + 4j) + + a = np.arange(10, dtype='c8') + a += 2j + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('c16').newbyteorder()], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + assert_equal(a, 2*np.arange(10, dtype='c8') + 4j) + + a = np.arange(10, dtype=np.clongdouble) + a = a.view(a.dtype.newbyteorder()).byteswap() + a += 2j + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('c16')], + buffersize=3) + with i: + for v in i: + v[...] *= 2 + assert_equal(a, 2*np.arange(10, dtype=np.clongdouble) + 4j) + + a = np.arange(10, dtype=np.longdouble) + a = a.view(a.dtype.newbyteorder()).byteswap() + i = nditer(a, ['buffered', 'external_loop'], + [['readwrite', 'nbo', 'aligned']], + casting='same_kind', + op_dtypes=[np.dtype('f4')], + buffersize=7) + with i: + for v in i: + v[...] *= 2 + assert_equal(a, 2*np.arange(10, dtype=np.longdouble)) + +def test_iter_buffered_cast_structured_type(): + # Tests buffering of structured types + + # simple -> struct type (duplicates the value) + sdt = [('a', 'f4'), ('b', 'i8'), ('c', 'c8', (2, 3)), ('d', 'O')] + a = np.arange(3, dtype='f4') + 0.5 + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt) + vals = [np.array(x) for x in i] + assert_equal(vals[0]['a'], 0.5) + assert_equal(vals[0]['b'], 0) + assert_equal(vals[0]['c'], [[(0.5)]*3]*2) + assert_equal(vals[0]['d'], 0.5) + assert_equal(vals[1]['a'], 1.5) + assert_equal(vals[1]['b'], 1) + assert_equal(vals[1]['c'], [[(1.5)]*3]*2) + assert_equal(vals[1]['d'], 1.5) + assert_equal(vals[0].dtype, np.dtype(sdt)) + + # object -> struct type + sdt = [('a', 'f4'), ('b', 'i8'), ('c', 'c8', (2, 3)), ('d', 'O')] + a = np.zeros((3,), dtype='O') + a[0] = (0.5, 0.5, [[0.5, 0.5, 0.5], [0.5, 0.5, 0.5]], 0.5) + a[1] = (1.5, 1.5, [[1.5, 1.5, 1.5], [1.5, 1.5, 1.5]], 1.5) + a[2] = (2.5, 2.5, [[2.5, 2.5, 2.5], [2.5, 2.5, 2.5]], 2.5) + if HAS_REFCOUNT: + rc = sys.getrefcount(a[0]) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt) + vals = [x.copy() for x in i] + assert_equal(vals[0]['a'], 0.5) + assert_equal(vals[0]['b'], 0) + assert_equal(vals[0]['c'], [[(0.5)]*3]*2) + assert_equal(vals[0]['d'], 0.5) + assert_equal(vals[1]['a'], 1.5) + assert_equal(vals[1]['b'], 1) + assert_equal(vals[1]['c'], [[(1.5)]*3]*2) + assert_equal(vals[1]['d'], 1.5) + assert_equal(vals[0].dtype, np.dtype(sdt)) + vals, i, x = [None]*3 + if HAS_REFCOUNT: + assert_equal(sys.getrefcount(a[0]), rc) + + # single-field struct type -> simple + sdt = [('a', 'f4')] + a = np.array([(5.5,), (8,)], dtype=sdt) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes='i4') + assert_equal([x_[()] for x_ in i], [5, 8]) + + # make sure multi-field struct type -> simple doesn't work + sdt = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] + a = np.array([(5.5, 7, 'test'), (8, 10, 11)], dtype=sdt) + assert_raises(TypeError, lambda: ( + nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes='i4'))) + + # struct type -> struct type (field-wise copy) + sdt1 = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] + sdt2 = [('d', 'u2'), ('a', 'O'), ('b', 'f8')] + a = np.array([(1, 2, 3), (4, 5, 6)], dtype=sdt1) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + assert_equal([np.array(x_) for x_ in i], + [np.array((1, 2, 3), dtype=sdt2), + np.array((4, 5, 6), dtype=sdt2)]) + + +def test_iter_buffered_cast_structured_type_failure_with_cleanup(): + # make sure struct type -> struct type with different + # number of fields fails + sdt1 = [('a', 'f4'), ('b', 'i8'), ('d', 'O')] + sdt2 = [('b', 'O'), ('a', 'f8')] + a = np.array([(1, 2, 3), (4, 5, 6)], dtype=sdt1) + + for intent in ["readwrite", "readonly", "writeonly"]: + # This test was initially designed to test an error at a different + # place, but will now raise earlier to to the cast not being possible: + # `assert np.can_cast(a.dtype, sdt2, casting="unsafe")` fails. + # Without a faulty DType, there is probably no reliable + # way to get the initial tested behaviour. + simple_arr = np.array([1, 2], dtype="i,i") # requires clean up + with pytest.raises(TypeError): + nditer((simple_arr, a), ['buffered', 'refs_ok'], [intent, intent], + casting='unsafe', op_dtypes=["f,f", sdt2]) + + +def test_buffered_cast_error_paths(): + with pytest.raises(ValueError): + # The input is cast into an `S3` buffer + np.nditer((np.array("a", dtype="S1"),), op_dtypes=["i"], + casting="unsafe", flags=["buffered"]) + + # The `M8[ns]` is cast into the `S3` output + it = np.nditer((np.array(1, dtype="i"),), op_dtypes=["S1"], + op_flags=["writeonly"], casting="unsafe", flags=["buffered"]) + with pytest.raises(ValueError): + with it: + buf = next(it) + buf[...] = "a" # cannot be converted to int. + +@pytest.mark.skipif(IS_WASM, reason="Cannot start subprocess") +@pytest.mark.skipif(not HAS_REFCOUNT, reason="PyPy seems to not hit this.") +def test_buffered_cast_error_paths_unraisable(): + # The following gives an unraisable error. Pytest sometimes captures that + # (depending python and/or pytest version). So with Python>=3.8 this can + # probably be cleaned out in the future to check for + # pytest.PytestUnraisableExceptionWarning: + code = textwrap.dedent(""" + import numpy as np + + it = np.nditer((np.array(1, dtype="i"),), op_dtypes=["S1"], + op_flags=["writeonly"], casting="unsafe", flags=["buffered"]) + buf = next(it) + buf[...] = "a" + del buf, it # Flushing only happens during deallocate right now. + """) + res = subprocess.check_output([sys.executable, "-c", code], + stderr=subprocess.STDOUT, text=True) + assert "ValueError" in res + + +def test_iter_buffered_cast_subarray(): + # Tests buffering of subarrays + + # one element -> many (copies it to all) + sdt1 = [('a', 'f4')] + sdt2 = [('a', 'f8', (3, 2, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + for x, count in zip(i, list(range(6))): + assert_(np.all(x['a'] == count)) + + # one element -> many -> back (copies it to all) + sdt1 = [('a', 'O', (1, 1))] + sdt2 = [('a', 'O', (3, 2, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'][:, 0, 0] = np.arange(6) + i = nditer(a, ['buffered', 'refs_ok'], ['readwrite'], + casting='unsafe', + op_dtypes=sdt2) + with i: + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_(np.all(x['a'] == count)) + x['a'][0] += 2 + count += 1 + assert_equal(a['a'], np.arange(6).reshape(6, 1, 1)+2) + + # many -> one element -> back (copies just element 0) + sdt1 = [('a', 'O', (3, 2, 2))] + sdt2 = [('a', 'O', (1,))] + a = np.zeros((6,), dtype=sdt1) + a['a'][:, 0, 0, 0] = np.arange(6) + i = nditer(a, ['buffered', 'refs_ok'], ['readwrite'], + casting='unsafe', + op_dtypes=sdt2) + with i: + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'], count) + x['a'] += 2 + count += 1 + assert_equal(a['a'], np.arange(6).reshape(6, 1, 1, 1)*np.ones((1, 3, 2, 2))+2) + + # many -> one element -> back (copies just element 0) + sdt1 = [('a', 'f8', (3, 2, 2))] + sdt2 = [('a', 'O', (1,))] + a = np.zeros((6,), dtype=sdt1) + a['a'][:, 0, 0, 0] = np.arange(6) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'], count) + count += 1 + + # many -> one element (copies just element 0) + sdt1 = [('a', 'O', (3, 2, 2))] + sdt2 = [('a', 'f4', (1,))] + a = np.zeros((6,), dtype=sdt1) + a['a'][:, 0, 0, 0] = np.arange(6) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'], count) + count += 1 + + # many -> matching shape (straightforward copy) + sdt1 = [('a', 'O', (3, 2, 2))] + sdt2 = [('a', 'f4', (3, 2, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*3*2*2).reshape(6, 3, 2, 2) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'], a[count]['a']) + count += 1 + + # vector -> smaller vector (truncates) + sdt1 = [('a', 'f8', (6,))] + sdt2 = [('a', 'f4', (2,))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*6).reshape(6, 6) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'], a[count]['a'][:2]) + count += 1 + + # vector -> bigger vector (pads with zeros) + sdt1 = [('a', 'f8', (2,))] + sdt2 = [('a', 'f4', (6,))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*2).reshape(6, 2) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'][:2], a[count]['a']) + assert_equal(x['a'][2:], [0, 0, 0, 0]) + count += 1 + + # vector -> matrix (broadcasts) + sdt1 = [('a', 'f8', (2,))] + sdt2 = [('a', 'f4', (2, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*2).reshape(6, 2) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'][0], a[count]['a']) + assert_equal(x['a'][1], a[count]['a']) + count += 1 + + # vector -> matrix (broadcasts and zero-pads) + sdt1 = [('a', 'f8', (2, 1))] + sdt2 = [('a', 'f4', (3, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*2).reshape(6, 2, 1) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'][:2, 0], a[count]['a'][:, 0]) + assert_equal(x['a'][:2, 1], a[count]['a'][:, 0]) + assert_equal(x['a'][2,:], [0, 0]) + count += 1 + + # matrix -> matrix (truncates and zero-pads) + sdt1 = [('a', 'f8', (2, 3))] + sdt2 = [('a', 'f4', (3, 2))] + a = np.zeros((6,), dtype=sdt1) + a['a'] = np.arange(6*2*3).reshape(6, 2, 3) + i = nditer(a, ['buffered', 'refs_ok'], ['readonly'], + casting='unsafe', + op_dtypes=sdt2) + assert_equal(i[0].dtype, np.dtype(sdt2)) + count = 0 + for x in i: + assert_equal(x['a'][:2, 0], a[count]['a'][:, 0]) + assert_equal(x['a'][:2, 1], a[count]['a'][:, 1]) + assert_equal(x['a'][2,:], [0, 0]) + count += 1 + +def test_iter_buffering_badwriteback(): + # Writing back from a buffer cannot combine elements + + # a needs write buffering, but had a broadcast dimension + a = np.arange(6).reshape(2, 3, 1) + b = np.arange(12).reshape(2, 3, 2) + assert_raises(ValueError, nditer, [a, b], + ['buffered', 'external_loop'], + [['readwrite'], ['writeonly']], + order='C') + + # But if a is readonly, it's fine + nditer([a, b], ['buffered', 'external_loop'], + [['readonly'], ['writeonly']], + order='C') + + # If a has just one element, it's fine too (constant 0 stride, a reduction) + a = np.arange(1).reshape(1, 1, 1) + nditer([a, b], ['buffered', 'external_loop', 'reduce_ok'], + [['readwrite'], ['writeonly']], + order='C') + + # check that it fails on other dimensions too + a = np.arange(6).reshape(1, 3, 2) + assert_raises(ValueError, nditer, [a, b], + ['buffered', 'external_loop'], + [['readwrite'], ['writeonly']], + order='C') + a = np.arange(4).reshape(2, 1, 2) + assert_raises(ValueError, nditer, [a, b], + ['buffered', 'external_loop'], + [['readwrite'], ['writeonly']], + order='C') + +def test_iter_buffering_string(): + # Safe casting disallows shrinking strings + a = np.array(['abc', 'a', 'abcd'], dtype=np.bytes_) + assert_equal(a.dtype, np.dtype('S4')) + assert_raises(TypeError, nditer, a, ['buffered'], ['readonly'], + op_dtypes='S2') + i = nditer(a, ['buffered'], ['readonly'], op_dtypes='S6') + assert_equal(i[0], b'abc') + assert_equal(i[0].dtype, np.dtype('S6')) + + a = np.array(['abc', 'a', 'abcd'], dtype=np.str_) + assert_equal(a.dtype, np.dtype('U4')) + assert_raises(TypeError, nditer, a, ['buffered'], ['readonly'], + op_dtypes='U2') + i = nditer(a, ['buffered'], ['readonly'], op_dtypes='U6') + assert_equal(i[0], 'abc') + assert_equal(i[0].dtype, np.dtype('U6')) + +def test_iter_buffering_growinner(): + # Test that the inner loop grows when no buffering is needed + a = np.arange(30) + i = nditer(a, ['buffered', 'growinner', 'external_loop'], + buffersize=5) + # Should end up with just one inner loop here + assert_equal(i[0].size, a.size) + + +@pytest.mark.slow +def test_iter_buffered_reduce_reuse(): + # large enough array for all views, including negative strides. + a = np.arange(2*3**5)[3**5:3**5+1] + flags = ['buffered', 'delay_bufalloc', 'multi_index', 'reduce_ok', 'refs_ok'] + op_flags = [('readonly',), ('readwrite', 'allocate')] + op_axes_list = [[(0, 1, 2), (0, 1, -1)], [(0, 1, 2), (0, -1, -1)]] + # wrong dtype to force buffering + op_dtypes = [float, a.dtype] + + def get_params(): + for xs in range(-3**2, 3**2 + 1): + for ys in range(xs, 3**2 + 1): + for op_axes in op_axes_list: + # last stride is reduced and because of that not + # important for this test, as it is the inner stride. + strides = (xs * a.itemsize, ys * a.itemsize, a.itemsize) + arr = np.lib.stride_tricks.as_strided(a, (3, 3, 3), strides) + + for skip in [0, 1]: + yield arr, op_axes, skip + + for arr, op_axes, skip in get_params(): + nditer2 = np.nditer([arr.copy(), None], + op_axes=op_axes, flags=flags, op_flags=op_flags, + op_dtypes=op_dtypes) + with nditer2: + nditer2.operands[-1][...] = 0 + nditer2.reset() + nditer2.iterindex = skip + + for (a2_in, b2_in) in nditer2: + b2_in += a2_in.astype(np.int_) + + comp_res = nditer2.operands[-1] + + for bufsize in range(0, 3**3): + nditer1 = np.nditer([arr, None], + op_axes=op_axes, flags=flags, op_flags=op_flags, + buffersize=bufsize, op_dtypes=op_dtypes) + with nditer1: + nditer1.operands[-1][...] = 0 + nditer1.reset() + nditer1.iterindex = skip + + for (a1_in, b1_in) in nditer1: + b1_in += a1_in.astype(np.int_) + + res = nditer1.operands[-1] + assert_array_equal(res, comp_res) + + +def test_iter_no_broadcast(): + # Test that the no_broadcast flag works + a = np.arange(24).reshape(2, 3, 4) + b = np.arange(6).reshape(2, 3, 1) + c = np.arange(12).reshape(3, 4) + + nditer([a, b, c], [], + [['readonly', 'no_broadcast'], + ['readonly'], ['readonly']]) + assert_raises(ValueError, nditer, [a, b, c], [], + [['readonly'], ['readonly', 'no_broadcast'], ['readonly']]) + assert_raises(ValueError, nditer, [a, b, c], [], + [['readonly'], ['readonly'], ['readonly', 'no_broadcast']]) + + +class TestIterNested: + + def test_basic(self): + # Test nested iteration basic usage + a = arange(12).reshape(2, 3, 2) + + i, j = np.nested_iters(a, [[0], [1, 2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) + + i, j = np.nested_iters(a, [[0, 1], [2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) + + i, j = np.nested_iters(a, [[0, 2], [1]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) + + def test_reorder(self): + # Test nested iteration basic usage + a = arange(12).reshape(2, 3, 2) + + # In 'K' order (default), it gets reordered + i, j = np.nested_iters(a, [[0], [2, 1]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) + + i, j = np.nested_iters(a, [[1, 0], [2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) + + i, j = np.nested_iters(a, [[2, 0], [1]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) + + # In 'C' order, it doesn't + i, j = np.nested_iters(a, [[0], [2, 1]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 2, 4, 1, 3, 5], [6, 8, 10, 7, 9, 11]]) + + i, j = np.nested_iters(a, [[1, 0], [2]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1], [6, 7], [2, 3], [8, 9], [4, 5], [10, 11]]) + + i, j = np.nested_iters(a, [[2, 0], [1]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 2, 4], [6, 8, 10], [1, 3, 5], [7, 9, 11]]) + + def test_flip_axes(self): + # Test nested iteration with negative axes + a = arange(12).reshape(2, 3, 2)[::-1, ::-1, ::-1] + + # In 'K' order (default), the axes all get flipped + i, j = np.nested_iters(a, [[0], [1, 2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1, 2, 3, 4, 5], [6, 7, 8, 9, 10, 11]]) + + i, j = np.nested_iters(a, [[0, 1], [2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1], [2, 3], [4, 5], [6, 7], [8, 9], [10, 11]]) + + i, j = np.nested_iters(a, [[0, 2], [1]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) + + # In 'C' order, flipping axes is disabled + i, j = np.nested_iters(a, [[0], [1, 2]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[11, 10, 9, 8, 7, 6], [5, 4, 3, 2, 1, 0]]) + + i, j = np.nested_iters(a, [[0, 1], [2]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[11, 10], [9, 8], [7, 6], [5, 4], [3, 2], [1, 0]]) + + i, j = np.nested_iters(a, [[0, 2], [1]], order='C') + vals = [list(j) for _ in i] + assert_equal(vals, [[11, 9, 7], [10, 8, 6], [5, 3, 1], [4, 2, 0]]) + + def test_broadcast(self): + # Test nested iteration with broadcasting + a = arange(2).reshape(2, 1) + b = arange(3).reshape(1, 3) + + i, j = np.nested_iters([a, b], [[0], [1]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[[0, 0], [0, 1], [0, 2]], [[1, 0], [1, 1], [1, 2]]]) + + i, j = np.nested_iters([a, b], [[1], [0]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[[0, 0], [1, 0]], [[0, 1], [1, 1]], [[0, 2], [1, 2]]]) + + def test_dtype_copy(self): + # Test nested iteration with a copy to change dtype + + # copy + a = arange(6, dtype='i4').reshape(2, 3) + i, j = np.nested_iters(a, [[0], [1]], + op_flags=['readonly', 'copy'], + op_dtypes='f8') + assert_equal(j[0].dtype, np.dtype('f8')) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1, 2], [3, 4, 5]]) + vals = None + + # writebackifcopy - using context manager + a = arange(6, dtype='f4').reshape(2, 3) + i, j = np.nested_iters(a, [[0], [1]], + op_flags=['readwrite', 'updateifcopy'], + casting='same_kind', + op_dtypes='f8') + with i, j: + assert_equal(j[0].dtype, np.dtype('f8')) + for x in i: + for y in j: + y[...] += 1 + assert_equal(a, [[0, 1, 2], [3, 4, 5]]) + assert_equal(a, [[1, 2, 3], [4, 5, 6]]) + + # writebackifcopy - using close() + a = arange(6, dtype='f4').reshape(2, 3) + i, j = np.nested_iters(a, [[0], [1]], + op_flags=['readwrite', 'updateifcopy'], + casting='same_kind', + op_dtypes='f8') + assert_equal(j[0].dtype, np.dtype('f8')) + for x in i: + for y in j: + y[...] += 1 + assert_equal(a, [[0, 1, 2], [3, 4, 5]]) + i.close() + j.close() + assert_equal(a, [[1, 2, 3], [4, 5, 6]]) + + def test_dtype_buffered(self): + # Test nested iteration with buffering to change dtype + + a = arange(6, dtype='f4').reshape(2, 3) + i, j = np.nested_iters(a, [[0], [1]], + flags=['buffered'], + op_flags=['readwrite'], + casting='same_kind', + op_dtypes='f8') + assert_equal(j[0].dtype, np.dtype('f8')) + for x in i: + for y in j: + y[...] += 1 + assert_equal(a, [[1, 2, 3], [4, 5, 6]]) + + def test_0d(self): + a = np.arange(12).reshape(2, 3, 2) + i, j = np.nested_iters(a, [[], [1, 0, 2]]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]]) + + i, j = np.nested_iters(a, [[1, 0, 2], []]) + vals = [list(j) for _ in i] + assert_equal(vals, [[0], [1], [2], [3], [4], [5], [6], [7], [8], [9], [10], [11]]) + + i, j, k = np.nested_iters(a, [[2, 0], [], [1]]) + vals = [] + for x in i: + for y in j: + vals.append([z for z in k]) + assert_equal(vals, [[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]) + + def test_iter_nested_iters_dtype_buffered(self): + # Test nested iteration with buffering to change dtype + + a = arange(6, dtype='f4').reshape(2, 3) + i, j = np.nested_iters(a, [[0], [1]], + flags=['buffered'], + op_flags=['readwrite'], + casting='same_kind', + op_dtypes='f8') + with i, j: + assert_equal(j[0].dtype, np.dtype('f8')) + for x in i: + for y in j: + y[...] += 1 + assert_equal(a, [[1, 2, 3], [4, 5, 6]]) + +def test_iter_reduction_error(): + + a = np.arange(6) + assert_raises(ValueError, nditer, [a, None], [], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[[0], [-1]]) + + a = np.arange(6).reshape(2, 3) + assert_raises(ValueError, nditer, [a, None], ['external_loop'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[[0, 1], [-1, -1]]) + +def test_iter_reduction(): + # Test doing reductions with the iterator + + a = np.arange(6) + i = nditer([a, None], ['reduce_ok'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[[0], [-1]]) + # Need to initialize the output operand to the addition unit + with i: + i.operands[1][...] = 0 + # Do the reduction + for x, y in i: + y[...] += x + # Since no axes were specified, should have allocated a scalar + assert_equal(i.operands[1].ndim, 0) + assert_equal(i.operands[1], np.sum(a)) + + a = np.arange(6).reshape(2, 3) + i = nditer([a, None], ['reduce_ok', 'external_loop'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[[0, 1], [-1, -1]]) + # Need to initialize the output operand to the addition unit + with i: + i.operands[1][...] = 0 + # Reduction shape/strides for the output + assert_equal(i[1].shape, (6,)) + assert_equal(i[1].strides, (0,)) + # Do the reduction + for x, y in i: + # Use a for loop instead of ``y[...] += x`` + # (equivalent to ``y[...] = y[...].copy() + x``), + # because y has zero strides we use for the reduction + for j in range(len(y)): + y[j] += x[j] + # Since no axes were specified, should have allocated a scalar + assert_equal(i.operands[1].ndim, 0) + assert_equal(i.operands[1], np.sum(a)) + + # This is a tricky reduction case for the buffering double loop + # to handle + a = np.ones((2, 3, 5)) + it1 = nditer([a, None], ['reduce_ok', 'external_loop'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[None, [0, -1, 1]]) + it2 = nditer([a, None], ['reduce_ok', 'external_loop', + 'buffered', 'delay_bufalloc'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[None, [0, -1, 1]], buffersize=10) + with it1, it2: + it1.operands[1].fill(0) + it2.operands[1].fill(0) + it2.reset() + for x in it1: + x[1][...] += x[0] + for x in it2: + x[1][...] += x[0] + assert_equal(it1.operands[1], it2.operands[1]) + assert_equal(it2.operands[1].sum(), a.size) + +def test_iter_buffering_reduction(): + # Test doing buffered reductions with the iterator + + a = np.arange(6) + b = np.array(0., dtype='f8').byteswap() + b = b.view(b.dtype.newbyteorder()) + i = nditer([a, b], ['reduce_ok', 'buffered'], + [['readonly'], ['readwrite', 'nbo']], + op_axes=[[0], [-1]]) + with i: + assert_equal(i[1].dtype, np.dtype('f8')) + assert_(i[1].dtype != b.dtype) + # Do the reduction + for x, y in i: + y[...] += x + # Since no axes were specified, should have allocated a scalar + assert_equal(b, np.sum(a)) + + a = np.arange(6).reshape(2, 3) + b = np.array([0, 0], dtype='f8').byteswap() + b = b.view(b.dtype.newbyteorder()) + i = nditer([a, b], ['reduce_ok', 'external_loop', 'buffered'], + [['readonly'], ['readwrite', 'nbo']], + op_axes=[[0, 1], [0, -1]]) + # Reduction shape/strides for the output + with i: + assert_equal(i[1].shape, (3,)) + assert_equal(i[1].strides, (0,)) + # Do the reduction + for x, y in i: + # Use a for loop instead of ``y[...] += x`` + # (equivalent to ``y[...] = y[...].copy() + x``), + # because y has zero strides we use for the reduction + for j in range(len(y)): + y[j] += x[j] + assert_equal(b, np.sum(a, axis=1)) + + # Iterator inner double loop was wrong on this one + p = np.arange(2) + 1 + it = np.nditer([p, None], + ['delay_bufalloc', 'reduce_ok', 'buffered', 'external_loop'], + [['readonly'], ['readwrite', 'allocate']], + op_axes=[[-1, 0], [-1, -1]], + itershape=(2, 2)) + with it: + it.operands[1].fill(0) + it.reset() + assert_equal(it[0], [1, 2, 1, 2]) + + # Iterator inner loop should take argument contiguity into account + x = np.ones((7, 13, 8), np.int8)[4:6,1:11:6,1:5].transpose(1, 2, 0) + x[...] = np.arange(x.size).reshape(x.shape) + y_base = np.arange(4*4, dtype=np.int8).reshape(4, 4) + y_base_copy = y_base.copy() + y = y_base[::2,:,None] + + it = np.nditer([y, x], + ['buffered', 'external_loop', 'reduce_ok'], + [['readwrite'], ['readonly']]) + with it: + for a, b in it: + a.fill(2) + + assert_equal(y_base[1::2], y_base_copy[1::2]) + assert_equal(y_base[::2], 2) + +def test_iter_buffering_reduction_reuse_reduce_loops(): + # There was a bug triggering reuse of the reduce loop inappropriately, + # which caused processing to happen in unnecessarily small chunks + # and overran the buffer. + + a = np.zeros((2, 7)) + b = np.zeros((1, 7)) + it = np.nditer([a, b], flags=['reduce_ok', 'external_loop', 'buffered'], + op_flags=[['readonly'], ['readwrite']], + buffersize=5) + + with it: + bufsizes = [x.shape[0] for x, y in it] + assert_equal(bufsizes, [5, 2, 5, 2]) + assert_equal(sum(bufsizes), a.size) + +def test_iter_writemasked_badinput(): + a = np.zeros((2, 3)) + b = np.zeros((3,)) + m = np.array([[True, True, False], [False, True, False]]) + m2 = np.array([True, True, False]) + m3 = np.array([0, 1, 1], dtype='u1') + mbad1 = np.array([0, 1, 1], dtype='i1') + mbad2 = np.array([0, 1, 1], dtype='f4') + + # Need an 'arraymask' if any operand is 'writemasked' + assert_raises(ValueError, nditer, [a, m], [], + [['readwrite', 'writemasked'], ['readonly']]) + + # A 'writemasked' operand must not be readonly + assert_raises(ValueError, nditer, [a, m], [], + [['readonly', 'writemasked'], ['readonly', 'arraymask']]) + + # 'writemasked' and 'arraymask' may not be used together + assert_raises(ValueError, nditer, [a, m], [], + [['readonly'], ['readwrite', 'arraymask', 'writemasked']]) + + # 'arraymask' may only be specified once + assert_raises(ValueError, nditer, [a, m, m2], [], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask'], + ['readonly', 'arraymask']]) + + # An 'arraymask' with nothing 'writemasked' also doesn't make sense + assert_raises(ValueError, nditer, [a, m], [], + [['readwrite'], ['readonly', 'arraymask']]) + + # A writemasked reduction requires a similarly smaller mask + assert_raises(ValueError, nditer, [a, b, m], ['reduce_ok'], + [['readonly'], + ['readwrite', 'writemasked'], + ['readonly', 'arraymask']]) + # But this should work with a smaller/equal mask to the reduction operand + np.nditer([a, b, m2], ['reduce_ok'], + [['readonly'], + ['readwrite', 'writemasked'], + ['readonly', 'arraymask']]) + # The arraymask itself cannot be a reduction + assert_raises(ValueError, nditer, [a, b, m2], ['reduce_ok'], + [['readonly'], + ['readwrite', 'writemasked'], + ['readwrite', 'arraymask']]) + + # A uint8 mask is ok too + np.nditer([a, m3], ['buffered'], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']], + op_dtypes=['f4', None], + casting='same_kind') + # An int8 mask isn't ok + assert_raises(TypeError, np.nditer, [a, mbad1], ['buffered'], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']], + op_dtypes=['f4', None], + casting='same_kind') + # A float32 mask isn't ok + assert_raises(TypeError, np.nditer, [a, mbad2], ['buffered'], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']], + op_dtypes=['f4', None], + casting='same_kind') + + +def _is_buffered(iterator): + try: + iterator.itviews + except ValueError: + return True + return False + +@pytest.mark.parametrize("a", + [np.zeros((3,), dtype='f8'), + np.zeros((9876, 3*5), dtype='f8')[::2, :], + np.zeros((4, 312, 124, 3), dtype='f8')[::2, :, ::2, :], + # Also test with the last dimension strided (so it does not fit if + # there is repeated access) + np.zeros((9,), dtype='f8')[::3], + np.zeros((9876, 3*10), dtype='f8')[::2, ::5], + np.zeros((4, 312, 124, 3), dtype='f8')[::2, :, ::2, ::-1]]) +def test_iter_writemasked(a): + # Note, the slicing above is to ensure that nditer cannot combine multiple + # axes into one. The repetition is just to make things a bit more + # interesting. + shape = a.shape + reps = shape[-1] // 3 + msk = np.empty(shape, dtype=bool) + msk[...] = [True, True, False] * reps + + # When buffering is unused, 'writemasked' effectively does nothing. + # It's up to the user of the iterator to obey the requested semantics. + it = np.nditer([a, msk], [], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']]) + with it: + for x, m in it: + x[...] = 1 + # Because we violated the semantics, all the values became 1 + assert_equal(a, np.broadcast_to([1, 1, 1] * reps, shape)) + + # Even if buffering is enabled, we still may be accessing the array + # directly. + it = np.nditer([a, msk], ['buffered'], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']]) + # @seberg: I honestly don't currently understand why a "buffered" iterator + # would end up not using a buffer for the small array here at least when + # "writemasked" is used, that seems confusing... Check by testing for + # actual memory overlap! + is_buffered = True + with it: + for x, m in it: + x[...] = 2.5 + if np.may_share_memory(x, a): + is_buffered = False + + if not is_buffered: + # Because we violated the semantics, all the values became 2.5 + assert_equal(a, np.broadcast_to([2.5, 2.5, 2.5] * reps, shape)) + else: + # For large sizes, the iterator may be buffered: + assert_equal(a, np.broadcast_to([2.5, 2.5, 1] * reps, shape)) + a[...] = 2.5 + + # If buffering will definitely happening, for instance because of + # a cast, only the items selected by the mask will be copied back from + # the buffer. + it = np.nditer([a, msk], ['buffered'], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']], + op_dtypes=['i8', None], + casting='unsafe') + with it: + for x, m in it: + x[...] = 3 + # Even though we violated the semantics, only the selected values + # were copied back + assert_equal(a, np.broadcast_to([3, 3, 2.5] * reps, shape)) + + +@pytest.mark.parametrize(["mask", "mask_axes"], [ + # Allocated operand (only broadcasts with -1) + (None, [-1, 0]), + # Reduction along the first dimension (with and without op_axes) + (np.zeros((1, 4), dtype="bool"), [0, 1]), + (np.zeros((1, 4), dtype="bool"), None), + # Test 0-D and -1 op_axes + (np.zeros(4, dtype="bool"), [-1, 0]), + (np.zeros((), dtype="bool"), [-1, -1]), + (np.zeros((), dtype="bool"), None)]) +def test_iter_writemasked_broadcast_error(mask, mask_axes): + # This assumes that a readwrite mask makes sense. This is likely not the + # case and should simply be deprecated. + arr = np.zeros((3, 4)) + itflags = ["reduce_ok"] + mask_flags = ["arraymask", "readwrite", "allocate"] + a_flags = ["writeonly", "writemasked"] + if mask_axes is None: + op_axes = None + else: + op_axes = [mask_axes, [0, 1]] + + with assert_raises(ValueError): + np.nditer((mask, arr), flags=itflags, op_flags=[mask_flags, a_flags], + op_axes=op_axes) + + +def test_iter_writemasked_decref(): + # force casting (to make it interesting) by using a structured dtype. + arr = np.arange(10000).astype(">i,O") + original = arr.copy() + mask = np.random.randint(0, 2, size=10000).astype(bool) + + it = np.nditer([arr, mask], ['buffered', "refs_ok"], + [['readwrite', 'writemasked'], + ['readonly', 'arraymask']], + op_dtypes=[" 0.5 + + mean = np.mean(A, + axis=1, + keepdims=True, + where=where) + + std = np.std(A, + axis=1, + keepdims=False, + mean=mean, + where=where) + + # Shape of returned mean and std should be same + assert std.shape == (10, 5) + + # Output should be the same as from the individual algorithms + std_old = np.std(A, axis=1, where=where) + mean_old = np.mean(A, axis=1, where=where) + + assert std_old.shape == mean_old.shape + assert_equal(std, std_old) + + def test_var_with_mean_keyword_where_nontrivial(self): + rng = np.random.RandomState(1234) + A = rng.randn(10, 20, 5) + 0.5 + + where = A > 0.5 + + mean = np.mean(A, + axis=1, + keepdims=True, + where=where) + + var = np.var(A, + axis=1, + keepdims=False, + mean=mean, + where=where) + + # Shape of returned mean and var should be same + assert var.shape == (10, 5) + + # Output should be the same as from the individual algorithms + var_old = np.var(A, axis=1, where=where) + mean_old = np.mean(A, axis=1, where=where) + + assert var_old.shape == mean_old.shape + assert_equal(var, var_old) + + def test_std_with_mean_keyword_multiple_axis(self): + # Setting the seed to make the test reproducible + rng = np.random.RandomState(1234) + A = rng.randn(10, 20, 5) + 0.5 + + axis = (0, 2) + + mean = np.mean(A, + out=None, + axis=axis, + keepdims=True) + + std = np.std(A, + out=None, + axis=axis, + keepdims=False, + mean=mean) + + # Shape of returned mean and std should be same + assert std.shape == (20,) + + # Output should be the same as from the individual algorithms + std_old = np.std(A, axis=axis, keepdims=False) + + assert_almost_equal(std, std_old) + + def test_std_with_mean_keyword_axis_None(self): + # Setting the seed to make the test reproducible + rng = np.random.RandomState(1234) + A = rng.randn(10, 20, 5) + 0.5 + + axis = None + + mean = np.mean(A, + out=None, + axis=axis, + keepdims=True) + + std = np.std(A, + out=None, + axis=axis, + keepdims=False, + mean=mean) + + # Shape of returned mean and std should be same + assert std.shape == () + + # Output should be the same as from the individual algorithms + std_old = np.std(A, axis=axis, keepdims=False) + + assert_almost_equal(std, std_old) + + def test_std_with_mean_keyword_keepdims_true_masked(self): + + A = ma.array([[2., 3., 4., 5.], + [1., 2., 3., 4.]], + mask=[[True, False, True, False], + [True, False, True, False]]) + + B = ma.array([[100., 3., 104., 5.], + [101., 2., 103., 4.]], + mask=[[True, False, True, False], + [True, False, True, False]]) + + mean_out = ma.array([[0., 0., 0., 0.]], + mask=[[False, False, False, False]]) + std_out = ma.array([[0., 0., 0., 0.]], + mask=[[False, False, False, False]]) + + axis = 0 + + mean = np.mean(A, out=mean_out, + axis=axis, keepdims=True) + + std = np.std(A, out=std_out, + axis=axis, keepdims=True, + mean=mean) + + # Shape of returned mean and std should be same + assert std.shape == mean.shape + assert std.shape == (1, 4) + + # Output should be the same as from the individual algorithms + std_old = np.std(A, axis=axis, keepdims=True) + mean_old = np.mean(A, axis=axis, keepdims=True) + + assert std_old.shape == mean_old.shape + assert_almost_equal(std, std_old) + assert_almost_equal(mean, mean_old) + + assert mean_out is mean + assert std_out is std + + # masked elements should be ignored + mean_b = np.mean(B, axis=axis, keepdims=True) + std_b = np.std(B, axis=axis, keepdims=True, mean=mean_b) + assert_almost_equal(std, std_b) + assert_almost_equal(mean, mean_b) + + def test_var_with_mean_keyword_keepdims_true_masked(self): + + A = ma.array([[2., 3., 4., 5.], + [1., 2., 3., 4.]], + mask=[[True, False, True, False], + [True, False, True, False]]) + + B = ma.array([[100., 3., 104., 5.], + [101., 2., 103., 4.]], + mask=[[True, False, True, False], + [True, False, True, False]]) + + mean_out = ma.array([[0., 0., 0., 0.]], + mask=[[False, False, False, False]]) + var_out = ma.array([[0., 0., 0., 0.]], + mask=[[False, False, False, False]]) + + axis = 0 + + mean = np.mean(A, out=mean_out, + axis=axis, keepdims=True) + + var = np.var(A, out=var_out, + axis=axis, keepdims=True, + mean=mean) + + # Shape of returned mean and var should be same + assert var.shape == mean.shape + assert var.shape == (1, 4) + + # Output should be the same as from the individual algorithms + var_old = np.var(A, axis=axis, keepdims=True) + mean_old = np.mean(A, axis=axis, keepdims=True) + + assert var_old.shape == mean_old.shape + assert_almost_equal(var, var_old) + assert_almost_equal(mean, mean_old) + + assert mean_out is mean + assert var_out is var + + # masked elements should be ignored + mean_b = np.mean(B, axis=axis, keepdims=True) + var_b = np.var(B, axis=axis, keepdims=True, mean=mean_b) + assert_almost_equal(var, var_b) + assert_almost_equal(mean, mean_b) + + +class TestIsscalar: + def test_isscalar(self): + assert_(np.isscalar(3.1)) + assert_(np.isscalar(np.int16(12345))) + assert_(np.isscalar(False)) + assert_(np.isscalar('numpy')) + assert_(not np.isscalar([3.1])) + assert_(not np.isscalar(None)) + + # PEP 3141 + from fractions import Fraction + assert_(np.isscalar(Fraction(5, 17))) + from numbers import Number + assert_(np.isscalar(Number())) + + +class TestBoolScalar: + def test_logical(self): + f = np.False_ + t = np.True_ + s = "xyz" + assert_((t and s) is s) + assert_((f and s) is f) + + def test_bitwise_or(self): + f = np.False_ + t = np.True_ + assert_((t | t) is t) + assert_((f | t) is t) + assert_((t | f) is t) + assert_((f | f) is f) + + def test_bitwise_and(self): + f = np.False_ + t = np.True_ + assert_((t & t) is t) + assert_((f & t) is f) + assert_((t & f) is f) + assert_((f & f) is f) + + def test_bitwise_xor(self): + f = np.False_ + t = np.True_ + assert_((t ^ t) is f) + assert_((f ^ t) is t) + assert_((t ^ f) is t) + assert_((f ^ f) is f) + + +class TestBoolArray: + def setup_method(self): + # offset for simd tests + self.t = np.array([True] * 41, dtype=bool)[1::] + self.f = np.array([False] * 41, dtype=bool)[1::] + self.o = np.array([False] * 42, dtype=bool)[2::] + self.nm = self.f.copy() + self.im = self.t.copy() + self.nm[3] = True + self.nm[-2] = True + self.im[3] = False + self.im[-2] = False + + def test_all_any(self): + assert_(self.t.all()) + assert_(self.t.any()) + assert_(not self.f.all()) + assert_(not self.f.any()) + assert_(self.nm.any()) + assert_(self.im.any()) + assert_(not self.nm.all()) + assert_(not self.im.all()) + # check bad element in all positions + for i in range(256 - 7): + d = np.array([False] * 256, dtype=bool)[7::] + d[i] = True + assert_(np.any(d)) + e = np.array([True] * 256, dtype=bool)[7::] + e[i] = False + assert_(not np.all(e)) + assert_array_equal(e, ~d) + # big array test for blocked libc loops + for i in list(range(9, 6000, 507)) + [7764, 90021, -10]: + d = np.array([False] * 100043, dtype=bool) + d[i] = True + assert_(np.any(d), msg="%r" % i) + e = np.array([True] * 100043, dtype=bool) + e[i] = False + assert_(not np.all(e), msg="%r" % i) + + def test_logical_not_abs(self): + assert_array_equal(~self.t, self.f) + assert_array_equal(np.abs(~self.t), self.f) + assert_array_equal(np.abs(~self.f), self.t) + assert_array_equal(np.abs(self.f), self.f) + assert_array_equal(~np.abs(self.f), self.t) + assert_array_equal(~np.abs(self.t), self.f) + assert_array_equal(np.abs(~self.nm), self.im) + np.logical_not(self.t, out=self.o) + assert_array_equal(self.o, self.f) + np.abs(self.t, out=self.o) + assert_array_equal(self.o, self.t) + + def test_logical_and_or_xor(self): + assert_array_equal(self.t | self.t, self.t) + assert_array_equal(self.f | self.f, self.f) + assert_array_equal(self.t | self.f, self.t) + assert_array_equal(self.f | self.t, self.t) + np.logical_or(self.t, self.t, out=self.o) + assert_array_equal(self.o, self.t) + assert_array_equal(self.t & self.t, self.t) + assert_array_equal(self.f & self.f, self.f) + assert_array_equal(self.t & self.f, self.f) + assert_array_equal(self.f & self.t, self.f) + np.logical_and(self.t, self.t, out=self.o) + assert_array_equal(self.o, self.t) + assert_array_equal(self.t ^ self.t, self.f) + assert_array_equal(self.f ^ self.f, self.f) + assert_array_equal(self.t ^ self.f, self.t) + assert_array_equal(self.f ^ self.t, self.t) + np.logical_xor(self.t, self.t, out=self.o) + assert_array_equal(self.o, self.f) + + assert_array_equal(self.nm & self.t, self.nm) + assert_array_equal(self.im & self.f, False) + assert_array_equal(self.nm & True, self.nm) + assert_array_equal(self.im & False, self.f) + assert_array_equal(self.nm | self.t, self.t) + assert_array_equal(self.im | self.f, self.im) + assert_array_equal(self.nm | True, self.t) + assert_array_equal(self.im | False, self.im) + assert_array_equal(self.nm ^ self.t, self.im) + assert_array_equal(self.im ^ self.f, self.im) + assert_array_equal(self.nm ^ True, self.im) + assert_array_equal(self.im ^ False, self.im) + + +class TestBoolCmp: + def setup_method(self): + self.f = np.ones(256, dtype=np.float32) + self.ef = np.ones(self.f.size, dtype=bool) + self.d = np.ones(128, dtype=np.float64) + self.ed = np.ones(self.d.size, dtype=bool) + # generate values for all permutation of 256bit simd vectors + s = 0 + for i in range(32): + self.f[s:s+8] = [i & 2**x for x in range(8)] + self.ef[s:s+8] = [(i & 2**x) != 0 for x in range(8)] + s += 8 + s = 0 + for i in range(16): + self.d[s:s+4] = [i & 2**x for x in range(4)] + self.ed[s:s+4] = [(i & 2**x) != 0 for x in range(4)] + s += 4 + + self.nf = self.f.copy() + self.nd = self.d.copy() + self.nf[self.ef] = np.nan + self.nd[self.ed] = np.nan + + self.inff = self.f.copy() + self.infd = self.d.copy() + self.inff[::3][self.ef[::3]] = np.inf + self.infd[::3][self.ed[::3]] = np.inf + self.inff[1::3][self.ef[1::3]] = -np.inf + self.infd[1::3][self.ed[1::3]] = -np.inf + self.inff[2::3][self.ef[2::3]] = np.nan + self.infd[2::3][self.ed[2::3]] = np.nan + self.efnonan = self.ef.copy() + self.efnonan[2::3] = False + self.ednonan = self.ed.copy() + self.ednonan[2::3] = False + + self.signf = self.f.copy() + self.signd = self.d.copy() + self.signf[self.ef] *= -1. + self.signd[self.ed] *= -1. + self.signf[1::6][self.ef[1::6]] = -np.inf + self.signd[1::6][self.ed[1::6]] = -np.inf + # On RISC-V, many operations that produce NaNs, such as converting + # a -NaN from f64 to f32, return a canonical NaN. The canonical + # NaNs are always positive. See section 11.3 NaN Generation and + # Propagation of the RISC-V Unprivileged ISA for more details. + # We disable the float32 sign test on riscv64 for -np.nan as the sign + # of the NaN will be lost when it's converted to a float32. + if platform.machine() != 'riscv64': + self.signf[3::6][self.ef[3::6]] = -np.nan + self.signd[3::6][self.ed[3::6]] = -np.nan + self.signf[4::6][self.ef[4::6]] = -0. + self.signd[4::6][self.ed[4::6]] = -0. + + def test_float(self): + # offset for alignment test + for i in range(4): + assert_array_equal(self.f[i:] > 0, self.ef[i:]) + assert_array_equal(self.f[i:] - 1 >= 0, self.ef[i:]) + assert_array_equal(self.f[i:] == 0, ~self.ef[i:]) + assert_array_equal(-self.f[i:] < 0, self.ef[i:]) + assert_array_equal(-self.f[i:] + 1 <= 0, self.ef[i:]) + r = self.f[i:] != 0 + assert_array_equal(r, self.ef[i:]) + r2 = self.f[i:] != np.zeros_like(self.f[i:]) + r3 = 0 != self.f[i:] + assert_array_equal(r, r2) + assert_array_equal(r, r3) + # check bool == 0x1 + assert_array_equal(r.view(np.int8), r.astype(np.int8)) + assert_array_equal(r2.view(np.int8), r2.astype(np.int8)) + assert_array_equal(r3.view(np.int8), r3.astype(np.int8)) + + # isnan on amd64 takes the same code path + assert_array_equal(np.isnan(self.nf[i:]), self.ef[i:]) + assert_array_equal(np.isfinite(self.nf[i:]), ~self.ef[i:]) + assert_array_equal(np.isfinite(self.inff[i:]), ~self.ef[i:]) + assert_array_equal(np.isinf(self.inff[i:]), self.efnonan[i:]) + assert_array_equal(np.signbit(self.signf[i:]), self.ef[i:]) + + def test_double(self): + # offset for alignment test + for i in range(2): + assert_array_equal(self.d[i:] > 0, self.ed[i:]) + assert_array_equal(self.d[i:] - 1 >= 0, self.ed[i:]) + assert_array_equal(self.d[i:] == 0, ~self.ed[i:]) + assert_array_equal(-self.d[i:] < 0, self.ed[i:]) + assert_array_equal(-self.d[i:] + 1 <= 0, self.ed[i:]) + r = self.d[i:] != 0 + assert_array_equal(r, self.ed[i:]) + r2 = self.d[i:] != np.zeros_like(self.d[i:]) + r3 = 0 != self.d[i:] + assert_array_equal(r, r2) + assert_array_equal(r, r3) + # check bool == 0x1 + assert_array_equal(r.view(np.int8), r.astype(np.int8)) + assert_array_equal(r2.view(np.int8), r2.astype(np.int8)) + assert_array_equal(r3.view(np.int8), r3.astype(np.int8)) + + # isnan on amd64 takes the same code path + assert_array_equal(np.isnan(self.nd[i:]), self.ed[i:]) + assert_array_equal(np.isfinite(self.nd[i:]), ~self.ed[i:]) + assert_array_equal(np.isfinite(self.infd[i:]), ~self.ed[i:]) + assert_array_equal(np.isinf(self.infd[i:]), self.ednonan[i:]) + assert_array_equal(np.signbit(self.signd[i:]), self.ed[i:]) + + +class TestSeterr: + def test_default(self): + err = np.geterr() + assert_equal(err, + dict(divide='warn', + invalid='warn', + over='warn', + under='ignore') + ) + + def test_set(self): + with np.errstate(): + err = np.seterr() + old = np.seterr(divide='print') + assert_(err == old) + new = np.seterr() + assert_(new['divide'] == 'print') + np.seterr(over='raise') + assert_(np.geterr()['over'] == 'raise') + assert_(new['divide'] == 'print') + np.seterr(**old) + assert_(np.geterr() == old) + + @pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support") + @pytest.mark.skipif(platform.machine() == "armv5tel", reason="See gh-413.") + def test_divide_err(self): + with np.errstate(divide='raise'): + with assert_raises(FloatingPointError): + np.array([1.]) / np.array([0.]) + + np.seterr(divide='ignore') + np.array([1.]) / np.array([0.]) + + +class TestFloatExceptions: + def assert_raises_fpe(self, fpeerr, flop, x, y): + ftype = type(x) + try: + flop(x, y) + assert_(False, + "Type %s did not raise fpe error '%s'." % (ftype, fpeerr)) + except FloatingPointError as exc: + assert_(str(exc).find(fpeerr) >= 0, + "Type %s raised wrong fpe error '%s'." % (ftype, exc)) + + def assert_op_raises_fpe(self, fpeerr, flop, sc1, sc2): + # Check that fpe exception is raised. + # + # Given a floating operation `flop` and two scalar values, check that + # the operation raises the floating point exception specified by + # `fpeerr`. Tests all variants with 0-d array scalars as well. + + self.assert_raises_fpe(fpeerr, flop, sc1, sc2) + self.assert_raises_fpe(fpeerr, flop, sc1[()], sc2) + self.assert_raises_fpe(fpeerr, flop, sc1, sc2[()]) + self.assert_raises_fpe(fpeerr, flop, sc1[()], sc2[()]) + + # Test for all real and complex float types + @pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support") + @pytest.mark.parametrize("typecode", np.typecodes["AllFloat"]) + def test_floating_exceptions(self, typecode): + if 'bsd' in sys.platform and typecode in 'gG': + pytest.skip(reason="Fallback impl for (c)longdouble may not raise " + "FPE errors as expected on BSD OSes, " + "see gh-24876, gh-23379") + + # Test basic arithmetic function errors + with np.errstate(all='raise'): + ftype = obj2sctype(typecode) + if np.dtype(ftype).kind == 'f': + # Get some extreme values for the type + fi = np.finfo(ftype) + ft_tiny = fi._machar.tiny + ft_max = fi.max + ft_eps = fi.eps + underflow = 'underflow' + divbyzero = 'divide by zero' + else: + # 'c', complex, corresponding real dtype + rtype = type(ftype(0).real) + fi = np.finfo(rtype) + ft_tiny = ftype(fi._machar.tiny) + ft_max = ftype(fi.max) + ft_eps = ftype(fi.eps) + # The complex types raise different exceptions + underflow = '' + divbyzero = '' + overflow = 'overflow' + invalid = 'invalid' + + # The value of tiny for double double is NaN, so we need to + # pass the assert + if not np.isnan(ft_tiny): + self.assert_raises_fpe(underflow, + lambda a, b: a/b, ft_tiny, ft_max) + self.assert_raises_fpe(underflow, + lambda a, b: a*b, ft_tiny, ft_tiny) + self.assert_raises_fpe(overflow, + lambda a, b: a*b, ft_max, ftype(2)) + self.assert_raises_fpe(overflow, + lambda a, b: a/b, ft_max, ftype(0.5)) + self.assert_raises_fpe(overflow, + lambda a, b: a+b, ft_max, ft_max*ft_eps) + self.assert_raises_fpe(overflow, + lambda a, b: a-b, -ft_max, ft_max*ft_eps) + self.assert_raises_fpe(overflow, + np.power, ftype(2), ftype(2**fi.nexp)) + self.assert_raises_fpe(divbyzero, + lambda a, b: a/b, ftype(1), ftype(0)) + self.assert_raises_fpe( + invalid, lambda a, b: a/b, ftype(np.inf), ftype(np.inf) + ) + self.assert_raises_fpe(invalid, + lambda a, b: a/b, ftype(0), ftype(0)) + self.assert_raises_fpe( + invalid, lambda a, b: a-b, ftype(np.inf), ftype(np.inf) + ) + self.assert_raises_fpe( + invalid, lambda a, b: a+b, ftype(np.inf), ftype(-np.inf) + ) + self.assert_raises_fpe(invalid, + lambda a, b: a*b, ftype(0), ftype(np.inf)) + + @pytest.mark.skipif(IS_WASM, reason="no wasm fp exception support") + def test_warnings(self): + # test warning code path + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter("always") + with np.errstate(all="warn"): + np.divide(1, 0.) + assert_equal(len(w), 1) + assert_("divide by zero" in str(w[0].message)) + np.array(1e300) * np.array(1e300) + assert_equal(len(w), 2) + assert_("overflow" in str(w[-1].message)) + np.array(np.inf) - np.array(np.inf) + assert_equal(len(w), 3) + assert_("invalid value" in str(w[-1].message)) + np.array(1e-300) * np.array(1e-300) + assert_equal(len(w), 4) + assert_("underflow" in str(w[-1].message)) + + +class TestTypes: + def check_promotion_cases(self, promote_func): + # tests that the scalars get coerced correctly. + b = np.bool(0) + i8, i16, i32, i64 = np.int8(0), np.int16(0), np.int32(0), np.int64(0) + u8, u16, u32, u64 = np.uint8(0), np.uint16(0), np.uint32(0), np.uint64(0) + f32, f64, fld = np.float32(0), np.float64(0), np.longdouble(0) + c64, c128, cld = np.complex64(0), np.complex128(0), np.clongdouble(0) + + # coercion within the same kind + assert_equal(promote_func(i8, i16), np.dtype(np.int16)) + assert_equal(promote_func(i32, i8), np.dtype(np.int32)) + assert_equal(promote_func(i16, i64), np.dtype(np.int64)) + assert_equal(promote_func(u8, u32), np.dtype(np.uint32)) + assert_equal(promote_func(f32, f64), np.dtype(np.float64)) + assert_equal(promote_func(fld, f32), np.dtype(np.longdouble)) + assert_equal(promote_func(f64, fld), np.dtype(np.longdouble)) + assert_equal(promote_func(c128, c64), np.dtype(np.complex128)) + assert_equal(promote_func(cld, c128), np.dtype(np.clongdouble)) + assert_equal(promote_func(c64, fld), np.dtype(np.clongdouble)) + + # coercion between kinds + assert_equal(promote_func(b, i32), np.dtype(np.int32)) + assert_equal(promote_func(b, u8), np.dtype(np.uint8)) + assert_equal(promote_func(i8, u8), np.dtype(np.int16)) + assert_equal(promote_func(u8, i32), np.dtype(np.int32)) + assert_equal(promote_func(i64, u32), np.dtype(np.int64)) + assert_equal(promote_func(u64, i32), np.dtype(np.float64)) + assert_equal(promote_func(i32, f32), np.dtype(np.float64)) + assert_equal(promote_func(i64, f32), np.dtype(np.float64)) + assert_equal(promote_func(f32, i16), np.dtype(np.float32)) + assert_equal(promote_func(f32, u32), np.dtype(np.float64)) + assert_equal(promote_func(f32, c64), np.dtype(np.complex64)) + assert_equal(promote_func(c128, f32), np.dtype(np.complex128)) + assert_equal(promote_func(cld, f64), np.dtype(np.clongdouble)) + + # coercion between scalars and 1-D arrays + assert_equal(promote_func(np.array([b]), i8), np.dtype(np.int8)) + assert_equal(promote_func(np.array([b]), u8), np.dtype(np.uint8)) + assert_equal(promote_func(np.array([b]), i32), np.dtype(np.int32)) + assert_equal(promote_func(np.array([b]), u32), np.dtype(np.uint32)) + assert_equal(promote_func(np.array([i8]), i64), np.dtype(np.int64)) + # unsigned and signed unfortunately tend to promote to float64: + assert_equal(promote_func(u64, np.array([i32])), np.dtype(np.float64)) + assert_equal(promote_func(i64, np.array([u32])), np.dtype(np.int64)) + assert_equal(promote_func(np.array([u16]), i32), np.dtype(np.int32)) + assert_equal(promote_func(np.int32(-1), np.array([u64])), + np.dtype(np.float64)) + assert_equal(promote_func(f64, np.array([f32])), np.dtype(np.float64)) + assert_equal(promote_func(fld, np.array([f32])), + np.dtype(np.longdouble)) + assert_equal(promote_func(np.array([f64]), fld), + np.dtype(np.longdouble)) + assert_equal(promote_func(fld, np.array([c64])), + np.dtype(np.clongdouble)) + assert_equal(promote_func(c64, np.array([f64])), + np.dtype(np.complex128)) + assert_equal(promote_func(np.complex64(3j), np.array([f64])), + np.dtype(np.complex128)) + assert_equal(promote_func(np.array([f32]), c128), + np.dtype(np.complex128)) + + # coercion between scalars and 1-D arrays, where + # the scalar has greater kind than the array + assert_equal(promote_func(np.array([b]), f64), np.dtype(np.float64)) + assert_equal(promote_func(np.array([b]), i64), np.dtype(np.int64)) + assert_equal(promote_func(np.array([b]), u64), np.dtype(np.uint64)) + assert_equal(promote_func(np.array([i8]), f64), np.dtype(np.float64)) + assert_equal(promote_func(np.array([u16]), f64), np.dtype(np.float64)) + + + def test_coercion(self): + def res_type(a, b): + return np.add(a, b).dtype + + self.check_promotion_cases(res_type) + + # Use-case: float/complex scalar * bool/int8 array + # shouldn't narrow the float/complex type + for a in [np.array([True, False]), np.array([-3, 12], dtype=np.int8)]: + b = 1.234 * a + assert_equal(b.dtype, np.dtype('f8'), "array type %s" % a.dtype) + b = np.longdouble(1.234) * a + assert_equal(b.dtype, np.dtype(np.longdouble), + "array type %s" % a.dtype) + b = np.float64(1.234) * a + assert_equal(b.dtype, np.dtype('f8'), "array type %s" % a.dtype) + b = np.float32(1.234) * a + assert_equal(b.dtype, np.dtype('f4'), "array type %s" % a.dtype) + b = np.float16(1.234) * a + assert_equal(b.dtype, np.dtype('f2'), "array type %s" % a.dtype) + + b = 1.234j * a + assert_equal(b.dtype, np.dtype('c16'), "array type %s" % a.dtype) + b = np.clongdouble(1.234j) * a + assert_equal(b.dtype, np.dtype(np.clongdouble), + "array type %s" % a.dtype) + b = np.complex128(1.234j) * a + assert_equal(b.dtype, np.dtype('c16'), "array type %s" % a.dtype) + b = np.complex64(1.234j) * a + assert_equal(b.dtype, np.dtype('c8'), "array type %s" % a.dtype) + + # The following use-case is problematic, and to resolve its + # tricky side-effects requires more changes. + # + # Use-case: (1-t)*a, where 't' is a boolean array and 'a' is + # a float32, shouldn't promote to float64 + # + # a = np.array([1.0, 1.5], dtype=np.float32) + # t = np.array([True, False]) + # b = t*a + # assert_equal(b, [1.0, 0.0]) + # assert_equal(b.dtype, np.dtype('f4')) + # b = (1-t)*a + # assert_equal(b, [0.0, 1.5]) + # assert_equal(b.dtype, np.dtype('f4')) + # + # Probably ~t (bitwise negation) is more proper to use here, + # but this is arguably less intuitive to understand at a glance, and + # would fail if 't' is actually an integer array instead of boolean: + # + # b = (~t)*a + # assert_equal(b, [0.0, 1.5]) + # assert_equal(b.dtype, np.dtype('f4')) + + def test_result_type(self): + self.check_promotion_cases(np.result_type) + assert_(np.result_type(None) == np.dtype(None)) + + def test_promote_types_endian(self): + # promote_types should always return native-endian types + assert_equal(np.promote_types('i8', '>i8'), np.dtype('i8')) + + assert_equal(np.promote_types('>i8', '>U16'), np.dtype('U21')) + assert_equal(np.promote_types('U16', '>i8'), np.dtype('U21')) + assert_equal(np.promote_types('S5', '>U8'), np.dtype('U8')) + assert_equal(np.promote_types('U8', '>S5'), np.dtype('U8')) + assert_equal(np.promote_types('U8', '>U5'), np.dtype('U8')) + + assert_equal(np.promote_types('M8', '>M8'), np.dtype('M8')) + assert_equal(np.promote_types('m8', '>m8'), np.dtype('m8')) + + def test_can_cast_and_promote_usertypes(self): + # The rational type defines safe casting for signed integers, + # boolean. Rational itself *does* cast safely to double. + # (rational does not actually cast to all signed integers, e.g. + # int64 can be both long and longlong and it registers only the first) + valid_types = ["int8", "int16", "int32", "int64", "bool"] + invalid_types = "BHILQP" + "FDG" + "mM" + "f" + "V" + + rational_dt = np.dtype(rational) + for numpy_dtype in valid_types: + numpy_dtype = np.dtype(numpy_dtype) + assert np.can_cast(numpy_dtype, rational_dt) + assert np.promote_types(numpy_dtype, rational_dt) is rational_dt + + for numpy_dtype in invalid_types: + numpy_dtype = np.dtype(numpy_dtype) + assert not np.can_cast(numpy_dtype, rational_dt) + with pytest.raises(TypeError): + np.promote_types(numpy_dtype, rational_dt) + + double_dt = np.dtype("double") + assert np.can_cast(rational_dt, double_dt) + assert np.promote_types(double_dt, rational_dt) is double_dt + + @pytest.mark.parametrize("swap", ["", "swap"]) + @pytest.mark.parametrize("string_dtype", ["U", "S"]) + def test_promote_types_strings(self, swap, string_dtype): + if swap == "swap": + promote_types = lambda a, b: np.promote_types(b, a) + else: + promote_types = np.promote_types + + S = string_dtype + + # Promote numeric with unsized string: + assert_equal(promote_types('bool', S), np.dtype(S+'5')) + assert_equal(promote_types('b', S), np.dtype(S+'4')) + assert_equal(promote_types('u1', S), np.dtype(S+'3')) + assert_equal(promote_types('u2', S), np.dtype(S+'5')) + assert_equal(promote_types('u4', S), np.dtype(S+'10')) + assert_equal(promote_types('u8', S), np.dtype(S+'20')) + assert_equal(promote_types('i1', S), np.dtype(S+'4')) + assert_equal(promote_types('i2', S), np.dtype(S+'6')) + assert_equal(promote_types('i4', S), np.dtype(S+'11')) + assert_equal(promote_types('i8', S), np.dtype(S+'21')) + # Promote numeric with sized string: + assert_equal(promote_types('bool', S+'1'), np.dtype(S+'5')) + assert_equal(promote_types('bool', S+'30'), np.dtype(S+'30')) + assert_equal(promote_types('b', S+'1'), np.dtype(S+'4')) + assert_equal(promote_types('b', S+'30'), np.dtype(S+'30')) + assert_equal(promote_types('u1', S+'1'), np.dtype(S+'3')) + assert_equal(promote_types('u1', S+'30'), np.dtype(S+'30')) + assert_equal(promote_types('u2', S+'1'), np.dtype(S+'5')) + assert_equal(promote_types('u2', S+'30'), np.dtype(S+'30')) + assert_equal(promote_types('u4', S+'1'), np.dtype(S+'10')) + assert_equal(promote_types('u4', S+'30'), np.dtype(S+'30')) + assert_equal(promote_types('u8', S+'1'), np.dtype(S+'20')) + assert_equal(promote_types('u8', S+'30'), np.dtype(S+'30')) + # Promote with object: + assert_equal(promote_types('O', S+'30'), np.dtype('O')) + + @pytest.mark.parametrize(["dtype1", "dtype2"], + [[np.dtype("V6"), np.dtype("V10")], # mismatch shape + # Mismatching names: + [np.dtype([("name1", "i8")]), np.dtype([("name2", "i8")])], + ]) + def test_invalid_void_promotion(self, dtype1, dtype2): + with pytest.raises(TypeError): + np.promote_types(dtype1, dtype2) + + @pytest.mark.parametrize(["dtype1", "dtype2"], + [[np.dtype("V10"), np.dtype("V10")], + [np.dtype([("name1", "i8")]), + np.dtype([("name1", np.dtype("i8").newbyteorder())])], + [np.dtype("i8,i8"), np.dtype("i8,>i8")], + [np.dtype("i8,i8"), np.dtype("i4,i4")], + ]) + def test_valid_void_promotion(self, dtype1, dtype2): + assert np.promote_types(dtype1, dtype2) == dtype1 + + @pytest.mark.parametrize("dtype", + list(np.typecodes["All"]) + + ["i,i", "10i", "S3", "S100", "U3", "U100", rational]) + def test_promote_identical_types_metadata(self, dtype): + # The same type passed in twice to promote types always + # preserves metadata + metadata = {1: 1} + dtype = np.dtype(dtype, metadata=metadata) + + res = np.promote_types(dtype, dtype) + assert res.metadata == dtype.metadata + + # byte-swapping preserves and makes the dtype native: + dtype = dtype.newbyteorder() + if dtype.isnative: + # The type does not have byte swapping + return + + res = np.promote_types(dtype, dtype) + + # Metadata is (currently) generally lost on byte-swapping (except for + # unicode. + if dtype.char != "U": + assert res.metadata is None + else: + assert res.metadata == metadata + assert res.isnative + + @pytest.mark.slow + @pytest.mark.filterwarnings('ignore:Promotion of numbers:FutureWarning') + @pytest.mark.parametrize(["dtype1", "dtype2"], + itertools.product( + list(np.typecodes["All"]) + + ["i,i", "S3", "S100", "U3", "U100", rational], + repeat=2)) + def test_promote_types_metadata(self, dtype1, dtype2): + """Metadata handling in promotion does not appear formalized + right now in NumPy. This test should thus be considered to + document behaviour, rather than test the correct definition of it. + + This test is very ugly, it was useful for rewriting part of the + promotion, but probably should eventually be replaced/deleted + (i.e. when metadata handling in promotion is better defined). + """ + metadata1 = {1: 1} + metadata2 = {2: 2} + dtype1 = np.dtype(dtype1, metadata=metadata1) + dtype2 = np.dtype(dtype2, metadata=metadata2) + + try: + res = np.promote_types(dtype1, dtype2) + except TypeError: + # Promotion failed, this test only checks metadata + return + + if res.char not in "USV" or res.names is not None or res.shape != (): + # All except string dtypes (and unstructured void) lose metadata + # on promotion (unless both dtypes are identical). + # At some point structured ones did not, but were restrictive. + assert res.metadata is None + elif res == dtype1: + # If one result is the result, it is usually returned unchanged: + assert res is dtype1 + elif res == dtype2: + # dtype1 may have been cast to the same type/kind as dtype2. + # If the resulting dtype is identical we currently pick the cast + # version of dtype1, which lost the metadata: + if np.promote_types(dtype1, dtype2.kind) == dtype2: + res.metadata is None + else: + res.metadata == metadata2 + else: + assert res.metadata is None + + # Try again for byteswapped version + dtype1 = dtype1.newbyteorder() + assert dtype1.metadata == metadata1 + res_bs = np.promote_types(dtype1, dtype2) + assert res_bs == res + assert res_bs.metadata == res.metadata + + def test_can_cast(self): + assert_(np.can_cast(np.int32, np.int64)) + assert_(np.can_cast(np.float64, complex)) + assert_(not np.can_cast(complex, float)) + + assert_(np.can_cast('i8', 'f8')) + assert_(not np.can_cast('i8', 'f4')) + assert_(np.can_cast('i4', 'S11')) + + assert_(np.can_cast('i8', 'i8', 'no')) + assert_(not np.can_cast('i8', 'no')) + + assert_(np.can_cast('i8', 'equiv')) + assert_(not np.can_cast('i8', 'equiv')) + + assert_(np.can_cast('i8', 'safe')) + assert_(not np.can_cast('i4', 'safe')) + + assert_(np.can_cast('i4', 'same_kind')) + assert_(not np.can_cast('u4', 'same_kind')) + + assert_(np.can_cast('u4', 'unsafe')) + + assert_(np.can_cast('bool', 'S5')) + assert_(not np.can_cast('bool', 'S4')) + + assert_(np.can_cast('b', 'S4')) + assert_(not np.can_cast('b', 'S3')) + + assert_(np.can_cast('u1', 'S3')) + assert_(not np.can_cast('u1', 'S2')) + assert_(np.can_cast('u2', 'S5')) + assert_(not np.can_cast('u2', 'S4')) + assert_(np.can_cast('u4', 'S10')) + assert_(not np.can_cast('u4', 'S9')) + assert_(np.can_cast('u8', 'S20')) + assert_(not np.can_cast('u8', 'S19')) + + assert_(np.can_cast('i1', 'S4')) + assert_(not np.can_cast('i1', 'S3')) + assert_(np.can_cast('i2', 'S6')) + assert_(not np.can_cast('i2', 'S5')) + assert_(np.can_cast('i4', 'S11')) + assert_(not np.can_cast('i4', 'S10')) + assert_(np.can_cast('i8', 'S21')) + assert_(not np.can_cast('i8', 'S20')) + + assert_(np.can_cast('bool', 'S5')) + assert_(not np.can_cast('bool', 'S4')) + + assert_(np.can_cast('b', 'U4')) + assert_(not np.can_cast('b', 'U3')) + + assert_(np.can_cast('u1', 'U3')) + assert_(not np.can_cast('u1', 'U2')) + assert_(np.can_cast('u2', 'U5')) + assert_(not np.can_cast('u2', 'U4')) + assert_(np.can_cast('u4', 'U10')) + assert_(not np.can_cast('u4', 'U9')) + assert_(np.can_cast('u8', 'U20')) + assert_(not np.can_cast('u8', 'U19')) + + assert_(np.can_cast('i1', 'U4')) + assert_(not np.can_cast('i1', 'U3')) + assert_(np.can_cast('i2', 'U6')) + assert_(not np.can_cast('i2', 'U5')) + assert_(np.can_cast('i4', 'U11')) + assert_(not np.can_cast('i4', 'U10')) + assert_(np.can_cast('i8', 'U21')) + assert_(not np.can_cast('i8', 'U20')) + + assert_raises(TypeError, np.can_cast, 'i4', None) + assert_raises(TypeError, np.can_cast, None, 'i4') + + # Also test keyword arguments + assert_(np.can_cast(from_=np.int32, to=np.int64)) + + def test_can_cast_simple_to_structured(self): + # Non-structured can only be cast to structured in 'unsafe' mode. + assert_(not np.can_cast('i4', 'i4,i4')) + assert_(not np.can_cast('i4', 'i4,i2')) + assert_(np.can_cast('i4', 'i4,i4', casting='unsafe')) + assert_(np.can_cast('i4', 'i4,i2', casting='unsafe')) + # Even if there is just a single field which is OK. + assert_(not np.can_cast('i2', [('f1', 'i4')])) + assert_(not np.can_cast('i2', [('f1', 'i4')], casting='same_kind')) + assert_(np.can_cast('i2', [('f1', 'i4')], casting='unsafe')) + # It should be the same for recursive structured or subarrays. + assert_(not np.can_cast('i2', [('f1', 'i4,i4')])) + assert_(np.can_cast('i2', [('f1', 'i4,i4')], casting='unsafe')) + assert_(not np.can_cast('i2', [('f1', '(2,3)i4')])) + assert_(np.can_cast('i2', [('f1', '(2,3)i4')], casting='unsafe')) + + def test_can_cast_structured_to_simple(self): + # Need unsafe casting for structured to simple. + assert_(not np.can_cast([('f1', 'i4')], 'i4')) + assert_(np.can_cast([('f1', 'i4')], 'i4', casting='unsafe')) + assert_(np.can_cast([('f1', 'i4')], 'i2', casting='unsafe')) + # Since it is unclear what is being cast, multiple fields to + # single should not work even for unsafe casting. + assert_(not np.can_cast('i4,i4', 'i4', casting='unsafe')) + # But a single field inside a single field is OK. + assert_(not np.can_cast([('f1', [('x', 'i4')])], 'i4')) + assert_(np.can_cast([('f1', [('x', 'i4')])], 'i4', casting='unsafe')) + # And a subarray is fine too - it will just take the first element + # (arguably not very consistently; might also take the first field). + assert_(not np.can_cast([('f0', '(3,)i4')], 'i4')) + assert_(np.can_cast([('f0', '(3,)i4')], 'i4', casting='unsafe')) + # But a structured subarray with multiple fields should fail. + assert_(not np.can_cast([('f0', ('i4,i4'), (2,))], 'i4', + casting='unsafe')) + + @pytest.mark.xfail(np._get_promotion_state() != "legacy", + reason="NEP 50: no python int/float/complex support (yet)") + def test_can_cast_values(self): + # gh-5917 + for dt in sctypes['int'] + sctypes['uint']: + ii = np.iinfo(dt) + assert_(np.can_cast(ii.min, dt)) + assert_(np.can_cast(ii.max, dt)) + assert_(not np.can_cast(ii.min - 1, dt)) + assert_(not np.can_cast(ii.max + 1, dt)) + + for dt in sctypes['float']: + fi = np.finfo(dt) + assert_(np.can_cast(fi.min, dt)) + assert_(np.can_cast(fi.max, dt)) + + @pytest.mark.parametrize("dtype", + list("?bhilqBHILQefdgFDG") + [rational]) + def test_can_cast_scalars(self, dtype): + # Basic test to ensure that scalars are supported in can-cast + # (does not check behavior exhaustively). + dtype = np.dtype(dtype) + scalar = dtype.type(0) + + assert np.can_cast(scalar, "int64") == np.can_cast(dtype, "int64") + assert np.can_cast(scalar, "float32", casting="unsafe") + + +# Custom exception class to test exception propagation in fromiter +class NIterError(Exception): + pass + + +class TestFromiter: + def makegen(self): + return (x**2 for x in range(24)) + + def test_types(self): + ai32 = np.fromiter(self.makegen(), np.int32) + ai64 = np.fromiter(self.makegen(), np.int64) + af = np.fromiter(self.makegen(), float) + assert_(ai32.dtype == np.dtype(np.int32)) + assert_(ai64.dtype == np.dtype(np.int64)) + assert_(af.dtype == np.dtype(float)) + + def test_lengths(self): + expected = np.array(list(self.makegen())) + a = np.fromiter(self.makegen(), int) + a20 = np.fromiter(self.makegen(), int, 20) + assert_(len(a) == len(expected)) + assert_(len(a20) == 20) + assert_raises(ValueError, np.fromiter, + self.makegen(), int, len(expected) + 10) + + def test_values(self): + expected = np.array(list(self.makegen())) + a = np.fromiter(self.makegen(), int) + a20 = np.fromiter(self.makegen(), int, 20) + assert_(np.all(a == expected, axis=0)) + assert_(np.all(a20 == expected[:20], axis=0)) + + def load_data(self, n, eindex): + # Utility method for the issue 2592 tests. + # Raise an exception at the desired index in the iterator. + for e in range(n): + if e == eindex: + raise NIterError('error at index %s' % eindex) + yield e + + @pytest.mark.parametrize("dtype", [int, object]) + @pytest.mark.parametrize(["count", "error_index"], [(10, 5), (10, 9)]) + def test_2592(self, count, error_index, dtype): + # Test iteration exceptions are correctly raised. The data/generator + # has `count` elements but errors at `error_index` + iterable = self.load_data(count, error_index) + with pytest.raises(NIterError): + np.fromiter(iterable, dtype=dtype, count=count) + + @pytest.mark.parametrize("dtype", ["S", "S0", "V0", "U0"]) + def test_empty_not_structured(self, dtype): + # Note, "S0" could be allowed at some point, so long "S" (without + # any length) is rejected. + with pytest.raises(ValueError, match="Must specify length"): + np.fromiter([], dtype=dtype) + + @pytest.mark.parametrize(["dtype", "data"], + [("d", [1, 2, 3, 4, 5, 6, 7, 8, 9]), + ("O", [1, 2, 3, 4, 5, 6, 7, 8, 9]), + ("i,O", [(1, 2), (5, 4), (2, 3), (9, 8), (6, 7)]), + # subarray dtypes (important because their dimensions end up + # in the result arrays dimension: + ("2i", [(1, 2), (5, 4), (2, 3), (9, 8), (6, 7)]), + (np.dtype(("O", (2, 3))), + [((1, 2, 3), (3, 4, 5)), ((3, 2, 1), (5, 4, 3))])]) + @pytest.mark.parametrize("length_hint", [0, 1]) + def test_growth_and_complicated_dtypes(self, dtype, data, length_hint): + dtype = np.dtype(dtype) + + data = data * 100 # make sure we realloc a bit + + class MyIter: + # Class/example from gh-15789 + def __length_hint__(self): + # only required to be an estimate, this is legal + return length_hint # 0 or 1 + + def __iter__(self): + return iter(data) + + res = np.fromiter(MyIter(), dtype=dtype) + expected = np.array(data, dtype=dtype) + + assert_array_equal(res, expected) + + def test_empty_result(self): + class MyIter: + def __length_hint__(self): + return 10 + + def __iter__(self): + return iter([]) # actual iterator is empty. + + res = np.fromiter(MyIter(), dtype="d") + assert res.shape == (0,) + assert res.dtype == "d" + + def test_too_few_items(self): + msg = "iterator too short: Expected 10 but iterator had only 3 items." + with pytest.raises(ValueError, match=msg): + np.fromiter([1, 2, 3], count=10, dtype=int) + + def test_failed_itemsetting(self): + with pytest.raises(TypeError): + np.fromiter([1, None, 3], dtype=int) + + # The following manages to hit somewhat trickier code paths: + iterable = ((2, 3, 4) for i in range(5)) + with pytest.raises(ValueError): + np.fromiter(iterable, dtype=np.dtype((int, 2))) + +class TestNonzero: + def test_nonzero_trivial(self): + assert_equal(np.count_nonzero(np.array([])), 0) + assert_equal(np.count_nonzero(np.array([], dtype='?')), 0) + assert_equal(np.nonzero(np.array([])), ([],)) + + assert_equal(np.count_nonzero(np.array([0])), 0) + assert_equal(np.count_nonzero(np.array([0], dtype='?')), 0) + assert_equal(np.nonzero(np.array([0])), ([],)) + + assert_equal(np.count_nonzero(np.array([1])), 1) + assert_equal(np.count_nonzero(np.array([1], dtype='?')), 1) + assert_equal(np.nonzero(np.array([1])), ([0],)) + + def test_nonzero_zerodim(self): + err_msg = "Calling nonzero on 0d arrays is not allowed" + with assert_raises_regex(ValueError, err_msg): + np.nonzero(np.array(0)) + with assert_raises_regex(ValueError, err_msg): + np.array(1).nonzero() + + def test_nonzero_onedim(self): + x = np.array([1, 0, 2, -1, 0, 0, 8]) + assert_equal(np.count_nonzero(x), 4) + assert_equal(np.count_nonzero(x), 4) + assert_equal(np.nonzero(x), ([0, 2, 3, 6],)) + + # x = np.array([(1, 2), (0, 0), (1, 1), (-1, 3), (0, 7)], + # dtype=[('a', 'i4'), ('b', 'i2')]) + x = np.array([(1, 2, -5, -3), (0, 0, 2, 7), (1, 1, 0, 1), (-1, 3, 1, 0), (0, 7, 0, 4)], + dtype=[('a', 'i4'), ('b', 'i2'), ('c', 'i1'), ('d', 'i8')]) + assert_equal(np.count_nonzero(x['a']), 3) + assert_equal(np.count_nonzero(x['b']), 4) + assert_equal(np.count_nonzero(x['c']), 3) + assert_equal(np.count_nonzero(x['d']), 4) + assert_equal(np.nonzero(x['a']), ([0, 2, 3],)) + assert_equal(np.nonzero(x['b']), ([0, 2, 3, 4],)) + + def test_nonzero_twodim(self): + x = np.array([[0, 1, 0], [2, 0, 3]]) + assert_equal(np.count_nonzero(x.astype('i1')), 3) + assert_equal(np.count_nonzero(x.astype('i2')), 3) + assert_equal(np.count_nonzero(x.astype('i4')), 3) + assert_equal(np.count_nonzero(x.astype('i8')), 3) + assert_equal(np.nonzero(x), ([0, 1, 1], [1, 0, 2])) + + x = np.eye(3) + assert_equal(np.count_nonzero(x.astype('i1')), 3) + assert_equal(np.count_nonzero(x.astype('i2')), 3) + assert_equal(np.count_nonzero(x.astype('i4')), 3) + assert_equal(np.count_nonzero(x.astype('i8')), 3) + assert_equal(np.nonzero(x), ([0, 1, 2], [0, 1, 2])) + + x = np.array([[(0, 1), (0, 0), (1, 11)], + [(1, 1), (1, 0), (0, 0)], + [(0, 0), (1, 5), (0, 1)]], dtype=[('a', 'f4'), ('b', 'u1')]) + assert_equal(np.count_nonzero(x['a']), 4) + assert_equal(np.count_nonzero(x['b']), 5) + assert_equal(np.nonzero(x['a']), ([0, 1, 1, 2], [2, 0, 1, 1])) + assert_equal(np.nonzero(x['b']), ([0, 0, 1, 2, 2], [0, 2, 0, 1, 2])) + + assert_(not x['a'].T.flags.aligned) + assert_equal(np.count_nonzero(x['a'].T), 4) + assert_equal(np.count_nonzero(x['b'].T), 5) + assert_equal(np.nonzero(x['a'].T), ([0, 1, 1, 2], [1, 1, 2, 0])) + assert_equal(np.nonzero(x['b'].T), ([0, 0, 1, 2, 2], [0, 1, 2, 0, 2])) + + def test_sparse(self): + # test special sparse condition boolean code path + for i in range(20): + c = np.zeros(200, dtype=bool) + c[i::20] = True + assert_equal(np.nonzero(c)[0], np.arange(i, 200 + i, 20)) + + c = np.zeros(400, dtype=bool) + c[10 + i:20 + i] = True + c[20 + i*2] = True + assert_equal(np.nonzero(c)[0], + np.concatenate((np.arange(10 + i, 20 + i), [20 + i*2]))) + + def test_return_type(self): + class C(np.ndarray): + pass + + for view in (C, np.ndarray): + for nd in range(1, 4): + shape = tuple(range(2, 2+nd)) + x = np.arange(np.prod(shape)).reshape(shape).view(view) + for nzx in (np.nonzero(x), x.nonzero()): + for nzx_i in nzx: + assert_(type(nzx_i) is np.ndarray) + assert_(nzx_i.flags.writeable) + + def test_count_nonzero_axis(self): + # Basic check of functionality + m = np.array([[0, 1, 7, 0, 0], [3, 0, 0, 2, 19]]) + + expected = np.array([1, 1, 1, 1, 1]) + assert_equal(np.count_nonzero(m, axis=0), expected) + + expected = np.array([2, 3]) + assert_equal(np.count_nonzero(m, axis=1), expected) + + assert_raises(ValueError, np.count_nonzero, m, axis=(1, 1)) + assert_raises(TypeError, np.count_nonzero, m, axis='foo') + assert_raises(AxisError, np.count_nonzero, m, axis=3) + assert_raises(TypeError, np.count_nonzero, + m, axis=np.array([[1], [2]])) + + def test_count_nonzero_axis_all_dtypes(self): + # More thorough test that the axis argument is respected + # for all dtypes and responds correctly when presented with + # either integer or tuple arguments for axis + msg = "Mismatch for dtype: %s" + + def assert_equal_w_dt(a, b, err_msg): + assert_equal(a.dtype, b.dtype, err_msg=err_msg) + assert_equal(a, b, err_msg=err_msg) + + for dt in np.typecodes['All']: + err_msg = msg % (np.dtype(dt).name,) + + if dt != 'V': + if dt != 'M': + m = np.zeros((3, 3), dtype=dt) + n = np.ones(1, dtype=dt) + + m[0, 0] = n[0] + m[1, 0] = n[0] + + else: # np.zeros doesn't work for np.datetime64 + m = np.array(['1970-01-01'] * 9) + m = m.reshape((3, 3)) + + m[0, 0] = '1970-01-12' + m[1, 0] = '1970-01-12' + m = m.astype(dt) + + expected = np.array([2, 0, 0], dtype=np.intp) + assert_equal_w_dt(np.count_nonzero(m, axis=0), + expected, err_msg=err_msg) + + expected = np.array([1, 1, 0], dtype=np.intp) + assert_equal_w_dt(np.count_nonzero(m, axis=1), + expected, err_msg=err_msg) + + expected = np.array(2) + assert_equal(np.count_nonzero(m, axis=(0, 1)), + expected, err_msg=err_msg) + assert_equal(np.count_nonzero(m, axis=None), + expected, err_msg=err_msg) + assert_equal(np.count_nonzero(m), + expected, err_msg=err_msg) + + if dt == 'V': + # There are no 'nonzero' objects for np.void, so the testing + # setup is slightly different for this dtype + m = np.array([np.void(1)] * 6).reshape((2, 3)) + + expected = np.array([0, 0, 0], dtype=np.intp) + assert_equal_w_dt(np.count_nonzero(m, axis=0), + expected, err_msg=err_msg) + + expected = np.array([0, 0], dtype=np.intp) + assert_equal_w_dt(np.count_nonzero(m, axis=1), + expected, err_msg=err_msg) + + expected = np.array(0) + assert_equal(np.count_nonzero(m, axis=(0, 1)), + expected, err_msg=err_msg) + assert_equal(np.count_nonzero(m, axis=None), + expected, err_msg=err_msg) + assert_equal(np.count_nonzero(m), + expected, err_msg=err_msg) + + def