Add files using upload-large-folder tool

wemm/lib/python3.10/site-packages/numpy/core/tests/_locales.py

@@ -0,0 +1,74 @@
+"""Provide class for testing in French locale
+
+"""
+import sys
+import locale
+
+import pytest
+
+__ALL__ = ['CommaDecimalPointLocale']
+
+
+def find_comma_decimal_point_locale():
+    """See if platform has a decimal point as comma locale.
+
+    Find a locale that uses a comma instead of a period as the
+    decimal point.
+
+    Returns
+    -------
+    old_locale: str
+        Locale when the function was called.
+    new_locale: {str, None)
+        First French locale found, None if none found.
+
+    """
+    if sys.platform == 'win32':
+        locales = ['FRENCH']
+    else:
+        locales = ['fr_FR', 'fr_FR.UTF-8', 'fi_FI', 'fi_FI.UTF-8']
+
+    old_locale = locale.getlocale(locale.LC_NUMERIC)
+    new_locale = None
+    try:
+        for loc in locales:
+            try:
+                locale.setlocale(locale.LC_NUMERIC, loc)
+                new_locale = loc
+                break
+            except locale.Error:
+                pass
+    finally:
+        locale.setlocale(locale.LC_NUMERIC, locale=old_locale)
+    return old_locale, new_locale
+
+
+class CommaDecimalPointLocale:
+    """Sets LC_NUMERIC to a locale with comma as decimal point.
+
+    Classes derived from this class have setup and teardown methods that run
+    tests with locale.LC_NUMERIC set to a locale where commas (',') are used as
+    the decimal point instead of periods ('.'). On exit the locale is restored
+    to the initial locale. It also serves as context manager with the same
+    effect. If no such locale is available, the test is skipped.
+
+    .. versionadded:: 1.15.0
+
+    """
+    (cur_locale, tst_locale) = find_comma_decimal_point_locale()
+
+    def setup(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def teardown(self):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)
+
+    def __enter__(self):
+        if self.tst_locale is None:
+            pytest.skip("No French locale available")
+        locale.setlocale(locale.LC_NUMERIC, locale=self.tst_locale)
+
+    def __exit__(self, type, value, traceback):
+        locale.setlocale(locale.LC_NUMERIC, locale=self.cur_locale)

wemm/lib/python3.10/site-packages/numpy/core/tests/examples/cython/checks.pyx

@@ -0,0 +1,32 @@
+#cython: language_level=3
+
+"""
+Functions in this module give python-space wrappers for cython functions
+exposed in numpy/__init__.pxd, so they can be tested in test_cython.py
+"""
+cimport numpy as cnp
+cnp.import_array()
+
+
+def is_td64(obj):
+    return cnp.is_timedelta64_object(obj)
+
+
+def is_dt64(obj):
+    return cnp.is_datetime64_object(obj)
+
+
+def get_dt64_value(obj):
+    return cnp.get_datetime64_value(obj)
+
+
+def get_td64_value(obj):
+    return cnp.get_timedelta64_value(obj)
+
+
+def get_dt64_unit(obj):
+    return cnp.get_datetime64_unit(obj)
+
+
+def is_integer(obj):
+    return isinstance(obj, (cnp.integer, int))

wemm/lib/python3.10/site-packages/numpy/core/tests/examples/cython/setup.py

@@ -0,0 +1,25 @@
+"""
+Provide python-space access to the functions exposed in numpy/__init__.pxd
+for testing.
+"""
+
+import numpy as np
+from distutils.core import setup
+from Cython.Build import cythonize
+from setuptools.extension import Extension
+import os
+
+macros = [("NPY_NO_DEPRECATED_API", 0)]
+
+checks = Extension(
+    "checks",
+    sources=[os.path.join('.', "checks.pyx")],
+    include_dirs=[np.get_include()],
+    define_macros=macros,
+)
+
+extensions = [checks]
+
+setup(
+    ext_modules=cythonize(extensions)
+)

wemm/lib/python3.10/site-packages/numpy/core/tests/examples/limited_api/limited_api.c

@@ -0,0 +1,17 @@
+#define Py_LIMITED_API 0x03060000
+
+#include <Python.h>
+#include <numpy/arrayobject.h>
+#include <numpy/ufuncobject.h>
+
+static PyModuleDef moduledef = {
+    .m_base = PyModuleDef_HEAD_INIT,
+    .m_name = "limited_api"
+};
+
+PyMODINIT_FUNC PyInit_limited_api(void)
+{
+    import_array();
+    import_umath();
+    return PyModule_Create(&moduledef);
+}

wemm/lib/python3.10/site-packages/numpy/core/tests/examples/limited_api/setup.py

@@ -0,0 +1,22 @@
+"""
+Build an example package using the limited Python C API.
+"""
+
+import numpy as np
+from setuptools import setup, Extension
+import os
+
+macros = [("NPY_NO_DEPRECATED_API", 0), ("Py_LIMITED_API", "0x03060000")]
+
+limited_api = Extension(
+    "limited_api",
+    sources=[os.path.join('.', "limited_api.c")],
+    include_dirs=[np.get_include()],
+    define_macros=macros,
+)
+
+extensions = [limited_api]
+
+setup(
+    ext_modules=extensions
+)

wemm/lib/python3.10/site-packages/numpy/core/tests/test__exceptions.py

@@ -0,0 +1,88 @@
+"""
+Tests of the ._exceptions module. Primarily for exercising the __str__ methods.
+"""
+
+import pickle
+
+import pytest
+import numpy as np
+
+_ArrayMemoryError = np.core._exceptions._ArrayMemoryError
+_UFuncNoLoopError = np.core._exceptions._UFuncNoLoopError
+
+class TestArrayMemoryError:
+    def test_pickling(self):
+        """ Test that _ArrayMemoryError can be pickled """
+        error = _ArrayMemoryError((1023,), np.dtype(np.uint8))
+        res = pickle.loads(pickle.dumps(error))
+        assert res._total_size == error._total_size
+
+    def test_str(self):
+        e = _ArrayMemoryError((1023,), np.dtype(np.uint8))
+        str(e)  # not crashing is enough
+
+    # testing these properties is easier than testing the full string repr
+    def test__size_to_string(self):
+        """ Test e._size_to_string """
+        f = _ArrayMemoryError._size_to_string
+        Ki = 1024
+        assert f(0) == '0 bytes'
+        assert f(1) == '1 bytes'
+        assert f(1023) == '1023 bytes'
+        assert f(Ki) == '1.00 KiB'
+        assert f(Ki+1) == '1.00 KiB'
+        assert f(10*Ki) == '10.0 KiB'
+        assert f(int(999.4*Ki)) == '999. KiB'
+        assert f(int(1023.4*Ki)) == '1023. KiB'
+        assert f(int(1023.5*Ki)) == '1.00 MiB'
+        assert f(Ki*Ki) == '1.00 MiB'
+
+        # 1023.9999 Mib should round to 1 GiB
+        assert f(int(Ki*Ki*Ki*0.9999)) == '1.00 GiB'
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki) == '1.00 EiB'
+        # larger than sys.maxsize, adding larger prefixes isn't going to help
+        # anyway.
+        assert f(Ki*Ki*Ki*Ki*Ki*Ki*123456) == '123456. EiB'
+
+    def test__total_size(self):
+        """ Test e._total_size """
+        e = _ArrayMemoryError((1,), np.dtype(np.uint8))
+        assert e._total_size == 1
+
+        e = _ArrayMemoryError((2, 4), np.dtype((np.uint64, 16)))
+        assert e._total_size == 1024
+
+
+class TestUFuncNoLoopError:
+    def test_pickling(self):
+        """ Test that _UFuncNoLoopError can be pickled """
+        assert isinstance(pickle.dumps(_UFuncNoLoopError), bytes)
+
+
+@pytest.mark.parametrize("args", [
+    (2, 1, None),
+    (2, 1, "test_prefix"),
+    ("test message",),
+])
+class TestAxisError:
+    def test_attr(self, args):
+        """Validate attribute types."""
+        exc = np.AxisError(*args)
+        if len(args) == 1:
+            assert exc.axis is None
+            assert exc.ndim is None
+        else:
+            axis, ndim, *_ = args
+            assert exc.axis == axis
+            assert exc.ndim == ndim
+
+    def test_pickling(self, args):
+        """Test that `AxisError` can be pickled."""
+        exc = np.AxisError(*args)
+        exc2 = pickle.loads(pickle.dumps(exc))
+
+        assert type(exc) is type(exc2)
+        for name in ("axis", "ndim", "args"):
+            attr1 = getattr(exc, name)
+            attr2 = getattr(exc2, name)
+            assert attr1 == attr2, name

wemm/lib/python3.10/site-packages/numpy/core/tests/test_abc.py

@@ -0,0 +1,54 @@
+from numpy.testing import assert_
+
+import numbers
+
+import numpy as np
+from numpy.core.numerictypes import sctypes
+
+class TestABC:
+    def test_abstract(self):
+        assert_(issubclass(np.number, numbers.Number))
+
+        assert_(issubclass(np.inexact, numbers.Complex))
+        assert_(issubclass(np.complexfloating, numbers.Complex))
+        assert_(issubclass(np.floating, numbers.Real))
+
+        assert_(issubclass(np.integer, numbers.Integral))
+        assert_(issubclass(np.signedinteger, numbers.Integral))
+        assert_(issubclass(np.unsignedinteger, numbers.Integral))
+
+    def test_floats(self):
+        for t in sctypes['float']:
+            assert_(isinstance(t(), numbers.Real),
+                    "{0} is not instance of Real".format(t.__name__))
+            assert_(issubclass(t, numbers.Real),
+                    "{0} is not subclass of Real".format(t.__name__))
+            assert_(not isinstance(t(), numbers.Rational),
+                    "{0} is instance of Rational".format(t.__name__))
+            assert_(not issubclass(t, numbers.Rational),
+                    "{0} is subclass of Rational".format(t.__name__))
+
+    def test_complex(self):
+        for t in sctypes['complex']:
+            assert_(isinstance(t(), numbers.Complex),
+                    "{0} is not instance of Complex".format(t.__name__))
+            assert_(issubclass(t, numbers.Complex),
+                    "{0} is not subclass of Complex".format(t.__name__))
+            assert_(not isinstance(t(), numbers.Real),
+                    "{0} is instance of Real".format(t.__name__))
+            assert_(not issubclass(t, numbers.Real),
+                    "{0} is subclass of Real".format(t.__name__))
+
+    def test_int(self):
+        for t in sctypes['int']:
+            assert_(isinstance(t(), numbers.Integral),
+                    "{0} is not instance of Integral".format(t.__name__))
+            assert_(issubclass(t, numbers.Integral),
+                    "{0} is not subclass of Integral".format(t.__name__))
+
+    def test_uint(self):
+        for t in sctypes['uint']:
+            assert_(isinstance(t(), numbers.Integral),
+                    "{0} is not instance of Integral".format(t.__name__))
+            assert_(issubclass(t, numbers.Integral),
+                    "{0} is not subclass of Integral".format(t.__name__))

wemm/lib/python3.10/site-packages/numpy/core/tests/test_api.py

@@ -0,0 +1,606 @@
+import sys
+
+import numpy as np
+from numpy.core._rational_tests import rational
+import pytest
+from numpy.testing import (
+     assert_, assert_equal, assert_array_equal, assert_raises, assert_warns,
+     HAS_REFCOUNT
+    )
+
+
+def test_array_array():
+    tobj = type(object)
+    ones11 = np.ones((1, 1), np.float64)
+    tndarray = type(ones11)
+    # Test is_ndarray
+    assert_equal(np.array(ones11, dtype=np.float64), ones11)
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tndarray)
+        np.array(ones11)
+        assert_equal(old_refcount, sys.getrefcount(tndarray))
+
+    # test None
+    assert_equal(np.array(None, dtype=np.float64),
+                 np.array(np.nan, dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(tobj)
+        np.array(None, dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(tobj))
+
+    # test scalar
+    assert_equal(np.array(1.0, dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    if HAS_REFCOUNT:
+        old_refcount = sys.getrefcount(np.float64)
+        np.array(np.array(1.0, dtype=np.float64), dtype=np.float64)
+        assert_equal(old_refcount, sys.getrefcount(np.float64))
+
+    # test string
+    S2 = np.dtype((bytes, 2))
+    S3 = np.dtype((bytes, 3))
+    S5 = np.dtype((bytes, 5))
+    assert_equal(np.array(b"1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array(b"1.0").dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=bytes).dtype, S3)
+    assert_equal(np.array(b"1.0", dtype=S2), np.array(b"1."))
+    assert_equal(np.array(b"1", dtype=S5), np.ones((), dtype=S5))
+
+    # test string
+    U2 = np.dtype((str, 2))
+    U3 = np.dtype((str, 3))
+    U5 = np.dtype((str, 5))
+    assert_equal(np.array("1.0", dtype=np.float64),
+                 np.ones((), dtype=np.float64))
+    assert_equal(np.array("1.0").dtype, U3)
+    assert_equal(np.array("1.0", dtype=str).dtype, U3)
+    assert_equal(np.array("1.0", dtype=U2), np.array(str("1.")))
+    assert_equal(np.array("1", dtype=U5), np.ones((), dtype=U5))
+
+    builtins = getattr(__builtins__, '__dict__', __builtins__)
+    assert_(hasattr(builtins, 'get'))
+
+    # test memoryview
+    dat = np.array(memoryview(b'1.0'), dtype=np.float64)
+    assert_equal(dat, [49.0, 46.0, 48.0])
+    assert_(dat.dtype.type is np.float64)
+
+    dat = np.array(memoryview(b'1.0'))
+    assert_equal(dat, [49, 46, 48])
+    assert_(dat.dtype.type is np.uint8)
+
+    # test array interface
+    a = np.array(100.0, dtype=np.float64)
+    o = type("o", (object,),
+             dict(__array_interface__=a.__array_interface__))
+    assert_equal(np.array(o, dtype=np.float64), a)
+
+    # test array_struct interface
+    a = np.array([(1, 4.0, 'Hello'), (2, 6.0, 'World')],
+                 dtype=[('f0', int), ('f1', float), ('f2', str)])
+    o = type("o", (object,),
+             dict(__array_struct__=a.__array_struct__))
+    ## wasn't what I expected... is np.array(o) supposed to equal a ?
+    ## instead we get a array([...], dtype=">V18")
+    assert_equal(bytes(np.array(o).data), bytes(a.data))
+
+    # test array
+    o = type("o", (object,),
+             dict(__array__=lambda *x: np.array(100.0, dtype=np.float64)))()
+    assert_equal(np.array(o, dtype=np.float64), np.array(100.0, np.float64))
+
+    # test recursion
+    nested = 1.5
+    for i in range(np.MAXDIMS):
+        nested = [nested]
+
+    # no error
+    np.array(nested)
+
+    # Exceeds recursion limit
+    assert_raises(ValueError, np.array, [nested], dtype=np.float64)
+
+    # Try with lists...
+    assert_equal(np.array([None] * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None]] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([[None] * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array([1.0] * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([[1.0]] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([[1.0] * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+    # Try with tuples
+    assert_equal(np.array((None,) * 10, dtype=np.float64),
+                 np.full((10,), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,)] * 10, dtype=np.float64),
+                 np.full((10, 1), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10], dtype=np.float64),
+                 np.full((1, 10), np.nan, dtype=np.float64))
+    assert_equal(np.array([(None,) * 10] * 10, dtype=np.float64),
+                 np.full((10, 10), np.nan, dtype=np.float64))
+
+    assert_equal(np.array((1.0,) * 10, dtype=np.float64),
+                 np.ones((10,), dtype=np.float64))
+    assert_equal(np.array([(1.0,)] * 10, dtype=np.float64),
+                 np.ones((10, 1), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10], dtype=np.float64),
+                 np.ones((1, 10), dtype=np.float64))
+    assert_equal(np.array([(1.0,) * 10] * 10, dtype=np.float64),
+                 np.ones((10, 10), dtype=np.float64))
+
+@pytest.mark.parametrize("array", [True, False])
+def test_array_impossible_casts(array):
+    # All builtin types can be forcibly cast, at least theoretically,
+    # but user dtypes cannot necessarily.
+    rt = rational(1, 2)
+    if array:
+        rt = np.array(rt)
+    with assert_raises(TypeError):
+        np.array(rt, dtype="M8")
+
+
+def test_fastCopyAndTranspose():
+    # 0D array
+    a = np.array(2)
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+    # 1D array
+    a = np.array([3, 2, 7, 0])
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+    # 2D array
+    a = np.arange(6).reshape(2, 3)
+    b = np.fastCopyAndTranspose(a)
+    assert_equal(b, a.T)
+    assert_(b.flags.owndata)
+
+def test_array_astype():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+    # Default behavior: allows unsafe casts, keeps memory layout,
+    #                   always copies.
+    b = a.astype('i4')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.strides, b.strides)
+    b = a.T.astype('i4')
+    assert_equal(a.T, b)
+    assert_equal(b.dtype, np.dtype('i4'))
+    assert_equal(a.T.strides, b.strides)
+    b = a.astype('f4')
+    assert_equal(a, b)
+    assert_(not (a is b))
+
+    # copy=False parameter can sometimes skip a copy
+    b = a.astype('f4', copy=False)
+    assert_(a is b)
+
+    # order parameter allows overriding of the memory layout,
+    # forcing a copy if the layout is wrong
+    b = a.astype('f4', order='F', copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(b.flags.f_contiguous)
+
+    b = a.astype('f4', order='C', copy=False)
+    assert_equal(a, b)
+    assert_(a is b)
+    assert_(b.flags.c_contiguous)
+
+    # casting parameter allows catching bad casts
+    b = a.astype('c8', casting='safe')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('c8'))
+
+    assert_raises(TypeError, a.astype, 'i4', casting='safe')
+
+    # subok=False passes through a non-subclassed array
+    b = a.astype('f4', subok=0, copy=False)
+    assert_(a is b)
+
+    class MyNDArray(np.ndarray):
+        pass
+
+    a = np.array([[0, 1, 2], [3, 4, 5]], dtype='f4').view(MyNDArray)
+
+    # subok=True passes through a subclass
+    b = a.astype('f4', subok=True, copy=False)
+    assert_(a is b)
+
+    # subok=True is default, and creates a subtype on a cast
+    b = a.astype('i4', copy=False)
+    assert_equal(a, b)
+    assert_equal(type(b), MyNDArray)
+
+    # subok=False never returns a subclass
+    b = a.astype('f4', subok=False, copy=False)
+    assert_equal(a, b)
+    assert_(not (a is b))
+    assert_(type(b) is not MyNDArray)
+
+    # Make sure converting from string object to fixed length string
+    # does not truncate.
+    a = np.array([b'a'*100], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S100'))
+    a = np.array([u'a'*100], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U100'))
+
+    # Same test as above but for strings shorter than 64 characters
+    a = np.array([b'a'*10], dtype='O')
+    b = a.astype('S')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('S10'))
+    a = np.array([u'a'*10], dtype='O')
+    b = a.astype('U')
+    assert_equal(a, b)
+    assert_equal(b.dtype, np.dtype('U10'))
+
+    a = np.array(123456789012345678901234567890, dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='O').astype('U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array([123456789012345678901234567890], dtype='O').astype('S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array([123456789012345678901234567890], dtype='O').astype('U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array(123456789012345678901234567890, dtype='S')
+    assert_array_equal(a, np.array(b'1234567890' * 3, dtype='S30'))
+    a = np.array(123456789012345678901234567890, dtype='U')
+    assert_array_equal(a, np.array(u'1234567890' * 3, dtype='U30'))
+
+    a = np.array(u'a\u0140', dtype='U')
+    b = np.ndarray(buffer=a, dtype='uint32', shape=2)
+    assert_(b.size == 2)
+
+    a = np.array([1000], dtype='i4')
+    assert_raises(TypeError, a.astype, 'S1', casting='safe')
+
+    a = np.array(1000, dtype='i4')
+    assert_raises(TypeError, a.astype, 'U1', casting='safe')
+
+@pytest.mark.parametrize("dt", ["S", "U"])
+def test_array_astype_to_string_discovery_empty(dt):
+    # See also gh-19085
+    arr = np.array([""], dtype=object)
+    # Note, the itemsize is the `0 -> 1` logic, which should change.
+    # The important part the test is rather that it does not error.
+    assert arr.astype(dt).dtype.itemsize == np.dtype(f"{dt}1").itemsize
+
+    # check the same thing for `np.can_cast` (since it accepts arrays)
+    assert np.can_cast(arr, dt, casting="unsafe")
+    assert not np.can_cast(arr, dt, casting="same_kind")
+    # as well as for the object as a descriptor:
+    assert np.can_cast("O", dt, casting="unsafe")
+
+@pytest.mark.parametrize("dt", ["d", "f", "S13", "U32"])
+def test_array_astype_to_void(dt):
+    dt = np.dtype(dt)
+    arr = np.array([], dtype=dt)
+    assert arr.astype("V").dtype.itemsize == dt.itemsize
+
+def test_object_array_astype_to_void():
+    # This is different to `test_array_astype_to_void` as object arrays
+    # are inspected.  The default void is "V8" (8 is the length of double)
+    arr = np.array([], dtype="O").astype("V")
+    assert arr.dtype == "V8"
+
+@pytest.mark.parametrize("t",
+    np.sctypes['uint'] + np.sctypes['int'] + np.sctypes['float']
+)
+def test_array_astype_warning(t):
+    # test ComplexWarning when casting from complex to float or int
+    a = np.array(10, dtype=np.complex_)
+    assert_warns(np.ComplexWarning, a.astype, t)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.unicode_, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast(dtype, out_dtype):
+    """
+    Currently, for `astype` strings are cast to booleans effectively by
+    calling `bool(int(string)`. This is not consistent (see gh-9875) and
+    will eventually be deprecated.
+    """
+    arr = np.array(["10", "10\0\0\0", "0\0\0", "0"], dtype=dtype)
+    expected = np.array([True, True, False, False], dtype=out_dtype)
+    assert_array_equal(arr.astype(out_dtype), expected)
+
+@pytest.mark.parametrize(["dtype", "out_dtype"],
+        [(np.bytes_, np.bool_),
+         (np.unicode_, np.bool_),
+         (np.dtype("S10,S9"), np.dtype("?,?"))])
+def test_string_to_boolean_cast_errors(dtype, out_dtype):
+    """
+    These currently error out, since cast to integers fails, but should not
+    error out in the future.
+    """
+    for invalid in ["False", "True", "", "\0", "non-empty"]:
+        arr = np.array([invalid], dtype=dtype)
+        with assert_raises(ValueError):
+            arr.astype(out_dtype)
+
+@pytest.mark.parametrize("str_type", [str, bytes, np.str_, np.unicode_])
+@pytest.mark.parametrize("scalar_type",
+        [np.complex64, np.complex128, np.clongdouble])
+def test_string_to_complex_cast(str_type, scalar_type):
+    value = scalar_type(b"1+3j")
+    assert scalar_type(value) == 1+3j
+    assert np.array([value], dtype=object).astype(scalar_type)[()] == 1+3j
+    assert np.array(value).astype(scalar_type)[()] == 1+3j
+    arr = np.zeros(1, dtype=scalar_type)
+    arr[0] = value
+    assert arr[0] == 1+3j
+
+@pytest.mark.parametrize("dtype", np.typecodes["AllFloat"])
+def test_none_to_nan_cast(dtype):
+    # Note that at the time of writing this test, the scalar constructors
+    # reject None
+    arr = np.zeros(1, dtype=dtype)
+    arr[0] = None
+    assert np.isnan(arr)[0]
+    assert np.isnan(np.array(None, dtype=dtype))[()]
+    assert np.isnan(np.array([None], dtype=dtype))[0]
+    assert np.isnan(np.array(None).astype(dtype))[()]
+
+def test_copyto_fromscalar():
+    a = np.arange(6, dtype='f4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, 1.5)
+    assert_equal(a, 1.5)
+    np.copyto(a.T, 2.5)
+    assert_equal(a, 2.5)
+
+    # Where-masked copy
+    mask = np.array([[0, 1, 0], [0, 0, 1]], dtype='?')
+    np.copyto(a, 3.5, where=mask)
+    assert_equal(a, [[2.5, 3.5, 2.5], [2.5, 2.5, 3.5]])
+    mask = np.array([[0, 1], [1, 1], [1, 0]], dtype='?')
+    np.copyto(a.T, 4.5, where=mask)
+    assert_equal(a, [[2.5, 4.5, 4.5], [4.5, 4.5, 3.5]])
+
+def test_copyto():
+    a = np.arange(6, dtype='i4').reshape(2, 3)
+
+    # Simple copy
+    np.copyto(a, [[3, 1, 5], [6, 2, 1]])
+    assert_equal(a, [[3, 1, 5], [6, 2, 1]])
+
+    # Overlapping copy should work
+    np.copyto(a[:, :2], a[::-1, 1::-1])
+    assert_equal(a, [[2, 6, 5], [1, 3, 1]])
+
+    # Defaults to 'same_kind' casting
+    assert_raises(TypeError, np.copyto, a, 1.5)
+
+    # Force a copy with 'unsafe' casting, truncating 1.5 to 1
+    np.copyto(a, 1.5, casting='unsafe')
+    assert_equal(a, 1)
+
+    # Copying with a mask
+    np.copyto(a, 3, where=[True, False, True])
+    assert_equal(a, [[3, 1, 3], [3, 1, 3]])
+
+    # Casting rule still applies with a mask
+    assert_raises(TypeError, np.copyto, a, 3.5, where=[True, False, True])
+
+    # Lists of integer 0's and 1's is ok too
+    np.copyto(a, 4.0, casting='unsafe', where=[[0, 1, 1], [1, 0, 0]])
+    assert_equal(a, [[3, 4, 4], [4, 1, 3]])
+
+    # Overlapping copy with mask should work
+    np.copyto(a[:, :2], a[::-1, 1::-1], where=[[0, 1], [1, 1]])
+    assert_equal(a, [[3, 4, 4], [4, 3, 3]])
+
+    # 'dst' must be an array
+    assert_raises(TypeError, np.copyto, [1, 2, 3], [2, 3, 4])
+
+def test_copyto_permut():
+    # test explicit overflow case
+    pad = 500
+    l = [True] * pad + [True, True, True, True]
+    r = np.zeros(len(l)-pad)
+    d = np.ones(len(l)-pad)
+    mask = np.array(l)[pad:]
+    np.copyto(r, d, where=mask[::-1])
+
+    # test all permutation of possible masks, 9 should be sufficient for
+    # current 4 byte unrolled code
+    power = 9
+    d = np.ones(power)
+    for i in range(2**power):
+        r = np.zeros(power)
+        l = [(i & x) != 0 for x in range(power)]
+        mask = np.array(l)
+        np.copyto(r, d, where=mask)
+        assert_array_equal(r == 1, l)
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r, d, where=mask[::-1])
+        assert_array_equal(r == 1, l[::-1])
+        assert_equal(r.sum(), sum(l))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::2])
+        assert_array_equal(r[::2] == 1, l[::2])
+        assert_equal(r[::2].sum(), sum(l[::2]))
+
+        r = np.zeros(power)
+        np.copyto(r[::2], d[::2], where=mask[::-2])
+        assert_array_equal(r[::2] == 1, l[::-2])
+        assert_equal(r[::2].sum(), sum(l[::-2]))
+
+        for c in [0xFF, 0x7F, 0x02, 0x10]:
+            r = np.zeros(power)
+            mask = np.array(l)
+            imask = np.array(l).view(np.uint8)
+            imask[mask != 0] = c
+            np.copyto(r, d, where=mask)
+            assert_array_equal(r == 1, l)
+            assert_equal(r.sum(), sum(l))
+
+    r = np.zeros(power)
+    np.copyto(r, d, where=True)
+    assert_equal(r.sum(), r.size)
+    r = np.ones(power)
+    d = np.zeros(power)
+    np.copyto(r, d, where=False)
+    assert_equal(r.sum(), r.size)
+
+def test_copy_order():
+    a = np.arange(24).reshape(2, 1, 3, 4)
+    b = a.copy(order='F')
+    c = np.arange(24).reshape(2, 1, 4, 3).swapaxes(2, 3)
+
+    def check_copy_result(x, y, ccontig, fcontig, strides=False):
+        assert_(not (x is y))
+        assert_equal(x, y)
+        assert_equal(res.flags.c_contiguous, ccontig)
+        assert_equal(res.flags.f_contiguous, fcontig)
+
+    # Validate the initial state of a, b, and c
+    assert_(a.flags.c_contiguous)
+    assert_(not a.flags.f_contiguous)
+    assert_(not b.flags.c_contiguous)
+    assert_(b.flags.f_contiguous)
+    assert_(not c.flags.c_contiguous)
+    assert_(not c.flags.f_contiguous)
+
+    # Copy with order='C'
+    res = a.copy(order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = c.copy(order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(a, order='C')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='C')
+    check_copy_result(res, b, ccontig=True, fcontig=False, strides=False)
+    res = np.copy(c, order='C')
+    check_copy_result(res, c, ccontig=True, fcontig=False, strides=False)
+
+    # Copy with order='F'
+    res = a.copy(order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = b.copy(order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(a, order='F')
+    check_copy_result(res, a, ccontig=False, fcontig=True, strides=False)
+    res = np.copy(b, order='F')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='F')
+    check_copy_result(res, c, ccontig=False, fcontig=True, strides=False)
+
+    # Copy with order='K'
+    res = a.copy(order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = b.copy(order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = c.copy(order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+    res = np.copy(a, order='K')
+    check_copy_result(res, a, ccontig=True, fcontig=False, strides=True)
+    res = np.copy(b, order='K')
+    check_copy_result(res, b, ccontig=False, fcontig=True, strides=True)
+    res = np.copy(c, order='K')
+    check_copy_result(res, c, ccontig=False, fcontig=False, strides=True)
+
+def test_contiguous_flags():
+    a = np.ones((4, 4, 1))[::2,:,:]
+    a.strides = a.strides[:2] + (-123,)
+    b = np.ones((2, 2, 1, 2, 2)).swapaxes(3, 4)
+
+    def check_contig(a, ccontig, fcontig):
+        assert_(a.flags.c_contiguous == ccontig)
+        assert_(a.flags.f_contiguous == fcontig)
+
+    # Check if new arrays are correct:
+    check_contig(a, False, False)
+    check_contig(b, False, False)
+    check_contig(np.empty((2, 2, 0, 2, 2)), True, True)
+    check_contig(np.array([[[1], [2]]], order='F'), True, True)
+    check_contig(np.empty((2, 2)), True, False)
+    check_contig(np.empty((2, 2), order='F'), False, True)
+
+    # Check that np.array creates correct contiguous flags:
+    check_contig(np.array(a, copy=False), False, False)
+    check_contig(np.array(a, copy=False, order='C'), True, False)
+    check_contig(np.array(a, ndmin=4, copy=False, order='F'), False, True)
+
+    # Check slicing update of flags and :
+    check_contig(a[0], True, True)
+    check_contig(a[None, ::4, ..., None], True, True)
+    check_contig(b[0, 0, ...], False, True)
+    check_contig(b[:, :, 0:0, :, :], True, True)
+
+    # Test ravel and squeeze.
+    check_contig(a.ravel(), True, True)
+    check_contig(np.ones((1, 3, 1)).squeeze(), True, True)
+
+def test_broadcast_arrays():
+    # Test user defined dtypes
+    a = np.array([(1, 2, 3)], dtype='u4,u4,u4')
+    b = np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4')
+    result = np.broadcast_arrays(a, b)
+    assert_equal(result[0], np.array([(1, 2, 3), (1, 2, 3), (1, 2, 3)], dtype='u4,u4,u4'))
+    assert_equal(result[1], np.array([(1, 2, 3), (4, 5, 6), (7, 8, 9)], dtype='u4,u4,u4'))
+
+@pytest.mark.parametrize(["shape", "fill_value", "expected_output"],
+        [((2, 2), [5.0,  6.0], np.array([[5.0, 6.0], [5.0, 6.0]])),
+         ((3, 2), [1.0,  2.0], np.array([[1.0, 2.0], [1.0, 2.0], [1.0,  2.0]]))])
+def test_full_from_list(shape, fill_value, expected_output):
+    output = np.full(shape, fill_value)
+    assert_equal(output, expected_output)
+
+def test_astype_copyflag():
+    # test the various copyflag options
+    arr = np.arange(10, dtype=np.intp)
+
+    res_true = arr.astype(np.intp, copy=True)
+    assert not np.may_share_memory(arr, res_true)
+    res_always = arr.astype(np.intp, copy=np._CopyMode.ALWAYS)
+    assert not np.may_share_memory(arr, res_always)
+
+    res_false = arr.astype(np.intp, copy=False)
+    # `res_false is arr` currently, but check `may_share_memory`.
+    assert np.may_share_memory(arr, res_false)
+    res_if_needed = arr.astype(np.intp, copy=np._CopyMode.IF_NEEDED)
+    # `res_if_needed is arr` currently, but check `may_share_memory`.
+    assert np.may_share_memory(arr, res_if_needed)
+
+    res_never = arr.astype(np.intp, copy=np._CopyMode.NEVER)
+    assert np.may_share_memory(arr, res_never)
+
+    # Simple tests for when a copy is necessary:
+    res_false = arr.astype(np.float64, copy=False)
+    assert_array_equal(res_false, arr)
+    res_if_needed = arr.astype(np.float64, 
+                               copy=np._CopyMode.IF_NEEDED)
+    assert_array_equal(res_if_needed, arr)
+    assert_raises(ValueError, arr.astype, np.float64,
+                  copy=np._CopyMode.NEVER)

