diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_asteroidal.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_asteroidal.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..b57639034af79fd204c541773f8787d33f20237e Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_asteroidal.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_boundary.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_boundary.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..49c0ccbe3020ecbdcbe3afd444e8a4db6871c18b Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_boundary.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_bridges.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_bridges.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..2da0c63731c875b3b891496018e46272685670f8 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_bridges.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_broadcasting.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_broadcasting.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..dd0e6240088580fc1cb7e89b67817856458aa3e9 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_broadcasting.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_clique.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_clique.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..f74f6516de54195092ecf25c47cc1d73c35383c4 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_clique.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_communicability.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_communicability.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..bb5ab04738f20bc0500b589ce6c70ef9b9a8d33b Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_communicability.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_core.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_core.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..649280cbd22f11b20046938f5c77a1f021e305e8 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_core.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_d_separation.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_d_separation.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..9ee3c1f7eb9ba3cad365efdaca33ad79c6c7741e Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_d_separation.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_measures.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_measures.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..00490ef3d3c623a5588cdb5a79d23a8deaca512f Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_measures.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_regular.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_regular.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..935191c7ddf3c30533ddc4f21795505344b895ee Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_distance_regular.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_efficiency.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_efficiency.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..0d9c29da55b9eecda21548930ef98fc9be17f997 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_efficiency.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_euler.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_euler.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..9272a9d3b17c3ec5bce2fbd04e30003a3033f821 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_euler.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graph_hashing.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graph_hashing.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..4b2270aa3f7aeda46982bc24352c7d54366eec9a Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graph_hashing.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graphical.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graphical.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..997b90746fbafe6917acf3732cc8189f1e2ed158 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_graphical.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_link_prediction.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_link_prediction.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..5fcecf0b6b6b6d312557ca43f9d3d90019f87051 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_link_prediction.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_max_weight_clique.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_max_weight_clique.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..3b5145d39e0e1484c4642fea1a94664c1ba883a1 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_max_weight_clique.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_mis.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_mis.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..43c06c6b6d17ee7052f17d3517b133604e52d6d4 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_mis.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_node_classification.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_node_classification.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..351d1b5e19f78ac86f370d4a3a50f25218b473dc Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_node_classification.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_non_randomness.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_non_randomness.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..af17346c55b76e1574482594e2ab671d3b8654b3 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_non_randomness.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planar_drawing.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planar_drawing.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..1b1c6b6064e4f995e4f3fb4cd77b3e1e6f1de4e7 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planar_drawing.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planarity.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planarity.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..978819249f3afb139c29ebc6b70ca3047b849faf Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_planarity.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_reciprocity.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_reciprocity.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..f9e460b0abef40fe3ab91e444e76410690ae449a Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_reciprocity.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_richclub.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_richclub.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..270fc95bf4cd7285226ebd77f10f0ac9e1df2895 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_richclub.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_similarity.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_similarity.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..c7d9c77f37c8c8f3a305c42eeff011f9d86b8384 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_similarity.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_simple_paths.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_simple_paths.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..f9cc11fb9ee76ba62ccf247bd3e4458357a9a738 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_simple_paths.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_smallworld.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_smallworld.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..885621e1e6189d430b950ec38eefee21cd28b6ee Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_smallworld.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_structuralholes.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_structuralholes.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..78795d665dee9ad1c5fa5869728e5879df57da1c Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_structuralholes.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_summarization.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_summarization.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..b402735e53043c4aef9a64ef2dd00a11279ab221 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_summarization.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_time_dependent.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_time_dependent.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..79e4f5942e085e830afdeeb604c81cb2adc404c2 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_time_dependent.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_triads.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_triads.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..df3143bbb054be33ff1948f66b71f16fd2ca7b8a Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_triads.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_vitality.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_vitality.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..9d5eebe1c73b478a7ebe9d59b2b3d24998a70c09 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_vitality.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_walks.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_walks.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..991ef4162794e1a156c19f343ea2662f0955233e Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_walks.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_wiener.cpython-310.pyc b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_wiener.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..a175031a99631db962c7af7a92d013a04388ed40 Binary files /dev/null and b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/__pycache__/test_wiener.cpython-310.pyc differ diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_boundary.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_boundary.py new file mode 100644 index 0000000000000000000000000000000000000000..856be465556941fe6f2bfc2c8bab6d4b508cf999 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_boundary.py @@ -0,0 +1,154 @@ +"""Unit tests for the :mod:`networkx.algorithms.boundary` module.""" + +from itertools import combinations + +import pytest + +import networkx as nx +from networkx import convert_node_labels_to_integers as cnlti +from networkx.utils import edges_equal + + +class TestNodeBoundary: + """Unit tests for the :func:`~networkx.node_boundary` function.""" + + def test_null_graph(self): + """Tests that the null graph has empty node boundaries.""" + null = nx.null_graph() + assert nx.node_boundary(null, []) == set() + assert nx.node_boundary(null, [], []) == set() + assert nx.node_boundary(null, [1, 2, 3]) == set() + assert nx.node_boundary(null, [1, 2, 3], [4, 5, 6]) == set() + assert nx.node_boundary(null, [1, 2, 3], [3, 4, 5]) == set() + + def test_path_graph(self): + P10 = cnlti(nx.path_graph(10), first_label=1) + assert nx.node_boundary(P10, []) == set() + assert nx.node_boundary(P10, [], []) == set() + assert nx.node_boundary(P10, [1, 2, 3]) == {4} + assert nx.node_boundary(P10, [4, 5, 6]) == {3, 7} + assert nx.node_boundary(P10, [3, 4, 5, 6, 7]) == {2, 8} + assert nx.node_boundary(P10, [8, 9, 10]) == {7} + assert nx.node_boundary(P10, [4, 5, 6], [9, 10]) == set() + + def test_complete_graph(self): + K10 = cnlti(nx.complete_graph(10), first_label=1) + assert nx.node_boundary(K10, []) == set() + assert nx.node_boundary(K10, [], []) == set() + assert nx.node_boundary(K10, [1, 2, 3]) == {4, 5, 6, 7, 8, 9, 10} + assert nx.node_boundary(K10, [4, 5, 6]) == {1, 2, 3, 7, 8, 9, 10} + assert nx.node_boundary(K10, [3, 4, 5, 6, 7]) == {1, 2, 8, 9, 10} + assert nx.node_boundary(K10, [4, 5, 6], []) == set() + assert nx.node_boundary(K10, K10) == set() + assert nx.node_boundary(K10, [1, 2, 3], [3, 4, 5]) == {4, 5} + + def test_petersen(self): + """Check boundaries in the petersen graph + + cheeger(G,k)=min(|bdy(S)|/|S| for |S|=k, 0 B <- C + # B -> D -> E; + # B -> F; + # G -> E; + assert not nx.is_d_separator(large_collider_graph, {"B"}, {"E"}, set()) + + # minimal set of the corresponding graph + # for B and E should be (D,) + Zmin = nx.find_minimal_d_separator(large_collider_graph, "B", "E") + # check that the minimal d-separator is a d-separating set + assert nx.is_d_separator(large_collider_graph, "B", "E", Zmin) + # the minimal separating set should also pass the test for minimality + assert nx.is_minimal_d_separator(large_collider_graph, "B", "E", Zmin) + # function should also work with set arguments + assert nx.is_minimal_d_separator(large_collider_graph, {"A", "B"}, {"G", "E"}, Zmin) + assert Zmin == {"D"} + + # Case 2: + # create a graph A -> B -> C + # B -> D -> C; + assert not nx.is_d_separator(chain_and_fork_graph, {"A"}, {"C"}, set()) + Zmin = nx.find_minimal_d_separator(chain_and_fork_graph, "A", "C") + + # the minimal separating set should pass the test for minimality + assert nx.is_minimal_d_separator(chain_and_fork_graph, "A", "C", Zmin) + assert Zmin == {"B"} + Znotmin = Zmin.union({"D"}) + assert not nx.is_minimal_d_separator(chain_and_fork_graph, "A", "C", Znotmin) + + # Case 3: + # create a graph A -> B + + # there is no m-separating set between A and B at all, so + # no minimal m-separating set can exist + assert not nx.is_d_separator(no_separating_set_graph, {"A"}, {"B"}, set()) + assert nx.find_minimal_d_separator(no_separating_set_graph, "A", "B") is None + + # Case 4: + # create a graph A -> B with A <- C -> B + + # there is no m-separating set between A and B at all, so + # no minimal m-separating set can exist + # however, the algorithm will initially propose C as a + # minimal (but invalid) separating set + assert not nx.is_d_separator(large_no_separating_set_graph, {"A"}, {"B"}, {"C"}) + assert nx.find_minimal_d_separator(large_no_separating_set_graph, "A", "B") is None + + # Test `included` and `excluded` args + # create graph A -> B <- C -> D + assert nx.find_minimal_d_separator(collider_trek_graph, "A", "D", included="B") == { + "B", + "C", + } + assert ( + nx.find_minimal_d_separator( + collider_trek_graph, "A", "D", included="B", restricted="B" + ) + is None + ) + + +def test_is_minimal_d_separator_checks_dsep(): + """Test that is_minimal_d_separator checks for d-separation as well.""" + g = nx.DiGraph() + g.add_edges_from( + [ + ("A", "B"), + ("A", "E"), + ("B", "C"), + ("B", "D"), + ("D", "C"), + ("D", "F"), + ("E", "D"), + ("E", "F"), + ] + ) + + assert not nx.is_d_separator(g, {"C"}, {"F"}, {"D"}) + + # since {'D'} and {} are not d-separators, we return false + assert not nx.is_minimal_d_separator(g, "C", "F", {"D"}) + assert not nx.is_minimal_d_separator(g, "C", "F", set()) + + +def test__reachable(large_collider_graph): + reachable = nx.algorithms.d_separation._reachable + g = large_collider_graph + x = {"F", "D"} + ancestors = {"A", "B", "C", "D", "F"} + assert reachable(g, x, ancestors, {"B"}) == {"B", "F", "D"} + assert reachable(g, x, ancestors, set()) == ancestors + + +def test_deprecations(): + G = nx.DiGraph([(0, 1), (1, 2)]) + with pytest.deprecated_call(): + nx.d_separated(G, 0, 2, {1}) + with pytest.deprecated_call(): + z = nx.minimal_d_separator(G, 0, 2) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_distance_measures.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_distance_measures.py new file mode 100644 index 0000000000000000000000000000000000000000..0b3840fd23e0bca32d708a276d4b3e328b9dc82d --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_distance_measures.py @@ -0,0 +1,774 @@ +import math +from random import Random + +import pytest + +import networkx as nx +from networkx import convert_node_labels_to_integers as cnlti +from networkx.algorithms.distance_measures import _extrema_bounding + + +def test__extrema_bounding_invalid_compute_kwarg(): + G = nx.path_graph(3) + with pytest.raises(ValueError, match="compute must be one of"): + _extrema_bounding(G, compute="spam") + + +class TestDistance: + def setup_method(self): + G = cnlti(nx.grid_2d_graph(4, 4), first_label=1, ordering="sorted") + self.G = G + + def test_eccentricity(self): + assert nx.eccentricity(self.G, 1) == 6 + e = nx.eccentricity(self.G) + assert e[1] == 6 + + sp = dict(nx.shortest_path_length(self.G)) + e = nx.eccentricity(self.G, sp=sp) + assert e[1] == 6 + + e = nx.eccentricity(self.G, v=1) + assert e == 6 + + # This behavior changed in version 1.8 (ticket #739) + e = nx.eccentricity(self.G, v=[1, 1]) + assert e[1] == 6 + e = nx.eccentricity(self.G, v=[1, 2]) + assert e[1] == 6 + + # test against graph with one node + G = nx.path_graph(1) + e = nx.eccentricity(G) + assert e[0] == 0 + e = nx.eccentricity(G, v=0) + assert e == 0 + pytest.raises(nx.NetworkXError, nx.eccentricity, G, 1) + + # test against empty graph + G = nx.empty_graph() + e = nx.eccentricity(G) + assert e == {} + + def test_diameter(self): + assert nx.diameter(self.G) == 6 + + def test_harmonic_diameter(self): + assert abs(nx.harmonic_diameter(self.G) - 2.0477815699658715) < 1e-12 + + def test_harmonic_diameter_empty(self): + assert math.isnan(nx.harmonic_diameter(nx.empty_graph())) + + def test_harmonic_diameter_single_node(self): + assert math.isnan(nx.harmonic_diameter(nx.empty_graph(1))) + + def test_harmonic_diameter_discrete(self): + assert math.isinf(nx.harmonic_diameter(nx.empty_graph(3))) + + def test_harmonic_diameter_not_strongly_connected(self): + DG = nx.DiGraph() + DG.add_edge(0, 1) + assert nx.harmonic_diameter(DG) == 2 + + def test_radius(self): + assert nx.radius(self.G) == 4 + + def test_periphery(self): + assert set(nx.periphery(self.G)) == {1, 4, 13, 16} + + def test_center(self): + assert set(nx.center(self.G)) == {6, 7, 10, 11} + + def test_bound_diameter(self): + assert nx.diameter(self.G, usebounds=True) == 6 + + def test_bound_radius(self): + assert nx.radius(self.G, usebounds=True) == 4 + + def test_bound_periphery(self): + result = {1, 4, 13, 16} + assert set(nx.periphery(self.G, usebounds=True)) == result + + def test_bound_center(self): + result = {6, 7, 10, 11} + assert set(nx.center(self.G, usebounds=True)) == result + + def test_radius_exception(self): + G = nx.Graph() + G.add_edge(1, 2) + G.add_edge(3, 4) + pytest.raises(nx.NetworkXError, nx.diameter, G) + + def test_eccentricity_infinite(self): + with pytest.raises(nx.NetworkXError): + G = nx.Graph([(1, 2), (3, 4)]) + e = nx.eccentricity(G) + + def test_eccentricity_undirected_not_connected(self): + with pytest.raises(nx.NetworkXError): + G = nx.Graph([(1, 2), (3, 4)]) + e = nx.eccentricity(G, sp=1) + + def test_eccentricity_directed_weakly_connected(self): + with pytest.raises(nx.NetworkXError): + DG = nx.DiGraph([(1, 2), (1, 3)]) + nx.eccentricity(DG) + + +class TestWeightedDistance: + def setup_method(self): + G = nx.Graph() + G.add_edge(0, 1, weight=0.6, cost=0.6, high_cost=6) + G.add_edge(0, 2, weight=0.2, cost=0.2, high_cost=2) + G.add_edge(2, 3, weight=0.1, cost=0.1, high_cost=1) + G.add_edge(2, 4, weight=0.7, cost=0.7, high_cost=7) + G.add_edge(2, 5, weight=0.9, cost=0.9, high_cost=9) + G.add_edge(1, 5, weight=0.3, cost=0.3, high_cost=3) + self.G = G + self.weight_fn = lambda v, u, e: 2 + + def test_eccentricity_weight_None(self): + assert nx.eccentricity(self.G, 1, weight=None) == 3 + e = nx.eccentricity(self.G, weight=None) + assert e[1] == 3 + + e = nx.eccentricity(self.G, v=1, weight=None) + assert e == 3 + + # This behavior changed in version 1.8 (ticket #739) + e = nx.eccentricity(self.G, v=[1, 1], weight=None) + assert e[1] == 3 + e = nx.eccentricity(self.G, v=[1, 2], weight=None) + assert e[1] == 3 + + def test_eccentricity_weight_attr(self): + assert nx.eccentricity(self.G, 1, weight="weight") == 1.5 + e = nx.eccentricity(self.G, weight="weight") + assert ( + e + == nx.eccentricity(self.G, weight="cost") + != nx.eccentricity(self.G, weight="high_cost") + ) + assert e[1] == 1.5 + + e = nx.eccentricity(self.G, v=1, weight="weight") + assert e == 1.5 + + # This behavior changed in version 1.8 (ticket #739) + e = nx.eccentricity(self.G, v=[1, 1], weight="weight") + assert e[1] == 1.5 + e = nx.eccentricity(self.G, v=[1, 2], weight="weight") + assert e[1] == 1.5 + + def test_eccentricity_weight_fn(self): + assert nx.eccentricity(self.G, 1, weight=self.weight_fn) == 6 + e = nx.eccentricity(self.G, weight=self.weight_fn) + assert e[1] == 6 + + e = nx.eccentricity(self.G, v=1, weight=self.weight_fn) + assert e == 6 + + # This behavior changed in version 1.8 (ticket #739) + e = nx.eccentricity(self.G, v=[1, 1], weight=self.weight_fn) + assert e[1] == 6 + e = nx.eccentricity(self.G, v=[1, 2], weight=self.weight_fn) + assert e[1] == 6 + + def test_diameter_weight_None(self): + assert nx.diameter(self.G, weight=None) == 3 + + def test_diameter_weight_attr(self): + assert ( + nx.diameter(self.G, weight="weight") + == nx.diameter(self.G, weight="cost") + == 1.6 + != nx.diameter(self.G, weight="high_cost") + ) + + def test_diameter_weight_fn(self): + assert nx.diameter(self.G, weight=self.weight_fn) == 6 + + def test_radius_weight_None(self): + assert pytest.approx(nx.radius(self.G, weight=None)) == 2 + + def test_radius_weight_attr(self): + assert ( + pytest.approx(nx.radius(self.G, weight="weight")) + == pytest.approx(nx.radius(self.G, weight="cost")) + == 0.9 + != nx.radius(self.G, weight="high_cost") + ) + + def test_radius_weight_fn(self): + assert nx.radius(self.G, weight=self.weight_fn) == 4 + + def test_periphery_weight_None(self): + for v in set(nx.periphery(self.G, weight=None)): + assert nx.eccentricity(self.G, v, weight=None) == nx.diameter( + self.G, weight=None + ) + + def test_periphery_weight_attr(self): + periphery = set(nx.periphery(self.G, weight="weight")) + assert ( + periphery + == set(nx.periphery(self.G, weight="cost")) + == set(nx.periphery(self.G, weight="high_cost")) + ) + for v in periphery: + assert ( + nx.eccentricity(self.G, v, weight="high_cost") + != nx.eccentricity(self.G, v, weight="weight") + == nx.eccentricity(self.G, v, weight="cost") + == nx.diameter(self.G, weight="weight") + == nx.diameter(self.G, weight="cost") + != nx.diameter(self.G, weight="high_cost") + ) + assert nx.eccentricity(self.G, v, weight="high_cost") == nx.diameter( + self.G, weight="high_cost" + ) + + def test_periphery_weight_fn(self): + for v in set(nx.periphery(self.G, weight=self.weight_fn)): + assert nx.eccentricity(self.G, v, weight=self.weight_fn) == nx.diameter( + self.G, weight=self.weight_fn + ) + + def test_center_weight_None(self): + for v in set(nx.center(self.G, weight=None)): + assert pytest.approx(nx.eccentricity(self.G, v, weight=None)) == nx.radius( + self.G, weight=None + ) + + def test_center_weight_attr(self): + center = set(nx.center(self.G, weight="weight")) + assert ( + center + == set(nx.center(self.G, weight="cost")) + != set(nx.center(self.G, weight="high_cost")) + ) + for v in center: + assert ( + nx.eccentricity(self.G, v, weight="high_cost") + != pytest.approx(nx.eccentricity(self.G, v, weight="weight")) + == pytest.approx(nx.eccentricity(self.G, v, weight="cost")) + == nx.radius(self.G, weight="weight") + == nx.radius(self.G, weight="cost") + != nx.radius(self.G, weight="high_cost") + ) + assert nx.eccentricity(self.G, v, weight="high_cost") == nx.radius( + self.G, weight="high_cost" + ) + + def test_center_weight_fn(self): + for v in set(nx.center(self.G, weight=self.weight_fn)): + assert nx.eccentricity(self.G, v, weight=self.weight_fn) == nx.radius( + self.G, weight=self.weight_fn + ) + + def test_bound_diameter_weight_None(self): + assert nx.diameter(self.G, usebounds=True, weight=None) == 3 + + def test_bound_diameter_weight_attr(self): + assert ( + nx.diameter(self.G, usebounds=True, weight="high_cost") + != nx.diameter(self.G, usebounds=True, weight="weight") + == nx.diameter(self.G, usebounds=True, weight="cost") + == 1.6 + != nx.diameter(self.G, usebounds=True, weight="high_cost") + ) + assert nx.diameter(self.G, usebounds=True, weight="high_cost") == nx.diameter( + self.G, usebounds=True, weight="high_cost" + ) + + def test_bound_diameter_weight_fn(self): + assert nx.diameter(self.G, usebounds=True, weight=self.weight_fn) == 6 + + def test_bound_radius_weight_None(self): + assert pytest.approx(nx.radius(self.G, usebounds=True, weight=None)) == 2 + + def test_bound_radius_weight_attr(self): + assert ( + nx.radius(self.G, usebounds=True, weight="high_cost") + != pytest.approx(nx.radius(self.G, usebounds=True, weight="weight")) + == pytest.approx(nx.radius(self.G, usebounds=True, weight="cost")) + == 0.9 + != nx.radius(self.G, usebounds=True, weight="high_cost") + ) + assert nx.radius(self.G, usebounds=True, weight="high_cost") == nx.radius( + self.G, usebounds=True, weight="high_cost" + ) + + def test_bound_radius_weight_fn(self): + assert nx.radius(self.G, usebounds=True, weight=self.weight_fn) == 4 + + def test_bound_periphery_weight_None(self): + result = {1, 3, 4} + assert set(nx.periphery(self.G, usebounds=True, weight=None)) == result + + def test_bound_periphery_weight_attr(self): + result = {4, 5} + assert ( + set(nx.periphery(self.G, usebounds=True, weight="weight")) + == set(nx.periphery(self.G, usebounds=True, weight="cost")) + == result + ) + + def test_bound_periphery_weight_fn(self): + result = {1, 3, 4} + assert ( + set(nx.periphery(self.G, usebounds=True, weight=self.weight_fn)) == result + ) + + def test_bound_center_weight_None(self): + result = {0, 2, 5} + assert set(nx.center(self.G, usebounds=True, weight=None)) == result + + def test_bound_center_weight_attr(self): + result = {0} + assert ( + set(nx.center(self.G, usebounds=True, weight="weight")) + == set(nx.center(self.G, usebounds=True, weight="cost")) + == result + ) + + def test_bound_center_weight_fn(self): + result = {0, 2, 5} + assert set(nx.center(self.G, usebounds=True, weight=self.weight_fn)) == result + + +class TestResistanceDistance: + @classmethod + def setup_class(cls): + global np + np = pytest.importorskip("numpy") + sp = pytest.importorskip("scipy") + + def setup_method(self): + G = nx.Graph() + G.add_edge(1, 2, weight=2) + G.add_edge(2, 3, weight=4) + G.add_edge(3, 4, weight=1) + G.add_edge(1, 4, weight=3) + self.G = G + + def test_resistance_distance_directed_graph(self): + G = nx.DiGraph() + with pytest.raises(nx.NetworkXNotImplemented): + nx.resistance_distance(G) + + def test_resistance_distance_empty(self): + G = nx.Graph() + with pytest.raises(nx.NetworkXError): + nx.resistance_distance(G) + + def test_resistance_distance_not_connected(self): + with pytest.raises(nx.NetworkXError): + self.G.add_node(5) + nx.resistance_distance(self.G, 1, 5) + + def test_resistance_distance_nodeA_not_in_graph(self): + with pytest.raises(nx.NetworkXError): + nx.resistance_distance(self.G, 9, 1) + + def test_resistance_distance_nodeB_not_in_graph(self): + with pytest.raises(nx.NetworkXError): + nx.resistance_distance(self.G, 1, 9) + + def test_resistance_distance(self): + rd = nx.resistance_distance(self.G, 1, 3, "weight", True) + test_data = 1 / (1 / (2 + 4) + 1 / (1 + 3)) + assert round(rd, 5) == round(test_data, 5) + + def test_resistance_distance_noinv(self): + rd = nx.resistance_distance(self.G, 1, 3, "weight", False) + test_data = 1 / (1 / (1 / 2 + 1 / 4) + 1 / (1 / 1 + 1 / 3)) + assert round(rd, 5) == round(test_data, 5) + + def test_resistance_distance_no_weight(self): + rd = nx.resistance_distance(self.G, 1, 3) + assert round(rd, 5) == 1 + + def test_resistance_distance_neg_weight(self): + self.G[2][3]["weight"] = -4 + rd = nx.resistance_distance(self.G, 1, 3, "weight", True) + test_data = 1 / (1 / (2 + -4) + 1 / (1 + 3)) + assert round(rd, 5) == round(test_data, 5) + + def test_multigraph(self): + G = nx.MultiGraph() + G.add_edge(1, 2, weight=2) + G.add_edge(2, 3, weight=4) + G.add_edge(3, 4, weight=1) + G.add_edge(1, 4, weight=3) + rd = nx.resistance_distance(G, 1, 3, "weight", True) + assert np.isclose(rd, 1 / (1 / (2 + 4) + 1 / (1 + 3))) + + def test_resistance_distance_div0(self): + with pytest.raises(ZeroDivisionError): + self.G[1][2]["weight"] = 0 + nx.resistance_distance(self.G, 1, 3, "weight") + + def test_resistance_distance_same_node(self): + assert nx.resistance_distance(self.G, 1, 1) == 0 + + def test_resistance_distance_only_nodeA(self): + rd = nx.resistance_distance(self.G, nodeA=1) + test_data = {} + test_data[1] = 0 + test_data[2] = 0.75 + test_data[3] = 1 + test_data[4] = 0.75 + assert type(rd) == dict + assert sorted(rd.keys()) == sorted(test_data.keys()) + for key in rd: + assert np.isclose(rd[key], test_data[key]) + + def test_resistance_distance_only_nodeB(self): + rd = nx.resistance_distance(self.G, nodeB=1) + test_data = {} + test_data[1] = 0 + test_data[2] = 0.75 + test_data[3] = 1 + test_data[4] = 0.75 + assert type(rd) == dict + assert sorted(rd.keys()) == sorted(test_data.keys()) + for key in rd: + assert np.isclose(rd[key], test_data[key]) + + def test_resistance_distance_all(self): + rd = nx.resistance_distance(self.G) + assert type(rd) == dict + assert round(rd[1][3], 5) == 1 + + +class TestEffectiveGraphResistance: + @classmethod + def setup_class(cls): + global np + np = pytest.importorskip("numpy") + sp = pytest.importorskip("scipy") + + def setup_method(self): + G = nx.Graph() + G.add_edge(1, 2, weight=2) + G.add_edge(1, 3, weight=1) + G.add_edge(2, 3, weight=4) + self.G = G + + def test_effective_graph_resistance_directed_graph(self): + G = nx.DiGraph() + with pytest.raises(nx.NetworkXNotImplemented): + nx.effective_graph_resistance(G) + + def test_effective_graph_resistance_empty(self): + G = nx.Graph() + with pytest.raises(nx.NetworkXError): + nx.effective_graph_resistance(G) + + def test_effective_graph_resistance_not_connected(self): + G = nx.Graph([(1, 2), (3, 4)]) + RG = nx.effective_graph_resistance(G) + assert np.isinf(RG) + + def test_effective_graph_resistance(self): + RG = nx.effective_graph_resistance(self.G, "weight", True) + rd12 = 1 / (1 / (1 + 4) + 1 / 2) + rd13 = 1 / (1 / (1 + 2) + 1 / 4) + rd23 = 1 / (1 / (2 + 4) + 1 / 1) + assert np.isclose(RG, rd12 + rd13 + rd23) + + def test_effective_graph_resistance_noinv(self): + RG = nx.effective_graph_resistance(self.G, "weight", False) + rd12 = 1 / (1 / (1 / 1 + 1 / 4) + 1 / (1 / 2)) + rd13 = 1 / (1 / (1 / 1 + 1 / 2) + 1 / (1 / 4)) + rd23 = 1 / (1 / (1 / 2 + 1 / 4) + 1 / (1 / 1)) + assert np.isclose(RG, rd12 + rd13 + rd23) + + def test_effective_graph_resistance_no_weight(self): + RG = nx.effective_graph_resistance(self.G) + assert np.isclose(RG, 2) + + def test_effective_graph_resistance_neg_weight(self): + self.G[2][3]["weight"] = -4 + RG = nx.effective_graph_resistance(self.G, "weight", True) + rd12 = 1 / (1 / (1 + -4) + 1 / 2) + rd13 = 1 / (1 / (1 + 2) + 1 / (-4)) + rd23 = 1 / (1 / (2 + -4) + 1 / 1) + assert np.isclose(RG, rd12 + rd13 + rd23) + + def test_effective_graph_resistance_multigraph(self): + G = nx.MultiGraph() + G.add_edge(1, 2, weight=2) + G.add_edge(1, 3, weight=1) + G.add_edge(2, 3, weight=1) + G.add_edge(2, 3, weight=3) + RG = nx.effective_graph_resistance(G, "weight", True) + edge23 = 1 / (1 / 1 + 1 / 3) + rd12 = 1 / (1 / (1 + edge23) + 1 / 2) + rd13 = 1 / (1 / (1 + 2) + 1 / edge23) + rd23 = 1 / (1 / (2 + edge23) + 1 / 1) + assert np.isclose(RG, rd12 + rd13 + rd23) + + def test_effective_graph_resistance_div0(self): + with pytest.raises(ZeroDivisionError): + self.G[1][2]["weight"] = 0 + nx.effective_graph_resistance(self.G, "weight") + + def test_effective_graph_resistance_complete_graph(self): + N = 10 + G = nx.complete_graph(N) + RG = nx.effective_graph_resistance(G) + assert np.isclose(RG, N - 1) + + def test_effective_graph_resistance_path_graph(self): + N = 10 + G = nx.path_graph(N) + RG = nx.effective_graph_resistance(G) + assert np.isclose(RG, (N - 1) * N * (N + 1) // 6) + + +class TestBarycenter: + """Test :func:`networkx.algorithms.distance_measures.barycenter`.""" + + def barycenter_as_subgraph(self, g, **kwargs): + """Return the subgraph induced on the barycenter of g""" + b = nx.barycenter(g, **kwargs) + assert isinstance(b, list) + assert set(b) <= set(g) + return g.subgraph(b) + + def test_must_be_connected(self): + pytest.raises(nx.NetworkXNoPath, nx.barycenter, nx.empty_graph(5)) + + def test_sp_kwarg(self): + # Complete graph K_5. Normally it works... + K_5 = nx.complete_graph(5) + sp = dict(nx.shortest_path_length(K_5)) + assert nx.barycenter(K_5, sp=sp) == list(K_5) + + # ...but not with the weight argument + for u, v, data in K_5.edges.data(): + data["weight"] = 1 + pytest.raises(ValueError, nx.barycenter, K_5, sp=sp, weight="weight") + + # ...and a corrupted sp can make it seem like K_5 is disconnected + del sp[0][1] + pytest.raises(nx.NetworkXNoPath, nx.barycenter, K_5, sp=sp) + + def test_trees(self): + """The barycenter of a tree is a single vertex or an edge. + + See [West01]_, p. 78. + """ + prng = Random(0xDEADBEEF) + for i in range(50): + RT = nx.random_labeled_tree(prng.randint(1, 75), seed=prng) + b = self.barycenter_as_subgraph(RT) + if len(b) == 2: + assert b.size() == 1 + else: + assert len(b) == 1 + assert b.size() == 0 + + def test_this_one_specific_tree(self): + """Test the tree pictured at the bottom of [West01]_, p. 78.""" + g = nx.Graph( + { + "a": ["b"], + "b": ["a", "x"], + "x": ["b", "y"], + "y": ["x", "z"], + "z": ["y", 0, 1, 2, 3, 4], + 0: ["z"], + 1: ["z"], + 2: ["z"], + 3: ["z"], + 4: ["z"], + } + ) + b = self.barycenter_as_subgraph(g, attr="barycentricity") + assert list(b) == ["z"] + assert not b.edges + expected_barycentricity = { + 0: 23, + 1: 23, + 2: 23, + 3: 23, + 4: 23, + "a": 35, + "b": 27, + "x": 21, + "y": 17, + "z": 15, + } + for node, barycentricity in expected_barycentricity.items(): + assert g.nodes[node]["barycentricity"] == barycentricity + + # Doubling weights should do nothing but double the barycentricities + for edge in g.edges: + g.edges[edge]["weight"] = 2 + b = self.barycenter_as_subgraph(g, weight="weight", attr="barycentricity2") + assert list(b) == ["z"] + assert not b.edges + for node, barycentricity in expected_barycentricity.items(): + assert g.nodes[node]["barycentricity2"] == barycentricity * 2 + + +class TestKemenyConstant: + @classmethod + def setup_class(cls): + global np + np = pytest.importorskip("numpy") + sp = pytest.importorskip("scipy") + + def setup_method(self): + G = nx.Graph() + w12 = 2 + w13 = 3 + w23 = 4 + G.add_edge(1, 2, weight=w12) + G.add_edge(1, 3, weight=w13) + G.add_edge(2, 3, weight=w23) + self.G = G + + def test_kemeny_constant_directed(self): + G = nx.DiGraph() + G.add_edge(1, 2) + G.add_edge(1, 3) + G.add_edge(2, 3) + with pytest.raises(nx.NetworkXNotImplemented): + nx.kemeny_constant(G) + + def test_kemeny_constant_not_connected(self): + self.G.add_node(5) + with pytest.raises(nx.NetworkXError): + nx.kemeny_constant(self.G) + + def test_kemeny_constant_no_nodes(self): + G = nx.Graph() + with pytest.raises(nx.NetworkXError): + nx.kemeny_constant(G) + + def test_kemeny_constant_negative_weight(self): + G = nx.Graph() + w12 = 2 + w13 = 3 + w23 = -10 + G.add_edge(1, 2, weight=w12) + G.add_edge(1, 3, weight=w13) + G.add_edge(2, 3, weight=w23) + with pytest.raises(nx.NetworkXError): + nx.kemeny_constant(G, weight="weight") + + def test_kemeny_constant(self): + K = nx.kemeny_constant(self.G, weight="weight") + w12 = 2 + w13 = 3 + w23 = 4 + test_data = ( + 3 + / 2 + * (w12 + w13) + * (w12 + w23) + * (w13 + w23) + / ( + w12**2 * (w13 + w23) + + w13**2 * (w12 + w23) + + w23**2 * (w12 + w13) + + 3 * w12 * w13 * w23 + ) + ) + assert np.isclose(K, test_data) + + def test_kemeny_constant_no_weight(self): + K = nx.kemeny_constant(self.G) + assert np.isclose(K, 4 / 3) + + def test_kemeny_constant_multigraph(self): + G = nx.MultiGraph() + w12_1 = 2 + w12_2 = 1 + w13 = 3 + w23 = 4 + G.add_edge(1, 2, weight=w12_1) + G.add_edge(1, 2, weight=w12_2) + G.add_edge(1, 3, weight=w13) + G.add_edge(2, 3, weight=w23) + K = nx.kemeny_constant(G, weight="weight") + w12 = w12_1 + w12_2 + test_data = ( + 3 + / 2 + * (w12 + w13) + * (w12 + w23) + * (w13 + w23) + / ( + w12**2 * (w13 + w23) + + w13**2 * (w12 + w23) + + w23**2 * (w12 + w13) + + 3 * w12 * w13 * w23 + ) + ) + assert np.isclose(K, test_data) + + def test_kemeny_constant_weight0(self): + G = nx.Graph() + w12 = 0 + w13 = 3 + w23 = 4 + G.add_edge(1, 2, weight=w12) + G.add_edge(1, 3, weight=w13) + G.add_edge(2, 3, weight=w23) + K = nx.kemeny_constant(G, weight="weight") + test_data = ( + 3 + / 2 + * (w12 + w13) + * (w12 + w23) + * (w13 + w23) + / ( + w12**2 * (w13 + w23) + + w13**2 * (w12 + w23) + + w23**2 * (w12 + w13) + + 3 * w12 * w13 * w23 + ) + ) + assert np.isclose(K, test_data) + + def test_kemeny_constant_selfloop(self): + G = nx.Graph() + w11 = 1 + w12 = 2 + w13 = 3 + w23 = 4 + G.add_edge(1, 1, weight=w11) + G.add_edge(1, 2, weight=w12) + G.add_edge(1, 3, weight=w13) + G.add_edge(2, 3, weight=w23) + K = nx.kemeny_constant(G, weight="weight") + test_data = ( + (2 * w11 + 3 * w12 + 3 * w13) + * (w12 + w23) + * (w13 + w23) + / ( + (w12 * w13 + w12 * w23 + w13 * w23) + * (w11 + 2 * w12 + 2 * w13 + 2 * w23) + ) + ) + assert np.isclose(K, test_data) + + def test_kemeny_constant_complete_bipartite_graph(self): + # Theorem 1 in https://www.sciencedirect.com/science/article/pii/S0166218X20302912 + n1 = 5 + n2 = 4 + G = nx.complete_bipartite_graph(n1, n2) + K = nx.kemeny_constant(G) + assert np.isclose(K, n1 + n2 - 3 / 2) + + def test_kemeny_constant_path_graph(self): + # Theorem 2 in https://www.sciencedirect.com/science/article/pii/S0166218X20302912 + n = 10 + G = nx.path_graph(n) + K = nx.kemeny_constant(G) + assert np.isclose(K, n**2 / 3 - 2 * n / 3 + 1 / 2) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominance.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominance.py new file mode 100644 index 0000000000000000000000000000000000000000..9b804c2f6eaafd3fb9a3dba556d43729ea0db70a --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominance.py @@ -0,0 +1,286 @@ +import pytest + +import networkx as nx + + +class TestImmediateDominators: + def test_exceptions(self): + G = nx.Graph() + G.add_node(0) + pytest.raises(nx.NetworkXNotImplemented, nx.immediate_dominators, G, 0) + G = nx.MultiGraph(G) + pytest.raises(nx.NetworkXNotImplemented, nx.immediate_dominators, G, 0) + G = nx.DiGraph([[0, 0]]) + pytest.raises(nx.NetworkXError, nx.immediate_dominators, G, 1) + + def test_singleton(self): + G = nx.DiGraph() + G.add_node(0) + assert nx.immediate_dominators(G, 0) == {0: 0} + G.add_edge(0, 0) + assert nx.immediate_dominators(G, 0) == {0: 0} + + def test_path(self): + n = 5 + G = nx.path_graph(n, create_using=nx.DiGraph()) + assert nx.immediate_dominators(G, 0) == {i: max(i - 1, 0) for i in range(n)} + + def test_cycle(self): + n = 5 + G = nx.cycle_graph(n, create_using=nx.DiGraph()) + assert nx.immediate_dominators(G, 0) == {i: max(i - 1, 0) for i in range(n)} + + def test_unreachable(self): + n = 5 + assert n > 1 + G = nx.path_graph(n, create_using=nx.DiGraph()) + assert nx.immediate_dominators(G, n // 2) == { + i: max(i - 1, n // 2) for i in range(n // 2, n) + } + + def test_irreducible1(self): + """ + Graph taken from figure 2 of "A simple, fast dominance algorithm." (2006). + https://hdl.handle.net/1911/96345 + """ + edges = [(1, 2), (2, 1), (3, 2), (4, 1), (5, 3), (5, 4)] + G = nx.DiGraph(edges) + assert nx.immediate_dominators(G, 5) == {i: 5 for i in range(1, 6)} + + def test_irreducible2(self): + """ + Graph taken from figure 4 of "A simple, fast dominance algorithm." (2006). + https://hdl.handle.net/1911/96345 + """ + + edges = [(1, 2), (2, 1), (2, 3), (3, 2), (4, 2), (4, 3), (5, 1), (6, 4), (6, 5)] + G = nx.DiGraph(edges) + result = nx.immediate_dominators(G, 6) + assert result == {i: 6 for i in range(1, 7)} + + def test_domrel_png(self): + # Graph taken from https://commons.wikipedia.org/wiki/File:Domrel.png + edges = [(1, 2), (2, 3), (2, 4), (2, 6), (3, 5), (4, 5), (5, 2)] + G = nx.DiGraph(edges) + result = nx.immediate_dominators(G, 1) + assert result == {1: 1, 2: 1, 3: 2, 4: 2, 5: 2, 6: 2} + # Test postdominance. + result = nx.immediate_dominators(G.reverse(copy=False), 6) + assert result == {1: 2, 2: 6, 3: 5, 4: 5, 5: 2, 6: 6} + + def test_boost_example(self): + # Graph taken from Figure 1 of + # http://www.boost.org/doc/libs/1_56_0/libs/graph/doc/lengauer_tarjan_dominator.htm + edges = [(0, 1), (1, 2), (1, 3), (2, 7), (3, 4), (4, 5), (4, 6), (5, 7), (6, 4)] + G = nx.DiGraph(edges) + result = nx.immediate_dominators(G, 0) + assert result == {0: 0, 1: 0, 2: 1, 3: 1, 4: 3, 5: 4, 6: 4, 7: 1} + # Test postdominance. + result = nx.immediate_dominators(G.reverse(copy=False), 7) + assert result == {0: 1, 1: 7, 2: 7, 3: 4, 4: 5, 5: 7, 6: 4, 7: 7} + + +class TestDominanceFrontiers: + def test_exceptions(self): + G = nx.Graph() + G.add_node(0) + pytest.raises(nx.NetworkXNotImplemented, nx.dominance_frontiers, G, 0) + G = nx.MultiGraph(G) + pytest.raises(nx.NetworkXNotImplemented, nx.dominance_frontiers, G, 0) + G = nx.DiGraph([[0, 0]]) + pytest.raises(nx.NetworkXError, nx.dominance_frontiers, G, 1) + + def test_singleton(self): + G = nx.DiGraph() + G.add_node(0) + assert nx.dominance_frontiers(G, 0) == {0: set()} + G.add_edge(0, 0) + assert nx.dominance_frontiers(G, 0) == {0: set()} + + def test_path(self): + n = 5 + G = nx.path_graph(n, create_using=nx.DiGraph()) + assert nx.dominance_frontiers(G, 0) == {i: set() for i in range(n)} + + def test_cycle(self): + n = 5 + G = nx.cycle_graph(n, create_using=nx.DiGraph()) + assert nx.dominance_frontiers(G, 0) == {i: set() for i in range(n)} + + def test_unreachable(self): + n = 5 + assert n > 1 + G = nx.path_graph(n, create_using=nx.DiGraph()) + assert nx.dominance_frontiers(G, n // 2) == {i: set() for i in range(n // 2, n)} + + def test_irreducible1(self): + """ + Graph taken from figure 2 of "A simple, fast dominance algorithm." (2006). + https://hdl.handle.net/1911/96345 + """ + edges = [(1, 2), (2, 1), (3, 2), (4, 1), (5, 3), (5, 4)] + G = nx.DiGraph(edges) + assert dict(nx.dominance_frontiers(G, 5).items()) == { + 1: {2}, + 2: {1}, + 3: {2}, + 4: {1}, + 5: set(), + } + + def test_irreducible2(self): + """ + Graph taken from figure 4 of "A simple, fast dominance algorithm." (2006). + https://hdl.handle.net/1911/96345 + """ + edges = [(1, 2), (2, 1), (2, 3), (3, 2), (4, 2), (4, 3), (5, 1), (6, 4), (6, 5)] + G = nx.DiGraph(edges) + assert nx.dominance_frontiers(G, 6) == { + 1: {2}, + 2: {1, 3}, + 3: {2}, + 4: {2, 3}, + 5: {1}, + 6: set(), + } + + def test_domrel_png(self): + # Graph taken from https://commons.wikipedia.org/wiki/File:Domrel.png + edges = [(1, 2), (2, 3), (2, 4), (2, 6), (3, 5), (4, 5), (5, 2)] + G = nx.DiGraph(edges) + assert nx.dominance_frontiers(G, 1) == { + 1: set(), + 2: {2}, + 3: {5}, + 4: {5}, + 5: {2}, + 6: set(), + } + # Test postdominance. + result = nx.dominance_frontiers(G.reverse(copy=False), 6) + assert result == {1: set(), 2: {2}, 3: {2}, 4: {2}, 5: {2}, 6: set()} + + def test_boost_example(self): + # Graph taken from Figure 1 of + # http://www.boost.org/doc/libs/1_56_0/libs/graph/doc/lengauer_tarjan_dominator.htm + edges = [(0, 1), (1, 2), (1, 3), (2, 7), (3, 4), (4, 5), (4, 6), (5, 7), (6, 4)] + G = nx.DiGraph(edges) + assert nx.dominance_frontiers(G, 0) == { + 0: set(), + 1: set(), + 2: {7}, + 3: {7}, + 4: {4, 7}, + 5: {7}, + 6: {4}, + 7: set(), + } + # Test postdominance. + result = nx.dominance_frontiers(G.reverse(copy=False), 7) + expected = { + 0: set(), + 1: set(), + 2: {1}, + 3: {1}, + 4: {1, 4}, + 5: {1}, + 6: {4}, + 7: set(), + } + assert result == expected + + def test_discard_issue(self): + # https://github.com/networkx/networkx/issues/2071 + g = nx.DiGraph() + g.add_edges_from( + [ + ("b0", "b1"), + ("b1", "b2"), + ("b2", "b3"), + ("b3", "b1"), + ("b1", "b5"), + ("b5", "b6"), + ("b5", "b8"), + ("b6", "b7"), + ("b8", "b7"), + ("b7", "b3"), + ("b3", "b4"), + ] + ) + df = nx.dominance_frontiers(g, "b0") + assert df == { + "b4": set(), + "b5": {"b3"}, + "b6": {"b7"}, + "b7": {"b3"}, + "b0": set(), + "b1": {"b1"}, + "b2": {"b3"}, + "b3": {"b1"}, + "b8": {"b7"}, + } + + def test_loop(self): + g = nx.DiGraph() + g.add_edges_from([("a", "b"), ("b", "c"), ("b", "a")]) + df = nx.dominance_frontiers(g, "a") + assert df == {"a": set(), "b": set(), "c": set()} + + def test_missing_immediate_doms(self): + # see https://github.com/networkx/networkx/issues/2070 + g = nx.DiGraph() + edges = [ + ("entry_1", "b1"), + ("b1", "b2"), + ("b2", "b3"), + ("b3", "exit"), + ("entry_2", "b3"), + ] + + # entry_1 + # | + # b1 + # | + # b2 entry_2 + # | / + # b3 + # | + # exit + + g.add_edges_from(edges) + # formerly raised KeyError on entry_2 when parsing b3 + # because entry_2 does not have immediate doms (no path) + nx.dominance_frontiers(g, "entry_1") + + def test_loops_larger(self): + # from + # http://ecee.colorado.edu/~waite/Darmstadt/motion.html + g = nx.DiGraph() + edges = [ + ("entry", "exit"), + ("entry", "1"), + ("1", "2"), + ("2", "3"), + ("3", "4"), + ("4", "5"), + ("5", "6"), + ("6", "exit"), + ("6", "2"), + ("5", "3"), + ("4", "4"), + ] + + g.add_edges_from(edges) + df = nx.dominance_frontiers(g, "entry") + answer = { + "entry": set(), + "1": {"exit"}, + "2": {"exit", "2"}, + "3": {"exit", "3", "2"}, + "4": {"exit", "4", "3", "2"}, + "5": {"exit", "3", "2"}, + "6": {"exit", "2"}, + "exit": set(), + } + for n in df: + assert set(df[n]) == set(answer[n]) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominating.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominating.py new file mode 100644 index 0000000000000000000000000000000000000000..b945c7386374d7076ee08db67631cc7d845e6762 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_dominating.py @@ -0,0 +1,46 @@ +import pytest + +import networkx as nx + + +def test_dominating_set(): + G = nx.gnp_random_graph(100, 0.1) + D = nx.dominating_set(G) + assert nx.is_dominating_set(G, D) + D = nx.dominating_set(G, start_with=0) + assert nx.is_dominating_set(G, D) + + +def test_complete(): + """In complete graphs each node is a dominating set. + Thus the dominating set has to be of cardinality 1. + """ + K4 = nx.complete_graph(4) + assert len(nx.dominating_set(K4)) == 1 + K5 = nx.complete_graph(5) + assert len(nx.dominating_set(K5)) == 1 + + +def test_raise_dominating_set(): + with pytest.raises(nx.NetworkXError): + G = nx.path_graph(4) + D = nx.dominating_set(G, start_with=10) + + +def test_is_dominating_set(): + G = nx.path_graph(4) + d = {1, 3} + assert nx.is_dominating_set(G, d) + d = {0, 2} + assert nx.is_dominating_set(G, d) + d = {1} + assert not nx.is_dominating_set(G, d) + + +def test_wikipedia_is_dominating_set(): + """Example from https://en.wikipedia.org/wiki/Dominating_set""" + G = nx.cycle_graph(4) + G.add_edges_from([(0, 4), (1, 4), (2, 5)]) + assert nx.is_dominating_set(G, {4, 3, 5}) + assert nx.is_dominating_set(G, {0, 2}) + assert nx.is_dominating_set(G, {1, 2}) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_efficiency.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_efficiency.py new file mode 100644 index 0000000000000000000000000000000000000000..9a2e7d0463b3a0abeb8395df4ab870456faa64b7 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_efficiency.py @@ -0,0 +1,58 @@ +"""Unit tests for the :mod:`networkx.algorithms.efficiency` module.""" + +import networkx as nx + + +class TestEfficiency: + def setup_method(self): + # G1 is a disconnected graph + self.G1 = nx.Graph() + self.G1.add_nodes_from([1, 2, 3]) + # G2 is a cycle graph + self.G2 = nx.cycle_graph(4) + # G3 is the triangle graph with one additional edge + self.G3 = nx.lollipop_graph(3, 1) + + def test_efficiency_disconnected_nodes(self): + """ + When nodes are disconnected, efficiency is 0 + """ + assert nx.efficiency(self.G1, 1, 2) == 0 + + def test_local_efficiency_disconnected_graph(self): + """ + In a disconnected graph the efficiency is 0 + """ + assert nx.local_efficiency(self.G1) == 0 + + def test_efficiency(self): + assert nx.efficiency(self.G2, 0, 1) == 1 + assert nx.efficiency(self.G2, 0, 2) == 1 / 2 + + def test_global_efficiency(self): + assert nx.global_efficiency(self.G2) == 5 / 6 + + def test_global_efficiency_complete_graph(self): + """ + Tests that the average global efficiency of the complete graph is one. + """ + for n in range(2, 10): + G = nx.complete_graph(n) + assert nx.global_efficiency(G) == 1 + + def test_local_efficiency_complete_graph(self): + """ + Test that the local efficiency for a complete graph with at least 3 + nodes should be one. For a graph with only 2 nodes, the induced + subgraph has no edges. + """ + for n in range(3, 10): + G = nx.complete_graph(n) + assert nx.local_efficiency(G) == 1 + + def test_using_ego_graph(self): + """ + Test that the ego graph is used when computing local efficiency. + For more information, see GitHub issue #2710. + """ + assert nx.local_efficiency(self.G3) == 7 / 12 diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graph_hashing.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graph_hashing.py new file mode 100644 index 0000000000000000000000000000000000000000..0828069d1c3c821a0eaeae844fb6182470aadb25 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graph_hashing.py @@ -0,0 +1,686 @@ +import pytest + +import networkx as nx +from networkx.generators import directed + +# Unit tests for the :func:`~networkx.weisfeiler_lehman_graph_hash` function + + +def test_empty_graph_hash(): + """ + empty graphs should give hashes regardless of other params + """ + G1 = nx.empty_graph() + G2 = nx.empty_graph() + + h1 = nx.weisfeiler_lehman_graph_hash(G1) + h2 = nx.weisfeiler_lehman_graph_hash(G2) + h3 = nx.weisfeiler_lehman_graph_hash(G2, edge_attr="edge_attr1") + h4 = nx.weisfeiler_lehman_graph_hash(G2, node_attr="node_attr1") + h5 = nx.weisfeiler_lehman_graph_hash( + G2, edge_attr="edge_attr1", node_attr="node_attr1" + ) + h6 = nx.weisfeiler_lehman_graph_hash(G2, iterations=10) + + assert h1 == h2 + assert h1 == h3 + assert h1 == h4 + assert h1 == h5 + assert h1 == h6 + + +def test_directed(): + """ + A directed graph with no bi-directional edges should yield different a graph hash + to the same graph taken as undirected if there are no hash collisions. + """ + r = 10 + for i in range(r): + G_directed = nx.gn_graph(10 + r, seed=100 + i) + G_undirected = nx.to_undirected(G_directed) + + h_directed = nx.weisfeiler_lehman_graph_hash(G_directed) + h_undirected = nx.weisfeiler_lehman_graph_hash(G_undirected) + + assert h_directed != h_undirected + + +def test_reversed(): + """ + A directed graph with no bi-directional edges should yield different a graph hash + to the same graph taken with edge directions reversed if there are no hash collisions. + Here we test a cycle graph which is the minimal counterexample + """ + G = nx.cycle_graph(5, create_using=nx.DiGraph) + nx.set_node_attributes(G, {n: str(n) for n in G.nodes()}, name="label") + + G_reversed = G.reverse() + + h = nx.weisfeiler_lehman_graph_hash(G, node_attr="label") + h_reversed = nx.weisfeiler_lehman_graph_hash(G_reversed, node_attr="label") + + assert h != h_reversed + + +def test_isomorphic(): + """ + graph hashes should be invariant to node-relabeling (when the output is reindexed + by the same mapping) + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=200 + i) + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g1_hash = nx.weisfeiler_lehman_graph_hash(G1) + g2_hash = nx.weisfeiler_lehman_graph_hash(G2) + + assert g1_hash == g2_hash + + +def test_isomorphic_edge_attr(): + """ + Isomorphic graphs with differing edge attributes should yield different graph + hashes if the 'edge_attr' argument is supplied and populated in the graph, + and there are no hash collisions. + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=300 + i) + + for a, b in G1.edges: + G1[a][b]["edge_attr1"] = f"{a}-{b}-1" + G1[a][b]["edge_attr2"] = f"{a}-{b}-2" + + g1_hash_with_edge_attr1 = nx.weisfeiler_lehman_graph_hash( + G1, edge_attr="edge_attr1" + ) + g1_hash_with_edge_attr2 = nx.weisfeiler_lehman_graph_hash( + G1, edge_attr="edge_attr2" + ) + g1_hash_no_edge_attr = nx.weisfeiler_lehman_graph_hash(G1, edge_attr=None) + + assert g1_hash_with_edge_attr1 != g1_hash_no_edge_attr + assert g1_hash_with_edge_attr2 != g1_hash_no_edge_attr + assert g1_hash_with_edge_attr1 != g1_hash_with_edge_attr2 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_with_edge_attr1 = nx.weisfeiler_lehman_graph_hash( + G2, edge_attr="edge_attr1" + ) + g2_hash_with_edge_attr2 = nx.weisfeiler_lehman_graph_hash( + G2, edge_attr="edge_attr2" + ) + + assert g1_hash_with_edge_attr1 == g2_hash_with_edge_attr1 + assert g1_hash_with_edge_attr2 == g2_hash_with_edge_attr2 + + +def test_missing_edge_attr(): + """ + If the 'edge_attr' argument is supplied but is missing from an edge in the graph, + we should raise a KeyError + """ + G = nx.Graph() + G.add_edges_from([(1, 2, {"edge_attr1": "a"}), (1, 3, {})]) + pytest.raises(KeyError, nx.weisfeiler_lehman_graph_hash, G, edge_attr="edge_attr1") + + +def test_isomorphic_node_attr(): + """ + Isomorphic graphs with differing node attributes should yield different graph + hashes if the 'node_attr' argument is supplied and populated in the graph, and + there are no hash collisions. + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=400 + i) + + for u in G1.nodes(): + G1.nodes[u]["node_attr1"] = f"{u}-1" + G1.nodes[u]["node_attr2"] = f"{u}-2" + + g1_hash_with_node_attr1 = nx.weisfeiler_lehman_graph_hash( + G1, node_attr="node_attr1" + ) + g1_hash_with_node_attr2 = nx.weisfeiler_lehman_graph_hash( + G1, node_attr="node_attr2" + ) + g1_hash_no_node_attr = nx.weisfeiler_lehman_graph_hash(G1, node_attr=None) + + assert g1_hash_with_node_attr1 != g1_hash_no_node_attr + assert g1_hash_with_node_attr2 != g1_hash_no_node_attr + assert g1_hash_with_node_attr1 != g1_hash_with_node_attr2 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_with_node_attr1 = nx.weisfeiler_lehman_graph_hash( + G2, node_attr="node_attr1" + ) + g2_hash_with_node_attr2 = nx.weisfeiler_lehman_graph_hash( + G2, node_attr="node_attr2" + ) + + assert g1_hash_with_node_attr1 == g2_hash_with_node_attr1 + assert g1_hash_with_node_attr2 == g2_hash_with_node_attr2 + + +def test_missing_node_attr(): + """ + If the 'node_attr' argument is supplied but is missing from a node in the graph, + we should raise a KeyError + """ + G = nx.Graph() + G.add_nodes_from([(1, {"node_attr1": "a"}), (2, {})]) + G.add_edges_from([(1, 2), (2, 3), (3, 1), (1, 4)]) + pytest.raises(KeyError, nx.weisfeiler_lehman_graph_hash, G, node_attr="node_attr1") + + +def test_isomorphic_edge_attr_and_node_attr(): + """ + Isomorphic graphs with differing node attributes should yield different graph + hashes if the 'node_attr' and 'edge_attr' argument is supplied and populated in + the graph, and there are no hash collisions. + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=500 + i) + + for u in G1.nodes(): + G1.nodes[u]["node_attr1"] = f"{u}-1" + G1.nodes[u]["node_attr2"] = f"{u}-2" + + for a, b in G1.edges: + G1[a][b]["edge_attr1"] = f"{a}-{b}-1" + G1[a][b]["edge_attr2"] = f"{a}-{b}-2" + + g1_hash_edge1_node1 = nx.weisfeiler_lehman_graph_hash( + G1, edge_attr="edge_attr1", node_attr="node_attr1" + ) + g1_hash_edge2_node2 = nx.weisfeiler_lehman_graph_hash( + G1, edge_attr="edge_attr2", node_attr="node_attr2" + ) + g1_hash_edge1_node2 = nx.weisfeiler_lehman_graph_hash( + G1, edge_attr="edge_attr1", node_attr="node_attr2" + ) + g1_hash_no_attr = nx.weisfeiler_lehman_graph_hash(G1) + + assert g1_hash_edge1_node1 != g1_hash_no_attr + assert g1_hash_edge2_node2 != g1_hash_no_attr + assert g1_hash_edge1_node1 != g1_hash_edge2_node2 + assert g1_hash_edge1_node2 != g1_hash_edge2_node2 + assert g1_hash_edge1_node2 != g1_hash_edge1_node1 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_edge1_node1 = nx.weisfeiler_lehman_graph_hash( + G2, edge_attr="edge_attr1", node_attr="node_attr1" + ) + g2_hash_edge2_node2 = nx.weisfeiler_lehman_graph_hash( + G2, edge_attr="edge_attr2", node_attr="node_attr2" + ) + + assert g1_hash_edge1_node1 == g2_hash_edge1_node1 + assert g1_hash_edge2_node2 == g2_hash_edge2_node2 + + +def test_digest_size(): + """ + The hash string lengths should be as expected for a variety of graphs and + digest sizes + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=1000 + i) + + h16 = nx.weisfeiler_lehman_graph_hash(G) + h32 = nx.weisfeiler_lehman_graph_hash(G, digest_size=32) + + assert h16 != h32 + assert len(h16) == 16 * 2 + assert len(h32) == 32 * 2 + + +# Unit tests for the :func:`~networkx.weisfeiler_lehman_hash_subgraphs` function + + +def is_subiteration(a, b): + """ + returns True if that each hash sequence in 'a' is a prefix for + the corresponding sequence indexed by the same node in 'b'. + """ + return all(b[node][: len(hashes)] == hashes for node, hashes in a.items()) + + +def hexdigest_sizes_correct(a, digest_size): + """ + returns True if all hex digest sizes are the expected length in a node:subgraph-hashes + dictionary. Hex digest string length == 2 * bytes digest length since each pair of hex + digits encodes 1 byte (https://docs.python.org/3/library/hashlib.html) + """ + hexdigest_size = digest_size * 2 + list_digest_sizes_correct = lambda l: all(len(x) == hexdigest_size for x in l) + return all(list_digest_sizes_correct(hashes) for hashes in a.values()) + + +def test_empty_graph_subgraph_hash(): + """ " + empty graphs should give empty dict subgraph hashes regardless of other params + """ + G = nx.empty_graph() + + subgraph_hashes1 = nx.weisfeiler_lehman_subgraph_hashes(G) + subgraph_hashes2 = nx.weisfeiler_lehman_subgraph_hashes(G, edge_attr="edge_attr") + subgraph_hashes3 = nx.weisfeiler_lehman_subgraph_hashes(G, node_attr="edge_attr") + subgraph_hashes4 = nx.weisfeiler_lehman_subgraph_hashes(G, iterations=2) + subgraph_hashes5 = nx.weisfeiler_lehman_subgraph_hashes(G, digest_size=64) + + assert subgraph_hashes1 == {} + assert subgraph_hashes2 == {} + assert subgraph_hashes3 == {} + assert subgraph_hashes4 == {} + assert subgraph_hashes5 == {} + + +def test_directed_subgraph_hash(): + """ + A directed graph with no bi-directional edges should yield different subgraph hashes + to the same graph taken as undirected, if all hashes don't collide. + """ + r = 10 + for i in range(r): + G_directed = nx.gn_graph(10 + r, seed=100 + i) + G_undirected = nx.to_undirected(G_directed) + + directed_subgraph_hashes = nx.weisfeiler_lehman_subgraph_hashes(G_directed) + undirected_subgraph_hashes = nx.weisfeiler_lehman_subgraph_hashes(G_undirected) + + assert directed_subgraph_hashes != undirected_subgraph_hashes + + +def test_reversed_subgraph_hash(): + """ + A directed graph with no bi-directional edges should yield different subgraph hashes + to the same graph taken with edge directions reversed if there are no hash collisions. + Here we test a cycle graph which is the minimal counterexample + """ + G = nx.cycle_graph(5, create_using=nx.DiGraph) + nx.set_node_attributes(G, {n: str(n) for n in G.nodes()}, name="label") + + G_reversed = G.reverse() + + h = nx.weisfeiler_lehman_subgraph_hashes(G, node_attr="label") + h_reversed = nx.weisfeiler_lehman_subgraph_hashes(G_reversed, node_attr="label") + + assert h != h_reversed + + +def test_isomorphic_subgraph_hash(): + """ + the subgraph hashes should be invariant to node-relabeling when the output is reindexed + by the same mapping and all hashes don't collide. + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=200 + i) + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g1_subgraph_hashes = nx.weisfeiler_lehman_subgraph_hashes(G1) + g2_subgraph_hashes = nx.weisfeiler_lehman_subgraph_hashes(G2) + + assert g1_subgraph_hashes == {-1 * k: v for k, v in g2_subgraph_hashes.items()} + + +def test_isomorphic_edge_attr_subgraph_hash(): + """ + Isomorphic graphs with differing edge attributes should yield different subgraph + hashes if the 'edge_attr' argument is supplied and populated in the graph, and + all hashes don't collide. + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=300 + i) + + for a, b in G1.edges: + G1[a][b]["edge_attr1"] = f"{a}-{b}-1" + G1[a][b]["edge_attr2"] = f"{a}-{b}-2" + + g1_hash_with_edge_attr1 = nx.weisfeiler_lehman_subgraph_hashes( + G1, edge_attr="edge_attr1" + ) + g1_hash_with_edge_attr2 = nx.weisfeiler_lehman_subgraph_hashes( + G1, edge_attr="edge_attr2" + ) + g1_hash_no_edge_attr = nx.weisfeiler_lehman_subgraph_hashes(G1, edge_attr=None) + + assert g1_hash_with_edge_attr1 != g1_hash_no_edge_attr + assert g1_hash_with_edge_attr2 != g1_hash_no_edge_attr + assert g1_hash_with_edge_attr1 != g1_hash_with_edge_attr2 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_with_edge_attr1 = nx.weisfeiler_lehman_subgraph_hashes( + G2, edge_attr="edge_attr1" + ) + g2_hash_with_edge_attr2 = nx.weisfeiler_lehman_subgraph_hashes( + G2, edge_attr="edge_attr2" + ) + + assert g1_hash_with_edge_attr1 == { + -1 * k: v for k, v in g2_hash_with_edge_attr1.items() + } + assert g1_hash_with_edge_attr2 == { + -1 * k: v for k, v in g2_hash_with_edge_attr2.items() + } + + +def test_missing_edge_attr_subgraph_hash(): + """ + If the 'edge_attr' argument is supplied but is missing from an edge in the graph, + we should raise a KeyError + """ + G = nx.Graph() + G.add_edges_from([(1, 2, {"edge_attr1": "a"}), (1, 3, {})]) + pytest.raises( + KeyError, nx.weisfeiler_lehman_subgraph_hashes, G, edge_attr="edge_attr1" + ) + + +def test_isomorphic_node_attr_subgraph_hash(): + """ + Isomorphic graphs with differing node attributes should yield different subgraph + hashes if the 'node_attr' argument is supplied and populated in the graph, and + all hashes don't collide. + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=400 + i) + + for u in G1.nodes(): + G1.nodes[u]["node_attr1"] = f"{u}-1" + G1.nodes[u]["node_attr2"] = f"{u}-2" + + g1_hash_with_node_attr1 = nx.weisfeiler_lehman_subgraph_hashes( + G1, node_attr="node_attr1" + ) + g1_hash_with_node_attr2 = nx.weisfeiler_lehman_subgraph_hashes( + G1, node_attr="node_attr2" + ) + g1_hash_no_node_attr = nx.weisfeiler_lehman_subgraph_hashes(G1, node_attr=None) + + assert g1_hash_with_node_attr1 != g1_hash_no_node_attr + assert g1_hash_with_node_attr2 != g1_hash_no_node_attr + assert g1_hash_with_node_attr1 != g1_hash_with_node_attr2 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_with_node_attr1 = nx.weisfeiler_lehman_subgraph_hashes( + G2, node_attr="node_attr1" + ) + g2_hash_with_node_attr2 = nx.weisfeiler_lehman_subgraph_hashes( + G2, node_attr="node_attr2" + ) + + assert g1_hash_with_node_attr1 == { + -1 * k: v for k, v in g2_hash_with_node_attr1.items() + } + assert g1_hash_with_node_attr2 == { + -1 * k: v for k, v in g2_hash_with_node_attr2.items() + } + + +def test_missing_node_attr_subgraph_hash(): + """ + If the 'node_attr' argument is supplied but is missing from a node in the graph, + we should raise a KeyError + """ + G = nx.Graph() + G.add_nodes_from([(1, {"node_attr1": "a"}), (2, {})]) + G.add_edges_from([(1, 2), (2, 3), (3, 1), (1, 4)]) + pytest.raises( + KeyError, nx.weisfeiler_lehman_subgraph_hashes, G, node_attr="node_attr1" + ) + + +def test_isomorphic_edge_attr_and_node_attr_subgraph_hash(): + """ + Isomorphic graphs with differing node attributes should yield different subgraph + hashes if the 'node_attr' and 'edge_attr' argument is supplied and populated in + the graph, and all hashes don't collide + The output should still be invariant to node-relabeling + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G1 = nx.erdos_renyi_graph(n, p * i, seed=500 + i) + + for u in G1.nodes(): + G1.nodes[u]["node_attr1"] = f"{u}-1" + G1.nodes[u]["node_attr2"] = f"{u}-2" + + for a, b in G1.edges: + G1[a][b]["edge_attr1"] = f"{a}-{b}-1" + G1[a][b]["edge_attr2"] = f"{a}-{b}-2" + + g1_hash_edge1_node1 = nx.weisfeiler_lehman_subgraph_hashes( + G1, edge_attr="edge_attr1", node_attr="node_attr1" + ) + g1_hash_edge2_node2 = nx.weisfeiler_lehman_subgraph_hashes( + G1, edge_attr="edge_attr2", node_attr="node_attr2" + ) + g1_hash_edge1_node2 = nx.weisfeiler_lehman_subgraph_hashes( + G1, edge_attr="edge_attr1", node_attr="node_attr2" + ) + g1_hash_no_attr = nx.weisfeiler_lehman_subgraph_hashes(G1) + + assert g1_hash_edge1_node1 != g1_hash_no_attr + assert g1_hash_edge2_node2 != g1_hash_no_attr + assert g1_hash_edge1_node1 != g1_hash_edge2_node2 + assert g1_hash_edge1_node2 != g1_hash_edge2_node2 + assert g1_hash_edge1_node2 != g1_hash_edge1_node1 + + G2 = nx.relabel_nodes(G1, {u: -1 * u for u in G1.nodes()}) + + g2_hash_edge1_node1 = nx.weisfeiler_lehman_subgraph_hashes( + G2, edge_attr="edge_attr1", node_attr="node_attr1" + ) + g2_hash_edge2_node2 = nx.weisfeiler_lehman_subgraph_hashes( + G2, edge_attr="edge_attr2", node_attr="node_attr2" + ) + + assert g1_hash_edge1_node1 == { + -1 * k: v for k, v in g2_hash_edge1_node1.items() + } + assert g1_hash_edge2_node2 == { + -1 * k: v for k, v in g2_hash_edge2_node2.items() + } + + +def test_iteration_depth(): + """ + All nodes should have the correct number of subgraph hashes in the output when + using degree as initial node labels + Subsequent iteration depths for the same graph should be additive for each node + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=600 + i) + + depth3 = nx.weisfeiler_lehman_subgraph_hashes(G, iterations=3) + depth4 = nx.weisfeiler_lehman_subgraph_hashes(G, iterations=4) + depth5 = nx.weisfeiler_lehman_subgraph_hashes(G, iterations=5) + + assert all(len(hashes) == 3 for hashes in depth3.values()) + assert all(len(hashes) == 4 for hashes in depth4.values()) + assert all(len(hashes) == 5 for hashes in depth5.values()) + + assert is_subiteration(depth3, depth4) + assert is_subiteration(depth4, depth5) + assert is_subiteration(depth3, depth5) + + +def test_iteration_depth_edge_attr(): + """ + All nodes should have the correct number of subgraph hashes in the output when + setting initial node labels empty and using an edge attribute when aggregating + neighborhoods. + Subsequent iteration depths for the same graph should be additive for each node + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=700 + i) + + for a, b in G.edges: + G[a][b]["edge_attr1"] = f"{a}-{b}-1" + + depth3 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", iterations=3 + ) + depth4 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", iterations=4 + ) + depth5 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", iterations=5 + ) + + assert all(len(hashes) == 3 for hashes in depth3.values()) + assert all(len(hashes) == 4 for hashes in depth4.values()) + assert all(len(hashes) == 5 for hashes in depth5.values()) + + assert is_subiteration(depth3, depth4) + assert is_subiteration(depth4, depth5) + assert is_subiteration(depth3, depth5) + + +def test_iteration_depth_node_attr(): + """ + All nodes should have the correct number of subgraph hashes in the output when + setting initial node labels to an attribute. + Subsequent iteration depths for the same graph should be additive for each node + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=800 + i) + + for u in G.nodes(): + G.nodes[u]["node_attr1"] = f"{u}-1" + + depth3 = nx.weisfeiler_lehman_subgraph_hashes( + G, node_attr="node_attr1", iterations=3 + ) + depth4 = nx.weisfeiler_lehman_subgraph_hashes( + G, node_attr="node_attr1", iterations=4 + ) + depth5 = nx.weisfeiler_lehman_subgraph_hashes( + G, node_attr="node_attr1", iterations=5 + ) + + assert all(len(hashes) == 3 for hashes in depth3.values()) + assert all(len(hashes) == 4 for hashes in depth4.values()) + assert all(len(hashes) == 5 for hashes in depth5.values()) + + assert is_subiteration(depth3, depth4) + assert is_subiteration(depth4, depth5) + assert is_subiteration(depth3, depth5) + + +def test_iteration_depth_node_edge_attr(): + """ + All nodes should have the correct number of subgraph hashes in the output when + setting initial node labels to an attribute and also using an edge attribute when + aggregating neighborhoods. + Subsequent iteration depths for the same graph should be additive for each node + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=900 + i) + + for u in G.nodes(): + G.nodes[u]["node_attr1"] = f"{u}-1" + + for a, b in G.edges: + G[a][b]["edge_attr1"] = f"{a}-{b}-1" + + depth3 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", node_attr="node_attr1", iterations=3 + ) + depth4 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", node_attr="node_attr1", iterations=4 + ) + depth5 = nx.weisfeiler_lehman_subgraph_hashes( + G, edge_attr="edge_attr1", node_attr="node_attr1", iterations=5 + ) + + assert all(len(hashes) == 3 for hashes in depth3.values()) + assert all(len(hashes) == 4 for hashes in depth4.values()) + assert all(len(hashes) == 5 for hashes in depth5.values()) + + assert is_subiteration(depth3, depth4) + assert is_subiteration(depth4, depth5) + assert is_subiteration(depth3, depth5) + + +def test_digest_size_subgraph_hash(): + """ + The hash string lengths should be as expected for a variety of graphs and + digest sizes + """ + n, r = 100, 10 + p = 1.0 / r + for i in range(1, r + 1): + G = nx.erdos_renyi_graph(n, p * i, seed=1000 + i) + + digest_size16_hashes = nx.weisfeiler_lehman_subgraph_hashes(G) + digest_size32_hashes = nx.weisfeiler_lehman_subgraph_hashes(G, digest_size=32) + + assert digest_size16_hashes != digest_size32_hashes + + assert hexdigest_sizes_correct(digest_size16_hashes, 16) + assert hexdigest_sizes_correct(digest_size32_hashes, 32) + + +def test_initial_node_labels_subgraph_hash(): + """ + Including the hashed initial label prepends an extra hash to the lists + """ + G = nx.path_graph(5) + nx.set_node_attributes(G, {i: int(0 < i < 4) for i in G}, "label") + # initial node labels: + # 0--1--1--1--0 + + without_initial_label = nx.weisfeiler_lehman_subgraph_hashes(G, node_attr="label") + assert all(len(v) == 3 for v in without_initial_label.values()) + # 3 different 1 hop nhds + assert len({v[0] for v in without_initial_label.values()}) == 3 + + with_initial_label = nx.weisfeiler_lehman_subgraph_hashes( + G, node_attr="label", include_initial_labels=True + ) + assert all(len(v) == 4 for v in with_initial_label.values()) + # 2 different initial labels + assert len({v[0] for v in with_initial_label.values()}) == 2 + + # check hashes match otherwise + for u in G: + for a, b in zip( + with_initial_label[u][1:], without_initial_label[u], strict=True + ): + assert a == b diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graphical.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graphical.py new file mode 100644 index 0000000000000000000000000000000000000000..99f766f799d8573e80d905482f4b685a2d16bcc0 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_graphical.py @@ -0,0 +1,163 @@ +import pytest + +import networkx as nx + + +def test_valid_degree_sequence1(): + n = 100 + p = 0.3 + for i in range(10): + G = nx.erdos_renyi_graph(n, p) + deg = (d for n, d in G.degree()) + assert nx.is_graphical(deg, method="eg") + assert nx.is_graphical(deg, method="hh") + + +def test_valid_degree_sequence2(): + n = 100 + for i in range(10): + G = nx.barabasi_albert_graph(n, 1) + deg = (d for n, d in G.degree()) + assert nx.is_graphical(deg, method="eg") + assert nx.is_graphical(deg, method="hh") + + +def test_string_input(): + pytest.raises(nx.NetworkXException, nx.is_graphical, [], "foo") + pytest.raises(nx.NetworkXException, nx.is_graphical, ["red"], "hh") + pytest.raises(nx.NetworkXException, nx.is_graphical, ["red"], "eg") + + +def test_non_integer_input(): + pytest.raises(nx.NetworkXException, nx.is_graphical, [72.5], "eg") + pytest.raises(nx.NetworkXException, nx.is_graphical, [72.5], "hh") + + +def test_negative_input(): + assert not nx.is_graphical([-1], "hh") + assert not nx.is_graphical([-1], "eg") + + +class TestAtlas: + @classmethod + def setup_class(cls): + global atlas + from networkx.generators import atlas + + cls.GAG = atlas.graph_atlas_g() + + def test_atlas(self): + for graph in self.GAG: + deg = (d for n, d in graph.degree()) + assert nx.is_graphical(deg, method="eg") + assert nx.is_graphical(deg, method="hh") + + +def test_small_graph_true(): + z = [5, 3, 3, 3, 3, 2, 2, 2, 1, 1, 1] + assert nx.is_graphical(z, method="hh") + assert nx.is_graphical(z, method="eg") + z = [10, 3, 3, 3, 3, 2, 2, 2, 2, 2, 2] + assert nx.is_graphical(z, method="hh") + assert nx.is_graphical(z, method="eg") + z = [1, 1, 1, 1, 1, 2, 2, 2, 3, 4] + assert nx.is_graphical(z, method="hh") + assert nx.is_graphical(z, method="eg") + + +def test_small_graph_false(): + z = [1000, 3, 3, 3, 3, 2, 2, 2, 1, 1, 1] + assert not nx.is_graphical(z, method="hh") + assert not nx.is_graphical(z, method="eg") + z = [6, 5, 4, 4, 2, 1, 1, 1] + assert not nx.is_graphical(z, method="hh") + assert not nx.is_graphical(z, method="eg") + z = [1, 1, 1, 1, 1, 1, 2, 2, 2, 3, 4] + assert not nx.is_graphical(z, method="hh") + assert not nx.is_graphical(z, method="eg") + + +def test_directed_degree_sequence(): + # Test a range of valid directed degree sequences + n, r = 100, 10 + p = 1.0 / r + for i in range(r): + G = nx.erdos_renyi_graph(n, p * (i + 1), None, True) + din = (d for n, d in G.in_degree()) + dout = (d for n, d in G.out_degree()) + assert nx.is_digraphical(din, dout) + + +def test_small_directed_sequences(): + dout = [5, 3, 3, 3, 3, 2, 2, 2, 1, 1, 1] + din = [3, 3, 3, 3, 3, 2, 2, 2, 2, 2, 1] + assert nx.is_digraphical(din, dout) + # Test nongraphical directed sequence + dout = [1000, 3, 3, 3, 3, 2, 2, 2, 1, 1, 1] + din = [103, 102, 102, 102, 102, 102, 102, 102, 102, 102] + assert not nx.is_digraphical(din, dout) + # Test digraphical small sequence + dout = [1, 1, 1, 1, 1, 2, 2, 2, 3, 4] + din = [2, 2, 2, 2, 2, 2, 2, 2, 1, 1] + assert nx.is_digraphical(din, dout) + # Test nonmatching sum + din = [2, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1] + assert not nx.is_digraphical(din, dout) + # Test for negative integer in sequence + din = [2, 2, 2, -2, 2, 2, 2, 2, 1, 1, 4] + assert not nx.is_digraphical(din, dout) + # Test for noninteger + din = dout = [1, 1, 1.1, 1] + assert not nx.is_digraphical(din, dout) + din = dout = [1, 1, "rer", 1] + assert not nx.is_digraphical(din, dout) + + +def test_multi_sequence(): + # Test nongraphical multi sequence + seq = [1000, 3, 3, 3, 3, 2, 2, 2, 1, 1] + assert not nx.is_multigraphical(seq) + # Test small graphical multi sequence + seq = [6, 5, 4, 4, 2, 1, 1, 1] + assert nx.is_multigraphical(seq) + # Test for negative integer in sequence + seq = [6, 5, 4, -4, 2, 1, 1, 1] + assert not nx.is_multigraphical(seq) + # Test for sequence with odd sum + seq = [1, 1, 1, 1, 1, 1, 2, 2, 2, 3, 4] + assert not nx.is_multigraphical(seq) + # Test for noninteger + seq = [1, 1, 1.1, 1] + assert not nx.is_multigraphical(seq) + seq = [1, 1, "rer", 1] + assert not nx.is_multigraphical(seq) + + +def test_pseudo_sequence(): + # Test small valid pseudo sequence + seq = [1000, 3, 3, 3, 3, 2, 2, 2, 1, 1] + assert nx.is_pseudographical(seq) + # Test for sequence with odd sum + seq = [1000, 3, 3, 3, 3, 2, 2, 2, 1, 1, 1] + assert not nx.is_pseudographical(seq) + # Test for negative integer in sequence + seq = [1000, 3, 3, 3, 3, 2, 2, -2, 1, 1] + assert not nx.is_pseudographical(seq) + # Test for noninteger + seq = [1, 1, 1.1, 1] + assert not nx.is_pseudographical(seq) + seq = [1, 1, "rer", 1] + assert not nx.is_pseudographical(seq) + + +def test_numpy_degree_sequence(): + np = pytest.importorskip("numpy") + ds = np.array([1, 2, 2, 2, 1], dtype=np.int64) + assert nx.is_graphical(ds, "eg") + assert nx.is_graphical(ds, "hh") + ds = np.array([1, 2, 2, 2, 1], dtype=np.float64) + assert nx.is_graphical(ds, "eg") + assert nx.is_graphical(ds, "hh") + ds = np.array([1.1, 2, 2, 2, 1], dtype=np.float64) + pytest.raises(nx.NetworkXException, nx.is_graphical, ds, "eg") + pytest.raises(nx.NetworkXException, nx.is_graphical, ds, "hh") diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_lowest_common_ancestors.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_lowest_common_ancestors.py new file mode 100644 index 0000000000000000000000000000000000000000..66d75220327cb27c8b378505aea2780ea96021af --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_lowest_common_ancestors.py @@ -0,0 +1,427 @@ +from itertools import chain, combinations, product + +import pytest + +import networkx as nx + +tree_all_pairs_lca = nx.tree_all_pairs_lowest_common_ancestor +all_pairs_lca = nx.all_pairs_lowest_common_ancestor + + +def get_pair(dictionary, n1, n2): + if (n1, n2) in dictionary: + return dictionary[n1, n2] + else: + return dictionary[n2, n1] + + +class TestTreeLCA: + @classmethod + def setup_class(cls): + cls.DG = nx.DiGraph() + edges = [(0, 1), (0, 2), (1, 3), (1, 4), (2, 5), (2, 6)] + cls.DG.add_edges_from(edges) + cls.ans = dict(tree_all_pairs_lca(cls.DG, 0)) + gold = {(n, n): n for n in cls.DG} + gold.update({(0, i): 0 for i in range(1, 7)}) + gold.update( + { + (1, 2): 0, + (1, 3): 1, + (1, 4): 1, + (1, 5): 0, + (1, 6): 0, + (2, 3): 0, + (2, 4): 0, + (2, 5): 2, + (2, 6): 2, + (3, 4): 1, + (3, 5): 0, + (3, 6): 0, + (4, 5): 0, + (4, 6): 0, + (5, 6): 2, + } + ) + + cls.gold = gold + + @staticmethod + def assert_has_same_pairs(d1, d2): + for a, b in ((min(pair), max(pair)) for pair in chain(d1, d2)): + assert get_pair(d1, a, b) == get_pair(d2, a, b) + + def test_tree_all_pairs_lca_default_root(self): + assert dict(tree_all_pairs_lca(self.DG)) == self.ans + + def test_tree_all_pairs_lca_return_subset(self): + test_pairs = [(0, 1), (0, 1), (1, 0)] + ans = dict(tree_all_pairs_lca(self.DG, 0, test_pairs)) + assert (0, 1) in ans and (1, 0) in ans + assert len(ans) == 2 + + def test_tree_all_pairs_lca(self): + all_pairs = chain(combinations(self.DG, 2), ((node, node) for node in self.DG)) + + ans = dict(tree_all_pairs_lca(self.DG, 0, all_pairs)) + self.assert_has_same_pairs(ans, self.ans) + + def test_tree_all_pairs_gold_example(self): + ans = dict(tree_all_pairs_lca(self.DG)) + self.assert_has_same_pairs(self.gold, ans) + + def test_tree_all_pairs_lca_invalid_input(self): + empty_digraph = tree_all_pairs_lca(nx.DiGraph()) + pytest.raises(nx.NetworkXPointlessConcept, list, empty_digraph) + + bad_pairs_digraph = tree_all_pairs_lca(self.DG, pairs=[(-1, -2)]) + pytest.raises(nx.NodeNotFound, list, bad_pairs_digraph) + + def test_tree_all_pairs_lca_subtrees(self): + ans = dict(tree_all_pairs_lca(self.DG, 1)) + gold = { + pair: lca + for (pair, lca) in self.gold.items() + if all(n in (1, 3, 4) for n in pair) + } + self.assert_has_same_pairs(gold, ans) + + def test_tree_all_pairs_lca_disconnected_nodes(self): + G = nx.DiGraph() + G.add_node(1) + assert {(1, 1): 1} == dict(tree_all_pairs_lca(G)) + + G.add_node(0) + assert {(1, 1): 1} == dict(tree_all_pairs_lca(G, 1)) + assert {(0, 0): 0} == dict(tree_all_pairs_lca(G, 0)) + + pytest.raises(nx.NetworkXError, list, tree_all_pairs_lca(G)) + + def test_tree_all_pairs_lca_error_if_input_not_tree(self): + # Cycle + G = nx.DiGraph([(1, 2), (2, 1)]) + pytest.raises(nx.NetworkXError, list, tree_all_pairs_lca(G)) + # DAG + G = nx.DiGraph([(0, 2), (1, 2)]) + pytest.raises(nx.NetworkXError, list, tree_all_pairs_lca(G)) + + def test_tree_all_pairs_lca_generator(self): + pairs = iter([(0, 1), (0, 1), (1, 0)]) + some_pairs = dict(tree_all_pairs_lca(self.DG, 0, pairs)) + assert (0, 1) in some_pairs and (1, 0) in some_pairs + assert len(some_pairs) == 2 + + def test_tree_all_pairs_lca_nonexisting_pairs_exception(self): + lca = tree_all_pairs_lca(self.DG, 0, [(-1, -1)]) + pytest.raises(nx.NodeNotFound, list, lca) + # check if node is None + lca = tree_all_pairs_lca(self.DG, None, [(-1, -1)]) + pytest.raises(nx.NodeNotFound, list, lca) + + def test_tree_all_pairs_lca_routine_bails_on_DAGs(self): + G = nx.DiGraph([(3, 4), (5, 4)]) + pytest.raises(nx.NetworkXError, list, tree_all_pairs_lca(G)) + + def test_tree_all_pairs_lca_not_implemented(self): + NNI = nx.NetworkXNotImplemented + G = nx.Graph([(0, 1)]) + with pytest.raises(NNI): + next(tree_all_pairs_lca(G)) + with pytest.raises(NNI): + next(all_pairs_lca(G)) + pytest.raises(NNI, nx.lowest_common_ancestor, G, 0, 1) + G = nx.MultiGraph([(0, 1)]) + with pytest.raises(NNI): + next(tree_all_pairs_lca(G)) + with pytest.raises(NNI): + next(all_pairs_lca(G)) + pytest.raises(NNI, nx.lowest_common_ancestor, G, 0, 1) + + def test_tree_all_pairs_lca_trees_without_LCAs(self): + G = nx.DiGraph() + G.add_node(3) + ans = list(tree_all_pairs_lca(G)) + assert ans == [((3, 3), 3)] + + +class TestMultiTreeLCA(TestTreeLCA): + @classmethod + def setup_class(cls): + cls.DG = nx.MultiDiGraph() + edges = [(0, 1), (0, 2), (1, 3), (1, 4), (2, 5), (2, 6)] + cls.DG.add_edges_from(edges) + cls.ans = dict(tree_all_pairs_lca(cls.DG, 0)) + # add multiedges + cls.DG.add_edges_from(edges) + + gold = {(n, n): n for n in cls.DG} + gold.update({(0, i): 0 for i in range(1, 7)}) + gold.update( + { + (1, 2): 0, + (1, 3): 1, + (1, 4): 1, + (1, 5): 0, + (1, 6): 0, + (2, 3): 0, + (2, 4): 0, + (2, 5): 2, + (2, 6): 2, + (3, 4): 1, + (3, 5): 0, + (3, 6): 0, + (4, 5): 0, + (4, 6): 0, + (5, 6): 2, + } + ) + + cls.gold = gold + + +class TestDAGLCA: + @classmethod + def setup_class(cls): + cls.DG = nx.DiGraph() + nx.add_path(cls.DG, (0, 1, 2, 3)) + nx.add_path(cls.DG, (0, 4, 3)) + nx.add_path(cls.DG, (0, 5, 6, 8, 3)) + nx.add_path(cls.DG, (5, 7, 8)) + cls.DG.add_edge(6, 2) + cls.DG.add_edge(7, 2) + + cls.root_distance = nx.shortest_path_length(cls.DG, source=0) + + cls.gold = { + (1, 1): 1, + (1, 2): 1, + (1, 3): 1, + (1, 4): 0, + (1, 5): 0, + (1, 6): 0, + (1, 7): 0, + (1, 8): 0, + (2, 2): 2, + (2, 3): 2, + (2, 4): 0, + (2, 5): 5, + (2, 6): 6, + (2, 7): 7, + (2, 8): 7, + (3, 3): 3, + (3, 4): 4, + (3, 5): 5, + (3, 6): 6, + (3, 7): 7, + (3, 8): 8, + (4, 4): 4, + (4, 5): 0, + (4, 6): 0, + (4, 7): 0, + (4, 8): 0, + (5, 5): 5, + (5, 6): 5, + (5, 7): 5, + (5, 8): 5, + (6, 6): 6, + (6, 7): 5, + (6, 8): 6, + (7, 7): 7, + (7, 8): 7, + (8, 8): 8, + } + cls.gold.update(((0, n), 0) for n in cls.DG) + + def assert_lca_dicts_same(self, d1, d2, G=None): + """Checks if d1 and d2 contain the same pairs and + have a node at the same distance from root for each. + If G is None use self.DG.""" + if G is None: + G = self.DG + root_distance = self.root_distance + else: + roots = [n for n, deg in G.in_degree if deg == 0] + assert len(roots) == 1 + root_distance = nx.shortest_path_length(G, source=roots[0]) + + for a, b in ((min(pair), max(pair)) for pair in chain(d1, d2)): + assert ( + root_distance[get_pair(d1, a, b)] == root_distance[get_pair(d2, a, b)] + ) + + def test_all_pairs_lca_gold_example(self): + self.assert_lca_dicts_same(dict(all_pairs_lca(self.DG)), self.gold) + + def test_all_pairs_lca_all_pairs_given(self): + all_pairs = list(product(self.DG.nodes(), self.DG.nodes())) + ans = all_pairs_lca(self.DG, pairs=all_pairs) + self.assert_lca_dicts_same(dict(ans), self.gold) + + def test_all_pairs_lca_generator(self): + all_pairs = product(self.DG.nodes(), self.DG.nodes()) + ans = all_pairs_lca(self.DG, pairs=all_pairs) + self.assert_lca_dicts_same(dict(ans), self.gold) + + def test_all_pairs_lca_input_graph_with_two_roots(self): + G = self.DG.copy() + G.add_edge(9, 10) + G.add_edge(9, 4) + gold = self.gold.copy() + gold[9, 9] = 9 + gold[9, 10] = 9 + gold[9, 4] = 9 + gold[9, 3] = 9 + gold[10, 4] = 9 + gold[10, 3] = 9 + gold[10, 10] = 10 + + testing = dict(all_pairs_lca(G)) + + G.add_edge(-1, 9) + G.add_edge(-1, 0) + self.assert_lca_dicts_same(testing, gold, G) + + def test_all_pairs_lca_nonexisting_pairs_exception(self): + pytest.raises(nx.NodeNotFound, all_pairs_lca, self.DG, [(-1, -1)]) + + def test_all_pairs_lca_pairs_without_lca(self): + G = self.DG.copy() + G.add_node(-1) + gen = all_pairs_lca(G, [(-1, -1), (-1, 0)]) + assert dict(gen) == {(-1, -1): -1} + + def test_all_pairs_lca_null_graph(self): + pytest.raises(nx.NetworkXPointlessConcept, all_pairs_lca, nx.DiGraph()) + + def test_all_pairs_lca_non_dags(self): + pytest.raises(nx.NetworkXError, all_pairs_lca, nx.DiGraph([(3, 4), (4, 3)])) + + def test_all_pairs_lca_nonempty_graph_without_lca(self): + G = nx.DiGraph() + G.add_node(3) + ans = list(all_pairs_lca(G)) + assert ans == [((3, 3), 3)] + + def test_all_pairs_lca_bug_gh4942(self): + G = nx.DiGraph([(0, 2), (1, 2), (2, 3)]) + ans = list(all_pairs_lca(G)) + assert len(ans) == 9 + + def test_all_pairs_lca_default_kwarg(self): + G = nx.DiGraph([(0, 1), (2, 1)]) + sentinel = object() + assert nx.lowest_common_ancestor(G, 0, 2, default=sentinel) is sentinel + + def test_all_pairs_lca_identity(self): + G = nx.DiGraph() + G.add_node(3) + assert nx.lowest_common_ancestor(G, 3, 3) == 3 + + def test_all_pairs_lca_issue_4574(self): + G = nx.DiGraph() + G.add_nodes_from(range(17)) + G.add_edges_from( + [ + (2, 0), + (1, 2), + (3, 2), + (5, 2), + (8, 2), + (11, 2), + (4, 5), + (6, 5), + (7, 8), + (10, 8), + (13, 11), + (14, 11), + (15, 11), + (9, 10), + (12, 13), + (16, 15), + ] + ) + + assert nx.lowest_common_ancestor(G, 7, 9) == None + + def test_all_pairs_lca_one_pair_gh4942(self): + G = nx.DiGraph() + # Note: order edge addition is critical to the test + G.add_edge(0, 1) + G.add_edge(2, 0) + G.add_edge(2, 3) + G.add_edge(4, 0) + G.add_edge(5, 2) + + assert nx.lowest_common_ancestor(G, 1, 3) == 2 + + +class TestMultiDiGraph_DAGLCA(TestDAGLCA): + @classmethod + def setup_class(cls): + cls.DG = nx.MultiDiGraph() + nx.add_path(cls.DG, (0, 1, 2, 3)) + # add multiedges + nx.add_path(cls.DG, (0, 1, 2, 3)) + nx.add_path(cls.DG, (0, 4, 3)) + nx.add_path(cls.DG, (0, 5, 6, 8, 3)) + nx.add_path(cls.DG, (5, 7, 8)) + cls.DG.add_edge(6, 2) + cls.DG.add_edge(7, 2) + + cls.root_distance = nx.shortest_path_length(cls.DG, source=0) + + cls.gold = { + (1, 1): 1, + (1, 2): 1, + (1, 3): 1, + (1, 4): 0, + (1, 5): 0, + (1, 6): 0, + (1, 7): 0, + (1, 8): 0, + (2, 2): 2, + (2, 3): 2, + (2, 4): 0, + (2, 5): 5, + (2, 6): 6, + (2, 7): 7, + (2, 8): 7, + (3, 3): 3, + (3, 4): 4, + (3, 5): 5, + (3, 6): 6, + (3, 7): 7, + (3, 8): 8, + (4, 4): 4, + (4, 5): 0, + (4, 6): 0, + (4, 7): 0, + (4, 8): 0, + (5, 5): 5, + (5, 6): 5, + (5, 7): 5, + (5, 8): 5, + (6, 6): 6, + (6, 7): 5, + (6, 8): 6, + (7, 7): 7, + (7, 8): 7, + (8, 8): 8, + } + cls.gold.update(((0, n), 0) for n in cls.DG) + + +def test_all_pairs_lca_self_ancestors(): + """Self-ancestors should always be the node itself, i.e. lca of (0, 0) is 0. + See gh-4458.""" + # DAG for test - note order of node/edge addition is relevant + G = nx.DiGraph() + G.add_nodes_from(range(5)) + G.add_edges_from([(1, 0), (2, 0), (3, 2), (4, 1), (4, 3)]) + + ap_lca = nx.all_pairs_lowest_common_ancestor + assert all(u == v == a for (u, v), a in ap_lca(G) if u == v) + MG = nx.MultiDiGraph(G) + assert all(u == v == a for (u, v), a in ap_lca(MG) if u == v) + MG.add_edges_from([(1, 0), (2, 0)]) + assert all(u == v == a for (u, v), a in ap_lca(MG) if u == v) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_matching.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_matching.py new file mode 100644 index 0000000000000000000000000000000000000000..37853e3896c0fd6bcac1f46524a844ae2e2fb518 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_matching.py @@ -0,0 +1,605 @@ +import math +from itertools import permutations + +from pytest import raises + +import networkx as nx +from networkx.algorithms.matching import matching_dict_to_set +from networkx.utils import edges_equal + + +class TestMaxWeightMatching: + """Unit tests for the + :func:`~networkx.algorithms.matching.max_weight_matching` function. + + """ + + def test_trivial1(self): + """Empty graph""" + G = nx.Graph() + assert nx.max_weight_matching(G) == set() + assert nx.min_weight_matching(G) == set() + + def test_selfloop(self): + G = nx.Graph() + G.add_edge(0, 0, weight=100) + assert nx.max_weight_matching(G) == set() + assert nx.min_weight_matching(G) == set() + + def test_single_edge(self): + G = nx.Graph() + G.add_edge(0, 1) + assert edges_equal( + nx.max_weight_matching(G), matching_dict_to_set({0: 1, 1: 0}) + ) + assert edges_equal( + nx.min_weight_matching(G), matching_dict_to_set({0: 1, 1: 0}) + ) + + def test_two_path(self): + G = nx.Graph() + G.add_edge("one", "two", weight=10) + G.add_edge("two", "three", weight=11) + assert edges_equal( + nx.max_weight_matching(G), + matching_dict_to_set({"three": "two", "two": "three"}), + ) + assert edges_equal( + nx.min_weight_matching(G), + matching_dict_to_set({"one": "two", "two": "one"}), + ) + + def test_path(self): + G = nx.Graph() + G.add_edge(1, 2, weight=5) + G.add_edge(2, 3, weight=11) + G.add_edge(3, 4, weight=5) + assert edges_equal( + nx.max_weight_matching(G), matching_dict_to_set({2: 3, 3: 2}) + ) + assert edges_equal( + nx.max_weight_matching(G, 1), matching_dict_to_set({1: 2, 2: 1, 3: 4, 4: 3}) + ) + assert edges_equal( + nx.min_weight_matching(G), matching_dict_to_set({1: 2, 3: 4}) + ) + assert edges_equal( + nx.min_weight_matching(G, 1), matching_dict_to_set({1: 2, 3: 4}) + ) + + def test_square(self): + G = nx.Graph() + G.add_edge(1, 4, weight=2) + G.add_edge(2, 3, weight=2) + G.add_edge(1, 2, weight=1) + G.add_edge(3, 4, weight=4) + assert edges_equal( + nx.max_weight_matching(G), matching_dict_to_set({1: 2, 3: 4}) + ) + assert edges_equal( + nx.min_weight_matching(G), matching_dict_to_set({1: 4, 2: 3}) + ) + + def test_edge_attribute_name(self): + G = nx.Graph() + G.add_edge("one", "two", weight=10, abcd=11) + G.add_edge("two", "three", weight=11, abcd=10) + assert edges_equal( + nx.max_weight_matching(G, weight="abcd"), + matching_dict_to_set({"one": "two", "two": "one"}), + ) + assert edges_equal( + nx.min_weight_matching(G, weight="abcd"), + matching_dict_to_set({"three": "two"}), + ) + + def test_floating_point_weights(self): + G = nx.Graph() + G.add_edge(1, 2, weight=math.pi) + G.add_edge(2, 3, weight=math.exp(1)) + G.add_edge(1, 3, weight=3.0) + G.add_edge(1, 4, weight=math.sqrt(2.0)) + assert edges_equal( + nx.max_weight_matching(G), matching_dict_to_set({1: 4, 2: 3, 3: 2, 4: 1}) + ) + assert edges_equal( + nx.min_weight_matching(G), matching_dict_to_set({1: 4, 2: 3, 3: 2, 4: 1}) + ) + + def test_negative_weights(self): + G = nx.Graph() + G.add_edge(1, 2, weight=2) + G.add_edge(1, 3, weight=-2) + G.add_edge(2, 3, weight=1) + G.add_edge(2, 4, weight=-1) + G.add_edge(3, 4, weight=-6) + assert edges_equal( + nx.max_weight_matching(G), matching_dict_to_set({1: 2, 2: 1}) + ) + assert edges_equal( + nx.max_weight_matching(G, maxcardinality=True), + matching_dict_to_set({1: 3, 2: 4, 3: 1, 4: 2}), + ) + assert edges_equal( + nx.min_weight_matching(G), matching_dict_to_set({1: 2, 3: 4}) + ) + + def test_s_blossom(self): + """Create S-blossom and use it for augmentation:""" + G = nx.Graph() + G.add_weighted_edges_from([(1, 2, 8), (1, 3, 9), (2, 3, 10), (3, 4, 7)]) + answer = matching_dict_to_set({1: 2, 2: 1, 3: 4, 4: 3}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + G.add_weighted_edges_from([(1, 6, 5), (4, 5, 6)]) + answer = matching_dict_to_set({1: 6, 2: 3, 3: 2, 4: 5, 5: 4, 6: 1}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_s_t_blossom(self): + """Create S-blossom, relabel as T-blossom, use for augmentation:""" + G = nx.Graph() + G.add_weighted_edges_from( + [(1, 2, 9), (1, 3, 8), (2, 3, 10), (1, 4, 5), (4, 5, 4), (1, 6, 3)] + ) + answer = matching_dict_to_set({1: 6, 2: 3, 3: 2, 4: 5, 5: 4, 6: 1}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + G.add_edge(4, 5, weight=3) + G.add_edge(1, 6, weight=4) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + G.remove_edge(1, 6) + G.add_edge(3, 6, weight=4) + answer = matching_dict_to_set({1: 2, 2: 1, 3: 6, 4: 5, 5: 4, 6: 3}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nested_s_blossom(self): + """Create nested S-blossom, use for augmentation:""" + + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 9), + (1, 3, 9), + (2, 3, 10), + (2, 4, 8), + (3, 5, 8), + (4, 5, 10), + (5, 6, 6), + ] + ) + dict_format = {1: 3, 2: 4, 3: 1, 4: 2, 5: 6, 6: 5} + expected = {frozenset(e) for e in matching_dict_to_set(dict_format)} + answer = {frozenset(e) for e in nx.max_weight_matching(G)} + assert answer == expected + answer = {frozenset(e) for e in nx.min_weight_matching(G)} + assert answer == expected + + def test_nested_s_blossom_relabel(self): + """Create S-blossom, relabel as S, include in nested S-blossom:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 10), + (1, 7, 10), + (2, 3, 12), + (3, 4, 20), + (3, 5, 20), + (4, 5, 25), + (5, 6, 10), + (6, 7, 10), + (7, 8, 8), + ] + ) + answer = matching_dict_to_set({1: 2, 2: 1, 3: 4, 4: 3, 5: 6, 6: 5, 7: 8, 8: 7}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nested_s_blossom_expand(self): + """Create nested S-blossom, augment, expand recursively:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 8), + (1, 3, 8), + (2, 3, 10), + (2, 4, 12), + (3, 5, 12), + (4, 5, 14), + (4, 6, 12), + (5, 7, 12), + (6, 7, 14), + (7, 8, 12), + ] + ) + answer = matching_dict_to_set({1: 2, 2: 1, 3: 5, 4: 6, 5: 3, 6: 4, 7: 8, 8: 7}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_s_blossom_relabel_expand(self): + """Create S-blossom, relabel as T, expand:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 23), + (1, 5, 22), + (1, 6, 15), + (2, 3, 25), + (3, 4, 22), + (4, 5, 25), + (4, 8, 14), + (5, 7, 13), + ] + ) + answer = matching_dict_to_set({1: 6, 2: 3, 3: 2, 4: 8, 5: 7, 6: 1, 7: 5, 8: 4}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nested_s_blossom_relabel_expand(self): + """Create nested S-blossom, relabel as T, expand:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 19), + (1, 3, 20), + (1, 8, 8), + (2, 3, 25), + (2, 4, 18), + (3, 5, 18), + (4, 5, 13), + (4, 7, 7), + (5, 6, 7), + ] + ) + answer = matching_dict_to_set({1: 8, 2: 3, 3: 2, 4: 7, 5: 6, 6: 5, 7: 4, 8: 1}) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nasty_blossom1(self): + """Create blossom, relabel as T in more than one way, expand, + augment: + """ + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 45), + (1, 5, 45), + (2, 3, 50), + (3, 4, 45), + (4, 5, 50), + (1, 6, 30), + (3, 9, 35), + (4, 8, 35), + (5, 7, 26), + (9, 10, 5), + ] + ) + ansdict = {1: 6, 2: 3, 3: 2, 4: 8, 5: 7, 6: 1, 7: 5, 8: 4, 9: 10, 10: 9} + answer = matching_dict_to_set(ansdict) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nasty_blossom2(self): + """Again but slightly different:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 45), + (1, 5, 45), + (2, 3, 50), + (3, 4, 45), + (4, 5, 50), + (1, 6, 30), + (3, 9, 35), + (4, 8, 26), + (5, 7, 40), + (9, 10, 5), + ] + ) + ans = {1: 6, 2: 3, 3: 2, 4: 8, 5: 7, 6: 1, 7: 5, 8: 4, 9: 10, 10: 9} + answer = matching_dict_to_set(ans) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nasty_blossom_least_slack(self): + """Create blossom, relabel as T, expand such that a new + least-slack S-to-free dge is produced, augment: + """ + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 45), + (1, 5, 45), + (2, 3, 50), + (3, 4, 45), + (4, 5, 50), + (1, 6, 30), + (3, 9, 35), + (4, 8, 28), + (5, 7, 26), + (9, 10, 5), + ] + ) + ans = {1: 6, 2: 3, 3: 2, 4: 8, 5: 7, 6: 1, 7: 5, 8: 4, 9: 10, 10: 9} + answer = matching_dict_to_set(ans) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nasty_blossom_augmenting(self): + """Create nested blossom, relabel as T in more than one way""" + # expand outer blossom such that inner blossom ends up on an + # augmenting path: + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 45), + (1, 7, 45), + (2, 3, 50), + (3, 4, 45), + (4, 5, 95), + (4, 6, 94), + (5, 6, 94), + (6, 7, 50), + (1, 8, 30), + (3, 11, 35), + (5, 9, 36), + (7, 10, 26), + (11, 12, 5), + ] + ) + ans = { + 1: 8, + 2: 3, + 3: 2, + 4: 6, + 5: 9, + 6: 4, + 7: 10, + 8: 1, + 9: 5, + 10: 7, + 11: 12, + 12: 11, + } + answer = matching_dict_to_set(ans) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_nasty_blossom_expand_recursively(self): + """Create nested S-blossom, relabel as S, expand recursively:""" + G = nx.Graph() + G.add_weighted_edges_from( + [ + (1, 2, 40), + (1, 3, 40), + (2, 3, 60), + (2, 4, 55), + (3, 5, 55), + (4, 5, 50), + (1, 8, 15), + (5, 7, 30), + (7, 6, 10), + (8, 10, 10), + (4, 9, 30), + ] + ) + ans = {1: 2, 2: 1, 3: 5, 4: 9, 5: 3, 6: 7, 7: 6, 8: 10, 9: 4, 10: 8} + answer = matching_dict_to_set(ans) + assert edges_equal(nx.max_weight_matching(G), answer) + assert edges_equal(nx.min_weight_matching(G), answer) + + def test_wrong_graph_type(self): + error = nx.NetworkXNotImplemented + raises(error, nx.max_weight_matching, nx.MultiGraph()) + raises(error, nx.max_weight_matching, nx.MultiDiGraph()) + raises(error, nx.max_weight_matching, nx.DiGraph()) + raises(error, nx.min_weight_matching, nx.DiGraph()) + + +class TestIsMatching: + """Unit tests for the + :func:`~networkx.algorithms.matching.is_matching` function. + + """ + + def test_dict(self): + G = nx.path_graph(4) + assert nx.is_matching(G, {0: 1, 1: 0, 2: 3, 3: 2}) + + def test_empty_matching(self): + G = nx.path_graph(4) + assert nx.is_matching(G, set()) + + def test_single_edge(self): + G = nx.path_graph(4) + assert nx.is_matching(G, {(1, 2)}) + + def test_edge_order(self): + G = nx.path_graph(4) + assert nx.is_matching(G, {(0, 1), (2, 3)}) + assert nx.is_matching(G, {(1, 0), (2, 3)}) + assert nx.is_matching(G, {(0, 1), (3, 2)}) + assert nx.is_matching(G, {(1, 0), (3, 2)}) + + def test_valid_matching(self): + G = nx.path_graph(4) + assert nx.is_matching(G, {(0, 1), (2, 3)}) + + def test_invalid_input(self): + error = nx.NetworkXError + G = nx.path_graph(4) + # edge to node not in G + raises(error, nx.is_matching, G, {(0, 5), (2, 3)}) + # edge not a 2-tuple + raises(error, nx.is_matching, G, {(0, 1, 2), (2, 3)}) + raises(error, nx.is_matching, G, {(0,), (2, 3)}) + + def test_selfloops(self): + error = nx.NetworkXError + G = nx.path_graph(4) + # selfloop for node not in G + raises(error, nx.is_matching, G, {(5, 5), (2, 3)}) + # selfloop edge not in G + assert not nx.is_matching(G, {(0, 0), (1, 2), (2, 3)}) + # selfloop edge in G + G.add_edge(0, 0) + assert not nx.is_matching(G, {(0, 0), (1, 2)}) + + def test_invalid_matching(self): + G = nx.path_graph(4) + assert not nx.is_matching(G, {(0, 1), (1, 2), (2, 3)}) + + def test_invalid_edge(self): + G = nx.path_graph(4) + assert not nx.is_matching(G, {(0, 3), (1, 2)}) + raises(nx.NetworkXError, nx.is_matching, G, {(0, 55)}) + + G = nx.DiGraph(G.edges) + assert nx.is_matching(G, {(0, 1)}) + assert not nx.is_matching(G, {(1, 0)}) + + +class TestIsMaximalMatching: + """Unit tests for the + :func:`~networkx.algorithms.matching.is_maximal_matching` function. + + """ + + def test_dict(self): + G = nx.path_graph(4) + assert nx.is_maximal_matching(G, {0: 1, 1: 0, 2: 3, 3: 2}) + + def test_invalid_input(self): + error = nx.NetworkXError + G = nx.path_graph(4) + # edge to node not in G + raises(error, nx.is_maximal_matching, G, {(0, 5)}) + raises(error, nx.is_maximal_matching, G, {(5, 0)}) + # edge not a 2-tuple + raises(error, nx.is_maximal_matching, G, {(0, 1, 2), (2, 3)}) + raises(error, nx.is_maximal_matching, G, {(0,), (2, 3)}) + + def test_valid(self): + G = nx.path_graph(4) + assert nx.is_maximal_matching(G, {(0, 1), (2, 3)}) + + def test_not_matching(self): + G = nx.path_graph(4) + assert not nx.is_maximal_matching(G, {(0, 1), (1, 2), (2, 3)}) + assert not nx.is_maximal_matching(G, {(0, 3)}) + G.add_edge(0, 0) + assert not nx.is_maximal_matching(G, {(0, 0)}) + + def test_not_maximal(self): + G = nx.path_graph(4) + assert not nx.is_maximal_matching(G, {(0, 1)}) + + +class TestIsPerfectMatching: + """Unit tests for the + :func:`~networkx.algorithms.matching.is_perfect_matching` function. + + """ + + def test_dict(self): + G = nx.path_graph(4) + assert nx.is_perfect_matching(G, {0: 1, 1: 0, 2: 3, 3: 2}) + + def test_valid(self): + G = nx.path_graph(4) + assert nx.is_perfect_matching(G, {(0, 1), (2, 3)}) + + def test_valid_not_path(self): + G = nx.cycle_graph(4) + G.add_edge(0, 4) + G.add_edge(1, 4) + G.add_edge(5, 2) + + assert nx.is_perfect_matching(G, {(1, 4), (0, 3), (5, 2)}) + + def test_invalid_input(self): + error = nx.NetworkXError + G = nx.path_graph(4) + # edge to node not in G + raises(error, nx.is_perfect_matching, G, {(0, 5)}) + raises(error, nx.is_perfect_matching, G, {(5, 0)}) + # edge not a 2-tuple + raises(error, nx.is_perfect_matching, G, {(0, 1, 2), (2, 3)}) + raises(error, nx.is_perfect_matching, G, {(0,), (2, 3)}) + + def test_selfloops(self): + error = nx.NetworkXError + G = nx.path_graph(4) + # selfloop for node not in G + raises(error, nx.is_perfect_matching, G, {(5, 5), (2, 3)}) + # selfloop edge not in G + assert not nx.is_perfect_matching(G, {(0, 0), (1, 2), (2, 3)}) + # selfloop edge in G + G.add_edge(0, 0) + assert not nx.is_perfect_matching(G, {(0, 0), (1, 2)}) + + def test_not_matching(self): + G = nx.path_graph(4) + assert not nx.is_perfect_matching(G, {(0, 3)}) + assert not nx.is_perfect_matching(G, {(0, 1), (1, 2), (2, 3)}) + + def test_maximal_but_not_perfect(self): + G = nx.cycle_graph(4) + G.add_edge(0, 4) + G.add_edge(1, 4) + + assert not nx.is_perfect_matching(G, {(1, 4), (0, 3)}) + + +class TestMaximalMatching: + """Unit tests for the + :func:`~networkx.algorithms.matching.maximal_matching`. + + """ + + def test_valid_matching(self): + edges = [(1, 2), (1, 5), (2, 3), (2, 5), (3, 4), (3, 6), (5, 6)] + G = nx.Graph(edges) + matching = nx.maximal_matching(G) + assert nx.is_maximal_matching(G, matching) + + def test_single_edge_matching(self): + # In the star graph, any maximal matching has just one edge. + G = nx.star_graph(5) + matching = nx.maximal_matching(G) + assert 1 == len(matching) + assert nx.is_maximal_matching(G, matching) + + def test_self_loops(self): + # Create the path graph with two self-loops. + G = nx.path_graph(3) + G.add_edges_from([(0, 0), (1, 1)]) + matching = nx.maximal_matching(G) + assert len(matching) == 1 + # The matching should never include self-loops. + assert not any(u == v for u, v in matching) + assert nx.is_maximal_matching(G, matching) + + def test_ordering(self): + """Tests that a maximal matching is computed correctly + regardless of the order in which nodes are added to the graph. + + """ + for nodes in permutations(range(3)): + G = nx.Graph() + G.add_nodes_from(nodes) + G.add_edges_from([(0, 1), (0, 2)]) + matching = nx.maximal_matching(G) + assert len(matching) == 1 + assert nx.is_maximal_matching(G, matching) + + def test_wrong_graph_type(self): + error = nx.NetworkXNotImplemented + raises(error, nx.maximal_matching, nx.MultiGraph()) + raises(error, nx.maximal_matching, nx.MultiDiGraph()) + raises(error, nx.maximal_matching, nx.DiGraph()) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_mis.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_mis.py new file mode 100644 index 0000000000000000000000000000000000000000..02be02d4c33f233d27d2838e5e3d361c4212c40b --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_mis.py @@ -0,0 +1,62 @@ +""" +Tests for maximal (not maximum) independent sets. + +""" + +import random + +import pytest + +import networkx as nx + + +def test_random_seed(): + G = nx.empty_graph(5) + assert nx.maximal_independent_set(G, seed=1) == [1, 0, 3, 2, 4] + + +@pytest.mark.parametrize("graph", [nx.complete_graph(5), nx.complete_graph(55)]) +def test_K5(graph): + """Maximal independent set for complete graphs""" + assert all(nx.maximal_independent_set(graph, [n]) == [n] for n in graph) + + +def test_exceptions(): + """Bad input should raise exception.""" + G = nx.florentine_families_graph() + pytest.raises(nx.NetworkXUnfeasible, nx.maximal_independent_set, G, ["Smith"]) + pytest.raises( + nx.NetworkXUnfeasible, nx.maximal_independent_set, G, ["Salviati", "Pazzi"] + ) + # MaximalIndependentSet is not implemented for directed graphs + pytest.raises(nx.NetworkXNotImplemented, nx.maximal_independent_set, nx.DiGraph(G)) + + +def test_florentine_family(): + G = nx.florentine_families_graph() + indep = nx.maximal_independent_set(G, ["Medici", "Bischeri"]) + assert set(indep) == { + "Medici", + "Bischeri", + "Castellani", + "Pazzi", + "Ginori", + "Lamberteschi", + } + + +def test_bipartite(): + G = nx.complete_bipartite_graph(12, 34) + indep = nx.maximal_independent_set(G, [4, 5, 9, 10]) + assert sorted(indep) == list(range(12)) + + +def test_random_graphs(): + """Generate 5 random graphs of different types and sizes and + make sure that all sets are independent and maximal.""" + for i in range(0, 50, 10): + G = nx.erdos_renyi_graph(i * 10 + 1, random.random()) + IS = nx.maximal_independent_set(G) + assert G.subgraph(IS).number_of_edges() == 0 + nbrs_of_MIS = set.union(*(set(G.neighbors(v)) for v in IS)) + assert all(v in nbrs_of_MIS for v in set(G.nodes()).difference(IS)) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_non_randomness.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_non_randomness.py new file mode 100644 index 0000000000000000000000000000000000000000..2f495be28d57db2368b9412e93e1d137f2cac86b --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_non_randomness.py @@ -0,0 +1,42 @@ +import pytest + +import networkx as nx + +np = pytest.importorskip("numpy") + + +@pytest.mark.parametrize( + "k, weight, expected", + [ + (None, None, 7.21), # infers 3 communities + (2, None, 11.7), + (None, "weight", 25.45), + (2, "weight", 38.8), + ], +) +def test_non_randomness(k, weight, expected): + G = nx.karate_club_graph() + np.testing.assert_almost_equal( + nx.non_randomness(G, k, weight)[0], expected, decimal=2 + ) + + +def test_non_connected(): + G = nx.Graph([(1, 2)]) + G.add_node(3) + with pytest.raises(nx.NetworkXException, match="Non connected"): + nx.non_randomness(G) + + +def test_self_loops(): + G = nx.Graph() + G.add_edge(1, 2) + G.add_edge(1, 1) + with pytest.raises(nx.NetworkXError, match="Graph must not contain self-loops"): + nx.non_randomness(G) + + +def test_empty_graph(): + G = nx.empty_graph(1) + with pytest.raises(nx.NetworkXError, match=".*not applicable to empty graphs"): + nx.non_randomness(G) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_reciprocity.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_reciprocity.py new file mode 100644 index 0000000000000000000000000000000000000000..e713bc4303f9bfea1199f01d8369c6bdab1a221f --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_reciprocity.py @@ -0,0 +1,37 @@ +import pytest + +import networkx as nx + + +class TestReciprocity: + # test overall reciprocity by passing whole graph + def test_reciprocity_digraph(self): + DG = nx.DiGraph([(1, 2), (2, 1)]) + reciprocity = nx.reciprocity(DG) + assert reciprocity == 1.0 + + # test empty graph's overall reciprocity which will throw an error + def test_overall_reciprocity_empty_graph(self): + with pytest.raises(nx.NetworkXError): + DG = nx.DiGraph() + nx.overall_reciprocity(DG) + + # test for reciprocity for a list of nodes + def test_reciprocity_graph_nodes(self): + DG = nx.DiGraph([(1, 2), (2, 3), (3, 2)]) + reciprocity = nx.reciprocity(DG, [1, 2]) + expected_reciprocity = {1: 0.0, 2: 0.6666666666666666} + assert reciprocity == expected_reciprocity + + # test for reciprocity for a single node + def test_reciprocity_graph_node(self): + DG = nx.DiGraph([(1, 2), (2, 3), (3, 2)]) + reciprocity = nx.reciprocity(DG, 2) + assert reciprocity == 0.6666666666666666 + + # test for reciprocity for an isolated node + def test_reciprocity_graph_isolated_nodes(self): + with pytest.raises(nx.NetworkXError): + DG = nx.DiGraph([(1, 2)]) + DG.add_node(4) + nx.reciprocity(DG, 4) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_regular.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_regular.py new file mode 100644 index 0000000000000000000000000000000000000000..a8b4c3a30de612f91b4739fd35bc9ba06ab292ce --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_regular.py @@ -0,0 +1,92 @@ +import pytest + +import networkx +import networkx as nx +import networkx.algorithms.regular as reg +import networkx.generators as gen + + +class TestKFactor: + def test_k_factor_trivial(self): + g = gen.cycle_graph(4) + f = reg.k_factor(g, 2) + assert g.edges == f.edges + + def test_k_factor1(self): + g = gen.grid_2d_graph(4, 4) + g_kf = reg.k_factor(g, 2) + for edge in g_kf.edges(): + assert g.has_edge(edge[0], edge[1]) + for _, degree in g_kf.degree(): + assert degree == 2 + + def test_k_factor2(self): + g = gen.complete_graph(6) + g_kf = reg.k_factor(g, 3) + for edge in g_kf.edges(): + assert g.has_edge(edge[0], edge[1]) + for _, degree in g_kf.degree(): + assert degree == 3 + + def test_k_factor3(self): + g = gen.grid_2d_graph(4, 4) + with pytest.raises(nx.NetworkXUnfeasible): + reg.k_factor(g, 3) + + def test_k_factor4(self): + g = gen.lattice.hexagonal_lattice_graph(4, 4) + # Perfect matching doesn't exist for 4,4 hexagonal lattice graph + with pytest.raises(nx.NetworkXUnfeasible): + reg.k_factor(g, 2) + + def test_k_factor5(self): + g = gen.complete_graph(6) + # small k to exercise SmallKGadget + g_kf = reg.k_factor(g, 2) + for edge in g_kf.edges(): + assert g.has_edge(edge[0], edge[1]) + for _, degree in g_kf.degree(): + assert degree == 2 + + +class TestIsRegular: + def test_is_regular1(self): + g = gen.cycle_graph(4) + assert reg.is_regular(g) + + def test_is_regular2(self): + g = gen.complete_graph(5) + assert reg.is_regular(g) + + def test_is_regular3(self): + g = gen.lollipop_graph(5, 5) + assert not reg.is_regular(g) + + def test_is_regular4(self): + g = nx.DiGraph() + g.add_edges_from([(0, 1), (1, 2), (2, 0)]) + assert reg.is_regular(g) + + +def test_is_regular_empty_graph_raises(): + G = nx.Graph() + with pytest.raises(nx.NetworkXPointlessConcept, match="Graph has no nodes"): + nx.is_regular(G) + + +class TestIsKRegular: + def test_is_k_regular1(self): + g = gen.cycle_graph(4) + assert reg.is_k_regular(g, 2) + assert not reg.is_k_regular(g, 3) + + def test_is_k_regular2(self): + g = gen.complete_graph(5) + assert reg.is_k_regular(g, 4) + assert not reg.is_k_regular(g, 3) + assert not reg.is_k_regular(g, 6) + + def test_is_k_regular3(self): + g = gen.lollipop_graph(5, 5) + assert not reg.is_k_regular(g, 5) + assert not reg.is_k_regular(g, 6) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_structuralholes.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_structuralholes.py new file mode 100644 index 0000000000000000000000000000000000000000..1e5952b2347d22f7e25c055426d414ac26632c33 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_structuralholes.py @@ -0,0 +1,137 @@ +"""Unit tests for the :mod:`networkx.algorithms.structuralholes` module.""" + +import math + +import pytest + +import networkx as nx +from networkx.classes.tests import dispatch_interface + + +class TestStructuralHoles: + """Unit tests for computing measures of structural holes. + + The expected values for these functions were originally computed using the + proprietary software `UCINET`_ and the free software `IGraph`_ , and then + computed by hand to make sure that the results are correct. + + .. _UCINET: https://sites.google.com/site/ucinetsoftware/home + .. _IGraph: http://igraph.org/ + + """ + + def setup_method(self): + self.D = nx.DiGraph() + self.D.add_edges_from([(0, 1), (0, 2), (1, 0), (2, 1)]) + self.D_weights = {(0, 1): 2, (0, 2): 2, (1, 0): 1, (2, 1): 1} + # Example from http://www.analytictech.com/connections/v20(1)/holes.htm + self.G = nx.Graph() + self.G.add_edges_from( + [ + ("A", "B"), + ("A", "F"), + ("A", "G"), + ("A", "E"), + ("E", "G"), + ("F", "G"), + ("B", "G"), + ("B", "D"), + ("D", "G"), + ("G", "C"), + ] + ) + self.G_weights = { + ("A", "B"): 2, + ("A", "F"): 3, + ("A", "G"): 5, + ("A", "E"): 2, + ("E", "G"): 8, + ("F", "G"): 3, + ("B", "G"): 4, + ("B", "D"): 1, + ("D", "G"): 3, + ("G", "C"): 10, + } + + def test_constraint_directed(self): + constraint = nx.constraint(self.D) + assert constraint[0] == pytest.approx(1.003, abs=1e-3) + assert constraint[1] == pytest.approx(1.003, abs=1e-3) + assert constraint[2] == pytest.approx(1.389, abs=1e-3) + + def test_effective_size_directed(self): + effective_size = nx.effective_size(self.D) + assert effective_size[0] == pytest.approx(1.167, abs=1e-3) + assert effective_size[1] == pytest.approx(1.167, abs=1e-3) + assert effective_size[2] == pytest.approx(1, abs=1e-3) + + def test_constraint_weighted_directed(self): + D = self.D.copy() + nx.set_edge_attributes(D, self.D_weights, "weight") + constraint = nx.constraint(D, weight="weight") + assert constraint[0] == pytest.approx(0.840, abs=1e-3) + assert constraint[1] == pytest.approx(1.143, abs=1e-3) + assert constraint[2] == pytest.approx(1.378, abs=1e-3) + + def test_effective_size_weighted_directed(self): + D = self.D.copy() + nx.set_edge_attributes(D, self.D_weights, "weight") + effective_size = nx.effective_size(D, weight="weight") + assert effective_size[0] == pytest.approx(1.567, abs=1e-3) + assert effective_size[1] == pytest.approx(1.083, abs=1e-3) + assert effective_size[2] == pytest.approx(1, abs=1e-3) + + def test_constraint_undirected(self): + constraint = nx.constraint(self.G) + assert constraint["G"] == pytest.approx(0.400, abs=1e-3) + assert constraint["A"] == pytest.approx(0.595, abs=1e-3) + assert constraint["C"] == pytest.approx(1, abs=1e-3) + + def test_effective_size_undirected_borgatti(self): + effective_size = nx.effective_size(self.G) + assert effective_size["G"] == pytest.approx(4.67, abs=1e-2) + assert effective_size["A"] == pytest.approx(2.50, abs=1e-2) + assert effective_size["C"] == pytest.approx(1, abs=1e-2) + + def test_effective_size_undirected(self): + G = self.G.copy() + nx.set_edge_attributes(G, 1, "weight") + effective_size = nx.effective_size(G, weight="weight") + assert effective_size["G"] == pytest.approx(4.67, abs=1e-2) + assert effective_size["A"] == pytest.approx(2.50, abs=1e-2) + assert effective_size["C"] == pytest.approx(1, abs=1e-2) + + def test_constraint_weighted_undirected(self): + G = self.G.copy() + nx.set_edge_attributes(G, self.G_weights, "weight") + constraint = nx.constraint(G, weight="weight") + assert constraint["G"] == pytest.approx(0.299, abs=1e-3) + assert constraint["A"] == pytest.approx(0.795, abs=1e-3) + assert constraint["C"] == pytest.approx(1, abs=1e-3) + + def test_effective_size_weighted_undirected(self): + G = self.G.copy() + nx.set_edge_attributes(G, self.G_weights, "weight") + effective_size = nx.effective_size(G, weight="weight") + assert effective_size["G"] == pytest.approx(5.47, abs=1e-2) + assert effective_size["A"] == pytest.approx(2.47, abs=1e-2) + assert effective_size["C"] == pytest.approx(1, abs=1e-2) + + def test_constraint_isolated(self): + G = self.G.copy() + G.add_node(1) + constraint = nx.constraint(G) + assert math.isnan(constraint[1]) + + def test_effective_size_isolated(self): + G = self.G.copy() + G.add_node(1) + nx.set_edge_attributes(G, self.G_weights, "weight") + effective_size = nx.effective_size(G, weight="weight") + assert math.isnan(effective_size[1]) + + def test_effective_size_borgatti_isolated(self): + G = self.G.copy() + G.add_node(1) + effective_size = nx.effective_size(G) + assert math.isnan(effective_size[1]) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_swap.