messages list | task string | label int64 | drug string |
|---|---|---|---|
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)C=Cc1ccc(O)c(O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | COc1ccc(C(=O)/C(Br)=C\C(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(C)NC[C@@H](O)c1ccc(O)c(O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1ccccc1S(N)(=O)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc(C[C@@](C)(N)C(=O)O)cc1OC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N([Na])S(=O)(=O)c1ccc(N)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Nc1c(F)c(N)c(F)c(F)c1F |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1cc(C)cc(S(=O)(=O)O)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CN(C)c1ccc(/N=N/S(=O)(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CNCCc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1ccc(S(=O)(=O)OCC(N)CN=O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1c(O)cccc1C(=O)CC(N)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)CNC(=O)C(CS)Cc1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NCc1cccc(I)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNC(C)(C)Cc1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCC(O)c1ccc(O)c(OC)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc(C(=O)/C(Br)=C\C(=O)O)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COCCc1ccc(OCC(O)CNC(C)C)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCCCNc1ccc(C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOC)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(CCl)OC(C)CCl |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@@H](CC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NOCC[C@H](N)C(=O)O.O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | O=C/C=C\O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C=CCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN(C)CCCSC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCNNCCCC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCNN |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(O)CNC(=O)N(N=O)C(C)Cl |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | C=CCNNCC=C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CN(C)CCN(CCN=O)C(N)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCCCCCCCCCCCNC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@@H](CC(=O)O)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCC(O)C(O)C(O)C(O)CO |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CS(=N)(=O)CC[C@H](N)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N=C(N)NCCCCNC(=N)N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(N/C(=N/C#N)Nc1ccncc1)C(C)(C)C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNCCc1ccccn1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | ClCc1ccccn1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CCC1(c2ccccc2)C(=O)N=C(O)NC1=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H](C)C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN(N=O)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccn(C)c(=O)c1C#N |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC1(C)[C@@H](OC(=O)CCC(=O)O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@H]3C[C@@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@@H](O[C@@H]7O[C@H](CO)[C@H](O)[C@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@H]7O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)CC[C@]6(C)[C@H]5CC[C@@]43C)N2C1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cn1cc(C(=O)O)c(=O)c2ccc(/C=C/c3ccc([N+](=O)[O-])o3)nc21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C=C(NC(=O)C(=C)NC(=O)c1csc(C2=N[C@H]3c4csc(n4)[C@H]4NC(=O)c5csc(n5)[C@H]([C@@](C)(O)[C@@H](C)O)NC(=O)[C@H]5CSC(=N5)/C(=C\C)NC(=O)[C@H]([C@@H](C)O)NC(=O)c5csc(n5)[C@]3(CC2)NC(=O)[C@H](C)NC(=O)C(=C)NC(=O)[C@H](C)NC(=O)[C@H](C(C)CC)N[C@@H]2C=Cc3c([C@H](C)O)cc(nc3[C@H]2O)C(=O)O[C@@H]4C)n1)C(N)=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Nc1nc2c(ncn2[C@H]2CC(O)[C@@H](CO)O2)c(=S)[nH]1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CO[C@@]1(NC(=O)CSCC#N)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | c1ccc2nc(N3CCNCC3)ccc2c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCC(=O)O[C@H]1[C@H](C)O[C@@H](O[C@@H]2[C@@H](C)O[C@H](O[C@@H]3[C@@H](OC)[C@H](OC(=O)CC)CC(=O)O[C@H](C)C/C=C/C=C/[C@@H](O)[C@H](C)C[C@@H]3CC=O)[C@H](O)[C@H]2N(C)C)C[C@@]1(C)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COC(=O)C1=CO[C@@H](C)[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@H]12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COC(=O)Nc1nc2cc(SC(C)C)ccc2[nH]1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc2c(OC)c3ccoc3nc2c1OC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1c2ccoc2nc2c(OC)c(OC[C@@H](O)C(C)(C)O)ccc12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc2cc1Oc1ccc(cc1)C[C@H]1c3cc(c(OC)cc3CCN1C)Oc1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCC(C)N1CCC2(CC1)N=C1C(=C3NC(=O)/C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)/C=C/O[C@@]4(C)Oc5c(C)c(O)c(c1c5C4=O)C3=O)N2 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(=O)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)c4ccc(S(=O)(=O)O)cc34)c(O)c12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN1CCc2cc3c(cc2[C@H]1[C@@H]1OC(=O)c2c1ccc1c2OCO1)OCO3 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC(O)CN(C)c1ccc(NN)nn1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN1CCC(=C2c3ccccc3CCc3sccc32)CC1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1ncnc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | OC(CCN1CCCCC1)(c1ccccc1)c1ccccc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=c1ccc2cc(O)c(O)cc2o1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1cc2ccc(=O)oc2cc1O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)Nc1cc2ccccc2oc1=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC(=O)c1cc2ccccc2oc1=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(O)[C@]1(O)C[C@H](O)[C@@H](O)[C@@H](O)C1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=c1cccc2n1C[C@@H]1CNC[C@H]2C1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | O=C(c1ccc(F)cc1)C1CCN(CCn2c(=O)[nH]c3ccccc3c2=O)CC1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](NC(=O)N3CCNC3=O)c3ccccc3)C(=O)N2[C@H]1C(=O)O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1nc2[nH]nnc2c(=O)[nH]1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Cn1c(-c2ccc3c(c2)OCO3)cc(=O)c2ccccc21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C=C1C(=O)O[C@H]2[C@H]1CC/C(C)=C/CC[C@@]1(C)O[C@H]21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C=C(C)[C@@H]1CC[C@]2(CO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@@H](O)CC[C@@]43C)[C@@H]1CCC2=O |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | Nc1ncn(C2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1cc(/C=C/C(=O)N2CCC=CC2=O)cc(OC)c1OC |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34C1[C@]1(OCO[C@@]15C[C@H](OC)[C@H]1C[C@@H]3[C@@H]5[C@H]1OC)[C@@H](O)[C@H]24 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CCN1C[C@]2(C)CC[C@H](OC)[C@@]34C1[C@]1(OCO[C@@]15C[C@H](OC)[C@H]1C[C@]3(O)[C@@H]5[C@H]1OC)[C@@H](OC(C)=O)[C@H]24 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CN(C)Cc1c[nH]c2ccccc12 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | CSc1ccc2c(c1)C(N1CCN(C)CC1)Cc1ccccc1S2 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(/N=N/c3ccccc3)c(O)ccc2c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1cc(C)c(/N=N/c2c(O)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)cc1C |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | Cc1ccc(/N=N/c2c(O)c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc23)c(C)c1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | O=S(=O)(O)c1ccc(/N=N/c2c(O)ccc3cc(S(=O)(=O)O)ccc23)cc1 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 0 | N/N=C1\N=NC=C2C=CC=CC21 |
[
{
"content": "Instructions: Answer the following question about drug properties.\nContext: A carcinogen is any substance, radionuclide, or radiation that promotes carcinogenesis, the formation of cancer. This may be due to the ability to damage the genome or to the disruption of cellular metabolic processes.\nQ... | Carcinogens_Lagunin | 1 | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3ccccc3C(=O)OCC)c-2cc1C |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.