wemm/lib/python3.10/site-packages/numpy/core/tests/test_argparse.py

@@ -0,0 +1,62 @@
+"""
+Tests for the private NumPy argument parsing functionality.
+They mainly exists to ensure good test coverage without having to try the
+weirder cases on actual numpy functions but test them in one place.
+
+The test function is defined in C to be equivalent to (errors may not always
+match exactly, and could be adjusted):
+
+    def func(arg1, /, arg2, *, arg3):
+        i = integer(arg1)  # reproducing the 'i' parsing in Python.
+        return None
+"""
+
+import pytest
+
+import numpy as np
+from numpy.core._multiarray_tests import argparse_example_function as func
+
+
+def test_invalid_integers():
+    with pytest.raises(TypeError,
+            match="integer argument expected, got float"):
+        func(1.)
+    with pytest.raises(OverflowError):
+        func(2**100)
+
+
+def test_missing_arguments():
+    with pytest.raises(TypeError,
+            match="missing required positional argument 0"):
+        func()
+    with pytest.raises(TypeError,
+            match="missing required positional argument 0"):
+        func(arg2=1, arg3=4)
+    with pytest.raises(TypeError,
+            match=r"missing required argument \'arg2\' \(pos 1\)"):
+        func(1, arg3=5)
+
+
+def test_too_many_positional():
+    # the second argument is positional but can be passed as keyword.
+    with pytest.raises(TypeError,
+            match="takes from 2 to 3 positional arguments but 4 were given"):
+        func(1, 2, 3, 4)
+
+
+def test_multiple_values():
+    with pytest.raises(TypeError,
+            match=r"given by name \('arg2'\) and position \(position 1\)"):
+        func(1, 2, arg2=3)
+
+
+def test_string_fallbacks():
+    # We can (currently?) use numpy strings to test the "slow" fallbacks
+    # that should normally not be taken due to string interning.
+    arg2 = np.unicode_("arg2")
+    missing_arg = np.unicode_("missing_arg")
+    func(1, **{arg2: 3})
+    with pytest.raises(TypeError,
+            match="got an unexpected keyword argument 'missing_arg'"):
+        func(2, **{missing_arg: 3})
+