test_count_nonzero_axis_consistent(self): + # Check that the axis behaviour for valid axes in + # non-special cases is consistent (and therefore + # correct) by checking it against an integer array + # that is then casted to the generic object dtype + from itertools import combinations, permutations + + axis = (0, 1, 2, 3) + size = (5, 5, 5, 5) + msg = "Mismatch for axis: %s" + + rng = np.random.RandomState(1234) + m = rng.randint(-100, 100, size=size) + n = m.astype(object) + + for length in range(len(axis)): + for combo in combinations(axis, length): + for perm in permutations(combo): + assert_equal( + np.count_nonzero(m, axis=perm), + np.count_nonzero(n, axis=perm), + err_msg=msg % (perm,)) + + def test_countnonzero_axis_empty(self): + a = np.array([[0, 0, 1], [1, 0, 1]]) + assert_equal(np.count_nonzero(a, axis=()), a.astype(bool)) + + def test_countnonzero_keepdims(self): + a = np.array([[0, 0, 1, 0], + [0, 3, 5, 0], + [7, 9, 2, 0]]) + assert_equal(np.count_nonzero(a, axis=0, keepdims=True), + [[1, 2, 3, 0]]) + assert_equal(np.count_nonzero(a, axis=1, keepdims=True), + [[1], [2], [3]]) + assert_equal(np.count_nonzero(a, keepdims=True), + [[6]]) + + def test_array_method(self): + # Tests that the array method + # call to nonzero works + m = np.array([[1, 0, 0], [4, 0, 6]]) + tgt = [[0, 1, 1], [0, 0, 2]] + + assert_equal(m.nonzero(), tgt) + + def test_nonzero_invalid_object(self): + # gh-9295 + a = np.array([np.array([1, 2]), 3], dtype=object) + assert_raises(ValueError, np.nonzero, a) + + class BoolErrors: + def __bool__(self): + raise ValueError("Not allowed") + + assert_raises(ValueError, np.nonzero, np.array([BoolErrors()])) + + def test_nonzero_sideeffect_safety(self): + # gh-13631 + class FalseThenTrue: + _val = False + def __bool__(self): + try: + return self._val + finally: + self._val = True + + class TrueThenFalse: + _val = True + def __bool__(self): + try: + return self._val + finally: + self._val = False + + # result grows on the second pass + a = np.array([True, FalseThenTrue()]) + assert_raises(RuntimeError, np.nonzero, a) + + a = np.array([[True], [FalseThenTrue()]]) + assert_raises(RuntimeError, np.nonzero, a) + + # result shrinks on the second pass + a = np.array([False, TrueThenFalse()]) + assert_raises(RuntimeError, np.nonzero, a) + + a = np.array([[False], [TrueThenFalse()]]) + assert_raises(RuntimeError, np.nonzero, a) + + def test_nonzero_sideffects_structured_void(self): + # Checks that structured void does not mutate alignment flag of + # original array. + arr = np.zeros(5, dtype="i1,i8,i8") # `ones` may short-circuit + assert arr.flags.aligned # structs are considered "aligned" + assert not arr["f2"].flags.aligned + # make sure that nonzero/count_nonzero do not flip the flag: + np.nonzero(arr) + assert arr.flags.aligned + np.count_nonzero(arr) + assert arr.flags.aligned + + def test_nonzero_exception_safe(self): + # gh-13930 + + class ThrowsAfter: + def __init__(self, iters): + self.iters_left = iters + + def __bool__(self): + if self.iters_left == 0: + raise ValueError("called `iters` times") + + self.iters_left -= 1 + return True + + """ + Test that a ValueError is raised instead of a SystemError + + If the __bool__ function is called after the error state is set, + Python (cpython) will raise a SystemError. + """ + + # assert that an exception in first pass is handled correctly + a = np.array([ThrowsAfter(5)]*10) + assert_raises(ValueError, np.nonzero, a) + + # raise exception in second pass for 1-dimensional loop + a = np.array([ThrowsAfter(15)]*10) + assert_raises(ValueError, np.nonzero, a) + + # raise exception in second pass for n-dimensional loop + a = np.array([[ThrowsAfter(15)]]*10) + assert_raises(ValueError, np.nonzero, a) + + @pytest.mark.skipif(IS_WASM, reason="wasm doesn't have threads") + def test_structured_threadsafety(self): + # Nonzero (and some other functions) should be threadsafe for + # structured datatypes, see gh-15387. This test can behave randomly. + from concurrent.futures import ThreadPoolExecutor + + # Create a deeply nested dtype to make a failure more likely: + dt = np.dtype([("", "f8")]) + dt = np.dtype([("", dt)]) + dt = np.dtype([("", dt)] * 2) + # The array should be large enough to likely run into threading issues + arr = np.random.uniform(size=(5000, 4)).view(dt)[:, 0] + def func(arr): + arr.nonzero() + + tpe = ThreadPoolExecutor(max_workers=8) + futures = [tpe.submit(func, arr) for _ in range(10)] + for f in futures: + f.result() + + assert arr.dtype is dt + + +class TestIndex: + def test_boolean(self): + a = rand(3, 5, 8) + V = rand(5, 8) + g1 = randint(0, 5, size=15) + g2 = randint(0, 8, size=15) + V[g1, g2] = -V[g1, g2] + assert_((np.array([a[0][V > 0], a[1][V > 0], a[2][V > 0]]) == a[:, V > 0]).all()) + + def test_boolean_edgecase(self): + a = np.array([], dtype='int32') + b = np.array([], dtype='bool') + c = a[b] + assert_equal(c, []) + assert_equal(c.dtype, np.dtype('int32')) + + +class TestBinaryRepr: + def test_zero(self): + assert_equal(np.binary_repr(0), '0') + + def test_positive(self): + assert_equal(np.binary_repr(10), '1010') + assert_equal(np.binary_repr(12522), + '11000011101010') + assert_equal(np.binary_repr(10736848), + '101000111101010011010000') + + def test_negative(self): + assert_equal(np.binary_repr(-1), '-1') + assert_equal(np.binary_repr(-10), '-1010') + assert_equal(np.binary_repr(-12522), + '-11000011101010') + assert_equal(np.binary_repr(-10736848), + '-101000111101010011010000') + + def test_sufficient_width(self): + assert_equal(np.binary_repr(0, width=5), '00000') + assert_equal(np.binary_repr(10, width=7), '0001010') + assert_equal(np.binary_repr(-5, width=7), '1111011') + + def test_neg_width_boundaries(self): + # see gh-8670 + + # Ensure that the example in the issue does not + # break before proceeding to a more thorough test. + assert_equal(np.binary_repr(-128, width=8), '10000000') + + for width in range(1, 11): + num = -2**(width - 1) + exp = '1' + (width - 1) * '0' + assert_equal(np.binary_repr(num, width=width), exp) + + def test_large_neg_int64(self): + # See gh-14289. + assert_equal(np.binary_repr(np.int64(-2**62), width=64), + '11' + '0'*62) + + +class TestBaseRepr: + def test_base3(self): + assert_equal(np.base_repr(3**5, 3), '100000') + + def test_positive(self): + assert_equal(np.base_repr(12, 10), '12') + assert_equal(np.base_repr(12, 10, 4), '000012') + assert_equal(np.base_repr(12, 4), '30') + assert_equal(np.base_repr(3731624803700888, 36), '10QR0ROFCEW') + + def test_negative(self): + assert_equal(np.base_repr(-12, 10), '-12') + assert_equal(np.base_repr(-12, 10, 4), '-000012') + assert_equal(np.base_repr(-12, 4), '-30') + + def test_base_range(self): + with assert_raises(ValueError): + np.base_repr(1, 1) + with assert_raises(ValueError): + np.base_repr(1, 37) + + def test_minimal_signed_int(self): + assert_equal(np.base_repr(np.int8(-128)), '-10000000') + + +def _test_array_equal_parametrizations(): + """ + we pre-create arrays as we sometime want to pass the same instance + and sometime not. Passing the same instances may not mean the array are + equal, especially when containing None + """ + # those are 0-d arrays, it used to be a special case + # where (e0 == e0).all() would raise + e0 = np.array(0, dtype="int") + e1 = np.array(1, dtype="float") + # x,y, nan_equal, expected_result + yield (e0, e0.copy(), None, True) + yield (e0, e0.copy(), False, True) + yield (e0, e0.copy(), True, True) + + # + yield (e1, e1.copy(), None, True) + yield (e1, e1.copy(), False, True) + yield (e1, e1.copy(), True, True) + + # Non-nanable – those cannot hold nans + a12 = np.array([1, 2]) + a12b = a12.copy() + a123 = np.array([1, 2, 3]) + a13 = np.array([1, 3]) + a34 = np.array([3, 4]) + + aS1 = np.array(["a"], dtype="S1") + aS1b = aS1.copy() + aS1u4 = np.array([("a", 1)], dtype="S1,u4") + aS1u4b = aS1u4.copy() + + yield (a12, a12b, None, True) + yield (a12, a12, None, True) + yield (a12, a123, None, False) + yield (a12, a34, None, False) + yield (a12, a13, None, False) + yield (aS1, aS1b, None, True) + yield (aS1, aS1, None, True) + + # Non-float dtype - equal_nan should have no effect, + yield (a123, a123, None, True) + yield (a123, a123, False, True) + yield (a123, a123, True, True) + yield (a123, a123.copy(), None, True) + yield (a123, a123.copy(), False, True) + yield (a123, a123.copy(), True, True) + yield (a123.astype("float"), a123.astype("float"), None, True) + yield (a123.astype("float"), a123.astype("float"), False, True) + yield (a123.astype("float"), a123.astype("float"), True, True) + + # these can hold None + b1 = np.array([1, 2, np.nan]) + b2 = np.array([1, np.nan, 2]) + b3 = np.array([1, 2, np.inf]) + b4 = np.array(np.nan) + + # instances are the same + yield (b1, b1, None, False) + yield (b1, b1, False, False) + yield (b1, b1, True, True) + + # equal but not same instance + yield (b1, b1.copy(), None, False) + yield (b1, b1.copy(), False, False) + yield (b1, b1.copy(), True, True) + + # same once stripped of Nan + yield (b1, b2, None, False) + yield (b1, b2, False, False) + yield (b1, b2, True, False) + + # nan's not conflated with inf's + yield (b1, b3, None, False) + yield (b1, b3, False, False) + yield (b1, b3, True, False) + + # all Nan + yield (b4, b4, None, False) + yield (b4, b4, False, False) + yield (b4, b4, True, True) + yield (b4, b4.copy(), None, False) + yield (b4, b4.copy(), False, False) + yield (b4, b4.copy(), True, True) + + t1 = b1.astype("timedelta64") + t2 = b2.astype("timedelta64") + + # Timedeltas are particular + yield (t1, t1, None, False) + yield (t1, t1, False, False) + yield (t1, t1, True, True) + + yield (t1, t1.copy(), None, False) + yield (t1, t1.copy(), False, False) + yield (t1, t1.copy(), True, True) + + yield (t1, t2, None, False) + yield (t1, t2, False, False) + yield (t1, t2, True, False) + + # Multi-dimensional array + md1 = np.array([[0, 1], [np.nan, 1]]) + + yield (md1, md1, None, False) + yield (md1, md1, False, False) + yield (md1, md1, True, True) + yield (md1, md1.copy(), None, False) + yield (md1, md1.copy(), False, False) + yield (md1, md1.copy(), True, True) + # both complexes are nan+nan.j but the same instance + cplx1, cplx2 = [np.array([np.nan + np.nan * 1j])] * 2 + + # only real or img are nan. + cplx3, cplx4 = np.complex64(1, np.nan), np.complex64(np.nan, 1) + + # Complex values + yield (cplx1, cplx2, None, False) + yield (cplx1, cplx2, False, False) + yield (cplx1, cplx2, True, True) + + # Complex values, 1+nan, nan+1j + yield (cplx3, cplx4, None, False) + yield (cplx3, cplx4, False, False) + yield (cplx3, cplx4, True, True) + + +class TestArrayComparisons: + @pytest.mark.parametrize( + "bx,by,equal_nan,expected", _test_array_equal_parametrizations() + ) + def test_array_equal_equal_nan(self, bx, by, equal_nan, expected): + """ + This test array_equal for a few combinaison: + + - are the two inputs the same object or not (same object many not + be equal if contains NaNs) + - Whether we should consider or not, NaNs, being equal. + + """ + if equal_nan is None: + res = np.array_equal(bx, by) + else: + res = np.array_equal(bx, by, equal_nan=equal_nan) + assert_(res is expected) + assert_(type(res) is bool) + + def test_array_equal_different_scalar_types(self): + # https://github.com/numpy/numpy/issues/27271 + a = np.array("foo") + b = np.array(1) + assert not np.array_equal(a, b) + assert not np.array_equiv(a, b) + + def test_none_compares_elementwise(self): + a = np.array([None, 1, None], dtype=object) + assert_equal(a == None, [True, False, True]) + assert_equal(a != None, [False, True, False]) + + a = np.ones(3) + assert_equal(a == None, [False, False, False]) + assert_equal(a != None, [True, True, True]) + + def test_array_equiv(self): + res = np.array_equiv(np.array([1, 2]), np.array([1, 2])) + assert_(res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([1, 2, 3])) + assert_(not res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([3, 4])) + assert_(not res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([1, 3])) + assert_(not res) + assert_(type(res) is bool) + + res = np.array_equiv(np.array([1, 1]), np.array([1])) + assert_(res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 1]), np.array([[1], [1]])) + assert_(res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([2])) + assert_(not res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([[1], [2]])) + assert_(not res) + assert_(type(res) is bool) + res = np.array_equiv(np.array([1, 2]), np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]])) + assert_(not res) + assert_(type(res) is bool) + + @pytest.mark.parametrize("dtype", ["V0", "V3", "V10"]) + def test_compare_unstructured_voids(self, dtype): + zeros = np.zeros(3, dtype=dtype) + + assert_array_equal(zeros, zeros) + assert not (zeros != zeros).any() + + if dtype == "V0": + # Can't test != of actually different data + return + + nonzeros = np.array([b"1", b"2", b"3"], dtype=dtype) + + assert not (zeros == nonzeros).any() + assert (zeros != nonzeros).all() + + +def assert_array_strict_equal(x, y): + assert_array_equal(x, y) + # Check flags, 32 bit arches typically don't provide 16 byte alignment + if ((x.dtype.alignment <= 8 or + np.intp().dtype.itemsize != 4) and + sys.platform != 'win32'): + assert_(x.flags == y.flags) + else: + assert_(x.flags.owndata == y.flags.owndata) + assert_(x.flags.writeable == y.flags.writeable) + assert_(x.flags.c_contiguous == y.flags.c_contiguous) + assert_(x.flags.f_contiguous == y.flags.f_contiguous) + assert_(x.flags.writebackifcopy == y.flags.writebackifcopy) + # check endianness + assert_(x.dtype.isnative == y.dtype.isnative) + + +class TestClip: + def setup_method(self): + self.nr = 5 + self.nc = 3 + + def fastclip(self, a, m, M, out=None, **kwargs): + return a.clip(m, M, out=out, **kwargs) + + def clip(self, a, m, M, out=None): + # use a.choose to verify fastclip result + selector = np.less(a, m) + 2*np.greater(a, M) + return selector.choose((a, m, M), out=out) + + # Handy functions + def _generate_data(self, n, m): + return randn(n, m) + + def _generate_data_complex(self, n, m): + return randn(n, m) + 1.j * rand(n, m) + + def _generate_flt_data(self, n, m): + return (randn(n, m)).astype(np.float32) + + def _neg_byteorder(self, a): + a = np.asarray(a) + if sys.byteorder == 'little': + a = a.astype(a.dtype.newbyteorder('>')) + else: + a = a.astype(a.dtype.newbyteorder('<')) + return a + + def _generate_non_native_data(self, n, m): + data = randn(n, m) + data = self._neg_byteorder(data) + assert_(not data.dtype.isnative) + return data + + def _generate_int_data(self, n, m): + return (10 * rand(n, m)).astype(np.int64) + + def _generate_int32_data(self, n, m): + return (10 * rand(n, m)).astype(np.int32) + + # Now the real test cases + + @pytest.mark.parametrize("dtype", '?bhilqpBHILQPefdgFDGO') + def test_ones_pathological(self, dtype): + # for preservation of behavior described in + # gh-12519; amin > amax behavior may still change + # in the future + arr = np.ones(10, dtype=dtype) + expected = np.zeros(10, dtype=dtype) + actual = np.clip(arr, 1, 0) + if dtype == 'O': + assert actual.tolist() == expected.tolist() + else: + assert_equal(actual, expected) + + def test_simple_double(self): + # Test native double input with scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = 0.1 + M = 0.6 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_simple_int(self): + # Test native int input with scalar min/max. + a = self._generate_int_data(self.nr, self.nc) + a = a.astype(int) + m = -2 + M = 4 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_array_double(self): + # Test native double input with array min/max. + a = self._generate_data(self.nr, self.nc) + m = np.zeros(a.shape) + M = m + 0.5 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_simple_nonnative(self): + # Test non native double input with scalar min/max. + # Test native double input with non native double scalar min/max. + a = self._generate_non_native_data(self.nr, self.nc) + m = -0.5 + M = 0.6 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_equal(ac, act) + + # Test native double input with non native double scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 + M = self._neg_byteorder(0.6) + assert_(not M.dtype.isnative) + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_equal(ac, act) + + def test_simple_complex(self): + # Test native complex input with native double scalar min/max. + # Test native input with complex double scalar min/max. + a = 3 * self._generate_data_complex(self.nr, self.nc) + m = -0.5 + M = 1. + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + # Test native input with complex double scalar min/max. + a = 3 * self._generate_data(self.nr, self.nc) + m = -0.5 + 1.j + M = 1. + 2.j + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_clip_complex(self): + # Address Issue gh-5354 for clipping complex arrays + # Test native complex input without explicit min/max + # ie, either min=None or max=None + a = np.ones(10, dtype=complex) + m = a.min() + M = a.max() + am = self.fastclip(a, m, None) + aM = self.fastclip(a, None, M) + assert_array_strict_equal(am, a) + assert_array_strict_equal(aM, a) + + def test_clip_non_contig(self): + # Test clip for non contiguous native input and native scalar min/max. + a = self._generate_data(self.nr * 2, self.nc * 3) + a = a[::2, ::3] + assert_(not a.flags['F_CONTIGUOUS']) + assert_(not a.flags['C_CONTIGUOUS']) + ac = self.fastclip(a, -1.6, 1.7) + act = self.clip(a, -1.6, 1.7) + assert_array_strict_equal(ac, act) + + def test_simple_out(self): + # Test native double input with scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 + M = 0.6 + ac = np.zeros(a.shape) + act = np.zeros(a.shape) + self.fastclip(a, m, M, ac) + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + @pytest.mark.parametrize("casting", [None, "unsafe"]) + def test_simple_int32_inout(self, casting): + # Test native int32 input with double min/max and int32 out. + a = self._generate_int32_data(self.nr, self.nc) + m = np.float64(0) + M = np.float64(2) + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + if casting is None: + with pytest.raises(TypeError): + self.fastclip(a, m, M, ac, casting=casting) + else: + # explicitly passing "unsafe" will silence warning + self.fastclip(a, m, M, ac, casting=casting) + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_simple_int64_out(self): + # Test native int32 input with int32 scalar min/max and int64 out. + a = self._generate_int32_data(self.nr, self.nc) + m = np.int32(-1) + M = np.int32(1) + ac = np.zeros(a.shape, dtype=np.int64) + act = ac.copy() + self.fastclip(a, m, M, ac) + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_simple_int64_inout(self): + # Test native int32 input with double array min/max and int32 out. + a = self._generate_int32_data(self.nr, self.nc) + m = np.zeros(a.shape, np.float64) + M = np.float64(1) + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + self.fastclip(a, m, M, out=ac, casting="unsafe") + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_simple_int32_out(self): + # Test native double input with scalar min/max and int out. + a = self._generate_data(self.nr, self.nc) + m = -1.0 + M = 2.0 + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + self.fastclip(a, m, M, out=ac, casting="unsafe") + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_simple_inplace_01(self): + # Test native double input with array min/max in-place. + a = self._generate_data(self.nr, self.nc) + ac = a.copy() + m = np.zeros(a.shape) + M = 1.0 + self.fastclip(a, m, M, a) + self.clip(a, m, M, ac) + assert_array_strict_equal(a, ac) + + def test_simple_inplace_02(self): + # Test native double input with scalar min/max in-place. + a = self._generate_data(self.nr, self.nc) + ac = a.copy() + m = -0.5 + M = 0.6 + self.fastclip(a, m, M, a) + self.clip(ac, m, M, ac) + assert_array_strict_equal(a, ac) + + def test_noncontig_inplace(self): + # Test non contiguous double input with double scalar min/max in-place. + a = self._generate_data(self.nr * 2, self.nc * 3) + a = a[::2, ::3] + assert_(not a.flags['F_CONTIGUOUS']) + assert_(not a.flags['C_CONTIGUOUS']) + ac = a.copy() + m = -0.5 + M = 0.6 + self.fastclip(a, m, M, a) + self.clip(ac, m, M, ac) + assert_array_equal(a, ac) + + def test_type_cast_01(self): + # Test native double input with scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 + M = 0.6 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_02(self): + # Test native int32 input with int32 scalar min/max. + a = self._generate_int_data(self.nr, self.nc) + a = a.astype(np.int32) + m = -2 + M = 4 + ac = self.fastclip(a, m, M) + act = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_03(self): + # Test native int32 input with float64 scalar min/max. + a = self._generate_int32_data(self.nr, self.nc) + m = -2 + M = 4 + ac = self.fastclip(a, np.float64(m), np.float64(M)) + act = self.clip(a, np.float64(m), np.float64(M)) + assert_array_strict_equal(ac, act) + + def test_type_cast_04(self): + # Test native int32 input with float32 scalar min/max. + a = self._generate_int32_data(self.nr, self.nc) + m = np.float32(-2) + M = np.float32(4) + act = self.fastclip(a, m, M) + ac = self.clip(a, m, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_05(self): + # Test native int32 with double arrays min/max. + a = self._generate_int_data(self.nr, self.nc) + m = -0.5 + M = 1. + ac = self.fastclip(a, m * np.zeros(a.shape), M) + act = self.clip(a, m * np.zeros(a.shape), M) + assert_array_strict_equal(ac, act) + + def test_type_cast_06(self): + # Test native with NON native scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = 0.5 + m_s = self._neg_byteorder(m) + M = 1. + act = self.clip(a, m_s, M) + ac = self.fastclip(a, m_s, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_07(self): + # Test NON native with native array min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 * np.ones(a.shape) + M = 1. + a_s = self._neg_byteorder(a) + assert_(not a_s.dtype.isnative) + act = a_s.clip(m, M) + ac = self.fastclip(a_s, m, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_08(self): + # Test NON native with native scalar min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 + M = 1. + a_s = self._neg_byteorder(a) + assert_(not a_s.dtype.isnative) + ac = self.fastclip(a_s, m, M) + act = a_s.clip(m, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_09(self): + # Test native with NON native array min/max. + a = self._generate_data(self.nr, self.nc) + m = -0.5 * np.ones(a.shape) + M = 1. + m_s = self._neg_byteorder(m) + assert_(not m_s.dtype.isnative) + ac = self.fastclip(a, m_s, M) + act = self.clip(a, m_s, M) + assert_array_strict_equal(ac, act) + + def test_type_cast_10(self): + # Test native int32 with float min/max and float out for output argument. + a = self._generate_int_data(self.nr, self.nc) + b = np.zeros(a.shape, dtype=np.float32) + m = np.float32(-0.5) + M = np.float32(1) + act = self.clip(a, m, M, out=b) + ac = self.fastclip(a, m, M, out=b) + assert_array_strict_equal(ac, act) + + def test_type_cast_11(self): + # Test non native with native scalar, min/max, out non native + a = self._generate_non_native_data(self.nr, self.nc) + b = a.copy() + b = b.astype(b.dtype.newbyteorder('>')) + bt = b.copy() + m = -0.5 + M = 1. + self.fastclip(a, m, M, out=b) + self.clip(a, m, M, out=bt) + assert_array_strict_equal(b, bt) + + def test_type_cast_12(self): + # Test native int32 input and min/max and float out + a = self._generate_int_data(self.nr, self.nc) + b = np.zeros(a.shape, dtype=np.float32) + m = np.int32(0) + M = np.int32(1) + act = self.clip(a, m, M, out=b) + ac = self.fastclip(a, m, M, out=b) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_simple(self): + # Test native double input with scalar min/max + a = self._generate_data(self.nr, self.nc) + m = -0.5 + M = 0.6 + ac = np.zeros(a.shape) + act = np.zeros(a.shape) + self.fastclip(a, m, M, ac) + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_simple2(self): + # Test native int32 input with double min/max and int32 out + a = self._generate_int32_data(self.nr, self.nc) + m = np.float64(0) + M = np.float64(2) + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + self.fastclip(a, m, M, out=ac, casting="unsafe") + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_simple_int32(self): + # Test native int32 input with int32 scalar min/max and int64 out + a = self._generate_int32_data(self.nr, self.nc) + m = np.int32(-1) + M = np.int32(1) + ac = np.zeros(a.shape, dtype=np.int64) + act = ac.copy() + self.fastclip(a, m, M, ac) + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_array_int32(self): + # Test native int32 input with double array min/max and int32 out + a = self._generate_int32_data(self.nr, self.nc) + m = np.zeros(a.shape, np.float64) + M = np.float64(1) + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + self.fastclip(a, m, M, out=ac, casting="unsafe") + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_array_outint32(self): + # Test native double input with scalar min/max and int out + a = self._generate_data(self.nr, self.nc) + m = -1.0 + M = 2.0 + ac = np.zeros(a.shape, dtype=np.int32) + act = ac.copy() + self.fastclip(a, m, M, out=ac, casting="unsafe") + self.clip(a, m, M, act) + assert_array_strict_equal(ac, act) + + def test_clip_with_out_transposed(self): + # Test that the out argument works when transposed + a = np.arange(16).reshape(4, 4) + out = np.empty_like(a).T + a.clip(4, 10, out=out) + expected = self.clip(a, 4, 10) + assert_array_equal(out, expected) + + def test_clip_with_out_memory_overlap(self): + # Test that the out argument works when it has memory overlap + a = np.arange(16).reshape(4, 4) + ac = a.copy() + a[:-1].clip(4, 10, out=a[1:]) + expected = self.clip(ac[:-1], 4, 10) + assert_array_equal(a[1:], expected) + + def test_clip_inplace_array(self): + # Test native double input with array min/max + a = self._generate_data(self.nr, self.nc) + ac = a.copy() + m = np.zeros(a.shape) + M = 1.0 + self.fastclip(a, m, M, a) + self.clip(a, m, M, ac) + assert_array_strict_equal(a, ac) + + def test_clip_inplace_simple(self): + # Test native double input with scalar min/max + a = self._generate_data(self.nr, self.nc) + ac = a.copy() + m = -0.5 + M = 0.6 + self.fastclip(a, m, M, a) + self.clip(a, m, M, ac) + assert_array_strict_equal(a, ac) + + def test_clip_func_takes_out(self): + # Ensure that the clip() function takes an out=argument. + a = self._generate_data(self.nr, self.nc) + ac = a.copy() + m = -0.5 + M = 0.6 + a2 = np.clip(a, m, M, out=a) + self.clip(a, m, M, ac) + assert_array_strict_equal(a2, ac) + assert_(a2 is a) + + def test_clip_nan(self): + d = np.arange(7.) + assert_equal(d.clip(min=np.nan), np.nan) + assert_equal(d.clip(max=np.nan), np.nan) + assert_equal(d.clip(min=np.nan, max=np.nan), np.nan) + assert_equal(d.clip(min=-2, max=np.nan), np.nan) + assert_equal(d.clip(min=np.nan, max=10), np.nan) + + def test_object_clip(self): + a = np.arange(10, dtype=object) + actual = np.clip(a, 1, 5) + expected = np.array([1, 1, 2, 3, 4, 5, 5, 5, 5, 5]) + assert actual.tolist() == expected.tolist() + + def test_clip_all_none(self): + arr = np.arange(10, dtype=object) + assert_equal(np.clip(arr, None, None), arr) + assert_equal(np.clip(arr), arr) + + def test_clip_invalid_casting(self): + a = np.arange(10, dtype=object) + with assert_raises_regex(ValueError, + 'casting must be one of'): + self.fastclip(a, 1, 8, casting="garbage") + + @pytest.mark.parametrize("amin, amax", [ + # two scalars + (1, 0), + # mix scalar and array + (1, np.zeros(10)), + # two arrays + (np.ones(10), np.zeros(10)), + ]) + def test_clip_value_min_max_flip(self, amin, amax): + a = np.arange(10, dtype=np.int64) + # requirement from ufunc_docstrings.py + expected = np.minimum(np.maximum(a, amin), amax) + actual = np.clip(a, amin, amax) + assert_equal(actual, expected) + + @pytest.mark.parametrize("arr, amin, amax, exp", [ + # for a bug in npy_ObjectClip, based on a + # case produced by hypothesis + (np.zeros(10, dtype=object), + 0, + -2**64+1, + np.full(10, -2**64+1, dtype=object)), + # for bugs in NPY_TIMEDELTA_MAX, based on a case + # produced by hypothesis + (np.zeros(10, dtype='m8') - 1, + 0, + 0, + np.zeros(10, dtype='m8')), + ]) + def test_clip_problem_cases(self, arr, amin, amax, exp): + actual = np.clip(arr, amin, amax) + assert_equal(actual, exp) + + @pytest.mark.parametrize("arr, amin, amax", [ + # problematic scalar nan case from hypothesis + (np.zeros(10, dtype=np.int64), + np.array(np.nan), + np.zeros(10, dtype=np.int32)), + ]) + def test_clip_scalar_nan_propagation(self, arr, amin, amax): + # enforcement of scalar nan propagation for comparisons + # called through clip() + expected = np.minimum(np.maximum(arr, amin), amax) + actual = np.clip(arr, amin, amax) + assert_equal(actual, expected) + + @pytest.mark.xfail(reason="propagation doesn't match spec") + @pytest.mark.parametrize("arr, amin, amax", [ + (np.array([1] * 10, dtype='m8'), + np.timedelta64('NaT'), + np.zeros(10, dtype=np.int32)), + ]) + @pytest.mark.filterwarnings("ignore::DeprecationWarning") + def test_NaT_propagation(self, arr, amin, amax): + # NOTE: the expected function spec doesn't + # propagate NaT, but clip() now does + expected = np.minimum(np.maximum(arr, amin), amax) + actual = np.clip(arr, amin, amax) + assert_equal(actual, expected) + + @given( + data=st.data(), + arr=hynp.arrays( + dtype=hynp.integer_dtypes() | hynp.floating_dtypes(), + shape=hynp.array_shapes() + ) + ) + def test_clip_property(self, data, arr): + """A property-based test using Hypothesis. + + This aims for maximum generality: it could in principle generate *any* + valid inputs to np.clip, and in practice generates much more varied + inputs than human testers come up with. + + Because many of the inputs have tricky dependencies - compatible dtypes + and mutually-broadcastable shapes - we use `st.data()` strategy draw + values *inside* the test function, from strategies we construct based + on previous values. An alternative would be to define a custom strategy + with `@st.composite`, but until we have duplicated code inline is fine. + + That accounts for most of the function; the actual test is just three + lines to calculate and compare actual vs expected results! + """ + numeric_dtypes = hynp.integer_dtypes() | hynp.floating_dtypes() + # Generate shapes for the bounds which can be broadcast with each other + # and with the base shape. Below, we might decide to use scalar bounds, + # but it's clearer to generate these shapes unconditionally in advance. + in_shapes, result_shape = data.draw( + hynp.mutually_broadcastable_shapes( + num_shapes=2, base_shape=arr.shape + ) + ) + # Scalar `nan` is deprecated due to the differing behaviour it shows. + s = numeric_dtypes.flatmap( + lambda x: hynp.from_dtype(x, allow_nan=False)) + amin = data.draw(s | hynp.arrays(dtype=numeric_dtypes, + shape=in_shapes[0], elements={"allow_nan": False})) + amax = data.draw(s | hynp.arrays(dtype=numeric_dtypes, + shape=in_shapes[1], elements={"allow_nan": False})) + + # Then calculate our result and expected result and check that they're + # equal! See gh-12519 and gh-19457 for discussion deciding on this + # property and the result_type argument. + result = np.clip(arr, amin, amax) + t = np.result_type(arr, amin, amax) + expected = np.minimum(amax, np.maximum(arr, amin, dtype=t), dtype=t) + assert result.dtype == t + assert_array_equal(result, expected) + + def test_clip_min_max_args(self): + arr = np.arange(5) + + assert_array_equal(np.clip(arr), arr) + assert_array_equal(np.clip(arr, min=2, max=3), np.clip(arr, 2, 3)) + assert_array_equal(np.clip(arr, min=None, max=2), + np.clip(arr, None, 2)) + + with assert_raises_regex(TypeError, "missing 1 required positional " + "argument: 'a_max'"): + np.clip(arr, 2) + with assert_raises_regex(TypeError, "missing 1 required positional " + "argument: 'a_min'"): + np.clip(arr, a_max=2) + msg = ("Passing `min` or `max` keyword argument when `a_min` and " + "`a_max` are provided is forbidden.") + with assert_raises_regex(ValueError, msg): + np.clip(arr, 2, 3, max=3) + with assert_raises_regex(ValueError, msg): + np.clip(arr, 2, 3, min=2) + + @pytest.mark.parametrize("dtype,min,max", [ + ("int32", -2**32-1, 2**32), + ("int32", -2**320, None), + ("int32", None, 2**300), + ("int32", -1000, 2**32), + ("int32", -2**32-1, 1000), + ("uint8", -1, 129), + ]) + def test_out_of_bound_pyints(self, dtype, min, max): + a = np.arange(10000).astype(dtype) + # Check min only + c = np.clip(a, min=min, max=max) + assert not np.may_share_memory(a, c) + assert c.dtype == a.dtype + if min is not None: + assert (c >= min).all() + if max is not None: + assert (c <= max).all() + +class TestAllclose: + rtol = 1e-5 + atol = 1e-8 + + def setup_method(self): + self.olderr = np.seterr(invalid='ignore') + + def teardown_method(self): + np.seterr(**self.olderr) + + def tst_allclose(self, x, y): + assert_(np.allclose(x, y), "%s and %s not close" % (x, y)) + + def tst_not_allclose(self, x, y): + assert_(not np.allclose(x, y), "%s and %s shouldn't be close" % (x, y)) + + def test_ip_allclose(self): + # Parametric test factory. + arr = np.array([100, 1000]) + aran = np.arange(125).reshape((5, 5, 5)) + + atol = self.atol + rtol = self.rtol + + data = [([1, 0], [1, 0]), + ([atol], [0]), + ([1], [1+rtol+atol]), + (arr, arr + arr*rtol), + (arr, arr + arr*rtol + atol*2), + (aran, aran + aran*rtol), + (np.inf, np.inf), + (np.inf, [np.inf])] + + for (x, y) in data: + self.tst_allclose(x, y) + + def test_ip_not_allclose(self): + # Parametric test factory. + aran = np.arange(125).reshape((5, 5, 5)) + + atol = self.atol + rtol = self.rtol + + data = [([np.inf, 0], [1, np.inf]), + ([np.inf, 0], [1, 0]), + ([np.inf, np.inf], [1, np.inf]), + ([np.inf, np.inf], [1, 0]), + ([-np.inf, 0], [np.inf, 0]), + ([np.nan, 0], [np.nan, 0]), + ([atol*2], [0]), + ([1], [1+rtol+atol*2]), + (aran, aran + aran*atol + atol*2), + (np.array([np.inf, 1]), np.array([0, np.inf]))] + + for (x, y) in data: + self.tst_not_allclose(x, y) + + def test_no_parameter_modification(self): + x = np.array([np.inf, 1]) + y = np.array([0, np.inf]) + np.allclose(x, y) + assert_array_equal(x, np.array([np.inf, 1])) + assert_array_equal(y, np.array([0, np.inf])) + + def test_min_int(self): + # Could make problems because of abs(min_int) == min_int + min_int = np.iinfo(np.int_).min + a = np.array([min_int], dtype=np.int_) + assert_(np.allclose(a, a)) + + def test_equalnan(self): + x = np.array([1.0, np.nan]) + assert_(np.allclose(x, x, equal_nan=True)) + + def test_return_class_is_ndarray(self): + # Issue gh-6475 + # Check that allclose does not preserve subtypes + class Foo(np.ndarray): + def __new__(cls, *args, **kwargs): + return np.array(*args, **kwargs).view(cls) + + a = Foo([1]) + assert_(type(np.allclose(a, a)) is bool) + + +class TestIsclose: + rtol = 1e-5 + atol = 1e-8 + + def _setup(self): + atol = self.atol + rtol = self.rtol + arr = np.array([100, 1000]) + aran = np.arange(125).reshape((5, 5, 5)) + + self.all_close_tests = [ + ([1, 0], [1, 0]), + ([atol], [0]), + ([1], [1 + rtol + atol]), + (arr, arr + arr*rtol), + (arr, arr + arr*rtol + atol), + (aran, aran + aran*rtol), + (np.inf, np.inf), + (np.inf, [np.inf]), + ([np.inf, -np.inf], [np.inf, -np.inf]), + ] + self.none_close_tests = [ + ([np.inf, 0], [1, np.inf]), + ([np.inf, -np.inf], [1, 0]), + ([np.inf, np.inf], [1, -np.inf]), + ([np.inf, np.inf], [1, 0]), + ([np.nan, 0], [np.nan, -np.inf]), + ([atol*2], [0]), + ([1], [1 + rtol + atol*2]), + (aran, aran + rtol*1.1*aran + atol*1.1), + (np.array([np.inf, 1]), np.array([0, np.inf])), + ] + self.some_close_tests = [ + ([np.inf, 0], [np.inf, atol*2]), + ([atol, 1, 1e6*(1 + 2*rtol) + atol], [0, np.nan, 1e6]), + (np.arange(3), [0, 1, 2.1]), + (np.nan, [np.nan, np.nan, np.nan]), + ([0], [atol, np.inf, -np.inf, np.nan]), + (0, [atol, np.inf, -np.inf, np.nan]), + ] + self.some_close_results = [ + [True, False], + [True, False, False], + [True, True, False], + [False, False, False], + [True, False, False, False], + [True, False, False, False], + ] + + def test_ip_isclose(self): + self._setup() + tests = self.some_close_tests + results = self.some_close_results + for (x, y), result in zip(tests, results): + assert_array_equal(np.isclose(x, y), result) + + x = np.array([2.1, 2.1, 2.1, 2.1, 5, np.nan]) + y = np.array([2, 2, 2, 2, np.nan, 5]) + atol = [0.11, 0.09, 1e-8, 1e-8, 1, 1] + rtol = [1e-8, 1e-8, 0.06, 0.04, 1, 1] + expected = np.array([True, False, True, False, False, False]) + assert_array_equal(np.isclose(x, y, rtol=rtol, atol=atol), expected) + + message = "operands could not be broadcast together..." + atol = np.array([1e-8, 1e-8]) + with assert_raises(ValueError, msg=message): + np.isclose(x, y, atol=atol) + + rtol = np.array([1e-5, 1e-5]) + with assert_raises(ValueError, msg=message): + np.isclose(x, y, rtol=rtol) + + def test_nep50_isclose(self): + below_one = float(1.-np.finfo('f8').eps) + f32 = np.array(below_one, 'f4') # This is just 1 at float32 precision + assert f32 > np.array(below_one) + # NEP 50 broadcasting of python scalars + assert f32 == below_one + # Test that it works for isclose arguments too (and that those fail if + # one uses a numpy float64). + assert np.isclose(f32, below_one, atol=0, rtol=0) + assert np.isclose(f32, np.float32(0), atol=below_one) + assert np.isclose(f32, 2, atol=0, rtol=below_one/2) + assert not np.isclose(f32, np.float64(below_one), atol=0, rtol=0) + assert not np.isclose(f32, np.float32(0), atol=np.float64(below_one)) + assert not np.isclose(f32, 2, atol=0, rtol=np.float64(below_one/2)) + + def tst_all_isclose(self, x, y): + assert_(np.all(np.isclose(x, y)), "%s and %s not close" % (x, y)) + + def tst_none_isclose(self, x, y): + msg = "%s and %s shouldn't be close" + assert_(not np.any(np.isclose(x, y)), msg % (x, y)) + + def tst_isclose_allclose(self, x, y): + msg = "isclose.all() and allclose aren't same for %s and %s" + msg2 = "isclose and allclose aren't same for %s and %s" + if np.isscalar(x) and np.isscalar(y): + assert_(np.isclose(x, y) == np.allclose(x, y), msg=msg2 % (x, y)) + else: + assert_array_equal(np.isclose(x, y).all(), np.allclose(x, y), msg % (x, y)) + + def test_ip_all_isclose(self): + self._setup() + for (x, y) in self.all_close_tests: + self.tst_all_isclose(x, y) + + x = np.array([2.3, 3.6, 4.4, np.nan]) + y = np.array([2, 3, 4, np.nan]) + atol = [0.31, 0, 0, 1] + rtol = [0, 0.21, 0.11, 1] + assert np.allclose(x, y, atol=atol, rtol=rtol, equal_nan=True) + assert not np.allclose(x, y, atol=0.1, rtol=0.1, equal_nan=True) + + # Show that gh-14330 is resolved + assert np.allclose([1, 2, float('nan')], [1, 2, float('nan')], + atol=[1, 1, 1], equal_nan=True) + + def test_ip_none_isclose(self): + self._setup() + for (x, y) in self.none_close_tests: + self.tst_none_isclose(x, y) + + def test_ip_isclose_allclose(self): + self._setup() + tests = (self.all_close_tests + self.none_close_tests + + self.some_close_tests) + for (x, y) in tests: + self.tst_isclose_allclose(x, y) + + def test_equal_nan(self): + assert_array_equal(np.isclose(np.nan, np.nan, equal_nan=True), [True]) + arr = np.array([1.0, np.nan]) + assert_array_equal(np.isclose(arr, arr, equal_nan=True), [True, True]) + + def test_masked_arrays(self): + # Make sure to test the output type when arguments are interchanged. + + x = np.ma.masked_where([True, True, False], np.arange(3)) + assert_(type(x) is type(np.isclose(2, x))) + assert_(type(x) is type(np.isclose(x, 2))) + + x = np.ma.masked_where([True, True, False], [np.nan, np.inf, np.nan]) + assert_(type(x) is type(np.isclose(np.inf, x))) + assert_(type(x) is type(np.isclose(x, np.inf))) + + x = np.ma.masked_where([True, True, False], [np.nan, np.nan, np.nan]) + y = np.isclose(np.nan, x, equal_nan=True) + assert_(type(x) is type(y)) + # Ensure that the mask isn't modified... + assert_array_equal([True, True, False], y.mask) + y = np.isclose(x, np.nan, equal_nan=True) + assert_(type(x) is type(y)) + # Ensure that the mask isn't modified... + assert_array_equal([True, True, False], y.mask) + + x = np.ma.masked_where([True, True, False], [np.nan, np.nan, np.nan]) + y = np.isclose(x, x, equal_nan=True) + assert_(type(x) is type(y)) + # Ensure that the mask isn't modified... + assert_array_equal([True, True, False], y.mask) + + def test_scalar_return(self): + assert_(np.isscalar(np.isclose(1, 1))) + + def test_no_parameter_modification(self): + x = np.array([np.inf, 1]) + y = np.array([0, np.inf]) + np.isclose(x, y) + assert_array_equal(x, np.array([np.inf, 1])) + assert_array_equal(y, np.array([0, np.inf])) + + def test_non_finite_scalar(self): + # GH7014, when two scalars are compared the output should also be a + # scalar + assert_(np.isclose(np.inf, -np.inf) is np.False_) + assert_(np.isclose(0, np.inf) is np.False_) + assert_(type(np.isclose(0, np.inf)) is np.bool) + + def test_timedelta(self): + # Allclose currently works for timedelta64 as long as `atol` is + # an integer or also a timedelta64 + a = np.array([[1, 2, 3, "NaT"]], dtype="m8[ns]") + assert np.isclose(a, a, atol=0, equal_nan=True).all() + assert np.isclose(a, a, atol=np.timedelta64(1, "ns"), equal_nan=True).all() + assert np.allclose(a, a, atol=0, equal_nan=True) + assert np.allclose(a, a, atol=np.timedelta64(1, "ns"), equal_nan=True) + + +class TestStdVar: + def setup_method(self): + self.A = np.array([1, -1, 1, -1]) + self.real_var = 1 + + def test_basic(self): + assert_almost_equal(np.var(self.A), self.real_var) + assert_almost_equal(np.std(self.A)**2, self.real_var) + + def test_scalars(self): + assert_equal(np.var(1), 0) + assert_equal(np.std(1), 0) + + def test_ddof1(self): + assert_almost_equal(np.var(self.A, ddof=1), + self.real_var * len(self.A) / (len(self.A) - 1)) + assert_almost_equal(np.std(self.A, ddof=1)**2, + self.real_var*len(self.A) / (len(self.A) - 1)) + + def test_ddof2(self): + assert_almost_equal(np.var(self.A, ddof=2), + self.real_var * len(self.A) / (len(self.A) - 2)) + assert_almost_equal(np.std(self.A, ddof=2)**2, + self.real_var * len(self.A) / (len(self.A) - 2)) + + def test_correction(self): + assert_almost_equal( + np.var(self.A, correction=1), np.var(self.A, ddof=1) + ) + assert_almost_equal( + np.std(self.A, correction=1), np.std(self.A, ddof=1) + ) + + err_msg = "ddof and correction can't be provided simultaneously." + + with assert_raises_regex(ValueError, err_msg): + np.var(self.A, ddof=1, correction=0) + + with assert_raises_regex(ValueError, err_msg): + np.std(self.A, ddof=1, correction=1) + + def test_out_scalar(self): + d = np.arange(10) + out = np.array(0.) + r = np.std(d, out=out) + assert_(r is out) + assert_array_equal(r, out) + r = np.var(d, out=out) + assert_(r is out) + assert_array_equal(r, out) + r = np.mean(d, out=out) + assert_(r is out) + assert_array_equal(r, out) + + +class TestStdVarComplex: + def test_basic(self): + A = np.array([1, 1.j, -1, -1.j]) + real_var = 1 + assert_almost_equal(np.var(A), real_var) + assert_almost_equal(np.std(A)**2, real_var) + + def test_scalars(self): + assert_equal(np.var(1j), 0) + assert_equal(np.std(1j), 0) + + +class TestCreationFuncs: + # Test ones, zeros, empty and full. + + def setup_method(self): + dtypes = {np.dtype(tp) for tp in itertools.chain(*sctypes.values())} + # void, bytes, str + variable_sized = {tp for tp in dtypes if tp.str.endswith('0')} + keyfunc = lambda dtype: dtype.str + self.dtypes = sorted(dtypes - variable_sized | + {np.dtype(tp.str.replace("0", str(i))) + for tp in variable_sized for i in range(1, 10)}, + key=keyfunc) + self.dtypes += [type(dt) for dt in sorted(dtypes, key=keyfunc)] + self.orders = {'C': 'c_contiguous', 'F': 'f_contiguous'} + self.ndims = 10 + + def check_function(self, func, fill_value=None): + par = ((0, 1, 2), + range(self.ndims), + self.orders, + self.dtypes) + fill_kwarg = {} + if fill_value is not None: + fill_kwarg = {'fill_value': fill_value} + + for size, ndims, order, dtype in itertools.product(*par): + shape = ndims * [size] + + is_void = dtype is np.dtypes.VoidDType or ( + isinstance(dtype, np.dtype) and dtype.str.startswith('|V')) + + # do not fill void type + if fill_kwarg and is_void: + continue + + arr = func(shape, order=order, dtype=dtype, + **fill_kwarg) + + if isinstance(dtype, np.dtype): + assert_equal(arr.dtype, dtype) + elif isinstance(dtype, type(np.dtype)): + if dtype in (np.dtypes.StrDType, np.dtypes.BytesDType): + dtype_str = np.dtype(dtype.type).str.replace('0', '1') + assert_equal(arr.dtype, np.dtype(dtype_str)) + else: + assert_equal(arr.dtype, np.dtype(dtype.type)) + assert_(getattr(arr.flags, self.orders[order])) + + if fill_value is not None: + if arr.dtype.str.startswith('|S'): + val = str(fill_value) + else: + val = fill_value + assert_equal(arr, dtype.type(val)) + + def test_zeros(self): + self.check_function(np.zeros) + + def test_ones(self): + self.check_function(np.ones) + + def test_empty(self): + self.check_function(np.empty) + + def test_full(self): + self.check_function(np.full, 0) + self.check_function(np.full, 1) + + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_for_reference_leak(self): + # Make sure we have an object for reference + dim = 1 + beg = sys.getrefcount(dim) + np.zeros([dim]*10) + assert_(sys.getrefcount(dim) == beg) + np.ones([dim]*10) + assert_(sys.getrefcount(dim) == beg) + np.empty([dim]*10) + assert_(sys.getrefcount(dim) == beg) + np.full([dim]*10, 0) + assert_(sys.getrefcount(dim) == beg) + + +class TestLikeFuncs: + '''Test ones_like, zeros_like, empty_like and full_like''' + + def setup_method(self): + self.data = [ + # Array scalars + (np.array(3.), None), + (np.array(3), 'f8'), + # 1D arrays + (np.arange(6, dtype='f4'), None), + (np.arange(6), 'c16'), + # 2D C-layout arrays + (np.arange(6).reshape(2, 3), None), + (np.arange(6).reshape(3, 2), 'i1'), + # 2D F-layout arrays + (np.arange(6).reshape((2, 3), order='F'), None), + (np.arange(6).reshape((3, 2), order='F'), 'i1'), + # 3D C-layout arrays + (np.arange(24).reshape(2, 3, 4), None), + (np.arange(24).reshape(4, 3, 2), 'f4'), + # 3D F-layout arrays + (np.arange(24).reshape((2, 3, 4), order='F'), None), + (np.arange(24).reshape((4, 3, 2), order='F'), 'f4'), + # 3D non-C/F-layout arrays + (np.arange(24).reshape(2, 3, 4).swapaxes(0, 1), None), + (np.arange(24).reshape(4, 3, 2).swapaxes(0, 1), '?'), + ] + self.shapes = [(), (5,), (5,6,), (5,6,7,)] + + def compare_array_value(self, dz, value, fill_value): + if value is not None: + if fill_value: + # Conversion is close to what np.full_like uses + # but we may want to convert directly in the future + # which may result in errors (where this does not). + z = np.array(value).astype(dz.dtype) + assert_(np.all(dz == z)) + else: + assert_(np.all(dz == value)) + + def check_like_function(self, like_function, value, fill_value=False): + if fill_value: + fill_kwarg = {'fill_value': value} + else: + fill_kwarg = {} + for d, dtype in self.data: + # default (K) order, dtype + dz = like_function(d, dtype=dtype, **fill_kwarg) + assert_equal(dz.shape, d.shape) + assert_equal(np.array(dz.strides)*d.dtype.itemsize, + np.array(d.strides)*dz.dtype.itemsize) + assert_equal(d.flags.c_contiguous, dz.flags.c_contiguous) + assert_equal(d.flags.f_contiguous, dz.flags.f_contiguous) + if dtype is None: + assert_equal(dz.dtype, d.dtype) + else: + assert_equal(dz.dtype, np.dtype(dtype)) + self.compare_array_value(dz, value, fill_value) + + # C order, default dtype + dz = like_function(d, order='C', dtype=dtype, **fill_kwarg) + assert_equal(dz.shape, d.shape) + assert_(dz.flags.c_contiguous) + if dtype is None: + assert_equal(dz.dtype, d.dtype) + else: + assert_equal(dz.dtype, np.dtype(dtype)) + self.compare_array_value(dz, value, fill_value) + + # F order, default dtype + dz = like_function(d, order='F', dtype=dtype, **fill_kwarg) + assert_equal(dz.shape, d.shape) + assert_(dz.flags.f_contiguous) + if dtype is None: + assert_equal(dz.dtype, d.dtype) + else: + assert_equal(dz.dtype, np.dtype(dtype)) + self.compare_array_value(dz, value, fill_value) + + # A order + dz = like_function(d, order='A', dtype=dtype, **fill_kwarg) + assert_equal(dz.shape, d.shape) + if d.flags.f_contiguous: + assert_(dz.flags.f_contiguous) + else: + assert_(dz.flags.c_contiguous) + if dtype is None: + assert_equal(dz.dtype, d.dtype) + else: + assert_equal(dz.dtype, np.dtype(dtype)) + self.compare_array_value(dz, value, fill_value) + + # Test the 'shape' parameter + for s in self.shapes: + for o in 'CFA': + sz = like_function(d, dtype=dtype, shape=s, order=o, + **fill_kwarg) + assert_equal(sz.shape, s) + if dtype is None: + assert_equal(sz.dtype, d.dtype) + else: + assert_equal(sz.dtype, np.dtype(dtype)) + if o == 'C' or (o == 'A' and d.flags.c_contiguous): + assert_(sz.flags.c_contiguous) + elif o == 'F' or (o == 'A' and d.flags.f_contiguous): + assert_(sz.flags.f_contiguous) + self.compare_array_value(sz, value, fill_value) + + if (d.ndim != len(s)): + assert_equal(np.argsort(like_function(d, dtype=dtype, + shape=s, order='K', + **fill_kwarg).strides), + np.argsort(np.empty(s, dtype=dtype, + order='C').strides)) + else: + assert_equal(np.argsort(like_function(d, dtype=dtype, + shape=s, order='K', + **fill_kwarg).strides), + np.argsort(d.strides)) + + # Test the 'subok' parameter + class MyNDArray(np.ndarray): + pass + + a = np.array([[1, 2], [3, 4]]).view(MyNDArray) + + b = like_function(a, **fill_kwarg) + assert_(type(b) is MyNDArray) + + b = like_function(a, subok=False, **fill_kwarg) + assert_(type(b) is not MyNDArray) + + # Test invalid dtype + with assert_raises(TypeError): + a = np.array(b"abc") + like_function(a, dtype="S-1", **fill_kwarg) + + def test_ones_like(self): + self.check_like_function(np.ones_like, 1) + + def test_zeros_like(self): + self.check_like_function(np.zeros_like, 0) + + def test_empty_like(self): + self.check_like_function(np.empty_like, None) + + def test_filled_like(self): + self.check_like_function(np.full_like, 0, True) + self.check_like_function(np.full_like, 1, True) + # Large integers may overflow, but using int64 is OK (casts) + # see also gh-27075 + with pytest.raises(OverflowError): + np.full_like(np.ones(3, dtype=np.int8), 1000) + self.check_like_function(np.full_like, np.int64(1000), True) + self.check_like_function(np.full_like, 123.456, True) + # Inf to integer casts cause invalid-value errors: ignore them. + with np.errstate(invalid="ignore"): + self.check_like_function(np.full_like, np.inf, True) + + @pytest.mark.parametrize('likefunc', [np.empty_like, np.full_like, + np.zeros_like, np.ones_like]) + @pytest.mark.parametrize('dtype', [str, bytes]) + def test_dtype_str_bytes(self, likefunc, dtype): + # Regression test for gh-19860 + a = np.arange(16).reshape(2, 8) + b = a[:, ::2] # Ensure b is not contiguous. + kwargs = {'fill_value': ''} if likefunc == np.full_like else {} + result = likefunc(b, dtype=dtype, **kwargs) + if dtype == str: + assert result.strides == (16, 4) + else: + # dtype is bytes + assert result.strides == (4, 1) + + +class TestCorrelate: + def _setup(self, dt): + self.x = np.array([1, 2, 3, 4, 5], dtype=dt) + self.xs = np.arange(1, 20)[::3] + self.y = np.array([-1, -2, -3], dtype=dt) + self.z1 = np.array([-3., -8., -14., -20., -26., -14., -5.], dtype=dt) + self.z1_4 = np.array([-2., -5., -8., -11., -14., -5.], dtype=dt) + self.z1r = np.array([-15., -22., -22., -16., -10., -4., -1.], dtype=dt) + self.z2 = np.array([-5., -14., -26., -20., -14., -8., -3.], dtype=dt) + self.z2r = np.array([-1., -4., -10., -16., -22., -22., -15.], dtype=dt) + self.zs = np.array([-3., -14., -30., -48., -66., -84., + -102., -54., -19.], dtype=dt) + + def test_float(self): + self._setup(float) + z = np.correlate(self.x, self.y, 'full') + assert_array_almost_equal(z, self.z1) + z = np.correlate(self.x, self.y[:-1], 'full') + assert_array_almost_equal(z, self.z1_4) + z = np.correlate(self.y, self.x, 'full') + assert_array_almost_equal(z, self.z2) + z = np.correlate(self.x[::-1], self.y, 'full') + assert_array_almost_equal(z, self.z1r) + z = np.correlate(self.y, self.x[::-1], 'full') + assert_array_almost_equal(z, self.z2r) + z = np.correlate(self.xs, self.y, 'full') + assert_array_almost_equal(z, self.zs) + + def test_object(self): + self._setup(Decimal) + z = np.correlate(self.x, self.y, 'full') + assert_array_almost_equal(z, self.z1) + z = np.correlate(self.y, self.x, 'full') + assert_array_almost_equal(z, self.z2) + + def test_no_overwrite(self): + d = np.ones(100) + k = np.ones(3) + np.correlate(d, k) + assert_array_equal(d, np.ones(100)) + assert_array_equal(k, np.ones(3)) + + def test_complex(self): + x = np.array([1, 2, 3, 4+1j], dtype=complex) + y = np.array([-1, -2j, 3+1j], dtype=complex) + r_z = np.array([3-1j, 6, 8+1j, 11+5j, -5+8j, -4-1j], dtype=complex) + r_z = r_z[::-1].conjugate() + z = np.correlate(y, x, mode='full') + assert_array_almost_equal(z, r_z) + + def test_zero_size(self): + with pytest.raises(ValueError): + np.correlate(np.array([]), np.ones(1000), mode='full') + with pytest.raises(ValueError): + np.correlate(np.ones(1000), np.array([]), mode='full') + + def test_mode(self): + d = np.ones(100) + k = np.ones(3) + default_mode = np.correlate(d, k, mode='valid') + with assert_warns(DeprecationWarning): + valid_mode = np.correlate(d, k, mode='v') + assert_array_equal(valid_mode, default_mode) + # integer mode + with assert_raises(ValueError): + np.correlate(d, k, mode=-1) + assert_array_equal(np.correlate(d, k, mode=0), valid_mode) + # illegal arguments + with assert_raises(TypeError): + np.correlate(d, k, mode=None) + + +class TestConvolve: + def test_object(self): + d = [1.] * 100 + k = [1.] * 3 + assert_array_almost_equal(np.convolve(d, k)[2:-2], np.full(98, 3)) + + def test_no_overwrite(self): + d = np.ones(100) + k = np.ones(3) + np.convolve(d, k) + assert_array_equal(d, np.ones(100)) + assert_array_equal(k, np.ones(3)) + + def test_mode(self): + d = np.ones(100) + k = np.ones(3) + default_mode = np.convolve(d, k, mode='full') + with assert_warns(DeprecationWarning): + full_mode = np.convolve(d, k, mode='f') + assert_array_equal(full_mode, default_mode) + # integer mode + with assert_raises(ValueError): + np.convolve(d, k, mode=-1) + assert_array_equal(np.convolve(d, k, mode=2), full_mode) + # illegal arguments + with assert_raises(TypeError): + np.convolve(d, k, mode=None) + + +class TestArgwhere: + + @pytest.mark.parametrize('nd', [0, 1, 2]) + def test_nd(self, nd): + # get an nd array with multiple elements in every dimension + x = np.empty((2,)*nd, bool) + + # none + x[...] = False + assert_equal(np.argwhere(x).shape, (0, nd)) + + # only one + x[...] = False + x.flat[0] = True + assert_equal(np.argwhere(x).shape, (1, nd)) + + # all but one + x[...] = True + x.flat[0] = False + assert_equal(np.argwhere(x).shape, (x.size - 1, nd)) + + # all + x[...] = True + assert_equal(np.argwhere(x).shape, (x.size, nd)) + + def test_2D(self): + x = np.arange(6).reshape((2, 3)) + assert_array_equal(np.argwhere(x > 1), + [[0, 2], + [1, 0], + [1, 1], + [1, 2]]) + + def test_list(self): + assert_equal(np.argwhere([4, 0, 2, 1, 3]), [[0], [2], [3], [4]]) + + +class TestRoll: + def test_roll1d(self): + x = np.arange(10) + xr = np.roll(x, 2) + assert_equal(xr, np.array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7])) + + def test_roll2d(self): + x2 = np.reshape(np.arange(10), (2, 5)) + x2r = np.roll(x2, 1) + assert_equal(x2r, np.array([[9, 0, 1, 2, 3], [4, 5, 6, 7, 8]])) + + x2r = np.roll(x2, 1, axis=0) + assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) + + x2r = np.roll(x2, 1, axis=1) + assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) + + # Roll multiple axes at once. + x2r = np.roll(x2, 1, axis=(0, 1)) + assert_equal(x2r, np.array([[9, 5, 6, 7, 8], [4, 0, 1, 2, 3]])) + + x2r = np.roll(x2, (1, 0), axis=(0, 1)) + assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) + + x2r = np.roll(x2, (-1, 0), axis=(0, 1)) + assert_equal(x2r, np.array([[5, 6, 7, 8, 9], [0, 1, 2, 3, 4]])) + + x2r = np.roll(x2, (0, 1), axis=(0, 1)) + assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) + + x2r = np.roll(x2, (0, -1), axis=(0, 1)) + assert_equal(x2r, np.array([[1, 2, 3, 4, 0], [6, 7, 8, 9, 5]])) + + x2r = np.roll(x2, (1, 1), axis=(0, 1)) + assert_equal(x2r, np.array([[9, 5, 6, 7, 8], [4, 0, 1, 2, 3]])) + + x2r = np.roll(x2, (-1, -1), axis=(0, 1)) + assert_equal(x2r, np.array([[6, 7, 8, 9, 5], [1, 2, 3, 4, 0]])) + + # Roll the same axis multiple times. + x2r = np.roll(x2, 1, axis=(0, 0)) + assert_equal(x2r, np.array([[0, 1, 2, 3, 4], [5, 6, 7, 8, 9]])) + + x2r = np.roll(x2, 1, axis=(1, 1)) + assert_equal(x2r, np.array([[3, 4, 0, 1, 2], [8, 9, 5, 6, 7]])) + + # Roll more than one turn in either direction. + x2r = np.roll(x2, 6, axis=1) + assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) + + x2r = np.roll(x2, -4, axis=1) + assert_equal(x2r, np.array([[4, 0, 1, 2, 3], [9, 5, 6, 7, 8]])) + + def test_roll_empty(self): + x = np.array([]) + assert_equal(np.roll(x, 1), np.array([])) + + +class TestRollaxis: + + # expected shape indexed by (axis, start) for array of + # shape (1, 2, 3, 4) + tgtshape = {(0, 0): (1, 2, 3, 4), (0, 1): (1, 2, 3, 4), + (0, 2): (2, 1, 3, 4), (0, 3): (2, 3, 1, 4), + (0, 4): (2, 3, 4, 1), + (1, 0): (2, 1, 3, 4), (1, 1): (1, 2, 3, 4), + (1, 2): (1, 2, 3, 4), (1, 3): (1, 3, 2, 4), + (1, 4): (1, 3, 4, 2), + (2, 0): (3, 1, 2, 4), (2, 1): (1, 3, 2, 4), + (2, 2): (1, 2, 3, 4), (2, 3): (1, 2, 3, 4), + (2, 4): (1, 2, 4, 3), + (3, 0): (4, 1, 2, 3), (3, 1): (1, 4, 2, 3), + (3, 2): (1, 2, 4, 3), (3, 3): (1, 2, 3, 4), + (3, 4): (1, 2, 3, 4)} + + def test_exceptions(self): + a = np.arange(1*2*3*4).reshape(1, 2, 3, 4) + assert_raises(AxisError, np.rollaxis, a, -5, 0) + assert_raises(AxisError, np.rollaxis, a, 0, -5) + assert_raises(AxisError, np.rollaxis, a, 4, 0) + assert_raises(AxisError, np.rollaxis, a, 0, 5) + + def test_results(self): + a = np.arange(1*2*3*4).reshape(1, 2, 3, 4).copy() + aind = np.indices(a.shape) + assert_(a.flags['OWNDATA']) + for (i, j) in self.tgtshape: + # positive axis, positive start + res = np.rollaxis(a, axis=i, start=j) + i0, i1, i2, i3 = aind[np.array(res.shape) - 1] + assert_(np.all(res[i0, i1, i2, i3] == a)) + assert_(res.shape == self.tgtshape[(i, j)], str((i,j))) + assert_(not res.flags['OWNDATA']) + + # negative axis, positive start + ip = i + 1 + res = np.rollaxis(a, axis=-ip, start=j) + i0, i1, i2, i3 = aind[np.array(res.shape) - 1] + assert_(np.all(res[i0, i1, i2, i3] == a)) + assert_(res.shape == self.tgtshape[(4 - ip, j)]) + assert_(not res.flags['OWNDATA']) + + # positive axis, negative start + jp = j + 1 if j < 4 else j + res = np.rollaxis(a, axis=i, start=-jp) + i0, i1, i2, i3 = aind[np.array(res.shape) - 1] + assert_(np.all(res[i0, i1, i2, i3] == a)) + assert_(res.shape == self.tgtshape[(i, 4 - jp)]) + assert_(not res.flags['OWNDATA']) + + # negative axis, negative start + ip = i + 1 + jp = j + 1 if j < 4 else j + res = np.rollaxis(a, axis=-ip, start=-jp) + i0, i1, i2, i3 = aind[np.array(res.shape) - 1] + assert_(np.all(res[i0, i1, i2, i3] == a)) + assert_(res.shape == self.tgtshape[(4 - ip, 4 - jp)]) + assert_(not res.flags['OWNDATA']) + + +class TestMoveaxis: + def test_move_to_end(self): + x = np.random.randn(5, 6, 7) + for source, expected in [(0, (6, 7, 5)), + (1, (5, 7, 6)), + (2, (5, 6, 7)), + (-1, (5, 6, 7))]: + actual = np.moveaxis(x, source, -1).shape + assert_(actual, expected) + + def test_move_new_position(self): + x = np.random.randn(1, 2, 3, 4) + for source, destination, expected in [ + (0, 1, (2, 1, 3, 4)), + (1, 2, (1, 3, 2, 4)), + (1, -1, (1, 3, 4, 2)), + ]: + actual = np.moveaxis(x, source, destination).shape + assert_(actual, expected) + + def test_preserve_order(self): + x = np.zeros((1, 2, 3, 4)) + for source, destination in [ + (0, 0), + (3, -1), + (-1, 3), + ([0, -1], [0, -1]), + ([2, 0], [2, 0]), + (range(4), range(4)), + ]: + actual = np.moveaxis(x, source, destination).shape + assert_(actual, (1, 2, 3, 4)) + + def test_move_multiples(self): + x = np.zeros((0, 1, 2, 3)) + for source, destination, expected in [ + ([0, 1], [2, 3], (2, 3, 0, 1)), + ([2, 3], [0, 1], (2, 3, 0, 1)), + ([0, 1, 2], [2, 3, 0], (2, 3, 0, 1)), + ([3, 0], [1, 0], (0, 3, 1, 2)), + ([0, 3], [0, 1], (0, 3, 1, 2)), + ]: + actual = np.moveaxis(x, source, destination).shape + assert_(actual, expected) + + def test_errors(self): + x = np.random.randn(1, 2, 3) + assert_raises_regex(AxisError, 'source.*out of bounds', + np.moveaxis, x, 3, 0) + assert_raises_regex(AxisError, 'source.*out of bounds', + np.moveaxis, x, -4, 0) + assert_raises_regex(AxisError, 'destination.*out of bounds', + np.moveaxis, x, 0, 5) + assert_raises_regex(ValueError, 'repeated axis in `source`', + np.moveaxis, x, [0, 0], [0, 1]) + assert_raises_regex(ValueError, 'repeated axis in `destination`', + np.moveaxis, x, [0, 1], [1, 1]) + assert_raises_regex(ValueError, 'must have the same number', + np.moveaxis, x, 0, [0, 1]) + assert_raises_regex(ValueError, 'must have the same number', + np.moveaxis, x, [0, 1], [0]) + + def test_array_likes(self): + x = np.ma.zeros((1, 2, 3)) + result = np.moveaxis(x, 0, 0) + assert_(x.shape, result.shape) + assert_(isinstance(result, np.ma.MaskedArray)) + + x = [1, 2, 3] + result = np.moveaxis(x, 0, 0) + assert_(x, list(result)) + assert_(isinstance(result, np.ndarray)) + + +class TestCross: + @pytest.mark.filterwarnings( + "ignore:.*2-dimensional vectors.*:DeprecationWarning" + ) + def test_2x2(self): + u = [1, 2] + v = [3, 4] + z = -2 + cp = np.cross(u, v) + assert_equal(cp, z) + cp = np.cross(v, u) + assert_equal(cp, -z) + + @pytest.mark.filterwarnings( + "ignore:.*2-dimensional vectors.*:DeprecationWarning" + ) + def test_2x3(self): + u = [1, 2] + v = [3, 4, 5] + z = np.array([10, -5, -2]) + cp = np.cross(u, v) + assert_equal(cp, z) + cp = np.cross(v, u) + assert_equal(cp, -z) + + def test_3x3(self): + u = [1, 2, 3] + v = [4, 5, 6] + z = np.array([-3, 6, -3]) + cp = np.cross(u, v) + assert_equal(cp, z) + cp = np.cross(v, u) + assert_equal(cp, -z) + + @pytest.mark.filterwarnings( + "ignore:.*2-dimensional vectors.*:DeprecationWarning" + ) + def test_broadcasting(self): + # Ticket #2624 (Trac #2032) + u = np.tile([1, 2], (11, 1)) + v = np.tile([3, 4], (11, 1)) + z = -2 + assert_equal(np.cross(u, v), z) + assert_equal(np.cross(v, u), -z) + assert_equal(np.cross(u, u), 0) + + u = np.tile([1, 2], (11, 1)).T + v = np.tile([3, 4, 5], (11, 1)) + z = np.tile([10, -5, -2], (11, 1)) + assert_equal(np.cross(u, v, axisa=0), z) + assert_equal(np.cross(v, u.T), -z) + assert_equal(np.cross(v, v), 0) + + u = np.tile([1, 2, 3], (11, 1)).T + v = np.tile([3, 4], (11, 1)).T + z = np.tile([-12, 9, -2], (11, 1)) + assert_equal(np.cross(u, v, axisa=0, axisb=0), z) + assert_equal(np.cross(v.T, u.T), -z) + assert_equal(np.cross(u.T, u.T), 0) + + u = np.tile([1, 2, 3], (5, 1)) + v = np.tile([4, 5, 6], (5, 1)).T + z = np.tile([-3, 6, -3], (5, 1)) + assert_equal(np.cross(u, v, axisb=0), z) + assert_equal(np.cross(v.T, u), -z) + assert_equal(np.cross(u, u), 0) + + @pytest.mark.filterwarnings( + "ignore:.*2-dimensional vectors.*:DeprecationWarning" + ) + def test_broadcasting_shapes(self): + u = np.ones((2, 1, 3)) + v = np.ones((5, 3)) + assert_equal(np.cross(u, v).shape, (2, 5, 3)) + u = np.ones((10, 3, 5)) + v = np.ones((2, 5)) + assert_equal(np.cross(u, v, axisa=1, axisb=0).shape, (10, 5, 3)) + assert_raises(AxisError, np.cross, u, v, axisa=1, axisb=2) + assert_raises(AxisError, np.cross, u, v, axisa=3, axisb=0) + u = np.ones((10, 3, 5, 7)) + v = np.ones((5, 7, 2)) + assert_equal(np.cross(u, v, axisa=1, axisc=2).shape, (10, 5, 3, 7)) + assert_raises(AxisError, np.cross, u, v, axisa=-5, axisb=2) + assert_raises(AxisError, np.cross, u, v, axisa=1, axisb=-4) + # gh-5885 + u = np.ones((3, 4, 2)) + for axisc in range(-2, 2): + assert_equal(np.cross(u, u, axisc=axisc).shape, (3, 4)) + + def test_uint8_int32_mixed_dtypes(self): + # regression test for gh-19138 + u = np.array([[195, 8, 9]], np.uint8) + v = np.array([250, 166, 68], np.int32) + z = np.array([[950, 11010, -30370]], dtype=np.int32) + assert_equal(np.cross(v, u), z) + assert_equal(np.cross(u, v), -z) + + @pytest.mark.parametrize("a, b", [(0, [1, 2]), ([1, 2], 3)]) + def test_zero_dimension(self, a, b): + with pytest.raises(ValueError) as exc: + np.cross(a, b) + assert "At least one array has zero dimension" in str(exc.value) + + +def test_outer_out_param(): + arr1 = np.ones((5,)) + arr2 = np.ones((2,)) + arr3 = np.linspace(-2, 2, 5) + out1 = np.ndarray(shape=(5,5)) + out2 = np.ndarray(shape=(2, 5)) + res1 = np.outer(arr1, arr3, out1) + assert_equal(res1, out1) + assert_equal(np.outer(arr2, arr3, out2), out2) + + +class TestIndices: + + def test_simple(self): + [x, y] = np.indices((4, 3)) + assert_array_equal(x, np.array([[0, 0, 0], + [1, 1, 1], + [2, 2, 2], + [3, 3, 3]])) + assert_array_equal(y, np.array([[0, 1, 2], + [0, 1, 2], + [0, 1, 2], + [0, 1, 2]])) + + def test_single_input(self): + [x] = np.indices((4,)) + assert_array_equal(x, np.array([0, 1, 2, 3])) + + [x] = np.indices((4,), sparse=True) + assert_array_equal(x, np.array([0, 1, 2, 3])) + + def test_scalar_input(self): + assert_array_equal([], np.indices(())) + assert_array_equal([], np.indices((), sparse=True)) + assert_array_equal([[]], np.indices((0,))) + assert_array_equal([[]], np.indices((0,), sparse=True)) + + def test_sparse(self): + [x, y] = np.indices((4,3), sparse=True) + assert_array_equal(x, np.array([[0], [1], [2], [3]])) + assert_array_equal(y, np.array([[0, 1, 2]])) + + @pytest.mark.parametrize("dtype", [np.int32, np.int64, np.float32, np.float64]) + @pytest.mark.parametrize("dims", [(), (0,), (4, 3)]) + def test_return_type(self, dtype, dims): + inds = np.indices(dims, dtype=dtype) + assert_(inds.dtype == dtype) + + for arr in np.indices(dims, dtype=dtype, sparse=True): + assert_(arr.dtype == dtype) + + +class TestRequire: + flag_names = ['C', 'C_CONTIGUOUS', 'CONTIGUOUS', + 'F', 'F_CONTIGUOUS', 'FORTRAN', + 'A', 'ALIGNED', + 'W', 'WRITEABLE', + 'O', 'OWNDATA'] + + def generate_all_false(self, dtype): + arr = np.zeros((2, 2), [('junk', 'i1'), ('a', dtype)]) + arr.setflags(write=False) + a = arr['a'] + assert_(not a.flags['C']) + assert_(not a.flags['F']) + assert_(not a.flags['O']) + assert_(not a.flags['W']) + assert_(not a.flags['A']) + return a + + def set_and_check_flag(self, flag, dtype, arr): + if dtype is None: + dtype = arr.dtype + b = np.require(arr, dtype, [flag]) + assert_(b.flags[flag]) + assert_(b.dtype == dtype) + + # a further call to np.require ought to return the same array + # unless OWNDATA is specified. + c = np.require(b, None, [flag]) + if flag[0] != 'O': + assert_(c is b) + else: + assert_(c.flags[flag]) + + def test_require_each(self): + + id = ['f8', 'i4'] + fd = [None, 'f8', 'c16'] + for idtype, fdtype, flag in itertools.product(id, fd, self.flag_names): + a = self.generate_all_false(idtype) + self.set_and_check_flag(flag, fdtype, a) + + def test_unknown_requirement(self): + a = self.generate_all_false('f8') + assert_raises(KeyError, np.require, a, None, 'Q') + + def test_non_array_input(self): + a = np.require([1, 2, 3, 4], 'i4', ['C', 'A', 'O']) + assert_(a.flags['O']) + assert_(a.flags['C']) + assert_(a.flags['A']) + assert_(a.dtype == 'i4') + assert_equal(a, [1, 2, 3, 4]) + + def test_C_and_F_simul(self): + a = self.generate_all_false('f8') + assert_raises(ValueError, np.require, a, None, ['C', 'F']) + + def test_ensure_array(self): + class ArraySubclass(np.ndarray): + pass + + a = ArraySubclass((2, 2)) + b = np.require(a, None, ['E']) + assert_(type(b) is np.ndarray) + + def test_preserve_subtype(self): + class ArraySubclass(np.ndarray): + pass + + for flag in self.flag_names: + a = ArraySubclass((2, 2)) + self.set_and_check_flag(flag, None, a) + + +class TestBroadcast: + def test_broadcast_in_args(self): + # gh-5881 + arrs = [np.empty((6, 7)), np.empty((5, 6, 1)), np.empty((7,)), + np.empty((5, 1, 7))] + mits = [np.broadcast(*arrs), + np.broadcast(np.broadcast(*arrs[:0]), np.broadcast(*arrs[0:])), + np.broadcast(np.broadcast(*arrs[:1]), np.broadcast(*arrs[1:])), + np.broadcast(np.broadcast(*arrs[:2]), np.broadcast(*arrs[2:])), + np.broadcast(arrs[0], np.broadcast(*arrs[1:-1]), arrs[-1])] + for mit in mits: + assert_equal(mit.shape, (5, 6, 7)) + assert_equal(mit.ndim, 3) + assert_equal(mit.nd, 3) + assert_equal(mit.numiter, 4) + for a, ia in zip(arrs, mit.iters): + assert_(a is ia.base) + + def test_broadcast_single_arg(self): + # gh-6899 + arrs = [np.empty((5, 6, 7))] + mit = np.broadcast(*arrs) + assert_equal(mit.shape, (5, 6, 7)) + assert_equal(mit.ndim, 3) + assert_equal(mit.nd, 3) + assert_equal(mit.numiter, 1) + assert_(arrs[0] is mit.iters[0].base) + + def test_number_of_arguments(self): + arr = np.empty((5,)) + for j in range(70): + arrs = [arr] * j + if j > 64: + assert_raises(ValueError, np.broadcast, *arrs) + else: + mit = np.broadcast(*arrs) + assert_equal(mit.numiter, j) + + def test_broadcast_error_kwargs(self): + #gh-13455 + arrs = [np.empty((5, 6, 7))] + mit = np.broadcast(*arrs) + mit2 = np.broadcast(*arrs, **{}) + assert_equal(mit.shape, mit2.shape) + assert_equal(mit.ndim, mit2.ndim) + assert_equal(mit.nd, mit2.nd) + assert_equal(mit.numiter, mit2.numiter) + assert_(mit.iters[0].base is mit2.iters[0].base) + + assert_raises(ValueError, np.broadcast, 1, **{'x': 1}) + + def test_shape_mismatch_error_message(self): + with pytest.raises(ValueError, match=r"arg 0 with shape \(1, 3\) and " + r"arg 2 with shape \(2,\)"): + np.broadcast([[1, 2, 3]], [[4], [5]], [6, 7]) + + +class TestKeepdims: + + class sub_array(np.ndarray): + def sum(self, axis=None, dtype=None, out=None): + return np.ndarray.sum(self, axis, dtype, out, keepdims=True) + + def test_raise(self): + sub_class = self.sub_array + x = np.arange(30).view(sub_class) + assert_raises(TypeError, np.sum, x, keepdims=True) + + +class TestTensordot: + + def test_zero_dimension(self): + # Test resolution to issue #5663 + a = np.ndarray((3,0)) + b = np.ndarray((0,4)) + td = np.tensordot(a, b, (1, 0)) + assert_array_equal(td, np.dot(a, b)) + assert_array_equal(td, np.einsum('ij,jk', a, b)) + + def test_zero_dimensional(self): + # gh-12130 + arr_0d = np.array(1) + ret = np.tensordot(arr_0d, arr_0d, ([], [])) # contracting no axes is well defined + assert_array_equal(ret, arr_0d) + + +class TestAsType: + + def test_astype(self): + data = [[1, 2], [3, 4]] + actual = np.astype( + np.array(data, dtype=np.int64), np.uint32 + ) + expected = np.array(data, dtype=np.uint32) + + assert_array_equal(actual, expected) + assert_equal(actual.dtype, expected.dtype) + + assert np.shares_memory( + actual, np.astype(actual, actual.dtype, copy=False) + ) + + actual = np.astype(np.int64(10), np.float64) + expected = np.float64(10) + assert_equal(actual, expected) + assert_equal(actual.dtype, expected.dtype) + + with pytest.raises(TypeError, match="Input should be a NumPy array"): + np.astype(data, np.float64) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_protocols.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_protocols.py new file mode 100644 index 0000000000000000000000000000000000000000..1709629fa89b3ccc482bad501fd45917b18cbddd --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_protocols.py @@ -0,0 +1,45 @@ +import pytest +import warnings +import numpy as np + + +@pytest.mark.filterwarnings("error") +def test_getattr_warning(): + # issue gh-14735: make sure we clear only getattr errors, and let warnings + # through + class Wrapper: + def __init__(self, array): + self.array = array + + def __len__(self): + return len(self.array) + + def __getitem__(self, item): + return type(self)(self.array[item]) + + def __getattr__(self, name): + if name.startswith("__array_"): + warnings.warn("object got converted", UserWarning, stacklevel=1) + + return getattr(self.array, name) + + def __repr__(self): + return "".format(self=self) + + array = Wrapper(np.arange(10)) + with pytest.raises(UserWarning, match="object got converted"): + np.asarray(array) + + +def test_array_called(): + class Wrapper: + val = '0' * 100 + + def __array__(self, dtype=None, copy=None): + return np.array([self.val], dtype=dtype, copy=copy) + + + wrapped = Wrapper() + arr = np.array(wrapped, dtype=str) + assert arr.dtype == 'U100' + assert arr[0] == Wrapper.val diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_records.