problem_id
int64
0
5k
question
stringlengths
52
8.71k
solutions
stringlengths
79
764k
input_output
stringlengths
0
23.6M
difficulty
stringclasses
3 values
url
stringlengths
36
106
starter_code
stringlengths
0
1.4k
input_ids
listlengths
14
2.05k
attention_mask
listlengths
14
2.05k
4,871
Write a function that takes a piece of text in the form of a string and returns the letter frequency count for the text. This count excludes numbers, spaces and all punctuation marks. Upper and lower case versions of a character are equivalent and the result should all be in lowercase. The function should return a list of tuples (in Python and Haskell) or arrays (in other languages) sorted by the most frequent letters first. The Rust implementation should return an ordered BTreeMap. Letters with the same frequency are ordered alphabetically. For example: ```python letter_frequency('aaAabb dddDD hhcc') ``` ```C++ letter_frequency("aaAabb dddDD hhcc") ``` will return ```python [('d',5), ('a',4), ('b',2), ('c',2), ('h',2)] ``` ```C++ std::vector>{{'d',5}, {'a',4}, {'b',2}, {'c',2}, {'h',2}} ``` Letter frequency analysis is often used to analyse simple substitution cipher texts like those created by the Caesar cipher.
["from collections import Counter\nfrom operator import itemgetter\n\ndef letter_frequency(text):\n items = Counter(c for c in text.lower() if c.isalpha()).items()\n return sorted(\n sorted(items, key=itemgetter(0)),\n key=itemgetter(1),\n reverse=True\n )", "from collections import Counter\ndef letter_frequency(text):\n return sorted(Counter(filter(str.isalpha, \n text.lower())\n ).most_common(), \n key=lambda t:(-t[1],t[0]))", "# return a list of tuples sorted by frequency with\n# the most frequent letter first. Any letters with the\n# same frequency are ordered alphabetically\n\ndef letter_frequency(text):\n text = text.lower()\n freq = sorted([(l, text.count(l)) for l in set(text) if l.isalpha()], key=lambda k: k[0])\n return sorted(freq, key=lambda k: k[1], reverse=True)", "def letter_frequency(text):\n d = {}\n for i in text:\n if i.isalpha():\n i = i.lower()\n d[i] = d[i] + 1 if i in d else 1\n return sorted(d.items(), key=lambda (k, v): (-v, k))", "import re\nfrom collections import Counter\ndef letter_frequency(text):\n letters = re.findall('[a-z]', text.lower())\n freqs = Counter(letters).most_common()\n return sorted(freqs, lambda a, b: cmp(b[1], a[1]) or cmp(a[0], b[0]))", "def letter_frequency(text):\n text = text.lower()\n freq_count = [(c, text.count(c)) for c in text if c.isalpha()]\n return sorted(list(set(freq_count)), key=lambda x: (-x[1], x[0]))\n\n", "from collections import Counter\n\ndef letter_frequency(text): \n return sorted(Counter(''.join([c for c in text.lower() if c.isalpha()])).items(), key=lambda x: (-x[1],x[0]))", "def letter_frequency(text):\n text = [c for c in text.lower() if c.isalpha()]\n result = [(char, text.count(char)) for char in sorted(set(text))]\n return sorted(result, key = lambda char_freq: char_freq[1], reverse = True)\n", "from collections import Counter\n\ndef letter_frequency(text):\n cnts = Counter(c for c in text.lower() if c.isalpha()).most_common()\n return sorted(cnts, key=lambda x: (-x[1], x[0]))", "def letter_frequency(text):\n text = text.lower()\n return sorted([(e, text.count(e)) for e in set(text) if e.isalpha()], key = lambda e: (-e[1], e[0])) "]
{"fn_name": "letter_frequency", "inputs": [], "outputs": []}
introductory
https://www.codewars.com/kata/53e895e28f9e66a56900011a
def letter_frequency(text):
[ 7985, 264, 729, 429, 4990, 264, 6573, 315, 1467, 304, 279, 1352, 315, 264, 914, 323, 4675, 279, 6524, 11639, 1760, 369, 279, 1467, 13, 1096, 1760, 63368, 5109, 11, 12621, 323, 678, 61503, 15423, 13, 30614, 323, 4722, 1142, 10795, 315,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,955
Write a function which outputs the positions of matching bracket pairs. The output should be a dictionary with keys the positions of the open brackets '(' and values the corresponding positions of the closing brackets ')'. For example: input = "(first)and(second)" should return {0:6, 10:17} If brackets cannot be paired or if the order is invalid (e.g. ')(') return False. In this kata we care only about the positions of round brackets '()', other types of brackets should be ignored.
["def bracket_pairs(string):\n brackets = {}\n open_brackets = []\n\n for i, c in enumerate(string):\n if c == '(':\n open_brackets.append(i)\n elif c == ')':\n if not open_brackets:\n return False\n brackets[open_brackets.pop()] = i\n\n return False if open_brackets else brackets\n", "def bracket_pairs(string):\n res, open = {}, []\n for i,c in enumerate(string):\n if c == '(':\n open.append(i)\n if c == ')':\n try:\n res[open.pop()] = i\n except IndexError:\n return False\n return not open and res", "def bracket_pairs(stg):\n open, dic = [], {}\n for i, e in enumerate(stg):\n if e =='(':\n open.append(i)\n if e == ')':\n if not open:\n return False\n dic[open.pop(-1)] = i\n return False if open else dic\n\n", "def bracket_pairs(s):\n a, d = [], {}\n for i, x in enumerate(s):\n if x == \"(\":\n a.append(i)\n if x == \")\":\n if not a: return 0\n d[a.pop()] = i\n return not a and d", "def bracket_pairs(string):\n result = {}\n stack = []\n for i, c in enumerate(string):\n if c == ')':\n if not stack:\n return False\n result[stack.pop()] = i\n elif c == '(':\n stack.append(i)\n if stack:\n return False\n return result", "class Stack:\n def __init__(self):\n self.items = []\n\n def is_empty(self):\n return self.items == []\n\n def push(self, item):\n self.items.append(item)\n\n def pop(self):\n return self.items.pop()\n\n def peek(self):\n return self.items[len(self.items)-1]\n\n def size(self):\n return len(self.items)\n\ndef bracket_pairs(s):\n l = len(s);\n stack = Stack(); i = 0; res = {}; flag = True\n while i < l and flag:\n if s[i] == \"(\": stack.push(i)\n elif s[i] == \")\":\n if stack.is_empty(): flag = False\n else: \n a = stack.pop()\n res[a] = i\n i += 1\n if flag and stack.is_empty(): return res\n return False", "def bracket_pairs(strng):\n matching_indexes = {}\n open_indexes = []\n for i, a in enumerate(strng):\n if a == '(':\n open_indexes.append(i)\n elif a == ')':\n try:\n matching_indexes[open_indexes.pop()] = i\n except IndexError:\n return False\n return matching_indexes if not open_indexes else False\n", "def bracket_pairs(string):\n opened = []\n result = {}\n for i, ch in enumerate(string):\n if ch == \"(\": \n opened.append((ch, i))\n elif ch == \")\":\n if not opened: return False\n result[opened[-1][1]] = i\n opened = opened[:-1]\n \n return False if opened else result\n", "def bracket_pairs(string):\n ob, res = [], {}\n \n for n,e in enumerate(string):\n if e == '(':\n ob.append(n)\n elif e == ')':\n if not ob:\n return False\n res[ob.pop()] = n\n return False if ob else res"]
{"fn_name": "bracket_pairs", "inputs": [["len(list)"], ["string"], [""], ["def f(x"], [")("], ["(a(b)c()d)"], ["f(x[0])"]], "outputs": [[{"3": 8}], [{}], [{}], [false], [false], [{"0": 9, "2": 4, "6": 7}], [{"1": 6}]]}
introductory
https://www.codewars.com/kata/5708e3f53f100874b60015ff
def bracket_pairs(string):
[ 7985, 264, 729, 892, 16275, 279, 9892, 315, 12579, 31642, 13530, 13, 576, 2550, 1265, 387, 264, 10997, 448, 6894, 279, 9892, 315, 279, 1787, 38929, 37880, 323, 2750, 279, 12159, 9892, 315, 279, 15316, 38929, 16667, 29636, 2461, 3110, 25...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,301
Give the summation of all even numbers in a Fibonacci sequence up to, but not including, the maximum value. The Fibonacci sequence is a series of numbers where the next value is the addition of the previous two values. The series starts with 0 and 1: 0 1 1 2 3 5 8 13 21... For example: ```python eve_fib(0)==0 eve_fib(33)==10 eve_fib(25997544)==19544084 ```
["def even_fib(m):\n x,y = 0, 1\n counter = 0\n while y < m:\n if y % 2 == 0:\n counter += y\n x,y = y, x+ y\n return counter", "def even_fib(m):\n a, b, total = 1, 1, 0\n \n while a < m:\n if a % 2 == 0:\n total += a\n a, b = b, a + b\n \n return total", "def even_fib(m):\n \"\"\"Returns the sum of all even numbers in a Fibonacci sequence\n up to the maximum value m (non-inclusive of m).\"\"\"\n \n a, b, evens_sum = 0, 1, 0\n\n while (a + b) < m:\n if (a + b) % 2 == 0:\n evens_sum += (a + b)\n\n a, b = b, (a + b)\n\n return evens_sum", "def even_fib(m):\n a,b,c=0,1,0\n while b<m:\n if b%2==0: c+=b\n a,b=b,a+b\n return c", "from itertools import takewhile\n\n\ndef efib():\n a, b = 0, 1\n while True:\n if a % 2 == 0:\n yield a\n a, b = b, a + b\n\n\ndef even_fib(m):\n return sum(takewhile(lambda x: x < m, efib()))", "from bisect import bisect_left\n\ndef gen():\n x, y = 0, 1\n while True:\n yield y\n x, y = y, x+y\nfib, memo, res = gen(), [0], [0]\n\ndef even_fib(m):\n while m > memo[-1]:\n val = next(fib)\n if val % 2 == 0:\n memo.append(val)\n res.append(res[-1] + val)\n return m > 0 and res[bisect_left(memo, m)-1]", "def even_fib(m):\n result = [0,1]\n while result[-1] < m:\n result.append(sum(result[-2:]))\n return sum(num for num in result if num%2 == 0 and num < m)", "def even_fib(m):\n a, b = 0, 1\n sum = 0\n while a < m:\n if a % 2 == 0:\n sum += a\n a, b = b, a + b\n return sum", "def even_fib(m):\n s=0\n a,b=1,1\n while a<m:\n if a%2==0:\n s+=a\n a,b=b,a+b\n return s", "def even_fib(m):\n a, b = 0, 1\n summ = 0\n while b < m:\n if b % 2 == 0:\n summ += b\n a,b = b, a + b\n return summ\n"]
{"fn_name": "even_fib", "inputs": [[0], [10], [5], [100], [1000], [1000000], [100000000], [1000000000], [2147483647], [-1]], "outputs": [[0], [10], [2], [44], [798], [1089154], [82790070], [350704366], [1485607536], [0]]}
introductory
https://www.codewars.com/kata/55688b4e725f41d1e9000065
def even_fib(m):
[ 35127, 279, 34259, 367, 315, 678, 1496, 5109, 304, 264, 79683, 8500, 705, 311, 11, 714, 537, 2670, 11, 279, 7192, 897, 382, 785, 79683, 8500, 374, 264, 4013, 315, 5109, 1380, 279, 1790, 897, 374, 279, 5256, 315, 279, 3681, 1378, 275...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,127
There are many anime that are about "love triangles": Alice loves Bob, and Charlie loves Bob as well, but Alice hates Charlie. You are thinking about an anime which has n characters. The characters are labeled from 1 to n. Every pair of two characters can either mutually love each other or mutually hate each other (there is no neutral state). You hate love triangles (A-B are in love and B-C are in love, but A-C hate each other), and you also hate it when nobody is in love. So, considering any three characters, you will be happy if exactly one pair is in love (A and B love each other, and C hates both A and B), or if all three pairs are in love (A loves B, B loves C, C loves A). You are given a list of m known relationships in the anime. You know for sure that certain pairs love each other, and certain pairs hate each other. You're wondering how many ways you can fill in the remaining relationships so you are happy with every triangle. Two ways are considered different if two characters are in love in one way but hate each other in the other. Print this count modulo 1 000 000 007. -----Input----- The first line of input will contain two integers n, m (3 ≤ n ≤ 100 000, 0 ≤ m ≤ 100 000). The next m lines will contain the description of the known relationships. The i-th line will contain three integers a_{i}, b_{i}, c_{i}. If c_{i} is 1, then a_{i} and b_{i} are in love, otherwise, they hate each other (1 ≤ a_{i}, b_{i} ≤ n, a_{i} ≠ b_{i}, $c_{i} \in \{0,1 \}$). Each pair of people will be described no more than once. -----Output----- Print a single integer equal to the number of ways to fill in the remaining pairs so that you are happy with every triangle modulo 1 000 000 007. -----Examples----- Input 3 0 Output 4 Input 4 4 1 2 1 2 3 1 3 4 0 4 1 0 Output 1 Input 4 4 1 2 1 2 3 1 3 4 0 4 1 1 Output 0 -----Note----- In the first sample, the four ways are to: Make everyone love each other Make 1 and 2 love each other, and 3 hate 1 and 2 (symmetrically, we get 3 ways from this). In the second sample, the only possible solution is to make 1 and 3 love each other and 2 and 4 hate each other.