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_swap.py new file mode 100644 index 0000000000000000000000000000000000000000..e765bd5e11496841072990aa792b90ca8772b4d3 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_swap.py @@ -0,0 +1,179 @@ +import pytest + +import networkx as nx + +cycle = nx.cycle_graph(5, create_using=nx.DiGraph) +tree = nx.DiGraph() +tree.add_edges_from(nx.random_labeled_tree(10, seed=42).edges) +path = nx.path_graph(5, create_using=nx.DiGraph) +binomial = nx.binomial_tree(3, create_using=nx.DiGraph) +HH = nx.directed_havel_hakimi_graph([1, 2, 1, 2, 2, 2], [3, 1, 0, 1, 2, 3]) +balanced_tree = nx.balanced_tree(2, 3, create_using=nx.DiGraph) + + +@pytest.mark.parametrize("G", [path, binomial, HH, cycle, tree, balanced_tree]) +def test_directed_edge_swap(G): + in_degree = set(G.in_degree) + out_degree = set(G.out_degree) + edges = set(G.edges) + nx.directed_edge_swap(G, nswap=1, max_tries=100, seed=1) + assert in_degree == set(G.in_degree) + assert out_degree == set(G.out_degree) + assert edges != set(G.edges) + assert 3 == sum(e not in edges for e in G.edges) + + +def test_directed_edge_swap_undo_previous_swap(): + G = nx.DiGraph(nx.path_graph(4).edges) # only 1 swap possible + edges = set(G.edges) + nx.directed_edge_swap(G, nswap=2, max_tries=100) + assert edges == set(G.edges) + + nx.directed_edge_swap(G, nswap=1, max_tries=100, seed=1) + assert {(0, 2), (1, 3), (2, 1)} == set(G.edges) + nx.directed_edge_swap(G, nswap=1, max_tries=100, seed=1) + assert edges == set(G.edges) + + +def test_edge_cases_directed_edge_swap(): + # Tests cases when swaps are impossible, either too few edges exist, or self loops/cycles are unavoidable + # TODO: Rewrite function to explicitly check for impossible swaps and raise error + e = ( + "Maximum number of swap attempts \\(11\\) exceeded " + "before desired swaps achieved \\(\\d\\)." + ) + graph = nx.DiGraph([(0, 0), (0, 1), (1, 0), (2, 3), (3, 2)]) + with pytest.raises(nx.NetworkXAlgorithmError, match=e): + nx.directed_edge_swap(graph, nswap=1, max_tries=10, seed=1) + + +def test_double_edge_swap(): + graph = nx.barabasi_albert_graph(200, 1) + degrees = sorted(d for n, d in graph.degree()) + G = nx.double_edge_swap(graph, 40) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_double_edge_swap_seed(): + graph = nx.barabasi_albert_graph(200, 1) + degrees = sorted(d for n, d in graph.degree()) + G = nx.double_edge_swap(graph, 40, seed=1) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_connected_double_edge_swap(): + graph = nx.barabasi_albert_graph(200, 1) + degrees = sorted(d for n, d in graph.degree()) + G = nx.connected_double_edge_swap(graph, 40, seed=1) + assert nx.is_connected(graph) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_connected_double_edge_swap_low_window_threshold(): + graph = nx.barabasi_albert_graph(200, 1) + degrees = sorted(d for n, d in graph.degree()) + G = nx.connected_double_edge_swap(graph, 40, _window_threshold=0, seed=1) + assert nx.is_connected(graph) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_connected_double_edge_swap_star(): + # Testing ui==xi in connected_double_edge_swap + graph = nx.star_graph(40) + degrees = sorted(d for n, d in graph.degree()) + G = nx.connected_double_edge_swap(graph, 1, seed=4) + assert nx.is_connected(graph) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_connected_double_edge_swap_star_low_window_threshold(): + # Testing ui==xi in connected_double_edge_swap with low window threshold + graph = nx.star_graph(40) + degrees = sorted(d for n, d in graph.degree()) + G = nx.connected_double_edge_swap(graph, 1, _window_threshold=0, seed=4) + assert nx.is_connected(graph) + assert degrees == sorted(d for n, d in graph.degree()) + + +def test_directed_edge_swap_small(): + with pytest.raises(nx.NetworkXError): + G = nx.directed_edge_swap(nx.path_graph(3, create_using=nx.DiGraph)) + + +def test_directed_edge_swap_tries(): + with pytest.raises(nx.NetworkXError): + G = nx.directed_edge_swap( + nx.path_graph(3, create_using=nx.DiGraph), nswap=1, max_tries=0 + ) + + +def test_directed_exception_undirected(): + graph = nx.Graph([(0, 1), (2, 3)]) + with pytest.raises(nx.NetworkXNotImplemented): + G = nx.directed_edge_swap(graph) + + +def test_directed_edge_max_tries(): + with pytest.raises(nx.NetworkXAlgorithmError): + G = nx.directed_edge_swap( + nx.complete_graph(4, nx.DiGraph()), nswap=1, max_tries=5 + ) + + +def test_double_edge_swap_small(): + with pytest.raises(nx.NetworkXError): + G = nx.double_edge_swap(nx.path_graph(3)) + + +def test_double_edge_swap_tries(): + with pytest.raises(nx.NetworkXError): + G = nx.double_edge_swap(nx.path_graph(10), nswap=1, max_tries=0) + + +def test_double_edge_directed(): + graph = nx.DiGraph([(0, 1), (2, 3)]) + with pytest.raises(nx.NetworkXError, match="not defined for directed graphs."): + G = nx.double_edge_swap(graph) + + +def test_double_edge_max_tries(): + with pytest.raises(nx.NetworkXAlgorithmError): + G = nx.double_edge_swap(nx.complete_graph(4), nswap=1, max_tries=5) + + +def test_connected_double_edge_swap_small(): + with pytest.raises(nx.NetworkXError): + G = nx.connected_double_edge_swap(nx.path_graph(3)) + + +def test_connected_double_edge_swap_not_connected(): + with pytest.raises(nx.NetworkXError): + G = nx.path_graph(3) + nx.add_path(G, [10, 11, 12]) + G = nx.connected_double_edge_swap(G) + + +def test_degree_seq_c4(): + G = nx.cycle_graph(4) + degrees = sorted(d for n, d in G.degree()) + G = nx.double_edge_swap(G, 1, 100) + assert degrees == sorted(d for n, d in G.degree()) + + +def test_fewer_than_4_nodes(): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2]) + with pytest.raises(nx.NetworkXError, match=".*fewer than four nodes."): + nx.directed_edge_swap(G) + + +def test_less_than_3_edges(): + G = nx.DiGraph([(0, 1), (1, 2)]) + G.add_nodes_from([3, 4]) + with pytest.raises(nx.NetworkXError, match=".*fewer than 3 edges"): + nx.directed_edge_swap(G) + + G = nx.Graph() + G.add_nodes_from([0, 1, 2, 3]) + with pytest.raises(nx.NetworkXError, match=".*fewer than 2 edges"): + nx.double_edge_swap(G) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_threshold.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_threshold.py new file mode 100644 index 0000000000000000000000000000000000000000..07aad44bb268a42944260b4217bce15b1278ebfd --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_threshold.py @@ -0,0 +1,269 @@ +""" +Threshold Graphs +================ +""" + +import pytest + +import networkx as nx +import networkx.algorithms.threshold as nxt +from networkx.algorithms.isomorphism.isomorph import graph_could_be_isomorphic + +cnlti = nx.convert_node_labels_to_integers + + +class TestGeneratorThreshold: + def test_threshold_sequence_graph_test(self): + G = nx.star_graph(10) + assert nxt.is_threshold_graph(G) + assert nxt.is_threshold_sequence([d for n, d in G.degree()]) + + G = nx.complete_graph(10) + assert nxt.is_threshold_graph(G) + assert nxt.is_threshold_sequence([d for n, d in G.degree()]) + + deg = [3, 2, 2, 1, 1, 1] + assert not nxt.is_threshold_sequence(deg) + + deg = [3, 2, 2, 1] + assert nxt.is_threshold_sequence(deg) + + G = nx.generators.havel_hakimi_graph(deg) + assert nxt.is_threshold_graph(G) + + def test_creation_sequences(self): + deg = [3, 2, 2, 1] + G = nx.generators.havel_hakimi_graph(deg) + + with pytest.raises(ValueError): + nxt.creation_sequence(deg, with_labels=True, compact=True) + + cs0 = nxt.creation_sequence(deg) + H0 = nxt.threshold_graph(cs0) + assert "".join(cs0) == "ddid" + + cs1 = nxt.creation_sequence(deg, with_labels=True) + H1 = nxt.threshold_graph(cs1) + assert cs1 == [(1, "d"), (2, "d"), (3, "i"), (0, "d")] + + cs2 = nxt.creation_sequence(deg, compact=True) + H2 = nxt.threshold_graph(cs2) + assert cs2 == [2, 1, 1] + assert "".join(nxt.uncompact(cs2)) == "ddid" + assert graph_could_be_isomorphic(H0, G) + assert graph_could_be_isomorphic(H0, H1) + assert graph_could_be_isomorphic(H0, H2) + + def test_make_compact(self): + assert nxt.make_compact(["d", "d", "d", "i", "d", "d"]) == [3, 1, 2] + assert nxt.make_compact([3, 1, 2]) == [3, 1, 2] + assert pytest.raises(TypeError, nxt.make_compact, [3.0, 1.0, 2.0]) + + def test_uncompact(self): + assert nxt.uncompact([3, 1, 2]) == ["d", "d", "d", "i", "d", "d"] + assert nxt.uncompact(["d", "d", "i", "d"]) == ["d", "d", "i", "d"] + assert nxt.uncompact( + nxt.uncompact([(1, "d"), (2, "d"), (3, "i"), (0, "d")]) + ) == nxt.uncompact([(1, "d"), (2, "d"), (3, "i"), (0, "d")]) + assert pytest.raises(TypeError, nxt.uncompact, [3.0, 1.0, 2.0]) + + def test_creation_sequence_to_weights(self): + assert nxt.creation_sequence_to_weights([3, 1, 2]) == [ + 0.5, + 0.5, + 0.5, + 0.25, + 0.75, + 0.75, + ] + assert pytest.raises( + TypeError, nxt.creation_sequence_to_weights, [3.0, 1.0, 2.0] + ) + + def test_weights_to_creation_sequence(self): + deg = [3, 2, 2, 1] + with pytest.raises(ValueError): + nxt.weights_to_creation_sequence(deg, with_labels=True, compact=True) + assert nxt.weights_to_creation_sequence(deg, with_labels=True) == [ + (3, "d"), + (1, "d"), + (2, "d"), + (0, "d"), + ] + assert nxt.weights_to_creation_sequence(deg, compact=True) == [4] + + def test_find_alternating_4_cycle(self): + G = nx.Graph() + G.add_edge(1, 2) + assert not nxt.find_alternating_4_cycle(G) + + def test_shortest_path(self): + deg = [3, 2, 2, 1] + G = nx.generators.havel_hakimi_graph(deg) + cs1 = nxt.creation_sequence(deg, with_labels=True) + for n, m in [(3, 0), (0, 3), (0, 2), (0, 1), (1, 3), (3, 1), (1, 2), (2, 3)]: + assert nxt.shortest_path(cs1, n, m) == nx.shortest_path(G, n, m) + + spl = nxt.shortest_path_length(cs1, 3) + spl2 = nxt.shortest_path_length([t for v, t in cs1], 2) + assert spl == spl2 + + spld = {} + for j, pl in enumerate(spl): + n = cs1[j][0] + spld[n] = pl + assert spld == nx.single_source_shortest_path_length(G, 3) + + assert nxt.shortest_path(["d", "d", "d", "i", "d", "d"], 1, 2) == [1, 2] + assert nxt.shortest_path([3, 1, 2], 1, 2) == [1, 2] + assert pytest.raises(TypeError, nxt.shortest_path, [3.0, 1.0, 2.0], 1, 2) + assert pytest.raises(ValueError, nxt.shortest_path, [3, 1, 2], "a", 2) + assert pytest.raises(ValueError, nxt.shortest_path, [3, 1, 2], 1, "b") + assert nxt.shortest_path([3, 1, 2], 1, 1) == [1] + + def test_shortest_path_length(self): + assert nxt.shortest_path_length([3, 1, 2], 1) == [1, 0, 1, 2, 1, 1] + assert nxt.shortest_path_length(["d", "d", "d", "i", "d", "d"], 1) == [ + 1, + 0, + 1, + 2, + 1, + 1, + ] + assert nxt.shortest_path_length(("d", "d", "d", "i", "d", "d"), 1) == [ + 1, + 0, + 1, + 2, + 1, + 1, + ] + assert pytest.raises(TypeError, nxt.shortest_path, [3.0, 1.0, 2.0], 1) + + def test_random_threshold_sequence(self): + assert len(nxt.random_threshold_sequence(10, 0.5)) == 10 + assert nxt.random_threshold_sequence(10, 0.5, seed=42) == [ + "d", + "i", + "d", + "d", + "d", + "i", + "i", + "i", + "d", + "d", + ] + assert pytest.raises(ValueError, nxt.random_threshold_sequence, 10, 1.5) + + def test_right_d_threshold_sequence(self): + assert nxt.right_d_threshold_sequence(3, 2) == ["d", "i", "d"] + assert pytest.raises(ValueError, nxt.right_d_threshold_sequence, 2, 3) + + def test_left_d_threshold_sequence(self): + assert nxt.left_d_threshold_sequence(3, 2) == ["d", "i", "d"] + assert pytest.raises(ValueError, nxt.left_d_threshold_sequence, 2, 3) + + def test_weights_thresholds(self): + wseq = [3, 4, 3, 3, 5, 6, 5, 4, 5, 6] + cs = nxt.weights_to_creation_sequence(wseq, threshold=10) + wseq = nxt.creation_sequence_to_weights(cs) + cs2 = nxt.weights_to_creation_sequence(wseq) + assert cs == cs2 + + wseq = nxt.creation_sequence_to_weights(nxt.uncompact([3, 1, 2, 3, 3, 2, 3])) + assert wseq == [ + s * 0.125 for s in [4, 4, 4, 3, 5, 5, 2, 2, 2, 6, 6, 6, 1, 1, 7, 7, 7] + ] + + wseq = nxt.creation_sequence_to_weights([3, 1, 2, 3, 3, 2, 3]) + assert wseq == [ + s * 0.125 for s in [4, 4, 4, 3, 5, 5, 2, 2, 2, 6, 6, 6, 1, 1, 7, 7, 7] + ] + + wseq = nxt.creation_sequence_to_weights(list(enumerate("ddidiiidididi"))) + assert wseq == [s * 0.1 for s in [5, 5, 4, 6, 3, 3, 3, 7, 2, 8, 1, 9, 0]] + + wseq = nxt.creation_sequence_to_weights("ddidiiidididi") + assert wseq == [s * 0.1 for s in [5, 5, 4, 6, 3, 3, 3, 7, 2, 8, 1, 9, 0]] + + wseq = nxt.creation_sequence_to_weights("ddidiiidididid") + ws = [s / 12 for s in [6, 6, 5, 7, 4, 4, 4, 8, 3, 9, 2, 10, 1, 11]] + assert sum(abs(c - d) for c, d in zip(wseq, ws)) < 1e-14 + + def test_finding_routines(self): + G = nx.Graph({1: [2], 2: [3], 3: [4], 4: [5], 5: [6]}) + G.add_edge(2, 4) + G.add_edge(2, 5) + G.add_edge(2, 7) + G.add_edge(3, 6) + G.add_edge(4, 6) + + # Alternating 4 cycle + assert nxt.find_alternating_4_cycle(G) == [1, 2, 3, 6] + + # Threshold graph + TG = nxt.find_threshold_graph(G) + assert nxt.is_threshold_graph(TG) + assert sorted(TG.nodes()) == [1, 2, 3, 4, 5, 7] + + cs = nxt.creation_sequence(dict(TG.degree()), with_labels=True) + assert nxt.find_creation_sequence(G) == cs + + def test_fast_versions_properties_threshold_graphs(self): + cs = "ddiiddid" + G = nxt.threshold_graph(cs) + assert nxt.density("ddiiddid") == nx.density(G) + assert sorted(nxt.degree_sequence(cs)) == sorted(d for n, d in G.degree()) + + ts = nxt.triangle_sequence(cs) + assert ts == list(nx.triangles(G).values()) + assert sum(ts) // 3 == nxt.triangles(cs) + + c1 = nxt.cluster_sequence(cs) + c2 = list(nx.clustering(G).values()) + assert sum(abs(c - d) for c, d in zip(c1, c2)) == pytest.approx(0, abs=1e-7) + + b1 = nx.betweenness_centrality(G).values() + b2 = nxt.betweenness_sequence(cs) + assert sum(abs(c - d) for c, d in zip(b1, b2)) < 1e-7 + + assert nxt.eigenvalues(cs) == [0, 1, 3, 3, 5, 7, 7, 8] + + # Degree Correlation + assert abs(nxt.degree_correlation(cs) + 0.593038821954) < 1e-12 + assert nxt.degree_correlation("diiiddi") == -0.8 + assert nxt.degree_correlation("did") == -1.0 + assert nxt.degree_correlation("ddd") == 1.0 + assert nxt.eigenvalues("dddiii") == [0, 0, 0, 0, 3, 3] + assert nxt.eigenvalues("dddiiid") == [0, 1, 1, 1, 4, 4, 7] + + def test_tg_creation_routines(self): + s = nxt.left_d_threshold_sequence(5, 7) + s = nxt.right_d_threshold_sequence(5, 7) + s1 = nxt.swap_d(s, 1.0, 1.0) + s1 = nxt.swap_d(s, 1.0, 1.0, seed=1) + + def test_eigenvectors(self): + np = pytest.importorskip("numpy") + eigenval = np.linalg.eigvals + pytest.importorskip("scipy") + + cs = "ddiiddid" + G = nxt.threshold_graph(cs) + (tgeval, tgevec) = nxt.eigenvectors(cs) + np.testing.assert_allclose([np.dot(lv, lv) for lv in tgevec], 1.0, rtol=1e-9) + lapl = nx.laplacian_matrix(G) + + def test_create_using(self): + cs = "ddiiddid" + G = nxt.threshold_graph(cs) + assert pytest.raises( + nx.exception.NetworkXError, + nxt.threshold_graph, + cs, + create_using=nx.DiGraph(), + ) + MG = nxt.threshold_graph(cs, create_using=nx.MultiGraph()) + assert sorted(MG.edges()) == sorted(G.edges()) diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_time_dependent.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_time_dependent.py new file mode 100644 index 0000000000000000000000000000000000000000..1e256f4bc69389464cfa164f209bc2db713b79ee --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_time_dependent.py @@ -0,0 +1,431 @@ +"""Unit testing for time dependent algorithms.""" + +from datetime import datetime, timedelta + +import pytest + +import networkx as nx + +_delta = timedelta(days=5 * 365) + + +class TestCdIndex: + """Unit testing for the cd index function.""" + + def test_common_graph(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 1) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(1997, 1, 1)}, + 6: {"time": datetime(1998, 1, 1)}, + 7: {"time": datetime(1999, 1, 1)}, + 8: {"time": datetime(1999, 1, 1)}, + 9: {"time": datetime(1998, 1, 1)}, + 10: {"time": datetime(1997, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 4, time_delta=_delta) == 0.17 + + def test_common_graph_with_given_attributes(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 1) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"date": datetime(1992, 1, 1)}, + 1: {"date": datetime(1992, 1, 1)}, + 2: {"date": datetime(1993, 1, 1)}, + 3: {"date": datetime(1993, 1, 1)}, + 4: {"date": datetime(1995, 1, 1)}, + 5: {"date": datetime(1997, 1, 1)}, + 6: {"date": datetime(1998, 1, 1)}, + 7: {"date": datetime(1999, 1, 1)}, + 8: {"date": datetime(1999, 1, 1)}, + 9: {"date": datetime(1998, 1, 1)}, + 10: {"date": datetime(1997, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 4, time_delta=_delta, time="date") == 0.17 + + def test_common_graph_with_int_attributes(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 1) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": 20}, + 1: {"time": 20}, + 2: {"time": 30}, + 3: {"time": 30}, + 4: {"time": 50}, + 5: {"time": 70}, + 6: {"time": 80}, + 7: {"time": 90}, + 8: {"time": 90}, + 9: {"time": 80}, + 10: {"time": 74}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 4, time_delta=50) == 0.17 + + def test_common_graph_with_float_attributes(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 1) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": 20.2}, + 1: {"time": 20.2}, + 2: {"time": 30.7}, + 3: {"time": 30.7}, + 4: {"time": 50.9}, + 5: {"time": 70.1}, + 6: {"time": 80.6}, + 7: {"time": 90.7}, + 8: {"time": 90.7}, + 9: {"time": 80.6}, + 10: {"time": 74.2}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 4, time_delta=50) == 0.17 + + def test_common_graph_with_weights(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 1) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(1997, 1, 1)}, + 6: {"time": datetime(1998, 1, 1), "weight": 5}, + 7: {"time": datetime(1999, 1, 1), "weight": 2}, + 8: {"time": datetime(1999, 1, 1), "weight": 6}, + 9: {"time": datetime(1998, 1, 1), "weight": 3}, + 10: {"time": datetime(1997, 4, 1), "weight": 10}, + } + + nx.set_node_attributes(G, node_attrs) + assert nx.cd_index(G, 4, time_delta=_delta, weight="weight") == 0.04 + + def test_node_with_no_predecessors(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(2005, 1, 1)}, + 6: {"time": datetime(2010, 1, 1)}, + 7: {"time": datetime(2001, 1, 1)}, + 8: {"time": datetime(2020, 1, 1)}, + 9: {"time": datetime(2017, 1, 1)}, + 10: {"time": datetime(2004, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + assert nx.cd_index(G, 4, time_delta=_delta) == 0.0 + + def test_node_with_no_successors(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(8, 2) + G.add_edge(6, 0) + G.add_edge(6, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(1997, 1, 1)}, + 6: {"time": datetime(1998, 1, 1)}, + 7: {"time": datetime(1999, 1, 1)}, + 8: {"time": datetime(1999, 1, 1)}, + 9: {"time": datetime(1998, 1, 1)}, + 10: {"time": datetime(1997, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + assert nx.cd_index(G, 4, time_delta=_delta) == 1.0 + + def test_n_equals_zero(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 3) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(2005, 1, 1)}, + 6: {"time": datetime(2010, 1, 1)}, + 7: {"time": datetime(2001, 1, 1)}, + 8: {"time": datetime(2020, 1, 1)}, + 9: {"time": datetime(2017, 1, 1)}, + 10: {"time": datetime(2004, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + with pytest.raises( + nx.NetworkXError, match="The cd index cannot be defined." + ) as ve: + nx.cd_index(G, 4, time_delta=_delta) + + def test_time_timedelta_compatibility(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(4, 2) + G.add_edge(4, 0) + G.add_edge(4, 3) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": 20.2}, + 1: {"time": 20.2}, + 2: {"time": 30.7}, + 3: {"time": 30.7}, + 4: {"time": 50.9}, + 5: {"time": 70.1}, + 6: {"time": 80.6}, + 7: {"time": 90.7}, + 8: {"time": 90.7}, + 9: {"time": 80.6}, + 10: {"time": 74.2}, + } + + nx.set_node_attributes(G, node_attrs) + + with pytest.raises( + nx.NetworkXError, + match="Addition and comparison are not supported between", + ) as ve: + nx.cd_index(G, 4, time_delta=_delta) + + def test_node_with_no_time(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10]) + G.add_edge(8, 2) + G.add_edge(6, 0) + G.add_edge(6, 3) + G.add_edge(5, 2) + G.add_edge(6, 2) + G.add_edge(6, 4) + G.add_edge(7, 4) + G.add_edge(8, 4) + G.add_edge(9, 4) + G.add_edge(9, 1) + G.add_edge(9, 3) + G.add_edge(10, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 6: {"time": datetime(1998, 1, 1)}, + 7: {"time": datetime(1999, 1, 1)}, + 8: {"time": datetime(1999, 1, 1)}, + 9: {"time": datetime(1998, 1, 1)}, + 10: {"time": datetime(1997, 4, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + with pytest.raises( + nx.NetworkXError, match="Not all nodes have a 'time' attribute." + ) as ve: + nx.cd_index(G, 4, time_delta=_delta) + + def test_maximally_consolidating(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) + G.add_edge(5, 1) + G.add_edge(5, 2) + G.add_edge(5, 3) + G.add_edge(5, 4) + G.add_edge(6, 1) + G.add_edge(6, 5) + G.add_edge(7, 1) + G.add_edge(7, 5) + G.add_edge(8, 2) + G.add_edge(8, 5) + G.add_edge(9, 5) + G.add_edge(9, 3) + G.add_edge(10, 5) + G.add_edge(10, 3) + G.add_edge(10, 4) + G.add_edge(11, 5) + G.add_edge(11, 4) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(1997, 1, 1)}, + 6: {"time": datetime(1998, 1, 1)}, + 7: {"time": datetime(1999, 1, 1)}, + 8: {"time": datetime(1999, 1, 1)}, + 9: {"time": datetime(1998, 1, 1)}, + 10: {"time": datetime(1997, 4, 1)}, + 11: {"time": datetime(1998, 5, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 5, time_delta=_delta) == -1 + + def test_maximally_destabilizing(self): + G = nx.DiGraph() + G.add_nodes_from([0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) + G.add_edge(5, 1) + G.add_edge(5, 2) + G.add_edge(5, 3) + G.add_edge(5, 4) + G.add_edge(6, 5) + G.add_edge(7, 5) + G.add_edge(8, 5) + G.add_edge(9, 5) + G.add_edge(10, 5) + G.add_edge(11, 5) + + node_attrs = { + 0: {"time": datetime(1992, 1, 1)}, + 1: {"time": datetime(1992, 1, 1)}, + 2: {"time": datetime(1993, 1, 1)}, + 3: {"time": datetime(1993, 1, 1)}, + 4: {"time": datetime(1995, 1, 1)}, + 5: {"time": datetime(1997, 1, 1)}, + 6: {"time": datetime(1998, 1, 1)}, + 7: {"time": datetime(1999, 1, 1)}, + 8: {"time": datetime(1999, 1, 1)}, + 9: {"time": datetime(1998, 1, 1)}, + 10: {"time": datetime(1997, 4, 1)}, + 11: {"time": datetime(1998, 5, 1)}, + } + + nx.set_node_attributes(G, node_attrs) + + assert nx.cd_index(G, 5, time_delta=_delta) == 1 diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_vitality.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_vitality.py new file mode 100644 index 0000000000000000000000000000000000000000..248206e670fa911f62177bb6727d6a7a6df1e6b9 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_vitality.py @@ -0,0 +1,41 @@ +import networkx as nx + + +class TestClosenessVitality: + def test_unweighted(self): + G = nx.cycle_graph(3) + vitality = nx.closeness_vitality(G) + assert vitality == {0: 2, 1: 2, 2: 2} + + def test_weighted(self): + G = nx.Graph() + nx.add_cycle(G, [0, 1, 2], weight=2) + vitality = nx.closeness_vitality(G, weight="weight") + assert vitality == {0: 4, 1: 4, 2: 4} + + def test_unweighted_digraph(self): + G = nx.DiGraph(nx.cycle_graph(3)) + vitality = nx.closeness_vitality(G) + assert vitality == {0: 4, 1: 4, 2: 4} + + def test_weighted_digraph(self): + G = nx.DiGraph() + nx.add_cycle(G, [0, 1, 2], weight=2) + nx.add_cycle(G, [2, 1, 0], weight=2) + vitality = nx.closeness_vitality(G, weight="weight") + assert vitality == {0: 8, 1: 8, 2: 8} + + def test_weighted_multidigraph(self): + G = nx.MultiDiGraph() + nx.add_cycle(G, [0, 1, 2], weight=2) + nx.add_cycle(G, [2, 1, 0], weight=2) + vitality = nx.closeness_vitality(G, weight="weight") + assert vitality == {0: 8, 1: 8, 2: 8} + + def test_disconnecting_graph(self): + """Tests that the closeness vitality of a node whose removal + disconnects the graph is negative infinity. + + """ + G = nx.path_graph(3) + assert nx.closeness_vitality(G, node=1) == -float("inf") diff --git a/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_voronoi.py b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_voronoi.py new file mode 100644 index 0000000000000000000000000000000000000000..3269ae62a023ff0cf9fdc55122cb6e7c8d2ba319 --- /dev/null +++ b/mplug_owl2/lib/python3.10/site-packages/networkx/algorithms/tests/test_voronoi.py @@ -0,0 +1,103 @@ +import networkx as nx +from networkx.utils import pairwise + + +class TestVoronoiCells: + """Unit tests for the Voronoi cells function.""" + + def test_isolates(self): + """Tests that a graph with isolated nodes has all isolates in + one block of the partition. + + """ + G = nx.empty_graph(5) + cells = nx.voronoi_cells(G, {0, 2, 4}) + expected = {0: {0}, 2: {2}, 4: {4}, "unreachable": {1, 3}} + assert expected == cells + + def test_undirected_unweighted(self): + G = nx.cycle_graph(6) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0, 1, 5}, 3: {2, 3, 4}} + assert expected == cells + + def test_directed_unweighted(self): + # This is the singly-linked directed cycle graph on six nodes. + G = nx.DiGraph(pairwise(range(6), cyclic=True)) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0, 1, 2}, 3: {3, 4, 5}} + assert expected == cells + + def test_directed_inward(self): + """Tests that reversing the graph gives the "inward" Voronoi + partition. + + """ + # This is the singly-linked reverse directed cycle graph on six nodes. + G = nx.DiGraph(pairwise(range(6), cyclic=True)) + G = G.reverse(copy=False) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0, 4, 5}, 3: {1, 2, 3}} + assert expected == cells + + def test_undirected_weighted(self): + edges = [(0, 1, 10), (1, 2, 1), (2, 3, 1)] + G = nx.Graph() + G.add_weighted_edges_from(edges) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0}, 3: {1, 2, 3}} + assert expected == cells + + def test_directed_weighted(self): + edges = [(0, 1, 10), (1, 2, 1), (2, 3, 1), (3, 2, 1), (2, 1, 1)] + G = nx.DiGraph() + G.add_weighted_edges_from(edges) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0}, 3: {1, 2, 3}} + assert expected == cells + + def test_multigraph_unweighted(self): + """Tests that the Voronoi cells for a multigraph are the same as + for a simple graph. + + """ + edges = [(0, 1), (1, 2), (2, 3)] + G = nx.MultiGraph(2 * edges) + H = nx.Graph(G) + G_cells = nx.voronoi_cells(G, {0, 3}) + H_cells = nx.voronoi_cells(H, {0, 3}) + assert G_cells == H_cells + + def test_multidigraph_unweighted(self): + # This is the twice-singly-linked directed cycle graph on six nodes. + edges = list(pairwise(range(6), cyclic=True)) + G = nx.MultiDiGraph(2 * edges) + H = nx.DiGraph(G) + G_cells = nx.voronoi_cells(G, {0, 3}) + H_cells = nx.voronoi_cells(H, {0, 3}) + assert G_cells == H_cells + + def test_multigraph_weighted(self): + edges = [(0, 1, 10), (0, 1, 10), (1, 2, 1), (1, 2, 100), (2, 3, 1), (2, 3, 100)] + G = nx.MultiGraph() + G.add_weighted_edges_from(edges) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0}, 3: {1, 2, 3}} + assert expected == cells + + def test_multidigraph_weighted(self): + edges = [ + (0, 1, 10), + (0, 1, 10), + (1, 2, 1), + (2, 3, 1), + (3, 2, 10), + (3, 2, 1), + (2, 1, 10), + (2, 1, 1), + ] + G = nx.MultiDiGraph() + G.add_weighted_edges_from(edges) + cells = nx.voronoi_cells(G, {0, 3}) + expected = {0: {0}, 3: {1, 2, 3}} + assert expected == cells diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_add_newdocs_scalars.py b/pllava/lib/python3.10/site-packages/numpy/core/_add_newdocs_scalars.py new file mode 100644 index 0000000000000000000000000000000000000000..f9a6ad963ec3c04d4e6c9dd57255b323e2959cfe --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_add_newdocs_scalars.py @@ -0,0 +1,372 @@ +""" +This file is separate from ``_add_newdocs.py`` so that it can be mocked out by +our sphinx ``conf.py`` during doc builds, where we want to avoid showing +platform-dependent information. +""" +import sys +import os +from numpy.core import dtype +from numpy.core import numerictypes as _numerictypes +from numpy.core.function_base import add_newdoc + +############################################################################## +# +# Documentation for concrete scalar classes +# +############################################################################## + +def numeric_type_aliases(aliases): + def type_aliases_gen(): + for alias, doc in aliases: + try: + alias_type = getattr(_numerictypes, alias) + except AttributeError: + # The set of aliases that actually exist varies between platforms + pass + else: + yield (alias_type, alias, doc) + return list(type_aliases_gen()) + + +possible_aliases = numeric_type_aliases([ + ('int8', '8-bit signed integer (``-128`` to ``127``)'), + ('int16', '16-bit signed integer (``-32_768`` to ``32_767``)'), + ('int32', '32-bit signed integer (``-2_147_483_648`` to ``2_147_483_647``)'), + ('int64', '64-bit signed integer (``-9_223_372_036_854_775_808`` to ``9_223_372_036_854_775_807``)'), + ('intp', 'Signed integer large enough to fit pointer, compatible with C ``intptr_t``'), + ('uint8', '8-bit unsigned integer (``0`` to ``255``)'), + ('uint16', '16-bit unsigned integer (``0`` to ``65_535``)'), + ('uint32', '32-bit unsigned integer (``0`` to ``4_294_967_295``)'), + ('uint64', '64-bit unsigned integer (``0`` to ``18_446_744_073_709_551_615``)'), + ('uintp', 'Unsigned integer large enough to fit pointer, compatible with C ``uintptr_t``'), + ('float16', '16-bit-precision floating-point number type: sign bit, 5 bits exponent, 10 bits mantissa'), + ('float32', '32-bit-precision floating-point number type: sign bit, 8 bits exponent, 23 bits mantissa'), + ('float64', '64-bit precision floating-point number type: sign bit, 11 bits exponent, 52 bits mantissa'), + ('float96', '96-bit extended-precision floating-point number type'), + ('float128', '128-bit extended-precision floating-point number type'), + ('complex64', 'Complex number type composed of 2 32-bit-precision floating-point numbers'), + ('complex128', 'Complex number type composed of 2 64-bit-precision floating-point numbers'), + ('complex192', 'Complex number type composed of 2 96-bit extended-precision floating-point numbers'), + ('complex256', 'Complex number type composed of 2 128-bit extended-precision floating-point numbers'), + ]) + + +def _get_platform_and_machine(): + try: + system, _, _, _, machine = os.uname() + except AttributeError: + system = sys.platform + if system == 'win32': + machine = os.environ.get('PROCESSOR_ARCHITEW6432', '') \ + or os.environ.get('PROCESSOR_ARCHITECTURE', '') + else: + machine = 'unknown' + return system, machine + + +_system, _machine = _get_platform_and_machine() +_doc_alias_string = f":Alias on this platform ({_system} {_machine}):" + + +def add_newdoc_for_scalar_type(obj, fixed_aliases, doc): + # note: `:field: value` is rST syntax which renders as field lists. + o = getattr(_numerictypes, obj) + + character_code = dtype(o).char + canonical_name_doc = "" if obj == o.__name__ else \ + f":Canonical name: `numpy.{obj}`\n " + if fixed_aliases: + alias_doc = ''.join(f":Alias: `numpy.{alias}`\n " + for alias in fixed_aliases) + else: + alias_doc = '' + alias_doc += ''.join(f"{_doc_alias_string} `numpy.{alias}`: {doc}.\n " + for (alias_type, alias, doc) in possible_aliases if alias_type is o) + + docstring = f""" + {doc.strip()} + + :Character code: ``'{character_code}'`` + {canonical_name_doc}{alias_doc} + """ + + add_newdoc('numpy.core.numerictypes', obj, docstring) + + +add_newdoc_for_scalar_type('bool_', [], + """ + Boolean type (True or False), stored as a byte. + + .. warning:: + + The :class:`bool_` type is not a subclass of the :class:`int_` type + (the :class:`bool_` is not even a number type). This is different + than Python's default implementation of :class:`bool` as a + sub-class of :class:`int`. + """) + +add_newdoc_for_scalar_type('byte', [], + """ + Signed integer type, compatible with C ``char``. + """) + +add_newdoc_for_scalar_type('short', [], + """ + Signed integer type, compatible with C ``short``. + """) + +add_newdoc_for_scalar_type('intc', [], + """ + Signed integer type, compatible with C ``int``. + """) + +add_newdoc_for_scalar_type('int_', [], + """ + Signed integer type, compatible with Python `int` and C ``long``. + """) + +add_newdoc_for_scalar_type('longlong', [], + """ + Signed integer type, compatible with C ``long long``. + """) + +add_newdoc_for_scalar_type('ubyte', [], + """ + Unsigned integer type, compatible with C ``unsigned char``. + """) + +add_newdoc_for_scalar_type('ushort', [], + """ + Unsigned integer type, compatible with C ``unsigned short``. + """) + +add_newdoc_for_scalar_type('uintc', [], + """ + Unsigned integer type, compatible with C ``unsigned int``. + """) + +add_newdoc_for_scalar_type('uint', [], + """ + Unsigned integer type, compatible with C ``unsigned long``. + """) + +add_newdoc_for_scalar_type('ulonglong', [], + """ + Signed integer type, compatible with C ``unsigned long long``. + """) + +add_newdoc_for_scalar_type('half', [], + """ + Half-precision floating-point number type. + """) + +add_newdoc_for_scalar_type('single', [], + """ + Single-precision floating-point number type, compatible with C ``float``. + """) + +add_newdoc_for_scalar_type('double', ['float_'], + """ + Double-precision floating-point number type, compatible with Python `float` + and C ``double``. + """) + +add_newdoc_for_scalar_type('longdouble', ['longfloat'], + """ + Extended-precision floating-point number type, compatible with C + ``long double`` but not necessarily with IEEE 754 quadruple-precision. + """) + +add_newdoc_for_scalar_type('csingle', ['singlecomplex'], + """ + Complex number type composed of two single-precision floating-point + numbers. + """) + +add_newdoc_for_scalar_type('cdouble', ['cfloat', 'complex_'], + """ + Complex number type composed of two double-precision floating-point + numbers, compatible with Python `complex`. + """) + +add_newdoc_for_scalar_type('clongdouble', ['clongfloat', 'longcomplex'], + """ + Complex number type composed of two extended-precision floating-point + numbers. + """) + +add_newdoc_for_scalar_type('object_', [], + """ + Any Python object. + """) + +add_newdoc_for_scalar_type('str_', ['unicode_'], + r""" + A unicode string. + + This type strips trailing null codepoints. + + >>> s = np.str_("abc\x00") + >>> s + 'abc' + + Unlike the builtin `str`, this supports the :ref:`python:bufferobjects`, exposing its + contents as UCS4: + + >>> m = memoryview(np.str_("abc")) + >>> m.format + '3w' + >>> m.tobytes() + b'a\x00\x00\x00b\x00\x00\x00c\x00\x00\x00' + """) + +add_newdoc_for_scalar_type('bytes_', ['string_'], + r""" + A byte string. + + When used in arrays, this type strips trailing null bytes. + """) + +add_newdoc_for_scalar_type('void', [], + r""" + np.void(length_or_data, /, dtype=None) + + Create a new structured or unstructured void scalar. + + Parameters + ---------- + length_or_data : int, array-like, bytes-like, object + One of multiple meanings (see notes). The length or + bytes data of an unstructured void. Or alternatively, + the data to be stored in the new scalar when `dtype` + is provided. + This can be an array-like, in which case an array may + be returned. + dtype : dtype, optional + If provided the dtype of the new scalar. This dtype must + be "void" dtype (i.e. a structured or unstructured void, + see also :ref:`defining-structured-types`). + + ..versionadded:: 1.24 + + Notes + ----- + For historical reasons and because void scalars can represent both + arbitrary byte data and structured dtypes, the void constructor + has three calling conventions: + + 1. ``np.void(5)`` creates a ``dtype="V5"`` scalar filled with five + ``\0`` bytes. The 5 can be a Python or NumPy integer. + 2. ``np.void(b"bytes-like")`` creates a void scalar from the byte string. + The dtype itemsize will match the byte string length, here ``"V10"``. + 3. When a ``dtype=`` is passed the call is roughly the same as an + array creation. However, a void scalar rather than array is returned. + + Please see the examples which show all three different conventions. + + Examples + -------- + >>> np.void(5) + void(b'\x00\x00\x00\x00\x00') + >>> np.void(b'abcd') + void(b'\x61\x62\x63\x64') + >>> np.void((5, 3.2, "eggs"), dtype="i,d,S5") + (5, 3.2, b'eggs') # looks like a tuple, but is `np.void` + >>> np.void(3, dtype=[('x', np.int8), ('y', np.int8)]) + (3, 3) # looks like a tuple, but is `np.void` + + """) + +add_newdoc_for_scalar_type('datetime64', [], + """ + If created from a 64-bit integer, it represents an offset from + ``1970-01-01T00:00:00``. + If created from string, the string can be in ISO 8601 date + or datetime format. + + >>> np.datetime64(10, 'Y') + numpy.datetime64('1980') + >>> np.datetime64('1980', 'Y') + numpy.datetime64('1980') + >>> np.datetime64(10, 'D') + numpy.datetime64('1970-01-11') + + See :ref:`arrays.datetime` for more information. + """) + +add_newdoc_for_scalar_type('timedelta64', [], + """ + A timedelta stored as a 64-bit integer. + + See :ref:`arrays.datetime` for more information. + """) + +add_newdoc('numpy.core.numerictypes', "integer", ('is_integer', + """ + integer.is_integer() -> bool + + Return ``True`` if the number is finite with integral value. + + .. versionadded:: 1.22 + + Examples + -------- + >>> np.int64(-2).is_integer() + True + >>> np.uint32(5).is_integer() + True + """)) + +# TODO: work out how to put this on the base class, np.floating +for float_name in ('half', 'single', 'double', 'longdouble'): + add_newdoc('numpy.core.numerictypes', float_name, ('as_integer_ratio', + """ + {ftype}.as_integer_ratio() -> (int, int) + + Return a pair of integers, whose ratio is exactly equal to the original + floating point number, and with a positive denominator. + Raise `OverflowError` on infinities and a `ValueError` on NaNs. + + >>> np.{ftype}(10.0).as_integer_ratio() + (10, 1) + >>> np.{ftype}(0.0).as_integer_ratio() + (0, 1) + >>> np.{ftype}(-.25).as_integer_ratio() + (-1, 4) + """.format(ftype=float_name))) + + add_newdoc('numpy.core.numerictypes', float_name, ('is_integer', + f""" + {float_name}.is_integer() -> bool + + Return ``True`` if the floating point number is finite with integral + value, and ``False`` otherwise. + + .. versionadded:: 1.22 + + Examples + -------- + >>> np.{float_name}(-2.0).is_integer() + True + >>> np.{float_name}(3.2).is_integer() + False + """)) + +for int_name in ('int8', 'uint8', 'int16', 'uint16', 'int32', 'uint32', + 'int64', 'uint64', 'int64', 'uint64', 'int64', 'uint64'): + # Add negative examples for signed cases by checking typecode + add_newdoc('numpy.core.numerictypes', int_name, ('bit_count', + f""" + {int_name}.bit_count() -> int + + Computes the number of 1-bits in the absolute value of the input. + Analogous to the builtin `int.bit_count` or ``popcount`` in C++. + + Examples + -------- + >>> np.{int_name}(127).bit_count() + 7""" + + (f""" + >>> np.{int_name}(-127).bit_count() + 7 + """ if dtype(int_name).char.islower() else ""))) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_asarray.py b/pllava/lib/python3.10/site-packages/numpy/core/_asarray.py new file mode 100644 index 0000000000000000000000000000000000000000..a9abc5a88ca38cf248996db806f789bb49b5f68b --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_asarray.py @@ -0,0 +1,134 @@ +""" +Functions in the ``as*array`` family that promote array-likes into arrays. + +`require` fits this category despite its name not matching this pattern. +""" +from .overrides import ( + array_function_dispatch, + set_array_function_like_doc, + set_module, +) +from .multiarray import array, asanyarray + + +__all__ = ["require"] + + +POSSIBLE_FLAGS = { + 'C': 'C', 'C_CONTIGUOUS': 'C', 'CONTIGUOUS': 'C', + 'F': 'F', 'F_CONTIGUOUS': 'F', 'FORTRAN': 'F', + 'A': 'A', 'ALIGNED': 'A', + 'W': 'W', 'WRITEABLE': 'W', + 'O': 'O', 'OWNDATA': 'O', + 'E': 'E', 'ENSUREARRAY': 'E' +} + + +@set_array_function_like_doc +@set_module('numpy') +def require(a, dtype=None, requirements=None, *, like=None): + """ + Return an ndarray of the provided type that satisfies requirements. + + This function is useful to be sure that an array with the correct flags + is returned for passing to compiled code (perhaps through ctypes). + + Parameters + ---------- + a : array_like + The object to be converted to a type-and-requirement-satisfying array. + dtype : data-type + The required data-type. If None preserve the current dtype. If your + application requires the data to be in native byteorder, include + a byteorder specification as a part of the dtype specification. + requirements : str or sequence of str + The requirements list can be any of the following + + * 'F_CONTIGUOUS' ('F') - ensure a Fortran-contiguous array + * 'C_CONTIGUOUS' ('C') - ensure a C-contiguous array + * 'ALIGNED' ('A') - ensure a data-type aligned array + * 'WRITEABLE' ('W') - ensure a writable array + * 'OWNDATA' ('O') - ensure an array that owns its own data + * 'ENSUREARRAY', ('E') - ensure a base array, instead of a subclass + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array with specified requirements and type if given. + + See Also + -------- + asarray : Convert input to an ndarray. + asanyarray : Convert to an ndarray, but pass through ndarray subclasses. + ascontiguousarray : Convert input to a contiguous array. + asfortranarray : Convert input to an ndarray with column-major + memory order. + ndarray.flags : Information about the memory layout of the array. + + Notes + ----- + The returned array will be guaranteed to have the listed requirements + by making a copy if needed. + + Examples + -------- + >>> x = np.arange(6).reshape(2,3) + >>> x.flags + C_CONTIGUOUS : True + F_CONTIGUOUS : False + OWNDATA : False + WRITEABLE : True + ALIGNED : True + WRITEBACKIFCOPY : False + + >>> y = np.require(x, dtype=np.float32, requirements=['A', 'O', 'W', 'F']) + >>> y.flags + C_CONTIGUOUS : False + F_CONTIGUOUS : True + OWNDATA : True + WRITEABLE : True + ALIGNED : True + WRITEBACKIFCOPY : False + + """ + if like is not None: + return _require_with_like( + like, + a, + dtype=dtype, + requirements=requirements, + ) + + if not requirements: + return asanyarray(a, dtype=dtype) + + requirements = {POSSIBLE_FLAGS[x.upper()] for x in requirements} + + if 'E' in requirements: + requirements.remove('E') + subok = False + else: + subok = True + + order = 'A' + if requirements >= {'C', 'F'}: + raise ValueError('Cannot specify both "C" and "F" order') + elif 'F' in requirements: + order = 'F' + requirements.remove('F') + elif 'C' in requirements: + order = 'C' + requirements.remove('C') + + arr = array(a, dtype=dtype, order=order, copy=False, subok=subok) + + for prop in requirements: + if not arr.flags[prop]: + return arr.copy(order) + return arr + + +_require_with_like = array_function_dispatch()(require) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_internal.py b/pllava/lib/python3.10/site-packages/numpy/core/_internal.py new file mode 100644 index 0000000000000000000000000000000000000000..c783858804017a30c5e7ff48586c54f9f4dcfe26 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_internal.py @@ -0,0 +1,935 @@ +""" +A place for internal code + +Some things are more easily handled Python. + +""" +import ast +import re +import sys +import warnings + +from ..exceptions import DTypePromotionError +from .multiarray import dtype, array, ndarray, promote_types +try: + import ctypes +except ImportError: + ctypes = None + +IS_PYPY = sys.implementation.name == 'pypy' + +if sys.byteorder == 'little': + _nbo = '<' +else: + _nbo = '>' + +def _makenames_list(adict, align): + allfields = [] + + for fname, obj in adict.items(): + n = len(obj) + if not isinstance(obj, tuple) or n not in (2, 3): + raise ValueError("entry not a 2- or 3- tuple") + if n > 2 and obj[2] == fname: + continue + num = int(obj[1]) + if num < 0: + raise ValueError("invalid offset.") + format = dtype(obj[0], align=align) + if n > 2: + title = obj[2] + else: + title = None + allfields.append((fname, format, num, title)) + # sort by offsets + allfields.sort(key=lambda x: x[2]) + names = [x[0] for x in allfields] + formats = [x[1] for x in allfields] + offsets = [x[2] for x in allfields] + titles = [x[3] for x in allfields] + + return names, formats, offsets, titles + +# Called in PyArray_DescrConverter function when +# a dictionary without "names" and "formats" +# fields is used as a data-type descriptor. +def _usefields(adict, align): + try: + names = adict[-1] + except KeyError: + names = None + if names is None: + names, formats, offsets, titles = _makenames_list(adict, align) + else: + formats = [] + offsets = [] + titles = [] + for name in names: + res = adict[name] + formats.append(res[0]) + offsets.append(res[1]) + if len(res) > 2: + titles.append(res[2]) + else: + titles.append(None) + + return dtype({"names": names, + "formats": formats, + "offsets": offsets, + "titles": titles}, align) + + +# construct an array_protocol descriptor list +# from the fields attribute of a descriptor +# This calls itself recursively but should eventually hit +# a descriptor that has no fields and then return +# a simple typestring + +def _array_descr(descriptor): + fields = descriptor.fields + if fields is None: + subdtype = descriptor.subdtype + if subdtype is None: + if descriptor.metadata is None: + return descriptor.str + else: + new = descriptor.metadata.copy() + if new: + return (descriptor.str, new) + else: + return descriptor.str + else: + return (_array_descr(subdtype[0]), subdtype[1]) + + names = descriptor.names + ordered_fields = [fields[x] + (x,) for x in names] + result = [] + offset = 0 + for field in ordered_fields: + if field[1] > offset: + num = field[1] - offset + result.append(('', f'|V{num}')) + offset += num + elif field[1] < offset: + raise ValueError( + "dtype.descr is not defined for types with overlapping or " + "out-of-order fields") + if len(field) > 3: + name = (field[2], field[3]) + else: + name = field[2] + if field[0].subdtype: + tup = (name, _array_descr(field[0].subdtype[0]), + field[0].subdtype[1]) + else: + tup = (name, _array_descr(field[0])) + offset += field[0].itemsize + result.append(tup) + + if descriptor.itemsize > offset: + num = descriptor.itemsize - offset + result.append(('', f'|V{num}')) + + return result + +# Build a new array from the information in a pickle. +# Note that the name numpy.core._internal._reconstruct is embedded in +# pickles of ndarrays made with NumPy before release 1.0 +# so don't remove the name here, or you'll +# break backward compatibility. +def _reconstruct(subtype, shape, dtype): + return ndarray.__new__(subtype, shape, dtype) + + +# format_re was originally from numarray by J. Todd Miller + +format_re = re.compile(r'(?P[<>|=]?)' + r'(?P *[(]?[ ,0-9]*[)]? *)' + r'(?P[<>|=]?)' + r'(?P[A-Za-z0-9.?]*(?:\[[a-zA-Z0-9,.]+\])?)') +sep_re = re.compile(r'\s*,\s*') +space_re = re.compile(r'\s+$') + +# astr is a string (perhaps comma separated) + +_convorder = {'=': _nbo} + +def _commastring(astr): + startindex = 0 + result = [] + while startindex < len(astr): + mo = format_re.match(astr, pos=startindex) + try: + (order1, repeats, order2, dtype) = mo.groups() + except (TypeError, AttributeError): + raise ValueError( + f'format number {len(result)+1} of "{astr}" is not recognized' + ) from None + startindex = mo.end() + # Separator or ending padding + if startindex < len(astr): + if space_re.match(astr, pos=startindex): + startindex = len(astr) + else: + mo = sep_re.match(astr, pos=startindex) + if not mo: + raise ValueError( + 'format number %d of "%s" is not recognized' % + (len(result)+1, astr)) + startindex = mo.end() + + if order2 == '': + order = order1 + elif order1 == '': + order = order2 + else: + order1 = _convorder.get(order1, order1) + order2 = _convorder.get(order2, order2) + if (order1 != order2): + raise ValueError( + 'inconsistent byte-order specification %s and %s' % + (order1, order2)) + order = order1 + + if order in ('|', '=', _nbo): + order = '' + dtype = order + dtype + if (repeats == ''): + newitem = dtype + else: + newitem = (dtype, ast.literal_eval(repeats)) + result.append(newitem) + + return result + +class dummy_ctype: + def __init__(self, cls): + self._cls = cls + def __mul__(self, other): + return self + def __call__(self, *other): + return self._cls(other) + def __eq__(self, other): + return self._cls == other._cls + def __ne__(self, other): + return self._cls != other._cls + +def _getintp_ctype(): + val = _getintp_ctype.cache + if val is not None: + return val + if ctypes is None: + import numpy as np + val = dummy_ctype(np.intp) + else: + char = dtype('p').char + if char == 'i': + val = ctypes.c_int + elif char == 'l': + val = ctypes.c_long + elif char == 'q': + val = ctypes.c_longlong + else: + val = ctypes.c_long + _getintp_ctype.cache = val + return val +_getintp_ctype.cache = None + +# Used for .ctypes attribute of ndarray + +class _missing_ctypes: + def cast(self, num, obj): + return num.value + + class c_void_p: + def __init__(self, ptr): + self.value = ptr + + +class _ctypes: + def __init__(self, array, ptr=None): + self._arr = array + + if ctypes: + self._ctypes = ctypes + self._data = self._ctypes.c_void_p(ptr) + else: + # fake a pointer-like object that holds onto the reference + self._ctypes = _missing_ctypes() + self._data = self._ctypes.c_void_p(ptr) + self._data._objects = array + + if self._arr.ndim == 0: + self._zerod = True + else: + self._zerod = False + + def data_as(self, obj): + """ + Return the data pointer cast to a particular c-types object. + For example, calling ``self._as_parameter_`` is equivalent to + ``self.data_as(ctypes.c_void_p)``. Perhaps you want to use the data as a + pointer to a ctypes array of floating-point data: + ``self.data_as(ctypes.POINTER(ctypes.c_double))``. + + The returned pointer will keep a reference to the array. + """ + # _ctypes.cast function causes a circular reference of self._data in + # self._data._objects. Attributes of self._data cannot be released + # until gc.collect is called. Make a copy of the pointer first then let + # it hold the array reference. This is a workaround to circumvent the + # CPython bug https://bugs.python.org/issue12836 + ptr = self._ctypes.cast(self._data, obj) + ptr._arr = self._arr + return ptr + + def shape_as(self, obj): + """ + Return the shape tuple as an array of some other c-types + type. For example: ``self.shape_as(ctypes.c_short)``. + """ + if self._zerod: + return None + return (obj*self._arr.ndim)(*self._arr.shape) + + def strides_as(self, obj): + """ + Return the strides tuple as an array of some other + c-types type. For example: ``self.strides_as(ctypes.c_longlong)``. + """ + if self._zerod: + return None + return (obj*self._arr.ndim)(*self._arr.strides) + + @property + def data(self): + """ + A pointer to the memory area of the array as a Python integer. + This memory area may contain data that is not aligned, or not in correct + byte-order. The memory area may not even be writeable. The array + flags and data-type of this array should be respected when passing this + attribute to arbitrary C-code to avoid trouble that can include Python + crashing. User Beware! The value of this attribute is exactly the same + as ``self._array_interface_['data'][0]``. + + Note that unlike ``data_as``, a reference will not be kept to the array: + code like ``ctypes.c_void_p((a + b).ctypes.data)`` will result in a + pointer to a deallocated array, and should be spelt + ``(a + b).ctypes.data_as(ctypes.c_void_p)`` + """ + return self._data.value + + @property + def shape(self): + """ + (c_intp*self.ndim): A ctypes array of length self.ndim where + the basetype is the C-integer corresponding to ``dtype('p')`` on this + platform (see `~numpy.ctypeslib.c_intp`). This base-type could be + `ctypes.c_int`, `ctypes.c_long`, or `ctypes.c_longlong` depending on + the platform. The ctypes array contains the shape of + the underlying array. + """ + return self.shape_as(_getintp_ctype()) + + @property + def strides(self): + """ + (c_intp*self.ndim): A ctypes array of length self.ndim where + the basetype is the same as for the shape attribute. This ctypes array + contains the strides information from the underlying array. This strides + information is important for showing how many bytes must be jumped to + get to the next element in the array. + """ + return self.strides_as(_getintp_ctype()) + + @property + def _as_parameter_(self): + """ + Overrides the ctypes semi-magic method + + Enables `c_func(some_array.ctypes)` + """ + return self.data_as(ctypes.c_void_p) + + # Numpy 1.21.0, 2021-05-18 + + def get_data(self): + """Deprecated getter for the `_ctypes.data` property. + + .. deprecated:: 1.21 + """ + warnings.warn('"get_data" is deprecated. Use "data" instead', + DeprecationWarning, stacklevel=2) + return self.data + + def get_shape(self): + """Deprecated getter for the `_ctypes.shape` property. + + .. deprecated:: 1.21 + """ + warnings.warn('"get_shape" is deprecated. Use "shape" instead', + DeprecationWarning, stacklevel=2) + return self.shape + + def get_strides(self): + """Deprecated getter for the `_ctypes.strides` property. + + .. deprecated:: 1.21 + """ + warnings.warn('"get_strides" is deprecated. Use "strides" instead', + DeprecationWarning, stacklevel=2) + return self.strides + + def get_as_parameter(self): + """Deprecated getter for the `_ctypes._as_parameter_` property. + + .. deprecated:: 1.21 + """ + warnings.warn( + '"get_as_parameter" is deprecated. Use "_as_parameter_" instead', + DeprecationWarning, stacklevel=2, + ) + return self._as_parameter_ + + +def _newnames(datatype, order): + """ + Given a datatype and an order object, return a new names tuple, with the + order indicated + """ + oldnames = datatype.names + nameslist = list(oldnames) + if isinstance(order, str): + order = [order] + seen = set() + if isinstance(order, (list, tuple)): + for name in order: + try: + nameslist.remove(name) + except ValueError: + if name in seen: + raise ValueError(f"duplicate field name: {name}") from None + else: + raise ValueError(f"unknown field name: {name}") from None + seen.add(name) + return tuple(list(order) + nameslist) + raise ValueError(f"unsupported order value: {order}") + +def _copy_fields(ary): + """Return copy of structured array with padding between fields removed. + + Parameters + ---------- + ary : ndarray + Structured array from which to remove padding bytes + + Returns + ------- + ary_copy : ndarray + Copy of ary with padding bytes removed + """ + dt = ary.dtype + copy_dtype = {'names': dt.names, + 'formats': [dt.fields[name][0] for name in dt.names]} + return array(ary, dtype=copy_dtype, copy=True) + +def _promote_fields(dt1, dt2): + """ Perform type promotion for two structured dtypes. + + Parameters + ---------- + dt1 : structured dtype + First dtype. + dt2 : structured dtype + Second dtype. + + Returns + ------- + out : dtype + The promoted dtype + + Notes + ----- + If one of the inputs is aligned, the result will be. The titles of + both descriptors must match (point to the same field). + """ + # Both must be structured and have the same names in the same order + if (dt1.names is None or dt2.names is None) or dt1.names != dt2.names: + raise DTypePromotionError( + f"field names `{dt1.names}` and `{dt2.names}` mismatch.") + + # if both are identical, we can (maybe!) just return the same dtype. + identical = dt1 is dt2 + new_fields = [] + for name in dt1.names: + field1 = dt1.fields[name] + field2 = dt2.fields[name] + new_descr = promote_types(field1[0], field2[0]) + identical = identical and new_descr is field1[0] + + # Check that the titles match (if given): + if field1[2:] != field2[2:]: + raise DTypePromotionError( + f"field titles of field '{name}' mismatch") + if len(field1) == 2: + new_fields.append((name, new_descr)) + else: + new_fields.append(((field1[2], name), new_descr)) + + res = dtype(new_fields, align=dt1.isalignedstruct or dt2.isalignedstruct) + + # Might as well preserve identity (and metadata) if the dtype is identical + # and the itemsize, offsets are also unmodified. This could probably be + # sped up, but also probably just be removed entirely. + if identical and res.itemsize == dt1.itemsize: + for name in dt1.names: + if dt1.fields[name][1] != res.fields[name][1]: + return res # the dtype changed. + return dt1 + + return res + + +def _getfield_is_safe(oldtype, newtype, offset): + """ Checks safety of getfield for object arrays. + + As in _view_is_safe, we need to check that memory containing objects is not + reinterpreted as a non-object datatype and vice versa. + + Parameters + ---------- + oldtype : data-type + Data type of the original ndarray. + newtype : data-type + Data type of the field being accessed by ndarray.getfield + offset : int + Offset of the field being accessed by ndarray.getfield + + Raises + ------ + TypeError + If the field access is invalid + + """ + if newtype.hasobject or oldtype.hasobject: + if offset == 0 and newtype == oldtype: + return + if oldtype.names is not None: + for name in oldtype.names: + if (oldtype.fields[name][1] == offset and + oldtype.fields[name][0] == newtype): + return + raise TypeError("Cannot get/set field of an object array") + return + +def _view_is_safe(oldtype, newtype): + """ Checks safety of a view involving object arrays, for example when + doing:: + + np.zeros(10, dtype=oldtype).view(newtype) + + Parameters + ---------- + oldtype : data-type + Data type of original ndarray + newtype : data-type + Data type of the view + + Raises + ------ + TypeError + If the new type is incompatible with the old type. + + """ + + # if the types are equivalent, there is no problem. + # for example: dtype((np.record, 'i4,i4')) == dtype((np.void, 'i4,i4')) + if oldtype == newtype: + return + + if newtype.hasobject or oldtype.hasobject: + raise TypeError("Cannot change data-type for object array.") + return + +# Given a string containing a PEP 3118 format specifier, +# construct a NumPy dtype + +_pep3118_native_map = { + '?': '?', + 'c': 'S1', + 'b': 'b', + 'B': 'B', + 'h': 'h', + 'H': 'H', + 'i': 'i', + 'I': 'I', + 'l': 'l', + 'L': 'L', + 'q': 'q', + 'Q': 'Q', + 'e': 'e', + 'f': 'f', + 'd': 'd', + 'g': 'g', + 'Zf': 'F', + 'Zd': 'D', + 'Zg': 'G', + 's': 'S', + 'w': 'U', + 'O': 'O', + 'x': 'V', # padding +} +_pep3118_native_typechars = ''.join(_pep3118_native_map.keys()) + +_pep3118_standard_map = { + '?': '?', + 'c': 'S1', + 'b': 'b', + 'B': 'B', + 'h': 'i2', + 'H': 'u2', + 'i': 'i4', + 'I': 'u4', + 'l': 'i4', + 'L': 'u4', + 'q': 'i8', + 'Q': 'u8', + 'e': 'f2', + 'f': 'f', + 'd': 'd', + 'Zf': 'F', + 'Zd': 'D', + 's': 'S', + 'w': 'U', + 'O': 'O', + 'x': 'V', # padding +} +_pep3118_standard_typechars = ''.join(_pep3118_standard_map.keys()) + +_pep3118_unsupported_map = { + 'u': 'UCS-2 strings', + '&': 'pointers', + 't': 'bitfields', + 'X': 'function pointers', +} + +class _Stream: + def __init__(self, s): + self.s = s + self.byteorder = '@' + + def advance(self, n): + res = self.s[:n] + self.s = self.s[n:] + return res + + def consume(self, c): + if self.s[:len(c)] == c: + self.advance(len(c)) + return True + return False + + def consume_until(self, c): + if callable(c): + i = 0 + while i < len(self.s) and not c(self.s[i]): + i = i + 1 + return self.advance(i) + else: + i = self.s.index(c) + res = self.advance(i) + self.advance(len(c)) + return res + + @property + def next(self): + return self.s[0] + + def __bool__(self): + return bool(self.s) + + +def _dtype_from_pep3118(spec): + stream = _Stream(spec) + dtype, align = __dtype_from_pep3118(stream, is_subdtype=False) + return dtype + +def __dtype_from_pep3118(stream, is_subdtype): + field_spec = dict( + names=[], + formats=[], + offsets=[], + itemsize=0 + ) + offset = 0 + common_alignment = 1 + is_padding = False + + # Parse spec + while stream: + value = None + + # End of structure, bail out to upper level + if stream.consume('}'): + break + + # Sub-arrays (1) + shape = None + if stream.consume('('): + shape = stream.consume_until(')') + shape = tuple(map(int, shape.split(','))) + + # Byte order + if stream.next in ('@', '=', '<', '>', '^', '!'): + byteorder = stream.advance(1) + if byteorder == '!': + byteorder = '>' + stream.byteorder = byteorder + + # Byte order characters also control native vs. standard type sizes + if stream.byteorder in ('@', '^'): + type_map = _pep3118_native_map + type_map_chars = _pep3118_native_typechars + else: + type_map = _pep3118_standard_map + type_map_chars = _pep3118_standard_typechars + + # Item sizes + itemsize_str = stream.consume_until(lambda c: not c.isdigit()) + if itemsize_str: + itemsize = int(itemsize_str) + else: + itemsize = 1 + + # Data types + is_padding = False + + if stream.consume('T{'): + value, align = __dtype_from_pep3118( + stream, is_subdtype=True) + elif stream.next in type_map_chars: + if stream.next == 'Z': + typechar = stream.advance(2) + else: + typechar = stream.advance(1) + + is_padding = (typechar == 'x') + dtypechar = type_map[typechar] + if dtypechar in 'USV': + dtypechar += '%d' % itemsize + itemsize = 1 + numpy_byteorder = {'@': '=', '^': '='}.get( + stream.byteorder, stream.byteorder) + value = dtype(numpy_byteorder + dtypechar) + align = value.alignment + elif stream.next in _pep3118_unsupported_map: + desc = _pep3118_unsupported_map[stream.next] + raise NotImplementedError( + "Unrepresentable PEP 3118 data type {!r} ({})" + .format(stream.next, desc)) + else: + raise ValueError("Unknown PEP 3118 data type specifier %r" % stream.s) + + # + # Native alignment may require padding + # + # Here we assume that the presence of a '@' character implicitly implies + # that the start of the array is *already* aligned. + # + extra_offset = 0 + if stream.byteorder == '@': + start_padding = (-offset) % align + intra_padding = (-value.itemsize) % align + + offset += start_padding + + if intra_padding != 0: + if itemsize > 1 or (shape is not None and _prod(shape) > 1): + # Inject internal padding to the end of the sub-item + value = _add_trailing_padding(value, intra_padding) + else: + # We can postpone the injection of internal padding, + # as the item appears at most once + extra_offset += intra_padding + + # Update common alignment + common_alignment = _lcm(align, common_alignment) + + # Convert itemsize to sub-array + if itemsize != 1: + value = dtype((value, (itemsize,))) + + # Sub-arrays (2) + if shape is not None: + value = dtype((value, shape)) + + # Field name + if stream.consume(':'): + name = stream.consume_until(':') + else: + name = None + + if not (is_padding and name is None): + if name is not None and name in field_spec['names']: + raise RuntimeError(f"Duplicate field name '{name}' in PEP3118 format") + field_spec['names'].append(name) + field_spec['formats'].append(value) + field_spec['offsets'].append(offset) + + offset += value.itemsize + offset += extra_offset + + field_spec['itemsize'] = offset + + # extra final padding for aligned types + if stream.byteorder == '@': + field_spec['itemsize'] += (-offset) % common_alignment + + # Check if this was a simple 1-item type, and unwrap it + if (field_spec['names'] == [None] + and field_spec['offsets'][0] == 0 + and field_spec['itemsize'] == field_spec['formats'][0].itemsize + and not is_subdtype): + ret = field_spec['formats'][0] + else: + _fix_names(field_spec) + ret = dtype(field_spec) + + # Finished + return ret, common_alignment + +def _fix_names(field_spec): + """ Replace names which are None with the next unused f%d name """ + names = field_spec['names'] + for i, name in enumerate(names): + if name is not None: + continue + + j = 0 + while True: + name = f'f{j}' + if name not in names: + break + j = j + 1 + names[i] = name + +def _add_trailing_padding(value, padding): + """Inject the specified number of padding bytes at the end of a dtype""" + if value.fields is None: + field_spec = dict( + names=['f0'], + formats=[value], + offsets=[0], + itemsize=value.itemsize + ) + else: + fields = value.fields + names = value.names + field_spec = dict( + names=names, + formats=[fields[name][0] for name in names], + offsets=[fields[name][1] for name in names], + itemsize=value.itemsize + ) + + field_spec['itemsize'] += padding + return dtype(field_spec) + +def _prod(a): + p = 1 + for x in a: + p *= x + return p + +def _gcd(a, b): + """Calculate the greatest common divisor of a and b""" + while b: + a, b = b, a % b + return a + +def _lcm(a, b): + return a // _gcd(a, b) * b + +def array_ufunc_errmsg_formatter(dummy, ufunc, method, *inputs, **kwargs): + """ Format the error message for when __array_ufunc__ gives up. """ + args_string = ', '.join(['{!r}'.format(arg) for arg in inputs] + + ['{}={!r}'.format(k, v) + for k, v in kwargs.items()]) + args = inputs + kwargs.get('out', ()) + types_string = ', '.join(repr(type(arg).