wemm/lib/python3.10/site-packages/numpy/core/tests/test_array_coercion.py

@@ -0,0 +1,767 @@
+"""
+Tests for array coercion, mainly through testing `np.array` results directly.
+Note that other such tests exist e.g. in `test_api.py` and many corner-cases
+are tested (sometimes indirectly) elsewhere.
+"""
+
+import pytest
+from pytest import param
+
+from itertools import product
+
+import numpy as np
+from numpy.core._rational_tests import rational
+from numpy.core._multiarray_umath import _discover_array_parameters
+
+from numpy.testing import (
+    assert_array_equal, assert_warns, IS_PYPY)
+
+
+def arraylikes():
+    """
+    Generator for functions converting an array into various array-likes.
+    If full is True (default) includes array-likes not capable of handling
+    all dtypes
+    """
+    # base array:
+    def ndarray(a):
+        return a
+
+    yield param(ndarray, id="ndarray")
+
+    # subclass:
+    class MyArr(np.ndarray):
+        pass
+
+    def subclass(a):
+        return a.view(MyArr)
+
+    yield subclass
+
+    class _SequenceLike():
+        # We are giving a warning that array-like's were also expected to be
+        # sequence-like in `np.array([array_like])`, this can be removed
+        # when the deprecation exired (started NumPy 1.20)
+        def __len__(self):
+            raise TypeError
+
+        def __getitem__(self):
+            raise TypeError
+
+    # Array-interface
+    class ArrayDunder(_SequenceLike):
+        def __init__(self, a):
+            self.a = a
+
+        def __array__(self, dtype=None):
+            return self.a
+
+    yield param(ArrayDunder, id="__array__")
+
+    # memory-view
+    yield param(memoryview, id="memoryview")
+
+    # Array-interface
+    class ArrayInterface(_SequenceLike):
+        def __init__(self, a):
+            self.a = a  # need to hold on to keep interface valid
+            self.__array_interface__ = a.__array_interface__
+
+    yield param(ArrayInterface, id="__array_interface__")
+
+    # Array-Struct
+    class ArrayStruct(_SequenceLike):
+        def __init__(self, a):
+            self.a = a  # need to hold on to keep struct valid
+            self.__array_struct__ = a.__array_struct__
+
+    yield param(ArrayStruct, id="__array_struct__")
+
+
+def scalar_instances(times=True, extended_precision=True, user_dtype=True):
+    # Hard-coded list of scalar instances.
+    # Floats:
+    yield param(np.sqrt(np.float16(5)), id="float16")
+    yield param(np.sqrt(np.float32(5)), id="float32")
+    yield param(np.sqrt(np.float64(5)), id="float64")
+    if extended_precision:
+        yield param(np.sqrt(np.longdouble(5)), id="longdouble")
+
+    # Complex:
+    yield param(np.sqrt(np.complex64(2+3j)), id="complex64")
+    yield param(np.sqrt(np.complex128(2+3j)), id="complex128")
+    if extended_precision:
+        yield param(np.sqrt(np.longcomplex(2+3j)), id="clongdouble")
+
+    # Bool:
+    # XFAIL: Bool should be added, but has some bad properties when it
+    # comes to strings, see also gh-9875
+    # yield param(np.bool_(0), id="bool")
+
+    # Integers:
+    yield param(np.int8(2), id="int8")
+    yield param(np.int16(2), id="int16")
+    yield param(np.int32(2), id="int32")
+    yield param(np.int64(2), id="int64")
+
+    yield param(np.uint8(2), id="uint8")
+    yield param(np.uint16(2), id="uint16")
+    yield param(np.uint32(2), id="uint32")
+    yield param(np.uint64(2), id="uint64")
+
+    # Rational:
+    if user_dtype:
+        yield param(rational(1, 2), id="rational")
+
+    # Cannot create a structured void scalar directly:
+    structured = np.array([(1, 3)], "i,i")[0]
+    assert isinstance(structured, np.void)
+    assert structured.dtype == np.dtype("i,i")
+    yield param(structured, id="structured")
+
+    if times:
+        # Datetimes and timedelta
+        yield param(np.timedelta64(2), id="timedelta64[generic]")
+        yield param(np.timedelta64(23, "s"), id="timedelta64[s]")
+        yield param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)")
+
+        yield param(np.datetime64("NaT"), id="datetime64[generic](NaT)")
+        yield param(np.datetime64("2020-06-07 12:43", "ms"), id="datetime64[ms]")
+
+    # Strings and unstructured void:
+    yield param(np.bytes_(b"1234"), id="bytes")
+    yield param(np.unicode_("2345"), id="unicode")
+    yield param(np.void(b"4321"), id="unstructured_void")
+
+
+def is_parametric_dtype(dtype):
+    """Returns True if the the dtype is a parametric legacy dtype (itemsize
+    is 0, or a datetime without units)
+    """
+    if dtype.itemsize == 0:
+        return True
+    if issubclass(dtype.type, (np.datetime64, np.timedelta64)):
+        if dtype.name.endswith("64"):
+            # Generic time units
+            return True
+    return False
+
+
+class TestStringDiscovery:
+    @pytest.mark.parametrize("obj",
+            [object(), 1.2, 10**43, None, "string"],
+            ids=["object", "1.2", "10**43", "None", "string"])
+    def test_basic_stringlength(self, obj):
+        length = len(str(obj))
+        expected = np.dtype(f"S{length}")
+
+        assert np.array(obj, dtype="S").dtype == expected
+        assert np.array([obj], dtype="S").dtype == expected
+
+        # A nested array is also discovered correctly
+        arr = np.array(obj, dtype="O")
+        assert np.array(arr, dtype="S").dtype == expected
+        # Check that .astype() behaves identical
+        assert arr.astype("S").dtype == expected
+
+    @pytest.mark.parametrize("obj",
+            [object(), 1.2, 10**43, None, "string"],
+            ids=["object", "1.2", "10**43", "None", "string"])
+    def test_nested_arrays_stringlength(self, obj):
+        length = len(str(obj))
+        expected = np.dtype(f"S{length}")
+        arr = np.array(obj, dtype="O")
+        assert np.array([arr, arr], dtype="S").dtype == expected
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_unpack_first_level(self, arraylike):
+        # We unpack exactly one level of array likes
+        obj = np.array([None])
+        obj[0] = np.array(1.2)
+        # the length of the included item, not of the float dtype
+        length = len(str(obj[0]))
+        expected = np.dtype(f"S{length}")
+
+        obj = arraylike(obj)
+        # casting to string usually calls str(obj)
+        arr = np.array([obj], dtype="S")
+        assert arr.shape == (1, 1)
+        assert arr.dtype == expected
+
+
+class TestScalarDiscovery:
+    def test_void_special_case(self):
+        # Void dtypes with structures discover tuples as elements
+        arr = np.array((1, 2, 3), dtype="i,i,i")
+        assert arr.shape == ()
+        arr = np.array([(1, 2, 3)], dtype="i,i,i")
+        assert arr.shape == (1,)
+
+    def test_char_special_case(self):
+        arr = np.array("string", dtype="c")
+        assert arr.shape == (6,)
+        assert arr.dtype.char == "c"
+        arr = np.array(["string"], dtype="c")
+        assert arr.shape == (1, 6)
+        assert arr.dtype.char == "c"
+
+    def test_char_special_case_deep(self):
+        # Check that the character special case errors correctly if the
+        # array is too deep:
+        nested = ["string"]  # 2 dimensions (due to string being sequence)
+        for i in range(np.MAXDIMS - 2):
+            nested = [nested]
+
+        arr = np.array(nested, dtype='c')
+        assert arr.shape == (1,) * (np.MAXDIMS - 1) + (6,)
+        with pytest.raises(ValueError):
+            np.array([nested], dtype="c")
+
+    def test_unknown_object(self):
+        arr = np.array(object())
+        assert arr.shape == ()
+        assert arr.dtype == np.dtype("O")
+
+    @pytest.mark.parametrize("scalar", scalar_instances())
+    def test_scalar(self, scalar):
+        arr = np.array(scalar)
+        assert arr.shape == ()
+        assert arr.dtype == scalar.dtype
+
+        arr = np.array([[scalar, scalar]])
+        assert arr.shape == (1, 2)
+        assert arr.dtype == scalar.dtype
+
+    # Additionally to string this test also runs into a corner case
+    # with datetime promotion (the difference is the promotion order).
+    @pytest.mark.filterwarnings("ignore:Promotion of numbers:FutureWarning")
+    def test_scalar_promotion(self):
+        for sc1, sc2 in product(scalar_instances(), scalar_instances()):
+            sc1, sc2 = sc1.values[0], sc2.values[0]
+            # test all combinations:
+            try:
+                arr = np.array([sc1, sc2])
+            except (TypeError, ValueError):
+                # The promotion between two times can fail
+                # XFAIL (ValueError): Some object casts are currently undefined
+                continue
+            assert arr.shape == (2,)
+            try:
+                dt1, dt2 = sc1.dtype, sc2.dtype
+                expected_dtype = np.promote_types(dt1, dt2)
+                assert arr.dtype == expected_dtype
+            except TypeError as e:
+                # Will currently always go to object dtype
+                assert arr.dtype == np.dtype("O")
+
+    @pytest.mark.parametrize("scalar", scalar_instances())
+    def test_scalar_coercion(self, scalar):
+        # This tests various scalar coercion paths, mainly for the numerical
+        # types.  It includes some paths not directly related to `np.array`
+        if isinstance(scalar, np.inexact):
+            # Ensure we have a full-precision number if available
+            scalar = type(scalar)((scalar * 2)**0.5)
+
+        if type(scalar) is rational:
+            # Rational generally fails due to a missing cast. In the future
+            # object casts should automatically be defined based on `setitem`.
+            pytest.xfail("Rational to object cast is undefined currently.")
+
+        # Use casting from object:
+        arr = np.array(scalar, dtype=object).astype(scalar.dtype)
+
+        # Test various ways to create an array containing this scalar:
+        arr1 = np.array(scalar).reshape(1)
+        arr2 = np.array([scalar])
+        arr3 = np.empty(1, dtype=scalar.dtype)
+        arr3[0] = scalar
+        arr4 = np.empty(1, dtype=scalar.dtype)
+        arr4[:] = [scalar]
+        # All of these methods should yield the same results
+        assert_array_equal(arr, arr1)
+        assert_array_equal(arr, arr2)
+        assert_array_equal(arr, arr3)
+        assert_array_equal(arr, arr4)
+
+    @pytest.mark.xfail(IS_PYPY, reason="`int(np.complex128(3))` fails on PyPy")
+    @pytest.mark.filterwarnings("ignore::numpy.ComplexWarning")
+    @pytest.mark.parametrize("cast_to", scalar_instances())
+    def test_scalar_coercion_same_as_cast_and_assignment(self, cast_to):
+        """
+        Test that in most cases:
+           * `np.array(scalar, dtype=dtype)`
+           * `np.empty((), dtype=dtype)[()] = scalar`
+           * `np.array(scalar).astype(dtype)`
+        should behave the same.  The only exceptions are paramteric dtypes
+        (mainly datetime/timedelta without unit) and void without fields.
+        """
+        dtype = cast_to.dtype  # use to parametrize only the target dtype
+
+        for scalar in scalar_instances(times=False):
+            scalar = scalar.values[0]
+
+            if dtype.type == np.void:
+               if scalar.dtype.fields is not None and dtype.fields is None:
+                    # Here, coercion to "V6" works, but the cast fails.
+                    # Since the types are identical, SETITEM takes care of
+                    # this, but has different rules than the cast.
+                    with pytest.raises(TypeError):
+                        np.array(scalar).astype(dtype)
+                    np.array(scalar, dtype=dtype)
+                    np.array([scalar], dtype=dtype)
+                    continue
+
+            # The main test, we first try to use casting and if it succeeds
+            # continue below testing that things are the same, otherwise
+            # test that the alternative paths at least also fail.
+            try:
+                cast = np.array(scalar).astype(dtype)
+            except (TypeError, ValueError, RuntimeError):
+                # coercion should also raise (error type may change)
+                with pytest.raises(Exception):
+                    np.array(scalar, dtype=dtype)
+
+                if (isinstance(scalar, rational) and
+                        np.issubdtype(dtype, np.signedinteger)):
+                    return
+
+                with pytest.raises(Exception):
+                    np.array([scalar], dtype=dtype)
+                # assignment should also raise
+                res = np.zeros((), dtype=dtype)
+                with pytest.raises(Exception):
+                    res[()] = scalar
+
+                return
+
+            # Non error path:
+            arr = np.array(scalar, dtype=dtype)
+            assert_array_equal(arr, cast)
+            # assignment behaves the same
+            ass = np.zeros((), dtype=dtype)
+            ass[()] = scalar
+            assert_array_equal(ass, cast)
+
+    @pytest.mark.parametrize("pyscalar", [10, 10.32, 10.14j, 10**100])
+    def test_pyscalar_subclasses(self, pyscalar):
+        """NumPy arrays are read/write which means that anything but invariant
+        behaviour is on thin ice.  However, we currently are happy to discover
+        subclasses of Python float, int, complex the same as the base classes.
+        This should potentially be deprecated.
+        """
+        class MyScalar(type(pyscalar)):
+            pass
+
+        res = np.array(MyScalar(pyscalar))
+        expected = np.array(pyscalar)
+        assert_array_equal(res, expected)
+
+    @pytest.mark.parametrize("dtype_char", np.typecodes["All"])
+    def test_default_dtype_instance(self, dtype_char):
+        if dtype_char in "SU":
+            dtype = np.dtype(dtype_char + "1")
+        elif dtype_char == "V":
+            # Legacy behaviour was to use V8. The reason was float64 being the
+            # default dtype and that having 8 bytes.
+            dtype = np.dtype("V8")
+        else:
+            dtype = np.dtype(dtype_char)
+
+        discovered_dtype, _ = _discover_array_parameters([], type(dtype))
+
+        assert discovered_dtype == dtype
+        assert discovered_dtype.itemsize == dtype.itemsize
+
+    @pytest.mark.parametrize("dtype", np.typecodes["Integer"])
+    def test_scalar_to_int_coerce_does_not_cast(self, dtype):
+        """
+        Signed integers are currently different in that they do not cast other
+        NumPy scalar, but instead use scalar.__int__(). The hardcoded
+        exception to this rule is `np.array(scalar, dtype=integer)`.
+        """
+        dtype = np.dtype(dtype)
+        invalid_int = np.ulonglong(-1)
+
+        float_nan = np.float64(np.nan)
+
+        for scalar in [float_nan, invalid_int]:
+            # This is a special case using casting logic and thus not failing:
+            coerced = np.array(scalar, dtype=dtype)
+            cast = np.array(scalar).astype(dtype)
+            assert_array_equal(coerced, cast)
+
+            # However these fail:
+            with pytest.raises((ValueError, OverflowError)):
+                np.array([scalar], dtype=dtype)
+            with pytest.raises((ValueError, OverflowError)):
+                cast[()] = scalar
+
+
+class TestTimeScalars:
+    @pytest.mark.parametrize("dtype", [np.int64, np.float32])
+    @pytest.mark.parametrize("scalar",
+            [param(np.timedelta64("NaT", "s"), id="timedelta64[s](NaT)"),
+             param(np.timedelta64(123, "s"), id="timedelta64[s]"),
+             param(np.datetime64("NaT", "generic"), id="datetime64[generic](NaT)"),
+             param(np.datetime64(1, "D"), id="datetime64[D]")],)
+    def test_coercion_basic(self, dtype, scalar):
+        # Note the `[scalar]` is there because np.array(scalar) uses stricter
+        # `scalar.__int__()` rules for backward compatibility right now.
+        arr = np.array(scalar, dtype=dtype)
+        cast = np.array(scalar).astype(dtype)
+        assert_array_equal(arr, cast)
+
+        ass = np.ones((), dtype=dtype)
+        if issubclass(dtype, np.integer):
+            with pytest.raises(TypeError):
+                # raises, as would np.array([scalar], dtype=dtype), this is
+                # conversion from times, but behaviour of integers.
+                ass[()] = scalar
+        else:
+            ass[()] = scalar
+            assert_array_equal(ass, cast)
+
+    @pytest.mark.parametrize("dtype", [np.int64, np.float32])
+    @pytest.mark.parametrize("scalar",
+            [param(np.timedelta64(123, "ns"), id="timedelta64[ns]"),
+             param(np.timedelta64(12, "generic"), id="timedelta64[generic]")])
+    def test_coercion_timedelta_convert_to_number(self, dtype, scalar):
+        # Only "ns" and "generic" timedeltas can be converted to numbers
+        # so these are slightly special.
+        arr = np.array(scalar, dtype=dtype)
+        cast = np.array(scalar).astype(dtype)
+        ass = np.ones((), dtype=dtype)
+        ass[()] = scalar  # raises, as would np.array([scalar], dtype=dtype)
+
+        assert_array_equal(arr, cast)
+        assert_array_equal(cast, cast)
+
+    @pytest.mark.parametrize("dtype", ["S6", "U6"])
+    @pytest.mark.parametrize(["val", "unit"],
+            [param(123, "s", id="[s]"), param(123, "D", id="[D]")])
+    def test_coercion_assignment_datetime(self, val, unit, dtype):
+        # String from datetime64 assignment is currently special cased to
+        # never use casting.  This is because casting will error in this
+        # case, and traditionally in most cases the behaviour is maintained
+        # like this.  (`np.array(scalar, dtype="U6")` would have failed before)
+        # TODO: This discrepancy _should_ be resolved, either by relaxing the
+        #       cast, or by deprecating the first part.
+        scalar = np.datetime64(val, unit)
+        dtype = np.dtype(dtype)
+        cut_string = dtype.type(str(scalar)[:6])
+
+        arr = np.array(scalar, dtype=dtype)
+        assert arr[()] == cut_string
+        ass = np.ones((), dtype=dtype)
+        ass[()] = scalar
+        assert ass[()] == cut_string
+
+        with pytest.raises(RuntimeError):
+            # However, unlike the above assignment using `str(scalar)[:6]`
+            # due to being handled by the string DType and not be casting
+            # the explicit cast fails:
+            np.array(scalar).astype(dtype)
+
+
+    @pytest.mark.parametrize(["val", "unit"],
+            [param(123, "s", id="[s]"), param(123, "D", id="[D]")])
+    def test_coercion_assignment_timedelta(self, val, unit):
+        scalar = np.timedelta64(val, unit)
+
+        # Unlike datetime64, timedelta allows the unsafe cast:
+        np.array(scalar, dtype="S6")
+        cast = np.array(scalar).astype("S6")
+        ass = np.ones((), dtype="S6")
+        ass[()] = scalar
+        expected = scalar.astype("S")[:6]
+        assert cast[()] == expected
+        assert ass[()] == expected
+
+class TestNested:
+    def test_nested_simple(self):
+        initial = [1.2]
+        nested = initial
+        for i in range(np.MAXDIMS - 1):
+            nested = [nested]
+
+        arr = np.array(nested, dtype="float64")
+        assert arr.shape == (1,) * np.MAXDIMS
+        with pytest.raises(ValueError):
+            np.array([nested], dtype="float64")
+
+        # We discover object automatically at this time:
+        with assert_warns(np.VisibleDeprecationWarning):
+            arr = np.array([nested])
+        assert arr.dtype == np.dtype("O")
+        assert arr.shape == (1,) * np.MAXDIMS
+        assert arr.item() is initial
+
+    def test_pathological_self_containing(self):
+        # Test that this also works for two nested sequences
+        l = []
+        l.append(l)
+        arr = np.array([l, l, l], dtype=object)
+        assert arr.shape == (3,) + (1,) * (np.MAXDIMS - 1)
+
+        # Also check a ragged case:
+        arr = np.array([l, [None], l], dtype=object)
+        assert arr.shape == (3, 1)
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_nested_arraylikes(self, arraylike):
+        # We try storing an array like into an array, but the array-like
+        # will have too many dimensions.  This means the shape discovery
+        # decides that the array-like must be treated as an object (a special
+        # case of ragged discovery).  The result will be an array with one
+        # dimension less than the maximum dimensions, and the array being
+        # assigned to it (which does work for object or if `float(arraylike)`
+        # works).
+        initial = arraylike(np.ones((1, 1)))
+
+        nested = initial
+        for i in range(np.MAXDIMS - 1):
+            nested = [nested]
+
+        with pytest.warns(DeprecationWarning):
+            # It will refuse to assign the array into
+            np.array(nested, dtype="float64")
+
+        # If this is object, we end up assigning a (1, 1) array into (1,)
+        # (due to running out of dimensions), this is currently supported but
+        # a special case which is not ideal.
+        arr = np.array(nested, dtype=object)
+        assert arr.shape == (1,) * np.MAXDIMS
+        assert arr.item() == np.array(initial).item()
+
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_uneven_depth_ragged(self, arraylike):
+        arr = np.arange(4).reshape((2, 2))
+        arr = arraylike(arr)
+
+        # Array is ragged in the second dimension already:
+        out = np.array([arr, [arr]], dtype=object)
+        assert out.shape == (2,)
+        assert out[0] is arr
+        assert type(out[1]) is list
+
+        # Array is ragged in the third dimension:
+        with pytest.raises(ValueError):
+            # This is a broadcast error during assignment, because
+            # the array shape would be (2, 2, 2) but `arr[0, 0] = arr` fails.
+            np.array([arr, [arr, arr]], dtype=object)
+
+    def test_empty_sequence(self):
+        arr = np.array([[], [1], [[1]]], dtype=object)
+        assert arr.shape == (3,)
+
+        # The empty sequence stops further dimension discovery, so the
+        # result shape will be (0,) which leads to an error during:
+        with pytest.raises(ValueError):
+            np.array([[], np.empty((0, 1))], dtype=object)
+
+    def test_array_of_different_depths(self):
+        # When multiple arrays (or array-likes) are included in a
+        # sequences and have different depth, we currently discover
+        # as many dimensions as they share. (see also gh-17224)
+        arr = np.zeros((3, 2))
+        mismatch_first_dim = np.zeros((1, 2))
+        mismatch_second_dim = np.zeros((3, 3))
+
+        dtype, shape = _discover_array_parameters(
+            [arr, mismatch_second_dim], dtype=np.dtype("O"))
+        assert shape == (2, 3)
+
+        dtype, shape = _discover_array_parameters(
+            [arr, mismatch_first_dim], dtype=np.dtype("O"))
+        assert shape == (2,)
+        # The second case is currently supported because the arrays
+        # can be stored as objects:
+        res = np.asarray([arr, mismatch_first_dim], dtype=np.dtype("O"))
+        assert res[0] is arr
+        assert res[1] is mismatch_first_dim
+
+
+class TestBadSequences:
+    # These are tests for bad objects passed into `np.array`, in general
+    # these have undefined behaviour.  In the old code they partially worked
+    # when now they will fail.  We could (and maybe should) create a copy
+    # of all sequences to be safe against bad-actors.
+
+    def test_growing_list(self):
+        # List to coerce, `mylist` will append to it during coercion
+        obj = []
+        class mylist(list):
+            def __len__(self):
+                obj.append([1, 2])
+                return super().__len__()
+
+        obj.append(mylist([1, 2]))
+
+        with pytest.raises(RuntimeError):
+            np.array(obj)
+
+    # Note: We do not test a shrinking list.  These do very evil things
+    #       and the only way to fix them would be to copy all sequences.
+    #       (which may be a real option in the future).
+
+    def test_mutated_list(self):
+        # List to coerce, `mylist` will mutate the first element
+        obj = []
+        class mylist(list):
+            def __len__(self):
+                obj[0] = [2, 3]  # replace with a different list.
+                return super().__len__()
+
+        obj.append([2, 3])
+        obj.append(mylist([1, 2]))
+        with pytest.raises(RuntimeError):
+            np.array(obj)
+
+    def test_replace_0d_array(self):
+        # List to coerce, `mylist` will mutate the first element
+        obj = []
+        class baditem:
+            def __len__(self):
+                obj[0][0] = 2  # replace with a different list.
+                raise ValueError("not actually a sequence!")
+
+            def __getitem__(self):
+                pass
+
+        # Runs into a corner case in the new code, the `array(2)` is cached
+        # so replacing it invalidates the cache.
+        obj.append([np.array(2), baditem()])
+        with pytest.raises(RuntimeError):
+            np.array(obj)
+
+
+class TestArrayLikes:
+    @pytest.mark.parametrize("arraylike", arraylikes())
+    def test_0d_object_special_case(self, arraylike):
+        arr = np.array(0.)
+        obj = arraylike(arr)
+        # A single array-like is always converted:
+        res = np.array(obj, dtype=object)
+        assert_array_equal(arr, res)
+
+        # But a single 0-D nested array-like never:
+        res = np.array([obj], dtype=object)
+        assert res[0] is obj
+
+    def test_0d_generic_special_case(self):
+        class ArraySubclass(np.ndarray):
+            def __float__(self):
+                raise TypeError("e.g. quantities raise on this")
+
+        arr = np.array(0.)
+        obj = arr.view(ArraySubclass)
+        res = np.array(obj)
+        # The subclass is simply cast:
+        assert_array_equal(arr, res)
+
+        # If the 0-D array-like is included, __float__ is currently
+        # guaranteed to be used.  We may want to change that, quantities
+        # and masked arrays half make use of this.
+        with pytest.raises(TypeError):
+            np.array([obj])
+
+        # The same holds for memoryview:
+        obj = memoryview(arr)
+        res = np.array(obj)
+        assert_array_equal(arr, res)
+        with pytest.raises(ValueError):
+            # The error type does not matter much here.
+            np.array([obj])
+
+    def test_arraylike_classes(self):
+        # The classes of array-likes should generally be acceptable to be
+        # stored inside a numpy (object) array.  This tests all of the
+        # special attributes (since all are checked during coercion).
+        arr = np.array(np.int64)
+        assert arr[()] is np.int64
+        arr = np.array([np.int64])
+        assert arr[0] is np.int64
+
+        # This also works for properties/unbound methods:
+        class ArrayLike:
+            @property
+            def __array_interface__(self):
+                pass
+
+            @property
+            def __array_struct__(self):
+                pass
+
+            def __array__(self):
+                pass
+
+        arr = np.array(ArrayLike)
+        assert arr[()] is ArrayLike
+        arr = np.array([ArrayLike])
+        assert arr[0] is ArrayLike
+
+    @pytest.mark.skipif(
+            np.dtype(np.intp).itemsize < 8, reason="Needs 64bit platform")
+    def test_too_large_array_error_paths(self):
+        """Test the error paths, including for memory leaks"""
+        arr = np.array(0, dtype="uint8")
+        # Guarantees that a contiguous copy won't work:
+        arr = np.broadcast_to(arr, 2**62)
+
+        for i in range(5):
+            # repeat, to ensure caching cannot have an effect:
+            with pytest.raises(MemoryError):
+                np.array(arr)
+            with pytest.raises(MemoryError):
+                np.array([arr])
+
+    @pytest.mark.parametrize("attribute",
+        ["__array_interface__", "__array__", "__array_struct__"])
+    @pytest.mark.parametrize("error", [RecursionError, MemoryError])
+    def test_bad_array_like_attributes(self, attribute, error):
+        # RecursionError and MemoryError are considered fatal. All errors
+        # (except AttributeError) should probably be raised in the future,
+        # but shapely made use of it, so it will require a deprecation.
+
+        class BadInterface:
+            def __getattr__(self, attr):
+                if attr == attribute:
+                    raise error
+                super().__getattr__(attr)
+
+        with pytest.raises(error):
+            np.array(BadInterface())
+
+    @pytest.mark.parametrize("error", [RecursionError, MemoryError])
+    def test_bad_array_like_bad_length(self, error):
+        # RecursionError and MemoryError are considered "critical" in
+        # sequences. We could expand this more generally though. (NumPy 1.20)
+        class BadSequence:
+            def __len__(self):
+                raise error
+            def __getitem__(self):
+                # must have getitem to be a Sequence
+                return 1
+
+        with pytest.raises(error):
+            np.array(BadSequence())
+
+
+class TestSpecialAttributeLookupFailure:
+    # An exception was raised while fetching the attribute
+
+    class WeirdArrayLike:
+        @property
+        def __array__(self):
+            raise RuntimeError("oops!")
+
+    class WeirdArrayInterface:
+        @property
+        def __array_interface__(self):
+            raise RuntimeError("oops!")
+
+    def test_deprecated(self):
+        with pytest.raises(RuntimeError):
+            np.array(self.WeirdArrayLike())
+        with pytest.raises(RuntimeError):
+            np.array(self.WeirdArrayInterface())

wemm/lib/python3.10/site-packages/numpy/core/tests/test_array_interface.py

@@ -0,0 +1,216 @@
+import sys
+import pytest
+import numpy as np
+from numpy.testing import extbuild
+
+
+@pytest.fixture
+def get_module(tmp_path):
+    """ Some codes to generate data and manage temporary buffers use when
+    sharing with numpy via the array interface protocol.
+    """
+
+    if not sys.platform.startswith('linux'):
+        pytest.skip('link fails on cygwin')
+
+    prologue = '''
+        #include <Python.h>
+        #define NPY_NO_DEPRECATED_API NPY_1_7_API_VERSION
+        #include <numpy/arrayobject.h>
+        #include <stdio.h>
+        #include <math.h>
+
+        NPY_NO_EXPORT
+        void delete_array_struct(PyObject *cap) {
+
+            /* get the array interface structure */
+            PyArrayInterface *inter = (PyArrayInterface*)
+                PyCapsule_GetPointer(cap, NULL);
+
+            /* get the buffer by which data was shared */
+            double *ptr = (double*)PyCapsule_GetContext(cap);
+
+            /* for the purposes of the regression test set the elements
+               to nan */
+            for (npy_intp i = 0; i < inter->shape[0]; ++i)
+                ptr[i] = nan("");
+
+            /* free the shared buffer */
+            free(ptr);
+
+            /* free the array interface structure */
+            free(inter->shape);
+            free(inter);
+
+            fprintf(stderr, "delete_array_struct\\ncap = %ld inter = %ld"
+                " ptr = %ld\\n", (long)cap, (long)inter, (long)ptr);
+        }
+        '''
+
+    functions = [
+        ("new_array_struct", "METH_VARARGS", """
+
+            long long n_elem = 0;
+            double value = 0.0;
+
+            if (!PyArg_ParseTuple(args, "Ld", &n_elem, &value)) {
+                Py_RETURN_NONE;
+            }
+
+            /* allocate and initialize the data to share with numpy */
+            long long n_bytes = n_elem*sizeof(double);
+            double *data = (double*)malloc(n_bytes);
+
+            if (!data) {
+                PyErr_Format(PyExc_MemoryError,
+                    "Failed to malloc %lld bytes", n_bytes);
+
+                Py_RETURN_NONE;
+            }
+
+            for (long long i = 0; i < n_elem; ++i) {
+                data[i] = value;
+            }
+
+            /* calculate the shape and stride */
+            int nd = 1;
+
+            npy_intp *ss = (npy_intp*)malloc(2*nd*sizeof(npy_intp));
+            npy_intp *shape = ss;
+            npy_intp *stride = ss + nd;
+
+            shape[0] = n_elem;
+            stride[0] = sizeof(double);
+
+            /* construct the array interface */
+            PyArrayInterface *inter = (PyArrayInterface*)
+                malloc(sizeof(PyArrayInterface));
+
+            memset(inter, 0, sizeof(PyArrayInterface));
+
+            inter->two = 2;
+            inter->nd = nd;
+            inter->typekind = 'f';
+            inter->itemsize = sizeof(double);
+            inter->shape = shape;
+            inter->strides = stride;
+            inter->data = data;
+            inter->flags = NPY_ARRAY_WRITEABLE | NPY_ARRAY_NOTSWAPPED |
+                           NPY_ARRAY_ALIGNED | NPY_ARRAY_C_CONTIGUOUS;
+
+            /* package into a capsule */
+            PyObject *cap = PyCapsule_New(inter, NULL, delete_array_struct);
+
+            /* save the pointer to the data */
+            PyCapsule_SetContext(cap, data);
+
+            fprintf(stderr, "new_array_struct\\ncap = %ld inter = %ld"
+                " ptr = %ld\\n", (long)cap, (long)inter, (long)data);
+
+            return cap;
+        """)
+        ]
+
+    more_init = "import_array();"
+
+    try:
+        import array_interface_testing
+        return array_interface_testing
+    except ImportError:
+        pass
+
+    # if it does not exist, build and load it
+    return extbuild.build_and_import_extension('array_interface_testing',
+                                               functions,
+                                               prologue=prologue,
+                                               include_dirs=[np.get_include()],
+                                               build_dir=tmp_path,
+                                               more_init=more_init)
+
+
+@pytest.mark.slow
+def test_cstruct(get_module):
+
+    class data_source:
+        """
+        This class is for testing the timing of the PyCapsule destructor
+        invoked when numpy release its reference to the shared data as part of
+        the numpy array interface protocol. If the PyCapsule destructor is
+        called early the shared data is freed and invlaid memory accesses will
+        occur.
+        """
+
+        def __init__(self, size, value):
+            self.size = size
+            self.value = value
+
+        @property
+        def __array_struct__(self):
+            return get_module.new_array_struct(self.size, self.value)
+
+    # write to the same stream as the C code
+    stderr = sys.__stderr__
+
+    # used to validate the shared data.
+    expected_value = -3.1415
+    multiplier = -10000.0
+
+    # create some data to share with numpy via the array interface
+    # assign the data an expected value.
+    stderr.write(' ---- create an object to share data ---- \n')
+    buf = data_source(256, expected_value)
+    stderr.write(' ---- OK!\n\n')
+
+    # share the data
+    stderr.write(' ---- share data via the array interface protocol ---- \n')
+    arr = np.array(buf, copy=False)
+    stderr.write('arr.__array_interface___ = %s\n' % (
+                 str(arr.__array_interface__)))
+    stderr.write('arr.base = %s\n' % (str(arr.base)))
+    stderr.write(' ---- OK!\n\n')
+
+    # release the source of the shared data. this will not release the data
+    # that was shared with numpy, that is done in the PyCapsule destructor.
+    stderr.write(' ---- destroy the object that shared data ---- \n')
+    buf = None
+    stderr.write(' ---- OK!\n\n')
+
+    # check that we got the expected data. If the PyCapsule destructor we
+    # defined was prematurely called then this test will fail because our
+    # destructor sets the elements of the array to NaN before free'ing the
+    # buffer. Reading the values here may also cause a SEGV
+    assert np.allclose(arr, expected_value)
+
+    # read the data. If the PyCapsule destructor we defined was prematurely
+    # called then reading the values here may cause a SEGV and will be reported
+    # as invalid reads by valgrind
+    stderr.write(' ---- read shared data ---- \n')
+    stderr.write('arr = %s\n' % (str(arr)))
+    stderr.write(' ---- OK!\n\n')
+
+    # write to the shared buffer. If the shared data was prematurely deleted
+    # this will may cause a SEGV and valgrind will report invalid writes
+    stderr.write(' ---- modify shared data ---- \n')
+    arr *= multiplier
+    expected_value *= multiplier
+    stderr.write('arr.__array_interface___ = %s\n' % (
+                 str(arr.__array_interface__)))
+    stderr.write('arr.base = %s\n' % (str(arr.base)))
+    stderr.write(' ---- OK!\n\n')
+
+    # read the data. If the shared data was prematurely deleted this
+    # will may cause a SEGV and valgrind will report invalid reads
+    stderr.write(' ---- read modified shared data ---- \n')
+    stderr.write('arr = %s\n' % (str(arr)))
+    stderr.write(' ---- OK!\n\n')
+
+    # check that we got the expected data. If the PyCapsule destructor we
+    # defined was prematurely called then this test will fail because our
+    # destructor sets the elements of the array to NaN before free'ing the
+    # buffer. Reading the values here may also cause a SEGV
+    assert np.allclose(arr, expected_value)
+
+    # free the shared data, the PyCapsule destructor should run here
+    stderr.write(' ---- free shared data ---- \n')
+    arr = None
+    stderr.write(' ---- OK!\n\n')