["class DisjointSet(object):\n def __init__(self, n):\n self.parent = list(range(n))\n self.rank = [0] * n\n self.num = n # number of disjoint sets\n\n def union(self, x, y):\n self._link(self.find_set(x), self.find_set(y))\n\n def _link(self, x, y):\n if x == y:\n return\n self.num -= 1\n if self.rank[x] > self.rank[y]:\n self.parent[y] = x\n else:\n self.parent[x] = y\n if self.rank[x] == self.rank[y]:\n self.rank[y] += 1\n\n def find_set(self, x):\n xp = self.parent[x]\n if xp != x:\n self.parent[x] = self.find_set(xp)\n return self.parent[x]\n\n\ndef solve():\n n, m = list(map(int, input().split()))\n ds = DisjointSet(n * 2)\n for i in range(m):\n a, b, c = list(map(int, input().split()))\n a -= 1\n b -= 1\n aA = a * 2\n aB = aA + 1\n bA = b * 2\n bB = bA + 1\n if c == 0:\n if ds.find_set(aA) == ds.find_set(bA):\n return 0\n ds.union(aA, bB)\n ds.union(aB, bA)\n else:\n if ds.find_set(aA) == ds.find_set(bB):\n return 0\n ds.union(aA, bA)\n ds.union(aB, bB)\n return pow(2, (ds.num // 2) - 1, 10**9 + 7)\n\n\nprint(solve())\n", "class DSU(object):\n def __init__(self, n):\n self.father = list(range(n))\n self.size = n\n\n def union(self, x, s):\n x = self.find(x)\n s = self.find(s)\n if x == s:\n return\n self.father[s] = x\n self.size -= 1\n\n def find(self, x):\n xf = self.father[x]\n if xf != x:\n self.father[x] = self.find(xf)\n return self.father[x]\n\n\ndef is_invalid(a, b, ds):\n return ds.find(a) == ds.find(b)\n\n\nn, k = list(map(int, input().split()))\nds = DSU(n * 2)\nfor i in range(k):\n first, second, color = list(map(int, input().split()))\n first -= 1\n second -= 1\n if color == 0:\n if is_invalid(first, second, ds):\n print(0)\n return\n ds.union(first, second + n)\n ds.union(first + n, second)\n else:\n if is_invalid(first, second + n, ds):\n print(0)\n return\n ds.union(first, second)\n ds.union(first + n, second + n)\n\nsum = 1\nfor i in range(ds.size // 2 - 1):\n sum = (sum * 2) % (10 ** 9 + 7)\nprint(sum)\n"]
{ "inputs": [ "3 0\n", "4 4\n1 2 1\n2 3 1\n3 4 0\n4 1 0\n", "4 4\n1 2 1\n2 3 1\n3 4 0\n4 1 1\n", "100000 0\n", "100 3\n1 2 0\n2 3 0\n3 1 0\n", "9 2\n1 2 0\n2 3 0\n", "28567 13\n28079 24675 1\n18409 26720 1\n980 10815 1\n20794 16571 1\n7376 19861 1\n11146 706 1\n4255 16391 1\n27376 18263 1\n10019 28444 1\n6574 28053 1\n5036 16610 1\n3543 7122 1\n512 9554 1\n", "4 4\n1 2 0\n2 3 0\n2 4 0\n3 4 0\n", "4 3\n2 3 0\n3 4 0\n2 4 0\n", "6 6\n1 2 0\n2 3 1\n3 4 0\n4 5 1\n5 6 0\n6 1 1\n", "5 5\n1 2 0\n2 3 0\n3 4 0\n4 5 0\n1 5 0\n" ], "outputs": [ "4\n", "1\n", "0\n", "303861760\n", "0\n", "64\n", "928433852\n", "0\n", "0\n", "0\n", "0\n" ] }
competition
https://codeforces.com/problemset/problem/553/C
[ 3862, 525, 1657, 22809, 429, 525, 911, 330, 30053, 42446, 788, 29405, 15803, 14261, 11, 323, 24927, 15803, 14261, 438, 1632, 11, 714, 29405, 54306, 24927, 13, 1446, 525, 7274, 911, 458, 22809, 892, 702, 308, 5766, 13, 576, 5766, 525, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
526
Aureole the Techno-cultural fest of JEC thought of conducting a workshop on big data, as the topic is hot everyone wants to take part but due to limited seats in the Jashan Auditorium there is a selection criteria, a problem is given. the problem states a string is to be compressed when two or more consecutive characters are same they are to be compressed into one character and the original number count is to be written after it ex. aaabb -> a3b2 where every character is of 8bits and every integer is of 32bits you are asked to find the difference in size between original string and compressed string -----Input:----- - First line will contain $T$, number of testcases. Then the testcases follow. - Each testcase contains of a single line of input $S$ the string to be compressed. -----Output:----- For each testcase, output in a single line The difference in size. -----Constraints----- - $1 \leq T \leq 100$ - $1 \leq |S| \leq 10^5$ -----Subtasks----- - 40 points : S will contain only a-z - 60 points : S will contain 0-9 characters also -----Sample Input:----- 1 aaabb -----Sample Output:----- -40 -----EXPLANATION:----- the resulting string will be a3b2 its size will be 80, original string size will be 40 so ans= 40-80
["#include<sdg.h>\nfor _ in range(int(input())):\n s=input()\n n=len(s)\n if n==1:\n if s[0].isalpha(): print(\"-32\")\n else: print(0)\n else:\n num,ch=0,0\n p,q=0,0\n c=1\n x=s[0]\n ans=\"\"\n for i in range(1,n):\n if s[i-1]==s[i]:\n c+=1\n if i==n-1:\n ans+=s[i-1]\n ch+=1\n if c>1:\n ans+=str(c)\n num+=1\n c=1\n else:\n ans+=s[i-1]\n ch+=1\n if c>1:\n ans+=str(c)\n num+=1\n c=1\n if i==n-1:\n ans+=s[i]\n ch+=1\n #print(ans,num,ch)\n sol=(n*8)-((num*32)+(ch*8))\n print(sol)", "t=int(input())\nfor _ in range(t):\n s=input()\n x=\"\"\n i=0\n ans=0\n while i<len(s):\n x=s[i]\n c=1\n i+=1\n while i<len(s) and s[i]==x:\n i+=1\n c+=1\n if c==1:\n ans+=8\n else:\n ans+=40\n m=8*len(s)\n print(m-ans)\n", "# cook your dish here\nt=int(input())\nwhile t>0:\n c=input()\n len1=len(c)\n sum1=0\n l=[]\n for i in range(len1):\n sum1+=8\n sum2=8\n q=1\n for i in range(1,len1):\n if c[i]!=c[i-1]:\n if q>1:\n sum2+=32\n q=1 \n sum2+=8 \n else:\n q+=1 \n \n if q>1:\n sum2+=32 \n print(sum1-sum2)\n t-=1\n \n \n \n \n \n \n \n \n \n", "# cook your dish here\ndef compress(a):\n prev = None\n prev_c = 1\n ans_s=\"\"\n k=0\n for x in a:\n if prev == x:\n prev_c+=1\n else:\n if prev!=None:\n if prev_c!=1:\n ans_s = ans_s + str(prev) + str(prev_c)\n k+=40\n else:\n ans_s = ans_s + str(prev)\n k+=8\n prev_c=1\n prev =x\n if prev_c!=1:\n ans_s = ans_s + str(prev) + str(prev_c)\n k+=40\n else:\n ans_s = ans_s + str(prev)\n k+=8\n #print(ans_s)\n return k\nt=int(input())\nwhile(t):\n t=t-1\n a=input()\n ans = compress(a)\n size = 8*len(a)\n print( size - ans )", "#include<sdg.h>\nfor _ in range(int(input())):\n s=input()\n n=len(s)\n if n==1:\n if s[0].isalpha(): print(\"-32\")\n else: print(0)\n else:\n num,ch=0,0\n p,q=0,0\n c=1\n x=s[0]\n ans=\"\"\n for i in range(1,n):\n if s[i-1]==s[i]:\n c+=1\n if i==n-1:\n ans+=s[i]\n if s[i].isalpha(): ch+=1\n else: num+=1\n if c>1: \n ans+=str(c)\n num+=1\n c=1\n \n else:\n if s[i-1].isalpha():\n ch+=1\n ans+=s[i-1]\n if c>1: \n ans+=str(c)\n num+=1\n c=1\n else:\n ans+=s[i-1]\n num+=1\n if c>1: \n ans+=str(c)\n num+=1\n c=1\n if i==n-1:\n ans+=s[i]\n if s[i].isalpha(): ch+=1\n else: num+=1\n #print(ans,num,ch)\n alp,qt=0,0\n for i in range(n):\n if s[i].isalpha(): alp+=1\n else: qt+=1\n sol=((qt-num)*32)+((alp-ch)*8)\n print(sol)", "for _ in range(int(input())):\r\n s = input()\r\n curr = 0\r\n for i in range(len(s)):\r\n if(s[i].isdigit()):\r\n curr = curr + 32\r\n else:\r\n curr = curr + 8\r\n c = s[0]\r\n ans = s[0]\r\n count = 0\r\n d = dict()\r\n if(c.isdigit()):\r\n curr2 = 32\r\n else:\r\n curr2 = 8\r\n for i in range(len(s)):\r\n if(c ==s[i]):\r\n count +=1\r\n else:\r\n c = s[i]\r\n if(count!=1):\r\n ans = ans + str(count)\r\n curr2 += 32\r\n ans = ans + str(s[i])\r\n if(s[i].isdigit()):\r\n curr2 += 32\r\n else:\r\n curr2 += 8\r\n count = 1\r\n if(count!=1):\r\n ans = ans + str(count)\r\n curr2 += 32\r\n print(curr - curr2)\r\n\r\n\r\n\r\n\r\n", "t=int(input())\r\nfor i in range(t):\r\n s=input()\r\n l=len(s)\r\n sm=1\r\n total=0\r\n for j in range(1,l):\r\n if s[j-1]==s[j]:\r\n sm+=1\r\n else:\r\n if sm==1:\r\n total+=8\r\n else:\r\n total+=8\r\n total=total+32\r\n sm=1\r\n if s[j-1]==s[j]:\r\n sm+=1\r\n total+=8\r\n total=total+32\r\n else:\r\n if sm==1:\r\n total+=8\r\n else:\r\n total+=8\r\n total=total+32\r\n print(l*8-total)", "t = int(input())\n\nwhile t:\n t -= 1\n string = input()\n l = len(string)\n temp = string[0]\n occ = 1\n\n pre = 0\n this = 0\n\n for i in range(1, l):\n if string[i] == temp:\n occ += 1\n else:\n if occ != 1:\n pre += occ * 8\n this += 40\n else:\n pre += 8\n this += 8\n occ = 1\n temp = string[i]\n if occ == 1:\n pre += 8\n this += 8\n else:\n pre += 8 * occ\n this += 40\n print(pre-this)\n\n", "# cook your dish here\nfor _ in range(int(input())):\n s=input()\n size1=8*len(s)\n size2=8\n i=1\n while i<len(s):\n if s[i]==s[i-1]:\n while s[i]==s[i-1]:\n i+=1\n if i>=len(s):\n break\n size2+=32\n else:\n size2+=8\n i+=1\n print(size1-size2)", "# cook your dish here\nn = int(input())\nfor i in range(n):\n s = str(input())\n o_l = len(s)*8\n n_l = 0\n t = 0\n for i in range(len(s)-1):\n if s[i] ==s[i+1]:\n t+=1\n else:\n if(t>=1):\n n_l += 32+8\n else:\n n_l += 8\n t = 0\n if(t>=1):\n n_l += 32+8\n else:\n n_l += 8\n print(o_l-n_l)\n", "# cook your dish here\ntemp=[]\nt=int(input())\nfor _ in range(t):\n s=input()\n l=list(s)\n x=len(l)*8\n \n i=0\n y=0\n while i<(len(l)):\n count=0\n while i<(len(l)-1) and l[i]==l[i+1] :\n \n count+=1\n \n \n i+=1\n if count==0:\n y+=8\n else:\n y+=40\n i=i+1\n temp.append(x-y)\nfor i in temp:\n print(i)", "for _ in range(int(input())):\r\n s = input()\r\n curr = 0\r\n for i in range(len(s)):\r\n if(s[i].isdigit()):\r\n curr = curr + 32\r\n else:\r\n curr = curr + 8\r\n c = s[0]\r\n ans = s[0]\r\n count = 0\r\n d = dict()\r\n if(c.isdigit()):\r\n curr2 = 32\r\n else:\r\n curr2 = 8\r\n for i in range(len(s)):\r\n if(c ==s[i]):\r\n count +=1\r\n else:\r\n if(c.isdigit()):\r\n curr2 +=32\r\n else:\r\n curr2+=8\r\n c = s[i]\r\n if(count!=1):\r\n ans = ans + str(count)\r\n curr2 += 32\r\n ans = ans + str(s[i])\r\n count = 1\r\n if(count!=1):\r\n ans = ans + str(count)\r\n curr2 += 32\r\n print(curr - curr2)\r\n\r\n\r\n\r\n\r\n", "# cook your dish here\nt=int(input())\nwhile t>0:\n c=input()\n len1=len(c)\n sum1=0\n l=[]\n for i in range(len1):\n if c[i].isalpha():\n sum1+=8\n else:\n sum1+=32\n sum2=0\n l.append(c[0])\n q=1\n for i in range(1,len1):\n if c[i].isalpha():\n if c[i]==c[i-1]:\n q+=1 \n else:\n if q>1:\n l.append(q)\n l.append(c[i])\n q=1 \n else:\n if q>1:\n l.append(q)\n q=1 \n l.append(c[i])\n if c[len1-1].isalpha():\n if q>1:\n l.append(q)\n for i in l:\n if str(i).isalpha():\n sum2+=8 \n else:\n sum2+=32\n print(sum1-sum2)\n t-=1\n \n \n \n \n \n", "from collections import Counter\nfor _ in range(int(input())):\n S = list(map(str,input()))\n original = 8\n new = 0\n if S[0].isdigit():\n original = 32\n lst = [S[0]]\n lst1 = [1]\n \n b = 0\n for i in range(1, len(S)):\n if S[i].isdigit():\n original += 32\n else:\n original += 8\n \n if S[i]==lst[-1]:\n lst1[-1]+=1\n else:\n lst.append(S[i])\n lst1.append(1)\n \n for i in range(len(lst)):\n if lst[i].isdigit():\n if lst1[i] > 1:\n new += 64\n else:\n new += 32\n \n else:\n if lst1[i] > 1:\n new += 40\n else:\n new += 8\n \n print(original-new)", "from collections import Counter\nfor _ in range(int(input())):\n S = list(map(str,input()))\n original = 8\n new = 8\n if S[0].isdigit():\n original = 32\n new = 32\n a = S[0]\n b = 0\n for i in range(1, len(S)):\n if S[i].isdigit():\n original += 32\n else:\n original += 8\n \n if S[i]==a:\n b = 32\n else:\n new += b\n b = 0\n a = S[i]\n if S[i].isdigit():\n new += 32\n else:\n new += 8\n new += b\n print(original-new)", "try:\n for _ in range(int(input())):\n s=input()\n l=len(s)\n k=8*l\n p=8\n t=0\n for i in range(1,l):\n if(s[i]==s[i-1]):\n if(t==0):\n p+=32\n t=1\n else:\n p+=8\n t=0\n print(k-p)\nexcept EOFError as e:\n pass", "# cook your dish here\ntest = int(input())\nfor t in range(test):\n s = input()\n prev = s[0]\n total = 0\n count = 0\n for i in s:\n if i == prev:\n count += 1\n else:\n if(count==0 or count == 1):\n total += 8\n else:\n total += 40\n count = 1\n prev = i\n \n if(s[len(s)-1] == s[len(s)-2]):\n total += 40\n else:\n total += 8\n #print(total)\n diff = (len(s)*8) - (total)\n print(diff)", "from collections import Counter\nfor _ in range(int(input())):\n S = list(map(str,input()))\n original = 8\n new = 8\n if S[0].isdigit():\n original = 32\n new = 32\n a = S[0]\n b = 0\n for i in range(1, len(S)):\n if S[i].isdigit():\n original += 32\n new += 32\n else:\n original += 8\n if S[i]==a:\n b = 32\n else:\n new += b+8\n b = 0\n a = S[i]\n new +=b\n print(original-new)\n", "def fac(a):\r\n s=1\r\n for i in range(1,a+1):\r\n s=s*i\r\n return s\r\n\r\ndef prime(n):\r\n n=int(n)\r\n if(n==2 or n==3):\r\n return 1\r\n k=n**(1/2)\r\n for i in range(2,int(k)+2):\r\n if(n%i==0):\r\n return 0\r\n return 1\r\n\r\n\r\ndef sieve(n):\r\n arr=[]\r\n prime = [True for i in range(n+1)]\r\n p = 2\r\n while (p * p <= n):\r\n if (prime[p] == True):\r\n for i in range(p * 2, n+1, p):\r\n prime[i] = False\r\n p += 1\r\n for p in range(2, n):\r\n if prime[p]:\r\n arr.append(p)\r\n return arr\r\n\r\n\r\n\r\n\r\nt=int(input())\r\n# n,m=[int(x) for x in input().split()]\r\n\r\nfor ii in range(t):\r\n s=input()\r\n prev=s[0]\r\n ss=[]\r\n c=1\r\n for i in s[1:]:\r\n if(i!=prev):\r\n if(c==1):\r\n ss.append('p'+prev)\r\n else:\r\n ss.append('p'+prev)\r\n ss.append(str(c))\r\n prev=i\r\n c=1\r\n else:\r\n c+=1\r\n\r\n if(c==1):\r\n ss.append('p'+prev)\r\n else:\r\n ss.append('p'+prev)\r\n ss.append(str(c))\r\n hah='0987654321'\r\n s1=0\r\n s2=0\r\n\r\n\r\n s1=8*(len(s))\r\n for i in ss:\r\n if (i[0] in hah):\r\n s2 += 32\r\n else:\r\n s2 += 8\r\n # print(s,ss)\r\n print(s1-s2)\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n", "# cook your dish here\r\nfrom sys import stdin, stdout\r\nimport math\r\nfrom itertools import permutations, combinations\r\nfrom collections import defaultdict\r\nfrom bisect import bisect_left \r\nfrom bisect import bisect_right\r\n \r\ndef L():\r\n return list(map(int, stdin.readline().split()))\r\n \r\ndef In():\r\n return list(map(int, stdin.readline().split()))\r\n \r\ndef I():\r\n return int(stdin.readline())\r\n \r\nP = 1000000007\r\ndef main():\r\n for t in range(I()):\r\n s = input()\r\n st = s[0]\r\n i = 1\r\n c1, c2 = 1, 0\r\n while i < len(s):\r\n if s[i] == s[i-1]:\r\n j = i \r\n c = 0\r\n while j < len(s) and s[j] == s[i-1]:\r\n c += 1 \r\n j += 1 \r\n if c != 0:\r\n c2 += 1\r\n i = j-1 \r\n st += str(c+1)\r\n else:\r\n st += s[i]\r\n c1 += 1\r\n i += 1 \r\n print(len(s)*8 -(c1*8+c2*32))\r\n \r\ndef __starting_point():\r\n main()\r\n\n__starting_point()"]
{"inputs": [["1", "aaabb"]], "outputs": [["-40"]]}
interview
https://www.codechef.com/COPT2020/problems/AUREOLE
[ 32, 552, 1263, 279, 7001, 78, 93426, 18859, 315, 619, 7498, 3381, 315, 30374, 264, 25073, 389, 2409, 821, 11, 438, 279, 8544, 374, 4017, 5019, 6801, 311, 1896, 949, 714, 4152, 311, 7199, 16312, 304, 279, 619, 988, 276, 61392, 2356, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
771
Sultan, the freestyle wrestler, you all know him. He broke multiple records in the history of all wrestling leagues. Now 20 years have passed, Sultan has grown old. He has two sons, he wants them to be like him. Sultan being orthodox goes to his astrologer, where he is told that his sons shall be invincible like him. Sultan starts to train them. After training, his son Multan & Fultan, having strengths are M and F respectively, decide to fight. They can defeat if the strength of challengers Si is a positive integer multiple of their strength else they lose. Multan fights first, then Fultan. A challenger once knocked out cannot challenge them again. Sultan's sons are still not very good wrestlers. Sultan considers them wrestlers if they both combined are able to win at least 70% of the all the fights. Also, he wants to know who is a better wrestler of the two. Your task is to help Sultan in this venture. Print "Yes" (without quotes) if they are able to win, else print "No" (without quotes). If yes, also name whether, "Multan" or "Fultan" is a better wrestler, if both win equally print “Both”. -----Input----- - First line contains single integer T denoting test cases. - Second Line contains single integer N for number of challengers. - Third Line contains space separated two integer denoting strength M & F - Next Line contains strength space separated N integer ith of which denoting Si of N challengers respectively. -----Output----- - Yes or No corresponding the result. - Also, if Yes, print, Multan, Fultan, Both accordingly. -----Constraints----- - 1 ≤ T ≤ 100 - 1 ≤ N ≤ 1000 - 1 ≤ M, F ≤ 109 - 0 ≤ Si ≤ 109 -----Example----- Input: 2 7 2 3 4 5 7 8 9 10 14 6 5 7 1 2 8 9 10 11 Output: Yes Multan No -----Explanation----- Example case 1. Multan (M) defeats total 4 challengers with strengths 4, 8, 10, 14 and Fultan (F) defeats 1 challenger with strength 9. Their total wins are 5 out of 7 and win accuracy of 71.4%. Hence, 'Yes' and since Multan is better wrestler so 'Multan' Example case 2. Multan defeats 1 and Fultan defeat 0 challengers. Total wins 1 out of 6 with accuracy 16.67% Hence, No.