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_records.py new file mode 100644 index 0000000000000000000000000000000000000000..151fa4e687274724071c285f7a230c46bd4a9f01 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_records.py @@ -0,0 +1,540 @@ +import collections.abc +import textwrap +from io import BytesIO +from os import path +from pathlib import Path +import pickle + +import pytest + +import numpy as np +from numpy.testing import ( + assert_, assert_equal, assert_array_equal, assert_array_almost_equal, + assert_raises, temppath, + ) + + +class TestFromrecords: + def test_fromrecords(self): + r = np.rec.fromrecords([[456, 'dbe', 1.2], [2, 'de', 1.3]], + names='col1,col2,col3') + assert_equal(r[0].item(), (456, 'dbe', 1.2)) + assert_equal(r['col1'].dtype.kind, 'i') + assert_equal(r['col2'].dtype.kind, 'U') + assert_equal(r['col2'].dtype.itemsize, 12) + assert_equal(r['col3'].dtype.kind, 'f') + + def test_fromrecords_0len(self): + """ Verify fromrecords works with a 0-length input """ + dtype = [('a', float), ('b', float)] + r = np.rec.fromrecords([], dtype=dtype) + assert_equal(r.shape, (0,)) + + def test_fromrecords_2d(self): + data = [ + [(1, 2), (3, 4), (5, 6)], + [(6, 5), (4, 3), (2, 1)] + ] + expected_a = [[1, 3, 5], [6, 4, 2]] + expected_b = [[2, 4, 6], [5, 3, 1]] + + # try with dtype + r1 = np.rec.fromrecords(data, dtype=[('a', int), ('b', int)]) + assert_equal(r1['a'], expected_a) + assert_equal(r1['b'], expected_b) + + # try with names + r2 = np.rec.fromrecords(data, names=['a', 'b']) + assert_equal(r2['a'], expected_a) + assert_equal(r2['b'], expected_b) + + assert_equal(r1, r2) + + def test_method_array(self): + r = np.rec.array( + b'abcdefg' * 100, formats='i2,S3,i4', shape=3, byteorder='big' + ) + assert_equal(r[1].item(), (25444, b'efg', 1633837924)) + + def test_method_array2(self): + r = np.rec.array( + [ + (1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), + (5, 55, 'ex'), (6, 66, 'f'), (7, 77, 'g') + ], + formats='u1,f4,S1' + ) + assert_equal(r[1].item(), (2, 22.0, b'b')) + + def test_recarray_slices(self): + r = np.rec.array( + [ + (1, 11, 'a'), (2, 22, 'b'), (3, 33, 'c'), (4, 44, 'd'), + (5, 55, 'ex'), (6, 66, 'f'), (7, 77, 'g') + ], + formats='u1,f4,S1' + ) + assert_equal(r[1::2][1].item(), (4, 44.0, b'd')) + + def test_recarray_fromarrays(self): + x1 = np.array([1, 2, 3, 4]) + x2 = np.array(['a', 'dd', 'xyz', '12']) + x3 = np.array([1.1, 2, 3, 4]) + r = np.rec.fromarrays([x1, x2, x3], names='a,b,c') + assert_equal(r[1].item(), (2, 'dd', 2.0)) + x1[1] = 34 + assert_equal(r.a, np.array([1, 2, 3, 4])) + + def test_recarray_fromfile(self): + data_dir = path.join(path.dirname(__file__), 'data') + filename = path.join(data_dir, 'recarray_from_file.fits') + fd = open(filename, 'rb') + fd.seek(2880 * 2) + r1 = np.rec.fromfile(fd, formats='f8,i4,S5', shape=3, byteorder='big') + fd.seek(2880 * 2) + r2 = np.rec.array(fd, formats='f8,i4,S5', shape=3, byteorder='big') + fd.seek(2880 * 2) + bytes_array = BytesIO() + bytes_array.write(fd.read()) + bytes_array.seek(0) + r3 = np.rec.fromfile( + bytes_array, formats='f8,i4,S5', shape=3, byteorder='big' + ) + fd.close() + assert_equal(r1, r2) + assert_equal(r2, r3) + + def test_recarray_from_obj(self): + count = 10 + a = np.zeros(count, dtype='O') + b = np.zeros(count, dtype='f8') + c = np.zeros(count, dtype='f8') + for i in range(len(a)): + a[i] = list(range(1, 10)) + + mine = np.rec.fromarrays([a, b, c], names='date,data1,data2') + for i in range(len(a)): + assert_(mine.date[i] == list(range(1, 10))) + assert_(mine.data1[i] == 0.0) + assert_(mine.data2[i] == 0.0) + + def test_recarray_repr(self): + a = np.array([(1, 0.1), (2, 0.2)], + dtype=[('foo', ' 2) & (a < 6)) + xb = np.where((b > 2) & (b < 6)) + ya = ((a > 2) & (a < 6)) + yb = ((b > 2) & (b < 6)) + assert_array_almost_equal(xa, ya.nonzero()) + assert_array_almost_equal(xb, yb.nonzero()) + assert_(np.all(a[ya] > 0.5)) + assert_(np.all(b[yb] > 0.5)) + + def test_endian_where(self): + # GitHub issue #369 + net = np.zeros(3, dtype='>f4') + net[1] = 0.00458849 + net[2] = 0.605202 + max_net = net.max() + test = np.where(net <= 0., max_net, net) + correct = np.array([ 0.60520202, 0.00458849, 0.60520202]) + assert_array_almost_equal(test, correct) + + def test_endian_recarray(self): + # Ticket #2185 + dt = np.dtype([ + ('head', '>u4'), + ('data', '>u4', 2), + ]) + buf = np.recarray(1, dtype=dt) + buf[0]['head'] = 1 + buf[0]['data'][:] = [1, 1] + + h = buf[0]['head'] + d = buf[0]['data'][0] + buf[0]['head'] = h + buf[0]['data'][0] = d + assert_(buf[0]['head'] == 1) + + def test_mem_dot(self): + # Ticket #106 + x = np.random.randn(0, 1) + y = np.random.randn(10, 1) + # Dummy array to detect bad memory access: + _z = np.ones(10) + _dummy = np.empty((0, 10)) + z = np.lib.stride_tricks.as_strided(_z, _dummy.shape, _dummy.strides) + np.dot(x, np.transpose(y), out=z) + assert_equal(_z, np.ones(10)) + # Do the same for the built-in dot: + np._core.multiarray.dot(x, np.transpose(y), out=z) + assert_equal(_z, np.ones(10)) + + def test_arange_endian(self): + # Ticket #111 + ref = np.arange(10) + x = np.arange(10, dtype=' 1 and x['two'] > 2) + + def test_method_args(self): + # Make sure methods and functions have same default axis + # keyword and arguments + funcs1 = ['argmax', 'argmin', 'sum', 'any', 'all', 'cumsum', + 'cumprod', 'prod', 'std', 'var', 'mean', + 'round', 'min', 'max', 'argsort', 'sort'] + funcs2 = ['compress', 'take', 'repeat'] + + for func in funcs1: + arr = np.random.rand(8, 7) + arr2 = arr.copy() + res1 = getattr(arr, func)() + res2 = getattr(np, func)(arr2) + if res1 is None: + res1 = arr + + if res1.dtype.kind in 'uib': + assert_((res1 == res2).all(), func) + else: + assert_(abs(res1-res2).max() < 1e-8, func) + + for func in funcs2: + arr1 = np.random.rand(8, 7) + arr2 = np.random.rand(8, 7) + res1 = None + if func == 'compress': + arr1 = arr1.ravel() + res1 = getattr(arr2, func)(arr1) + else: + arr2 = (15*arr2).astype(int).ravel() + if res1 is None: + res1 = getattr(arr1, func)(arr2) + res2 = getattr(np, func)(arr1, arr2) + assert_(abs(res1-res2).max() < 1e-8, func) + + def test_mem_lexsort_strings(self): + # Ticket #298 + lst = ['abc', 'cde', 'fgh'] + np.lexsort((lst,)) + + def test_fancy_index(self): + # Ticket #302 + x = np.array([1, 2])[np.array([0])] + assert_equal(x.shape, (1,)) + + def test_recarray_copy(self): + # Ticket #312 + dt = [('x', np.int16), ('y', np.float64)] + ra = np.array([(1, 2.3)], dtype=dt) + rb = np.rec.array(ra, dtype=dt) + rb['x'] = 2. + assert_(ra['x'] != rb['x']) + + def test_rec_fromarray(self): + # Ticket #322 + x1 = np.array([[1, 2], [3, 4], [5, 6]]) + x2 = np.array(['a', 'dd', 'xyz']) + x3 = np.array([1.1, 2, 3]) + np.rec.fromarrays([x1, x2, x3], formats="(2,)i4,S3,f8") + + def test_object_array_assign(self): + x = np.empty((2, 2), object) + x.flat[2] = (1, 2, 3) + assert_equal(x.flat[2], (1, 2, 3)) + + def test_ndmin_float64(self): + # Ticket #324 + x = np.array([1, 2, 3], dtype=np.float64) + assert_equal(np.array(x, dtype=np.float32, ndmin=2).ndim, 2) + assert_equal(np.array(x, dtype=np.float64, ndmin=2).ndim, 2) + + def test_ndmin_order(self): + # Issue #465 and related checks + assert_(np.array([1, 2], order='C', ndmin=3).flags.c_contiguous) + assert_(np.array([1, 2], order='F', ndmin=3).flags.f_contiguous) + assert_(np.array(np.ones((2, 2), order='F'), ndmin=3).flags.f_contiguous) + assert_(np.array(np.ones((2, 2), order='C'), ndmin=3).flags.c_contiguous) + + def test_mem_axis_minimization(self): + # Ticket #327 + data = np.arange(5) + data = np.add.outer(data, data) + + def test_mem_float_imag(self): + # Ticket #330 + np.float64(1.0).imag + + def test_dtype_tuple(self): + # Ticket #334 + assert_(np.dtype('i4') == np.dtype(('i4', ()))) + + def test_dtype_posttuple(self): + # Ticket #335 + np.dtype([('col1', '()i4')]) + + def test_numeric_carray_compare(self): + # Ticket #341 + assert_equal(np.array(['X'], 'c'), b'X') + + def test_string_array_size(self): + # Ticket #342 + assert_raises(ValueError, + np.array, [['X'], ['X', 'X', 'X']], '|S1') + + def test_dtype_repr(self): + # Ticket #344 + dt1 = np.dtype(('uint32', 2)) + dt2 = np.dtype(('uint32', (2,))) + assert_equal(dt1.__repr__(), dt2.__repr__()) + + def test_reshape_order(self): + # Make sure reshape order works. + a = np.arange(6).reshape(2, 3, order='F') + assert_equal(a, [[0, 2, 4], [1, 3, 5]]) + a = np.array([[1, 2], [3, 4], [5, 6], [7, 8]]) + b = a[:, 1] + assert_equal(b.reshape(2, 2, order='F'), [[2, 6], [4, 8]]) + + def test_reshape_zero_strides(self): + # Issue #380, test reshaping of zero strided arrays + a = np.ones(1) + a = np.lib.stride_tricks.as_strided(a, shape=(5,), strides=(0,)) + assert_(a.reshape(5, 1).strides[0] == 0) + + def test_reshape_zero_size(self): + # GitHub Issue #2700, setting shape failed for 0-sized arrays + a = np.ones((0, 2)) + a.shape = (-1, 2) + + def test_reshape_trailing_ones_strides(self): + # GitHub issue gh-2949, bad strides for trailing ones of new shape + a = np.zeros(12, dtype=np.int32)[::2] # not contiguous + strides_c = (16, 8, 8, 8) + strides_f = (8, 24, 48, 48) + assert_equal(a.reshape(3, 2, 1, 1).strides, strides_c) + assert_equal(a.reshape(3, 2, 1, 1, order='F').strides, strides_f) + assert_equal(np.array(0, dtype=np.int32).reshape(1, 1).strides, (4, 4)) + + def test_repeat_discont(self): + # Ticket #352 + a = np.arange(12).reshape(4, 3)[:, 2] + assert_equal(a.repeat(3), [2, 2, 2, 5, 5, 5, 8, 8, 8, 11, 11, 11]) + + def test_array_index(self): + # Make sure optimization is not called in this case. + a = np.array([1, 2, 3]) + a2 = np.array([[1, 2, 3]]) + assert_equal(a[np.where(a == 3)], a2[np.where(a2 == 3)]) + + def test_object_argmax(self): + a = np.array([1, 2, 3], dtype=object) + assert_(a.argmax() == 2) + + def test_recarray_fields(self): + # Ticket #372 + dt0 = np.dtype([('f0', 'i4'), ('f1', 'i4')]) + dt1 = np.dtype([('f0', 'i8'), ('f1', 'i8')]) + for a in [np.array([(1, 2), (3, 4)], "i4,i4"), + np.rec.array([(1, 2), (3, 4)], "i4,i4"), + np.rec.array([(1, 2), (3, 4)]), + np.rec.fromarrays([(1, 2), (3, 4)], "i4,i4"), + np.rec.fromarrays([(1, 2), (3, 4)])]: + assert_(a.dtype in [dt0, dt1]) + + def test_random_shuffle(self): + # Ticket #374 + a = np.arange(5).reshape((5, 1)) + b = a.copy() + np.random.shuffle(b) + assert_equal(np.sort(b, axis=0), a) + + def test_refcount_vdot(self): + # Changeset #3443 + _assert_valid_refcount(np.vdot) + + def test_startswith(self): + ca = np.char.array(['Hi', 'There']) + assert_equal(ca.startswith('H'), [True, False]) + + def test_noncommutative_reduce_accumulate(self): + # Ticket #413 + tosubtract = np.arange(5) + todivide = np.array([2.0, 0.5, 0.25]) + assert_equal(np.subtract.reduce(tosubtract), -10) + assert_equal(np.divide.reduce(todivide), 16.0) + assert_array_equal(np.subtract.accumulate(tosubtract), + np.array([0, -1, -3, -6, -10])) + assert_array_equal(np.divide.accumulate(todivide), + np.array([2., 4., 16.])) + + def test_convolve_empty(self): + # Convolve should raise an error for empty input array. + assert_raises(ValueError, np.convolve, [], [1]) + assert_raises(ValueError, np.convolve, [1], []) + + def test_multidim_byteswap(self): + # Ticket #449 + r = np.array([(1, (0, 1, 2))], dtype="i2,3i2") + assert_array_equal(r.byteswap(), + np.array([(256, (0, 256, 512))], r.dtype)) + + def test_string_NULL(self): + # Changeset 3557 + assert_equal(np.array("a\x00\x0b\x0c\x00").item(), + 'a\x00\x0b\x0c') + + def test_junk_in_string_fields_of_recarray(self): + # Ticket #483 + r = np.array([[b'abc']], dtype=[('var1', '|S20')]) + assert_(asbytes(r['var1'][0][0]) == b'abc') + + def test_take_output(self): + # Ensure that 'take' honours output parameter. + x = np.arange(12).reshape((3, 4)) + a = np.take(x, [0, 2], axis=1) + b = np.zeros_like(a) + np.take(x, [0, 2], axis=1, out=b) + assert_array_equal(a, b) + + def test_take_object_fail(self): + # Issue gh-3001 + d = 123. + a = np.array([d, 1], dtype=object) + if HAS_REFCOUNT: + ref_d = sys.getrefcount(d) + try: + a.take([0, 100]) + except IndexError: + pass + if HAS_REFCOUNT: + assert_(ref_d == sys.getrefcount(d)) + + def test_array_str_64bit(self): + # Ticket #501 + s = np.array([1, np.nan], dtype=np.float64) + with np.errstate(all='raise'): + np.array_str(s) # Should succeed + + def test_frompyfunc_endian(self): + # Ticket #503 + from math import radians + uradians = np.frompyfunc(radians, 1, 1) + big_endian = np.array([83.4, 83.5], dtype='>f8') + little_endian = np.array([83.4, 83.5], dtype=' object + # casting succeeds + def rs(): + x = np.ones([484, 286]) + y = np.zeros([484, 286]) + x |= y + + assert_raises(TypeError, rs) + + def test_unicode_scalar(self): + # Ticket #600 + x = np.array(["DROND", "DROND1"], dtype="U6") + el = x[1] + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + new = pickle.loads(pickle.dumps(el, protocol=proto)) + assert_equal(new, el) + + def test_arange_non_native_dtype(self): + # Ticket #616 + for T in ('>f4', ' 0)] = v + + assert_raises(IndexError, ia, x, s, np.zeros(9, dtype=float)) + assert_raises(IndexError, ia, x, s, np.zeros(11, dtype=float)) + + # Old special case (different code path): + assert_raises(ValueError, ia, x.flat, s, np.zeros(9, dtype=float)) + assert_raises(ValueError, ia, x.flat, s, np.zeros(11, dtype=float)) + + def test_mem_scalar_indexing(self): + # Ticket #603 + x = np.array([0], dtype=float) + index = np.array(0, dtype=np.int32) + x[index] + + def test_binary_repr_0_width(self): + assert_equal(np.binary_repr(0, width=3), '000') + + def test_fromstring(self): + assert_equal(np.fromstring("12:09:09", dtype=int, sep=":"), + [12, 9, 9]) + + def test_searchsorted_variable_length(self): + x = np.array(['a', 'aa', 'b']) + y = np.array(['d', 'e']) + assert_equal(x.searchsorted(y), [3, 3]) + + def test_string_argsort_with_zeros(self): + # Check argsort for strings containing zeros. + x = np.frombuffer(b"\x00\x02\x00\x01", dtype="|S2") + assert_array_equal(x.argsort(kind='m'), np.array([1, 0])) + assert_array_equal(x.argsort(kind='q'), np.array([1, 0])) + + def test_string_sort_with_zeros(self): + # Check sort for strings containing zeros. + x = np.frombuffer(b"\x00\x02\x00\x01", dtype="|S2") + y = np.frombuffer(b"\x00\x01\x00\x02", dtype="|S2") + assert_array_equal(np.sort(x, kind="q"), y) + + def test_copy_detection_zero_dim(self): + # Ticket #658 + np.indices((0, 3, 4)).T.reshape(-1, 3) + + def test_flat_byteorder(self): + # Ticket #657 + x = np.arange(10) + assert_array_equal(x.astype('>i4'), x.astype('i4').flat[:], x.astype('i4')): + x = np.array([-1, 0, 1], dtype=dt) + assert_equal(x.flat[0].dtype, x[0].dtype) + + def test_copy_detection_corner_case(self): + # Ticket #658 + np.indices((0, 3, 4)).T.reshape(-1, 3) + + def test_object_array_refcounting(self): + # Ticket #633 + if not hasattr(sys, 'getrefcount'): + return + + # NB. this is probably CPython-specific + + cnt = sys.getrefcount + + a = object() + b = object() + c = object() + + cnt0_a = cnt(a) + cnt0_b = cnt(b) + cnt0_c = cnt(c) + + # -- 0d -> 1-d broadcast slice assignment + + arr = np.zeros(5, dtype=np.object_) + + arr[:] = a + assert_equal(cnt(a), cnt0_a + 5) + + arr[:] = b + assert_equal(cnt(a), cnt0_a) + assert_equal(cnt(b), cnt0_b + 5) + + arr[:2] = c + assert_equal(cnt(b), cnt0_b + 3) + assert_equal(cnt(c), cnt0_c + 2) + + del arr + + # -- 1-d -> 2-d broadcast slice assignment + + arr = np.zeros((5, 2), dtype=np.object_) + arr0 = np.zeros(2, dtype=np.object_) + + arr0[0] = a + assert_(cnt(a) == cnt0_a + 1) + arr0[1] = b + assert_(cnt(b) == cnt0_b + 1) + + arr[:, :] = arr0 + assert_(cnt(a) == cnt0_a + 6) + assert_(cnt(b) == cnt0_b + 6) + + arr[:, 0] = None + assert_(cnt(a) == cnt0_a + 1) + + del arr, arr0 + + # -- 2-d copying + flattening + + arr = np.zeros((5, 2), dtype=np.object_) + + arr[:, 0] = a + arr[:, 1] = b + assert_(cnt(a) == cnt0_a + 5) + assert_(cnt(b) == cnt0_b + 5) + + arr2 = arr.copy() + assert_(cnt(a) == cnt0_a + 10) + assert_(cnt(b) == cnt0_b + 10) + + arr2 = arr[:, 0].copy() + assert_(cnt(a) == cnt0_a + 10) + assert_(cnt(b) == cnt0_b + 5) + + arr2 = arr.flatten() + assert_(cnt(a) == cnt0_a + 10) + assert_(cnt(b) == cnt0_b + 10) + + del arr, arr2 + + # -- concatenate, repeat, take, choose + + arr1 = np.zeros((5, 1), dtype=np.object_) + arr2 = np.zeros((5, 1), dtype=np.object_) + + arr1[...] = a + arr2[...] = b + assert_(cnt(a) == cnt0_a + 5) + assert_(cnt(b) == cnt0_b + 5) + + tmp = np.concatenate((arr1, arr2)) + assert_(cnt(a) == cnt0_a + 5 + 5) + assert_(cnt(b) == cnt0_b + 5 + 5) + + tmp = arr1.repeat(3, axis=0) + assert_(cnt(a) == cnt0_a + 5 + 3*5) + + tmp = arr1.take([1, 2, 3], axis=0) + assert_(cnt(a) == cnt0_a + 5 + 3) + + x = np.array([[0], [1], [0], [1], [1]], int) + tmp = x.choose(arr1, arr2) + assert_(cnt(a) == cnt0_a + 5 + 2) + assert_(cnt(b) == cnt0_b + 5 + 3) + + del tmp # Avoid pyflakes unused variable warning + + def test_mem_custom_float_to_array(self): + # Ticket 702 + class MyFloat: + def __float__(self): + return 1.0 + + tmp = np.atleast_1d([MyFloat()]) + tmp.astype(float) # Should succeed + + def test_object_array_refcount_self_assign(self): + # Ticket #711 + class VictimObject: + deleted = False + + def __del__(self): + self.deleted = True + + d = VictimObject() + arr = np.zeros(5, dtype=np.object_) + arr[:] = d + del d + arr[:] = arr # refcount of 'd' might hit zero here + assert_(not arr[0].deleted) + arr[:] = arr # trying to induce a segfault by doing it again... + assert_(not arr[0].deleted) + + def test_mem_fromiter_invalid_dtype_string(self): + x = [1, 2, 3] + assert_raises(ValueError, + np.fromiter, [xi for xi in x], dtype='S') + + def test_reduce_big_object_array(self): + # Ticket #713 + oldsize = np.setbufsize(10*16) + a = np.array([None]*161, object) + assert_(not np.any(a)) + np.setbufsize(oldsize) + + def test_mem_0d_array_index(self): + # Ticket #714 + np.zeros(10)[np.array(0)] + + def test_nonnative_endian_fill(self): + # Non-native endian arrays were incorrectly filled with scalars + # before r5034. + if sys.byteorder == 'little': + dtype = np.dtype('>i4') + else: + dtype = np.dtype('data contains non-zero floats + x = np.array([123456789e199], dtype=np.float64) + if IS_PYPY: + x.resize((m, 0), refcheck=False) + else: + x.resize((m, 0)) + y = np.array([123456789e199], dtype=np.float64) + if IS_PYPY: + y.resize((0, n), refcheck=False) + else: + y.resize((0, n)) + + # `dot` should just return zero (m, n) matrix + z = np.dot(x, y) + assert_(np.all(z == 0)) + assert_(z.shape == (m, n)) + + def test_zeros(self): + # Regression test for #1061. + # Set a size which cannot fit into a 64 bits signed integer + sz = 2 ** 64 + with assert_raises_regex(ValueError, + 'Maximum allowed dimension exceeded'): + np.empty(sz) + + def test_huge_arange(self): + # Regression test for #1062. + # Set a size which cannot fit into a 64 bits signed integer + sz = 2 ** 64 + with assert_raises_regex(ValueError, + 'Maximum allowed size exceeded'): + np.arange(sz) + assert_(np.size == sz) + + def test_fromiter_bytes(self): + # Ticket #1058 + a = np.fromiter(list(range(10)), dtype='b') + b = np.fromiter(list(range(10)), dtype='B') + assert_(np.all(a == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) + assert_(np.all(b == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) + + def test_array_from_sequence_scalar_array(self): + # Ticket #1078: segfaults when creating an array with a sequence of + # 0d arrays. + a = np.array((np.ones(2), np.array(2)), dtype=object) + assert_equal(a.shape, (2,)) + assert_equal(a.dtype, np.dtype(object)) + assert_equal(a[0], np.ones(2)) + assert_equal(a[1], np.array(2)) + + a = np.array(((1,), np.array(1)), dtype=object) + assert_equal(a.shape, (2,)) + assert_equal(a.dtype, np.dtype(object)) + assert_equal(a[0], (1,)) + assert_equal(a[1], np.array(1)) + + def test_array_from_sequence_scalar_array2(self): + # Ticket #1081: weird array with strange input... + t = np.array([np.array([]), np.array(0, object)], dtype=object) + assert_equal(t.shape, (2,)) + assert_equal(t.dtype, np.dtype(object)) + + def test_array_too_big(self): + # Ticket #1080. + assert_raises(ValueError, np.zeros, [975]*7, np.int8) + assert_raises(ValueError, np.zeros, [26244]*5, np.int8) + + def test_dtype_keyerrors_(self): + # Ticket #1106. + dt = np.dtype([('f1', np.uint)]) + assert_raises(KeyError, dt.__getitem__, "f2") + assert_raises(IndexError, dt.__getitem__, 1) + assert_raises(TypeError, dt.__getitem__, 0.0) + + def test_lexsort_buffer_length(self): + # Ticket #1217, don't segfault. + a = np.ones(100, dtype=np.int8) + b = np.ones(100, dtype=np.int32) + i = np.lexsort((a[::-1], b)) + assert_equal(i, np.arange(100, dtype=int)) + + def test_object_array_to_fixed_string(self): + # Ticket #1235. + a = np.array(['abcdefgh', 'ijklmnop'], dtype=np.object_) + b = np.array(a, dtype=(np.str_, 8)) + assert_equal(a, b) + c = np.array(a, dtype=(np.str_, 5)) + assert_equal(c, np.array(['abcde', 'ijklm'])) + d = np.array(a, dtype=(np.str_, 12)) + assert_equal(a, d) + e = np.empty((2, ), dtype=(np.str_, 8)) + e[:] = a[:] + assert_equal(a, e) + + def test_unicode_to_string_cast(self): + # Ticket #1240. + a = np.array([['abc', '\u03a3'], + ['asdf', 'erw']], + dtype='U') + assert_raises(UnicodeEncodeError, np.array, a, 'S4') + + def test_unicode_to_string_cast_error(self): + # gh-15790 + a = np.array(['\x80'] * 129, dtype='U3') + assert_raises(UnicodeEncodeError, np.array, a, 'S') + b = a.reshape(3, 43)[:-1, :-1] + assert_raises(UnicodeEncodeError, np.array, b, 'S') + + def test_mixed_string_byte_array_creation(self): + a = np.array(['1234', b'123']) + assert_(a.itemsize == 16) + a = np.array([b'123', '1234']) + assert_(a.itemsize == 16) + a = np.array(['1234', b'123', '12345']) + assert_(a.itemsize == 20) + a = np.array([b'123', '1234', b'12345']) + assert_(a.itemsize == 20) + a = np.array([b'123', '1234', b'1234']) + assert_(a.itemsize == 16) + + def test_misaligned_objects_segfault(self): + # Ticket #1198 and #1267 + a1 = np.zeros((10,), dtype='O,c') + a2 = np.array(['a', 'b', 'c', 'd', 'e', 'f', 'g', 'h', 'i', 'j'], 'S10') + a1['f0'] = a2 + repr(a1) + np.argmax(a1['f0']) + a1['f0'][1] = "FOO" + a1['f0'] = "FOO" + np.array(a1['f0'], dtype='S') + np.nonzero(a1['f0']) + a1.sort() + copy.deepcopy(a1) + + def test_misaligned_scalars_segfault(self): + # Ticket #1267 + s1 = np.array(('a', 'Foo'), dtype='c,O') + s2 = np.array(('b', 'Bar'), dtype='c,O') + s1['f1'] = s2['f1'] + s1['f1'] = 'Baz' + + def test_misaligned_dot_product_objects(self): + # Ticket #1267 + # This didn't require a fix, but it's worth testing anyway, because + # it may fail if .dot stops enforcing the arrays to be BEHAVED + a = np.array([[(1, 'a'), (0, 'a')], [(0, 'a'), (1, 'a')]], dtype='O,c') + b = np.array([[(4, 'a'), (1, 'a')], [(2, 'a'), (2, 'a')]], dtype='O,c') + np.dot(a['f0'], b['f0']) + + def test_byteswap_complex_scalar(self): + # Ticket #1259 and gh-441 + for dtype in [np.dtype('<'+t) for t in np.typecodes['Complex']]: + z = np.array([2.2-1.1j], dtype) + x = z[0] # always native-endian + y = x.byteswap() + if x.dtype.byteorder == z.dtype.byteorder: + # little-endian machine + assert_equal(x, np.frombuffer(y.tobytes(), dtype=dtype.newbyteorder())) + else: + # big-endian machine + assert_equal(x, np.frombuffer(y.tobytes(), dtype=dtype)) + # double check real and imaginary parts: + assert_equal(x.real, y.real.byteswap()) + assert_equal(x.imag, y.imag.byteswap()) + + def test_structured_arrays_with_objects1(self): + # Ticket #1299 + stra = 'aaaa' + strb = 'bbbb' + x = np.array([[(0, stra), (1, strb)]], 'i8,O') + x[x.nonzero()] = x.ravel()[:1] + assert_(x[0, 1] == x[0, 0]) + + @pytest.mark.skipif( + sys.version_info >= (3, 12), + reason="Python 3.12 has immortal refcounts, this test no longer works." + ) + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_structured_arrays_with_objects2(self): + # Ticket #1299 second test + stra = 'aaaa' + strb = 'bbbb' + numb = sys.getrefcount(strb) + numa = sys.getrefcount(stra) + x = np.array([[(0, stra), (1, strb)]], 'i8,O') + x[x.nonzero()] = x.ravel()[:1] + assert_(sys.getrefcount(strb) == numb) + assert_(sys.getrefcount(stra) == numa + 2) + + def test_duplicate_title_and_name(self): + # Ticket #1254 + dtspec = [(('a', 'a'), 'i'), ('b', 'i')] + assert_raises(ValueError, np.dtype, dtspec) + + def test_signed_integer_division_overflow(self): + # Ticket #1317. + def test_type(t): + min = np.array([np.iinfo(t).min]) + min //= -1 + + with np.errstate(over="ignore"): + for t in (np.int8, np.int16, np.int32, np.int64, int): + test_type(t) + + def test_buffer_hashlib(self): + from hashlib import sha256 + + x = np.array([1, 2, 3], dtype=np.dtype('c') + + def test_log1p_compiler_shenanigans(self): + # Check if log1p is behaving on 32 bit intel systems. + assert_(np.isfinite(np.log1p(np.exp2(-53)))) + + def test_fromiter_comparison(self): + a = np.fromiter(list(range(10)), dtype='b') + b = np.fromiter(list(range(10)), dtype='B') + assert_(np.all(a == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) + assert_(np.all(b == np.array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]))) + + def test_fromstring_crash(self): + # Ticket #1345: the following should not cause a crash + with assert_warns(DeprecationWarning): + np.fromstring(b'aa, aa, 1.0', sep=',') + + def test_ticket_1539(self): + dtypes = [x for x in np._core.sctypeDict.values() + if (issubclass(x, np.number) + and not issubclass(x, np.timedelta64))] + a = np.array([], np.bool) # not x[0] because it is unordered + failures = [] + + for x in dtypes: + b = a.astype(x) + for y in dtypes: + c = a.astype(y) + try: + d = np.dot(b, c) + except TypeError: + failures.append((x, y)) + else: + if d != 0: + failures.append((x, y)) + if failures: + raise AssertionError("Failures: %r" % failures) + + def test_ticket_1538(self): + x = np.finfo(np.float32) + for name in 'eps epsneg max min resolution tiny'.split(): + assert_equal(type(getattr(x, name)), np.float32, + err_msg=name) + + def test_ticket_1434(self): + # Check that the out= argument in var and std has an effect + data = np.array(((1, 2, 3), (4, 5, 6), (7, 8, 9))) + out = np.zeros((3,)) + + ret = data.var(axis=1, out=out) + assert_(ret is out) + assert_array_equal(ret, data.var(axis=1)) + + ret = data.std(axis=1, out=out) + assert_(ret is out) + assert_array_equal(ret, data.std(axis=1)) + + def test_complex_nan_maximum(self): + cnan = complex(0, np.nan) + assert_equal(np.maximum(1, cnan), cnan) + + def test_subclass_int_tuple_assignment(self): + # ticket #1563 + class Subclass(np.ndarray): + def __new__(cls, i): + return np.ones((i,)).view(cls) + + x = Subclass(5) + x[(0,)] = 2 # shouldn't raise an exception + assert_equal(x[0], 2) + + def test_ufunc_no_unnecessary_views(self): + # ticket #1548 + class Subclass(np.ndarray): + pass + x = np.array([1, 2, 3]).view(Subclass) + y = np.add(x, x, x) + assert_equal(id(x), id(y)) + + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_take_refcount(self): + # ticket #939 + a = np.arange(16, dtype=float) + a.shape = (4, 4) + lut = np.ones((5 + 3, 4), float) + rgba = np.empty(shape=a.shape + (4,), dtype=lut.dtype) + c1 = sys.getrefcount(rgba) + try: + lut.take(a, axis=0, mode='clip', out=rgba) + except TypeError: + pass + c2 = sys.getrefcount(rgba) + assert_equal(c1, c2) + + def test_fromfile_tofile_seeks(self): + # On Python 3, tofile/fromfile used to get (#1610) the Python + # file handle out of sync + f0 = tempfile.NamedTemporaryFile() + f = f0.file + f.write(np.arange(255, dtype='u1').tobytes()) + + f.seek(20) + ret = np.fromfile(f, count=4, dtype='u1') + assert_equal(ret, np.array([20, 21, 22, 23], dtype='u1')) + assert_equal(f.tell(), 24) + + f.seek(40) + np.array([1, 2, 3], dtype='u1').tofile(f) + assert_equal(f.tell(), 43) + + f.seek(40) + data = f.read(3) + assert_equal(data, b"\x01\x02\x03") + + f.seek(80) + f.read(4) + data = np.fromfile(f, dtype='u1', count=4) + assert_equal(data, np.array([84, 85, 86, 87], dtype='u1')) + + f.close() + + def test_complex_scalar_warning(self): + for tp in [np.csingle, np.cdouble, np.clongdouble]: + x = tp(1+2j) + assert_warns(ComplexWarning, float, x) + with suppress_warnings() as sup: + sup.filter(ComplexWarning) + assert_equal(float(x), float(x.real)) + + def test_complex_scalar_complex_cast(self): + for tp in [np.csingle, np.cdouble, np.clongdouble]: + x = tp(1+2j) + assert_equal(complex(x), 1+2j) + + def test_complex_boolean_cast(self): + # Ticket #2218 + for tp in [np.csingle, np.cdouble, np.clongdouble]: + x = np.array([0, 0+0.5j, 0.5+0j], dtype=tp) + assert_equal(x.astype(bool), np.array([0, 1, 1], dtype=bool)) + assert_(np.any(x)) + assert_(np.all(x[1:])) + + def test_uint_int_conversion(self): + x = 2**64 - 1 + assert_equal(int(np.uint64(x)), x) + + def test_duplicate_field_names_assign(self): + ra = np.fromiter(((i*3, i*2) for i in range(10)), dtype='i8,f8') + ra.dtype.names = ('f1', 'f2') + repr(ra) # should not cause a segmentation fault + assert_raises(ValueError, setattr, ra.dtype, 'names', ('f1', 'f1')) + + def test_eq_string_and_object_array(self): + # From e-mail thread "__eq__ with str and object" (Keith Goodman) + a1 = np.array(['a', 'b'], dtype=object) + a2 = np.array(['a', 'c']) + assert_array_equal(a1 == a2, [True, False]) + assert_array_equal(a2 == a1, [True, False]) + + def test_nonzero_byteswap(self): + a = np.array([0x80000000, 0x00000080, 0], dtype=np.uint32) + a.dtype = np.float32 + assert_equal(a.nonzero()[0], [1]) + a = a.byteswap() + a = a.view(a.dtype.newbyteorder()) + assert_equal(a.nonzero()[0], [1]) # [0] if nonzero() ignores swap + + def test_empty_mul(self): + a = np.array([1.]) + a[1:1] *= 2 + assert_equal(a, [1.]) + + def test_array_side_effect(self): + # The second use of itemsize was throwing an exception because in + # ctors.c, discover_itemsize was calling PyObject_Length without + # checking the return code. This failed to get the length of the + # number 2, and the exception hung around until something checked + # PyErr_Occurred() and returned an error. + assert_equal(np.dtype('S10').itemsize, 10) + np.array([['abc', 2], ['long ', '0123456789']], dtype=np.bytes_) + assert_equal(np.dtype('S10').itemsize, 10) + + def test_any_float(self): + # all and any for floats + a = np.array([0.1, 0.9]) + assert_(np.any(a)) + assert_(np.all(a)) + + def test_large_float_sum(self): + a = np.arange(10000, dtype='f') + assert_equal(a.sum(dtype='d'), a.astype('d').sum()) + + def test_ufunc_casting_out(self): + a = np.array(1.0, dtype=np.float32) + b = np.array(1.0, dtype=np.float64) + c = np.array(1.0, dtype=np.float32) + np.add(a, b, out=c) + assert_equal(c, 2.0) + + def test_array_scalar_contiguous(self): + # Array scalars are both C and Fortran contiguous + assert_(np.array(1.0).flags.c_contiguous) + assert_(np.array(1.0).flags.f_contiguous) + assert_(np.array(np.float32(1.0)).flags.c_contiguous) + assert_(np.array(np.float32(1.0)).flags.f_contiguous) + + def test_squeeze_contiguous(self): + # Similar to GitHub issue #387 + a = np.zeros((1, 2)).squeeze() + b = np.zeros((2, 2, 2), order='F')[:, :, ::2].squeeze() + assert_(a.flags.c_contiguous) + assert_(a.flags.f_contiguous) + assert_(b.flags.f_contiguous) + + def test_squeeze_axis_handling(self): + # Issue #10779 + # Ensure proper handling of objects + # that don't support axis specification + # when squeezing + + class OldSqueeze(np.ndarray): + + def __new__(cls, + input_array): + obj = np.asarray(input_array).view(cls) + return obj + + # it is perfectly reasonable that prior + # to numpy version 1.7.0 a subclass of ndarray + # might have been created that did not expect + # squeeze to have an axis argument + # NOTE: this example is somewhat artificial; + # it is designed to simulate an old API + # expectation to guard against regression + def squeeze(self): + return super().squeeze() + + oldsqueeze = OldSqueeze(np.array([[1],[2],[3]])) + + # if no axis argument is specified the old API + # expectation should give the correct result + assert_equal(np.squeeze(oldsqueeze), + np.array([1,2,3])) + + # likewise, axis=None should work perfectly well + # with the old API expectation + assert_equal(np.squeeze(oldsqueeze, axis=None), + np.array([1,2,3])) + + # however, specification of any particular axis + # should raise a TypeError in the context of the + # old API specification, even when using a valid + # axis specification like 1 for this array + with assert_raises(TypeError): + # this would silently succeed for array + # subclasses / objects that did not support + # squeeze axis argument handling before fixing + # Issue #10779 + np.squeeze(oldsqueeze, axis=1) + + # check for the same behavior when using an invalid + # axis specification -- in this case axis=0 does not + # have size 1, but the priority should be to raise + # a TypeError for the axis argument and NOT a + # ValueError for squeezing a non-empty dimension + with assert_raises(TypeError): + np.squeeze(oldsqueeze, axis=0) + + # the new API knows how to handle the axis + # argument and will return a ValueError if + # attempting to squeeze an axis that is not + # of length 1 + with assert_raises(ValueError): + np.squeeze(np.array([[1],[2],[3]]), axis=0) + + def test_reduce_contiguous(self): + # GitHub issue #387 + a = np.add.reduce(np.zeros((2, 1, 2)), (0, 1)) + b = np.add.reduce(np.zeros((2, 1, 2)), 1) + assert_(a.flags.c_contiguous) + assert_(a.flags.f_contiguous) + assert_(b.flags.c_contiguous) + + @pytest.mark.skipif(IS_PYSTON, reason="Pyston disables recursion checking") + def test_object_array_self_reference(self): + # Object arrays with references to themselves can cause problems + a = np.array(0, dtype=object) + a[()] = a + assert_raises(RecursionError, int, a) + assert_raises(RecursionError, float, a) + a[()] = None + + @pytest.mark.skipif(IS_PYSTON, reason="Pyston disables recursion checking") + def test_object_array_circular_reference(self): + # Test the same for a circular reference. + a = np.array(0, dtype=object) + b = np.array(0, dtype=object) + a[()] = b + b[()] = a + assert_raises(RecursionError, int, a) + # NumPy has no tp_traverse currently, so circular references + # cannot be detected. So resolve it: + a[()] = None + + # This was causing a to become like the above + a = np.array(0, dtype=object) + a[...] += 1 + assert_equal(a, 1) + + def test_object_array_nested(self): + # but is fine with a reference to a different array + a = np.array(0, dtype=object) + b = np.array(0, dtype=object) + a[()] = b + assert_equal(int(a), int(0)) + assert_equal(float(a), float(0)) + + def test_object_array_self_copy(self): + # An object array being copied into itself DECREF'ed before INCREF'ing + # causing segmentation faults (gh-3787) + a = np.array(object(), dtype=object) + np.copyto(a, a) + if HAS_REFCOUNT: + assert_(sys.getrefcount(a[()]) == 2) + a[()].__class__ # will segfault if object was deleted + + def test_zerosize_accumulate(self): + "Ticket #1733" + x = np.array([[42, 0]], dtype=np.uint32) + assert_equal(np.add.accumulate(x[:-1, 0]), []) + + def test_objectarray_setfield(self): + # Setfield should not overwrite Object fields with non-Object data + x = np.array([1, 2, 3], dtype=object) + assert_raises(TypeError, x.setfield, 4, np.int32, 0) + + def test_setting_rank0_string(self): + "Ticket #1736" + s1 = b"hello1" + s2 = b"hello2" + a = np.zeros((), dtype="S10") + a[()] = s1 + assert_equal(a, np.array(s1)) + a[()] = np.array(s2) + assert_equal(a, np.array(s2)) + + a = np.zeros((), dtype='f4') + a[()] = 3 + assert_equal(a, np.array(3)) + a[()] = np.array(4) + assert_equal(a, np.array(4)) + + def test_string_astype(self): + "Ticket #1748" + s1 = b'black' + s2 = b'white' + s3 = b'other' + a = np.array([[s1], [s2], [s3]]) + assert_equal(a.dtype, np.dtype('S5')) + b = a.astype(np.dtype('S0')) + assert_equal(b.dtype, np.dtype('S5')) + + def test_ticket_1756(self): + # Ticket #1756 + s = b'0123456789abcdef' + a = np.array([s]*5) + for i in range(1, 17): + a1 = np.array(a, "|S%d" % i) + a2 = np.array([s[:i]]*5) + assert_equal(a1, a2) + + def test_fields_strides(self): + "gh-2355" + r = np.frombuffer(b'abcdefghijklmnop'*4*3, dtype='i4,(2,3)u2') + assert_equal(r[0:3:2]['f1'], r['f1'][0:3:2]) + assert_equal(r[0:3:2]['f1'][0], r[0:3:2][0]['f1']) + assert_equal(r[0:3:2]['f1'][0][()], r[0:3:2][0]['f1'][()]) + assert_equal(r[0:3:2]['f1'][0].strides, r[0:3:2][0]['f1'].strides) + + def test_alignment_update(self): + # Check that alignment flag is updated on stride setting + a = np.arange(10) + assert_(a.flags.aligned) + a.strides = 3 + assert_(not a.flags.aligned) + + def test_ticket_1770(self): + "Should not segfault on python 3k" + import numpy as np + try: + a = np.zeros((1,), dtype=[('f1', 'f')]) + a['f1'] = 1 + a['f2'] = 1 + except ValueError: + pass + except Exception: + raise AssertionError + + def test_ticket_1608(self): + "x.flat shouldn't modify data" + x = np.array([[1, 2], [3, 4]]).T + np.array(x.flat) + assert_equal(x, [[1, 3], [2, 4]]) + + def test_pickle_string_overwrite(self): + import re + + data = np.array([1], dtype='b') + blob = pickle.dumps(data, protocol=1) + data = pickle.loads(blob) + + # Check that loads does not clobber interned strings + s = re.sub("a(.)", "\x01\\1", "a_") + assert_equal(s[0], "\x01") + data[0] = 0x6a + s = re.sub("a(.)", "\x01\\1", "a_") + assert_equal(s[0], "\x01") + + def test_pickle_bytes_overwrite(self): + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + data = np.array([1], dtype='b') + data = pickle.loads(pickle.dumps(data, protocol=proto)) + data[0] = 0x7d + bytestring = "\x01 ".encode('ascii') + assert_equal(bytestring[0:1], '\x01'.encode('ascii')) + + def test_pickle_py2_array_latin1_hack(self): + # Check that unpickling hacks in Py3 that support + # encoding='latin1' work correctly. + + # Python2 output for pickle.dumps(numpy.array([129], dtype='b')) + data = b"cnumpy.core.multiarray\n_reconstruct\np0\n(cnumpy\nndarray\np1\n(I0\ntp2\nS'b'\np3\ntp4\nRp5\n(I1\n(I1\ntp6\ncnumpy\ndtype\np7\n(S'i1'\np8\nI0\nI1\ntp9\nRp10\n(I3\nS'|'\np11\nNNNI-1\nI-1\nI0\ntp12\nbI00\nS'\\x81'\np13\ntp14\nb." # noqa + # This should work: + result = pickle.loads(data, encoding='latin1') + assert_array_equal(result, np.array([129]).astype('b')) + # Should not segfault: + assert_raises(Exception, pickle.loads, data, encoding='koi8-r') + + def test_pickle_py2_scalar_latin1_hack(self): + # Check that scalar unpickling hack in Py3 that supports + # encoding='latin1' work correctly. + + # Python2 output for pickle.dumps(...) + datas = [ + # (original, python2_pickle, koi8r_validity) + (np.str_('\u6bd2'), + b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n(S'U1'\np2\nI0\nI1\ntp3\nRp4\n(I3\nS'<'\np5\nNNNI4\nI4\nI0\ntp6\nbS'\\xd2k\\x00\\x00'\np7\ntp8\nRp9\n.", # noqa + 'invalid'), + + (np.float64(9e123), + b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n(S'f8'\np2\nI0\nI1\ntp3\nRp4\n(I3\nS'<'\np5\nNNNI-1\nI-1\nI0\ntp6\nbS'O\\x81\\xb7Z\\xaa:\\xabY'\np7\ntp8\nRp9\n.", # noqa + 'invalid'), + + # different 8-bit code point in KOI8-R vs latin1 + (np.bytes_(b'\x9c'), + b"cnumpy.core.multiarray\nscalar\np0\n(cnumpy\ndtype\np1\n(S'S1'\np2\nI0\nI1\ntp3\nRp4\n(I3\nS'|'\np5\nNNNI1\nI1\nI0\ntp6\nbS'\\x9c'\np7\ntp8\nRp9\n.", # noqa + 'different'), + ] + for original, data, koi8r_validity in datas: + result = pickle.loads(data, encoding='latin1') + assert_equal(result, original) + + # Decoding under non-latin1 encoding (e.g.) KOI8-R can + # produce bad results, but should not segfault. + if koi8r_validity == 'different': + # Unicode code points happen to lie within latin1, + # but are different in koi8-r, resulting to silent + # bogus results + result = pickle.loads(data, encoding='koi8-r') + assert_(result != original) + elif koi8r_validity == 'invalid': + # Unicode code points outside latin1, so results + # to an encoding exception + assert_raises( + ValueError, pickle.loads, data, encoding='koi8-r' + ) + else: + raise ValueError(koi8r_validity) + + def test_structured_type_to_object(self): + a_rec = np.array([(0, 1), (3, 2)], dtype='i4,i8') + a_obj = np.empty((2,), dtype=object) + a_obj[0] = (0, 1) + a_obj[1] = (3, 2) + # astype records -> object + assert_equal(a_rec.astype(object), a_obj) + # '=' records -> object + b = np.empty_like(a_obj) + b[...] = a_rec + assert_equal(b, a_obj) + # '=' object -> records + b = np.empty_like(a_rec) + b[...] = a_obj + assert_equal(b, a_rec) + + def test_assign_obj_listoflists(self): + # Ticket # 1870 + # The inner list should get assigned to the object elements + a = np.zeros(4, dtype=object) + b = a.copy() + a[0] = [1] + a[1] = [2] + a[2] = [3] + a[3] = [4] + b[...] = [[1], [2], [3], [4]] + assert_equal(a, b) + # The first dimension should get broadcast + a = np.zeros((2, 2), dtype=object) + a[...] = [[1, 2]] + assert_equal(a, [[1, 2], [1, 2]]) + + @pytest.mark.slow_pypy + def test_memoryleak(self): + # Ticket #1917 - ensure that array data doesn't leak + for i in range(1000): + # 100MB times 1000 would give 100GB of memory usage if it leaks + a = np.empty((100000000,), dtype='i1') + del a + + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_ufunc_reduce_memoryleak(self): + a = np.arange(6) + acnt = sys.getrefcount(a) + np.add.reduce(a) + assert_equal(sys.getrefcount(a), acnt) + + def test_search_sorted_invalid_arguments(self): + # Ticket #2021, should not segfault. + x = np.arange(0, 4, dtype='datetime64[D]') + assert_raises(TypeError, x.searchsorted, 1) + + def test_string_truncation(self): + # Ticket #1990 - Data can be truncated in creation of an array from a + # mixed sequence of numeric values and strings (gh-2583) + for val in [True, 1234, 123.4, complex(1, 234)]: + for tostr, dtype in [(asunicode, "U"), (asbytes, "S")]: + b = np.array([val, tostr('xx')], dtype=dtype) + assert_equal(tostr(b[0]), tostr(val)) + b = np.array([tostr('xx'), val], dtype=dtype) + assert_equal(tostr(b[1]), tostr(val)) + + # test also with longer strings + b = np.array([val, tostr('xxxxxxxxxx')], dtype=dtype) + assert_equal(tostr(b[0]), tostr(val)) + b = np.array([tostr('xxxxxxxxxx'), val], dtype=dtype) + assert_equal(tostr(b[1]), tostr(val)) + + def test_string_truncation_ucs2(self): + # Ticket #2081. Python compiled with two byte unicode + # can lead to truncation if itemsize is not properly + # adjusted for NumPy's four byte unicode. + a = np.array(['abcd']) + assert_equal(a.dtype.itemsize, 16) + + def test_unique_stable(self): + # Ticket #2063 must always choose stable sort for argsort to + # get consistent results + v = np.array(([0]*5 + [1]*6 + [2]*6)*4) + res = np.unique(v, return_index=True) + tgt = (np.array([0, 1, 2]), np.array([ 0, 5, 11])) + assert_equal(res, tgt) + + def test_unicode_alloc_dealloc_match(self): + # Ticket #1578, the mismatch only showed up when running + # python-debug for python versions >= 2.7, and then as + # a core dump and error message. + a = np.array(['abc'], dtype=np.str_)[0] + del a + + def test_refcount_error_in_clip(self): + # Ticket #1588 + a = np.zeros((2,), dtype='>i2').clip(min=0) + x = a + a + # This used to segfault: + y = str(x) + # Check the final string: + assert_(y == "[0 0]") + + def test_searchsorted_wrong_dtype(self): + # Ticket #2189, it used to segfault, so we check that it raises the + # proper exception. + a = np.array([('a', 1)], dtype='S1, int') + assert_raises(TypeError, np.searchsorted, a, 1.2) + # Ticket #2066, similar problem: + dtype = np.rec.format_parser(['i4', 'i4'], [], []) + a = np.recarray((2,), dtype) + a[...] = [(1, 2), (3, 4)] + assert_raises(TypeError, np.searchsorted, a, 1) + + def test_complex64_alignment(self): + # Issue gh-2668 (trac 2076), segfault on sparc due to misalignment + dtt = np.complex64 + arr = np.arange(10, dtype=dtt) + # 2D array + arr2 = np.reshape(arr, (2, 5)) + # Fortran write followed by (C or F) read caused bus error + data_str = arr2.tobytes('F') + data_back = np.ndarray(arr2.shape, + arr2.dtype, + buffer=data_str, + order='F') + assert_array_equal(arr2, data_back) + + def test_structured_count_nonzero(self): + arr = np.array([0, 1]).astype('i4, 2i4')[:1] + count = np.count_nonzero(arr) + assert_equal(count, 0) + + def test_copymodule_preserves_f_contiguity(self): + a = np.empty((2, 2), order='F') + b = copy.copy(a) + c = copy.deepcopy(a) + assert_(b.flags.fortran) + assert_(b.flags.f_contiguous) + assert_(c.flags.fortran) + assert_(c.flags.f_contiguous) + + def test_fortran_order_buffer(self): + import numpy as np + a = np.array([['Hello', 'Foob']], dtype='U5', order='F') + arr = np.ndarray(shape=[1, 2, 5], dtype='U1', buffer=a) + arr2 = np.array([[['H', 'e', 'l', 'l', 'o'], + ['F', 'o', 'o', 'b', '']]]) + assert_array_equal(arr, arr2) + + def test_assign_from_sequence_error(self): + # Ticket #4024. + arr = np.array([1, 2, 3]) + assert_raises(ValueError, arr.__setitem__, slice(None), [9, 9]) + arr.__setitem__(slice(None), [9]) + assert_equal(arr, [9, 9, 9]) + + def test_format_on_flex_array_element(self): + # Ticket #4369. + dt = np.dtype([('date', ' 0: + # unpickling ndarray goes through _frombuffer for protocol 5 + assert b'numpy._core.numeric' in s + else: + assert b'numpy._core.multiarray' in s + + def test_object_casting_errors(self): + # gh-11993 update to ValueError (see gh-16909), since strings can in + # principle be converted to complex, but this string cannot. + arr = np.array(['AAAAA', 18465886.0, 18465886.0], dtype=object) + assert_raises(ValueError, arr.astype, 'c8') + + def test_eff1d_casting(self): + # gh-12711 + x = np.array([1, 2, 4, 7, 0], dtype=np.int16) + res = np.ediff1d(x, to_begin=-99, to_end=np.array([88, 99])) + assert_equal(res, [-99, 1, 2, 3, -7, 88, 99]) + + # The use of safe casting means, that 1<<20 is cast unsafely, an + # error may be better, but currently there is no mechanism for it. + res = np.ediff1d(x, to_begin=(1<<20), to_end=(1<<20)) + assert_equal(res, [0, 1, 2, 3, -7, 0]) + + def test_pickle_datetime64_array(self): + # gh-12745 (would fail with pickle5 installed) + d = np.datetime64('2015-07-04 12:59:59.50', 'ns') + arr = np.array([d]) + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + dumped = pickle.dumps(arr, protocol=proto) + assert_equal(pickle.loads(dumped), arr) + + def test_bad_array_interface(self): + class T: + __array_interface__ = {} + + with assert_raises(ValueError): + np.array([T()]) + + def test_2d__array__shape(self): + class T: + def __array__(self, dtype=None, copy=None): + return np.ndarray(shape=(0,0)) + + # Make sure __array__ is used instead of Sequence methods. + def __iter__(self): + return iter([]) + + def __getitem__(self, idx): + raise AssertionError("__getitem__ was called") + + def __len__(self): + return 0 + + + t = T() + # gh-13659, would raise in broadcasting [x=t for x in result] + arr = np.array([t]) + assert arr.shape == (1, 0, 0) + + @pytest.mark.skipif(sys.maxsize < 2 ** 31 + 1, reason='overflows 32-bit python') + def test_to_ctypes(self): + #gh-14214 + arr = np.zeros((2 ** 31 + 1,), 'b') + assert arr.size * arr.itemsize > 2 ** 31 + c_arr = np.ctypeslib.as_ctypes(arr) + assert_equal(c_arr._length_, arr.size) + + def test_complex_conversion_error(self): + # gh-17068 + with pytest.raises(TypeError, match=r"Unable to convert dtype.*"): + complex(np.array("now", np.datetime64)) + + def test__array_interface__descr(self): + # gh-17068 + dt = np.dtype(dict(names=['a', 'b'], + offsets=[0, 0], + formats=[np.int64, np.int64])) + descr = np.array((1, 1), dtype=dt).__array_interface__['descr'] + assert descr == [('', '|V8')] # instead of [(b'', '|V8')] + + @pytest.mark.skipif(sys.maxsize < 2 ** 31 + 1, reason='overflows 32-bit python') + @requires_memory(free_bytes=9e9) + def test_dot_big_stride(self): + # gh-17111 + # blas stride = stride//itemsize > int32 max + int32_max = np.iinfo(np.int32).max + n = int32_max + 3 + a = np.empty([n], dtype=np.float32) + b = a[::n-1] + b[...] = 1 + assert b.strides[0] > int32_max * b.dtype.itemsize + assert np.dot(b, b) == 2.0 + + def test_frompyfunc_name(self): + # name conversion was failing for python 3 strings + # resulting in the default '?' name. Also test utf-8 + # encoding using non-ascii name. + def cassé(x): + return x + + f = np.frompyfunc(cassé, 1, 1) + assert str(f) == "" + + @pytest.mark.parametrize("operation", [ + 'add', 'subtract', 'multiply', 'floor_divide', + 'conjugate', 'fmod', 'square', 'reciprocal', + 'power', 'absolute', 'negative', 'positive', + 'greater', 'greater_equal', 'less', + 'less_equal', 'equal', 'not_equal', 'logical_and', + 'logical_not', 'logical_or', 'bitwise_and', 'bitwise_or', + 'bitwise_xor', 'invert', 'left_shift', 'right_shift', + 'gcd', 'lcm' + ] + ) + @pytest.mark.parametrize("order", [ + ('b->', 'B->'), + ('h->', 'H->'), + ('i->', 'I->'), + ('l->', 'L->'), + ('q->', 'Q->'), + ] + ) + def test_ufunc_order(self, operation, order): + # gh-18075 + # Ensure signed types before unsigned + def get_idx(string, str_lst): + for i, s in enumerate(str_lst): + if string in s: + return i + raise ValueError(f"{string} not in list") + types = getattr(np, operation).types + assert get_idx(order[0], types) < get_idx(order[1], types), ( + f"Unexpected types order of ufunc in {operation}" + f"for {order}. Possible fix: Use signed before unsigned" + "in generate_umath.py") + + def test_nonbool_logical(self): + # gh-22845 + # create two arrays with bit patterns that do not overlap. + # needs to be large enough to test both SIMD and scalar paths + size = 100 + a = np.frombuffer(b'\x01' * size, dtype=np.bool) + b = np.frombuffer(b'\x80' * size, dtype=np.bool) + expected = np.ones(size, dtype=np.bool) + assert_array_equal(np.logical_and(a, b), expected) + + @pytest.mark.skipif(IS_PYPY, reason="PyPy issue 2742") + def test_gh_23737(self): + with pytest.raises(TypeError, match="not an acceptable base type"): + class Y(np.flexible): + pass + + with pytest.raises(TypeError, match="not an acceptable base type"): + class X(np.flexible, np.ma.core.MaskedArray): + pass + + def test_load_ufunc_pickle(self): + # ufuncs are pickled with a semi-private path in + # numpy.core._multiarray_umath and must be loadable without warning + # despite np.core being deprecated. + test_data = b'\x80\x04\x95(\x00\x00\x00\x00\x00\x00\x00\x8c\x1cnumpy.core._multiarray_umath\x94\x8c\x03add\x94\x93\x94.' # noqa + result = pickle.loads(test_data, encoding='bytes') + assert result is np.add + + def test__array_namespace__(self): + arr = np.arange(2) + + xp = arr.__array_namespace__() + assert xp is np + xp = arr.__array_namespace__(api_version="2021.12") + assert xp is np + xp = arr.__array_namespace__(api_version="2022.12") + assert xp is np + xp = arr.__array_namespace__(api_version="2023.12") + assert xp is np + xp = arr.__array_namespace__(api_version=None) + assert xp is np + + with pytest.raises( + ValueError, + match="Version \"2024.12\" of the Array API Standard " + "is not supported." + ): + arr.__array_namespace__(api_version="2024.12") + + with pytest.raises( + ValueError, + match="Only None and strings are allowed as the Array API version" + ): + arr.__array_namespace__(api_version=2023) + + def test_isin_refcnt_bug(self): + # gh-25295 + for _ in range(1000): + np.isclose(np.int64(2), np.int64(2), atol=1e-15, rtol=1e-300) + + def test_replace_regression(self): + # gh-25513 segfault + carr = np.char.chararray((2,), itemsize=25) + test_strings = [b' 4.52173913043478315E+00', + b' 4.95652173913043548E+00'] + carr[:] = test_strings + out = carr.replace(b"E", b"D") + expected = np.char.chararray((2,), itemsize=25) + expected[:] = [s.replace(b"E", b"D") for s in test_strings] + assert_array_equal(out, expected) + + def test_logspace_base_does_not_determine_dtype(self): + # gh-24957 and cupy/cupy/issues/7946 + start = np.array([0, 2], dtype=np.float16) + stop = np.array([2, 0], dtype=np.float16) + out = np.logspace(start, stop, num=5, axis=1, dtype=np.float32) + expected = np.array([[1., 3.1621094, 10., 31.625, 100.], + [100., 31.625, 10., 3.1621094, 1.]], + dtype=np.float32) + assert_almost_equal(out, expected) + # Check test fails if the calculation is done in float64, as happened + # before when a python float base incorrectly influenced the dtype. + out2 = np.logspace(start, stop, num=5, axis=1, dtype=np.float32, + base=np.array([10.0])) + with pytest.raises(AssertionError, match="not almost equal"): + assert_almost_equal(out2, expected) + + def test_vectorize_fixed_width_string(self): + arr = np.array(["SOme wOrd DŽ ß ᾛ ΣΣ ffi⁵Å Ç Ⅰ"]).astype(np.str_) + f = str.casefold + res = np.vectorize(f, otypes=[arr.dtype])(arr) + assert res.dtype == "U30" + + def test_repeated_square_consistency(self): + # gh-26940 + buf = np.array([-5.171866611150749e-07 + 2.5618634555957426e-07j, + 0, 0, 0, 0, 0]) + # Test buffer with regular and reverse strides + for in_vec in [buf[:3], buf[:3][::-1]]: + expected_res = np.square(in_vec) + # Output vector immediately follows input vector + # to reproduce off-by-one in nomemoverlap check. + for res in [buf[3:], buf[3:][::-1]]: + res = buf[3:] + np.square(in_vec, out=res) + assert_equal(res, expected_res) + + def test_sort_unique_crash(self): + # gh-27037 + for _ in range(4): + vals = np.linspace(0, 1, num=128) + data = np.broadcast_to(vals, (128, 128, 128)) + data = data.transpose(0, 2, 1).copy() + np.unique(data) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalar_methods.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalar_methods.py new file mode 100644 index 0000000000000000000000000000000000000000..7b6e83554d814cdfac78667f067df9f4f6ea728f --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalar_methods.py @@ -0,0 +1,225 @@ +""" +Test the scalar constructors, which also do type-coercion +""" +import fractions +import platform +import types +from typing import Any, Type + +import pytest +import numpy as np + +from numpy._core import sctypes +from numpy.testing import assert_equal, assert_raises, IS_MUSL + + +class TestAsIntegerRatio: + # derived in part from the cpython test "test_floatasratio" + + @pytest.mark.parametrize("ftype", [ + np.half, np.single, np.double, np.longdouble]) + @pytest.mark.parametrize("f, ratio", [ + (0.875, (7, 8)), + (-0.875, (-7, 8)), + (0.0, (0, 1)), + (11.5, (23, 2)), + ]) + def test_small(self, ftype, f, ratio): + assert_equal(ftype(f).as_integer_ratio(), ratio) + + @pytest.mark.parametrize("ftype", [ + np.half, np.single, np.double, np.longdouble]) + def test_simple_fractions(self, ftype): + R = fractions.Fraction + assert_equal(R(0, 1), + R(*ftype(0.0).as_integer_ratio())) + assert_equal(R(5, 2), + R(*ftype(2.5).as_integer_ratio())) + assert_equal(R(1, 2), + R(*ftype(0.5).as_integer_ratio())) + assert_equal(R(-2100, 1), + R(*ftype(-2100.0).as_integer_ratio())) + + @pytest.mark.parametrize("ftype", [ + np.half, np.single, np.double, np.longdouble]) + def test_errors(self, ftype): + assert_raises(OverflowError, ftype('inf').as_integer_ratio) + assert_raises(OverflowError, ftype('-inf').as_integer_ratio) + assert_raises(ValueError, ftype('nan').as_integer_ratio) + + def test_against_known_values(self): + R = fractions.Fraction + assert_equal(R(1075, 512), + R(*np.half(2.1).as_integer_ratio())) + assert_equal(R(-1075, 512), + R(*np.half(-2.1).as_integer_ratio())) + assert_equal(R(4404019, 2097152), + R(*np.single(2.1).as_integer_ratio())) + assert_equal(R(-4404019, 2097152), + R(*np.single(-2.1).as_integer_ratio())) + assert_equal(R(4728779608739021, 2251799813685248), + R(*np.double(2.1).as_integer_ratio())) + assert_equal(R(-4728779608739021, 2251799813685248), + R(*np.double(-2.1).as_integer_ratio())) + # longdouble is platform dependent + + @pytest.mark.parametrize("ftype, frac_vals, exp_vals", [ + # dtype test cases generated using hypothesis + # first five generated cases per dtype + (np.half, [0.0, 0.01154830649280303, 0.31082276347447274, + 0.527350517124794, 0.8308562335072596], + [0, 1, 0, -8, 12]), + (np.single, [0.0, 0.09248576989263226, 0.8160498218131407, + 0.17389442853722373, 0.7956044195067877], + [0, 12, 10, 17, -26]), + (np.double, [0.0, 0.031066908499895136, 0.5214135908877832, + 0.45780736035689296, 0.5906586745934036], + [0, -801, 51, 194, -653]), + pytest.param( + np.longdouble, + [0.0, 0.20492557202724854, 0.4277180662199366, 0.9888085019891495, + 0.9620175814461964], + [0, -7400, 14266, -7822, -8721], + marks=[ + pytest.mark.skipif( + np.finfo(np.double) == np.finfo(np.longdouble), + reason="long double is same as double"), + pytest.mark.skipif( + platform.machine().startswith("ppc"), + reason="IBM double double"), + ] + ) + ]) + def test_roundtrip(self, ftype, frac_vals, exp_vals): + for frac, exp in zip(frac_vals, exp_vals): + f = np.ldexp(ftype(frac), exp) + assert f.dtype == ftype + n, d = f.as_integer_ratio() + + try: + nf = np.longdouble(n) + df = np.longdouble(d) + if not np.isfinite(df): + raise OverflowError + except (OverflowError, RuntimeWarning): + # the values may not fit in any float type + pytest.skip("longdouble too small on this platform") + + assert_equal(nf / df, f, "{}/{}".format(n, d)) + + +class TestIsInteger: + @pytest.mark.parametrize("str_value", ["inf", "nan"]) + @pytest.mark.parametrize("code", np.typecodes["Float"]) + def test_special(self, code: str, str_value: str) -> None: + cls = np.dtype(code).type + value = cls(str_value) + assert not value.is_integer() + + @pytest.mark.parametrize( + "code", np.typecodes["Float"] + np.typecodes["AllInteger"] + ) + def test_true(self, code: str) -> None: + float_array = np.arange(-5, 5).astype(code) + for value in float_array: + assert value.is_integer() + + @pytest.mark.parametrize("code", np.typecodes["Float"]) + def test_false(self, code: str) -> None: + float_array = np.arange(-5, 5).astype(code) + float_array *= 1.1 + for value in float_array: + if value == 0: + continue + assert not value.is_integer() + + +class TestClassGetItem: + @pytest.mark.parametrize("cls", [ + np.number, + np.integer, + np.inexact, + np.unsignedinteger, + np.signedinteger, + np.floating, + ]) + def test_abc(self, cls: Type[np.number]) -> None: + alias = cls[Any] + assert isinstance(alias, types.GenericAlias) + assert alias.__origin__ is cls + + def test_abc_complexfloating(self) -> None: + alias = np.complexfloating[Any, Any] + assert isinstance(alias, types.GenericAlias) + assert alias.__origin__ is np.complexfloating + + @pytest.mark.parametrize("arg_len", range(4)) + def test_abc_complexfloating_subscript_tuple(self, arg_len: int) -> None: + arg_tup = (Any,) * arg_len + if arg_len in (1, 2): + assert np.complexfloating[arg_tup] + else: + match = f"Too {'few' if arg_len == 0 else 'many'} arguments" + with pytest.raises(TypeError, match=match): + np.complexfloating[arg_tup] + + @pytest.mark.parametrize("cls", [np.generic, np.flexible, np.character]) + def test_abc_non_numeric(self, cls: Type[np.generic]) -> None: + with pytest.raises(TypeError): + cls[Any] + + @pytest.mark.parametrize("code", np.typecodes["All"]) + def test_concrete(self, code: str) -> None: + cls = np.dtype(code).type + with pytest.raises(TypeError): + cls[Any] + + @pytest.mark.parametrize("arg_len", range(4)) + def test_subscript_tuple(self, arg_len: int) -> None: + arg_tup = (Any,) * arg_len + if arg_len == 1: + assert np.number[arg_tup] + else: + with pytest.raises(TypeError): + np.number[arg_tup] + + def test_subscript_scalar(self) -> None: + assert np.number[Any] + + +class TestBitCount: + # derived in part from the cpython test "test_bit_count" + + @pytest.mark.parametrize("itype", sctypes['int']+sctypes['uint']) + def test_small(self, itype): + for a in range(max(np.iinfo(itype).min, 0), 128): + msg = f"Smoke test for {itype}({a}).bit_count()" + assert itype(a).bit_count() == bin(a).count("1"), msg + + def test_bit_count(self): + for exp in [10, 17, 63]: + a = 2**exp + assert np.uint64(a).bit_count() == 1 + assert np.uint64(a - 1).bit_count() == exp + assert np.uint64(a ^ 63).bit_count() == 7 + assert np.uint64((a - 1) ^ 510).bit_count() == exp - 8 + + +class TestDevice: + """ + Test scalar.device attribute and scalar.to_device() method. + """ + scalars = [np.bool(True), np.int64(1), np.uint64(1), np.float64(1.0), + np.complex128(1+1j)] + + @pytest.mark.parametrize("scalar", scalars) + def test_device(self, scalar): + assert scalar.device == "cpu" + + @pytest.mark.parametrize("scalar", scalars) + def test_to_device(self, scalar): + assert scalar.to_device("cpu") is scalar + + @pytest.mark.parametrize("scalar", scalars) + def test___array_namespace__(self, scalar): + assert scalar.__array_namespace__() is np diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarinherit.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarinherit.py new file mode 100644 index 0000000000000000000000000000000000000000..52591215a2e79512d8c9bc523c8aca7269ecbd75 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarinherit.py @@ -0,0 +1,105 @@ +""" Test printing of scalar types. + +""" +import pytest + +import numpy as np +from numpy.testing import assert_, assert_raises + + +class A: + pass +class B(A, np.float64): + pass + +class C(B): + pass +class D(C, B): + pass + +class B0(np.float64, A): + pass +class C0(B0): + pass + +class HasNew: + def __new__(cls, *args, **kwargs): + return cls, args, kwargs + +class B1(np.float64, HasNew): + pass + + +class TestInherit: + def test_init(self): + x = B(1.0) + assert_(str(x) == '1.0') + y = C(2.0) + assert_(str(y) == '2.0') + z = D(3.0) + assert_(str(z) == '3.0') + + def test_init2(self): + x = B0(1.0) + assert_(str(x) == '1.0') + y = C0(2.0) + assert_(str(y) == '2.0') + + def test_gh_15395(self): + # HasNew is the second base, so `np.float64` should have priority + x = B1(1.0) + assert_(str(x) == '1.0') + + # previously caused RecursionError!? + with pytest.raises(TypeError): + B1(1.0, 2.0) + + def test_int_repr(self): + # Test that integer repr works correctly for subclasses (gh-27106) + class my_int16(np.int16): + pass + + s = repr(my_int16(3)) + assert s == "my_int16(3)" + +class TestCharacter: + def test_char_radd(self): + # GH issue 9620, reached gentype_add and raise TypeError + np_s = np.bytes_('abc') + np_u = np.str_('abc') + s = b'def' + u = 'def' + assert_(np_s.__radd__(np_s) is NotImplemented) + assert_(np_s.__radd__(np_u) is NotImplemented) + assert_(np_s.__radd__(s) is NotImplemented) + assert_(np_s.__radd__(u) is NotImplemented) + assert_(np_u.__radd__(np_s) is NotImplemented) + assert_(np_u.__radd__(np_u) is NotImplemented) + assert_(np_u.__radd__(s) is NotImplemented) + assert_(np_u.__radd__(u) is NotImplemented) + assert_(s + np_s == b'defabc') + assert_(u + np_u == 'defabc') + + class MyStr(str, np.generic): + # would segfault + pass + + with assert_raises(TypeError): + # Previously worked, but gave completely wrong result + ret = s + MyStr('abc') + + class MyBytes(bytes, np.generic): + # would segfault + pass + + ret = s + MyBytes(b'abc') + assert(type(ret) is type(s)) + assert ret == b"defabc" + + def test_char_repeat(self): + np_s = np.bytes_('abc') + np_u = np.str_('abc') + res_s = b'abc' * 5 + res_u = 'abc' * 5 + assert_(np_s * 5 == res_s) + assert_(np_u * 5 == res_u) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarmath.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarmath.py new file mode 100644 index 0000000000000000000000000000000000000000..35350b01ef3a3ebc809858deb21983389783da9e --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_scalarmath.py @@ -0,0 +1,1166 @@ +import contextlib +import sys +import warnings +import itertools +import operator +import platform +from numpy._utils import _pep440 +import pytest +from hypothesis import given, settings +from hypothesis.strategies import sampled_from +from hypothesis.extra import numpy as hynp + +import numpy as np +from numpy.exceptions import ComplexWarning +from numpy._core._rational_tests import rational +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_almost_equal, + assert_array_equal, IS_PYPY, suppress_warnings, _gen_alignment_data, + assert_warns, _SUPPORTS_SVE, + ) + +types = [np.bool, np.byte, np.ubyte, np.short, np.ushort, np.intc, np.uintc, + np.int_, np.uint, np.longlong, np.ulonglong, + np.single, np.double, np.longdouble, np.csingle, + np.cdouble, np.clongdouble] + +floating_types = np.floating.__subclasses__() +complex_floating_types = np.complexfloating.__subclasses__() + +objecty_things = [object(), None, np.array(None, dtype=object)] + +binary_operators_for_scalars = [ + operator.lt, operator.le, operator.eq, operator.ne, operator.ge, + operator.gt, operator.add, operator.floordiv, operator.mod, + operator.mul, operator.pow, operator.sub, operator.truediv +] +binary_operators_for_scalar_ints = binary_operators_for_scalars + [ + operator.xor, operator.or_, operator.and_ +] + + +# This compares scalarmath against ufuncs. + +class TestTypes: + def test_types(self): + for atype in types: + a = atype(1) + assert_(a == 1, "error with %r: got %r" % (atype, a)) + + def test_type_add(self): + # list of types + for k, atype in enumerate(types): + a_scalar = atype(3) + a_array = np.array([3], dtype=atype) + for l, btype in enumerate(types): + b_scalar = btype(1) + b_array = np.array([1], dtype=btype) + c_scalar = a_scalar + b_scalar + c_array = a_array + b_array + # It was comparing the type numbers, but the new ufunc + # function-finding mechanism finds the lowest function + # to which both inputs can be cast - which produces 'l' + # when you do 'q' + 'b'. The old function finding mechanism + # skipped ahead based on the first argument, but that + # does not produce properly symmetric results... + assert_equal(c_scalar.dtype, c_array.dtype, + "error with types (%d/'%c' + %d/'%c')" % + (k, np.dtype(atype).char, l, np.dtype(btype).char)) + + def test_type_create(self): + for k, atype in enumerate(types): + a = np.array([1, 2, 3], atype) + b = atype([1, 2, 3]) + assert_equal(a, b) + + def test_leak(self): + # test leak of scalar objects + # a leak would show up in valgrind as still-reachable of ~2.6MB + for i in range(200000): + np.add(1, 1) + + +def check_ufunc_scalar_equivalence(op, arr1, arr2): + scalar1 = arr1[()] + scalar2 = arr2[()] + assert isinstance(scalar1, np.generic) + assert isinstance(scalar2, np.generic) + + if arr1.dtype.kind == "c" or arr2.dtype.kind == "c": + comp_ops = {operator.ge, operator.gt, operator.le, operator.lt} + if op in comp_ops and (np.isnan(scalar1) or np.isnan(scalar2)): + pytest.xfail("complex comp ufuncs use sort-order, scalars do not.") + if op == operator.pow and arr2.item() in [-1, 0, 0.5, 1, 2]: + # array**scalar special case can have different result dtype + # (Other powers may have issues also, but are not hit here.) + # TODO: It would be nice to resolve this issue. + pytest.skip("array**2 can have incorrect/weird result dtype") + + # ignore fpe's since they may just mismatch for integers anyway. + with warnings.catch_warnings(), np.errstate(all="ignore"): + # Comparisons DeprecationWarnings replacing errors (2022-03): + warnings.simplefilter("error", DeprecationWarning) + try: + res = op(arr1, arr2) + except Exception as e: + with pytest.raises(type(e)): + op(scalar1, scalar2) + else: + scalar_res = op(scalar1, scalar2) + assert_array_equal(scalar_res, res, strict=True) + + +@pytest.mark.slow +@settings(max_examples=10000, deadline=2000) +@given(sampled_from(binary_operators_for_scalars), + hynp.arrays(dtype=hynp.scalar_dtypes(), shape=()), + hynp.arrays(dtype=hynp.scalar_dtypes(), shape=())) +def test_array_scalar_ufunc_equivalence(op, arr1, arr2): + """ + This is a thorough test attempting to cover important promotion paths + and ensuring that arrays and scalars stay as aligned as possible. + However, if it creates troubles, it should maybe just be removed. + """ + check_ufunc_scalar_equivalence(op, arr1, arr2) + + +@pytest.mark.slow +@given(sampled_from(binary_operators_for_scalars), + hynp.scalar_dtypes(), hynp.scalar_dtypes()) +def test_array_scalar_ufunc_dtypes(op, dt1, dt2): + # Same as above, but don't worry about sampling weird values so that we + # do not have to sample as much + arr1 = np.array(2, dtype=dt1) + arr2 = np.array(3, dtype=dt2) # some power do weird things. + + check_ufunc_scalar_equivalence(op, arr1, arr2) + + +@pytest.mark.parametrize("fscalar", [np.float16, np.float32]) +def test_int_float_promotion_truediv(fscalar): + # Promotion for mixed int and float32/float16 must not go to float64 + i = np.int8(1) + f = fscalar(1) + expected = np.result_type(i, f) + assert (i / f).dtype == expected + assert (f / i).dtype == expected + # But normal int / int true division goes to float64: + assert (i / i).dtype == np.dtype("float64") + # For int16, result has to be ast least float32 (takes ufunc path): + assert (np.int16(1) / f).dtype == np.dtype("float32") + + +class TestBaseMath: + @pytest.mark.xfail(_SUPPORTS_SVE, reason="gh-22982") + def test_blocked(self): + # test alignments offsets for simd instructions + # alignments for vz + 2 * (vs - 1) + 1 + for dt, sz in [(np.float32, 11), (np.float64, 7), (np.int32, 11)]: + for out, inp1, inp2, msg in _gen_alignment_data(dtype=dt, + type='binary', + max_size=sz): + exp1 = np.ones_like(inp1) + inp1[...] = np.ones_like(inp1) + inp2[...] = np.zeros_like(inp2) + assert_almost_equal(np.add(inp1, inp2), exp1, err_msg=msg) + assert_almost_equal(np.add(inp1, 2), exp1 + 2, err_msg=msg) + assert_almost_equal(np.add(1, inp2), exp1, err_msg=msg) + + np.add(inp1, inp2, out=out) + assert_almost_equal(out, exp1, err_msg=msg) + + inp2[...] += np.arange(inp2.size, dtype=dt) + 1 + assert_almost_equal(np.square(inp2), + np.multiply(inp2, inp2), err_msg=msg) + # skip true divide for ints + if dt != np.int32: + assert_almost_equal(np.reciprocal(inp2), + np.divide(1, inp2), err_msg=msg) + + inp1[...] = np.ones_like(inp1) + np.add(inp1, 2, out=out) + assert_almost_equal(out, exp1 + 2, err_msg=msg) + inp2[...] = np.ones_like(inp2) + np.add(2, inp2, out=out) + assert_almost_equal(out, exp1 + 2, err_msg=msg) + + def test_lower_align(self): + # check data that is not aligned to element size + # i.e doubles are aligned to 4 bytes on i386 + d = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) + o = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) + assert_almost_equal(d + d, d * 2) + np.add(d, d, out=o) + np.add(np.ones_like(d), d, out=o) + np.add(d, np.ones_like(d), out=o) + np.add(np.ones_like(d), d) + np.add(d, np.ones_like(d)) + + +class TestPower: + def test_small_types(self): + for t in [np.int8, np.int16, np.float16]: + a = t(3) + b = a ** 4 + assert_(b == 81, "error with %r: got %r" % (t, b)) + + def test_large_types(self): + for t in [np.int32, np.int64, np.float32, np.float64, np.longdouble]: + a = t(51) + b = a ** 4 + msg = "error with %r: got %r" % (t, b) + if np.issubdtype(t, np.integer): + assert_(b == 6765201, msg) + else: + assert_almost_equal(b, 6765201, err_msg=msg) + + def test_integers_to_negative_integer_power(self): + # Note that the combination of uint64 with a signed integer + # has common type np.float64. The other combinations should all + # raise a ValueError for integer ** negative integer. + exp = [np.array(-1, dt)[()] for dt in 'bhilq'] + + # 1 ** -1 possible special case + base = [np.array(1, dt)[()] for dt in 'bhilqBHILQ'] + for i1, i2 in itertools.product(base, exp): + if i1.dtype != np.uint64: + assert_raises(ValueError, operator.pow, i1, i2) + else: + res = operator.pow(i1, i2) + assert_(res.dtype.type is np.float64) + assert_almost_equal(res, 1.) + + # -1 ** -1 possible special case + base = [np.array(-1, dt)[()] for dt in 'bhilq'] + for i1, i2 in itertools.product(base, exp): + if i1.dtype != np.uint64: + assert_raises(ValueError, operator.pow, i1, i2) + else: + res = operator.pow(i1, i2) + assert_(res.dtype.type is np.float64) + assert_almost_equal(res, -1.) + + # 2 ** -1 perhaps generic + base = [np.array(2, dt)[()] for dt in 'bhilqBHILQ'] + for i1, i2 in itertools.product(base, exp): + if i1.dtype != np.uint64: + assert_raises(ValueError, operator.pow, i1, i2) + else: + res = operator.pow(i1, i2) + assert_(res.dtype.type is np.float64) + assert_almost_equal(res, .5) + + def test_mixed_types(self): + typelist = [np.int8, np.int16, np.float16, + np.float32, np.float64, np.int8, + np.int16, np.int32, np.int64] + for t1 in typelist: + for t2 in typelist: + a = t1(3) + b = t2(2) + result = a**b + msg = ("error with %r and %r:" + "got %r, expected %r") % (t1, t2, result, 9) + if np.issubdtype(np.dtype(result), np.integer): + assert_(result == 9, msg) + else: + assert_almost_equal(result, 9, err_msg=msg) + + def test_modular_power(self): + # modular power is not implemented, so ensure it errors + a = 5 + b = 4 + c = 10 + expected = pow(a, b, c) # noqa: F841 + for t in (np.int32, np.float32, np.complex64): + # note that 3-operand power only dispatches on the first argument + assert_raises(TypeError, operator.pow, t(a), b, c) + assert_raises(TypeError, operator.pow, np.array(t(a)), b, c) + + +def floordiv_and_mod(x, y): + return (x // y, x % y) + + +def _signs(dt): + if dt in np.typecodes['UnsignedInteger']: + return (+1,) + else: + return (+1, -1) + + +class TestModulus: + + def test_modulus_basic(self): + dt = np.typecodes['AllInteger'] + np.typecodes['Float'] + for op in [floordiv_and_mod, divmod]: + for dt1, dt2 in itertools.product(dt, dt): + for sg1, sg2 in itertools.product(_signs(dt1), _signs(dt2)): + fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' + msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) + a = np.array(sg1*71, dtype=dt1)[()] + b = np.array(sg2*19, dtype=dt2)[()] + div, rem = op(a, b) + assert_equal(div*b + rem, a, err_msg=msg) + if sg2 == -1: + assert_(b < rem <= 0, msg) + else: + assert_(b > rem >= 0, msg) + + def test_float_modulus_exact(self): + # test that float results are exact for small integers. This also + # holds for the same integers scaled by powers of two. + nlst = list(range(-127, 0)) + plst = list(range(1, 128)) + dividend = nlst + [0] + plst + divisor = nlst + plst + arg = list(itertools.product(dividend, divisor)) + tgt = list(divmod(*t) for t in arg) + + a, b = np.array(arg, dtype=int).T + # convert exact integer results from Python to float so that + # signed zero can be used, it is checked. + tgtdiv, tgtrem = np.array(tgt, dtype=float).T + tgtdiv = np.where((tgtdiv == 0.0) & ((b < 0) ^ (a < 0)), -0.0, tgtdiv) + tgtrem = np.where((tgtrem == 0.0) & (b < 0), -0.0, tgtrem) + + for op in [floordiv_and_mod, divmod]: + for dt in np.typecodes['Float']: + msg = 'op: %s, dtype: %s' % (op.