wemm/lib/python3.10/site-packages/numpy/core/tests/test_arraymethod.py

@@ -0,0 +1,93 @@
+"""
+This file tests the generic aspects of ArrayMethod.  At the time of writing
+this is private API, but when added, public API may be added here.
+"""
+
+from __future__ import annotations
+
+import sys
+import types
+from typing import Any
+
+import pytest
+
+import numpy as np
+from numpy.core._multiarray_umath import _get_castingimpl as get_castingimpl
+
+
+class TestResolveDescriptors:
+    # Test mainly error paths of the resolve_descriptors function,
+    # note that the `casting_unittests` tests exercise this non-error paths.
+
+    # Casting implementations are the main/only current user:
+    method = get_castingimpl(type(np.dtype("d")), type(np.dtype("f")))
+
+    @pytest.mark.parametrize("args", [
+        (True,),  # Not a tuple.
+        ((None,)),  # Too few elements
+        ((None, None, None),),  # Too many
+        ((None, None),),  # Input dtype is None, which is invalid.
+        ((np.dtype("d"), True),),  # Output dtype is not a dtype
+        ((np.dtype("f"), None),),  # Input dtype does not match method
+    ])
+    def test_invalid_arguments(self, args):
+        with pytest.raises(TypeError):
+            self.method._resolve_descriptors(*args)
+
+
+class TestSimpleStridedCall:
+    # Test mainly error paths of the resolve_descriptors function,
+    # note that the `casting_unittests` tests exercise this non-error paths.
+
+    # Casting implementations are the main/only current user:
+    method = get_castingimpl(type(np.dtype("d")), type(np.dtype("f")))
+
+    @pytest.mark.parametrize(["args", "error"], [
+        ((True,), TypeError),  # Not a tuple
+        (((None,),), TypeError),  # Too few elements
+        ((None, None), TypeError),  # Inputs are not arrays.
+        (((None, None, None),), TypeError),  # Too many
+        (((np.arange(3), np.arange(3)),), TypeError),  # Incorrect dtypes
+        (((np.ones(3, dtype=">d"), np.ones(3, dtype="<f")),),
+         TypeError),  # Does not support byte-swapping
+        (((np.ones((2, 2), dtype="d"), np.ones((2, 2), dtype="f")),),
+         ValueError),  # not 1-D
+        (((np.ones(3, dtype="d"), np.ones(4, dtype="f")),),
+          ValueError),  # different length
+        (((np.frombuffer(b"\0x00"*3*2, dtype="d"),
+           np.frombuffer(b"\0x00"*3, dtype="f")),),
+         ValueError),  # output not writeable
+    ])
+    def test_invalid_arguments(self, args, error):
+        # This is private API, which may be modified freely
+        with pytest.raises(error):
+            self.method._simple_strided_call(*args)
+
+
+@pytest.mark.skipif(sys.version_info < (3, 9), reason="Requires python 3.9")
+@pytest.mark.parametrize(
+    "cls", [np.ndarray, np.recarray, np.chararray, np.matrix, np.memmap]
+)
+class TestClassGetItem:
+    def test_class_getitem(self, cls: type[np.ndarray]) -> None:
+        """Test `ndarray.__class_getitem__`."""
+        alias = cls[Any, Any]
+        assert isinstance(alias, types.GenericAlias)
+        assert alias.__origin__ is cls
+
+    @pytest.mark.parametrize("arg_len", range(4))
+    def test_subscript_tup(self, cls: type[np.ndarray], arg_len: int) -> None:
+        arg_tup = (Any,) * arg_len
+        if arg_len in (1, 2):
+            assert cls[arg_tup]
+        else:
+            match = f"Too {'few' if arg_len == 0 else 'many'} arguments"
+            with pytest.raises(TypeError, match=match):
+                cls[arg_tup]
+
+
+@pytest.mark.skipif(sys.version_info >= (3, 9), reason="Requires python 3.8")
+def test_class_getitem_38() -> None:
+    match = "Type subscription requires python >= 3.9"
+    with pytest.raises(TypeError, match=match):
+        np.ndarray[Any, Any]

wemm/lib/python3.10/site-packages/numpy/core/tests/test_arrayprint.py

@@ -0,0 +1,967 @@
+import sys
+import gc
+from hypothesis import given
+from hypothesis.extra import numpy as hynp
+import pytest
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_raises, assert_warns, HAS_REFCOUNT,
+    assert_raises_regex,
+    )
+import textwrap
+
+class TestArrayRepr:
+    def test_nan_inf(self):
+        x = np.array([np.nan, np.inf])
+        assert_equal(repr(x), 'array([nan, inf])')
+
+    def test_subclass(self):
+        class sub(np.ndarray): pass
+
+        # one dimensional
+        x1d = np.array([1, 2]).view(sub)
+        assert_equal(repr(x1d), 'sub([1, 2])')
+
+        # two dimensional
+        x2d = np.array([[1, 2], [3, 4]]).view(sub)
+        assert_equal(repr(x2d),
+            'sub([[1, 2],\n'
+            '     [3, 4]])')
+
+        # two dimensional with flexible dtype
+        xstruct = np.ones((2,2), dtype=[('a', '<i4')]).view(sub)
+        assert_equal(repr(xstruct),
+            "sub([[(1,), (1,)],\n"
+            "     [(1,), (1,)]], dtype=[('a', '<i4')])"
+        )
+
+    @pytest.mark.xfail(reason="See gh-10544")
+    def test_object_subclass(self):
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        # test that object + subclass is OK:
+        x = sub([None, None])
+        assert_equal(repr(x), 'sub([None, None], dtype=object)')
+        assert_equal(str(x), '[None None]')
+
+        x = sub([None, sub([None, None])])
+        assert_equal(repr(x),
+            'sub([None, sub([None, None], dtype=object)], dtype=object)')
+        assert_equal(str(x), '[None sub([None, None], dtype=object)]')
+
+    def test_0d_object_subclass(self):
+        # make sure that subclasses which return 0ds instead
+        # of scalars don't cause infinite recursion in str
+        class sub(np.ndarray):
+            def __new__(cls, inp):
+                obj = np.asarray(inp).view(cls)
+                return obj
+
+            def __getitem__(self, ind):
+                ret = super().__getitem__(ind)
+                return sub(ret)
+
+        x = sub(1)
+        assert_equal(repr(x), 'sub(1)')
+        assert_equal(str(x), '1')
+
+        x = sub([1, 1])
+        assert_equal(repr(x), 'sub([1, 1])')
+        assert_equal(str(x), '[1 1]')
+
+        # check it works properly with object arrays too
+        x = sub(None)
+        assert_equal(repr(x), 'sub(None, dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # plus recursive object arrays (even depth > 1)
+        y = sub(None)
+        x[()] = y
+        y[()] = x
+        assert_equal(repr(x),
+            'sub(sub(sub(..., dtype=object), dtype=object), dtype=object)')
+        assert_equal(str(x), '...')
+        x[()] = 0  # resolve circular references for garbage collector
+
+        # nested 0d-subclass-object
+        x = sub(None)
+        x[()] = sub(None)
+        assert_equal(repr(x), 'sub(sub(None, dtype=object), dtype=object)')
+        assert_equal(str(x), 'None')
+
+        # gh-10663
+        class DuckCounter(np.ndarray):
+            def __getitem__(self, item):
+                result = super().__getitem__(item)
+                if not isinstance(result, DuckCounter):
+                    result = result[...].view(DuckCounter)
+                return result
+
+            def to_string(self):
+                return {0: 'zero', 1: 'one', 2: 'two'}.get(self.item(), 'many')
+
+            def __str__(self):
+                if self.shape == ():
+                    return self.to_string()
+                else:
+                    fmt = {'all': lambda x: x.to_string()}
+                    return np.array2string(self, formatter=fmt)
+
+        dc = np.arange(5).view(DuckCounter)
+        assert_equal(str(dc), "[zero one two many many]")
+        assert_equal(str(dc[0]), "zero")
+
+    def test_self_containing(self):
+        arr0d = np.array(None)
+        arr0d[()] = arr0d
+        assert_equal(repr(arr0d),
+            'array(array(..., dtype=object), dtype=object)')
+        arr0d[()] = 0  # resolve recursion for garbage collector
+
+        arr1d = np.array([None, None])
+        arr1d[1] = arr1d
+        assert_equal(repr(arr1d),
+            'array([None, array(..., dtype=object)], dtype=object)')
+        arr1d[1] = 0  # resolve recursion for garbage collector
+
+        first = np.array(None)
+        second = np.array(None)
+        first[()] = second
+        second[()] = first
+        assert_equal(repr(first),
+            'array(array(array(..., dtype=object), dtype=object), dtype=object)')
+        first[()] = 0  # resolve circular references for garbage collector
+
+    def test_containing_list(self):
+        # printing square brackets directly would be ambiguuous
+        arr1d = np.array([None, None])
+        arr1d[0] = [1, 2]
+        arr1d[1] = [3]
+        assert_equal(repr(arr1d),
+            'array([list([1, 2]), list([3])], dtype=object)')
+
+    def test_void_scalar_recursion(self):
+        # gh-9345
+        repr(np.void(b'test'))  # RecursionError ?
+
+    def test_fieldless_structured(self):
+        # gh-10366
+        no_fields = np.dtype([])
+        arr_no_fields = np.empty(4, dtype=no_fields)
+        assert_equal(repr(arr_no_fields), 'array([(), (), (), ()], dtype=[])')
+
+
+class TestComplexArray:
+    def test_str(self):
+        rvals = [0, 1, -1, np.inf, -np.inf, np.nan]
+        cvals = [complex(rp, ip) for rp in rvals for ip in rvals]
+        dtypes = [np.complex64, np.cdouble, np.clongdouble]
+        actual = [str(np.array([c], dt)) for c in cvals for dt in dtypes]
+        wanted = [
+            '[0.+0.j]',    '[0.+0.j]',    '[0.+0.j]',
+            '[0.+1.j]',    '[0.+1.j]',    '[0.+1.j]',
+            '[0.-1.j]',    '[0.-1.j]',    '[0.-1.j]',
+            '[0.+infj]',   '[0.+infj]',   '[0.+infj]',
+            '[0.-infj]',   '[0.-infj]',   '[0.-infj]',
+            '[0.+nanj]',   '[0.+nanj]',   '[0.+nanj]',
+            '[1.+0.j]',    '[1.+0.j]',    '[1.+0.j]',
+            '[1.+1.j]',    '[1.+1.j]',    '[1.+1.j]',
+            '[1.-1.j]',    '[1.-1.j]',    '[1.-1.j]',
+            '[1.+infj]',   '[1.+infj]',   '[1.+infj]',
+            '[1.-infj]',   '[1.-infj]',   '[1.-infj]',
+            '[1.+nanj]',   '[1.+nanj]',   '[1.+nanj]',
+            '[-1.+0.j]',   '[-1.+0.j]',   '[-1.+0.j]',
+            '[-1.+1.j]',   '[-1.+1.j]',   '[-1.+1.j]',
+            '[-1.-1.j]',   '[-1.-1.j]',   '[-1.-1.j]',
+            '[-1.+infj]',  '[-1.+infj]',  '[-1.+infj]',
+            '[-1.-infj]',  '[-1.-infj]',  '[-1.-infj]',
+            '[-1.+nanj]',  '[-1.+nanj]',  '[-1.+nanj]',
+            '[inf+0.j]',   '[inf+0.j]',   '[inf+0.j]',
+            '[inf+1.j]',   '[inf+1.j]',   '[inf+1.j]',
+            '[inf-1.j]',   '[inf-1.j]',   '[inf-1.j]',
+            '[inf+infj]',  '[inf+infj]',  '[inf+infj]',
+            '[inf-infj]',  '[inf-infj]',  '[inf-infj]',
+            '[inf+nanj]',  '[inf+nanj]',  '[inf+nanj]',
+            '[-inf+0.j]',  '[-inf+0.j]',  '[-inf+0.j]',
+            '[-inf+1.j]',  '[-inf+1.j]',  '[-inf+1.j]',
+            '[-inf-1.j]',  '[-inf-1.j]',  '[-inf-1.j]',
+            '[-inf+infj]', '[-inf+infj]', '[-inf+infj]',
+            '[-inf-infj]', '[-inf-infj]', '[-inf-infj]',
+            '[-inf+nanj]', '[-inf+nanj]', '[-inf+nanj]',
+            '[nan+0.j]',   '[nan+0.j]',   '[nan+0.j]',
+            '[nan+1.j]',   '[nan+1.j]',   '[nan+1.j]',
+            '[nan-1.j]',   '[nan-1.j]',   '[nan-1.j]',
+            '[nan+infj]',  '[nan+infj]',  '[nan+infj]',
+            '[nan-infj]',  '[nan-infj]',  '[nan-infj]',
+            '[nan+nanj]',  '[nan+nanj]',  '[nan+nanj]']
+
+        for res, val in zip(actual, wanted):
+            assert_equal(res, val)
+
+class TestArray2String:
+    def test_basic(self):
+        """Basic test of array2string."""
+        a = np.arange(3)
+        assert_(np.array2string(a) == '[0 1 2]')
+        assert_(np.array2string(a, max_line_width=4, legacy='1.13') == '[0 1\n 2]')
+        assert_(np.array2string(a, max_line_width=4) == '[0\n 1\n 2]')
+
+    def test_unexpected_kwarg(self):
+        # ensure than an appropriate TypeError
+        # is raised when array2string receives
+        # an unexpected kwarg
+
+        with assert_raises_regex(TypeError, 'nonsense'):
+            np.array2string(np.array([1, 2, 3]),
+                            nonsense=None)
+
+    def test_format_function(self):
+        """Test custom format function for each element in array."""
+        def _format_function(x):
+            if np.abs(x) < 1:
+                return '.'
+            elif np.abs(x) < 2:
+                return 'o'
+            else:
+                return 'O'
+
+        x = np.arange(3)
+        x_hex = "[0x0 0x1 0x2]"
+        x_oct = "[0o0 0o1 0o2]"
+        assert_(np.array2string(x, formatter={'all':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'int_kind':_format_function}) ==
+                "[. o O]")
+        assert_(np.array2string(x, formatter={'all':lambda x: "%.4f" % x}) ==
+                "[0.0000 1.0000 2.0000]")
+        assert_equal(np.array2string(x, formatter={'int':lambda x: hex(x)}),
+                x_hex)
+        assert_equal(np.array2string(x, formatter={'int':lambda x: oct(x)}),
+                x_oct)
+
+        x = np.arange(3.)
+        assert_(np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+        assert_(np.array2string(x, formatter={'float':lambda x: "%.2f" % x}) ==
+                "[0.00 1.00 2.00]")
+
+        s = np.array(['abc', 'def'])
+        assert_(np.array2string(s, formatter={'numpystr':lambda s: s*2}) ==
+                '[abcabc defdef]')
+
+
+    def test_structure_format(self):
+        dt = np.dtype([('name', np.str_, 16), ('grades', np.float64, (2,))])
+        x = np.array([('Sarah', (8.0, 7.0)), ('John', (6.0, 7.0))], dtype=dt)
+        assert_equal(np.array2string(x),
+                "[('Sarah', [8., 7.]) ('John', [6., 7.])]")
+
+        np.set_printoptions(legacy='1.13')
+        try:
+            # for issue #5692
+            A = np.zeros(shape=10, dtype=[("A", "M8[s]")])
+            A[5:].fill(np.datetime64('NaT'))
+            assert_equal(
+                np.array2string(A),
+                textwrap.dedent("""\
+                [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+                 ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',) ('NaT',) ('NaT',)
+                 ('NaT',) ('NaT',) ('NaT',)]""")
+            )
+        finally:
+            np.set_printoptions(legacy=False)
+
+        # same again, but with non-legacy behavior
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) ('1970-01-01T00:00:00',)
+             ('1970-01-01T00:00:00',) (                'NaT',)
+             (                'NaT',) (                'NaT',)
+             (                'NaT',) (                'NaT',)]""")
+        )
+
+        # and again, with timedeltas
+        A = np.full(10, 123456, dtype=[("A", "m8[s]")])
+        A[5:].fill(np.datetime64('NaT'))
+        assert_equal(
+            np.array2string(A),
+            textwrap.dedent("""\
+            [(123456,) (123456,) (123456,) (123456,) (123456,) ( 'NaT',) ( 'NaT',)
+             ( 'NaT',) ( 'NaT',) ( 'NaT',)]""")
+        )
+
+        # See #8160
+        struct_int = np.array([([1, -1],), ([123, 1],)], dtype=[('B', 'i4', 2)])
+        assert_equal(np.array2string(struct_int),
+                "[([  1,  -1],) ([123,   1],)]")
+        struct_2dint = np.array([([[0, 1], [2, 3]],), ([[12, 0], [0, 0]],)],
+                dtype=[('B', 'i4', (2, 2))])
+        assert_equal(np.array2string(struct_2dint),
+                "[([[ 0,  1], [ 2,  3]],) ([[12,  0], [ 0,  0]],)]")
+
+        # See #8172
+        array_scalar = np.array(
+                (1., 2.1234567890123456789, 3.), dtype=('f8,f8,f8'))
+        assert_equal(np.array2string(array_scalar), "(1., 2.12345679, 3.)")
+
+    def test_unstructured_void_repr(self):
+        a = np.array([27, 91, 50, 75,  7, 65, 10,  8,
+                      27, 91, 51, 49,109, 82,101,100], dtype='u1').view('V8')
+        assert_equal(repr(a[0]), r"void(b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08')")
+        assert_equal(str(a[0]), r"b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'")
+        assert_equal(repr(a),
+            r"array([b'\x1B\x5B\x32\x4B\x07\x41\x0A\x08'," "\n"
+            r"       b'\x1B\x5B\x33\x31\x6D\x52\x65\x64'], dtype='|V8')")
+
+        assert_equal(eval(repr(a), vars(np)), a)
+        assert_equal(eval(repr(a[0]), vars(np)), a[0])
+
+    def test_edgeitems_kwarg(self):
+        # previously the global print options would be taken over the kwarg
+        arr = np.zeros(3, int)
+        assert_equal(
+            np.array2string(arr, edgeitems=1, threshold=0),
+            "[0 ... 0]"
+        )
+
+    def test_summarize_1d(self):
+        A = np.arange(1001)
+        strA = '[   0    1    2 ...  998  999 1000]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([   0,    1,    2, ...,  998,  999, 1000])'
+        assert_equal(repr(A), reprA)
+
+    def test_summarize_2d(self):
+        A = np.arange(1002).reshape(2, 501)
+        strA = '[[   0    1    2 ...  498  499  500]\n' \
+               ' [ 501  502  503 ...  999 1000 1001]]'
+        assert_equal(str(A), strA)
+
+        reprA = 'array([[   0,    1,    2, ...,  498,  499,  500],\n' \
+                '       [ 501,  502,  503, ...,  999, 1000, 1001]])'
+        assert_equal(repr(A), reprA)
+
+    def test_linewidth(self):
+        a = np.full(6, 1)
+
+        def make_str(a, width, **kw):
+            return np.array2string(a, separator="", max_line_width=width, **kw)
+
+        assert_equal(make_str(a, 8, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 7, legacy='1.13'), '[111111]')
+        assert_equal(make_str(a, 5, legacy='1.13'), '[1111\n'
+                                                    ' 11]')
+
+        assert_equal(make_str(a, 8), '[111111]')
+        assert_equal(make_str(a, 7), '[11111\n'
+                                     ' 1]')
+        assert_equal(make_str(a, 5), '[111\n'
+                                     ' 111]')
+
+        b = a[None,None,:]
+
+        assert_equal(make_str(b, 12, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  9, legacy='1.13'), '[[[111111]]]')
+        assert_equal(make_str(b,  8, legacy='1.13'), '[[[11111\n'
+                                                     '   1]]]')
+
+        assert_equal(make_str(b, 12), '[[[111111]]]')
+        assert_equal(make_str(b,  9), '[[[111\n'
+                                      '   111]]]')
+        assert_equal(make_str(b,  8), '[[[11\n'
+                                      '   11\n'
+                                      '   11]]]')
+
+    def test_wide_element(self):
+        a = np.array(['xxxxx'])
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            "['xxxxx']"
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5, legacy='1.13'),
+            "[ 'xxxxx']"
+        )
+
+    def test_multiline_repr(self):
+        class MultiLine:
+            def __repr__(self):
+                return "Line 1\nLine 2"
+
+        a = np.array([[None, MultiLine()], [MultiLine(), None]])
+
+        assert_equal(
+            np.array2string(a),
+            '[[None Line 1\n'
+            '       Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2 None]]'
+        )
+        assert_equal(
+            np.array2string(a, max_line_width=5),
+            '[[None\n'
+            '  Line 1\n'
+            '  Line 2]\n'
+            ' [Line 1\n'
+            '  Line 2\n'
+            '  None]]'
+        )
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              Line 2],\n'
+            '       [Line 1\n'
+            '        Line 2, None]], dtype=object)'
+        )