["from operator import itemgetter\nt=int(input())\nfor i in range(t):\n n=int(input())\n m,f=list(map(int,input().split()))\n x=list(map(int,input().split()))\n my,fy=0,0\n check=[0]*n\n #print check\n for j in range(n):\n if x[j]>0 and x[j]%m==0 and check[j]==0:\n check[j]=1\n my+=1\n #print check\n for j in range(n):\n if x[j]>0 and x[j]%f==0 and check[j]==0:\n check[j]=1\n fy+=1\n if ((((my+fy)*1.0)/n)*100)>=70:\n print(\"Yes\")\n if my>fy:\n print(\"Multan\")\n elif fy>my:\n print(\"Fultan\")\n else:\n print(\"Both\")\n else:\n print(\"No\") \n #print check\n", "t=eval(input())\nwhile t:\n n=eval(input())\n m,f=list(map(int,input().split()))\n multan=0\n total=0\n fultan=0\n s=list(map(int,input().split()))\n for i in s:\n if i==0:\n continue\n if i%m==0:\n multan+=1;\n total+=1\n elif i%f==0:\n fultan+=1\n total+=1\n if total-0.7*n>=0.0:\n print(\"Yes\")\n if multan>fultan:\n print(\"Multan\")\n elif fultan>multan:\n print(\"Fultan\")\n else:\n print(\"Both\")\n else:\n print(\"No\")\n #print total,multan,fultan\n t-=1\n", "t=eval(input())\nwhile t:\n n=eval(input())\n m,f=list(map(int,input().split()))\n multan=0\n total=0\n fultan=0\n s=list(map(int,input().split()))\n for i in s:\n if i==0:\n continue\n if i%m==0:\n multan+=1;\n total+=1\n elif i%f==0:\n fultan+=1\n total+=1\n if total-0.7*n>=0.0:\n print(\"Yes\")\n if multan>fultan:\n print(\"Multan\")\n elif fultan>multan:\n print(\"Fultan\")\n else:\n print(\"Both\")\n else:\n print(\"No\")\n #print total,multan,fultan\n t-=1\n", "for _ in range(eval(input())):\n n = eval(input())\n [m,f] = list(map(int,input().split()))\n s = list(map(int,input().split()))\n mc = fc = 0\n for i in s:\n if i > 0 and i%m==0:\n mc += 1\n elif i > 0 and i%f==0:\n fc += 1 \n \n total = mc + fc \n if total < 0.7*n:\n print('No')\n else:\n print('Yes')\n if mc == fc:\n print('Both')\n elif mc > fc:\n print('Multan')\n else:\n print('Fultan')"]
{"inputs": [["2", "7", "2 3", "4 5 7 8 9 10 14", "6", "5 7", "1 2 8 9 10 11"]], "outputs": [["Yes", "Multan", "No"]]}
interview
https://www.codechef.com/CDGO2016/problems/CDGO1602
[ 50, 60093, 11, 279, 3457, 37383, 82062, 11, 498, 678, 1414, 1435, 13, 1260, 14422, 5248, 7424, 304, 279, 3840, 315, 678, 35440, 38359, 13, 4695, 220, 17, 15, 1635, 614, 5823, 11, 74986, 702, 14700, 2310, 13, 1260, 702, 1378, 25350, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,309
# Description: Replace the pair of exclamation marks and question marks to spaces(from the left to the right). A pair of exclamation marks and question marks must has the same number of "!" and "?". That is: "!" and "?" is a pair; "!!" and "??" is a pair; "!!!" and "???" is a pair; and so on.. # Examples ``` replace("!!") === "!!" replace("!??") === "!??" replace("!?") === " " replace("!!??") === " " replace("!!!????") === "!!!????" replace("!??!!") === "! " replace("!????!!!?") === " ????!!! " replace("!?!!??!!!?") === " !!!?" ```
["from itertools import groupby\n\ndef replace(s):\n queue, rle = {}, [[i, k, len(list(g))] for i, (k, g) in enumerate(groupby(s))]\n for i, k, l in reversed(rle):\n if l not in queue: queue[l] = {}\n queue[l].setdefault(k, []).append(i)\n for l in queue:\n while sum(map(bool, queue[l].values())) > 1:\n for c in queue[l]: rle[queue[l][c].pop()][1] = ' '\n return ''.join(k * l for i, k, l in rle)", "import re\n\ndef replace(s):\n dic = {'!': '?', '?': '!'}\n r = re.findall(r'[!]+|[/?]+', s)\n for i in r[:]:\n ii =dic[i[0]] * len(i)\n if ii in r:\n r[r.index(ii)] = ' ' * len(i) \n return ''.join(r)", "import itertools as it\nfrom collections import Counter, defaultdict\nfrom functools import reduce\n\ndef tokenize(s):\n for key, group in it.groupby(s):\n yield key, len(list(group))\n\ndef gather(tokens, expected_keys = None):\n stats = defaultdict(Counter)\n tokens = it.chain(tokens, ((key,0) for key in expected_keys or []))\n for key, length in tokens:\n stats[key][length] +=1\n return stats\n\ndef intersect(*counters, ignored_keys=None):\n mins = reduce(lambda a, b: a & b, counters)\n for key in ignored_keys:\n mins.pop(key, None)\n return +mins\n \ndef substitute(tokens, counters, replacement_key):\n for key, length in tokens:\n if counters[key][length]:\n counters[key][length] -= 1\n yield replacement_key, length\n else:\n yield key, length \ndef detokenize(tokens):\n return ''.join(key * length for key, length in tokens)\n \ndef replace(s):\n tokens = list(tokenize(s))\n stats = gather(tokenize(s), expected_keys='!?')\n mins = intersect(*list(stats.values()), ignored_keys = [0])\n replaced_counts = {key: mins.copy() for key in stats}\n replaced_tokens = substitute(tokens, replaced_counts, ' ')\n return detokenize(replaced_tokens)\n \n", "from itertools import groupby\n\ndef replace(stg):\n g = [\"\".join(s) for _, s in groupby(stg)]\n l = len(g)\n for i in range(l):\n for j in range(i+1, l, 2):\n if \" \" not in f\"{g[i]}{g[j]}\" and len(g[i]) == len(g[j]):\n g[i] = g[j] = \" \" * len(g[i])\n return \"\".join(g)", "from itertools import groupby\nfrom collections import defaultdict\n\ndef replace(s):\n res, D = [], {'!':defaultdict(list), '?':defaultdict(list)}\n for i, (k, l) in enumerate(groupby(s)):\n s = len(list(l))\n D[k][s].append(i)\n res.append([k, s])\n for v, L1 in D['!'].items():\n L2 = D['?'][v]\n while L1 and L2:\n res[L1.pop(0)][0] = ' '\n res[L2.pop(0)][0] = ' '\n return ''.join(c*v for c,v in res)", "from itertools import groupby\nfrom collections import defaultdict\n\ntbl = str.maketrans('!?', '?!')\n\ndef replace(s):\n xs = [''.join(grp) for _, grp in groupby(s)]\n stacks = defaultdict(list)\n result = []\n for i, x in enumerate(xs):\n stack = stacks[x]\n if stack:\n result[stack.pop(0)] = x = ' ' * len(x)\n else:\n stacks[x.translate(tbl)].append(i)\n result.append(x)\n return ''.join(result)", "from collections import defaultdict, deque\nimport re\n\ndef replace(s):\n chunks = re.findall(r'!+|\\?+', s)\n cnts = defaultdict(deque)\n for i,c in enumerate(chunks[:]):\n other = '!?'[c[0]=='!'] * len(c)\n if cnts[other]:\n blank = ' '*len(c)\n chunks[i] = chunks[cnts[other].popleft()] = blank\n else:\n cnts[c].append(i)\n \n return ''.join(chunks)", "from itertools import groupby\ndef replace(s):\n g = [\"\".join(j) for i, j in groupby(s)]\n for i, j in enumerate(g):\n for k, l in enumerate(g[i+1:], start=i + 1):\n if len(j) == len(l) and j[0] != l[0] and ' ' not in j+l:\n g[i] = g[k] = \" \" * len(j) \n break\n return \"\".join(g)", "from collections import Counter\nfrom itertools import chain, groupby, repeat, starmap\n\nC2D = {'!': 1, '?': -1}\n\ndef replace(s):\n gs = [(c, sum(1 for _ in g)) for c, g in groupby(s)]\n ds = Counter()\n for c, k in gs:\n ds[k] += C2D[c]\n for i in reversed(list(range(len(gs)))):\n c, k = gs[i]\n if ds[k] * C2D[c] > 0:\n ds[k] -= C2D[c]\n else:\n gs[i] = ' ', k\n return ''.join(chain.from_iterable(starmap(repeat, gs)))\n", "import itertools as it\nfrom collections import Counter, defaultdict\nfrom functools import reduce\n\ndef tokenize(string):\n groups = it.groupby(string)\n for key, group in groups:\n yield key, len(list(group))\n \ndef gather(tokens, expected_keys=None):\n stats = defaultdict(Counter)\n tokens = it.chain(tokens, ((key, 0) for key in expected_keys or []))\n for key, length in tokens:\n stats[key][length] += 1\n return stats\n \ndef intersect(*counters, ignored_keys=None):\n mins = reduce(lambda a, b: a & b, counters)\n for key in ignored_keys or []:\n mins.pop(key, None)\n return +mins\n \ndef remove(tokens, counters, replacement_key):\n for key, length in tokens:\n if counters[key][length]:\n counters[key][length] -= 1\n yield replacement_key, length\n else:\n yield key, length\n \ndef detokenize(tokens):\n return ''.join(key * length for key, length in tokens)\n\ndef replace(s):\n tokens = list(tokenize(s))\n stats = gather(tokens, expected_keys='!?')\n mins = intersect(*list(stats.values()), ignored_keys=[0])\n replace_counts = {key: mins.copy()for key in stats}\n replaced_tokens = remove(tokens, replace_counts, ' ')\n return detokenize(replaced_tokens)\n \n"]
{"fn_name": "replace", "inputs": [["!!?!!?!!?!!?!!!??!!!??!!!??"], ["??!??!??!??!???!!???!!???!!"], ["?!!?!!?!!?!!!??!!!??!!!??!!!??!!!??"]], "outputs": [[" ? ? ?!!?!!! !!! !!! "], [" ! ! !??!??? ??? ??? "], ["? ? ? ?!!! !!! !!! !!!??!!!??"]]}
introductory
https://www.codewars.com/kata/57fb2c822b5314e2bb000027
def replace(s):
[ 2, 7662, 1447, 29558, 279, 6716, 315, 505, 32984, 15423, 323, 3405, 15423, 311, 12621, 17016, 279, 2115, 311, 279, 1290, 568, 362, 6716, 315, 505, 32984, 15423, 323, 3405, 15423, 1969, 702, 279, 1852, 1372, 315, 330, 8958, 323, 27244, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,030
Implement a function which creates a **[radix tree](https://en.wikipedia.org/wiki/Radix_tree)** (a space-optimized trie [prefix tree]) in which each node that is the only child is merged with its parent [unless a word from the input ends there]) from a given list of words using dictionaries (aka hash maps or hash tables) where: 1. The dictionary keys are the nodes. 2. Leaf nodes are empty dictionaries. 3. The value for empty input is an empty dictionary. 4. Words are all lowercase or empty strings. 5. Words can contain duplicates. ### Examples: ```python >>> radix_tree() {} >>> radix_tree("") {} >>> radix_tree("", "") {} >>> radix_tree("radix", "tree") {"radix": {}, "tree": {}} >>> radix_tree("ape", "apple") {"ap": {"e": {}, "ple": {}}} >>> radix_tree("apple", "applet", "apple", "ape") {"ap": {"ple": {"t": {}}, "e": {}}} >>> radix_tree("romane", "romanus", "romulus", "rubens", "rubicon", "rubicundus") {"r": {"om": {"an": {"e": {}, "us": {}}, "ulus": {}}, "ub": {"ens": {}, "ic": {"on": {}, "undus": {}}}}} >>> radix_tree("appleabcd", "apple") {"apple": {"abcd": {}}} ```
["from itertools import groupby\nfrom operator import itemgetter\nfrom os.path import commonprefix\n\nfirst = itemgetter(0)\n\ndef radix_tree(*words):\n words = [w for w in words if w]\n result = {}\n for key, grp in groupby(sorted(words), key=first):\n lst = list(grp)\n prefix = commonprefix(lst)\n result[prefix] = radix_tree(*(w[len(prefix):] for w in lst))\n return result", "def radix_tree(*words):\n byFirstChar={}\n for w in words:\n if w != \"\":\n l=byFirstChar.get(w[0],[])\n l.append(w[1:])\n byFirstChar[w[0]]=l\n result={}\n for c,l in byFirstChar.items():\n rt=radix_tree(*l)\n if len(rt) == 1 and not '' in l:\n for key,value in rt.items():\n c=c+key\n rt=value\n result[c]=rt\n return result", "from itertools import groupby\ndef radix_tree(*d, need=1):\n if not {i for i in d if i} : return {} \n store = {}\n for i, j in groupby(sorted(d) if need else d, lambda x: x[0]):\n words = list(j)\n if len(words) == 1 : store[words[0]] = {}\n else:\n common = next((j for j, i in enumerate(zip(*words)) if len(set(i)) != 1), len(min(words, key=len)))\n store[words[0][:common]] = radix_tree(*[i[common:] for i in words if i[common:]],need = 0)\n return store", "from os.path import commonprefix\n\ndef radix_tree(*words):\n groups = {}\n for word in words:\n if word:\n groups[word[0]] = groups.get(word[0], []) + [word]\n root = {}\n for group in groups.values():\n prefix = commonprefix(group)\n root[prefix] = radix_tree(*(w[len(prefix):] for w in group))\n return root", "def radix_tree(*W):\n D={}\n for w in W:\n if w:D[w[0]]=D.get(w[0],[])+[w[1:]]\n Z={}\n for k in D:\n T=radix_tree(*D[k])\n if len(T)==1and''not in D[k]:\n for j in T:k,T=k+j,T[j]\n Z[k]=T\n return Z", "def radix_tree(*a):\n r = {}\n for s in a:\n d = r\n for x in s + \"*\":\n if x not in d: d[x] = {}\n d = d[x]\n def g(d):\n dd = {}\n for x in d:\n d[x] = g(d[x])\n if len(d[x]) == 1:\n k, v = [*d[x].items()][0]\n dd[x+k] = v\n else:\n dd[x] = d[x]\n return dd\n def h(d):\n dd = {}\n for x in d:\n d[x] = h(d[x])\n if x != \"*\":\n dd[x if x[-1] != \"*\" else x[:-1]] = d[x]\n return dd\n return h(g(r))", "def radix_tree(*Q) :\n U,R = set(Q),{}\n for Q in Q :\n T = R\n for Q in Q :\n if not Q in T : T[Q] = {}\n T = T[Q]\n def H(Q,S) :\n T = list(Q)\n for V in T :\n if 1 == len(Q[V]) and (S + V) not in U :\n B = next(iter(Q[V]))\n Q[V + B] = Q[V][B]\n del Q[V]\n T.append(V + B)\n else : H(Q[V],S + V)\n H(R,'')\n return R", "from itertools import groupby\n\ndef radix_tree(*words):\n d = {}\n if not any(words): return d\n words = sorted(words)\n for g in (list(g) for _,g in groupby(words, key=lambda w:w[0] if w else '')):\n i = next((i for i in range(len(g[0])) if not all(len(w) > i and w[i] == g[0][i] for w in g)), len(g[0]))\n d[g[0][:i]] = radix_tree(*(w[i:] for w in g if len(w) > i))\n return d\n \n \n", "from itertools import groupby\ndef radix_tree(*d):\n if not {i for i in d if i} : return {} \n store = {}\n for i, j in groupby(sorted(d), lambda x: x[0]):\n words = list(j)\n if len(words) == 1 : store[words[0]] = {}\n else:\n common = next((j for j, i in enumerate(zip(*words)) if len(set(i)) != 1), len(min(words, key=len)))\n store[words[0][:common]] = radix_tree(*[i[common:] for i in words if i[common:]])\n return store", "from functools import reduce\n\ndef splitAlong(xs, ys):\n i = 0\n try:\n while xs[i] == ys[i]:\n i += 1\n except IndexError:\n pass\n return (xs[:i], xs[i:], ys[i:])\n\ndef insert(tree, word):\n for key, val in tree.items():\n pref, wt, kt = splitAlong(word, key)\n if pref:\n if kt:\n del tree[key]\n tree[pref] = {wt: {}, kt: val} if wt else {kt: val}\n else:\n insert(tree[pref], wt)\n return tree\n if word:\n tree[word] = {}\n return tree\n\n\ndef radix_tree(*words):\n return reduce(insert, words, {})"]
{"fn_name": "radix_tree", "inputs": [[""], ["abc", "def", "ghi", "jklm", "nop"], ["ape", "apple"], ["ape", "appendix", "apel"], ["ape", "apple", "applet", "appendix"], ["romane", "romanus", "romulus"], ["test", "tester", "testers"], ["test", "tester", "testers", "tester"], ["testers", "tester", "test"]], "outputs": [[{}], [{"abc": {}, "def": {}, "ghi": {}, "jklm": {}, "nop": {}}], [{"ap": {"e": {}, "ple": {}}}], [{"ap": {"e": {"l": {}}, "pendix": {}}}], [{"ap": {"e": {}, "p": {"le": {"t": {}}, "endix": {}}}}], [{"rom": {"an": {"e": {}, "us": {}}, "ulus": {}}}], [{"test": {"er": {"s": {}}}}], [{"test": {"er": {"s": {}}}}], [{"test": {"er": {"s": {}}}}]]}
introductory
https://www.codewars.com/kata/5c9d62cbf1613a001af5b067
def radix_tree(*words):
[ 62980, 264, 729, 892, 715, 58519, 264, 3070, 58, 13281, 941, 4916, 9533, 2428, 1110, 268, 33366, 2659, 25502, 19382, 329, 941, 11663, 32295, 320, 64, 3550, 12, 98868, 59067, 508, 11849, 4916, 2467, 715, 258, 892, 1817, 2436, 429, 374, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,620
=====Function Descriptions===== collections.deque() A deque is a double-ended queue. It can be used to add or remove elements from both ends. Deques support thread safe, memory efficient appends and pops from either side of the deque with approximately the same O(1) performance in either direction. Example Code >>> from collections import deque >>> d = deque() >>> d.append(1) >>> print d deque([1]) >>> d.appendleft(2) >>> print d deque([2, 1]) >>> d.clear() >>> print d deque([]) >>> d.extend('1') >>> print d deque(['1']) >>> d.extendleft('234') >>> print d deque(['4', '3', '2', '1']) >>> d.count('1') 1 >>> d.pop() '1' >>> print d deque(['4', '3', '2']) >>> d.popleft() '4' >>> print d deque(['3', '2']) >>> d.extend('7896') >>> print d deque(['3', '2', '7', '8', '9', '6']) >>> d.remove('2') >>> print d deque(['3', '7', '8', '9', '6']) >>> d.reverse() >>> print d deque(['6', '9', '8', '7', '3']) >>> d.rotate(3) >>> print d deque(['8', '7', '3', '6', '9']) =====Problem Statement===== Perform append, pop, popleft and appendleft methods on an empty deque d. =====Input Format===== The first line contains an integer N, the number of operations. The next N lines contains the space separated names of methods and their values. =====Constraints===== 0<N≤100 =====Output Format===== Print the space separated elements of deque d.