__name__, dt) + fa = a.astype(dt) + fb = b.astype(dt) + # use list comprehension so a_ and b_ are scalars + div, rem = zip(*[op(a_, b_) for a_, b_ in zip(fa, fb)]) + assert_equal(div, tgtdiv, err_msg=msg) + assert_equal(rem, tgtrem, err_msg=msg) + + def test_float_modulus_roundoff(self): + # gh-6127 + dt = np.typecodes['Float'] + for op in [floordiv_and_mod, divmod]: + for dt1, dt2 in itertools.product(dt, dt): + for sg1, sg2 in itertools.product((+1, -1), (+1, -1)): + fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' + msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) + a = np.array(sg1*78*6e-8, dtype=dt1)[()] + b = np.array(sg2*6e-8, dtype=dt2)[()] + div, rem = op(a, b) + # Equal assertion should hold when fmod is used + assert_equal(div*b + rem, a, err_msg=msg) + if sg2 == -1: + assert_(b < rem <= 0, msg) + else: + assert_(b > rem >= 0, msg) + + def test_float_modulus_corner_cases(self): + # Check remainder magnitude. + for dt in np.typecodes['Float']: + b = np.array(1.0, dtype=dt) + a = np.nextafter(np.array(0.0, dtype=dt), -b) + rem = operator.mod(a, b) + assert_(rem <= b, 'dt: %s' % dt) + rem = operator.mod(-a, -b) + assert_(rem >= -b, 'dt: %s' % dt) + + # Check nans, inf + with suppress_warnings() as sup: + sup.filter(RuntimeWarning, "invalid value encountered in remainder") + sup.filter(RuntimeWarning, "divide by zero encountered in remainder") + sup.filter(RuntimeWarning, "divide by zero encountered in floor_divide") + sup.filter(RuntimeWarning, "divide by zero encountered in divmod") + sup.filter(RuntimeWarning, "invalid value encountered in divmod") + for dt in np.typecodes['Float']: + fone = np.array(1.0, dtype=dt) + fzer = np.array(0.0, dtype=dt) + finf = np.array(np.inf, dtype=dt) + fnan = np.array(np.nan, dtype=dt) + rem = operator.mod(fone, fzer) + assert_(np.isnan(rem), 'dt: %s' % dt) + # MSVC 2008 returns NaN here, so disable the check. + #rem = operator.mod(fone, finf) + #assert_(rem == fone, 'dt: %s' % dt) + rem = operator.mod(fone, fnan) + assert_(np.isnan(rem), 'dt: %s' % dt) + rem = operator.mod(finf, fone) + assert_(np.isnan(rem), 'dt: %s' % dt) + for op in [floordiv_and_mod, divmod]: + div, mod = op(fone, fzer) + assert_(np.isinf(div)) and assert_(np.isnan(mod)) + + def test_inplace_floordiv_handling(self): + # issue gh-12927 + # this only applies to in-place floordiv //=, because the output type + # promotes to float which does not fit + a = np.array([1, 2], np.int64) + b = np.array([1, 2], np.uint64) + with pytest.raises(TypeError, + match=r"Cannot cast ufunc 'floor_divide' output from"): + a //= b + + +class TestComplexDivision: + def test_zero_division(self): + with np.errstate(all="ignore"): + for t in [np.complex64, np.complex128]: + a = t(0.0) + b = t(1.0) + assert_(np.isinf(b/a)) + b = t(complex(np.inf, np.inf)) + assert_(np.isinf(b/a)) + b = t(complex(np.inf, np.nan)) + assert_(np.isinf(b/a)) + b = t(complex(np.nan, np.inf)) + assert_(np.isinf(b/a)) + b = t(complex(np.nan, np.nan)) + assert_(np.isnan(b/a)) + b = t(0.) + assert_(np.isnan(b/a)) + + def test_signed_zeros(self): + with np.errstate(all="ignore"): + for t in [np.complex64, np.complex128]: + # tupled (numerator, denominator, expected) + # for testing as expected == numerator/denominator + data = ( + (( 0.0,-1.0), ( 0.0, 1.0), (-1.0,-0.0)), + (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), + (( 0.0,-1.0), (-0.0,-1.0), ( 1.0, 0.0)), + (( 0.0,-1.0), (-0.0, 1.0), (-1.0, 0.0)), + (( 0.0, 1.0), ( 0.0,-1.0), (-1.0, 0.0)), + (( 0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), + ((-0.0,-1.0), ( 0.0,-1.0), ( 1.0,-0.0)), + ((-0.0, 1.0), ( 0.0,-1.0), (-1.0,-0.0)) + ) + for cases in data: + n = cases[0] + d = cases[1] + ex = cases[2] + result = t(complex(n[0], n[1])) / t(complex(d[0], d[1])) + # check real and imag parts separately to avoid comparison + # in array context, which does not account for signed zeros + assert_equal(result.real, ex[0]) + assert_equal(result.imag, ex[1]) + + def test_branches(self): + with np.errstate(all="ignore"): + for t in [np.complex64, np.complex128]: + # tupled (numerator, denominator, expected) + # for testing as expected == numerator/denominator + data = list() + + # trigger branch: real(fabs(denom)) > imag(fabs(denom)) + # followed by else condition as neither are == 0 + data.append((( 2.0, 1.0), ( 2.0, 1.0), (1.0, 0.0))) + + # trigger branch: real(fabs(denom)) > imag(fabs(denom)) + # followed by if condition as both are == 0 + # is performed in test_zero_division(), so this is skipped + + # trigger else if branch: real(fabs(denom)) < imag(fabs(denom)) + data.append((( 1.0, 2.0), ( 1.0, 2.0), (1.0, 0.0))) + + for cases in data: + n = cases[0] + d = cases[1] + ex = cases[2] + result = t(complex(n[0], n[1])) / t(complex(d[0], d[1])) + # check real and imag parts separately to avoid comparison + # in array context, which does not account for signed zeros + assert_equal(result.real, ex[0]) + assert_equal(result.imag, ex[1]) + + +class TestConversion: + def test_int_from_long(self): + l = [1e6, 1e12, 1e18, -1e6, -1e12, -1e18] + li = [10**6, 10**12, 10**18, -10**6, -10**12, -10**18] + for T in [None, np.float64, np.int64]: + a = np.array(l, dtype=T) + assert_equal([int(_m) for _m in a], li) + + a = np.array(l[:3], dtype=np.uint64) + assert_equal([int(_m) for _m in a], li[:3]) + + def test_iinfo_long_values(self): + for code in 'bBhH': + with pytest.raises(OverflowError): + np.array(np.iinfo(code).max + 1, dtype=code) + + for code in np.typecodes['AllInteger']: + res = np.array(np.iinfo(code).max, dtype=code) + tgt = np.iinfo(code).max + assert_(res == tgt) + + for code in np.typecodes['AllInteger']: + res = np.dtype(code).type(np.iinfo(code).max) + tgt = np.iinfo(code).max + assert_(res == tgt) + + def test_int_raise_behaviour(self): + def overflow_error_func(dtype): + dtype(np.iinfo(dtype).max + 1) + + for code in [np.int_, np.uint, np.longlong, np.ulonglong]: + assert_raises(OverflowError, overflow_error_func, code) + + def test_int_from_infinite_longdouble(self): + # gh-627 + x = np.longdouble(np.inf) + assert_raises(OverflowError, int, x) + with suppress_warnings() as sup: + sup.record(ComplexWarning) + x = np.clongdouble(np.inf) + assert_raises(OverflowError, int, x) + assert_equal(len(sup.log), 1) + + @pytest.mark.skipif(not IS_PYPY, reason="Test is PyPy only (gh-9972)") + def test_int_from_infinite_longdouble___int__(self): + x = np.longdouble(np.inf) + assert_raises(OverflowError, x.__int__) + with suppress_warnings() as sup: + sup.record(ComplexWarning) + x = np.clongdouble(np.inf) + assert_raises(OverflowError, x.__int__) + assert_equal(len(sup.log), 1) + + @pytest.mark.skipif(np.finfo(np.double) == np.finfo(np.longdouble), + reason="long double is same as double") + @pytest.mark.skipif(platform.machine().startswith("ppc"), + reason="IBM double double") + def test_int_from_huge_longdouble(self): + # Produce a longdouble that would overflow a double, + # use exponent that avoids bug in Darwin pow function. + exp = np.finfo(np.double).maxexp - 1 + huge_ld = 2 * 1234 * np.longdouble(2) ** exp + huge_i = 2 * 1234 * 2 ** exp + assert_(huge_ld != np.inf) + assert_equal(int(huge_ld), huge_i) + + def test_int_from_longdouble(self): + x = np.longdouble(1.5) + assert_equal(int(x), 1) + x = np.longdouble(-10.5) + assert_equal(int(x), -10) + + def test_numpy_scalar_relational_operators(self): + # All integer + for dt1 in np.typecodes['AllInteger']: + assert_(1 > np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,)) + assert_(not 1 < np.array(0, dtype=dt1)[()], "type %s failed" % (dt1,)) + + for dt2 in np.typecodes['AllInteger']: + assert_(np.array(1, dtype=dt1)[()] > np.array(0, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1)[()] < np.array(0, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + + #Unsigned integers + for dt1 in 'BHILQP': + assert_(-1 < np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) + assert_(not -1 > np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) + assert_(-1 != np.array(1, dtype=dt1)[()], "type %s failed" % (dt1,)) + + #unsigned vs signed + for dt2 in 'bhilqp': + assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + assert_(np.array(1, dtype=dt1)[()] != np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + + #Signed integers and floats + for dt1 in 'bhlqp' + np.typecodes['Float']: + assert_(1 > np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) + assert_(not 1 < np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) + assert_(-1 == np.array(-1, dtype=dt1)[()], "type %s failed" % (dt1,)) + + for dt2 in 'bhlqp' + np.typecodes['Float']: + assert_(np.array(1, dtype=dt1)[()] > np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + assert_(not np.array(1, dtype=dt1)[()] < np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + assert_(np.array(-1, dtype=dt1)[()] == np.array(-1, dtype=dt2)[()], + "type %s and %s failed" % (dt1, dt2)) + + def test_scalar_comparison_to_none(self): + # Scalars should just return False and not give a warnings. + # The comparisons are flagged by pep8, ignore that. + with warnings.catch_warnings(record=True) as w: + warnings.filterwarnings('always', '', FutureWarning) + assert_(not np.float32(1) == None) + assert_(not np.str_('test') == None) + # This is dubious (see below): + assert_(not np.datetime64('NaT') == None) + + assert_(np.float32(1) != None) + assert_(np.str_('test') != None) + # This is dubious (see below): + assert_(np.datetime64('NaT') != None) + assert_(len(w) == 0) + + # For documentation purposes, this is why the datetime is dubious. + # At the time of deprecation this was no behaviour change, but + # it has to be considered when the deprecations are done. + assert_(np.equal(np.datetime64('NaT'), None)) + + +#class TestRepr: +# def test_repr(self): +# for t in types: +# val = t(1197346475.0137341) +# val_repr = repr(val) +# val2 = eval(val_repr) +# assert_equal( val, val2 ) + + +class TestRepr: + def _test_type_repr(self, t): + finfo = np.finfo(t) + last_fraction_bit_idx = finfo.nexp + finfo.nmant + last_exponent_bit_idx = finfo.nexp + storage_bytes = np.dtype(t).itemsize*8 + # could add some more types to the list below + for which in ['small denorm', 'small norm']: + # Values from https://en.wikipedia.org/wiki/IEEE_754 + constr = np.array([0x00]*storage_bytes, dtype=np.uint8) + if which == 'small denorm': + byte = last_fraction_bit_idx // 8 + bytebit = 7-(last_fraction_bit_idx % 8) + constr[byte] = 1 << bytebit + elif which == 'small norm': + byte = last_exponent_bit_idx // 8 + bytebit = 7-(last_exponent_bit_idx % 8) + constr[byte] = 1 << bytebit + else: + raise ValueError('hmm') + val = constr.view(t)[0] + val_repr = repr(val) + val2 = t(eval(val_repr)) + if not (val2 == 0 and val < 1e-100): + assert_equal(val, val2) + + def test_float_repr(self): + # long double test cannot work, because eval goes through a python + # float + for t in [np.float32, np.float64]: + self._test_type_repr(t) + + +if not IS_PYPY: + # sys.getsizeof() is not valid on PyPy + class TestSizeOf: + + def test_equal_nbytes(self): + for type in types: + x = type(0) + assert_(sys.getsizeof(x) > x.nbytes) + + def test_error(self): + d = np.float32() + assert_raises(TypeError, d.__sizeof__, "a") + + +class TestMultiply: + def test_seq_repeat(self): + # Test that basic sequences get repeated when multiplied with + # numpy integers. And errors are raised when multiplied with others. + # Some of this behaviour may be controversial and could be open for + # change. + accepted_types = set(np.typecodes["AllInteger"]) + deprecated_types = {'?'} + forbidden_types = ( + set(np.typecodes["All"]) - accepted_types - deprecated_types) + forbidden_types -= {'V'} # can't default-construct void scalars + + for seq_type in (list, tuple): + seq = seq_type([1, 2, 3]) + for numpy_type in accepted_types: + i = np.dtype(numpy_type).type(2) + assert_equal(seq * i, seq * int(i)) + assert_equal(i * seq, int(i) * seq) + + for numpy_type in deprecated_types: + i = np.dtype(numpy_type).type() + assert_equal( + assert_warns(DeprecationWarning, operator.mul, seq, i), + seq * int(i)) + assert_equal( + assert_warns(DeprecationWarning, operator.mul, i, seq), + int(i) * seq) + + for numpy_type in forbidden_types: + i = np.dtype(numpy_type).type() + assert_raises(TypeError, operator.mul, seq, i) + assert_raises(TypeError, operator.mul, i, seq) + + def test_no_seq_repeat_basic_array_like(self): + # Test that an array-like which does not know how to be multiplied + # does not attempt sequence repeat (raise TypeError). + # See also gh-7428. + class ArrayLike: + def __init__(self, arr): + self.arr = arr + + def __array__(self, dtype=None, copy=None): + return self.arr + + # Test for simple ArrayLike above and memoryviews (original report) + for arr_like in (ArrayLike(np.ones(3)), memoryview(np.ones(3))): + assert_array_equal(arr_like * np.float32(3.), np.full(3, 3.)) + assert_array_equal(np.float32(3.) * arr_like, np.full(3, 3.)) + assert_array_equal(arr_like * np.int_(3), np.full(3, 3)) + assert_array_equal(np.int_(3) * arr_like, np.full(3, 3)) + + +class TestNegative: + def test_exceptions(self): + a = np.ones((), dtype=np.bool)[()] + assert_raises(TypeError, operator.neg, a) + + def test_result(self): + types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + with suppress_warnings() as sup: + sup.filter(RuntimeWarning) + for dt in types: + a = np.ones((), dtype=dt)[()] + if dt in np.typecodes['UnsignedInteger']: + st = np.dtype(dt).type + max = st(np.iinfo(dt).max) + assert_equal(operator.neg(a), max) + else: + assert_equal(operator.neg(a) + a, 0) + +class TestSubtract: + def test_exceptions(self): + a = np.ones((), dtype=np.bool)[()] + assert_raises(TypeError, operator.sub, a, a) + + def test_result(self): + types = np.typecodes['AllInteger'] + np.typecodes['AllFloat'] + with suppress_warnings() as sup: + sup.filter(RuntimeWarning) + for dt in types: + a = np.ones((), dtype=dt)[()] + assert_equal(operator.sub(a, a), 0) + + +class TestAbs: + def _test_abs_func(self, absfunc, test_dtype): + x = test_dtype(-1.5) + assert_equal(absfunc(x), 1.5) + x = test_dtype(0.0) + res = absfunc(x) + # assert_equal() checks zero signedness + assert_equal(res, 0.0) + x = test_dtype(-0.0) + res = absfunc(x) + assert_equal(res, 0.0) + + x = test_dtype(np.finfo(test_dtype).max) + assert_equal(absfunc(x), x.real) + + with suppress_warnings() as sup: + sup.filter(UserWarning) + x = test_dtype(np.finfo(test_dtype).tiny) + assert_equal(absfunc(x), x.real) + + x = test_dtype(np.finfo(test_dtype).min) + assert_equal(absfunc(x), -x.real) + + @pytest.mark.parametrize("dtype", floating_types + complex_floating_types) + def test_builtin_abs(self, dtype): + if ( + sys.platform == "cygwin" and dtype == np.clongdouble and + ( + _pep440.parse(platform.release().split("-")[0]) + < _pep440.Version("3.3.0") + ) + ): + pytest.xfail( + reason="absl is computed in double precision on cygwin < 3.3" + ) + self._test_abs_func(abs, dtype) + + @pytest.mark.parametrize("dtype", floating_types + complex_floating_types) + def test_numpy_abs(self, dtype): + if ( + sys.platform == "cygwin" and dtype == np.clongdouble and + ( + _pep440.parse(platform.release().split("-")[0]) + < _pep440.Version("3.3.0") + ) + ): + pytest.xfail( + reason="absl is computed in double precision on cygwin < 3.3" + ) + self._test_abs_func(np.abs, dtype) + +class TestBitShifts: + + @pytest.mark.parametrize('type_code', np.typecodes['AllInteger']) + @pytest.mark.parametrize('op', + [operator.rshift, operator.lshift], ids=['>>', '<<']) + def test_shift_all_bits(self, type_code, op): + """Shifts where the shift amount is the width of the type or wider """ + # gh-2449 + dt = np.dtype(type_code) + nbits = dt.itemsize * 8 + for val in [5, -5]: + for shift in [nbits, nbits + 4]: + val_scl = np.array(val).astype(dt)[()] + shift_scl = dt.type(shift) + res_scl = op(val_scl, shift_scl) + if val_scl < 0 and op is operator.rshift: + # sign bit is preserved + assert_equal(res_scl, -1) + else: + assert_equal(res_scl, 0) + + # Result on scalars should be the same as on arrays + val_arr = np.array([val_scl]*32, dtype=dt) + shift_arr = np.array([shift]*32, dtype=dt) + res_arr = op(val_arr, shift_arr) + assert_equal(res_arr, res_scl) + + +class TestHash: + @pytest.mark.parametrize("type_code", np.typecodes['AllInteger']) + def test_integer_hashes(self, type_code): + scalar = np.dtype(type_code).type + for i in range(128): + assert hash(i) == hash(scalar(i)) + + @pytest.mark.parametrize("type_code", np.typecodes['AllFloat']) + def test_float_and_complex_hashes(self, type_code): + scalar = np.dtype(type_code).type + for val in [np.pi, np.inf, 3, 6.]: + numpy_val = scalar(val) + # Cast back to Python, in case the NumPy scalar has less precision + if numpy_val.dtype.kind == 'c': + val = complex(numpy_val) + else: + val = float(numpy_val) + assert val == numpy_val + assert hash(val) == hash(numpy_val) + + if hash(float(np.nan)) != hash(float(np.nan)): + # If Python distinguishes different NaNs we do so too (gh-18833) + assert hash(scalar(np.nan)) != hash(scalar(np.nan)) + + @pytest.mark.parametrize("type_code", np.typecodes['Complex']) + def test_complex_hashes(self, type_code): + # Test some complex valued hashes specifically: + scalar = np.dtype(type_code).type + for val in [np.pi+1j, np.inf-3j, 3j, 6.+1j]: + numpy_val = scalar(val) + assert hash(complex(numpy_val)) == hash(numpy_val) + + +@contextlib.contextmanager +def recursionlimit(n): + o = sys.getrecursionlimit() + try: + sys.setrecursionlimit(n) + yield + finally: + sys.setrecursionlimit(o) + + +@given(sampled_from(objecty_things), + sampled_from(binary_operators_for_scalar_ints), + sampled_from(types + [rational])) +def test_operator_object_left(o, op, type_): + try: + with recursionlimit(200): + op(o, type_(1)) + except TypeError: + pass + + +@given(sampled_from(objecty_things), + sampled_from(binary_operators_for_scalar_ints), + sampled_from(types + [rational])) +def test_operator_object_right(o, op, type_): + try: + with recursionlimit(200): + op(type_(1), o) + except TypeError: + pass + + +@given(sampled_from(binary_operators_for_scalars), + sampled_from(types), + sampled_from(types)) +def test_operator_scalars(op, type1, type2): + try: + op(type1(1), type2(1)) + except TypeError: + pass + + +@pytest.mark.parametrize("op", binary_operators_for_scalars) +@pytest.mark.parametrize("sctype", [np.longdouble, np.clongdouble]) +def test_longdouble_operators_with_obj(sctype, op): + # This is/used to be tricky, because NumPy generally falls back to + # using the ufunc via `np.asarray()`, this effectively might do: + # longdouble + None + # -> asarray(longdouble) + np.array(None, dtype=object) + # -> asarray(longdouble).astype(object) + np.array(None, dtype=object) + # And after getting the scalars in the inner loop: + # -> longdouble + None + # + # That would recurse infinitely. Other scalars return the python object + # on cast, so this type of things works OK. + # + # As of NumPy 2.1, this has been consolidated into the np.generic binops + # and now checks `.item()`. That also allows the below path to work now. + try: + op(sctype(3), None) + except TypeError: + pass + try: + op(None, sctype(3)) + except TypeError: + pass + + +@pytest.mark.parametrize("op", [operator.add, operator.pow, operator.sub]) +@pytest.mark.parametrize("sctype", [np.longdouble, np.clongdouble]) +def test_longdouble_with_arrlike(sctype, op): + # As of NumPy 2.1, longdouble behaves like other types and can coerce + # e.g. lists. (Not necessarily better, but consistent.) + assert_array_equal(op(sctype(3), [1, 2]), op(3, np.array([1, 2]))) + assert_array_equal(op([1, 2], sctype(3)), op(np.array([1, 2]), 3)) + + +@pytest.mark.parametrize("op", binary_operators_for_scalars) +@pytest.mark.parametrize("sctype", [np.longdouble, np.clongdouble]) +@np.errstate(all="ignore") +def test_longdouble_operators_with_large_int(sctype, op): + # (See `test_longdouble_operators_with_obj` for why longdouble is special) + # NEP 50 means that the result is clearly a (c)longdouble here: + if sctype == np.clongdouble and op in [operator.mod, operator.floordiv]: + # The above operators are not support for complex though... + with pytest.raises(TypeError): + op(sctype(3), 2**64) + with pytest.raises(TypeError): + op(sctype(3), 2**64) + else: + assert op(sctype(3), -2**64) == op(sctype(3), sctype(-2**64)) + assert op(2**64, sctype(3)) == op(sctype(2**64), sctype(3)) + + +@pytest.mark.parametrize("dtype", np.typecodes["AllInteger"]) +@pytest.mark.parametrize("operation", [ + lambda min, max: max + max, + lambda min, max: min - max, + lambda min, max: max * max], ids=["+", "-", "*"]) +def test_scalar_integer_operation_overflow(dtype, operation): + st = np.dtype(dtype).type + min = st(np.iinfo(dtype).min) + max = st(np.iinfo(dtype).max) + + with pytest.warns(RuntimeWarning, match="overflow encountered"): + operation(min, max) + + +@pytest.mark.parametrize("dtype", np.typecodes["Integer"]) +@pytest.mark.parametrize("operation", [ + lambda min, neg_1: -min, + lambda min, neg_1: abs(min), + lambda min, neg_1: min * neg_1, + pytest.param(lambda min, neg_1: min // neg_1, + marks=pytest.mark.skip(reason="broken on some platforms"))], + ids=["neg", "abs", "*", "//"]) +def test_scalar_signed_integer_overflow(dtype, operation): + # The minimum signed integer can "overflow" for some additional operations + st = np.dtype(dtype).type + min = st(np.iinfo(dtype).min) + neg_1 = st(-1) + + with pytest.warns(RuntimeWarning, match="overflow encountered"): + operation(min, neg_1) + + +@pytest.mark.parametrize("dtype", np.typecodes["UnsignedInteger"]) +def test_scalar_unsigned_integer_overflow(dtype): + val = np.dtype(dtype).type(8) + with pytest.warns(RuntimeWarning, match="overflow encountered"): + -val + + zero = np.dtype(dtype).type(0) + -zero # does not warn + +@pytest.mark.parametrize("dtype", np.typecodes["AllInteger"]) +@pytest.mark.parametrize("operation", [ + lambda val, zero: val // zero, + lambda val, zero: val % zero, ], ids=["//", "%"]) +def test_scalar_integer_operation_divbyzero(dtype, operation): + st = np.dtype(dtype).type + val = st(100) + zero = st(0) + + with pytest.warns(RuntimeWarning, match="divide by zero"): + operation(val, zero) + + +ops_with_names = [ + ("__lt__", "__gt__", operator.lt, True), + ("__le__", "__ge__", operator.le, True), + ("__eq__", "__eq__", operator.eq, True), + # Note __op__ and __rop__ may be identical here: + ("__ne__", "__ne__", operator.ne, True), + ("__gt__", "__lt__", operator.gt, True), + ("__ge__", "__le__", operator.ge, True), + ("__floordiv__", "__rfloordiv__", operator.floordiv, False), + ("__truediv__", "__rtruediv__", operator.truediv, False), + ("__add__", "__radd__", operator.add, False), + ("__mod__", "__rmod__", operator.mod, False), + ("__mul__", "__rmul__", operator.mul, False), + ("__pow__", "__rpow__", operator.pow, False), + ("__sub__", "__rsub__", operator.sub, False), +] + + +@pytest.mark.parametrize(["__op__", "__rop__", "op", "cmp"], ops_with_names) +@pytest.mark.parametrize("sctype", [np.float32, np.float64, np.longdouble]) +def test_subclass_deferral(sctype, __op__, __rop__, op, cmp): + """ + This test covers scalar subclass deferral. Note that this is exceedingly + complicated, especially since it tends to fall back to the array paths and + these additionally add the "array priority" mechanism. + + The behaviour was modified subtly in 1.22 (to make it closer to how Python + scalars work). Due to its complexity and the fact that subclassing NumPy + scalars is probably a bad idea to begin with. There is probably room + for adjustments here. + """ + class myf_simple1(sctype): + pass + + class myf_simple2(sctype): + pass + + def op_func(self, other): + return __op__ + + def rop_func(self, other): + return __rop__ + + myf_op = type("myf_op", (sctype,), {__op__: op_func, __rop__: rop_func}) + + # inheritance has to override, or this is correctly lost: + res = op(myf_simple1(1), myf_simple2(2)) + assert type(res) == sctype or type(res) == np.bool + assert op(myf_simple1(1), myf_simple2(2)) == op(1, 2) # inherited + + # Two independent subclasses do not really define an order. This could + # be attempted, but we do not since Python's `int` does neither: + assert op(myf_op(1), myf_simple1(2)) == __op__ + assert op(myf_simple1(1), myf_op(2)) == op(1, 2) # inherited + + +def test_longdouble_complex(): + # Simple test to check longdouble and complex combinations, since these + # need to go through promotion, which longdouble needs to be careful about. + x = np.longdouble(1) + assert x + 1j == 1+1j + assert 1j + x == 1+1j + + +@pytest.mark.parametrize(["__op__", "__rop__", "op", "cmp"], ops_with_names) +@pytest.mark.parametrize("subtype", [float, int, complex, np.float16]) +@np._no_nep50_warning() +def test_pyscalar_subclasses(subtype, __op__, __rop__, op, cmp): + # This tests that python scalar subclasses behave like a float64 (if they + # don't override it). + # In an earlier version of NEP 50, they behaved like the Python buildins. + def op_func(self, other): + return __op__ + + def rop_func(self, other): + return __rop__ + + # Check that deferring is indicated using `__array_ufunc__`: + myt = type("myt", (subtype,), + {__op__: op_func, __rop__: rop_func, "__array_ufunc__": None}) + + # Just like normally, we should never presume we can modify the float. + assert op(myt(1), np.float64(2)) == __op__ + assert op(np.float64(1), myt(2)) == __rop__ + + if op in {operator.mod, operator.floordiv} and subtype == complex: + return # module is not support for complex. Do not test. + + if __rop__ == __op__: + return + + # When no deferring is indicated, subclasses are handled normally. + myt = type("myt", (subtype,), {__rop__: rop_func}) + behaves_like = lambda x: np.array(subtype(x))[()] + + # Check for float32, as a float subclass float64 may behave differently + res = op(myt(1), np.float16(2)) + expected = op(behaves_like(1), np.float16(2)) + assert res == expected + assert type(res) == type(expected) + res = op(np.float32(2), myt(1)) + expected = op(np.float32(2), behaves_like(1)) + assert res == expected + assert type(res) == type(expected) + + # Same check for longdouble (compare via dtype to accept float64 when + # longdouble has the identical size), which is currently not perfectly + # consistent. + res = op(myt(1), np.longdouble(2)) + expected = op(behaves_like(1), np.longdouble(2)) + assert res == expected + assert np.dtype(type(res)) == np.dtype(type(expected)) + res = op(np.float32(2), myt(1)) + expected = op(np.float32(2), behaves_like(1)) + assert res == expected + assert np.dtype(type(res)) == np.dtype(type(expected)) + + +def test_truediv_int(): + # This should work, as the result is float: + assert np.uint8(3) / 123454 == np.float64(3) / 123454 + + +@pytest.mark.slow +@pytest.mark.parametrize("op", + # TODO: Power is a bit special, but here mostly bools seem to behave oddly + [op for op in binary_operators_for_scalars if op is not operator.pow]) +@pytest.mark.parametrize("sctype", types) +@pytest.mark.parametrize("other_type", [float, int, complex]) +@pytest.mark.parametrize("rop", [True, False]) +def test_scalar_matches_array_op_with_pyscalar(op, sctype, other_type, rop): + # Check that the ufunc path matches by coercing to an array explicitly + val1 = sctype(2) + val2 = other_type(2) + + if rop: + _op = op + op = lambda x, y: _op(y, x) + + try: + res = op(val1, val2) + except TypeError: + try: + expected = op(np.asarray(val1), val2) + raise AssertionError("ufunc didn't raise.") + except TypeError: + return + else: + expected = op(np.asarray(val1), val2) + + # Note that we only check dtype equivalency, as ufuncs may pick the lower + # dtype if they are equivalent. + assert res == expected + if isinstance(val1, float) and other_type is complex and rop: + # Python complex accepts float subclasses, so we don't get a chance + # and the result may be a Python complelx (thus, the `np.array()``) + assert np.array(res).dtype == expected.dtype + else: + assert res.dtype == expected.dtype diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_shape_base.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_shape_base.py new file mode 100644 index 0000000000000000000000000000000000000000..a885cb64a661d733a68cbfb3dab5e6a25a5a7258 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_shape_base.py @@ -0,0 +1,860 @@ +import pytest +import numpy as np +from numpy._core import ( + array, arange, atleast_1d, atleast_2d, atleast_3d, block, vstack, hstack, + newaxis, concatenate, stack + ) +from numpy.exceptions import AxisError +from numpy._core.shape_base import (_block_dispatcher, _block_setup, + _block_concatenate, _block_slicing) +from numpy.testing import ( + assert_, assert_raises, assert_array_equal, assert_equal, + assert_raises_regex, assert_warns, IS_PYPY + ) + + +class TestAtleast1d: + def test_0D_array(self): + a = array(1) + b = array(2) + res = [atleast_1d(a), atleast_1d(b)] + desired = [array([1]), array([2])] + assert_array_equal(res, desired) + + def test_1D_array(self): + a = array([1, 2]) + b = array([2, 3]) + res = [atleast_1d(a), atleast_1d(b)] + desired = [array([1, 2]), array([2, 3])] + assert_array_equal(res, desired) + + def test_2D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + res = [atleast_1d(a), atleast_1d(b)] + desired = [a, b] + assert_array_equal(res, desired) + + def test_3D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + a = array([a, a]) + b = array([b, b]) + res = [atleast_1d(a), atleast_1d(b)] + desired = [a, b] + assert_array_equal(res, desired) + + def test_r1array(self): + """ Test to make sure equivalent Travis O's r1array function + """ + assert_(atleast_1d(3).shape == (1,)) + assert_(atleast_1d(3j).shape == (1,)) + assert_(atleast_1d(3.0).shape == (1,)) + assert_(atleast_1d([[2, 3], [4, 5]]).shape == (2, 2)) + + +class TestAtleast2d: + def test_0D_array(self): + a = array(1) + b = array(2) + res = [atleast_2d(a), atleast_2d(b)] + desired = [array([[1]]), array([[2]])] + assert_array_equal(res, desired) + + def test_1D_array(self): + a = array([1, 2]) + b = array([2, 3]) + res = [atleast_2d(a), atleast_2d(b)] + desired = [array([[1, 2]]), array([[2, 3]])] + assert_array_equal(res, desired) + + def test_2D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + res = [atleast_2d(a), atleast_2d(b)] + desired = [a, b] + assert_array_equal(res, desired) + + def test_3D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + a = array([a, a]) + b = array([b, b]) + res = [atleast_2d(a), atleast_2d(b)] + desired = [a, b] + assert_array_equal(res, desired) + + def test_r2array(self): + """ Test to make sure equivalent Travis O's r2array function + """ + assert_(atleast_2d(3).shape == (1, 1)) + assert_(atleast_2d([3j, 1]).shape == (1, 2)) + assert_(atleast_2d([[[3, 1], [4, 5]], [[3, 5], [1, 2]]]).shape == (2, 2, 2)) + + +class TestAtleast3d: + def test_0D_array(self): + a = array(1) + b = array(2) + res = [atleast_3d(a), atleast_3d(b)] + desired = [array([[[1]]]), array([[[2]]])] + assert_array_equal(res, desired) + + def test_1D_array(self): + a = array([1, 2]) + b = array([2, 3]) + res = [atleast_3d(a), atleast_3d(b)] + desired = [array([[[1], [2]]]), array([[[2], [3]]])] + assert_array_equal(res, desired) + + def test_2D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + res = [atleast_3d(a), atleast_3d(b)] + desired = [a[:,:, newaxis], b[:,:, newaxis]] + assert_array_equal(res, desired) + + def test_3D_array(self): + a = array([[1, 2], [1, 2]]) + b = array([[2, 3], [2, 3]]) + a = array([a, a]) + b = array([b, b]) + res = [atleast_3d(a), atleast_3d(b)] + desired = [a, b] + assert_array_equal(res, desired) + + +class TestHstack: + def test_non_iterable(self): + assert_raises(TypeError, hstack, 1) + + def test_empty_input(self): + assert_raises(ValueError, hstack, ()) + + def test_0D_array(self): + a = array(1) + b = array(2) + res = hstack([a, b]) + desired = array([1, 2]) + assert_array_equal(res, desired) + + def test_1D_array(self): + a = array([1]) + b = array([2]) + res = hstack([a, b]) + desired = array([1, 2]) + assert_array_equal(res, desired) + + def test_2D_array(self): + a = array([[1], [2]]) + b = array([[1], [2]]) + res = hstack([a, b]) + desired = array([[1, 1], [2, 2]]) + assert_array_equal(res, desired) + + def test_generator(self): + with pytest.raises(TypeError, match="arrays to stack must be"): + hstack(np.arange(3) for _ in range(2)) + with pytest.raises(TypeError, match="arrays to stack must be"): + hstack(map(lambda x: x, np.ones((3, 2)))) + + def test_casting_and_dtype(self): + a = np.array([1, 2, 3]) + b = np.array([2.5, 3.5, 4.5]) + res = np.hstack((a, b), casting="unsafe", dtype=np.int64) + expected_res = np.array([1, 2, 3, 2, 3, 4]) + assert_array_equal(res, expected_res) + + def test_casting_and_dtype_type_error(self): + a = np.array([1, 2, 3]) + b = np.array([2.5, 3.5, 4.5]) + with pytest.raises(TypeError): + hstack((a, b), casting="safe", dtype=np.int64) + + +class TestVstack: + def test_non_iterable(self): + assert_raises(TypeError, vstack, 1) + + def test_empty_input(self): + assert_raises(ValueError, vstack, ()) + + def test_0D_array(self): + a = array(1) + b = array(2) + res = vstack([a, b]) + desired = array([[1], [2]]) + assert_array_equal(res, desired) + + def test_1D_array(self): + a = array([1]) + b = array([2]) + res = vstack([a, b]) + desired = array([[1], [2]]) + assert_array_equal(res, desired) + + def test_2D_array(self): + a = array([[1], [2]]) + b = array([[1], [2]]) + res = vstack([a, b]) + desired = array([[1], [2], [1], [2]]) + assert_array_equal(res, desired) + + def test_2D_array2(self): + a = array([1, 2]) + b = array([1, 2]) + res = vstack([a, b]) + desired = array([[1, 2], [1, 2]]) + assert_array_equal(res, desired) + + def test_generator(self): + with pytest.raises(TypeError, match="arrays to stack must be"): + vstack(np.arange(3) for _ in range(2)) + + def test_casting_and_dtype(self): + a = np.array([1, 2, 3]) + b = np.array([2.5, 3.5, 4.5]) + res = np.vstack((a, b), casting="unsafe", dtype=np.int64) + expected_res = np.array([[1, 2, 3], [2, 3, 4]]) + assert_array_equal(res, expected_res) + + def test_casting_and_dtype_type_error(self): + a = np.array([1, 2, 3]) + b = np.array([2.5, 3.5, 4.5]) + with pytest.raises(TypeError): + vstack((a, b), casting="safe", dtype=np.int64) + + + +class TestConcatenate: + def test_returns_copy(self): + a = np.eye(3) + b = np.concatenate([a]) + b[0, 0] = 2 + assert b[0, 0] != a[0, 0] + + def test_exceptions(self): + # test axis must be in bounds + for ndim in [1, 2, 3]: + a = np.ones((1,)*ndim) + np.concatenate((a, a), axis=0) # OK + assert_raises(AxisError, np.concatenate, (a, a), axis=ndim) + assert_raises(AxisError, np.concatenate, (a, a), axis=-(ndim + 1)) + + # Scalars cannot be concatenated + assert_raises(ValueError, concatenate, (0,)) + assert_raises(ValueError, concatenate, (np.array(0),)) + + # dimensionality must match + assert_raises_regex( + ValueError, + r"all the input arrays must have same number of dimensions, but " + r"the array at index 0 has 1 dimension\(s\) and the array at " + r"index 1 has 2 dimension\(s\)", + np.concatenate, (np.zeros(1), np.zeros((1, 1)))) + + # test shapes must match except for concatenation axis + a = np.ones((1, 2, 3)) + b = np.ones((2, 2, 3)) + axis = list(range(3)) + for i in range(3): + np.concatenate((a, b), axis=axis[0]) # OK + assert_raises_regex( + ValueError, + "all the input array dimensions except for the concatenation axis " + "must match exactly, but along dimension {}, the array at " + "index 0 has size 1 and the array at index 1 has size 2" + .format(i), + np.concatenate, (a, b), axis=axis[1]) + assert_raises(ValueError, np.concatenate, (a, b), axis=axis[2]) + a = np.moveaxis(a, -1, 0) + b = np.moveaxis(b, -1, 0) + axis.append(axis.pop(0)) + + # No arrays to concatenate raises ValueError + assert_raises(ValueError, concatenate, ()) + + def test_concatenate_axis_None(self): + a = np.arange(4, dtype=np.float64).reshape((2, 2)) + b = list(range(3)) + c = ['x'] + r = np.concatenate((a, a), axis=None) + assert_equal(r.dtype, a.dtype) + assert_equal(r.ndim, 1) + r = np.concatenate((a, b), axis=None) + assert_equal(r.size, a.size + len(b)) + assert_equal(r.dtype, a.dtype) + r = np.concatenate((a, b, c), axis=None, dtype="U") + d = array(['0.0', '1.0', '2.0', '3.0', + '0', '1', '2', 'x']) + assert_array_equal(r, d) + + out = np.zeros(a.size + len(b)) + r = np.concatenate((a, b), axis=None) + rout = np.concatenate((a, b), axis=None, out=out) + assert_(out is rout) + assert_equal(r, rout) + + def test_large_concatenate_axis_None(self): + # When no axis is given, concatenate uses flattened versions. + # This also had a bug with many arrays (see gh-5979). + x = np.arange(1, 100) + r = np.concatenate(x, None) + assert_array_equal(x, r) + + # Once upon a time, this was the same as `axis=None` now it fails + # (with an unspecified error, as multiple things are wrong here) + with pytest.raises(ValueError): + np.concatenate(x, 100) + + def test_concatenate(self): + # Test concatenate function + # One sequence returns unmodified (but as array) + r4 = list(range(4)) + assert_array_equal(concatenate((r4,)), r4) + # Any sequence + assert_array_equal(concatenate((tuple(r4),)), r4) + assert_array_equal(concatenate((array(r4),)), r4) + # 1D default concatenation + r3 = list(range(3)) + assert_array_equal(concatenate((r4, r3)), r4 + r3) + # Mixed sequence types + assert_array_equal(concatenate((tuple(r4), r3)), r4 + r3) + assert_array_equal(concatenate((array(r4), r3)), r4 + r3) + # Explicit axis specification + assert_array_equal(concatenate((r4, r3), 0), r4 + r3) + # Including negative + assert_array_equal(concatenate((r4, r3), -1), r4 + r3) + # 2D + a23 = array([[10, 11, 12], [13, 14, 15]]) + a13 = array([[0, 1, 2]]) + res = array([[10, 11, 12], [13, 14, 15], [0, 1, 2]]) + assert_array_equal(concatenate((a23, a13)), res) + assert_array_equal(concatenate((a23, a13), 0), res) + assert_array_equal(concatenate((a23.T, a13.T), 1), res.T) + assert_array_equal(concatenate((a23.T, a13.T), -1), res.T) + # Arrays much match shape + assert_raises(ValueError, concatenate, (a23.T, a13.T), 0) + # 3D + res = arange(2 * 3 * 7).reshape((2, 3, 7)) + a0 = res[..., :4] + a1 = res[..., 4:6] + a2 = res[..., 6:] + assert_array_equal(concatenate((a0, a1, a2), 2), res) + assert_array_equal(concatenate((a0, a1, a2), -1), res) + assert_array_equal(concatenate((a0.T, a1.T, a2.T), 0), res.T) + + out = res.copy() + rout = concatenate((a0, a1, a2), 2, out=out) + assert_(out is rout) + assert_equal(res, rout) + + @pytest.mark.skipif(IS_PYPY, reason="PYPY handles sq_concat, nb_add differently than cpython") + def test_operator_concat(self): + import operator + a = array([1, 2]) + b = array([3, 4]) + n = [1,2] + res = array([1, 2, 3, 4]) + assert_raises(TypeError, operator.concat, a, b) + assert_raises(TypeError, operator.concat, a, n) + assert_raises(TypeError, operator.concat, n, a) + assert_raises(TypeError, operator.concat, a, 1) + assert_raises(TypeError, operator.concat, 1, a) + + def test_bad_out_shape(self): + a = array([1, 2]) + b = array([3, 4]) + + assert_raises(ValueError, concatenate, (a, b), out=np.empty(5)) + assert_raises(ValueError, concatenate, (a, b), out=np.empty((4,1))) + assert_raises(ValueError, concatenate, (a, b), out=np.empty((1,4))) + concatenate((a, b), out=np.empty(4)) + + @pytest.mark.parametrize("axis", [None, 0]) + @pytest.mark.parametrize("out_dtype", ["c8", "f4", "f8", ">f8", "i8", "S4"]) + @pytest.mark.parametrize("casting", + ['no', 'equiv', 'safe', 'same_kind', 'unsafe']) + def test_out_and_dtype(self, axis, out_dtype, casting): + # Compare usage of `out=out` with `dtype=out.dtype` + out = np.empty(4, dtype=out_dtype) + to_concat = (array([1.1, 2.2]), array([3.3, 4.4])) + + if not np.can_cast(to_concat[0], out_dtype, casting=casting): + with assert_raises(TypeError): + concatenate(to_concat, out=out, axis=axis, casting=casting) + with assert_raises(TypeError): + concatenate(to_concat, dtype=out.dtype, + axis=axis, casting=casting) + else: + res_out = concatenate(to_concat, out=out, + axis=axis, casting=casting) + res_dtype = concatenate(to_concat, dtype=out.dtype, + axis=axis, casting=casting) + assert res_out is out + assert_array_equal(out, res_dtype) + assert res_dtype.dtype == out_dtype + + with assert_raises(TypeError): + concatenate(to_concat, out=out, dtype=out_dtype, axis=axis) + + @pytest.mark.parametrize("axis", [None, 0]) + @pytest.mark.parametrize("string_dt", ["S", "U", "S0", "U0"]) + @pytest.mark.parametrize("arrs", + [([0.],), ([0.], [1]), ([0], ["string"], [1.])]) + def test_dtype_with_promotion(self, arrs, string_dt, axis): + # Note that U0 and S0 should be deprecated eventually and changed to + # actually give the empty string result (together with `np.array`) + res = np.concatenate(arrs, axis=axis, dtype=string_dt, casting="unsafe") + # The actual dtype should be identical to a cast (of a double array): + assert res.dtype == np.array(1.).astype(string_dt).dtype + + @pytest.mark.parametrize("axis", [None, 0]) + def test_string_dtype_does_not_inspect(self, axis): + with pytest.raises(TypeError): + np.concatenate(([None], [1]), dtype="S", axis=axis) + with pytest.raises(TypeError): + np.concatenate(([None], [1]), dtype="U", axis=axis) + + @pytest.mark.parametrize("axis", [None, 0]) + def test_subarray_error(self, axis): + with pytest.raises(TypeError, match=".*subarray dtype"): + np.concatenate(([1], [1]), dtype="(2,)i", axis=axis) + + +def test_stack(): + # non-iterable input + assert_raises(TypeError, stack, 1) + + # 0d input + for input_ in [(1, 2, 3), + [np.int32(1), np.int32(2), np.int32(3)], + [np.array(1), np.array(2), np.array(3)]]: + assert_array_equal(stack(input_), [1, 2, 3]) + # 1d input examples + a = np.array([1, 2, 3]) + b = np.array([4, 5, 6]) + r1 = array([[1, 2, 3], [4, 5, 6]]) + assert_array_equal(np.stack((a, b)), r1) + assert_array_equal(np.stack((a, b), axis=1), r1.T) + # all input types + assert_array_equal(np.stack(list([a, b])), r1) + assert_array_equal(np.stack(array([a, b])), r1) + # all shapes for 1d input + arrays = [np.random.randn(3) for _ in range(10)] + axes = [0, 1, -1, -2] + expected_shapes = [(10, 3), (3, 10), (3, 10), (10, 3)] + for axis, expected_shape in zip(axes, expected_shapes): + assert_equal(np.stack(arrays, axis).shape, expected_shape) + assert_raises_regex(AxisError, 'out of bounds', stack, arrays, axis=2) + assert_raises_regex(AxisError, 'out of bounds', stack, arrays, axis=-3) + # all shapes for 2d input + arrays = [np.random.randn(3, 4) for _ in range(10)] + axes = [0, 1, 2, -1, -2, -3] + expected_shapes = [(10, 3, 4), (3, 10, 4), (3, 4, 10), + (3, 4, 10), (3, 10, 4), (10, 3, 4)] + for axis, expected_shape in zip(axes, expected_shapes): + assert_equal(np.stack(arrays, axis).shape, expected_shape) + # empty arrays + assert_(stack([[], [], []]).shape == (3, 0)) + assert_(stack([[], [], []], axis=1).shape == (0, 3)) + # out + out = np.zeros_like(r1) + np.stack((a, b), out=out) + assert_array_equal(out, r1) + # edge cases + assert_raises_regex(ValueError, 'need at least one array', stack, []) + assert_raises_regex(ValueError, 'must have the same shape', + stack, [1, np.arange(3)]) + assert_raises_regex(ValueError, 'must have the same shape', + stack, [np.arange(3), 1]) + assert_raises_regex(ValueError, 'must have the same shape', + stack, [np.arange(3), 1], axis=1) + assert_raises_regex(ValueError, 'must have the same shape', + stack, [np.zeros((3, 3)), np.zeros(3)], axis=1) + assert_raises_regex(ValueError, 'must have the same shape', + stack, [np.arange(2), np.arange(3)]) + + # do not accept generators + with pytest.raises(TypeError, match="arrays to stack must be"): + stack(x for x in range(3)) + + #casting and dtype test + a = np.array([1, 2, 3]) + b = np.array([2.5, 3.5, 4.5]) + res = np.stack((a, b), axis=1, casting="unsafe", dtype=np.int64) + expected_res = np.array([[1, 2], [2, 3], [3, 4]]) + assert_array_equal(res, expected_res) + #casting and dtype with TypeError + with assert_raises(TypeError): + stack((a, b), dtype=np.int64, axis=1, casting="safe") + + +def test_unstack(): + a = np.arange(24).reshape((2, 3, 4)) + + for stacks in [np.unstack(a), + np.unstack(a, axis=0), + np.unstack(a, axis=-3)]: + assert isinstance(stacks, tuple) + assert len(stacks) == 2 + assert_array_equal(stacks[0], a[0]) + assert_array_equal(stacks[1], a[1]) + + for stacks in [np.unstack(a, axis=1), + np.unstack(a, axis=-2)]: + assert isinstance(stacks, tuple) + assert len(stacks) == 3 + assert_array_equal(stacks[0], a[:, 0]) + assert_array_equal(stacks[1], a[:, 1]) + assert_array_equal(stacks[2], a[:, 2]) + + for stacks in [np.unstack(a, axis=2), + np.unstack(a, axis=-1)]: + assert isinstance(stacks, tuple) + assert len(stacks) == 4 + assert_array_equal(stacks[0], a[:, :, 0]) + assert_array_equal(stacks[1], a[:, :, 1]) + assert_array_equal(stacks[2], a[:, :, 2]) + assert_array_equal(stacks[3], a[:, :, 3]) + + assert_raises(ValueError, np.unstack, a, axis=3) + assert_raises(ValueError, np.unstack, a, axis=-4) + assert_raises(ValueError, np.unstack, np.array(0), axis=0) + + +@pytest.mark.parametrize("axis", [0]) +@pytest.mark.parametrize("out_dtype", ["c8", "f4", "f8", ">f8", "i8"]) +@pytest.mark.parametrize("casting", + ['no', 'equiv', 'safe', 'same_kind', 'unsafe']) +def test_stack_out_and_dtype(axis, out_dtype, casting): + to_concat = (array([1, 2]), array([3, 4])) + res = array([[1, 2], [3, 4]]) + out = np.zeros_like(res) + + if not np.can_cast(to_concat[0], out_dtype, casting=casting): + with assert_raises(TypeError): + stack(to_concat, dtype=out_dtype, + axis=axis, casting=casting) + else: + res_out = stack(to_concat, out=out, + axis=axis, casting=casting) + res_dtype = stack(to_concat, dtype=out_dtype, + axis=axis, casting=casting) + assert res_out is out + assert_array_equal(out, res_dtype) + assert res_dtype.dtype == out_dtype + + with assert_raises(TypeError): + stack(to_concat, out=out, dtype=out_dtype, axis=axis) + + +class TestBlock: + @pytest.fixture(params=['block', 'force_concatenate', 'force_slicing']) + def block(self, request): + # blocking small arrays and large arrays go through different paths. + # the algorithm is triggered depending on the number of element + # copies required. + # We define a test fixture that forces most tests to go through + # both code paths. + # Ultimately, this should be removed if a single algorithm is found + # to be faster for both small and large arrays. + def _block_force_concatenate(arrays): + arrays, list_ndim, result_ndim, _ = _block_setup(arrays) + return _block_concatenate(arrays, list_ndim, result_ndim) + + def _block_force_slicing(arrays): + arrays, list_ndim, result_ndim, _ = _block_setup(arrays) + return _block_slicing(arrays, list_ndim, result_ndim) + + if request.param == 'force_concatenate': + return _block_force_concatenate + elif request.param == 'force_slicing': + return _block_force_slicing + elif request.param == 'block': + return block + else: + raise ValueError('Unknown blocking request. There is a typo in the tests.') + + def test_returns_copy(self, block): + a = np.eye(3) + b = block(a) + b[0, 0] = 2 + assert b[0, 0] != a[0, 0] + + def test_block_total_size_estimate(self, block): + _, _, _, total_size = _block_setup([1]) + assert total_size == 1 + + _, _, _, total_size = _block_setup([[1]]) + assert total_size == 1 + + _, _, _, total_size = _block_setup([[1, 1]]) + assert total_size == 2 + + _, _, _, total_size = _block_setup([[1], [1]]) + assert total_size == 2 + + _, _, _, total_size = _block_setup([[1, 2], [3, 4]]) + assert total_size == 4 + + def test_block_simple_row_wise(self, block): + a_2d = np.ones((2, 2)) + b_2d = 2 * a_2d + desired = np.array([[1, 1, 2, 2], + [1, 1, 2, 2]]) + result = block([a_2d, b_2d]) + assert_equal(desired, result) + + def test_block_simple_column_wise(self, block): + a_2d = np.ones((2, 2)) + b_2d = 2 * a_2d + expected = np.array([[1, 1], + [1, 1], + [2, 2], + [2, 2]]) + result = block([[a_2d], [b_2d]]) + assert_equal(expected, result) + + def test_block_with_1d_arrays_row_wise(self, block): + # # # 1-D vectors are treated as row arrays + a = np.array([1, 2, 3]) + b = np.array([2, 3, 4]) + expected = np.array([1, 2, 3, 2, 3, 4]) + result = block([a, b]) + assert_equal(expected, result) + + def test_block_with_1d_arrays_multiple_rows(self, block): + a = np.array([1, 2, 3]) + b = np.array([2, 3, 4]) + expected = np.array([[1, 2, 3, 2, 3, 4], + [1, 2, 3, 2, 3, 4]]) + result = block([[a, b], [a, b]]) + assert_equal(expected, result) + + def test_block_with_1d_arrays_column_wise(self, block): + # # # 1-D vectors are treated as row arrays + a_1d = np.array([1, 2, 3]) + b_1d = np.array([2, 3, 4]) + expected = np.array([[1, 2, 3], + [2, 3, 4]]) + result = block([[a_1d], [b_1d]]) + assert_equal(expected, result) + + def test_block_mixed_1d_and_2d(self, block): + a_2d = np.ones((2, 2)) + b_1d = np.array([2, 2]) + result = block([[a_2d], [b_1d]]) + expected = np.array([[1, 1], + [1, 1], + [2, 2]]) + assert_equal(expected, result) + + def test_block_complicated(self, block): + # a bit more complicated + one_2d = np.array([[1, 1, 1]]) + two_2d = np.array([[2, 2, 2]]) + three_2d = np.array([[3, 3, 3, 3, 3, 3]]) + four_1d = np.array([4, 4, 4, 4, 4, 4]) + five_0d = np.array(5) + six_1d = np.array([6, 6, 6, 6, 6]) + zero_2d = np.zeros((2, 6)) + + expected = np.array([[1, 1, 1, 2, 2, 2], + [3, 3, 3, 3, 3, 3], + [4, 4, 4, 4, 4, 4], + [5, 6, 6, 6, 6, 6], + [0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0]]) + + result = block([[one_2d, two_2d], + [three_2d], + [four_1d], + [five_0d, six_1d], + [zero_2d]]) + assert_equal(result, expected) + + def test_nested(self, block): + one = np.array([1, 1, 1]) + two = np.array([[2, 2, 2], [2, 2, 2], [2, 2, 2]]) + three = np.array([3, 3, 3]) + four = np.array([4, 4, 4]) + five = np.array(5) + six = np.array([6, 6, 6, 6, 6]) + zero = np.zeros((2, 6)) + + result = block([ + [ + block([ + [one], + [three], + [four] + ]), + two + ], + [five, six], + [zero] + ]) + expected = np.array([[1, 1, 1, 2, 2, 2], + [3, 3, 3, 2, 2, 2], + [4, 4, 4, 2, 2, 2], + [5, 6, 6, 6, 6, 6], + [0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0]]) + + assert_equal(result, expected) + + def test_3d(self, block): + a000 = np.ones((2, 2, 2), int) * 1 + + a100 = np.ones((3, 2, 2), int) * 2 + a010 = np.ones((2, 3, 2), int) * 3 + a001 = np.ones((2, 2, 3), int) * 4 + + a011 = np.ones((2, 3, 3), int) * 5 + a101 = np.ones((3, 2, 3), int) * 6 + a110 = np.ones((3, 3, 2), int) * 7 + + a111 = np.ones((3, 3, 3), int) * 8 + + result = block([ + [ + [a000, a001], + [a010, a011], + ], + [ + [a100, a101], + [a110, a111], + ] + ]) + expected = array([[[1, 1, 4, 4, 4], + [1, 1, 4, 4, 4], + [3, 3, 5, 5, 5], + [3, 3, 5, 5, 5], + [3, 3, 5, 5, 5]], + + [[1, 1, 4, 4, 4], + [1, 1, 4, 4, 4], + [3, 3, 5, 5, 5], + [3, 3, 5, 5, 5], + [3, 3, 5, 5, 5]], + + [[2, 2, 6, 6, 6], + [2, 2, 6, 6, 6], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8]], + + [[2, 2, 6, 6, 6], + [2, 2, 6, 6, 6], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8]], + + [[2, 2, 6, 6, 6], + [2, 2, 6, 6, 6], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8], + [7, 7, 8, 8, 8]]]) + + assert_array_equal(result, expected) + + def test_block_with_mismatched_shape(self, block): + a = np.array([0, 0]) + b = np.eye(2) + assert_raises(ValueError, block, [a, b]) + assert_raises(ValueError, block, [b, a]) + + to_block = [[np.ones((2,3)), np.ones((2,2))], + [np.ones((2,2)), np.ones((2,2))]] + assert_raises(ValueError, block, to_block) + def test_no_lists(self, block): + assert_equal(block(1), np.array(1)) + assert_equal(block(np.eye(3)), np.eye(3)) + + def test_invalid_nesting(self, block): + msg = 'depths are mismatched' + assert_raises_regex(ValueError, msg, block, [1, [2]]) + assert_raises_regex(ValueError, msg, block, [1, []]) + assert_raises_regex(ValueError, msg, block, [[1], 2]) + assert_raises_regex(ValueError, msg, block, [[], 2]) + assert_raises_regex(ValueError, msg, block, [ + [[1], [2]], + [[3, 4]], + [5] # missing brackets + ]) + + def test_empty_lists(self, block): + assert_raises_regex(ValueError, 'empty', block, []) + assert_raises_regex(ValueError, 'empty', block, [[]]) + assert_raises_regex(ValueError, 'empty', block, [[1], []]) + + def test_tuple(self, block): + assert_raises_regex(TypeError, 'tuple', block, ([1, 2], [3, 4])) + assert_raises_regex(TypeError, 'tuple', block, [(1, 2), (3, 4)]) + + def test_different_ndims(self, block): + a = 1. + b = 2 * np.ones((1, 2)) + c = 3 * np.ones((1, 1, 3)) + + result = block([a, b, c]) + expected = np.array([[[1., 2., 2., 3., 3., 3.]]]) + + assert_equal(result, expected) + + def test_different_ndims_depths(self, block): + a = 1. + b = 2 * np.ones((1, 2)) + c = 3 * np.ones((1, 2, 3)) + + result = block([[a, b], [c]]) + expected = np.array([[[1., 2., 2.], + [3., 3., 3.], + [3., 3., 3.]]]) + + assert_equal(result, expected) + + def test_block_memory_order(self, block): + # 3D + arr_c = np.zeros((3,)*3, order='C') + arr_f = np.zeros((3,)*3, order='F') + + b_c = [[[arr_c, arr_c], + [arr_c, arr_c]], + [[arr_c, arr_c], + [arr_c, arr_c]]] + + b_f = [[[arr_f, arr_f], + [arr_f, arr_f]], + [[arr_f, arr_f], + [arr_f, arr_f]]] + + assert block(b_c).flags['C_CONTIGUOUS'] + assert block(b_f).flags['F_CONTIGUOUS'] + + arr_c = np.zeros((3, 3), order='C') + arr_f = np.zeros((3, 3), order='F') + # 2D + b_c = [[arr_c, arr_c], + [arr_c, arr_c]] + + b_f = [[arr_f, arr_f], + [arr_f, arr_f]] + + assert block(b_c).flags['C_CONTIGUOUS'] + assert block(b_f).flags['F_CONTIGUOUS'] + + +def test_block_dispatcher(): + class ArrayLike: + pass + a = ArrayLike() + b = ArrayLike() + c = ArrayLike() + assert_equal(list(_block_dispatcher(a)), [a]) + assert_equal(list(_block_dispatcher([a])), [a]) + assert_equal(list(_block_dispatcher([a, b])), [a, b]) + assert_equal(list(_block_dispatcher([[a], [b, [c]]])), [a, b, c]) + # don't recurse into non-lists + assert_equal(list(_block_dispatcher((a, b))), [(a, b)]) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd.py new file mode 100644 index 0000000000000000000000000000000000000000..9d472555edc43266ccbb825d10172cc663b9435e --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd.py @@ -0,0 +1,1333 @@ +# NOTE: Please avoid the use of numpy.testing since NPYV intrinsics +# may be involved in their functionality. +import pytest, math, re +import itertools +import operator +from numpy._core._simd import targets, clear_floatstatus, get_floatstatus +from numpy._core._multiarray_umath import __cpu_baseline__ + +def check_floatstatus(divbyzero=False, overflow=False, + underflow=False, invalid=False, + all=False): + #define NPY_FPE_DIVIDEBYZERO 1 + #define NPY_FPE_OVERFLOW 2 + #define NPY_FPE_UNDERFLOW 4 + #define NPY_FPE_INVALID 8 + err = get_floatstatus() + ret = (all or divbyzero) and (err & 1) != 0 + ret |= (all or overflow) and (err & 2) != 0 + ret |= (all or underflow) and (err & 4) != 0 + ret |= (all or invalid) and (err & 8) != 0 + return ret + +class _Test_Utility: + # submodule of the desired SIMD extension, e.g. targets["AVX512F"] + npyv = None + # the current data type suffix e.g. 's8' + sfx = None + # target name can be 'baseline' or one or more of CPU features + target_name = None + + def __getattr__(self, attr): + """ + To call NPV intrinsics without the attribute 'npyv' and + auto suffixing intrinsics according to class attribute 'sfx' + """ + return getattr(self.npyv, attr + "_" + self.sfx) + + def _x2(self, intrin_name): + return getattr(self.npyv, f"{intrin_name}_{self.sfx}x2") + + def _data(self, start=None, count=None, reverse=False): + """ + Create list of consecutive numbers according to number of vector's lanes. + """ + if start is None: + start = 1 + if count is None: + count = self.nlanes + rng = range(start, start + count) + if reverse: + rng = reversed(rng) + if self._is_fp(): + return [x / 1.0 for x in rng] + return list(rng) + + def _is_unsigned(self): + return self.sfx[0] == 'u' + + def _is_signed(self): + return self.sfx[0] == 's' + + def _is_fp(self): + return self.sfx[0] == 'f' + + def _scalar_size(self): + return int(self.sfx[1:]) + + def _int_clip(self, seq): + if self._is_fp(): + return seq + max_int = self._int_max() + min_int = self._int_min() + return [min(max(v, min_int), max_int) for v in seq] + + def _int_max(self): + if self._is_fp(): + return None + max_u = self._to_unsigned(self.setall(-1))[0] + if self._is_signed(): + return max_u // 2 + return max_u + + def _int_min(self): + if self._is_fp(): + return None + if self._is_unsigned(): + return 0 + return -(self._int_max() + 1) + + def _true_mask(self): + max_unsig = getattr(self.npyv, "setall_u" + self.sfx[1:])(-1) + return max_unsig[0] + + def _to_unsigned(self, vector): + if isinstance(vector, (list, tuple)): + return getattr(self.npyv, "load_u" + self.sfx[1:])(vector) + else: + sfx = vector.__name__.replace("npyv_", "") + if sfx[0] == "b": + cvt_intrin = "cvt_u{0}_b{0}" + else: + cvt_intrin = "reinterpret_u{0}_{1}" + return getattr(self.npyv, cvt_intrin.format(sfx[1:], sfx))(vector) + + def _pinfinity(self): + return float("inf") + + def _ninfinity(self): + return -float("inf") + + def _nan(self): + return float("nan") + + def _cpu_features(self): + target = self.target_name + if target == "baseline": + target = __cpu_baseline__ + else: + target = target.split('__') # multi-target separator + return ' '.join(target) + +class _SIMD_BOOL(_Test_Utility): + """ + To test all boolean vector types at once + """ + def _nlanes(self): + return getattr(self.npyv, "nlanes_u" + self.sfx[1:]) + + def _data(self, start=None, count=None, reverse=False): + true_mask = self._true_mask() + rng = range(self._nlanes()) + if reverse: + rng = reversed(rng) + return [true_mask if x % 2 else 0 for x in rng] + + def _load_b(self, data): + len_str = self.sfx[1:] + load = getattr(self.npyv, "load_u" + len_str) + cvt = getattr(self.npyv, f"cvt_b{len_str}_u{len_str}") + return cvt(load(data)) + + def test_operators_logical(self): + """ + Logical operations for boolean types. + Test intrinsics: + npyv_xor_##SFX, npyv_and_##SFX, npyv_or_##SFX, npyv_not_##SFX, + npyv_andc_b8, npvy_orc_b8, nvpy_xnor_b8 + """ + data_a = self._data() + data_b = self._data(reverse=True) + vdata_a = self._load_b(data_a) + vdata_b = self._load_b(data_b) + + data_and = [a & b for a, b in zip(data_a, data_b)] + vand = getattr(self, "and")(vdata_a, vdata_b) + assert vand == data_and + + data_or = [a | b for a, b in zip(data_a, data_b)] + vor = getattr(self, "or")(vdata_a, vdata_b) + assert vor == data_or + + data_xor = [a ^ b for a, b in zip(data_a, data_b)] + vxor = getattr(self, "xor")(vdata_a, vdata_b) + assert vxor == data_xor + + vnot = getattr(self, "not")(vdata_a) + assert vnot == data_b + + # among the boolean types, andc, orc and xnor only support b8 + if self.sfx not in ("b8"): + return + + data_andc = [(a & ~b) & 0xFF for a, b in zip(data_a, data_b)] + vandc = getattr(self, "andc")(vdata_a, vdata_b) + assert data_andc == vandc + + data_orc = [(a | ~b) & 0xFF for a, b in zip(data_a, data_b)] + vorc = getattr(self, "orc")(vdata_a, vdata_b) + assert data_orc == vorc + + data_xnor = [~(a ^ b) & 0xFF for a, b in zip(data_a, data_b)] + vxnor = getattr(self, "xnor")(vdata_a, vdata_b) + assert data_xnor == vxnor + + def test_tobits(self): + data2bits = lambda data: sum([int(x != 0) << i for i, x in enumerate(data, 0)]) + for data in (self._data(), self._data(reverse=True)): + vdata = self._load_b(data) + data_bits = data2bits(data) + tobits = self.tobits(vdata) + bin_tobits = bin(tobits) + assert bin_tobits == bin(data_bits) + + def test_pack(self): + """ + Pack multiple vectors into one + Test intrinsics: + npyv_pack_b8_b16 + npyv_pack_b8_b32 + npyv_pack_b8_b64 + """ + if self.sfx not in ("b16", "b32", "b64"): + return + # create the vectors + data = self._data() + rdata = self._data(reverse=True) + vdata = self._load_b(data) + vrdata = self._load_b(rdata) + pack_simd = getattr(self.npyv, f"pack_b8_{self.sfx}") + # for scalar execution, concatenate the elements of the multiple lists + # into a single list (spack) and then iterate over the elements of + # the created list applying a mask to capture the first byte of them. + if self.sfx == "b16": + spack = [(i & 0xFF) for i in (list(rdata) + list(data))] + vpack = pack_simd(vrdata, vdata) + elif self.sfx == "b32": + spack = [(i & 0xFF) for i in (2*list(rdata) + 2*list(data))] + vpack = pack_simd(vrdata, vrdata, vdata, vdata) + elif self.sfx == "b64": + spack = [(i & 0xFF) for i in (4*list(rdata) + 4*list(data))] + vpack = pack_simd(vrdata, vrdata, vrdata, vrdata, + vdata, vdata, vdata, vdata) + assert vpack == spack + + @pytest.mark.parametrize("intrin", ["any", "all"]) + @pytest.mark.parametrize("data", ( + [-1, 0], + [0, -1], + [-1], + [0] + )) + def test_operators_crosstest(self, intrin, data): + """ + Test intrinsics: + npyv_any_##SFX + npyv_all_##SFX + """ + data_a = self._load_b(data * self._nlanes()) + func = eval(intrin) + intrin = getattr(self, intrin) + desired = func(data_a) + simd = intrin(data_a) + assert not not simd == desired + +class _SIMD_INT(_Test_Utility): + """ + To test all integer vector types at once + """ + def test_operators_shift(self): + if self.sfx in ("u8", "s8"): + return + + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + for count in range(self._scalar_size()): + # load to cast + data_shl_a = self.load([a << count for a in data_a]) + # left shift + shl = self.shl(vdata_a, count) + assert shl == data_shl_a + # load to cast + data_shr_a = self.load([a >> count for a in data_a]) + # right shift + shr = self.shr(vdata_a, count) + assert shr == data_shr_a + + # shift by zero or max or out-range immediate constant is not applicable and illogical + for count in range(1, self._scalar_size()): + # load to cast + data_shl_a = self.load([a << count for a in data_a]) + # left shift by an immediate constant + shli = self.shli(vdata_a, count) + assert shli == data_shl_a + # load to cast + data_shr_a = self.load([a >> count for a in data_a]) + # right shift by an immediate constant + shri = self.shri(vdata_a, count) + assert shri == data_shr_a + + def test_arithmetic_subadd_saturated(self): + if self.sfx in ("u32", "s32", "u64", "s64"): + return + + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + data_adds = self._int_clip([a + b for a, b in zip(data_a, data_b)]) + adds = self.adds(vdata_a, vdata_b) + assert adds == data_adds + + data_subs = self._int_clip([a - b for a, b in zip(data_a, data_b)]) + subs = self.subs(vdata_a, vdata_b) + assert subs == data_subs + + def test_math_max_min(self): + data_a = self._data() + data_b = self._data(self.nlanes) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + data_max = [max(a, b) for a, b in zip(data_a, data_b)] + simd_max = self.max(vdata_a, vdata_b) + assert simd_max == data_max + + data_min = [min(a, b) for a, b in zip(data_a, data_b)] + simd_min = self.min(vdata_a, vdata_b) + assert simd_min == data_min + + @pytest.mark.parametrize("start", [-100, -10000, 0, 100, 10000]) + def test_reduce_max_min(self, start): + """ + Test intrinsics: + npyv_reduce_max_##sfx + npyv_reduce_min_##sfx + """ + vdata_a = self.load(self._data(start)) + assert self.reduce_max(vdata_a) == max(vdata_a) + assert self.reduce_min(vdata_a) == min(vdata_a) + + +class _SIMD_FP32(_Test_Utility): + """ + To only test single precision + """ + def test_conversions(self): + """ + Round to nearest even integer, assume CPU control register is set to rounding. + Test intrinsics: + npyv_round_s32_##SFX + """ + features = self._cpu_features() + if not self.npyv.simd_f64 and re.match(r".*(NEON|ASIMD)", features): + # very costly to emulate nearest even on Armv7 + # instead we round halves to up. e.g. 0.5 -> 1, -0.5 -> -1 + _round = lambda v: int(v + (0.5 if v >= 0 else -0.5)) + else: + _round = round + vdata_a = self.load(self._data()) + vdata_a = self.sub(vdata_a, self.setall(0.5)) + data_round = [_round(x) for x in vdata_a] + vround = self.round_s32(vdata_a) + assert vround == data_round + +class _SIMD_FP64(_Test_Utility): + """ + To only test double precision + """ + def test_conversions(self): + """ + Round to nearest even integer, assume CPU control register is set to rounding. + Test intrinsics: + npyv_round_s32_##SFX + """ + vdata_a = self.load(self._data()) + vdata_a = self.sub(vdata_a, self.setall(0.5)) + vdata_b = self.mul(vdata_a, self.setall(-1.5)) + data_round = [round(x) for x in list(vdata_a) + list(vdata_b)] + vround = self.round_s32(vdata_a, vdata_b) + assert vround == data_round + +class _SIMD_FP(_Test_Utility): + """ + To test all float vector types at once + """ + def test_arithmetic_fused(self): + vdata_a, vdata_b, vdata_c = [self.load(self._data())]*3 + vdata_cx2 = self.add(vdata_c, vdata_c) + # multiply and add, a*b + c + data_fma = self.load([a * b + c for a, b, c in zip(vdata_a, vdata_b, vdata_c)]) + fma = self.muladd(vdata_a, vdata_b, vdata_c) + assert fma == data_fma + # multiply and subtract, a*b - c + fms = self.mulsub(vdata_a, vdata_b, vdata_c) + data_fms = self.sub(data_fma, vdata_cx2) + assert fms == data_fms + # negate multiply and add, -(a*b) + c + nfma = self.nmuladd(vdata_a, vdata_b, vdata_c) + data_nfma = self.sub(vdata_cx2, data_fma) + assert nfma == data_nfma + # negate multiply and subtract, -(a*b) - c + nfms = self.nmulsub(vdata_a, vdata_b, vdata_c) + data_nfms = self.mul(data_fma, self.setall(-1)) + assert nfms == data_nfms + # multiply, add for odd elements and subtract even elements. + # (a * b) -+ c + fmas = list(self.muladdsub(vdata_a, vdata_b, vdata_c)) + assert fmas[0::2] == list(data_fms)[0::2] + assert fmas[1::2] == list(data_fma)[1::2] + + def test_abs(self): + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + data = self._data() + vdata = self.load(self._data()) + + abs_cases = ((-0, 0), (ninf, pinf), (pinf, pinf), (nan, nan)) + for case, desired in abs_cases: + data_abs = [desired]*self.nlanes + vabs = self.abs(self.setall(case)) + assert vabs == pytest.approx(data_abs, nan_ok=True) + + vabs = self.abs(self.mul(vdata, self.setall(-1))) + assert vabs == data + + def test_sqrt(self): + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + data = self._data() + vdata = self.load(self._data()) + + sqrt_cases = ((-0.0, -0.0), (0.0, 0.0), (-1.0, nan), (ninf, nan), (pinf, pinf)) + for case, desired in sqrt_cases: + data_sqrt = [desired]*self.nlanes + sqrt = self.sqrt(self.setall(case)) + assert sqrt == pytest.approx(data_sqrt, nan_ok=True) + + data_sqrt = self.load([math.sqrt(x) for x in data]) # load to truncate precision + sqrt = self.sqrt(vdata) + assert sqrt == data_sqrt + + def test_square(self): + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + data = self._data() + vdata = self.load(self._data()) + # square + square_cases = ((nan, nan), (pinf, pinf), (ninf, pinf)) + for case, desired in square_cases: + data_square = [desired]*self.nlanes + square = self.square(self.setall(case)) + assert square == pytest.approx(data_square, nan_ok=True) + + data_square = [x*x for x in data] + square = self.square(vdata) + assert square == data_square + + @pytest.mark.parametrize("intrin, func", [("ceil", math.ceil), + ("trunc", math.trunc), ("floor", math.floor), ("rint", round)]) + def test_rounding(self, intrin, func): + """ + Test intrinsics: + npyv_rint_##SFX + npyv_ceil_##SFX + npyv_trunc_##SFX + npyv_floor##SFX + """ + intrin_name = intrin + intrin = getattr(self, intrin) + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + # special cases + round_cases = ((nan, nan), (pinf, pinf), (ninf, ninf)) + for case, desired in round_cases: + data_round = [desired]*self.nlanes + _round = intrin(self.setall(case)) + assert _round == pytest.approx(data_round, nan_ok=True) + + for x in range(0, 2**20, 256**2): + for w in (-1.05, -1.10, -1.15, 1.05, 1.10, 1.15): + data = self.load([(x+a)*w for a in range(self.nlanes)]) + data_round = [func(x) for x in data] + _round = intrin(data) + assert _round == data_round + + # test large numbers + for i in ( + 1.1529215045988576e+18, 4.6116860183954304e+18, + 5.902958103546122e+20, 2.3611832414184488e+21 + ): + x = self.setall(i) + y = intrin(x) + data_round = [func(n) for n in x] + assert y == data_round + + # signed zero + if intrin_name == "floor": + data_szero = (-0.0,) + else: + data_szero = (-0.0, -0.25, -0.30, -0.45, -0.5) + + for w in data_szero: + _round = self._to_unsigned(intrin(self.setall(w))) + data_round = self._to_unsigned(self.setall(-0.0)) + assert _round == data_round + + @pytest.mark.parametrize("intrin", [ + "max", "maxp", "maxn", "min", "minp", "minn" + ]) + def test_max_min(self, intrin): + """ + Test intrinsics: + npyv_max_##sfx + npyv_maxp_##sfx + npyv_maxn_##sfx + npyv_min_##sfx + npyv_minp_##sfx + npyv_minn_##sfx + npyv_reduce_max_##sfx + npyv_reduce_maxp_##sfx + npyv_reduce_maxn_##sfx + npyv_reduce_min_##sfx + npyv_reduce_minp_##sfx + npyv_reduce_minn_##sfx + """ + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + chk_nan = {"xp": 1, "np": 1, "nn": 2, "xn": 2}.get(intrin[-2:], 0) + func = eval(intrin[:3]) + reduce_intrin = getattr(self, "reduce_" + intrin) + intrin = getattr(self, intrin) + hf_nlanes = self.nlanes//2 + + cases = ( + ([0.0, -0.0], [-0.0, 0.0]), + ([10, -10], [10, -10]), + ([pinf, 10], [10, ninf]), + ([10, pinf], [ninf, 10]), + ([10, -10], [10, -10]), + ([-10, 10], [-10, 10]) + ) + for op1, op2 in cases: + vdata_a = self.load(op1*hf_nlanes) + vdata_b = self.load(op2*hf_nlanes) + data = func(vdata_a, vdata_b) + simd = intrin(vdata_a, vdata_b) + assert simd == data + data = func(vdata_a) + simd = reduce_intrin(vdata_a) + assert simd == data + + if not chk_nan: + return + if chk_nan == 1: + test_nan = lambda a, b: ( + b if math.isnan(a) else a if math.isnan(b) else b + ) + else: + test_nan = lambda a, b: ( + nan if math.isnan(a) or math.isnan(b) else b + ) + cases = ( + (nan, 10), + (10, nan), + (nan, pinf), + (pinf, nan), + (nan, nan) + ) + for op1, op2 in cases: + vdata_ab = self.load([op1, op2]*hf_nlanes) + data = test_nan(op1, op2) + simd = reduce_intrin(vdata_ab) + assert simd == pytest.approx(data, nan_ok=True) + vdata_a = self.setall(op1) + vdata_b = self.setall(op2) + data = [data] * self.nlanes + simd = intrin(vdata_a, vdata_b) + assert simd == pytest.approx(data, nan_ok=True) + + def test_reciprocal(self): + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + data = self._data() + vdata = self.load(self._data()) + + recip_cases = ((nan, nan), (pinf, 0.0), (ninf, -0.0), (0.0, pinf), (-0.0, ninf)) + for case, desired in recip_cases: + data_recip = [desired]*self.nlanes + recip = self.recip(self.setall(case)) + assert recip == pytest.approx(data_recip, nan_ok=True) + + data_recip = self.load([1/x for x in data]) # load to truncate precision + recip = self.recip(vdata) + assert recip == data_recip + + def test_special_cases(self): + """ + Compare Not NaN. Test intrinsics: + npyv_notnan_##SFX + """ + nnan = self.notnan(self.setall(self._nan())) + assert nnan == [0]*self.nlanes + + @pytest.mark.parametrize("intrin_name", [ + "rint", "trunc", "ceil", "floor" + ]) + def test_unary_invalid_fpexception(self, intrin_name): + intrin = getattr(self, intrin_name) + for d in [float("nan"), float("inf"), -float("inf")]: + v = self.setall(d) + clear_floatstatus() + intrin(v) + assert check_floatstatus(invalid=True) == False + + @pytest.mark.parametrize('py_comp,np_comp', [ + (operator.lt, "cmplt"), + (operator.le, "cmple"), + (operator.gt, "cmpgt"), + (operator.ge, "cmpge"), + (operator.eq, "cmpeq"), + (operator.ne, "cmpneq") + ]) + def test_comparison_with_nan(self, py_comp, np_comp): + pinf, ninf, nan = self._pinfinity(), self._ninfinity(), self._nan() + mask_true = self._true_mask() + + def to_bool(vector): + return [lane == mask_true for lane in vector] + + intrin = getattr(self, np_comp) + cmp_cases = ((0, nan), (nan, 0), (nan, nan), (pinf, nan), + (ninf, nan), (-0.0, +0.0)) + for case_operand1, case_operand2 in cmp_cases: + data_a = [case_operand1]*self.nlanes + data_b = [case_operand2]*self.nlanes + vdata_a = self.setall(case_operand1) + vdata_b = self.setall(case_operand2) + vcmp = to_bool(intrin(vdata_a, vdata_b)) + data_cmp = [py_comp(a, b) for a, b in zip(data_a, data_b)] + assert vcmp == data_cmp + + @pytest.mark.parametrize("intrin", ["any", "all"]) + @pytest.mark.parametrize("data", ( + [float("nan"), 0], + [0, float("nan")], + [float("nan"), 1], + [1, float("nan")], + [float("nan"), float("nan")], + [0.0, -0.0], + [-0.0, 0.0], + [1.0, -0.0] + )) + def test_operators_crosstest(self, intrin, data): + """ + Test intrinsics: + npyv_any_##SFX + npyv_all_##SFX + """ + data_a = self.load(data * self.nlanes) + func = eval(intrin) + intrin = getattr(self, intrin) + desired = func(data_a) + simd = intrin(data_a) + assert not not simd == desired + +class _SIMD_ALL(_Test_Utility): + """ + To test all vector types at once + """ + def test_memory_load(self): + data = self._data() + # unaligned load + load_data = self.load(data) + assert load_data == data + # aligned load + loada_data = self.loada(data) + assert loada_data == data + # stream load + loads_data = self.loads(data) + assert loads_data == data + # load lower part + loadl = self.loadl(data) + loadl_half = list(loadl)[:self.nlanes//2] + data_half = data[:self.nlanes//2] + assert loadl_half == data_half + assert loadl != data # detect overflow + + def test_memory_store(self): + data = self._data() + vdata = self.load(data) + # unaligned store + store = [0] * self.nlanes + self.store(store, vdata) + assert store == data + # aligned store + store_a = [0] * self.nlanes + self.storea(store_a, vdata) + assert store_a == data + # stream store + store_s = [0] * self.nlanes + self.stores(store_s, vdata) + assert store_s == data + # store lower part + store_l = [0] * self.nlanes + self.storel(store_l, vdata) + assert store_l[:self.nlanes//2] == data[:self.nlanes//2] + assert store_l != vdata # detect overflow + # store higher part + store_h = [0] * self.nlanes + self.storeh(store_h, vdata) + assert store_h[:self.nlanes//2] == data[self.nlanes//2:] + assert store_h != vdata # detect overflow + + @pytest.mark.parametrize("intrin, elsizes, scale, fill", [ + ("self.load_tillz, self.load_till", (32, 64), 1, [0xffff]), + ("self.load2_tillz, self.load2_till", (32, 64), 2, [0xffff, 0x7fff]), + ]) + def test_memory_partial_load(self, intrin, elsizes, scale, fill): + if self._scalar_size() not in elsizes: + return + npyv_load_tillz, npyv_load_till = eval(intrin) + data = self._data() + lanes = list(range(1, self.nlanes + 1)) + lanes += [self.nlanes**2, self.nlanes**4] # test out of range + for n in lanes: + load_till = npyv_load_till(data, n, *fill) + load_tillz = npyv_load_tillz(data, n) + n *= scale + data_till = data[:n] + fill * ((self.nlanes-n) // scale) + assert load_till == data_till + data_tillz = data[:n] + [0] * (self.nlanes-n) + assert load_tillz == data_tillz + + @pytest.mark.parametrize("intrin, elsizes, scale", [ + ("self.store_till", (32, 64), 1), + ("self.store2_till", (32, 64), 2), + ]) + def test_memory_partial_store(self, intrin, elsizes, scale): + if self._scalar_size() not in elsizes: + return + npyv_store_till = eval(intrin) + data = self._data() + data_rev = self._data(reverse=True) + vdata = self.load(data) + lanes = list(range(1, self.nlanes + 1)) + lanes += [self.nlanes**2, self.nlanes**4] + for n in lanes: + data_till = data_rev.copy() + data_till[:n*scale] = data[:n*scale] + store_till = self._data(reverse=True) + npyv_store_till(store_till, n, vdata) + assert store_till == data_till + + @pytest.mark.parametrize("intrin, elsizes, scale", [ + ("self.loadn", (32, 64), 1), + ("self.loadn2", (32, 64), 2), + ]) + def test_memory_noncont_load(self, intrin, elsizes, scale): + if self._scalar_size() not in elsizes: + return + npyv_loadn = eval(intrin) + for stride in range(-64, 64): + if stride < 0: + data = self._data(stride, -stride*self.nlanes) + data_stride = list(itertools.chain( + *zip(*[data[-i::stride] for i in range(scale, 0, -1)]) + )) + elif stride == 0: + data = self._data() + data_stride = data[0:scale] * (self.nlanes//scale) + else: + data = self._data(count=stride*self.nlanes) + data_stride = list(itertools.chain( + *zip(*[data[i::stride] for i in range(scale)])) + ) + data_stride = self.load(data_stride) # cast unsigned + loadn = npyv_loadn(data, stride) + assert loadn == data_stride + + @pytest.mark.parametrize("intrin, elsizes, scale, fill", [ + ("self.loadn_tillz, self.loadn_till", (32, 64), 1, [0xffff]), + ("self.loadn2_tillz, self.loadn2_till", (32, 64), 2, [0xffff, 0x7fff]), + ]) + def test_memory_noncont_partial_load(self, intrin, elsizes, scale, fill): + if self._scalar_size() not in elsizes: + return + npyv_loadn_tillz, npyv_loadn_till = eval(intrin) + lanes = list(range(1, self.nlanes + 1)) + lanes += [self.nlanes**2, self.nlanes**4] + for stride in range(-64, 64): + if stride < 0: + data = self._data(stride, -stride*self.nlanes) + data_stride = list(itertools.chain( + *zip(*[data[-i::stride] for i in range(scale, 0, -1)]) + )) + elif stride == 0: + data = self._data() + data_stride = data[0:scale] * (self.nlanes//scale) + else: + data = self._data(count=stride*self.nlanes) + data_stride = list(itertools.chain( + *zip(*[data[i::stride] for i in range(scale)]) + )) + data_stride = list(self.load(data_stride)) # cast unsigned + for n in lanes: + nscale = n * scale + llanes = self.nlanes - nscale + data_stride_till = ( + data_stride[:nscale] + fill * (llanes//scale) + ) + loadn_till = npyv_loadn_till(data, stride, n, *fill) + assert loadn_till == data_stride_till + data_stride_tillz = data_stride[:nscale] + [0] * llanes + loadn_tillz = npyv_loadn_tillz(data, stride, n) + assert loadn_tillz == data_stride_tillz + + @pytest.mark.parametrize("intrin, elsizes, scale", [ + ("self.storen", (32, 64), 1), + ("self.storen2", (32, 64), 2), + ]) + def test_memory_noncont_store(self, intrin, elsizes, scale): + if self._scalar_size() not in elsizes: + return + npyv_storen = eval(intrin) + data = self._data() + vdata = self.load(data) + hlanes = self.nlanes // scale + for stride in range(1, 64): + data_storen = [0xff] * stride * self.nlanes + for s in range(0, hlanes*stride, stride): + i = (s//stride)*scale + data_storen[s:s+scale] = data[i:i+scale] + storen = [0xff] * stride * self.nlanes + storen += [0x7f]*64 + npyv_storen(storen, stride, vdata) + assert storen[:-64] == data_storen + assert storen[-64:] == [0x7f]*64 # detect overflow + + for stride in range(-64, 0): + data_storen = [0xff] * -stride * self.nlanes + for s in range(0, hlanes*stride, stride): + i = (s//stride)*scale + data_storen[s-scale:s or None] = data[i:i+scale] + storen = [0x7f]*64 + storen += [0xff] * -stride * self.nlanes + npyv_storen(storen, stride, vdata) + assert storen[64:] == data_storen + assert storen[:64] == [0x7f]*64 # detect overflow + # stride 0 + data_storen = [0x7f] * self.nlanes + storen = data_storen.copy() + data_storen[0:scale] = data[-scale:] + npyv_storen(storen, 0, vdata) + assert storen == data_storen + + @pytest.mark.parametrize("intrin, elsizes, scale", [ + ("self.storen_till", (32, 64), 1), + ("self.storen2_till", (32, 64), 2), + ]) + def test_memory_noncont_partial_store(self, intrin, elsizes, scale): + if self._scalar_size() not in elsizes: + return + npyv_storen_till = eval(intrin) + data = self._data() + vdata = self.load(data) + lanes = list(range(1, self.nlanes + 1)) + lanes += [self.nlanes**2, self.nlanes**4] + hlanes = self.nlanes // scale + for stride in range(1, 64): + for n in lanes: + data_till = [0xff] * stride * self.nlanes + tdata = data[:n*scale] + [0xff] * (self.nlanes-n*scale) + for s in range(0, hlanes*stride, stride)[:n]: + i = (s//stride)*scale + data_till[s:s+scale] = tdata[i:i+scale] + storen_till = [0xff] * stride * self.nlanes + storen_till += [0x7f]*64 + npyv_storen_till(storen_till, stride, n, vdata) + assert storen_till[:-64] == data_till + assert storen_till[-64:] == [0x7f]*64 # detect overflow + + for stride in range(-64, 0): + for n in lanes: + data_till = [0xff] * -stride * self.nlanes + tdata = data[:n*scale] + [0xff] * (self.nlanes-n*scale) + for s in range(0, hlanes*stride, stride)[:n]: + i = (s//stride)*scale + data_till[s-scale:s or None] = tdata[i:i+scale] + storen_till = [0x7f]*64 + storen_till += [0xff] * -stride * self.nlanes + npyv_storen_till(storen_till, stride, n, vdata) + assert storen_till[64:] == data_till + assert storen_till[:64] == [0x7f]*64 # detect overflow + + # stride 0 + for n in lanes: + data_till = [0x7f] * self.nlanes + storen_till = data_till.copy() + data_till[0:scale] = data[:n*scale][-scale:] + npyv_storen_till(storen_till, 0, n, vdata) + assert storen_till == data_till + + @pytest.mark.parametrize("intrin, table_size, elsize", [ + ("self.lut32", 32, 32), + ("self.lut16", 16, 64) + ]) + def test_lut(self, intrin, table_size, elsize): + """ + Test lookup table intrinsics: + npyv_lut32_##sfx + npyv_lut16_##sfx + """ + if elsize != self._scalar_size(): + return + intrin = eval(intrin) + idx_itrin = getattr(self.npyv, f"setall_u{elsize}") + table = range(0, table_size) + for i in table: + broadi = self.setall(i) + idx = idx_itrin(i) + lut = intrin(table, idx) + assert lut == broadi + + def test_misc(self): + broadcast_zero = self.zero() + assert broadcast_zero == [0] * self.nlanes + for i in range(1, 10): + broadcasti = self.setall(i) + assert broadcasti == [i] * self.nlanes + + data_a, data_b = self._data(), self._data(reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + # py level of npyv_set_* don't support ignoring the extra specified lanes or + # fill non-specified lanes with zero. + vset = self.set(*data_a) + assert vset == data_a + # py level of npyv_setf_* don't support ignoring the extra specified lanes or + # fill non-specified lanes with the specified scalar. + vsetf = self.setf(10, *data_a) + assert vsetf == data_a + + # We're testing the sanity of _simd's type-vector, + # reinterpret* intrinsics itself are tested via compiler + # during the build of _simd module + sfxes = ["u8", "s8", "u16", "s16", "u32", "s32", "u64", "s64"] + if self.npyv.simd_f64: + sfxes.append("f64") + if self.npyv.simd_f32: + sfxes.append("f32") + for sfx in sfxes: + vec_name = getattr(self, "reinterpret_" + sfx)(vdata_a).