+
+        class MultiLineLong:
+            def __repr__(self):
+                return "Line 1\nLooooooooooongestLine2\nLongerLine 3"
+
+        a = np.array([[None, MultiLineLong()], [MultiLineLong(), None]])
+        assert_equal(
+            repr(a),
+            'array([[None, Line 1\n'
+            '              LooooooooooongestLine2\n'
+            '              LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          , None]], dtype=object)'
+        )
+        assert_equal(
+            np.array_repr(a, 20),
+            'array([[None,\n'
+            '        Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ],\n'
+            '       [Line 1\n'
+            '        LooooooooooongestLine2\n'
+            '        LongerLine 3          ,\n'
+            '        None]],\n'
+            '      dtype=object)'
+        )
+
+    def test_nested_array_repr(self):
+        a = np.empty((2, 2), dtype=object)
+        a[0, 0] = np.eye(2)
+        a[0, 1] = np.eye(3)
+        a[1, 0] = None
+        a[1, 1] = np.ones((3, 1))
+        assert_equal(
+            repr(a),
+            'array([[array([[1., 0.],\n'
+            '               [0., 1.]]), array([[1., 0., 0.],\n'
+            '                                  [0., 1., 0.],\n'
+            '                                  [0., 0., 1.]])],\n'
+            '       [None, array([[1.],\n'
+            '                     [1.],\n'
+            '                     [1.]])]], dtype=object)'
+        )
+
+    @given(hynp.from_dtype(np.dtype("U")))
+    def test_any_text(self, text):
+        # This test checks that, given any value that can be represented in an
+        # array of dtype("U") (i.e. unicode string), ...
+        a = np.array([text, text, text])
+        # casting a list of them to an array does not e.g. truncate the value
+        assert_equal(a[0], text)
+        # and that np.array2string puts a newline in the expected location
+        expected_repr = "[{0!r} {0!r}\n {0!r}]".format(text)
+        result = np.array2string(a, max_line_width=len(repr(text)) * 2 + 3)
+        assert_equal(result, expected_repr)
+
+    @pytest.mark.skipif(not HAS_REFCOUNT, reason="Python lacks refcounts")
+    def test_refcount(self):
+        # make sure we do not hold references to the array due to a recursive
+        # closure (gh-10620)
+        gc.disable()
+        a = np.arange(2)
+        r1 = sys.getrefcount(a)
+        np.array2string(a)
+        np.array2string(a)
+        r2 = sys.getrefcount(a)
+        gc.collect()
+        gc.enable()
+        assert_(r1 == r2)
+
+class TestPrintOptions:
+    """Test getting and setting global print options."""
+
+    def setup_method(self):
+        self.oldopts = np.get_printoptions()
+
+    def teardown_method(self):
+        np.set_printoptions(**self.oldopts)
+
+    def test_basic(self):
+        x = np.array([1.5, 0, 1.234567890])
+        assert_equal(repr(x), "array([1.5       , 0.        , 1.23456789])")
+        np.set_printoptions(precision=4)
+        assert_equal(repr(x), "array([1.5   , 0.    , 1.2346])")
+
+    def test_precision_zero(self):
+        np.set_printoptions(precision=0)
+        for values, string in (
+                ([0.], "0."), ([.3], "0."), ([-.3], "-0."), ([.7], "1."),
+                ([1.5], "2."), ([-1.5], "-2."), ([-15.34], "-15."),
+                ([100.], "100."), ([.2, -1, 122.51], "  0.,  -1., 123."),
+                ([0], "0"), ([-12], "-12"), ([complex(.3, -.7)], "0.-1.j")):
+            x = np.array(values)
+            assert_equal(repr(x), "array([%s])" % string)
+
+    def test_formatter(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+
+    def test_formatter_reset(self):
+        x = np.arange(3)
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'all':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'all':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        np.set_printoptions(formatter={'int':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1, 0, 1])")
+        np.set_printoptions(formatter={'int_kind':None})
+        assert_equal(repr(x), "array([0, 1, 2])")
+
+        x = np.arange(3.)
+        np.set_printoptions(formatter={'float':lambda x: str(x-1)})
+        assert_equal(repr(x), "array([-1.0, 0.0, 1.0])")
+        np.set_printoptions(formatter={'float_kind':None})
+        assert_equal(repr(x), "array([0., 1., 2.])")
+
+    def test_0d_arrays(self):
+        assert_equal(str(np.array(u'café', '<U4')), u'café')
+
+        assert_equal(repr(np.array('café', '<U4')),
+                     "array('café', dtype='<U4')")
+        assert_equal(str(np.array('test', np.str_)), 'test')
+
+        a = np.zeros(1, dtype=[('a', '<i4', (3,))])
+        assert_equal(str(a[0]), '([0, 0, 0],)')
+
+        assert_equal(repr(np.datetime64('2005-02-25')[...]),
+                     "array('2005-02-25', dtype='datetime64[D]')")
+
+        assert_equal(repr(np.timedelta64('10', 'Y')[...]),
+                     "array(10, dtype='timedelta64[Y]')")
+
+        # repr of 0d arrays is affected by printoptions
+        x = np.array(1)
+        np.set_printoptions(formatter={'all':lambda x: "test"})
+        assert_equal(repr(x), "array(test)")
+        # str is unaffected
+        assert_equal(str(x), "1")
+
+        # check `style` arg raises
+        assert_warns(DeprecationWarning, np.array2string,
+                                         np.array(1.), style=repr)
+        # but not in legacy mode
+        np.array2string(np.array(1.), style=repr, legacy='1.13')
+        # gh-10934 style was broken in legacy mode, check it works
+        np.array2string(np.array(1.), legacy='1.13')
+
+    def test_float_spacing(self):
+        x = np.array([1., 2., 3.])
+        y = np.array([1., 2., -10.])
+        z = np.array([100., 2., -1.])
+        w = np.array([-100., 2., 1.])
+
+        assert_equal(repr(x), 'array([1., 2., 3.])')
+        assert_equal(repr(y), 'array([  1.,   2., -10.])')
+        assert_equal(repr(np.array(y[0])), 'array(1.)')
+        assert_equal(repr(np.array(y[-1])), 'array(-10.)')
+        assert_equal(repr(z), 'array([100.,   2.,  -1.])')
+        assert_equal(repr(w), 'array([-100.,    2.,    1.])')
+
+        assert_equal(repr(np.array([np.nan, np.inf])), 'array([nan, inf])')
+        assert_equal(repr(np.array([np.nan, -np.inf])), 'array([ nan, -inf])')
+
+        x = np.array([np.inf, 100000, 1.1234])
+        y = np.array([np.inf, 100000, -1.1234])
+        z = np.array([np.inf, 1.1234, -1e120])
+        np.set_printoptions(precision=2)
+        assert_equal(repr(x), 'array([     inf, 1.00e+05, 1.12e+00])')
+        assert_equal(repr(y), 'array([      inf,  1.00e+05, -1.12e+00])')
+        assert_equal(repr(z), 'array([       inf,  1.12e+000, -1.00e+120])')
+
+    def test_bool_spacing(self):
+        assert_equal(repr(np.array([True,  True])),
+                     'array([ True,  True])')
+        assert_equal(repr(np.array([True, False])),
+                     'array([ True, False])')
+        assert_equal(repr(np.array([True])),
+                     'array([ True])')
+        assert_equal(repr(np.array(True)),
+                     'array(True)')
+        assert_equal(repr(np.array(False)),
+                     'array(False)')
+
+    def test_sign_spacing(self):
+        a = np.arange(4.)
+        b = np.array([1.234e9])
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        assert_equal(repr(a), 'array([0., 1., 2., 3.])')
+        assert_equal(repr(np.array(1.)), 'array(1.)')
+        assert_equal(repr(b), 'array([1.234e+09])')
+        assert_equal(repr(np.array([0.])), 'array([0.])')
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign=' ')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(np.array(1.)), 'array( 1.)')
+        assert_equal(repr(b), 'array([ 1.234e+09])')
+        assert_equal(repr(c),
+            "array([ 1.        +1.j        ,  1.12345679+1.12345679j])")
+        assert_equal(repr(np.array([0., -0.])), 'array([ 0., -0.])')
+
+        np.set_printoptions(sign='+')
+        assert_equal(repr(a), 'array([+0., +1., +2., +3.])')
+        assert_equal(repr(np.array(1.)), 'array(+1.)')
+        assert_equal(repr(b), 'array([+1.234e+09])')
+        assert_equal(repr(c),
+            "array([+1.        +1.j        , +1.12345679+1.12345679j])")
+
+        np.set_printoptions(legacy='1.13')
+        assert_equal(repr(a), 'array([ 0.,  1.,  2.,  3.])')
+        assert_equal(repr(b),  'array([  1.23400000e+09])')
+        assert_equal(repr(-b), 'array([ -1.23400000e+09])')
+        assert_equal(repr(np.array(1.)), 'array(1.0)')
+        assert_equal(repr(np.array([0.])), 'array([ 0.])')
+        assert_equal(repr(c),
+            "array([ 1.00000000+1.j        ,  1.12345679+1.12345679j])")
+        # gh-10383
+        assert_equal(str(np.array([-1., 10])), "[ -1.  10.]")
+
+        assert_raises(TypeError, np.set_printoptions, wrongarg=True)
+
+    def test_float_overflow_nowarn(self):
+        # make sure internal computations in FloatingFormat don't
+        # warn about overflow
+        repr(np.array([1e4, 0.1], dtype='f2'))
+
+    def test_sign_spacing_structured(self):
+        a = np.ones(2, dtype='<f,<f')
+        assert_equal(repr(a),
+            "array([(1., 1.), (1., 1.)], dtype=[('f0', '<f4'), ('f1', '<f4')])")
+        assert_equal(repr(a[0]), "(1., 1.)")
+
+    def test_floatmode(self):
+        x = np.array([0.6104, 0.922, 0.457, 0.0906, 0.3733, 0.007244,
+                      0.5933, 0.947, 0.2383, 0.4226], dtype=np.float16)
+        y = np.array([0.2918820979355541, 0.5064172631089138,
+                      0.2848750619642916, 0.4342965294660567,
+                      0.7326538397312751, 0.3459503329096204,
+                      0.0862072768214508, 0.39112753029631175],
+                      dtype=np.float64)
+        z = np.arange(6, dtype=np.float16)/10
+        c = np.array([1.0 + 1.0j, 1.123456789 + 1.123456789j], dtype='c16')
+
+        # also make sure 1e23 is right (is between two fp numbers)
+        w = np.array(['1e{}'.format(i) for i in range(25)], dtype=np.float64)
+        # note: we construct w from the strings `1eXX` instead of doing
+        # `10.**arange(24)` because it turns out the two are not equivalent in
+        # python. On some architectures `1e23 != 10.**23`.
+        wp = np.array([1.234e1, 1e2, 1e123])
+
+        # unique mode
+        np.set_printoptions(floatmode='unique')
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918820979355541 , 0.5064172631089138 , 0.2848750619642916 ,\n"
+            "       0.4342965294660567 , 0.7326538397312751 , 0.3459503329096204 ,\n"
+            "       0.0862072768214508 , 0.39112753029631175])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w),
+            "array([1.e+00, 1.e+01, 1.e+02, 1.e+03, 1.e+04, 1.e+05, 1.e+06, 1.e+07,\n"
+            "       1.e+08, 1.e+09, 1.e+10, 1.e+11, 1.e+12, 1.e+13, 1.e+14, 1.e+15,\n"
+            "       1.e+16, 1.e+17, 1.e+18, 1.e+19, 1.e+20, 1.e+21, 1.e+22, 1.e+23,\n"
+            "       1.e+24])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.         +1.j         , 1.123456789+1.123456789j])")
+
+        # maxprec mode, precision=8
+        np.set_printoptions(floatmode='maxprec', precision=8)
+        assert_equal(repr(x),
+            "array([0.6104  , 0.922   , 0.457   , 0.0906  , 0.3733  , 0.007244,\n"
+            "       0.5933  , 0.947   , 0.2383  , 0.4226  ], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2918821 , 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0. , 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.        +1.j        , 1.12345679+1.12345679j])")
+
+        # fixed mode, precision=4
+        np.set_printoptions(floatmode='fixed', precision=4)
+        assert_equal(repr(x),
+            "array([0.6104, 0.9219, 0.4570, 0.0906, 0.3733, 0.0072, 0.5933, 0.9468,\n"
+            "       0.2383, 0.4226], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.2919, 0.5064, 0.2849, 0.4343, 0.7327, 0.3460, 0.0862, 0.3911])")
+        assert_equal(repr(z),
+            "array([0.0000, 0.1000, 0.2000, 0.3000, 0.3999, 0.5000], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.0000e+00, 1.0000e+05, 1.0000e+10, 1.0000e+15, 1.0000e+20])")
+        assert_equal(repr(wp), "array([1.2340e+001, 1.0000e+002, 1.0000e+123])")
+        assert_equal(repr(np.zeros(3)), "array([0.0000, 0.0000, 0.0000])")
+        assert_equal(repr(c),
+            "array([1.0000+1.0000j, 1.1235+1.1235j])")
+        # for larger precision, representation error becomes more apparent:
+        np.set_printoptions(floatmode='fixed', precision=8)
+        assert_equal(repr(z),
+            "array([0.00000000, 0.09997559, 0.19995117, 0.30004883, 0.39990234,\n"
+            "       0.50000000], dtype=float16)")
+
+        # maxprec_equal  mode, precision=8
+        np.set_printoptions(floatmode='maxprec_equal', precision=8)
+        assert_equal(repr(x),
+            "array([0.610352, 0.921875, 0.457031, 0.090576, 0.373291, 0.007244,\n"
+            "       0.593262, 0.946777, 0.238281, 0.422607], dtype=float16)")
+        assert_equal(repr(y),
+            "array([0.29188210, 0.50641726, 0.28487506, 0.43429653, 0.73265384,\n"
+            "       0.34595033, 0.08620728, 0.39112753])")
+        assert_equal(repr(z),
+            "array([0.0, 0.1, 0.2, 0.3, 0.4, 0.5], dtype=float16)")
+        assert_equal(repr(w[::5]),
+            "array([1.e+00, 1.e+05, 1.e+10, 1.e+15, 1.e+20])")
+        assert_equal(repr(wp), "array([1.234e+001, 1.000e+002, 1.000e+123])")
+        assert_equal(repr(c),
+            "array([1.00000000+1.00000000j, 1.12345679+1.12345679j])")
+
+        # test unique special case (gh-18609)
+        a = np.float64.fromhex('-1p-97')
+        assert_equal(np.float64(np.array2string(a, floatmode='unique')), a)
+
+    def test_legacy_mode_scalars(self):
+        # in legacy mode, str of floats get truncated, and complex scalars
+        # use * for non-finite imaginary part
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.float64(1.123456789123456789)), '1.12345678912')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nan*j)')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.float64(1.123456789123456789)),
+                     '1.1234567891234568')
+        assert_equal(str(np.complex128(complex(1, np.nan))), '(1+nanj)')
+
+    def test_legacy_stray_comma(self):
+        np.set_printoptions(legacy='1.13')
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ..., 9997 9998 9999]')
+
+        np.set_printoptions(legacy=False)
+        assert_equal(str(np.arange(10000)), '[   0    1    2 ... 9997 9998 9999]')
+
+    def test_dtype_linewidth_wrapping(self):
+        np.set_printoptions(linewidth=75)
+        assert_equal(repr(np.arange(10,20., dtype='f4')),
+            "array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19.], dtype=float32)")
+        assert_equal(repr(np.arange(10,23., dtype='f4')), textwrap.dedent("""\
+            array([10., 11., 12., 13., 14., 15., 16., 17., 18., 19., 20., 21., 22.],
+                  dtype=float32)"""))
+
+        styp = '<U4'
+        assert_equal(repr(np.ones(3, dtype=styp)),
+            "array(['1', '1', '1'], dtype='{}')".format(styp))
+        assert_equal(repr(np.ones(12, dtype=styp)), textwrap.dedent("""\
+            array(['1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1', '1'],
+                  dtype='{}')""".format(styp)))
+
+    def test_linewidth_repr(self):
+        a = np.full(7, fill_value=2)
+        np.set_printoptions(linewidth=17)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2])""")
+        )
+        np.set_printoptions(linewidth=17, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+        a = np.full(8, fill_value=2)
+
+        np.set_printoptions(linewidth=18, legacy=False)
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2,
+                   2, 2, 2,
+                   2, 2])""")
+        )
+
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([2, 2, 2, 2,
+                   2, 2, 2, 2])""")
+        )
+
+    def test_linewidth_str(self):
+        a = np.full(18, fill_value=2)
+        np.set_printoptions(linewidth=18)
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2
+             2 2]""")
+        )
+        np.set_printoptions(linewidth=18, legacy='1.13')
+        assert_equal(
+            str(a),
+            textwrap.dedent("""\
+            [2 2 2 2 2 2 2 2 2
+             2 2 2 2 2 2 2 2 2]""")
+        )
+
+    def test_edgeitems(self):
+        np.set_printoptions(edgeitems=1, threshold=1)
+        a = np.arange(27).reshape((3, 3, 3))
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ...,
+                    [ 6, ...,  8]],
+
+                   ...,
+
+                   [[18, ..., 20],
+                    ...,
+                    [24, ..., 26]]])""")
+        )
+
+        b = np.zeros((3, 3, 1, 1))
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[0.]],
+
+                    ...,
+
+                    [[0.]]],
+
+
+                   ...,
+
+
+                   [[[0.]],
+
+                    ...,
+
+                    [[0.]]]])""")
+        )
+
+        # 1.13 had extra trailing spaces, and was missing newlines
+        np.set_printoptions(legacy='1.13')
+
+        assert_equal(
+            repr(a),
+            textwrap.dedent("""\
+            array([[[ 0, ...,  2],
+                    ..., 
+                    [ 6, ...,  8]],
+
+                   ..., 
+                   [[18, ..., 20],
+                    ..., 
+                    [24, ..., 26]]])""")
+        )
+
+        assert_equal(
+            repr(b),
+            textwrap.dedent("""\
+            array([[[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]],
+
+
+                   ..., 
+                   [[[ 0.]],
+
+                    ..., 
+                    [[ 0.]]]])""")
+        )
+
+    def test_bad_args(self):
+        assert_raises(ValueError, np.set_printoptions, threshold=float('nan'))
+        assert_raises(TypeError, np.set_printoptions, threshold='1')
+        assert_raises(TypeError, np.set_printoptions, threshold=b'1')
+
+        assert_raises(TypeError, np.set_printoptions, precision='1')
+        assert_raises(TypeError, np.set_printoptions, precision=1.5)
+
+def test_unicode_object_array():
+    expected = "array(['é'], dtype=object)"
+    x = np.array([u'\xe9'], dtype=object)
+    assert_equal(repr(x), expected)
+
+
+class TestContextManager:
+    def test_ctx_mgr(self):
+        # test that context manager actually works
+        with np.printoptions(precision=2):
+            s = str(np.array([2.0]) / 3)
+        assert_equal(s, '[0.67]')
+
+    def test_ctx_mgr_restores(self):
+        # test that print options are actually restrored
+        opts = np.get_printoptions()
+        with np.printoptions(precision=opts['precision'] - 1,
+                             linewidth=opts['linewidth'] - 4):
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_exceptions(self):
+        # test that print options are restored even if an exception is raised
+        opts = np.get_printoptions()
+        try:
+            with np.printoptions(precision=2, linewidth=11):
+                raise ValueError
+        except ValueError:
+            pass
+        assert_equal(np.get_printoptions(), opts)
+
+    def test_ctx_mgr_as_smth(self):
+        opts = {"precision": 2}
+        with np.printoptions(**opts) as ctx:
+            saved_opts = ctx.copy()
+        assert_equal({k: saved_opts[k] for k in opts}, opts)