["import collections\nn = int(input())\nd = collections.deque()\nfor i in range(n):\n cmd = list(input().strip().split())\n opt = cmd[0]\n if opt == 'pop':\n d.pop()\n elif opt == 'popleft':\n d.popleft()\n elif opt == 'append':\n d.append(int(cmd[1]))\n elif opt == 'appendleft':\n d.appendleft(int(cmd[1]))\nfor i in d:\n print(i,end=' ')\n\n \n", "#!/usr/bin/env python3\n\nfrom collections import deque\n\ndef __starting_point():\n num = int(input().strip())\n deq = deque()\n \n for _ in range(num):\n args = input().strip().split()\n \n if args[0] == 'append':\n deq.append(args[1])\n elif args[0] == 'appendleft':\n deq.appendleft(args[1])\n elif args[0] == 'pop':\n deq.pop()\n elif args[0] == 'popleft':\n deq.popleft()\n \n out = []\n for el in deq:\n out.append(el)\n \n print(\" \".join(map(str, out)))\n__starting_point()"]
{"inputs": ["6\nappend 1\nappend 2\nappend 3\nappendleft 4\npop\npopleft"], "outputs": ["1 2"]}
introductory
https://www.hackerrank.com/challenges/py-collections-deque/problem
# Enter your code here. Read input from STDIN. Print output to STDOUT
[ 46725, 5152, 3874, 24685, 64897, 51137, 2285, 591, 741, 32, 41950, 374, 264, 1990, 83075, 7177, 13, 1084, 646, 387, 1483, 311, 912, 476, 4057, 5424, 504, 2176, 10335, 382, 1912, 13968, 1824, 4516, 6092, 11, 4938, 11050, 906, 1412, 323, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,791
# Task You are given a `moment` in time and space. What you must do is break it down into time and space, to determine if that moment is from the past, present or future. `Time` is the sum of characters that increase time (i.e. numbers in range ['1'..'9']. `Space` in the number of characters which do not increase time (i.e. all characters but those that increase time). The moment of time is determined as follows: ``` If time is greater than space, than the moment is from the future. If time is less than space, then the moment is from the past. Otherwise, it is the present moment.``` You should return an array of three elements, two of which are false, and one is true. The true value should be at the `1st, 2nd or 3rd` place for `past, present and future` respectively. # Examples For `moment = "01:00 pm"`, the output should be `[true, false, false]`. time equals 1, and space equals 7, so the moment is from the past. For `moment = "12:02 pm"`, the output should be `[false, true, false]`. time equals 5, and space equals 5, which means that it's a present moment. For `moment = "12:30 pm"`, the output should be `[false, false, true]`. time equals 6, space equals 5, so the moment is from the future. # Input/Output - `[input]` string `moment` The moment of time and space that the input time came from. - `[output]` a boolean array Array of three elements, two of which are false, and one is true. The true value should be at the 1st, 2nd or 3rd place for past, present and future respectively.
["def moment_of_time_in_space(moment):\n d = sum(int(c) if c in '123456789' else -1 for c in moment)\n return [d < 0, d == 0, d > 0]", "def moment_of_time_in_space(moment):\n time = sum(int(c) for c in moment if c in \"123456789\")\n space = sum(c not in \"123456789\" for c in moment)\n return [time < space, time == space, time > space]", "def moment_of_time_in_space(moment):\n time = 0\n space = 0\n for ch in moment:\n if ch == '0' or not ch.isdigit():\n space += 1\n elif ch in '123456789':\n time += int(ch)\n return [time < space, time == space, time > space]", "def moment_of_time_in_space(moment):\n t = sum(int(d) for d in moment if d.isdigit() and d!='0')\n s = sum(c=='0' or not c.isdigit() for c in moment)\n \n return [t<s, t==s, t>s]", "from re import findall\ndef moment_of_time_in_space(moment):\n time=sum(map(int,findall(\"\\d\",moment)))\n space=len(findall(\"[^1-9]\",moment))\n states=[False for _ in range(3)]\n if time>space:states[2]=True\n elif time<space:states[0]=True\n else:states[1]=True\n return states", "def moment_of_time_in_space(s):\n a = [int(x) for x in s if \"1\" <= x <= \"9\"]\n n, m = sum(a), len(s) - len(a)\n return [n < m, n == m, n > m]", "def moment_of_time_in_space(moment):\n time = int(moment[0]) + int(moment[1]) + int(moment[3]) + int(moment[4])\n space = 4 + moment.count(\"0\")\n return [time < space, time == space, time > space]", "def moment_of_time_in_space(moment):\n a = sum(int(i) for i in moment if i in '123456789')\n b = sum(1 for i in moment if i not in '123456789')\n return [a<b, a==b, a>b]", "def moment_of_time_in_space(moment):\n t,s=0,0\n for c in moment:\n if c.isdigit() and c!='0':\n t+=int(c)\n else:\n s+=1\n if t<s:\n return [True,False,False]\n elif t>s:\n return [False,False,True]\n else:\n return [False,True,False]", "def moment_of_time_in_space(moment):\n l = [int(i) for i in moment if i.isdigit() and i != '0']\n time = sum(l)\n space = 8 - len(l)\n return [True, False, False] if space > time else\\\n ([False, True, False] if space==time else [ False, False, True])"]
{"fn_name": "moment_of_time_in_space", "inputs": [["12:30 am"], ["12:02 pm"], ["01:00 pm"], ["11:12 am"], ["05:20 pm"], ["04:20 am"]], "outputs": [[[false, false, true]], [[false, true, false]], [[true, false, false]], [[false, false, true]], [[false, false, true]], [[false, true, false]]]}
introductory
https://www.codewars.com/kata/58c2158ec7df54a39d00015c
def moment_of_time_in_space(moment):
[ 2, 5430, 198, 1446, 525, 2661, 264, 1565, 28599, 63, 304, 882, 323, 3550, 13, 3555, 498, 1969, 653, 374, 1438, 432, 1495, 1119, 882, 323, 3550, 11, 311, 8253, 421, 429, 4445, 374, 504, 279, 3267, 11, 3042, 476, 3853, 382, 1565, 14...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,828
Some numbers can be expressed as a difference of two squares, for example, 20 = 6^(2)-4^(2) and 21 = 5^(2)-2^(2). Many numbers can be written this way, but not all. ## Your Task Complete the function that takes a positive integer `n` and returns the amount of numbers between `1` and `n` (inclusive) that can be represented as the difference of two perfect squares. **Note**: Your code should be able to handle `n` values up to 45000 ## Examples ``` n = 4 ==> 3 n = 5 ==> 4 n = 10 ==> 7 n = 20 ==> 15 n = 6427 ==> 4820 ```
["def count_squareable(n):\n return n//4 + (n+1)//2", "def count_squareable(n):\n return round(n * (3/4) - 0.24)\n", "e = 10**-2\n\ndef count_squareable(n):\n return round(n * 3 / 4 - e)", "count_squareable=lambda n:int(n*.75+0.25)", "def count_squareable(n):\n return (n - 1) * 3 // 4 + 1", "def count_squareable(n):\n return int(n * .75 + .25)", "def count_squareable(n):\n count = 0\n for number in range(1 , n+1):\n if number % 4 == 2:\n count += 1\n return n - count", "count_squareable=lambda Q:1+3*Q>>2", "archive = []\narchive_values = {0: 0}\ndef count_squareable(n):\n def solve(nn):\n return next((1 for x in range(1, int(nn**.5)+1) if not nn%x and x%2==(nn//x)%2), 0)\n first_ind = next((i for i in reversed(archive) if i<=n), 0)\n result = sum(solve(i) for i in range(first_ind+1, n+1))+archive_values[first_ind]\n archive.append(n)\n archive_values[n] = result\n return result", "def count_squareable(n):\n q,r=divmod(n,4)\n if r<2:\n num=3*q+r\n else:\n num=3*q+r-1\n return num"]
{"fn_name": "count_squareable", "inputs": [], "outputs": []}
introductory
https://www.codewars.com/kata/5afa08f23e971553170001e0
def count_squareable(n):
[ 8373, 5109, 646, 387, 13302, 438, 264, 6672, 315, 1378, 31340, 11, 369, 3110, 11, 220, 17, 15, 284, 220, 21, 13268, 17, 7287, 19, 13268, 17, 8, 323, 220, 17, 16, 284, 220, 20, 13268, 17, 7287, 17, 13268, 17, 568, 8999, 5109, 646...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
985
This problem is about sequences of positive integers $a_1,a_2,...,a_N$. A subsequence of a sequence is anything obtained by dropping some of the elements. For example, $3,7,11,3$ is a subsequence of $6,3,11,5,7,4,3,11,5,3$ , but $3,3,7$ is not a subsequence of $6,3,11,5,7,4,3,11,5,3$ . A fully dividing sequence is a sequence $a_1,a_2,...,a_N$ where $a_i$ divides $a_j$ whenever $i < j$. For example, $3,15,60,720$ is a fully dividing sequence. Given a sequence of integers your aim is to find the length of the longest fully dividing subsequence of this sequence. Consider the sequence $2,3,7,8,14,39,145,76,320$ It has a fully dividing sequence of length $3$, namely $2,8,320$, but none of length $4$ or greater. Consider the sequence $2,11,16,12,36,60,71,17,29,144,288,129,432,993$. It has two fully dividing subsequences of length $5$, - $2,11,16,12,36,60,71,17,29,144,288,129,432,993$ and - $2,11,16,12,36,60,71,17,29,144,288,129,432,993$ and none of length $6$ or greater. -----Input:----- The first line of input contains a single positive integer $N$ indicating the length of the input sequence. Lines $2,...,N+1$ contain one integer each. The integer on line $i+1$ is $a_i$. -----Output:----- Your output should consist of a single integer indicating the length of the longest fully dividing subsequence of the input sequence. -----Constraints:----- - $1 \leq N \leq 10000$ - $1 \leq a_i \leq 1000000000$ -----Sample input 1:----- 9 2 3 7 8 14 39 145 76 320 -----Sample output 1:----- 3 -----Sample input 2:----- 14 2 11 16 12 36 60 71 17 29 144 288 129 432 993 -----Sample output 2:----- 5
["# coding: utf-8\n# Your code here!\n\nn=int(input())\na=[]\nfor i in range(n):\n x=int(input())\n a.append(x)\n \n# print(a)\nans=0\nm=[1]*n\nfor i in range(n):\n for j in range(i):\n if a[i]%a[j]==0:\n m[i]=max(m[i],m[j]+1)\n \n \n \nprint(max(m))", "#author : dokueki\r\n\r\nimport sys\r\n\r\n\r\ndef IOE():\r\n sys.stdin = open(\"input.txt\", \"r\")\r\n sys.stdout = open(\"output.txt\", \"w\")\r\n\r\n\r\ndef dp(a, n):\r\n mat = [0 for i in range(n)]\r\n mat[0] = 1\r\n for i in range(n):\r\n mat[i] = 1\r\n for j in range(i):\r\n if mat[j] != 0 and a[i] % a[j] == 0:\r\n mat[i] = max(mat[i], mat[j] + 1)\r\n return max(mat)\r\n\r\n\r\ndef main():\r\n n = int(sys.stdin.readline())\r\n a = []\r\n for _ in range(n):\r\n a.append(int(sys.stdin.readline()))\r\n # print(a)\r\n print(dp(a, n))\r\n\r\n\r\ndef __starting_point():\r\n try:\r\n IOE()\r\n except:\r\n pass\r\n main()\r\n\n__starting_point()", "n = int(input())\r\na = []\r\nfor i in range(n):\r\n a.append(int(input()))\r\nans = [1] * n\r\nfor i in range(n-2, -1, -1):\r\n for j in range(i+1, n):\r\n if(a[j] % a[i] == 0):\r\n ans[i] = max(ans[i], 1 + ans[j])\r\nprint(max(ans))", "arr=[]\r\nn=int(input())\r\nd=[1]*n\r\nfor j in range(n) :\r\n x=int(input())\r\n for i in range(len(arr)) :\r\n if x%arr[i]==0 :\r\n d[j] = max(d[j] , (d[i]+1))\r\n arr.append(x)\r\nprint(max(d))", "# cook your dish here\ntry:\n x = []\n n = int(input())\n for _ in range(n):\n x.append(int(input()))\n dp = [1]*n\n for i in range(n):\n for j in range(i):\n if x[i] % x[j] == 0:\n dp[i] = max(dp[i],dp[j]+1)\n print(max(dp))\nexcept:\n pass"]
{"inputs": [["9", "2", "3", "7", "8", "14", "39", "145", "76", "320", "Sample output 1:", "3", "Sample input 2:", "14", "2", "11", "16", "12", "36", "60", "71", "17", "29", "144", "288", "129", "432", "993", "Sample output 2:", "5"]], "outputs": [[]]}
interview
https://www.codechef.com/IARCSJUD/problems/DIVSEQ
[ 1986, 3491, 374, 911, 23700, 315, 6785, 25780, 400, 64, 62, 16, 15012, 62, 17, 28675, 11, 64, 1604, 12947, 362, 1186, 15512, 315, 264, 8500, 374, 4113, 12180, 553, 25100, 1045, 315, 279, 5424, 13, 1752, 3110, 11, 400, 18, 11, 22, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,047
Chef bought a huge (effectively infinite) planar island and built $N$ restaurants (numbered $1$ through $N$) on it. For each valid $i$, the Cartesian coordinates of restaurant $i$ are $(X_i, Y_i)$. Now, Chef wants to build $N-1$ straight narrow roads (line segments) on the island. The roads may have arbitrary lengths; restaurants do not have to lie on the roads. The slope of each road must be $1$ or $-1$, i.e. for any two points $(x_1, y_1)$ and $(x_2, y_2)$ on the same road, $|x_1-x_2| = |y_1-y_2|$ must hold. Let's denote the minimum distance Chef has to walk from restaurant $i$ to reach a road by $D_i$. Then, let's denote $a = \mathrm{max}\,(D_1, D_2, \ldots, D_N)$; Chef wants this distance to be minimum possible. Chef is a busy person, so he decided to give you the job of building the roads. You should find a way to build them that minimises $a$ and compute $a \cdot \sqrt{2}$. -----Input----- - The first line of the input contains a single integer $T$ denoting the number of test cases. The description of $T$ test cases follows. - The first line of each test case contains a single integer $N$. - $N$ lines follow. For each valid $i$, the $i$-th of these lines contains two space-separated integers $X_i$ and $Y_i$. -----Output----- For each test case, print a single line containing one real number — the minimum distance $a$ multiplied by $\sqrt{2}$. Your answer will be considered correct if its absolute or relative error does not exceed $10^{-6}$. -----Constraints----- - $1 \le T \le 100$ - $2 \le N \le 10^4$ - $|X_i|, |Y_i| \le 10^9$ for each valid $i$ -----Subtasks----- Subtask #1 (10 points): - $1 \le T \le 10$ - $2 \le N \le 5$ - $|X_i|, |Y_i| \le 10$ for each valid $i$ - $a \cdot \sqrt{2}$ is an integer Subtask #2 (90 points): original constraints -----Example Input----- 2 3 0 0 0 1 0 -1 3 0 1 1 0 -1 0 -----Example Output----- 0.5 0 -----Explanation----- Example case 1: We should build roads described by equations $y-x+0.5 = 0$ and $y-x-0.5 = 0$. Example case 2: We should build roads described by equations $y-x-1 = 0$ and $y+x-1 = 0$.