__name__ + assert vec_name == "npyv_" + sfx + + # select & mask operations + select_a = self.select(self.cmpeq(self.zero(), self.zero()), vdata_a, vdata_b) + assert select_a == data_a + select_b = self.select(self.cmpneq(self.zero(), self.zero()), vdata_a, vdata_b) + assert select_b == data_b + + # test extract elements + assert self.extract0(vdata_b) == vdata_b[0] + + # cleanup intrinsic is only used with AVX for + # zeroing registers to avoid the AVX-SSE transition penalty, + # so nothing to test here + self.npyv.cleanup() + + def test_reorder(self): + data_a, data_b = self._data(), self._data(reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + # lower half part + data_a_lo = data_a[:self.nlanes//2] + data_b_lo = data_b[:self.nlanes//2] + # higher half part + data_a_hi = data_a[self.nlanes//2:] + data_b_hi = data_b[self.nlanes//2:] + # combine two lower parts + combinel = self.combinel(vdata_a, vdata_b) + assert combinel == data_a_lo + data_b_lo + # combine two higher parts + combineh = self.combineh(vdata_a, vdata_b) + assert combineh == data_a_hi + data_b_hi + # combine x2 + combine = self.combine(vdata_a, vdata_b) + assert combine == (data_a_lo + data_b_lo, data_a_hi + data_b_hi) + + # zip(interleave) + data_zipl = self.load([ + v for p in zip(data_a_lo, data_b_lo) for v in p + ]) + data_ziph = self.load([ + v for p in zip(data_a_hi, data_b_hi) for v in p + ]) + vzip = self.zip(vdata_a, vdata_b) + assert vzip == (data_zipl, data_ziph) + vzip = [0]*self.nlanes*2 + self._x2("store")(vzip, (vdata_a, vdata_b)) + assert vzip == list(data_zipl) + list(data_ziph) + + # unzip(deinterleave) + unzip = self.unzip(data_zipl, data_ziph) + assert unzip == (data_a, data_b) + unzip = self._x2("load")(list(data_zipl) + list(data_ziph)) + assert unzip == (data_a, data_b) + + def test_reorder_rev64(self): + # Reverse elements of each 64-bit lane + ssize = self._scalar_size() + if ssize == 64: + return + data_rev64 = [ + y for x in range(0, self.nlanes, 64//ssize) + for y in reversed(range(x, x + 64//ssize)) + ] + rev64 = self.rev64(self.load(range(self.nlanes))) + assert rev64 == data_rev64 + + def test_reorder_permi128(self): + """ + Test permuting elements for each 128-bit lane. + npyv_permi128_##sfx + """ + ssize = self._scalar_size() + if ssize < 32: + return + data = self.load(self._data()) + permn = 128//ssize + permd = permn-1 + nlane128 = self.nlanes//permn + shfl = [0, 1] if ssize == 64 else [0, 2, 4, 6] + for i in range(permn): + indices = [(i >> shf) & permd for shf in shfl] + vperm = self.permi128(data, *indices) + data_vperm = [ + data[j + (e & -permn)] + for e, j in enumerate(indices*nlane128) + ] + assert vperm == data_vperm + + @pytest.mark.parametrize('func, intrin', [ + (operator.lt, "cmplt"), + (operator.le, "cmple"), + (operator.gt, "cmpgt"), + (operator.ge, "cmpge"), + (operator.eq, "cmpeq") + ]) + def test_operators_comparison(self, func, intrin): + if self._is_fp(): + data_a = self._data() + else: + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + intrin = getattr(self, intrin) + + mask_true = self._true_mask() + def to_bool(vector): + return [lane == mask_true for lane in vector] + + data_cmp = [func(a, b) for a, b in zip(data_a, data_b)] + cmp = to_bool(intrin(vdata_a, vdata_b)) + assert cmp == data_cmp + + def test_operators_logical(self): + if self._is_fp(): + data_a = self._data() + else: + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + if self._is_fp(): + data_cast_a = self._to_unsigned(vdata_a) + data_cast_b = self._to_unsigned(vdata_b) + cast, cast_data = self._to_unsigned, self._to_unsigned + else: + data_cast_a, data_cast_b = data_a, data_b + cast, cast_data = lambda a: a, self.load + + data_xor = cast_data([a ^ b for a, b in zip(data_cast_a, data_cast_b)]) + vxor = cast(self.xor(vdata_a, vdata_b)) + assert vxor == data_xor + + data_or = cast_data([a | b for a, b in zip(data_cast_a, data_cast_b)]) + vor = cast(getattr(self, "or")(vdata_a, vdata_b)) + assert vor == data_or + + data_and = cast_data([a & b for a, b in zip(data_cast_a, data_cast_b)]) + vand = cast(getattr(self, "and")(vdata_a, vdata_b)) + assert vand == data_and + + data_not = cast_data([~a for a in data_cast_a]) + vnot = cast(getattr(self, "not")(vdata_a)) + assert vnot == data_not + + if self.sfx not in ("u8"): + return + data_andc = [a & ~b for a, b in zip(data_cast_a, data_cast_b)] + vandc = cast(getattr(self, "andc")(vdata_a, vdata_b)) + assert vandc == data_andc + + @pytest.mark.parametrize("intrin", ["any", "all"]) + @pytest.mark.parametrize("data", ( + [1, 2, 3, 4], + [-1, -2, -3, -4], + [0, 1, 2, 3, 4], + [0x7f, 0x7fff, 0x7fffffff, 0x7fffffffffffffff], + [0, -1, -2, -3, 4], + [0], + [1], + [-1] + )) + def test_operators_crosstest(self, intrin, data): + """ + Test intrinsics: + npyv_any_##SFX + npyv_all_##SFX + """ + data_a = self.load(data * self.nlanes) + func = eval(intrin) + intrin = getattr(self, intrin) + desired = func(data_a) + simd = intrin(data_a) + assert not not simd == desired + + def test_conversion_boolean(self): + bsfx = "b" + self.sfx[1:] + to_boolean = getattr(self.npyv, "cvt_%s_%s" % (bsfx, self.sfx)) + from_boolean = getattr(self.npyv, "cvt_%s_%s" % (self.sfx, bsfx)) + + false_vb = to_boolean(self.setall(0)) + true_vb = self.cmpeq(self.setall(0), self.setall(0)) + assert false_vb != true_vb + + false_vsfx = from_boolean(false_vb) + true_vsfx = from_boolean(true_vb) + assert false_vsfx != true_vsfx + + def test_conversion_expand(self): + """ + Test expand intrinsics: + npyv_expand_u16_u8 + npyv_expand_u32_u16 + """ + if self.sfx not in ("u8", "u16"): + return + totype = self.sfx[0]+str(int(self.sfx[1:])*2) + expand = getattr(self.npyv, f"expand_{totype}_{self.sfx}") + # close enough from the edge to detect any deviation + data = self._data(self._int_max() - self.nlanes) + vdata = self.load(data) + edata = expand(vdata) + # lower half part + data_lo = data[:self.nlanes//2] + # higher half part + data_hi = data[self.nlanes//2:] + assert edata == (data_lo, data_hi) + + def test_arithmetic_subadd(self): + if self._is_fp(): + data_a = self._data() + else: + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + # non-saturated + data_add = self.load([a + b for a, b in zip(data_a, data_b)]) # load to cast + add = self.add(vdata_a, vdata_b) + assert add == data_add + data_sub = self.load([a - b for a, b in zip(data_a, data_b)]) + sub = self.sub(vdata_a, vdata_b) + assert sub == data_sub + + def test_arithmetic_mul(self): + if self.sfx in ("u64", "s64"): + return + + if self._is_fp(): + data_a = self._data() + else: + data_a = self._data(self._int_max() - self.nlanes) + data_b = self._data(self._int_min(), reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + data_mul = self.load([a * b for a, b in zip(data_a, data_b)]) + mul = self.mul(vdata_a, vdata_b) + assert mul == data_mul + + def test_arithmetic_div(self): + if not self._is_fp(): + return + + data_a, data_b = self._data(), self._data(reverse=True) + vdata_a, vdata_b = self.load(data_a), self.load(data_b) + + # load to truncate f64 to precision of f32 + data_div = self.load([a / b for a, b in zip(data_a, data_b)]) + div = self.div(vdata_a, vdata_b) + assert div == data_div + + def test_arithmetic_intdiv(self): + """ + Test integer division intrinsics: + npyv_divisor_##sfx + npyv_divc_##sfx + """ + if self._is_fp(): + return + + int_min = self._int_min() + def trunc_div(a, d): + """ + Divide towards zero works with large integers > 2^53, + and wrap around overflow similar to what C does. + """ + if d == -1 and a == int_min: + return a + sign_a, sign_d = a < 0, d < 0 + if a == 0 or sign_a == sign_d: + return a // d + return (a + sign_d - sign_a) // d + 1 + + data = [1, -int_min] # to test overflow + data += range(0, 2**8, 2**5) + data += range(0, 2**8, 2**5-1) + bsize = self._scalar_size() + if bsize > 8: + data += range(2**8, 2**16, 2**13) + data += range(2**8, 2**16, 2**13-1) + if bsize > 16: + data += range(2**16, 2**32, 2**29) + data += range(2**16, 2**32, 2**29-1) + if bsize > 32: + data += range(2**32, 2**64, 2**61) + data += range(2**32, 2**64, 2**61-1) + # negate + data += [-x for x in data] + for dividend, divisor in itertools.product(data, data): + divisor = self.setall(divisor)[0] # cast + if divisor == 0: + continue + dividend = self.load(self._data(dividend)) + data_divc = [trunc_div(a, divisor) for a in dividend] + divisor_parms = self.divisor(divisor) + divc = self.divc(dividend, divisor_parms) + assert divc == data_divc + + def test_arithmetic_reduce_sum(self): + """ + Test reduce sum intrinsics: + npyv_sum_##sfx + """ + if self.sfx not in ("u32", "u64", "f32", "f64"): + return + # reduce sum + data = self._data() + vdata = self.load(data) + + data_sum = sum(data) + vsum = self.sum(vdata) + assert vsum == data_sum + + def test_arithmetic_reduce_sumup(self): + """ + Test extend reduce sum intrinsics: + npyv_sumup_##sfx + """ + if self.sfx not in ("u8", "u16"): + return + rdata = (0, self.nlanes, self._int_min(), self._int_max()-self.nlanes) + for r in rdata: + data = self._data(r) + vdata = self.load(data) + data_sum = sum(data) + vsum = self.sumup(vdata) + assert vsum == data_sum + + def test_mask_conditional(self): + """ + Conditional addition and subtraction for all supported data types. + Test intrinsics: + npyv_ifadd_##SFX, npyv_ifsub_##SFX + """ + vdata_a = self.load(self._data()) + vdata_b = self.load(self._data(reverse=True)) + true_mask = self.cmpeq(self.zero(), self.zero()) + false_mask = self.cmpneq(self.zero(), self.zero()) + + data_sub = self.sub(vdata_b, vdata_a) + ifsub = self.ifsub(true_mask, vdata_b, vdata_a, vdata_b) + assert ifsub == data_sub + ifsub = self.ifsub(false_mask, vdata_a, vdata_b, vdata_b) + assert ifsub == vdata_b + + data_add = self.add(vdata_b, vdata_a) + ifadd = self.ifadd(true_mask, vdata_b, vdata_a, vdata_b) + assert ifadd == data_add + ifadd = self.ifadd(false_mask, vdata_a, vdata_b, vdata_b) + assert ifadd == vdata_b + + if not self._is_fp(): + return + data_div = self.div(vdata_b, vdata_a) + ifdiv = self.ifdiv(true_mask, vdata_b, vdata_a, vdata_b) + assert ifdiv == data_div + ifdivz = self.ifdivz(true_mask, vdata_b, vdata_a) + assert ifdivz == data_div + ifdiv = self.ifdiv(false_mask, vdata_a, vdata_b, vdata_b) + assert ifdiv == vdata_b + ifdivz = self.ifdivz(false_mask, vdata_a, vdata_b) + assert ifdivz == self.zero() + +bool_sfx = ("b8", "b16", "b32", "b64") +int_sfx = ("u8", "s8", "u16", "s16", "u32", "s32", "u64", "s64") +fp_sfx = ("f32", "f64") +all_sfx = int_sfx + fp_sfx +tests_registry = { + bool_sfx: _SIMD_BOOL, + int_sfx : _SIMD_INT, + fp_sfx : _SIMD_FP, + ("f32",): _SIMD_FP32, + ("f64",): _SIMD_FP64, + all_sfx : _SIMD_ALL +} +for target_name, npyv in targets.items(): + simd_width = npyv.simd if npyv else '' + pretty_name = target_name.split('__') # multi-target separator + if len(pretty_name) > 1: + # multi-target + pretty_name = f"({' '.join(pretty_name)})" + else: + pretty_name = pretty_name[0] + + skip = "" + skip_sfx = dict() + if not npyv: + skip = f"target '{pretty_name}' isn't supported by current machine" + elif not npyv.simd: + skip = f"target '{pretty_name}' isn't supported by NPYV" + else: + if not npyv.simd_f32: + skip_sfx["f32"] = f"target '{pretty_name}' "\ + "doesn't support single-precision" + if not npyv.simd_f64: + skip_sfx["f64"] = f"target '{pretty_name}' doesn't"\ + "support double-precision" + + for sfxes, cls in tests_registry.items(): + for sfx in sfxes: + skip_m = skip_sfx.get(sfx, skip) + inhr = (cls,) + attr = dict(npyv=targets[target_name], sfx=sfx, target_name=target_name) + tcls = type(f"Test{cls.__name__}_{simd_width}_{target_name}_{sfx}", inhr, attr) + if skip_m: + pytest.mark.skip(reason=skip_m)(tcls) + globals()[tcls.__name__] = tcls diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd_module.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd_module.py new file mode 100644 index 0000000000000000000000000000000000000000..6bd68c22e1931e885081530913ea685325e94f96 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_simd_module.py @@ -0,0 +1,101 @@ +import pytest +from numpy._core._simd import targets +""" +This testing unit only for checking the sanity of common functionality, +therefore all we need is just to take one submodule that represents any +of enabled SIMD extensions to run the test on it and the second submodule +required to run only one check related to the possibility of mixing +the data types among each submodule. +""" +npyvs = [npyv_mod for npyv_mod in targets.values() if npyv_mod and npyv_mod.simd] +npyv, npyv2 = (npyvs + [None, None])[:2] + +unsigned_sfx = ["u8", "u16", "u32", "u64"] +signed_sfx = ["s8", "s16", "s32", "s64"] +fp_sfx = [] +if npyv and npyv.simd_f32: + fp_sfx.append("f32") +if npyv and npyv.simd_f64: + fp_sfx.append("f64") + +int_sfx = unsigned_sfx + signed_sfx +all_sfx = unsigned_sfx + int_sfx + +@pytest.mark.skipif(not npyv, reason="could not find any SIMD extension with NPYV support") +class Test_SIMD_MODULE: + + @pytest.mark.parametrize('sfx', all_sfx) + def test_num_lanes(self, sfx): + nlanes = getattr(npyv, "nlanes_" + sfx) + vector = getattr(npyv, "setall_" + sfx)(1) + assert len(vector) == nlanes + + @pytest.mark.parametrize('sfx', all_sfx) + def test_type_name(self, sfx): + vector = getattr(npyv, "setall_" + sfx)(1) + assert vector.__name__ == "npyv_" + sfx + + def test_raises(self): + a, b = [npyv.setall_u32(1)]*2 + for sfx in all_sfx: + vcb = lambda intrin: getattr(npyv, f"{intrin}_{sfx}") + pytest.raises(TypeError, vcb("add"), a) + pytest.raises(TypeError, vcb("add"), a, b, a) + pytest.raises(TypeError, vcb("setall")) + pytest.raises(TypeError, vcb("setall"), [1]) + pytest.raises(TypeError, vcb("load"), 1) + pytest.raises(ValueError, vcb("load"), [1]) + pytest.raises(ValueError, vcb("store"), [1], getattr(npyv, f"reinterpret_{sfx}_u32")(a)) + + @pytest.mark.skipif(not npyv2, reason=( + "could not find a second SIMD extension with NPYV support" + )) + def test_nomix(self): + # mix among submodules isn't allowed + a = npyv.setall_u32(1) + a2 = npyv2.setall_u32(1) + pytest.raises(TypeError, npyv.add_u32, a2, a2) + pytest.raises(TypeError, npyv2.add_u32, a, a) + + @pytest.mark.parametrize('sfx', unsigned_sfx) + def test_unsigned_overflow(self, sfx): + nlanes = getattr(npyv, "nlanes_" + sfx) + maxu = (1 << int(sfx[1:])) - 1 + maxu_72 = (1 << 72) - 1 + lane = getattr(npyv, "setall_" + sfx)(maxu_72)[0] + assert lane == maxu + lanes = getattr(npyv, "load_" + sfx)([maxu_72] * nlanes) + assert lanes == [maxu] * nlanes + lane = getattr(npyv, "setall_" + sfx)(-1)[0] + assert lane == maxu + lanes = getattr(npyv, "load_" + sfx)([-1] * nlanes) + assert lanes == [maxu] * nlanes + + @pytest.mark.parametrize('sfx', signed_sfx) + def test_signed_overflow(self, sfx): + nlanes = getattr(npyv, "nlanes_" + sfx) + maxs_72 = (1 << 71) - 1 + lane = getattr(npyv, "setall_" + sfx)(maxs_72)[0] + assert lane == -1 + lanes = getattr(npyv, "load_" + sfx)([maxs_72] * nlanes) + assert lanes == [-1] * nlanes + mins_72 = -1 << 71 + lane = getattr(npyv, "setall_" + sfx)(mins_72)[0] + assert lane == 0 + lanes = getattr(npyv, "load_" + sfx)([mins_72] * nlanes) + assert lanes == [0] * nlanes + + def test_truncate_f32(self): + if not npyv.simd_f32: + pytest.skip("F32 isn't support by the SIMD extension") + f32 = npyv.setall_f32(0.1)[0] + assert f32 != 0.1 + assert round(f32, 1) == 0.1 + + def test_compare(self): + data_range = range(0, npyv.nlanes_u32) + vdata = npyv.load_u32(data_range) + assert vdata == list(data_range) + assert vdata == tuple(data_range) + for i in data_range: + assert vdata[i] == data_range[i] diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_ufunc.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_ufunc.py new file mode 100644 index 0000000000000000000000000000000000000000..26b6a1aa5c27615f898c27ebb4b1449fff6eb7d4 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_ufunc.py @@ -0,0 +1,3178 @@ +import warnings +import itertools +import sys +import ctypes as ct +import pickle + +import pytest +from pytest import param + +import numpy as np +import numpy._core.umath as ncu +import numpy._core._umath_tests as umt +import numpy.linalg._umath_linalg as uml +import numpy._core._operand_flag_tests as opflag_tests +import numpy._core._rational_tests as _rational_tests +from numpy.exceptions import AxisError +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_array_equal, + assert_almost_equal, assert_array_almost_equal, assert_no_warnings, + assert_allclose, HAS_REFCOUNT, suppress_warnings, IS_WASM, IS_PYPY, + ) +from numpy.testing._private.utils import requires_memory + + +UNARY_UFUNCS = [obj for obj in np._core.umath.__dict__.values() + if isinstance(obj, np.ufunc)] +UNARY_OBJECT_UFUNCS = [uf for uf in UNARY_UFUNCS if "O->O" in uf.types] + +# Remove functions that do not support `floats` +UNARY_OBJECT_UFUNCS.remove(getattr(np, 'bitwise_count')) + + +class TestUfuncKwargs: + def test_kwarg_exact(self): + assert_raises(TypeError, np.add, 1, 2, castingx='safe') + assert_raises(TypeError, np.add, 1, 2, dtypex=int) + assert_raises(TypeError, np.add, 1, 2, extobjx=[4096]) + assert_raises(TypeError, np.add, 1, 2, outx=None) + assert_raises(TypeError, np.add, 1, 2, sigx='ii->i') + assert_raises(TypeError, np.add, 1, 2, signaturex='ii->i') + assert_raises(TypeError, np.add, 1, 2, subokx=False) + assert_raises(TypeError, np.add, 1, 2, wherex=[True]) + + def test_sig_signature(self): + assert_raises(TypeError, np.add, 1, 2, sig='ii->i', + signature='ii->i') + + def test_sig_dtype(self): + assert_raises(TypeError, np.add, 1, 2, sig='ii->i', + dtype=int) + assert_raises(TypeError, np.add, 1, 2, signature='ii->i', + dtype=int) + + def test_extobj_removed(self): + assert_raises(TypeError, np.add, 1, 2, extobj=[4096]) + + +class TestUfuncGenericLoops: + """Test generic loops. + + The loops to be tested are: + + PyUFunc_ff_f_As_dd_d + PyUFunc_ff_f + PyUFunc_dd_d + PyUFunc_gg_g + PyUFunc_FF_F_As_DD_D + PyUFunc_DD_D + PyUFunc_FF_F + PyUFunc_GG_G + PyUFunc_OO_O + PyUFunc_OO_O_method + PyUFunc_f_f_As_d_d + PyUFunc_d_d + PyUFunc_f_f + PyUFunc_g_g + PyUFunc_F_F_As_D_D + PyUFunc_F_F + PyUFunc_D_D + PyUFunc_G_G + PyUFunc_O_O + PyUFunc_O_O_method + PyUFunc_On_Om + + Where: + + f -- float + d -- double + g -- long double + F -- complex float + D -- complex double + G -- complex long double + O -- python object + + It is difficult to assure that each of these loops is entered from the + Python level as the special cased loops are a moving target and the + corresponding types are architecture dependent. We probably need to + define C level testing ufuncs to get at them. For the time being, I've + just looked at the signatures registered in the build directory to find + relevant functions. + + """ + np_dtypes = [ + (np.single, np.single), (np.single, np.double), + (np.csingle, np.csingle), (np.csingle, np.cdouble), + (np.double, np.double), (np.longdouble, np.longdouble), + (np.cdouble, np.cdouble), (np.clongdouble, np.clongdouble)] + + @pytest.mark.parametrize('input_dtype,output_dtype', np_dtypes) + def test_unary_PyUFunc(self, input_dtype, output_dtype, f=np.exp, x=0, y=1): + xs = np.full(10, input_dtype(x), dtype=output_dtype) + ys = f(xs)[::2] + assert_allclose(ys, y) + assert_equal(ys.dtype, output_dtype) + + def f2(x, y): + return x**y + + @pytest.mark.parametrize('input_dtype,output_dtype', np_dtypes) + def test_binary_PyUFunc(self, input_dtype, output_dtype, f=f2, x=0, y=1): + xs = np.full(10, input_dtype(x), dtype=output_dtype) + ys = f(xs, xs)[::2] + assert_allclose(ys, y) + assert_equal(ys.dtype, output_dtype) + + # class to use in testing object method loops + class foo: + def conjugate(self): + return np.bool(1) + + def logical_xor(self, obj): + return np.bool(1) + + def test_unary_PyUFunc_O_O(self): + x = np.ones(10, dtype=object) + assert_(np.all(np.abs(x) == 1)) + + def test_unary_PyUFunc_O_O_method_simple(self, foo=foo): + x = np.full(10, foo(), dtype=object) + assert_(np.all(np.conjugate(x) == True)) + + def test_binary_PyUFunc_OO_O(self): + x = np.ones(10, dtype=object) + assert_(np.all(np.add(x, x) == 2)) + + def test_binary_PyUFunc_OO_O_method(self, foo=foo): + x = np.full(10, foo(), dtype=object) + assert_(np.all(np.logical_xor(x, x))) + + def test_binary_PyUFunc_On_Om_method(self, foo=foo): + x = np.full((10, 2, 3), foo(), dtype=object) + assert_(np.all(np.logical_xor(x, x))) + + def test_python_complex_conjugate(self): + # The conjugate ufunc should fall back to calling the method: + arr = np.array([1+2j, 3-4j], dtype="O") + assert isinstance(arr[0], complex) + res = np.conjugate(arr) + assert res.dtype == np.dtype("O") + assert_array_equal(res, np.array([1-2j, 3+4j], dtype="O")) + + @pytest.mark.parametrize("ufunc", UNARY_OBJECT_UFUNCS) + def test_unary_PyUFunc_O_O_method_full(self, ufunc): + """Compare the result of the object loop with non-object one""" + val = np.float64(np.pi/4) + + class MyFloat(np.float64): + def __getattr__(self, attr): + try: + return super().__getattr__(attr) + except AttributeError: + return lambda: getattr(np._core.umath, attr)(val) + + # Use 0-D arrays, to ensure the same element call + num_arr = np.array(val, dtype=np.float64) + obj_arr = np.array(MyFloat(val), dtype="O") + + with np.errstate(all="raise"): + try: + res_num = ufunc(num_arr) + except Exception as exc: + with assert_raises(type(exc)): + ufunc(obj_arr) + else: + res_obj = ufunc(obj_arr) + assert_array_almost_equal(res_num.astype("O"), res_obj) + + +def _pickleable_module_global(): + pass + + +class TestUfunc: + def test_pickle(self): + for proto in range(2, pickle.HIGHEST_PROTOCOL + 1): + assert_(pickle.loads(pickle.dumps(np.sin, + protocol=proto)) is np.sin) + + # Check that ufunc not defined in the top level numpy namespace + # such as numpy._core._rational_tests.test_add can also be pickled + res = pickle.loads(pickle.dumps(_rational_tests.test_add, + protocol=proto)) + assert_(res is _rational_tests.test_add) + + def test_pickle_withstring(self): + astring = (b"cnumpy.core\n_ufunc_reconstruct\np0\n" + b"(S'numpy._core.umath'\np1\nS'cos'\np2\ntp3\nRp4\n.") + assert_(pickle.loads(astring) is np.cos) + + @pytest.mark.skipif(IS_PYPY, reason="'is' check does not work on PyPy") + def test_pickle_name_is_qualname(self): + # This tests that a simplification of our ufunc pickle code will + # lead to allowing qualnames as names. Future ufuncs should + # possible add a specific qualname, or a hook into pickling instead + # (dask+numba may benefit). + _pickleable_module_global.ufunc = umt._pickleable_module_global_ufunc + + obj = pickle.loads(pickle.dumps(_pickleable_module_global.ufunc)) + assert obj is umt._pickleable_module_global_ufunc + + def test_reduceat_shifting_sum(self): + L = 6 + x = np.arange(L) + idx = np.array(list(zip(np.arange(L - 2), np.arange(L - 2) + 2))).ravel() + assert_array_equal(np.add.reduceat(x, idx)[::2], [1, 3, 5, 7]) + + def test_all_ufunc(self): + """Try to check presence and results of all ufuncs. + + The list of ufuncs comes from generate_umath.py and is as follows: + + ===== ==== ============= =============== ======================== + done args function types notes + ===== ==== ============= =============== ======================== + n 1 conjugate nums + O + n 1 absolute nums + O complex -> real + n 1 negative nums + O + n 1 sign nums + O -> int + n 1 invert bool + ints + O flts raise an error + n 1 degrees real + M cmplx raise an error + n 1 radians real + M cmplx raise an error + n 1 arccos flts + M + n 1 arccosh flts + M + n 1 arcsin flts + M + n 1 arcsinh flts + M + n 1 arctan flts + M + n 1 arctanh flts + M + n 1 cos flts + M + n 1 sin flts + M + n 1 tan flts + M + n 1 cosh flts + M + n 1 sinh flts + M + n 1 tanh flts + M + n 1 exp flts + M + n 1 expm1 flts + M + n 1 log flts + M + n 1 log10 flts + M + n 1 log1p flts + M + n 1 sqrt flts + M real x < 0 raises error + n 1 ceil real + M + n 1 trunc real + M + n 1 floor real + M + n 1 fabs real + M + n 1 rint flts + M + n 1 isnan flts -> bool + n 1 isinf flts -> bool + n 1 isfinite flts -> bool + n 1 signbit real -> bool + n 1 modf real -> (frac, int) + n 1 logical_not bool + nums + M -> bool + n 2 left_shift ints + O flts raise an error + n 2 right_shift ints + O flts raise an error + n 2 add bool + nums + O boolean + is || + n 2 subtract bool + nums + O boolean - is ^ + n 2 multiply bool + nums + O boolean * is & + n 2 divide nums + O + n 2 floor_divide nums + O + n 2 true_divide nums + O bBhH -> f, iIlLqQ -> d + n 2 fmod nums + M + n 2 power nums + O + n 2 greater bool + nums + O -> bool + n 2 greater_equal bool + nums + O -> bool + n 2 less bool + nums + O -> bool + n 2 less_equal bool + nums + O -> bool + n 2 equal bool + nums + O -> bool + n 2 not_equal bool + nums + O -> bool + n 2 logical_and bool + nums + M -> bool + n 2 logical_or bool + nums + M -> bool + n 2 logical_xor bool + nums + M -> bool + n 2 maximum bool + nums + O + n 2 minimum bool + nums + O + n 2 bitwise_and bool + ints + O flts raise an error + n 2 bitwise_or bool + ints + O flts raise an error + n 2 bitwise_xor bool + ints + O flts raise an error + n 2 arctan2 real + M + n 2 remainder ints + real + O + n 2 hypot real + M + ===== ==== ============= =============== ======================== + + Types other than those listed will be accepted, but they are cast to + the smallest compatible type for which the function is defined. The + casting rules are: + + bool -> int8 -> float32 + ints -> double + + """ + pass + + # from include/numpy/ufuncobject.h + size_inferred = 2 + can_ignore = 4 + def test_signature0(self): + # the arguments to test_signature are: nin, nout, core_signature + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(i),(i)->()") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 1, 0)) + assert_equal(ixs, (0, 0)) + assert_equal(flags, (self.size_inferred,)) + assert_equal(sizes, (-1,)) + + def test_signature1(self): + # empty core signature; treat as plain ufunc (with trivial core) + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(),()->()") + assert_equal(enabled, 0) + assert_equal(num_dims, (0, 0, 0)) + assert_equal(ixs, ()) + assert_equal(flags, ()) + assert_equal(sizes, ()) + + def test_signature2(self): + # more complicated names for variables + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(i1,i2),(J_1)->(_kAB)") + assert_equal(enabled, 1) + assert_equal(num_dims, (2, 1, 1)) + assert_equal(ixs, (0, 1, 2, 3)) + assert_equal(flags, (self.size_inferred,)*4) + assert_equal(sizes, (-1, -1, -1, -1)) + + def test_signature3(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(i1, i12), (J_1)->(i12, i2)") + assert_equal(enabled, 1) + assert_equal(num_dims, (2, 1, 2)) + assert_equal(ixs, (0, 1, 2, 1, 3)) + assert_equal(flags, (self.size_inferred,)*4) + assert_equal(sizes, (-1, -1, -1, -1)) + + def test_signature4(self): + # matrix_multiply signature from _umath_tests + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(n,k),(k,m)->(n,m)") + assert_equal(enabled, 1) + assert_equal(num_dims, (2, 2, 2)) + assert_equal(ixs, (0, 1, 1, 2, 0, 2)) + assert_equal(flags, (self.size_inferred,)*3) + assert_equal(sizes, (-1, -1, -1)) + + def test_signature5(self): + # matmul signature from _umath_tests + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 2, 1, "(n?,k),(k,m?)->(n?,m?)") + assert_equal(enabled, 1) + assert_equal(num_dims, (2, 2, 2)) + assert_equal(ixs, (0, 1, 1, 2, 0, 2)) + assert_equal(flags, (self.size_inferred | self.can_ignore, + self.size_inferred, + self.size_inferred | self.can_ignore)) + assert_equal(sizes, (-1, -1, -1)) + + def test_signature6(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 1, 1, "(3)->()") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 0)) + assert_equal(ixs, (0,)) + assert_equal(flags, (0,)) + assert_equal(sizes, (3,)) + + def test_signature7(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 3, 1, "(3),(03,3),(n)->(9)") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 2, 1, 1)) + assert_equal(ixs, (0, 0, 0, 1, 2)) + assert_equal(flags, (0, self.size_inferred, 0)) + assert_equal(sizes, (3, -1, 9)) + + def test_signature8(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 3, 1, "(3?),(3?,3?),(n)->(9)") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 2, 1, 1)) + assert_equal(ixs, (0, 0, 0, 1, 2)) + assert_equal(flags, (self.can_ignore, self.size_inferred, 0)) + assert_equal(sizes, (3, -1, 9)) + + def test_signature9(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 1, 1, "( 3) -> ( )") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 0)) + assert_equal(ixs, (0,)) + assert_equal(flags, (0,)) + assert_equal(sizes, (3,)) + + def test_signature10(self): + enabled, num_dims, ixs, flags, sizes = umt.test_signature( + 3, 1, "( 3? ) , (3? , 3?) ,(n )-> ( 9)") + assert_equal(enabled, 1) + assert_equal(num_dims, (1, 2, 1, 1)) + assert_equal(ixs, (0, 0, 0, 1, 2)) + assert_equal(flags, (self.can_ignore, self.size_inferred, 0)) + assert_equal(sizes, (3, -1, 9)) + + def test_signature_failure_extra_parenthesis(self): + with assert_raises(ValueError): + umt.test_signature(2, 1, "((i)),(i)->()") + + def test_signature_failure_mismatching_parenthesis(self): + with assert_raises(ValueError): + umt.test_signature(2, 1, "(i),)i(->()") + + def test_signature_failure_signature_missing_input_arg(self): + with assert_raises(ValueError): + umt.test_signature(2, 1, "(i),->()") + + def test_signature_failure_signature_missing_output_arg(self): + with assert_raises(ValueError): + umt.test_signature(2, 2, "(i),(i)->()") + + def test_get_signature(self): + assert_equal(np.vecdot.signature, "(n),(n)->()") + + def test_forced_sig(self): + a = 0.5*np.arange(3, dtype='f8') + assert_equal(np.add(a, 0.5), [0.5, 1, 1.5]) + with pytest.warns(DeprecationWarning): + assert_equal(np.add(a, 0.5, sig='i', casting='unsafe'), [0, 0, 1]) + assert_equal(np.add(a, 0.5, sig='ii->i', casting='unsafe'), [0, 0, 1]) + with pytest.warns(DeprecationWarning): + assert_equal(np.add(a, 0.5, sig=('i4',), casting='unsafe'), + [0, 0, 1]) + assert_equal(np.add(a, 0.5, sig=('i4', 'i4', 'i4'), + casting='unsafe'), [0, 0, 1]) + + b = np.zeros((3,), dtype='f8') + np.add(a, 0.5, out=b) + assert_equal(b, [0.5, 1, 1.5]) + b[:] = 0 + with pytest.warns(DeprecationWarning): + np.add(a, 0.5, sig='i', out=b, casting='unsafe') + assert_equal(b, [0, 0, 1]) + b[:] = 0 + np.add(a, 0.5, sig='ii->i', out=b, casting='unsafe') + assert_equal(b, [0, 0, 1]) + b[:] = 0 + with pytest.warns(DeprecationWarning): + np.add(a, 0.5, sig=('i4',), out=b, casting='unsafe') + assert_equal(b, [0, 0, 1]) + b[:] = 0 + np.add(a, 0.5, sig=('i4', 'i4', 'i4'), out=b, casting='unsafe') + assert_equal(b, [0, 0, 1]) + + def test_signature_all_None(self): + # signature all None, is an acceptable alternative (since 1.21) + # to not providing a signature. + res1 = np.add([3], [4], sig=(None, None, None)) + res2 = np.add([3], [4]) + assert_array_equal(res1, res2) + res1 = np.maximum([3], [4], sig=(None, None, None)) + res2 = np.maximum([3], [4]) + assert_array_equal(res1, res2) + + with pytest.raises(TypeError): + # special case, that would be deprecated anyway, so errors: + np.add(3, 4, signature=(None,)) + + def test_signature_dtype_type(self): + # Since that will be the normal behaviour (past NumPy 1.21) + # we do support the types already: + float_dtype = type(np.dtype(np.float64)) + np.add(3, 4, signature=(float_dtype, float_dtype, None)) + + @pytest.mark.parametrize("get_kwarg", [ + lambda dt: dict(dtype=x), + lambda dt: dict(signature=(x, None, None))]) + def test_signature_dtype_instances_allowed(self, get_kwarg): + # We allow certain dtype instances when there is a clear singleton + # and the given one is equivalent; mainly for backcompat. + int64 = np.dtype("int64") + int64_2 = pickle.loads(pickle.dumps(int64)) + # Relies on pickling behavior, if assert fails just remove test... + assert int64 is not int64_2 + + assert np.add(1, 2, **get_kwarg(int64_2)).dtype == int64 + td = np.timedelta(2, "s") + assert np.add(td, td, **get_kwarg("m8")).dtype == "m8[s]" + + @pytest.mark.parametrize("get_kwarg", [ + param(lambda x: dict(dtype=x), id="dtype"), + param(lambda x: dict(signature=(x, None, None)), id="signature")]) + def test_signature_dtype_instances_allowed(self, get_kwarg): + msg = "The `dtype` and `signature` arguments to ufuncs" + + with pytest.raises(TypeError, match=msg): + np.add(3, 5, **get_kwarg(np.dtype("int64").newbyteorder())) + with pytest.raises(TypeError, match=msg): + np.add(3, 5, **get_kwarg(np.dtype("m8[ns]"))) + with pytest.raises(TypeError, match=msg): + np.add(3, 5, **get_kwarg("m8[ns]")) + + @pytest.mark.parametrize("casting", ["unsafe", "same_kind", "safe"]) + def test_partial_signature_mismatch(self, casting): + # If the second argument matches already, no need to specify it: + res = np.ldexp(np.float32(1.), np.int_(2), dtype="d") + assert res.dtype == "d" + res = np.ldexp(np.float32(1.), np.int_(2), signature=(None, None, "d")) + assert res.dtype == "d" + + # ldexp only has a loop for long input as second argument, overriding + # the output cannot help with that (no matter the casting) + with pytest.raises(TypeError): + np.ldexp(1., np.uint64(3), dtype="d") + with pytest.raises(TypeError): + np.ldexp(1., np.uint64(3), signature=(None, None, "d")) + + def test_partial_signature_mismatch_with_cache(self): + with pytest.raises(TypeError): + np.add(np.float16(1), np.uint64(2), sig=("e", "d", None)) + # Ensure e,d->None is in the dispatching cache (double loop) + np.add(np.float16(1), np.float64(2)) + # The error must still be raised: + with pytest.raises(TypeError): + np.add(np.float16(1), np.uint64(2), sig=("e", "d", None)) + + @pytest.mark.xfail(np._get_promotion_state() != "legacy", + reason="NEP 50 impl breaks casting checks when `dtype=` is used " + "together with python scalars.") + def test_use_output_signature_for_all_arguments(self): + # Test that providing only `dtype=` or `signature=(None, None, dtype)` + # is sufficient if falling back to a homogeneous signature works. + # In this case, the `intp, intp -> intp` loop is chosen. + res = np.power(1.5, 2.8, dtype=np.intp, casting="unsafe") + assert res == 1 # the cast happens first. + res = np.power(1.5, 2.8, signature=(None, None, np.intp), + casting="unsafe") + assert res == 1 + with pytest.raises(TypeError): + # the unsafe casting would normally cause errors though: + np.power(1.5, 2.8, dtype=np.intp) + + def test_signature_errors(self): + with pytest.raises(TypeError, + match="the signature object to ufunc must be a string or"): + np.add(3, 4, signature=123.) # neither a string nor a tuple + + with pytest.raises(ValueError): + # bad symbols that do not translate to dtypes + np.add(3, 4, signature="%^->#") + + with pytest.raises(ValueError): + np.add(3, 4, signature=b"ii-i") # incomplete and byte string + + with pytest.raises(ValueError): + np.add(3, 4, signature="ii>i") # incomplete string + + with pytest.raises(ValueError): + np.add(3, 4, signature=(None, "f8")) # bad length + + with pytest.raises(UnicodeDecodeError): + np.add(3, 4, signature=b"\xff\xff->i") + + def test_forced_dtype_times(self): + # Signatures only set the type numbers (not the actual loop dtypes) + # so using `M` in a signature/dtype should generally work: + a = np.array(['2010-01-02', '1999-03-14', '1833-03'], dtype='>M8[D]') + np.maximum(a, a, dtype="M") + np.maximum.reduce(a, dtype="M") + + arr = np.arange(10, dtype="m8[s]") + np.add(arr, arr, dtype="m") + np.maximum(arr, arr, dtype="m") + + @pytest.mark.parametrize("ufunc", [np.add, np.sqrt]) + def test_cast_safety(self, ufunc): + """Basic test for the safest casts, because ufuncs inner loops can + indicate a cast-safety as well (which is normally always "no"). + """ + def call_ufunc(arr, **kwargs): + return ufunc(*(arr,) * ufunc.nin, **kwargs) + + arr = np.array([1., 2., 3.], dtype=np.float32) + arr_bs = arr.astype(arr.dtype.newbyteorder()) + expected = call_ufunc(arr) + # Normally, a "no" cast: + res = call_ufunc(arr, casting="no") + assert_array_equal(expected, res) + # Byte-swapping is not allowed with "no" though: + with pytest.raises(TypeError): + call_ufunc(arr_bs, casting="no") + + # But is allowed with "equiv": + res = call_ufunc(arr_bs, casting="equiv") + assert_array_equal(expected, res) + + # Casting to float64 is safe, but not equiv: + with pytest.raises(TypeError): + call_ufunc(arr_bs, dtype=np.float64, casting="equiv") + + # but it is safe cast: + res = call_ufunc(arr_bs, dtype=np.float64, casting="safe") + expected = call_ufunc(arr.astype(np.float64)) # upcast + assert_array_equal(expected, res) + + @pytest.mark.parametrize("ufunc", [np.add, np.equal]) + def test_cast_safety_scalar(self, ufunc): + # We test add and equal, because equal has special scalar handling + # Note that the "equiv" casting behavior should maybe be considered + # a current implementation detail. + with pytest.raises(TypeError): + # this picks an integer loop, which is not safe + ufunc(3., 4., dtype=int, casting="safe") + + with pytest.raises(TypeError): + # We accept python float as float64 but not float32 for equiv. + ufunc(3., 4., dtype="float32", casting="equiv") + + # Special case for object and equal (note that equiv implies safe) + ufunc(3, 4, dtype=object, casting="equiv") + # Picks a double loop for both, first is equiv, second safe: + ufunc(np.array([3.]), 3., casting="equiv") + ufunc(np.array([3.]), 3, casting="safe") + ufunc(np.array([3]), 3, casting="equiv") + + def test_cast_safety_scalar_special(self): + # We allow this (and it succeeds) via object, although the equiv + # part may not be important. + np.equal(np.array([3]), 2**300, casting="equiv") + + def test_true_divide(self): + a = np.array(10) + b = np.array(20) + tgt = np.array(0.5) + + for tc in 'bhilqBHILQefdgFDG': + dt = np.dtype(tc) + aa = a.astype(dt) + bb = b.astype(dt) + + # Check result value and dtype. + for x, y in itertools.product([aa, -aa], [bb, -bb]): + + # Check with no output type specified + if tc in 'FDG': + tgt = complex(x)/complex(y) + else: + tgt = float(x)/float(y) + + res = np.true_divide(x, y) + rtol = max(np.finfo(res).resolution, 1e-15) + assert_allclose(res, tgt, rtol=rtol) + + if tc in 'bhilqBHILQ': + assert_(res.dtype.name == 'float64') + else: + assert_(res.dtype.name == dt.name ) + + # Check with output type specified. This also checks for the + # incorrect casts in issue gh-3484 because the unary '-' does + # not change types, even for unsigned types, Hence casts in the + # ufunc from signed to unsigned and vice versa will lead to + # errors in the values. + for tcout in 'bhilqBHILQ': + dtout = np.dtype(tcout) + assert_raises(TypeError, np.true_divide, x, y, dtype=dtout) + + for tcout in 'efdg': + dtout = np.dtype(tcout) + if tc in 'FDG': + # Casting complex to float is not allowed + assert_raises(TypeError, np.true_divide, x, y, dtype=dtout) + else: + tgt = float(x)/float(y) + rtol = max(np.finfo(dtout).resolution, 1e-15) + # The value of tiny for double double is NaN + with suppress_warnings() as sup: + sup.filter(UserWarning) + if not np.isnan(np.finfo(dtout).tiny): + atol = max(np.finfo(dtout).tiny, 3e-308) + else: + atol = 3e-308 + # Some test values result in invalid for float16 + # and the cast to it may overflow to inf. + with np.errstate(invalid='ignore', over='ignore'): + res = np.true_divide(x, y, dtype=dtout) + if not np.isfinite(res) and tcout == 'e': + continue + assert_allclose(res, tgt, rtol=rtol, atol=atol) + assert_(res.dtype.name == dtout.name) + + for tcout in 'FDG': + dtout = np.dtype(tcout) + tgt = complex(x)/complex(y) + rtol = max(np.finfo(dtout).resolution, 1e-15) + # The value of tiny for double double is NaN + with suppress_warnings() as sup: + sup.filter(UserWarning) + if not np.isnan(np.finfo(dtout).tiny): + atol = max(np.finfo(dtout).tiny, 3e-308) + else: + atol = 3e-308 + res = np.true_divide(x, y, dtype=dtout) + if not np.isfinite(res): + continue + assert_allclose(res, tgt, rtol=rtol, atol=atol) + assert_(res.dtype.name == dtout.name) + + # Check booleans + a = np.ones((), dtype=np.bool) + res = np.true_divide(a, a) + assert_(res == 1.0) + assert_(res.dtype.name == 'float64') + res = np.true_divide(~a, a) + assert_(res == 0.0) + assert_(res.dtype.name == 'float64') + + def test_sum_stability(self): + a = np.ones(500, dtype=np.float32) + assert_almost_equal((a / 10.).sum() - a.size / 10., 0, 4) + + a = np.ones(500, dtype=np.float64) + assert_almost_equal((a / 10.).sum() - a.size / 10., 0, 13) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_sum(self): + for dt in (int, np.float16, np.float32, np.float64, np.longdouble): + for v in (0, 1, 2, 7, 8, 9, 15, 16, 19, 127, + 128, 1024, 1235): + # warning if sum overflows, which it does in float16 + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter("always", RuntimeWarning) + + tgt = dt(v * (v + 1) / 2) + overflow = not np.isfinite(tgt) + assert_equal(len(w), 1 * overflow) + + d = np.arange(1, v + 1, dtype=dt) + + assert_almost_equal(np.sum(d), tgt) + assert_equal(len(w), 2 * overflow) + + assert_almost_equal(np.sum(d[::-1]), tgt) + assert_equal(len(w), 3 * overflow) + + d = np.ones(500, dtype=dt) + assert_almost_equal(np.sum(d[::2]), 250.) + assert_almost_equal(np.sum(d[1::2]), 250.) + assert_almost_equal(np.sum(d[::3]), 167.) + assert_almost_equal(np.sum(d[1::3]), 167.) + assert_almost_equal(np.sum(d[::-2]), 250.) + assert_almost_equal(np.sum(d[-1::-2]), 250.) + assert_almost_equal(np.sum(d[::-3]), 167.) + assert_almost_equal(np.sum(d[-1::-3]), 167.) + # sum with first reduction entry != 0 + d = np.ones((1,), dtype=dt) + d += d + assert_almost_equal(d, 2.) + + def test_sum_complex(self): + for dt in (np.complex64, np.complex128, np.clongdouble): + for v in (0, 1, 2, 7, 8, 9, 15, 16, 19, 127, + 128, 1024, 1235): + tgt = dt(v * (v + 1) / 2) - dt((v * (v + 1) / 2) * 1j) + d = np.empty(v, dtype=dt) + d.real = np.arange(1, v + 1) + d.imag = -np.arange(1, v + 1) + assert_almost_equal(np.sum(d), tgt) + assert_almost_equal(np.sum(d[::-1]), tgt) + + d = np.ones(500, dtype=dt) + 1j + assert_almost_equal(np.sum(d[::2]), 250. + 250j) + assert_almost_equal(np.sum(d[1::2]), 250. + 250j) + assert_almost_equal(np.sum(d[::3]), 167. + 167j) + assert_almost_equal(np.sum(d[1::3]), 167. + 167j) + assert_almost_equal(np.sum(d[::-2]), 250. + 250j) + assert_almost_equal(np.sum(d[-1::-2]), 250. + 250j) + assert_almost_equal(np.sum(d[::-3]), 167. + 167j) + assert_almost_equal(np.sum(d[-1::-3]), 167. + 167j) + # sum with first reduction entry != 0 + d = np.ones((1,), dtype=dt) + 1j + d += d + assert_almost_equal(d, 2. + 2j) + + def test_sum_initial(self): + # Integer, single axis + assert_equal(np.sum([3], initial=2), 5) + + # Floating point + assert_almost_equal(np.sum([0.2], initial=0.1), 0.3) + + # Multiple non-adjacent axes + assert_equal(np.sum(np.ones((2, 3, 5), dtype=np.int64), axis=(0, 2), initial=2), + [12, 12, 12]) + + def test_sum_where(self): + # More extensive tests done in test_reduction_with_where. + assert_equal(np.sum([[1., 2.], [3., 4.]], where=[True, False]), 4.) + assert_equal(np.sum([[1., 2.], [3., 4.]], axis=0, initial=5., + where=[True, False]), [9., 5.]) + + def test_vecdot(self): + arr1 = np.arange(6).reshape((2, 3)) + arr2 = np.arange(3).reshape((1, 3)) + + actual = np.vecdot(arr1, arr2) + expected = np.array([5, 14]) + + assert_array_equal(actual, expected) + + actual2 = np.vecdot(arr1.T, arr2.T, axis=-2) + assert_array_equal(actual2, expected) + + actual3 = np.vecdot(arr1.astype("object"), arr2) + assert_array_equal(actual3, expected.astype("object")) + + def test_vecdot_complex(self): + arr1 = np.array([1, 2j, 3]) + arr2 = np.array([1, 2, 3]) + + actual = np.vecdot(arr1, arr2) + expected = np.array([10-4j]) + assert_array_equal(actual, expected) + + actual2 = np.vecdot(arr2, arr1) + assert_array_equal(actual2, expected.conj()) + + actual3 = np.vecdot(arr1.astype("object"), arr2.astype("object")) + assert_array_equal(actual3, expected.astype("object")) + + def test_vecdot_subclass(self): + class MySubclass(np.ndarray): + pass + + arr1 = np.arange(6).reshape((2, 3)).view(MySubclass) + arr2 = np.arange(3).reshape((1, 3)).view(MySubclass) + result = np.vecdot(arr1, arr2) + assert isinstance(result, MySubclass) + + def test_vecdot_object_no_conjugate(self): + arr = np.array(["1", "2"], dtype=object) + with pytest.raises(AttributeError, match="conjugate"): + np.vecdot(arr, arr) + + def test_vecdot_object_breaks_outer_loop_on_error(self): + arr1 = np.ones((3, 3)).astype(object) + arr2 = arr1.copy() + arr2[1, 1] = None + out = np.zeros(3).astype(object) + with pytest.raises(TypeError, match=r"\*: 'float' and 'NoneType'"): + np.vecdot(arr1, arr2, out=out) + assert out[0] == 3 + assert out[1] == out[2] == 0 + + def test_broadcast(self): + msg = "broadcast" + a = np.arange(4).reshape((2, 1, 2)) + b = np.arange(4).reshape((1, 2, 2)) + assert_array_equal(np.vecdot(a, b), np.sum(a*b, axis=-1), err_msg=msg) + msg = "extend & broadcast loop dimensions" + b = np.arange(4).reshape((2, 2)) + assert_array_equal(np.vecdot(a, b), np.sum(a*b, axis=-1), err_msg=msg) + # Broadcast in core dimensions should fail + a = np.arange(8).reshape((4, 2)) + b = np.arange(4).reshape((4, 1)) + assert_raises(ValueError, np.vecdot, a, b) + # Extend core dimensions should fail + a = np.arange(8).reshape((4, 2)) + b = np.array(7) + assert_raises(ValueError, np.vecdot, a, b) + # Broadcast should fail + a = np.arange(2).reshape((2, 1, 1)) + b = np.arange(3).reshape((3, 1, 1)) + assert_raises(ValueError, np.vecdot, a, b) + + # Writing to a broadcasted array with overlap should warn, gh-2705 + a = np.arange(2) + b = np.arange(4).reshape((2, 2)) + u, v = np.broadcast_arrays(a, b) + assert_equal(u.strides[0], 0) + x = u + v + with warnings.catch_warnings(record=True) as w: + warnings.simplefilter("always") + u += v + assert_equal(len(w), 1) + assert_(x[0, 0] != u[0, 0]) + + # Output reduction should not be allowed. + # See gh-15139 + a = np.arange(6).reshape(3, 2) + b = np.ones(2) + out = np.empty(()) + assert_raises(ValueError, np.vecdot, a, b, out) + out2 = np.empty(3) + c = np.vecdot(a, b, out2) + assert_(c is out2) + + def test_out_broadcasts(self): + # For ufuncs and gufuncs (not for reductions), we currently allow + # the output to cause broadcasting of the input arrays. + # both along dimensions with shape 1 and dimensions which do not + # exist at all in the inputs. + arr = np.arange(3).reshape(1, 3) + out = np.empty((5, 4, 3)) + np.add(arr, arr, out=out) + assert (out == np.arange(3) * 2).all() + + # The same holds for gufuncs (gh-16484) + np.vecdot(arr, arr, out=out) + # the result would be just a scalar `5`, but is broadcast fully: + assert (out == 5).all() + + @pytest.mark.parametrize(["arr", "out"], [ + ([2], np.empty(())), + ([1, 2], np.empty(1)), + (np.ones((4, 3)), np.empty((4, 1)))], + ids=["(1,)->()", "(2,)->(1,)", "(4, 3)->(4, 1)"]) + def test_out_broadcast_errors(self, arr, out): + # Output is (currently) allowed to broadcast inputs, but it cannot be + # smaller than the actual result. + with pytest.raises(ValueError, match="non-broadcastable"): + np.positive(arr, out=out) + + with pytest.raises(ValueError, match="non-broadcastable"): + np.add(np.ones(()), arr, out=out) + + def test_type_cast(self): + msg = "type cast" + a = np.arange(6, dtype='short').reshape((2, 3)) + assert_array_equal(np.vecdot(a, a), np.sum(a*a, axis=-1), + err_msg=msg) + msg = "type cast on one argument" + a = np.arange(6).reshape((2, 3)) + b = a + 0.1 + assert_array_almost_equal(np.vecdot(a, b), np.sum(a*b, axis=-1), + err_msg=msg) + + def test_endian(self): + msg = "big endian" + a = np.arange(6, dtype='>i4').reshape((2, 3)) + assert_array_equal(np.vecdot(a, a), np.sum(a*a, axis=-1), + err_msg=msg) + msg = "little endian" + a = np.arange(6, dtype='()' + a = np.arange(27.).reshape((3, 3, 3)) + b = np.arange(10., 19.).reshape((3, 1, 3)) + # basic tests on inputs (outputs tested below with matrix_multiply). + c = np.vecdot(a, b) + assert_array_equal(c, (a * b).sum(-1)) + # default + c = np.vecdot(a, b, axes=[(-1,), (-1,), ()]) + assert_array_equal(c, (a * b).sum(-1)) + # integers ok for single axis. + c = np.vecdot(a, b, axes=[-1, -1, ()]) + assert_array_equal(c, (a * b).sum(-1)) + # mix fine + c = np.vecdot(a, b, axes=[(-1,), -1, ()]) + assert_array_equal(c, (a * b).sum(-1)) + # can omit last axis. + c = np.vecdot(a, b, axes=[-1, -1]) + assert_array_equal(c, (a * b).sum(-1)) + # can pass in other types of integer (with __index__ protocol) + c = np.vecdot(a, b, axes=[np.int8(-1), np.array(-1, dtype=np.int32)]) + assert_array_equal(c, (a * b).sum(-1)) + # swap some axes + c = np.vecdot(a, b, axes=[0, 0]) + assert_array_equal(c, (a * b).sum(0)) + c = np.vecdot(a, b, axes=[0, 2]) + assert_array_equal(c, (a.transpose(1, 2, 0) * b).sum(-1)) + # Check errors for improperly constructed axes arguments. + # should have list. + assert_raises(TypeError, np.vecdot, a, b, axes=-1) + # needs enough elements + assert_raises(ValueError, np.vecdot, a, b, axes=[-1]) + # should pass in indices. + assert_raises(TypeError, np.vecdot, a, b, axes=[-1.0, -1.0]) + assert_raises(TypeError, np.vecdot, a, b, axes=[(-1.0,), -1]) + assert_raises(TypeError, np.vecdot, a, b, axes=[None, 1]) + # cannot pass an index unless there is only one dimension + # (output is wrong in this case) + assert_raises(AxisError, np.vecdot, a, b, axes=[-1, -1, -1]) + # or pass in generally the wrong number of axes + assert_raises(AxisError, np.vecdot, a, b, axes=[-1, -1, (-1,)]) + assert_raises(AxisError, np.vecdot, a, b, axes=[-1, (-2, -1), ()]) + # axes need to have same length. + assert_raises(ValueError, np.vecdot, a, b, axes=[0, 1]) + + # matrix_multiply signature: '(m,n),(n,p)->(m,p)' + mm = umt.matrix_multiply + a = np.arange(12).reshape((2, 3, 2)) + b = np.arange(8).reshape((2, 2, 2, 1)) + 1 + # Sanity check. + c = mm(a, b) + assert_array_equal(c, np.matmul(a, b)) + # Default axes. + c = mm(a, b, axes=[(-2, -1), (-2, -1), (-2, -1)]) + assert_array_equal(c, np.matmul(a, b)) + # Default with explicit axes. + c = mm(a, b, axes=[(1, 2), (2, 3), (2, 3)]) + assert_array_equal(c, np.matmul(a, b)) + # swap some axes. + c = mm(a, b, axes=[(0, -1), (1, 2), (-2, -1)]) + assert_array_equal(c, np.matmul(a.transpose(1, 0, 2), + b.transpose(0, 3, 1, 2))) + # Default with output array. + c = np.empty((2, 2, 3, 1)) + d = mm(a, b, out=c, axes=[(1, 2), (2, 3), (2, 3)]) + assert_(c is d) + assert_array_equal(c, np.matmul(a, b)) + # Transposed output array + c = np.empty((1, 2, 2, 3)) + d = mm(a, b, out=c, axes=[(-2, -1), (-2, -1), (3, 0)]) + assert_(c is d) + assert_array_equal(c, np.matmul(a, b).transpose(3, 0, 1, 2)) + # Check errors for improperly constructed axes arguments. + # wrong argument + assert_raises(TypeError, mm, a, b, axis=1) + # axes should be list + assert_raises(TypeError, mm, a, b, axes=1) + assert_raises(TypeError, mm, a, b, axes=((-2, -1), (-2, -1), (-2, -1))) + # list needs to have right length + assert_raises(ValueError, mm, a, b, axes=[]) + assert_raises(ValueError, mm, a, b, axes=[(-2, -1)]) + # list should not contain None, or lists + assert_raises(TypeError, mm, a, b, axes=[None, None, None]) + assert_raises(TypeError, + mm, a, b, axes=[[-2, -1], [-2, -1], [-2, -1]]) + assert_raises(TypeError, + mm, a, b, axes=[(-2, -1), (-2, -1), [-2, -1]]) + assert_raises(TypeError, mm, a, b, axes=[(-2, -1), (-2, -1), None]) + # single integers are AxisErrors if more are required + assert_raises(AxisError, mm, a, b, axes=[-1, -1, -1]) + assert_raises(AxisError, mm, a, b, axes=[(-2, -1), (-2, -1), -1]) + # tuples should not have duplicated values + assert_raises(ValueError, mm, a, b, axes=[(-2, -1), (-2, -1), (-2, -2)]) + # arrays should have enough axes. + z = np.zeros((2, 2)) + assert_raises(ValueError, mm, z, z[0]) + assert_raises(ValueError, mm, z, z, out=z[:, 0]) + assert_raises(ValueError, mm, z[1], z, axes=[0, 1]) + assert_raises(ValueError, mm, z, z, out=z[0], axes=[0, 1]) + # Regular ufuncs should not accept axes. + assert_raises(TypeError, np.add, 1., 1., axes=[0]) + # should be able to deal with bad unrelated kwargs. + assert_raises(TypeError, mm, z, z, axes=[0, 1], parrot=True) + + def test_axis_argument(self): + # vecdot signature: '(n),(n)->()' + a = np.arange(27.).reshape((3, 3, 3)) + b = np.arange(10., 19.).reshape((3, 1, 3)) + c = np.vecdot(a, b) + assert_array_equal(c, (a * b).sum(-1)) + c = np.vecdot(a, b, axis=-1) + assert_array_equal(c, (a * b).sum(-1)) + out = np.zeros_like(c) + d = np.vecdot(a, b, axis=-1, out=out) + assert_(d is out) + assert_array_equal(d, c) + c = np.vecdot(a, b, axis=0) + assert_array_equal(c, (a * b).sum(0)) + # Sanity checks on innerwt and cumsum. + a = np.arange(6).reshape((2, 3)) + b = np.arange(10, 16).reshape((2, 3)) + w = np.arange(20, 26).reshape((2, 3)) + assert_array_equal(umt.innerwt(a, b, w, axis=0), + np.sum(a * b * w, axis=0)) + assert_array_equal(umt.cumsum(a, axis=0), np.cumsum(a, axis=0)) + assert_array_equal(umt.cumsum(a, axis=-1), np.cumsum(a, axis=-1)) + out = np.empty_like(a) + b = umt.cumsum(a, out=out, axis=0) + assert_(out is b) + assert_array_equal(b, np.cumsum(a, axis=0)) + b = umt.cumsum(a, out=out, axis=1) + assert_(out is b) + assert_array_equal(b, np.cumsum(a, axis=-1)) + # Check errors. + # Cannot pass in both axis and axes. + assert_raises(TypeError, np.vecdot, a, b, axis=0, axes=[0, 0]) + # Not an integer. + assert_raises(TypeError, np.vecdot, a, b, axis=[0]) + # more than 1 core dimensions. + mm = umt.matrix_multiply + assert_raises(TypeError, mm, a, b, axis=1) + # Output wrong size in axis. + out = np.empty((1, 2, 3), dtype=a.dtype) + assert_raises(ValueError, umt.cumsum, a, out=out, axis=0) + # Regular ufuncs should not accept axis. + assert_raises(TypeError, np.add, 1., 1., axis=0) + + def test_keepdims_argument(self): + # vecdot signature: '(n),(n)->()' + a = np.arange(27.).reshape((3, 3, 3)) + b = np.arange(10., 19.).reshape((3, 1, 3)) + c = np.vecdot(a, b) + assert_array_equal(c, (a * b).sum(-1)) + c = np.vecdot(a, b, keepdims=False) + assert_array_equal(c, (a * b).sum(-1)) + c = np.vecdot(a, b, keepdims=True) + assert_array_equal(c, (a * b).sum(-1, keepdims=True)) + out = np.zeros_like(c) + d = np.vecdot(a, b, keepdims=True, out=out) + assert_(d is out) + assert_array_equal(d, c) + # Now combined with axis and axes. + c = np.vecdot(a, b, axis=-1, keepdims=False) + assert_array_equal(c, (a * b).sum(-1, keepdims=False)) + c = np.vecdot(a, b, axis=-1, keepdims=True) + assert_array_equal(c, (a * b).sum(-1, keepdims=True)) + c = np.vecdot(a, b, axis=0, keepdims=False) + assert_array_equal(c, (a * b).sum(0, keepdims=False)) + c = np.vecdot(a, b, axis=0, keepdims=True) + assert_array_equal(c, (a * b).sum(0, keepdims=True)) + c = np.vecdot(a, b, axes=[(-1,), (-1,), ()], keepdims=False) + assert_array_equal(c, (a * b).sum(-1)) + c = np.vecdot(a, b, axes=[(-1,), (-1,), (-1,)], keepdims=True) + assert_array_equal(c, (a * b).sum(-1, keepdims=True)) + c = np.vecdot(a, b, axes=[0, 0], keepdims=False) + assert_array_equal(c, (a * b).sum(0)) + c = np.vecdot(a, b, axes=[0, 0, 0], keepdims=True) + assert_array_equal(c, (a * b).sum(0, keepdims=True)) + c = np.vecdot(a, b, axes=[0, 2], keepdims=False) + assert_array_equal(c, (a.transpose(1, 2, 0) * b).sum(-1)) + c = np.vecdot(a, b, axes=[0, 2], keepdims=True) + assert_array_equal(c, (a.transpose(1, 2, 0) * b).sum(-1, + keepdims=True)) + c = np.vecdot(a, b, axes=[0, 2, 2], keepdims=True) + assert_array_equal(c, (a.transpose(1, 2, 0) * b).sum(-1, + keepdims=True)) + c = np.vecdot(a, b, axes=[0, 2, 0], keepdims=True) + assert_array_equal(c, (a * b.transpose(2, 0, 1)).sum(0, keepdims=True)) + # Hardly useful, but should work. + c = np.vecdot(a, b, axes=[0, 2, 1], keepdims=True) + assert_array_equal(c, (a.transpose(1, 0, 2) * b.transpose(0, 2, 1)) + .sum(1, keepdims=True)) + # Check with two core dimensions. + a = np.eye(3) * np.arange(4.)[:, np.newaxis, np.newaxis] + expected = uml.det(a) + c = uml.det(a, keepdims=False) + assert_array_equal(c, expected) + c = uml.det(a, keepdims=True) + assert_array_equal(c, expected[:, np.newaxis, np.newaxis]) + a = np.eye(3) * np.arange(4.)[:, np.newaxis, np.newaxis] + expected_s, expected_l = uml.slogdet(a) + cs, cl = uml.slogdet(a, keepdims=False) + assert_array_equal(cs, expected_s) + assert_array_equal(cl, expected_l) + cs, cl = uml.slogdet(a, keepdims=True) + assert_array_equal(cs, expected_s[:, np.newaxis, np.newaxis]) + assert_array_equal(cl, expected_l[:, np.newaxis, np.newaxis]) + # Sanity check on innerwt. + a = np.arange(6).reshape((2, 3)) + b = np.arange(10, 16).reshape((2, 3)) + w = np.arange(20, 26).reshape((2, 3)) + assert_array_equal(umt.innerwt(a, b, w, keepdims=True), + np.sum(a * b * w, axis=-1, keepdims=True)) + assert_array_equal(umt.innerwt(a, b, w, axis=0, keepdims=True), + np.sum(a * b * w, axis=0, keepdims=True)) + # Check errors. + # Not a boolean + assert_raises(TypeError, np.vecdot, a, b, keepdims='true') + # More than 1 core dimension, and core output dimensions. + mm = umt.matrix_multiply + assert_raises(TypeError, mm, a, b, keepdims=True) + assert_raises(TypeError, mm, a, b, keepdims=False) + # Regular ufuncs should not accept keepdims. + assert_raises(TypeError, np.add, 1., 1., keepdims=False) + + def test_innerwt(self): + a = np.arange(6).reshape((2, 3)) + b = np.arange(10, 16).reshape((2, 3)) + w = np.arange(20, 26).reshape((2, 3)) + assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) + a = np.arange(100, 124).reshape((2, 3, 4)) + b = np.arange(200, 224).reshape((2, 3, 4)) + w = np.arange(300, 324).reshape((2, 3, 4)) + assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) + + def test_innerwt_empty(self): + """Test generalized ufunc with zero-sized operands""" + a = np.array([], dtype='f8') + b = np.array([], dtype='f8') + w = np.array([], dtype='f8') + assert_array_equal(umt.innerwt(a, b, w), np.sum(a*b*w, axis=-1)) + + def test_cross1d(self): + """Test with fixed-sized signature.""" + a = np.eye(3) + assert_array_equal(umt.cross1d(a, a), np.zeros((3, 3))) + out = np.zeros((3, 3)) + result = umt.cross1d(a[0], a, out) + assert_(result is out) + assert_array_equal(result, np.vstack((np.zeros(3), a[2], -a[1]))) + assert_raises(ValueError, umt.cross1d, np.eye(4), np.eye(4)) + assert_raises(ValueError, umt.cross1d, a, np.arange(4.)) + # Wrong output core dimension. + assert_raises(ValueError, umt.cross1d, a, np.arange(3.), np.zeros((3, 4))) + # Wrong output broadcast dimension (see gh-15139). + assert_raises(ValueError, umt.cross1d, a, np.arange(3.), np.zeros(3)) + + def test_can_ignore_signature(self): + # Comparing the effects of ? in signature: + # matrix_multiply: (m,n),(n,p)->(m,p) # all must be there. + # matmul: (m?,n),(n,p?)