wemm/lib/python3.10/site-packages/numpy/core/tests/test_casting_unittests.py

@@ -0,0 +1,811 @@
+"""
+The tests exercise the casting machinery in a more low-level manner.
+The reason is mostly to test a new implementation of the casting machinery.
+
+Unlike most tests in NumPy, these are closer to unit-tests rather
+than integration tests.
+"""
+
+import pytest
+import textwrap
+import enum
+import random
+
+import numpy as np
+from numpy.lib.stride_tricks import as_strided
+
+from numpy.testing import assert_array_equal
+from numpy.core._multiarray_umath import _get_castingimpl as get_castingimpl
+
+
+# Simple skips object, parametric and long double (unsupported by struct)
+simple_dtypes = "?bhilqBHILQefdFD"
+if np.dtype("l").itemsize != np.dtype("q").itemsize:
+    # Remove l and L, the table was generated with 64bit linux in mind.
+    simple_dtypes = simple_dtypes.replace("l", "").replace("L", "")
+simple_dtypes = [type(np.dtype(c)) for c in simple_dtypes]
+
+
+def simple_dtype_instances():
+    for dtype_class in simple_dtypes:
+        dt = dtype_class()
+        yield pytest.param(dt, id=str(dt))
+        if dt.byteorder != "|":
+            dt = dt.newbyteorder()
+            yield pytest.param(dt, id=str(dt))
+
+
+def get_expected_stringlength(dtype):
+    """Returns the string length when casting the basic dtypes to strings.
+    """
+    if dtype == np.bool_:
+        return 5
+    if dtype.kind in "iu":
+        if dtype.itemsize == 1:
+            length = 3
+        elif dtype.itemsize == 2:
+            length = 5
+        elif dtype.itemsize == 4:
+            length = 10
+        elif dtype.itemsize == 8:
+            length = 20
+        else:
+            raise AssertionError(f"did not find expected length for {dtype}")
+
+        if dtype.kind == "i":
+            length += 1  # adds one character for the sign
+
+        return length
+
+    # Note: Can't do dtype comparison for longdouble on windows
+    if dtype.char == "g":
+        return 48
+    elif dtype.char == "G":
+        return 48 * 2
+    elif dtype.kind == "f":
+        return 32  # also for half apparently.
+    elif dtype.kind == "c":
+        return 32 * 2
+
+    raise AssertionError(f"did not find expected length for {dtype}")
+
+
+class Casting(enum.IntEnum):
+    no = 0
+    equiv = 1
+    safe = 2
+    same_kind = 3
+    unsafe = 4
+
+
+def _get_cancast_table():
+    table = textwrap.dedent("""
+        X ? b h i l q B H I L Q e f d g F D G S U V O M m
+        ? # = = = = = = = = = = = = = = = = = = = = = . =
+        b . # = = = = . . . . . = = = = = = = = = = = . =
+        h . ~ # = = = . . . . . ~ = = = = = = = = = = . =
+        i . ~ ~ # = = . . . . . ~ ~ = = ~ = = = = = = . =
+        l . ~ ~ ~ # # . . . . . ~ ~ = = ~ = = = = = = . =
+        q . ~ ~ ~ # # . . . . . ~ ~ = = ~ = = = = = = . =
+        B . ~ = = = = # = = = = = = = = = = = = = = = . =
+        H . ~ ~ = = = ~ # = = = ~ = = = = = = = = = = . =
+        I . ~ ~ ~ = = ~ ~ # = = ~ ~ = = ~ = = = = = = . =
+        L . ~ ~ ~ ~ ~ ~ ~ ~ # # ~ ~ = = ~ = = = = = = . ~
+        Q . ~ ~ ~ ~ ~ ~ ~ ~ # # ~ ~ = = ~ = = = = = = . ~
+        e . . . . . . . . . . . # = = = = = = = = = = . .
+        f . . . . . . . . . . . ~ # = = = = = = = = = . .
+        d . . . . . . . . . . . ~ ~ # = ~ = = = = = = . .
+        g . . . . . . . . . . . ~ ~ ~ # ~ ~ = = = = = . .
+        F . . . . . . . . . . . . . . . # = = = = = = . .
+        D . . . . . . . . . . . . . . . ~ # = = = = = . .
+        G . . . . . . . . . . . . . . . ~ ~ # = = = = . .
+        S . . . . . . . . . . . . . . . . . . # = = = . .
+        U . . . . . . . . . . . . . . . . . . . # = = . .
+        V . . . . . . . . . . . . . . . . . . . . # = . .
+        O . . . . . . . . . . . . . . . . . . . . = # . .
+        M . . . . . . . . . . . . . . . . . . . . = = # .
+        m . . . . . . . . . . . . . . . . . . . . = = . #
+        """).strip().split("\n")
+    dtypes = [type(np.dtype(c)) for c in table[0][2::2]]
+
+    convert_cast = {".": Casting.unsafe, "~": Casting.same_kind,
+                    "=": Casting.safe, "#": Casting.equiv,
+                    " ": -1}
+
+    cancast = {}
+    for from_dt, row in zip(dtypes, table[1:]):
+        cancast[from_dt] = {}
+        for to_dt, c in zip(dtypes, row[2::2]):
+            cancast[from_dt][to_dt] = convert_cast[c]
+
+    return cancast
+
+CAST_TABLE = _get_cancast_table()
+
+
+class TestChanges:
+    """
+    These test cases exercise some behaviour changes
+    """
+    @pytest.mark.parametrize("string", ["S", "U"])
+    @pytest.mark.parametrize("floating", ["e", "f", "d", "g"])
+    def test_float_to_string(self, floating, string):
+        assert np.can_cast(floating, string)
+        # 100 is long enough to hold any formatted floating
+        assert np.can_cast(floating, f"{string}100")
+
+    def test_to_void(self):
+        # But in general, we do consider these safe:
+        assert np.can_cast("d", "V")
+        assert np.can_cast("S20", "V")
+
+        # Do not consider it a safe cast if the void is too smaller:
+        assert not np.can_cast("d", "V1")
+        assert not np.can_cast("S20", "V1")
+        assert not np.can_cast("U1", "V1")
+        # Structured to unstructured is just like any other:
+        assert np.can_cast("d,i", "V", casting="same_kind")
+        # Unstructured void to unstructured is actually no cast at all:
+        assert np.can_cast("V3", "V", casting="no")
+        assert np.can_cast("V0", "V", casting="no")
+
+
+class TestCasting:
+    size = 1500  # Best larger than NPY_LOWLEVEL_BUFFER_BLOCKSIZE * itemsize
+
+    def get_data(self, dtype1, dtype2):
+        if dtype2 is None or dtype1.itemsize >= dtype2.itemsize:
+            length = self.size // dtype1.itemsize
+        else:
+            length = self.size // dtype2.itemsize
+
+        # Assume that the base array is well enough aligned for all inputs.
+        arr1 = np.empty(length, dtype=dtype1)
+        assert arr1.flags.c_contiguous
+        assert arr1.flags.aligned
+
+        values = [random.randrange(-128, 128) for _ in range(length)]
+
+        for i, value in enumerate(values):
+            # Use item assignment to ensure this is not using casting:
+            arr1[i] = value
+
+        if dtype2 is None:
+            if dtype1.char == "?":
+                values = [bool(v) for v in values]
+            return arr1, values
+
+        if dtype2.char == "?":
+            values = [bool(v) for v in values]
+
+        arr2 = np.empty(length, dtype=dtype2)
+        assert arr2.flags.c_contiguous
+        assert arr2.flags.aligned
+
+        for i, value in enumerate(values):
+            # Use item assignment to ensure this is not using casting:
+            arr2[i] = value
+
+        return arr1, arr2, values
+
+    def get_data_variation(self, arr1, arr2, aligned=True, contig=True):
+        """
+        Returns a copy of arr1 that may be non-contiguous or unaligned, and a
+        matching array for arr2 (although not a copy).
+        """
+        if contig:
+            stride1 = arr1.dtype.itemsize
+            stride2 = arr2.dtype.itemsize
+        elif aligned:
+            stride1 = 2 * arr1.dtype.itemsize
+            stride2 = 2 * arr2.dtype.itemsize
+        else:
+            stride1 = arr1.dtype.itemsize + 1
+            stride2 = arr2.dtype.itemsize + 1
+
+        max_size1 = len(arr1) * 3 * arr1.dtype.itemsize + 1
+        max_size2 = len(arr2) * 3 * arr2.dtype.itemsize + 1
+        from_bytes = np.zeros(max_size1, dtype=np.uint8)
+        to_bytes = np.zeros(max_size2, dtype=np.uint8)
+
+        # Sanity check that the above is large enough:
+        assert stride1 * len(arr1) <= from_bytes.nbytes
+        assert stride2 * len(arr2) <= to_bytes.nbytes
+
+        if aligned:
+            new1 = as_strided(from_bytes[:-1].view(arr1.dtype),
+                              arr1.shape, (stride1,))
+            new2 = as_strided(to_bytes[:-1].view(arr2.dtype),
+                              arr2.shape, (stride2,))
+        else:
+            new1 = as_strided(from_bytes[1:].view(arr1.dtype),
+                              arr1.shape, (stride1,))
+            new2 = as_strided(to_bytes[1:].view(arr2.dtype),
+                              arr2.shape, (stride2,))
+
+        new1[...] = arr1
+
+        if not contig:
+            # Ensure we did not overwrite bytes that should not be written:
+            offset = arr1.dtype.itemsize if aligned else 0
+            buf = from_bytes[offset::stride1].tobytes()
+            assert buf.count(b"\0") == len(buf)
+
+        if contig:
+            assert new1.flags.c_contiguous
+            assert new2.flags.c_contiguous
+        else:
+            assert not new1.flags.c_contiguous
+            assert not new2.flags.c_contiguous
+
+        if aligned:
+            assert new1.flags.aligned
+            assert new2.flags.aligned
+        else:
+            assert not new1.flags.aligned or new1.dtype.alignment == 1
+            assert not new2.flags.aligned or new2.dtype.alignment == 1
+
+        return new1, new2
+
+    @pytest.mark.parametrize("from_Dt", simple_dtypes)
+    def test_simple_cancast(self, from_Dt):
+        for to_Dt in simple_dtypes:
+            cast = get_castingimpl(from_Dt, to_Dt)
+
+            for from_dt in [from_Dt(), from_Dt().newbyteorder()]:
+                default = cast._resolve_descriptors((from_dt, None))[1][1]
+                assert default == to_Dt()
+                del default
+
+                for to_dt in [to_Dt(), to_Dt().newbyteorder()]:
+                    casting, (from_res, to_res), view_off = (
+                            cast._resolve_descriptors((from_dt, to_dt)))
+                    assert(type(from_res) == from_Dt)
+                    assert(type(to_res) == to_Dt)
+                    if view_off is not None:
+                        # If a view is acceptable, this is "no" casting
+                        # and byte order must be matching.
+                        assert casting == Casting.no
+                        # The above table lists this as "equivalent"
+                        assert Casting.equiv == CAST_TABLE[from_Dt][to_Dt]
+                        # Note that to_res may not be the same as from_dt
+                        assert from_res.isnative == to_res.isnative
+                    else:
+                        if from_Dt == to_Dt:
+                            # Note that to_res may not be the same as from_dt
+                            assert from_res.isnative != to_res.isnative
+                        assert casting == CAST_TABLE[from_Dt][to_Dt]
+
+                    if from_Dt is to_Dt:
+                        assert(from_dt is from_res)
+                        assert(to_dt is to_res)
+
+
+    @pytest.mark.filterwarnings("ignore::numpy.ComplexWarning")
+    @pytest.mark.parametrize("from_dt", simple_dtype_instances())
+    def test_simple_direct_casts(self, from_dt):
+        """
+        This test checks numeric direct casts for dtypes supported also by the
+        struct module (plus complex).  It tries to be test a wide range of
+        inputs, but skips over possibly undefined behaviour (e.g. int rollover).
+        Longdouble and CLongdouble are tested, but only using double precision.
+
+        If this test creates issues, it should possibly just be simplified
+        or even removed (checking whether unaligned/non-contiguous casts give
+        the same results is useful, though).
+        """
+        for to_dt in simple_dtype_instances():
+            to_dt = to_dt.values[0]
+            cast = get_castingimpl(type(from_dt), type(to_dt))
+
+            casting, (from_res, to_res), view_off = cast._resolve_descriptors(
+                (from_dt, to_dt))
+
+            if from_res is not from_dt or to_res is not to_dt:
+                # Do not test this case, it is handled in multiple steps,
+                # each of which should is tested individually.
+                return
+
+            safe = casting <= Casting.safe
+            del from_res, to_res, casting
+
+            arr1, arr2, values = self.get_data(from_dt, to_dt)
+
+            cast._simple_strided_call((arr1, arr2))
+
+            # Check via python list
+            assert arr2.tolist() == values
+
+            # Check that the same results are achieved for strided loops
+            arr1_o, arr2_o = self.get_data_variation(arr1, arr2, True, False)
+            cast._simple_strided_call((arr1_o, arr2_o))
+
+            assert_array_equal(arr2_o, arr2)
+            assert arr2_o.tobytes() == arr2.tobytes()
+
+            # Check if alignment makes a difference, but only if supported
+            # and only if the alignment can be wrong
+            if ((from_dt.alignment == 1 and to_dt.alignment == 1) or
+                    not cast._supports_unaligned):
+                return
+
+            arr1_o, arr2_o = self.get_data_variation(arr1, arr2, False, True)
+            cast._simple_strided_call((arr1_o, arr2_o))
+
+            assert_array_equal(arr2_o, arr2)
+            assert arr2_o.tobytes() == arr2.tobytes()
+
+            arr1_o, arr2_o = self.get_data_variation(arr1, arr2, False, False)
+            cast._simple_strided_call((arr1_o, arr2_o))
+
+            assert_array_equal(arr2_o, arr2)
+            assert arr2_o.tobytes() == arr2.tobytes()
+
+            del arr1_o, arr2_o, cast
+
+    @pytest.mark.parametrize("from_Dt", simple_dtypes)
+    def test_numeric_to_times(self, from_Dt):
+        # We currently only implement contiguous loops, so only need to
+        # test those.
+        from_dt = from_Dt()
+
+        time_dtypes = [np.dtype("M8"), np.dtype("M8[ms]"), np.dtype("M8[4D]"),
+                       np.dtype("m8"), np.dtype("m8[ms]"), np.dtype("m8[4D]")]
+        for time_dt in time_dtypes:
+            cast = get_castingimpl(type(from_dt), type(time_dt))
+
+            casting, (from_res, to_res), view_off = cast._resolve_descriptors(
+                (from_dt, time_dt))
+
+            assert from_res is from_dt
+            assert to_res is time_dt
+            del from_res, to_res
+
+            assert casting & CAST_TABLE[from_Dt][type(time_dt)]
+            assert view_off is None
+
+            int64_dt = np.dtype(np.int64)
+            arr1, arr2, values = self.get_data(from_dt, int64_dt)
+            arr2 = arr2.view(time_dt)
+            arr2[...] = np.datetime64("NaT")
+
+            if time_dt == np.dtype("M8"):
+                # This is a bit of a strange path, and could probably be removed
+                arr1[-1] = 0  # ensure at least one value is not NaT
+
+                # The cast currently succeeds, but the values are invalid:
+                cast._simple_strided_call((arr1, arr2))
+                with pytest.raises(ValueError):
+                    str(arr2[-1])  # e.g. conversion to string fails
+                return
+
+            cast._simple_strided_call((arr1, arr2))
+
+            assert [int(v) for v in arr2.tolist()] == values
+
+            # Check that the same results are achieved for strided loops
+            arr1_o, arr2_o = self.get_data_variation(arr1, arr2, True, False)
+            cast._simple_strided_call((arr1_o, arr2_o))
+
+            assert_array_equal(arr2_o, arr2)
+            assert arr2_o.tobytes() == arr2.tobytes()
+
+    @pytest.mark.parametrize(
+            ["from_dt", "to_dt", "expected_casting", "expected_view_off",
+             "nom", "denom"],
+            [("M8[ns]", None, Casting.no, 0, 1, 1),
+             (str(np.dtype("M8[ns]").newbyteorder()), None,
+                  Casting.equiv, None, 1, 1),
+             ("M8", "M8[ms]", Casting.safe, 0, 1, 1),
+             # should be invalid cast:
+             ("M8[ms]", "M8", Casting.unsafe, None, 1, 1),
+             ("M8[5ms]", "M8[5ms]", Casting.no, 0, 1, 1),
+             ("M8[ns]", "M8[ms]", Casting.same_kind, None, 1, 10**6),
+             ("M8[ms]", "M8[ns]", Casting.safe, None, 10**6, 1),
+             ("M8[ms]", "M8[7ms]", Casting.same_kind, None, 1, 7),
+             ("M8[4D]", "M8[1M]", Casting.same_kind, None, None,
+                  # give full values based on NumPy 1.19.x
+                  [-2**63, 0, -1, 1314, -1315, 564442610]),
+             ("m8[ns]", None, Casting.no, 0, 1, 1),
+             (str(np.dtype("m8[ns]").newbyteorder()), None,
+                  Casting.equiv, None, 1, 1),
+             ("m8", "m8[ms]", Casting.safe, 0, 1, 1),
+             # should be invalid cast:
+             ("m8[ms]", "m8", Casting.unsafe, None, 1, 1),
+             ("m8[5ms]", "m8[5ms]", Casting.no, 0, 1, 1),
+             ("m8[ns]", "m8[ms]", Casting.same_kind, None, 1, 10**6),
+             ("m8[ms]", "m8[ns]", Casting.safe, None, 10**6, 1),
+             ("m8[ms]", "m8[7ms]", Casting.same_kind, None, 1, 7),
+             ("m8[4D]", "m8[1M]", Casting.unsafe, None, None,
+                  # give full values based on NumPy 1.19.x
+                  [-2**63, 0, 0, 1314, -1315, 564442610])])
+    def test_time_to_time(self, from_dt, to_dt,
+                          expected_casting, expected_view_off,
+                          nom, denom):
+        from_dt = np.dtype(from_dt)
+        if to_dt is not None:
+            to_dt = np.dtype(to_dt)
+
+        # Test a few values for casting (results generated with NumPy 1.19)
+        values = np.array([-2**63, 1, 2**63-1, 10000, -10000, 2**32])
+        values = values.astype(np.dtype("int64").newbyteorder(from_dt.byteorder))
+        assert values.dtype.byteorder == from_dt.byteorder
+        assert np.isnat(values.view(from_dt)[0])
+
+        DType = type(from_dt)
+        cast = get_castingimpl(DType, DType)
+        casting, (from_res, to_res), view_off = cast._resolve_descriptors(
+                (from_dt, to_dt))
+        assert from_res is from_dt
+        assert to_res is to_dt or to_dt is None
+        assert casting == expected_casting
+        assert view_off == expected_view_off
+
+        if nom is not None:
+            expected_out = (values * nom // denom).view(to_res)
+            expected_out[0] = "NaT"
+        else:
+            expected_out = np.empty_like(values)
+            expected_out[...] = denom
+            expected_out = expected_out.view(to_dt)
+
+        orig_arr = values.view(from_dt)
+        orig_out = np.empty_like(expected_out)
+
+        if casting == Casting.unsafe and (to_dt == "m8" or to_dt == "M8"):
+            # Casting from non-generic to generic units is an error and should
+            # probably be reported as an invalid cast earlier.
+            with pytest.raises(ValueError):
+                cast._simple_strided_call((orig_arr, orig_out))
+            return
+
+        for aligned in [True, True]:
+            for contig in [True, True]:
+                arr, out = self.get_data_variation(
+                        orig_arr, orig_out, aligned, contig)
+                out[...] = 0
+                cast._simple_strided_call((arr, out))
+                assert_array_equal(out.view("int64"), expected_out.view("int64"))
+
+    def string_with_modified_length(self, dtype, change_length):
+        fact = 1 if dtype.char == "S" else 4
+        length = dtype.itemsize // fact + change_length
+        return np.dtype(f"{dtype.byteorder}{dtype.char}{length}")
+
+    @pytest.mark.parametrize("other_DT", simple_dtypes)
+    @pytest.mark.parametrize("string_char", ["S", "U"])
+    def test_string_cancast(self, other_DT, string_char):
+        fact = 1 if string_char == "S" else 4
+
+        string_DT = type(np.dtype(string_char))
+        cast = get_castingimpl(other_DT, string_DT)
+
+        other_dt = other_DT()
+        expected_length = get_expected_stringlength(other_dt)
+        string_dt = np.dtype(f"{string_char}{expected_length}")
+
+        safety, (res_other_dt, res_dt), view_off = cast._resolve_descriptors(
+                (other_dt, None))
+        assert res_dt.itemsize == expected_length * fact
+        assert safety == Casting.safe  # we consider to string casts "safe"
+        assert view_off is None
+        assert isinstance(res_dt, string_DT)
+
+        # These casts currently implement changing the string length, so
+        # check the cast-safety for too long/fixed string lengths:
+        for change_length in [-1, 0, 1]:
+            if change_length >= 0:
+                expected_safety = Casting.safe
+            else:
+                expected_safety = Casting.same_kind
+
+            to_dt = self.string_with_modified_length(string_dt, change_length)
+            safety, (_, res_dt), view_off = cast._resolve_descriptors(
+                    (other_dt, to_dt))
+            assert res_dt is to_dt
+            assert safety == expected_safety
+            assert view_off is None
+
+        # The opposite direction is always considered unsafe:
+        cast = get_castingimpl(string_DT, other_DT)
+
+        safety, _, view_off = cast._resolve_descriptors((string_dt, other_dt))
+        assert safety == Casting.unsafe
+        assert view_off is None
+
+        cast = get_castingimpl(string_DT, other_DT)
+        safety, (_, res_dt), view_off = cast._resolve_descriptors(
+            (string_dt, None))
+        assert safety == Casting.unsafe
+        assert view_off is None
+        assert other_dt is res_dt  # returns the singleton for simple dtypes
+
+    @pytest.mark.parametrize("string_char", ["S", "U"])
+    @pytest.mark.parametrize("other_dt", simple_dtype_instances())
+    def test_simple_string_casts_roundtrip(self, other_dt, string_char):
+        """
+        Tests casts from and to string by checking the roundtripping property.
+
+        The test also covers some string to string casts (but not all).
+
+        If this test creates issues, it should possibly just be simplified
+        or even removed (checking whether unaligned/non-contiguous casts give
+        the same results is useful, though).
+        """
+        string_DT = type(np.dtype(string_char))
+
+        cast = get_castingimpl(type(other_dt), string_DT)
+        cast_back = get_castingimpl(string_DT, type(other_dt))
+        _, (res_other_dt, string_dt), _ = cast._resolve_descriptors(
+                (other_dt, None))
+
+        if res_other_dt is not other_dt:
+            # do not support non-native byteorder, skip test in that case
+            assert other_dt.byteorder != res_other_dt.byteorder
+            return
+
+        orig_arr, values = self.get_data(other_dt, None)
+        str_arr = np.zeros(len(orig_arr), dtype=string_dt)
+        string_dt_short = self.string_with_modified_length(string_dt, -1)
+        str_arr_short = np.zeros(len(orig_arr), dtype=string_dt_short)
+        string_dt_long = self.string_with_modified_length(string_dt, 1)
+        str_arr_long = np.zeros(len(orig_arr), dtype=string_dt_long)
+
+        assert not cast._supports_unaligned  # if support is added, should test
+        assert not cast_back._supports_unaligned
+
+        for contig in [True, False]:
+            other_arr, str_arr = self.get_data_variation(
+                orig_arr, str_arr, True, contig)
+            _, str_arr_short = self.get_data_variation(
+                orig_arr, str_arr_short.copy(), True, contig)
+            _, str_arr_long = self.get_data_variation(
+                orig_arr, str_arr_long, True, contig)
+
+            cast._simple_strided_call((other_arr, str_arr))
+
+            cast._simple_strided_call((other_arr, str_arr_short))
+            assert_array_equal(str_arr.astype(string_dt_short), str_arr_short)
+
+            cast._simple_strided_call((other_arr, str_arr_long))
+            assert_array_equal(str_arr, str_arr_long)
+
+            if other_dt.kind == "b":
+                # Booleans do not roundtrip
+                continue
+
+            other_arr[...] = 0
+            cast_back._simple_strided_call((str_arr, other_arr))
+            assert_array_equal(orig_arr, other_arr)
+
+            other_arr[...] = 0
+            cast_back._simple_strided_call((str_arr_long, other_arr))
+            assert_array_equal(orig_arr, other_arr)
+
+    @pytest.mark.parametrize("other_dt", ["S8", "<U8", ">U8"])
+    @pytest.mark.parametrize("string_char", ["S", "U"])
+    def test_string_to_string_cancast(self, other_dt, string_char):
+        other_dt = np.dtype(other_dt)
+
+        fact = 1 if string_char == "S" else 4
+        div = 1 if other_dt.char == "S" else 4
+
+        string_DT = type(np.dtype(string_char))
+        cast = get_castingimpl(type(other_dt), string_DT)
+
+        expected_length = other_dt.itemsize // div
+        string_dt = np.dtype(f"{string_char}{expected_length}")
+
+        safety, (res_other_dt, res_dt), view_off = cast._resolve_descriptors(
+                (other_dt, None))
+        assert res_dt.itemsize == expected_length * fact
+        assert isinstance(res_dt, string_DT)
+
+        expected_view_off = None
+        if other_dt.char == string_char:
+            if other_dt.isnative:
+                expected_safety = Casting.no
+                expected_view_off = 0
+            else:
+                expected_safety = Casting.equiv
+        elif string_char == "U":
+            expected_safety = Casting.safe
+        else:
+            expected_safety = Casting.unsafe
+
+        assert view_off == expected_view_off
+        assert expected_safety == safety
+
+        for change_length in [-1, 0, 1]:
+            to_dt = self.string_with_modified_length(string_dt, change_length)
+            safety, (_, res_dt), view_off = cast._resolve_descriptors(
+                    (other_dt, to_dt))
+
+            assert res_dt is to_dt
+            if change_length <= 0:
+                assert view_off == expected_view_off
+            else:
+                assert view_off is None
+            if expected_safety == Casting.unsafe:
+                assert safety == expected_safety
+            elif change_length < 0:
+                assert safety == Casting.same_kind
+            elif change_length == 0:
+                assert safety == expected_safety
+            elif change_length > 0:
+                assert safety == Casting.safe
+
+    @pytest.mark.parametrize("order1", [">", "<"])
+    @pytest.mark.parametrize("order2", [">", "<"])
+    def test_unicode_byteswapped_cast(self, order1, order2):
+        # Very specific tests (not using the castingimpl directly)
+        # that tests unicode bytedwaps including for unaligned array data.
+        dtype1 = np.dtype(f"{order1}U30")
+        dtype2 = np.dtype(f"{order2}U30")
+        data1 = np.empty(30 * 4 + 1, dtype=np.uint8)[1:].view(dtype1)
+        data2 = np.empty(30 * 4 + 1, dtype=np.uint8)[1:].view(dtype2)
+        if dtype1.alignment != 1:
+            # alignment should always be >1, but skip the check if not
+            assert not data1.flags.aligned
+            assert not data2.flags.aligned
+
+        element = "this is a ünicode string‽"
+        data1[()] = element
+        # Test both `data1` and `data1.copy()`  (which should be aligned)
+        for data in [data1, data1.copy()]:
+            data2[...] = data1
+            assert data2[()] == element
+            assert data2.copy()[()] == element
+
+    def test_void_to_string_special_case(self):
+        # Cover a small special case in void to string casting that could
+        # probably just as well be turned into an error (compare
+        # `test_object_to_parametric_internal_error` below).
+        assert np.array([], dtype="V5").astype("S").dtype.itemsize == 5
+        assert np.array([], dtype="V5").astype("U").dtype.itemsize == 4 * 5
+
+    def test_object_to_parametric_internal_error(self):
+        # We reject casting from object to a parametric type, without
+        # figuring out the correct instance first.
+        object_dtype = type(np.dtype(object))
+        other_dtype = type(np.dtype(str))
+        cast = get_castingimpl(object_dtype, other_dtype)
+        with pytest.raises(TypeError,
+                    match="casting from object to the parametric DType"):
+            cast._resolve_descriptors((np.dtype("O"), None))
+
+    @pytest.mark.parametrize("dtype", simple_dtype_instances())
+    def test_object_and_simple_resolution(self, dtype):
+        # Simple test to exercise the cast when no instance is specified
+        object_dtype = type(np.dtype(object))
+        cast = get_castingimpl(object_dtype, type(dtype))
+
+        safety, (_, res_dt), view_off = cast._resolve_descriptors(
+                (np.dtype("O"), dtype))
+        assert safety == Casting.unsafe
+        assert view_off is None
+        assert res_dt is dtype
+
+        safety, (_, res_dt), view_off = cast._resolve_descriptors(
+                (np.dtype("O"), None))
+        assert safety == Casting.unsafe
+        assert view_off is None
+        assert res_dt == dtype.newbyteorder("=")
+
+    @pytest.mark.parametrize("dtype", simple_dtype_instances())
+    def test_simple_to_object_resolution(self, dtype):
+        # Simple test to exercise the cast when no instance is specified
+        object_dtype = type(np.dtype(object))
+        cast = get_castingimpl(type(dtype), object_dtype)
+
+        safety, (_, res_dt), view_off = cast._resolve_descriptors(
+                (dtype, None))
+        assert safety == Casting.safe
+        assert view_off is None
+        assert res_dt is np.dtype("O")
+
+    @pytest.mark.parametrize("casting", ["no", "unsafe"])
+    def test_void_and_structured_with_subarray(self, casting):
+        # test case corresponding to gh-19325
+        dtype = np.dtype([("foo", "<f4", (3, 2))])
+        expected = casting == "unsafe"
+        assert np.can_cast("V4", dtype, casting=casting) == expected
+        assert np.can_cast(dtype, "V4", casting=casting) == expected
+
+    @pytest.mark.parametrize(["to_dt", "expected_off"],
+            [  # Same as `from_dt` but with both fields shifted:
+             (np.dtype({"names": ["a", "b"], "formats": ["i4", "f4"],
+                        "offsets": [0, 4]}), 2),
+             # Additional change of the names
+             (np.dtype({"names": ["b", "a"], "formats": ["i4", "f4"],
+                        "offsets": [0, 4]}), 2),
+             # Incompatible field offset change
+             (np.dtype({"names": ["b", "a"], "formats": ["i4", "f4"],
+                        "offsets": [0, 6]}), None)])
+    def test_structured_field_offsets(self, to_dt, expected_off):
+        # This checks the cast-safety and view offset for swapped and "shifted"
+        # fields which are viewable
+        from_dt = np.dtype({"names": ["a", "b"],
+                            "formats": ["i4", "f4"],
+                            "offsets": [2, 6]})
+        cast = get_castingimpl(type(from_dt), type(to_dt))
+        safety, _, view_off = cast._resolve_descriptors((from_dt, to_dt))
+        if from_dt.names == to_dt.names:
+            assert safety == Casting.equiv
+        else:
+            assert safety == Casting.safe
+        # Shifting the original data pointer by -2 will align both by
+        # effectively adding 2 bytes of spacing before `from_dt`.
+        assert view_off == expected_off
+
+    @pytest.mark.parametrize(("from_dt", "to_dt", "expected_off"), [
+            # Subarray cases:
+            ("i", "(1,1)i", 0),
+            ("(1,1)i", "i", 0),
+            ("(2,1)i", "(2,1)i", 0),
+            # field cases (field to field is tested explicitly also):
+            # Not considered viewable, because a negative offset would allow
+            # may structured dtype to indirectly access invalid memory.
+            ("i", dict(names=["a"], formats=["i"], offsets=[2]), None),
+            (dict(names=["a"], formats=["i"], offsets=[2]), "i", 2),
+            # Currently considered not viewable, due to multiple fields
+            # even though they overlap (maybe we should not allow that?)
+            ("i", dict(names=["a", "b"], formats=["i", "i"], offsets=[2, 2]),
+             None),
+            # different number of fields can't work, should probably just fail
+            # so it never reports "viewable":
+            ("i,i", "i,i,i", None),
+            # Unstructured void cases:
+            ("i4", "V3", 0),  # void smaller or equal
+            ("i4", "V4", 0),  # void smaller or equal
+            ("i4", "V10", None),  # void is larger (no view)
+            ("O", "V4", None),  # currently reject objects for view here.
+            ("O", "V8", None),  # currently reject objects for view here.
+            ("V4", "V3", 0),
+            ("V4", "V4", 0),
+            ("V3", "V4", None),
+            # Note that currently void-to-other cast goes via byte-strings
+            # and is not a "view" based cast like the opposite direction:
+            ("V4", "i4", None),
+            # completely invalid/impossible cast:
+            ("i,i", "i,i,i", None),
+        ])
+    def test_structured_view_offsets_paramteric(
+            self, from_dt, to_dt, expected_off):
+        # TODO: While this test is fairly thorough, right now, it does not
+        # really test some paths that may have nonzero offsets (they don't
+        # really exists).
+        from_dt = np.dtype(from_dt)
+        to_dt = np.dtype(to_dt)
+        cast = get_castingimpl(type(from_dt), type(to_dt))
+        _, _, view_off = cast._resolve_descriptors((from_dt, to_dt))
+        assert view_off == expected_off
+
+    @pytest.mark.parametrize("dtype", np.typecodes["All"])
+    def test_object_casts_NULL_None_equivalence(self, dtype):
+        # None to <other> casts may succeed or fail, but a NULL'ed array must
+        # behave the same as one filled with None's.
+        arr_normal = np.array([None] * 5)
+        arr_NULLs = np.empty_like([None] * 5)
+        # If the check fails (maybe it should) the test would lose its purpose:
+        assert arr_NULLs.tobytes() == b"\x00" * arr_NULLs.nbytes
+
+        try:
+            expected = arr_normal.astype(dtype)
+        except TypeError:
+            with pytest.raises(TypeError):
+                arr_NULLs.astype(dtype),
+        else:
+            assert_array_equal(expected, arr_NULLs.astype(dtype))
+
+    @pytest.mark.parametrize("dtype",
+            np.typecodes["AllInteger"] + np.typecodes["AllFloat"])
+    def test_nonstandard_bool_to_other(self, dtype):
+        # simple test for casting bool_ to numeric types, which should not
+        # expose the detail that NumPy bools can sometimes take values other
+        # than 0 and 1.  See also gh-19514.
+        nonstandard_bools = np.array([0, 3, -7], dtype=np.int8).view(bool)
+        res = nonstandard_bools.astype(dtype)
+        expected = [0, 1, 1]
+        assert_array_equal(res, expected)
+