__name__) for arg in args) + return ('operand type(s) all returned NotImplemented from ' + '__array_ufunc__({!r}, {!r}, {}): {}' + .format(ufunc, method, args_string, types_string)) + + +def array_function_errmsg_formatter(public_api, types): + """ Format the error message for when __array_ufunc__ gives up. """ + func_name = '{}.{}'.format(public_api.__module__, public_api.__name__) + return ("no implementation found for '{}' on types that implement " + '__array_function__: {}'.format(func_name, list(types))) + + +def _ufunc_doc_signature_formatter(ufunc): + """ + Builds a signature string which resembles PEP 457 + + This is used to construct the first line of the docstring + """ + + # input arguments are simple + if ufunc.nin == 1: + in_args = 'x' + else: + in_args = ', '.join(f'x{i+1}' for i in range(ufunc.nin)) + + # output arguments are both keyword or positional + if ufunc.nout == 0: + out_args = ', /, out=()' + elif ufunc.nout == 1: + out_args = ', /, out=None' + else: + out_args = '[, {positional}], / [, out={default}]'.format( + positional=', '.join( + 'out{}'.format(i+1) for i in range(ufunc.nout)), + default=repr((None,)*ufunc.nout) + ) + + # keyword only args depend on whether this is a gufunc + kwargs = ( + ", casting='same_kind'" + ", order='K'" + ", dtype=None" + ", subok=True" + ) + + # NOTE: gufuncs may or may not support the `axis` parameter + if ufunc.signature is None: + kwargs = f", where=True{kwargs}[, signature, extobj]" + else: + kwargs += "[, signature, extobj, axes, axis]" + + # join all the parts together + return '{name}({in_args}{out_args}, *{kwargs})'.format( + name=ufunc.__name__, + in_args=in_args, + out_args=out_args, + kwargs=kwargs + ) + + +def npy_ctypes_check(cls): + # determine if a class comes from ctypes, in order to work around + # a bug in the buffer protocol for those objects, bpo-10746 + try: + # ctypes class are new-style, so have an __mro__. This probably fails + # for ctypes classes with multiple inheritance. + if IS_PYPY: + # (..., _ctypes.basics._CData, Bufferable, object) + ctype_base = cls.__mro__[-3] + else: + # # (..., _ctypes._CData, object) + ctype_base = cls.__mro__[-2] + # right now, they're part of the _ctypes module + return '_ctypes' in ctype_base.__module__ + except Exception: + return False diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_methods.py b/pllava/lib/python3.10/site-packages/numpy/core/_methods.py new file mode 100644 index 0000000000000000000000000000000000000000..0fc070b34c381ecdf8e8bb0d015bb799313a232e --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_methods.py @@ -0,0 +1,234 @@ +""" +Array methods which are called by both the C-code for the method +and the Python code for the NumPy-namespace function + +""" +import warnings +from contextlib import nullcontext + +from numpy.core import multiarray as mu +from numpy.core import umath as um +from numpy.core.multiarray import asanyarray +from numpy.core import numerictypes as nt +from numpy.core import _exceptions +from numpy.core._ufunc_config import _no_nep50_warning +from numpy._globals import _NoValue +from numpy.compat import pickle, os_fspath + +# save those O(100) nanoseconds! +umr_maximum = um.maximum.reduce +umr_minimum = um.minimum.reduce +umr_sum = um.add.reduce +umr_prod = um.multiply.reduce +umr_any = um.logical_or.reduce +umr_all = um.logical_and.reduce + +# Complex types to -> (2,)float view for fast-path computation in _var() +_complex_to_float = { + nt.dtype(nt.csingle) : nt.dtype(nt.single), + nt.dtype(nt.cdouble) : nt.dtype(nt.double), +} +# Special case for windows: ensure double takes precedence +if nt.dtype(nt.longdouble) != nt.dtype(nt.double): + _complex_to_float.update({ + nt.dtype(nt.clongdouble) : nt.dtype(nt.longdouble), + }) + +# avoid keyword arguments to speed up parsing, saves about 15%-20% for very +# small reductions +def _amax(a, axis=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_maximum(a, axis, None, out, keepdims, initial, where) + +def _amin(a, axis=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_minimum(a, axis, None, out, keepdims, initial, where) + +def _sum(a, axis=None, dtype=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_sum(a, axis, dtype, out, keepdims, initial, where) + +def _prod(a, axis=None, dtype=None, out=None, keepdims=False, + initial=_NoValue, where=True): + return umr_prod(a, axis, dtype, out, keepdims, initial, where) + +def _any(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + # Parsing keyword arguments is currently fairly slow, so avoid it for now + if where is True: + return umr_any(a, axis, dtype, out, keepdims) + return umr_any(a, axis, dtype, out, keepdims, where=where) + +def _all(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + # Parsing keyword arguments is currently fairly slow, so avoid it for now + if where is True: + return umr_all(a, axis, dtype, out, keepdims) + return umr_all(a, axis, dtype, out, keepdims, where=where) + +def _count_reduce_items(arr, axis, keepdims=False, where=True): + # fast-path for the default case + if where is True: + # no boolean mask given, calculate items according to axis + if axis is None: + axis = tuple(range(arr.ndim)) + elif not isinstance(axis, tuple): + axis = (axis,) + items = 1 + for ax in axis: + items *= arr.shape[mu.normalize_axis_index(ax, arr.ndim)] + items = nt.intp(items) + else: + # TODO: Optimize case when `where` is broadcast along a non-reduction + # axis and full sum is more excessive than needed. + + # guarded to protect circular imports + from numpy.lib.stride_tricks import broadcast_to + # count True values in (potentially broadcasted) boolean mask + items = umr_sum(broadcast_to(where, arr.shape), axis, nt.intp, None, + keepdims) + return items + +def _clip(a, min=None, max=None, out=None, **kwargs): + if min is None and max is None: + raise ValueError("One of max or min must be given") + + if min is None: + return um.minimum(a, max, out=out, **kwargs) + elif max is None: + return um.maximum(a, min, out=out, **kwargs) + else: + return um.clip(a, min, max, out=out, **kwargs) + +def _mean(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True): + arr = asanyarray(a) + + is_float16_result = False + + rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where) + if rcount == 0 if where is True else umr_any(rcount == 0, axis=None): + warnings.warn("Mean of empty slice.", RuntimeWarning, stacklevel=2) + + # Cast bool, unsigned int, and int to float64 by default + if dtype is None: + if issubclass(arr.dtype.type, (nt.integer, nt.bool_)): + dtype = mu.dtype('f8') + elif issubclass(arr.dtype.type, nt.float16): + dtype = mu.dtype('f4') + is_float16_result = True + + ret = umr_sum(arr, axis, dtype, out, keepdims, where=where) + if isinstance(ret, mu.ndarray): + with _no_nep50_warning(): + ret = um.true_divide( + ret, rcount, out=ret, casting='unsafe', subok=False) + if is_float16_result and out is None: + ret = arr.dtype.type(ret) + elif hasattr(ret, 'dtype'): + if is_float16_result: + ret = arr.dtype.type(ret / rcount) + else: + ret = ret.dtype.type(ret / rcount) + else: + ret = ret / rcount + + return ret + +def _var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, + where=True): + arr = asanyarray(a) + + rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where) + # Make this warning show up on top. + if ddof >= rcount if where is True else umr_any(ddof >= rcount, axis=None): + warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning, + stacklevel=2) + + # Cast bool, unsigned int, and int to float64 by default + if dtype is None and issubclass(arr.dtype.type, (nt.integer, nt.bool_)): + dtype = mu.dtype('f8') + + # Compute the mean. + # Note that if dtype is not of inexact type then arraymean will + # not be either. + arrmean = umr_sum(arr, axis, dtype, keepdims=True, where=where) + # The shape of rcount has to match arrmean to not change the shape of out + # in broadcasting. Otherwise, it cannot be stored back to arrmean. + if rcount.ndim == 0: + # fast-path for default case when where is True + div = rcount + else: + # matching rcount to arrmean when where is specified as array + div = rcount.reshape(arrmean.shape) + if isinstance(arrmean, mu.ndarray): + with _no_nep50_warning(): + arrmean = um.true_divide(arrmean, div, out=arrmean, + casting='unsafe', subok=False) + elif hasattr(arrmean, "dtype"): + arrmean = arrmean.dtype.type(arrmean / rcount) + else: + arrmean = arrmean / rcount + + # Compute sum of squared deviations from mean + # Note that x may not be inexact and that we need it to be an array, + # not a scalar. + x = asanyarray(arr - arrmean) + + if issubclass(arr.dtype.type, (nt.floating, nt.integer)): + x = um.multiply(x, x, out=x) + # Fast-paths for built-in complex types + elif x.dtype in _complex_to_float: + xv = x.view(dtype=(_complex_to_float[x.dtype], (2,))) + um.multiply(xv, xv, out=xv) + x = um.add(xv[..., 0], xv[..., 1], out=x.real).real + # Most general case; includes handling object arrays containing imaginary + # numbers and complex types with non-native byteorder + else: + x = um.multiply(x, um.conjugate(x), out=x).real + + ret = umr_sum(x, axis, dtype, out, keepdims=keepdims, where=where) + + # Compute degrees of freedom and make sure it is not negative. + rcount = um.maximum(rcount - ddof, 0) + + # divide by degrees of freedom + if isinstance(ret, mu.ndarray): + with _no_nep50_warning(): + ret = um.true_divide( + ret, rcount, out=ret, casting='unsafe', subok=False) + elif hasattr(ret, 'dtype'): + ret = ret.dtype.type(ret / rcount) + else: + ret = ret / rcount + + return ret + +def _std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *, + where=True): + ret = _var(a, axis=axis, dtype=dtype, out=out, ddof=ddof, + keepdims=keepdims, where=where) + + if isinstance(ret, mu.ndarray): + ret = um.sqrt(ret, out=ret) + elif hasattr(ret, 'dtype'): + ret = ret.dtype.type(um.sqrt(ret)) + else: + ret = um.sqrt(ret) + + return ret + +def _ptp(a, axis=None, out=None, keepdims=False): + return um.subtract( + umr_maximum(a, axis, None, out, keepdims), + umr_minimum(a, axis, None, None, keepdims), + out + ) + +def _dump(self, file, protocol=2): + if hasattr(file, 'write'): + ctx = nullcontext(file) + else: + ctx = open(os_fspath(file), "wb") + with ctx as f: + pickle.dump(self, f, protocol=protocol) + +def _dumps(self, protocol=2): + return pickle.dumps(self, protocol=protocol) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_rational_tests.cpython-310-x86_64-linux-gnu.so b/pllava/lib/python3.10/site-packages/numpy/core/_rational_tests.cpython-310-x86_64-linux-gnu.so new file mode 100644 index 0000000000000000000000000000000000000000..88ae1fbc7c171d8b69a2f46317560b1a6d86a7b2 Binary files /dev/null and b/pllava/lib/python3.10/site-packages/numpy/core/_rational_tests.cpython-310-x86_64-linux-gnu.so differ diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_type_aliases.py b/pllava/lib/python3.10/site-packages/numpy/core/_type_aliases.py new file mode 100644 index 0000000000000000000000000000000000000000..38f1a099e9e20e431cfd0ce9a80b15938d5e89d1 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_type_aliases.py @@ -0,0 +1,245 @@ +""" +Due to compatibility, numpy has a very large number of different naming +conventions for the scalar types (those subclassing from `numpy.generic`). +This file produces a convoluted set of dictionaries mapping names to types, +and sometimes other mappings too. + +.. data:: allTypes + A dictionary of names to types that will be exposed as attributes through + ``np.core.numerictypes.*`` + +.. data:: sctypeDict + Similar to `allTypes`, but maps a broader set of aliases to their types. + +.. data:: sctypes + A dictionary keyed by a "type group" string, providing a list of types + under that group. + +""" + +from numpy.compat import unicode +from numpy.core._string_helpers import english_lower +from numpy.core.multiarray import typeinfo, dtype +from numpy.core._dtype import _kind_name + + +sctypeDict = {} # Contains all leaf-node scalar types with aliases +allTypes = {} # Collect the types we will add to the module + + +# separate the actual type info from the abstract base classes +_abstract_types = {} +_concrete_typeinfo = {} +for k, v in typeinfo.items(): + # make all the keys lowercase too + k = english_lower(k) + if isinstance(v, type): + _abstract_types[k] = v + else: + _concrete_typeinfo[k] = v + +_concrete_types = {v.type for k, v in _concrete_typeinfo.items()} + + +def _bits_of(obj): + try: + info = next(v for v in _concrete_typeinfo.values() if v.type is obj) + except StopIteration: + if obj in _abstract_types.values(): + msg = "Cannot count the bits of an abstract type" + raise ValueError(msg) from None + + # some third-party type - make a best-guess + return dtype(obj).itemsize * 8 + else: + return info.bits + + +def bitname(obj): + """Return a bit-width name for a given type object""" + bits = _bits_of(obj) + dt = dtype(obj) + char = dt.kind + base = _kind_name(dt) + + if base == 'object': + bits = 0 + + if bits != 0: + char = "%s%d" % (char, bits // 8) + + return base, bits, char + + +def _add_types(): + for name, info in _concrete_typeinfo.items(): + # define C-name and insert typenum and typechar references also + allTypes[name] = info.type + sctypeDict[name] = info.type + sctypeDict[info.char] = info.type + sctypeDict[info.num] = info.type + + for name, cls in _abstract_types.items(): + allTypes[name] = cls +_add_types() + +# This is the priority order used to assign the bit-sized NPY_INTxx names, which +# must match the order in npy_common.h in order for NPY_INTxx and np.intxx to be +# consistent. +# If two C types have the same size, then the earliest one in this list is used +# as the sized name. +_int_ctypes = ['long', 'longlong', 'int', 'short', 'byte'] +_uint_ctypes = list('u' + t for t in _int_ctypes) + +def _add_aliases(): + for name, info in _concrete_typeinfo.items(): + # these are handled by _add_integer_aliases + if name in _int_ctypes or name in _uint_ctypes: + continue + + # insert bit-width version for this class (if relevant) + base, bit, char = bitname(info.type) + + myname = "%s%d" % (base, bit) + + # ensure that (c)longdouble does not overwrite the aliases assigned to + # (c)double + if name in ('longdouble', 'clongdouble') and myname in allTypes: + continue + + # Add to the main namespace if desired: + if bit != 0 and base != "bool": + allTypes[myname] = info.type + + # add forward, reverse, and string mapping to numarray + sctypeDict[char] = info.type + + # add mapping for both the bit name + sctypeDict[myname] = info.type + + +_add_aliases() + +def _add_integer_aliases(): + seen_bits = set() + for i_ctype, u_ctype in zip(_int_ctypes, _uint_ctypes): + i_info = _concrete_typeinfo[i_ctype] + u_info = _concrete_typeinfo[u_ctype] + bits = i_info.bits # same for both + + for info, charname, intname in [ + (i_info,'i%d' % (bits//8,), 'int%d' % bits), + (u_info,'u%d' % (bits//8,), 'uint%d' % bits)]: + if bits not in seen_bits: + # sometimes two different types have the same number of bits + # if so, the one iterated over first takes precedence + allTypes[intname] = info.type + sctypeDict[intname] = info.type + sctypeDict[charname] = info.type + + seen_bits.add(bits) + +_add_integer_aliases() + +# We use these later +void = allTypes['void'] + +# +# Rework the Python names (so that float and complex and int are consistent +# with Python usage) +# +def _set_up_aliases(): + type_pairs = [('complex_', 'cdouble'), + ('single', 'float'), + ('csingle', 'cfloat'), + ('singlecomplex', 'cfloat'), + ('float_', 'double'), + ('intc', 'int'), + ('uintc', 'uint'), + ('int_', 'long'), + ('uint', 'ulong'), + ('cfloat', 'cdouble'), + ('longfloat', 'longdouble'), + ('clongfloat', 'clongdouble'), + ('longcomplex', 'clongdouble'), + ('bool_', 'bool'), + ('bytes_', 'string'), + ('string_', 'string'), + ('str_', 'unicode'), + ('unicode_', 'unicode'), + ('object_', 'object')] + for alias, t in type_pairs: + allTypes[alias] = allTypes[t] + sctypeDict[alias] = sctypeDict[t] + # Remove aliases overriding python types and modules + to_remove = ['object', 'int', 'float', + 'complex', 'bool', 'string', 'datetime', 'timedelta', + 'bytes', 'str'] + + for t in to_remove: + try: + del allTypes[t] + del sctypeDict[t] + except KeyError: + pass + + # Additional aliases in sctypeDict that should not be exposed as attributes + attrs_to_remove = ['ulong'] + + for t in attrs_to_remove: + try: + del allTypes[t] + except KeyError: + pass +_set_up_aliases() + + +sctypes = {'int': [], + 'uint':[], + 'float':[], + 'complex':[], + 'others':[bool, object, bytes, unicode, void]} + +def _add_array_type(typename, bits): + try: + t = allTypes['%s%d' % (typename, bits)] + except KeyError: + pass + else: + sctypes[typename].append(t) + +def _set_array_types(): + ibytes = [1, 2, 4, 8, 16, 32, 64] + fbytes = [2, 4, 8, 10, 12, 16, 32, 64] + for bytes in ibytes: + bits = 8*bytes + _add_array_type('int', bits) + _add_array_type('uint', bits) + for bytes in fbytes: + bits = 8*bytes + _add_array_type('float', bits) + _add_array_type('complex', 2*bits) + _gi = dtype('p') + if _gi.type not in sctypes['int']: + indx = 0 + sz = _gi.itemsize + _lst = sctypes['int'] + while (indx < len(_lst) and sz >= _lst[indx](0).itemsize): + indx += 1 + sctypes['int'].insert(indx, _gi.type) + sctypes['uint'].insert(indx, dtype('P').type) +_set_array_types() + + +# Add additional strings to the sctypeDict +_toadd = ['int', 'float', 'complex', 'bool', 'object', + 'str', 'bytes', ('a', 'bytes_'), + ('int0', 'intp'), ('uint0', 'uintp')] + +for name in _toadd: + if isinstance(name, tuple): + sctypeDict[name[0]] = allTypes[name[1]] + else: + sctypeDict[name] = allTypes['%s_' % name] + +del _toadd, name diff --git a/pllava/lib/python3.10/site-packages/numpy/core/_ufunc_config.pyi b/pllava/lib/python3.10/site-packages/numpy/core/_ufunc_config.pyi new file mode 100644 index 0000000000000000000000000000000000000000..f56504507ac02995b740e49a9073e0e351b7abf5 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/_ufunc_config.pyi @@ -0,0 +1,37 @@ +from collections.abc import Callable +from typing import Any, Literal, TypedDict + +from numpy import _SupportsWrite + +_ErrKind = Literal["ignore", "warn", "raise", "call", "print", "log"] +_ErrFunc = Callable[[str, int], Any] + +class _ErrDict(TypedDict): + divide: _ErrKind + over: _ErrKind + under: _ErrKind + invalid: _ErrKind + +class _ErrDictOptional(TypedDict, total=False): + all: None | _ErrKind + divide: None | _ErrKind + over: None | _ErrKind + under: None | _ErrKind + invalid: None | _ErrKind + +def seterr( + all: None | _ErrKind = ..., + divide: None | _ErrKind = ..., + over: None | _ErrKind = ..., + under: None | _ErrKind = ..., + invalid: None | _ErrKind = ..., +) -> _ErrDict: ... +def geterr() -> _ErrDict: ... +def setbufsize(size: int) -> int: ... +def getbufsize() -> int: ... +def seterrcall( + func: None | _ErrFunc | _SupportsWrite[str] +) -> None | _ErrFunc | _SupportsWrite[str]: ... +def geterrcall() -> None | _ErrFunc | _SupportsWrite[str]: ... + +# See `numpy/__init__.pyi` for the `errstate` class and `no_nep5_warnings` diff --git a/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.py b/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.py new file mode 100644 index 0000000000000000000000000000000000000000..62cd527073a615458b12619545f4da76664c4bc0 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.py @@ -0,0 +1,1725 @@ +"""Array printing function + +$Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $ + +""" +__all__ = ["array2string", "array_str", "array_repr", "set_string_function", + "set_printoptions", "get_printoptions", "printoptions", + "format_float_positional", "format_float_scientific"] +__docformat__ = 'restructuredtext' + +# +# Written by Konrad Hinsen +# last revision: 1996-3-13 +# modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details) +# and by Perry Greenfield 2000-4-1 for numarray +# and by Travis Oliphant 2005-8-22 for numpy + + +# Note: Both scalartypes.c.src and arrayprint.py implement strs for numpy +# scalars but for different purposes. scalartypes.c.src has str/reprs for when +# the scalar is printed on its own, while arrayprint.py has strs for when +# scalars are printed inside an ndarray. Only the latter strs are currently +# user-customizable. + +import functools +import numbers +import sys +try: + from _thread import get_ident +except ImportError: + from _dummy_thread import get_ident + +import numpy as np +from . import numerictypes as _nt +from .umath import absolute, isinf, isfinite, isnat +from . import multiarray +from .multiarray import (array, dragon4_positional, dragon4_scientific, + datetime_as_string, datetime_data, ndarray, + set_legacy_print_mode) +from .fromnumeric import any +from .numeric import concatenate, asarray, errstate +from .numerictypes import (longlong, intc, int_, float_, complex_, bool_, + flexible) +from .overrides import array_function_dispatch, set_module +import operator +import warnings +import contextlib + +_format_options = { + 'edgeitems': 3, # repr N leading and trailing items of each dimension + 'threshold': 1000, # total items > triggers array summarization + 'floatmode': 'maxprec', + 'precision': 8, # precision of floating point representations + 'suppress': False, # suppress printing small floating values in exp format + 'linewidth': 75, + 'nanstr': 'nan', + 'infstr': 'inf', + 'sign': '-', + 'formatter': None, + # Internally stored as an int to simplify comparisons; converted from/to + # str/False on the way in/out. + 'legacy': sys.maxsize} + +def _make_options_dict(precision=None, threshold=None, edgeitems=None, + linewidth=None, suppress=None, nanstr=None, infstr=None, + sign=None, formatter=None, floatmode=None, legacy=None): + """ + Make a dictionary out of the non-None arguments, plus conversion of + *legacy* and sanity checks. + """ + + options = {k: v for k, v in locals().items() if v is not None} + + if suppress is not None: + options['suppress'] = bool(suppress) + + modes = ['fixed', 'unique', 'maxprec', 'maxprec_equal'] + if floatmode not in modes + [None]: + raise ValueError("floatmode option must be one of " + + ", ".join('"{}"'.format(m) for m in modes)) + + if sign not in [None, '-', '+', ' ']: + raise ValueError("sign option must be one of ' ', '+', or '-'") + + if legacy == False: + options['legacy'] = sys.maxsize + elif legacy == '1.13': + options['legacy'] = 113 + elif legacy == '1.21': + options['legacy'] = 121 + elif legacy is None: + pass # OK, do nothing. + else: + warnings.warn( + "legacy printing option can currently only be '1.13', '1.21', or " + "`False`", stacklevel=3) + + if threshold is not None: + # forbid the bad threshold arg suggested by stack overflow, gh-12351 + if not isinstance(threshold, numbers.Number): + raise TypeError("threshold must be numeric") + if np.isnan(threshold): + raise ValueError("threshold must be non-NAN, try " + "sys.maxsize for untruncated representation") + + if precision is not None: + # forbid the bad precision arg as suggested by issue #18254 + try: + options['precision'] = operator.index(precision) + except TypeError as e: + raise TypeError('precision must be an integer') from e + + return options + + +@set_module('numpy') +def set_printoptions(precision=None, threshold=None, edgeitems=None, + linewidth=None, suppress=None, nanstr=None, infstr=None, + formatter=None, sign=None, floatmode=None, *, legacy=None): + """ + Set printing options. + + These options determine the way floating point numbers, arrays and + other NumPy objects are displayed. + + Parameters + ---------- + precision : int or None, optional + Number of digits of precision for floating point output (default 8). + May be None if `floatmode` is not `fixed`, to print as many digits as + necessary to uniquely specify the value. + threshold : int, optional + Total number of array elements which trigger summarization + rather than full repr (default 1000). + To always use the full repr without summarization, pass `sys.maxsize`. + edgeitems : int, optional + Number of array items in summary at beginning and end of + each dimension (default 3). + linewidth : int, optional + The number of characters per line for the purpose of inserting + line breaks (default 75). + suppress : bool, optional + If True, always print floating point numbers using fixed point + notation, in which case numbers equal to zero in the current precision + will print as zero. If False, then scientific notation is used when + absolute value of the smallest number is < 1e-4 or the ratio of the + maximum absolute value to the minimum is > 1e3. The default is False. + nanstr : str, optional + String representation of floating point not-a-number (default nan). + infstr : str, optional + String representation of floating point infinity (default inf). + sign : string, either '-', '+', or ' ', optional + Controls printing of the sign of floating-point types. If '+', always + print the sign of positive values. If ' ', always prints a space + (whitespace character) in the sign position of positive values. If + '-', omit the sign character of positive values. (default '-') + formatter : dict of callables, optional + If not None, the keys should indicate the type(s) that the respective + formatting function applies to. Callables should return a string. + Types that are not specified (by their corresponding keys) are handled + by the default formatters. Individual types for which a formatter + can be set are: + + - 'bool' + - 'int' + - 'timedelta' : a `numpy.timedelta64` + - 'datetime' : a `numpy.datetime64` + - 'float' + - 'longfloat' : 128-bit floats + - 'complexfloat' + - 'longcomplexfloat' : composed of two 128-bit floats + - 'numpystr' : types `numpy.bytes_` and `numpy.str_` + - 'object' : `np.object_` arrays + + Other keys that can be used to set a group of types at once are: + + - 'all' : sets all types + - 'int_kind' : sets 'int' + - 'float_kind' : sets 'float' and 'longfloat' + - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' + - 'str_kind' : sets 'numpystr' + floatmode : str, optional + Controls the interpretation of the `precision` option for + floating-point types. Can take the following values + (default maxprec_equal): + + * 'fixed': Always print exactly `precision` fractional digits, + even if this would print more or fewer digits than + necessary to specify the value uniquely. + * 'unique': Print the minimum number of fractional digits necessary + to represent each value uniquely. Different elements may + have a different number of digits. The value of the + `precision` option is ignored. + * 'maxprec': Print at most `precision` fractional digits, but if + an element can be uniquely represented with fewer digits + only print it with that many. + * 'maxprec_equal': Print at most `precision` fractional digits, + but if every element in the array can be uniquely + represented with an equal number of fewer digits, use that + many digits for all elements. + legacy : string or `False`, optional + If set to the string `'1.13'` enables 1.13 legacy printing mode. This + approximates numpy 1.13 print output by including a space in the sign + position of floats and different behavior for 0d arrays. This also + enables 1.21 legacy printing mode (described below). + + If set to the string `'1.21'` enables 1.21 legacy printing mode. This + approximates numpy 1.21 print output of complex structured dtypes + by not inserting spaces after commas that separate fields and after + colons. + + If set to `False`, disables legacy mode. + + Unrecognized strings will be ignored with a warning for forward + compatibility. + + .. versionadded:: 1.14.0 + .. versionchanged:: 1.22.0 + + See Also + -------- + get_printoptions, printoptions, set_string_function, array2string + + Notes + ----- + `formatter` is always reset with a call to `set_printoptions`. + + Use `printoptions` as a context manager to set the values temporarily. + + Examples + -------- + Floating point precision can be set: + + >>> np.set_printoptions(precision=4) + >>> np.array([1.123456789]) + [1.1235] + + Long arrays can be summarised: + + >>> np.set_printoptions(threshold=5) + >>> np.arange(10) + array([0, 1, 2, ..., 7, 8, 9]) + + Small results can be suppressed: + + >>> eps = np.finfo(float).eps + >>> x = np.arange(4.) + >>> x**2 - (x + eps)**2 + array([-4.9304e-32, -4.4409e-16, 0.0000e+00, 0.0000e+00]) + >>> np.set_printoptions(suppress=True) + >>> x**2 - (x + eps)**2 + array([-0., -0., 0., 0.]) + + A custom formatter can be used to display array elements as desired: + + >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)}) + >>> x = np.arange(3) + >>> x + array([int: 0, int: -1, int: -2]) + >>> np.set_printoptions() # formatter gets reset + >>> x + array([0, 1, 2]) + + To put back the default options, you can use: + + >>> np.set_printoptions(edgeitems=3, infstr='inf', + ... linewidth=75, nanstr='nan', precision=8, + ... suppress=False, threshold=1000, formatter=None) + + Also to temporarily override options, use `printoptions` as a context manager: + + >>> with np.printoptions(precision=2, suppress=True, threshold=5): + ... np.linspace(0, 10, 10) + array([ 0. , 1.11, 2.22, ..., 7.78, 8.89, 10. ]) + + """ + opt = _make_options_dict(precision, threshold, edgeitems, linewidth, + suppress, nanstr, infstr, sign, formatter, + floatmode, legacy) + # formatter is always reset + opt['formatter'] = formatter + _format_options.update(opt) + + # set the C variable for legacy mode + if _format_options['legacy'] == 113: + set_legacy_print_mode(113) + # reset the sign option in legacy mode to avoid confusion + _format_options['sign'] = '-' + elif _format_options['legacy'] == 121: + set_legacy_print_mode(121) + elif _format_options['legacy'] == sys.maxsize: + set_legacy_print_mode(0) + + +@set_module('numpy') +def get_printoptions(): + """ + Return the current print options. + + Returns + ------- + print_opts : dict + Dictionary of current print options with keys + + - precision : int + - threshold : int + - edgeitems : int + - linewidth : int + - suppress : bool + - nanstr : str + - infstr : str + - formatter : dict of callables + - sign : str + + For a full description of these options, see `set_printoptions`. + + See Also + -------- + set_printoptions, printoptions, set_string_function + + """ + opts = _format_options.copy() + opts['legacy'] = { + 113: '1.13', 121: '1.21', sys.maxsize: False, + }[opts['legacy']] + return opts + + +def _get_legacy_print_mode(): + """Return the legacy print mode as an int.""" + return _format_options['legacy'] + + +@set_module('numpy') +@contextlib.contextmanager +def printoptions(*args, **kwargs): + """Context manager for setting print options. + + Set print options for the scope of the `with` block, and restore the old + options at the end. See `set_printoptions` for the full description of + available options. + + Examples + -------- + + >>> from numpy.testing import assert_equal + >>> with np.printoptions(precision=2): + ... np.array([2.0]) / 3 + array([0.67]) + + The `as`-clause of the `with`-statement gives the current print options: + + >>> with np.printoptions(precision=2) as opts: + ... assert_equal(opts, np.get_printoptions()) + + See Also + -------- + set_printoptions, get_printoptions + + """ + opts = np.get_printoptions() + try: + np.set_printoptions(*args, **kwargs) + yield np.get_printoptions() + finally: + np.set_printoptions(**opts) + + +def _leading_trailing(a, edgeitems, index=()): + """ + Keep only the N-D corners (leading and trailing edges) of an array. + + Should be passed a base-class ndarray, since it makes no guarantees about + preserving subclasses. + """ + axis = len(index) + if axis == a.ndim: + return a[index] + + if a.shape[axis] > 2*edgeitems: + return concatenate(( + _leading_trailing(a, edgeitems, index + np.index_exp[ :edgeitems]), + _leading_trailing(a, edgeitems, index + np.index_exp[-edgeitems:]) + ), axis=axis) + else: + return _leading_trailing(a, edgeitems, index + np.index_exp[:]) + + +def _object_format(o): + """ Object arrays containing lists should be printed unambiguously """ + if type(o) is list: + fmt = 'list({!r})' + else: + fmt = '{!r}' + return fmt.format(o) + +def repr_format(x): + return repr(x) + +def str_format(x): + return str(x) + +def _get_formatdict(data, *, precision, floatmode, suppress, sign, legacy, + formatter, **kwargs): + # note: extra arguments in kwargs are ignored + + # wrapped in lambdas to avoid taking a code path with the wrong type of data + formatdict = { + 'bool': lambda: BoolFormat(data), + 'int': lambda: IntegerFormat(data), + 'float': lambda: FloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'longfloat': lambda: FloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'complexfloat': lambda: ComplexFloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'longcomplexfloat': lambda: ComplexFloatingFormat( + data, precision, floatmode, suppress, sign, legacy=legacy), + 'datetime': lambda: DatetimeFormat(data, legacy=legacy), + 'timedelta': lambda: TimedeltaFormat(data), + 'object': lambda: _object_format, + 'void': lambda: str_format, + 'numpystr': lambda: repr_format} + + # we need to wrap values in `formatter` in a lambda, so that the interface + # is the same as the above values. + def indirect(x): + return lambda: x + + if formatter is not None: + fkeys = [k for k in formatter.keys() if formatter[k] is not None] + if 'all' in fkeys: + for key in formatdict.keys(): + formatdict[key] = indirect(formatter['all']) + if 'int_kind' in fkeys: + for key in ['int']: + formatdict[key] = indirect(formatter['int_kind']) + if 'float_kind' in fkeys: + for key in ['float', 'longfloat']: + formatdict[key] = indirect(formatter['float_kind']) + if 'complex_kind' in fkeys: + for key in ['complexfloat', 'longcomplexfloat']: + formatdict[key] = indirect(formatter['complex_kind']) + if 'str_kind' in fkeys: + formatdict['numpystr'] = indirect(formatter['str_kind']) + for key in formatdict.keys(): + if key in fkeys: + formatdict[key] = indirect(formatter[key]) + + return formatdict + +def _get_format_function(data, **options): + """ + find the right formatting function for the dtype_ + """ + dtype_ = data.dtype + dtypeobj = dtype_.type + formatdict = _get_formatdict(data, **options) + if dtypeobj is None: + return formatdict["numpystr"]() + elif issubclass(dtypeobj, _nt.bool_): + return formatdict['bool']() + elif issubclass(dtypeobj, _nt.integer): + if issubclass(dtypeobj, _nt.timedelta64): + return formatdict['timedelta']() + else: + return formatdict['int']() + elif issubclass(dtypeobj, _nt.floating): + if issubclass(dtypeobj, _nt.longfloat): + return formatdict['longfloat']() + else: + return formatdict['float']() + elif issubclass(dtypeobj, _nt.complexfloating): + if issubclass(dtypeobj, _nt.clongfloat): + return formatdict['longcomplexfloat']() + else: + return formatdict['complexfloat']() + elif issubclass(dtypeobj, (_nt.str_, _nt.bytes_)): + return formatdict['numpystr']() + elif issubclass(dtypeobj, _nt.datetime64): + return formatdict['datetime']() + elif issubclass(dtypeobj, _nt.object_): + return formatdict['object']() + elif issubclass(dtypeobj, _nt.void): + if dtype_.names is not None: + return StructuredVoidFormat.from_data(data, **options) + else: + return formatdict['void']() + else: + return formatdict['numpystr']() + + +def _recursive_guard(fillvalue='...'): + """ + Like the python 3.2 reprlib.recursive_repr, but forwards *args and **kwargs + + Decorates a function such that if it calls itself with the same first + argument, it returns `fillvalue` instead of recursing. + + Largely copied from reprlib.recursive_repr + """ + + def decorating_function(f): + repr_running = set() + + @functools.wraps(f) + def wrapper(self, *args, **kwargs): + key = id(self), get_ident() + if key in repr_running: + return fillvalue + repr_running.add(key) + try: + return f(self, *args, **kwargs) + finally: + repr_running.discard(key) + + return wrapper + + return decorating_function + + +# gracefully handle recursive calls, when object arrays contain themselves +@_recursive_guard() +def _array2string(a, options, separator=' ', prefix=""): + # The formatter __init__s in _get_format_function cannot deal with + # subclasses yet, and we also need to avoid recursion issues in + # _formatArray with subclasses which return 0d arrays in place of scalars + data = asarray(a) + if a.shape == (): + a = data + + if a.size > options['threshold']: + summary_insert = "..." + data = _leading_trailing(data, options['edgeitems']) + else: + summary_insert = "" + + # find the right formatting function for the array + format_function = _get_format_function(data, **options) + + # skip over "[" + next_line_prefix = " " + # skip over array( + next_line_prefix += " "*len(prefix) + + lst = _formatArray(a, format_function, options['linewidth'], + next_line_prefix, separator, options['edgeitems'], + summary_insert, options['legacy']) + return lst + + +def _array2string_dispatcher( + a, max_line_width=None, precision=None, + suppress_small=None, separator=None, prefix=None, + style=None, formatter=None, threshold=None, + edgeitems=None, sign=None, floatmode=None, suffix=None, + *, legacy=None): + return (a,) + + +@array_function_dispatch(_array2string_dispatcher, module='numpy') +def array2string(a, max_line_width=None, precision=None, + suppress_small=None, separator=' ', prefix="", + style=np._NoValue, formatter=None, threshold=None, + edgeitems=None, sign=None, floatmode=None, suffix="", + *, legacy=None): + """ + Return a string representation of an array. + + Parameters + ---------- + a : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int or None, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + separator : str, optional + Inserted between elements. + prefix : str, optional + suffix : str, optional + The length of the prefix and suffix strings are used to respectively + align and wrap the output. An array is typically printed as:: + + prefix + array2string(a) + suffix + + The output is left-padded by the length of the prefix string, and + wrapping is forced at the column ``max_line_width - len(suffix)``. + It should be noted that the content of prefix and suffix strings are + not included in the output. + style : _NoValue, optional + Has no effect, do not use. + + .. deprecated:: 1.14.0 + formatter : dict of callables, optional + If not None, the keys should indicate the type(s) that the respective + formatting function applies to. Callables should return a string. + Types that are not specified (by their corresponding keys) are handled + by the default formatters. Individual types for which a formatter + can be set are: + + - 'bool' + - 'int' + - 'timedelta' : a `numpy.timedelta64` + - 'datetime' : a `numpy.datetime64` + - 'float' + - 'longfloat' : 128-bit floats + - 'complexfloat' + - 'longcomplexfloat' : composed of two 128-bit floats + - 'void' : type `numpy.void` + - 'numpystr' : types `numpy.bytes_` and `numpy.str_` + + Other keys that can be used to set a group of types at once are: + + - 'all' : sets all types + - 'int_kind' : sets 'int' + - 'float_kind' : sets 'float' and 'longfloat' + - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat' + - 'str_kind' : sets 'numpystr' + threshold : int, optional + Total number of array elements which trigger summarization + rather than full repr. + Defaults to ``numpy.get_printoptions()['threshold']``. + edgeitems : int, optional + Number of array items in summary at beginning and end of + each dimension. + Defaults to ``numpy.get_printoptions()['edgeitems']``. + sign : string, either '-', '+', or ' ', optional + Controls printing of the sign of floating-point types. If '+', always + print the sign of positive values. If ' ', always prints a space + (whitespace character) in the sign position of positive values. If + '-', omit the sign character of positive values. + Defaults to ``numpy.get_printoptions()['sign']``. + floatmode : str, optional + Controls the interpretation of the `precision` option for + floating-point types. + Defaults to ``numpy.get_printoptions()['floatmode']``. + Can take the following values: + + - 'fixed': Always print exactly `precision` fractional digits, + even if this would print more or fewer digits than + necessary to specify the value uniquely. + - 'unique': Print the minimum number of fractional digits necessary + to represent each value uniquely. Different elements may + have a different number of digits. The value of the + `precision` option is ignored. + - 'maxprec': Print at most `precision` fractional digits, but if + an element can be uniquely represented with fewer digits + only print it with that many. + - 'maxprec_equal': Print at most `precision` fractional digits, + but if every element in the array can be uniquely + represented with an equal number of fewer digits, use that + many digits for all elements. + legacy : string or `False`, optional + If set to the string `'1.13'` enables 1.13 legacy printing mode. This + approximates numpy 1.13 print output by including a space in the sign + position of floats and different behavior for 0d arrays. If set to + `False`, disables legacy mode. Unrecognized strings will be ignored + with a warning for forward compatibility. + + .. versionadded:: 1.14.0 + + Returns + ------- + array_str : str + String representation of the array. + + Raises + ------ + TypeError + if a callable in `formatter` does not return a string. + + See Also + -------- + array_str, array_repr, set_printoptions, get_printoptions + + Notes + ----- + If a formatter is specified for a certain type, the `precision` keyword is + ignored for that type. + + This is a very flexible function; `array_repr` and `array_str` are using + `array2string` internally so keywords with the same name should work + identically in all three functions. + + Examples + -------- + >>> x = np.array([1e-16,1,2,3]) + >>> np.array2string(x, precision=2, separator=',', + ... suppress_small=True) + '[0.,1.,2.,3.]' + + >>> x = np.arange(3.) + >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x}) + '[0.00 1.00 2.00]' + + >>> x = np.arange(3) + >>> np.array2string(x, formatter={'int':lambda x: hex(x)}) + '[0x0 0x1 0x2]' + + """ + + overrides = _make_options_dict(precision, threshold, edgeitems, + max_line_width, suppress_small, None, None, + sign, formatter, floatmode, legacy) + options = _format_options.copy() + options.update(overrides) + + if options['legacy'] <= 113: + if style is np._NoValue: + style = repr + + if a.shape == () and a.dtype.names is None: + return style(a.item()) + elif style is not np._NoValue: + # Deprecation 11-9-2017 v1.14 + warnings.warn("'style' argument is deprecated and no longer functional" + " except in 1.13 'legacy' mode", + DeprecationWarning, stacklevel=2) + + if options['legacy'] > 113: + options['linewidth'] -= len(suffix) + + # treat as a null array if any of shape elements == 0 + if a.size == 0: + return "[]" + + return _array2string(a, options, separator, prefix) + + +def _extendLine(s, line, word, line_width, next_line_prefix, legacy): + needs_wrap = len(line) + len(word) > line_width + if legacy > 113: + # don't wrap lines if it won't help + if len(line) <= len(next_line_prefix): + needs_wrap = False + + if needs_wrap: + s += line.rstrip() + "\n" + line = next_line_prefix + line += word + return s, line + + +def _extendLine_pretty(s, line, word, line_width, next_line_prefix, legacy): + """ + Extends line with nicely formatted (possibly multi-line) string ``word``. + """ + words = word.splitlines() + if len(words) == 1 or legacy <= 113: + return _extendLine(s, line, word, line_width, next_line_prefix, legacy) + + max_word_length = max(len(word) for word in words) + if (len(line) + max_word_length > line_width and + len(line) > len(next_line_prefix)): + s += line.rstrip() + '\n' + line = next_line_prefix + words[0] + indent = next_line_prefix + else: + indent = len(line)*' ' + line += words[0] + + for word in words[1::]: + s += line.rstrip() + '\n' + line = indent + word + + suffix_length = max_word_length - len(words[-1]) + line += suffix_length*' ' + + return s, line + +def _formatArray(a, format_function, line_width, next_line_prefix, + separator, edge_items, summary_insert, legacy): + """formatArray is designed for two modes of operation: + + 1. Full output + + 2. Summarized output + + """ + def recurser(index, hanging_indent, curr_width): + """ + By using this local function, we don't need to recurse with all the + arguments. Since this function is not created recursively, the cost is + not significant + """ + axis = len(index) + axes_left = a.ndim - axis + + if axes_left == 0: + return format_function(a[index]) + + # when recursing, add a space to align with the [ added, and reduce the + # length of the line by 1 + next_hanging_indent = hanging_indent + ' ' + if legacy <= 113: + next_width = curr_width + else: + next_width = curr_width - len(']') + + a_len = a.shape[axis] + show_summary = summary_insert and 2*edge_items < a_len + if show_summary: + leading_items = edge_items + trailing_items = edge_items + else: + leading_items = 0 + trailing_items = a_len + + # stringify the array with the hanging indent on the first line too + s = '' + + # last axis (rows) - wrap elements if they would not fit on one line + if axes_left == 1: + # the length up until the beginning of the separator / bracket + if legacy <= 113: + elem_width = curr_width - len(separator.rstrip()) + else: + elem_width = curr_width - max(len(separator.rstrip()), len(']')) + + line = hanging_indent + for i in range(leading_items): + word = recurser(index + (i,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + line += separator + + if show_summary: + s, line = _extendLine( + s, line, summary_insert, elem_width, hanging_indent, legacy) + if legacy <= 113: + line += ", " + else: + line += separator + + for i in range(trailing_items, 1, -1): + word = recurser(index + (-i,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + line += separator + + if legacy <= 113: + # width of the separator is not considered on 1.13 + elem_width = curr_width + word = recurser(index + (-1,), next_hanging_indent, next_width) + s, line = _extendLine_pretty( + s, line, word, elem_width, hanging_indent, legacy) + + s += line + + # other axes - insert newlines between rows + else: + s = '' + line_sep = separator.rstrip() + '\n'*(axes_left - 1) + + for i in range(leading_items): + nested = recurser(index + (i,), next_hanging_indent, next_width) + s += hanging_indent + nested + line_sep + + if show_summary: + if legacy <= 113: + # trailing space, fixed nbr of newlines, and fixed separator + s += hanging_indent + summary_insert + ", \n" + else: + s += hanging_indent + summary_insert + line_sep + + for i in range(trailing_items, 1, -1): + nested = recurser(index + (-i,), next_hanging_indent, + next_width) + s += hanging_indent + nested + line_sep + + nested = recurser(index + (-1,), next_hanging_indent, next_width) + s += hanging_indent + nested + + # remove the hanging indent, and wrap in [] + s = '[' + s[len(hanging_indent):] + ']' + return s + + try: + # invoke the recursive part with an initial index and prefix + return recurser(index=(), + hanging_indent=next_line_prefix, + curr_width=line_width) + finally: + # recursive closures have a cyclic reference to themselves, which + # requires gc to collect (gh-10620). To avoid this problem, for + # performance and PyPy friendliness, we break the cycle: + recurser = None + +def _none_or_positive_arg(x, name): + if x is None: + return -1 + if x < 0: + raise ValueError("{} must be >= 0".format(name)) + return x + +class FloatingFormat: + """ Formatter for subtypes of np.floating """ + def __init__(self, data, precision, floatmode, suppress_small, sign=False, + *, legacy=None): + # for backcompatibility, accept bools + if isinstance(sign, bool): + sign = '+' if sign else '-' + + self._legacy = legacy + if self._legacy <= 113: + # when not 0d, legacy does not support '-' + if data.shape != () and sign == '-': + sign = ' ' + + self.floatmode = floatmode + if floatmode == 'unique': + self.precision = None + else: + self.precision = precision + + self.precision = _none_or_positive_arg(self.precision, 'precision') + + self.suppress_small = suppress_small + self.sign = sign + self.exp_format = False + self.large_exponent = False + + self.fillFormat(data) + + def fillFormat(self, data): + # only the finite values are used to compute the number of digits + finite_vals = data[isfinite(data)] + + # choose exponential mode based on the non-zero finite values: + abs_non_zero = absolute(finite_vals[finite_vals != 0]) + if len(abs_non_zero) != 0: + max_val = np.max(abs_non_zero) + min_val = np.min(abs_non_zero) + with errstate(over='ignore'): # division can overflow + if max_val >= 1.e8 or (not self.suppress_small and + (min_val < 0.0001 or max_val/min_val > 1000.)): + self.exp_format = True + + # do a first pass of printing all the numbers, to determine sizes + if len(finite_vals) == 0: + self.pad_left = 0 + self.pad_right = 0 + self.trim = '.' + self.exp_size = -1 + self.unique = True + self.min_digits = None + elif self.exp_format: + trim, unique = '.', True + if self.floatmode == 'fixed' or self._legacy <= 113: + trim, unique = 'k', False + strs = (dragon4_scientific(x, precision=self.precision, + unique=unique, trim=trim, sign=self.sign == '+') + for x in finite_vals) + frac_strs, _, exp_strs = zip(*(s.partition('e') for s in strs)) + int_part, frac_part = zip(*(s.split('.') for s in frac_strs)) + self.exp_size = max(len(s) for s in exp_strs) - 1 + + self.trim = 'k' + self.precision = max(len(s) for s in frac_part) + self.min_digits = self.precision + self.unique = unique + + # for back-compat with np 1.13, use 2 spaces & sign and full prec + if self._legacy <= 113: + self.pad_left = 3 + else: + # this should be only 1 or 2. Can