->(m?,p?) # allow missing m, p. + mat = np.arange(12).reshape((2, 3, 2)) + single_vec = np.arange(2) + col_vec = single_vec[:, np.newaxis] + col_vec_array = np.arange(8).reshape((2, 2, 2, 1)) + 1 + # matrix @ single column vector with proper dimension + mm_col_vec = umt.matrix_multiply(mat, col_vec) + # matmul does the same thing + matmul_col_vec = umt.matmul(mat, col_vec) + assert_array_equal(matmul_col_vec, mm_col_vec) + # matrix @ vector without dimension making it a column vector. + # matrix multiply fails -> missing core dim. + assert_raises(ValueError, umt.matrix_multiply, mat, single_vec) + # matmul mimicker passes, and returns a vector. + matmul_col = umt.matmul(mat, single_vec) + assert_array_equal(matmul_col, mm_col_vec.squeeze()) + # Now with a column array: same as for column vector, + # broadcasting sensibly. + mm_col_vec = umt.matrix_multiply(mat, col_vec_array) + matmul_col_vec = umt.matmul(mat, col_vec_array) + assert_array_equal(matmul_col_vec, mm_col_vec) + # As above, but for row vector + single_vec = np.arange(3) + row_vec = single_vec[np.newaxis, :] + row_vec_array = np.arange(24).reshape((4, 2, 1, 1, 3)) + 1 + # row vector @ matrix + mm_row_vec = umt.matrix_multiply(row_vec, mat) + matmul_row_vec = umt.matmul(row_vec, mat) + assert_array_equal(matmul_row_vec, mm_row_vec) + # single row vector @ matrix + assert_raises(ValueError, umt.matrix_multiply, single_vec, mat) + matmul_row = umt.matmul(single_vec, mat) + assert_array_equal(matmul_row, mm_row_vec.squeeze()) + # row vector array @ matrix + mm_row_vec = umt.matrix_multiply(row_vec_array, mat) + matmul_row_vec = umt.matmul(row_vec_array, mat) + assert_array_equal(matmul_row_vec, mm_row_vec) + # Now for vector combinations + # row vector @ column vector + col_vec = row_vec.T + col_vec_array = row_vec_array.swapaxes(-2, -1) + mm_row_col_vec = umt.matrix_multiply(row_vec, col_vec) + matmul_row_col_vec = umt.matmul(row_vec, col_vec) + assert_array_equal(matmul_row_col_vec, mm_row_col_vec) + # single row vector @ single col vector + assert_raises(ValueError, umt.matrix_multiply, single_vec, single_vec) + matmul_row_col = umt.matmul(single_vec, single_vec) + assert_array_equal(matmul_row_col, mm_row_col_vec.squeeze()) + # row vector array @ matrix + mm_row_col_array = umt.matrix_multiply(row_vec_array, col_vec_array) + matmul_row_col_array = umt.matmul(row_vec_array, col_vec_array) + assert_array_equal(matmul_row_col_array, mm_row_col_array) + # Finally, check that things are *not* squeezed if one gives an + # output. + out = np.zeros_like(mm_row_col_array) + out = umt.matrix_multiply(row_vec_array, col_vec_array, out=out) + assert_array_equal(out, mm_row_col_array) + out[:] = 0 + out = umt.matmul(row_vec_array, col_vec_array, out=out) + assert_array_equal(out, mm_row_col_array) + # And check one cannot put missing dimensions back. + out = np.zeros_like(mm_row_col_vec) + assert_raises(ValueError, umt.matrix_multiply, single_vec, single_vec, + out) + # But fine for matmul, since it is just a broadcast. + out = umt.matmul(single_vec, single_vec, out) + assert_array_equal(out, mm_row_col_vec.squeeze()) + + def test_matrix_multiply(self): + self.compare_matrix_multiply_results(np.int64) + self.compare_matrix_multiply_results(np.double) + + def test_matrix_multiply_umath_empty(self): + res = umt.matrix_multiply(np.ones((0, 10)), np.ones((10, 0))) + assert_array_equal(res, np.zeros((0, 0))) + res = umt.matrix_multiply(np.ones((10, 0)), np.ones((0, 10))) + assert_array_equal(res, np.zeros((10, 10))) + + def compare_matrix_multiply_results(self, tp): + d1 = np.array(np.random.rand(2, 3, 4), dtype=tp) + d2 = np.array(np.random.rand(2, 3, 4), dtype=tp) + msg = "matrix multiply on type %s" % d1.dtype.name + + def permute_n(n): + if n == 1: + return ([0],) + ret = () + base = permute_n(n-1) + for perm in base: + for i in range(n): + new = perm + [n-1] + new[n-1] = new[i] + new[i] = n-1 + ret += (new,) + return ret + + def slice_n(n): + if n == 0: + return ((),) + ret = () + base = slice_n(n-1) + for sl in base: + ret += (sl+(slice(None),),) + ret += (sl+(slice(0, 1),),) + return ret + + def broadcastable(s1, s2): + return s1 == s2 or s1 == 1 or s2 == 1 + + permute_3 = permute_n(3) + slice_3 = slice_n(3) + ((slice(None, None, -1),)*3,) + + ref = True + for p1 in permute_3: + for p2 in permute_3: + for s1 in slice_3: + for s2 in slice_3: + a1 = d1.transpose(p1)[s1] + a2 = d2.transpose(p2)[s2] + ref = ref and a1.base is not None + ref = ref and a2.base is not None + if (a1.shape[-1] == a2.shape[-2] and + broadcastable(a1.shape[0], a2.shape[0])): + assert_array_almost_equal( + umt.matrix_multiply(a1, a2), + np.sum(a2[..., np.newaxis].swapaxes(-3, -1) * + a1[..., np.newaxis,:], axis=-1), + err_msg=msg + ' %s %s' % (str(a1.shape), + str(a2.shape))) + + assert_equal(ref, True, err_msg="reference check") + + def test_euclidean_pdist(self): + a = np.arange(12, dtype=float).reshape(4, 3) + out = np.empty((a.shape[0] * (a.shape[0] - 1) // 2,), dtype=a.dtype) + umt.euclidean_pdist(a, out) + b = np.sqrt(np.sum((a[:, None] - a)**2, axis=-1)) + b = b[~np.tri(a.shape[0], dtype=bool)] + assert_almost_equal(out, b) + # An output array is required to determine p with signature (n,d)->(p) + assert_raises(ValueError, umt.euclidean_pdist, a) + + def test_cumsum(self): + a = np.arange(10) + result = umt.cumsum(a) + assert_array_equal(result, a.cumsum()) + + def test_object_logical(self): + a = np.array([3, None, True, False, "test", ""], dtype=object) + assert_equal(np.logical_or(a, None), + np.array([x or None for x in a], dtype=object)) + assert_equal(np.logical_or(a, True), + np.array([x or True for x in a], dtype=object)) + assert_equal(np.logical_or(a, 12), + np.array([x or 12 for x in a], dtype=object)) + assert_equal(np.logical_or(a, "blah"), + np.array([x or "blah" for x in a], dtype=object)) + + assert_equal(np.logical_and(a, None), + np.array([x and None for x in a], dtype=object)) + assert_equal(np.logical_and(a, True), + np.array([x and True for x in a], dtype=object)) + assert_equal(np.logical_and(a, 12), + np.array([x and 12 for x in a], dtype=object)) + assert_equal(np.logical_and(a, "blah"), + np.array([x and "blah" for x in a], dtype=object)) + + assert_equal(np.logical_not(a), + np.array([not x for x in a], dtype=object)) + + assert_equal(np.logical_or.reduce(a), 3) + assert_equal(np.logical_and.reduce(a), None) + + def test_object_comparison(self): + class HasComparisons: + def __eq__(self, other): + return '==' + + arr0d = np.array(HasComparisons()) + assert_equal(arr0d == arr0d, True) + assert_equal(np.equal(arr0d, arr0d), True) # normal behavior is a cast + + arr1d = np.array([HasComparisons()]) + assert_equal(arr1d == arr1d, np.array([True])) + assert_equal(np.equal(arr1d, arr1d), np.array([True])) # normal behavior is a cast + assert_equal(np.equal(arr1d, arr1d, dtype=object), np.array(['=='])) + + def test_object_array_reduction(self): + # Reductions on object arrays + a = np.array(['a', 'b', 'c'], dtype=object) + assert_equal(np.sum(a), 'abc') + assert_equal(np.max(a), 'c') + assert_equal(np.min(a), 'a') + a = np.array([True, False, True], dtype=object) + assert_equal(np.sum(a), 2) + assert_equal(np.prod(a), 0) + assert_equal(np.any(a), True) + assert_equal(np.all(a), False) + assert_equal(np.max(a), True) + assert_equal(np.min(a), False) + assert_equal(np.array([[1]], dtype=object).sum(), 1) + assert_equal(np.array([[[1, 2]]], dtype=object).sum((0, 1)), [1, 2]) + assert_equal(np.array([1], dtype=object).sum(initial=1), 2) + assert_equal(np.array([[1], [2, 3]], dtype=object) + .sum(initial=[0], where=[False, True]), [0, 2, 3]) + + def test_object_array_accumulate_inplace(self): + # Checks that in-place accumulates work, see also gh-7402 + arr = np.ones(4, dtype=object) + arr[:] = [[1] for i in range(4)] + # Twice reproduced also for tuples: + np.add.accumulate(arr, out=arr) + np.add.accumulate(arr, out=arr) + assert_array_equal(arr, + np.array([[1]*i for i in [1, 3, 6, 10]], dtype=object), + ) + + # And the same if the axis argument is used + arr = np.ones((2, 4), dtype=object) + arr[0, :] = [[2] for i in range(4)] + np.add.accumulate(arr, out=arr, axis=-1) + np.add.accumulate(arr, out=arr, axis=-1) + assert_array_equal(arr[0, :], + np.array([[2]*i for i in [1, 3, 6, 10]], dtype=object), + ) + + def test_object_array_accumulate_failure(self): + # Typical accumulation on object works as expected: + res = np.add.accumulate(np.array([1, 0, 2], dtype=object)) + assert_array_equal(res, np.array([1, 1, 3], dtype=object)) + # But errors are propagated from the inner-loop if they occur: + with pytest.raises(TypeError): + np.add.accumulate([1, None, 2]) + + def test_object_array_reduceat_inplace(self): + # Checks that in-place reduceats work, see also gh-7465 + arr = np.empty(4, dtype=object) + arr[:] = [[1] for i in range(4)] + out = np.empty(4, dtype=object) + out[:] = [[1] for i in range(4)] + np.add.reduceat(arr, np.arange(4), out=arr) + np.add.reduceat(arr, np.arange(4), out=arr) + assert_array_equal(arr, out) + + # And the same if the axis argument is used + arr = np.ones((2, 4), dtype=object) + arr[0, :] = [[2] for i in range(4)] + out = np.ones((2, 4), dtype=object) + out[0, :] = [[2] for i in range(4)] + np.add.reduceat(arr, np.arange(4), out=arr, axis=-1) + np.add.reduceat(arr, np.arange(4), out=arr, axis=-1) + assert_array_equal(arr, out) + + def test_object_array_reduceat_failure(self): + # Reduceat works as expected when no invalid operation occurs (None is + # not involved in an operation here) + res = np.add.reduceat(np.array([1, None, 2], dtype=object), [1, 2]) + assert_array_equal(res, np.array([None, 2], dtype=object)) + # But errors when None would be involved in an operation: + with pytest.raises(TypeError): + np.add.reduceat([1, None, 2], [0, 2]) + + def test_zerosize_reduction(self): + # Test with default dtype and object dtype + for a in [[], np.array([], dtype=object)]: + assert_equal(np.sum(a), 0) + assert_equal(np.prod(a), 1) + assert_equal(np.any(a), False) + assert_equal(np.all(a), True) + assert_raises(ValueError, np.max, a) + assert_raises(ValueError, np.min, a) + + def test_axis_out_of_bounds(self): + a = np.array([False, False]) + assert_raises(AxisError, a.all, axis=1) + a = np.array([False, False]) + assert_raises(AxisError, a.all, axis=-2) + + a = np.array([False, False]) + assert_raises(AxisError, a.any, axis=1) + a = np.array([False, False]) + assert_raises(AxisError, a.any, axis=-2) + + def test_scalar_reduction(self): + # The functions 'sum', 'prod', etc allow specifying axis=0 + # even for scalars + assert_equal(np.sum(3, axis=0), 3) + assert_equal(np.prod(3.5, axis=0), 3.5) + assert_equal(np.any(True, axis=0), True) + assert_equal(np.all(False, axis=0), False) + assert_equal(np.max(3, axis=0), 3) + assert_equal(np.min(2.5, axis=0), 2.5) + + # Check scalar behaviour for ufuncs without an identity + assert_equal(np.power.reduce(3), 3) + + # Make sure that scalars are coming out from this operation + assert_(type(np.prod(np.float32(2.5), axis=0)) is np.float32) + assert_(type(np.sum(np.float32(2.5), axis=0)) is np.float32) + assert_(type(np.max(np.float32(2.5), axis=0)) is np.float32) + assert_(type(np.min(np.float32(2.5), axis=0)) is np.float32) + + # check if scalars/0-d arrays get cast + assert_(type(np.any(0, axis=0)) is np.bool) + + # assert that 0-d arrays get wrapped + class MyArray(np.ndarray): + pass + a = np.array(1).view(MyArray) + assert_(type(np.any(a)) is MyArray) + + def test_casting_out_param(self): + # Test that it's possible to do casts on output + a = np.ones((200, 100), np.int64) + b = np.ones((200, 100), np.int64) + c = np.ones((200, 100), np.float64) + np.add(a, b, out=c) + assert_equal(c, 2) + + a = np.zeros(65536) + b = np.zeros(65536, dtype=np.float32) + np.subtract(a, 0, out=b) + assert_equal(b, 0) + + def test_where_param(self): + # Test that the where= ufunc parameter works with regular arrays + a = np.arange(7) + b = np.ones(7) + c = np.zeros(7) + np.add(a, b, out=c, where=(a % 2 == 1)) + assert_equal(c, [0, 2, 0, 4, 0, 6, 0]) + + a = np.arange(4).reshape(2, 2) + 2 + np.power(a, [2, 3], out=a, where=[[0, 1], [1, 0]]) + assert_equal(a, [[2, 27], [16, 5]]) + # Broadcasting the where= parameter + np.subtract(a, 2, out=a, where=[True, False]) + assert_equal(a, [[0, 27], [14, 5]]) + + def test_where_param_buffer_output(self): + # This test is temporarily skipped because it requires + # adding masking features to the nditer to work properly + + # With casting on output + a = np.ones(10, np.int64) + b = np.ones(10, np.int64) + c = 1.5 * np.ones(10, np.float64) + np.add(a, b, out=c, where=[1, 0, 0, 1, 0, 0, 1, 1, 1, 0]) + assert_equal(c, [2, 1.5, 1.5, 2, 1.5, 1.5, 2, 2, 2, 1.5]) + + def test_where_param_alloc(self): + # With casting and allocated output + a = np.array([1], dtype=np.int64) + m = np.array([True], dtype=bool) + assert_equal(np.sqrt(a, where=m), [1]) + + # No casting and allocated output + a = np.array([1], dtype=np.float64) + m = np.array([True], dtype=bool) + assert_equal(np.sqrt(a, where=m), [1]) + + def test_where_with_broadcasting(self): + # See gh-17198 + a = np.random.random((5000, 4)) + b = np.random.random((5000, 1)) + + where = a > 0.3 + out = np.full_like(a, 0) + np.less(a, b, where=where, out=out) + b_where = np.broadcast_to(b, a.shape)[where] + assert_array_equal((a[where] < b_where), out[where].astype(bool)) + assert not out[~where].any() # outside mask, out remains all 0 + + def check_identityless_reduction(self, a): + # np.minimum.reduce is an identityless reduction + + # Verify that it sees the zero at various positions + a[...] = 1 + a[1, 0, 0] = 0 + assert_equal(np.minimum.reduce(a, axis=None), 0) + assert_equal(np.minimum.reduce(a, axis=(0, 1)), [0, 1, 1, 1]) + assert_equal(np.minimum.reduce(a, axis=(0, 2)), [0, 1, 1]) + assert_equal(np.minimum.reduce(a, axis=(1, 2)), [1, 0]) + assert_equal(np.minimum.reduce(a, axis=0), + [[0, 1, 1, 1], [1, 1, 1, 1], [1, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=1), + [[1, 1, 1, 1], [0, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=2), + [[1, 1, 1], [0, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=()), a) + + a[...] = 1 + a[0, 1, 0] = 0 + assert_equal(np.minimum.reduce(a, axis=None), 0) + assert_equal(np.minimum.reduce(a, axis=(0, 1)), [0, 1, 1, 1]) + assert_equal(np.minimum.reduce(a, axis=(0, 2)), [1, 0, 1]) + assert_equal(np.minimum.reduce(a, axis=(1, 2)), [0, 1]) + assert_equal(np.minimum.reduce(a, axis=0), + [[1, 1, 1, 1], [0, 1, 1, 1], [1, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=1), + [[0, 1, 1, 1], [1, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=2), + [[1, 0, 1], [1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=()), a) + + a[...] = 1 + a[0, 0, 1] = 0 + assert_equal(np.minimum.reduce(a, axis=None), 0) + assert_equal(np.minimum.reduce(a, axis=(0, 1)), [1, 0, 1, 1]) + assert_equal(np.minimum.reduce(a, axis=(0, 2)), [0, 1, 1]) + assert_equal(np.minimum.reduce(a, axis=(1, 2)), [0, 1]) + assert_equal(np.minimum.reduce(a, axis=0), + [[1, 0, 1, 1], [1, 1, 1, 1], [1, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=1), + [[1, 0, 1, 1], [1, 1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=2), + [[0, 1, 1], [1, 1, 1]]) + assert_equal(np.minimum.reduce(a, axis=()), a) + + @requires_memory(6 * 1024**3) + @pytest.mark.skipif(sys.maxsize < 2**32, + reason="test array too large for 32bit platform") + def test_identityless_reduction_huge_array(self): + # Regression test for gh-20921 (copying identity incorrectly failed) + arr = np.zeros((2, 2**31), 'uint8') + arr[:, 0] = [1, 3] + arr[:, -1] = [4, 1] + res = np.maximum.reduce(arr, axis=0) + del arr + assert res[0] == 3 + assert res[-1] == 4 + + def test_identityless_reduction_corder(self): + a = np.empty((2, 3, 4), order='C') + self.check_identityless_reduction(a) + + def test_identityless_reduction_forder(self): + a = np.empty((2, 3, 4), order='F') + self.check_identityless_reduction(a) + + def test_identityless_reduction_otherorder(self): + a = np.empty((2, 4, 3), order='C').swapaxes(1, 2) + self.check_identityless_reduction(a) + + def test_identityless_reduction_noncontig(self): + a = np.empty((3, 5, 4), order='C').swapaxes(1, 2) + a = a[1:, 1:, 1:] + self.check_identityless_reduction(a) + + def test_identityless_reduction_noncontig_unaligned(self): + a = np.empty((3*4*5*8 + 1,), dtype='i1') + a = a[1:].view(dtype='f8') + a.shape = (3, 4, 5) + a = a[1:, 1:, 1:] + self.check_identityless_reduction(a) + + def test_reduce_identity_depends_on_loop(self): + """ + The type of the result should always depend on the selected loop, not + necessarily the output (only relevant for object arrays). + """ + # For an object loop, the default value 0 with type int is used: + assert type(np.add.reduce([], dtype=object)) is int + out = np.array(None, dtype=object) + # When the loop is float64 but `out` is object this does not happen, + # the result is float64 cast to object (which gives Python `float`). + np.add.reduce([], out=out, dtype=np.float64) + assert type(out[()]) is float + + def test_initial_reduction(self): + # np.minimum.reduce is an identityless reduction + + # For cases like np.maximum(np.abs(...), initial=0) + # More generally, a supremum over non-negative numbers. + assert_equal(np.maximum.reduce([], initial=0), 0) + + # For cases like reduction of an empty array over the reals. + assert_equal(np.minimum.reduce([], initial=np.inf), np.inf) + assert_equal(np.maximum.reduce([], initial=-np.inf), -np.inf) + + # Random tests + assert_equal(np.minimum.reduce([5], initial=4), 4) + assert_equal(np.maximum.reduce([4], initial=5), 5) + assert_equal(np.maximum.reduce([5], initial=4), 5) + assert_equal(np.minimum.reduce([4], initial=5), 4) + + # Check initial=None raises ValueError for both types of ufunc reductions + assert_raises(ValueError, np.minimum.reduce, [], initial=None) + assert_raises(ValueError, np.add.reduce, [], initial=None) + # Also in the somewhat special object case: + with pytest.raises(ValueError): + np.add.reduce([], initial=None, dtype=object) + + # Check that np._NoValue gives default behavior. + assert_equal(np.add.reduce([], initial=np._NoValue), 0) + + # Check that initial kwarg behaves as intended for dtype=object + a = np.array([10], dtype=object) + res = np.add.reduce(a, initial=5) + assert_equal(res, 15) + + def test_empty_reduction_and_identity(self): + arr = np.zeros((0, 5)) + # OK, since the reduction itself is *not* empty, the result is + assert np.true_divide.reduce(arr, axis=1).shape == (0,) + # Not OK, the reduction itself is empty and we have no identity + with pytest.raises(ValueError): + np.true_divide.reduce(arr, axis=0) + + # Test that an empty reduction fails also if the result is empty + arr = np.zeros((0, 0, 5)) + with pytest.raises(ValueError): + np.true_divide.reduce(arr, axis=1) + + # Division reduction makes sense with `initial=1` (empty or not): + res = np.true_divide.reduce(arr, axis=1, initial=1) + assert_array_equal(res, np.ones((0, 5))) + + @pytest.mark.parametrize('axis', (0, 1, None)) + @pytest.mark.parametrize('where', (np.array([False, True, True]), + np.array([[True], [False], [True]]), + np.array([[True, False, False], + [False, True, False], + [False, True, True]]))) + def test_reduction_with_where(self, axis, where): + a = np.arange(9.).reshape(3, 3) + a_copy = a.copy() + a_check = np.zeros_like(a) + np.positive(a, out=a_check, where=where) + + res = np.add.reduce(a, axis=axis, where=where) + check = a_check.sum(axis) + assert_equal(res, check) + # Check we do not overwrite elements of a internally. + assert_array_equal(a, a_copy) + + @pytest.mark.parametrize(('axis', 'where'), + ((0, np.array([True, False, True])), + (1, [True, True, False]), + (None, True))) + @pytest.mark.parametrize('initial', (-np.inf, 5.)) + def test_reduction_with_where_and_initial(self, axis, where, initial): + a = np.arange(9.).reshape(3, 3) + a_copy = a.copy() + a_check = np.full(a.shape, -np.inf) + np.positive(a, out=a_check, where=where) + + res = np.maximum.reduce(a, axis=axis, where=where, initial=initial) + check = a_check.max(axis, initial=initial) + assert_equal(res, check) + + def test_reduction_where_initial_needed(self): + a = np.arange(9.).reshape(3, 3) + m = [False, True, False] + assert_raises(ValueError, np.maximum.reduce, a, where=m) + + def test_identityless_reduction_nonreorderable(self): + a = np.array([[8.0, 2.0, 2.0], [1.0, 0.5, 0.25]]) + + res = np.divide.reduce(a, axis=0) + assert_equal(res, [8.0, 4.0, 8.0]) + + res = np.divide.reduce(a, axis=1) + assert_equal(res, [2.0, 8.0]) + + res = np.divide.reduce(a, axis=()) + assert_equal(res, a) + + assert_raises(ValueError, np.divide.reduce, a, axis=(0, 1)) + + def test_reduce_zero_axis(self): + # If we have a n x m array and do a reduction with axis=1, then we are + # doing n reductions, and each reduction takes an m-element array. For + # a reduction operation without an identity, then: + # n > 0, m > 0: fine + # n = 0, m > 0: fine, doing 0 reductions of m-element arrays + # n > 0, m = 0: can't reduce a 0-element array, ValueError + # n = 0, m = 0: can't reduce a 0-element array, ValueError (for + # consistency with the above case) + # This test doesn't actually look at return values, it just checks to + # make sure that error we get an error in exactly those cases where we + # expect one, and assumes the calculations themselves are done + # correctly. + + def ok(f, *args, **kwargs): + f(*args, **kwargs) + + def err(f, *args, **kwargs): + assert_raises(ValueError, f, *args, **kwargs) + + def t(expect, func, n, m): + expect(func, np.zeros((n, m)), axis=1) + expect(func, np.zeros((m, n)), axis=0) + expect(func, np.zeros((n // 2, n // 2, m)), axis=2) + expect(func, np.zeros((n // 2, m, n // 2)), axis=1) + expect(func, np.zeros((n, m // 2, m // 2)), axis=(1, 2)) + expect(func, np.zeros((m // 2, n, m // 2)), axis=(0, 2)) + expect(func, np.zeros((m // 3, m // 3, m // 3, + n // 2, n // 2)), + axis=(0, 1, 2)) + # Check what happens if the inner (resp. outer) dimensions are a + # mix of zero and non-zero: + expect(func, np.zeros((10, m, n)), axis=(0, 1)) + expect(func, np.zeros((10, n, m)), axis=(0, 2)) + expect(func, np.zeros((m, 10, n)), axis=0) + expect(func, np.zeros((10, m, n)), axis=1) + expect(func, np.zeros((10, n, m)), axis=2) + + # np.maximum is just an arbitrary ufunc with no reduction identity + assert_equal(np.maximum.identity, None) + t(ok, np.maximum.reduce, 30, 30) + t(ok, np.maximum.reduce, 0, 30) + t(err, np.maximum.reduce, 30, 0) + t(err, np.maximum.reduce, 0, 0) + err(np.maximum.reduce, []) + np.maximum.reduce(np.zeros((0, 0)), axis=()) + + # all of the combinations are fine for a reduction that has an + # identity + t(ok, np.add.reduce, 30, 30) + t(ok, np.add.reduce, 0, 30) + t(ok, np.add.reduce, 30, 0) + t(ok, np.add.reduce, 0, 0) + np.add.reduce([]) + np.add.reduce(np.zeros((0, 0)), axis=()) + + # OTOH, accumulate always makes sense for any combination of n and m, + # because it maps an m-element array to an m-element array. These + # tests are simpler because accumulate doesn't accept multiple axes. + for uf in (np.maximum, np.add): + uf.accumulate(np.zeros((30, 0)), axis=0) + uf.accumulate(np.zeros((0, 30)), axis=0) + uf.accumulate(np.zeros((30, 30)), axis=0) + uf.accumulate(np.zeros((0, 0)), axis=0) + + def test_safe_casting(self): + # In old versions of numpy, in-place operations used the 'unsafe' + # casting rules. In versions >= 1.10, 'same_kind' is the + # default and an exception is raised instead of a warning. + # when 'same_kind' is not satisfied. + a = np.array([1, 2, 3], dtype=int) + # Non-in-place addition is fine + assert_array_equal(assert_no_warnings(np.add, a, 1.1), + [2.1, 3.1, 4.1]) + assert_raises(TypeError, np.add, a, 1.1, out=a) + + def add_inplace(a, b): + a += b + + assert_raises(TypeError, add_inplace, a, 1.1) + # Make sure that explicitly overriding the exception is allowed: + assert_no_warnings(np.add, a, 1.1, out=a, casting="unsafe") + assert_array_equal(a, [2, 3, 4]) + + def test_ufunc_custom_out(self): + # Test ufunc with built in input types and custom output type + + a = np.array([0, 1, 2], dtype='i8') + b = np.array([0, 1, 2], dtype='i8') + c = np.empty(3, dtype=_rational_tests.rational) + + # Output must be specified so numpy knows what + # ufunc signature to look for + result = _rational_tests.test_add(a, b, c) + target = np.array([0, 2, 4], dtype=_rational_tests.rational) + assert_equal(result, target) + + # The new resolution means that we can (usually) find custom loops + # as long as they match exactly: + result = _rational_tests.test_add(a, b) + assert_equal(result, target) + + # This works even more generally, so long the default common-dtype + # promoter works out: + result = _rational_tests.test_add(a, b.astype(np.uint16), out=c) + assert_equal(result, target) + + # This scalar path used to go into legacy promotion, but doesn't now: + result = _rational_tests.test_add(a, np.uint16(2)) + target = np.array([2, 3, 4], dtype=_rational_tests.rational) + assert_equal(result, target) + + def test_operand_flags(self): + a = np.arange(16, dtype=int).reshape(4, 4) + b = np.arange(9, dtype=int).reshape(3, 3) + opflag_tests.inplace_add(a[:-1, :-1], b) + assert_equal(a, np.array([[0, 2, 4, 3], [7, 9, 11, 7], + [14, 16, 18, 11], [12, 13, 14, 15]])) + + a = np.array(0) + opflag_tests.inplace_add(a, 3) + assert_equal(a, 3) + opflag_tests.inplace_add(a, [3, 4]) + assert_equal(a, 10) + + def test_struct_ufunc(self): + import numpy._core._struct_ufunc_tests as struct_ufunc + + a = np.array([(1, 2, 3)], dtype='u8,u8,u8') + b = np.array([(1, 2, 3)], dtype='u8,u8,u8') + + result = struct_ufunc.add_triplet(a, b) + assert_equal(result, np.array([(2, 4, 6)], dtype='u8,u8,u8')) + assert_raises(RuntimeError, struct_ufunc.register_fail) + + def test_custom_ufunc(self): + a = np.array( + [_rational_tests.rational(1, 2), + _rational_tests.rational(1, 3), + _rational_tests.rational(1, 4)], + dtype=_rational_tests.rational) + b = np.array( + [_rational_tests.rational(1, 2), + _rational_tests.rational(1, 3), + _rational_tests.rational(1, 4)], + dtype=_rational_tests.rational) + + result = _rational_tests.test_add_rationals(a, b) + expected = np.array( + [_rational_tests.rational(1), + _rational_tests.rational(2, 3), + _rational_tests.rational(1, 2)], + dtype=_rational_tests.rational) + assert_equal(result, expected) + + def test_custom_ufunc_forced_sig(self): + # gh-9351 - looking for a non-first userloop would previously hang + with assert_raises(TypeError): + np.multiply(_rational_tests.rational(1), 1, + signature=(_rational_tests.rational, int, None)) + + def test_custom_array_like(self): + + class MyThing: + __array_priority__ = 1000 + + rmul_count = 0 + getitem_count = 0 + + def __init__(self, shape): + self.shape = shape + + def __len__(self): + return self.shape[0] + + def __getitem__(self, i): + MyThing.getitem_count += 1 + if not isinstance(i, tuple): + i = (i,) + if len(i) > self.ndim: + raise IndexError("boo") + + return MyThing(self.shape[len(i):]) + + def __rmul__(self, other): + MyThing.rmul_count += 1 + return self + + np.float64(5)*MyThing((3, 3)) + assert_(MyThing.rmul_count == 1, MyThing.rmul_count) + assert_(MyThing.getitem_count <= 2, MyThing.getitem_count) + + @pytest.mark.parametrize("a", ( + np.arange(10, dtype=int), + np.arange(10, dtype=_rational_tests.rational), + )) + def test_ufunc_at_basic(self, a): + + aa = a.copy() + np.add.at(aa, [2, 5, 2], 1) + assert_equal(aa, [0, 1, 4, 3, 4, 6, 6, 7, 8, 9]) + + with pytest.raises(ValueError): + # missing second operand + np.add.at(aa, [2, 5, 3]) + + aa = a.copy() + np.negative.at(aa, [2, 5, 3]) + assert_equal(aa, [0, 1, -2, -3, 4, -5, 6, 7, 8, 9]) + + aa = a.copy() + b = np.array([100, 100, 100]) + np.add.at(aa, [2, 5, 2], b) + assert_equal(aa, [0, 1, 202, 3, 4, 105, 6, 7, 8, 9]) + + with pytest.raises(ValueError): + # extraneous second operand + np.negative.at(a, [2, 5, 3], [1, 2, 3]) + + with pytest.raises(ValueError): + # second operand cannot be converted to an array + np.add.at(a, [2, 5, 3], [[1, 2], 1]) + + # ufuncs with indexed loops for performance in ufunc.at + indexed_ufuncs = [np.add, np.subtract, np.multiply, np.floor_divide, + np.maximum, np.minimum, np.fmax, np.fmin] + + @pytest.mark.parametrize( + "typecode", np.typecodes['AllInteger'] + np.typecodes['Float']) + @pytest.mark.parametrize("ufunc", indexed_ufuncs) + def test_ufunc_at_inner_loops(self, typecode, ufunc): + if ufunc is np.divide and typecode in np.typecodes['AllInteger']: + # Avoid divide-by-zero and inf for integer divide + a = np.ones(100, dtype=typecode) + indx = np.random.randint(100, size=30, dtype=np.intp) + vals = np.arange(1, 31, dtype=typecode) + else: + a = np.ones(1000, dtype=typecode) + indx = np.random.randint(1000, size=3000, dtype=np.intp) + vals = np.arange(3000, dtype=typecode) + atag = a.copy() + # Do the calculation twice and compare the answers + with warnings.catch_warnings(record=True) as w_at: + warnings.simplefilter('always') + ufunc.at(a, indx, vals) + with warnings.catch_warnings(record=True) as w_loop: + warnings.simplefilter('always') + for i, v in zip(indx, vals): + # Make sure all the work happens inside the ufunc + # in order to duplicate error/warning handling + ufunc(atag[i], v, out=atag[i:i+1], casting="unsafe") + assert_equal(atag, a) + # If w_loop warned, make sure w_at warned as well + if len(w_loop) > 0: + # + assert len(w_at) > 0 + assert w_at[0].category == w_loop[0].category + assert str(w_at[0].message)[:10] == str(w_loop[0].message)[:10] + + @pytest.mark.parametrize("typecode", np.typecodes['Complex']) + @pytest.mark.parametrize("ufunc", [np.add, np.subtract, np.multiply]) + def test_ufunc_at_inner_loops_complex(self, typecode, ufunc): + a = np.ones(10, dtype=typecode) + indx = np.concatenate([np.ones(6, dtype=np.intp), + np.full(18, 4, dtype=np.intp)]) + value = a.dtype.type(1j) + ufunc.at(a, indx, value) + expected = np.ones_like(a) + if ufunc is np.multiply: + expected[1] = expected[4] = -1 + else: + expected[1] += 6 * (value if ufunc is np.add else -value) + expected[4] += 18 * (value if ufunc is np.add else -value) + + assert_array_equal(a, expected) + + def test_ufunc_at_ellipsis(self): + # Make sure the indexed loop check does not choke on iters + # with subspaces + arr = np.zeros(5) + np.add.at(arr, slice(None), np.ones(5)) + assert_array_equal(arr, np.ones(5)) + + def test_ufunc_at_negative(self): + arr = np.ones(5, dtype=np.int32) + indx = np.arange(5) + umt.indexed_negative.at(arr, indx) + # If it is [-1, -1, -1, -100, 0] then the regular strided loop was used + assert np.all(arr == [-1, -1, -1, -200, -1]) + + def test_ufunc_at_large(self): + # issue gh-23457 + indices = np.zeros(8195, dtype=np.int16) + b = np.zeros(8195, dtype=float) + b[0] = 10 + b[1] = 5 + b[8192:] = 100 + a = np.zeros(1, dtype=float) + np.add.at(a, indices, b) + assert a[0] == b.sum() + + def test_cast_index_fastpath(self): + arr = np.zeros(10) + values = np.ones(100000) + # index must be cast, which may be buffered in chunks: + index = np.zeros(len(values), dtype=np.uint8) + np.add.at(arr, index, values) + assert arr[0] == len(values) + + @pytest.mark.parametrize("value", [ + np.ones(1), np.ones(()), np.float64(1.), 1.]) + def test_ufunc_at_scalar_value_fastpath(self, value): + arr = np.zeros(1000) + # index must be cast, which may be buffered in chunks: + index = np.repeat(np.arange(1000), 2) + np.add.at(arr, index, value) + assert_array_equal(arr, np.full_like(arr, 2 * value)) + + def test_ufunc_at_multiD(self): + a = np.arange(9).reshape(3, 3) + b = np.array([[100, 100, 100], [200, 200, 200], [300, 300, 300]]) + np.add.at(a, (slice(None), [1, 2, 1]), b) + assert_equal(a, [[0, 201, 102], [3, 404, 205], [6, 607, 308]]) + + a = np.arange(27).reshape(3, 3, 3) + b = np.array([100, 200, 300]) + np.add.at(a, (slice(None), slice(None), [1, 2, 1]), b) + assert_equal(a, + [[[0, 401, 202], + [3, 404, 205], + [6, 407, 208]], + + [[9, 410, 211], + [12, 413, 214], + [15, 416, 217]], + + [[18, 419, 220], + [21, 422, 223], + [24, 425, 226]]]) + + a = np.arange(9).reshape(3, 3) + b = np.array([[100, 100, 100], [200, 200, 200], [300, 300, 300]]) + np.add.at(a, ([1, 2, 1], slice(None)), b) + assert_equal(a, [[0, 1, 2], [403, 404, 405], [206, 207, 208]]) + + a = np.arange(27).reshape(3, 3, 3) + b = np.array([100, 200, 300]) + np.add.at(a, (slice(None), [1, 2, 1], slice(None)), b) + assert_equal(a, + [[[0, 1, 2], + [203, 404, 605], + [106, 207, 308]], + + [[9, 10, 11], + [212, 413, 614], + [115, 216, 317]], + + [[18, 19, 20], + [221, 422, 623], + [124, 225, 326]]]) + + a = np.arange(9).reshape(3, 3) + b = np.array([100, 200, 300]) + np.add.at(a, (0, [1, 2, 1]), b) + assert_equal(a, [[0, 401, 202], [3, 4, 5], [6, 7, 8]]) + + a = np.arange(27).reshape(3, 3, 3) + b = np.array([100, 200, 300]) + np.add.at(a, ([1, 2, 1], 0, slice(None)), b) + assert_equal(a, + [[[0, 1, 2], + [3, 4, 5], + [6, 7, 8]], + + [[209, 410, 611], + [12, 13, 14], + [15, 16, 17]], + + [[118, 219, 320], + [21, 22, 23], + [24, 25, 26]]]) + + a = np.arange(27).reshape(3, 3, 3) + b = np.array([100, 200, 300]) + np.add.at(a, (slice(None), slice(None), slice(None)), b) + assert_equal(a, + [[[100, 201, 302], + [103, 204, 305], + [106, 207, 308]], + + [[109, 210, 311], + [112, 213, 314], + [115, 216, 317]], + + [[118, 219, 320], + [121, 222, 323], + [124, 225, 326]]]) + + def test_ufunc_at_0D(self): + a = np.array(0) + np.add.at(a, (), 1) + assert_equal(a, 1) + + assert_raises(IndexError, np.add.at, a, 0, 1) + assert_raises(IndexError, np.add.at, a, [], 1) + + def test_ufunc_at_dtypes(self): + # Test mixed dtypes + a = np.arange(10) + np.power.at(a, [1, 2, 3, 2], 3.5) + assert_equal(a, np.array([0, 1, 4414, 46, 4, 5, 6, 7, 8, 9])) + + def test_ufunc_at_boolean(self): + # Test boolean indexing and boolean ufuncs + a = np.arange(10) + index = a % 2 == 0 + np.equal.at(a, index, [0, 2, 4, 6, 8]) + assert_equal(a, [1, 1, 1, 3, 1, 5, 1, 7, 1, 9]) + + # Test unary operator + a = np.arange(10, dtype='u4') + np.invert.at(a, [2, 5, 2]) + assert_equal(a, [0, 1, 2, 3, 4, 5 ^ 0xffffffff, 6, 7, 8, 9]) + + def test_ufunc_at_advanced(self): + # Test empty subspace + orig = np.arange(4) + a = orig[:, None][:, 0:0] + np.add.at(a, [0, 1], 3) + assert_array_equal(orig, np.arange(4)) + + # Test with swapped byte order + index = np.array([1, 2, 1], np.dtype('i').newbyteorder()) + values = np.array([1, 2, 3, 4], np.dtype('f').newbyteorder()) + np.add.at(values, index, 3) + assert_array_equal(values, [1, 8, 6, 4]) + + # Test exception thrown + values = np.array(['a', 1], dtype=object) + assert_raises(TypeError, np.add.at, values, [0, 1], 1) + assert_array_equal(values, np.array(['a', 1], dtype=object)) + + # Test multiple output ufuncs raise error, gh-5665 + assert_raises(ValueError, np.modf.at, np.arange(10), [1]) + + # Test maximum + a = np.array([1, 2, 3]) + np.maximum.at(a, [0], 0) + assert_equal(a, np.array([1, 2, 3])) + + @pytest.mark.parametrize("dtype", + np.typecodes['AllInteger'] + np.typecodes['Float']) + @pytest.mark.parametrize("ufunc", + [np.add, np.subtract, np.divide, np.minimum, np.maximum]) + def test_at_negative_indexes(self, dtype, ufunc): + a = np.arange(0, 10).astype(dtype) + indxs = np.array([-1, 1, -1, 2]).astype(np.intp) + vals = np.array([1, 5, 2, 10], dtype=a.dtype) + + expected = a.copy() + for i, v in zip(indxs, vals): + expected[i] = ufunc(expected[i], v) + + ufunc.at(a, indxs, vals) + assert_array_equal(a, expected) + assert np.all(indxs == [-1, 1, -1, 2]) + + def test_at_not_none_signature(self): + # Test ufuncs with non-trivial signature raise a TypeError + a = np.ones((2, 2, 2)) + b = np.ones((1, 2, 2)) + assert_raises(TypeError, np.matmul.at, a, [0], b) + + a = np.array([[[1, 2], [3, 4]]]) + assert_raises(TypeError, np.linalg._umath_linalg.det.at, a, [0]) + + def test_at_no_loop_for_op(self): + # str dtype does not have a ufunc loop for np.add + arr = np.ones(10, dtype=str) + with pytest.raises(np._core._exceptions._UFuncNoLoopError): + np.add.at(arr, [0, 1], [0, 1]) + + def test_at_output_casting(self): + arr = np.array([-1]) + np.equal.at(arr, [0], [0]) + assert arr[0] == 0 + + def test_at_broadcast_failure(self): + arr = np.arange(5) + with pytest.raises(ValueError): + np.add.at(arr, [0, 1], [1, 2, 3]) + + + def test_reduce_arguments(self): + f = np.add.reduce + d = np.ones((5,2), dtype=int) + o = np.ones((2,), dtype=d.dtype) + r = o * 5 + assert_equal(f(d), r) + # a, axis=0, dtype=None, out=None, keepdims=False + assert_equal(f(d, axis=0), r) + assert_equal(f(d, 0), r) + assert_equal(f(d, 0, dtype=None), r) + assert_equal(f(d, 0, dtype='i'), r) + assert_equal(f(d, 0, 'i'), r) + assert_equal(f(d, 0, None), r) + assert_equal(f(d, 0, None, out=None), r) + assert_equal(f(d, 0, None, out=o), r) + assert_equal(f(d, 0, None, o), r) + assert_equal(f(d, 0, None, None), r) + assert_equal(f(d, 0, None, None, keepdims=False), r) + assert_equal(f(d, 0, None, None, True), r.reshape((1,) + r.shape)) + assert_equal(f(d, 0, None, None, False, 0), r) + assert_equal(f(d, 0, None, None, False, initial=0), r) + assert_equal(f(d, 0, None, None, False, 0, True), r) + assert_equal(f(d, 0, None, None, False, 0, where=True), r) + # multiple keywords + assert_equal(f(d, axis=0, dtype=None, out=None, keepdims=False), r) + assert_equal(f(d, 0, dtype=None, out=None, keepdims=False), r) + assert_equal(f(d, 0, None, out=None, keepdims=False), r) + assert_equal(f(d, 0, None, out=None, keepdims=False, initial=0, + where=True), r) + + # too little + assert_raises(TypeError, f) + # too much + assert_raises(TypeError, f, d, 0, None, None, False, 0, True, 1) + # invalid axis + assert_raises(TypeError, f, d, "invalid") + assert_raises(TypeError, f, d, axis="invalid") + assert_raises(TypeError, f, d, axis="invalid", dtype=None, + keepdims=True) + # invalid dtype + assert_raises(TypeError, f, d, 0, "invalid") + assert_raises(TypeError, f, d, dtype="invalid") + assert_raises(TypeError, f, d, dtype="invalid", out=None) + # invalid out + assert_raises(TypeError, f, d, 0, None, "invalid") + assert_raises(TypeError, f, d, out="invalid") + assert_raises(TypeError, f, d, out="invalid", dtype=None) + # keepdims boolean, no invalid value + # assert_raises(TypeError, f, d, 0, None, None, "invalid") + # assert_raises(TypeError, f, d, keepdims="invalid", axis=0, dtype=None) + # invalid mix + assert_raises(TypeError, f, d, 0, keepdims="invalid", dtype="invalid", + out=None) + + # invalid keyword + assert_raises(TypeError, f, d, axis=0, dtype=None, invalid=0) + assert_raises(TypeError, f, d, invalid=0) + assert_raises(TypeError, f, d, 0, keepdims=True, invalid="invalid", + out=None) + assert_raises(TypeError, f, d, axis=0, dtype=None, keepdims=True, + out=None, invalid=0) + assert_raises(TypeError, f, d, axis=0, dtype=None, + out=None, invalid=0) + + def test_structured_equal(self): + # https://github.com/numpy/numpy/issues/4855 + + class MyA(np.ndarray): + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return getattr(ufunc, method)(*(input.view(np.ndarray) + for input in inputs), **kwargs) + a = np.arange(12.).reshape(4,3) + ra = a.view(dtype=('f8,f8,f8')).squeeze() + mra = ra.view(MyA) + + target = np.array([ True, False, False, False], dtype=bool) + assert_equal(np.all(target == (mra == ra[0])), True) + + def test_scalar_equal(self): + # Scalar comparisons should always work, without deprecation warnings. + # even when the ufunc fails. + a = np.array(0.) + b = np.array('a') + assert_(a != b) + assert_(b != a) + assert_(not (a == b)) + assert_(not (b == a)) + + def test_NotImplemented_not_returned(self): + # See gh-5964 and gh-2091. Some of these functions are not operator + # related and were fixed for other reasons in the past. + binary_funcs = [ + np.power, np.add, np.subtract, np.multiply, np.divide, + np.true_divide, np.floor_divide, np.bitwise_and, np.bitwise_or, + np.bitwise_xor, np.left_shift, np.right_shift, np.fmax, + np.fmin, np.fmod, np.hypot, np.logaddexp, np.logaddexp2, + np.maximum, np.minimum, np.mod, + np.greater, np.greater_equal, np.less, np.less_equal, + np.equal, np.not_equal] + + a = np.array('1') + b = 1 + c = np.array([1., 2.]) + for f in binary_funcs: + assert_raises(TypeError, f, a, b) + assert_raises(TypeError, f, c, a) + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or]) # logical_xor object loop is bad + @pytest.mark.parametrize("signature", + [(None, None, object), (object, None, None), + (None, object, None)]) + def test_logical_ufuncs_object_signatures(self, ufunc, signature): + a = np.array([True, None, False], dtype=object) + res = ufunc(a, a, signature=signature) + assert res.dtype == object + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or, np.logical_xor]) + @pytest.mark.parametrize("signature", + [(bool, None, object), (object, None, bool), + (None, object, bool)]) + def test_logical_ufuncs_mixed_object_signatures(self, ufunc, signature): + # Most mixed signatures fail (except those with bool out, e.g. `OO->?`) + a = np.array([True, None, False]) + with pytest.raises(TypeError): + ufunc(a, a, signature=signature) + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or, np.logical_xor]) + def test_logical_ufuncs_support_anything(self, ufunc): + # The logical ufuncs support even input that can't be promoted: + a = np.array(b'1', dtype="V3") + c = np.array([1., 2.]) + assert_array_equal(ufunc(a, c), ufunc([True, True], True)) + assert ufunc.reduce(a) == True + # check that the output has no effect: + out = np.zeros(2, dtype=np.int32) + expected = ufunc([True, True], True).astype(out.dtype) + assert_array_equal(ufunc(a, c, out=out), expected) + out = np.zeros((), dtype=np.int32) + assert ufunc.reduce(a, out=out) == True + # Last check, test reduction when out and a match (the complexity here + # is that the "i,i->?" may seem right, but should not match. + a = np.array([3], dtype="i") + out = np.zeros((), dtype=a.dtype) + assert ufunc.reduce(a, out=out) == 1 + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or, np.logical_xor]) + @pytest.mark.parametrize("dtype", ["S", "U"]) + @pytest.mark.parametrize("values", [["1", "hi", "0"], ["", ""]]) + def test_logical_ufuncs_supports_string(self, ufunc, dtype, values): + # note that values are either all true or all false + arr = np.array(values, dtype=dtype) + obj_arr = np.array(values, dtype=object) + res = ufunc(arr, arr) + expected = ufunc(obj_arr, obj_arr, dtype=bool) + + assert_array_equal(res, expected) + + res = ufunc.reduce(arr) + expected = ufunc.reduce(obj_arr, dtype=bool) + assert_array_equal(res, expected) + + @pytest.mark.parametrize("ufunc", + [np.logical_and, np.logical_or, np.logical_xor]) + def test_logical_ufuncs_out_cast_check(self, ufunc): + a = np.array('1') + c = np.array([1., 2.]) + out = a.copy() + with pytest.raises(TypeError): + # It would be safe, but not equiv casting: + ufunc(a, c, out=out, casting="equiv") + + def test_reducelike_byteorder_resolution(self): + # See gh-20699, byte-order changes need some extra care in the type + # resolution to make the following succeed: + arr_be = np.arange(10, dtype=">i8") + arr_le = np.arange(10, dtype="i + if 'O' in typ or '?' in typ: + continue + inp, out = typ.split('->') + args = [np.ones((3, 3), t) for t in inp] + with warnings.catch_warnings(record=True): + warnings.filterwarnings("always") + res = ufunc(*args) + if isinstance(res, tuple): + outs = tuple(out) + assert len(res) == len(outs) + for r, t in zip(res, outs): + assert r.dtype == np.dtype(t) + else: + assert res.dtype == np.dtype(out) + +@pytest.mark.parametrize('ufunc', [getattr(np, x) for x in dir(np) + if isinstance(getattr(np, x), np.ufunc)]) +@np._no_nep50_warning() +def test_ufunc_noncontiguous(ufunc): + ''' + Check that contiguous and non-contiguous calls to ufuncs + have the same results for values in range(9) + ''' + for typ in ufunc.types: + # types is a list of strings like ii->i + if any(set('O?mM') & set(typ)): + # bool, object, datetime are too irregular for this simple test + continue + inp, out = typ.split('->') + args_c = [np.empty(6, t) for t in inp] + # non contiguous (3 step) + args_n = [np.empty(18, t)[::3] for t in inp] + # alignment != itemsize is possible. So create an array with such + # an odd step manually. + args_o = [] + for t in inp: + orig_dt = np.dtype(t) + off_dt = f"S{orig_dt.alignment}" # offset by alignment + dtype = np.dtype([("_", off_dt), ("t", orig_dt)], align=False) + args_o.append(np.empty(6, dtype=dtype)["t"]) + + for a in args_c + args_n + args_o: + a.flat = range(1,7) + + with warnings.catch_warnings(record=True): + warnings.filterwarnings("always") + res_c = ufunc(*args_c) + res_n = ufunc(*args_n) + res_o = ufunc(*args_o) + if len(out) == 1: + res_c = (res_c,) + res_n = (res_n,) + res_o = (res_o,) + for c_ar, n_ar, o_ar in zip(res_c, res_n, res_o): + dt = c_ar.dtype + if np.issubdtype(dt, np.floating): + # for floating point results allow a small fuss in comparisons + # since different algorithms (libm vs. intrinsics) can be used + # for different input strides + res_eps = np.finfo(dt).eps + tol = 2*res_eps + assert_allclose(res_c, res_n, atol=tol, rtol=tol) + assert_allclose(res_c, res_o, atol=tol, rtol=tol) + else: + assert_equal(c_ar, n_ar) + assert_equal(c_ar, o_ar) + + +@pytest.mark.parametrize('ufunc', [np.sign, np.equal]) +def test_ufunc_warn_with_nan(ufunc): + # issue gh-15127 + # test that calling certain ufuncs with a non-standard `nan` value does not + # emit a warning + # `b` holds a 64 bit signaling nan: the most significant bit of the + # significand is zero. + b = np.array([0x7ff0000000000001], 'i8').view('f8') + assert np.isnan(b) + if ufunc.nin == 1: + ufunc(b) + elif ufunc.nin == 2: + ufunc(b, b.copy()) + else: + raise ValueError('ufunc with more than 2 inputs') + + +@pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") +def test_ufunc_out_casterrors(): + # Tests that casting errors are correctly reported and buffers are + # cleared. + # The following array can be added to itself as an object array, but + # the result cannot be cast to an integer output: + value = 123 # relies on python cache (leak-check will still find it) + arr = np.array([value] * int(ncu.BUFSIZE * 1.5) + + ["string"] + + [value] * int(1.5 * ncu.BUFSIZE), dtype=object) + out = np.ones(len(arr), dtype=np.intp) + + count = sys.getrefcount(value) + with pytest.raises(ValueError): + # Output casting failure: + np.add(arr, arr, out=out, casting="unsafe") + + assert count == sys.getrefcount(value) + # output is unchanged after the error, this shows that the iteration + # was aborted (this is not necessarily defined behaviour) + assert out[-1] == 1 + + with pytest.raises(ValueError): + # Input casting failure: + np.add(arr, arr, out=out, dtype=np.intp, casting="unsafe") + + assert count == sys.getrefcount(value) + # output is unchanged after the error, this shows that the iteration + # was aborted (this is not necessarily defined behaviour) + assert out[-1] == 1 + + +@pytest.mark.parametrize("bad_offset", [0, int(ncu.BUFSIZE * 1.5)]) +def test_ufunc_input_casterrors(bad_offset): + value = 123 + arr = np.array([value] * bad_offset + + ["string"] + + [value] * int(1.5 * ncu.BUFSIZE), dtype=object) + with pytest.raises(ValueError): + # Force cast inputs, but the buffered cast of `arr` to intp fails: + np.add(arr, arr, dtype=np.intp, casting="unsafe") + + +@pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") +@pytest.mark.parametrize("bad_offset", [0, int(ncu.BUFSIZE * 1.5)]) +def test_ufunc_input_floatingpoint_error(bad_offset): + value = 123 + arr = np.array([value] * bad_offset + + [np.nan] + + [value] * int(1.5 * ncu.BUFSIZE)) + with np.errstate(invalid="raise"), pytest.raises(FloatingPointError): + # Force cast inputs, but the buffered cast of `arr` to intp fails: + np.add(arr, arr, dtype=np.intp, casting="unsafe") + + +def test_trivial_loop_invalid_cast(): + # This tests the fast-path "invalid cast", see gh-19904. + with pytest.raises(TypeError, + match="cast ufunc 'add' input 0"): + # the void dtype definitely cannot cast to double: + np.add(np.array(1, "i,i"), 3, signature="dd->d") + + +@pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") +@pytest.mark.parametrize("offset", + [0, ncu.BUFSIZE//2, int(1.5*ncu.BUFSIZE)]) +def test_reduce_casterrors(offset): + # Test reporting of casting errors in reductions, we test various + # offsets to where the casting error will occur, since these may occur + # at different places during the reduction procedure. For example + # the first item may be special. + value = 123 # relies on python cache (leak-check will still find it) + arr = np.array([value] * offset + + ["string"] + + [value] * int(1.5 * ncu.BUFSIZE), dtype=object) + out = np.array(-1, dtype=np.intp) + + count = sys.getrefcount(value) + with pytest.raises(ValueError, match="invalid literal"): + # This is an unsafe cast, but we currently always allow that. + # Note that the double loop is picked, but the cast fails. + # `initial=None` disables the use of an identity here to test failures + # while copying the first values path (not used when identity exists). + np.add.reduce(arr, dtype=np.intp, out=out, initial=None) + assert count == sys.getrefcount(value) + # If an error occurred during casting, the operation is done at most until + # the error occurs (the result of which would be `value * offset`) and -1 + # if the error happened immediately. + # This does not define behaviour, the output is invalid and thus undefined + assert out[()] < value * offset + + +def test_object_reduce_cleanup_on_failure(): + # Test cleanup, including of the initial value (manually provided or not) + with pytest.raises(TypeError): + np.add.reduce([1, 2, None], initial=4) + + with pytest.raises(TypeError): + np.add.reduce([1, 2, None]) + + +@pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") +@pytest.mark.parametrize("method", + [np.add.accumulate, np.add.reduce, + pytest.param(lambda x: np.add.reduceat(x, [0]), id="reduceat"), + pytest.param(lambda x: np.log.at(x, [2]), id="at")]) +def test_ufunc_methods_floaterrors(method): + # adding inf and -inf (or log(-inf) creates an invalid float and warns + arr = np.array([np.inf, 0, -np.inf]) + with np.errstate(all="warn"): + with pytest.warns(RuntimeWarning, match="invalid value"): + method(arr) + + arr = np.array([np.inf, 0, -np.inf]) + with np.errstate(all="raise"): + with pytest.raises(FloatingPointError): + method(arr) + + +def _check_neg_zero(value): + if value != 0.0: + return False + if not np.signbit(value.real): + return False + if value.dtype.kind == "c": + return np.signbit(value.imag) + return True + +@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"]) +def test_addition_negative_zero(dtype): + dtype = np.dtype(dtype) + if dtype.kind == "c": + neg_zero = dtype.type(complex(-0.0, -0.0)) + else: + neg_zero = dtype.type(-0.0) + + arr = np.array(neg_zero) + arr2 = np.array(neg_zero) + + assert _check_neg_zero(arr + arr2) + # In-place ops may end up on a different path (reduce path) see gh-21211 + arr += arr2 + assert _check_neg_zero(arr) + + +@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"]) +@pytest.mark.parametrize("use_initial", [True, False]) +def test_addition_reduce_negative_zero(dtype, use_initial): + dtype = np.dtype(dtype) + if dtype.kind == "c": + neg_zero = dtype.type(complex(-0.0, -0.0)) + else: + neg_zero = dtype.type(-0.0) + + kwargs = {} + if use_initial: + kwargs["initial"] = neg_zero + else: + pytest.xfail("-0. propagation in sum currently requires initial") + + # Test various length, in case SIMD paths or chunking play a role. + # 150 extends beyond the pairwise blocksize; probably not important. + for i in range(0, 150): + arr = np.array([neg_zero] * i, dtype=dtype) + res = np.sum(arr, **kwargs) + if i > 0 or use_initial: + assert _check_neg_zero(res) + else: + # `sum([])` should probably be 0.0 and not -0.0 like `sum([-0.0])` + assert not np.signbit(res.real) + assert not np.signbit(res.imag) + + +@pytest.mark.parametrize(["dt1", "dt2"], + [("S", "U"), ("U", "S"), ("S", "d"), ("S", "V"), ("U", "l")]) +def test_addition_string_types(dt1, dt2): + arr1 = np.array([1234234], dtype=dt1) + arr2 = np.array([b"423"], dtype=dt2) + with pytest.raises(np._core._exceptions.UFuncTypeError) as exc: + np.add(arr1, arr2) + + +@pytest.mark.parametrize("order1,order2", + [(">", ">"), ("<", "<"), (">", "<"), ("<", ">")]) +def test_addition_unicode_inverse_byte_order(order1, order2): + element = 'abcd' + arr1 = np.array([element], dtype=f"{order1}U4") + arr2 = np.array([element], dtype=f"{order2}U4") + result = arr1 + arr2 + assert result == 2*element + + +@pytest.mark.parametrize("dtype", [np.int8, np.int16, np.int32, np.int64]) +def test_find_non_long_args(dtype): + element = 'abcd' + start = dtype(0) + end = dtype(len(element)) + arr = np.array([element]) + result = np._core.umath.find(arr, "a", start, end) + assert result.dtype == np.dtype("intp") + assert result == 0 + + +def test_find_access_past_buffer(): + # This checks that no read past the string buffer occurs in + # string_fastsearch.h. The buffer class makes sure this is checked. + # To see it in action, you can remove the checks in the buffer and + # this test will produce an 'Invalid read' if run under valgrind. + arr = np.array([b'abcd', b'ebcd']) + result = np._core.umath.find(arr, b'cde', 0, np.iinfo(np.int64).max) + assert np.all(result == -1) + + +class TestLowlevelAPIAccess: + def test_resolve_dtypes_basic(self): + # Basic test for dtype resolution: + i4 = np.dtype("i4") + f4 = np.dtype("f4") + f8 = np.dtype("f8") + + r = np.add.resolve_dtypes((i4, f4, None)) + assert r == (f8, f8, f8) + + # Signature uses the same logic to parse as ufunc (less strict) + # the following is "same-kind" casting so works: + r = np.add.resolve_dtypes(( + i4, i4, None), signature=(None, None, "f4")) + assert r == (f4, f4, f4) + + # Check NEP 50 "weak" promotion also: + r = np.add.resolve_dtypes((f4, int, None)) + assert r == (f4, f4, f4) + + with pytest.raises(TypeError): + np.add.resolve_dtypes((i4, f4, None), casting="no") + + def test_resolve_dtypes_comparison(self): + i4 = np.dtype("i4") + i8 = np.dtype("i8") + b = np.dtype("?") + r = np.equal.resolve_dtypes((i4, i8, None)) + assert r == (i8, i8, b) + + def test_weird_dtypes(self): + S0 = np.dtype("S0") + # S0 is often converted by NumPy to S1, but not here: + r = np.equal.resolve_dtypes((S0, S0, None)) + assert r == (S0, S0, np.dtype(bool)) + + # Subarray dtypes are weird and may not work fully, we preserve them + # leading to a TypeError (currently no equal loop for void/structured) + dts = np.dtype("10i") + with pytest.raises(TypeError): + np.equal.resolve_dtypes((dts, dts, None)) + + def test_resolve_dtypes_reduction(self): + i2 = np.dtype("i2") + default_int_ = np.dtype(np.int_) + # Check special addition resolution: + res = np.add.resolve_dtypes((None, i2, None), reduction=True) + assert res == (default_int_, default_int_, default_int_) + + def test_resolve_dtypes_reduction_no_output(self): + i4 = np.dtype("i4") + with pytest.raises(TypeError): + # May be allowable at some point? + np.add.resolve_dtypes((i4, i4, i4), reduction=True) + + @pytest.mark.parametrize("dtypes", [ + (np.dtype("i"), np.dtype("i")), + (None, np.dtype("i"), np.dtype("f")), + (np.dtype("i"), None, np.dtype("f")), + ("i4", "i4", None)]) + def test_resolve_dtypes_errors(self, dtypes): + with pytest.raises(TypeError): + np.add.resolve_dtypes(dtypes) + + def test_resolve_dtypes_reduction_errors(self): + i2 = np.dtype("i2") + + with pytest.raises(TypeError): + np.add.resolve_dtypes((None, i2, i2)) + + with pytest.raises(TypeError): + np.add.signature((None, None, "i4")) + + @pytest.mark.skipif(not hasattr(ct, "pythonapi"), + reason="`ctypes.pythonapi` required for capsule unpacking.") + def test_loop_access(self): + # This is a basic test for the full strided loop access + data_t = ct.c_char_p * 2 + dim_t = ct.c_ssize_t * 1 + strides_t = ct.c_ssize_t * 2 + strided_loop_t = ct.CFUNCTYPE( + ct.c_int, ct.c_void_p, data_t, dim_t, strides_t, ct.c_void_p) + + class call_info_t(ct.Structure): + _fields_ = [ + ("strided_loop", strided_loop_t), + ("context", ct.c_void_p), + ("auxdata", ct.c_void_p), + ("requires_pyapi", ct.c_byte), + ("no_floatingpoint_errors", ct.c_byte), + ] + + i4 = np.dtype("i4") + dt, call_info_obj = np.negative._resolve_dtypes_and_context((i4, i4)) + assert dt == (i4, i4) # can be used without casting + + # Fill in the rest of the information: + np.negative._get_strided_loop(call_info_obj) + + ct.pythonapi.PyCapsule_GetPointer.restype = ct.c_void_p + call_info = ct.pythonapi.PyCapsule_GetPointer( + ct.py_object(call_info_obj), + ct.c_char_p(b"numpy_1.24_ufunc_call_info")) + + call_info = ct.cast(call_info, ct.POINTER(call_info_t)).contents + + arr = np.arange(10, dtype=i4) + call_info.strided_loop( + call_info.context, + data_t(arr.ctypes.data, arr.ctypes.data), + arr.ctypes.shape, # is a C-array with 10 here + strides_t(arr.ctypes.strides[0], arr.ctypes.strides[0]), + call_info.auxdata) + + # We just directly called the negative inner-loop in-place: + assert_array_equal(arr, -np.arange(10, dtype=i4)) + + @pytest.mark.parametrize("strides", [1, (1, 2, 3), (1, "2")]) + def test__get_strided_loop_errors_bad_strides(self, strides): + i4 = np.dtype("i4") + dt, call_info = np.negative._resolve_dtypes_and_context((i4, i4)) + + with pytest.raises(TypeError, match="fixed_strides.*tuple.*or None"): + np.negative._get_strided_loop(call_info, fixed_strides=strides) + + def test__get_strided_loop_errors_bad_call_info(self): + i4 = np.dtype("i4") + dt, call_info = np.negative._resolve_dtypes_and_context((i4, i4)) + + with pytest.raises(ValueError, match="PyCapsule"): + np.negative._get_strided_loop("not the capsule!") + + with pytest.raises(TypeError, match=".*incompatible context"): + np.add._get_strided_loop(call_info) + + np.negative._get_strided_loop(call_info) + with pytest.raises(TypeError): + # cannot call it a second time: + np.negative._get_strided_loop(call_info) + + def test_long_arrays(self): + t = np.zeros((1029, 917), dtype=np.single) + t[0][0] = 1 + t[28][414] = 1 + tc = np.cos(t) + assert_equal(tc[0][0], tc[28][414]) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath.py new file mode 100644 index 0000000000000000000000000000000000000000..9a300f19764c63a7b95e3768fff0172b49953a61 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath.py @@ -0,0 +1,4870 @@ +import platform +import warnings +import fnmatch +import itertools +import pytest +import sys +import os +import operator +from fractions import Fraction +from functools import reduce +from collections import namedtuple + +import numpy._core.umath as ncu +from numpy._core import _umath_tests as ncu_tests, sctypes +import numpy as np +from numpy.testing import ( + assert_, assert_equal, assert_raises, assert_raises_regex, + assert_array_equal, assert_almost_equal, assert_array_almost_equal, + assert_array_max_ulp, assert_allclose, assert_no_warnings, suppress_warnings, + _gen_alignment_data, assert_array_almost_equal_nulp, IS_WASM, IS_MUSL, + IS_PYPY, HAS_REFCOUNT + ) +from numpy.testing._private.utils import _glibc_older_than + +UFUNCS = [obj for obj in np._core.umath.__dict__.values() + if isinstance(obj, np.ufunc)] + +UFUNCS_UNARY = [ + uf for uf in UFUNCS if uf.nin == 1 +] +UFUNCS_UNARY_FP = [ + uf for uf in UFUNCS_UNARY if 'f->f' in uf.types +] + +UFUNCS_BINARY = [ + uf for uf in UFUNCS if uf.nin == 2 +] +UFUNCS_BINARY_ACC = [ + uf for uf in UFUNCS_BINARY if hasattr(uf, "accumulate") and uf.nout == 1 +] + +def interesting_binop_operands(val1, val2, dtype): + """ + Helper to create "interesting" operands to cover common code paths: + * scalar inputs + * only first "values" is an array (e.g. scalar division fast-paths) + * Longer array (SIMD) placing the value of interest at different positions + * Oddly strided arrays which may not be SIMD compatible + + It does not attempt to cover unaligned access or mixed dtypes. + These are normally handled by the casting/buffering machinery. + + This is not a fixture (currently), since I believe a fixture normally + only yields once? + """ + fill_value = 1 # could be a parameter, but maybe not an optional one? + + arr1 = np.full(10003, dtype=dtype, fill_value=fill_value) + arr2 = np.full(10003, dtype=dtype, fill_value=fill_value) + + arr1[0] = val1 + arr2[0] = val2 + + extractor = lambda res: res + yield arr1[0], arr2[0], extractor, "scalars" + + extractor = lambda res: res + yield arr1[0, ...], arr2[0, ...], extractor, "scalar-arrays" + + # reset array values to fill_value: + arr1[0] = fill_value + arr2[0] = fill_value + + for pos in [0, 1, 2, 3, 4, 5, -1, -2, -3, -4]: + arr1[pos] = val1 + arr2[pos] = val2 + + extractor = lambda res: res[pos] + yield arr1, arr2, extractor, f"off-{pos}" + yield arr1, arr2[pos], extractor, f"off-{pos}-with-scalar" + + arr1[pos] = fill_value + arr2[pos] = fill_value + + for stride in [-1, 113]: + op1 = arr1[::stride] + op2 = arr2[::stride] + op1[10] = val1 + op2[10] = val2 + + extractor = lambda res: res[10] + yield op1, op2, extractor, f"stride-{stride}" + + op1[10] = fill_value + op2[10] = fill_value + + +def on_powerpc(): + """ True if we are running on a Power PC platform.""" + return platform.processor() == 'powerpc' or \ + platform.machine().startswith('ppc') + + +def bad_arcsinh(): + """The blocklisted trig functions are not accurate on aarch64/PPC for + complex256. Rather than dig through the actual problem skip the + test. This should be fixed when we can move past glibc2.17 + which is the version in manylinux2014 + """ + if platform.machine() == 'aarch64': + x = 1.78e-10 + elif on_powerpc(): + x = 2.16e-10 + else: + return False + v1 = np.arcsinh(np.float128(x)) + v2 = np.arcsinh(np.complex256(x)).real + # The eps for float128 is 1-e33, so this is way bigger + return abs((v1 / v2) - 1.0) > 1e-23 + + +class _FilterInvalids: + def setup_method(self): + self.olderr = np.seterr(invalid='ignore') + + def teardown_method(self): + np.seterr(**self.olderr) + + +class TestConstants: + def test_pi(self): + assert_allclose(ncu.pi, 3.141592653589793, 1e-15) + + def test_e(self): + assert_allclose(ncu.e, 2.718281828459045, 1e-15) + + def test_euler_gamma(self): + assert_allclose(ncu.euler_gamma, 0.5772156649015329, 1e-15) + + +class TestOut: + def test_out_subok(self): + for subok in (True, False): + a = np.array(0.5) + o = np.empty(()) + + r = np.add(a, 2, o, subok=subok) + assert_(r is o) + r = np.add(a, 2, out=o, subok=subok) + assert_(r is o) + r = np.add(a, 2, out=(o,), subok=subok) + assert_(r is o) + + d = np.array(5.7) + o1 = np.empty(()) + o2 = np.empty((), dtype=np.int32) + + r1, r2 = np.frexp(d, o1, None, subok=subok) + assert_(r1 is o1) + r1, r2 = np.frexp(d, None, o2, subok=subok) + assert_(r2 is o2) + r1, r2 = np.frexp(d, o1, o2, subok=subok) + assert_(r1 is o1) + assert_(r2 is o2) + + r1, r2 = np.frexp(d, out=(o1, None), subok=subok) + assert_(r1 is o1) + r1, r2 = np.frexp(d, out=(None, o2), subok=subok) + assert_(r2 is o2) + r1, r2 = np.frexp(d, out=(o1, o2), subok=subok) + assert_(r1 is o1) + assert_(r2 is o2) + + with assert_raises(TypeError): + # Out argument must be tuple, since there are multiple outputs. + r1, r2 = np.frexp(d, out=o1, subok=subok) + + assert_raises(TypeError, np.add, a, 2, o, o, subok=subok) + assert_raises(TypeError, np.add, a, 2, o, out=o, subok=subok) + assert_raises(TypeError, np.add, a, 2, None, out=o, subok=subok) + assert_raises(ValueError, np.add, a, 2, out=(o, o), subok=subok) + assert_raises(ValueError, np.add, a, 2, out=(), subok=subok) + assert_raises(TypeError, np.add, a, 2, [], subok=subok) + assert_raises(TypeError, np.add, a, 2, out=[], subok=subok) + assert_raises(TypeError, np.add, a, 2, out=([],), subok=subok) + o.flags.writeable = False + assert_raises(ValueError, np.add, a, 2, o, subok=subok) + assert_raises(ValueError, np.add, a, 2, out=o, subok=subok) + assert_raises(ValueError, np.add, a, 2, out=(o,), subok=subok) + + def test_out_wrap_subok(self): + class ArrayWrap(np.ndarray): + __array_priority__ = 10 + + def __new__(cls, arr): + return np.asarray(arr).view(cls).copy() + + def __array_wrap__(self, arr, context=None, return_scalar=False): + return arr.view(type(self)) + + for subok in (True, False): + a = ArrayWrap([0.5]) + + r = np.add(a, 2, subok=subok) + if subok: + assert_(isinstance(r, ArrayWrap)) + else: + assert_(type(r) == np.ndarray) + + r = np.add(a, 2, None, subok=subok) + if subok: + assert_(isinstance(r, ArrayWrap)) + else: + assert_(type(r) == np.ndarray) + + r = np.add(a, 2, out=None, subok=subok) + if subok: + assert_(isinstance(r, ArrayWrap)) + else: + assert_(type(r) == np.ndarray) + + r = np.add(a, 2, out=(None,), subok=subok) + if subok: + assert_(isinstance(r, ArrayWrap)) + else: + assert_(type(r) == np.ndarray) + + d = ArrayWrap([5.7]) + o1 = np.empty((1,)) + o2 = np.empty((1,), dtype=np.int32) + + r1, r2 = np.frexp(d, o1, subok=subok) + if subok: + assert_(isinstance(r2, ArrayWrap)) + else: + assert_(type(r2) == np.ndarray) + + r1, r2 = np.frexp(d, o1, None, subok=subok) + if subok: + assert_(isinstance(r2, ArrayWrap)) + else: + assert_(type(r2) == np.ndarray) + + r1, r2 = np.frexp(d, None, o2, subok=subok) + if subok: + assert_(isinstance(r1, ArrayWrap)) + else: + assert_(type(r1) == np.ndarray) + + r1, r2 = np.frexp(d, out=(o1, None), subok=subok) + if subok: + assert_(isinstance(r2, ArrayWrap)) + else: + assert_(type(r2) == np.ndarray) + + r1, r2 = np.frexp(d, out=(None, o2), subok=subok) + if subok: + assert_(isinstance(r1, ArrayWrap)) + else: + assert_(type(r1) == np.ndarray) + + with assert_raises(TypeError): + # Out argument must be tuple, since there are multiple outputs. + r1, r2 = np.frexp(d, out=o1, subok=subok) + + @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts") + def test_out_wrap_no_leak(self): + # Regression test for gh-26545 + class ArrSubclass(np.ndarray): + pass + + arr = np.arange(10).view(ArrSubclass) + + arr *= 1 + assert sys.getrefcount(arr) == 2 + + +class TestComparisons: + import operator + + @pytest.mark.parametrize('dtype', sctypes['uint'] + sctypes['int'] + + sctypes['float'] + [np.bool]) + @pytest.mark.parametrize('py_comp,np_comp', [ + (operator.lt, np.less), + (operator.le, np.less_equal), + (operator.gt, np.greater), + (operator.ge, np.greater_equal), + (operator.eq, np.equal), + (operator.ne, np.not_equal) + ]) + def test_comparison_functions(self, dtype, py_comp, np_comp): + # Initialize input arrays + if dtype == np.bool: + a = np.random.choice(a=[False, True], size=1000) + b = np.random.choice(a=[False, True], size=1000) + scalar = True + else: + a = np.random.randint(low=1, high=10, size=1000).astype(dtype) + b = np.random.randint(low=1, high=10, size=1000).astype(dtype) + scalar = 5 + np_scalar = np.dtype(dtype).type(scalar) + a_lst = a.tolist() + b_lst = b.tolist() + + # (Binary) Comparison (x1=array, x2=array) + comp_b = np_comp(a, b).view(np.uint8) + comp_b_list = [int(py_comp(x, y)) for x, y in zip(a_lst, b_lst)] + + # (Scalar1) Comparison (x1=scalar, x2=array) + comp_s1 = np_comp(np_scalar, b).view(np.uint8) + comp_s1_list = [int(py_comp(scalar, x)) for x in b_lst] + + # (Scalar2) Comparison (x1=array, x2=scalar) + comp_s2 = np_comp(a, np_scalar).view(np.uint8) + comp_s2_list = [int(py_comp(x, scalar)) for x in a_lst] + + # Sequence: Binary, Scalar1 and Scalar2 + assert_(comp_b.tolist() == comp_b_list, + f"Failed comparison ({py_comp.__name__})") + assert_(comp_s1.tolist() == comp_s1_list, + f"Failed comparison ({py_comp.__name__})") + assert_(comp_s2.tolist() == comp_s2_list, + f"Failed comparison ({py_comp.__name__})") + + def test_ignore_object_identity_in_equal(self): + # Check comparing identical objects whose comparison + # is not a simple boolean, e.g., arrays that are compared elementwise. + a = np.array([np.array([1, 2, 3]), None], dtype=object) + assert_raises(ValueError, np.equal, a, a) + + # Check error raised when comparing identical non-comparable objects. + class FunkyType: + def __eq__(self, other): + raise TypeError("I won't compare") + + a = np.array([FunkyType()]) + assert_raises(TypeError, np.equal, a, a) + + # Check identity doesn't override comparison mismatch. + a = np.array([np.nan], dtype=object) + assert_equal(np.equal(a, a), [False]) + + def test_ignore_object_identity_in_not_equal(self): + # Check comparing identical objects whose comparison + # is not a simple boolean, e.g., arrays that are compared elementwise. + a = np.array([np.array([1, 2, 3]), None], dtype=object) + assert_raises(ValueError, np.not_equal, a, a) + + # Check error raised when comparing identical non-comparable objects. + class FunkyType: + def __ne__(self, other): + raise TypeError("I won't compare") + + a = np.array([FunkyType()]) + assert_raises(TypeError, np.not_equal, a, a) + + # Check identity doesn't override comparison mismatch. + a = np.array([np.nan], dtype=object) + assert_equal(np.not_equal(a, a), [True]) + + def test_error_in_equal_reduce(self): + # gh-20929 + # make sure np.equal.reduce raises a TypeError if an array is passed + # without specifying the dtype + a = np.array([0, 0]) + assert_equal(np.equal.reduce(a, dtype=bool), True) + assert_raises(TypeError, np.equal.reduce, a) + + def test_object_dtype(self): + assert np.equal(1, [1], dtype=object).dtype == object + assert np.equal(1, [1], signature=(None, None, "O")).dtype == object + + def test_object_nonbool_dtype_error(self): + # bool output dtype is fine of course: + assert np.equal(1, [1], dtype=bool).dtype == bool + + # but the following are examples do not have a loop: + with pytest.raises(TypeError, match="No loop matching"): + np.equal(1, 1, dtype=np.int64) + + with pytest.raises(TypeError, match="No loop matching"): + np.equal(1, 1, sig=(None, None, "l")) + + @pytest.mark.parametrize("dtypes", ["qQ", "Qq"]) + @pytest.mark.parametrize('py_comp, np_comp', [ + (operator.lt, np.less), + (operator.le, np.less_equal), + (operator.gt, np.greater), + (operator.ge, np.greater_equal), + (operator.eq, np.equal), + (operator.ne, np.not_equal) + ]) + @pytest.mark.parametrize("vals", [(2**60, 2**60+1), (2**60+1, 2**60)]) + def test_large_integer_direct_comparison( + self, dtypes, py_comp, np_comp, vals): + # Note that float(2**60) + 1 == float(2**60). + a1 = np.array([2**60], dtype=dtypes[0]) + a2 = np.array([2**60 + 1], dtype=dtypes[1]) + expected = py_comp(2**60, 2**60+1) + + assert py_comp(a1, a2) == expected + assert np_comp(a1, a2) == expected + # Also check the scalars: + s1 = a1[0] + s2 = a2[0] + assert isinstance(s1, np.integer) + assert isinstance(s2, np.integer) + # The Python operator here is mainly interesting: + assert py_comp(s1, s2) == expected + assert np_comp(s1, s2) == expected + + @pytest.mark.parametrize("dtype", np.typecodes['UnsignedInteger']) + @pytest.mark.parametrize('py_comp_func, np_comp_func', [ + (operator.lt, np.less), + (operator.le, np.less_equal), + (operator.gt, np.greater), + (operator.ge, np.greater_equal), + (operator.eq, np.equal), + (operator.ne, np.not_equal) + ]) + @pytest.mark.parametrize("flip", [True, False]) + def test_unsigned_signed_direct_comparison( + self, dtype, py_comp_func, np_comp_func, flip): + if flip: + py_comp = lambda x, y: py_comp_func(y, x) + np_comp = lambda x, y: np_comp_func(y, x) + else: + py_comp = py_comp_func + np_comp = np_comp_func + + arr = np.array([np.iinfo(dtype).max], dtype=dtype) + expected = py_comp(int(arr[0]), -1) + + assert py_comp(arr, -1) == expected + assert np_comp(arr, -1) == expected + + scalar = arr[0] + assert isinstance(scalar, np.integer) + # The Python operator here is mainly interesting: + assert py_comp(scalar, -1) == expected + assert np_comp(scalar, -1) == expected + + +class TestAdd: + def test_reduce_alignment(self): + # gh-9876 + # make sure arrays with weird strides work with the optimizations in + # pairwise_sum_@TYPE@. On x86, the 'b' field will count as aligned at a + # 4 byte offset, even though its itemsize is 8. + a = np.zeros(2, dtype=[('a', np.int32), ('b', np.float64)]) + a['a'] = -1 + assert_equal(a['b'].sum(), 0) + + +class TestDivision: + def test_division_int(self): + # int division should follow Python + x = np.array([5, 10, 90, 100, -5, -10, -90, -100, -120]) + if 5 / 10 == 0.5: + assert_equal(x / 100, [0.05, 0.1, 0.9, 1, + -0.05, -0.1, -0.9, -1, -1.2]) + else: + assert_equal(x / 100, [0, 0, 0, 1, -1, -1, -1, -1, -2]) + assert_equal(x // 100, [0, 0, 0, 1, -1, -1, -1, -1, -2]) + assert_equal(x % 100, [5, 10, 90, 0, 95, 90, 10, 0, 80]) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize("dtype,ex_val", itertools.product( + sctypes['int'] + sctypes['uint'], ( + ( + # dividend + "np.array(range(fo.max-lsize, fo.max)).astype(dtype)," + # divisors + "np.arange(lsize).astype(dtype)," + # scalar divisors + "range(15)" + ), + ( + # dividend + "np.arange(fo.min, fo.min+lsize).astype(dtype)," + # divisors + "np.arange(lsize//-2, lsize//2).astype(dtype)," + # scalar divisors + "range(fo.min, fo.min + 15)" + ), ( + # dividend + "np.array(range(fo.max-lsize, fo.max)).astype(dtype)," + # divisors + "np.arange(lsize).astype(dtype)," + # scalar divisors + "[1,3,9,13,neg, fo.min+1, fo.min//2, fo.max//3, fo.max//4]" + ) + ) + )) + def test_division_int_boundary(self, dtype, ex_val): + fo = np.iinfo(dtype) + neg = -1 if fo.min < 0 else 1 + # Large enough to test SIMD loops and remainder elements + lsize = 512 + 7 + a, b, divisors = eval(ex_val) + a_lst, b_lst = a.tolist(), b.tolist() + + c_div = lambda n, d: ( + 0 if d == 0 else ( + fo.min if (n and n == fo.min and d == -1) else n//d + ) + ) + with np.errstate(divide='ignore'): + ac = a.copy() + ac //= b + div_ab = a // b + div_lst = [c_div(x, y) for x, y in zip(a_lst, b_lst)] + + msg = "Integer arrays floor division check (//)" + assert all(div_ab == div_lst), msg + msg_eq = "Integer arrays floor division check (//=)" + assert all(ac == div_lst), msg_eq + + for divisor in divisors: + ac = a.copy() + with np.errstate(divide='ignore', over='ignore'): + div_a = a // divisor + ac //= divisor + div_lst = [c_div(i, divisor) for i in a_lst] + + assert all(div_a == div_lst), msg + assert all(ac == div_lst), msg_eq + + with np.errstate(divide='raise', over='raise'): + if 0 in b: + # Verify overflow case + with pytest.raises(FloatingPointError, + match="divide by zero encountered in floor_divide"): + a // b + else: + a // b + if fo.min and fo.min in a: + with pytest.raises(FloatingPointError, + match='overflow encountered in floor_divide'): + a // -1 + elif fo.min: + a // -1 + with pytest.raises(FloatingPointError, + match="divide by zero encountered in floor_divide"): + a // 0 + with pytest.raises(FloatingPointError, + match="divide by zero encountered in floor_divide"): + ac = a.copy() + ac //= 0 + + np.array([], dtype=dtype) // 0 + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize("dtype,ex_val", itertools.product( + sctypes['int'] + sctypes['uint'], ( + "np.array([fo.max, 1, 2, 1, 1, 2, 3], dtype=dtype)", + "np.array([fo.min, 1, -2, 1, 1, 2, -3]).astype(dtype)", + "np.arange(fo.min, fo.min+(100*10), 10, dtype=dtype)", + "np.array(range(fo.max-(100*7), fo.max, 7)).astype(dtype)", + ) + )) + def test_division_int_reduce(self, dtype, ex_val): + fo = np.iinfo(dtype) + a = eval(ex_val) + lst = a.tolist() + c_div = lambda n, d: ( + 0 if d == 0 or (n and n == fo.min and d == -1) else n//d + ) + + with np.errstate(divide='ignore'): + div_a = np.floor_divide.reduce(a) + div_lst = reduce(c_div, lst) + msg = "Reduce floor integer division check" + assert div_a == div_lst, msg + + with np.errstate(divide='raise', over='raise'): + with pytest.raises(FloatingPointError, + match="divide by zero encountered in reduce"): + np.floor_divide.reduce(np.arange(-100, 100).astype(dtype)) + if fo.min: + with pytest.raises(FloatingPointError, + match='overflow encountered in reduce'): + np.floor_divide.reduce( + np.array([fo.min, 1, -1], dtype=dtype) + ) + + @pytest.mark.parametrize( + "dividend,divisor,quotient", + [(np.timedelta64(2,'Y'), np.timedelta64(2,'M'), 12), + (np.timedelta64(2,'Y'), np.timedelta64(-2,'M'), -12), + (np.timedelta64(-2,'Y'), np.timedelta64(2,'M'), -12), + (np.timedelta64(-2,'Y'), np.timedelta64(-2,'M'), 12), + (np.timedelta64(2,'M'), np.timedelta64(-2,'Y'), -1), + (np.timedelta64(2,'Y'), np.timedelta64(0,'M'), 0), + (np.timedelta64(2,'Y'), 2, np.timedelta64(1,'Y')), + (np.timedelta64(2,'Y'), -2, np.timedelta64(-1,'Y')), + (np.timedelta64(-2,'Y'), 2, np.timedelta64(-1,'Y')), + (np.timedelta64(-2,'Y'), -2, np.timedelta64(1,'Y')), + (np.timedelta64(-2,'Y'), -2, np.timedelta64(1,'Y')), + (np.timedelta64(-2,'Y'), -3, np.timedelta64(0,'Y')), + (np.timedelta64(-2,'Y'), 0, np.timedelta64('Nat','Y')), + ]) + def test_division_int_timedelta(self, dividend, divisor, quotient): + # If either divisor is 0 or quotient is Nat, check for division by 0 + if divisor and (isinstance(quotient, int) or not np.isnat(quotient)): + msg = "Timedelta floor division check" + assert dividend // divisor == quotient, msg + + # Test for arrays as well + msg = "Timedelta arrays floor division check" + dividend_array = np.array([dividend]*5) + quotient_array = np.array([quotient]*5) + assert all(dividend_array // divisor == quotient_array), msg + else: + if IS_WASM: + pytest.skip("fp errors don't work in wasm") + with np.errstate(divide='raise', invalid='raise'): + with pytest.raises(FloatingPointError): + dividend // divisor + + def test_division_complex(self): + # check that implementation is correct + msg = "Complex division implementation check" + x = np.array([1. + 1.*1j, 1. + .5*1j, 1. + 2.*1j], dtype=np.complex128) + assert_almost_equal(x**2/x, x, err_msg=msg) + # check overflow, underflow + msg = "Complex division overflow/underflow check" + x = np.array([1.e+110, 1.e-110], dtype=np.complex128) + y = x**2/x + assert_almost_equal(y/x, [1, 1], err_msg=msg) + + def test_zero_division_complex(self): + with np.errstate(invalid="ignore", divide="ignore"): + x = np.array([0.0], dtype=np.complex128) + y = 1.0/x + assert_(np.isinf(y)[0]) + y = complex(np.inf, np.nan)/x + assert_(np.isinf(y)[0]) + y = complex(np.nan, np.inf)/x + assert_(np.isinf(y)[0]) + y = complex(np.inf, np.inf)/x + assert_(np.isinf(y)[0]) + y = 0.0/x + assert_(np.isnan(y)[0]) + + def test_floor_division_complex(self): + # check that floor division, divmod and remainder raises type errors + x = np.array([.9 + 1j, -.1 + 1j, .9 + .5*1j, .9 + 2.*1j], dtype=np.complex128) + with pytest.raises(TypeError): + x // 7 + with pytest.raises(TypeError): + np.divmod(x, 7) + with pytest.raises(TypeError): + np.remainder(x, 7) + + def test_floor_division_signed_zero(self): + # Check that the sign bit is correctly set when dividing positive and + # negative zero by one. + x = np.zeros(10) + assert_equal(np.signbit(x//1), 0) + assert_equal(np.signbit((-x)//1), 1) + + @pytest.mark.skipif(hasattr(np.__config__, "blas_ssl2_info"), + reason="gh-22982") + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize('dtype', np.typecodes['Float']) + def test_floor_division_errors(self, dtype): + fnan = np.array(np.nan, dtype=dtype) + fone = np.array(1.0, dtype=dtype) + fzer = np.array(0.0, dtype=dtype) + finf = np.array(np.inf, dtype=dtype) + # divide by zero error check + with np.errstate(divide='raise', invalid='ignore'): + assert_raises(FloatingPointError, np.floor_divide, fone, fzer) + with np.errstate(divide='ignore', invalid='raise'): + np.floor_divide(fone, fzer) + + # The following already contain a NaN and should not warn + with np.errstate(all='raise'): + np.floor_divide(fnan, fone) + np.floor_divide(fone, fnan) + np.floor_divide(fnan, fzer) + np.floor_divide(fzer, fnan) + + @pytest.mark.parametrize('dtype', np.typecodes['Float']) + def test_floor_division_corner_cases(self, dtype): + # test corner cases like 1.0//0.0 for errors and return vals + x = np.zeros(10, dtype=dtype) + y = np.ones(10, dtype=dtype) + fnan = np.array(np.nan, dtype=dtype) + fone = np.array(1.0, dtype=dtype) + fzer = np.array(0.0, dtype=dtype) + finf = np.array(np.inf, dtype=dtype) + with suppress_warnings() as sup: + sup.filter(RuntimeWarning, "invalid value encountered in floor_divide") + div = np.floor_divide(fnan, fone) + assert(np.isnan(div)), "dt: %s, div: %s" % (dt, div) + div = np.floor_divide(fone, fnan) + assert(np.isnan(div)), "dt: %s, div: %s" % (dt, div) + div = np.floor_divide(fnan, fzer) + assert(np.isnan(div)), "dt: %s, div: %s" % (dt, div) + # verify 1.0//0.0 computations return inf + with np.errstate(divide='ignore'): + z = np.floor_divide(y, x) + assert_(np.isinf(z).all()) + +def floor_divide_and_remainder(x, y): + return (np.floor_divide(x, y), np.remainder(x, y)) + + +def _signs(dt): + if dt in np.typecodes['UnsignedInteger']: + return (+1,) + else: + return (+1, -1) + + +class TestRemainder: + + def test_remainder_basic(self): + dt = np.typecodes['AllInteger'] + np.typecodes['Float'] + for op in [floor_divide_and_remainder, np.divmod]: + for dt1, dt2 in itertools.product(dt, dt): + for sg1, sg2 in itertools.product(_signs(dt1), _signs(dt2)): + fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' + msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) + a = np.array(sg1*71, dtype=dt1) + b = np.array(sg2*19, dtype=dt2) + div, rem = op(a, b) + assert_equal(div*b + rem, a, err_msg=msg) + if sg2 == -1: + assert_(b < rem <= 0, msg) + else: + assert_(b > rem >= 0, msg) + + def test_float_remainder_exact(self): + # test that float results are exact for small integers. This also + # holds for the same integers scaled by powers of two. + nlst = list(range(-127, 0)) + plst = list(range(1, 128)) + dividend = nlst + [0] + plst + divisor = nlst + plst + arg = list(itertools.product(dividend, divisor)) + tgt = list(divmod(*t) for t in arg) + + a, b = np.array(arg, dtype=int).T + # convert exact integer results from Python to float so that + # signed zero can be used, it is checked. + tgtdiv, tgtrem = np.array(tgt, dtype=float).T + tgtdiv = np.where((tgtdiv == 0.0) & ((b < 0) ^ (a < 0)), -0.0, tgtdiv) + tgtrem = np.where((tgtrem == 0.0) & (b < 0), -0.0, tgtrem) + + for op in [floor_divide_and_remainder, np.divmod]: + for dt in np.typecodes['Float']: + msg = 'op: %s, dtype: %s' % (op.__name__, dt) + fa = a.astype(dt) + fb = b.astype(dt) + div, rem = op(fa, fb) + assert_equal(div, tgtdiv, err_msg=msg) + assert_equal(rem, tgtrem, err_msg=msg) + + def test_float_remainder_roundoff(self): + # gh-6127 + dt = np.typecodes['Float'] + for op in [floor_divide_and_remainder, np.divmod]: + for dt1, dt2 in itertools.product(dt, dt): + for sg1, sg2 in itertools.product((+1, -1), (+1, -1)): + fmt = 'op: %s, dt1: %s, dt2: %s, sg1: %s, sg2: %s' + msg = fmt % (op.__name__, dt1, dt2, sg1, sg2) + a = np.array(sg1*78*6e-8, dtype=dt1) + b = np.array(sg2*6e-8, dtype=dt2) + div, rem = op(a, b) + # Equal assertion should hold when fmod is used + assert_equal(div*b + rem, a, err_msg=msg) + if sg2 == -1: + assert_(b < rem <= 0, msg) + else: + assert_(b > rem >= 0, msg) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.xfail(sys.platform.startswith("darwin"), + reason="MacOS seems to not give the correct 'invalid' warning for " + "`fmod`. Hopefully, others always do.") + @pytest.mark.parametrize('dtype', np.typecodes['Float']) + def test_float_divmod_errors(self, dtype): + # Check valid errors raised for divmod and remainder + fzero = np.array(0.0, dtype=dtype) + fone = np.array(1.0, dtype=dtype) + finf = np.array(np.inf, dtype=dtype) + fnan = np.array(np.nan, dtype=dtype) + # since divmod is combination of both remainder and divide + # ops it will set both dividebyzero and invalid flags + with np.errstate(divide='raise', invalid='ignore'): + assert_raises(FloatingPointError, np.divmod, fone, fzero) + with np.errstate(divide='ignore', invalid='raise'): + assert_raises(FloatingPointError, np.divmod, fone, fzero) + with np.errstate(invalid='raise'): + assert_raises(FloatingPointError, np.divmod, fzero, fzero) + with np.errstate(invalid='raise'): + assert_raises(FloatingPointError, np.divmod, finf, finf) + with np.errstate(divide='ignore', invalid='raise'): + assert_raises(FloatingPointError, np.divmod, finf, fzero) + with np.errstate(divide='raise', invalid='ignore'): + # inf / 0 does not set any flags, only the modulo creates a NaN + np.divmod(finf, fzero) + + @pytest.mark.skipif(hasattr(np.