wemm/lib/python3.10/site-packages/numpy/core/tests/test_cpu_dispatcher.py

@@ -0,0 +1,42 @@
+from numpy.core._multiarray_umath import __cpu_features__, __cpu_baseline__, __cpu_dispatch__
+from numpy.core import _umath_tests
+from numpy.testing import assert_equal
+
+def test_dispatcher():
+    """
+    Testing the utilities of the CPU dispatcher
+    """
+    targets = (
+        "SSE2", "SSE41", "AVX2",
+        "VSX", "VSX2", "VSX3",
+        "NEON", "ASIMD", "ASIMDHP"
+    )
+    highest_sfx = "" # no suffix for the baseline
+    all_sfx = []
+    for feature in reversed(targets):
+        # skip baseline features, by the default `CCompilerOpt` do not generate separated objects
+        # for the baseline,  just one object combined all of them via 'baseline' option
+        # within the configuration statements.
+        if feature in __cpu_baseline__:
+            continue
+        # check compiler and running machine support
+        if feature not in __cpu_dispatch__ or not __cpu_features__[feature]:
+            continue
+
+        if not highest_sfx:
+            highest_sfx = "_" + feature
+        all_sfx.append("func" + "_" + feature)
+
+    test = _umath_tests.test_dispatch()
+    assert_equal(test["func"], "func" + highest_sfx)
+    assert_equal(test["var"], "var"  + highest_sfx)
+
+    if highest_sfx:
+        assert_equal(test["func_xb"], "func" + highest_sfx)
+        assert_equal(test["var_xb"], "var"  + highest_sfx)
+    else:
+        assert_equal(test["func_xb"], "nobase")
+        assert_equal(test["var_xb"], "nobase")
+
+    all_sfx.append("func") # add the baseline
+    assert_equal(test["all"], all_sfx)

wemm/lib/python3.10/site-packages/numpy/core/tests/test_cpu_features.py

@@ -0,0 +1,185 @@
+import sys, platform, re, pytest
+from numpy.core._multiarray_umath import __cpu_features__
+
+def assert_features_equal(actual, desired, fname):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    actual, desired = str(actual), str(desired)
+    if actual == desired:
+        return
+    detected = str(__cpu_features__).replace("'", "")
+    try:
+        with open("/proc/cpuinfo", "r") as fd:
+            cpuinfo = fd.read(2048)
+    except Exception as err:
+        cpuinfo = str(err)
+
+    try:
+        import subprocess
+        auxv = subprocess.check_output(['/bin/true'], env=dict(LD_SHOW_AUXV="1"))
+        auxv = auxv.decode()
+    except Exception as err:
+        auxv = str(err)
+
+    import textwrap
+    error_report = textwrap.indent(
+"""
+###########################################
+### Extra debugging information
+###########################################
+-------------------------------------------
+--- NumPy Detections
+-------------------------------------------
+%s
+-------------------------------------------
+--- SYS / CPUINFO
+-------------------------------------------
+%s....
+-------------------------------------------
+--- SYS / AUXV
+-------------------------------------------
+%s
+""" % (detected, cpuinfo, auxv), prefix='\r')
+
+    raise AssertionError((
+        "Failure Detection\n"
+        " NAME: '%s'\n"
+        " ACTUAL: %s\n"
+        " DESIRED: %s\n"
+        "%s"
+    ) % (fname, actual, desired, error_report))
+
+class AbstractTest:
+    features = []
+    features_groups = {}
+    features_map = {}
+    features_flags = set()
+
+    def load_flags(self):
+        # a hook
+        pass
+    def test_features(self):
+        self.load_flags()
+        for gname, features in self.features_groups.items():
+            test_features = [self.cpu_have(f) for f in features]
+            assert_features_equal(__cpu_features__.get(gname), all(test_features), gname)
+
+        for feature_name in self.features:
+            cpu_have = self.cpu_have(feature_name)
+            npy_have = __cpu_features__.get(feature_name)
+            assert_features_equal(npy_have, cpu_have, feature_name)
+
+    def cpu_have(self, feature_name):
+        map_names = self.features_map.get(feature_name, feature_name)
+        if isinstance(map_names, str):
+            return map_names in self.features_flags
+        for f in map_names:
+            if f in self.features_flags:
+                return True
+        return False
+
+    def load_flags_cpuinfo(self, magic_key):
+        self.features_flags = self.get_cpuinfo_item(magic_key)
+
+    def get_cpuinfo_item(self, magic_key):
+        values = set()
+        with open('/proc/cpuinfo') as fd:
+            for line in fd:
+                if not line.startswith(magic_key):
+                    continue
+                flags_value = [s.strip() for s in line.split(':', 1)]
+                if len(flags_value) == 2:
+                    values = values.union(flags_value[1].upper().split())
+        return values
+
+    def load_flags_auxv(self):
+        import subprocess
+        auxv = subprocess.check_output(['/bin/true'], env=dict(LD_SHOW_AUXV="1"))
+        for at in auxv.split(b'\n'):
+            if not at.startswith(b"AT_HWCAP"):
+                continue
+            hwcap_value = [s.strip() for s in at.split(b':', 1)]
+            if len(hwcap_value) == 2:
+                self.features_flags = self.features_flags.union(
+                    hwcap_value[1].upper().decode().split()
+                )
+
+is_linux = sys.platform.startswith('linux')
+is_cygwin = sys.platform.startswith('cygwin')
+machine  = platform.machine()
+is_x86   = re.match("^(amd64|x86|i386|i686)", machine, re.IGNORECASE)
+@pytest.mark.skipif(
+    not (is_linux or is_cygwin) or not is_x86, reason="Only for Linux and x86"
+)
+class Test_X86_Features(AbstractTest):
+    features = [
+        "MMX", "SSE", "SSE2", "SSE3", "SSSE3", "SSE41", "POPCNT", "SSE42",
+        "AVX", "F16C", "XOP", "FMA4", "FMA3", "AVX2", "AVX512F", "AVX512CD",
+        "AVX512ER", "AVX512PF", "AVX5124FMAPS", "AVX5124VNNIW", "AVX512VPOPCNTDQ",
+        "AVX512VL", "AVX512BW", "AVX512DQ", "AVX512VNNI", "AVX512IFMA",
+        "AVX512VBMI", "AVX512VBMI2", "AVX512BITALG",
+    ]
+    features_groups = dict(
+        AVX512_KNL = ["AVX512F", "AVX512CD", "AVX512ER", "AVX512PF"],
+        AVX512_KNM = ["AVX512F", "AVX512CD", "AVX512ER", "AVX512PF", "AVX5124FMAPS",
+                      "AVX5124VNNIW", "AVX512VPOPCNTDQ"],
+        AVX512_SKX = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL"],
+        AVX512_CLX = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512VNNI"],
+        AVX512_CNL = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512IFMA",
+                      "AVX512VBMI"],
+        AVX512_ICL = ["AVX512F", "AVX512CD", "AVX512BW", "AVX512DQ", "AVX512VL", "AVX512IFMA",
+                      "AVX512VBMI", "AVX512VNNI", "AVX512VBMI2", "AVX512BITALG", "AVX512VPOPCNTDQ"],
+    )
+    features_map = dict(
+        SSE3="PNI", SSE41="SSE4_1", SSE42="SSE4_2", FMA3="FMA",
+        AVX512VNNI="AVX512_VNNI", AVX512BITALG="AVX512_BITALG", AVX512VBMI2="AVX512_VBMI2",
+        AVX5124FMAPS="AVX512_4FMAPS", AVX5124VNNIW="AVX512_4VNNIW", AVX512VPOPCNTDQ="AVX512_VPOPCNTDQ",
+    )
+    def load_flags(self):
+        self.load_flags_cpuinfo("flags")
+
+is_power = re.match("^(powerpc|ppc)64", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_power, reason="Only for Linux and Power")
+class Test_POWER_Features(AbstractTest):
+    features = ["VSX", "VSX2", "VSX3", "VSX4"]
+    features_map = dict(VSX2="ARCH_2_07", VSX3="ARCH_3_00", VSX4="ARCH_3_1")
+
+    def load_flags(self):
+        self.load_flags_auxv()
+
+
+is_zarch = re.match("^(s390x)", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_zarch,
+                    reason="Only for Linux and IBM Z")
+class Test_ZARCH_Features(AbstractTest):
+    features = ["VX", "VXE", "VXE2"]
+
+    def load_flags(self):
+        self.load_flags_auxv()
+
+
+is_arm = re.match("^(arm|aarch64)", machine, re.IGNORECASE)
+@pytest.mark.skipif(not is_linux or not is_arm, reason="Only for Linux and ARM")
+class Test_ARM_Features(AbstractTest):
+    features = [
+        "NEON", "ASIMD", "FPHP", "ASIMDHP", "ASIMDDP", "ASIMDFHM"
+    ]
+    features_groups = dict(
+        NEON_FP16  = ["NEON", "HALF"],
+        NEON_VFPV4 = ["NEON", "VFPV4"],
+    )
+    def load_flags(self):
+        self.load_flags_cpuinfo("Features")
+        arch = self.get_cpuinfo_item("CPU architecture")
+        # in case of mounting virtual filesystem of aarch64 kernel
+        is_rootfs_v8 = int('0'+next(iter(arch))) > 7 if arch else 0
+        if  re.match("^(aarch64|AARCH64)", machine) or is_rootfs_v8:
+            self.features_map = dict(
+                NEON="ASIMD", HALF="ASIMD", VFPV4="ASIMD"
+            )
+        else:
+            self.features_map = dict(
+                # ELF auxiliary vector and /proc/cpuinfo on Linux kernel(armv8 aarch32)
+                # doesn't provide information about ASIMD, so we assume that ASIMD is supported
+                # if the kernel reports any one of the following ARM8 features.
+                ASIMD=("AES", "SHA1", "SHA2", "PMULL", "CRC32")
+            )

wemm/lib/python3.10/site-packages/numpy/core/tests/test_custom_dtypes.py

@@ -0,0 +1,201 @@
+import pytest
+
+import numpy as np
+from numpy.testing import assert_array_equal
+from numpy.core._multiarray_umath import (
+    _discover_array_parameters as discover_array_params, _get_sfloat_dtype)
+
+
+SF = _get_sfloat_dtype()
+
+
+class TestSFloat:
+    def _get_array(self, scaling, aligned=True):
+        if not aligned:
+            a = np.empty(3*8 + 1, dtype=np.uint8)[1:]
+            a = a.view(np.float64)
+            a[:] = [1., 2., 3.]
+        else:
+            a = np.array([1., 2., 3.])
+
+        a *= 1./scaling  # the casting code also uses the reciprocal.
+        return a.view(SF(scaling))
+
+    def test_sfloat_rescaled(self):
+        sf = SF(1.)
+        sf2 = sf.scaled_by(2.)
+        assert sf2.get_scaling() == 2.
+        sf6 = sf2.scaled_by(3.)
+        assert sf6.get_scaling() == 6.
+
+    def test_class_discovery(self):
+        # This does not test much, since we always discover the scaling as 1.
+        # But most of NumPy (when writing) does not understand DType classes
+        dt, _ = discover_array_params([1., 2., 3.], dtype=SF)
+        assert dt == SF(1.)
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_scaled_float_from_floats(self, scaling):
+        a = np.array([1., 2., 3.], dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    def test_repr(self):
+        # Check the repr, mainly to cover the code paths:
+        assert repr(SF(scaling=1.)) == "_ScaledFloatTestDType(scaling=1.0)"
+
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_from_float(self, scaling):
+        a = np.array([1., 2., 3.]).astype(dtype=SF(scaling))
+
+        assert a.dtype.get_scaling() == scaling
+        assert_array_equal(scaling * a.view(np.float64), [1., 2., 3.])
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    @pytest.mark.parametrize("scaling", [1., -1., 2.])
+    def test_sfloat_getitem(self, aligned, scaling):
+        a = self._get_array(1., aligned)
+        assert a.tolist() == [1., 2., 3.]
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_casts(self, aligned):
+        a = self._get_array(1., aligned)
+
+        assert np.can_cast(a, SF(-1.), casting="equiv")
+        assert not np.can_cast(a, SF(-1.), casting="no")
+        na = a.astype(SF(-1.))
+        assert_array_equal(-1 * na.view(np.float64), a.view(np.float64))
+
+        assert np.can_cast(a, SF(2.), casting="same_kind")
+        assert not np.can_cast(a, SF(2.), casting="safe")
+        a2 = a.astype(SF(2.))
+        assert_array_equal(2 * a2.view(np.float64), a.view(np.float64))
+
+    @pytest.mark.parametrize("aligned", [True, False])
+    def test_sfloat_cast_internal_errors(self, aligned):
+        a = self._get_array(2e300, aligned)
+
+        with pytest.raises(TypeError,
+                match="error raised inside the core-loop: non-finite factor!"):
+            a.astype(SF(2e-300))
+
+    def test_sfloat_promotion(self):
+        assert np.result_type(SF(2.), SF(3.)) == SF(3.)
+        assert np.result_type(SF(3.), SF(2.)) == SF(3.)
+        # Float64 -> SF(1.) and then promotes normally, so both of this work:
+        assert np.result_type(SF(3.), np.float64) == SF(3.)
+        assert np.result_type(np.float64, SF(0.5)) == SF(1.)
+
+        # Test an undefined promotion:
+        with pytest.raises(TypeError):
+            np.result_type(SF(1.), np.int64)
+
+    def test_basic_multiply(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a * b
+        # multiplies dtype scaling and content separately:
+        assert res.dtype.get_scaling() == 8.
+        expected_view = a.view(np.float64) * b.view(np.float64)
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_possible_and_impossible_reduce(self):
+        # For reductions to work, the first and last operand must have the
+        # same dtype.  For this parametric DType that is not necessarily true.
+        a = self._get_array(2.)
+        # Addition reductin works (as of writing requires to pass initial
+        # because setting a scaled-float from the default `0` fails).
+        res = np.add.reduce(a, initial=0.)
+        assert res == a.astype(np.float64).sum()
+
+        # But each multiplication changes the factor, so a reduction is not
+        # possible (the relaxed version of the old refusal to handle any
+        # flexible dtype).
+        with pytest.raises(TypeError,
+                match="the resolved dtypes are not compatible"):
+            np.multiply.reduce(a)
+
+    def test_basic_ufunc_at(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        float_b = b.view(np.float64).copy()
+        np.multiply.at(float_b, [1, 1, 1], float_a)
+        np.multiply.at(b, [1, 1, 1], float_a)
+
+        assert_array_equal(b.view(np.float64), float_b)
+
+    def test_basic_multiply_promotion(self):
+        float_a = np.array([1., 2., 3.])
+        b = self._get_array(2.)
+
+        res1 = float_a * b
+        res2 = b * float_a
+
+        # one factor is one, so we get the factor of b:
+        assert res1.dtype == res2.dtype == b.dtype
+        expected_view = float_a * b.view(np.float64)
+        assert_array_equal(res1.view(np.float64), expected_view)
+        assert_array_equal(res2.view(np.float64), expected_view)
+
+        # Check that promotion works when `out` is used:
+        np.multiply(b, float_a, out=res2)
+        with pytest.raises(TypeError):
+            # The promoter accepts this (maybe it should not), but the SFloat
+            # result cannot be cast to integer:
+            np.multiply(b, float_a, out=np.arange(3))
+
+    def test_basic_addition(self):
+        a = self._get_array(2.)
+        b = self._get_array(4.)
+
+        res = a + b
+        # addition uses the type promotion rules for the result:
+        assert res.dtype == np.result_type(a.dtype, b.dtype)
+        expected_view = (a.astype(res.dtype).view(np.float64) +
+                         b.astype(res.dtype).view(np.float64))
+        assert_array_equal(res.view(np.float64), expected_view)
+
+    def test_addition_cast_safety(self):
+        """The addition method is special for the scaled float, because it
+        includes the "cast" between different factors, thus cast-safety
+        is influenced by the implementation.
+        """
+        a = self._get_array(2.)
+        b = self._get_array(-2.)
+        c = self._get_array(3.)
+
+        # sign change is "equiv":
+        np.add(a, b, casting="equiv")
+        with pytest.raises(TypeError):
+            np.add(a, b, casting="no")
+
+        # Different factor is "same_kind" (default) so check that "safe" fails
+        with pytest.raises(TypeError):
+            np.add(a, c, casting="safe")
+
+        # Check that casting the output fails also (done by the ufunc here)
+        with pytest.raises(TypeError):
+            np.add(a, a, out=c, casting="safe")
+
+    @pytest.mark.parametrize("ufunc",
+            [np.logical_and, np.logical_or, np.logical_xor])
+    def test_logical_ufuncs_casts_to_bool(self, ufunc):
+        a = self._get_array(2.)
+        a[0] = 0.  # make sure first element is considered False.
+
+        float_equiv = a.astype(float)
+        expected = ufunc(float_equiv, float_equiv)
+        res = ufunc(a, a)
+        assert_array_equal(res, expected)
+
+        # also check that the same works for reductions:
+        expected = ufunc.reduce(float_equiv)
+        res = ufunc.reduce(a)
+        assert_array_equal(res, expected)
+
+        # The output casting does not match the bool, bool -> bool loop:
+        with pytest.raises(TypeError):
+            ufunc(a, a, out=np.empty(a.shape, dtype=int), casting="equiv")

wemm/lib/python3.10/site-packages/numpy/core/tests/test_cython.py

@@ -0,0 +1,134 @@
+import os
+import shutil
+import subprocess
+import sys
+import pytest
+
+import numpy as np
+
+# This import is copied from random.tests.test_extending
+try:
+    import cython
+    from Cython.Compiler.Version import version as cython_version
+except ImportError:
+    cython = None
+else:
+    from numpy.compat import _pep440
+
+    # Cython 0.29.30 is required for Python 3.11 and there are
+    # other fixes in the 0.29 series that are needed even for earlier
+    # Python versions.
+    # Note: keep in sync with the one in pyproject.toml
+    required_version = "0.29.30"
+    if _pep440.parse(cython_version) < _pep440.Version(required_version):
+        # too old or wrong cython, skip the test
+        cython = None
+
+pytestmark = pytest.mark.skipif(cython is None, reason="requires cython")
+
+
+@pytest.fixture
+def install_temp(request, tmp_path):
+    # Based in part on test_cython from random.tests.test_extending
+
+    here = os.path.dirname(__file__)
+    ext_dir = os.path.join(here, "examples", "cython")
+
+    cytest = str(tmp_path / "cytest")
+
+    shutil.copytree(ext_dir, cytest)
+    # build the examples and "install" them into a temporary directory
+
+    install_log = str(tmp_path / "tmp_install_log.txt")
+    subprocess.check_output(
+        [
+            sys.executable,
+            "setup.py",
+            "build",
+            "install",
+            "--prefix", str(tmp_path / "installdir"),
+            "--single-version-externally-managed",
+            "--record",
+            install_log,
+        ],
+        cwd=cytest,
+    )
+
+    # In order to import the built module, we need its path to sys.path
+    # so parse that out of the record
+    with open(install_log) as fid:
+        for line in fid:
+            if "checks" in line:
+                sys.path.append(os.path.dirname(line))
+                break
+        else:
+            raise RuntimeError(f'could not parse "{install_log}"')
+
+
+def test_is_timedelta64_object(install_temp):
+    import checks
+
+    assert checks.is_td64(np.timedelta64(1234))
+    assert checks.is_td64(np.timedelta64(1234, "ns"))
+    assert checks.is_td64(np.timedelta64("NaT", "ns"))
+
+    assert not checks.is_td64(1)
+    assert not checks.is_td64(None)
+    assert not checks.is_td64("foo")
+    assert not checks.is_td64(np.datetime64("now", "s"))
+
+
+def test_is_datetime64_object(install_temp):
+    import checks
+
+    assert checks.is_dt64(np.datetime64(1234, "ns"))
+    assert checks.is_dt64(np.datetime64("NaT", "ns"))
+
+    assert not checks.is_dt64(1)
+    assert not checks.is_dt64(None)
+    assert not checks.is_dt64("foo")
+    assert not checks.is_dt64(np.timedelta64(1234))
+
+
+def test_get_datetime64_value(install_temp):
+    import checks
+
+    dt64 = np.datetime64("2016-01-01", "ns")
+
+    result = checks.get_dt64_value(dt64)
+    expected = dt64.view("i8")
+
+    assert result == expected
+
+
+def test_get_timedelta64_value(install_temp):
+    import checks
+
+    td64 = np.timedelta64(12345, "h")
+
+    result = checks.get_td64_value(td64)
+    expected = td64.view("i8")
+
+    assert result == expected
+
+
+def test_get_datetime64_unit(install_temp):
+    import checks
+
+    dt64 = np.datetime64("2016-01-01", "ns")
+    result = checks.get_dt64_unit(dt64)
+    expected = 10
+    assert result == expected
+
+    td64 = np.timedelta64(12345, "h")
+    result = checks.get_dt64_unit(td64)
+    expected = 5
+    assert result == expected
+
+
+def test_abstract_scalars(install_temp):
+    import checks
+
+    assert checks.is_integer(1)
+    assert checks.is_integer(np.int8(1))
+    assert checks.is_integer(np.uint64(1))