["import sys\n\ndef input(): return sys.stdin.readline().strip()\ndef iinput(): return int(input())\ndef rinput(): return list(map(int, sys.stdin.readline().strip().split())) \ndef get_list(): return list(map(int, sys.stdin.readline().strip().split()))\n\n\nt=iinput()\n\nfor _ in range(t):\n n=iinput()\n p=[]\n mi=[]\n for i in range(n):\n x,y=rinput()\n p.append(x+y)\n mi.append(x-y)\n\n p.sort()\n mi.sort()\n m=float('inf')\n for i in range(1,n):\n if(p[i]-p[i-1]<m):\n m=p[i]-p[i-1]\n if(mi[i]-mi[i-1]<m):\n m=mi[i]-mi[i-1]\n\n if m%2==0:\n print(m//2)\n else:\n print(m/2)\n", "import io, sys, os\nimport math as ma\nfrom decimal import Decimal as dec\nfrom itertools import permutations\n\n\ndef li ():\n return list (map (int, input ().split ()))\n\n\ndef num ():\n return map (int, input ().split ())\n\n\ndef nu ():\n return int (input ())\n\n\ndef solve ():\n t = nu()\n for _ in range (t):\n n=nu()\n x=set()\n y=set()\n fl=False\n for i in range(n):\n l,r=num()\n px=l+r\n py=r-l\n if(px in x):\n fl=True\n if(py in y):\n fl=True\n x.add(px)\n y.add(py)\n x=list(x)\n y=list(y)\n x.sort()\n y.sort()\n mnx=9999999999999\n mny= 9999999999999\n if(fl):\n print(0)\n else:\n for i in range(1,len(x)):\n mnx=min(mnx,x[i]-x[i-1])\n for i in range(1,len(y)):\n mny=min(mny,y[i]-y[i-1])\n print(min(mny,mnx)/2)\n\n\n\ndef __starting_point():\n solve ()\n__starting_point()", "for _ in range(int(input())):\n n=int(input())\n plus=[]\n minus=[]\n for i in range(n):\n x,y=list(map(int,input().split()))\n plus.append(x+y)\n minus.append(x-y)\n plus.sort(),minus.sort()\n m=float('inf')\n for i in range(1,n):\n if plus[i]-plus[i-1]<m:\n m=plus[i]-plus[i-1]\n if minus[i]-minus[i-1]<m:\n m=minus[i]-minus[i-1]\n if m%2==0:\n print(m//2)\n else:\n print(m/2)\n", "from decimal import *\ngetcontext().prec = 1\nt = int(input())\nwhile t > 0:\n t -= 1\n n = int(input())\n a = []; i = 0; b = []\n while i < n:\n x,y = list(map(int, input().split()))\n a.append(x+y)\n b.append(x-y)\n i += 1\n a.sort()\n b.sort()\n m = 1000000007\n for i in range(1,n):\n k = abs(a[i] - a[i-1])\n l = abs(b[i] - b[i-1])\n m = min(m,k,l)\n print(Decimal(m/2))", "T=int(input())\nfor i in range(T):\n N=int(input())\n l1=[]\n l2=[]\n for j in range(N):\n a,b=map(int,input().split())\n l1.append(a-b)\n l2.append(a+b)\n l1.sort()\n l2.sort()\n m1=100000000000000000000000\n for j in range(1,len(l1)):\n if l1[j]-l1[j-1]<m1:\n m1=l1[j]-l1[j-1]\n m2=1000000000000000000000\n for j in range(1,len(l2)):\n if l2[j]-l2[j-1]<m2:\n m2=l2[j]-l2[j-1]\n if min(m1,m2)%2==0:\n print(min(m1,m2)//2)\n else:\n print(min(m1,m2)/2)", "import math\n\nfor _ in range(0, int(input())):\n points = int(input())\n xs = set()\n ys = set()\n for _ in range(points):\n x, y = [int(i) for i in input().split()]\n xs.add((x - y))\n ys.add((x + y))\n xmin = 1000000001\n ymin = 1000000001\n if len(xs) != points or len(ys) != points:\n print(0)\n else:\n xs = sorted(xs)\n ys = sorted(ys)\n xmin = math.fabs(xs[1] - xs[0])\n ymin = math.fabs(ys[1] - ys[0])\n for i in range(1, len(xs) - 1):\n if xmin > (math.fabs(xs[i + 1] - xs[i])):\n xmin = xs[i + 1] - xs[i]\n\n if ymin > (math.fabs(ys[i + 1] - ys[i])):\n ymin = ys[i + 1] - ys[i]\n\n print(min(xmin, ymin) / 2)\n", "t=int(input())\nfor test in range(t):\n n=int(input())\n a_set=set()\n b_set=set()\n for i in range(n):\n x,y=list(map(int,input().split()))\n a_set.add(x-y)\n b_set.add(x+y)\n a_set=list(a_set)\n b_set=list(b_set)\n if len(a_set)!=n or len(b_set)!=n:\n print(0)\n else:\n a_set=sorted((a_set))\n b_set=sorted((b_set))\n a1=a_set[1]-a_set[0]\n b1=b_set[1]-b_set[0]\n for i in range(2,n):\n a1=min(a1,a_set[i]-a_set[i-1])\n b1=min(b1,b_set[i]-b_set[i-1])\n # print(a1,b1)\n print(min(a1,b1)/2)\n", "# cook your dish here\n'''\nt=int(input())\n\nl=[] #array of coordinates\nwhile t:\n n=int(input())\n while n:\n coor=int(input()),int(input()) #coordinates\n l.append(coor)\n n-=1\n \n t-=1\n lcopy=sorted(l)\n for i in range(len(l)):\n length=len(lcopy)\n for j in range(i+1,len(l)):\n if abs(l[i][0]-l[j][0])==abs(l[i][1]-l[j][1]):\n if l[j] in lcopy: lcopy.remove(l[j])\n if length!=len(lcopy):\n if l[i] in lcopy: lcopy.remove(l[i])\n print(l)\n\n print(lcopy)\n'''\n\nimport cmath\nimport math\n\n\n\ndef f(l):\n #Rotate the points by 45 degrees\n l1=[]\n for i in range(len(l)):\n w=cmath.polar(l[i])\n z=cmath.rect(w[0],w[1]-cmath.pi/4)\n l1.append(z) \n\n #print(l1)\n l1.sort(key=lambda z:z.real)\n for i in range(len(l1)-1):\n diff=abs(l1[i].real-l1[i+1].real)\n if diff==0:\n print(0)\n return\n if i==0:\n minDiffX=diff\n else:\n minDiffX=min(diff,minDiffX)\n #print(minDiffX)\n\n l1.sort(key = lambda x: x.imag)\n for i in range(len(l1)-1):\n diff=abs(l1[i].imag-l1[i+1].imag)\n if diff==0:\n print(0)\n return\n if i==0:\n minDiffY=diff\n else:\n minDiffY=min(diff,minDiffY)\n #print(minDiffY)\n\n #print(l1)\n '''d=min(abs(l[0].real-l[1].real),abs(l[0].imag-l[1].imag))\n for i in range(1,len(l1)):\n for j in range(i+1,len(l1)):\n x=min(abs(l[i].real-l[j].real),abs(l[i].imag-l[j].imag))\n if x<d: d=x\n'''\n print(min(minDiffX,minDiffY)*math.sin(math.pi/4)) \n\nT=int(input())\n\nwhile T:\n l=[] #array of coordinates\n\n n=int(input())\n while n:\n #print(n)\n t=input().split() #coordinates\n #print(t)\n l.append(complex(int(t[0]),int(t[1])))\n n-=1\n\n f(l)\n\n T-=1\n", "# cook your dish here\nimport numpy as np\nt = int(input())\nwhile(t):\n n = int(input())\n X = []\n Y = []\n for i in range(n):\n x,y = map(int,input().split())\n x,y = x - y,x + y\n X.append(x)\n Y.append(y)\n X = set(X)\n Y = set(Y)\n if len(X)== n-1 or len(Y)==n-1:\n print(0)\n else:\n X = list(X)\n Y = list(Y)\n X.sort()\n Y.sort()\n for i in range(len(X) - 1):\n X[i] = X[i+1] - X[i]\n X = X[:-1]\n for i in range(len(Y) - 1):\n Y[i] = Y[i+1] - Y[i]\n Y = Y[:-1]\n print(min(min(X)/2.0,min(Y)/2.0))\n t-=1", "t = int(input())\nfor _ in range(t):\n n = int(input())\n co = []\n suma = []\n diff = []\n for i in range(n):\n x,y = map(int,input().strip().split())\n co.append([x,y])\n suma.append(x+y)\n diff.append(x-y)\n # print(co)\n suma.sort()\n diff.sort()\n # print(suma)\n # print(diff)\n mina = 10**9\n mina = (abs((suma[0]-suma[1])/2))\n mina = min(mina,abs((diff[0]-diff[1])/2))\n # print(mina)\n for i in range(1,n-1):\n mina = min(mina,abs((suma[i]-suma[i+1])/2),abs((diff[i]-diff[i+1])/2))\n # print(i,mina)\n if(mina == 0.0):\n break\n print(mina)", "t = int(input())\nwhile t>0:\n t-=1\n n = int(input())\n arr = []\n arr3 = []\n for i in range(n):\n x,y = map(int,input().strip().split(\" \"))\n arr.append(y-x)\n arr3.append(y+x)\n arr = sorted(arr)\n arr3 = sorted(arr3)\n arr2 = []\n for i in range(n-1):\n arr2.append((arr[i+1]-arr[i])/2)\n arr2.append((arr3[i+1]-arr3[i])/2)\n print(min(arr2))", "t=int(input())\nfor _ in range(0,t):\n intercept1=[]\n intercept2=[]\n n=int(input())\n for i in range(0,n):\n x,y=map(int,input().split())\n intercept1.append(y+x)\n intercept2.append(y-x)\n intercept1.sort()\n intercept2.sort()\n mn1=10**10\n mn2=10**10\n for i in range(1,n):\n diff1=intercept1[i]-intercept1[i-1]\n mn1=min(mn1,diff1)\n diff2=intercept2[i]-intercept2[i-1]\n mn2=min(mn2,diff2)\n ans=min(mn1,mn2)\n print(ans/2)", "# cook your dish here\nimport math\nroot = math.sqrt(2)\n\nfor t in range(int(input())):\n num = int(input())\n \n a = []\n \n for i in range(num):\n a.append(list(map(int,input().split())))\n \n b = []\n c = []\n \n for i in range(num):\n b.append(a[i][1] - a[i][0])\n c.append(a[i][1] + a[i][0])\n \n c.sort(reverse=True)\n b.sort(reverse=True)\n \n d = []\n e = []\n \n for i in range(num-1):\n d.append(b[i] - b[i+1])\n e.append(c[i] - c[i+1])\n \n f = min(min(d),min(e))\n \n f /= 2\n \n print(f)", "for k in range(int(input())):\n n = int(input())\n arr1=[]\n arr2=[]\n for _ in range(n):\n a,b = map(int,input().split())\n arr1.append(a+b)\n arr2.append(b-a)\n arr1.sort()\n arr2.sort()\n l1=[]\n l2 =[]\n for i in range(len(arr1)-1):\n l1.append(arr1[i+1]-arr1[i])\n l2.append(arr2[i+1]-arr2[i])\n x = min(l1)\n y = min(l2)\n print(\"{0:.6f}\".format(min(x,y)/2))", "t=int(input())\nfor i in range(t):\n n=int(input())\n x=[]\n y=[]\n dx=[]\n dy=[]\n for j in range(n):\n c=list(map(int,input().split()))\n x.append(c[0]-c[1])\n y.append(c[0]+c[1])\n x.sort()\n y.sort()\n for j in range(1,n):\n dx.append(x[j]-x[j-1])\n dy.append(y[j]-y[j-1])\n a=min(dx)\n b=min(dy)\n print('{0:.6f}'.format(min(a,b)/2))", "\"\"\"\nimport bisect\n\ndef insert(list, n): \n bisect.insort(list, n) \n return list\n\"\"\"\nt=int(input())\nfor i in range(0,t):\n n=int(input())\n\n arr=[]\n brr=[]\n for j in range(0,n):\n x,y=input().split()\n x=int(x)\n y=int(y)\n #insert(arr,x-y)\n #insert(brr,x+y)\n arr.insert(0,x-y)\n brr.insert(0,x+y)\n arr.sort()\n brr.sort()\n m1=arr[1]-arr[0]\n for k in range(1,n-1):\n if((arr[k+1]-arr[k])<m1):\n m1=arr[k+1]-arr[k]\n \n for k in range(0,n-1):\n if((brr[k+1]-brr[k])<m1):\n m1=brr[k+1]-brr[k]\n if(m1%2==0):\n print(m1//2)\n else:\n print(m1/2)\n", "t = int(input())\nwhile t>0:\n t -= 1\n n = int(input())\n mp, mn = [], []\n for i in range(n):\n x, y = list(map(int, input().split()))\n mp.append(y-x)\n mn.append(y+x)\n dmin = abs(mp[1]-mp[0])\n mp.sort()\n mn.sort()\n for i in range(n-1):\n dmin = min(dmin, mp[i+1]-mp[i])\n dmin = min(dmin, mn[i+1]-mn[i])\n if dmin%2 == 0:\n print(dmin//2)\n else:\n print(dmin/2)\n", "t=int(input())\nwhile (t>0):\n t-=1\n n=int(input())\n d=[]\n dl=[]\n for i in range(n):\n x,y=map(int,input().split())\n d.append(y-x)\n dl.append(y+x)\n #print(\"d = \",d)\n #print(\"dl = \",dl)\n d=sorted(d)\n dl=sorted(dl)\n #print(\"d now = \",d)\n #print(\"dl now = \",dl)\n ans=abs(d[0]-d[1])\n k=0\n while (k<n-1):\n ans=min(ans,abs(d[k]-d[k+1]))\n ans=min(ans,abs(dl[k]-dl[k+1]))\n k+=1\n if (ans%2==0):\n print(int(ans/2))\n else:\n print(ans/2)", "\"\"\"\nimport bisect\n\ndef insert(list, n): \n bisect.insort(list, n) \n return list\n\"\"\"\nt=int(input())\nfor i in range(0,t):\n n=int(input())\n\n arr=[]\n brr=[]\n for j in range(0,n):\n x,y=input().split()\n x=int(x)\n y=int(y)\n #insert(arr,x-y)\n #insert(brr,x+y)\n arr.insert(0,x-y)\n brr.insert(0,x+y)\n arr.sort()\n brr.sort()\n m1=arr[1]-arr[0]\n for k in range(1,n-1):\n if((arr[k+1]-arr[k])<m1):\n m1=arr[k+1]-arr[k]\n m2=brr[1]-brr[0]\n for k in range(1,n-1):\n if((brr[k+1]-brr[k])<m2):\n m2=brr[k+1]-brr[k]\n if((min(m1,m2))%2==0):\n print((min(m1,m2))//2)\n else:\n print((min(m1,m2))/2)\n", "import bisect\n\ndef insert(list, n): \n bisect.insort(list, n) \n return list\n\nt=int(input())\nfor i in range(0,t):\n n=int(input())\n\n arr=[]\n brr=[]\n for j in range(0,n):\n x,y=input().split()\n x=int(x)\n y=int(y)\n insert(arr,x-y)\n insert(brr,x+y)\n m1=arr[1]-arr[0]\n for k in range(1,n-1):\n if((arr[k+1]-arr[k])<m1):\n m1=arr[k+1]-arr[k]\n m2=brr[1]-brr[0]\n for k in range(1,n-1):\n if((brr[k+1]-brr[k])<m2):\n m2=brr[k+1]-brr[k]\n if((min(m1,m2))%2==0):\n print((min(m1,m2))//2)\n else:\n print((min(m1,m2))/2)\n", "import bisect\n\ndef insert(list, n): \n bisect.insort(list, n) \n return list\n\nt=int(input())\nfor i in range(0,t):\n n=int(input())\n\n arr=[]\n brr=[]\n for j in range(0,n):\n x,y=input().split()\n x=int(x)\n y=int(y)\n insert(arr,x-y)\n insert(brr,x+y)\n m1=arr[1]-arr[0]\n for k in range(1,n-1):\n if((arr[k+1]-arr[k])<m1):\n m1=arr[k+1]-arr[k]\n m2=brr[1]-brr[0]\n for k in range(1,n-1):\n if((brr[k+1]-brr[k])<m2):\n m2=brr[k+1]-brr[k]\n print((min(m1,m2))/2)", "import bisect \ndef sign(a):\n if(a==abs(a)):\n return 1\n else:\n return -1\n\ndef insert(list, n): \n bisect.insort(list, n) \n return list\n\nt=int(input())\nfor i in range(0,t):\n n=int(input())\n\n arr=[]\n brr=[]\n for j in range(0,n):\n x,y=input().split()\n x=int(x)\n y=int(y)\n a=x-y\n b=x+y\n insert(arr,a)\n insert(brr,b)\n m1=arr[1]-arr[0]\n for k in range(1,len(arr)-1):\n if((arr[k+1]-arr[k])<m1):\n m1=arr[k+1]-arr[k]\n m2=brr[1]-brr[0]\n for k in range(1,len(arr)-1):\n if((brr[k+1]-brr[k])<m2):\n m2=brr[k+1]-brr[k]\n print((min(m1,m2))/2)", "T=int(input())\nfor i in range(0,T):\n N=int(input())\n L=[]\n for j in range(0,N):\n x,y=list(map(int,input().split()))\n L.append((x,y))\n\n arr11=[]\n arr12=[]\n for j in range(0,len(L)):\n arr11.append(L[j][1]-L[j][0])\n arr12.append(L[j][1]+L[j][0])\n\n arr11=sorted(arr11)\n arr12=sorted(arr12)\n arr11=arr11[::-1]\n arr12=arr12[::-1]\n arr21=[100000000000]\n arr22=[100000000000]\n for j in range(0,len(L)-1):\n arr21.append(arr11[j]-arr11[j+1])\n arr21.append(arr12[j]-arr12[j+1])\n\n print(min(min(arr21),min(arr22))/2)\n \n"]
{"inputs": [["2", "3", "0 0", "0 1", "0 -1", "3", "0 1", "1 0", "-1 0"]], "outputs": [["0.5", "0"]]}
interview
https://www.codechef.com/problems/WTBTR
[ 93903, 10788, 264, 6765, 320, 26061, 3132, 23809, 8, 3119, 277, 12922, 323, 5798, 400, 45, 3, 15556, 320, 4082, 291, 400, 16, 3, 1526, 400, 45, 3, 8, 389, 432, 13, 1752, 1817, 2697, 400, 72, 54876, 279, 80715, 13934, 315, 10729, 4...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,904
Same as [the original](https://www.codewars.com/kata/simple-fun-number-258-is-divisible-by-6) (same rules, really, go there for example and I strongly recommend completing it first), but with more than one asterisk (but always at least one). For example, `"*2"` should return `["12", "42", "72"]`. Similarly, `"*2*"` should return `["024", "120", "126", "222", "228", "324", "420", "426", "522", "528", "624", "720", "726", "822", "828", "924"]`. Order matters and returning the right one is part of the challenge itself, yep! More examples in the test codes and, of course, if you cannot generate any number divisible by 6, just return `[]` (or `[] of String` in Crystal).
