Upload descriptor_prediction.csv
Browse files
descriptor_prediction.csv
CHANGED
|
@@ -245,7 +245,7 @@ HBA: <number>
|
|
| 245 |
|
| 246 |
Now answer the following:
|
| 247 |
|
| 248 |
-
Input SMILES: O=S(=O)([O-])c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)[O-])cc4)c4ccc(s4)c(-c4ccc(S(=O)(=O)[O-])cc4)c4nc(c(-c5ccc(S(=O)(=O)[O-])cc5)c5ccc2s5)C=C4)C=C3)cc1.[Na+].[Na+].[Na+].[Na+]",O=S(=O)([O-])c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)[O-])cc4)c4ccc(s4)c(-c4ccc(S(=O)(=O)[O-])cc4)c4nc(c(-c5ccc(S(=O)(=O)[O-])cc5)c5ccc2s5)C=C4)C=C3)cc1.[Na+].[Na+].[Na+].[Na+],
|
| 249 |
"You are a professional chemist. Your task is to analyze the SMILES representation of a molecule and predict its key molecular descriptors.
|
| 250 |
|
| 251 |
Please strictly follow the output format shown in the examples. Do not provide any explanation or extra text.
|
|
@@ -283,7 +283,7 @@ HBA: <number>
|
|
| 283 |
|
| 284 |
Now answer the following:
|
| 285 |
|
| 286 |
-
Input SMILES: CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)NS(=O)(=O)c1cccc(-c2ccccc2)c1",CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)NS(=O)(=O)c1cccc(-c2ccccc2)c1,6,
|
| 287 |
"You are a professional chemist. Your task is to analyze the SMILES representation of a molecule and predict its key molecular descriptors.
|
| 288 |
|
| 289 |
Please strictly follow the output format shown in the examples. Do not provide any explanation or extra text.
|
|
|
|
| 245 |
|
| 246 |
Now answer the following:
|
| 247 |
|
| 248 |
+
Input SMILES: O=S(=O)([O-])c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)[O-])cc4)c4ccc(s4)c(-c4ccc(S(=O)(=O)[O-])cc4)c4nc(c(-c5ccc(S(=O)(=O)[O-])cc5)c5ccc2s5)C=C4)C=C3)cc1.[Na+].[Na+].[Na+].[Na+]",O=S(=O)([O-])c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)[O-])cc4)c4ccc(s4)c(-c4ccc(S(=O)(=O)[O-])cc4)c4nc(c(-c5ccc(S(=O)(=O)[O-])cc5)c5ccc2s5)C=C4)C=C3)cc1.[Na+].[Na+].[Na+].[Na+],0,16,1057.04,9.78,Biology,medium,Advance Reasoning,Descriptor Prediction,ChEMBL DB
|
| 249 |
"You are a professional chemist. Your task is to analyze the SMILES representation of a molecule and predict its key molecular descriptors.
|
| 250 |
|
| 251 |
Please strictly follow the output format shown in the examples. Do not provide any explanation or extra text.
|
|
|
|
| 283 |
|
| 284 |
Now answer the following:
|
| 285 |
|
| 286 |
+
Input SMILES: CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)NS(=O)(=O)c1cccc(-c2ccccc2)c1",CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)NS(=O)(=O)c1cccc(-c2ccccc2)c1,6,11,889.09,3.36,Biology,medium,Advance Reasoning,Descriptor Prediction,ChEMBL DB
|
| 287 |
"You are a professional chemist. Your task is to analyze the SMILES representation of a molecule and predict its key molecular descriptors.
|
| 288 |
|
| 289 |
Please strictly follow the output format shown in the examples. Do not provide any explanation or extra text.
|