wemm/lib/python3.10/site-packages/numpy/core/tests/test_defchararray.py

@@ -0,0 +1,673 @@
+
+import numpy as np
+from numpy.core.multiarray import _vec_string
+from numpy.testing import (
+    assert_, assert_equal, assert_array_equal, assert_raises,
+    assert_raises_regex
+    )
+
+kw_unicode_true = {'unicode': True}  # make 2to3 work properly
+kw_unicode_false = {'unicode': False}
+
+class TestBasic:
+    def test_from_object_array(self):
+        A = np.array([['abc', 2],
+                      ['long   ', '0123456789']], dtype='O')
+        B = np.char.array(A)
+        assert_equal(B.dtype.itemsize, 10)
+        assert_array_equal(B, [[b'abc', b'2'],
+                               [b'long', b'0123456789']])
+
+    def test_from_object_array_unicode(self):
+        A = np.array([['abc', u'Sigma \u03a3'],
+                      ['long   ', '0123456789']], dtype='O')
+        assert_raises(ValueError, np.char.array, (A,))
+        B = np.char.array(A, **kw_unicode_true)
+        assert_equal(B.dtype.itemsize, 10 * np.array('a', 'U').dtype.itemsize)
+        assert_array_equal(B, [['abc', u'Sigma \u03a3'],
+                               ['long', '0123456789']])
+
+    def test_from_string_array(self):
+        A = np.array([[b'abc', b'foo'],
+                      [b'long   ', b'0123456789']])
+        assert_equal(A.dtype.type, np.string_)
+        B = np.char.array(A)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+        B[0, 0] = 'changed'
+        assert_(B[0, 0] != A[0, 0])
+        C = np.char.asarray(A)
+        assert_array_equal(C, A)
+        assert_equal(C.dtype, A.dtype)
+        C[0, 0] = 'changed again'
+        assert_(C[0, 0] != B[0, 0])
+        assert_(C[0, 0] == A[0, 0])
+
+    def test_from_unicode_array(self):
+        A = np.array([['abc', u'Sigma \u03a3'],
+                      ['long   ', '0123456789']])
+        assert_equal(A.dtype.type, np.unicode_)
+        B = np.char.array(A)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+        B = np.char.array(A, **kw_unicode_true)
+        assert_array_equal(B, A)
+        assert_equal(B.dtype, A.dtype)
+        assert_equal(B.shape, A.shape)
+
+        def fail():
+            np.char.array(A, **kw_unicode_false)
+
+        assert_raises(UnicodeEncodeError, fail)
+
+    def test_unicode_upconvert(self):
+        A = np.char.array(['abc'])
+        B = np.char.array([u'\u03a3'])
+        assert_(issubclass((A + B).dtype.type, np.unicode_))
+
+    def test_from_string(self):
+        A = np.char.array(b'abc')
+        assert_equal(len(A), 1)
+        assert_equal(len(A[0]), 3)
+        assert_(issubclass(A.dtype.type, np.string_))
+
+    def test_from_unicode(self):
+        A = np.char.array(u'\u03a3')
+        assert_equal(len(A), 1)
+        assert_equal(len(A[0]), 1)
+        assert_equal(A.itemsize, 4)
+        assert_(issubclass(A.dtype.type, np.unicode_))
+
+class TestVecString:
+    def test_non_existent_method(self):
+
+        def fail():
+            _vec_string('a', np.string_, 'bogus')
+
+        assert_raises(AttributeError, fail)
+
+    def test_non_string_array(self):
+
+        def fail():
+            _vec_string(1, np.string_, 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_args_tuple(self):
+
+        def fail():
+            _vec_string(['a'], np.string_, 'strip', 1)
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_type_descr(self):
+
+        def fail():
+            _vec_string(['a'], 'BOGUS', 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_function_args(self):
+
+        def fail():
+            _vec_string(['a'], np.string_, 'strip', (1,))
+
+        assert_raises(TypeError, fail)
+
+    def test_invalid_result_type(self):
+
+        def fail():
+            _vec_string(['a'], np.int_, 'strip')
+
+        assert_raises(TypeError, fail)
+
+    def test_broadcast_error(self):
+
+        def fail():
+            _vec_string([['abc', 'def']], np.int_, 'find', (['a', 'd', 'j'],))
+
+        assert_raises(ValueError, fail)
+
+
+class TestWhitespace:
+    def setup_method(self):
+        self.A = np.array([['abc ', '123  '],
+                           ['789 ', 'xyz ']]).view(np.chararray)
+        self.B = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+
+    def test1(self):
+        assert_(np.all(self.A == self.B))
+        assert_(np.all(self.A >= self.B))
+        assert_(np.all(self.A <= self.B))
+        assert_(not np.any(self.A > self.B))
+        assert_(not np.any(self.A < self.B))
+        assert_(not np.any(self.A != self.B))
+
+class TestChar:
+    def setup_method(self):
+        self.A = np.array('abc1', dtype='c').view(np.chararray)
+
+    def test_it(self):
+        assert_equal(self.A.shape, (4,))
+        assert_equal(self.A.upper()[:2].tobytes(), b'AB')
+
+class TestComparisons:
+    def setup_method(self):
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+        self.B = np.array([['efg', '123  '],
+                           ['051', 'tuv']]).view(np.chararray)
+
+    def test_not_equal(self):
+        assert_array_equal((self.A != self.B), [[True, False], [True, True]])
+
+    def test_equal(self):
+        assert_array_equal((self.A == self.B), [[False, True], [False, False]])
+
+    def test_greater_equal(self):
+        assert_array_equal((self.A >= self.B), [[False, True], [True, True]])
+
+    def test_less_equal(self):
+        assert_array_equal((self.A <= self.B), [[True, True], [False, False]])
+
+    def test_greater(self):
+        assert_array_equal((self.A > self.B), [[False, False], [True, True]])
+
+    def test_less(self):
+        assert_array_equal((self.A < self.B), [[True, False], [False, False]])
+
+    def test_type(self):
+        out1 = np.char.equal(self.A, self.B)
+        out2 = np.char.equal('a', 'a')
+        assert_(isinstance(out1, np.ndarray))
+        assert_(isinstance(out2, np.ndarray))
+
+class TestComparisonsMixed1(TestComparisons):
+    """Ticket #1276"""
+
+    def setup_method(self):
+        TestComparisons.setup_method(self)
+        self.B = np.array([['efg', '123  '],
+                           ['051', 'tuv']], np.unicode_).view(np.chararray)
+
+class TestComparisonsMixed2(TestComparisons):
+    """Ticket #1276"""
+
+    def setup_method(self):
+        TestComparisons.setup_method(self)
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']], np.unicode_).view(np.chararray)
+
+class TestInformation:
+    def setup_method(self):
+        self.A = np.array([[' abc ', ''],
+                           ['12345', 'MixedCase'],
+                           ['123 \t 345 \0 ', 'UPPER']]).view(np.chararray)
+        self.B = np.array([[u' \u03a3 ', u''],
+                           [u'12345', u'MixedCase'],
+                           [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray)
+
+    def test_len(self):
+        assert_(issubclass(np.char.str_len(self.A).dtype.type, np.integer))
+        assert_array_equal(np.char.str_len(self.A), [[5, 0], [5, 9], [12, 5]])
+        assert_array_equal(np.char.str_len(self.B), [[3, 0], [5, 9], [12, 5]])
+
+    def test_count(self):
+        assert_(issubclass(self.A.count('').dtype.type, np.integer))
+        assert_array_equal(self.A.count('a'), [[1, 0], [0, 1], [0, 0]])
+        assert_array_equal(self.A.count('123'), [[0, 0], [1, 0], [1, 0]])
+        # Python doesn't seem to like counting NULL characters
+        # assert_array_equal(self.A.count('\0'), [[0, 0], [0, 0], [1, 0]])
+        assert_array_equal(self.A.count('a', 0, 2), [[1, 0], [0, 0], [0, 0]])
+        assert_array_equal(self.B.count('a'), [[0, 0], [0, 1], [0, 0]])
+        assert_array_equal(self.B.count('123'), [[0, 0], [1, 0], [1, 0]])
+        # assert_array_equal(self.B.count('\0'), [[0, 0], [0, 0], [1, 0]])
+
+    def test_endswith(self):
+        assert_(issubclass(self.A.endswith('').dtype.type, np.bool_))
+        assert_array_equal(self.A.endswith(' '), [[1, 0], [0, 0], [1, 0]])
+        assert_array_equal(self.A.endswith('3', 0, 3), [[0, 0], [1, 0], [1, 0]])
+
+        def fail():
+            self.A.endswith('3', 'fdjk')
+
+        assert_raises(TypeError, fail)
+
+    def test_find(self):
+        assert_(issubclass(self.A.find('a').dtype.type, np.integer))
+        assert_array_equal(self.A.find('a'), [[1, -1], [-1, 6], [-1, -1]])
+        assert_array_equal(self.A.find('3'), [[-1, -1], [2, -1], [2, -1]])
+        assert_array_equal(self.A.find('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]])
+        assert_array_equal(self.A.find(['1', 'P']), [[-1, -1], [0, -1], [0, 1]])
+
+    def test_index(self):
+
+        def fail():
+            self.A.index('a')
+
+        assert_raises(ValueError, fail)
+        assert_(np.char.index('abcba', 'b') == 1)
+        assert_(issubclass(np.char.index('abcba', 'b').dtype.type, np.integer))
+
+    def test_isalnum(self):
+        assert_(issubclass(self.A.isalnum().dtype.type, np.bool_))
+        assert_array_equal(self.A.isalnum(), [[False, False], [True, True], [False, True]])
+
+    def test_isalpha(self):
+        assert_(issubclass(self.A.isalpha().dtype.type, np.bool_))
+        assert_array_equal(self.A.isalpha(), [[False, False], [False, True], [False, True]])
+
+    def test_isdigit(self):
+        assert_(issubclass(self.A.isdigit().dtype.type, np.bool_))
+        assert_array_equal(self.A.isdigit(), [[False, False], [True, False], [False, False]])
+
+    def test_islower(self):
+        assert_(issubclass(self.A.islower().dtype.type, np.bool_))
+        assert_array_equal(self.A.islower(), [[True, False], [False, False], [False, False]])
+
+    def test_isspace(self):
+        assert_(issubclass(self.A.isspace().dtype.type, np.bool_))
+        assert_array_equal(self.A.isspace(), [[False, False], [False, False], [False, False]])
+
+    def test_istitle(self):
+        assert_(issubclass(self.A.istitle().dtype.type, np.bool_))
+        assert_array_equal(self.A.istitle(), [[False, False], [False, False], [False, False]])
+
+    def test_isupper(self):
+        assert_(issubclass(self.A.isupper().dtype.type, np.bool_))
+        assert_array_equal(self.A.isupper(), [[False, False], [False, False], [False, True]])
+
+    def test_rfind(self):
+        assert_(issubclass(self.A.rfind('a').dtype.type, np.integer))
+        assert_array_equal(self.A.rfind('a'), [[1, -1], [-1, 6], [-1, -1]])
+        assert_array_equal(self.A.rfind('3'), [[-1, -1], [2, -1], [6, -1]])
+        assert_array_equal(self.A.rfind('a', 0, 2), [[1, -1], [-1, -1], [-1, -1]])
+        assert_array_equal(self.A.rfind(['1', 'P']), [[-1, -1], [0, -1], [0, 2]])
+
+    def test_rindex(self):
+
+        def fail():
+            self.A.rindex('a')
+
+        assert_raises(ValueError, fail)
+        assert_(np.char.rindex('abcba', 'b') == 3)
+        assert_(issubclass(np.char.rindex('abcba', 'b').dtype.type, np.integer))
+
+    def test_startswith(self):
+        assert_(issubclass(self.A.startswith('').dtype.type, np.bool_))
+        assert_array_equal(self.A.startswith(' '), [[1, 0], [0, 0], [0, 0]])
+        assert_array_equal(self.A.startswith('1', 0, 3), [[0, 0], [1, 0], [1, 0]])
+
+        def fail():
+            self.A.startswith('3', 'fdjk')
+
+        assert_raises(TypeError, fail)
+
+
+class TestMethods:
+    def setup_method(self):
+        self.A = np.array([[' abc ', ''],
+                           ['12345', 'MixedCase'],
+                           ['123 \t 345 \0 ', 'UPPER']],
+                          dtype='S').view(np.chararray)
+        self.B = np.array([[u' \u03a3 ', u''],
+                           [u'12345', u'MixedCase'],
+                           [u'123 \t 345 \0 ', u'UPPER']]).view(np.chararray)
+
+    def test_capitalize(self):
+        tgt = [[b' abc ', b''],
+               [b'12345', b'Mixedcase'],
+               [b'123 \t 345 \0 ', b'Upper']]
+        assert_(issubclass(self.A.capitalize().dtype.type, np.string_))
+        assert_array_equal(self.A.capitalize(), tgt)
+
+        tgt = [[u' \u03c3 ', ''],
+               ['12345', 'Mixedcase'],
+               ['123 \t 345 \0 ', 'Upper']]
+        assert_(issubclass(self.B.capitalize().dtype.type, np.unicode_))
+        assert_array_equal(self.B.capitalize(), tgt)
+
+    def test_center(self):
+        assert_(issubclass(self.A.center(10).dtype.type, np.string_))
+        C = self.A.center([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.center(20, b'#')
+        assert_(np.all(C.startswith(b'#')))
+        assert_(np.all(C.endswith(b'#')))
+
+        C = np.char.center(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'   FOO    ', b'        FOO         '],
+               [b'      FOO      ', b'  FOO   ']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_decode(self):
+        A = np.char.array([b'\\u03a3'])
+        assert_(A.decode('unicode-escape')[0] == '\u03a3')
+
+    def test_encode(self):
+        B = self.B.encode('unicode_escape')
+        assert_(B[0][0] == str(' \\u03a3 ').encode('latin1'))
+
+    def test_expandtabs(self):
+        T = self.A.expandtabs()
+        assert_(T[2, 0] == b'123      345 \0')
+
+    def test_join(self):
+        # NOTE: list(b'123') == [49, 50, 51]
+        #       so that b','.join(b'123') results to an error on Py3
+        A0 = self.A.decode('ascii')
+
+        A = np.char.join([',', '#'], A0)
+        assert_(issubclass(A.dtype.type, np.unicode_))
+        tgt = np.array([[' ,a,b,c, ', ''],
+                        ['1,2,3,4,5', 'M#i#x#e#d#C#a#s#e'],
+                        ['1,2,3, ,\t, ,3,4,5, ,\x00, ', 'U#P#P#E#R']])
+        assert_array_equal(np.char.join([',', '#'], A0), tgt)
+
+    def test_ljust(self):
+        assert_(issubclass(self.A.ljust(10).dtype.type, np.string_))
+
+        C = self.A.ljust([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.ljust(20, b'#')
+        assert_array_equal(C.startswith(b'#'), [
+                [False, True], [False, False], [False, False]])
+        assert_(np.all(C.endswith(b'#')))
+
+        C = np.char.ljust(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'FOO       ', b'FOO                 '],
+               [b'FOO            ', b'FOO     ']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_lower(self):
+        tgt = [[b' abc ', b''],
+               [b'12345', b'mixedcase'],
+               [b'123 \t 345 \0 ', b'upper']]
+        assert_(issubclass(self.A.lower().dtype.type, np.string_))
+        assert_array_equal(self.A.lower(), tgt)
+
+        tgt = [[u' \u03c3 ', u''],
+               [u'12345', u'mixedcase'],
+               [u'123 \t 345 \0 ', u'upper']]
+        assert_(issubclass(self.B.lower().dtype.type, np.unicode_))
+        assert_array_equal(self.B.lower(), tgt)
+
+    def test_lstrip(self):
+        tgt = [[b'abc ', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345 \0 ', b'UPPER']]
+        assert_(issubclass(self.A.lstrip().dtype.type, np.string_))
+        assert_array_equal(self.A.lstrip(), tgt)
+
+        tgt = [[b' abc', b''],
+               [b'2345', b'ixedCase'],
+               [b'23 \t 345 \x00', b'UPPER']]
+        assert_array_equal(self.A.lstrip([b'1', b'M']), tgt)
+
+        tgt = [[u'\u03a3 ', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345 \0 ', 'UPPER']]
+        assert_(issubclass(self.B.lstrip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.lstrip(), tgt)
+
+    def test_partition(self):
+        P = self.A.partition([b'3', b'M'])
+        tgt = [[(b' abc ', b'', b''), (b'', b'', b'')],
+               [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')],
+               [(b'12', b'3', b' \t 345 \0 '), (b'UPPER', b'', b'')]]
+        assert_(issubclass(P.dtype.type, np.string_))
+        assert_array_equal(P, tgt)
+
+    def test_replace(self):
+        R = self.A.replace([b'3', b'a'],
+                           [b'##########', b'@'])
+        tgt = [[b' abc ', b''],
+               [b'12##########45', b'MixedC@se'],
+               [b'12########## \t ##########45 \x00', b'UPPER']]
+        assert_(issubclass(R.dtype.type, np.string_))
+        assert_array_equal(R, tgt)
+
+    def test_rjust(self):
+        assert_(issubclass(self.A.rjust(10).dtype.type, np.string_))
+
+        C = self.A.rjust([10, 20])
+        assert_array_equal(np.char.str_len(C), [[10, 20], [10, 20], [12, 20]])
+
+        C = self.A.rjust(20, b'#')
+        assert_(np.all(C.startswith(b'#')))
+        assert_array_equal(C.endswith(b'#'),
+                           [[False, True], [False, False], [False, False]])
+
+        C = np.char.rjust(b'FOO', [[10, 20], [15, 8]])
+        tgt = [[b'       FOO', b'                 FOO'],
+               [b'            FOO', b'     FOO']]
+        assert_(issubclass(C.dtype.type, np.string_))
+        assert_array_equal(C, tgt)
+
+    def test_rpartition(self):
+        P = self.A.rpartition([b'3', b'M'])
+        tgt = [[(b'', b'', b' abc '), (b'', b'', b'')],
+               [(b'12', b'3', b'45'), (b'', b'M', b'ixedCase')],
+               [(b'123 \t ', b'3', b'45 \0 '), (b'', b'', b'UPPER')]]
+        assert_(issubclass(P.dtype.type, np.string_))
+        assert_array_equal(P, tgt)
+
+    def test_rsplit(self):
+        A = self.A.rsplit(b'3')
+        tgt = [[[b' abc '], [b'']],
+               [[b'12', b'45'], [b'MixedCase']],
+               [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]]
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_equal(A.tolist(), tgt)
+
+    def test_rstrip(self):
+        assert_(issubclass(self.A.rstrip().dtype.type, np.string_))
+
+        tgt = [[b' abc', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345', b'UPPER']]
+        assert_array_equal(self.A.rstrip(), tgt)
+
+        tgt = [[b' abc ', b''],
+               [b'1234', b'MixedCase'],
+               [b'123 \t 345 \x00', b'UPP']
+               ]
+        assert_array_equal(self.A.rstrip([b'5', b'ER']), tgt)
+
+        tgt = [[u' \u03a3', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345', 'UPPER']]
+        assert_(issubclass(self.B.rstrip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.rstrip(), tgt)
+
+    def test_strip(self):
+        tgt = [[b'abc', b''],
+               [b'12345', b'MixedCase'],
+               [b'123 \t 345', b'UPPER']]
+        assert_(issubclass(self.A.strip().dtype.type, np.string_))
+        assert_array_equal(self.A.strip(), tgt)
+
+        tgt = [[b' abc ', b''],
+               [b'234', b'ixedCas'],
+               [b'23 \t 345 \x00', b'UPP']]
+        assert_array_equal(self.A.strip([b'15', b'EReM']), tgt)
+
+        tgt = [[u'\u03a3', ''],
+               ['12345', 'MixedCase'],
+               ['123 \t 345', 'UPPER']]
+        assert_(issubclass(self.B.strip().dtype.type, np.unicode_))
+        assert_array_equal(self.B.strip(), tgt)
+
+    def test_split(self):
+        A = self.A.split(b'3')
+        tgt = [
+               [[b' abc '], [b'']],
+               [[b'12', b'45'], [b'MixedCase']],
+               [[b'12', b' \t ', b'45 \x00 '], [b'UPPER']]]
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_equal(A.tolist(), tgt)
+
+    def test_splitlines(self):
+        A = np.char.array(['abc\nfds\nwer']).splitlines()
+        assert_(issubclass(A.dtype.type, np.object_))
+        assert_(A.shape == (1,))
+        assert_(len(A[0]) == 3)
+
+    def test_swapcase(self):
+        tgt = [[b' ABC ', b''],
+               [b'12345', b'mIXEDcASE'],
+               [b'123 \t 345 \0 ', b'upper']]
+        assert_(issubclass(self.A.swapcase().dtype.type, np.string_))
+        assert_array_equal(self.A.swapcase(), tgt)
+
+        tgt = [[u' \u03c3 ', u''],
+               [u'12345', u'mIXEDcASE'],
+               [u'123 \t 345 \0 ', u'upper']]
+        assert_(issubclass(self.B.swapcase().dtype.type, np.unicode_))
+        assert_array_equal(self.B.swapcase(), tgt)
+
+    def test_title(self):
+        tgt = [[b' Abc ', b''],
+               [b'12345', b'Mixedcase'],
+               [b'123 \t 345 \0 ', b'Upper']]
+        assert_(issubclass(self.A.title().dtype.type, np.string_))
+        assert_array_equal(self.A.title(), tgt)
+
+        tgt = [[u' \u03a3 ', u''],
+               [u'12345', u'Mixedcase'],
+               [u'123 \t 345 \0 ', u'Upper']]
+        assert_(issubclass(self.B.title().dtype.type, np.unicode_))
+        assert_array_equal(self.B.title(), tgt)
+
+    def test_upper(self):
+        tgt = [[b' ABC ', b''],
+               [b'12345', b'MIXEDCASE'],
+               [b'123 \t 345 \0 ', b'UPPER']]
+        assert_(issubclass(self.A.upper().dtype.type, np.string_))
+        assert_array_equal(self.A.upper(), tgt)
+
+        tgt = [[u' \u03a3 ', u''],
+               [u'12345', u'MIXEDCASE'],
+               [u'123 \t 345 \0 ', u'UPPER']]
+        assert_(issubclass(self.B.upper().dtype.type, np.unicode_))
+        assert_array_equal(self.B.upper(), tgt)
+
+    def test_isnumeric(self):
+
+        def fail():
+            self.A.isnumeric()
+
+        assert_raises(TypeError, fail)
+        assert_(issubclass(self.B.isnumeric().dtype.type, np.bool_))
+        assert_array_equal(self.B.isnumeric(), [
+                [False, False], [True, False], [False, False]])
+
+    def test_isdecimal(self):
+
+        def fail():
+            self.A.isdecimal()
+
+        assert_raises(TypeError, fail)
+        assert_(issubclass(self.B.isdecimal().dtype.type, np.bool_))
+        assert_array_equal(self.B.isdecimal(), [
+                [False, False], [True, False], [False, False]])
+
+
+class TestOperations:
+    def setup_method(self):
+        self.A = np.array([['abc', '123'],
+                           ['789', 'xyz']]).view(np.chararray)
+        self.B = np.array([['efg', '456'],
+                           ['051', 'tuv']]).view(np.chararray)
+
+    def test_add(self):
+        AB = np.array([['abcefg', '123456'],
+                       ['789051', 'xyztuv']]).view(np.chararray)
+        assert_array_equal(AB, (self.A + self.B))
+        assert_(len((self.A + self.B)[0][0]) == 6)
+
+    def test_radd(self):
+        QA = np.array([['qabc', 'q123'],
+                       ['q789', 'qxyz']]).view(np.chararray)
+        assert_array_equal(QA, ('q' + self.A))
+
+    def test_mul(self):
+        A = self.A
+        for r in (2, 3, 5, 7, 197):
+            Ar = np.array([[A[0, 0]*r, A[0, 1]*r],
+                           [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray)
+
+            assert_array_equal(Ar, (self.A * r))
+
+        for ob in [object(), 'qrs']:
+            with assert_raises_regex(ValueError,
+                                     'Can only multiply by integers'):
+                A*ob
+
+    def test_rmul(self):
+        A = self.A
+        for r in (2, 3, 5, 7, 197):
+            Ar = np.array([[A[0, 0]*r, A[0, 1]*r],
+                           [A[1, 0]*r, A[1, 1]*r]]).view(np.chararray)
+            assert_array_equal(Ar, (r * self.A))
+
+        for ob in [object(), 'qrs']:
+            with assert_raises_regex(ValueError,
+                                     'Can only multiply by integers'):
+                ob * A
+
+    def test_mod(self):
+        """Ticket #856"""
+        F = np.array([['%d', '%f'], ['%s', '%r']]).view(np.chararray)
+        C = np.array([[3, 7], [19, 1]])
+        FC = np.array([['3', '7.000000'],
+                       ['19', '1']]).view(np.chararray)
+        assert_array_equal(FC, F % C)
+
+        A = np.array([['%.3f', '%d'], ['%s', '%r']]).view(np.chararray)
+        A1 = np.array([['1.000', '1'], ['1', '1']]).view(np.chararray)
+        assert_array_equal(A1, (A % 1))
+
+        A2 = np.array([['1.000', '2'], ['3', '4']]).view(np.chararray)
+        assert_array_equal(A2, (A % [[1, 2], [3, 4]]))
+
+    def test_rmod(self):
+        assert_(("%s" % self.A) == str(self.A))
+        assert_(("%r" % self.A) == repr(self.A))
+
+        for ob in [42, object()]:
+            with assert_raises_regex(
+                    TypeError, "unsupported operand type.* and 'chararray'"):
+                ob % self.A
+
+    def test_slice(self):
+        """Regression test for https://github.com/numpy/numpy/issues/5982"""
+
+        arr = np.array([['abc ', 'def '], ['geh ', 'ijk ']],
+                       dtype='S4').view(np.chararray)
+        sl1 = arr[:]
+        assert_array_equal(sl1, arr)
+        assert_(sl1.base is arr)
+        assert_(sl1.base.base is arr.base)
+
+        sl2 = arr[:, :]
+        assert_array_equal(sl2, arr)
+        assert_(sl2.base is arr)
+        assert_(sl2.base.base is arr.base)
+
+        assert_(arr[0, 0] == b'abc')
+
+
+def test_empty_indexing():
+    """Regression test for ticket 1948."""
+    # Check that indexing a chararray with an empty list/array returns an
+    # empty chararray instead of a chararray with a single empty string in it.
+    s = np.chararray((4,))
+    assert_(s[[]].size == 0)