__config__, "blas_ssl2_info"), + reason="gh-22982") + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.xfail(sys.platform.startswith("darwin"), + reason="MacOS seems to not give the correct 'invalid' warning for " + "`fmod`. Hopefully, others always do.") + @pytest.mark.parametrize('dtype', np.typecodes['Float']) + @pytest.mark.parametrize('fn', [np.fmod, np.remainder]) + def test_float_remainder_errors(self, dtype, fn): + fzero = np.array(0.0, dtype=dtype) + fone = np.array(1.0, dtype=dtype) + finf = np.array(np.inf, dtype=dtype) + fnan = np.array(np.nan, dtype=dtype) + + # The following already contain a NaN and should not warn. + with np.errstate(all='raise'): + with pytest.raises(FloatingPointError, + match="invalid value"): + fn(fone, fzero) + fn(fnan, fzero) + fn(fzero, fnan) + fn(fone, fnan) + fn(fnan, fone) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_float_remainder_overflow(self): + a = np.finfo(np.float64).tiny + with np.errstate(over='ignore', invalid='ignore'): + div, mod = np.divmod(4, a) + np.isinf(div) + assert_(mod == 0) + with np.errstate(over='raise', invalid='ignore'): + assert_raises(FloatingPointError, np.divmod, 4, a) + with np.errstate(invalid='raise', over='ignore'): + assert_raises(FloatingPointError, np.divmod, 4, a) + + def test_float_divmod_corner_cases(self): + # check nan cases + for dt in np.typecodes['Float']: + fnan = np.array(np.nan, dtype=dt) + fone = np.array(1.0, dtype=dt) + fzer = np.array(0.0, dtype=dt) + finf = np.array(np.inf, dtype=dt) + with suppress_warnings() as sup: + sup.filter(RuntimeWarning, "invalid value encountered in divmod") + sup.filter(RuntimeWarning, "divide by zero encountered in divmod") + div, rem = np.divmod(fone, fzer) + assert(np.isinf(div)), 'dt: %s, div: %s' % (dt, rem) + assert(np.isnan(rem)), 'dt: %s, rem: %s' % (dt, rem) + div, rem = np.divmod(fzer, fzer) + assert(np.isnan(rem)), 'dt: %s, rem: %s' % (dt, rem) + assert_(np.isnan(div)), 'dt: %s, rem: %s' % (dt, rem) + div, rem = np.divmod(finf, finf) + assert(np.isnan(div)), 'dt: %s, rem: %s' % (dt, rem) + assert(np.isnan(rem)), 'dt: %s, rem: %s' % (dt, rem) + div, rem = np.divmod(finf, fzer) + assert(np.isinf(div)), 'dt: %s, rem: %s' % (dt, rem) + assert(np.isnan(rem)), 'dt: %s, rem: %s' % (dt, rem) + div, rem = np.divmod(fnan, fone) + assert(np.isnan(rem)), "dt: %s, rem: %s" % (dt, rem) + assert(np.isnan(div)), "dt: %s, rem: %s" % (dt, rem) + div, rem = np.divmod(fone, fnan) + assert(np.isnan(rem)), "dt: %s, rem: %s" % (dt, rem) + assert(np.isnan(div)), "dt: %s, rem: %s" % (dt, rem) + div, rem = np.divmod(fnan, fzer) + assert(np.isnan(rem)), "dt: %s, rem: %s" % (dt, rem) + assert(np.isnan(div)), "dt: %s, rem: %s" % (dt, rem) + + def test_float_remainder_corner_cases(self): + # Check remainder magnitude. + for dt in np.typecodes['Float']: + fone = np.array(1.0, dtype=dt) + fzer = np.array(0.0, dtype=dt) + fnan = np.array(np.nan, dtype=dt) + b = np.array(1.0, dtype=dt) + a = np.nextafter(np.array(0.0, dtype=dt), -b) + rem = np.remainder(a, b) + assert_(rem <= b, 'dt: %s' % dt) + rem = np.remainder(-a, -b) + assert_(rem >= -b, 'dt: %s' % dt) + + # Check nans, inf + with suppress_warnings() as sup: + sup.filter(RuntimeWarning, "invalid value encountered in remainder") + sup.filter(RuntimeWarning, "invalid value encountered in fmod") + for dt in np.typecodes['Float']: + fone = np.array(1.0, dtype=dt) + fzer = np.array(0.0, dtype=dt) + finf = np.array(np.inf, dtype=dt) + fnan = np.array(np.nan, dtype=dt) + rem = np.remainder(fone, fzer) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + # MSVC 2008 returns NaN here, so disable the check. + #rem = np.remainder(fone, finf) + #assert_(rem == fone, 'dt: %s, rem: %s' % (dt, rem)) + rem = np.remainder(finf, fone) + fmod = np.fmod(finf, fone) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, fmod)) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + rem = np.remainder(finf, finf) + fmod = np.fmod(finf, fone) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, fmod)) + rem = np.remainder(finf, fzer) + fmod = np.fmod(finf, fzer) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, fmod)) + rem = np.remainder(fone, fnan) + fmod = np.fmod(fone, fnan) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, fmod)) + rem = np.remainder(fnan, fzer) + fmod = np.fmod(fnan, fzer) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, rem)) + rem = np.remainder(fnan, fone) + fmod = np.fmod(fnan, fone) + assert_(np.isnan(rem), 'dt: %s, rem: %s' % (dt, rem)) + assert_(np.isnan(fmod), 'dt: %s, fmod: %s' % (dt, rem)) + + +class TestDivisionIntegerOverflowsAndDivideByZero: + result_type = namedtuple('result_type', + ['nocast', 'casted']) + helper_lambdas = { + 'zero': lambda dtype: 0, + 'min': lambda dtype: np.iinfo(dtype).min, + 'neg_min': lambda dtype: -np.iinfo(dtype).min, + 'min-zero': lambda dtype: (np.iinfo(dtype).min, 0), + 'neg_min-zero': lambda dtype: (-np.iinfo(dtype).min, 0), + } + overflow_results = { + np.remainder: result_type( + helper_lambdas['zero'], helper_lambdas['zero']), + np.fmod: result_type( + helper_lambdas['zero'], helper_lambdas['zero']), + operator.mod: result_type( + helper_lambdas['zero'], helper_lambdas['zero']), + operator.floordiv: result_type( + helper_lambdas['min'], helper_lambdas['neg_min']), + np.floor_divide: result_type( + helper_lambdas['min'], helper_lambdas['neg_min']), + np.divmod: result_type( + helper_lambdas['min-zero'], helper_lambdas['neg_min-zero']) + } + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize("dtype", np.typecodes["Integer"]) + def test_signed_division_overflow(self, dtype): + to_check = interesting_binop_operands(np.iinfo(dtype).min, -1, dtype) + for op1, op2, extractor, operand_identifier in to_check: + with pytest.warns(RuntimeWarning, match="overflow encountered"): + res = op1 // op2 + + assert res.dtype == op1.dtype + assert extractor(res) == np.iinfo(op1.dtype).min + + # Remainder is well defined though, and does not warn: + res = op1 % op2 + assert res.dtype == op1.dtype + assert extractor(res) == 0 + # Check fmod as well: + res = np.fmod(op1, op2) + assert extractor(res) == 0 + + # Divmod warns for the division part: + with pytest.warns(RuntimeWarning, match="overflow encountered"): + res1, res2 = np.divmod(op1, op2) + + assert res1.dtype == res2.dtype == op1.dtype + assert extractor(res1) == np.iinfo(op1.dtype).min + assert extractor(res2) == 0 + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize("dtype", np.typecodes["AllInteger"]) + def test_divide_by_zero(self, dtype): + # Note that the return value cannot be well defined here, but NumPy + # currently uses 0 consistently. This could be changed. + to_check = interesting_binop_operands(1, 0, dtype) + for op1, op2, extractor, operand_identifier in to_check: + with pytest.warns(RuntimeWarning, match="divide by zero"): + res = op1 // op2 + + assert res.dtype == op1.dtype + assert extractor(res) == 0 + + with pytest.warns(RuntimeWarning, match="divide by zero"): + res1, res2 = np.divmod(op1, op2) + + assert res1.dtype == res2.dtype == op1.dtype + assert extractor(res1) == 0 + assert extractor(res2) == 0 + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize("dividend_dtype", sctypes['int']) + @pytest.mark.parametrize("divisor_dtype", sctypes['int']) + @pytest.mark.parametrize("operation", + [np.remainder, np.fmod, np.divmod, np.floor_divide, + operator.mod, operator.floordiv]) + @np.errstate(divide='warn', over='warn') + def test_overflows(self, dividend_dtype, divisor_dtype, operation): + # SIMD tries to perform the operation on as many elements as possible + # that is a multiple of the register's size. We resort to the + # default implementation for the leftover elements. + # We try to cover all paths here. + arrays = [np.array([np.iinfo(dividend_dtype).min]*i, + dtype=dividend_dtype) for i in range(1, 129)] + divisor = np.array([-1], dtype=divisor_dtype) + # If dividend is a larger type than the divisor (`else` case), + # then, result will be a larger type than dividend and will not + # result in an overflow for `divmod` and `floor_divide`. + if np.dtype(dividend_dtype).itemsize >= np.dtype( + divisor_dtype).itemsize and operation in ( + np.divmod, np.floor_divide, operator.floordiv): + with pytest.warns( + RuntimeWarning, + match="overflow encountered in"): + result = operation( + dividend_dtype(np.iinfo(dividend_dtype).min), + divisor_dtype(-1) + ) + assert result == self.overflow_results[operation].nocast( + dividend_dtype) + + # Arrays + for a in arrays: + # In case of divmod, we need to flatten the result + # column first as we get a column vector of quotient and + # remainder and a normal flatten of the expected result. + with pytest.warns( + RuntimeWarning, + match="overflow encountered in"): + result = np.array(operation(a, divisor)).flatten('f') + expected_array = np.array( + [self.overflow_results[operation].nocast( + dividend_dtype)]*len(a)).flatten() + assert_array_equal(result, expected_array) + else: + # Scalars + result = operation( + dividend_dtype(np.iinfo(dividend_dtype).min), + divisor_dtype(-1) + ) + assert result == self.overflow_results[operation].casted( + dividend_dtype) + + # Arrays + for a in arrays: + # See above comment on flatten + result = np.array(operation(a, divisor)).flatten('f') + expected_array = np.array( + [self.overflow_results[operation].casted( + dividend_dtype)]*len(a)).flatten() + assert_array_equal(result, expected_array) + + +class TestCbrt: + def test_cbrt_scalar(self): + assert_almost_equal((np.cbrt(np.float32(-2.5)**3)), -2.5) + + def test_cbrt(self): + x = np.array([1., 2., -3., np.inf, -np.inf]) + assert_almost_equal(np.cbrt(x**3), x) + + assert_(np.isnan(np.cbrt(np.nan))) + assert_equal(np.cbrt(np.inf), np.inf) + assert_equal(np.cbrt(-np.inf), -np.inf) + + +class TestPower: + def test_power_float(self): + x = np.array([1., 2., 3.]) + assert_equal(x**0, [1., 1., 1.]) + assert_equal(x**1, x) + assert_equal(x**2, [1., 4., 9.]) + y = x.copy() + y **= 2 + assert_equal(y, [1., 4., 9.]) + assert_almost_equal(x**(-1), [1., 0.5, 1./3]) + assert_almost_equal(x**(0.5), [1., ncu.sqrt(2), ncu.sqrt(3)]) + + for out, inp, msg in _gen_alignment_data(dtype=np.float32, + type='unary', + max_size=11): + exp = [ncu.sqrt(i) for i in inp] + assert_almost_equal(inp**(0.5), exp, err_msg=msg) + np.sqrt(inp, out=out) + assert_equal(out, exp, err_msg=msg) + + for out, inp, msg in _gen_alignment_data(dtype=np.float64, + type='unary', + max_size=7): + exp = [ncu.sqrt(i) for i in inp] + assert_almost_equal(inp**(0.5), exp, err_msg=msg) + np.sqrt(inp, out=out) + assert_equal(out, exp, err_msg=msg) + + def test_power_complex(self): + x = np.array([1+2j, 2+3j, 3+4j]) + assert_equal(x**0, [1., 1., 1.]) + assert_equal(x**1, x) + assert_almost_equal(x**2, [-3+4j, -5+12j, -7+24j]) + assert_almost_equal(x**3, [(1+2j)**3, (2+3j)**3, (3+4j)**3]) + assert_almost_equal(x**4, [(1+2j)**4, (2+3j)**4, (3+4j)**4]) + assert_almost_equal(x**(-1), [1/(1+2j), 1/(2+3j), 1/(3+4j)]) + assert_almost_equal(x**(-2), [1/(1+2j)**2, 1/(2+3j)**2, 1/(3+4j)**2]) + assert_almost_equal(x**(-3), [(-11+2j)/125, (-46-9j)/2197, + (-117-44j)/15625]) + assert_almost_equal(x**(0.5), [ncu.sqrt(1+2j), ncu.sqrt(2+3j), + ncu.sqrt(3+4j)]) + norm = 1./((x**14)[0]) + assert_almost_equal(x**14 * norm, + [i * norm for i in [-76443+16124j, 23161315+58317492j, + 5583548873 + 2465133864j]]) + + # Ticket #836 + def assert_complex_equal(x, y): + assert_array_equal(x.real, y.real) + assert_array_equal(x.imag, y.imag) + + for z in [complex(0, np.inf), complex(1, np.inf)]: + z = np.array([z], dtype=np.complex128) + with np.errstate(invalid="ignore"): + assert_complex_equal(z**1, z) + assert_complex_equal(z**2, z*z) + assert_complex_equal(z**3, z*z*z) + + def test_power_zero(self): + # ticket #1271 + zero = np.array([0j]) + one = np.array([1+0j]) + cnan = np.array([complex(np.nan, np.nan)]) + # FIXME cinf not tested. + #cinf = np.array([complex(np.inf, 0)]) + + def assert_complex_equal(x, y): + x, y = np.asarray(x), np.asarray(y) + assert_array_equal(x.real, y.real) + assert_array_equal(x.imag, y.imag) + + # positive powers + for p in [0.33, 0.5, 1, 1.5, 2, 3, 4, 5, 6.6]: + assert_complex_equal(np.power(zero, p), zero) + + # zero power + assert_complex_equal(np.power(zero, 0), one) + with np.errstate(invalid="ignore"): + assert_complex_equal(np.power(zero, 0+1j), cnan) + + # negative power + for p in [0.33, 0.5, 1, 1.5, 2, 3, 4, 5, 6.6]: + assert_complex_equal(np.power(zero, -p), cnan) + assert_complex_equal(np.power(zero, -1+0.2j), cnan) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_zero_power_nonzero(self): + # Testing 0^{Non-zero} issue 18378 + zero = np.array([0.0+0.0j]) + cnan = np.array([complex(np.nan, np.nan)]) + + def assert_complex_equal(x, y): + assert_array_equal(x.real, y.real) + assert_array_equal(x.imag, y.imag) + + #Complex powers with positive real part will not generate a warning + assert_complex_equal(np.power(zero, 1+4j), zero) + assert_complex_equal(np.power(zero, 2-3j), zero) + #Testing zero values when real part is greater than zero + assert_complex_equal(np.power(zero, 1+1j), zero) + assert_complex_equal(np.power(zero, 1+0j), zero) + assert_complex_equal(np.power(zero, 1-1j), zero) + #Complex powers will negative real part or 0 (provided imaginary + # part is not zero) will generate a NAN and hence a RUNTIME warning + with pytest.warns(expected_warning=RuntimeWarning) as r: + assert_complex_equal(np.power(zero, -1+1j), cnan) + assert_complex_equal(np.power(zero, -2-3j), cnan) + assert_complex_equal(np.power(zero, -7+0j), cnan) + assert_complex_equal(np.power(zero, 0+1j), cnan) + assert_complex_equal(np.power(zero, 0-1j), cnan) + assert len(r) == 5 + + def test_fast_power(self): + x = np.array([1, 2, 3], np.int16) + res = x**2.0 + assert_((x**2.00001).dtype is res.dtype) + assert_array_equal(res, [1, 4, 9]) + # check the inplace operation on the casted copy doesn't mess with x + assert_(not np.may_share_memory(res, x)) + assert_array_equal(x, [1, 2, 3]) + + # Check that the fast path ignores 1-element not 0-d arrays + res = x ** np.array([[[2]]]) + assert_equal(res.shape, (1, 1, 3)) + + def test_integer_power(self): + a = np.array([15, 15], 'i8') + b = np.power(a, a) + assert_equal(b, [437893890380859375, 437893890380859375]) + + def test_integer_power_with_integer_zero_exponent(self): + dtypes = np.typecodes['Integer'] + for dt in dtypes: + arr = np.arange(-10, 10, dtype=dt) + assert_equal(np.power(arr, 0), np.ones_like(arr)) + + dtypes = np.typecodes['UnsignedInteger'] + for dt in dtypes: + arr = np.arange(10, dtype=dt) + assert_equal(np.power(arr, 0), np.ones_like(arr)) + + def test_integer_power_of_1(self): + dtypes = np.typecodes['AllInteger'] + for dt in dtypes: + arr = np.arange(10, dtype=dt) + assert_equal(np.power(1, arr), np.ones_like(arr)) + + def test_integer_power_of_zero(self): + dtypes = np.typecodes['AllInteger'] + for dt in dtypes: + arr = np.arange(1, 10, dtype=dt) + assert_equal(np.power(0, arr), np.zeros_like(arr)) + + def test_integer_to_negative_power(self): + dtypes = np.typecodes['Integer'] + for dt in dtypes: + a = np.array([0, 1, 2, 3], dtype=dt) + b = np.array([0, 1, 2, -3], dtype=dt) + one = np.array(1, dtype=dt) + minusone = np.array(-1, dtype=dt) + assert_raises(ValueError, np.power, a, b) + assert_raises(ValueError, np.power, a, minusone) + assert_raises(ValueError, np.power, one, b) + assert_raises(ValueError, np.power, one, minusone) + + def test_float_to_inf_power(self): + for dt in [np.float32, np.float64]: + a = np.array([1, 1, 2, 2, -2, -2, np.inf, -np.inf], dt) + b = np.array([np.inf, -np.inf, np.inf, -np.inf, + np.inf, -np.inf, np.inf, -np.inf], dt) + r = np.array([1, 1, np.inf, 0, np.inf, 0, np.inf, 0], dt) + assert_equal(np.power(a, b), r) + + def test_power_fast_paths(self): + # gh-26055 + for dt in [np.float32, np.float64]: + a = np.array([0, 1.1, 2, 12e12, -10., np.inf, -np.inf], dt) + expected = np.array([0.0, 1.21, 4., 1.44e+26, 100, np.inf, np.inf]) + result = np.power(a, 2.) + assert_array_max_ulp(result, expected.astype(dt), maxulp=1) + + a = np.array([0, 1.1, 2, 12e12], dt) + expected = np.sqrt(a).astype(dt) + result = np.power(a, 0.5) + assert_array_max_ulp(result, expected, maxulp=1) + + +class TestFloat_power: + def test_type_conversion(self): + arg_type = '?bhilBHILefdgFDG' + res_type = 'ddddddddddddgDDG' + for dtin, dtout in zip(arg_type, res_type): + msg = "dtin: %s, dtout: %s" % (dtin, dtout) + arg = np.ones(1, dtype=dtin) + res = np.float_power(arg, arg) + assert_(res.dtype.name == np.dtype(dtout).name, msg) + + +class TestLog2: + @pytest.mark.parametrize('dt', ['f', 'd', 'g']) + def test_log2_values(self, dt): + x = [1, 2, 4, 8, 16, 32, 64, 128, 256, 512, 1024] + y = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_almost_equal(np.log2(xf), yf) + + @pytest.mark.parametrize("i", range(1, 65)) + def test_log2_ints(self, i): + # a good log2 implementation should provide this, + # might fail on OS with bad libm + v = np.log2(2.**i) + assert_equal(v, float(i), err_msg='at exponent %d' % i) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_log2_special(self): + assert_equal(np.log2(1.), 0.) + assert_equal(np.log2(np.inf), np.inf) + assert_(np.isnan(np.log2(np.nan))) + + with warnings.catch_warnings(record=True) as w: + warnings.filterwarnings('always', '', RuntimeWarning) + assert_(np.isnan(np.log2(-1.))) + assert_(np.isnan(np.log2(-np.inf))) + assert_equal(np.log2(0.), -np.inf) + assert_(w[0].category is RuntimeWarning) + assert_(w[1].category is RuntimeWarning) + assert_(w[2].category is RuntimeWarning) + + +class TestExp2: + def test_exp2_values(self): + x = [1, 2, 4, 8, 16, 32, 64, 128, 256, 512, 1024] + y = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + for dt in ['f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_almost_equal(np.exp2(yf), xf) + + +class TestLogAddExp2(_FilterInvalids): + # Need test for intermediate precisions + def test_logaddexp2_values(self): + x = [1, 2, 3, 4, 5] + y = [5, 4, 3, 2, 1] + z = [6, 6, 6, 6, 6] + for dt, dec_ in zip(['f', 'd', 'g'], [6, 15, 15]): + xf = np.log2(np.array(x, dtype=dt)) + yf = np.log2(np.array(y, dtype=dt)) + zf = np.log2(np.array(z, dtype=dt)) + assert_almost_equal(np.logaddexp2(xf, yf), zf, decimal=dec_) + + def test_logaddexp2_range(self): + x = [1000000, -1000000, 1000200, -1000200] + y = [1000200, -1000200, 1000000, -1000000] + z = [1000200, -1000000, 1000200, -1000000] + for dt in ['f', 'd', 'g']: + logxf = np.array(x, dtype=dt) + logyf = np.array(y, dtype=dt) + logzf = np.array(z, dtype=dt) + assert_almost_equal(np.logaddexp2(logxf, logyf), logzf) + + def test_inf(self): + inf = np.inf + x = [inf, -inf, inf, -inf, inf, 1, -inf, 1] + y = [inf, inf, -inf, -inf, 1, inf, 1, -inf] + z = [inf, inf, inf, -inf, inf, inf, 1, 1] + with np.errstate(invalid='raise'): + for dt in ['f', 'd', 'g']: + logxf = np.array(x, dtype=dt) + logyf = np.array(y, dtype=dt) + logzf = np.array(z, dtype=dt) + assert_equal(np.logaddexp2(logxf, logyf), logzf) + + def test_nan(self): + assert_(np.isnan(np.logaddexp2(np.nan, np.inf))) + assert_(np.isnan(np.logaddexp2(np.inf, np.nan))) + assert_(np.isnan(np.logaddexp2(np.nan, 0))) + assert_(np.isnan(np.logaddexp2(0, np.nan))) + assert_(np.isnan(np.logaddexp2(np.nan, np.nan))) + + def test_reduce(self): + assert_equal(np.logaddexp2.identity, -np.inf) + assert_equal(np.logaddexp2.reduce([]), -np.inf) + assert_equal(np.logaddexp2.reduce([-np.inf]), -np.inf) + assert_equal(np.logaddexp2.reduce([-np.inf, 0]), 0) + + +class TestLog: + def test_log_values(self): + x = [1, 2, 4, 8, 16, 32, 64, 128, 256, 512, 1024] + y = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + for dt in ['f', 'd', 'g']: + log2_ = 0.69314718055994530943 + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt)*log2_ + assert_almost_equal(np.log(xf), yf) + + # test aliasing(issue #17761) + x = np.array([2, 0.937500, 3, 0.947500, 1.054697]) + xf = np.log(x) + assert_almost_equal(np.log(x, out=x), xf) + + def test_log_values_maxofdtype(self): + # test log() of max for dtype does not raise + dtypes = [np.float32, np.float64] + # This is failing at least on linux aarch64 (see gh-25460), and on most + # other non x86-64 platforms checking `longdouble` isn't too useful as + # it's an alias for float64. + if platform.machine() == 'x86_64': + dtypes += [np.longdouble] + + for dt in dtypes: + with np.errstate(all='raise'): + x = np.finfo(dt).max + np.log(x) + + def test_log_strides(self): + np.random.seed(42) + strides = np.array([-4,-3,-2,-1,1,2,3,4]) + sizes = np.arange(2,100) + for ii in sizes: + x_f64 = np.float64(np.random.uniform(low=0.01, high=100.0,size=ii)) + x_special = x_f64.copy() + x_special[3:-1:4] = 1.0 + y_true = np.log(x_f64) + y_special = np.log(x_special) + for jj in strides: + assert_array_almost_equal_nulp(np.log(x_f64[::jj]), y_true[::jj], nulp=2) + assert_array_almost_equal_nulp(np.log(x_special[::jj]), y_special[::jj], nulp=2) + + # Reference values were computed with mpmath, with mp.dps = 200. + @pytest.mark.parametrize( + 'z, wref', + [(1 + 1e-12j, 5e-25 + 1e-12j), + (1.000000000000001 + 3e-08j, + 1.5602230246251546e-15 + 2.999999999999996e-08j), + (0.9999995000000417 + 0.0009999998333333417j, + 7.831475869017683e-18 + 0.001j), + (0.9999999999999996 + 2.999999999999999e-08j, + 5.9107901499372034e-18 + 3e-08j), + (0.99995000042 - 0.009999833j, + -7.015159763822903e-15 - 0.009999999665816696j)], + ) + def test_log_precision_float64(self, z, wref): + w = np.log(z) + assert_allclose(w, wref, rtol=1e-15) + + # Reference values were computed with mpmath, with mp.dps = 200. + @pytest.mark.parametrize( + 'z, wref', + [(np.complex64(1.0 + 3e-6j), np.complex64(4.5e-12+3e-06j)), + (np.complex64(1.0 - 2e-5j), np.complex64(1.9999999e-10 - 2e-5j)), + (np.complex64(0.9999999 + 1e-06j), + np.complex64(-1.192088e-07+1.0000001e-06j))], + ) + def test_log_precision_float32(self, z, wref): + w = np.log(z) + assert_allclose(w, wref, rtol=1e-6) + + +class TestExp: + def test_exp_values(self): + x = [1, 2, 4, 8, 16, 32, 64, 128, 256, 512, 1024] + y = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10] + for dt in ['f', 'd', 'g']: + log2_ = 0.69314718055994530943 + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt)*log2_ + assert_almost_equal(np.exp(yf), xf) + + def test_exp_strides(self): + np.random.seed(42) + strides = np.array([-4,-3,-2,-1,1,2,3,4]) + sizes = np.arange(2,100) + for ii in sizes: + x_f64 = np.float64(np.random.uniform(low=0.01, high=709.1,size=ii)) + y_true = np.exp(x_f64) + for jj in strides: + assert_array_almost_equal_nulp(np.exp(x_f64[::jj]), y_true[::jj], nulp=2) + +class TestSpecialFloats: + def test_exp_values(self): + with np.errstate(under='raise', over='raise'): + x = [np.nan, np.nan, np.inf, 0.] + y = [np.nan, -np.nan, np.inf, -np.inf] + for dt in ['e', 'f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_equal(np.exp(yf), xf) + + # See: https://github.com/numpy/numpy/issues/19192 + @pytest.mark.xfail( + _glibc_older_than("2.17"), + reason="Older glibc versions may not raise appropriate FP exceptions" + ) + def test_exp_exceptions(self): + with np.errstate(over='raise'): + assert_raises(FloatingPointError, np.exp, np.float16(11.0899)) + assert_raises(FloatingPointError, np.exp, np.float32(100.)) + assert_raises(FloatingPointError, np.exp, np.float32(1E19)) + assert_raises(FloatingPointError, np.exp, np.float64(800.)) + assert_raises(FloatingPointError, np.exp, np.float64(1E19)) + + with np.errstate(under='raise'): + assert_raises(FloatingPointError, np.exp, np.float16(-17.5)) + assert_raises(FloatingPointError, np.exp, np.float32(-1000.)) + assert_raises(FloatingPointError, np.exp, np.float32(-1E19)) + assert_raises(FloatingPointError, np.exp, np.float64(-1000.)) + assert_raises(FloatingPointError, np.exp, np.float64(-1E19)) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_log_values(self): + with np.errstate(all='ignore'): + x = [np.nan, np.nan, np.inf, np.nan, -np.inf, np.nan] + y = [np.nan, -np.nan, np.inf, -np.inf, 0.0, -1.0] + y1p = [np.nan, -np.nan, np.inf, -np.inf, -1.0, -2.0] + for dt in ['e', 'f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + yf1p = np.array(y1p, dtype=dt) + assert_equal(np.log(yf), xf) + assert_equal(np.log2(yf), xf) + assert_equal(np.log10(yf), xf) + assert_equal(np.log1p(yf1p), xf) + + with np.errstate(divide='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.log, + np.array(0.0, dtype=dt)) + assert_raises(FloatingPointError, np.log2, + np.array(0.0, dtype=dt)) + assert_raises(FloatingPointError, np.log10, + np.array(0.0, dtype=dt)) + assert_raises(FloatingPointError, np.log1p, + np.array(-1.0, dtype=dt)) + + with np.errstate(invalid='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.log, + np.array(-np.inf, dtype=dt)) + assert_raises(FloatingPointError, np.log, + np.array(-1.0, dtype=dt)) + assert_raises(FloatingPointError, np.log2, + np.array(-np.inf, dtype=dt)) + assert_raises(FloatingPointError, np.log2, + np.array(-1.0, dtype=dt)) + assert_raises(FloatingPointError, np.log10, + np.array(-np.inf, dtype=dt)) + assert_raises(FloatingPointError, np.log10, + np.array(-1.0, dtype=dt)) + assert_raises(FloatingPointError, np.log1p, + np.array(-np.inf, dtype=dt)) + assert_raises(FloatingPointError, np.log1p, + np.array(-2.0, dtype=dt)) + + # See https://github.com/numpy/numpy/issues/18005 + with assert_no_warnings(): + a = np.array(1e9, dtype='float32') + np.log(a) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize('dtype', ['e', 'f', 'd', 'g']) + def test_sincos_values(self, dtype): + with np.errstate(all='ignore'): + x = [np.nan, np.nan, np.nan, np.nan] + y = [np.nan, -np.nan, np.inf, -np.inf] + xf = np.array(x, dtype=dtype) + yf = np.array(y, dtype=dtype) + assert_equal(np.sin(yf), xf) + assert_equal(np.cos(yf), xf) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.xfail( + sys.platform.startswith("darwin"), + reason="underflow is triggered for scalar 'sin'" + ) + def test_sincos_underflow(self): + with np.errstate(under='raise'): + underflow_trigger = np.array( + float.fromhex("0x1.f37f47a03f82ap-511"), + dtype=np.float64 + ) + np.sin(underflow_trigger) + np.cos(underflow_trigger) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.parametrize('callable', [np.sin, np.cos]) + @pytest.mark.parametrize('dtype', ['e', 'f', 'd']) + @pytest.mark.parametrize('value', [np.inf, -np.inf]) + def test_sincos_errors(self, callable, dtype, value): + with np.errstate(invalid='raise'): + assert_raises(FloatingPointError, callable, + np.array([value], dtype=dtype)) + + @pytest.mark.parametrize('callable', [np.sin, np.cos]) + @pytest.mark.parametrize('dtype', ['f', 'd']) + @pytest.mark.parametrize('stride', [-1, 1, 2, 4, 5]) + def test_sincos_overlaps(self, callable, dtype, stride): + N = 100 + M = N // abs(stride) + rng = np.random.default_rng(42) + x = rng.standard_normal(N, dtype) + y = callable(x[::stride]) + callable(x[::stride], out=x[:M]) + assert_equal(x[:M], y) + + @pytest.mark.parametrize('dt', ['e', 'f', 'd', 'g']) + def test_sqrt_values(self, dt): + with np.errstate(all='ignore'): + x = [np.nan, np.nan, np.inf, np.nan, 0.] + y = [np.nan, -np.nan, np.inf, -np.inf, 0.] + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_equal(np.sqrt(yf), xf) + + # with np.errstate(invalid='raise'): + # assert_raises( + # FloatingPointError, np.sqrt, np.array(-100., dtype=dt) + # ) + + def test_abs_values(self): + x = [np.nan, np.nan, np.inf, np.inf, 0., 0., 1.0, 1.0] + y = [np.nan, -np.nan, np.inf, -np.inf, 0., -0., -1.0, 1.0] + for dt in ['e', 'f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_equal(np.abs(yf), xf) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_square_values(self): + x = [np.nan, np.nan, np.inf, np.inf] + y = [np.nan, -np.nan, np.inf, -np.inf] + with np.errstate(all='ignore'): + for dt in ['e', 'f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_equal(np.square(yf), xf) + + with np.errstate(over='raise'): + assert_raises(FloatingPointError, np.square, + np.array(1E3, dtype='e')) + assert_raises(FloatingPointError, np.square, + np.array(1E32, dtype='f')) + assert_raises(FloatingPointError, np.square, + np.array(1E200, dtype='d')) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_reciprocal_values(self): + with np.errstate(all='ignore'): + x = [np.nan, np.nan, 0.0, -0.0, np.inf, -np.inf] + y = [np.nan, -np.nan, np.inf, -np.inf, 0., -0.] + for dt in ['e', 'f', 'd', 'g']: + xf = np.array(x, dtype=dt) + yf = np.array(y, dtype=dt) + assert_equal(np.reciprocal(yf), xf) + + with np.errstate(divide='raise'): + for dt in ['e', 'f', 'd', 'g']: + assert_raises(FloatingPointError, np.reciprocal, + np.array(-0.0, dtype=dt)) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_tan(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, 0.0, -0.0, np.inf, -np.inf] + out = [np.nan, np.nan, 0.0, -0.0, np.nan, np.nan] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.tan(in_arr), out_arr) + + with np.errstate(invalid='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.tan, + np.array(np.inf, dtype=dt)) + assert_raises(FloatingPointError, np.tan, + np.array(-np.inf, dtype=dt)) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_arcsincos(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.nan, np.nan] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.arcsin(in_arr), out_arr) + assert_equal(np.arccos(in_arr), out_arr) + + for callable in [np.arcsin, np.arccos]: + for value in [np.inf, -np.inf, 2.0, -2.0]: + for dt in ['e', 'f', 'd']: + with np.errstate(invalid='raise'): + assert_raises(FloatingPointError, callable, + np.array(value, dtype=dt)) + + def test_arctan(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan] + out = [np.nan, np.nan] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.arctan(in_arr), out_arr) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_sinh(self): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.inf, -np.inf] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.sinh(in_arr), out_arr) + + with np.errstate(over='raise'): + assert_raises(FloatingPointError, np.sinh, + np.array(12.0, dtype='e')) + assert_raises(FloatingPointError, np.sinh, + np.array(120.0, dtype='f')) + assert_raises(FloatingPointError, np.sinh, + np.array(1200.0, dtype='d')) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + @pytest.mark.skipif('bsd' in sys.platform, + reason="fallback implementation may not raise, see gh-2487") + def test_cosh(self): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.inf, np.inf] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.cosh(in_arr), out_arr) + + with np.errstate(over='raise'): + assert_raises(FloatingPointError, np.cosh, + np.array(12.0, dtype='e')) + assert_raises(FloatingPointError, np.cosh, + np.array(120.0, dtype='f')) + assert_raises(FloatingPointError, np.cosh, + np.array(1200.0, dtype='d')) + + def test_tanh(self): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, 1.0, -1.0] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_array_max_ulp(np.tanh(in_arr), out_arr, 3) + + def test_arcsinh(self): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.inf, -np.inf] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.arcsinh(in_arr), out_arr) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_arccosh(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, np.inf, -np.inf, 1.0, 0.0] + out = [np.nan, np.nan, np.inf, np.nan, 0.0, np.nan] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.arccosh(in_arr), out_arr) + + for value in [0.0, -np.inf]: + with np.errstate(invalid='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.arccosh, + np.array(value, dtype=dt)) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_arctanh(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, np.inf, -np.inf, 1.0, -1.0, 2.0] + out = [np.nan, np.nan, np.nan, np.nan, np.inf, -np.inf, np.nan] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.arctanh(in_arr), out_arr) + + for value in [1.01, np.inf, -np.inf, 1.0, -1.0]: + with np.errstate(invalid='raise', divide='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.arctanh, + np.array(value, dtype=dt)) + + # Make sure glibc < 2.18 atanh is not used, issue 25087 + assert np.signbit(np.arctanh(-1j).real) + + # See: https://github.com/numpy/numpy/issues/20448 + @pytest.mark.xfail( + _glibc_older_than("2.17"), + reason="Older glibc versions may not raise appropriate FP exceptions" + ) + def test_exp2(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.inf, 0.0] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.exp2(in_arr), out_arr) + + for value in [2000.0, -2000.0]: + with np.errstate(over='raise', under='raise'): + for dt in ['e', 'f', 'd']: + assert_raises(FloatingPointError, np.exp2, + np.array(value, dtype=dt)) + + @pytest.mark.skipif(IS_WASM, reason="fp errors don't work in wasm") + def test_expm1(self): + with np.errstate(all='ignore'): + in_ = [np.nan, -np.nan, np.inf, -np.inf] + out = [np.nan, np.nan, np.inf, -1.0] + for dt in ['e', 'f', 'd']: + in_arr = np.array(in_, dtype=dt) + out_arr = np.array(out, dtype=dt) + assert_equal(np.expm1(in_arr), out_arr) + + for value in [200.0, 2000.0]: + with np.errstate(over='raise'): + for dt in ['e', 'f']: + assert_raises(FloatingPointError, np.expm1, + np.array(value, dtype=dt)) + + # test to ensure no spurious FP exceptions are raised due to SIMD + INF_INVALID_ERR = [ + np.cos, np.sin, np.tan, np.arccos, np.arcsin, np.spacing, np.arctanh + ] + NEG_INVALID_ERR = [ + np.log, np.log2, np.log10, np.log1p, np.sqrt, np.arccosh, + np.arctanh + ] + ONE_INVALID_ERR = [ + np.arctanh, + ] + LTONE_INVALID_ERR = [ + np.arccosh, + ] + BYZERO_ERR = [ + np.log, np.log2, np.log10, np.reciprocal, np.arccosh + ] + + @pytest.mark.parametrize("ufunc", UFUNCS_UNARY_FP) + @pytest.mark.parametrize("dtype", ('e', 'f', 'd')) + @pytest.mark.parametrize("data, escape", ( + ([0.03], LTONE_INVALID_ERR), + ([0.03]*32, LTONE_INVALID_ERR), + # neg + ([-1.0], NEG_INVALID_ERR), + ([-1.0]*32, NEG_INVALID_ERR), + # flat + ([1.0], ONE_INVALID_ERR), + ([1.0]*32, ONE_INVALID_ERR), + # zero + ([0.0], BYZERO_ERR), + ([0.0]*32, BYZERO_ERR), + ([-0.0], BYZERO_ERR), + ([-0.0]*32, BYZERO_ERR), + # nan + ([0.5, 0.5, 0.5, np.nan], LTONE_INVALID_ERR), + ([0.5, 0.5, 0.5, np.nan]*32, LTONE_INVALID_ERR), + ([np.nan, 1.0, 1.0, 1.0], ONE_INVALID_ERR), + ([np.nan, 1.0, 1.0, 1.0]*32, ONE_INVALID_ERR), + ([np.nan], []), + ([np.nan]*32, []), + # inf + ([0.5, 0.5, 0.5, np.inf], INF_INVALID_ERR + LTONE_INVALID_ERR), + ([0.5, 0.5, 0.5, np.inf]*32, INF_INVALID_ERR + LTONE_INVALID_ERR), + ([np.inf, 1.0, 1.0, 1.0], INF_INVALID_ERR), + ([np.inf, 1.0, 1.0, 1.0]*32, INF_INVALID_ERR), + ([np.inf], INF_INVALID_ERR), + ([np.inf]*32, INF_INVALID_ERR), + # ninf + ([0.5, 0.5, 0.5, -np.inf], + NEG_INVALID_ERR + INF_INVALID_ERR + LTONE_INVALID_ERR), + ([0.5, 0.5, 0.5, -np.inf]*32, + NEG_INVALID_ERR + INF_INVALID_ERR + LTONE_INVALID_ERR), + ([-np.inf, 1.0, 1.0, 1.0], NEG_INVALID_ERR + INF_INVALID_ERR), + ([-np.inf, 1.0, 1.0, 1.0]*32, NEG_INVALID_ERR + INF_INVALID_ERR), + ([-np.inf], NEG_INVALID_ERR + INF_INVALID_ERR), + ([-np.inf]*32, NEG_INVALID_ERR + INF_INVALID_ERR), + )) + def test_unary_spurious_fpexception(self, ufunc, dtype, data, escape): + if escape and ufunc in escape: + return + # FIXME: NAN raises FP invalid exception: + # - ceil/float16 on MSVC:32-bit + # - spacing/float16 on almost all platforms + if ufunc in (np.spacing, np.ceil) and dtype == 'e': + return + array = np.array(data, dtype=dtype) + with assert_no_warnings(): + ufunc(array) + + @pytest.mark.parametrize("dtype", ('e', 'f', 'd')) + def test_divide_spurious_fpexception(self, dtype): + dt = np.dtype(dtype) + dt_info = np.finfo(dt) + subnorm = dt_info.smallest_subnormal + # Verify a bug fix caused due to filling the remaining lanes of the + # partially loaded dividend SIMD vector with ones, which leads to + # raising an overflow warning when the divisor is denormal. + # see https://github.com/numpy/numpy/issues/25097 + with assert_no_warnings(): + np.zeros(128 + 1, dtype=dt) / subnorm + +class TestFPClass: + @pytest.mark.parametrize("stride", [-5, -4, -3, -2, -1, 1, + 2, 4, 5, 6, 7, 8, 9, 10]) + def test_fpclass(self, stride): + arr_f64 = np.array([np.nan, -np.nan, np.inf, -np.inf, -1.0, 1.0, -0.0, 0.0, 2.2251e-308, -2.2251e-308], dtype='d') + arr_f32 = np.array([np.nan, -np.nan, np.inf, -np.inf, -1.0, 1.0, -0.0, 0.0, 1.4013e-045, -1.4013e-045], dtype='f') + nan = np.array([True, True, False, False, False, False, False, False, False, False]) + inf = np.array([False, False, True, True, False, False, False, False, False, False]) + sign = np.array([False, True, False, True, True, False, True, False, False, True]) + finite = np.array([False, False, False, False, True, True, True, True, True, True]) + assert_equal(np.isnan(arr_f32[::stride]), nan[::stride]) + assert_equal(np.isnan(arr_f64[::stride]), nan[::stride]) + assert_equal(np.isinf(arr_f32[::stride]), inf[::stride]) + assert_equal(np.isinf(arr_f64[::stride]), inf[::stride]) + if platform.machine() == 'riscv64': + # On RISC-V, many operations that produce NaNs, such as converting + # a -NaN from f64 to f32, return a canonical NaN. The canonical + # NaNs are always positive. See section 11.3 NaN Generation and + # Propagation of the RISC-V Unprivileged ISA for more details. + # We disable the sign test on riscv64 for -np.nan as we + # cannot assume that its sign will be honoured in these tests. + arr_f64_rv = np.copy(arr_f64) + arr_f32_rv = np.copy(arr_f32) + arr_f64_rv[1] = -1.0 + arr_f32_rv[1] = -1.0 + assert_equal(np.signbit(arr_f32_rv[::stride]), sign[::stride]) + assert_equal(np.signbit(arr_f64_rv[::stride]), sign[::stride]) + else: + assert_equal(np.signbit(arr_f32[::stride]), sign[::stride]) + assert_equal(np.signbit(arr_f64[::stride]), sign[::stride]) + assert_equal(np.isfinite(arr_f32[::stride]), finite[::stride]) + assert_equal(np.isfinite(arr_f64[::stride]), finite[::stride]) + + @pytest.mark.parametrize("dtype", ['d', 'f']) + def test_fp_noncontiguous(self, dtype): + data = np.array([np.nan, -np.nan, np.inf, -np.inf, -1.0, + 1.0, -0.0, 0.0, 2.2251e-308, + -2.2251e-308], dtype=dtype) + nan = np.array([True, True, False, False, False, False, + False, False, False, False]) + inf = np.array([False, False, True, True, False, False, + False, False, False, False]) + sign = np.array([False, True, False, True, True, False, + True, False, False, True]) + finite = np.array([False, False, False, False, True, True, + True, True, True, True]) + out = np.ndarray(data.shape, dtype='bool') + ncontig_in = data[1::3] + ncontig_out = out[1::3] + contig_in = np.array(ncontig_in) + + if platform.machine() == 'riscv64': + # Disable the -np.nan signbit tests on riscv64. See comments in + # test_fpclass for more details. + data_rv = np.copy(data) + data_rv[1] = -1.0 + ncontig_sign_in = data_rv[1::3] + contig_sign_in = np.array(ncontig_sign_in) + else: + ncontig_sign_in = ncontig_in + contig_sign_in = contig_in + + assert_equal(ncontig_in.flags.c_contiguous, False) + assert_equal(ncontig_out.flags.c_contiguous, False) + assert_equal(contig_in.flags.c_contiguous, True) + assert_equal(ncontig_sign_in.flags.c_contiguous, False) + assert_equal(contig_sign_in.flags.c_contiguous, True) + # ncontig in, ncontig out + assert_equal(np.isnan(ncontig_in, out=ncontig_out), nan[1::3]) + assert_equal(np.isinf(ncontig_in, out=ncontig_out), inf[1::3]) + assert_equal(np.signbit(ncontig_sign_in, out=ncontig_out), sign[1::3]) + assert_equal(np.isfinite(ncontig_in, out=ncontig_out), finite[1::3]) + # contig in, ncontig out + assert_equal(np.isnan(contig_in, out=ncontig_out), nan[1::3]) + assert_equal(np.isinf(contig_in, out=ncontig_out), inf[1::3]) + assert_equal(np.signbit(contig_sign_in, out=ncontig_out), sign[1::3]) + assert_equal(np.isfinite(contig_in, out=ncontig_out), finite[1::3]) + # ncontig in, contig out + assert_equal(np.isnan(ncontig_in), nan[1::3]) + assert_equal(np.isinf(ncontig_in), inf[1::3]) + assert_equal(np.signbit(ncontig_sign_in), sign[1::3]) + assert_equal(np.isfinite(ncontig_in), finite[1::3]) + # contig in, contig out, nd stride + data_split = np.array(np.array_split(data, 2)) + nan_split = np.array(np.array_split(nan, 2)) + inf_split = np.array(np.array_split(inf, 2)) + sign_split = np.array(np.array_split(sign, 2)) + finite_split = np.array(np.array_split(finite, 2)) + assert_equal(np.isnan(data_split), nan_split) + assert_equal(np.isinf(data_split), inf_split) + if platform.machine() == 'riscv64': + data_split_rv = np.array(np.array_split(data_rv, 2)) + assert_equal(np.signbit(data_split_rv), sign_split) + else: + assert_equal(np.signbit(data_split), sign_split) + assert_equal(np.isfinite(data_split), finite_split) + +class TestLDExp: + @pytest.mark.parametrize("stride", [-4,-2,-1,1,2,4]) + @pytest.mark.parametrize("dtype", ['f', 'd']) + def test_ldexp(self, dtype, stride): + mant = np.array([0.125, 0.25, 0.5, 1., 1., 2., 4., 8.], dtype=dtype) + exp = np.array([3, 2, 1, 0, 0, -1, -2, -3], dtype='i') + out = np.zeros(8, dtype=dtype) + assert_equal(np.ldexp(mant[::stride], exp[::stride], out=out[::stride]), np.ones(8, dtype=dtype)[::stride]) + assert_equal(out[::stride], np.ones(8, dtype=dtype)[::stride]) + +class TestFRExp: + @pytest.mark.parametrize("stride", [-4,-2,-1,1,2,4]) + @pytest.mark.parametrize("dtype", ['f', 'd']) + @pytest.mark.skipif(not sys.platform.startswith('linux'), + reason="np.frexp gives different answers for NAN/INF on windows and linux") + @pytest.mark.xfail(IS_MUSL, reason="gh23049") + def test_frexp(self, dtype, stride): + arr = np.array([np.nan, np.nan, np.inf, -np.inf, 0.0, -0.0, 1.0, -1.0], dtype=dtype) + mant_true = np.array([np.nan, np.nan, np.inf, -np.inf, 0.0, -0.0, 0.5, -0.5], dtype=dtype) + exp_true = np.array([0, 0, 0, 0, 0, 0, 1, 1], dtype='i') + out_mant = np.ones(8, dtype=dtype) + out_exp = 2*np.ones(8, dtype='i') + mant, exp = np.frexp(arr[::stride], out=(out_mant[::stride], out_exp[::stride])) + assert_equal(mant_true[::stride], mant) + assert_equal(exp_true[::stride], exp) + assert_equal(out_mant[::stride], mant_true[::stride]) + assert_equal(out_exp[::stride], exp_true[::stride]) + +# func : [maxulperror, low, high] +avx_ufuncs = {'sqrt' :[1, 0., 100.], + 'absolute' :[0, -100., 100.], + 'reciprocal' :[1, 1., 100.], + 'square' :[1, -100., 100.], + 'rint' :[0, -100., 100.], + 'floor' :[0, -100., 100.], + 'ceil' :[0, -100., 100.], + 'trunc' :[0, -100., 100.]} + +class TestAVXUfuncs: + def test_avx_based_ufunc(self): + strides = np.array([-4,-3,-2,-1,1,2,3,4]) + np.random.seed(42) + for func, prop in avx_ufuncs.items(): + maxulperr = prop[0] + minval = prop[1] + maxval = prop[2] + # various array sizes to ensure masking in AVX is tested + for size in range(1,32): + myfunc = getattr(np, func) + x_f32 = np.random.uniform(low=minval, high=maxval, + size=size).astype(np.float32) + x_f64 = x_f32.astype(np.float64) + x_f128 = x_f32.astype(np.longdouble) + y_true128 = myfunc(x_f128) + if maxulperr == 0: + assert_equal(myfunc(x_f32), y_true128.astype(np.float32)) + assert_equal(myfunc(x_f64), y_true128.astype(np.float64)) + else: + assert_array_max_ulp(myfunc(x_f32), + y_true128.astype(np.float32), + maxulp=maxulperr) + assert_array_max_ulp(myfunc(x_f64), + y_true128.astype(np.float64), + maxulp=maxulperr) + # various strides to test gather instruction + if size > 1: + y_true32 = myfunc(x_f32) + y_true64 = myfunc(x_f64) + for jj in strides: + assert_equal(myfunc(x_f64[::jj]), y_true64[::jj]) + assert_equal(myfunc(x_f32[::jj]), y_true32[::jj]) + +class TestAVXFloat32Transcendental: + def test_exp_float32(self): + np.random.seed(42) + x_f32 = np.float32(np.random.uniform(low=0.0,high=88.1,size=1000000)) + x_f64 = np.float64(x_f32) + assert_array_max_ulp(np.exp(x_f32), np.float32(np.exp(x_f64)), maxulp=3) + + def test_log_float32(self): + np.random.seed(42) + x_f32 = np.float32(np.random.uniform(low=0.0,high=1000,size=1000000)) + x_f64 = np.float64(x_f32) + assert_array_max_ulp(np.log(x_f32), np.float32(np.log(x_f64)), maxulp=4) + + def test_sincos_float32(self): + np.random.seed(42) + N = 1000000 + M = np.int_(N/20) + index = np.random.randint(low=0, high=N, size=M) + x_f32 = np.float32(np.random.uniform(low=-100.,high=100.,size=N)) + if not _glibc_older_than("2.17"): + # test coverage for elements > 117435.992f for which glibc is used + # this is known to be problematic on old glibc, so skip it there + x_f32[index] = np.float32(10E+10*np.random.rand(M)) + x_f64 = np.float64(x_f32) + assert_array_max_ulp(np.sin(x_f32), np.float32(np.sin(x_f64)), maxulp=2) + assert_array_max_ulp(np.cos(x_f32), np.float32(np.cos(x_f64)), maxulp=2) + # test aliasing(issue #17761) + tx_f32 = x_f32.copy() + assert_array_max_ulp(np.sin(x_f32, out=x_f32), np.float32(np.sin(x_f64)), maxulp=2) + assert_array_max_ulp(np.cos(tx_f32, out=tx_f32), np.float32(np.cos(x_f64)), maxulp=2) + + def test_strided_float32(self): + np.random.seed(42) + strides = np.array([-4,-3,-2,-1,1,2,3,4]) + sizes = np.arange(2,100) + for ii in sizes: + x_f32 = np.float32(np.random.uniform(low=0.01,high=88.1,size=ii)) + x_f32_large = x_f32.copy() + x_f32_large[3:-1:4] = 120000.0 + exp_true = np.exp(x_f32) + log_true = np.log(x_f32) + sin_true = np.sin(x_f32_large) + cos_true = np.cos(x_f32_large) + for jj in strides: + assert_array_almost_equal_nulp(np.exp(x_f32[::jj]), exp_true[::jj], nulp=2) + assert_array_almost_equal_nulp(np.log(x_f32[::jj]), log_true[::jj], nulp=2) + assert_array_almost_equal_nulp(np.sin(x_f32_large[::jj]), sin_true[::jj], nulp=2) + assert_array_almost_equal_nulp(np.cos(x_f32_large[::jj]), cos_true[::jj], nulp=2) + +class TestLogAddExp(_FilterInvalids): + def test_logaddexp_values(self): + x = [1, 2, 3, 4, 5] + y = [5, 4, 3, 2, 1] + z = [6, 6, 6, 6, 6] + for dt, dec_ in zip(['f', 'd', 'g'], [6, 15, 15]): + xf = np.log(np.array(x, dtype=dt)) + yf = np.log(np.array(y, dtype=dt)) + zf = np.log(np.array(z, dtype=dt)) + assert_almost_equal(np.logaddexp(xf, yf), zf, decimal=dec_) + + def test_logaddexp_range(self): + x = [1000000, -1000000, 1000200, -1000200] + y = [1000200, -1000200, 1000000, -1000000] + z = [1000200, -1000000, 1000200, -1000000] + for dt in ['f', 'd', 'g']: + logxf = np.array(x, dtype=dt) + logyf = np.array(y, dtype=dt) + logzf = np.array(z, dtype=dt) + assert_almost_equal(np.logaddexp(logxf, logyf), logzf) + + def test_inf(self): + inf = np.inf + x = [inf, -inf, inf, -inf, inf, 1, -inf, 1] + y = [inf, inf, -inf, -inf, 1, inf, 1, -inf] + z = [inf, inf, inf, -inf, inf, inf, 1, 1] + with np.errstate(invalid='raise'): + for dt in ['f', 'd', 'g']: + logxf = np.array(x, dtype=dt) + logyf = np.array(y, dtype=dt) + logzf = np.array(z, dtype=dt) + assert_equal(np.logaddexp(logxf, logyf), logzf) + + def test_nan(self): + assert_(np.isnan(np.logaddexp(np.nan, np.inf))) + assert_(np.isnan(np.logaddexp(np.inf, np.nan))) + assert_(np.isnan(np.logaddexp(np.nan, 0))) + assert_(np.isnan(np.logaddexp(0, np.nan))) + assert_(np.isnan(np.logaddexp(np.nan, np.nan))) + + def test_reduce(self): + assert_equal(np.logaddexp.identity, -np.inf) + assert_equal(np.logaddexp.reduce([]), -np.inf) + + +class TestLog1p: + def test_log1p(self): + assert_almost_equal(ncu.log1p(0.2), ncu.log(1.2)) + assert_almost_equal(ncu.log1p(1e-6), ncu.log(1+1e-6)) + + def test_special(self): + with np.errstate(invalid="ignore", divide="ignore"): + assert_equal(ncu.log1p(np.nan), np.nan) + assert_equal(ncu.log1p(np.inf), np.inf) + assert_equal(ncu.log1p(-1.), -np.inf) + assert_equal(ncu.log1p(-2.), np.nan) + assert_equal(ncu.log1p(-np.inf), np.nan) + + +class TestExpm1: + def test_expm1(self): + assert_almost_equal(ncu.expm1(0.2), ncu.exp(0.2)-1) + assert_almost_equal(ncu.expm1(1e-6), ncu.exp(1e-6)-1) + + def test_special(self): + assert_equal(ncu.expm1(np.inf), np.inf) + assert_equal(ncu.expm1(0.), 0.) + assert_equal(ncu.expm1(-0.), -0.) + assert_equal(ncu.expm1(np.inf), np.inf) + assert_equal(ncu.expm1(-np.inf), -1.) + + def test_complex(self): + x = np.asarray(1e-12) + assert_allclose(x, ncu.expm1(x)) + x = x.astype(np.complex128) + assert_allclose(x, ncu.expm1(x)) + + +class TestHypot: + def test_simple(self): + assert_almost_equal(ncu.hypot(1, 1), ncu.sqrt(2)) + assert_almost_equal(ncu.hypot(0, 0), 0) + + def test_reduce(self): + assert_almost_equal(ncu.hypot.reduce([3.0, 4.0]), 5.0) + assert_almost_equal(ncu.hypot.reduce([3.0, 4.0, 0]), 5.0) + assert_almost_equal(ncu.hypot.reduce([9.0, 12.0, 20.0]), 25.0) + assert_equal(ncu.hypot.reduce([]), 0.0) + + +def assert_hypot_isnan(x, y): + with np.errstate(invalid='ignore'): + assert_(np.isnan(ncu.hypot(x, y)), + "hypot(%s, %s) is %s, not nan" % (x, y, ncu.hypot(x, y))) + + +def assert_hypot_isinf(x, y): + with np.errstate(invalid='ignore'): + assert_(np.isinf(ncu.hypot(x, y)), + "hypot(%s, %s) is %s, not inf" % (x, y, ncu.hypot(x, y))) + + +class TestHypotSpecialValues: + def test_nan_outputs(self): + assert_hypot_isnan(np.nan, np.nan) + assert_hypot_isnan(np.nan, 1) + + def test_nan_outputs2(self): + assert_hypot_isinf(np.nan, np.inf) + assert_hypot_isinf(np.inf, np.nan) + assert_hypot_isinf(np.inf, 0) + assert_hypot_isinf(0, np.inf) + assert_hypot_isinf(np.inf, np.inf) + assert_hypot_isinf(np.inf, 23.0) + + def test_no_fpe(self): + assert_no_warnings(ncu.hypot, np.inf, 0) + + +def assert_arctan2_isnan(x, y): + assert_(np.isnan(ncu.arctan2(x, y)), "arctan(%s, %s) is %s, not nan" % (x, y, ncu.arctan2(x, y))) + + +def assert_arctan2_ispinf(x, y): + assert_((np.isinf(ncu.arctan2(x, y)) and ncu.arctan2(x, y) > 0), "arctan(%s, %s) is %s, not +inf" % (x, y, ncu.arctan2(x, y))) + + +def assert_arctan2_isninf(x, y): + assert_((np.isinf(ncu.arctan2(x, y)) and ncu.arctan2(x, y) < 0), "arctan(%s, %s) is %s, not -inf" % (x, y, ncu.arctan2(x, y))) + + +def assert_arctan2_ispzero(x, y): + assert_((ncu.arctan2(x, y) == 0 and not np.signbit(ncu.arctan2(x, y))), "arctan(%s, %s) is %s, not +0" % (x, y, ncu.arctan2(x, y))) + + +def assert_arctan2_isnzero(x, y): + assert_((ncu.arctan2(x, y) == 0 and np.signbit(ncu.arctan2(x, y))), "arctan(%s, %s) is %s, not -0" % (x, y, ncu.arctan2(x, y))) + + +class TestArctan2SpecialValues: + def test_one_one(self): + # atan2(1, 1) returns pi/4. + assert_almost_equal(ncu.arctan2(1, 1), 0.25 * np.pi) + assert_almost_equal(ncu.arctan2(-1, 1), -0.25 * np.pi) + assert_almost_equal(ncu.arctan2(1, -1), 0.75 * np.pi) + + def test_zero_nzero(self): + # atan2(+-0, -0) returns +-pi. + assert_almost_equal(ncu.arctan2(ncu.PZERO, ncu.NZERO), np.pi) + assert_almost_equal(ncu.arctan2(ncu.NZERO, ncu.NZERO), -np.pi) + + def test_zero_pzero(self): + # atan2(+-0, +0) returns +-0. + assert_arctan2_ispzero(ncu.PZERO, ncu.PZERO) + assert_arctan2_isnzero(ncu.NZERO, ncu.PZERO) + + def test_zero_negative(self): + # atan2(+-0, x) returns +-pi for x < 0. + assert_almost_equal(ncu.arctan2(ncu.PZERO, -1), np.pi) + assert_almost_equal(ncu.arctan2(ncu.NZERO, -1), -np.pi) + + def test_zero_positive(self): + # atan2(+-0, x) returns +-0 for x > 0. + assert_arctan2_ispzero(ncu.PZERO, 1) + assert_arctan2_isnzero(ncu.NZERO, 1) + + def test_positive_zero(self): + # atan2(y, +-0) returns +pi/2 for y > 0. + assert_almost_equal(ncu.arctan2(1, ncu.PZERO), 0.5 * np.pi) + assert_almost_equal(ncu.arctan2(1, ncu.NZERO), 0.5 * np.pi) + + def test_negative_zero(self): + # atan2(y, +-0) returns -pi/2 for y < 0. + assert_almost_equal(ncu.arctan2(-1, ncu.PZERO), -0.5 * np.pi) + assert_almost_equal(ncu.arctan2(-1, ncu.NZERO), -0.5 * np.pi) + + def test_any_ninf(self): + # atan2(+-y, -infinity) returns +-pi for finite y > 0. + assert_almost_equal(ncu.arctan2(1, -np.inf), np.pi) + assert_almost_equal(ncu.arctan2(-1, -np.inf), -np.pi) + + def test_any_pinf(self): + # atan2(+-y, +infinity) returns +-0 for finite y > 0. + assert_arctan2_ispzero(1, np.inf) + assert_arctan2_isnzero(-1, np.inf) + + def test_inf_any(self): + # atan2(+-infinity, x) returns +-pi/2 for finite x. + assert_almost_equal(ncu.arctan2( np.inf, 1), 0.5 * np.pi) + assert_almost_equal(ncu.arctan2(-np.inf, 1), -0.5 * np.pi) + + def test_inf_ninf(self): + # atan2(+-infinity, -infinity) returns +-3*pi/4. + assert_almost_equal(ncu.arctan2( np.inf, -np.inf), 0.75 * np.pi) + assert_almost_equal(ncu.arctan2(-np.inf, -np.inf), -0.75 * np.pi) + + def test_inf_pinf(self): + # atan2(+-infinity, +infinity) returns +-pi/4. + assert_almost_equal(ncu.arctan2( np.inf, np.inf), 0.25 * np.pi) + assert_almost_equal(ncu.arctan2(-np.inf, np.inf), -0.25 * np.pi) + + def test_nan_any(self): + # atan2(nan, x) returns nan for any x, including inf + assert_arctan2_isnan(np.nan, np.inf) + assert_arctan2_isnan(np.inf, np.nan) + assert_arctan2_isnan(np.nan, np.nan) + + +class TestLdexp: + def _check_ldexp(self, tp): + assert_almost_equal(ncu.ldexp(np.array(2., np.float32), + np.array(3, tp)), 16.) + assert_almost_equal(ncu.ldexp(np.array(2., np.float64), + np.array(3, tp)), 16.) + assert_almost_equal(ncu.ldexp(np.array(2., np.longdouble), + np.array(3, tp)), 16.) + + def test_ldexp(self): + # The default Python int type should work + assert_almost_equal(ncu.ldexp(2., 3), 16.) + # The following int types should all be accepted + self._check_ldexp(np.int8) + self._check_ldexp(np.int16) + self._check_ldexp(np.int32) + self._check_ldexp('i') + self._check_ldexp('l') + + def test_ldexp_overflow(self): + # silence warning emitted on overflow + with np.errstate(over="ignore"): + imax = np.iinfo(np.dtype('l')).max + imin = np.iinfo(np.dtype('l')).min + assert_equal(ncu.ldexp(2., imax), np.inf) + assert_equal(ncu.ldexp(2., imin), 0) + + +class TestMaximum(_FilterInvalids): + def test_reduce(self): + dflt = np.typecodes['AllFloat'] + dint = np.typecodes['AllInteger'] + seq1 = np.arange(11) + seq2 = seq1[::-1] + func = np.maximum.reduce + for dt in dint: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 10) + assert_equal(func(tmp2), 10) + for dt in dflt: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 10) + assert_equal(func(tmp2), 10) + tmp1[::2] = np.nan + tmp2[::2] = np.nan + assert_equal(func(tmp1), np.nan) + assert_equal(func(tmp2), np.nan) + + def test_reduce_complex(self): + assert_equal(np.maximum.reduce([1, 2j]), 1) + assert_equal(np.maximum.reduce([1+3j, 2j]), 1+3j) + + def test_float_nans(self): + nan = np.nan + arg1 = np.array([0, nan, nan]) + arg2 = np.array([nan, 0, nan]) + out = np.array([nan, nan, nan]) + assert_equal(np.maximum(arg1, arg2), out) + + def test_object_nans(self): + # Multiple checks to give this a chance to + # fail if cmp is used instead of rich compare. + # Failure cannot be guaranteed. + for i in range(1): + x = np.array(float('nan'), object) + y = 1.0 + z = np.array(float('nan'), object) + assert_(np.maximum(x, y) == 1.0) + assert_(np.maximum(z, y) == 1.0) + + def test_complex_nans(self): + nan = np.nan + for cnan in [complex(nan, 0), complex(0, nan), complex(nan, nan)]: + arg1 = np.array([0, cnan, cnan], dtype=complex) + arg2 = np.array([cnan, 0, cnan], dtype=complex) + out = np.array([nan, nan, nan], dtype=complex) + assert_equal(np.maximum(arg1, arg2), out) + + def test_object_array(self): + arg1 = np.arange(5, dtype=object) + arg2 = arg1 + 1 + assert_equal(np.maximum(arg1, arg2), arg2) + + def test_strided_array(self): + arr1 = np.array([-4.0, 1.0, 10.0, 0.0, np.nan, -np.nan, np.inf, -np.inf]) + arr2 = np.array([-2.0,-1.0, np.nan, 1.0, 0.0, np.nan, 1.0, -3.0]) + maxtrue = np.array([-2.0, 1.0, np.nan, 1.0, np.nan, np.nan, np.inf, -3.0]) + out = np.ones(8) + out_maxtrue = np.array([-2.0, 1.0, 1.0, 10.0, 1.0, 1.0, np.nan, 1.0]) + assert_equal(np.maximum(arr1,arr2), maxtrue) + assert_equal(np.maximum(arr1[::2],arr2[::2]), maxtrue[::2]) + assert_equal(np.maximum(arr1[:4:], arr2[::2]), np.array([-2.0, np.nan, 10.0, 1.0])) + assert_equal(np.maximum(arr1[::3], arr2[:3:]), np.array([-2.0, 0.0, np.nan])) + assert_equal(np.maximum(arr1[:6:2], arr2[::3], out=out[::3]), np.array([-2.0, 10., np.nan])) + assert_equal(out, out_maxtrue) + + def test_precision(self): + dtypes = [np.float16, np.float32, np.float64, np.longdouble] + + for dt in dtypes: + dtmin = np.finfo(dt).min + dtmax = np.finfo(dt).max + d1 = dt(0.1) + d1_next = np.nextafter(d1, np.inf) + + test_cases = [ + # v1 v2 expected + (dtmin, -np.inf, dtmin), + (dtmax, -np.inf, dtmax), + (d1, d1_next, d1_next), + (dtmax, np.nan, np.nan), + ] + + for v1, v2, expected in test_cases: + assert_equal(np.maximum([v1], [v2]), [expected]) + assert_equal(np.maximum.reduce([v1, v2]), expected) + + +class TestMinimum(_FilterInvalids): + def test_reduce(self): + dflt = np.typecodes['AllFloat'] + dint = np.typecodes['AllInteger'] + seq1 = np.arange(11) + seq2 = seq1[::-1] + func = np.minimum.reduce + for dt in dint: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 0) + assert_equal(func(tmp2), 0) + for dt in dflt: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 0) + assert_equal(func(tmp2), 0) + tmp1[::2] = np.nan + tmp2[::2] = np.nan + assert_equal(func(tmp1), np.nan) + assert_equal(func(tmp2), np.nan) + + def test_reduce_complex(self): + assert_equal(np.minimum.reduce([1, 2j]), 2j) + assert_equal(np.minimum.reduce([1+3j, 2j]), 2j) + + def test_float_nans(self): + nan = np.nan + arg1 = np.array([0, nan, nan]) + arg2 = np.array([nan, 0, nan]) + out = np.array([nan, nan, nan]) + assert_equal(np.minimum(arg1, arg2), out) + + def test_object_nans(self): + # Multiple checks to give this a chance to + # fail if cmp is used instead of rich compare. + # Failure cannot be guaranteed. + for i in range(1): + x = np.array(float('nan'), object) + y = 1.0 + z = np.array(float('nan'), object) + assert_(np.minimum(x, y) == 1.0) + assert_(np.minimum(z, y) == 1.0) + + def test_complex_nans(self): + nan = np.nan + for cnan in [complex(nan, 0), complex(0, nan), complex(nan, nan)]: + arg1 = np.array([0, cnan, cnan], dtype=complex) + arg2 = np.array([cnan, 0, cnan], dtype=complex) + out = np.array([nan, nan, nan], dtype=complex) + assert_equal(np.minimum(arg1, arg2), out) + + def test_object_array(self): + arg1 = np.arange(5, dtype=object) + arg2 = arg1 + 1 + assert_equal(np.minimum(arg1, arg2), arg1) + + def test_strided_array(self): + arr1 = np.array([-4.0, 1.0, 10.0, 0.0, np.nan, -np.nan, np.inf, -np.inf]) + arr2 = np.array([-2.0,-1.0, np.nan, 1.0, 0.0, np.nan, 1.0, -3.0]) + mintrue = np.array([-4.0, -1.0, np.nan, 0.0, np.nan, np.nan, 1.0, -np.inf]) + out = np.ones(8) + out_mintrue = np.array([-4.0, 1.0, 1.0, 1.0, 1.0, 1.0, np.nan, 1.0]) + assert_equal(np.minimum(arr1,arr2), mintrue) + assert_equal(np.minimum(arr1[::2],arr2[::2]), mintrue[::2]) + assert_equal(np.minimum(arr1[:4:], arr2[::2]), np.array([-4.0, np.nan, 0.0, 0.0])) + assert_equal(np.minimum(arr1[::3], arr2[:3:]), np.array([-4.0, -1.0, np.nan])) + assert_equal(np.minimum(arr1[:6:2], arr2[::3], out=out[::3]), np.array([-4.0, 1.0, np.nan])) + assert_equal(out, out_mintrue) + + def test_precision(self): + dtypes = [np.float16, np.float32, np.float64, np.longdouble] + + for dt in dtypes: + dtmin = np.finfo(dt).min + dtmax = np.finfo(dt).max + d1 = dt(0.1) + d1_next = np.nextafter(d1, np.inf) + + test_cases = [ + # v1 v2 expected + (dtmin, np.inf, dtmin), + (dtmax, np.inf, dtmax), + (d1, d1_next, d1), + (dtmin, np.nan, np.nan), + ] + + for v1, v2, expected in test_cases: + assert_equal(np.minimum([v1], [v2]), [expected]) + assert_equal(np.minimum.reduce([v1, v2]), expected) + + +class TestFmax(_FilterInvalids): + def test_reduce(self): + dflt = np.typecodes['AllFloat'] + dint = np.typecodes['AllInteger'] + seq1 = np.arange(11) + seq2 = seq1[::-1] + func = np.fmax.reduce + for dt in dint: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 10) + assert_equal(func(tmp2), 10) + for dt in dflt: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 10) + assert_equal(func(tmp2), 10) + tmp1[::2] = np.nan + tmp2[::2] = np.nan + assert_equal(func(tmp1), 9) + assert_equal(func(tmp2), 9) + + def test_reduce_complex(self): + assert_equal(np.fmax.reduce([1, 2j]), 1) + assert_equal(np.fmax.reduce([1+3j, 2j]), 1+3j) + + def test_float_nans(self): + nan = np.nan + arg1 = np.array([0, nan, nan]) + arg2 = np.array([nan, 0, nan]) + out = np.array([0, 0, nan]) + assert_equal(np.fmax(arg1, arg2), out) + + def test_complex_nans(self): + nan = np.nan + for cnan in [complex(nan, 0), complex(0, nan), complex(nan, nan)]: + arg1 = np.array([0, cnan, cnan], dtype=complex) + arg2 = np.array([cnan, 0, cnan], dtype=complex) + out = np.array([0, 0, nan], dtype=complex) + assert_equal(np.fmax(arg1, arg2), out) + + def test_precision(self): + dtypes = [np.float16, np.float32, np.float64, np.longdouble] + + for dt in dtypes: + dtmin = np.finfo(dt).min + dtmax = np.finfo(dt).max + d1 = dt(0.1) + d1_next = np.nextafter(d1, np.inf) + + test_cases = [ + # v1 v2 expected + (dtmin, -np.inf, dtmin), + (dtmax, -np.inf, dtmax), + (d1, d1_next, d1_next), + (dtmax, np.nan, dtmax), + ] + + for v1, v2, expected in test_cases: + assert_equal(np.fmax([v1], [v2]), [expected]) + assert_equal(np.fmax.reduce([v1, v2]), expected) + + +class TestFmin(_FilterInvalids): + def test_reduce(self): + dflt = np.typecodes['AllFloat'] + dint = np.typecodes['AllInteger'] + seq1 = np.arange(11) + seq2 = seq1[::-1] + func = np.fmin.reduce + for dt in dint: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 0) + assert_equal(func(tmp2), 0) + for dt in dflt: + tmp1 = seq1.astype(dt) + tmp2 = seq2.astype(dt) + assert_equal(func(tmp1), 0) + assert_equal(func(tmp2), 0) + tmp1[::2] = np.nan + tmp2[::2] = np.nan + assert_equal(func(tmp1), 1) + assert_equal(func(tmp2), 1) + + def test_reduce_complex(self): + assert_equal(np.fmin.reduce([1, 2j]), 2j) + assert_equal(np.fmin.reduce([1+3j, 2j]), 2j) + + def test_float_nans(self): + nan = np.nan + arg1 = np.array([0, nan, nan]) + arg2 = np.array([nan, 0, nan]) + out = np.array([0, 0, nan]) + assert_equal(np.fmin(arg1, arg2), out) + + def test_complex_nans(self): + nan = np.nan + for cnan in [complex(nan, 0), complex(0, nan), complex(nan, nan)]: + arg1 = np.array([0, cnan, cnan], dtype=complex) + arg2 = np.array([cnan, 0, cnan], dtype=complex) + out = np.array([0, 0, nan], dtype=complex) + assert_equal(np.fmin(arg1, arg2), out) + + def test_precision(self): + dtypes = [np.float16, np.float32, np.float64, np.longdouble] + + for dt in dtypes: + dtmin = np.finfo(dt).min + dtmax = np.finfo(dt).max + d1 = dt(0.1) + d1_next = np.nextafter(d1, np.inf) + + test_cases = [ + # v1 v2 expected + (dtmin, np.inf, dtmin), + (dtmax, np.inf, dtmax), + (d1, d1_next, d1), + (dtmin, np.nan, dtmin), + ] + + for v1, v2, expected in test_cases: + assert_equal(np.fmin([v1], [v2]), [expected]) + assert_equal(np.fmin.reduce([v1, v2]), expected) + + +class TestBool: + def test_exceptions(self): + a = np.ones(1, dtype=np.bool) + assert_raises(TypeError, np.negative, a) + assert_raises(TypeError, np.positive, a) + assert_raises(TypeError, np.subtract, a, a) + + def test_truth_table_logical(self): + # 2, 3 and 4 serves as true values + input1 = [0, 0, 3, 2] + input2 = [0, 4, 0, 2] + + typecodes = (np.typecodes['AllFloat'] + + np.typecodes['AllInteger'] + + '?') # boolean + for dtype in map(np.dtype, typecodes): + arg1 = np.asarray(input1, dtype=dtype) + arg2 = np.asarray(input2, dtype=dtype) + + # OR + out = [False, True, True, True] + for func in (np.logical_or, np.maximum): + assert_equal(func(arg1, arg2).astype(bool), out) + # AND + out = [False, False, False, True] + for func in (np.logical_and, np.minimum): + assert_equal(func(arg1, arg2).astype(bool), out) + # XOR + out = [False, True, True, False] + for func in (np.logical_xor, np.not_equal): + assert_equal(func(arg1, arg2).astype(bool), out) + + def test_truth_table_bitwise(self): + arg1 = [False, False, True, True] + arg2 = [False, True, False, True] + + out = [False, True, True, True] + assert_equal(np.bitwise_or(arg1, arg2), out) + + out = [False, False, False, True] + assert_equal(np.bitwise_and(arg1, arg2), out) + + out = [False, True, True, False] + assert_equal(np.bitwise_xor(arg1, arg2), out) + + def test_reduce(self): + none = np.array([0, 0, 0, 0], bool) + some = np.array([1, 0, 1, 1], bool) + every = np.array([1, 1, 1, 1], bool) + empty = np.array([], bool) + + arrs = [none, some, every, empty] + + for arr in arrs: + assert_equal(np.logical_and.reduce(arr), all(arr)) + + for arr in arrs: + assert_equal(np.logical_or.reduce(arr), any(arr)) + + for arr in arrs: + assert_equal(np.logical_xor.reduce(arr), arr.sum() % 2 == 1) + + +class TestBitwiseUFuncs: + + _all_ints_bits = [ + np.dtype(c).itemsize * 8 for c in np.typecodes["AllInteger"]] + bitwise_types = [ + np.dtype(c) for c in '?' + np.typecodes["AllInteger"] + 'O'] + bitwise_bits = [ + 2, # boolean type + *_all_ints_bits, # All integers + max(_all_ints_bits) + 1, # Object_ type + ] + + def test_values(self): + for dt in self.bitwise_types: + zeros = np.array([0], dtype=dt) + ones = np.array([-1]).astype(dt) + msg = "dt = '%s'" % dt.char + + assert_equal(np.bitwise_not(zeros), ones, err_msg=msg) + assert_equal(np.bitwise_not(ones), zeros, err_msg=msg) + + assert_equal(np.bitwise_or(zeros, zeros), zeros, err_msg=msg) + assert_equal(np.bitwise_or(zeros, ones), ones, err_msg=msg) + assert_equal(np.bitwise_or(ones, zeros), ones, err_msg=msg) + assert_equal(np.bitwise_or(ones, ones), ones, err_msg=msg) + + assert_equal(np.bitwise_xor(zeros, zeros), zeros, err_msg=msg) + assert_equal(np.bitwise_xor(zeros, ones), ones, err_msg=msg) + assert_equal(np.bitwise_xor(ones, zeros), ones, err_msg=msg) + assert_equal(np.bitwise_xor(ones, ones), zeros, err_msg=msg) + + assert_equal(np.bitwise_and(zeros, zeros), zeros, err_msg=msg) + assert_equal(np.bitwise_and(zeros, ones), zeros, err_msg=msg) + assert_equal(np.bitwise_and(ones, zeros), zeros, err_msg=msg) + assert_equal(np.bitwise_and(ones, ones), ones, err_msg=msg) + + def test_types(self): + for dt in self.bitwise_types: + zeros = np.array([0], dtype=dt) + ones = np.array([-1]).astype(dt) + msg = "dt = '%s'" % dt.char + + assert_(np.bitwise_not(zeros).dtype == dt, msg) + assert_(np.bitwise_or(zeros, zeros).dtype == dt, msg) + assert_(np.bitwise_xor(zeros, zeros).dtype == dt, msg) + assert_(np.bitwise_and(zeros, zeros).dtype == dt, msg) + + def test_identity(self): + assert_(np.bitwise_or.identity == 0, 'bitwise_or') + assert_(np.bitwise_xor.identity == 0, 'bitwise_xor') + assert_(np.bitwise_and.identity == -1, 'bitwise_and') + + def test_reduction(self): + binary_funcs = (np.bitwise_or, np.bitwise_xor, np.bitwise_and) + + for dt in self.bitwise_types: + zeros = np.array([0], dtype=dt) + ones = np.array([-1]).astype(dt) + for f in binary_funcs: + msg = "dt: '%s', f: '%s'" % (dt, f) + assert_equal(f.reduce(zeros), zeros, err_msg=msg) + assert_equal(f.reduce(ones), ones, err_msg=msg) + + # Test empty reduction, no object dtype + for dt in self.bitwise_types[:-1]: + # No object array types + empty = np.array([], dtype=dt) + for f in binary_funcs: + msg = "dt: '%s', f: '%s'" % (dt, f) + tgt = np.array(f.identity).astype(dt) + res = f.reduce(empty) + assert_equal(res, tgt, err_msg=msg) + assert_(res.dtype == tgt.dtype, msg) + + # Empty object arrays use the identity. Note that the types may + # differ, the actual type used is determined by the assign_identity + # function and is not the same as the type returned by the identity + # method. + for f in binary_funcs: + msg = "dt: '%s'" % (f,) + empty = np.array([], dtype=object) + tgt = f.identity + res = f.reduce(empty) + assert_equal(res, tgt, err_msg=msg) + + # Non-empty object arrays do not use the identity + for f in binary_funcs: + msg = "dt: '%s'" % (f,) + btype = np.array([True], dtype=object) + assert_(type(f.reduce(btype)) is bool, msg) + + @pytest.mark.parametrize("input_dtype_obj, bitsize", + zip(bitwise_types, bitwise_bits)) + def test_bitwise_count(self, input_dtype_obj, bitsize): + input_dtype = input_dtype_obj.type + + for i in range(1, bitsize): + num = 2**i - 1 + msg = f"bitwise_count for {num}" + assert i == np.bitwise_count(input_dtype(num)), msg + if np.issubdtype( + input_dtype, np.signedinteger) or input_dtype == np.object_: + assert i == np.bitwise_count(input_dtype(-num)), msg + + a = np.array([2**i-1 for i in range(1, bitsize)], dtype=input_dtype) + bitwise_count_a = np.bitwise_count(a) + expected = np.arange(1, bitsize, dtype=input_dtype) + + msg = f"array bitwise_count for {input_dtype}" + assert all(bitwise_count_a == expected), msg + + +class TestInt: + def test_logical_not(self): + x = np.ones(10, dtype=np.int16) + o = np.ones(10 * 2, dtype=bool) + tgt = o.copy() + tgt[::2] = False + os = o[::2] + assert_array_equal(np.logical_not(x, out=os), False) + assert_array_equal(o, tgt) + + +class TestFloatingPoint: + def test_floating_point(self): + assert_equal(ncu.FLOATING_POINT_SUPPORT, 1) + + +class TestDegrees: + def test_degrees(self): + assert_almost_equal(ncu.degrees(np.pi), 180.0) + assert_almost_equal(ncu.degrees(-0.5*np.pi), -90.0) + + +class TestRadians: + def test_radians(self): + assert_almost_equal(ncu.radians(180.0), np.pi) + assert_almost_equal(ncu.radians(-90.0), -0.5*np.pi) + + +class TestHeavside: + def test_heaviside(self): + x = np.array([[-30.0, -0.1, 0.0, 0.2], [7.5, np.nan, np.inf, -np.inf]]) + expectedhalf = np.array([[0.0, 0.0, 0.5, 1.0], [1.0, np.nan, 1.0, 0.0]]) + expected1 = expectedhalf.copy() + expected1[0, 2] = 1 + + h = ncu.heaviside(x, 0.5) + assert_equal(h, expectedhalf) + + h = ncu.heaviside(x, 1.0) + assert_equal(h, expected1) + + x = x.astype(np.float32) + + h = ncu.heaviside(x, np.float32(0.5)) + assert_equal(h, expectedhalf.astype(np.float32)) + + h = ncu.heaviside(x, np.float32(1.0)) + assert_equal(h, expected1.astype(np.float32)) + + +class TestSign: + def test_sign(self): + a = np.array([np.inf, -np.inf, np.nan, 0.0, 3.0, -3.0]) + out = np.zeros(a.shape) + tgt = np.array([1., -1., np.nan, 0.0, 1.0, -1.0]) + + with np.errstate(invalid='ignore'): + res = ncu.sign(a) + assert_equal(res, tgt) + res = ncu.sign(a, out) + assert_equal(res, tgt) + assert_equal(out, tgt) + + def test_sign_complex(self): + a = np.array([ + np.inf, -np.inf, complex(0, np.inf), complex(0, -np.inf), + complex(np.inf, np.inf), complex(np.inf, -np.inf), # nan + np.nan, complex(0, np.nan), complex(np.nan, np.nan), # nan + 0.0, # 0. + 3.0, -3.0, -2j, 3.0+4.0j, -8.0+6.0j + ]) + out = np.zeros(a.shape, a.dtype) + tgt = np.array([ + 1., -1., 1j, -1j, + ] + [complex(np.nan, np.nan)] * 5 + [ + 0.0, + 1.0, -1.0, -1j, 0.6+0.8j, -0.8+0.6j]) + + with np.errstate(invalid='ignore'): + res = ncu.sign(a) + assert_equal(res, tgt) + res = ncu.sign(a, out) + assert_(res is out) + assert_equal(res, tgt) + + def test_sign_dtype_object(self): + # In reference to github issue #6229 + + foo = np.array([-.1, 0, .1]) + a = np.sign(foo.astype(object)) + b = np.sign(foo) + + assert_array_equal(a, b) + + def test_sign_dtype_nan_object(self): + # In reference to github issue #6229 + def test_nan(): + foo = np.array([np.nan]) + # FIXME: a not used + a = np.sign(foo.astype(object)) + + assert_raises(TypeError, test_nan) + +class TestMinMax: + def test_minmax_blocked(self): + # simd tests on max/min, test all alignments, slow but important + # for 2 * vz + 2 * (vs - 1) + 1 (unrolled once) + for dt, sz in [(np.float32, 15), (np.float64, 7)]: + for out, inp, msg in _gen_alignment_data(dtype=dt, type='unary', + max_size=sz): + for i in range(inp.size): + inp[:] = np.arange(inp.size, dtype=dt) + inp[i] = np.nan + emsg = lambda: '%r\n%s' % (inp, msg) + with suppress_warnings() as sup: + sup.filter(RuntimeWarning, + "invalid value encountered in reduce") + assert_(np.isnan(inp.max()), msg=emsg) + assert_(np.isnan(inp.min()), msg=emsg) + + inp[i] = 1e10 + assert_equal(inp.max(), 1e10, err_msg=msg) + inp[i] = -1e10 + assert_equal(inp.min(), -1e10, err_msg=msg) + + def test_lower_align(self): + # check data that is not aligned to element size + # i.e doubles are aligned to 4 bytes on i386 + d = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) + assert_equal(d.max(), d[0]) + assert_equal(d.min(), d[0]) + + def test_reduce_reorder(self): + # gh 10370, 11029 Some compilers reorder the call to npy_getfloatstatus + # and put it before the call to an intrinsic function that causes + # invalid status to be set. Also make sure warnings are not emitted + for n in (2, 4, 8, 16, 32): + for dt in (np.float32, np.float16, np.complex64): + for r in np.diagflat(np.array([np.nan] * n, dtype=dt)): + assert_equal(np.min(r), np.nan) + + def test_minimize_no_warns(self): + a = np.minimum(np.nan, 1) + assert_equal(a, np.nan) + + +class TestAbsoluteNegative: + def test_abs_neg_blocked(self): + # simd tests on abs, test all alignments for vz + 2 * (vs - 1) + 1 + for dt, sz in [(np.float32, 11), (np.float64, 5)]: + for out, inp, msg in _gen_alignment_data(dtype=dt, type='unary', + max_size=sz): + tgt = [ncu.absolute(i) for i in inp] + np.absolute(inp, out=out) + assert_equal(out, tgt, err_msg=msg) + assert_((out >= 0).all()) + + tgt = [-1*(i) for i in inp] + np.negative(inp, out=out) + assert_equal(out, tgt, err_msg=msg) + + for v in [np.nan, -np.inf, np.inf]: + for i in range(inp.size): + d = np.arange(inp.size, dtype=dt) + inp[:] = -d + inp[i] = v + d[i] = -v if v == -np.inf else v + assert_array_equal(np.abs(inp), d, err_msg=msg) + np.abs(inp, out=out) + assert_array_equal(out, d, err_msg=msg) + + assert_array_equal(-inp, -1*inp, err_msg=msg) + d = -1 * inp + np.negative(inp, out=out) + assert_array_equal(out, d, err_msg=msg) + + def test_lower_align(self): + # check data that is not aligned to element size + # i.e doubles are aligned to 4 bytes on i386 + d = np.zeros(23 * 8, dtype=np.int8)[4:-4].view(np.float64) + assert_equal(np.abs(d), d) + assert_equal(np.negative(d), -d) + np.negative(d, out=d) + np.negative(np.ones_like(d), out=d) + np.abs(d, out=d) + np.abs(np.ones_like(d), out=d) + + @pytest.mark.parametrize("dtype", ['d', 'f', 'int32', 'int64']) + @pytest.mark.parametrize("big", [True, False]) + def test_noncontiguous(self, dtype, big): + data = np.array([-1.0, 1.0, -0.0, 0.0, 2.2251e-308, -2.5, 2.5, -6, + 6, -2.2251e-308, -8, 10], dtype=dtype) + expect = np.array([1.0, -1.0, 0.0, -0.0, -2.2251e-308, 2.5, -2.5, 6, + -6, 2.2251e-308, 8, -10], dtype=dtype) + if big: + data = np.repeat(data, 10) + expect = np.repeat(expect, 10) + out = np.ndarray(data.shape, dtype=dtype) + ncontig_in = data[1::2] + ncontig_out = out[1::2] + contig_in = np.array(ncontig_in) + # contig in, contig out + assert_array_equal(np.negative(contig_in), expect[1::2]) + # contig in, ncontig out + assert_array_equal(np.negative(contig_in, out=ncontig_out), + expect[1::2]) + # ncontig in, contig out + assert_array_equal(np.negative(ncontig_in), expect[1::2]) + # ncontig in, ncontig out + assert_array_equal(np.negative(ncontig_in, out=ncontig_out), + expect[1::2]) + # contig in, contig out, nd stride + data_split = np.array(np.array_split(data, 2)) + expect_split = np.array(np.array_split(expect, 2)) + assert_equal(np.negative(data_split), expect_split) + + +class TestPositive: + def test_valid(self): + valid_dtypes = [int, float, complex, object] + for dtype in valid_dtypes: + x = np.arange(5, dtype=dtype) + result = np.positive(x) + assert_equal(x, result, err_msg=str(dtype)) + + def test_invalid(self): + with assert_raises(TypeError): + np.positive(True) + with assert_raises(TypeError): + np.positive(np.datetime64('2000-01-01')) + with assert_raises(TypeError): + np.positive(np.array(['foo'], dtype=str)) + with assert_raises(TypeError): + np.positive(np.array(['bar'], dtype=object)) + + +class TestSpecialMethods: + def test_wrap(self): + + class with_wrap: + def __array__(self, dtype=None, copy=None): + return np.zeros(1) + + def __array_wrap__(self, arr, context, return_scalar): + r = with_wrap() + r.arr = arr + r.context = context + return r + + a = with_wrap() + x = ncu.minimum(a, a) + assert_equal(x.arr, np.zeros(1)) + func, args, i = x.context + assert_(func is ncu.minimum) + assert_equal(len(args), 2) + assert_equal(args[0], a) + assert_equal(args[1], a) + assert_equal(i, 0) + + def test_wrap_out(self): + # Calling convention for out should not affect how special methods are + # called + + class StoreArrayPrepareWrap(np.ndarray): + _wrap_args = None + _prepare_args = None + + def __new__(cls): + return np.zeros(()).view(cls) + + def __array_wrap__(self, obj, context, return_scalar): + self._wrap_args = context[1] + return obj + + @property + def args(self): + # We need to ensure these are fetched at the same time, before + # any other ufuncs are called by the assertions + return self._wrap_args + + def __repr__(self): + return "a" # for short test output + + def do_test(f_call, f_expected): + a = StoreArrayPrepareWrap() + + f_call(a) + + w = a.args + expected = f_expected(a) + try: + assert w == expected + except AssertionError as e: + # assert_equal produces truly useless error messages + raise AssertionError("\n".join([ + "Bad arguments passed in ufunc call", + " expected: {}".format(expected), + " __array_wrap__ got: {}".format(w) + ])) + + # method not on the out argument + do_test(lambda a: np.add(a, 0), lambda a: (a, 0)) + do_test(lambda a: np.add(a, 0, None), lambda a: (a, 0)) + do_test(lambda a: np.add(a, 0, out=None), lambda a: (a, 0)) + do_test(lambda a: np.add(a, 0, out=(None,)), lambda a: (a, 0)) + + # method on the out argument + do_test(lambda a: np.add(0, 0, a), lambda a: (0, 0, a)) + do_test(lambda a: np.add(0, 0, out=a), lambda a: (0, 0, a)) + do_test(lambda a: np.add(0, 0, out=(a,)), lambda a: (0, 0, a)) + + # Also check the where mask handling: + do_test(lambda a: np.add(a, 0, where=False), lambda a: (a, 0)) + do_test(lambda a: np.add(0, 0, a, where=False), lambda a: (0, 0, a)) + + def test_wrap_with_iterable(self): + # test fix for bug #1026: + + class with_wrap(np.ndarray): + __array_priority__ = 10 + + def __new__(cls): + return np.asarray(1).view(cls).copy() + + def __array_wrap__(self, arr, context, return_scalar): + return arr.view(type(self)) + + a = with_wrap() + x = ncu.multiply(a, (1, 2, 3)) + assert_(isinstance(x, with_wrap)) + assert_array_equal(x, np.array((1, 2, 3))) + + def test_priority_with_scalar(self): + # test fix for bug #826: + + class A(np.ndarray): + __array_priority__ = 10 + + def __new__(cls): + return np.asarray(1.0, 'float64').view(cls).copy() + + a = A() + x = np.float64(1)*a + assert_(isinstance(x, A)) + assert_array_equal(x, np.array(1)) + + def test_priority(self): + + class A: + def __array__(self, dtype=None, copy=None): + return np.zeros(1) + + def __array_wrap__(self, arr, context, return_scalar): + r = type(self)() + r.arr = arr + r.context = context + return r + + class B(A): + __array_priority__ = 20. + + class C(A): + __array_priority__ = 40. + + x = np.zeros(1) + a = A() + b = B() + c = C() + f = ncu.minimum + assert_(type(f(x, x)) is np.ndarray) + assert_(type(f(x, a)) is A) + assert_(type(f(x, b)) is B) + assert_(type(f(x, c)) is C) + assert_(type(f(a, x)) is A) + assert_(type(f(b, x)) is B) + assert_(type(f(c, x)) is C) + + assert_(type(f(a, a)) is A) + assert_(type(f(a, b)) is B) + assert_(type(f(b, a)) is B) + assert_(type(f(b, b)) is B) + assert_(type(f(b, c)) is C) + assert_(type(f(c, b)) is C) + assert_(type(f(c, c)) is C) + + assert_(type(ncu.exp(a) is A)) + assert_(type(ncu.exp(b) is B)) + assert_(type(ncu.exp(c) is C)) + + def test_failing_wrap(self): + + class A: + def __array__(self, dtype=None, copy=None): + return np.zeros(2) + + def __array_wrap__(self, arr, context, return_scalar): + raise RuntimeError + + a = A() + assert_raises(RuntimeError, ncu.maximum, a, a) + assert_raises(RuntimeError, ncu.maximum.reduce, a) + + def test_failing_out_wrap(self): + + singleton = np.array([1.0]) + + class Ok(np.ndarray): + def __array_wrap__(self, obj, context, return_scalar): + return singleton + + class Bad(np.ndarray): + def __array_wrap__(self, obj, context, return_scalar): + raise RuntimeError + + ok = np.empty(1).view(Ok) + bad = np.empty(1).view(Bad) + # double-free (segfault) of "ok" if "bad" raises an exception + for i in range(10): + assert_raises(RuntimeError, ncu.frexp, 1, ok, bad) + + def test_none_wrap(self): + # Tests that issue #8507 is resolved. Previously, this would segfault + + class A: + def __array__(self, dtype=None, copy=None): + return np.zeros(1) + + def __array_wrap__(self, arr, context=None, return_scalar=False): + return None + + a = A() + assert_equal(ncu.maximum(a, a), None) + + def test_default_prepare(self): + + class with_wrap: + __array_priority__ = 10 + + def __array__(self, dtype=None, copy=None): + return np.zeros(1) + + def __array_wrap__(self, arr, context, return_scalar): + return arr + + a = with_wrap() + x = ncu.minimum(a, a) + assert_equal(x, np.zeros(1)) + assert_equal(type(x), np.ndarray) + + def test_array_too_many_args(self): + + class A: + def __array__(self, dtype, context, copy=None): + return np.zeros(1) + + a = A() + assert_raises_regex(TypeError, '2 required positional', np.sum, a) + + def test_ufunc_override(self): + # check override works even with instance with high priority. + class A: + def __array_ufunc__(self, func, method, *inputs, **kwargs): + return self, func, method, inputs, kwargs + + class MyNDArray(np.ndarray): + __array_priority__ = 100 + + a = A() + b = np.array([1]).view(MyNDArray) + res0 = np.multiply(a, b) + res1 = np.multiply(b, b, out=a) + + # self + assert_equal(res0[0], a) + assert_equal(res1[0], a) + assert_equal(res0[1], np.multiply) + assert_equal(res1[1], np.multiply) + assert_equal(res0[2], '__call__') + assert_equal(res1[2], '__call__') + assert_equal(res0[3], (a, b)) + assert_equal(res1[3], (b, b)) + assert_equal(res0[4], {}) + assert_equal(res1[4], {'out': (a,)}) + + def test_ufunc_override_mro(self): + + # Some multi arg functions for testing. + def tres_mul(a, b, c): + return a * b * c + + def quatro_mul(a, b, c, d): + return a * b * c * d + + # Make these into ufuncs. + three_mul_ufunc = np.frompyfunc(tres_mul, 3, 1) + four_mul_ufunc = np.frompyfunc(quatro_mul, 4, 1) + + class A: + def __array_ufunc__(self, func, method, *inputs, **kwargs): + return "A" + + class ASub(A): + def __array_ufunc__(self, func, method, *inputs, **kwargs): + return "ASub" + + class B: + def __array_ufunc__(self, func, method, *inputs, **kwargs): + return "B" + + class C: + def __init__(self): + self.count = 0 + + def __array_ufunc__(self, func, method, *inputs, **kwargs): + self.count += 1 + return NotImplemented + + class CSub(C): + def __array_ufunc__(self, func, method, *inputs, **kwargs): + self.count += 1 + return NotImplemented + + a = A() + a_sub = ASub() + b = B() + c = C() + + # Standard + res = np.multiply(a, a_sub) + assert_equal(res, "ASub") + res = np.multiply(a_sub, b) + assert_equal(res, "ASub") + + # With 1 NotImplemented + res = np.multiply(c, a) + assert_equal(res, "A") + assert_equal(c.count, 1) + # Check our counter works, so we can trust tests below. + res = np.multiply(c, a) + assert_equal(c.count, 2) + + # Both NotImplemented. + c = C() + c_sub = CSub() + assert_raises(TypeError, np.multiply, c, c_sub) + assert_equal(c.count, 1) + assert_equal(c_sub.count, 1) + c.count = c_sub.count = 0 + assert_raises(TypeError, np.multiply, c_sub, c) + assert_equal(c.count, 1) + assert_equal(c_sub.count, 1) + c.count = 0 + assert_raises(TypeError, np.multiply, c, c) + assert_equal(c.count, 1) + c.count = 0 + assert_raises(TypeError, np.multiply, 2, c) + assert_equal(c.count, 1) + + # Ternary testing. + assert_equal(three_mul_ufunc(a, 1, 2), "A") + assert_equal(three_mul_ufunc(1, a, 2), "A") + assert_equal(three_mul_ufunc(1, 2, a), "A") + + assert_equal(three_mul_ufunc(a, a, 6), "A") + assert_equal(three_mul_ufunc(a, 2, a), "A") + assert_equal(three_mul_ufunc(a, 2, b), "A") + assert_equal(three_mul_ufunc(a, 2, a_sub), "ASub") + assert_equal(three_mul_ufunc(a, a_sub, 3), "ASub") + c.count = 0 + assert_equal(three_mul_ufunc(c, a_sub, 3), "ASub") + assert_equal(c.count, 1) + c.count = 0 + assert_equal(three_mul_ufunc(1, a_sub, c), "ASub") + assert_equal(c.count, 0) + + c.count = 0 + assert_equal(three_mul_ufunc(a, b, c), "A") + assert_equal(c.count, 0) + c_sub.count = 0 + assert_equal(three_mul_ufunc(a, b, c_sub), "A") + assert_equal(c_sub.count, 0) + assert_equal(three_mul_ufunc(1, 2, b), "B") + + assert_raises(TypeError, three_mul_ufunc, 1, 2, c) + assert_raises(TypeError, three_mul_ufunc, c_sub, 2, c) + assert_raises(TypeError, three_mul_ufunc, c_sub, 2, 3) + + # Quaternary testing. + assert_equal(four_mul_ufunc(a, 1, 2, 3), "A") + assert_equal(four_mul_ufunc(1, a, 2, 3), "A") + assert_equal(four_mul_ufunc(1, 1, a, 3), "A") + assert_equal(four_mul_ufunc(1, 1, 2, a), "A") + + assert_equal(four_mul_ufunc(a, b, 2, 3), "A") + assert_equal(four_mul_ufunc(1, a, 2, b), "A") + assert_equal(four_mul_ufunc(b, 1, a, 3), "B") + assert_equal(four_mul_ufunc(a_sub, 1, 2, a), "ASub") + assert_equal(four_mul_ufunc(a, 1, 2, a_sub), "ASub") + + c = C() + c_sub = CSub() + assert_raises(TypeError, four_mul_ufunc, 1, 2, 3, c) + assert_equal(c.count, 1) + c.count = 0 + assert_raises(TypeError, four_mul_ufunc, 1, 2, c_sub, c) + assert_equal(c_sub.count, 1) + assert_equal(c.count, 1) + c2 = C() + c.count = c_sub.count = 0 + assert_raises(TypeError, four_mul_ufunc, 1, c, c_sub, c2) + assert_equal(c_sub.count, 1) + assert_equal(c.count, 1) + assert_equal(c2.count, 0) + c.count = c2.count = c_sub.count = 0 + assert_raises(TypeError, four_mul_ufunc, c2, c, c_sub, c) + assert_equal(c_sub.count, 1) + assert_equal(c.count, 0) + assert_equal(c2.count, 1) + + def test_ufunc_override_methods(self): + + class A: + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return self, ufunc, method, inputs, kwargs + + # __call__ + a = A() + with assert_raises(TypeError): + np.multiply.