be calculated from sign. + self.pad_left = max(len(s) for s in int_part) + # pad_right is only needed for nan length calculation + self.pad_right = self.exp_size + 2 + self.precision + else: + trim, unique = '.', True + if self.floatmode == 'fixed': + trim, unique = 'k', False + strs = (dragon4_positional(x, precision=self.precision, + fractional=True, + unique=unique, trim=trim, + sign=self.sign == '+') + for x in finite_vals) + int_part, frac_part = zip(*(s.split('.') for s in strs)) + if self._legacy <= 113: + self.pad_left = 1 + max(len(s.lstrip('-+')) for s in int_part) + else: + self.pad_left = max(len(s) for s in int_part) + self.pad_right = max(len(s) for s in frac_part) + self.exp_size = -1 + self.unique = unique + + if self.floatmode in ['fixed', 'maxprec_equal']: + self.precision = self.min_digits = self.pad_right + self.trim = 'k' + else: + self.trim = '.' + self.min_digits = 0 + + if self._legacy > 113: + # account for sign = ' ' by adding one to pad_left + if self.sign == ' ' and not any(np.signbit(finite_vals)): + self.pad_left += 1 + + # if there are non-finite values, may need to increase pad_left + if data.size != finite_vals.size: + neginf = self.sign != '-' or any(data[isinf(data)] < 0) + nanlen = len(_format_options['nanstr']) + inflen = len(_format_options['infstr']) + neginf + offset = self.pad_right + 1 # +1 for decimal pt + self.pad_left = max(self.pad_left, nanlen - offset, inflen - offset) + + def __call__(self, x): + if not np.isfinite(x): + with errstate(invalid='ignore'): + if np.isnan(x): + sign = '+' if self.sign == '+' else '' + ret = sign + _format_options['nanstr'] + else: # isinf + sign = '-' if x < 0 else '+' if self.sign == '+' else '' + ret = sign + _format_options['infstr'] + return ' '*(self.pad_left + self.pad_right + 1 - len(ret)) + ret + + if self.exp_format: + return dragon4_scientific(x, + precision=self.precision, + min_digits=self.min_digits, + unique=self.unique, + trim=self.trim, + sign=self.sign == '+', + pad_left=self.pad_left, + exp_digits=self.exp_size) + else: + return dragon4_positional(x, + precision=self.precision, + min_digits=self.min_digits, + unique=self.unique, + fractional=True, + trim=self.trim, + sign=self.sign == '+', + pad_left=self.pad_left, + pad_right=self.pad_right) + + +@set_module('numpy') +def format_float_scientific(x, precision=None, unique=True, trim='k', + sign=False, pad_left=None, exp_digits=None, + min_digits=None): + """ + Format a floating-point scalar as a decimal string in scientific notation. + + Provides control over rounding, trimming and padding. Uses and assumes + IEEE unbiased rounding. Uses the "Dragon4" algorithm. + + Parameters + ---------- + x : python float or numpy floating scalar + Value to format. + precision : non-negative integer or None, optional + Maximum number of digits to print. May be None if `unique` is + `True`, but must be an integer if unique is `False`. + unique : boolean, optional + If `True`, use a digit-generation strategy which gives the shortest + representation which uniquely identifies the floating-point number from + other values of the same type, by judicious rounding. If `precision` + is given fewer digits than necessary can be printed. If `min_digits` + is given more can be printed, in which cases the last digit is rounded + with unbiased rounding. + If `False`, digits are generated as if printing an infinite-precision + value and stopping after `precision` digits, rounding the remaining + value with unbiased rounding + trim : one of 'k', '.', '0', '-', optional + Controls post-processing trimming of trailing digits, as follows: + + * 'k' : keep trailing zeros, keep decimal point (no trimming) + * '.' : trim all trailing zeros, leave decimal point + * '0' : trim all but the zero before the decimal point. Insert the + zero if it is missing. + * '-' : trim trailing zeros and any trailing decimal point + sign : boolean, optional + Whether to show the sign for positive values. + pad_left : non-negative integer, optional + Pad the left side of the string with whitespace until at least that + many characters are to the left of the decimal point. + exp_digits : non-negative integer, optional + Pad the exponent with zeros until it contains at least this many digits. + If omitted, the exponent will be at least 2 digits. + min_digits : non-negative integer or None, optional + Minimum number of digits to print. This only has an effect for + `unique=True`. In that case more digits than necessary to uniquely + identify the value may be printed and rounded unbiased. + + -- versionadded:: 1.21.0 + + Returns + ------- + rep : string + The string representation of the floating point value + + See Also + -------- + format_float_positional + + Examples + -------- + >>> np.format_float_scientific(np.float32(np.pi)) + '3.1415927e+00' + >>> s = np.float32(1.23e24) + >>> np.format_float_scientific(s, unique=False, precision=15) + '1.230000071797338e+24' + >>> np.format_float_scientific(s, exp_digits=4) + '1.23e+0024' + """ + precision = _none_or_positive_arg(precision, 'precision') + pad_left = _none_or_positive_arg(pad_left, 'pad_left') + exp_digits = _none_or_positive_arg(exp_digits, 'exp_digits') + min_digits = _none_or_positive_arg(min_digits, 'min_digits') + if min_digits > 0 and precision > 0 and min_digits > precision: + raise ValueError("min_digits must be less than or equal to precision") + return dragon4_scientific(x, precision=precision, unique=unique, + trim=trim, sign=sign, pad_left=pad_left, + exp_digits=exp_digits, min_digits=min_digits) + + +@set_module('numpy') +def format_float_positional(x, precision=None, unique=True, + fractional=True, trim='k', sign=False, + pad_left=None, pad_right=None, min_digits=None): + """ + Format a floating-point scalar as a decimal string in positional notation. + + Provides control over rounding, trimming and padding. Uses and assumes + IEEE unbiased rounding. Uses the "Dragon4" algorithm. + + Parameters + ---------- + x : python float or numpy floating scalar + Value to format. + precision : non-negative integer or None, optional + Maximum number of digits to print. May be None if `unique` is + `True`, but must be an integer if unique is `False`. + unique : boolean, optional + If `True`, use a digit-generation strategy which gives the shortest + representation which uniquely identifies the floating-point number from + other values of the same type, by judicious rounding. If `precision` + is given fewer digits than necessary can be printed, or if `min_digits` + is given more can be printed, in which cases the last digit is rounded + with unbiased rounding. + If `False`, digits are generated as if printing an infinite-precision + value and stopping after `precision` digits, rounding the remaining + value with unbiased rounding + fractional : boolean, optional + If `True`, the cutoffs of `precision` and `min_digits` refer to the + total number of digits after the decimal point, including leading + zeros. + If `False`, `precision` and `min_digits` refer to the total number of + significant digits, before or after the decimal point, ignoring leading + zeros. + trim : one of 'k', '.', '0', '-', optional + Controls post-processing trimming of trailing digits, as follows: + + * 'k' : keep trailing zeros, keep decimal point (no trimming) + * '.' : trim all trailing zeros, leave decimal point + * '0' : trim all but the zero before the decimal point. Insert the + zero if it is missing. + * '-' : trim trailing zeros and any trailing decimal point + sign : boolean, optional + Whether to show the sign for positive values. + pad_left : non-negative integer, optional + Pad the left side of the string with whitespace until at least that + many characters are to the left of the decimal point. + pad_right : non-negative integer, optional + Pad the right side of the string with whitespace until at least that + many characters are to the right of the decimal point. + min_digits : non-negative integer or None, optional + Minimum number of digits to print. Only has an effect if `unique=True` + in which case additional digits past those necessary to uniquely + identify the value may be printed, rounding the last additional digit. + + -- versionadded:: 1.21.0 + + Returns + ------- + rep : string + The string representation of the floating point value + + See Also + -------- + format_float_scientific + + Examples + -------- + >>> np.format_float_positional(np.float32(np.pi)) + '3.1415927' + >>> np.format_float_positional(np.float16(np.pi)) + '3.14' + >>> np.format_float_positional(np.float16(0.3)) + '0.3' + >>> np.format_float_positional(np.float16(0.3), unique=False, precision=10) + '0.3000488281' + """ + precision = _none_or_positive_arg(precision, 'precision') + pad_left = _none_or_positive_arg(pad_left, 'pad_left') + pad_right = _none_or_positive_arg(pad_right, 'pad_right') + min_digits = _none_or_positive_arg(min_digits, 'min_digits') + if not fractional and precision == 0: + raise ValueError("precision must be greater than 0 if " + "fractional=False") + if min_digits > 0 and precision > 0 and min_digits > precision: + raise ValueError("min_digits must be less than or equal to precision") + return dragon4_positional(x, precision=precision, unique=unique, + fractional=fractional, trim=trim, + sign=sign, pad_left=pad_left, + pad_right=pad_right, min_digits=min_digits) + + +class IntegerFormat: + def __init__(self, data): + if data.size > 0: + max_str_len = max(len(str(np.max(data))), + len(str(np.min(data)))) + else: + max_str_len = 0 + self.format = '%{}d'.format(max_str_len) + + def __call__(self, x): + return self.format % x + + +class BoolFormat: + def __init__(self, data, **kwargs): + # add an extra space so " True" and "False" have the same length and + # array elements align nicely when printed, except in 0d arrays + self.truestr = ' True' if data.shape != () else 'True' + + def __call__(self, x): + return self.truestr if x else "False" + + +class ComplexFloatingFormat: + """ Formatter for subtypes of np.complexfloating """ + def __init__(self, x, precision, floatmode, suppress_small, + sign=False, *, legacy=None): + # for backcompatibility, accept bools + if isinstance(sign, bool): + sign = '+' if sign else '-' + + floatmode_real = floatmode_imag = floatmode + if legacy <= 113: + floatmode_real = 'maxprec_equal' + floatmode_imag = 'maxprec' + + self.real_format = FloatingFormat( + x.real, precision, floatmode_real, suppress_small, + sign=sign, legacy=legacy + ) + self.imag_format = FloatingFormat( + x.imag, precision, floatmode_imag, suppress_small, + sign='+', legacy=legacy + ) + + def __call__(self, x): + r = self.real_format(x.real) + i = self.imag_format(x.imag) + + # add the 'j' before the terminal whitespace in i + sp = len(i.rstrip()) + i = i[:sp] + 'j' + i[sp:] + + return r + i + + +class _TimelikeFormat: + def __init__(self, data): + non_nat = data[~isnat(data)] + if len(non_nat) > 0: + # Max str length of non-NaT elements + max_str_len = max(len(self._format_non_nat(np.max(non_nat))), + len(self._format_non_nat(np.min(non_nat)))) + else: + max_str_len = 0 + if len(non_nat) < data.size: + # data contains a NaT + max_str_len = max(max_str_len, 5) + self._format = '%{}s'.format(max_str_len) + self._nat = "'NaT'".rjust(max_str_len) + + def _format_non_nat(self, x): + # override in subclass + raise NotImplementedError + + def __call__(self, x): + if isnat(x): + return self._nat + else: + return self._format % self._format_non_nat(x) + + +class DatetimeFormat(_TimelikeFormat): + def __init__(self, x, unit=None, timezone=None, casting='same_kind', + legacy=False): + # Get the unit from the dtype + if unit is None: + if x.dtype.kind == 'M': + unit = datetime_data(x.dtype)[0] + else: + unit = 's' + + if timezone is None: + timezone = 'naive' + self.timezone = timezone + self.unit = unit + self.casting = casting + self.legacy = legacy + + # must be called after the above are configured + super().__init__(x) + + def __call__(self, x): + if self.legacy <= 113: + return self._format_non_nat(x) + return super().__call__(x) + + def _format_non_nat(self, x): + return "'%s'" % datetime_as_string(x, + unit=self.unit, + timezone=self.timezone, + casting=self.casting) + + +class TimedeltaFormat(_TimelikeFormat): + def _format_non_nat(self, x): + return str(x.astype('i8')) + + +class SubArrayFormat: + def __init__(self, format_function, **options): + self.format_function = format_function + self.threshold = options['threshold'] + self.edge_items = options['edgeitems'] + + def __call__(self, a): + self.summary_insert = "..." if a.size > self.threshold else "" + return self.format_array(a) + + def format_array(self, a): + if np.ndim(a) == 0: + return self.format_function(a) + + if self.summary_insert and a.shape[0] > 2*self.edge_items: + formatted = ( + [self.format_array(a_) for a_ in a[:self.edge_items]] + + [self.summary_insert] + + [self.format_array(a_) for a_ in a[-self.edge_items:]] + ) + else: + formatted = [self.format_array(a_) for a_ in a] + + return "[" + ", ".join(formatted) + "]" + + +class StructuredVoidFormat: + """ + Formatter for structured np.void objects. + + This does not work on structured alias types like np.dtype(('i4', 'i2,i2')), + as alias scalars lose their field information, and the implementation + relies upon np.void.__getitem__. + """ + def __init__(self, format_functions): + self.format_functions = format_functions + + @classmethod + def from_data(cls, data, **options): + """ + This is a second way to initialize StructuredVoidFormat, using the raw data + as input. Added to avoid changing the signature of __init__. + """ + format_functions = [] + for field_name in data.dtype.names: + format_function = _get_format_function(data[field_name], **options) + if data.dtype[field_name].shape != (): + format_function = SubArrayFormat(format_function, **options) + format_functions.append(format_function) + return cls(format_functions) + + def __call__(self, x): + str_fields = [ + format_function(field) + for field, format_function in zip(x, self.format_functions) + ] + if len(str_fields) == 1: + return "({},)".format(str_fields[0]) + else: + return "({})".format(", ".join(str_fields)) + + +def _void_scalar_repr(x): + """ + Implements the repr for structured-void scalars. It is called from the + scalartypes.c.src code, and is placed here because it uses the elementwise + formatters defined above. + """ + return StructuredVoidFormat.from_data(array(x), **_format_options)(x) + + +_typelessdata = [int_, float_, complex_, bool_] + + +def dtype_is_implied(dtype): + """ + Determine if the given dtype is implied by the representation of its values. + + Parameters + ---------- + dtype : dtype + Data type + + Returns + ------- + implied : bool + True if the dtype is implied by the representation of its values. + + Examples + -------- + >>> np.core.arrayprint.dtype_is_implied(int) + True + >>> np.array([1, 2, 3], int) + array([1, 2, 3]) + >>> np.core.arrayprint.dtype_is_implied(np.int8) + False + >>> np.array([1, 2, 3], np.int8) + array([1, 2, 3], dtype=int8) + """ + dtype = np.dtype(dtype) + if _format_options['legacy'] <= 113 and dtype.type == bool_: + return False + + # not just void types can be structured, and names are not part of the repr + if dtype.names is not None: + return False + + # should care about endianness *unless size is 1* (e.g., int8, bool) + if not dtype.isnative: + return False + + return dtype.type in _typelessdata + + +def dtype_short_repr(dtype): + """ + Convert a dtype to a short form which evaluates to the same dtype. + + The intent is roughly that the following holds + + >>> from numpy import * + >>> dt = np.int64([1, 2]).dtype + >>> assert eval(dtype_short_repr(dt)) == dt + """ + if type(dtype).__repr__ != np.dtype.__repr__: + # TODO: Custom repr for user DTypes, logic should likely move. + return repr(dtype) + if dtype.names is not None: + # structured dtypes give a list or tuple repr + return str(dtype) + elif issubclass(dtype.type, flexible): + # handle these separately so they don't give garbage like str256 + return "'%s'" % str(dtype) + + typename = dtype.name + if not dtype.isnative: + # deal with cases like dtype(' 0 + + prefix = class_name + "(" + suffix = ")" if skipdtype else "," + + if (_format_options['legacy'] <= 113 and + arr.shape == () and not arr.dtype.names): + lst = repr(arr.item()) + elif arr.size > 0 or arr.shape == (0,): + lst = array2string(arr, max_line_width, precision, suppress_small, + ', ', prefix, suffix=suffix) + else: # show zero-length shape unless it is (0,) + lst = "[], shape=%s" % (repr(arr.shape),) + + arr_str = prefix + lst + suffix + + if skipdtype: + return arr_str + + dtype_str = "dtype={})".format(dtype_short_repr(arr.dtype)) + + # compute whether we should put dtype on a new line: Do so if adding the + # dtype would extend the last line past max_line_width. + # Note: This line gives the correct result even when rfind returns -1. + last_line_len = len(arr_str) - (arr_str.rfind('\n') + 1) + spacer = " " + if _format_options['legacy'] <= 113: + if issubclass(arr.dtype.type, flexible): + spacer = '\n' + ' '*len(class_name + "(") + elif last_line_len + len(dtype_str) + 1 > max_line_width: + spacer = '\n' + ' '*len(class_name + "(") + + return arr_str + spacer + dtype_str + + +def _array_repr_dispatcher( + arr, max_line_width=None, precision=None, suppress_small=None): + return (arr,) + + +@array_function_dispatch(_array_repr_dispatcher, module='numpy') +def array_repr(arr, max_line_width=None, precision=None, suppress_small=None): + """ + Return the string representation of an array. + + Parameters + ---------- + arr : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + + Returns + ------- + string : str + The string representation of an array. + + See Also + -------- + array_str, array2string, set_printoptions + + Examples + -------- + >>> np.array_repr(np.array([1,2])) + 'array([1, 2])' + >>> np.array_repr(np.ma.array([0.])) + 'MaskedArray([0.])' + >>> np.array_repr(np.array([], np.int32)) + 'array([], dtype=int32)' + + >>> x = np.array([1e-6, 4e-7, 2, 3]) + >>> np.array_repr(x, precision=6, suppress_small=True) + 'array([0.000001, 0. , 2. , 3. ])' + + """ + return _array_repr_implementation( + arr, max_line_width, precision, suppress_small) + + +@_recursive_guard() +def _guarded_repr_or_str(v): + if isinstance(v, bytes): + return repr(v) + return str(v) + + +def _array_str_implementation( + a, max_line_width=None, precision=None, suppress_small=None, + array2string=array2string): + """Internal version of array_str() that allows overriding array2string.""" + if (_format_options['legacy'] <= 113 and + a.shape == () and not a.dtype.names): + return str(a.item()) + + # the str of 0d arrays is a special case: It should appear like a scalar, + # so floats are not truncated by `precision`, and strings are not wrapped + # in quotes. So we return the str of the scalar value. + if a.shape == (): + # obtain a scalar and call str on it, avoiding problems for subclasses + # for which indexing with () returns a 0d instead of a scalar by using + # ndarray's getindex. Also guard against recursive 0d object arrays. + return _guarded_repr_or_str(np.ndarray.__getitem__(a, ())) + + return array2string(a, max_line_width, precision, suppress_small, ' ', "") + + +def _array_str_dispatcher( + a, max_line_width=None, precision=None, suppress_small=None): + return (a,) + + +@array_function_dispatch(_array_str_dispatcher, module='numpy') +def array_str(a, max_line_width=None, precision=None, suppress_small=None): + """ + Return a string representation of the data in an array. + + The data in the array is returned as a single string. This function is + similar to `array_repr`, the difference being that `array_repr` also + returns information on the kind of array and its data type. + + Parameters + ---------- + a : ndarray + Input array. + max_line_width : int, optional + Inserts newlines if text is longer than `max_line_width`. + Defaults to ``numpy.get_printoptions()['linewidth']``. + precision : int, optional + Floating point precision. + Defaults to ``numpy.get_printoptions()['precision']``. + suppress_small : bool, optional + Represent numbers "very close" to zero as zero; default is False. + Very close is defined by precision: if the precision is 8, e.g., + numbers smaller (in absolute value) than 5e-9 are represented as + zero. + Defaults to ``numpy.get_printoptions()['suppress']``. + + See Also + -------- + array2string, array_repr, set_printoptions + + Examples + -------- + >>> np.array_str(np.arange(3)) + '[0 1 2]' + + """ + return _array_str_implementation( + a, max_line_width, precision, suppress_small) + + +# needed if __array_function__ is disabled +_array2string_impl = getattr(array2string, '__wrapped__', array2string) +_default_array_str = functools.partial(_array_str_implementation, + array2string=_array2string_impl) +_default_array_repr = functools.partial(_array_repr_implementation, + array2string=_array2string_impl) + + +def set_string_function(f, repr=True): + """ + Set a Python function to be used when pretty printing arrays. + + Parameters + ---------- + f : function or None + Function to be used to pretty print arrays. The function should expect + a single array argument and return a string of the representation of + the array. If None, the function is reset to the default NumPy function + to print arrays. + repr : bool, optional + If True (default), the function for pretty printing (``__repr__``) + is set, if False the function that returns the default string + representation (``__str__``) is set. + + See Also + -------- + set_printoptions, get_printoptions + + Examples + -------- + >>> def pprint(arr): + ... return 'HA! - What are you going to do now?' + ... + >>> np.set_string_function(pprint) + >>> a = np.arange(10) + >>> a + HA! - What are you going to do now? + >>> _ = a + >>> # [0 1 2 3 4 5 6 7 8 9] + + We can reset the function to the default: + + >>> np.set_string_function(None) + >>> a + array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) + + `repr` affects either pretty printing or normal string representation. + Note that ``__repr__`` is still affected by setting ``__str__`` + because the width of each array element in the returned string becomes + equal to the length of the result of ``__str__()``. + + >>> x = np.arange(4) + >>> np.set_string_function(lambda x:'random', repr=False) + >>> x.__str__() + 'random' + >>> x.__repr__() + 'array([0, 1, 2, 3])' + + """ + if f is None: + if repr: + return multiarray.set_string_function(_default_array_repr, 1) + else: + return multiarray.set_string_function(_default_array_str, 0) + else: + return multiarray.set_string_function(f, repr) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.pyi b/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.pyi new file mode 100644 index 0000000000000000000000000000000000000000..d8255387a3a52635b30312d2800d02220b7ce6f2 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/arrayprint.pyi @@ -0,0 +1,142 @@ +from types import TracebackType +from collections.abc import Callable +from typing import Any, Literal, TypedDict, SupportsIndex + +# Using a private class is by no means ideal, but it is simply a consequence +# of a `contextlib.context` returning an instance of aforementioned class +from contextlib import _GeneratorContextManager + +from numpy import ( + ndarray, + generic, + bool_, + integer, + timedelta64, + datetime64, + floating, + complexfloating, + void, + str_, + bytes_, + longdouble, + clongdouble, +) +from numpy._typing import ArrayLike, _CharLike_co, _FloatLike_co + +_FloatMode = Literal["fixed", "unique", "maxprec", "maxprec_equal"] + +class _FormatDict(TypedDict, total=False): + bool: Callable[[bool_], str] + int: Callable[[integer[Any]], str] + timedelta: Callable[[timedelta64], str] + datetime: Callable[[datetime64], str] + float: Callable[[floating[Any]], str] + longfloat: Callable[[longdouble], str] + complexfloat: Callable[[complexfloating[Any, Any]], str] + longcomplexfloat: Callable[[clongdouble], str] + void: Callable[[void], str] + numpystr: Callable[[_CharLike_co], str] + object: Callable[[object], str] + all: Callable[[object], str] + int_kind: Callable[[integer[Any]], str] + float_kind: Callable[[floating[Any]], str] + complex_kind: Callable[[complexfloating[Any, Any]], str] + str_kind: Callable[[_CharLike_co], str] + +class _FormatOptions(TypedDict): + precision: int + threshold: int + edgeitems: int + linewidth: int + suppress: bool + nanstr: str + infstr: str + formatter: None | _FormatDict + sign: Literal["-", "+", " "] + floatmode: _FloatMode + legacy: Literal[False, "1.13", "1.21"] + +def set_printoptions( + precision: None | SupportsIndex = ..., + threshold: None | int = ..., + edgeitems: None | int = ..., + linewidth: None | int = ..., + suppress: None | bool = ..., + nanstr: None | str = ..., + infstr: None | str = ..., + formatter: None | _FormatDict = ..., + sign: Literal[None, "-", "+", " "] = ..., + floatmode: None | _FloatMode = ..., + *, + legacy: Literal[None, False, "1.13", "1.21"] = ... +) -> None: ... +def get_printoptions() -> _FormatOptions: ... +def array2string( + a: ndarray[Any, Any], + max_line_width: None | int = ..., + precision: None | SupportsIndex = ..., + suppress_small: None | bool = ..., + separator: str = ..., + prefix: str = ..., + # NOTE: With the `style` argument being deprecated, + # all arguments between `formatter` and `suffix` are de facto + # keyworld-only arguments + *, + formatter: None | _FormatDict = ..., + threshold: None | int = ..., + edgeitems: None | int = ..., + sign: Literal[None, "-", "+", " "] = ..., + floatmode: None | _FloatMode = ..., + suffix: str = ..., + legacy: Literal[None, False, "1.13", "1.21"] = ..., +) -> str: ... +def format_float_scientific( + x: _FloatLike_co, + precision: None | int = ..., + unique: bool = ..., + trim: Literal["k", ".", "0", "-"] = ..., + sign: bool = ..., + pad_left: None | int = ..., + exp_digits: None | int = ..., + min_digits: None | int = ..., +) -> str: ... +def format_float_positional( + x: _FloatLike_co, + precision: None | int = ..., + unique: bool = ..., + fractional: bool = ..., + trim: Literal["k", ".", "0", "-"] = ..., + sign: bool = ..., + pad_left: None | int = ..., + pad_right: None | int = ..., + min_digits: None | int = ..., +) -> str: ... +def array_repr( + arr: ndarray[Any, Any], + max_line_width: None | int = ..., + precision: None | SupportsIndex = ..., + suppress_small: None | bool = ..., +) -> str: ... +def array_str( + a: ndarray[Any, Any], + max_line_width: None | int = ..., + precision: None | SupportsIndex = ..., + suppress_small: None | bool = ..., +) -> str: ... +def set_string_function( + f: None | Callable[[ndarray[Any, Any]], str], repr: bool = ... +) -> None: ... +def printoptions( + precision: None | SupportsIndex = ..., + threshold: None | int = ..., + edgeitems: None | int = ..., + linewidth: None | int = ..., + suppress: None | bool = ..., + nanstr: None | str = ..., + infstr: None | str = ..., + formatter: None | _FormatDict = ..., + sign: Literal[None, "-", "+", " "] = ..., + floatmode: None | _FloatMode = ..., + *, + legacy: Literal[None, False, "1.13", "1.21"] = ... +) -> _GeneratorContextManager[_FormatOptions]: ... diff --git a/pllava/lib/python3.10/site-packages/numpy/core/cversions.py b/pllava/lib/python3.10/site-packages/numpy/core/cversions.py new file mode 100644 index 0000000000000000000000000000000000000000..00159c3a8031d8ccd44b226db42090f97014cd9f --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/cversions.py @@ -0,0 +1,13 @@ +"""Simple script to compute the api hash of the current API. + +The API has is defined by numpy_api_order and ufunc_api_order. + +""" +from os.path import dirname + +from code_generators.genapi import fullapi_hash +from code_generators.numpy_api import full_api + +if __name__ == '__main__': + curdir = dirname(__file__) + print(fullapi_hash(full_api)) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/defchararray.pyi b/pllava/lib/python3.10/site-packages/numpy/core/defchararray.pyi new file mode 100644 index 0000000000000000000000000000000000000000..73d90bb2fc531a1c38dce4feb0c8ac97c0e17e24 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/defchararray.pyi @@ -0,0 +1,421 @@ +from typing import ( + Literal as L, + overload, + TypeVar, + Any, +) + +from numpy import ( + chararray as chararray, + dtype, + str_, + bytes_, + int_, + bool_, + object_, + _OrderKACF, +) + +from numpy._typing import ( + NDArray, + _ArrayLikeStr_co as U_co, + _ArrayLikeBytes_co as S_co, + _ArrayLikeInt_co as i_co, + _ArrayLikeBool_co as b_co, +) + +from numpy.core.multiarray import compare_chararrays as compare_chararrays + +_SCT = TypeVar("_SCT", str_, bytes_) +_CharArray = chararray[Any, dtype[_SCT]] + +__all__: list[str] + +# Comparison +@overload +def equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +@overload +def not_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def not_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +@overload +def greater_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def greater_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +@overload +def less_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def less_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +@overload +def greater(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def greater(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +@overload +def less(x1: U_co, x2: U_co) -> NDArray[bool_]: ... +@overload +def less(x1: S_co, x2: S_co) -> NDArray[bool_]: ... + +# String operations +@overload +def add(x1: U_co, x2: U_co) -> NDArray[str_]: ... +@overload +def add(x1: S_co, x2: S_co) -> NDArray[bytes_]: ... + +@overload +def multiply(a: U_co, i: i_co) -> NDArray[str_]: ... +@overload +def multiply(a: S_co, i: i_co) -> NDArray[bytes_]: ... + +@overload +def mod(a: U_co, value: Any) -> NDArray[str_]: ... +@overload +def mod(a: S_co, value: Any) -> NDArray[bytes_]: ... + +@overload +def capitalize(a: U_co) -> NDArray[str_]: ... +@overload +def capitalize(a: S_co) -> NDArray[bytes_]: ... + +@overload +def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ... +@overload +def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ... + +def decode( + a: S_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[str_]: ... + +def encode( + a: U_co, + encoding: None | str = ..., + errors: None | str = ..., +) -> NDArray[bytes_]: ... + +@overload +def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[str_]: ... +@overload +def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[bytes_]: ... + +@overload +def join(sep: U_co, seq: U_co) -> NDArray[str_]: ... +@overload +def join(sep: S_co, seq: S_co) -> NDArray[bytes_]: ... + +@overload +def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ... +@overload +def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ... + +@overload +def lower(a: U_co) -> NDArray[str_]: ... +@overload +def lower(a: S_co) -> NDArray[bytes_]: ... + +@overload +def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def partition(a: U_co, sep: U_co) -> NDArray[str_]: ... +@overload +def partition(a: S_co, sep: S_co) -> NDArray[bytes_]: ... + +@overload +def replace( + a: U_co, + old: U_co, + new: U_co, + count: None | i_co = ..., +) -> NDArray[str_]: ... +@overload +def replace( + a: S_co, + old: S_co, + new: S_co, + count: None | i_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def rjust( + a: U_co, + width: i_co, + fillchar: U_co = ..., +) -> NDArray[str_]: ... +@overload +def rjust( + a: S_co, + width: i_co, + fillchar: S_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def rpartition(a: U_co, sep: U_co) -> NDArray[str_]: ... +@overload +def rpartition(a: S_co, sep: S_co) -> NDArray[bytes_]: ... + +@overload +def rsplit( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... +@overload +def rsplit( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... + +@overload +def rstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def rstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def split( + a: U_co, + sep: None | U_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... +@overload +def split( + a: S_co, + sep: None | S_co = ..., + maxsplit: None | i_co = ..., +) -> NDArray[object_]: ... + +@overload +def splitlines(a: U_co, keepends: None | b_co = ...) -> NDArray[object_]: ... +@overload +def splitlines(a: S_co, keepends: None | b_co = ...) -> NDArray[object_]: ... + +@overload +def strip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ... +@overload +def strip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ... + +@overload +def swapcase(a: U_co) -> NDArray[str_]: ... +@overload +def swapcase(a: S_co) -> NDArray[bytes_]: ... + +@overload +def title(a: U_co) -> NDArray[str_]: ... +@overload +def title(a: S_co) -> NDArray[bytes_]: ... + +@overload +def translate( + a: U_co, + table: U_co, + deletechars: None | U_co = ..., +) -> NDArray[str_]: ... +@overload +def translate( + a: S_co, + table: S_co, + deletechars: None | S_co = ..., +) -> NDArray[bytes_]: ... + +@overload +def upper(a: U_co) -> NDArray[str_]: ... +@overload +def upper(a: S_co) -> NDArray[bytes_]: ... + +@overload +def zfill(a: U_co, width: i_co) -> NDArray[str_]: ... +@overload +def zfill(a: S_co, width: i_co) -> NDArray[bytes_]: ... + +# String information +@overload +def count( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def count( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def endswith( + a: U_co, + suffix: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[bool_]: ... +@overload +def endswith( + a: S_co, + suffix: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[bool_]: ... + +@overload +def find( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def find( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def index( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def index( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +def isalpha(a: U_co | S_co) -> NDArray[bool_]: ... +def isalnum(a: U_co | S_co) -> NDArray[bool_]: ... +def isdecimal(a: U_co | S_co) -> NDArray[bool_]: ... +def isdigit(a: U_co | S_co) -> NDArray[bool_]: ... +def islower(a: U_co | S_co) -> NDArray[bool_]: ... +def isnumeric(a: U_co | S_co) -> NDArray[bool_]: ... +def isspace(a: U_co | S_co) -> NDArray[bool_]: ... +def istitle(a: U_co | S_co) -> NDArray[bool_]: ... +def isupper(a: U_co | S_co) -> NDArray[bool_]: ... + +@overload +def rfind( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def rfind( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def rindex( + a: U_co, + sub: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... +@overload +def rindex( + a: S_co, + sub: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[int_]: ... + +@overload +def startswith( + a: U_co, + prefix: U_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[bool_]: ... +@overload +def startswith( + a: S_co, + prefix: S_co, + start: i_co = ..., + end: None | i_co = ..., +) -> NDArray[bool_]: ... + +def str_len(A: U_co | S_co) -> NDArray[int_]: ... + +# Overload 1 and 2: str- or bytes-based array-likes +# overload 3: arbitrary object with unicode=False (-> bytes_) +# overload 4: arbitrary object with unicode=True (-> str_) +@overload +def array( + obj: U_co, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... +@overload +def array( + obj: S_co, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def array( + obj: object, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def array( + obj: object, + itemsize: None | int = ..., + copy: bool = ..., + unicode: L[True] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... + +@overload +def asarray( + obj: U_co, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... +@overload +def asarray( + obj: S_co, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def asarray( + obj: object, + itemsize: None | int = ..., + unicode: L[False] = ..., + order: _OrderKACF = ..., +) -> _CharArray[bytes_]: ... +@overload +def asarray( + obj: object, + itemsize: None | int = ..., + unicode: L[True] = ..., + order: _OrderKACF = ..., +) -> _CharArray[str_]: ... diff --git a/pllava/lib/python3.10/site-packages/numpy/core/memmap.pyi b/pllava/lib/python3.10/site-packages/numpy/core/memmap.pyi new file mode 100644 index 0000000000000000000000000000000000000000..03c6b772dcd52c87bb958329f5acecd0ed8c1092 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/memmap.pyi @@ -0,0 +1,3 @@ +from numpy import memmap as memmap + +__all__: list[str] diff --git a/pllava/lib/python3.10/site-packages/numpy/core/multiarray.py b/pllava/lib/python3.10/site-packages/numpy/core/multiarray.py new file mode 100644 index 0000000000000000000000000000000000000000..d11283345952d4302ee67bcb700cd325854f6414 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/multiarray.py @@ -0,0 +1,1715 @@ +""" +Create the numpy.core.multiarray namespace for backward compatibility. In v1.16 +the multiarray and umath c-extension modules were merged into a single +_multiarray_umath extension module. So we replicate the old namespace +by importing from the extension module. + +""" + +import functools +from . import overrides +from . import _multiarray_umath +from ._multiarray_umath import * # noqa: F403 +# These imports are needed for backward compatibility, +# do not change them. issue gh-15518 +# _get_ndarray_c_version is semi-public, on purpose not added to __all__ +from ._multiarray_umath import ( + fastCopyAndTranspose, _flagdict, from_dlpack, _place, _reconstruct, + _vec_string, _ARRAY_API, _monotonicity, _get_ndarray_c_version, + _get_madvise_hugepage, _set_madvise_hugepage, + _get_promotion_state, _set_promotion_state, _using_numpy2_behavior + ) + +__all__ = [ + '_ARRAY_API', 'ALLOW_THREADS', 'BUFSIZE', 'CLIP', 'DATETIMEUNITS', + 'ITEM_HASOBJECT', 'ITEM_IS_POINTER', 'LIST_PICKLE', 'MAXDIMS', + 'MAY_SHARE_BOUNDS', 'MAY_SHARE_EXACT', 'NEEDS_INIT', 'NEEDS_PYAPI', + 'RAISE', 'USE_GETITEM', 'USE_SETITEM', 'WRAP', + '_flagdict', 'from_dlpack', '_place', '_reconstruct', '_vec_string', + '_monotonicity', 'add_docstring', 'arange', 'array', 'asarray', + 'asanyarray', 'ascontiguousarray', 'asfortranarray', 'bincount', + 'broadcast', 'busday_count', 'busday_offset', 'busdaycalendar', 'can_cast', + 'compare_chararrays', 'concatenate', 'copyto', 'correlate', 'correlate2', + 'count_nonzero', 'c_einsum', 'datetime_as_string', 'datetime_data', + 'dot', 'dragon4_positional', 'dragon4_scientific', 'dtype', + 'empty', 'empty_like', 'error', 'flagsobj', 'flatiter', 'format_longfloat', + 'frombuffer', 'fromfile', 'fromiter', 'fromstring', + 'get_handler_name', 'get_handler_version', 'inner', 'interp', + 'interp_complex', 'is_busday', 'lexsort', 'matmul', 'may_share_memory', + 'min_scalar_type', 'ndarray', 'nditer', 'nested_iters', + 'normalize_axis_index', 'packbits', 'promote_types', 'putmask', + 'ravel_multi_index', 'result_type', 'scalar', 'set_datetimeparse_function', + 'set_legacy_print_mode', 'set_numeric_ops', 'set_string_function', + 'set_typeDict', 'shares_memory', 'tracemalloc_domain', 'typeinfo', + 'unpackbits', 'unravel_index', 'vdot', 'where', 'zeros', + '_get_promotion_state', '_set_promotion_state', '_using_numpy2_behavior'] + +# For backward compatibility, make sure pickle imports these functions from here +_reconstruct.__module__ = 'numpy.core.multiarray' +scalar.__module__ = 'numpy.core.multiarray' + + +from_dlpack.__module__ = 'numpy' +arange.__module__ = 'numpy' +array.__module__ = 'numpy' +asarray.__module__ = 'numpy' +asanyarray.__module__ = 'numpy' +ascontiguousarray.__module__ = 'numpy' +asfortranarray.__module__ = 'numpy' +datetime_data.__module__ = 'numpy' +empty.__module__ = 'numpy' +frombuffer.__module__ = 'numpy' +fromfile.__module__ = 'numpy' +fromiter.__module__ = 'numpy' +frompyfunc.__module__ = 'numpy' +fromstring.__module__ = 'numpy' +geterrobj.__module__ = 'numpy' +may_share_memory.__module__ = 'numpy' +nested_iters.__module__ = 'numpy' +promote_types.__module__ = 'numpy' +set_numeric_ops.__module__ = 'numpy' +seterrobj.__module__ = 'numpy' +zeros.__module__ = 'numpy' +_get_promotion_state.__module__ = 'numpy' +_set_promotion_state.__module__ = 'numpy' +_using_numpy2_behavior.__module__ = 'numpy' + + +# We can't verify dispatcher signatures because NumPy's C functions don't +# support introspection. +array_function_from_c_func_and_dispatcher = functools.partial( + overrides.array_function_from_dispatcher, + module='numpy', docs_from_dispatcher=True, verify=False) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.empty_like) +def empty_like(prototype, dtype=None, order=None, subok=None, shape=None): + """ + empty_like(prototype, dtype=None, order='K', subok=True, shape=None) + + Return a new array with the same shape and type as a given array. + + Parameters + ---------- + prototype : array_like + The shape and data-type of `prototype` define these same attributes + of the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `prototype` is Fortran + contiguous, 'C' otherwise. 'K' means match the layout of `prototype` + as closely as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `prototype`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + + Returns + ------- + out : ndarray + Array of uninitialized (arbitrary) data with the same + shape and type as `prototype`. + + See Also + -------- + ones_like : Return an array of ones with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full_like : Return a new array with shape of input filled with value. + empty : Return a new uninitialized array. + + Notes + ----- + This function does *not* initialize the returned array; to do that use + `zeros_like` or `ones_like` instead. It may be marginally faster than + the functions that do set the array values. + + Examples + -------- + >>> a = ([1,2,3], [4,5,6]) # a is array-like + >>> np.empty_like(a) + array([[-1073741821, -1073741821, 3], # uninitialized + [ 0, 0, -1073741821]]) + >>> a = np.array([[1., 2., 3.],[4.,5.,6.]]) + >>> np.empty_like(a) + array([[ -2.00000715e+000, 1.48219694e-323, -2.00000572e+000], # uninitialized + [ 4.38791518e-305, -2.00000715e+000, 4.17269252e-309]]) + + """ + return (prototype,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.concatenate) +def concatenate(arrays, axis=None, out=None, *, dtype=None, casting=None): + """ + concatenate((a1, a2, ...), axis=0, out=None, dtype=None, casting="same_kind") + + Join a sequence of arrays along an existing axis. + + Parameters + ---------- + a1, a2, ... : sequence of array_like + The arrays must have the same shape, except in the dimension + corresponding to `axis` (the first, by default). + axis : int, optional + The axis along which the arrays will be joined. If axis is None, + arrays are flattened before use. Default is 0. + out : ndarray, optional + If provided, the destination to place the result. The shape must be + correct, matching that of what concatenate would have returned if no + out argument were specified. + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.20.0 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.20.0 + + Returns + ------- + res : ndarray + The concatenated array. + + See Also + -------- + ma.concatenate : Concatenate function that preserves input masks. + array_split : Split an array into multiple sub-arrays of equal or + near-equal size. + split : Split array into a list of multiple sub-arrays of equal size. + hsplit : Split array into multiple sub-arrays horizontally (column wise). + vsplit : Split array into multiple sub-arrays vertically (row wise). + dsplit : Split array into multiple sub-arrays along the 3rd axis (depth). + stack : Stack a sequence of arrays along a new axis. + block : Assemble arrays from blocks. + hstack : Stack arrays in sequence horizontally (column wise). + vstack : Stack arrays in sequence vertically (row wise). + dstack : Stack arrays in sequence depth wise (along third dimension). + column_stack : Stack 1-D arrays as columns into a 2-D array. + + Notes + ----- + When one or more of the arrays to be concatenated is a MaskedArray, + this function will return a MaskedArray object instead of an ndarray, + but the input masks are *not* preserved. In cases where a MaskedArray + is expected as input, use the ma.concatenate function from the masked + array module instead. + + Examples + -------- + >>> a = np.array([[1, 2], [3, 4]]) + >>> b = np.array([[5, 6]]) + >>> np.concatenate((a, b), axis=0) + array([[1, 2], + [3, 4], + [5, 6]]) + >>> np.concatenate((a, b.T), axis=1) + array([[1, 2, 5], + [3, 4, 6]]) + >>> np.concatenate((a, b), axis=None) + array([1, 2, 3, 4, 5, 6]) + + This function will not preserve masking of MaskedArray inputs. + + >>> a = np.ma.arange(3) + >>> a[1] = np.ma.masked + >>> b = np.arange(2, 5) + >>> a + masked_array(data=[0, --, 2], + mask=[False, True, False], + fill_value=999999) + >>> b + array([2, 3, 4]) + >>> np.concatenate([a, b]) + masked_array(data=[0, 1, 2, 2, 3, 4], + mask=False, + fill_value=999999) + >>> np.ma.concatenate([a, b]) + masked_array(data=[0, --, 2, 2, 3, 4], + mask=[False, True, False, False, False, False], + fill_value=999999) + + """ + if out is not None: + # optimize for the typical case where only arrays is provided + arrays = list(arrays) + arrays.append(out) + return arrays + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.inner) +def inner(a, b): + """ + inner(a, b, /) + + Inner product of two arrays. + + Ordinary inner product of vectors for 1-D arrays (without complex + conjugation), in higher dimensions a sum product over the last axes. + + Parameters + ---------- + a, b : array_like + If `a` and `b` are nonscalar, their last dimensions must match. + + Returns + ------- + out : ndarray + If `a` and `b` are both + scalars or both 1-D arrays then a scalar is returned; otherwise + an array is returned. + ``out.shape = (*a.shape[:-1], *b.shape[:-1])`` + + Raises + ------ + ValueError + If both `a` and `b` are nonscalar and their last dimensions have + different sizes. + + See Also + -------- + tensordot : Sum products over arbitrary axes. + dot : Generalised matrix product, using second last dimension of `b`. + einsum : Einstein summation convention. + + Notes + ----- + For vectors (1-D arrays) it computes the ordinary inner-product:: + + np.inner(a, b) = sum(a[:]*b[:]) + + More generally, if ``ndim(a) = r > 0`` and ``ndim(b) = s > 0``:: + + np.inner(a, b) = np.tensordot(a, b, axes=(-1,-1)) + + or explicitly:: + + np.inner(a, b)[i0,...,ir-2,j0,...,js-2] + = sum(a[i0,...,ir-2,:]*b[j0,...,js-2,:]) + + In addition `a` or `b` may be scalars, in which case:: + + np.inner(a,b) = a*b + + Examples + -------- + Ordinary inner product for vectors: + + >>> a = np.array([1,2,3]) + >>> b = np.array([0,1,0]) + >>> np.inner(a, b) + 2 + + Some multidimensional examples: + + >>> a = np.arange(24).reshape((2,3,4)) + >>> b = np.arange(4) + >>> c = np.inner(a, b) + >>> c.shape + (2, 3) + >>> c + array([[ 14, 38, 62], + [ 86, 110, 134]]) + + >>> a = np.arange(2).reshape((1,1,2)) + >>> b = np.arange(6).reshape((3,2)) + >>> c = np.inner(a, b) + >>> c.shape + (1, 1, 3) + >>> c + array([[[1, 3, 5]]]) + + An example where `b` is a scalar: + + >>> np.inner(np.eye(2), 7) + array([[7., 0.], + [0., 7.]]) + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.where) +def where(condition, x=None, y=None): + """ + where(condition, [x, y], /) + + Return elements chosen from `x` or `y` depending on `condition`. + + .. note:: + When only `condition` is provided, this function is a shorthand for + ``np.asarray(condition).nonzero()``. Using `nonzero` directly should be + preferred, as it behaves correctly for subclasses. The rest of this + documentation covers only the case where all three arguments are + provided. + + Parameters + ---------- + condition : array_like, bool + Where True, yield `x`, otherwise yield `y`. + x, y : array_like + Values from which to choose. `x`, `y` and `condition` need to be + broadcastable to some shape. + + Returns + ------- + out : ndarray + An array with elements from `x` where `condition` is True, and elements + from `y` elsewhere. + + See Also + -------- + choose + nonzero : The function that is called when x and y are omitted + + Notes + ----- + If all the arrays are 1-D, `where` is equivalent to:: + + [xv if c else yv + for c, xv, yv in zip(condition, x, y)] + + Examples + -------- + >>> a = np.arange(10) + >>> a + array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9]) + >>> np.where(a < 5, a, 10*a) + array([ 0, 1, 2, 3, 4, 50, 60, 70, 80, 90]) + + This can be used on multidimensional arrays too: + + >>> np.where([[True, False], [True, True]], + ... [[1, 2], [3, 4]], + ... [[9, 8], [7, 6]]) + array([[1, 8], + [3, 4]]) + + The shapes of x, y, and the condition are broadcast together: + + >>> x, y = np.ogrid[:3, :4] + >>> np.where(x < y, x, 10 + y) # both x and 10+y are broadcast + array([[10, 0, 0, 0], + [10, 11, 1, 1], + [10, 11, 12, 2]]) + + >>> a = np.array([[0, 1, 2], + ... [0, 2, 4], + ... [0, 3, 6]]) + >>> np.where(a < 4, a, -1) # -1 is broadcast + array([[ 0, 1, 2], + [ 0, 2, -1], + [ 0, 3, -1]]) + """ + return (condition, x, y) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.lexsort) +def lexsort(keys, axis=None): + """ + lexsort(keys, axis=-1) + + Perform an indirect stable sort using a sequence of keys. + + Given multiple sorting keys, which can be interpreted as columns in a + spreadsheet, lexsort returns an array of integer indices that describes + the sort order by multiple columns. The last key in the sequence is used + for the primary sort order, the second-to-last key for the secondary sort + order, and so on. The keys argument must be a sequence of objects that + can be converted to arrays of the same shape. If a 2D array is provided + for the keys argument, its rows are interpreted as the sorting keys and + sorting is according to the last row, second last row etc. + + Parameters + ---------- + keys : (k, N) array or tuple containing k (N,)-shaped sequences + The `k` different "columns" to be sorted. The last column (or row if + `keys` is a 2D array) is the primary sort key. + axis : int, optional + Axis to be indirectly sorted. By default, sort over the last axis. + + Returns + ------- + indices : (N,) ndarray of ints + Array of indices that sort the keys along the specified axis. + + See Also + -------- + argsort : Indirect sort. + ndarray.sort : In-place sort. + sort : Return a sorted copy of an array. + + Examples + -------- + Sort names: first by surname, then by name. + + >>> surnames = ('Hertz', 'Galilei', 'Hertz') + >>> first_names = ('Heinrich', 'Galileo', 'Gustav') + >>> ind = np.lexsort((first_names, surnames)) + >>> ind + array([1, 2, 0]) + + >>> [surnames[i] + ", " + first_names[i] for i in ind] + ['Galilei, Galileo', 'Hertz, Gustav', 'Hertz, Heinrich'] + + Sort two columns of numbers: + + >>> a = [1,5,1,4,3,4,4] # First column + >>> b = [9,4,0,4,0,2,1] # Second column + >>> ind = np.lexsort((b,a)) # Sort by a, then by b + >>> ind + array([2, 0, 4, 6, 5, 3, 1]) + + >>> [(a[i],b[i]) for i in ind] + [(1, 0), (1, 9), (3, 0), (4, 1), (4, 2), (4, 4), (5, 4)] + + Note that sorting is first according to the elements of ``a``. + Secondary sorting is according to the elements of ``b``. + + A normal ``argsort`` would have yielded: + + >>> [(a[i],b[i]) for i in np.argsort(a)] + [(1, 9), (1, 0), (3, 0), (4, 4), (4, 2), (4, 1), (5, 4)] + + Structured arrays are sorted lexically by ``argsort``: + + >>> x = np.array([(1,9), (5,4), (1,0), (4,4), (3,0), (4,2), (4,1)], + ... dtype=np.dtype([('x', int), ('y', int)])) + + >>> np.argsort(x) # or np.argsort(x, order=('x', 'y')) + array([2, 0, 4, 6, 5, 3, 1]) + + """ + if isinstance(keys, tuple): + return keys + else: + return (keys,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.can_cast) +def can_cast(from_, to, casting=None): + """ + can_cast(from_, to, casting='safe') + + Returns True if cast between data types can occur according to the + casting rule. If from is a scalar or array scalar, also returns + True if the scalar value can be cast without overflow or truncation + to an integer. + + Parameters + ---------- + from_ : dtype, dtype specifier, scalar, or array + Data type, scalar, or array to cast from. + to : dtype or dtype specifier + Data type to cast to. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + + Returns + ------- + out : bool + True if cast can occur according to the casting rule. + + Notes + ----- + .. versionchanged:: 1.17.0 + Casting between a simple data type and a structured one is possible only + for "unsafe" casting. Casting to multiple fields is allowed, but + casting from multiple fields is not. + + .. versionchanged:: 1.9.0 + Casting from numeric to string types in 'safe' casting mode requires + that the string dtype length is long enough to store the maximum + integer/float value converted. + + See also + -------- + dtype, result_type + + Examples + -------- + Basic examples + + >>> np.can_cast(np.int32, np.int64) + True + >>> np.can_cast(np.float64, complex) + True + >>> np.can_cast(complex, float) + False + + >>> np.can_cast('i8', 'f8') + True + >>> np.can_cast('i8', 'f4') + False + >>> np.can_cast('i4', 'S4') + False + + Casting scalars + + >>> np.can_cast(100, 'i1') + True + >>> np.can_cast(150, 'i1') + False + >>> np.can_cast(150, 'u1') + True + + >>> np.can_cast(3.5e100, np.float32) + False + >>> np.can_cast(1000.0, np.float32) + True + + Array scalar checks the value, array does not + + >>> np.can_cast(np.array(1000.0), np.float32) + True + >>> np.can_cast(np.array([1000.0]), np.float32) + False + + Using the casting rules + + >>> np.can_cast('i8', 'i8', 'no') + True + >>> np.can_cast('i8', 'no') + False + + >>> np.can_cast('i8', 'equiv') + True + >>> np.can_cast('i8', 'equiv') + False + + >>> np.can_cast('i8', 'safe') + True + >>> np.can_cast('i4', 'safe') + False + + >>> np.can_cast('i4', 'same_kind') + True + >>> np.can_cast('u4', 'same_kind') + False + + >>> np.can_cast('u4', 'unsafe') + True + + """ + return (from_,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.min_scalar_type) +def min_scalar_type(a): + """ + min_scalar_type(a, /) + + For scalar ``a``, returns the data type with the smallest size + and smallest scalar kind which can hold its value. For non-scalar + array ``a``, returns the vector's dtype unmodified. + + Floating point values are not demoted to integers, + and complex values are not demoted to floats. + + Parameters + ---------- + a : scalar or array_like + The value whose minimal data type is to be found. + + Returns + ------- + out : dtype + The minimal data type. + + Notes + ----- + .. versionadded:: 1.6.0 + + See Also + -------- + result_type, promote_types, dtype, can_cast + + Examples + -------- + >>> np.min_scalar_type(10) + dtype('uint8') + + >>> np.min_scalar_type(-260) + dtype('int16') + + >>> np.min_scalar_type(3.1) + dtype('float16') + + >>> np.min_scalar_type(1e50) + dtype('float64') + + >>> np.min_scalar_type(np.arange(4,dtype='f8')) + dtype('float64') + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.result_type) +def result_type(*arrays_and_dtypes): + """ + result_type(*arrays_and_dtypes) + + Returns the type that results from applying the NumPy + type promotion rules to the arguments. + + Type promotion in NumPy works similarly to the rules in languages + like C++, with some slight differences. When both scalars and + arrays are used, the array's type takes precedence and the actual value + of the scalar is taken into account. + + For example, calculating 3*a, where a is an array of 32-bit floats, + intuitively should result in a 32-bit float output. If the 3 is a + 32-bit integer, the NumPy rules indicate it can't convert losslessly + into a 32-bit float, so a 64-bit float should be the result type. + By examining the value of the constant, '3', we see that it fits in + an 8-bit integer, which can be cast losslessly into the 32-bit float. + + Parameters + ---------- + arrays_and_dtypes : list of arrays and dtypes + The operands of some operation whose result type is needed. + + Returns + ------- + out : dtype + The result type. + + See also + -------- + dtype, promote_types, min_scalar_type, can_cast + + Notes + ----- + .. versionadded:: 1.6.0 + + The specific algorithm used is as follows. + + Categories are determined by first checking which of boolean, + integer (int/uint), or floating point (float/complex) the maximum + kind of all the arrays and the scalars are. + + If there are only scalars or the maximum category of the scalars + is higher than the maximum category of the arrays, + the data types are combined with :func:`promote_types` + to produce the return value. + + Otherwise, `min_scalar_type` is called on each scalar, and + the resulting data types are all combined with :func:`promote_types` + to produce the return value. + + The set of int values is not a subset of the uint values for types + with the same number of bits, something not reflected in + :func:`min_scalar_type`, but handled as a special case in `result_type`. + + Examples + -------- + >>> np.result_type(3, np.arange(7, dtype='i1')) + dtype('int8') + + >>> np.result_type('i4', 'c8') + dtype('complex128') + + >>> np.result_type(3.0, -2) + dtype('float64') + + """ + return arrays_and_dtypes + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.dot) +def dot(a, b, out=None): + """ + dot(a, b, out=None) + + Dot product of two arrays. Specifically, + + - If both `a` and `b` are 1-D arrays, it is inner product of vectors + (without complex conjugation). + + - If both `a` and `b` are 2-D arrays, it is matrix multiplication, + but using :func:`matmul` or ``a @ b`` is preferred. + + - If either `a` or `b` is 0-D (scalar), it is equivalent to + :func:`multiply` and using ``numpy.multiply(a, b)`` or ``a * b`` is + preferred. + + - If `a` is an N-D array and `b` is a 1-D array, it is a sum product over + the last axis of `a` and `b`. + + - If `a` is an N-D array and `b` is an M-D array (where ``M>=2``), it is a + sum product over the last axis of `a` and the second-to-last axis of + `b`:: + + dot(a, b)[i,j,k,m] = sum(a[i,j,:] * b[k,:,m]) + + It uses an optimized BLAS library when possible (see `numpy.linalg`). + + Parameters + ---------- + a : array_like + First argument. + b : array_like + Second argument. + out : ndarray, optional + Output argument. This must have the exact kind that would be returned + if it was not used. In particular, it must have the right type, must be + C-contiguous, and its dtype must be the dtype that would be returned + for `dot(a,b)`. This is a performance feature. Therefore, if these + conditions are not met, an exception is raised, instead of attempting + to be flexible. + + Returns + ------- + output : ndarray + Returns the dot product of `a` and `b`. If `a` and `b` are both + scalars or both 1-D arrays then a scalar is returned; otherwise + an array is returned. + If `out` is given, then it is returned. + + Raises + ------ + ValueError + If the last dimension of `a` is not the same size as + the second-to-last dimension of `b`. + + See Also + -------- + vdot : Complex-conjugating dot product. + tensordot : Sum products over arbitrary axes. + einsum : Einstein summation convention. + matmul : '@' operator as method with out parameter. + linalg.multi_dot : Chained dot product. + + Examples + -------- + >>> np.dot(3, 4) + 12 + + Neither argument is complex-conjugated: + + >>> np.dot([2j, 3j], [2j, 3j]) + (-13+0j) + + For 2-D arrays it is the matrix product: + + >>> a = [[1, 0], [0, 1]] + >>> b = [[4, 1], [2, 2]] + >>> np.dot(a, b) + array([[4, 1], + [2, 2]]) + + >>> a = np.arange(3*4*5*6).reshape((3,4,5,6)) + >>> b = np.arange(3*4*5*6)[::-1].reshape((5,4,6,3)) + >>> np.dot(a, b)[2,3,2,1,2,2] + 499128 + >>> sum(a[2,3,2,:] * b[1,2,:,2]) + 499128 + + """ + return (a, b, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.vdot) +def vdot(a, b): + """ + vdot(a, b, /) + + Return the dot product of two vectors. + + The vdot(`a`, `b`) function handles complex numbers differently than + dot(`a`, `b`). If the first argument is complex the complex conjugate + of the first argument is used for the calculation of the dot product. + + Note that `vdot` handles multidimensional arrays differently than `dot`: + it does *not* perform a matrix product, but flattens input arguments + to 1-D vectors first. Consequently, it should only be used for vectors. + + Parameters + ---------- + a : array_like + If `a` is complex the complex conjugate is taken before calculation + of the dot product. + b : array_like + Second argument to the dot product. + + Returns + ------- + output : ndarray + Dot product of `a` and `b`. Can be an int, float, or + complex depending on the types of `a` and `b`. + + See Also + -------- + dot : Return the dot product without using the complex conjugate of the + first argument. + + Examples + -------- + >>> a = np.array([1+2j,3+4j]) + >>> b = np.array([5+6j,7+8j]) + >>> np.vdot(a, b) + (70-8j) + >>> np.vdot(b, a) + (70+8j) + + Note that higher-dimensional arrays are flattened! + + >>> a = np.array([[1, 4], [5, 6]]) + >>> b = np.array([[4, 1], [2, 2]]) + >>> np.vdot(a, b) + 30 + >>> np.vdot(b, a) + 30 + >>> 1*4 + 4*1 + 5*2 + 6*2 + 30 + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.bincount) +def bincount(x, weights=None, minlength=None): + """ + bincount(x, /, weights=None, minlength=0) + + Count number of occurrences of each value in array of non-negative ints. + + The number of bins (of size 1) is one larger than the largest value in + `x`. If `minlength` is specified, there will be at least this number + of bins in the output array (though it will be longer if necessary, + depending on the contents of `x`). + Each bin gives the number of occurrences of its index value in `x`. + If `weights` is specified the input array is weighted by it, i.e. if a + value ``n`` is found at position ``i``, ``out[n] += weight[i]`` instead + of ``out[n] += 1``. + + Parameters + ---------- + x : array_like, 1 dimension, nonnegative ints + Input array. + weights : array_like, optional + Weights, array of the same shape as `x`. + minlength : int, optional + A minimum number of bins for the output array. + + .. versionadded:: 1.6.0 + + Returns + ------- + out : ndarray of ints + The result of binning the input array. + The length of `out` is equal to ``np.amax(x)+1``. + + Raises + ------ + ValueError + If the input is not 1-dimensional, or contains elements with negative + values, or if `minlength` is negative. + TypeError + If the type of the input is float or complex. + + See Also + -------- + histogram, digitize, unique + + Examples + -------- + >>> np.bincount(np.arange(5)) + array([1, 1, 1, 1, 1]) + >>> np.bincount(np.array([0, 1, 1, 3, 2, 1, 7])) + array([1, 3, 1, 1, 0, 0, 0, 1]) + + >>> x = np.array([0, 1, 1, 3, 2, 1, 7, 23]) + >>> np.bincount(x).size == np.amax(x)+1 + True + + The input array needs to be of integer dtype, otherwise a + TypeError is raised: + + >>> np.bincount(np.arange(5, dtype=float)) + Traceback (most recent call last): + ... + TypeError: Cannot cast array data from dtype('float64') to dtype('int64') + according to the rule 'safe' + + A possible use of ``bincount`` is to perform sums over + variable-size chunks of an array, using the ``weights`` keyword. + + >>> w = np.array([0.3, 0.5, 0.2, 0.7, 1., -0.6]) # weights + >>> x = np.array([0, 1, 1, 2, 2, 2]) + >>> np.bincount(x, weights=w) + array([ 0.3, 0.7, 1.1]) + + """ + return (x, weights) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.ravel_multi_index) +def ravel_multi_index(multi_index, dims, mode=None, order=None): + """ + ravel_multi_index(multi_index, dims, mode='raise', order='C') + + Converts a tuple of index arrays into an array of flat + indices, applying boundary modes to the multi-index. + + Parameters + ---------- + multi_index : tuple of array_like + A tuple of integer arrays, one array for each dimension. + dims : tuple of ints + The shape of array into which the indices from ``multi_index`` apply. + mode : {'raise', 'wrap', 'clip'}, optional + Specifies how out-of-bounds indices are handled. Can specify + either one mode or a tuple of modes, one mode per index. + + * 'raise' -- raise an error (default) + * 'wrap' -- wrap around + * 'clip' -- clip to the range + + In 'clip' mode, a negative index which would normally + wrap will clip to 0 instead. + order : {'C', 'F'}, optional + Determines whether the multi-index should be viewed as + indexing in row-major (C-style) or column-major + (Fortran-style) order. + + Returns + ------- + raveled_indices : ndarray + An array of indices into the flattened version of an array + of dimensions ``dims``. + + See Also + -------- + unravel_index + + Notes + ----- + .. versionadded:: 1.6.0 + + Examples + -------- + >>> arr = np.array([[3,6,6],[4,5,1]]) + >>> np.ravel_multi_index(arr, (7,6)) + array([22, 41, 37]) + >>> np.ravel_multi_index(arr, (7,6), order='F') + array([31, 41, 13]) + >>> np.ravel_multi_index(arr, (4,6), mode='clip') + array([22, 23, 19]) + >>> np.ravel_multi_index(arr, (4,4), mode=('clip','wrap')) + array([12, 13, 13]) + + >>> np.ravel_multi_index((3,1,4,1), (6,7,8,9)) + 1621 + """ + return multi_index + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.unravel_index) +def unravel_index(indices, shape=None, order=None): + """ + unravel_index(indices, shape, order='C') + + Converts a flat index or array of flat indices into a tuple + of coordinate arrays. + + Parameters + ---------- + indices : array_like + An integer array whose elements are indices into the flattened + version of an array of dimensions ``shape``. Before version 1.6.0, + this function accepted just one index value. + shape : tuple of ints + The shape of the array to use for unraveling ``indices``. + + .. versionchanged:: 1.16.0 + Renamed from ``dims`` to ``shape``. + + order : {'C', 'F'}, optional + Determines whether the indices should be viewed as indexing in + row-major (C-style) or column-major (Fortran-style) order. + + .. versionadded:: 1.6.0 + + Returns + ------- + unraveled_coords : tuple of ndarray + Each array in the tuple has the same shape as the ``indices`` + array. + + See Also + -------- + ravel_multi_index + + Examples + -------- + >>> np.unravel_index([22, 41, 37], (7,6)) + (array([3, 6, 6]), array([4, 5, 1])) + >>> np.unravel_index([31, 41, 13], (7,6), order='F') + (array([3, 6, 6]), array([4, 5, 1])) + + >>> np.unravel_index(1621, (6,7,8,9)) + (3, 1, 4, 1) + + """ + return (indices,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.copyto) +def copyto(dst, src, casting=None, where=None): + """ + copyto(dst, src, casting='same_kind', where=True) + + Copies values from one array to another, broadcasting as necessary. + + Raises a TypeError if the `casting` rule is violated, and if + `where` is provided, it selects which elements to copy. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dst : ndarray + The array into which values are copied. + src : array_like + The array from which values are copied. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur when copying. + + * 'no' means the data types should not be cast at all. + * 'equiv' means only byte-order changes are allowed. + * 'safe' means only casts which can preserve values are allowed. + * 'same_kind' means only safe casts or casts within a kind, + like float64 to float32, are allowed. + * 'unsafe' means any data conversions may be done. + where : array_like of bool, optional + A boolean array which is broadcasted to match the dimensions + of `dst`, and selects elements to copy from `src` to `dst` + wherever it contains the value True. + + Examples + -------- + >>> A = np.array([4, 5, 6]) + >>> B = [1, 2, 3] + >>> np.copyto(A, B) + >>> A + array([1, 2, 3]) + + >>> A = np.array([[1, 2, 3], [4, 5, 6]]) + >>> B = [[4, 5, 6], [7, 8, 9]] + >>> np.copyto(A, B) + >>> A + array([[4, 5, 6], + [7, 8, 9]]) + + """ + return (dst, src, where) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.putmask) +def putmask(a, /, mask, values): + """ + putmask(a, mask, values) + + Changes elements of an array based on conditional and input values. + + Sets ``a.flat[n] = values[n]`` for each n where ``mask.flat[n]==True``. + + If `values` is not the same size as `a` and `mask` then it will repeat. + This gives behavior different from ``a[mask] = values``. + + Parameters + ---------- + a : ndarray + Target array. + mask : array_like + Boolean mask array. It has to be the same shape as `a`. + values : array_like + Values to put into `a` where `mask` is True. If `values` is smaller + than `a` it will be repeated. + + See Also + -------- + place, put, take, copyto + + Examples + -------- + >>> x = np.arange(6).reshape(2, 3) + >>> np.putmask(x, x>2, x**2) + >>> x + array([[ 0, 1, 2], + [ 9, 16, 25]]) + + If `values` is smaller than `a` it is repeated: + + >>> x = np.arange(5) + >>> np.putmask(x, x>1, [-33, -44]) + >>> x + array([ 0, 1, -33, -44, -33]) + + """ + return (a, mask, values) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.packbits) +def packbits(a, axis=None, bitorder='big'): + """ + packbits(a, /, axis=None, bitorder='big') + + Packs the elements of a binary-valued array into bits in a uint8 array. + + The result is padded to full bytes by inserting zero bits at the end. + + Parameters + ---------- + a : array_like + An array of integers or booleans whose elements should be packed to + bits. + axis : int, optional + The dimension over which bit-packing is done. + ``None`` implies packing the flattened array. + bitorder : {'big', 'little'}, optional + The order of the input bits. 'big' will mimic bin(val), + ``[0, 0, 0, 0, 0, 0, 1, 1] => 3 = 0b00000011``, 'little' will + reverse the order so ``[1, 1, 0, 0, 0, 0, 0, 0] => 3``. + Defaults to 'big'. + + .. versionadded:: 1.17.0 + + Returns + ------- + packed : ndarray + Array of type uint8 whose elements represent bits corresponding to the + logical (0 or nonzero) value of the input elements. The shape of + `packed` has the same number of dimensions as the input (unless `axis` + is None, in which case the output is 1-D). + + See Also + -------- + unpackbits: Unpacks elements of a uint8 array into a binary-valued output + array. + + Examples + -------- + >>> a = np.array([[[1,0,1], + ... [0,1,0]], + ... [[1,1,0], + ... [0,0,1]]]) + >>> b = np.packbits(a, axis=-1) + >>> b + array([[[160], + [ 64]], + [[192], + [ 32]]], dtype=uint8) + + Note that in binary 160 = 1010 0000, 64 = 0100 0000, 192 = 1100 0000, + and 32 = 0010 0000. + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.unpackbits) +def unpackbits(a, axis=None, count=None, bitorder='big'): + """ + unpackbits(a, /, axis=None, count=None, bitorder='big') + + Unpacks elements of a uint8 array into a binary-valued output array. + + Each element of `a` represents a bit-field that should be unpacked + into a binary-valued output array. The shape of the output array is + either 1-D (if `axis` is ``None``) or the same shape as the input + array with unpacking done along the axis specified. + + Parameters + ---------- + a : ndarray, uint8 type + Input array. + axis : int, optional + The dimension over which bit-unpacking is done. + ``None`` implies unpacking the flattened array. + count : int or None, optional + The number of elements to unpack along `axis`, provided as a way + of undoing the effect of packing a size that is not a multiple + of eight. A non-negative number means to only unpack `count` + bits. A negative number means to trim off that many bits from + the end. ``None`` means to unpack the entire array (the + default). Counts larger than the available number of bits will + add zero padding to the output. Negative counts must not + exceed the available number of bits. + + .. versionadded:: 1.17.0 + + bitorder : {'big', 'little'}, optional + The order of the returned bits. 'big' will mimic bin(val), + ``3 = 0b00000011 => [0, 0, 0, 0, 0, 0, 1, 1]``, 'little' will reverse + the order to ``[1, 1, 0, 0, 0, 0, 0, 0]``. + Defaults to 'big'. + + .. versionadded:: 1.17.0 + + Returns + ------- + unpacked : ndarray, uint8 type + The elements are binary-valued (0 or 1). + + See Also + -------- + packbits : Packs the elements of a binary-valued array into bits in + a uint8 array. + + Examples + -------- + >>> a = np.array([[2], [7], [23]], dtype=np.uint8) + >>> a + array([[ 2], + [ 7], + [23]], dtype=uint8) + >>> b = np.unpackbits(a, axis=1) + >>> b + array([[0, 0, 0, 0, 0, 0, 1, 0], + [0, 0, 0, 0, 0, 1, 1, 1], + [0, 0, 0, 1, 0, 1, 1, 1]], dtype=uint8) + >>> c = np.unpackbits(a, axis=1, count=-3) + >>> c + array([[0, 0, 0, 0, 0], + [0, 0, 0, 0, 0], + [0, 0, 0, 1, 0]], dtype=uint8) + + >>> p = np.packbits(b, axis=0) + >>> np.unpackbits(p, axis=0) + array([[0, 0, 0, 0, 0, 0, 1, 0], + [0, 0, 0, 0, 0, 1, 1, 1], + [0, 0, 0, 1, 0, 1, 1, 1], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0], + [0, 0, 0, 0, 0, 0, 0, 0]], dtype=uint8) + >>> np.array_equal(b, np.unpackbits(p, axis=0, count=b.shape[0])) + True + + """ + return (a,) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.shares_memory) +def shares_memory(a, b, max_work=None): + """ + shares_memory(a, b, /, max_work=None) + + Determine if two arrays share memory. + + .. warning:: + + This function can be exponentially slow for some inputs, unless + `max_work` is set to a finite number or ``MAY_SHARE_BOUNDS``. + If in doubt, use `numpy.may_share_memory` instead. + + Parameters + ---------- + a, b : ndarray + Input arrays + max_work : int, optional + Effort to spend on solving the overlap problem (maximum number + of candidate solutions to consider). The following special + values are recognized: + + max_work=MAY_SHARE_EXACT (default) + The problem is solved exactly. In this case, the function returns + True only if there is an element shared between the arrays. Finding + the exact solution may take extremely long in some cases. + max_work=MAY_SHARE_BOUNDS + Only the memory bounds of a and b are checked. + + Raises + ------ + numpy.exceptions.TooHardError + Exceeded max_work. + + Returns + ------- + out : bool + + See Also + -------- + may_share_memory + + Examples + -------- + >>> x = np.array([1, 2, 3, 4]) + >>> np.shares_memory(x, np.array([5, 6, 7])) + False + >>> np.shares_memory(x[::2], x) + True + >>> np.shares_memory(x[::2], x[1::2]) + False + + Checking whether two arrays share memory is NP-complete, and + runtime may increase exponentially in the number of + dimensions. Hence, `max_work` should generally be set to a finite + number, as it is possible to construct examples that take + extremely long to run: + + >>> from numpy.lib.stride_tricks import as_strided + >>> x = np.zeros([192163377], dtype=np.int8) + >>> x1 = as_strided(x, strides=(36674, 61119, 85569), shape=(1049, 1049, 1049)) + >>> x2 = as_strided(x[64023025:], strides=(12223, 12224, 1), shape=(1049, 1049, 1)) + >>> np.shares_memory(x1, x2, max_work=1000) + Traceback (most recent call last): + ... + numpy.exceptions.TooHardError: Exceeded max_work + + Running ``np.shares_memory(x1, x2)`` without `max_work` set takes + around 1 minute for this case. It is possible to find problems + that take still significantly longer. + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.may_share_memory) +def may_share_memory(a, b, max_work=None): + """ + may_share_memory(a, b, /, max_work=None) + + Determine if two arrays might share memory + + A return of True does not necessarily mean that the two arrays + share any element. It just means that they *might*. + + Only the memory bounds of a and b are checked by default. + + Parameters + ---------- + a, b : ndarray + Input arrays + max_work : int, optional + Effort to spend on solving the overlap problem. See + `shares_memory` for details. Default for ``may_share_memory`` + is to do a bounds check. + + Returns + ------- + out : bool + + See Also + -------- + shares_memory + + Examples + -------- + >>> np.may_share_memory(np.array([1,2]), np.array([5,8,9])) + False + >>> x = np.zeros([3, 4]) + >>> np.may_share_memory(x[:,0], x[:,1]) + True + + """ + return (a, b) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.is_busday) +def is_busday(dates, weekmask=None, holidays=None, busdaycal=None, out=None): + """ + is_busday(dates, weekmask='1111100', holidays=None, busdaycal=None, out=None) + + Calculates which of the given dates are valid days, and which are not. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dates : array_like of datetime64[D] + The array of dates to process. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of bool, optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of bool + An array with the same shape as ``dates``, containing True for + each valid day, and False for each invalid day. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + busday_offset : Applies an offset counted in valid days. + busday_count : Counts how many valid days are in a half-open date range. + + Examples + -------- + >>> # The weekdays are Friday, Saturday, and Monday + ... np.is_busday(['2011-07-01', '2011-07-02', '2011-07-18'], + ... holidays=['2011-07-01', '2011-07-04', '2011-07-17']) + array([False, False, True]) + """ + return (dates, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_offset) +def busday_offset(dates, offsets, roll=None, weekmask=None, holidays=None, + busdaycal=None, out=None): + """ + busday_offset(dates, offsets, roll='raise', weekmask='1111100', holidays=None, busdaycal=None, out=None) + + First adjusts the date to fall on a valid day according to + the ``roll`` rule, then applies offsets to the given dates + counted in valid days. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + dates : array_like of datetime64[D] + The array of dates to process. + offsets : array_like of int + The array of offsets, which is broadcast with ``dates``. + roll : {'raise', 'nat', 'forward', 'following', 'backward', 'preceding', 'modifiedfollowing', 'modifiedpreceding'}, optional + How to treat dates that do not fall on a valid day. The default + is 'raise'. + + * 'raise' means to raise an exception for an invalid day. + * 'nat' means to return a NaT (not-a-time) for an invalid day. + * 'forward' and 'following' mean to take the first valid day + later in time. + * 'backward' and 'preceding' mean to take the first valid day + earlier in time. + * 'modifiedfollowing' means to take the first valid day + later in time unless it is across a Month boundary, in which + case to take the first valid day earlier in time. + * 'modifiedpreceding' means to take the first valid day + earlier in time unless it is across a Month boundary, in which + case to take the first valid day later in time. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of datetime64[D], optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of datetime64[D] + An array with a shape from broadcasting ``dates`` and ``offsets`` + together, containing the dates with offsets applied. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + is_busday : Returns a boolean array indicating valid days. + busday_count : Counts how many valid days are in a half-open date range. + + Examples + -------- + >>> # First business day in October 2011 (not accounting for holidays) + ... np.busday_offset('2011-10', 0, roll='forward') + numpy.datetime64('2011-10-03') + >>> # Last business day in February 2012 (not accounting for holidays) + ... np.busday_offset('2012-03', -1, roll='forward') + numpy.datetime64('2012-02-29') + >>> # Third Wednesday in January 2011 + ... np.busday_offset('2011-01', 2, roll='forward', weekmask='Wed') + numpy.datetime64('2011-01-19') + >>> # 2012 Mother's Day in Canada and the U.S. + ... np.busday_offset('2012-05', 1, roll='forward', weekmask='Sun') + numpy.datetime64('2012-05-13') + + >>> # First business day on or after a date + ... np.busday_offset('2011-03-20', 0, roll='forward') + numpy.datetime64('2011-03-21') + >>> np.busday_offset('2011-03-22', 0, roll='forward') + numpy.datetime64('2011-03-22') + >>> # First business day after a date + ... np.busday_offset('2011-03-20', 1, roll='backward') + numpy.datetime64('2011-03-21') + >>> np.busday_offset('2011-03-22', 1, roll='backward') + numpy.datetime64('2011-03-23') + """ + return (dates, offsets, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_count) +def busday_count(begindates, enddates, weekmask=None, holidays=None, + busdaycal=None, out=None): + """ + busday_count(begindates, enddates, weekmask='1111100', holidays=[], busdaycal=None, out=None) + + Counts the number of valid days between `begindates` and + `enddates`, not including the day of `enddates`. + + If ``enddates`` specifies a date value that is earlier than the + corresponding ``begindates`` date value, the count will be negative. + + .. versionadded:: 1.7.0 + + Parameters + ---------- + begindates : array_like of datetime64[D] + The array of the first dates for counting. + enddates : array_like of datetime64[D] + The array of the end dates for counting, which are excluded + from the count themselves. + weekmask : str or array_like of bool, optional + A seven-element array indicating which of Monday through Sunday are + valid days. May be specified as a length-seven list or array, like + [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string + like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for + weekdays, optionally separated by white space. Valid abbreviations + are: Mon Tue Wed Thu Fri Sat Sun + holidays : array_like of datetime64[D], optional + An array of dates to consider as invalid dates. They may be + specified in any order, and NaT (not-a-time) dates are ignored. + This list is saved in a normalized form that is suited for + fast calculations of valid days. + busdaycal : busdaycalendar, optional + A `busdaycalendar` object which specifies the valid days. If this + parameter is provided, neither weekmask nor holidays may be + provided. + out : array of int, optional + If provided, this array is filled with the result. + + Returns + ------- + out : array of int + An array with a shape from broadcasting ``begindates`` and ``enddates`` + together, containing the number of valid days between + the begin and end dates. + + See Also + -------- + busdaycalendar : An object that specifies a custom set of valid days. + is_busday : Returns a boolean array indicating valid days. + busday_offset : Applies an offset counted in valid days. + + Examples + -------- + >>> # Number of weekdays in January 2011 + ... np.busday_count('2011-01', '2011-02') + 21 + >>> # Number of weekdays in 2011 + >>> np.busday_count('2011', '2012') + 260 + >>> # Number of Saturdays in 2011 + ... np.busday_count('2011', '2012', weekmask='Sat') + 53 + """ + return (begindates, enddates, weekmask, holidays, out) + + +@array_function_from_c_func_and_dispatcher( + _multiarray_umath.datetime_as_string) +def datetime_as_string(arr, unit=None, timezone=None, casting=None): + """ + datetime_as_string(arr, unit=None, timezone='naive', casting='same_kind') + + Convert an array of datetimes into an array of strings. + + Parameters + ---------- + arr : array_like of datetime64 + The array of UTC timestamps to format. + unit : str + One of None, 'auto', or a :ref:`datetime unit `. + timezone : {'naive', 'UTC', 'local'} or tzinfo + Timezone information to use when displaying the datetime. If 'UTC', end + with a Z to indicate UTC time. If 'local', convert to the local timezone + first, and suffix with a +-#### timezone offset. If a tzinfo object, + then do as with 'local', but use the specified timezone. + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'} + Casting to allow when changing between datetime units. + + Returns + ------- + str_arr : ndarray + An array of strings the same shape as `arr`. + + Examples + -------- + >>> import pytz + >>> d = np.arange('2002-10-27T04:30', 4*60, 60, dtype='M8[m]') + >>> d + array(['2002-10-27T04:30', '2002-10-27T05:30', '2002-10-27T06:30', + '2002-10-27T07:30'], dtype='datetime64[m]') + + Setting the timezone to UTC shows the same information, but with a Z suffix + + >>> np.datetime_as_string(d, timezone='UTC') + array(['2002-10-27T04:30Z', '2002-10-27T05:30Z', '2002-10-27T06:30Z', + '2002-10-27T07:30Z'], dtype='>> np.datetime_as_string(d, timezone=pytz.timezone('US/Eastern')) + array(['2002-10-27T00:30-0400', '2002-10-27T01:30-0400', + '2002-10-27T01:30-0500', '2002-10-27T02:30-0500'], dtype='>> np.datetime_as_string(d, unit='h') + array(['2002-10-27T04', '2002-10-27T05', '2002-10-27T06', '2002-10-27T07'], + dtype='>> np.datetime_as_string(d, unit='s') + array(['2002-10-27T04:30:00', '2002-10-27T05:30:00', '2002-10-27T06:30:00', + '2002-10-27T07:30:00'], dtype='>> np.datetime_as_string(d, unit='h', casting='safe') + Traceback (most recent call last): + ... + TypeError: Cannot create a datetime string as units 'h' from a NumPy + datetime with units 'm' according to the rule 'safe' + """ + return (arr,) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/multiarray.pyi b/pllava/lib/python3.10/site-packages/numpy/core/multiarray.pyi new file mode 100644 index 0000000000000000000000000000000000000000..dc05f8126ba892683b0bbcaa75e978396fd5bc1f --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/multiarray.pyi @@ -0,0 +1,1022 @@ +# TODO: Sort out any and all missing functions in this namespace + +import os +import datetime as dt +from collections.abc import Sequence, Callable, Iterable +from typing import ( + Literal as L, + Any, + overload, + TypeVar, + SupportsIndex, + final, + Final, + Protocol, + ClassVar, +) + +from numpy import ( + # Re-exports + busdaycalendar as busdaycalendar, + broadcast as broadcast, + dtype as dtype, + ndarray as ndarray, + nditer as nditer, + + # The rest + ufunc, + str_, + bool_, + uint8, + intp, + int_, + float64, + timedelta64, + datetime64, + generic, + unsignedinteger, + signedinteger, + floating, + complexfloating, + _OrderKACF, + _OrderCF, + _CastingKind, + _ModeKind, + _SupportsBuffer, + _IOProtocol, + _CopyMode, + _NDIterFlagsKind, + _NDIterOpFlagsKind, +) + +from numpy._typing import ( + # Shapes + _ShapeLike, + + # DTypes + DTypeLike, + _DTypeLike, + + # Arrays + NDArray, + ArrayLike, + _ArrayLike, + _SupportsArrayFunc, + _NestedSequence, + _ArrayLikeBool_co, + _ArrayLikeUInt_co, + _ArrayLikeInt_co, + _ArrayLikeFloat_co, + _ArrayLikeComplex_co, + _ArrayLikeTD64_co, + _ArrayLikeDT64_co, + _ArrayLikeObject_co, + _ArrayLikeStr_co, + _ArrayLikeBytes_co, + _ScalarLike_co, + _IntLike_co, + _FloatLike_co, + _TD64Like_co, +) + +_T_co = TypeVar("_T_co", covariant=True) +_T_contra = TypeVar("_T_contra", contravariant=True) +_SCT = TypeVar("_SCT", bound=generic) +_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any]) + +# Valid time units +_UnitKind = L[ + "Y", + "M", + "D", + "h", + "m", + "s", + "ms", + "us", "μs", + "ns", + "ps", + "fs", + "as", +] +_RollKind = L[ # `raise` is deliberately excluded + "nat", + "forward", + "following", + "backward", + "preceding", + "modifiedfollowing", + "modifiedpreceding", +] + +class _SupportsLenAndGetItem(Protocol[_T_contra, _T_co]): + def __len__(self) -> int: ... + def __getitem__(self, key: _T_contra, /) -> _T_co: ... + +__all__: list[str] + +ALLOW_THREADS: Final[int] # 0 or 1 (system-specific) +BUFSIZE: L[8192] +CLIP: L[0] +WRAP: L[1] +RAISE: L[2] +MAXDIMS: L[32] +MAY_SHARE_BOUNDS: L[0] +MAY_SHARE_EXACT: L[-1] +tracemalloc_domain: L[389047] + +@overload +def empty_like( + prototype: _ArrayType, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., +) -> _ArrayType: ... +@overload +def empty_like( + prototype: _ArrayLike[_SCT], + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., +) -> NDArray[_SCT]: ... +@overload +def empty_like( + prototype: object, + dtype: None = ..., + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., +) -> NDArray[Any]: ... +@overload +def empty_like( + prototype: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., +) -> NDArray[_SCT]: ... +@overload +def empty_like( + prototype: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + subok: bool = ..., + shape: None | _ShapeLike = ..., +) -> NDArray[Any]: ... + +@overload +def array( + object: _ArrayType, + dtype: None = ..., + *, + copy: bool | _CopyMode = ..., + order: _OrderKACF = ..., + subok: L[True], + ndmin: int = ..., + like: None | _SupportsArrayFunc = ..., +) -> _ArrayType: ... +@overload +def array( + object: _ArrayLike[_SCT], + dtype: None = ..., + *, + copy: bool | _CopyMode = ..., + order: _OrderKACF = ..., + subok: bool = ..., + ndmin: int = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def array( + object: object, + dtype: None = ..., + *, + copy: bool | _CopyMode = ..., + order: _OrderKACF = ..., + subok: bool = ..., + ndmin: int = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def array( + object: Any, + dtype: _DTypeLike[_SCT], + *, + copy: bool | _CopyMode = ..., + order: _OrderKACF = ..., + subok: bool = ..., + ndmin: int = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def array( + object: Any, + dtype: DTypeLike, + *, + copy: bool | _CopyMode = ..., + order: _OrderKACF = ..., + subok: bool = ..., + ndmin: int = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def zeros( + shape: _ShapeLike, + dtype: None = ..., + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def zeros( + shape: _ShapeLike, + dtype: _DTypeLike[_SCT], + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def zeros( + shape: _ShapeLike, + dtype: DTypeLike, + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def empty( + shape: _ShapeLike, + dtype: None = ..., + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def empty( + shape: _ShapeLike, + dtype: _DTypeLike[_SCT], + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def empty( + shape: _ShapeLike, + dtype: DTypeLike, + order: _OrderCF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def unravel_index( # type: ignore[misc] + indices: _IntLike_co, + shape: _ShapeLike, + order: _OrderCF = ..., +) -> tuple[intp, ...]: ... +@overload +def unravel_index( + indices: _ArrayLikeInt_co, + shape: _ShapeLike, + order: _OrderCF = ..., +) -> tuple[NDArray[intp], ...]: ... + +@overload +def ravel_multi_index( # type: ignore[misc] + multi_index: Sequence[_IntLike_co], + dims: Sequence[SupportsIndex], + mode: _ModeKind | tuple[_ModeKind, ...] = ..., + order: _OrderCF = ..., +) -> intp: ... +@overload +def ravel_multi_index( + multi_index: Sequence[_ArrayLikeInt_co], + dims: Sequence[SupportsIndex], + mode: _ModeKind | tuple[_ModeKind, ...] = ..., + order: _OrderCF = ..., +) -> NDArray[intp]: ... + +# NOTE: Allow any sequence of array-like objects +@overload +def concatenate( # type: ignore[misc] + arrays: _ArrayLike[_SCT], + /, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + dtype: None = ..., + casting: None | _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def concatenate( # type: ignore[misc] + arrays: _SupportsLenAndGetItem[int, ArrayLike], + /, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + dtype: None = ..., + casting: None | _CastingKind = ... +) -> NDArray[Any]: ... +@overload +def concatenate( # type: ignore[misc] + arrays: _SupportsLenAndGetItem[int, ArrayLike], + /, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + dtype: _DTypeLike[_SCT], + casting: None | _CastingKind = ... +) -> NDArray[_SCT]: ... +@overload +def concatenate( # type: ignore[misc] + arrays: _SupportsLenAndGetItem[int, ArrayLike], + /, + axis: None | SupportsIndex = ..., + out: None = ..., + *, + dtype: DTypeLike, + casting: None | _CastingKind = ... +) -> NDArray[Any]: ... +@overload +def concatenate( + arrays: _SupportsLenAndGetItem[int, ArrayLike], + /, + axis: None | SupportsIndex = ..., + out: _ArrayType = ..., + *, + dtype: DTypeLike = ..., + casting: None | _CastingKind = ... +) -> _ArrayType: ... + +def inner( + a: ArrayLike, + b: ArrayLike, + /, +) -> Any: ... + +@overload +def where( + condition: ArrayLike, + /, +) -> tuple[NDArray[intp], ...]: ... +@overload +def where( + condition: ArrayLike, + x: ArrayLike, + y: ArrayLike, + /, +) -> NDArray[Any]: ... + +def lexsort( + keys: ArrayLike, + axis: None | SupportsIndex = ..., +) -> Any: ... + +def can_cast( + from_: ArrayLike | DTypeLike, + to: DTypeLike, + casting: None | _CastingKind = ..., +) -> bool: ... + +def min_scalar_type( + a: ArrayLike, /, +) -> dtype[Any]: ... + +def result_type( + *arrays_and_dtypes: ArrayLike | DTypeLike, +) -> dtype[Any]: ... + +@overload +def dot(a: ArrayLike, b: ArrayLike, out: None = ...) -> Any: ... +@overload +def dot(a: ArrayLike, b: ArrayLike, out: _ArrayType) -> _ArrayType: ... + +@overload +def vdot(a: _ArrayLikeBool_co, b: _ArrayLikeBool_co, /) -> bool_: ... # type: ignore[misc] +@overload +def vdot(a: _ArrayLikeUInt_co, b: _ArrayLikeUInt_co, /) -> unsignedinteger[Any]: ... # type: ignore[misc] +@overload +def vdot(a: _ArrayLikeInt_co, b: _ArrayLikeInt_co, /) -> signedinteger[Any]: ... # type: ignore[misc] +@overload +def vdot(a: _ArrayLikeFloat_co, b: _ArrayLikeFloat_co, /) -> floating[Any]: ... # type: ignore[misc] +@overload +def vdot(a: _ArrayLikeComplex_co, b: _ArrayLikeComplex_co, /) -> complexfloating[Any, Any]: ... # type: ignore[misc] +@overload +def vdot(a: _ArrayLikeTD64_co, b: _ArrayLikeTD64_co, /) -> timedelta64: ... +@overload +def vdot(a: _ArrayLikeObject_co, b: Any, /) -> Any: ... +@overload +def vdot(a: Any, b: _ArrayLikeObject_co, /) -> Any: ... + +def bincount( + x: ArrayLike, + /, + weights: None | ArrayLike = ..., + minlength: SupportsIndex = ..., +) -> NDArray[intp]: ... + +def copyto( + dst: NDArray[Any], + src: ArrayLike, + casting: None | _CastingKind = ..., + where: None | _ArrayLikeBool_co = ..., +) -> None: ... + +def putmask( + a: NDArray[Any], + /, + mask: _ArrayLikeBool_co, + values: ArrayLike, +) -> None: ... + +def packbits( + a: _ArrayLikeInt_co, + /, + axis: None | SupportsIndex = ..., + bitorder: L["big", "little"] = ..., +) -> NDArray[uint8]: ... + +def unpackbits( + a: _ArrayLike[uint8], + /, + axis: None | SupportsIndex = ..., + count: None | SupportsIndex = ..., + bitorder: L["big", "little"] = ..., +) -> NDArray[uint8]: ... + +def shares_memory( + a: object, + b: object, + /, + max_work: None | int = ..., +) -> bool: ... + +def may_share_memory( + a: object, + b: object, + /, + max_work: None | int = ..., +) -> bool: ... + +@overload +def asarray( + a: _ArrayLike[_SCT], + dtype: None = ..., + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asarray( + a: object, + dtype: None = ..., + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def asarray( + a: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asarray( + a: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def asanyarray( + a: _ArrayType, # Preserve subclass-information + dtype: None = ..., + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> _ArrayType: ... +@overload +def asanyarray( + a: _ArrayLike[_SCT], + dtype: None = ..., + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asanyarray( + a: object, + dtype: None = ..., + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def asanyarray( + a: Any, + dtype: _DTypeLike[_SCT], + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asanyarray( + a: Any, + dtype: DTypeLike, + order: _OrderKACF = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def ascontiguousarray( + a: _ArrayLike[_SCT], + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def ascontiguousarray( + a: object, + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def ascontiguousarray( + a: Any, + dtype: _DTypeLike[_SCT], + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def ascontiguousarray( + a: Any, + dtype: DTypeLike, + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def asfortranarray( + a: _ArrayLike[_SCT], + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asfortranarray( + a: object, + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def asfortranarray( + a: Any, + dtype: _DTypeLike[_SCT], + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def asfortranarray( + a: Any, + dtype: DTypeLike, + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +# In practice `list[Any]` is list with an int, int and a valid +# `np.seterrcall()` object +def geterrobj() -> list[Any]: ... +def seterrobj(errobj: list[Any], /) -> None: ... + +def promote_types(__type1: DTypeLike, __type2: DTypeLike) -> dtype[Any]: ... + +# `sep` is a de facto mandatory argument, as its default value is deprecated +@overload +def fromstring( + string: str | bytes, + dtype: None = ..., + count: SupportsIndex = ..., + *, + sep: str, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def fromstring( + string: str | bytes, + dtype: _DTypeLike[_SCT], + count: SupportsIndex = ..., + *, + sep: str, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def fromstring( + string: str | bytes, + dtype: DTypeLike, + count: SupportsIndex = ..., + *, + sep: str, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +def frompyfunc( + func: Callable[..., Any], /, + nin: SupportsIndex, + nout: SupportsIndex, + *, + identity: Any = ..., +) -> ufunc: ... + +@overload +def fromfile( + file: str | bytes | os.PathLike[Any] | _IOProtocol, + dtype: None = ..., + count: SupportsIndex = ..., + sep: str = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def fromfile( + file: str | bytes | os.PathLike[Any] | _IOProtocol, + dtype: _DTypeLike[_SCT], + count: SupportsIndex = ..., + sep: str = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def fromfile( + file: str | bytes | os.PathLike[Any] | _IOProtocol, + dtype: DTypeLike, + count: SupportsIndex = ..., + sep: str = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def fromiter( + iter: Iterable[Any], + dtype: _DTypeLike[_SCT], + count: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def fromiter( + iter: Iterable[Any], + dtype: DTypeLike, + count: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def frombuffer( + buffer: _SupportsBuffer, + dtype: None = ..., + count: SupportsIndex = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[float64]: ... +@overload +def frombuffer( + buffer: _SupportsBuffer, + dtype: _DTypeLike[_SCT], + count: SupportsIndex = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def frombuffer( + buffer: _SupportsBuffer, + dtype: DTypeLike, + count: SupportsIndex = ..., + offset: SupportsIndex = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +@overload +def arange( # type: ignore[misc] + stop: _IntLike_co, + /, *, + dtype: None = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def arange( # type: ignore[misc] + start: _IntLike_co, + stop: _IntLike_co, + step: _IntLike_co = ..., + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[signedinteger[Any]]: ... +@overload +def arange( # type: ignore[misc] + stop: _FloatLike_co, + /, *, + dtype: None = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[floating[Any]]: ... +@overload +def arange( # type: ignore[misc] + start: _FloatLike_co, + stop: _FloatLike_co, + step: _FloatLike_co = ..., + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[floating[Any]]: ... +@overload +def arange( + stop: _TD64Like_co, + /, *, + dtype: None = ..., + like: None | _SupportsArrayFunc = ..., +) -> NDArray[timedelta64]: ... +@overload +def arange( + start: _TD64Like_co, + stop: _TD64Like_co, + step: _TD64Like_co = ..., + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[timedelta64]: ... +@overload +def arange( # both start and stop must always be specified for datetime64 + start: datetime64, + stop: datetime64, + step: datetime64 = ..., + dtype: None = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[datetime64]: ... +@overload +def arange( + stop: Any, + /, *, + dtype: _DTypeLike[_SCT], + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def arange( + start: Any, + stop: Any, + step: Any = ..., + dtype: _DTypeLike[_SCT] = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[_SCT]: ... +@overload +def arange( + stop: Any, /, + *, + dtype: DTypeLike, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... +@overload +def arange( + start: Any, + stop: Any, + step: Any = ..., + dtype: DTypeLike = ..., + *, + like: None | _SupportsArrayFunc = ..., +) -> NDArray[Any]: ... + +def datetime_data( + dtype: str | _DTypeLike[datetime64] | _DTypeLike[timedelta64], /, +) -> tuple[str, int]: ... + +# The datetime functions perform unsafe casts to `datetime64[D]`, +# so a lot of different argument types are allowed here + +@overload +def busday_count( # type: ignore[misc] + begindates: _ScalarLike_co | dt.date, + enddates: _ScalarLike_co | dt.date, + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> int_: ... +@overload +def busday_count( # type: ignore[misc] + begindates: ArrayLike | dt.date | _NestedSequence[dt.date], + enddates: ArrayLike | dt.date | _NestedSequence[dt.date], + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> NDArray[int_]: ... +@overload +def busday_count( + begindates: ArrayLike | dt.date | _NestedSequence[dt.date], + enddates: ArrayLike | dt.date | _NestedSequence[dt.date], + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +# `roll="raise"` is (more or less?) equivalent to `casting="safe"` +@overload +def busday_offset( # type: ignore[misc] + dates: datetime64 | dt.date, + offsets: _TD64Like_co | dt.timedelta, + roll: L["raise"] = ..., + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> datetime64: ... +@overload +def busday_offset( # type: ignore[misc] + dates: _ArrayLike[datetime64] | dt.date | _NestedSequence[dt.date], + offsets: _ArrayLikeTD64_co | dt.timedelta | _NestedSequence[dt.timedelta], + roll: L["raise"] = ..., + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> NDArray[datetime64]: ... +@overload +def busday_offset( # type: ignore[misc] + dates: _ArrayLike[datetime64] | dt.date | _NestedSequence[dt.date], + offsets: _ArrayLikeTD64_co | dt.timedelta | _NestedSequence[dt.timedelta], + roll: L["raise"] = ..., + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... +@overload +def busday_offset( # type: ignore[misc] + dates: _ScalarLike_co | dt.date, + offsets: _ScalarLike_co | dt.timedelta, + roll: _RollKind, + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> datetime64: ... +@overload +def busday_offset( # type: ignore[misc] + dates: ArrayLike | dt.date | _NestedSequence[dt.date], + offsets: ArrayLike | dt.timedelta | _NestedSequence[dt.timedelta], + roll: _RollKind, + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> NDArray[datetime64]: ... +@overload +def busday_offset( + dates: ArrayLike | dt.date | _NestedSequence[dt.date], + offsets: ArrayLike | dt.timedelta | _NestedSequence[dt.timedelta], + roll: _RollKind, + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def is_busday( # type: ignore[misc] + dates: _ScalarLike_co | dt.date, + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> bool_: ... +@overload +def is_busday( # type: ignore[misc] + dates: ArrayLike | _NestedSequence[dt.date], + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: None = ..., +) -> NDArray[bool_]: ... +@overload +def is_busday( + dates: ArrayLike | _NestedSequence[dt.date], + weekmask: ArrayLike = ..., + holidays: None | ArrayLike | dt.date | _NestedSequence[dt.date] = ..., + busdaycal: None | busdaycalendar = ..., + out: _ArrayType = ..., +) -> _ArrayType: ... + +@overload +def datetime_as_string( # type: ignore[misc] + arr: datetime64 | dt.date, + unit: None | L["auto"] | _UnitKind = ..., + timezone: L["naive", "UTC", "local"] | dt.tzinfo = ..., + casting: _CastingKind = ..., +) -> str_: ... +@overload +def datetime_as_string( + arr: _ArrayLikeDT64_co | _NestedSequence[dt.date], + unit: None | L["auto"] | _UnitKind = ..., + timezone: L["naive", "UTC", "local"] | dt.tzinfo = ..., + casting: _CastingKind = ..., +) -> NDArray[str_]: ... + +@overload +def compare_chararrays( + a1: _ArrayLikeStr_co, + a2: _ArrayLikeStr_co, + cmp: L["<", "<=", "==", ">=", ">", "!="], + rstrip: bool, +) -> NDArray[bool_]: ... +@overload +def compare_chararrays( + a1: _ArrayLikeBytes_co, + a2: _ArrayLikeBytes_co, + cmp: L["<", "<=", "==", ">=", ">", "!="], + rstrip: bool, +) -> NDArray[bool_]: ... + +def add_docstring(obj: Callable[..., Any], docstring: str, /) -> None: ... + +_GetItemKeys = L[ + "C", "CONTIGUOUS", "C_CONTIGUOUS", + "F", "FORTRAN", "F_CONTIGUOUS", + "W", "WRITEABLE", + "B", "BEHAVED", + "O", "OWNDATA", + "A", "ALIGNED", + "X", "WRITEBACKIFCOPY", + "CA", "CARRAY", + "FA", "FARRAY", + "FNC", + "FORC", +] +_SetItemKeys = L[ + "A", "ALIGNED", + "W", "WRITEABLE", + "X", "WRITEBACKIFCOPY", +] + +@final +class flagsobj: + __hash__: ClassVar[None] # type: ignore[assignment] + aligned: bool + # NOTE: deprecated + # updateifcopy: bool + writeable: bool + writebackifcopy: bool + @property + def behaved(self) -> bool: ... + @property + def c_contiguous(self) -> bool: ... + @property + def carray(self) -> bool: ... + @property + def contiguous(self) -> bool: ... + @property + def f_contiguous(self) -> bool: ... + @property + def farray(self) -> bool: ... + @property + def fnc(self) -> bool: ... + @property + def forc(self) -> bool: ... + @property + def fortran(self) -> bool: ... + @property + def num(self) -> int: ... + @property + def owndata(self) -> bool: ... + def __getitem__(self, key: _GetItemKeys) -> bool: ... + def __setitem__(self, key: _SetItemKeys, value: bool) -> None: ... + +def nested_iters( + op: ArrayLike | Sequence[ArrayLike], + axes: Sequence[Sequence[SupportsIndex]], + flags: None | Sequence[_NDIterFlagsKind] = ..., + op_flags: None | Sequence[Sequence[_NDIterOpFlagsKind]] = ..., + op_dtypes: DTypeLike | Sequence[DTypeLike] = ..., + order: _OrderKACF = ..., + casting: _CastingKind = ..., + buffersize: SupportsIndex = ..., +) -> tuple[nditer, ...]: ... diff --git a/pllava/lib/python3.10/site-packages/numpy/core/numeric.py b/pllava/lib/python3.10/site-packages/numpy/core/numeric.py new file mode 100644 index 0000000000000000000000000000000000000000..91ac3f8606fedbf9c57edf5b1ec64693a9c3edd7 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/numeric.py @@ -0,0 +1,2530 @@ +import functools +import itertools +import operator +import sys +import warnings +import numbers +import builtins + +import numpy as np +from . import multiarray +from .multiarray import ( + fastCopyAndTranspose, ALLOW_THREADS, + BUFSIZE, CLIP, MAXDIMS, MAY_SHARE_BOUNDS, MAY_SHARE_EXACT, RAISE, + WRAP, arange, array, asarray, asanyarray, ascontiguousarray, + asfortranarray, broadcast, can_cast, compare_chararrays, + concatenate, copyto, dot, dtype, empty, + empty_like, flatiter, frombuffer, from_dlpack, fromfile, fromiter, + fromstring, inner, lexsort, matmul, may_share_memory, + min_scalar_type, ndarray, nditer, nested_iters, promote_types, + putmask, result_type, set_numeric_ops, shares_memory, vdot, where, + zeros, normalize_axis_index, _get_promotion_state, _set_promotion_state, + _using_numpy2_behavior) + +from . import overrides +from . import umath +from . import shape_base +from .overrides import set_array_function_like_doc, set_module +from .umath import (multiply, invert, sin, PINF, NAN) +from . import numerictypes +from .numerictypes import longlong, intc, int_, float_, complex_, bool_ +from ..exceptions import ComplexWarning, TooHardError, AxisError +from ._ufunc_config import errstate, _no_nep50_warning + +bitwise_not = invert +ufunc = type(sin) +newaxis = None + +array_function_dispatch = functools.partial( + overrides.array_function_dispatch, module='numpy') + + +__all__ = [ + 'newaxis', 'ndarray', 'flatiter', 'nditer', 'nested_iters', 'ufunc', + 'arange', 'array', 'asarray', 'asanyarray', 'ascontiguousarray', + 'asfortranarray', 'zeros', 'count_nonzero', 'empty', 'broadcast', 'dtype', + 'fromstring', 'fromfile', 'frombuffer', 'from_dlpack', 'where', + 'argwhere', 'copyto', 'concatenate', 'fastCopyAndTranspose', 'lexsort', + 'set_numeric_ops', 'can_cast', 'promote_types', 'min_scalar_type', + 'result_type', 'isfortran', 'empty_like', 'zeros_like', 'ones_like', + 'correlate', 'convolve', 'inner', 'dot', 'outer', 'vdot', 'roll', + 'rollaxis', 'moveaxis', 'cross', 'tensordot', 'little_endian', + 'fromiter', 'array_equal', 'array_equiv', 'indices', 'fromfunction', + 'isclose', 'isscalar', 'binary_repr', 'base_repr', 'ones', + 'identity', 'allclose', 'compare_chararrays', 'putmask', + 'flatnonzero', 'Inf', 'inf', 'infty', 'Infinity', 'nan', 'NaN', + 'False_', 'True_', 'bitwise_not', 'CLIP', 'RAISE', 'WRAP', 'MAXDIMS', + 'BUFSIZE', 'ALLOW_THREADS', 'full', 'full_like', + 'matmul', 'shares_memory', 'may_share_memory', 'MAY_SHARE_BOUNDS', + 'MAY_SHARE_EXACT', '_get_promotion_state', '_set_promotion_state', + '_using_numpy2_behavior'] + + +def _zeros_like_dispatcher(a, dtype=None, order=None, subok=None, shape=None): + return (a,) + + +@array_function_dispatch(_zeros_like_dispatcher) +def zeros_like(a, dtype=None, order='K', subok=True, shape=None): + """ + Return an array of zeros with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + + Returns + ------- + out : ndarray + Array of zeros with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones_like : Return an array of ones with shape and type of input. + full_like : Return a new array with shape of input filled with value. + zeros : Return a new array setting values to zero. + + Examples + -------- + >>> x = np.arange(6) + >>> x = x.reshape((2, 3)) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.zeros_like(x) + array([[0, 0, 0], + [0, 0, 0]]) + + >>> y = np.arange(3, dtype=float) + >>> y + array([0., 1., 2.]) + >>> np.zeros_like(y) + array([0., 0., 0.]) + + """ + res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape) + # needed instead of a 0 to get same result as zeros for string dtypes + z = zeros(1, dtype=res.dtype) + multiarray.copyto(res, z, casting='unsafe') + return res + + +@set_array_function_like_doc +@set_module('numpy') +def ones(shape, dtype=None, order='C', *, like=None): + """ + Return a new array of given shape and type, filled with ones. + + Parameters + ---------- + shape : int or sequence of ints + Shape of the new array, e.g., ``(2, 3)`` or ``2``. + dtype : data-type, optional + The desired data-type for the array, e.g., `numpy.int8`. Default is + `numpy.float64`. + order : {'C', 'F'}, optional, default: C + Whether to store multi-dimensional data in row-major + (C-style) or column-major (Fortran-style) order in + memory. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of ones with the given shape, dtype, and order. + + See Also + -------- + ones_like : Return an array of ones with shape and type of input. + empty : Return a new uninitialized array. + zeros : Return a new array setting values to zero. + full : Return a new array of given shape filled with value. + + + Examples + -------- + >>> np.ones(5) + array([1., 1., 1., 1., 1.]) + + >>> np.ones((5,), dtype=int) + array([1, 1, 1, 1, 1]) + + >>> np.ones((2, 1)) + array([[1.], + [1.]]) + + >>> s = (2,2) + >>> np.ones(s) + array([[1., 1.], + [1., 1.]]) + + """ + if like is not None: + return _ones_with_like(like, shape, dtype=dtype, order=order) + + a = empty(shape, dtype, order) + multiarray.copyto(a, 1, casting='unsafe') + return a + + +_ones_with_like = array_function_dispatch()(ones) + + +def _ones_like_dispatcher(a, dtype=None, order=None, subok=None, shape=None): + return (a,) + + +@array_function_dispatch(_ones_like_dispatcher) +def ones_like(a, dtype=None, order='K', subok=True, shape=None): + """ + Return an array of ones with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + dtype : data-type, optional + Overrides the data type of the result. + + .. versionadded:: 1.6.0 + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + + .. versionadded:: 1.6.0 + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + + Returns + ------- + out : ndarray + Array of ones with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full_like : Return a new array with shape of input filled with value. + ones : Return a new array setting values to one. + + Examples + -------- + >>> x = np.arange(6) + >>> x = x.reshape((2, 3)) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.ones_like(x) + array([[1, 1, 1], + [1, 1, 1]]) + + >>> y = np.arange(3, dtype=float) + >>> y + array([0., 1., 2.]) + >>> np.ones_like(y) + array([1., 1., 1.]) + + """ + res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape) + multiarray.copyto(res, 1, casting='unsafe') + return res + + +def _full_dispatcher(shape, fill_value, dtype=None, order=None, *, like=None): + return(like,) + + +@set_array_function_like_doc +@set_module('numpy') +def full(shape, fill_value, dtype=None, order='C', *, like=None): + """ + Return a new array of given shape and type, filled with `fill_value`. + + Parameters + ---------- + shape : int or sequence of ints + Shape of the new array, e.g., ``(2, 3)`` or ``2``. + fill_value : scalar or array_like + Fill value. + dtype : data-type, optional + The desired data-type for the array The default, None, means + ``np.array(fill_value).dtype``. + order : {'C', 'F'}, optional + Whether to store multidimensional data in C- or Fortran-contiguous + (row- or column-wise) order in memory. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + Array of `fill_value` with the given shape, dtype, and order. + + See Also + -------- + full_like : Return a new array with shape of input filled with value. + empty : Return a new uninitialized array. + ones : Return a new array setting values to one. + zeros : Return a new array setting values to zero. + + Examples + -------- + >>> np.full((2, 2), np.inf) + array([[inf, inf], + [inf, inf]]) + >>> np.full((2, 2), 10) + array([[10, 10], + [10, 10]]) + + >>> np.full((2, 2), [1, 2]) + array([[1, 2], + [1, 2]]) + + """ + if like is not None: + return _full_with_like( + like, shape, fill_value, dtype=dtype, order=order) + + if dtype is None: + fill_value = asarray(fill_value) + dtype = fill_value.dtype + a = empty(shape, dtype, order) + multiarray.copyto(a, fill_value, casting='unsafe') + return a + + +_full_with_like = array_function_dispatch()(full) + + +def _full_like_dispatcher(a, fill_value, dtype=None, order=None, subok=None, shape=None): + return (a,) + + +@array_function_dispatch(_full_like_dispatcher) +def full_like(a, fill_value, dtype=None, order='K', subok=True, shape=None): + """ + Return a full array with the same shape and type as a given array. + + Parameters + ---------- + a : array_like + The shape and data-type of `a` define these same attributes of + the returned array. + fill_value : array_like + Fill value. + dtype : data-type, optional + Overrides the data type of the result. + order : {'C', 'F', 'A', or 'K'}, optional + Overrides the memory layout of the result. 'C' means C-order, + 'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous, + 'C' otherwise. 'K' means match the layout of `a` as closely + as possible. + subok : bool, optional. + If True, then the newly created array will use the sub-class + type of `a`, otherwise it will be a base-class array. Defaults + to True. + shape : int or sequence of ints, optional. + Overrides the shape of the result. If order='K' and the number of + dimensions is unchanged, will try to keep order, otherwise, + order='C' is implied. + + .. versionadded:: 1.17.0 + + Returns + ------- + out : ndarray + Array of `fill_value` with the same shape and type as `a`. + + See Also + -------- + empty_like : Return an empty array with shape and type of input. + ones_like : Return an array of ones with shape and type of input. + zeros_like : Return an array of zeros with shape and type of input. + full : Return a new array of given shape filled with value. + + Examples + -------- + >>> x = np.arange(6, dtype=int) + >>> np.full_like(x, 1) + array([1, 1, 1, 1, 1, 1]) + >>> np.full_like(x, 0.1) + array([0, 0, 0, 0, 0, 0]) + >>> np.full_like(x, 0.1, dtype=np.double) + array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) + >>> np.full_like(x, np.nan, dtype=np.double) + array([nan, nan, nan, nan, nan, nan]) + + >>> y = np.arange(6, dtype=np.double) + >>> np.full_like(y, 0.1) + array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1]) + + >>> y = np.zeros([2, 2, 3], dtype=int) + >>> np.full_like(y, [0, 0, 255]) + array([[[ 0, 0, 255], + [ 0, 0, 255]], + [[ 0, 0, 255], + [ 0, 0, 255]]]) + """ + res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape) + multiarray.copyto(res, fill_value, casting='unsafe') + return res + + +def _count_nonzero_dispatcher(a, axis=None, *, keepdims=None): + return (a,) + + +@array_function_dispatch(_count_nonzero_dispatcher) +def count_nonzero(a, axis=None, *, keepdims=False): + """ + Counts the number of non-zero values in the array ``a``. + + The word "non-zero" is in reference to the Python 2.x + built-in method ``__nonzero__()`` (renamed ``__bool__()`` + in Python 3.x) of Python objects that tests an object's + "truthfulness". For example, any number is considered + truthful if it is nonzero, whereas any string is considered + truthful if it is not the empty string. Thus, this function + (recursively) counts how many elements in ``a`` (and in + sub-arrays thereof) have their ``__nonzero__()`` or ``__bool__()`` + method evaluated to ``True``. + + Parameters + ---------- + a : array_like + The array for which to count non-zeros. + axis : int or tuple, optional + Axis or tuple of axes along which to count non-zeros. + Default is None, meaning that non-zeros will be counted + along a flattened version of ``a``. + + .. versionadded:: 1.12.0 + + keepdims : bool, optional + If this is set to True, the axes that are counted are left + in the result as dimensions with size one. With this option, + the result will broadcast correctly against the input array. + + .. versionadded:: 1.19.0 + + Returns + ------- + count : int or array of int + Number of non-zero values in the array along a given axis. + Otherwise, the total number of non-zero values in the array + is returned. + + See Also + -------- + nonzero : Return the coordinates of all the non-zero values. + + Examples + -------- + >>> np.count_nonzero(np.eye(4)) + 4 + >>> a = np.array([[0, 1, 7, 0], + ... [3, 0, 2, 19]]) + >>> np.count_nonzero(a) + 5 + >>> np.count_nonzero(a, axis=0) + array([1, 1, 2, 1]) + >>> np.count_nonzero(a, axis=1) + array([2, 3]) + >>> np.count_nonzero(a, axis=1, keepdims=True) + array([[2], + [3]]) + """ + if axis is None and not keepdims: + return multiarray.count_nonzero(a) + + a = asanyarray(a) + + # TODO: this works around .astype(bool) not working properly (gh-9847) + if np.issubdtype(a.dtype, np.character): + a_bool = a != a.dtype.type() + else: + a_bool = a.astype(np.bool_, copy=False) + + return a_bool.sum(axis=axis, dtype=np.intp, keepdims=keepdims) + + +@set_module('numpy') +def isfortran(a): + """ + Check if the array is Fortran contiguous but *not* C contiguous. + + This function is obsolete and, because of changes due to relaxed stride + checking, its return value for the same array may differ for versions + of NumPy >= 1.10.0 and previous versions. If you only want to check if an + array is Fortran contiguous use ``a.flags.f_contiguous`` instead. + + Parameters + ---------- + a : ndarray + Input array. + + Returns + ------- + isfortran : bool + Returns True if the array is Fortran contiguous but *not* C contiguous. + + + Examples + -------- + + np.array allows to specify whether the array is written in C-contiguous + order (last index varies the fastest), or FORTRAN-contiguous order in + memory (first index varies the fastest). + + >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') + >>> a + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(a) + False + + >>> b = np.array([[1, 2, 3], [4, 5, 6]], order='F') + >>> b + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(b) + True + + + The transpose of a C-ordered array is a FORTRAN-ordered array. + + >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C') + >>> a + array([[1, 2, 3], + [4, 5, 6]]) + >>> np.isfortran(a) + False + >>> b = a.T + >>> b + array([[1, 4], + [2, 5], + [3, 6]]) + >>> np.isfortran(b) + True + + C-ordered arrays evaluate as False even if they are also FORTRAN-ordered. + + >>> np.isfortran(np.array([1, 2], order='F')) + False + + """ + return a.flags.fnc + + +def _argwhere_dispatcher(a): + return (a,) + + +@array_function_dispatch(_argwhere_dispatcher) +def argwhere(a): + """ + Find the indices of array elements that are non-zero, grouped by element. + + Parameters + ---------- + a : array_like + Input data. + + Returns + ------- + index_array : (N, a.ndim) ndarray + Indices of elements that are non-zero. Indices are grouped by element. + This array will have shape ``(N, a.ndim)`` where ``N`` is the number of + non-zero items. + + See Also + -------- + where, nonzero + + Notes + ----- + ``np.argwhere(a)`` is almost the same as ``np.transpose(np.nonzero(a))``, + but produces a result of the correct shape for a 0D array. + + The output of ``argwhere`` is not suitable for indexing arrays. + For this purpose use ``nonzero(a)`` instead. + + Examples + -------- + >>> x = np.arange(6).reshape(2,3) + >>> x + array([[0, 1, 2], + [3, 4, 5]]) + >>> np.argwhere(x>1) + array([[0, 2], + [1, 0], + [1, 1], + [1, 2]]) + + """ + # nonzero does not behave well on 0d, so promote to 1d + if np.ndim(a) == 0: + a = shape_base.atleast_1d(a) + # then remove the added dimension + return argwhere(a)[:,:0] + return transpose(nonzero(a)) + + +def _flatnonzero_dispatcher(a): + return (a,) + + +@array_function_dispatch(_flatnonzero_dispatcher) +def flatnonzero(a): + """ + Return indices that are non-zero in the flattened version of a. + + This is equivalent to ``np.nonzero(np.ravel(a))[0]``. + + Parameters + ---------- + a : array_like + Input data. + + Returns + ------- + res : ndarray + Output array, containing the indices of the elements of ``a.ravel()`` + that are non-zero. + + See Also + -------- + nonzero : Return the indices of the non-zero elements of the input array. + ravel : Return a 1-D array containing the elements of the input array. + + Examples + -------- + >>> x = np.arange(-2, 3) + >>> x + array([-2, -1, 0, 1, 2]) + >>> np.flatnonzero(x) + array([0, 1, 3, 4]) + + Use the indices of the non-zero elements as an index array to extract + these elements: + + >>> x.ravel()[np.flatnonzero(x)] + array([-2, -1, 1, 2]) + + """ + return np.nonzero(np.ravel(a))[0] + + +def _correlate_dispatcher(a, v, mode=None): + return (a, v) + + +@array_function_dispatch(_correlate_dispatcher) +def correlate(a, v, mode='valid'): + r""" + Cross-correlation of two 1-dimensional sequences. + + This function computes the correlation as generally defined in signal + processing texts: + + .. math:: c_k = \sum_n a_{n+k} \cdot \overline{v}_n + + with a and v sequences being zero-padded where necessary and + :math:`\overline x` denoting complex conjugation. + + Parameters + ---------- + a, v : array_like + Input sequences. + mode : {'valid', 'same', 'full'}, optional + Refer to the `convolve` docstring. Note that the default + is 'valid', unlike `convolve`, which uses 'full'. + old_behavior : bool + `old_behavior` was removed in NumPy 1.10. If you need the old + behavior, use `multiarray.correlate`. + + Returns + ------- + out : ndarray + Discrete cross-correlation of `a` and `v`. + + See Also + -------- + convolve : Discrete, linear convolution of two one-dimensional sequences. + multiarray.correlate : Old, no conjugate, version of correlate. + scipy.signal.correlate : uses FFT which has superior performance on large arrays. + + Notes + ----- + The definition of correlation above is not unique and sometimes correlation + may be defined differently. Another common definition is: + + .. math:: c'_k = \sum_n a_{n} \cdot \overline{v_{n+k}} + + which is related to :math:`c_k` by :math:`c'_k = c_{-k}`. + + `numpy.correlate` may perform slowly in large arrays (i.e. n = 1e5) because it does + not use the FFT to compute the convolution; in that case, `scipy.signal.correlate` might + be preferable. + + + Examples + -------- + >>> np.correlate([1, 2, 3], [0, 1, 0.5]) + array([3.5]) + >>> np.correlate([1, 2, 3], [0, 1, 0.5], "same") + array([2. , 3.5, 3. ]) + >>> np.correlate([1, 2, 3], [0, 1, 0.5], "full") + array([0.5, 2. , 3.5, 3. , 0. ]) + + Using complex sequences: + + >>> np.correlate([1+1j, 2, 3-1j], [0, 1, 0.5j], 'full') + array([ 0.5-0.5j, 1.0+0.j , 1.5-1.5j, 3.0-1.j , 0.0+0.j ]) + + Note that you get the time reversed, complex conjugated result + (:math:`\overline{c_{-k}}`) when the two input sequences a and v change + places: + + >>> np.correlate([0, 1, 0.5j], [1+1j, 2, 3-1j], 'full') + array([ 0.0+0.j , 3.0+1.j , 1.5+1.5j, 1.0+0.j , 0.5+0.5j]) + + """ + return multiarray.correlate2(a, v, mode) + + +def _convolve_dispatcher(a, v, mode=None): + return (a, v) + + +@array_function_dispatch(_convolve_dispatcher) +def convolve(a, v, mode='full'): + """ + Returns the discrete, linear convolution of two one-dimensional sequences. + + The convolution operator is often seen in signal processing, where it + models the effect of a linear time-invariant system on a signal [1]_. In + probability theory, the sum of two independent random variables is + distributed according to the convolution of their individual + distributions. + + If `v` is longer than `a`, the arrays are swapped before computation. + + Parameters + ---------- + a : (N,) array_like + First one-dimensional input array. + v : (M,) array_like + Second one-dimensional input array. + mode : {'full', 'valid', 'same'}, optional + 'full': + By default, mode is 'full'. This returns the convolution + at each point of overlap, with an output shape of (N+M-1,). At + the end-points of the convolution, the signals do not overlap + completely, and boundary effects may be seen. + + 'same': + Mode 'same' returns output of length ``max(M, N)``. Boundary + effects are still visible. + + 'valid': + Mode 'valid' returns output of length + ``max(M, N) - min(M, N) + 1``. The convolution product is only given + for points where the signals overlap completely. Values outside + the signal boundary have no effect. + + Returns + ------- + out : ndarray + Discrete, linear convolution of `a` and `v`. + + See Also + -------- + scipy.signal.fftconvolve : Convolve two arrays using the Fast Fourier + Transform. + scipy.linalg.toeplitz : Used to construct the convolution operator. + polymul : Polynomial multiplication. Same output as convolve, but also + accepts poly1d objects as input. + + Notes + ----- + The discrete convolution operation is defined as + + .. math:: (a * v)_n = \\sum_{m = -\\infty}^{\\infty} a_m v_{n - m} + + It can be shown that a convolution :math:`x(t) * y(t)` in time/space + is equivalent to the multiplication :math:`X(f) Y(f)` in the Fourier + domain, after appropriate padding (padding is necessary to prevent + circular convolution). Since multiplication is more efficient (faster) + than convolution, the function `scipy.signal.fftconvolve` exploits the + FFT to calculate the convolution of large data-sets. + + References + ---------- + .. [1] Wikipedia, "Convolution", + https://en.wikipedia.org/wiki/Convolution + + Examples + -------- + Note how the convolution operator flips the second array + before "sliding" the two across one another: + + >>> np.convolve([1, 2, 3], [0, 1, 0.5]) + array([0. , 1. , 2.5, 4. , 1.5]) + + Only return the middle values of the convolution. + Contains boundary effects, where zeros are taken + into account: + + >>> np.convolve([1,2,3],[0,1,0.5], 'same') + array([1. , 2.5, 4. ]) + + The two arrays are of the same length, so there + is only one position where they completely overlap: + + >>> np.convolve([1,2,3],[0,1,0.5], 'valid') + array([2.5]) + + """ + a, v = array(a, copy=False, ndmin=1), array(v, copy=False, ndmin=1) + if (len(v) > len(a)): + a, v = v, a + if len(a) == 0: + raise ValueError('a cannot be empty') + if len(v) == 0: + raise ValueError('v cannot be empty') + return multiarray.correlate(a, v[::-1], mode) + + +def _outer_dispatcher(a, b, out=None): + return (a, b, out) + + +@array_function_dispatch(_outer_dispatcher) +def outer(a, b, out=None): + """ + Compute the outer product of two vectors. + + Given two vectors `a` and `b` of length ``M`` and ``N``, repsectively, + the outer product [1]_ is:: + + [[a_0*b_0 a_0*b_1 ... a_0*b_{N-1} ] + [a_1*b_0 . + [ ... . + [a_{M-1}*b_0 a_{M-1}*b_{N-1} ]] + + Parameters + ---------- + a : (M,) array_like + First input vector. Input is flattened if + not already 1-dimensional. + b : (N,) array_like + Second input vector. Input is flattened if + not already 1-dimensional. + out : (M, N) ndarray, optional + A location where the result is stored + + .. versionadded:: 1.9.0 + + Returns + ------- + out : (M, N) ndarray + ``out[i, j] = a[i] * b[j]`` + + See also + -------- + inner + einsum : ``einsum('i,j->ij', a.ravel(), b.ravel())`` is the equivalent. + ufunc.outer : A generalization to dimensions other than 1D and other + operations. ``np.multiply.outer(a.ravel(), b.ravel())`` + is the equivalent. + tensordot : ``np.tensordot(a.ravel(), b.ravel(), axes=((), ()))`` + is the equivalent. + + References + ---------- + .. [1] G. H. Golub and C. F. Van Loan, *Matrix Computations*, 3rd + ed., Baltimore, MD, Johns Hopkins University Press, 1996, + pg. 8. + + Examples + -------- + Make a (*very* coarse) grid for computing a Mandelbrot set: + + >>> rl = np.outer(np.ones((5,)), np.linspace(-2, 2, 5)) + >>> rl + array([[-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.], + [-2., -1., 0., 1., 2.]]) + >>> im = np.outer(1j*np.linspace(2, -2, 5), np.ones((5,))) + >>> im + array([[0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j], + [0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j], + [0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j], + [0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j], + [0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j]]) + >>> grid = rl + im + >>> grid + array([[-2.+2.j, -1.+2.j, 0.+2.j, 1.+2.j, 2.+2.j], + [-2.+1.j, -1.+1.j, 0.+1.j, 1.+1.j, 2.+1.j], + [-2.+0.j, -1.+0.j, 0.+0.j, 1.+0.j, 2.+0.j], + [-2.-1.j, -1.-1.j, 0.-1.j, 1.-1.j, 2.-1.j], + [-2.-2.j, -1.-2.j, 0.-2.j, 1.-2.j, 2.-2.j]]) + + An example using a "vector" of letters: + + >>> x = np.array(['a', 'b', 'c'], dtype=object) + >>> np.outer(x, [1, 2, 3]) + array([['a', 'aa', 'aaa'], + ['b', 'bb', 'bbb'], + ['c', 'cc', 'ccc']], dtype=object) + + """ + a = asarray(a) + b = asarray(b) + return multiply(a.ravel()[:, newaxis], b.ravel()[newaxis, :], out) + + +def _tensordot_dispatcher(a, b, axes=None): + return (a, b) + + +@array_function_dispatch(_tensordot_dispatcher) +def tensordot(a, b, axes=2): + """ + Compute tensor dot product along specified axes. + + Given two tensors, `a` and `b`, and an array_like object containing + two array_like objects, ``(a_axes, b_axes)``, sum the products of + `a`'s and `b`'s elements (components) over the axes specified by + ``a_axes`` and ``b_axes``. The third argument can be a single non-negative + integer_like scalar, ``N``; if it is such, then the last ``N`` dimensions + of `a` and the first ``N`` dimensions of `b` are summed over. + + Parameters + ---------- + a, b : array_like + Tensors to "dot". + + axes : int or (2,) array_like + * integer_like + If an int N, sum over the last N axes of `a` and the first N axes + of `b` in order. The sizes of the corresponding axes must match. + * (2,) array_like + Or, a list of axes to be summed over, first sequence applying to `a`, + second to `b`. Both elements array_like must be of the same length. + + Returns + ------- + output : ndarray + The tensor dot product of the input. + + See Also + -------- + dot, einsum + + Notes + ----- + Three common use cases are: + * ``axes = 0`` : tensor product :math:`a\\otimes b` + * ``axes = 1`` : tensor dot product :math:`a\\cdot b` + * ``axes = 2`` : (default) tensor double contraction :math:`a:b` + + When `axes` is integer_like, the sequence for evaluation will be: first + the -Nth axis in `a` and 0th axis in `b`, and the -1th axis in `a` and + Nth axis in `b` last. + + When there is more than one axis to sum over - and they are not the last + (first) axes of `a` (`b`) - the argument `axes` should consist of + two sequences of the same length, with the first axis to sum over given + first in both sequences, the second axis second, and so forth. + + The shape of the result consists of the non-contracted axes of the + first tensor, followed by the non-contracted axes of the second. + + Examples + -------- + A "traditional" example: + + >>> a = np.arange(60.).reshape(3,4,5) + >>> b = np.arange(24.).reshape(4,3,2) + >>> c = np.tensordot(a,b, axes=([1,0],[0,1])) + >>> c.shape + (5, 2) + >>> c + array([[4400., 4730.], + [4532., 4874.], + [4664., 5018.], + [4796., 5162.], + [4928., 5306.]]) + >>> # A slower but equivalent way of computing the same... + >>> d = np.zeros((5,2)) + >>> for i in range(5): + ... for j in range(2): + ... for k in range(3): + ... for n in range(4): + ... d[i,j] += a[k,n,i] * b[n,k,j] + >>> c == d + array([[ True, True], + [ True, True], + [ True, True], + [ True, True], + [ True, True]]) + + An extended example taking advantage of the overloading of + and \\*: + + >>> a = np.array(range(1, 9)) + >>> a.shape = (2, 2, 2) + >>> A = np.array(('a', 'b', 'c', 'd'), dtype=object) + >>> A.shape = (2, 2) + >>> a; A + array([[[1, 2], + [3, 4]], + [[5, 6], + [7, 8]]]) + array([['a', 'b'], + ['c', 'd']], dtype=object) + + >>> np.tensordot(a, A) # third argument default is 2 for double-contraction + array(['abbcccdddd', 'aaaaabbbbbbcccccccdddddddd'], dtype=object) + + >>> np.tensordot(a, A, 1) + array([[['acc', 'bdd'], + ['aaacccc', 'bbbdddd']], + [['aaaaacccccc', 'bbbbbdddddd'], + ['aaaaaaacccccccc', 'bbbbbbbdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, 0) # tensor product (result too long to incl.) + array([[[[['a', 'b'], + ['c', 'd']], + ... + + >>> np.tensordot(a, A, (0, 1)) + array([[['abbbbb', 'cddddd'], + ['aabbbbbb', 'ccdddddd']], + [['aaabbbbbbb', 'cccddddddd'], + ['aaaabbbbbbbb', 'ccccdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, (2, 1)) + array([[['abb', 'cdd'], + ['aaabbbb', 'cccdddd']], + [['aaaaabbbbbb', 'cccccdddddd'], + ['aaaaaaabbbbbbbb', 'cccccccdddddddd']]], dtype=object) + + >>> np.tensordot(a, A, ((0, 1), (0, 1))) + array(['abbbcccccddddddd', 'aabbbbccccccdddddddd'], dtype=object) + + >>> np.tensordot(a, A, ((2, 1), (1, 0))) + array(['acccbbdddd', 'aaaaacccccccbbbbbbdddddddd'], dtype=object) + + """ + try: + iter(axes) + except Exception: + axes_a = list(range(-axes, 0)) + axes_b = list(range(0, axes)) + else: + axes_a, axes_b = axes + try: + na = len(axes_a) + axes_a = list(axes_a) + except TypeError: + axes_a = [axes_a] + na = 1 + try: + nb = len(axes_b) + axes_b = list(axes_b) + except TypeError: + axes_b = [axes_b] + nb = 1 + + a, b = asarray(a), asarray(b) + as_ = a.shape + nda = a.ndim + bs = b.shape + ndb = b.ndim + equal = True + if na != nb: + equal = False + else: + for k in range(na): + if as_[axes_a[k]] != bs[axes_b[k]]: + equal = False + break + if axes_a[k] < 0: + axes_a[k] += nda + if axes_b[k] < 0: + axes_b[k] += ndb + if not equal: + raise ValueError("shape-mismatch for sum") + + # Move the axes to sum over to the end of "a" + # and to the front of "b" + notin = [k for k in range(nda) if k not in axes_a] + newaxes_a = notin + axes_a + N2 = 1 + for axis in axes_a: + N2 *= as_[axis] + newshape_a = (int(multiply.reduce([as_[ax] for ax in notin])), N2) + olda = [as_[axis] for axis in notin] + + notin = [k for k in range(ndb) if k not in axes_b] + newaxes_b = axes_b + notin + N2 = 1 + for axis in axes_b: + N2 *= bs[axis] + newshape_b = (N2, int(multiply.reduce([bs[ax] for ax in notin]))) + oldb = [bs[axis] for axis in notin] + + at = a.transpose(newaxes_a).reshape(newshape_a) + bt = b.transpose(newaxes_b).reshape(newshape_b) + res = dot(at, bt) + return res.reshape(olda + oldb) + + +def _roll_dispatcher(a, shift, axis=None): + return (a,) + + +@array_function_dispatch(_roll_dispatcher) +def roll(a, shift, axis=None): + """ + Roll array elements along a given axis. + + Elements that roll beyond the last position are re-introduced at + the first. + + Parameters + ---------- + a : array_like + Input array. + shift : int or tuple of ints + The number of places by which elements are shifted. If a tuple, + then `axis` must be a tuple of the same size, and each of the + given axes is shifted by the corresponding number. If an int + while `axis` is a tuple of ints, then the same value is used for + all given axes. + axis : int or tuple of ints, optional + Axis or axes along which elements are shifted. By default, the + array is flattened before shifting, after which the original + shape is restored. + + Returns + ------- + res : ndarray + Output array, with the same shape as `a`. + + See Also + -------- + rollaxis : Roll the specified axis backwards, until it lies in a + given position. + + Notes + ----- + .. versionadded:: 1.12.0 + + Supports rolling over multiple dimensions simultaneously. + + Examples + -------- + >>> x = np.arange(10) + >>> np.roll(x, 2) + array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7]) + >>> np.roll(x, -2) + array([2, 3, 4, 5, 6, 7, 8, 9, 0, 1]) + + >>> x2 = np.reshape(x, (2, 5)) + >>> x2 + array([[0, 1, 2, 3, 4], + [5, 6, 7, 8, 9]]) + >>> np.roll(x2, 1) + array([[9, 0, 1, 2, 3], + [4, 5, 6, 7, 8]]) + >>> np.roll(x2, -1) + array([[1, 2, 3, 4, 5], + [6, 7, 8, 9, 0]]) + >>> np.roll(x2, 1, axis=0) + array([[5, 6, 7, 8, 9], + [0, 1, 2, 3, 4]]) + >>> np.roll(x2, -1, axis=0) + array([[5, 6, 7, 8, 9], + [0, 1, 2, 3, 4]]) + >>> np.roll(x2, 1, axis=1) + array([[4, 0, 1, 2, 3], + [9, 5, 6, 7, 8]]) + >>> np.roll(x2, -1, axis=1) + array([[1, 2, 3, 4, 0], + [6, 7, 8, 9, 5]]) + >>> np.roll(x2, (1, 1), axis=(1, 0)) + array([[9, 5, 6, 7, 8], + [4, 0, 1, 2, 3]]) + >>> np.roll(x2, (2, 1), axis=(1, 0)) + array([[8, 9, 5, 6, 7], + [3, 4, 0, 1, 2]]) + + """ + a = asanyarray(a) + if axis is None: + return roll(a.ravel(), shift, 0).reshape(a.shape) + + else: + axis = normalize_axis_tuple(axis, a.ndim, allow_duplicate=True) + broadcasted = broadcast(shift, axis) + if broadcasted.ndim > 1: + raise ValueError( + "'shift' and 'axis' should be scalars or 1D sequences") + shifts = {ax: 0 for ax in range(a.ndim)} + for sh, ax in broadcasted: + shifts[ax] += sh + + rolls = [((slice(None), slice(None)),)] * a.ndim + for ax, offset in shifts.items(): + offset %= a.shape[ax] or 1 # If `a` is empty, nothing matters. + if offset: + # (original, result), (original, result) + rolls[ax] = ((slice(None, -offset), slice(offset, None)), + (slice(-offset, None), slice(None, offset))) + + result = empty_like(a) + for indices in itertools.product(*rolls): + arr_index, res_index = zip(*indices) + result[res_index] = a[arr_index] + + return result + + +def _rollaxis_dispatcher(a, axis, start=None): + return (a,) + + +@array_function_dispatch(_rollaxis_dispatcher) +def rollaxis(a, axis, start=0): + """ + Roll the specified axis backwards, until it lies in a given position. + + This function continues to be supported for backward compatibility, but you + should prefer `moveaxis`. The `moveaxis` function was added in NumPy + 1.11. + + Parameters + ---------- + a : ndarray + Input array. + axis : int + The axis to be rolled. The positions of the other axes do not + change relative to one another. + start : int, optional + When ``start <= axis``, the axis is rolled back until it lies in + this position. When ``start > axis``, the axis is rolled until it + lies before this position. The default, 0, results in a "complete" + roll. The following table describes how negative values of ``start`` + are interpreted: + + .. table:: + :align: left + + +-------------------+----------------------+ + | ``start`` | Normalized ``start`` | + +===================+======================+ + | ``-(arr.ndim+1)`` | raise ``AxisError`` | + +-------------------+----------------------+ + | ``-arr.ndim`` | 0 | + +-------------------+----------------------+ + | |vdots| | |vdots| | + +-------------------+----------------------+ + | ``-1`` | ``arr.ndim-1`` | + +-------------------+----------------------+ + | ``0`` | ``0`` | + +-------------------+----------------------+ + | |vdots| | |vdots| | + +-------------------+----------------------+ + | ``arr.ndim`` | ``arr.ndim`` | + +-------------------+----------------------+ + | ``arr.ndim + 1`` | raise ``AxisError`` | + +-------------------+----------------------+ + + .. |vdots| unicode:: U+22EE .. Vertical Ellipsis + + Returns + ------- + res : ndarray + For NumPy >= 1.10.0 a view of `a` is always returned. For earlier + NumPy versions a view of `a` is returned only if the order of the + axes is changed, otherwise the input array is returned. + + See Also + -------- + moveaxis : Move array axes to new positions. + roll : Roll the elements of an array by a number of positions along a + given axis. + + Examples + -------- + >>> a = np.ones((3,4,5,6)) + >>> np.rollaxis(a, 3, 1).shape + (3, 6, 4, 5) + >>> np.rollaxis(a, 2).shape + (5, 3, 4, 6) + >>> np.rollaxis(a, 1, 4).shape + (3, 5, 6, 4) + + """ + n = a.ndim + axis = normalize_axis_index(axis, n) + if start < 0: + start += n + msg = "'%s' arg requires %d <= %s < %d, but %d was passed in" + if not (0 <= start < n + 1): + raise AxisError(msg % ('start', -n, 'start', n + 1, start)) + if axis < start: + # it's been removed + start -= 1 + if axis == start: + return a[...] + axes = list(range(0, n)) + axes.remove(axis) + axes.insert(start, axis) + return a.transpose(axes) + + +def normalize_axis_tuple(axis, ndim, argname=None, allow_duplicate=False): + """ + Normalizes an axis argument into a tuple of non-negative integer axes. + + This handles shorthands such as ``1`` and converts them to ``(1,)``, + as well as performing the handling of negative indices covered by + `normalize_axis_index`. + + By default, this forbids axes from being specified multiple times. + + Used internally by multi-axis-checking logic. + + .. versionadded:: 1.13.0 + + Parameters + ---------- + axis : int, iterable of int + The un-normalized index or indices of the axis. + ndim : int + The number of dimensions of the array that `axis` should be normalized + against. + argname : str, optional + A prefix to put before the error message, typically the name of the + argument. + allow_duplicate : bool, optional + If False, the default, disallow an axis from being specified twice. + + Returns + ------- + normalized_axes : tuple of int + The normalized axis index, such that `0 <= normalized_axis < ndim` + + Raises + ------ + AxisError + If any axis provided is out of range + ValueError + If an axis is repeated + + See also + -------- + normalize_axis_index : normalizing a single scalar axis + """ + # Optimization to speed-up the most common cases. + if type(axis) not in (tuple, list): + try: + axis = [operator.index(axis)] + except TypeError: + pass + # Going via an iterator directly is slower than via list comprehension. + axis = tuple([normalize_axis_index(ax, ndim, argname) for ax in axis]) + if not allow_duplicate and len(set(axis)) != len(axis): + if argname: + raise ValueError('repeated axis in `{}` argument'.format(argname)) + else: + raise ValueError('repeated axis') + return axis + + +def _moveaxis_dispatcher(a, source, destination): + return (a,) + + +@array_function_dispatch(_moveaxis_dispatcher) +def moveaxis(a, source, destination): + """ + Move axes of an array to new positions. + + Other axes remain in their original order. + + .. versionadded:: 1.11.0 + + Parameters + ---------- + a : np.ndarray + The array whose axes should be reordered. + source : int or sequence of int + Original positions of the axes to move. These must be unique. + destination : int or sequence of int + Destination positions for each of the original axes. These must also be + unique. + + Returns + ------- + result : np.ndarray + Array with moved axes. This array is a view of the input array. + + See Also + -------- + transpose : Permute the dimensions of an array. + swapaxes : Interchange two axes of an array. + + Examples + -------- + >>> x = np.zeros((3, 4, 5)) + >>> np.moveaxis(x, 0, -1).shape + (4, 5, 3) + >>> np.moveaxis(x, -1, 0).shape + (5, 3, 4) + + These all achieve the same result: + + >>> np.transpose(x).shape + (5, 4, 3) + >>> np.swapaxes(x, 0, -1).shape + (5, 4, 3) + >>> np.moveaxis(x, [0, 1], [-1, -2]).shape + (5, 4, 3) + >>> np.moveaxis(x, [0, 1, 2], [-1, -2, -3]).shape + (5, 4, 3) + + """ + try: + # allow duck-array types if they define transpose + transpose = a.transpose + except AttributeError: + a = asarray(a) + transpose = a.transpose + + source = normalize_axis_tuple(source, a.ndim, 'source') + destination = normalize_axis_tuple(destination, a.ndim, 'destination') + if len(source) != len(destination): + raise ValueError('`source` and `destination` arguments must have ' + 'the same number of elements') + + order = [n for n in range(a.ndim) if n not in source] + + for dest, src in sorted(zip(destination, source)): + order.insert(dest, src) + + result = transpose(order) + return result + + +def _cross_dispatcher(a, b, axisa=None, axisb=None, axisc=None, axis=None): + return (a, b) + + +@array_function_dispatch(_cross_dispatcher) +def cross(a, b, axisa=-1, axisb=-1, axisc=-1, axis=None): + """ + Return the cross product of two (arrays of) vectors. + + The cross product of `a` and `b` in :math:`R^3` is a vector perpendicular + to both `a` and `b`. If `a` and `b` are arrays of vectors, the vectors + are defined by the last axis of `a` and `b` by default, and these axes + can have dimensions 2 or 3. Where the dimension of either `a` or `b` is + 2, the third component of the input vector is assumed to be zero and the + cross product calculated accordingly. In cases where both input vectors + have dimension 2, the z-component of the cross product is returned. + + Parameters + ---------- + a : array_like + Components of the first vector(s). + b : array_like + Components of the second vector(s). + axisa : int, optional + Axis of `a` that defines the vector(s). By default, the last axis. + axisb : int, optional + Axis of `b` that defines the vector(s). By default, the last axis. + axisc : int, optional + Axis of `c` containing the cross product vector(s). Ignored if + both input vectors have dimension 2, as the return is scalar. + By default, the last axis. + axis : int, optional + If defined, the axis of `a`, `b` and `c` that defines the vector(s) + and cross product(s). Overrides `axisa`, `axisb` and `axisc`. + + Returns + ------- + c : ndarray + Vector cross product(s). + + Raises + ------ + ValueError + When the dimension of the vector(s) in `a` and/or `b` does not + equal 2 or 3. + + See Also + -------- + inner : Inner product + outer : Outer product. + ix_ : Construct index arrays. + + Notes + ----- + .. versionadded:: 1.9.0 + + Supports full broadcasting of the inputs. + + Examples + -------- + Vector cross-product. + + >>> x = [1, 2, 3] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([-3, 6, -3]) + + One vector with dimension 2. + + >>> x = [1, 2] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([12, -6, -3]) + + Equivalently: + + >>> x = [1, 2, 0] + >>> y = [4, 5, 6] + >>> np.cross(x, y) + array([12, -6, -3]) + + Both vectors with dimension 2. + + >>> x = [1,2] + >>> y = [4,5] + >>> np.cross(x, y) + array(-3) + + Multiple vector cross-products. Note that the direction of the cross + product vector is defined by the *right-hand rule*. + + >>> x = np.array([[1,2,3], [4,5,6]]) + >>> y = np.array([[4,5,6], [1,2,3]]) + >>> np.cross(x, y) + array([[-3, 6, -3], + [ 3, -6, 3]]) + + The orientation of `c` can be changed using the `axisc` keyword. + + >>> np.cross(x, y, axisc=0) + array([[-3, 3], + [ 6, -6], + [-3, 3]]) + + Change the vector definition of `x` and `y` using `axisa` and `axisb`. + + >>> x = np.array([[1,2,3], [4,5,6], [7, 8, 9]]) + >>> y = np.array([[7, 8, 9], [4,5,6], [1,2,3]]) + >>> np.cross(x, y) + array([[ -6, 12, -6], + [ 0, 0, 0], + [ 6, -12, 6]]) + >>> np.cross(x, y, axisa=0, axisb=0) + array([[-24, 48, -24], + [-30, 60, -30], + [-36, 72, -36]]) + + """ + if axis is not None: + axisa, axisb, axisc = (axis,) * 3 + a = asarray(a) + b = asarray(b) + # Check axisa and axisb are within bounds + axisa = normalize_axis_index(axisa, a.ndim, msg_prefix='axisa') + axisb = normalize_axis_index(axisb, b.ndim, msg_prefix='axisb') + + # Move working axis to the end of the shape + a = moveaxis(a, axisa, -1) + b = moveaxis(b, axisb, -1) + msg = ("incompatible dimensions for cross product\n" + "(dimension must be 2 or 3)") + if a.shape[-1] not in (2, 3) or b.shape[-1] not in (2, 3): + raise ValueError(msg) + + # Create the output array + shape = broadcast(a[..., 0], b[..., 0]).shape + if a.shape[-1] == 3 or b.shape[-1] == 3: + shape += (3,) + # Check axisc is within bounds + axisc = normalize_axis_index(axisc, len(shape), msg_prefix='axisc') + dtype = promote_types(a.dtype, b.dtype) + cp = empty(shape, dtype) + + # recast arrays as dtype + a = a.astype(dtype) + b = b.astype(dtype) + + # create local aliases for readability + a0 = a[..., 0] + a1 = a[..., 1] + if a.shape[-1] == 3: + a2 = a[..., 2] + b0 = b[..., 0] + b1 = b[..., 1] + if b.shape[-1] == 3: + b2 = b[..., 2] + if cp.ndim != 0 and cp.shape[-1] == 3: + cp0 = cp[..., 0] + cp1 = cp[..., 1] + cp2 = cp[..., 2] + + if a.shape[-1] == 2: + if b.shape[-1] == 2: + # a0 * b1 - a1 * b0 + multiply(a0, b1, out=cp) + cp -= a1 * b0 + return cp + else: + assert b.shape[-1] == 3 + # cp0 = a1 * b2 - 0 (a2 = 0) + # cp1 = 0 - a0 * b2 (a2 = 0) + # cp2 = a0 * b1 - a1 * b0 + multiply(a1, b2, out=cp0) + multiply(a0, b2, out=cp1) + negative(cp1, out=cp1) + multiply(a0, b1, out=cp2) + cp2 -= a1 * b0 + else: + assert a.shape[-1] == 3 + if b.shape[-1] == 3: + # cp0 = a1 * b2 - a2 * b1 + # cp1 = a2 * b0 - a0 * b2 + # cp2 = a0 * b1 - a1 * b0 + multiply(a1, b2, out=cp0) + tmp = array(a2 * b1) + cp0 -= tmp + multiply(a2, b0, out=cp1) + multiply(a0, b2, out=tmp) + cp1 -= tmp + multiply(a0, b1, out=cp2) + multiply(a1, b0, out=tmp) + cp2 -= tmp + else: + assert b.shape[-1] == 2 + # cp0 = 0 - a2 * b1 (b2 = 0) + # cp1 = a2 * b0 - 0 (b2 = 0) + # cp2 = a0 * b1 - a1 * b0 + multiply(a2, b1, out=cp0) + negative(cp0, out=cp0) + multiply(a2, b0, out=cp1) + multiply(a0, b1, out=cp2) + cp2 -= a1 * b0 + + return moveaxis(cp, -1, axisc) + + +little_endian = (sys.byteorder == 'little') + + +@set_module('numpy') +def indices(dimensions, dtype=int, sparse=False): + """ + Return an array representing the indices of a grid. + + Compute an array where the subarrays contain index values 0, 1, ... + varying only along the corresponding axis. + + Parameters + ---------- + dimensions : sequence of ints + The shape of the grid. + dtype : dtype, optional + Data type of the result. + sparse : boolean, optional + Return a sparse representation of the grid instead of a dense + representation. Default is False. + + .. versionadded:: 1.17 + + Returns + ------- + grid : one ndarray or tuple of ndarrays + If sparse is False: + Returns one array of grid indices, + ``grid.shape = (len(dimensions),) + tuple(dimensions)``. + If sparse is True: + Returns a tuple of arrays, with + ``grid[i].shape = (1, ..., 1, dimensions[i], 1, ..., 1)`` with + dimensions[i] in the ith place + + See Also + -------- + mgrid, ogrid, meshgrid + + Notes + ----- + The output shape in the dense case is obtained by prepending the number + of dimensions in front of the tuple of dimensions, i.e. if `dimensions` + is a tuple ``(r0, ..., rN-1)`` of length ``N``, the output shape is + ``(N, r0, ..., rN-1)``. + + The subarrays ``grid[k]`` contains the N-D array of indices along the + ``k-th`` axis. Explicitly:: + + grid[k, i0, i1, ..., iN-1] = ik + + Examples + -------- + >>> grid = np.indices((2, 3)) + >>> grid.shape + (2, 2, 3) + >>> grid[0] # row indices + array([[0, 0, 0], + [1, 1, 1]]) + >>> grid[1] # column indices + array([[0, 1, 2], + [0, 1, 2]]) + + The indices can be used as an index into an array. + + >>> x = np.arange(20).reshape(5, 4) + >>> row, col = np.indices((2, 3)) + >>> x[row, col] + array([[0, 1, 2], + [4, 5, 6]]) + + Note that it would be more straightforward in the above example to + extract the required elements directly with ``x[:2, :3]``. + + If sparse is set to true, the grid will be returned in a sparse + representation. + + >>> i, j = np.indices((2, 3), sparse=True) + >>> i.shape + (2, 1) + >>> j.shape + (1, 3) + >>> i # row indices + array([[0], + [1]]) + >>> j # column indices + array([[0, 1, 2]]) + + """ + dimensions = tuple(dimensions) + N = len(dimensions) + shape = (1,)*N + if sparse: + res = tuple() + else: + res = empty((N,)+dimensions, dtype=dtype) + for i, dim in enumerate(dimensions): + idx = arange(dim, dtype=dtype).reshape( + shape[:i] + (dim,) + shape[i+1:] + ) + if sparse: + res = res + (idx,) + else: + res[i] = idx + return res + + +@set_array_function_like_doc +@set_module('numpy') +def fromfunction(function, shape, *, dtype=float, like=None, **kwargs): + """ + Construct an array by executing a function over each coordinate. + + The resulting array therefore has a value ``fn(x, y, z)`` at + coordinate ``(x, y, z)``. + + Parameters + ---------- + function : callable + The function is called with N parameters, where N is the rank of + `shape`. Each parameter represents the coordinates of the array + varying along a specific axis. For example, if `shape` + were ``(2, 2)``, then the parameters would be + ``array([[0, 0], [1, 1]])`` and ``array([[0, 1], [0, 1]])`` + shape : (N,) tuple of ints + Shape of the output array, which also determines the shape of + the coordinate arrays passed to `function`. + dtype : data-type, optional + Data-type of the coordinate arrays passed to `function`. + By default, `dtype` is float. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + fromfunction : any + The result of the call to `function` is passed back directly. + Therefore the shape of `fromfunction` is completely determined by + `function`. If `function` returns a scalar value, the shape of + `fromfunction` would not match the `shape` parameter. + + See Also + -------- + indices, meshgrid + + Notes + ----- + Keywords other than `dtype` and `like` are passed to `function`. + + Examples + -------- + >>> np.fromfunction(lambda i, j: i, (2, 2), dtype=float) + array([[0., 0.], + [1., 1.]]) + + >>> np.fromfunction(lambda i, j: j, (2, 2), dtype=float) + array([[0., 1.], + [0., 1.]]) + + >>> np.fromfunction(lambda i, j: i == j, (3, 3), dtype=int) + array([[ True, False, False], + [False, True, False], + [False, False, True]]) + + >>> np.fromfunction(lambda i, j: i + j, (3, 3), dtype=int) + array([[0, 1, 2], + [1, 2, 3], + [2, 3, 4]]) + + """ + if like is not None: + return _fromfunction_with_like( + like, function, shape, dtype=dtype, **kwargs) + + args = indices(shape, dtype=dtype) + return function(*args, **kwargs) + + +_fromfunction_with_like = array_function_dispatch()(fromfunction) + + +def _frombuffer(buf, dtype, shape, order): + return frombuffer(buf, dtype=dtype).reshape(shape, order=order) + + +@set_module('numpy') +def isscalar(element): + """ + Returns True if the type of `element` is a scalar type. + + Parameters + ---------- + element : any + Input argument, can be of any type and shape. + + Returns + ------- + val : bool + True if `element` is a scalar type, False if it is not. + + See Also + -------- + ndim : Get the number of dimensions of an array + + Notes + ----- + If you need a stricter way to identify a *numerical* scalar, use + ``isinstance(x, numbers.Number)``, as that returns ``False`` for most + non-numerical elements such as strings. + + In most cases ``np.ndim(x) == 0`` should be used instead of this function, + as that will also return true for 0d arrays. This is how numpy overloads + functions in the style of the ``dx`` arguments to `gradient` and the ``bins`` + argument to `histogram`. Some key differences: + + +--------------------------------------+---------------+-------------------+ + | x |``isscalar(x)``|``np.ndim(x) == 0``| + +======================================+===============+===================+ + | PEP 3141 numeric objects (including | ``True`` | ``True`` | + | builtins) | | | + +--------------------------------------+---------------+-------------------+ + | builtin string and buffer objects | ``True`` | ``True`` | + +--------------------------------------+---------------+-------------------+ + | other builtin objects, like | ``False`` | ``True`` | + | `pathlib.Path`, `Exception`, | | | + | the result of `re.compile` | | | + +--------------------------------------+---------------+-------------------+ + | third-party objects like | ``False`` | ``True`` | + | `matplotlib.figure.Figure` | | | + +--------------------------------------+---------------+-------------------+ + | zero-dimensional numpy arrays | ``False`` | ``True`` | + +--------------------------------------+---------------+-------------------+ + | other numpy arrays | ``False`` | ``False`` | + +--------------------------------------+---------------+-------------------+ + | `list`, `tuple`, and other sequence | ``False`` | ``False`` | + | objects | | | + +--------------------------------------+---------------+-------------------+ + + Examples + -------- + >>> np.isscalar(3.1) + True + >>> np.isscalar(np.array(3.1)) + False + >>> np.isscalar([3.1]) + False + >>> np.isscalar(False) + True + >>> np.isscalar('numpy') + True + + NumPy supports PEP 3141 numbers: + + >>> from fractions import Fraction + >>> np.isscalar(Fraction(5, 17)) + True + >>> from numbers import Number + >>> np.isscalar(Number()) + True + + """ + return (isinstance(element, generic) + or type(element) in ScalarType + or isinstance(element, numbers.Number)) + + +@set_module('numpy') +def binary_repr(num, width=None): + """ + Return the binary representation of the input number as a string. + + For negative numbers, if width is not given, a minus sign is added to the + front. If width is given, the two's complement of the number is + returned, with respect to that width. + + In a two's-complement system negative numbers are represented by the two's + complement of the absolute value. This is the most common method of + representing signed integers on computers [1]_. A N-bit two's-complement + system can represent every integer in the range + :math:`-2^{N-1}` to :math:`+2^{N-1}-1`. + + Parameters + ---------- + num : int + Only an integer decimal number can be used. + width : int, optional + The length of the returned string if `num` is positive, or the length + of the two's complement if `num` is negative, provided that `width` is + at least a sufficient number of bits for `num` to be represented in the + designated form. + + If the `width` value is insufficient, it will be ignored, and `num` will + be returned in binary (`num` > 0) or two's complement (`num` < 0) form + with its width equal to the minimum number of bits needed to represent + the number in the designated form. This behavior is deprecated and will + later raise an error. + + .. deprecated:: 1.12.0 + + Returns + ------- + bin : str + Binary representation of `num` or two's complement of `num`. + + See Also + -------- + base_repr: Return a string representation of a number in the given base + system. + bin: Python's built-in binary representation generator of an integer. + + Notes + ----- + `binary_repr` is equivalent to using `base_repr` with base 2, but about 25x + faster. + + References + ---------- + .. [1] Wikipedia, "Two's complement", + https://en.wikipedia.org/wiki/Two's_complement + + Examples + -------- + >>> np.binary_repr(3) + '11' + >>> np.binary_repr(-3) + '-11' + >>> np.binary_repr(3, width=4) + '0011' + + The two's complement is returned when the input number is negative and + width is specified: + + >>> np.binary_repr(-3, width=3) + '101' + >>> np.binary_repr(-3, width=5) + '11101' + + """ + def warn_if_insufficient(width, binwidth): + if width is not None and width < binwidth: + warnings.warn( + "Insufficient bit width provided. This behavior " + "will raise an error in the future.", DeprecationWarning, + stacklevel=3) + + # Ensure that num is a Python integer to avoid overflow or unwanted + # casts to floating point. + num = operator.index(num) + + if num == 0: + return '0' * (width or 1) + + elif num > 0: + binary = bin(num)[2:] + binwidth = len(binary) + outwidth = (binwidth if width is None + else builtins.max(binwidth, width)) + warn_if_insufficient(width, binwidth) + return binary.zfill(outwidth) + + else: + if width is None: + return '-' + bin(-num)[2:] + + else: + poswidth = len(bin(-num)[2:]) + + # See gh-8679: remove extra digit + # for numbers at boundaries. + if 2**(poswidth - 1) == -num: + poswidth -= 1 + + twocomp = 2**(poswidth + 1) + num + binary = bin(twocomp)[2:] + binwidth = len(binary) + + outwidth = builtins.max(binwidth, width) + warn_if_insufficient(width, binwidth) + return '1' * (outwidth - binwidth) + binary + + +@set_module('numpy') +def base_repr(number, base=2, padding=0): + """ + Return a string representation of a number in the given base system. + + Parameters + ---------- + number : int + The value to convert. Positive and negative values are handled. + base : int, optional + Convert `number` to the `base` number system. The valid range is 2-36, + the default value is 2. + padding : int, optional + Number of zeros padded on the left. Default is 0 (no padding). + + Returns + ------- + out : str + String representation of `number` in `base` system. + + See Also + -------- + binary_repr : Faster version of `base_repr` for base 2. + + Examples + -------- + >>> np.base_repr(5) + '101' + >>> np.base_repr(6, 5) + '11' + >>> np.base_repr(7, base=5, padding=3) + '00012' + + >>> np.base_repr(10, base=16) + 'A' + >>> np.base_repr(32, base=16) + '20' + + """ + digits = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ' + if base > len(digits): + raise ValueError("Bases greater than 36 not handled in base_repr.") + elif base < 2: + raise ValueError("Bases less than 2 not handled in base_repr.") + + num = abs(number) + res = [] + while num: + res.append(digits[num % base]) + num //= base + if padding: + res.append('0' * padding) + if number < 0: + res.append('-') + return ''.join(reversed(res or '0')) + + +# These are all essentially abbreviations +# These might wind up in a special abbreviations module + + +def _maketup(descr, val): + dt = dtype(descr) + # Place val in all scalar tuples: + fields = dt.fields + if fields is None: + return val + else: + res = [_maketup(fields[name][0], val) for name in dt.names] + return tuple(res) + + +@set_array_function_like_doc +@set_module('numpy') +def identity(n, dtype=None, *, like=None): + """ + Return the identity array. + + The identity array is a square array with ones on + the main diagonal. + + Parameters + ---------- + n : int + Number of rows (and columns) in `n` x `n` output. + dtype : data-type, optional + Data-type of the output. Defaults to ``float``. + ${ARRAY_FUNCTION_LIKE} + + .. versionadded:: 1.20.0 + + Returns + ------- + out : ndarray + `n` x `n` array with its main diagonal set to one, + and all other elements 0. + + Examples + -------- + >>> np.identity(3) + array([[1., 0., 0.], + [0., 1., 0.], + [0., 0., 1.]]) + + """ + if like is not None: + return _identity_with_like(like, n, dtype=dtype) + + from numpy import eye + return eye(n, dtype=dtype, like=like) + + +_identity_with_like = array_function_dispatch()(identity) + + +def _allclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None): + return (a, b) + + +@array_function_dispatch(_allclose_dispatcher) +def allclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): + """ + Returns True if two arrays are element-wise equal within a tolerance. + + The tolerance values are positive, typically very small numbers. The + relative difference (`rtol` * abs(`b`)) and the absolute difference + `atol` are added together to compare against the absolute difference + between `a` and `b`. + + NaNs are treated as equal if they are in the same place and if + ``equal_nan=True``. Infs are treated as equal if they are in the same + place and of the same sign in both arrays. + + Parameters + ---------- + a, b : array_like + Input arrays to compare. + rtol : float + The relative tolerance parameter (see Notes). + atol : float + The absolute tolerance parameter (see Notes). + equal_nan : bool + Whether to compare NaN's as equal. If True, NaN's in `a` will be + considered equal to NaN's in `b` in the output array. + + .. versionadded:: 1.10.0 + + Returns + ------- + allclose : bool + Returns True if the two arrays are equal within the given + tolerance; False otherwise. + + See Also + -------- + isclose, all, any, equal + + Notes + ----- + If the following equation is element-wise True, then allclose returns + True. + + absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`)) + + The above equation is not symmetric in `a` and `b`, so that + ``allclose(a, b)`` might be different from ``allclose(b, a)`` in + some rare cases. + + The comparison of `a` and `b` uses standard broadcasting, which + means that `a` and `b` need not have the same shape in order for + ``allclose(a, b)`` to evaluate to True. The same is true for + `equal` but not `array_equal`. + + `allclose` is not defined for non-numeric data types. + `bool` is considered a numeric data-type for this purpose. + + Examples + -------- + >>> np.allclose([1e10,1e-7], [1.00001e10,1e-8]) + False + >>> np.allclose([1e10,1e-8], [1.00001e10,1e-9]) + True + >>> np.allclose([1e10,1e-8], [1.0001e10,1e-9]) + False + >>> np.allclose([1.0, np.nan], [1.0, np.nan]) + False + >>> np.allclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) + True + + """ + res = all(isclose(a, b, rtol=rtol, atol=atol, equal_nan=equal_nan)) + return bool(res) + + +def _isclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None): + return (a, b) + + +@array_function_dispatch(_isclose_dispatcher) +def isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False): + """ + Returns a boolean array where two arrays are element-wise equal within a + tolerance. + + The tolerance values are positive, typically very small numbers. The + relative difference (`rtol` * abs(`b`)) and the absolute difference + `atol` are added together to compare against the absolute difference + between `a` and `b`. + + .. warning:: The default `atol` is not appropriate for comparing numbers + that are much smaller than one (see Notes). + + Parameters + ---------- + a, b : array_like + Input arrays to compare. + rtol : float + The relative tolerance parameter (see Notes). + atol : float + The absolute tolerance parameter (see Notes). + equal_nan : bool + Whether to compare NaN's as equal. If True, NaN's in `a` will be + considered equal to NaN's in `b` in the output array. + + Returns + ------- + y : array_like + Returns a boolean array of where `a` and `b` are equal within the + given tolerance. If both `a` and `b` are scalars, returns a single + boolean value. + + See Also + -------- + allclose + math.isclose + + Notes + ----- + .. versionadded:: 1.7.0 + + For finite values, isclose uses the following equation to test whether + two floating point values are equivalent. + + absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`)) + + Unlike the built-in `math.isclose`, the above equation is not symmetric + in `a` and `b` -- it assumes `b` is the reference value -- so that + `isclose(a, b)` might be different from `isclose(b, a)`. Furthermore, + the default value of atol is not zero, and is used to determine what + small values should be considered close to zero. The default value is + appropriate for expected values of order unity: if the expected values + are significantly smaller than one, it can result in false positives. + `atol` should be carefully selected for the use case at hand. A zero value + for `atol` will result in `False` if either `a` or `b` is zero. + + `isclose` is not defined for non-numeric data types. + `bool` is considered a numeric data-type for this purpose. + + Examples + -------- + >>> np.isclose([1e10,1e-7], [1.00001e10,1e-8]) + array([ True, False]) + >>> np.isclose([1e10,1e-8], [1.00001e10,1e-9]) + array([ True, True]) + >>> np.isclose([1e10,1e-8], [1.0001e10,1e-9]) + array([False, True]) + >>> np.isclose([1.0, np.nan], [1.0, np.nan]) + array([ True, False]) + >>> np.isclose([1.0, np.nan], [1.0, np.nan], equal_nan=True) + array([ True, True]) + >>> np.isclose([1e-8, 1e-7], [0.0, 0.0]) + array([ True, False]) + >>> np.isclose([1e-100, 1e-7], [0.0, 0.0], atol=0.0) + array([False, False]) + >>> np.isclose([1e-10, 1e-10], [1e-20, 0.0]) + array([ True, True]) + >>> np.isclose([1e-10, 1e-10], [1e-20, 0.999999e-10], atol=0.0) + array([False, True]) + """ + def within_tol(x, y, atol, rtol): + with errstate(invalid='ignore'), _no_nep50_warning(): + return less_equal(abs(x-y), atol + rtol * abs(y)) + + x = asanyarray(a) + y = asanyarray(b) + + # Make sure y is an inexact type to avoid bad behavior on abs(MIN_INT). + # This will cause casting of x later. Also, make sure to allow subclasses + # (e.g., for numpy.ma). + # NOTE: We explicitly allow timedelta, which used to work. This could + # possibly be deprecated. See also gh-18286. + # timedelta works if `atol` is an integer or also a timedelta. + # Although, the default tolerances are unlikely to be useful + if y.dtype.kind != "m": + dt = multiarray.result_type(y, 1.) + y = asanyarray(y, dtype=dt) + + xfin = isfinite(x) + yfin = isfinite(y) + if all(xfin) and all(yfin): + return within_tol(x, y, atol, rtol) + else: + finite = xfin & yfin + cond = zeros_like(finite, subok=True) + # Because we're using boolean indexing, x & y must be the same shape. + # Ideally, we'd just do x, y = broadcast_arrays(x, y). It's in + # lib.stride_tricks, though, so we can't import it here. + x = x * ones_like(cond) + y = y * ones_like(cond) + # Avoid subtraction with infinite/nan values... + cond[finite] = within_tol(x[finite], y[finite], atol, rtol) + # Check for equality of infinite values... + cond[~finite] = (x[~finite] == y[~finite]) + if equal_nan: + # Make NaN == NaN + both_nan = isnan(x) & isnan(y) + + # Needed to treat masked arrays correctly. = True would not work. + cond[both_nan] = both_nan[both_nan] + + return cond[()] # Flatten 0d arrays to scalars + + +def _array_equal_dispatcher(a1, a2, equal_nan=None): + return (a1, a2) + + +@array_function_dispatch(_array_equal_dispatcher) +def array_equal(a1, a2, equal_nan=False): + """ + True if two arrays have the same shape and elements, False otherwise. + + Parameters + ---------- + a1, a2 : array_like + Input arrays. + equal_nan : bool + Whether to compare NaN's as equal. If the dtype of a1 and a2 is + complex, values will be considered equal if either the real or the + imaginary component of a given value is ``nan``. + + .. versionadded:: 1.19.0 + + Returns + ------- + b : bool + Returns True if the arrays are equal. + + See Also + -------- + allclose: Returns True if two arrays are element-wise equal within a + tolerance. + array_equiv: Returns True if input arrays are shape consistent and all + elements equal. + + Examples + -------- + >>> np.array_equal([1, 2], [1, 2]) + True + >>> np.array_equal(np.array([1, 2]), np.array([1, 2])) + True + >>> np.array_equal([1, 2], [1, 2, 3]) + False + >>> np.array_equal([1, 2], [1, 4]) + False + >>> a = np.array([1, np.nan]) + >>> np.array_equal(a, a) + False + >>> np.array_equal(a, a, equal_nan=True) + True + + When ``equal_nan`` is True, complex values with nan components are + considered equal if either the real *or* the imaginary components are nan. + + >>> a = np.array([1 + 1j]) + >>> b = a.copy() + >>> a.real = np.nan + >>> b.imag = np.nan + >>> np.array_equal(a, b, equal_nan=True) + True + """ + try: + a1, a2 = asarray(a1), asarray(a2) + except Exception: + return False + if a1.shape != a2.shape: + return False + if not equal_nan: + return bool(asarray(a1 == a2).all()) + # Handling NaN values if equal_nan is True + a1nan, a2nan = isnan(a1), isnan(a2) + # NaN's occur at different locations + if not (a1nan == a2nan).all(): + return False + # Shapes of a1, a2 and masks are guaranteed to be consistent by this point + return bool(asarray(a1[~a1nan] == a2[~a1nan]).all()) + + +def _array_equiv_dispatcher(a1, a2): + return (a1, a2) + + +@array_function_dispatch(_array_equiv_dispatcher) +def array_equiv(a1, a2): + """ + Returns True if input arrays are shape consistent and all elements equal. + + Shape consistent means they are either the same shape, or one input array + can be broadcasted to create the same shape as the other one. + + Parameters + ---------- + a1, a2 : array_like + Input arrays. + + Returns + ------- + out : bool + True if equivalent, False otherwise. + + Examples + -------- + >>> np.array_equiv([1, 2], [1, 2]) + True + >>> np.array_equiv([1, 2], [1, 3]) + False + + Showing the shape equivalence: + + >>> np.array_equiv([1, 2], [[1, 2], [1, 2]]) + True + >>> np.array_equiv([1, 2], [[1, 2, 1, 2], [1, 2, 1, 2]]) + False + + >>> np.array_equiv([1, 2], [[1, 2], [1, 3]]) + False + + """ + try: + a1, a2 = asarray(a1), asarray(a2) + except Exception: + return False + try: + multiarray.broadcast(a1, a2) + except Exception: + return False + + return bool(asarray(a1 == a2).all()) + + +Inf = inf = infty = Infinity = PINF +nan = NaN = NAN +False_ = bool_(False) +True_ = bool_(True) + + +def extend_all(module): + existing = set(__all__) + mall = getattr(module, '__all__') + for a in mall: + if a not in existing: + __all__.append(a) + + +from .umath import * +from .numerictypes import * +from . import fromnumeric +from .fromnumeric import * +from . import arrayprint +from .arrayprint import * +from . import _asarray +from ._asarray import * +from . import _ufunc_config +from ._ufunc_config import * +extend_all(fromnumeric) +extend_all(umath) +extend_all(numerictypes) +extend_all(arrayprint) +extend_all(_asarray) +extend_all(_ufunc_config) diff --git a/pllava/lib/python3.10/site-packages/numpy/core/overrides.py b/pllava/lib/python3.10/site-packages/numpy/core/overrides.py new file mode 100644 index 0000000000000000000000000000000000000000..6403e65b02b8a34fe49717ca3d4e9a592082f68d --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/overrides.py @@ -0,0 +1,181 @@ +"""Implementation of __array_function__ overrides from NEP-18.""" +import collections +import functools +import os + +from .._utils import set_module +from .._utils._inspect import getargspec +from numpy.core._multiarray_umath import ( + add_docstring, _get_implementing_args, _ArrayFunctionDispatcher) + + +ARRAY_FUNCTIONS = set() + +array_function_like_doc = ( + """like : array_like, optional + Reference object to allow the creation of arrays which are not + NumPy arrays. If an array-like passed in as ``like`` supports + the ``__array_function__`` protocol, the result will be defined + by it. In this case, it ensures the creation of an array object + compatible with that passed in via this argument.""" +) + +def set_array_function_like_doc(public_api): + if public_api.