__call__(1, a, foo='bar', answer=42) + res = np.multiply.__call__(1, a, subok='bar', where=42) + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], '__call__') + assert_equal(res[3], (1, a)) + assert_equal(res[4], {'subok': 'bar', 'where': 42}) + + # __call__, wrong args + assert_raises(TypeError, np.multiply, a) + assert_raises(TypeError, np.multiply, a, a, a, a) + assert_raises(TypeError, np.multiply, a, a, sig='a', signature='a') + assert_raises(TypeError, ncu_tests.inner1d, a, a, axis=0, axes=[0, 0]) + + # reduce, positional args + res = np.multiply.reduce(a, 'axis0', 'dtype0', 'out0', 'keep0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'reduce') + assert_equal(res[3], (a,)) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'keepdims': 'keep0', + 'axis': 'axis0'}) + + # reduce, kwargs + res = np.multiply.reduce(a, axis='axis0', dtype='dtype0', out='out0', + keepdims='keep0', initial='init0', + where='where0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'reduce') + assert_equal(res[3], (a,)) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'keepdims': 'keep0', + 'axis': 'axis0', + 'initial': 'init0', + 'where': 'where0'}) + + # reduce, output equal to None removed, but not other explicit ones, + # even if they are at their default value. + res = np.multiply.reduce(a, 0, None, None, False) + assert_equal(res[4], {'axis': 0, 'dtype': None, 'keepdims': False}) + res = np.multiply.reduce(a, out=None, axis=0, keepdims=True) + assert_equal(res[4], {'axis': 0, 'keepdims': True}) + res = np.multiply.reduce(a, None, out=(None,), dtype=None) + assert_equal(res[4], {'axis': None, 'dtype': None}) + res = np.multiply.reduce(a, 0, None, None, False, 2, True) + assert_equal(res[4], {'axis': 0, 'dtype': None, 'keepdims': False, + 'initial': 2, 'where': True}) + # np._NoValue ignored for initial + res = np.multiply.reduce(a, 0, None, None, False, + np._NoValue, True) + assert_equal(res[4], {'axis': 0, 'dtype': None, 'keepdims': False, + 'where': True}) + # None kept for initial, True for where. + res = np.multiply.reduce(a, 0, None, None, False, None, True) + assert_equal(res[4], {'axis': 0, 'dtype': None, 'keepdims': False, + 'initial': None, 'where': True}) + + # reduce, wrong args + assert_raises(ValueError, np.multiply.reduce, a, out=()) + assert_raises(ValueError, np.multiply.reduce, a, out=('out0', 'out1')) + assert_raises(TypeError, np.multiply.reduce, a, 'axis0', axis='axis0') + + # accumulate, pos args + res = np.multiply.accumulate(a, 'axis0', 'dtype0', 'out0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'accumulate') + assert_equal(res[3], (a,)) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'axis': 'axis0'}) + + # accumulate, kwargs + res = np.multiply.accumulate(a, axis='axis0', dtype='dtype0', + out='out0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'accumulate') + assert_equal(res[3], (a,)) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'axis': 'axis0'}) + + # accumulate, output equal to None removed. + res = np.multiply.accumulate(a, 0, None, None) + assert_equal(res[4], {'axis': 0, 'dtype': None}) + res = np.multiply.accumulate(a, out=None, axis=0, dtype='dtype1') + assert_equal(res[4], {'axis': 0, 'dtype': 'dtype1'}) + res = np.multiply.accumulate(a, None, out=(None,), dtype=None) + assert_equal(res[4], {'axis': None, 'dtype': None}) + + # accumulate, wrong args + assert_raises(ValueError, np.multiply.accumulate, a, out=()) + assert_raises(ValueError, np.multiply.accumulate, a, + out=('out0', 'out1')) + assert_raises(TypeError, np.multiply.accumulate, a, + 'axis0', axis='axis0') + + # reduceat, pos args + res = np.multiply.reduceat(a, [4, 2], 'axis0', 'dtype0', 'out0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'reduceat') + assert_equal(res[3], (a, [4, 2])) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'axis': 'axis0'}) + + # reduceat, kwargs + res = np.multiply.reduceat(a, [4, 2], axis='axis0', dtype='dtype0', + out='out0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'reduceat') + assert_equal(res[3], (a, [4, 2])) + assert_equal(res[4], {'dtype':'dtype0', + 'out': ('out0',), + 'axis': 'axis0'}) + + # reduceat, output equal to None removed. + res = np.multiply.reduceat(a, [4, 2], 0, None, None) + assert_equal(res[4], {'axis': 0, 'dtype': None}) + res = np.multiply.reduceat(a, [4, 2], axis=None, out=None, dtype='dt') + assert_equal(res[4], {'axis': None, 'dtype': 'dt'}) + res = np.multiply.reduceat(a, [4, 2], None, None, out=(None,)) + assert_equal(res[4], {'axis': None, 'dtype': None}) + + # reduceat, wrong args + assert_raises(ValueError, np.multiply.reduce, a, [4, 2], out=()) + assert_raises(ValueError, np.multiply.reduce, a, [4, 2], + out=('out0', 'out1')) + assert_raises(TypeError, np.multiply.reduce, a, [4, 2], + 'axis0', axis='axis0') + + # outer + res = np.multiply.outer(a, 42) + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'outer') + assert_equal(res[3], (a, 42)) + assert_equal(res[4], {}) + + # outer, wrong args + assert_raises(TypeError, np.multiply.outer, a) + assert_raises(TypeError, np.multiply.outer, a, a, a, a) + assert_raises(TypeError, np.multiply.outer, a, a, sig='a', signature='a') + + # at + res = np.multiply.at(a, [4, 2], 'b0') + assert_equal(res[0], a) + assert_equal(res[1], np.multiply) + assert_equal(res[2], 'at') + assert_equal(res[3], (a, [4, 2], 'b0')) + + # at, wrong args + assert_raises(TypeError, np.multiply.at, a) + assert_raises(TypeError, np.multiply.at, a, a, a, a) + + def test_ufunc_override_out(self): + + class A: + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return kwargs + + class B: + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return kwargs + + a = A() + b = B() + res0 = np.multiply(a, b, 'out_arg') + res1 = np.multiply(a, b, out='out_arg') + res2 = np.multiply(2, b, 'out_arg') + res3 = np.multiply(3, b, out='out_arg') + res4 = np.multiply(a, 4, 'out_arg') + res5 = np.multiply(a, 5, out='out_arg') + + assert_equal(res0['out'][0], 'out_arg') + assert_equal(res1['out'][0], 'out_arg') + assert_equal(res2['out'][0], 'out_arg') + assert_equal(res3['out'][0], 'out_arg') + assert_equal(res4['out'][0], 'out_arg') + assert_equal(res5['out'][0], 'out_arg') + + # ufuncs with multiple output modf and frexp. + res6 = np.modf(a, 'out0', 'out1') + res7 = np.frexp(a, 'out0', 'out1') + assert_equal(res6['out'][0], 'out0') + assert_equal(res6['out'][1], 'out1') + assert_equal(res7['out'][0], 'out0') + assert_equal(res7['out'][1], 'out1') + + # While we're at it, check that default output is never passed on. + assert_(np.sin(a, None) == {}) + assert_(np.sin(a, out=None) == {}) + assert_(np.sin(a, out=(None,)) == {}) + assert_(np.modf(a, None) == {}) + assert_(np.modf(a, None, None) == {}) + assert_(np.modf(a, out=(None, None)) == {}) + with assert_raises(TypeError): + # Out argument must be tuple, since there are multiple outputs. + np.modf(a, out=None) + + # don't give positional and output argument, or too many arguments. + # wrong number of arguments in the tuple is an error too. + assert_raises(TypeError, np.multiply, a, b, 'one', out='two') + assert_raises(TypeError, np.multiply, a, b, 'one', 'two') + assert_raises(ValueError, np.multiply, a, b, out=('one', 'two')) + assert_raises(TypeError, np.multiply, a, out=()) + assert_raises(TypeError, np.modf, a, 'one', out=('two', 'three')) + assert_raises(TypeError, np.modf, a, 'one', 'two', 'three') + assert_raises(ValueError, np.modf, a, out=('one', 'two', 'three')) + assert_raises(ValueError, np.modf, a, out=('one',)) + + def test_ufunc_override_where(self): + + class OverriddenArrayOld(np.ndarray): + + def _unwrap(self, objs): + cls = type(self) + result = [] + for obj in objs: + if isinstance(obj, cls): + obj = np.array(obj) + elif type(obj) != np.ndarray: + return NotImplemented + result.append(obj) + return result + + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + + inputs = self._unwrap(inputs) + if inputs is NotImplemented: + return NotImplemented + + kwargs = kwargs.copy() + if "out" in kwargs: + kwargs["out"] = self._unwrap(kwargs["out"]) + if kwargs["out"] is NotImplemented: + return NotImplemented + + r = super().__array_ufunc__(ufunc, method, *inputs, **kwargs) + if r is not NotImplemented: + r = r.view(type(self)) + + return r + + class OverriddenArrayNew(OverriddenArrayOld): + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + + kwargs = kwargs.copy() + if "where" in kwargs: + kwargs["where"] = self._unwrap((kwargs["where"], )) + if kwargs["where"] is NotImplemented: + return NotImplemented + else: + kwargs["where"] = kwargs["where"][0] + + r = super().__array_ufunc__(ufunc, method, *inputs, **kwargs) + if r is not NotImplemented: + r = r.view(type(self)) + + return r + + ufunc = np.negative + + array = np.array([1, 2, 3]) + where = np.array([True, False, True]) + expected = ufunc(array, where=where) + + with pytest.raises(TypeError): + ufunc(array, where=where.view(OverriddenArrayOld)) + + result_1 = ufunc( + array, + where=where.view(OverriddenArrayNew) + ) + assert isinstance(result_1, OverriddenArrayNew) + assert np.all(np.array(result_1) == expected, where=where) + + result_2 = ufunc( + array.view(OverriddenArrayNew), + where=where.view(OverriddenArrayNew) + ) + assert isinstance(result_2, OverriddenArrayNew) + assert np.all(np.array(result_2) == expected, where=where) + + def test_ufunc_override_exception(self): + + class A: + def __array_ufunc__(self, *a, **kwargs): + raise ValueError("oops") + + a = A() + assert_raises(ValueError, np.negative, 1, out=a) + assert_raises(ValueError, np.negative, a) + assert_raises(ValueError, np.divide, 1., a) + + def test_ufunc_override_not_implemented(self): + + class A: + def __array_ufunc__(self, *args, **kwargs): + return NotImplemented + + msg = ("operand type(s) all returned NotImplemented from " + "__array_ufunc__(, '__call__', <*>): 'A'") + with assert_raises_regex(TypeError, fnmatch.translate(msg)): + np.negative(A()) + + msg = ("operand type(s) all returned NotImplemented from " + "__array_ufunc__(, '__call__', <*>, , " + "out=(1,)): 'A', 'object', 'int'") + with assert_raises_regex(TypeError, fnmatch.translate(msg)): + np.add(A(), object(), out=1) + + def test_ufunc_override_disabled(self): + + class OptOut: + __array_ufunc__ = None + + opt_out = OptOut() + + # ufuncs always raise + msg = "operand 'OptOut' does not support ufuncs" + with assert_raises_regex(TypeError, msg): + np.add(opt_out, 1) + with assert_raises_regex(TypeError, msg): + np.add(1, opt_out) + with assert_raises_regex(TypeError, msg): + np.negative(opt_out) + + # opt-outs still hold even when other arguments have pathological + # __array_ufunc__ implementations + + class GreedyArray: + def __array_ufunc__(self, *args, **kwargs): + return self + + greedy = GreedyArray() + assert_(np.negative(greedy) is greedy) + with assert_raises_regex(TypeError, msg): + np.add(greedy, opt_out) + with assert_raises_regex(TypeError, msg): + np.add(greedy, 1, out=opt_out) + + def test_gufunc_override(self): + # gufunc are just ufunc instances, but follow a different path, + # so check __array_ufunc__ overrides them properly. + class A: + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + return self, ufunc, method, inputs, kwargs + + inner1d = ncu_tests.inner1d + a = A() + res = inner1d(a, a) + assert_equal(res[0], a) + assert_equal(res[1], inner1d) + assert_equal(res[2], '__call__') + assert_equal(res[3], (a, a)) + assert_equal(res[4], {}) + + res = inner1d(1, 1, out=a) + assert_equal(res[0], a) + assert_equal(res[1], inner1d) + assert_equal(res[2], '__call__') + assert_equal(res[3], (1, 1)) + assert_equal(res[4], {'out': (a,)}) + + # wrong number of arguments in the tuple is an error too. + assert_raises(TypeError, inner1d, a, out='two') + assert_raises(TypeError, inner1d, a, a, 'one', out='two') + assert_raises(TypeError, inner1d, a, a, 'one', 'two') + assert_raises(ValueError, inner1d, a, a, out=('one', 'two')) + assert_raises(ValueError, inner1d, a, a, out=()) + + def test_ufunc_override_with_super(self): + # NOTE: this class is used in doc/source/user/basics.subclassing.rst + # if you make any changes here, do update it there too. + class A(np.ndarray): + def __array_ufunc__(self, ufunc, method, *inputs, out=None, **kwargs): + args = [] + in_no = [] + for i, input_ in enumerate(inputs): + if isinstance(input_, A): + in_no.append(i) + args.append(input_.view(np.ndarray)) + else: + args.append(input_) + + outputs = out + out_no = [] + if outputs: + out_args = [] + for j, output in enumerate(outputs): + if isinstance(output, A): + out_no.append(j) + out_args.append(output.view(np.ndarray)) + else: + out_args.append(output) + kwargs['out'] = tuple(out_args) + else: + outputs = (None,) * ufunc.nout + + info = {} + if in_no: + info['inputs'] = in_no + if out_no: + info['outputs'] = out_no + + results = super().__array_ufunc__(ufunc, method, + *args, **kwargs) + if results is NotImplemented: + return NotImplemented + + if method == 'at': + if isinstance(inputs[0], A): + inputs[0].info = info + return + + if ufunc.nout == 1: + results = (results,) + + results = tuple((np.asarray(result).view(A) + if output is None else output) + for result, output in zip(results, outputs)) + if results and isinstance(results[0], A): + results[0].info = info + + return results[0] if len(results) == 1 else results + + class B: + def __array_ufunc__(self, ufunc, method, *inputs, **kwargs): + if any(isinstance(input_, A) for input_ in inputs): + return "A!" + else: + return NotImplemented + + d = np.arange(5.) + # 1 input, 1 output + a = np.arange(5.).view(A) + b = np.sin(a) + check = np.sin(d) + assert_(np.all(check == b)) + assert_equal(b.info, {'inputs': [0]}) + b = np.sin(d, out=(a,)) + assert_(np.all(check == b)) + assert_equal(b.info, {'outputs': [0]}) + assert_(b is a) + a = np.arange(5.).view(A) + b = np.sin(a, out=a) + assert_(np.all(check == b)) + assert_equal(b.info, {'inputs': [0], 'outputs': [0]}) + + # 1 input, 2 outputs + a = np.arange(5.).view(A) + b1, b2 = np.modf(a) + assert_equal(b1.info, {'inputs': [0]}) + b1, b2 = np.modf(d, out=(None, a)) + assert_(b2 is a) + assert_equal(b1.info, {'outputs': [1]}) + a = np.arange(5.).view(A) + b = np.arange(5.).view(A) + c1, c2 = np.modf(a, out=(a, b)) + assert_(c1 is a) + assert_(c2 is b) + assert_equal(c1.info, {'inputs': [0], 'outputs': [0, 1]}) + + # 2 input, 1 output + a = np.arange(5.).view(A) + b = np.arange(5.).view(A) + c = np.add(a, b, out=a) + assert_(c is a) + assert_equal(c.info, {'inputs': [0, 1], 'outputs': [0]}) + # some tests with a non-ndarray subclass + a = np.arange(5.) + b = B() + assert_(a.__array_ufunc__(np.add, '__call__', a, b) is NotImplemented) + assert_(b.__array_ufunc__(np.add, '__call__', a, b) is NotImplemented) + assert_raises(TypeError, np.add, a, b) + a = a.view(A) + assert_(a.__array_ufunc__(np.add, '__call__', a, b) is NotImplemented) + assert_(b.__array_ufunc__(np.add, '__call__', a, b) == "A!") + assert_(np.add(a, b) == "A!") + # regression check for gh-9102 -- tests ufunc.reduce implicitly. + d = np.array([[1, 2, 3], [1, 2, 3]]) + a = d.view(A) + c = a.any() + check = d.any() + assert_equal(c, check) + assert_(c.info, {'inputs': [0]}) + c = a.max() + check = d.max() + assert_equal(c, check) + assert_(c.info, {'inputs': [0]}) + b = np.array(0).view(A) + c = a.max(out=b) + assert_equal(c, check) + assert_(c is b) + assert_(c.info, {'inputs': [0], 'outputs': [0]}) + check = a.max(axis=0) + b = np.zeros_like(check).view(A) + c = a.max(axis=0, out=b) + assert_equal(c, check) + assert_(c is b) + assert_(c.info, {'inputs': [0], 'outputs': [0]}) + # simple explicit tests of reduce, accumulate, reduceat + check = np.add.reduce(d, axis=1) + c = np.add.reduce(a, axis=1) + assert_equal(c, check) + assert_(c.info, {'inputs': [0]}) + b = np.zeros_like(c) + c = np.add.reduce(a, 1, None, b) + assert_equal(c, check) + assert_(c is b) + assert_(c.info, {'inputs': [0], 'outputs': [0]}) + check = np.add.accumulate(d, axis=0) + c = np.add.accumulate(a, axis=0) + assert_equal(c, check) + assert_(c.info, {'inputs': [0]}) + b = np.zeros_like(c) + c = np.add.accumulate(a, 0, None, b) + assert_equal(c, check) + assert_(c is b) + assert_(c.info, {'inputs': [0], 'outputs': [0]}) + indices = [0, 2, 1] + check = np.add.reduceat(d, indices, axis=1) + c = np.add.reduceat(a, indices, axis=1) + assert_equal(c, check) + assert_(c.info, {'inputs': [0]}) + b = np.zeros_like(c) + c = np.add.reduceat(a, indices, 1, None, b) + assert_equal(c, check) + assert_(c is b) + assert_(c.info, {'inputs': [0], 'outputs': [0]}) + # and a few tests for at + d = np.array([[1, 2, 3], [1, 2, 3]]) + check = d.copy() + a = d.copy().view(A) + np.add.at(check, ([0, 1], [0, 2]), 1.) + np.add.at(a, ([0, 1], [0, 2]), 1.) + assert_equal(a, check) + assert_(a.info, {'inputs': [0]}) + b = np.array(1.).view(A) + a = d.copy().view(A) + np.add.at(a, ([0, 1], [0, 2]), b) + assert_equal(a, check) + assert_(a.info, {'inputs': [0, 2]}) + + def test_array_ufunc_direct_call(self): + # This is mainly a regression test for gh-24023 (shouldn't segfault) + a = np.array(1) + with pytest.raises(TypeError): + a.__array_ufunc__() + + # No kwargs means kwargs may be NULL on the C-level + with pytest.raises(TypeError): + a.__array_ufunc__(1, 2) + + # And the same with a valid call: + res = a.__array_ufunc__(np.add, "__call__", a, a) + assert_array_equal(res, a + a) + +class TestChoose: + def test_mixed(self): + c = np.array([True, True]) + a = np.array([True, True]) + assert_equal(np.choose(c, (a, 1)), np.array([1, 1])) + + +class TestRationalFunctions: + def test_lcm(self): + self._test_lcm_inner(np.int16) + self._test_lcm_inner(np.uint16) + + def test_lcm_object(self): + self._test_lcm_inner(np.object_) + + def test_gcd(self): + self._test_gcd_inner(np.int16) + self._test_lcm_inner(np.uint16) + + def test_gcd_object(self): + self._test_gcd_inner(np.object_) + + def _test_lcm_inner(self, dtype): + # basic use + a = np.array([12, 120], dtype=dtype) + b = np.array([20, 200], dtype=dtype) + assert_equal(np.lcm(a, b), [60, 600]) + + if not issubclass(dtype, np.unsignedinteger): + # negatives are ignored + a = np.array([12, -12, 12, -12], dtype=dtype) + b = np.array([20, 20, -20, -20], dtype=dtype) + assert_equal(np.lcm(a, b), [60]*4) + + # reduce + a = np.array([3, 12, 20], dtype=dtype) + assert_equal(np.lcm.reduce([3, 12, 20]), 60) + + # broadcasting, and a test including 0 + a = np.arange(6).astype(dtype) + b = 20 + assert_equal(np.lcm(a, b), [0, 20, 20, 60, 20, 20]) + + def _test_gcd_inner(self, dtype): + # basic use + a = np.array([12, 120], dtype=dtype) + b = np.array([20, 200], dtype=dtype) + assert_equal(np.gcd(a, b), [4, 40]) + + if not issubclass(dtype, np.unsignedinteger): + # negatives are ignored + a = np.array([12, -12, 12, -12], dtype=dtype) + b = np.array([20, 20, -20, -20], dtype=dtype) + assert_equal(np.gcd(a, b), [4]*4) + + # reduce + a = np.array([15, 25, 35], dtype=dtype) + assert_equal(np.gcd.reduce(a), 5) + + # broadcasting, and a test including 0 + a = np.arange(6).astype(dtype) + b = 20 + assert_equal(np.gcd(a, b), [20, 1, 2, 1, 4, 5]) + + def test_lcm_overflow(self): + # verify that we don't overflow when a*b does overflow + big = np.int32(np.iinfo(np.int32).max // 11) + a = 2*big + b = 5*big + assert_equal(np.lcm(a, b), 10*big) + + def test_gcd_overflow(self): + for dtype in (np.int32, np.int64): + # verify that we don't overflow when taking abs(x) + # not relevant for lcm, where the result is unrepresentable anyway + a = dtype(np.iinfo(dtype).min) # negative power of two + q = -(a // 4) + assert_equal(np.gcd(a, q*3), q) + assert_equal(np.gcd(a, -q*3), q) + + def test_decimal(self): + from decimal import Decimal + a = np.array([1, 1, -1, -1]) * Decimal('0.20') + b = np.array([1, -1, 1, -1]) * Decimal('0.12') + + assert_equal(np.gcd(a, b), 4*[Decimal('0.04')]) + assert_equal(np.lcm(a, b), 4*[Decimal('0.60')]) + + def test_float(self): + # not well-defined on float due to rounding errors + assert_raises(TypeError, np.gcd, 0.3, 0.4) + assert_raises(TypeError, np.lcm, 0.3, 0.4) + + def test_huge_integers(self): + # Converting to an array first is a bit different as it means we + # have an explicit object dtype: + assert_equal(np.array(2**200), 2**200) + # Special promotion rules should ensure that this also works for + # two Python integers (even if slow). + # (We do this for comparisons, as the result is always bool and + # we also special case array comparisons with Python integers) + np.equal(2**200, 2**200) + + # But, we cannot do this when it would affect the result dtype: + with pytest.raises(OverflowError): + np.gcd(2**100, 3**100) + + # Asking for `object` explicitly is fine, though: + assert np.gcd(2**100, 3**100, dtype=object) == 1 + + # As of now, the below work, because it is using arrays (which + # will be object arrays) + a = np.array(2**100 * 3**5) + b = np.array([2**100 * 5**7, 2**50 * 3**10]) + assert_equal(np.gcd(a, b), [2**100, 2**50 * 3**5]) + assert_equal(np.lcm(a, b), [2**100 * 3**5 * 5**7, 2**100 * 3**10]) + + def test_inf_and_nan(self): + inf = np.array([np.inf], dtype=np.object_) + assert_raises(ValueError, np.gcd, inf, 1) + assert_raises(ValueError, np.gcd, 1, inf) + assert_raises(ValueError, np.gcd, np.nan, inf) + assert_raises(TypeError, np.gcd, 4, float(np.inf)) + + + +class TestRoundingFunctions: + + def test_object_direct(self): + """ test direct implementation of these magic methods """ + class C: + def __floor__(self): + return 1 + def __ceil__(self): + return 2 + def __trunc__(self): + return 3 + + arr = np.array([C(), C()]) + assert_equal(np.floor(arr), [1, 1]) + assert_equal(np.ceil(arr), [2, 2]) + assert_equal(np.trunc(arr), [3, 3]) + + def test_object_indirect(self): + """ test implementations via __float__ """ + class C: + def __float__(self): + return -2.5 + + arr = np.array([C(), C()]) + assert_equal(np.floor(arr), [-3, -3]) + assert_equal(np.ceil(arr), [-2, -2]) + with pytest.raises(TypeError): + np.trunc(arr) # consistent with math.trunc + + def test_fraction(self): + f = Fraction(-4, 3) + assert_equal(np.floor(f), -2) + assert_equal(np.ceil(f), -1) + assert_equal(np.trunc(f), -1) + + @pytest.mark.parametrize('func', [np.floor, np.ceil, np.trunc]) + @pytest.mark.parametrize('dtype', [np.bool, np.float64, np.float32, + np.int64, np.uint32]) + def test_output_dtype(self, func, dtype): + arr = np.array([-2, 0, 4, 8]).astype(dtype) + result = func(arr) + assert_equal(arr, result) + assert result.dtype == dtype + + +class TestComplexFunctions: + funcs = [np.arcsin, np.arccos, np.arctan, np.arcsinh, np.arccosh, + np.arctanh, np.sin, np.cos, np.tan, np.exp, + np.exp2, np.log, np.sqrt, np.log10, np.log2, + np.log1p] + + def test_it(self): + for f in self.funcs: + if f is np.arccosh: + x = 1.5 + else: + x = .5 + fr = f(x) + fz = f(complex(x)) + assert_almost_equal(fz.real, fr, err_msg='real part %s' % f) + assert_almost_equal(fz.imag, 0., err_msg='imag part %s' % f) + + @pytest.mark.xfail(IS_WASM, reason="doesn't work") + def test_precisions_consistent(self): + z = 1 + 1j + for f in self.funcs: + fcf = f(np.csingle(z)) + fcd = f(np.cdouble(z)) + fcl = f(np.clongdouble(z)) + assert_almost_equal(fcf, fcd, decimal=6, err_msg='fch-fcd %s' % f) + assert_almost_equal(fcl, fcd, decimal=15, err_msg='fch-fcl %s' % f) + + @pytest.mark.xfail(IS_WASM, reason="doesn't work") + def test_branch_cuts(self): + # check branch cuts and continuity on them + _check_branch_cut(np.log, -0.5, 1j, 1, -1, True) + _check_branch_cut(np.log2, -0.5, 1j, 1, -1, True) + _check_branch_cut(np.log10, -0.5, 1j, 1, -1, True) + _check_branch_cut(np.log1p, -1.5, 1j, 1, -1, True) + _check_branch_cut(np.sqrt, -0.5, 1j, 1, -1, True) + + _check_branch_cut(np.arcsin, [ -2, 2], [1j, 1j], 1, -1, True) + _check_branch_cut(np.arccos, [ -2, 2], [1j, 1j], 1, -1, True) + _check_branch_cut(np.arctan, [0-2j, 2j], [1, 1], -1, 1, True) + + _check_branch_cut(np.arcsinh, [0-2j, 2j], [1, 1], -1, 1, True) + _check_branch_cut(np.arccosh, [ -1, 0.5], [1j, 1j], 1, -1, True) + _check_branch_cut(np.arctanh, [ -2, 2], [1j, 1j], 1, -1, True) + + # check against bogus branch cuts: assert continuity between quadrants + _check_branch_cut(np.arcsin, [0-2j, 2j], [ 1, 1], 1, 1) + _check_branch_cut(np.arccos, [0-2j, 2j], [ 1, 1], 1, 1) + _check_branch_cut(np.arctan, [ -2, 2], [1j, 1j], 1, 1) + + _check_branch_cut(np.arcsinh, [ -2, 2, 0], [1j, 1j, 1], 1, 1) + _check_branch_cut(np.arccosh, [0-2j, 2j, 2], [1, 1, 1j], 1, 1) + _check_branch_cut(np.arctanh, [0-2j, 2j, 0], [1, 1, 1j], 1, 1) + + @pytest.mark.xfail(IS_WASM, reason="doesn't work") + def test_branch_cuts_complex64(self): + # check branch cuts and continuity on them + _check_branch_cut(np.log, -0.5, 1j, 1, -1, True, np.complex64) + _check_branch_cut(np.log2, -0.5, 1j, 1, -1, True, np.complex64) + _check_branch_cut(np.log10, -0.5, 1j, 1, -1, True, np.complex64) + _check_branch_cut(np.log1p, -1.5, 1j, 1, -1, True, np.complex64) + _check_branch_cut(np.sqrt, -0.5, 1j, 1, -1, True, np.complex64) + + _check_branch_cut(np.arcsin, [ -2, 2], [1j, 1j], 1, -1, True, np.complex64) + _check_branch_cut(np.arccos, [ -2, 2], [1j, 1j], 1, -1, True, np.complex64) + _check_branch_cut(np.arctan, [0-2j, 2j], [1, 1], -1, 1, True, np.complex64) + + _check_branch_cut(np.arcsinh, [0-2j, 2j], [1, 1], -1, 1, True, np.complex64) + _check_branch_cut(np.arccosh, [ -1, 0.5], [1j, 1j], 1, -1, True, np.complex64) + _check_branch_cut(np.arctanh, [ -2, 2], [1j, 1j], 1, -1, True, np.complex64) + + # check against bogus branch cuts: assert continuity between quadrants + _check_branch_cut(np.arcsin, [0-2j, 2j], [ 1, 1], 1, 1, False, np.complex64) + _check_branch_cut(np.arccos, [0-2j, 2j], [ 1, 1], 1, 1, False, np.complex64) + _check_branch_cut(np.arctan, [ -2, 2], [1j, 1j], 1, 1, False, np.complex64) + + _check_branch_cut(np.arcsinh, [ -2, 2, 0], [1j, 1j, 1], 1, 1, False, np.complex64) + _check_branch_cut(np.arccosh, [0-2j, 2j, 2], [1, 1, 1j], 1, 1, False, np.complex64) + _check_branch_cut(np.arctanh, [0-2j, 2j, 0], [1, 1, 1j], 1, 1, False, np.complex64) + + def test_against_cmath(self): + import cmath + + points = [-1-1j, -1+1j, +1-1j, +1+1j] + name_map = {'arcsin': 'asin', 'arccos': 'acos', 'arctan': 'atan', + 'arcsinh': 'asinh', 'arccosh': 'acosh', 'arctanh': 'atanh'} + atol = 4*np.finfo(complex).eps + for func in self.funcs: + fname = func.__name__.split('.')[-1] + cname = name_map.get(fname, fname) + try: + cfunc = getattr(cmath, cname) + except AttributeError: + continue + for p in points: + a = complex(func(np.complex128(p))) + b = cfunc(p) + assert_( + abs(a - b) < atol, + "%s %s: %s; cmath: %s" % (fname, p, a, b) + ) + + @pytest.mark.xfail( + # manylinux2014 uses glibc2.17 + _glibc_older_than("2.18"), + reason="Older glibc versions are imprecise (maybe passes with SIMD?)" + ) + @pytest.mark.xfail(IS_WASM, reason="doesn't work") + @pytest.mark.parametrize('dtype', [ + np.complex64, np.complex128, np.clongdouble + ]) + def test_loss_of_precision(self, dtype): + """Check loss of precision in complex arc* functions""" + if dtype is np.clongdouble and platform.machine() != 'x86_64': + # Failures on musllinux, aarch64, s390x, ppc64le (see gh-17554) + pytest.skip('Only works reliably for x86-64 and recent glibc') + + # Check against known-good functions + + info = np.finfo(dtype) + real_dtype = dtype(0.).real.dtype + eps = info.eps + + def check(x, rtol): + x = x.astype(real_dtype) + + z = x.astype(dtype) + d = np.absolute(np.arcsinh(x)/np.arcsinh(z).real - 1) + assert_(np.all(d < rtol), (np.argmax(d), x[np.argmax(d)], d.max(), + 'arcsinh')) + + z = (1j*x).astype(dtype) + d = np.absolute(np.arcsinh(x)/np.arcsin(z).imag - 1) + assert_(np.all(d < rtol), (np.argmax(d), x[np.argmax(d)], d.max(), + 'arcsin')) + + z = x.astype(dtype) + d = np.absolute(np.arctanh(x)/np.arctanh(z).real - 1) + assert_(np.all(d < rtol), (np.argmax(d), x[np.argmax(d)], d.max(), + 'arctanh')) + + z = (1j*x).astype(dtype) + d = np.absolute(np.arctanh(x)/np.arctan(z).imag - 1) + assert_(np.all(d < rtol), (np.argmax(d), x[np.argmax(d)], d.max(), + 'arctan')) + + # The switchover was chosen as 1e-3; hence there can be up to + # ~eps/1e-3 of relative cancellation error before it + + x_series = np.logspace(-20, -3.001, 200) + x_basic = np.logspace(-2.999, 0, 10, endpoint=False) + + if dtype is np.clongdouble: + if bad_arcsinh(): + pytest.skip("Trig functions of np.clongdouble values known " + "to be inaccurate on aarch64 and PPC for some " + "compilation configurations.") + # It's not guaranteed that the system-provided arc functions + # are accurate down to a few epsilons. (Eg. on Linux 64-bit) + # So, give more leeway for long complex tests here: + check(x_series, 50.0*eps) + else: + check(x_series, 2.1*eps) + check(x_basic, 2.0*eps/1e-3) + + # Check a few points + + z = np.array([1e-5*(1+1j)], dtype=dtype) + p = 9.999999999333333333e-6 + 1.000000000066666666e-5j + d = np.absolute(1-np.arctanh(z)/p) + assert_(np.all(d < 1e-15)) + + p = 1.0000000000333333333e-5 + 9.999999999666666667e-6j + d = np.absolute(1-np.arcsinh(z)/p) + assert_(np.all(d < 1e-15)) + + p = 9.999999999333333333e-6j + 1.000000000066666666e-5 + d = np.absolute(1-np.arctan(z)/p) + assert_(np.all(d < 1e-15)) + + p = 1.0000000000333333333e-5j + 9.999999999666666667e-6 + d = np.absolute(1-np.arcsin(z)/p) + assert_(np.all(d < 1e-15)) + + # Check continuity across switchover points + + def check(func, z0, d=1): + z0 = np.asarray(z0, dtype=dtype) + zp = z0 + abs(z0) * d * eps * 2 + zm = z0 - abs(z0) * d * eps * 2 + assert_(np.all(zp != zm), (zp, zm)) + + # NB: the cancellation error at the switchover is at least eps + good = (abs(func(zp) - func(zm)) < 2*eps) + assert_(np.all(good), (func, z0[~good])) + + for func in (np.arcsinh, np.arcsinh, np.arcsin, np.arctanh, np.arctan): + pts = [rp+1j*ip for rp in (-1e-3, 0, 1e-3) for ip in(-1e-3, 0, 1e-3) + if rp != 0 or ip != 0] + check(func, pts, 1) + check(func, pts, 1j) + check(func, pts, 1+1j) + + @np.errstate(all="ignore") + def test_promotion_corner_cases(self): + for func in self.funcs: + assert func(np.float16(1)).dtype == np.float16 + # Integer to low precision float promotion is a dubious choice: + assert func(np.uint8(1)).dtype == np.float16 + assert func(np.int16(1)).dtype == np.float32 + + +class TestAttributes: + def test_attributes(self): + add = ncu.add + assert_equal(add.__name__, 'add') + assert_(add.ntypes >= 18) # don't fail if types added + assert_('ii->i' in add.types) + assert_equal(add.nin, 2) + assert_equal(add.nout, 1) + assert_equal(add.identity, 0) + + def test_doc(self): + # don't bother checking the long list of kwargs, which are likely to + # change + assert_(ncu.add.__doc__.startswith( + "add(x1, x2, /, out=None, *, where=True")) + assert_(ncu.frexp.__doc__.startswith( + "frexp(x[, out1, out2], / [, out=(None, None)], *, where=True")) + + +class TestSubclass: + + def test_subclass_op(self): + + class simple(np.ndarray): + def __new__(subtype, shape): + self = np.ndarray.__new__(subtype, shape, dtype=object) + self.fill(0) + return self + + a = simple((3, 4)) + assert_equal(a+a, a) + + +class TestFrompyfunc: + + def test_identity(self): + def mul(a, b): + return a * b + + # with identity=value + mul_ufunc = np.frompyfunc(mul, nin=2, nout=1, identity=1) + assert_equal(mul_ufunc.reduce([2, 3, 4]), 24) + assert_equal(mul_ufunc.reduce(np.ones((2, 2)), axis=(0, 1)), 1) + assert_equal(mul_ufunc.reduce([]), 1) + + # with identity=None (reorderable) + mul_ufunc = np.frompyfunc(mul, nin=2, nout=1, identity=None) + assert_equal(mul_ufunc.reduce([2, 3, 4]), 24) + assert_equal(mul_ufunc.reduce(np.ones((2, 2)), axis=(0, 1)), 1) + assert_raises(ValueError, lambda: mul_ufunc.reduce([])) + + # with no identity (not reorderable) + mul_ufunc = np.frompyfunc(mul, nin=2, nout=1) + assert_equal(mul_ufunc.reduce([2, 3, 4]), 24) + assert_raises(ValueError, lambda: mul_ufunc.reduce(np.ones((2, 2)), axis=(0, 1))) + assert_raises(ValueError, lambda: mul_ufunc.reduce([])) + + +def _check_branch_cut(f, x0, dx, re_sign=1, im_sign=-1, sig_zero_ok=False, + dtype=complex): + """ + Check for a branch cut in a function. + + Assert that `x0` lies on a branch cut of function `f` and `f` is + continuous from the direction `dx`. + + Parameters + ---------- + f : func + Function to check + x0 : array-like + Point on branch cut + dx : array-like + Direction to check continuity in + re_sign, im_sign : {1, -1} + Change of sign of the real or imaginary part expected + sig_zero_ok : bool + Whether to check if the branch cut respects signed zero (if applicable) + dtype : dtype + Dtype to check (should be complex) + + """ + x0 = np.atleast_1d(x0).astype(dtype) + dx = np.atleast_1d(dx).astype(dtype) + + if np.dtype(dtype).char == 'F': + scale = np.finfo(dtype).eps * 1e2 + atol = np.float32(1e-2) + else: + scale = np.finfo(dtype).eps * 1e3 + atol = 1e-4 + + y0 = f(x0) + yp = f(x0 + dx*scale*np.absolute(x0)/np.absolute(dx)) + ym = f(x0 - dx*scale*np.absolute(x0)/np.absolute(dx)) + + assert_(np.all(np.absolute(y0.real - yp.real) < atol), (y0, yp)) + assert_(np.all(np.absolute(y0.imag - yp.imag) < atol), (y0, yp)) + assert_(np.all(np.absolute(y0.real - ym.real*re_sign) < atol), (y0, ym)) + assert_(np.all(np.absolute(y0.imag - ym.imag*im_sign) < atol), (y0, ym)) + + if sig_zero_ok: + # check that signed zeros also work as a displacement + jr = (x0.real == 0) & (dx.real != 0) + ji = (x0.imag == 0) & (dx.imag != 0) + if np.any(jr): + x = x0[jr] + x.real = ncu.NZERO + ym = f(x) + assert_(np.all(np.absolute(y0[jr].real - ym.real*re_sign) < atol), (y0[jr], ym)) + assert_(np.all(np.absolute(y0[jr].imag - ym.imag*im_sign) < atol), (y0[jr], ym)) + + if np.any(ji): + x = x0[ji] + x.imag = ncu.NZERO + ym = f(x) + assert_(np.all(np.absolute(y0[ji].real - ym.real*re_sign) < atol), (y0[ji], ym)) + assert_(np.all(np.absolute(y0[ji].imag - ym.imag*im_sign) < atol), (y0[ji], ym)) + +def test_copysign(): + assert_(np.copysign(1, -1) == -1) + with np.errstate(divide="ignore"): + assert_(1 / np.copysign(0, -1) < 0) + assert_(1 / np.copysign(0, 1) > 0) + assert_(np.signbit(np.copysign(np.nan, -1))) + assert_(not np.signbit(np.copysign(np.nan, 1))) + +def _test_nextafter(t): + one = t(1) + two = t(2) + zero = t(0) + eps = np.finfo(t).eps + assert_(np.nextafter(one, two) - one == eps) + assert_(np.nextafter(one, zero) - one < 0) + assert_(np.isnan(np.nextafter(np.nan, one))) + assert_(np.isnan(np.nextafter(one, np.nan))) + assert_(np.nextafter(one, one) == one) + +def test_nextafter(): + return _test_nextafter(np.float64) + + +def test_nextafterf(): + return _test_nextafter(np.float32) + + +@pytest.mark.skipif(np.finfo(np.double) == np.finfo(np.longdouble), + reason="long double is same as double") +@pytest.mark.xfail(condition=platform.machine().startswith("ppc64"), + reason="IBM double double") +def test_nextafterl(): + return _test_nextafter(np.longdouble) + + +def test_nextafter_0(): + for t, direction in itertools.product(np._core.sctypes['float'], (1, -1)): + # The value of tiny for double double is NaN, so we need to pass the + # assert + with suppress_warnings() as sup: + sup.filter(UserWarning) + if not np.isnan(np.finfo(t).tiny): + tiny = np.finfo(t).tiny + assert_( + 0. < direction * np.nextafter(t(0), t(direction)) < tiny) + assert_equal(np.nextafter(t(0), t(direction)) / t(2.1), direction * 0.0) + +def _test_spacing(t): + one = t(1) + eps = np.finfo(t).eps + nan = t(np.nan) + inf = t(np.inf) + with np.errstate(invalid='ignore'): + assert_equal(np.spacing(one), eps) + assert_(np.isnan(np.spacing(nan))) + assert_(np.isnan(np.spacing(inf))) + assert_(np.isnan(np.spacing(-inf))) + assert_(np.spacing(t(1e30)) != 0) + +def test_spacing(): + return _test_spacing(np.float64) + +def test_spacingf(): + return _test_spacing(np.float32) + + +@pytest.mark.skipif(np.finfo(np.double) == np.finfo(np.longdouble), + reason="long double is same as double") +@pytest.mark.xfail(condition=platform.machine().startswith("ppc64"), + reason="IBM double double") +def test_spacingl(): + return _test_spacing(np.longdouble) + +def test_spacing_gfortran(): + # Reference from this fortran file, built with gfortran 4.3.3 on linux + # 32bits: + # PROGRAM test_spacing + # INTEGER, PARAMETER :: SGL = SELECTED_REAL_KIND(p=6, r=37) + # INTEGER, PARAMETER :: DBL = SELECTED_REAL_KIND(p=13, r=200) + # + # WRITE(*,*) spacing(0.00001_DBL) + # WRITE(*,*) spacing(1.0_DBL) + # WRITE(*,*) spacing(1000._DBL) + # WRITE(*,*) spacing(10500._DBL) + # + # WRITE(*,*) spacing(0.00001_SGL) + # WRITE(*,*) spacing(1.0_SGL) + # WRITE(*,*) spacing(1000._SGL) + # WRITE(*,*) spacing(10500._SGL) + # END PROGRAM + ref = {np.float64: [1.69406589450860068E-021, + 2.22044604925031308E-016, + 1.13686837721616030E-013, + 1.81898940354585648E-012], + np.float32: [9.09494702E-13, + 1.19209290E-07, + 6.10351563E-05, + 9.76562500E-04]} + + for dt, dec_ in zip([np.float32, np.float64], (10, 20)): + x = np.array([1e-5, 1, 1000, 10500], dtype=dt) + assert_array_almost_equal(np.spacing(x), ref[dt], decimal=dec_) + +def test_nextafter_vs_spacing(): + # XXX: spacing does not handle long double yet + for t in [np.float32, np.float64]: + for _f in [1, 1e-5, 1000]: + f = t(_f) + f1 = t(_f + 1) + assert_(np.nextafter(f, f1) - f == np.spacing(f)) + +def test_pos_nan(): + """Check np.nan is a positive nan.""" + assert_(np.signbit(np.nan) == 0) + +def test_reduceat(): + """Test bug in reduceat when structured arrays are not copied.""" + db = np.dtype([('name', 'S11'), ('time', np.int64), ('value', np.float32)]) + a = np.empty([100], dtype=db) + a['name'] = 'Simple' + a['time'] = 10 + a['value'] = 100 + indx = [0, 7, 15, 25] + + h2 = [] + val1 = indx[0] + for val2 in indx[1:]: + h2.append(np.add.reduce(a['value'][val1:val2])) + val1 = val2 + h2.append(np.add.reduce(a['value'][val1:])) + h2 = np.array(h2) + + # test buffered -- this should work + h1 = np.add.reduceat(a['value'], indx) + assert_array_almost_equal(h1, h2) + + # This is when the error occurs. + # test no buffer + np.setbufsize(32) + h1 = np.add.reduceat(a['value'], indx) + np.setbufsize(ncu.UFUNC_BUFSIZE_DEFAULT) + assert_array_almost_equal(h1, h2) + +def test_reduceat_empty(): + """Reduceat should work with empty arrays""" + indices = np.array([], 'i4') + x = np.array([], 'f8') + result = np.add.reduceat(x, indices) + assert_equal(result.dtype, x.dtype) + assert_equal(result.shape, (0,)) + # Another case with a slightly different zero-sized shape + x = np.ones((5, 2)) + result = np.add.reduceat(x, [], axis=0) + assert_equal(result.dtype, x.dtype) + assert_equal(result.shape, (0, 2)) + result = np.add.reduceat(x, [], axis=1) + assert_equal(result.dtype, x.dtype) + assert_equal(result.shape, (5, 0)) + +def test_complex_nan_comparisons(): + nans = [complex(np.nan, 0), complex(0, np.nan), complex(np.nan, np.nan)] + fins = [complex(1, 0), complex(-1, 0), complex(0, 1), complex(0, -1), + complex(1, 1), complex(-1, -1), complex(0, 0)] + + with np.errstate(invalid='ignore'): + for x in nans + fins: + x = np.array([x]) + for y in nans + fins: + y = np.array([y]) + + if np.isfinite(x) and np.isfinite(y): + continue + + assert_equal(x < y, False, err_msg="%r < %r" % (x, y)) + assert_equal(x > y, False, err_msg="%r > %r" % (x, y)) + assert_equal(x <= y, False, err_msg="%r <= %r" % (x, y)) + assert_equal(x >= y, False, err_msg="%r >= %r" % (x, y)) + assert_equal(x == y, False, err_msg="%r == %r" % (x, y)) + + +def test_rint_big_int(): + # np.rint bug for large integer values on Windows 32-bit and MKL + # https://github.com/numpy/numpy/issues/6685 + val = 4607998452777363968 + # This is exactly representable in floating point + assert_equal(val, int(float(val))) + # Rint should not change the value + assert_equal(val, np.rint(val)) + + +@pytest.mark.parametrize('ftype', [np.float32, np.float64]) +def test_memoverlap_accumulate(ftype): + # Reproduces bug https://github.com/numpy/numpy/issues/15597 + arr = np.array([0.61, 0.60, 0.77, 0.41, 0.19], dtype=ftype) + out_max = np.array([0.61, 0.61, 0.77, 0.77, 0.77], dtype=ftype) + out_min = np.array([0.61, 0.60, 0.60, 0.41, 0.19], dtype=ftype) + assert_equal(np.maximum.accumulate(arr), out_max) + assert_equal(np.minimum.accumulate(arr), out_min) + +@pytest.mark.parametrize("ufunc, dtype", [ + (ufunc, t[0]) + for ufunc in UFUNCS_BINARY_ACC + for t in ufunc.types + if t[-1] == '?' and t[0] not in 'DFGMmO' +]) +def test_memoverlap_accumulate_cmp(ufunc, dtype): + if ufunc.signature: + pytest.skip('For generic signatures only') + for size in (2, 8, 32, 64, 128, 256): + arr = np.array([0, 1, 1]*size, dtype=dtype) + acc = ufunc.accumulate(arr, dtype='?') + acc_u8 = acc.view(np.uint8) + exp = np.array(list(itertools.accumulate(arr, ufunc)), dtype=np.uint8) + assert_equal(exp, acc_u8) + +@pytest.mark.parametrize("ufunc, dtype", [ + (ufunc, t[0]) + for ufunc in UFUNCS_BINARY_ACC + for t in ufunc.types + if t[0] == t[1] and t[0] == t[-1] and t[0] not in 'DFGMmO?' +]) +def test_memoverlap_accumulate_symmetric(ufunc, dtype): + if ufunc.signature: + pytest.skip('For generic signatures only') + with np.errstate(all='ignore'): + for size in (2, 8, 32, 64, 128, 256): + arr = np.array([0, 1, 2]*size).astype(dtype) + acc = ufunc.accumulate(arr, dtype=dtype) + exp = np.array(list(itertools.accumulate(arr, ufunc)), dtype=dtype) + assert_equal(exp, acc) + +def test_signaling_nan_exceptions(): + with assert_no_warnings(): + a = np.ndarray(shape=(), dtype='float32', buffer=b'\x00\xe0\xbf\xff') + np.isnan(a) + +@pytest.mark.parametrize("arr", [ + np.arange(2), + np.matrix([0, 1]), + np.matrix([[0, 1], [2, 5]]), + ]) +def test_outer_subclass_preserve(arr): + # for gh-8661 + class foo(np.ndarray): pass + actual = np.multiply.outer(arr.view(foo), arr.view(foo)) + assert actual.__class__.__name__ == 'foo' + +def test_outer_bad_subclass(): + class BadArr1(np.ndarray): + def __array_finalize__(self, obj): + # The outer call reshapes to 3 dims, try to do a bad reshape. + if self.ndim == 3: + self.shape = self.shape + (1,) + + class BadArr2(np.ndarray): + def __array_finalize__(self, obj): + if isinstance(obj, BadArr2): + # outer inserts 1-sized dims. In that case disturb them. + if self.shape[-1] == 1: + self.shape = self.shape[::-1] + + for cls in [BadArr1, BadArr2]: + arr = np.ones((2, 3)).view(cls) + with assert_raises(TypeError) as a: + # The first array gets reshaped (not the second one) + np.add.outer(arr, [1, 2]) + + # This actually works, since we only see the reshaping error: + arr = np.ones((2, 3)).view(cls) + assert type(np.add.outer([1, 2], arr)) is cls + +def test_outer_exceeds_maxdims(): + deep = np.ones((1,) * 33) + with assert_raises(ValueError): + np.add.outer(deep, deep) + +def test_bad_legacy_ufunc_silent_errors(): + # legacy ufuncs can't report errors and NumPy can't check if the GIL + # is released. So NumPy has to check after the GIL is released just to + # cover all bases. `np.power` uses/used to use this. + arr = np.arange(3).astype(np.float64) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error(arr, arr) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + # not contiguous means the fast-path cannot be taken + non_contig = arr.repeat(20).reshape(-1, 6)[:, ::2] + ncu_tests.always_error(non_contig, arr) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error.outer(arr, arr) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error.reduce(arr) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error.reduceat(arr, [0, 1]) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error.accumulate(arr) + + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error.at(arr, [0, 1, 2], arr) + + +@pytest.mark.parametrize('x1', [np.arange(3.0), [0.0, 1.0, 2.0]]) +def test_bad_legacy_gufunc_silent_errors(x1): + # Verify that an exception raised in a gufunc loop propagates correctly. + # The signature of always_error_gufunc is '(i),()->()'. + with pytest.raises(RuntimeError, match=r"How unexpected :\)!"): + ncu_tests.always_error_gufunc(x1, 0.0) + + +class TestAddDocstring: + @pytest.mark.skipif(sys.flags.optimize == 2, reason="Python running -OO") + @pytest.mark.skipif(IS_PYPY, reason="PyPy does not modify tp_doc") + def test_add_same_docstring(self): + # test for attributes (which are C-level defined) + ncu.add_docstring(np.ndarray.flat, np.ndarray.flat.__doc__) + + # And typical functions: + def func(): + """docstring""" + return + + ncu.add_docstring(func, func.__doc__) + + @pytest.mark.skipif(sys.flags.optimize == 2, reason="Python running -OO") + def test_different_docstring_fails(self): + # test for attributes (which are C-level defined) + with assert_raises(RuntimeError): + ncu.add_docstring(np.ndarray.flat, "different docstring") + + # And typical functions: + def func(): + """docstring""" + return + + with assert_raises(RuntimeError): + ncu.add_docstring(func, "different docstring") + + +class TestAdd_newdoc_ufunc: + def test_ufunc_arg(self): + assert_raises(TypeError, ncu._add_newdoc_ufunc, 2, "blah") + assert_raises(ValueError, ncu._add_newdoc_ufunc, np.add, "blah") + + def test_string_arg(self): + assert_raises(TypeError, ncu._add_newdoc_ufunc, np.add, 3) diff --git a/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath_complex.py b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath_complex.py new file mode 100644 index 0000000000000000000000000000000000000000..cc54c16da2e3e70595188c285c12257131ea9287 --- /dev/null +++ b/valley/lib/python3.10/site-packages/numpy/_core/tests/test_umath_complex.py @@ -0,0 +1,622 @@ +import sys +import platform +import pytest + +import numpy as np +# import the c-extension module directly since _arg is not exported via umath +import numpy._core._multiarray_umath as ncu +from numpy.testing import ( + assert_raises, assert_equal, assert_array_equal, assert_almost_equal, assert_array_max_ulp + ) + +# TODO: branch cuts (use Pauli code) +# TODO: conj 'symmetry' +# TODO: FPU exceptions + +# At least on Windows the results of many complex functions are not conforming +# to the C99 standard. See ticket 1574. +# Ditto for Solaris (ticket 1642) and OS X on PowerPC. +#FIXME: this will probably change when we require full C99 compatibility +with np.errstate(all='ignore'): + functions_seem_flaky = ((np.exp(complex(np.inf, 0)).imag != 0) + or (np.log(complex(ncu.NZERO, 0)).imag != np.pi)) +# TODO: replace with a check on whether platform-provided C99 funcs are used +xfail_complex_tests = (not sys.platform.startswith('linux') or functions_seem_flaky) + +# TODO This can be xfail when the generator functions are got rid of. +platform_skip = pytest.mark.skipif(xfail_complex_tests, + reason="Inadequate C99 complex support") + + + +class TestCexp: + def test_simple(self): + check = check_complex_value + f = np.exp + + check(f, 1, 0, np.exp(1), 0, False) + check(f, 0, 1, np.cos(1), np.sin(1), False) + + ref = np.exp(1) * complex(np.cos(1), np.sin(1)) + check(f, 1, 1, ref.real, ref.imag, False) + + @platform_skip + def test_special_values(self): + # C99: Section G 6.3.1 + + check = check_complex_value + f = np.exp + + # cexp(+-0 + 0i) is 1 + 0i + check(f, ncu.PZERO, 0, 1, 0, False) + check(f, ncu.NZERO, 0, 1, 0, False) + + # cexp(x + infi) is nan + nani for finite x and raises 'invalid' FPU + # exception + check(f, 1, np.inf, np.nan, np.nan) + check(f, -1, np.inf, np.nan, np.nan) + check(f, 0, np.inf, np.nan, np.nan) + + # cexp(inf + 0i) is inf + 0i + check(f, np.inf, 0, np.inf, 0) + + # cexp(-inf + yi) is +0 * (cos(y) + i sin(y)) for finite y + check(f, -np.inf, 1, ncu.PZERO, ncu.PZERO) + check(f, -np.inf, 0.75 * np.pi, ncu.NZERO, ncu.PZERO) + + # cexp(inf + yi) is +inf * (cos(y) + i sin(y)) for finite y + check(f, np.inf, 1, np.inf, np.inf) + check(f, np.inf, 0.75 * np.pi, -np.inf, np.inf) + + # cexp(-inf + inf i) is +-0 +- 0i (signs unspecified) + def _check_ninf_inf(dummy): + msgform = "cexp(-inf, inf) is (%f, %f), expected (+-0, +-0)" + with np.errstate(invalid='ignore'): + z = f(np.array(complex(-np.inf, np.inf))) + if z.real != 0 or z.imag != 0: + raise AssertionError(msgform % (z.real, z.imag)) + + _check_ninf_inf(None) + + # cexp(inf + inf i) is +-inf + NaNi and raised invalid FPU ex. + def _check_inf_inf(dummy): + msgform = "cexp(inf, inf) is (%f, %f), expected (+-inf, nan)" + with np.errstate(invalid='ignore'): + z = f(np.array(complex(np.inf, np.inf))) + if not np.isinf(z.real) or not np.isnan(z.imag): + raise AssertionError(msgform % (z.real, z.imag)) + + _check_inf_inf(None) + + # cexp(-inf + nan i) is +-0 +- 0i + def _check_ninf_nan(dummy): + msgform = "cexp(-inf, nan) is (%f, %f), expected (+-0, +-0)" + with np.errstate(invalid='ignore'): + z = f(np.array(complex(-np.inf, np.nan))) + if z.real != 0 or z.imag != 0: + raise AssertionError(msgform % (z.real, z.imag)) + + _check_ninf_nan(None) + + # cexp(inf + nan i) is +-inf + nan + def _check_inf_nan(dummy): + msgform = "cexp(-inf, nan) is (%f, %f), expected (+-inf, nan)" + with np.errstate(invalid='ignore'): + z = f(np.array(complex(np.inf, np.nan))) + if not np.isinf(z.real) or not np.isnan(z.imag): + raise AssertionError(msgform % (z.real, z.imag)) + + _check_inf_nan(None) + + # cexp(nan + yi) is nan + nani for y != 0 (optional: raises invalid FPU + # ex) + check(f, np.nan, 1, np.nan, np.nan) + check(f, np.nan, -1, np.nan, np.nan) + + check(f, np.nan, np.inf, np.nan, np.nan) + check(f, np.nan, -np.inf, np.nan, np.nan) + + # cexp(nan + nani) is nan + nani + check(f, np.nan, np.nan, np.nan, np.nan) + + # TODO This can be xfail when the generator functions are got rid of. + @pytest.mark.skip(reason="cexp(nan + 0I) is wrong on most platforms") + def test_special_values2(self): + # XXX: most implementations get it wrong here (including glibc <= 2.10) + # cexp(nan + 0i) is nan + 0i + check = check_complex_value + f = np.exp + + check(f, np.nan, 0, np.nan, 0) + +class TestClog: + def test_simple(self): + x = np.array([1+0j, 1+2j]) + y_r = np.log(np.abs(x)) + 1j * np.angle(x) + y = np.log(x) + assert_almost_equal(y, y_r) + + @platform_skip + @pytest.mark.skipif(platform.machine() == "armv5tel", reason="See gh-413.") + def test_special_values(self): + xl = [] + yl = [] + + # From C99 std (Sec 6.3.2) + # XXX: check exceptions raised + # --- raise for invalid fails. + + # clog(-0 + i0) returns -inf + i pi and raises the 'divide-by-zero' + # floating-point exception. + with np.errstate(divide='raise'): + x = np.array([ncu.NZERO], dtype=complex) + y = complex(-np.inf, np.pi) + assert_raises(FloatingPointError, np.log, x) + with np.errstate(divide='ignore'): + assert_almost_equal(np.log(x), y) + + xl.append(x) + yl.append(y) + + # clog(+0 + i0) returns -inf + i0 and raises the 'divide-by-zero' + # floating-point exception. + with np.errstate(divide='raise'): + x = np.array([0], dtype=complex) + y = complex(-np.inf, 0) + assert_raises(FloatingPointError, np.log, x) + with np.errstate(divide='ignore'): + assert_almost_equal(np.log(x), y) + + xl.append(x) + yl.append(y) + + # clog(x + i inf returns +inf + i pi /2, for finite x. + x = np.array([complex(1, np.inf)], dtype=complex) + y = complex(np.inf, 0.5 * np.pi) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + x = np.array([complex(-1, np.inf)], dtype=complex) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(x + iNaN) returns NaN + iNaN and optionally raises the + # 'invalid' floating- point exception, for finite x. + with np.errstate(invalid='raise'): + x = np.array([complex(1., np.nan)], dtype=complex) + y = complex(np.nan, np.nan) + #assert_raises(FloatingPointError, np.log, x) + with np.errstate(invalid='ignore'): + assert_almost_equal(np.log(x), y) + + xl.append(x) + yl.append(y) + + with np.errstate(invalid='raise'): + x = np.array([np.inf + 1j * np.nan], dtype=complex) + #assert_raises(FloatingPointError, np.log, x) + with np.errstate(invalid='ignore'): + assert_almost_equal(np.log(x), y) + + xl.append(x) + yl.append(y) + + # clog(- inf + iy) returns +inf + ipi , for finite positive-signed y. + x = np.array([-np.inf + 1j], dtype=complex) + y = complex(np.inf, np.pi) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(+ inf + iy) returns +inf + i0, for finite positive-signed y. + x = np.array([np.inf + 1j], dtype=complex) + y = complex(np.inf, 0) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(- inf + i inf) returns +inf + i3pi /4. + x = np.array([complex(-np.inf, np.inf)], dtype=complex) + y = complex(np.inf, 0.75 * np.pi) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(+ inf + i inf) returns +inf + ipi /4. + x = np.array([complex(np.inf, np.inf)], dtype=complex) + y = complex(np.inf, 0.25 * np.pi) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(+/- inf + iNaN) returns +inf + iNaN. + x = np.array([complex(np.inf, np.nan)], dtype=complex) + y = complex(np.inf, np.nan) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + x = np.array([complex(-np.inf, np.nan)], dtype=complex) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(NaN + iy) returns NaN + iNaN and optionally raises the + # 'invalid' floating-point exception, for finite y. + x = np.array([complex(np.nan, 1)], dtype=complex) + y = complex(np.nan, np.nan) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(NaN + i inf) returns +inf + iNaN. + x = np.array([complex(np.nan, np.inf)], dtype=complex) + y = complex(np.inf, np.nan) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(NaN + iNaN) returns NaN + iNaN. + x = np.array([complex(np.nan, np.nan)], dtype=complex) + y = complex(np.nan, np.nan) + assert_almost_equal(np.log(x), y) + xl.append(x) + yl.append(y) + + # clog(conj(z)) = conj(clog(z)). + xa = np.array(xl, dtype=complex) + ya = np.array(yl, dtype=complex) + with np.errstate(divide='ignore'): + for i in range(len(xa)): + assert_almost_equal(np.log(xa[i].conj()), ya[i].conj()) + + +class TestCsqrt: + + def test_simple(self): + # sqrt(1) + check_complex_value(np.sqrt, 1, 0, 1, 0) + + # sqrt(1i) + rres = 0.5*np.sqrt(2) + ires = rres + check_complex_value(np.sqrt, 0, 1, rres, ires, False) + + # sqrt(-1) + check_complex_value(np.sqrt, -1, 0, 0, 1) + + def test_simple_conjugate(self): + ref = np.conj(np.sqrt(complex(1, 1))) + + def f(z): + return np.sqrt(np.conj(z)) + + check_complex_value(f, 1, 1, ref.real, ref.imag, False) + + #def test_branch_cut(self): + # _check_branch_cut(f, -1, 0, 1, -1) + + @platform_skip + def test_special_values(self): + # C99: Sec G 6.4.2 + + check = check_complex_value + f = np.sqrt + + # csqrt(+-0 + 0i) is 0 + 0i + check(f, ncu.PZERO, 0, 0, 0) + check(f, ncu.NZERO, 0, 0, 0) + + # csqrt(x + infi) is inf + infi for any x (including NaN) + check(f, 1, np.inf, np.inf, np.inf) + check(f, -1, np.inf, np.inf, np.inf) + + check(f, ncu.PZERO, np.inf, np.inf, np.inf) + check(f, ncu.NZERO, np.inf, np.inf, np.inf) + check(f, np.inf, np.inf, np.inf, np.inf) + check(f, -np.inf, np.inf, np.inf, np.inf) + check(f, -np.nan, np.inf, np.inf, np.inf) + + # csqrt(x + nani) is nan + nani for any finite x + check(f, 1, np.nan, np.nan, np.nan) + check(f, -1, np.nan, np.nan, np.nan) + check(f, 0, np.nan, np.nan, np.nan) + + # csqrt(-inf + yi) is +0 + infi for any finite y > 0 + check(f, -np.inf, 1, ncu.PZERO, np.inf) + + # csqrt(inf + yi) is +inf + 0i for any finite y > 0 + check(f, np.inf, 1, np.inf, ncu.PZERO) + + # csqrt(-inf + nani) is nan +- infi (both +i infi are valid) + def _check_ninf_nan(dummy): + msgform = "csqrt(-inf, nan) is (%f, %f), expected (nan, +-inf)" + z = np.sqrt(np.array(complex(-np.inf, np.nan))) + #Fixme: ugly workaround for isinf bug. + with np.errstate(invalid='ignore'): + if not (np.isnan(z.real) and np.isinf(z.imag)): + raise AssertionError(msgform % (z.real, z.imag)) + + _check_ninf_nan(None) + + # csqrt(+inf + nani) is inf + nani + check(f, np.inf, np.nan, np.inf, np.nan) + + # csqrt(nan + yi) is nan + nani for any finite y (infinite handled in x + # + nani) + check(f, np.nan, 0, np.nan, np.nan) + check(f, np.nan, 1, np.nan, np.nan) + check(f, np.nan, np.nan, np.nan, np.nan) + + # XXX: check for conj(csqrt(z)) == csqrt(conj(z)) (need to fix branch + # cuts first) + +class TestCpow: + def setup_method(self): + self.olderr = np.seterr(invalid='ignore') + + def teardown_method(self): + np.seterr(**self.olderr) + + def test_simple(self): + x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan]) + y_r = x ** 2 + y = np.power(x, 2) + assert_almost_equal(y, y_r) + + def test_scalar(self): + x = np.array([1, 1j, 2, 2.5+.37j, np.inf, np.nan]) + y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j, 2, 3]) + lx = list(range(len(x))) + + # Hardcode the expected `builtins.complex` values, + # as complex exponentiation is broken as of bpo-44698 + p_r = [ + 1+0j, + 0.20787957635076193+0j, + 0.35812203996480685+0.6097119028618724j, + 0.12659112128185032+0.48847676699581527j, + complex(np.inf, np.nan), + complex(np.nan, np.nan), + ] + + n_r = [x[i] ** y[i] for i in lx] + for i in lx: + assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i) + + def test_array(self): + x = np.array([1, 1j, 2, 2.5+.37j, np.inf, np.nan]) + y = np.array([1, 1j, -0.5+1.5j, -0.5+1.5j, 2, 3]) + lx = list(range(len(x))) + + # Hardcode the expected `builtins.complex` values, + # as complex exponentiation is broken as of bpo-44698 + p_r = [ + 1+0j, + 0.20787957635076193+0j, + 0.35812203996480685+0.6097119028618724j, + 0.12659112128185032+0.48847676699581527j, + complex(np.inf, np.nan), + complex(np.nan, np.nan), + ] + + n_r = x ** y + for i in lx: + assert_almost_equal(n_r[i], p_r[i], err_msg='Loop %d\n' % i) + +class TestCabs: + def setup_method(self): + self.olderr = np.seterr(invalid='ignore') + + def teardown_method(self): + np.seterr(**self.olderr) + + def test_simple(self): + x = np.array([1+1j, 0+2j, 1+2j, np.inf, np.nan]) + y_r = np.array([np.sqrt(2.), 2, np.sqrt(5), np.inf, np.nan]) + y = np.abs(x) + assert_almost_equal(y, y_r) + + def test_fabs(self): + # Test that np.abs(x +- 0j) == np.abs(x) (as mandated by C99 for cabs) + x = np.array([1+0j], dtype=complex) + assert_array_equal(np.abs(x), np.real(x)) + + x = np.array([complex(1, ncu.NZERO)], dtype=complex) + assert_array_equal(np.abs(x), np.real(x)) + + x = np.array([complex(np.inf, ncu.NZERO)], dtype=complex) + assert_array_equal(np.abs(x), np.real(x)) + + x = np.array([complex(np.nan, ncu.NZERO)], dtype=complex) + assert_array_equal(np.abs(x), np.real(x)) + + def test_cabs_inf_nan(self): + x, y = [], [] + + # cabs(+-nan + nani) returns nan + x.append(np.nan) + y.append(np.nan) + check_real_value(np.abs, np.nan, np.nan, np.nan) + + x.append(np.nan) + y.append(-np.nan) + check_real_value(np.abs, -np.nan, np.nan, np.nan) + + # According to C99 standard, if exactly one of the real/part is inf and + # the other nan, then cabs should return inf + x.append(np.inf) + y.append(np.nan) + check_real_value(np.abs, np.inf, np.nan, np.inf) + + x.append(-np.inf) + y.append(np.nan) + check_real_value(np.abs, -np.inf, np.nan, np.inf) + + # cabs(conj(z)) == conj(cabs(z)) (= cabs(z)) + def f(a): + return np.abs(np.conj(a)) + + def g(a, b): + return np.abs(complex(a, b)) + + xa = np.array(x, dtype=complex) + assert len(xa) == len(x) == len(y) + for xi, yi in zip(x, y): + ref = g(xi, yi) + check_real_value(f, xi, yi, ref) + +class TestCarg: + def test_simple(self): + check_real_value(ncu._arg, 1, 0, 0, False) + check_real_value(ncu._arg, 0, 1, 0.5*np.pi, False) + + check_real_value(ncu._arg, 1, 1, 0.25*np.pi, False) + check_real_value(ncu._arg, ncu.PZERO, ncu.PZERO, ncu.PZERO) + + # TODO This can be xfail when the generator functions are got rid of. + @pytest.mark.skip( + reason="Complex arithmetic with signed zero fails on most platforms") + def test_zero(self): + # carg(-0 +- 0i) returns +- pi + check_real_value(ncu._arg, ncu.NZERO, ncu.PZERO, np.pi, False) + check_real_value(ncu._arg, ncu.NZERO, ncu.NZERO, -np.pi, False) + + # carg(+0 +- 0i) returns +- 0 + check_real_value(ncu._arg, ncu.PZERO, ncu.PZERO, ncu.PZERO) + check_real_value(ncu._arg, ncu.PZERO, ncu.NZERO, ncu.NZERO) + + # carg(x +- 0i) returns +- 0 for x > 0 + check_real_value(ncu._arg, 1, ncu.PZERO, ncu.PZERO, False) + check_real_value(ncu._arg, 1, ncu.NZERO, ncu.NZERO, False) + + # carg(x +- 0i) returns +- pi for x < 0 + check_real_value(ncu._arg, -1, ncu.PZERO, np.pi, False) + check_real_value(ncu._arg, -1, ncu.NZERO, -np.pi, False) + + # carg(+- 0 + yi) returns pi/2 for y > 0 + check_real_value(ncu._arg, ncu.PZERO, 1, 0.5 * np.pi, False) + check_real_value(ncu._arg, ncu.NZERO, 1, 0.5 * np.pi, False) + + # carg(+- 0 + yi) returns -pi/2 for y < 0 + check_real_value(ncu._arg, ncu.PZERO, -1, 0.5 * np.pi, False) + check_real_value(ncu._arg, ncu.NZERO, -1, -0.5 * np.pi, False) + + #def test_branch_cuts(self): + # _check_branch_cut(ncu._arg, -1, 1j, -1, 1) + + def test_special_values(self): + # carg(-np.inf +- yi) returns +-pi for finite y > 0 + check_real_value(ncu._arg, -np.inf, 1, np.pi, False) + check_real_value(ncu._arg, -np.inf, -1, -np.pi, False) + + # carg(np.inf +- yi) returns +-0 for finite y > 0 + check_real_value(ncu._arg, np.inf, 1, ncu.PZERO, False) + check_real_value(ncu._arg, np.inf, -1, ncu.NZERO, False) + + # carg(x +- np.infi) returns +-pi/2 for finite x + check_real_value(ncu._arg, 1, np.inf, 0.5 * np.pi, False) + check_real_value(ncu._arg, 1, -np.inf, -0.5 * np.pi, False) + + # carg(-np.inf +- np.infi) returns +-3pi/4 + check_real_value(ncu._arg, -np.inf, np.inf, 0.75 * np.pi, False) + check_real_value(ncu._arg, -np.inf, -np.inf, -0.75 * np.pi, False) + + # carg(np.inf +- np.infi) returns +-pi/4 + check_real_value(ncu._arg, np.inf, np.inf, 0.25 * np.pi, False) + check_real_value(ncu._arg, np.inf, -np.inf, -0.25 * np.pi, False) + + # carg(x + yi) returns np.nan if x or y is nan + check_real_value(ncu._arg, np.nan, 0, np.nan, False) + check_real_value(ncu._arg, 0, np.nan, np.nan, False) + + check_real_value(ncu._arg, np.nan, np.inf, np.nan, False) + check_real_value(ncu._arg, np.inf, np.nan, np.nan, False) + + +def check_real_value(f, x1, y1, x, exact=True): + z1 = np.array([complex(x1, y1)]) + if exact: + assert_equal(f(z1), x) + else: + assert_almost_equal(f(z1), x) + + +def check_complex_value(f, x1, y1, x2, y2, exact=True): + z1 = np.array([complex(x1, y1)]) + z2 = complex(x2, y2) + with np.errstate(invalid='ignore'): + if exact: + assert_equal(f(z1), z2) + else: + assert_almost_equal(f(z1), z2) + +class TestSpecialComplexAVX: + @pytest.mark.parametrize("stride", [-4,-2,-1,1,2,4]) + @pytest.mark.parametrize("astype", [np.complex64, np.complex128]) + def test_array(self, stride, astype): + arr = np.array([complex(np.nan , np.nan), + complex(np.nan , np.inf), + complex(np.inf , np.nan), + complex(np.inf , np.inf), + complex(0. , np.inf), + complex(np.inf , 0.), + complex(0. , 0.), + complex(0. , np.nan), + complex(np.nan , 0.)], dtype=astype) + abs_true = np.array([np.nan, np.inf, np.inf, np.inf, np.inf, np.inf, 0., np.nan, np.nan], dtype=arr.real.dtype) + sq_true = np.array([complex(np.nan, np.nan), + complex(np.nan, np.nan), + complex(np.nan, np.nan), + complex(np.nan, np.inf), + complex(-np.inf, np.nan), + complex(np.inf, np.nan), + complex(0., 0.), + complex(np.nan, np.nan), + complex(np.nan, np.nan)], dtype=astype) + with np.errstate(invalid='ignore'): + assert_equal(np.abs(arr[::stride]), abs_true[::stride]) + assert_equal(np.square(arr[::stride]), sq_true[::stride]) + +class TestComplexAbsoluteAVX: + @pytest.mark.parametrize("arraysize", [1,2,3,4,5,6,7,8,9,10,11,13,15,17,18,19]) + @pytest.mark.parametrize("stride", [-4,-3,-2,-1,1,2,3,4]) + @pytest.mark.parametrize("astype", [np.complex64, np.complex128]) + # test to ensure masking and strides work as intended in the AVX implementation + def test_array(self, arraysize, stride, astype): + arr = np.ones(arraysize, dtype=astype) + abs_true = np.ones(arraysize, dtype=arr.real.dtype) + assert_equal(np.abs(arr[::stride]), abs_true[::stride]) + +# Testcase taken as is from https://github.com/numpy/numpy/issues/16660 +class TestComplexAbsoluteMixedDTypes: + @pytest.mark.parametrize("stride", [-4,-3,-2,-1,1,2,3,4]) + @pytest.mark.parametrize("astype", [np.complex64, np.complex128]) + @pytest.mark.parametrize("func", ['abs', 'square', 'conjugate']) + + def test_array(self, stride, astype, func): + dtype = [('template_id', 'U') + uni_arr2 = str_arr.astype('