__doc__ is not None: + public_api.__doc__ = public_api.__doc__.replace( + "${ARRAY_FUNCTION_LIKE}", + array_function_like_doc, + ) + return public_api + + +add_docstring( + _ArrayFunctionDispatcher, + """ + Class to wrap functions with checks for __array_function__ overrides. + + All arguments are required, and can only be passed by position. + + Parameters + ---------- + dispatcher : function or None + The dispatcher function that returns a single sequence-like object + of all arguments relevant. It must have the same signature (except + the default values) as the actual implementation. + If ``None``, this is a ``like=`` dispatcher and the + ``_ArrayFunctionDispatcher`` must be called with ``like`` as the + first (additional and positional) argument. + implementation : function + Function that implements the operation on NumPy arrays without + overrides. Arguments passed calling the ``_ArrayFunctionDispatcher`` + will be forwarded to this (and the ``dispatcher``) as if using + ``*args, **kwargs``. + + Attributes + ---------- + _implementation : function + The original implementation passed in. + """) + + +# exposed for testing purposes; used internally by _ArrayFunctionDispatcher +add_docstring( + _get_implementing_args, + """ + Collect arguments on which to call __array_function__. + + Parameters + ---------- + relevant_args : iterable of array-like + Iterable of possibly array-like arguments to check for + __array_function__ methods. + + Returns + ------- + Sequence of arguments with __array_function__ methods, in the order in + which they should be called. + """) + + +ArgSpec = collections.namedtuple('ArgSpec', 'args varargs keywords defaults') + + +def verify_matching_signatures(implementation, dispatcher): + """Verify that a dispatcher function has the right signature.""" + implementation_spec = ArgSpec(*getargspec(implementation)) + dispatcher_spec = ArgSpec(*getargspec(dispatcher)) + + if (implementation_spec.args != dispatcher_spec.args or + implementation_spec.varargs != dispatcher_spec.varargs or + implementation_spec.keywords != dispatcher_spec.keywords or + (bool(implementation_spec.defaults) != + bool(dispatcher_spec.defaults)) or + (implementation_spec.defaults is not None and + len(implementation_spec.defaults) != + len(dispatcher_spec.defaults))): + raise RuntimeError('implementation and dispatcher for %s have ' + 'different function signatures' % implementation) + + if implementation_spec.defaults is not None: + if dispatcher_spec.defaults != (None,) * len(dispatcher_spec.defaults): + raise RuntimeError('dispatcher functions can only use None for ' + 'default argument values') + + +def array_function_dispatch(dispatcher=None, module=None, verify=True, + docs_from_dispatcher=False): + """Decorator for adding dispatch with the __array_function__ protocol. + + See NEP-18 for example usage. + + Parameters + ---------- + dispatcher : callable or None + Function that when called like ``dispatcher(*args, **kwargs)`` with + arguments from the NumPy function call returns an iterable of + array-like arguments to check for ``__array_function__``. + + If `None`, the first argument is used as the single `like=` argument + and not passed on. A function implementing `like=` must call its + dispatcher with `like` as the first non-keyword argument. + module : str, optional + __module__ attribute to set on new function, e.g., ``module='numpy'``. + By default, module is copied from the decorated function. + verify : bool, optional + If True, verify the that the signature of the dispatcher and decorated + function signatures match exactly: all required and optional arguments + should appear in order with the same names, but the default values for + all optional arguments should be ``None``. Only disable verification + if the dispatcher's signature needs to deviate for some particular + reason, e.g., because the function has a signature like + ``func(*args, **kwargs)``. + docs_from_dispatcher : bool, optional + If True, copy docs from the dispatcher function onto the dispatched + function, rather than from the implementation. This is useful for + functions defined in C, which otherwise don't have docstrings. + + Returns + ------- + Function suitable for decorating the implementation of a NumPy function. + + """ + def decorator(implementation): + if verify: + if dispatcher is not None: + verify_matching_signatures(implementation, dispatcher) + else: + # Using __code__ directly similar to verify_matching_signature + co = implementation.__code__ + last_arg = co.co_argcount + co.co_kwonlyargcount - 1 + last_arg = co.co_varnames[last_arg] + if last_arg != "like" or co.co_kwonlyargcount == 0: + raise RuntimeError( + "__array_function__ expects `like=` to be the last " + "argument and a keyword-only argument. " + f"{implementation} does not seem to comply.") + + if docs_from_dispatcher: + add_docstring(implementation, dispatcher.__doc__) + + public_api = _ArrayFunctionDispatcher(dispatcher, implementation) + public_api = functools.wraps(implementation)(public_api) + + if module is not None: + public_api.__module__ = module + + ARRAY_FUNCTIONS.add(public_api) + + return public_api + + return decorator + + +def array_function_from_dispatcher( + implementation, module=None, verify=True, docs_from_dispatcher=True): + """Like array_function_dispatcher, but with function arguments flipped.""" + + def decorator(dispatcher): + return array_function_dispatch( + dispatcher, module, verify=verify, + docs_from_dispatcher=docs_from_dispatcher)(implementation) + return decorator diff --git a/pllava/lib/python3.10/site-packages/numpy/core/records.py b/pllava/lib/python3.10/site-packages/numpy/core/records.py new file mode 100644 index 0000000000000000000000000000000000000000..0fb49e8f70f122e578649ea7fe38d96e30e59802 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/records.py @@ -0,0 +1,1099 @@ +""" +Record Arrays +============= +Record arrays expose the fields of structured arrays as properties. + +Most commonly, ndarrays contain elements of a single type, e.g. floats, +integers, bools etc. However, it is possible for elements to be combinations +of these using structured types, such as:: + + >>> a = np.array([(1, 2.0), (1, 2.0)], dtype=[('x', np.int64), ('y', np.float64)]) + >>> a + array([(1, 2.), (1, 2.)], dtype=[('x', '>> a['x'] + array([1, 1]) + + >>> a['y'] + array([2., 2.]) + +Record arrays allow us to access fields as properties:: + + >>> ar = np.rec.array(a) + + >>> ar.x + array([1, 1]) + + >>> ar.y + array([2., 2.]) + +""" +import warnings +from collections import Counter +from contextlib import nullcontext + +from .._utils import set_module +from . import numeric as sb +from . import numerictypes as nt +from numpy.compat import os_fspath +from .arrayprint import _get_legacy_print_mode + +# All of the functions allow formats to be a dtype +__all__ = [ + 'record', 'recarray', 'format_parser', + 'fromarrays', 'fromrecords', 'fromstring', 'fromfile', 'array', +] + + +ndarray = sb.ndarray + +_byteorderconv = {'b':'>', + 'l':'<', + 'n':'=', + 'B':'>', + 'L':'<', + 'N':'=', + 'S':'s', + 's':'s', + '>':'>', + '<':'<', + '=':'=', + '|':'|', + 'I':'|', + 'i':'|'} + +# formats regular expression +# allows multidimensional spec with a tuple syntax in front +# of the letter code '(2,3)f4' and ' ( 2 , 3 ) f4 ' +# are equally allowed + +numfmt = nt.sctypeDict + + +def find_duplicate(list): + """Find duplication in a list, return a list of duplicated elements""" + return [ + item + for item, counts in Counter(list).items() + if counts > 1 + ] + + +@set_module('numpy') +class format_parser: + """ + Class to convert formats, names, titles description to a dtype. + + After constructing the format_parser object, the dtype attribute is + the converted data-type: + ``dtype = format_parser(formats, names, titles).dtype`` + + Attributes + ---------- + dtype : dtype + The converted data-type. + + Parameters + ---------- + formats : str or list of str + The format description, either specified as a string with + comma-separated format descriptions in the form ``'f8, i4, a5'``, or + a list of format description strings in the form + ``['f8', 'i4', 'a5']``. + names : str or list/tuple of str + The field names, either specified as a comma-separated string in the + form ``'col1, col2, col3'``, or as a list or tuple of strings in the + form ``['col1', 'col2', 'col3']``. + An empty list can be used, in that case default field names + ('f0', 'f1', ...) are used. + titles : sequence + Sequence of title strings. An empty list can be used to leave titles + out. + aligned : bool, optional + If True, align the fields by padding as the C-compiler would. + Default is False. + byteorder : str, optional + If specified, all the fields will be changed to the + provided byte-order. Otherwise, the default byte-order is + used. For all available string specifiers, see `dtype.newbyteorder`. + + See Also + -------- + dtype, typename, sctype2char + + Examples + -------- + >>> np.format_parser(['>> np.format_parser(['f8', 'i4', 'a5'], ['col1', 'col2', 'col3'], + ... []).dtype + dtype([('col1', '>> np.format_parser([' len(titles): + self._titles += [None] * (self._nfields - len(titles)) + + def _createdtype(self, byteorder): + dtype = sb.dtype({ + 'names': self._names, + 'formats': self._f_formats, + 'offsets': self._offsets, + 'titles': self._titles, + }) + if byteorder is not None: + byteorder = _byteorderconv[byteorder[0]] + dtype = dtype.newbyteorder(byteorder) + + self.dtype = dtype + + +class record(nt.void): + """A data-type scalar that allows field access as attribute lookup. + """ + + # manually set name and module so that this class's type shows up + # as numpy.record when printed + __name__ = 'record' + __module__ = 'numpy' + + def __repr__(self): + if _get_legacy_print_mode() <= 113: + return self.__str__() + return super().__repr__() + + def __str__(self): + if _get_legacy_print_mode() <= 113: + return str(self.item()) + return super().__str__() + + def __getattribute__(self, attr): + if attr in ('setfield', 'getfield', 'dtype'): + return nt.void.__getattribute__(self, attr) + try: + return nt.void.__getattribute__(self, attr) + except AttributeError: + pass + fielddict = nt.void.__getattribute__(self, 'dtype').fields + res = fielddict.get(attr, None) + if res: + obj = self.getfield(*res[:2]) + # if it has fields return a record, + # otherwise return the object + try: + dt = obj.dtype + except AttributeError: + #happens if field is Object type + return obj + if dt.names is not None: + return obj.view((self.__class__, obj.dtype)) + return obj + else: + raise AttributeError("'record' object has no " + "attribute '%s'" % attr) + + def __setattr__(self, attr, val): + if attr in ('setfield', 'getfield', 'dtype'): + raise AttributeError("Cannot set '%s' attribute" % attr) + fielddict = nt.void.__getattribute__(self, 'dtype').fields + res = fielddict.get(attr, None) + if res: + return self.setfield(val, *res[:2]) + else: + if getattr(self, attr, None): + return nt.void.__setattr__(self, attr, val) + else: + raise AttributeError("'record' object has no " + "attribute '%s'" % attr) + + def __getitem__(self, indx): + obj = nt.void.__getitem__(self, indx) + + # copy behavior of record.__getattribute__, + if isinstance(obj, nt.void) and obj.dtype.names is not None: + return obj.view((self.__class__, obj.dtype)) + else: + # return a single element + return obj + + def pprint(self): + """Pretty-print all fields.""" + # pretty-print all fields + names = self.dtype.names + maxlen = max(len(name) for name in names) + fmt = '%% %ds: %%s' % maxlen + rows = [fmt % (name, getattr(self, name)) for name in names] + return "\n".join(rows) + +# The recarray is almost identical to a standard array (which supports +# named fields already) The biggest difference is that it can use +# attribute-lookup to find the fields and it is constructed using +# a record. + +# If byteorder is given it forces a particular byteorder on all +# the fields (and any subfields) + +class recarray(ndarray): + """Construct an ndarray that allows field access using attributes. + + Arrays may have a data-types containing fields, analogous + to columns in a spread sheet. An example is ``[(x, int), (y, float)]``, + where each entry in the array is a pair of ``(int, float)``. Normally, + these attributes are accessed using dictionary lookups such as ``arr['x']`` + and ``arr['y']``. Record arrays allow the fields to be accessed as members + of the array, using ``arr.x`` and ``arr.y``. + + Parameters + ---------- + shape : tuple + Shape of output array. + dtype : data-type, optional + The desired data-type. By default, the data-type is determined + from `formats`, `names`, `titles`, `aligned` and `byteorder`. + formats : list of data-types, optional + A list containing the data-types for the different columns, e.g. + ``['i4', 'f8', 'i4']``. `formats` does *not* support the new + convention of using types directly, i.e. ``(int, float, int)``. + Note that `formats` must be a list, not a tuple. + Given that `formats` is somewhat limited, we recommend specifying + `dtype` instead. + names : tuple of str, optional + The name of each column, e.g. ``('x', 'y', 'z')``. + buf : buffer, optional + By default, a new array is created of the given shape and data-type. + If `buf` is specified and is an object exposing the buffer interface, + the array will use the memory from the existing buffer. In this case, + the `offset` and `strides` keywords are available. + + Other Parameters + ---------------- + titles : tuple of str, optional + Aliases for column names. For example, if `names` were + ``('x', 'y', 'z')`` and `titles` is + ``('x_coordinate', 'y_coordinate', 'z_coordinate')``, then + ``arr['x']`` is equivalent to both ``arr.x`` and ``arr.x_coordinate``. + byteorder : {'<', '>', '='}, optional + Byte-order for all fields. + aligned : bool, optional + Align the fields in memory as the C-compiler would. + strides : tuple of ints, optional + Buffer (`buf`) is interpreted according to these strides (strides + define how many bytes each array element, row, column, etc. + occupy in memory). + offset : int, optional + Start reading buffer (`buf`) from this offset onwards. + order : {'C', 'F'}, optional + Row-major (C-style) or column-major (Fortran-style) order. + + Returns + ------- + rec : recarray + Empty array of the given shape and type. + + See Also + -------- + core.records.fromrecords : Construct a record array from data. + record : fundamental data-type for `recarray`. + format_parser : determine a data-type from formats, names, titles. + + Notes + ----- + This constructor can be compared to ``empty``: it creates a new record + array but does not fill it with data. To create a record array from data, + use one of the following methods: + + 1. Create a standard ndarray and convert it to a record array, + using ``arr.view(np.recarray)`` + 2. Use the `buf` keyword. + 3. Use `np.rec.fromrecords`. + + Examples + -------- + Create an array with two fields, ``x`` and ``y``: + + >>> x = np.array([(1.0, 2), (3.0, 4)], dtype=[('x', '>> x + array([(1., 2), (3., 4)], dtype=[('x', '>> x['x'] + array([1., 3.]) + + View the array as a record array: + + >>> x = x.view(np.recarray) + + >>> x.x + array([1., 3.]) + + >>> x.y + array([2, 4]) + + Create a new, empty record array: + + >>> np.recarray((2,), + ... dtype=[('x', int), ('y', float), ('z', int)]) #doctest: +SKIP + rec.array([(-1073741821, 1.2249118382103472e-301, 24547520), + (3471280, 1.2134086255804012e-316, 0)], + dtype=[('x', ' 0 or self.shape == (0,): + lst = sb.array2string( + self, separator=', ', prefix=prefix, suffix=',') + else: + # show zero-length shape unless it is (0,) + lst = "[], shape=%s" % (repr(self.shape),) + + lf = '\n'+' '*len(prefix) + if _get_legacy_print_mode() <= 113: + lf = ' ' + lf # trailing space + return fmt % (lst, lf, repr_dtype) + + def field(self, attr, val=None): + if isinstance(attr, int): + names = ndarray.__getattribute__(self, 'dtype').names + attr = names[attr] + + fielddict = ndarray.__getattribute__(self, 'dtype').fields + + res = fielddict[attr][:2] + + if val is None: + obj = self.getfield(*res) + if obj.dtype.names is not None: + return obj + return obj.view(ndarray) + else: + return self.setfield(val, *res) + + +def _deprecate_shape_0_as_None(shape): + if shape == 0: + warnings.warn( + "Passing `shape=0` to have the shape be inferred is deprecated, " + "and in future will be equivalent to `shape=(0,)`. To infer " + "the shape and suppress this warning, pass `shape=None` instead.", + FutureWarning, stacklevel=3) + return None + else: + return shape + + +@set_module("numpy.rec") +def fromarrays(arrayList, dtype=None, shape=None, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + """Create a record array from a (flat) list of arrays + + Parameters + ---------- + arrayList : list or tuple + List of array-like objects (such as lists, tuples, + and ndarrays). + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + Shape of the resulting array. If not provided, inferred from + ``arrayList[0]``. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + + Returns + ------- + np.recarray + Record array consisting of given arrayList columns. + + Examples + -------- + >>> x1=np.array([1,2,3,4]) + >>> x2=np.array(['a','dd','xyz','12']) + >>> x3=np.array([1.1,2,3,4]) + >>> r = np.core.records.fromarrays([x1,x2,x3],names='a,b,c') + >>> print(r[1]) + (2, 'dd', 2.0) # may vary + >>> x1[1]=34 + >>> r.a + array([1, 2, 3, 4]) + + >>> x1 = np.array([1, 2, 3, 4]) + >>> x2 = np.array(['a', 'dd', 'xyz', '12']) + >>> x3 = np.array([1.1, 2, 3,4]) + >>> r = np.core.records.fromarrays( + ... [x1, x2, x3], + ... dtype=np.dtype([('a', np.int32), ('b', 'S3'), ('c', np.float32)])) + >>> r + rec.array([(1, b'a', 1.1), (2, b'dd', 2. ), (3, b'xyz', 3. ), + (4, b'12', 4. )], + dtype=[('a', ' 0: + shape = shape[:-nn] + + _array = recarray(shape, descr) + + # populate the record array (makes a copy) + for k, obj in enumerate(arrayList): + nn = descr[k].ndim + testshape = obj.shape[:obj.ndim - nn] + name = _names[k] + if testshape != shape: + raise ValueError(f'array-shape mismatch in array {k} ("{name}")') + + _array[name] = obj + + return _array + + +@set_module("numpy.rec") +def fromrecords(recList, dtype=None, shape=None, formats=None, names=None, + titles=None, aligned=False, byteorder=None): + """Create a recarray from a list of records in text form. + + Parameters + ---------- + recList : sequence + data in the same field may be heterogeneous - they will be promoted + to the highest data type. + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + shape of each array. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + + If both `formats` and `dtype` are None, then this will auto-detect + formats. Use list of tuples rather than list of lists for faster + processing. + + Returns + ------- + np.recarray + record array consisting of given recList rows. + + Examples + -------- + >>> r=np.core.records.fromrecords([(456,'dbe',1.2),(2,'de',1.3)], + ... names='col1,col2,col3') + >>> print(r[0]) + (456, 'dbe', 1.2) + >>> r.col1 + array([456, 2]) + >>> r.col2 + array(['dbe', 'de'], dtype='>> import pickle + >>> pickle.loads(pickle.dumps(r)) + rec.array([(456, 'dbe', 1.2), ( 2, 'de', 1.3)], + dtype=[('col1', ' 1: + raise ValueError("Can only deal with 1-d array.") + _array = recarray(shape, descr) + for k in range(_array.size): + _array[k] = tuple(recList[k]) + # list of lists instead of list of tuples ? + # 2018-02-07, 1.14.1 + warnings.warn( + "fromrecords expected a list of tuples, may have received a list " + "of lists instead. In the future that will raise an error", + FutureWarning, stacklevel=2) + return _array + else: + if shape is not None and retval.shape != shape: + retval.shape = shape + + res = retval.view(recarray) + + return res + + +@set_module("numpy.rec") +def fromstring(datastring, dtype=None, shape=None, offset=0, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + r"""Create a record array from binary data + + Note that despite the name of this function it does not accept `str` + instances. + + Parameters + ---------- + datastring : bytes-like + Buffer of binary data + dtype : data-type, optional + Valid dtype for all arrays + shape : int or tuple of ints, optional + Shape of each array. + offset : int, optional + Position in the buffer to start reading from. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + + + Returns + ------- + np.recarray + Record array view into the data in datastring. This will be readonly + if `datastring` is readonly. + + See Also + -------- + numpy.frombuffer + + Examples + -------- + >>> a = b'\x01\x02\x03abc' + >>> np.core.records.fromstring(a, dtype='u1,u1,u1,S3') + rec.array([(1, 2, 3, b'abc')], + dtype=[('f0', 'u1'), ('f1', 'u1'), ('f2', 'u1'), ('f3', 'S3')]) + + >>> grades_dtype = [('Name', (np.str_, 10)), ('Marks', np.float64), + ... ('GradeLevel', np.int32)] + >>> grades_array = np.array([('Sam', 33.3, 3), ('Mike', 44.4, 5), + ... ('Aadi', 66.6, 6)], dtype=grades_dtype) + >>> np.core.records.fromstring(grades_array.tobytes(), dtype=grades_dtype) + rec.array([('Sam', 33.3, 3), ('Mike', 44.4, 5), ('Aadi', 66.6, 6)], + dtype=[('Name', '>> s = '\x01\x02\x03abc' + >>> np.core.records.fromstring(s, dtype='u1,u1,u1,S3') + Traceback (most recent call last) + ... + TypeError: a bytes-like object is required, not 'str' + """ + + if dtype is None and formats is None: + raise TypeError("fromstring() needs a 'dtype' or 'formats' argument") + + if dtype is not None: + descr = sb.dtype(dtype) + else: + descr = format_parser(formats, names, titles, aligned, byteorder).dtype + + itemsize = descr.itemsize + + # NumPy 1.19.0, 2020-01-01 + shape = _deprecate_shape_0_as_None(shape) + + if shape in (None, -1): + shape = (len(datastring) - offset) // itemsize + + _array = recarray(shape, descr, buf=datastring, offset=offset) + return _array + +def get_remaining_size(fd): + pos = fd.tell() + try: + fd.seek(0, 2) + return fd.tell() - pos + finally: + fd.seek(pos, 0) + + +@set_module("numpy.rec") +def fromfile(fd, dtype=None, shape=None, offset=0, formats=None, + names=None, titles=None, aligned=False, byteorder=None): + """Create an array from binary file data + + Parameters + ---------- + fd : str or file type + If file is a string or a path-like object then that file is opened, + else it is assumed to be a file object. The file object must + support random access (i.e. it must have tell and seek methods). + dtype : data-type, optional + valid dtype for all arrays + shape : int or tuple of ints, optional + shape of each array. + offset : int, optional + Position in the file to start reading from. + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation + + Returns + ------- + np.recarray + record array consisting of data enclosed in file. + + Examples + -------- + >>> from tempfile import TemporaryFile + >>> a = np.empty(10,dtype='f8,i4,a5') + >>> a[5] = (0.5,10,'abcde') + >>> + >>> fd=TemporaryFile() + >>> a = a.newbyteorder('<') + >>> a.tofile(fd) + >>> + >>> _ = fd.seek(0) + >>> r=np.core.records.fromfile(fd, formats='f8,i4,a5', shape=10, + ... byteorder='<') + >>> print(r[5]) + (0.5, 10, 'abcde') + >>> r.shape + (10,) + """ + + if dtype is None and formats is None: + raise TypeError("fromfile() needs a 'dtype' or 'formats' argument") + + # NumPy 1.19.0, 2020-01-01 + shape = _deprecate_shape_0_as_None(shape) + + if shape is None: + shape = (-1,) + elif isinstance(shape, int): + shape = (shape,) + + if hasattr(fd, 'readinto'): + # GH issue 2504. fd supports io.RawIOBase or io.BufferedIOBase interface. + # Example of fd: gzip, BytesIO, BufferedReader + # file already opened + ctx = nullcontext(fd) + else: + # open file + ctx = open(os_fspath(fd), 'rb') + + with ctx as fd: + if offset > 0: + fd.seek(offset, 1) + size = get_remaining_size(fd) + + if dtype is not None: + descr = sb.dtype(dtype) + else: + descr = format_parser(formats, names, titles, aligned, byteorder).dtype + + itemsize = descr.itemsize + + shapeprod = sb.array(shape).prod(dtype=nt.intp) + shapesize = shapeprod * itemsize + if shapesize < 0: + shape = list(shape) + shape[shape.index(-1)] = size // -shapesize + shape = tuple(shape) + shapeprod = sb.array(shape).prod(dtype=nt.intp) + + nbytes = shapeprod * itemsize + + if nbytes > size: + raise ValueError( + "Not enough bytes left in file for specified shape and type") + + # create the array + _array = recarray(shape, descr) + nbytesread = fd.readinto(_array.data) + if nbytesread != nbytes: + raise OSError("Didn't read as many bytes as expected") + + return _array + + +@set_module("numpy.rec") +def array(obj, dtype=None, shape=None, offset=0, strides=None, formats=None, + names=None, titles=None, aligned=False, byteorder=None, copy=True): + """ + Construct a record array from a wide-variety of objects. + + A general-purpose record array constructor that dispatches to the + appropriate `recarray` creation function based on the inputs (see Notes). + + Parameters + ---------- + obj : any + Input object. See Notes for details on how various input types are + treated. + dtype : data-type, optional + Valid dtype for array. + shape : int or tuple of ints, optional + Shape of each array. + offset : int, optional + Position in the file or buffer to start reading from. + strides : tuple of ints, optional + Buffer (`buf`) is interpreted according to these strides (strides + define how many bytes each array element, row, column, etc. + occupy in memory). + formats, names, titles, aligned, byteorder : + If `dtype` is ``None``, these arguments are passed to + `numpy.format_parser` to construct a dtype. See that function for + detailed documentation. + copy : bool, optional + Whether to copy the input object (True), or to use a reference instead. + This option only applies when the input is an ndarray or recarray. + Defaults to True. + + Returns + ------- + np.recarray + Record array created from the specified object. + + Notes + ----- + If `obj` is ``None``, then call the `~numpy.recarray` constructor. If + `obj` is a string, then call the `fromstring` constructor. If `obj` is a + list or a tuple, then if the first object is an `~numpy.ndarray`, call + `fromarrays`, otherwise call `fromrecords`. If `obj` is a + `~numpy.recarray`, then make a copy of the data in the recarray + (if ``copy=True``) and use the new formats, names, and titles. If `obj` + is a file, then call `fromfile`. Finally, if obj is an `ndarray`, then + return ``obj.view(recarray)``, making a copy of the data if ``copy=True``. + + Examples + -------- + >>> a = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) + array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]]) + + >>> np.core.records.array(a) + rec.array([[1, 2, 3], + [4, 5, 6], + [7, 8, 9]], + dtype=int32) + + >>> b = [(1, 1), (2, 4), (3, 9)] + >>> c = np.core.records.array(b, formats = ['i2', 'f2'], names = ('x', 'y')) + >>> c + rec.array([(1, 1.0), (2, 4.0), (3, 9.0)], + dtype=[('x', '>> c.x + rec.array([1, 2, 3], dtype=int16) + + >>> c.y + rec.array([ 1.0, 4.0, 9.0], dtype=float16) + + >>> r = np.rec.array(['abc','def'], names=['col1','col2']) + >>> print(r.col1) + abc + + >>> r.col1 + array('abc', dtype='>> r.col2 + array('def', dtype='= 1``. + Copies are made only if necessary. + + See Also + -------- + atleast_2d, atleast_3d + + Examples + -------- + >>> np.atleast_1d(1.0) + array([1.]) + + >>> x = np.arange(9.0).reshape(3,3) + >>> np.atleast_1d(x) + array([[0., 1., 2.], + [3., 4., 5.], + [6., 7., 8.]]) + >>> np.atleast_1d(x) is x + True + + >>> np.atleast_1d(1, [3, 4]) + [array([1]), array([3, 4])] + + """ + res = [] + for ary in arys: + ary = asanyarray(ary) + if ary.ndim == 0: + result = ary.reshape(1) + else: + result = ary + res.append(result) + if len(res) == 1: + return res[0] + else: + return res + + +def _atleast_2d_dispatcher(*arys): + return arys + + +@array_function_dispatch(_atleast_2d_dispatcher) +def atleast_2d(*arys): + """ + View inputs as arrays with at least two dimensions. + + Parameters + ---------- + arys1, arys2, ... : array_like + One or more array-like sequences. Non-array inputs are converted + to arrays. Arrays that already have two or more dimensions are + preserved. + + Returns + ------- + res, res2, ... : ndarray + An array, or list of arrays, each with ``a.ndim >= 2``. + Copies are avoided where possible, and views with two or more + dimensions are returned. + + See Also + -------- + atleast_1d, atleast_3d + + Examples + -------- + >>> np.atleast_2d(3.0) + array([[3.]]) + + >>> x = np.arange(3.0) + >>> np.atleast_2d(x) + array([[0., 1., 2.]]) + >>> np.atleast_2d(x).base is x + True + + >>> np.atleast_2d(1, [1, 2], [[1, 2]]) + [array([[1]]), array([[1, 2]]), array([[1, 2]])] + + """ + res = [] + for ary in arys: + ary = asanyarray(ary) + if ary.ndim == 0: + result = ary.reshape(1, 1) + elif ary.ndim == 1: + result = ary[_nx.newaxis, :] + else: + result = ary + res.append(result) + if len(res) == 1: + return res[0] + else: + return res + + +def _atleast_3d_dispatcher(*arys): + return arys + + +@array_function_dispatch(_atleast_3d_dispatcher) +def atleast_3d(*arys): + """ + View inputs as arrays with at least three dimensions. + + Parameters + ---------- + arys1, arys2, ... : array_like + One or more array-like sequences. Non-array inputs are converted to + arrays. Arrays that already have three or more dimensions are + preserved. + + Returns + ------- + res1, res2, ... : ndarray + An array, or list of arrays, each with ``a.ndim >= 3``. Copies are + avoided where possible, and views with three or more dimensions are + returned. For example, a 1-D array of shape ``(N,)`` becomes a view + of shape ``(1, N, 1)``, and a 2-D array of shape ``(M, N)`` becomes a + view of shape ``(M, N, 1)``. + + See Also + -------- + atleast_1d, atleast_2d + + Examples + -------- + >>> np.atleast_3d(3.0) + array([[[3.]]]) + + >>> x = np.arange(3.0) + >>> np.atleast_3d(x).shape + (1, 3, 1) + + >>> x = np.arange(12.0).reshape(4,3) + >>> np.atleast_3d(x).shape + (4, 3, 1) + >>> np.atleast_3d(x).base is x.base # x is a reshape, so not base itself + True + + >>> for arr in np.atleast_3d([1, 2], [[1, 2]], [[[1, 2]]]): + ... print(arr, arr.shape) # doctest: +SKIP + ... + [[[1] + [2]]] (1, 2, 1) + [[[1] + [2]]] (1, 2, 1) + [[[1 2]]] (1, 1, 2) + + """ + res = [] + for ary in arys: + ary = asanyarray(ary) + if ary.ndim == 0: + result = ary.reshape(1, 1, 1) + elif ary.ndim == 1: + result = ary[_nx.newaxis, :, _nx.newaxis] + elif ary.ndim == 2: + result = ary[:, :, _nx.newaxis] + else: + result = ary + res.append(result) + if len(res) == 1: + return res[0] + else: + return res + + +def _arrays_for_stack_dispatcher(arrays): + if not hasattr(arrays, "__getitem__"): + raise TypeError('arrays to stack must be passed as a "sequence" type ' + 'such as list or tuple.') + + return tuple(arrays) + + +def _vhstack_dispatcher(tup, *, dtype=None, casting=None): + return _arrays_for_stack_dispatcher(tup) + + +@array_function_dispatch(_vhstack_dispatcher) +def vstack(tup, *, dtype=None, casting="same_kind"): + """ + Stack arrays in sequence vertically (row wise). + + This is equivalent to concatenation along the first axis after 1-D arrays + of shape `(N,)` have been reshaped to `(1,N)`. Rebuilds arrays divided by + `vsplit`. + + This function makes most sense for arrays with up to 3 dimensions. For + instance, for pixel-data with a height (first axis), width (second axis), + and r/g/b channels (third axis). The functions `concatenate`, `stack` and + `block` provide more general stacking and concatenation operations. + + ``np.row_stack`` is an alias for `vstack`. They are the same function. + + Parameters + ---------- + tup : sequence of ndarrays + The arrays must have the same shape along all but the first axis. + 1-D arrays must have the same length. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + Returns + ------- + stacked : ndarray + The array formed by stacking the given arrays, will be at least 2-D. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + block : Assemble an nd-array from nested lists of blocks. + hstack : Stack arrays in sequence horizontally (column wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + vsplit : Split an array into multiple sub-arrays vertically (row-wise). + + Examples + -------- + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.vstack((a,b)) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> a = np.array([[1], [2], [3]]) + >>> b = np.array([[4], [5], [6]]) + >>> np.vstack((a,b)) + array([[1], + [2], + [3], + [4], + [5], + [6]]) + + """ + arrs = atleast_2d(*tup) + if not isinstance(arrs, list): + arrs = [arrs] + return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting) + + +@array_function_dispatch(_vhstack_dispatcher) +def hstack(tup, *, dtype=None, casting="same_kind"): + """ + Stack arrays in sequence horizontally (column wise). + + This is equivalent to concatenation along the second axis, except for 1-D + arrays where it concatenates along the first axis. Rebuilds arrays divided + by `hsplit`. + + This function makes most sense for arrays with up to 3 dimensions. For + instance, for pixel-data with a height (first axis), width (second axis), + and r/g/b channels (third axis). The functions `concatenate`, `stack` and + `block` provide more general stacking and concatenation operations. + + Parameters + ---------- + tup : sequence of ndarrays + The arrays must have the same shape along all but the second axis, + except 1-D arrays which can be any length. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + Returns + ------- + stacked : ndarray + The array formed by stacking the given arrays. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + block : Assemble an nd-array from nested lists of blocks. + vstack : Stack arrays in sequence vertically (row wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + hsplit : Split an array into multiple sub-arrays horizontally (column-wise). + + Examples + -------- + >>> a = np.array((1,2,3)) + >>> b = np.array((4,5,6)) + >>> np.hstack((a,b)) + array([1, 2, 3, 4, 5, 6]) + >>> a = np.array([[1],[2],[3]]) + >>> b = np.array([[4],[5],[6]]) + >>> np.hstack((a,b)) + array([[1, 4], + [2, 5], + [3, 6]]) + + """ + arrs = atleast_1d(*tup) + if not isinstance(arrs, list): + arrs = [arrs] + # As a special case, dimension 0 of 1-dimensional arrays is "horizontal" + if arrs and arrs[0].ndim == 1: + return _nx.concatenate(arrs, 0, dtype=dtype, casting=casting) + else: + return _nx.concatenate(arrs, 1, dtype=dtype, casting=casting) + + +def _stack_dispatcher(arrays, axis=None, out=None, *, + dtype=None, casting=None): + arrays = _arrays_for_stack_dispatcher(arrays) + if out is not None: + # optimize for the typical case where only arrays is provided + arrays = list(arrays) + arrays.append(out) + return arrays + + +@array_function_dispatch(_stack_dispatcher) +def stack(arrays, axis=0, out=None, *, dtype=None, casting="same_kind"): + """ + Join a sequence of arrays along a new axis. + + The ``axis`` parameter specifies the index of the new axis in the + dimensions of the result. For example, if ``axis=0`` it will be the first + dimension and if ``axis=-1`` it will be the last dimension. + + .. versionadded:: 1.10.0 + + Parameters + ---------- + arrays : sequence of array_like + Each array must have the same shape. + + axis : int, optional + The axis in the result array along which the input arrays are stacked. + + out : ndarray, optional + If provided, the destination to place the result. The shape must be + correct, matching that of what stack would have returned if no + out argument were specified. + + dtype : str or dtype + If provided, the destination array will have this dtype. Cannot be + provided together with `out`. + + .. versionadded:: 1.24 + + casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional + Controls what kind of data casting may occur. Defaults to 'same_kind'. + + .. versionadded:: 1.24 + + + Returns + ------- + stacked : ndarray + The stacked array has one more dimension than the input arrays. + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + block : Assemble an nd-array from nested lists of blocks. + split : Split array into a list of multiple sub-arrays of equal size. + + Examples + -------- + >>> arrays = [np.random.randn(3, 4) for _ in range(10)] + >>> np.stack(arrays, axis=0).shape + (10, 3, 4) + + >>> np.stack(arrays, axis=1).shape + (3, 10, 4) + + >>> np.stack(arrays, axis=2).shape + (3, 4, 10) + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.stack((a, b)) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> np.stack((a, b), axis=-1) + array([[1, 4], + [2, 5], + [3, 6]]) + + """ + arrays = [asanyarray(arr) for arr in arrays] + if not arrays: + raise ValueError('need at least one array to stack') + + shapes = {arr.shape for arr in arrays} + if len(shapes) != 1: + raise ValueError('all input arrays must have the same shape') + + result_ndim = arrays[0].ndim + 1 + axis = normalize_axis_index(axis, result_ndim) + + sl = (slice(None),) * axis + (_nx.newaxis,) + expanded_arrays = [arr[sl] for arr in arrays] + return _nx.concatenate(expanded_arrays, axis=axis, out=out, + dtype=dtype, casting=casting) + + +# Internal functions to eliminate the overhead of repeated dispatch in one of +# the two possible paths inside np.block. +# Use getattr to protect against __array_function__ being disabled. +_size = getattr(_from_nx.size, '__wrapped__', _from_nx.size) +_ndim = getattr(_from_nx.ndim, '__wrapped__', _from_nx.ndim) +_concatenate = getattr(_from_nx.concatenate, + '__wrapped__', _from_nx.concatenate) + + +def _block_format_index(index): + """ + Convert a list of indices ``[0, 1, 2]`` into ``"arrays[0][1][2]"``. + """ + idx_str = ''.join('[{}]'.format(i) for i in index if i is not None) + return 'arrays' + idx_str + + +def _block_check_depths_match(arrays, parent_index=[]): + """ + Recursive function checking that the depths of nested lists in `arrays` + all match. Mismatch raises a ValueError as described in the block + docstring below. + + The entire index (rather than just the depth) needs to be calculated + for each innermost list, in case an error needs to be raised, so that + the index of the offending list can be printed as part of the error. + + Parameters + ---------- + arrays : nested list of arrays + The arrays to check + parent_index : list of int + The full index of `arrays` within the nested lists passed to + `_block_check_depths_match` at the top of the recursion. + + Returns + ------- + first_index : list of int + The full index of an element from the bottom of the nesting in + `arrays`. If any element at the bottom is an empty list, this will + refer to it, and the last index along the empty axis will be None. + max_arr_ndim : int + The maximum of the ndims of the arrays nested in `arrays`. + final_size: int + The number of elements in the final array. This is used the motivate + the choice of algorithm used using benchmarking wisdom. + + """ + if type(arrays) is tuple: + # not strictly necessary, but saves us from: + # - more than one way to do things - no point treating tuples like + # lists + # - horribly confusing behaviour that results when tuples are + # treated like ndarray + raise TypeError( + '{} is a tuple. ' + 'Only lists can be used to arrange blocks, and np.block does ' + 'not allow implicit conversion from tuple to ndarray.'.format( + _block_format_index(parent_index) + ) + ) + elif type(arrays) is list and len(arrays) > 0: + idxs_ndims = (_block_check_depths_match(arr, parent_index + [i]) + for i, arr in enumerate(arrays)) + + first_index, max_arr_ndim, final_size = next(idxs_ndims) + for index, ndim, size in idxs_ndims: + final_size += size + if ndim > max_arr_ndim: + max_arr_ndim = ndim + if len(index) != len(first_index): + raise ValueError( + "List depths are mismatched. First element was at depth " + "{}, but there is an element at depth {} ({})".format( + len(first_index), + len(index), + _block_format_index(index) + ) + ) + # propagate our flag that indicates an empty list at the bottom + if index[-1] is None: + first_index = index + + return first_index, max_arr_ndim, final_size + elif type(arrays) is list and len(arrays) == 0: + # We've 'bottomed out' on an empty list + return parent_index + [None], 0, 0 + else: + # We've 'bottomed out' - arrays is either a scalar or an array + size = _size(arrays) + return parent_index, _ndim(arrays), size + + +def _atleast_nd(a, ndim): + # Ensures `a` has at least `ndim` dimensions by prepending + # ones to `a.shape` as necessary + return array(a, ndmin=ndim, copy=False, subok=True) + + +def _accumulate(values): + return list(itertools.accumulate(values)) + + +def _concatenate_shapes(shapes, axis): + """Given array shapes, return the resulting shape and slices prefixes. + + These help in nested concatenation. + + Returns + ------- + shape: tuple of int + This tuple satisfies:: + + shape, _ = _concatenate_shapes([arr.shape for shape in arrs], axis) + shape == concatenate(arrs, axis).shape + + slice_prefixes: tuple of (slice(start, end), ) + For a list of arrays being concatenated, this returns the slice + in the larger array at axis that needs to be sliced into. + + For example, the following holds:: + + ret = concatenate([a, b, c], axis) + _, (sl_a, sl_b, sl_c) = concatenate_slices([a, b, c], axis) + + ret[(slice(None),) * axis + sl_a] == a + ret[(slice(None),) * axis + sl_b] == b + ret[(slice(None),) * axis + sl_c] == c + + These are called slice prefixes since they are used in the recursive + blocking algorithm to compute the left-most slices during the + recursion. Therefore, they must be prepended to rest of the slice + that was computed deeper in the recursion. + + These are returned as tuples to ensure that they can quickly be added + to existing slice tuple without creating a new tuple every time. + + """ + # Cache a result that will be reused. + shape_at_axis = [shape[axis] for shape in shapes] + + # Take a shape, any shape + first_shape = shapes[0] + first_shape_pre = first_shape[:axis] + first_shape_post = first_shape[axis+1:] + + if any(shape[:axis] != first_shape_pre or + shape[axis+1:] != first_shape_post for shape in shapes): + raise ValueError( + 'Mismatched array shapes in block along axis {}.'.format(axis)) + + shape = (first_shape_pre + (sum(shape_at_axis),) + first_shape[axis+1:]) + + offsets_at_axis = _accumulate(shape_at_axis) + slice_prefixes = [(slice(start, end),) + for start, end in zip([0] + offsets_at_axis, + offsets_at_axis)] + return shape, slice_prefixes + + +def _block_info_recursion(arrays, max_depth, result_ndim, depth=0): + """ + Returns the shape of the final array, along with a list + of slices and a list of arrays that can be used for assignment inside the + new array + + Parameters + ---------- + arrays : nested list of arrays + The arrays to check + max_depth : list of int + The number of nested lists + result_ndim : int + The number of dimensions in thefinal array. + + Returns + ------- + shape : tuple of int + The shape that the final array will take on. + slices: list of tuple of slices + The slices into the full array required for assignment. These are + required to be prepended with ``(Ellipsis, )`` to obtain to correct + final index. + arrays: list of ndarray + The data to assign to each slice of the full array + + """ + if depth < max_depth: + shapes, slices, arrays = zip( + *[_block_info_recursion(arr, max_depth, result_ndim, depth+1) + for arr in arrays]) + + axis = result_ndim - max_depth + depth + shape, slice_prefixes = _concatenate_shapes(shapes, axis) + + # Prepend the slice prefix and flatten the slices + slices = [slice_prefix + the_slice + for slice_prefix, inner_slices in zip(slice_prefixes, slices) + for the_slice in inner_slices] + + # Flatten the array list + arrays = functools.reduce(operator.add, arrays) + + return shape, slices, arrays + else: + # We've 'bottomed out' - arrays is either a scalar or an array + # type(arrays) is not list + # Return the slice and the array inside a list to be consistent with + # the recursive case. + arr = _atleast_nd(arrays, result_ndim) + return arr.shape, [()], [arr] + + +def _block(arrays, max_depth, result_ndim, depth=0): + """ + Internal implementation of block based on repeated concatenation. + `arrays` is the argument passed to + block. `max_depth` is the depth of nested lists within `arrays` and + `result_ndim` is the greatest of the dimensions of the arrays in + `arrays` and the depth of the lists in `arrays` (see block docstring + for details). + """ + if depth < max_depth: + arrs = [_block(arr, max_depth, result_ndim, depth+1) + for arr in arrays] + return _concatenate(arrs, axis=-(max_depth-depth)) + else: + # We've 'bottomed out' - arrays is either a scalar or an array + # type(arrays) is not list + return _atleast_nd(arrays, result_ndim) + + +def _block_dispatcher(arrays): + # Use type(...) is list to match the behavior of np.block(), which special + # cases list specifically rather than allowing for generic iterables or + # tuple. Also, we know that list.__array_function__ will never exist. + if type(arrays) is list: + for subarrays in arrays: + yield from _block_dispatcher(subarrays) + else: + yield arrays + + +@array_function_dispatch(_block_dispatcher) +def block(arrays): + """ + Assemble an nd-array from nested lists of blocks. + + Blocks in the innermost lists are concatenated (see `concatenate`) along + the last dimension (-1), then these are concatenated along the + second-last dimension (-2), and so on until the outermost list is reached. + + Blocks can be of any dimension, but will not be broadcasted using the normal + rules. Instead, leading axes of size 1 are inserted, to make ``block.ndim`` + the same for all blocks. This is primarily useful for working with scalars, + and means that code like ``np.block([v, 1])`` is valid, where + ``v.ndim == 1``. + + When the nested list is two levels deep, this allows block matrices to be + constructed from their components. + + .. versionadded:: 1.13.0 + + Parameters + ---------- + arrays : nested list of array_like or scalars (but not tuples) + If passed a single ndarray or scalar (a nested list of depth 0), this + is returned unmodified (and not copied). + + Elements shapes must match along the appropriate axes (without + broadcasting), but leading 1s will be prepended to the shape as + necessary to make the dimensions match. + + Returns + ------- + block_array : ndarray + The array assembled from the given blocks. + + The dimensionality of the output is equal to the greatest of: + * the dimensionality of all the inputs + * the depth to which the input list is nested + + Raises + ------ + ValueError + * If list depths are mismatched - for instance, ``[[a, b], c]`` is + illegal, and should be spelt ``[[a, b], [c]]`` + * If lists are empty - for instance, ``[[a, b], []]`` + + See Also + -------- + concatenate : Join a sequence of arrays along an existing axis. + stack : Join a sequence of arrays along a new axis. + vstack : Stack arrays in sequence vertically (row wise). + hstack : Stack arrays in sequence horizontally (column wise). + dstack : Stack arrays in sequence depth wise (along third axis). + column_stack : Stack 1-D arrays as columns into a 2-D array. + vsplit : Split an array into multiple sub-arrays vertically (row-wise). + + Notes + ----- + + When called with only scalars, ``np.block`` is equivalent to an ndarray + call. So ``np.block([[1, 2], [3, 4]])`` is equivalent to + ``np.array([[1, 2], [3, 4]])``. + + This function does not enforce that the blocks lie on a fixed grid. + ``np.block([[a, b], [c, d]])`` is not restricted to arrays of the form:: + + AAAbb + AAAbb + cccDD + + But is also allowed to produce, for some ``a, b, c, d``:: + + AAAbb + AAAbb + cDDDD + + Since concatenation happens along the last axis first, `block` is _not_ + capable of producing the following directly:: + + AAAbb + cccbb + cccDD + + Matlab's "square bracket stacking", ``[A, B, ...; p, q, ...]``, is + equivalent to ``np.block([[A, B, ...], [p, q, ...]])``. + + Examples + -------- + The most common use of this function is to build a block matrix + + >>> A = np.eye(2) * 2 + >>> B = np.eye(3) * 3 + >>> np.block([ + ... [A, np.zeros((2, 3))], + ... [np.ones((3, 2)), B ] + ... ]) + array([[2., 0., 0., 0., 0.], + [0., 2., 0., 0., 0.], + [1., 1., 3., 0., 0.], + [1., 1., 0., 3., 0.], + [1., 1., 0., 0., 3.]]) + + With a list of depth 1, `block` can be used as `hstack` + + >>> np.block([1, 2, 3]) # hstack([1, 2, 3]) + array([1, 2, 3]) + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.block([a, b, 10]) # hstack([a, b, 10]) + array([ 1, 2, 3, 4, 5, 6, 10]) + + >>> A = np.ones((2, 2), int) + >>> B = 2 * A + >>> np.block([A, B]) # hstack([A, B]) + array([[1, 1, 2, 2], + [1, 1, 2, 2]]) + + With a list of depth 2, `block` can be used in place of `vstack`: + + >>> a = np.array([1, 2, 3]) + >>> b = np.array([4, 5, 6]) + >>> np.block([[a], [b]]) # vstack([a, b]) + array([[1, 2, 3], + [4, 5, 6]]) + + >>> A = np.ones((2, 2), int) + >>> B = 2 * A + >>> np.block([[A], [B]]) # vstack([A, B]) + array([[1, 1], + [1, 1], + [2, 2], + [2, 2]]) + + It can also be used in places of `atleast_1d` and `atleast_2d` + + >>> a = np.array(0) + >>> b = np.array([1]) + >>> np.block([a]) # atleast_1d(a) + array([0]) + >>> np.block([b]) # atleast_1d(b) + array([1]) + + >>> np.block([[a]]) # atleast_2d(a) + array([[0]]) + >>> np.block([[b]]) # atleast_2d(b) + array([[1]]) + + + """ + arrays, list_ndim, result_ndim, final_size = _block_setup(arrays) + + # It was found through benchmarking that making an array of final size + # around 256x256 was faster by straight concatenation on a + # i7-7700HQ processor and dual channel ram 2400MHz. + # It didn't seem to matter heavily on the dtype used. + # + # A 2D array using repeated concatenation requires 2 copies of the array. + # + # The fastest algorithm will depend on the ratio of CPU power to memory + # speed. + # One can monitor the results of the benchmark + # https://pv.github.io/numpy-bench/#bench_shape_base.Block2D.time_block2d + # to tune this parameter until a C version of the `_block_info_recursion` + # algorithm is implemented which would likely be faster than the python + # version. + if list_ndim * final_size > (2 * 512 * 512): + return _block_slicing(arrays, list_ndim, result_ndim) + else: + return _block_concatenate(arrays, list_ndim, result_ndim) + + +# These helper functions are mostly used for testing. +# They allow us to write tests that directly call `_block_slicing` +# or `_block_concatenate` without blocking large arrays to force the wisdom +# to trigger the desired path. +def _block_setup(arrays): + """ + Returns + (`arrays`, list_ndim, result_ndim, final_size) + """ + bottom_index, arr_ndim, final_size = _block_check_depths_match(arrays) + list_ndim = len(bottom_index) + if bottom_index and bottom_index[-1] is None: + raise ValueError( + 'List at {} cannot be empty'.format( + _block_format_index(bottom_index) + ) + ) + result_ndim = max(arr_ndim, list_ndim) + return arrays, list_ndim, result_ndim, final_size + + +def _block_slicing(arrays, list_ndim, result_ndim): + shape, slices, arrays = _block_info_recursion( + arrays, list_ndim, result_ndim) + dtype = _nx.result_type(*[arr.dtype for arr in arrays]) + + # Test preferring F only in the case that all input arrays are F + F_order = all(arr.flags['F_CONTIGUOUS'] for arr in arrays) + C_order = all(arr.flags['C_CONTIGUOUS'] for arr in arrays) + order = 'F' if F_order and not C_order else 'C' + result = _nx.empty(shape=shape, dtype=dtype, order=order) + # Note: In a c implementation, the function + # PyArray_CreateMultiSortedStridePerm could be used for more advanced + # guessing of the desired order. + + for the_slice, arr in zip(slices, arrays): + result[(Ellipsis,) + the_slice] = arr + return result + + +def _block_concatenate(arrays, list_ndim, result_ndim): + result = _block(arrays, list_ndim, result_ndim) + if list_ndim == 0: + # Catch an edge case where _block returns a view because + # `arrays` is a single numpy array and not a list of numpy arrays. + # This might copy scalars or lists twice, but this isn't a likely + # usecase for those interested in performance + result = result.copy() + return result diff --git a/pllava/lib/python3.10/site-packages/numpy/core/umath_tests.py b/pllava/lib/python3.10/site-packages/numpy/core/umath_tests.py new file mode 100644 index 0000000000000000000000000000000000000000..90ab17e6744a751c4d60e9b86e150cdbc3f6ff2e --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/core/umath_tests.py @@ -0,0 +1,13 @@ +""" +Shim for _umath_tests to allow a deprecation period for the new name. + +""" +import warnings + +# 2018-04-04, numpy 1.15.0 +warnings.warn(("numpy.core.umath_tests is an internal NumPy " + "module and should not be imported. It will " + "be removed in a future NumPy release."), + category=DeprecationWarning, stacklevel=2) + +from ._umath_tests import * diff --git a/pllava/lib/python3.10/site-packages/numpy/typing/tests/data/reveal/flatiter.pyi b/pllava/lib/python3.10/site-packages/numpy/typing/tests/data/reveal/flatiter.pyi new file mode 100644 index 0000000000000000000000000000000000000000..84d3b03b7d37afb0ddb2965300f9ce49ba9e4a53 --- /dev/null +++ b/pllava/lib/python3.10/site-packages/numpy/typing/tests/data/reveal/flatiter.pyi @@ -0,0 +1,31 @@ +import sys +from typing import Any + +import numpy as np +import numpy.typing as npt + +if sys.version_info >= (3, 11): + from typing import assert_type +else: + from typing_extensions import assert_type + +a: np.flatiter[npt.NDArray[np.str_]] + +assert_type(a.base, npt.NDArray[np.str_]) +assert_type(a.copy(), npt.NDArray[np.str_]) +assert_type(a.coords, tuple[int, ...]) +assert_type(a.index, int) +assert_type(iter(a), np.flatiter[npt.NDArray[np.str_]]) +assert_type(next(a), np.str_) +assert_type(a[0], np.str_) +assert_type(a[[0, 1, 2]], npt.NDArray[np.str_]) +assert_type(a[...], npt.NDArray[np.str_]) +assert_type(a[:], npt.NDArray[np.str_]) +assert_type(a[(...,)], npt.NDArray[np.str_]) +assert_type(a[(0,)], np.str_) +assert_type(a.__array__(), npt.NDArray[np.str_]) +assert_type(a.__array__(np.dtype(np.float64)), npt.NDArray[np.float64]) +a[0] = "a" +a[:5] = "a" +a[...] = "a" +a[(...,)] = "a"