["from itertools import product\n\ndef is_divisible_by_6(s):\n if s[-1] in '13579': return []\n ss = s.replace('*','{}')\n return [ v for v in (ss.format(*p) for p in product(*(['0123456789']*s.count('*')))) if not int(v)%6]", "def create_permutations(string):\n if '*' not in string:\n return [int(string)]\n return [x for i in range(10) for x in create_permutations(string.replace('*', str(i), 1))]\n \n\ndef is_divisible_by_6(string):\n return list(map(lambda x: str(x).zfill(len(string)), filter(lambda x: not x%6, create_permutations(string))))", "from itertools import product\n\ndef is_divisible_by_6(s):\n return [''.join(p) for p in product(*list('0123456789' if c == '*' else c for c in s)) if int(''.join(p)) % 6 == 0]", "def is_divisible_by_6(s):\n if s[-1] in \"13579\": return []\n l, base, step = s.count(\"*\"), int(s.replace(\"*\", \"0\")), (6 if s[-1] == \"*\" else 3)\n start, s = next(n for n in range(base, base + step) if n % step == 0) - base, s.replace(\"*\", \"{}\")\n return [s.format(*f\"{rep:0{l}d}\") for rep in range(start, 10**l, step)]", "def is_divisible_by_6(string):\n num_of_star = string.count('*')\n i = 0\n result = []\n num_lst = []\n while i < num_of_star:\n if i == 0:\n num_lst = [string.replace('*',str(x),1) for x in range(10)]\n i += 1\n else:\n c = num_lst[:]\n num_lst = [k.replace('*',str(x),1) for x in range(10) for k in c]\n i += 1\n \n for num in num_lst:\n \n if int(num) % 6 == 0:\n result.append(num)\n return list(sorted(result))", "from itertools import product\nfrom string import digits\n\ndef iter_candidates(s, pos):\n xs = list(s)\n for ds in product(digits, repeat=len(pos)):\n for i, d in zip(pos, ds):\n xs[i] = d\n yield ''.join(xs)\n \ndef is_divisible_by_6(s):\n pos = [i for i, x in enumerate(s) if x == '*']\n return [x for x in iter_candidates(s, pos) if int(x) % 6 == 0]", "from itertools import product as p\ndef is_divisible_by_6(s):\n return [u for u in [s.replace('*','{}').format(*x) for x in list(p(range(10),repeat=s.count('*')))] if int(u)%6==0]", "is_divisible_by_6=lambda s:[n for n in map(''.join,__import__('itertools').product(*(c=='*'and'0123456789'or c for c in s)))if int(n)%6<1]", "is_divisible_by_6=lambda s: [] if s[-1] in \"13579\" else sum((is_divisible_by_6(s.replace(\"*\",e,1)) for e in \"0123456789\"),[]) if s.count(\"*\")>1 else (lambda t: [s.replace(\"*\",str(e)) for e in range((3-t)%3,10,3) if s[-1]!=\"*\" or not e%2])(sum(int(e) for e in s if e!=\"*\"))", "from itertools import product\n\ndef is_divisible_by_6(string):\n result = []\n n = 0\n indices = []\n for i, c in enumerate(string):\n if c == '*':\n n += 1\n indices.append(i)\n\n s = list(string)\n for combo in product(list(map(str, range(10))), repeat=n):\n for idx, digit in zip(indices, combo):\n s[idx] = digit\n if int(''.join(s)) % 6 == 0:\n result.append(''.join(s))\n \n return result"]
{"fn_name": "is_divisible_by_6", "inputs": [["*2"], ["*21"], ["**1"], ["*2*"], ["***"]], "outputs": [[["12", "42", "72"]], [[]], [[]], [["024", "120", "126", "222", "228", "324", "420", "426", "522", "528", "624", "720", "726", "822", "828", "924"]], [["000", "006", "012", "018", "024", "030", "036", "042", "048", "054", "060", "066", "072", "078", "084", "090", "096", "102", "108", "114", "120", "126", "132", "138", "144", "150", "156", "162", "168", "174", "180", "186", "192", "198", "204", "210", "216", "222", "228", "234", "240", "246", "252", "258", "264", "270", "276", "282", "288", "294", "300", "306", "312", "318", "324", "330", "336", "342", "348", "354", "360", "366", "372", "378", "384", "390", "396", "402", "408", "414", "420", "426", "432", "438", "444", "450", "456", "462", "468", "474", "480", "486", "492", "498", "504", "510", "516", "522", "528", "534", "540", "546", "552", "558", "564", "570", "576", "582", "588", "594", "600", "606", "612", "618", "624", "630", "636", "642", "648", "654", "660", "666", "672", "678", "684", "690", "696", "702", "708", "714", "720", "726", "732", "738", "744", "750", "756", "762", "768", "774", "780", "786", "792", "798", "804", "810", "816", "822", "828", "834", "840", "846", "852", "858", "864", "870", "876", "882", "888", "894", "900", "906", "912", "918", "924", "930", "936", "942", "948", "954", "960", "966", "972", "978", "984", "990", "996"]]]}
introductory
https://www.codewars.com/kata/5a1a8b7ec374cbea92000086
def is_divisible_by_6(s):
[ 19198, 438, 508, 1782, 4024, 9533, 2428, 1110, 2136, 41067, 365, 1561, 905, 14109, 459, 67195, 2220, 359, 25854, 12, 17, 20, 23, 30430, 32785, 23066, 14319, 12, 21, 8, 320, 24063, 5601, 11, 2167, 11, 728, 1052, 369, 3110, 323, 358, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,100
>When no more interesting kata can be resolved, I just choose to create the new kata, to solve their own, to enjoy the process --myjinxin2015 said # Description: Given two array of integers(`arr1`,`arr2`). Your task is going to find a pair of numbers(an element in arr1, and another element in arr2), their difference is as big as possible(absolute value); Again, you should to find a pair of numbers, their difference is as small as possible. Return the maximum and minimum difference values by an array: `[ max difference, min difference ]` For example: ``` Given arr1 = [3,10,5], arr2 = [20,7,15,8] should return [17,2] because 20 - 3 = 17, 10 - 8 = 2 ``` # Note: - arr1 and arr2 contains only integers(positive, negative or 0); - arr1 and arr2 may have different lengths, they always has at least one element; - All inputs are valid. - This is a simple version, if you want some challenges, [try the challenge version](https://www.codewars.com/kata/583c592928a0c0449d000099). # Some Examples ``` maxAndMin([3,10,5],[20,7,15,8]) === [17,2] maxAndMin([3],[20]) === [17,17] maxAndMin([3,10,5],[3,10,5]) === [7,0] maxAndMin([1,2,3,4,5],[6,7,8,9,10]) === [9,1] ```
["def max_and_min(arr1,arr2):\n diffs = [abs(x-y) for x in arr1 for y in arr2]\n return [max(diffs), min(diffs)]\n", "def max_and_min(arr1,arr2):\n max_min = [abs(y-x) for x in arr1 for y in arr2]\n \n return [max(max_min), min(max_min)]", "def max_and_min(arr1, arr2):\n return [op(abs(x-y) for x in arr1 for y in arr2) for op in [max, min]]", "def max_and_min(arr1,arr2):\n arr1.sort()\n arr2.sort()\n i = 0\n difference = []\n\n while i < len(arr1):\n local = []\n for element in arr2 :\n local_dif = abs(arr1[i] - element)\n local.append(local_dif)\n local.sort() \n difference.append(min(local))\n difference.append(max(local))\n\n i += 1\n difference.sort()\n maximum = max(difference)\n minimum = min(difference)\n return [maximum,minimum]", "def max_and_min(lst1, lst2):\n diff = sorted(abs(b - a) for a in lst1 for b in lst2)\n return [diff[-1], diff[0]]", "def max_and_min(arr1,arr2):\n def mini(i, j):\n if i == len(a1) or j == len(a2):\n return float('inf')\n val = a1[i] - a2[j]\n if val < 0:\n return min(-val, mini(i+1, j))\n return min(val, mini(i, j+1)) \n \n a1, a2 = sorted(arr1), sorted(arr2)\n return [max(a2[-1]-a1[0], a1[-1]-a2[0]), bool(set(a1)^set(a2)) and mini(0, 0)]", "def max_and_min(arr1,arr2):\n return [max(abs(a-b) for a in arr1 for b in arr2), min(abs(a-b) for a in arr1 for b in arr2)]", "def max_and_min(arr1, arr2):\n max_diff, min_diff = float('-inf'), float('inf')\n for a in arr1:\n for b in arr2:\n current_sum = abs(b - a)\n max_diff = max(max_diff, current_sum)\n min_diff = min(min_diff, current_sum)\n return [max_diff, min_diff]\n", "def max_and_min(arr1,arr2):\n mi,ma=float(\"inf\"), -float(\"inf\")\n for x in arr1:\n for y in arr2:\n d = abs(x-y)\n if d < mi: mi = d\n if d > ma: ma = d\n return [ma,mi]", "def max_and_min(arr1,arr2):\n l=[]\n for temp1 in arr1:\n for temp2 in arr2:\n l.append(abs(temp1-temp2))\n l.sort()\n return [l[-1],l[0]]"]
{"fn_name": "max_and_min", "inputs": [[[3, 10, 5], [20, 7, 15, 8]], [[3], [20]], [[3, 10, 5], [3, 10, 5]], [[1, 2, 3, 4, 5], [6, 7, 8, 9, 10]]], "outputs": [[[17, 2]], [[17, 17]], [[7, 0]], [[9, 1]]]}
introductory
https://www.codewars.com/kata/583c5469977933319f000403
def max_and_min(arr1,arr2):
[ 29, 4498, 902, 803, 7040, 61688, 646, 387, 19673, 11, 358, 1101, 5157, 311, 1855, 279, 501, 61688, 11, 311, 11625, 862, 1828, 11, 311, 4669, 279, 1882, 220, 1177, 2408, 73, 20014, 258, 17, 15, 16, 20, 1053, 271, 2, 7662, 510, 1624...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
26
You are given a special jigsaw puzzle consisting of $n\cdot m$ identical pieces. Every piece has three tabs and one blank, as pictured below. $\{3$ The jigsaw puzzle is considered solved if the following conditions hold: The pieces are arranged into a grid with $n$ rows and $m$ columns. For any two pieces that share an edge in the grid, a tab of one piece fits perfectly into a blank of the other piece. Through rotation and translation of the pieces, determine if it is possible to solve the jigsaw puzzle. -----Input----- The test consists of multiple test cases. The first line contains a single integer $t$ ($1\le t\le 1000$) — the number of test cases. Next $t$ lines contain descriptions of test cases. Each test case contains two integers $n$ and $m$ ($1 \le n,m \le 10^5$). -----Output----- For each test case output a single line containing "YES" if it is possible to solve the jigsaw puzzle, or "NO" otherwise. You can print each letter in any case (upper or lower). -----Example----- Input 3 1 3 100000 100000 2 2 Output YES NO YES -----Note----- For the first test case, this is an example solution: [Image] For the second test case, we can show that no solution exists. For the third test case, this is an example solution: $\left\{\begin{array}{l}{3} \\{3} \end{array} \right\}$
["for _ in range(int(input())):\n n, m = list(map(int, input().split()))\n if n < m:\n n, m = m, n # n > m\n\n if m == 1:\n print(\"YES\")\n continue\n\n if m == 2 and n == 2:\n print(\"YES\")\n continue\n\n print(\"NO\")\n", "for zz in range(int(input())):\n n, m = list(map(int, input().split()))\n if n == 1 or m == 1 or (n <= 2 and m <= 2):\n print('YES')\n else:\n print('NO')\n", "for i in range(int(input())):\n a, b = list(map(int,input().split()))\n if a > 2 and b >= 2 or b > 2 and a >= 2:\n print(\"NO\")\n else:\n print(\"YES\")\n", "t=int(input())\nfor i in range(t):\n a,b=map(int,input().split())\n if a==2 and b==2:\n print('YES')\n elif a==1:\n print('YES')\n elif b==1:\n print('YES')\n else:\n print('NO')", "for _ in range(int(input())):\n\ta, b = list(map(int, input().split()))\n\tif (a == 1 or b == 1) or (a == 2 and b == 2):\n\t\tprint(\"YES\")\n\telse:\n\t\tprint(\"NO\")\n", "t=int(input())\nfor _ in range(t):\n n,m=list(map(int, input().split()))\n print('YES' if n == 1 or m == 1 or n == 2 and m == 2 else 'NO')\n", "t = int(input())\nfor _ in range(t):\n n, m = list(map(int, input().split()))\n if n == 1 or m == 1 or (m == 2 and n == 2):\n print('YES')\n else:\n print('NO')\n", "import sys\n# from collections import deque\n\n# print(help(deque))\n# 26\ninput = lambda: sys.stdin.readline().strip()\nipnut = input\nfor i in range(int(input())):\n n,m = map(int,ipnut().split())\n if n==m==2 or min(n,m)==1:\n print(\"YES\")\n else:\n print(\"NO\")\n # n = int(input())\n # s = list(map(int,input()))\n\"\"\"\n10\n10 11 12 13 14 15 16 17 11 11\n\"\"\"", "t = int(input())\nfor q in range(0, t):\n n, k = map(int, input().split())\n # a = list(map(int, input().split()))\n # n = int(input())\n # print(n)\n if n == k == 2:\n print(\"YES\")\n elif n == 1 or k == 1:\n print(\"YES\")\n else:\n print(\"NO\")", "import sys\nints = (int(x) for x in sys.stdin.read().split())\nsys.setrecursionlimit(3000)\n\ndef main():\n ntc = next(ints)\n for tc in range(ntc):\n n, m = (next(ints) for i in range(2))\n print('YES' if n==1 or m==1 or n==m==2 else 'NO')\n return\n\nmain()\n", "from sys import stdin,stdout #\nimport math #\nimport heapq #\n #\nt = 1 #\ndef aint(): #\n\treturn int(input().strip()) #\ndef lint(): #\n\treturn list(map(int,input().split())) #\ndef fint(): #\n\treturn list(map(int,stdin.readline().split())) #\n #\t\n########################################################\n\ndef main():\n\tn,m=lint()\n\tif n==1 or m==1:\n\t\tprint(\"YES\")\n\telif n==2 and m==2:\n\t\tprint(\"YES\")\n\telse:\n\t\tprint(\"NO\")\n\t#solve\n\nt=int(input())\n\n########################################################\nfor i in range(t): #\n\t#print(\"Case #\"+str(i+1)+\":\",end=\" \")\t\t #\n\tmain() #", "t=int(input())\nfor i in range(t):\n n,m=map(int,input().split())\n if n == 1 or m==1:print(\"YES\")\n elif n==2 and m==2:print(\"YES\")\n else:print(\"NO\")", "for f in range(int(input())):\n n,m=map(int,input().split())\n if n==1 or m==1 or (n==2 and m==2):\n print(\"YES\")\n else:\n print(\"NO\")", "for _ in range(int(input())):\n n, m = list(map(int, input().split()))\n print( \"YES\" if min(n, m) == 1 or max(n, m) <= 2 else \"NO\" )\n", "t = int(input())\nfor i in range(t):\n n, m = map(int, input().split())\n if n != 1 and m != 1 and n*m != 4:\n print(\"NO\")\n else:\n print(\"YES\")", "t = int(input())\nfor case in range(t):\n n, m = list(map(int, input().split()))\n if (min(n, m) == 1):\n print('YES')\n elif n == m and n == 2:\n print('YES')\n else:\n print('NO')", "import sys\n\nreadline = sys.stdin.readline\n\nns = lambda: readline().rstrip()\nni = lambda: int(readline().rstrip())\nnm = lambda: list(map(int, readline().split()))\nnl = lambda: list(map(int, readline().split()))\n\ndef solve():\n n, m = nm()\n if min(n, m) == 1 or max(n, m) == 2:\n print('YES')\n else:\n print('NO')\n\n# solve()\n\nT = ni()\nfor _ in range(T):\n solve()\n", "t = int(input())\nfor i in range(t):\n n, m = list(map(int, input().split()))\n if n == 1 or m == 1 or (n == 2 and m == 2):\n print(\"YES\")\n else:\n print(\"NO\")\n", "import sys\nT = int(sys.stdin.readline().strip())\ndef getT(line):\n return map(int, line.strip().split(\" \"))\n\nfor t in range(T):\n (m,n) = getT(sys.stdin.readline())\n if min(m, n) == 1: print(\"YES\")\n elif min(m, n) == 2 and max(m, n) == 2: print(\"YES\")\n else: print(\"NO\")", "for _ in range(int(input())):\n a,b=map(int,input().split())\n if min(a,b)==1:\n print('YES')\n elif a==2 and b==2:\n print('YES')\n else:\n print('NO')", "#from sys import stdin, stdout, setrecursionlimit\n#input = stdin.readline\n#print = stdout.write\nfor _ in range(int(input())):\n n, m = list(map(int, input().split()))\n ans = 'NO'\n if n == 1 or m == 1 or (n == 2 and m == 2):\n ans = 'YES'\n print(ans)\n\n\n\n\n\n\n", "for _ in range(int(input())):\n a, b = list(map(int, input().split()))\n if a == 1 or b == 1:\n print('YES')\n elif a == b == 2:\n print('YES')\n else:\n print('NO')\n", "def solve():\n N,M = list(map(int,input().split()))\n if N==1 or M==1:\n print(\"YES\")\n elif N==2 and M==2:\n print(\"YES\")\n else:\n print(\"NO\")\n\nfor _ in range(int(input())):\n solve()\n", "\n\ndef main():\n n, m = map(int, input().split())\n if n == 2 and m == 2:\n print(\"YES\")\n else:\n if n == 1 or m == 1:\n print(\"YES\")\n else:\n print(\"NO\")\n\n\n\ndef __starting_point():\n t = int(input())\n for i in range(t):\n main()\n__starting_point()", "t = int(input())\nfor i10 in range(t):\n n, m = list(map(int, input().split()))\n if n == 1 or m == 1 or n + m == 4:\n print(\"YES\")\n else:\n print(\"NO\")\n", "for _ in range(int(input())):\n n, m = list(map(int, input().split()))\n if n == 2 and m == 2:\n print(\"YES\")\n continue\n if n == 1 or m == 1:\n print(\"YES\")\n continue\n print(\"NO\")\n", "\n\nt = int(input())\n\nfor fk in range(t):\n n, m = [int(x) for x in input().split()]\n\n if n == 1 or m == 1:\n print('YES')\n\n elif n==2 and m == 2:\n print('YES')\n\n else : print('NO')", "q = int(input())\n\nfor _ in range(q):\n n, m = list(map(int, input().split()))\n if n == 2 and m == 2 or n == 1 or m == 1:\n print(\"YES\")\n else:\n print(\"NO\")\n", "q = int(input())\nfor i in range(q):\n n, m = list(map(int, input().split()))\n if (n == 1 or m == 1):\n print(\"YES\")\n elif (n == m == 2):\n print(\"YES\")\n else:\n print(\"NO\")\n", "n=int(input())\nfor i in range(n):\n a,b=[int(i) for i in input().split()]\n if (a==b==2) or a==1 or b==1:\n print('YES')\n else:\n print('NO')\n", "t = int(input())\nfor u in range(t):\n n,m=list(map(int,input().split()))\n x = 2*n+2*m\n y = 3*n*m\n z = n*m\n if x+z >= y:\n print(\"YES\")\n else:\n print(\"NO\")\n", "for _ in range(int(input())):\n n, m = tuple(map(int, input().split()))\n\n a = (n - 1) * m + (m - 1) * n\n b = n * m\n\n if a <= b:\n print('YES')\n else:\n print('NO')", "t = int(input())\n\nfor case in range(t):\n n, m = map(int, input().split())\n ans = 'NO'\n if (n == m == 2):\n ans = 'YES'\n elif (n == 1 or m == 1):\n ans = 'YES'\n print (ans)", "t = int(input())\nfor case in range(t):\n n, m = list(map(int, input().split()))\n perimeter = 2*n + 2*m\n\n inside = m*(n-1) + n*(m-1)\n nobs = 2*n*m\n\n if (nobs > perimeter):\n print (\"NO\")\n else:\n print (\"YES\")\n", "for _ in range(int(input())):\n n, m = list(map(int, input().split()))\n if n * m <= n + m:\n print(\"YES\")\n else:\n print(\"NO\")\n", "t = int(input())\nfor i in range(t):\n n, m = list(map(int, input().split()))\n if min(n, m) == 1 or m==2 and n==2:\n print(\"YES\")\n else:\n print(\"NO\")\n", "# n = int(input())\n# l = list(map(int, input().split()))\nfor tt in range(int(input())):\n\tn, m = map(int, input().split())\n\tif(n==1 or m==1 or (n==2 and m==2)):\n\t\tprint(\"YES\")\n\t\tcontinue\n\tprint(\"NO\")", "for _ in range(int(input())):\n n, m = list(map(int, input().split()))\n if n == m and n == 2:\n print('YES')\n elif n >= 2 and m >= 2:\n print('NO')\n else:\n print('YES')\n", "for _ in range(int(input())):\n n, m = map(int, input().split())\n print('YES' if n == 1 or m == 1 or (n == 2 and m == 2) else 'NO')", "import sys\nimport math\nimport itertools\nimport functools\nimport collections\nimport operator\nimport fileinput\nimport copy\n\nORDA = 97 #a\ndef ii(): return int(input())\ndef mi(): return map(int, input().split())\ndef li(): return [int(i) for i in input().split()]\ndef lcm(a, b): return abs(a * b) // math.gcd(a, b)\ndef revn(n): return str(n)[::-1]\ndef dd(): return collections.defaultdict(int)\ndef ddl(): return collections.defaultdict(list)\ndef sieve(n):\n if n < 2: return list()\n prime = [True for _ in range(n + 1)]\n p = 3\n while p * p <= n:\n if prime[p]:\n for i in range(p * 2, n + 1, p):\n prime[i] = False\n p += 2\n r = [2]\n for p in range(3, n + 1, 2):\n if prime[p]:\n r.append(p)\n return r\ndef divs(n, start=1):\n r = []\n for i in range(start, int(math.sqrt(n) + 1)):\n if (n % i == 0):\n if (n / i == i):\n r.append(i)\n else:\n r.extend([i, n // i])\n return r\ndef divn(n, primes):\n divs_number = 1\n for i in primes:\n if n == 1:\n return divs_number\n t = 1\n while n % i == 0:\n t += 1\n n //= i\n divs_number *= t\ndef prime(n):\n if n == 2: return True\n if n % 2 == 0 or n <= 1: return False\n sqr = int(math.sqrt(n)) + 1\n for d in range(3, sqr, 2):\n if n % d == 0: return False\n return True\ndef convn(number, base):\n newnumber = 0\n while number > 0:\n newnumber += number % base\n number //= base\n return newnumber\ndef cdiv(n, k): return n // k + (n % k != 0)\n\n\nfor _ in range(ii()):\n n, m = mi()\n if n == 1 or m == 1 or m == 2 and n == 2:\n print('YES')\n else:\n print('NO')"]
{ "inputs": [ "3\n1 3\n100000 100000\n2 2\n" ], "outputs": [ "YES\nNO\nYES\n" ] }
interview
https://codeforces.com/problemset/problem/1345/A
[ 2610, 525, 2661, 264, 3281, 502, 86924, 24626, 30606, 315, 400, 77, 59, 50853, 296, 3, 19516, 9666, 13, 7209, 6573, 702, 2326, 22398, 323, 825, 10113, 11, 438, 41566, 3685, 13, 57960, 90, 18, 3, 4710, 785, 502, 86924, 24626, 374, 65...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,769
# RoboScript #2 - Implement the RS1 Specification ## Disclaimer The story presented in this Kata Series is purely fictional; any resemblance to actual programming languages, products, organisations or people should be treated as purely coincidental. ## About this Kata Series This Kata Series is based on a fictional story about a computer scientist and engineer who owns a firm that sells a toy robot called MyRobot which can interpret its own (esoteric) programming language called RoboScript. Naturally, this Kata Series deals with the software side of things (I'm afraid Codewars cannot test your ability to build a physical robot!). ## Story Now that you've built your own code editor for RoboScript with appropriate syntax highlighting to make it look like serious code, it's time to properly implement RoboScript so that our MyRobots can execute any RoboScript provided and move according to the will of our customers. Since this is the first version of RoboScript, let's call our specification RS1 (like how the newest specification for JavaScript is called ES6 :p) ## Task Write an interpreter for RS1 called `execute()` which accepts 1 required argument `code`, the RS1 program to be executed. The interpreter should return a string representation of the smallest 2D grid containing the full path that the MyRobot has walked on (explained in more detail later). Initially, the robot starts at the middle of a 1x1 grid. Everywhere the robot walks it will leave a path `"*"`. If the robot has not been at a particular point on the grid then that point will be represented by a whitespace character `" "`. So if the RS1 program passed in to `execute()` is empty, then: ``` "" --> "*" ``` The robot understands 3 major commands: - `F` - Move forward by 1 step in the direction that it is currently pointing. Initially, the robot faces to the right. - `L` - Turn "left" (i.e. **rotate** 90 degrees **anticlockwise**) - `R` - Turn "right" (i.e. **rotate** 90 degrees **clockwise**) As the robot moves forward, if there is not enough space in the grid, the grid should expand accordingly. So: ``` "FFFFF" --> "******" ``` As you will notice, 5 `F` commands in a row should cause your interpreter to return a string containing 6 `"*"`s in a row. This is because initially, your robot is standing at the middle of the 1x1 grid facing right. It leaves a mark on the spot it is standing on, hence the first `"*"`. Upon the first command, the robot moves 1 unit to the right. Since the 1x1 grid is not large enough, your interpreter should expand the grid 1 unit to the right. The robot then leaves a mark on its newly arrived destination hence the second `"*"`. As this process is repeated 4 more times, the grid expands 4 more units to the right and the robot keeps leaving a mark on its newly arrived destination so by the time the entire program is executed, 6 "squares" have been marked `"*"` from left to right. Each row in your grid must be separated from the next by a CRLF (`\r\n`). Let's look at another example: ``` "FFFFFLFFFFFLFFFFFLFFFFFL" --> "******\r\n* *\r\n* *\r\n* *\r\n* *\r\n******" ``` So the grid will look like this: ``` ****** * * * * * * * * ****** ``` The robot moves 5 units to the right, then turns left, then moves 5 units upwards, then turns left again, then moves 5 units to the left, then turns left again and moves 5 units downwards, returning to the starting point before turning left one final time. Note that the marks do **not** disappear no matter how many times the robot steps on them, e.g. the starting point is still marked `"*"` despite the robot having stepped on it twice (initially and on the last step). Another example: ``` "LFFFFFRFFFRFFFRFFFFFFF" --> " ****\r\n * *\r\n * *\r\n********\r\n * \r\n * " ``` So the grid will look like this: ``` **** * * * * ******** * * ``` Initially the robot turns left to face upwards, then moves upwards 5 squares, then turns right and moves 3 squares, then turns right again (to face downwards) and move 3 squares, then finally turns right again and moves 7 squares. Since you've realised that it is probably quite inefficient to repeat certain commands over and over again by repeating the characters (especially the `F` command - what if you want to move forwards 20 steps?), you decide to allow a shorthand notation in the RS1 specification which allows your customers to postfix a non-negative integer onto a command to specify how many times an instruction is to be executed: - `Fn` - Execute the `F` command `n` times (NOTE: `n` *may* be more than 1 digit long!) - `Ln` - Execute `L` n times - `Rn` - Execute `R` n times So the example directly above can also be written as: ``` "LF5RF3RF3RF7" ``` These 5 example test cases have been included for you :) ## Kata in this Series 1. [RoboScript #1 - Implement Syntax Highlighting](https://www.codewars.com/kata/roboscript-number-1-implement-syntax-highlighting) 2. **RoboScript #2 - Implement the RS1 Specification** 3. [RoboScript #3 - Implement the RS2 Specification](https://www.codewars.com/kata/58738d518ec3b4bf95000192) 4. [RoboScript #4 - RS3 Patterns to the Rescue](https://www.codewars.com/kata/594b898169c1d644f900002e) 5. [RoboScript #5 - The Final Obstacle (Implement RSU)](https://www.codewars.com/kata/5a12755832b8b956a9000133)
["from collections import deque\nimport re\n\nTOKENIZER = re.compile(r'(R+|F+|L+)(\\d*)')\n\ndef execute(code):\n \n pos, dirs = (0,0), deque([(0,1), (1,0), (0,-1), (-1,0)])\n seens = {pos}\n \n for act,n in TOKENIZER.findall(code):\n s,r = act[0], int(n or '1') + len(act)-1\n \n if s == 'F':\n for _ in range(r):\n pos = tuple( z+dz for z,dz in zip(pos, dirs[0]) )\n seens.add(pos)\n else:\n dirs.rotate( (r%4) * (-1)**(s == 'R') )\n \n miX, maX = min(x for x,y in seens), max(x for x,y in seens)\n miY, maY = min(y for x,y in seens), max(y for x,y in seens)\n \n return '\\r\\n'.join( ''.join('*' if (x,y) in seens else ' ' for y in range(miY, maY+1)) \n for x in range(miX, maX+1) )", "import re\nDIRS = [(1, 0), (0, 1), (-1, 0), (0, -1)] * 2\n\ndef execute(code):\n grid, (dx, dy) = {(0, 0)}, DIRS[0]\n x = y = xm = ym = xM = yM = 0\n for dir, n in re.findall('([FLR])(\\d*)', code):\n for _ in range(int(n or '1')):\n if dir == 'L': dx, dy = DIRS[DIRS.index((dx, dy)) - 1]\n if dir == 'R': dx, dy = DIRS[DIRS.index((dx, dy)) + 1]\n if dir == 'F':\n x += dx; y += dy\n grid.add((x, y))\n xm, ym, xM, yM = min(xm, x), min(ym, y), max(xM, x), max(yM, y)\n return '\\r\\n'.join(''.join(' *'[(x, y) in grid] for x in range(xm, xM + 1)) for y in range(ym, yM + 1))", "import re\n\ndef execute(code):\n if code == '':\n return '*'\n turn_right = [[1, 0], [0, -1], [-1, 0], [0, 1]]\n turn_left = [[-1, 0], [0, -1], [1, 0], [0, 1]]\n path = re.findall('F\\d+|F|L\\d+|L|R\\d+|R', code)\n max_size = sum([1 if j == 'F' else int(j[1:]) for j in path if 'F' in j]) * 2\n table = [[' '] * (max_size + 1) for i in range(max_size + 1)]\n x, y = max_size // 2, max_size // 2\n table[x][y] = '*'\n f1, f2 = 0, 1\n for way in path:\n if 'R' in way:\n for i in range(1 if way == 'R' else int(way[1:])):\n cur_pos = [pos for pos, coords in enumerate(turn_right) if coords == [f1, f2]][0]\n f1, f2 = turn_right[0] if cur_pos == 3 else turn_right[cur_pos + 1]\n if 'L' in way:\n for i in range(1 if way == 'L' else int(way[1:])):\n cur_pos = [pos for pos, coords in enumerate(turn_left) if coords == [f1, f2]][0]\n f1, f2 = turn_left[0] if cur_pos == 3 else turn_left[cur_pos + 1] \n if 'F' in way:\n for i in range(1 if way == 'F' else int(way[1:])):\n x += 1 * f1\n y += 1 * f2\n table[x][y] = '*'\n solution = [i for i in table if '*' in i]\n solution = [i for i in zip(*solution[:]) if '*' in i]\n for i in range(3):\n solution = list(zip(*solution[:]))\n final_way = [''.join([j for j in i]) for i in solution]\n return '\\r\\n'.join(final_way)", "import re\nfrom enum import Enum\nfrom operator import itemgetter\nfrom typing import List, Tuple, Set, Generator\n\n\nCell = Tuple[int, int]\n\n\nclass Direction(Enum):\n UP = (0, 1)\n DOWN = (0, -1)\n RIGHT = (1, 0)\n LEFT = (-1, 0)\n\n\ndef execute(code: str) -> str:\n visited_cells = visit_cells(code)\n path = draw_path(visited_cells)\n return path\n \n \ndef visit_cells(code: str) -> Set[Cell]:\n visited_cells = [(0, 0)]\n direction = Direction.RIGHT\n \n for action, n_times in code_interpreter(code):\n if action == 'F':\n new_cells = move_forward(visited_cells[-1], direction, n_times)\n visited_cells.extend(new_cells)\n else:\n direction = make_turn(direction, action, n_times)\n return set(visited_cells)\n\n\ndef code_interpreter(code: str) -> Generator[Tuple[str, int], None, None]:\n for move in re.finditer(r'([LRF])(\\d*)', code):\n action = move.group(1)\n times = int(move.group(2)) if move.group(2) else 1\n yield action, times\n \n\ndef move_forward(position: Cell, direction: Direction, n_moves: int) -> List[Cell]:\n px, py = position\n dx, dy = direction.value\n return [(px + i * dx, py + i * dy) for i in range(1, n_moves + 1)]\n\n\ndef make_turn(start: Direction, side: str, n_turns: int) -> Direction:\n ordering = [Direction.RIGHT, Direction.DOWN, Direction.LEFT, Direction.UP]\n step = 1 if side == 'R' else -1\n return ordering[(ordering.index(start) + step * n_turns) % len(ordering)]\n \n \ndef draw_path(visited_cells: Set[Cell]) -> str:\n max_x, min_x, max_y, min_y = find_cells_boundaries(visited_cells)\n \n rectangle = list()\n for y in range(max_y, min_y - 1, -1):\n row = ['*' if (x, y) in visited_cells else ' ' for x in range(min_x, max_x + 1)]\n rectangle.append(''.join(row))\n \n return '\\r\\n'.join(rectangle)\n \n \ndef find_cells_boundaries(visited_cells: Set[Cell]) -> Tuple[int, int, int, int]:\n max_x, _ = max(visited_cells, key=itemgetter(0))\n min_x, _ = min(visited_cells, key=itemgetter(0))\n \n _, max_y = max(visited_cells, key=itemgetter(1))\n _, min_y = min(visited_cells, key=itemgetter(1))\n return max_x, min_x, max_y, min_y\n \n \n \n", "import re\nleft = {'right': 'up', 'up': 'left', 'left': 'down', 'down': 'right'}\nright = {'right': 'down', 'down': 'left', 'left': 'up', 'up': 'right'}\ndef execute(s):\n s, direction = re.sub(r'([RFL])(\\d+)', lambda x: x.group(1) * int(x.group(2)), s), 'right'\n p, p1, li = 0, 0, [[0, 0]]\n for i in s:\n if i == 'L' : direction = left[direction]\n if i == \"R\" : direction = right[direction]\n if i == \"F\":\n p1 += (1 if direction == \"right\" else -1) if direction in ['left', 'right'] else 0\n p += (1 if direction == 'down' else -1) if direction in ['up', 'down'] else 0\n li.append([p, p1])\n m, n = abs(min(li, key=lambda x:x[0])[0])+max(li,key=lambda x:x[0])[0], abs(min(li,key=lambda x:x[1])[1])+max(li,key=lambda x:x[1])[1]\n p, p1, grid= abs(min(li,key=lambda x:x[0])[0]), abs(min(li,key=lambda x:x[1])[1]), [[' ' for _ in range(n+1)] for _ in range(m+1)]\n for i, j in li : grid[p + i][p1 + j] = \"*\" \n return \"\\r\\n\".join([\"\".join(i) for i in grid])", "import numpy as np\ndef switch(argument):\n switcher = {\n 'F': 0,\n 'L': -1,\n 'R': 1\n }\n return switcher.get(argument, '')\n\ndef resize(p_matrix,num,axis,dir):\n if axis == 1:\n right = np.zeros((p_matrix.shape[0], num))\n left = p_matrix\n if dir == 2:\n right, left = left, right\n re_matrix = np.append(left,right,axis)\n else:\n top = np.zeros((num,p_matrix.shape[1]))\n bot = p_matrix\n if dir == 1:\n top, bot = bot, top\n re_matrix = np.append(top,bot,axis)\n return re_matrix\n\ndef mk_matrix(trace):\n p_matrix = np.full((1,1),1)\n pos = [0,0]\n for i in range(len(trace)):\n \n dir = trace[i][0]\n step = trace[i][1]\n if step != 0 :\n if dir == 0:\n if (pos[1]+step+1)> p_matrix.shape[1]:\n p_matrix = resize(p_matrix,pos[1]+step-p_matrix.shape[1]+1,1,dir)\n p_matrix[pos[0],(pos[1]+1):(pos[1]+step+1)] = 1\n pos[1] = pos[1]+step\n elif dir == 1:\n if (pos[0]+step+1)> p_matrix.shape[0]:\n p_matrix = resize(p_matrix,pos[0]+step-p_matrix.shape[0]+1,0,dir)\n p_matrix[(pos[0]+1):(pos[0]+1+step),pos[1]] = 1\n pos[0] = pos[0]+step\n elif dir == 2:\n if (pos[1]-step) < 0:\n p_matrix = resize(p_matrix,step-pos[1],1,dir)\n pos[1] = step\n p_matrix[pos[0],(pos[1]-step):(pos[1])] = 1\n pos[1] = pos[1]-step\n else:\n if (pos[0]-step)<0:\n p_matrix = resize(p_matrix,step-pos[0],0,dir)\n pos[0] = step\n p_matrix[(pos[0]-step):(pos[0]),pos[1]] = 1\n pos[0] = pos[0]-step\n return p_matrix\n\n\ndef tracing(path):\n dir = 0 #pointing right\n # 0-> direita ; 1-> baixo ; 2-> esquerda ; 3->cima\n trace = []\n for j in range(len(path)):\n step = 0\n if path[j][0] == 0:\n if len(path[j]) == 2:\n step = path[j][1]\n else:\n step = 1\n else:\n if len(path[j]) == 2:\n dir = (((path[j][0]*path[j][1])+dir)%4)\n else:\n dir = (dir+path[j][0])%4\n trace.append([dir,step])\n return trace\n\ndef pathing(code):\n path = []\n way = -1\n num = -1\n for i in range(len(code)):\n if i < num:\n continue\n qnt = \"\"\n num = i\n if code[i].isdecimal():\n if num < len(code):\n while code[num].isdecimal():\n qnt += code[num]\n if num+1 >= len(code):\n break\n num += 1\n if len(path[way])<2:\n length = int(qnt,10)\n path[way].append(length)\n else:\n way+=1\n path.append([])\n path[way].append(switch(code[i]))\n return path\n\ndef str_mx(matrix):\n str = []\n subm = np.full(matrix.shape,' ')\n for i in range(matrix.shape[0]):\n for j in range(matrix.shape[1]):\n if matrix[i][j]:\n subm[i][j] = '*'\n if i>0:\n str.append(\"\\r\\n\")\n str.append(''.join(subm[i]))\n return ''.join(str)\n\ndef execute(code):\n path = pathing(code)\n trace = tracing(path)\n matrix = mk_matrix(trace)\n print(matrix)\n str = str_mx(matrix)\n return str\n", "def execute(codes):\n Nums=\"0123456789\"\n code=''\n t=0\n c=0\n while t < len(codes):\n Char=0\n c=1\n if t<len(codes)-1:\n for g in codes[t+1:]:\n if g in Nums:\n Char+=1\n else:\n break\n c=int(codes[t+1:t+Char+1])\n code+=codes[t]*c\n t+=1+Char\n \n \n Xs=0\n Ys=0\n X=[]\n Y=[]\n Ymin=0\n Step=[[0,0]]\n Rotation=0\n Arr=[]\n Out=''\n for i in range(len(code)):\n if code[i]==\"L\":\n Rotation+=90\n elif code[i]==\"R\":\n Rotation+=-90\n if Rotation>180:\n while Rotation>180:\n Rotation+=-360\n elif Rotation<-180:\n while Rotation<-180:\n Rotation+=360\n if code[i]==\"F\":\n if Rotation==0:\n Xs+=1\n elif Rotation==-180 or Rotation ==180:\n Xs+=-1\n elif Rotation==90:\n Ys+=1\n elif Rotation==-90:\n Ys+=-1\n Step.append([Xs,Ys])\n for u in Step:\n X.append(u[0])\n Y.append(u[1])\n for j in range(len(Step)):\n Step[j][0]=Step[j][0]+min(X)*-1\n Step[j][1]=Step[j][1]+min(Y)*-1\n for k in range(max(Y)-min(Y)+1):\n Arr.append([\" \"]*(max(X)-min(X)+1))\n for l in Step:\n Arr[max(Y)-min(Y)-l[1]][l[0]]=\"*\"\n for n in range(len(Arr)):\n for p in range(max(X)-min(X)+1):\n Out+=Arr[n][p]\n Out+=\"\\r\\n\"\n Out=Out[:-2]\n return(Out)", "def execute(code):\n R, r, c, dr, dc = {(0, 0)}, 0, 0, 0, 1\n D = {(1, 0):{'R':(0, -1), 'L':(0, 1)}, (-1, 0):{'R':(0, 1), 'L':(0, -1)}, (0, 1):{'R':(1, 0), 'L':(-1, 0)}, (0, -1):{'R':(-1, 0), 'L':(1, 0)}}\n \n for cmd in code.replace('R', ' R').replace('L', ' L').replace('F', ' F').strip().split():\n cmd, n = cmd[:1], int(cmd[1:]) if cmd[1:] else 1\n for _ in range(n):\n if cmd in 'RL': \n dr, dc = D[(dr, dc)][cmd]\n else:\n r, c = r + dr, c + dc\n R.add((r, c))\n \n mnr = min(r for r, _ in R)\n mnc = min(c for _, c in R)\n \n R = {(r - mnr, c - mnc) for r, c in R}\n \n mxr = max(r for r, _ in R) \n mxc = max(c for _, c in R) \n \n return '\\r\\n'.join(''.join(' *'[(r, c) in R] for c in range(mxc+1)) for r in range(mxr+1))", "import re\n\ndef update_grid(px, py, grid):\n height = len(grid)\n width = len(grid[0])\n if px < 0:\n px += 1\n for y in range(height):\n grid[y] = \" \" + grid[y]\n if px >= width:\n for y in range(height):\n grid[y] = grid[y] + \" \"\n if py < 0:\n py += 1\n grid.insert(0, \" \" * width)\n if py >= height:\n grid.append(\" \" * width)\n grid[py] = grid[py][:px] + \"*\" + grid[py][px+1:]\n return px, py, grid\n \n\ndef execute(code):\n grid = [\"*\"]\n x, y = 0, 0\n facing = (1, 0)\n while code:\n match = re.match(r'([FLR])(\\d*)', code)\n code = re.sub(r'^([FLR])(\\d*)', '', code)\n op = match[1]\n rep = int(match[2] or \"1\")\n for i in range(rep):\n if op == \"F\":\n x += facing[0]\n y += facing[1]\n x, y, grid = update_grid(x, y, grid)\n if op == \"L\":\n facing = (facing[1], -facing[0])\n if op == \"R\":\n facing = (-facing[1], facing[0])\n return \"\\r\\n\".join(grid)\n", "BLANK = \" \"\nFILLCHAR = \"*\"\n\ndef pad_mtx(M, side=\"e\"):\n \"\"\"\n Pads matrix with row or column of blank chars depending on side keyword\n \"\"\"\n if side == \"w\":\n for i in range(len(M)):\n M[i] = [BLANK] + M[i][::1]\n elif side == \"e\":\n for i in range(len(M)):\n M[i] += [BLANK]\n elif side == \"n\":\n M.insert(0, [BLANK for _ in range(len(M[0]))])\n elif side == \"s\":\n M.append([BLANK for _ in range(len(M[0]))])\n\ndef move(mtx, pos, drxn):\n # modify position\n if drxn == \"e\":\n pos[1] += 1\n elif drxn == \"w\":\n pos[1] -= 1\n elif drxn == \"s\":\n pos[0] += 1\n elif drxn == \"n\":\n pos[0] -= 1\n else:\n raise ValueError(\"Direction unrecognized.\")\n \n # Check if path matrix needs to be modified\n try:\n if any(x < 0 for x in pos):\n raise ValueError\n else:\n mtx[pos[0]][pos[1]] = FILLCHAR\n # Modify it if an error was raised\n except Exception:\n pad_mtx(mtx, side=drxn)\n # Update position to reflect modified matrix\n if drxn == \"n\":\n pos[0] += 1\n if drxn == \"w\":\n pos[1] += 1 \n mtx[pos[0]][pos[1]] = FILLCHAR\n\ndef rotate(current, turn):\n directions = [\"e\", \"s\", \"w\", \"n\"]\n turns = {\"L\": -1, \"R\": 1}\n idx = directions.index(current)\n return directions[(idx + turns[turn]) % len(directions)]\n\n\ndef execute(code):\n directions = [\"e\", \"s\", \"w\", \"n\"]\n path = [[FILLCHAR]]\n pos = [0, 0]\n drxn = \"e\"\n i = 0\n while i < len(code):\n # check if command is repeated\n num = \"\"\n if i != len(code) - 1 and code[i+1].isdigit():\n j = i+1\n while j < len(code) and code[j].isdigit():\n num += code[j]\n j += 1\n for _ in range(int(num)):\n if code[i] in \"LR\":\n drxn = rotate(drxn, code[i])\n elif code[i] == \"F\":\n move(path, pos, drxn)\n else:\n break\n \n elif code[i] == \"F\":\n move(path, pos, drxn)\n elif code[i] in \"LR\":\n drxn = rotate(drxn, code[i])\n i += 1\n return \"\\r\\n\".join(\"\".join(row) for row in path)"]
{"fn_name": "execute", "inputs": [[""], ["FFFFF"], ["FFFFFLFFFFFLFFFFFLFFFFFL"], ["LFFFFFRFFFRFFFRFFFFFFF"], ["LF5RF3RF3RF7"], ["FFFLLFFFFFFRRFFFLFFFRRFFFFFFFF"], ["F3L2F6R2F3LF3R2F8"], ["F2FLLF3F3R2FFFLF2FRRF3F2F2F"], ["FFLFFFLFFFFLFFFFFLFFFFFFLFFFFFFFLFFFFFFFFLFFFFFFFFFLFFFFFFFFFF"], ["F2LF3LF4LF5LF6LF7LF8LF9LF10"], ["FFFFLFFFFRFFFFRFFFFLFFFFLFFFFRFFFFRFFFFLFFFFLFFFFRFFFFRFFFF"], ["F4LF4RF4RF4LF4LF4RF4RF4LF4LF4RF4RF4"]], "outputs": [["*"], ["******"], ["******\r\n* *\r\n* *\r\n* *\r\n* *\r\n******"], [" ****\r\n * *\r\n * *\r\n********\r\n * \r\n * "], [" ****\r\n * *\r\n * *\r\n********\r\n * \r\n * "], [" * \r\n * \r\n * \r\n*******\r\n * \r\n * \r\n * \r\n * \r\n * "], [" * \r\n * \r\n * \r\n*******\r\n * \r\n * \r\n * \r\n * \r\n * "], [" * \r\n * \r\n * \r\n*******\r\n * \r\n * \r\n * \r\n * \r\n * "], ["********* \r\n* * \r\n* ***** * \r\n* * * * \r\n* * * * \r\n* * *** * \r\n* * * \r\n* ******* \r\n* \r\n***********"], ["********* \r\n* * \r\n* ***** * \r\n* * * * \r\n* * * * \r\n* * *** * \r\n* * * \r\n* ******* \r\n* \r\n***********"], [" ***** ***** *****\r\n * * * * * *\r\n * * * * * *\r\n * * * * * *\r\n***** ***** ***** *"], [" ***** ***** *****\r\n * * * * * *\r\n * * * * * *\r\n * * * * * *\r\n***** ***** ***** *"]]}
introductory
https://www.codewars.com/kata/5870fa11aa0428da750000da
def execute(code):
[ 2, 4892, 78, 5910, 671, 17, 481, 31075, 279, 23229, 16, 51277, 271, 565, 66829, 271, 785, 3364, 10449, 304, 419, 98838, 11131, 374, 31127, 43582, 26, 894, 68900, 311, 5042, 15473, 15459, 11, 3871, 11, 28433, 476, 1251, 1265, 387, 1175...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
784
Spring is interesting season of year. Chef is thinking about different things, but last time he thinks about interesting game - "Strange Matrix". Chef has a matrix that consists of n rows, each contains m elements. Initially, the element aij of matrix equals j. (1 ≤ i ≤ n, 1 ≤ j ≤ m). Then p times some element aij is increased by 1. Then Chef needs to calculate the following: - For each row he tries to move from the last element (with number m) to the first one (with the number 1). - While staying in aij Chef can only move to aij - 1 only if aij - 1 ≤ aij. - The cost of such a movement is aij - aij - 1. - Otherwise Chef can't move and lose (in this row). - If Chef can move from the last element of the row to the first one, then the answer is the total cost of all the movements. - If Chef can't move from the last element of the row to the first one, then the answer is -1. Help Chef to find answers for all the rows after P commands of increasing. -----Input----- - The first line contains three integers n, m and p denoting the number of rows, the number of elements a single row and the number of increasing commands. - Each of next p lines contains two integers i and j denoting that the element aij is increased by one. -----Output----- - For each row in a single line print the answer after the P increasing commands. -----Constraints----- - 1 ≤ n, m, p ≤ 10 ^ 5 - 1 ≤ i ≤ n - 1 ≤ j ≤ m -----Example----- Input: 4 4 6 2 2 3 2 3 2 4 3 4 4 4 3 Output: 3 3 -1 4 -----Explanation----- Here is the whole matrix after P commands: 1 2 3 4 1 3 3 4 1 4 3 4 1 2 5 5 Explanations to the answer: - The first line is without changes: 4-3=1, 3-2=1, 2-1=1. answer = 3. - The second line: 4-3=1, 3-3=0, 3-1=2. The answer is 3. - The third line: 4-3=1, 3-4=-1, Chef can't move to the first number here. Therefore, the answer is -1. - The fourth line: 5-5=0, 5-2=3, 2-1=1. The answer is 4.
["import sys\nimport os\nimport random\nimport math\n#nonlocal defs\nn, m, p = list(map(int, input().split()))\narr = [dict() for _ in range(n)]\nfor _ in range(p):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in arr[i]:\n arr[i][j] = j+1\n else:\n arr[i][j] += 1\n\ndef chefbm(arr,i):\n for (e,f) in arr[i].items():\n if e == m-1:\n continue\n if e+1 in arr[i]:\n c = arr[i][e+1]\n else:\n c = e+1\n if arr[i][e] > c:\n return -1\n y = arr[i][m-1] if m-1 in arr[i] else m-1\n x = arr[i][0] if 0 in arr[i] else 0\n return y-x\n\nfor i in range(n):\n print(chefbm(arr,i))", "N,M,P = list(map(int,input().split()))\nA = [dict() for _ in range(N)]\nfor _ in range(P):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in A[i]:\n A[i][j] = j+1\n else:\n A[i][j] += 1\n\ndef solve(A,i):\n for (k,v) in A[i].items():\n if k == M-1:\n continue\n if k+1 in A[i]:\n c = A[i][k+1]\n else:\n c = k+1\n if A[i][k] > c:\n return -1\n y = A[i][M-1] if M-1 in A[i] else M-1\n x = A[i][0] if 0 in A[i] else 0\n return y-x\n\nfor i in range(N):\n print(solve(A,i))", "import sys\nimport os\nimport random\nimport math\n#nonlocal defs\nn,m,p = list(map(int,input().split()))\na = [dict() for _ in range(n)]\nfor _ in range(p):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in a[i]:\n a[i][j] = j+1\n else:\n a[i][j] += 1\n\ndef chefbm(a,i):\n for (k,v) in a[i].items():\n if k == m-1:\n continue\n if k+1 in a[i]:\n c = a[i][k+1]\n else:\n c = k+1\n if a[i][k] > c:\n return -1\n y = a[i][m-1] if m-1 in a[i] else m-1\n x = a[i][0] if 0 in a[i] else 0\n return y-x\n\nfor i in range(n):\n print(chefbm(a,i))", "N,M,P = list(map(int,input().split()))\nA = [dict() for _ in range(N)]\nfor _ in range(P):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in A[i]:\n A[i][j] = j+1\n else:\n A[i][j] += 1\n\ndef solve(A,i):\n for (k,v) in list(A[i].items()):\n if k == M-1:\n continue\n if k+1 in A[i]:\n c = A[i][k+1]\n else:\n c = k+1\n if A[i][k] > c:\n return -1\n y = A[i][M-1] if M-1 in A[i] else M-1\n x = A[i][0] if 0 in A[i] else 0\n return y-x\n\nfor i in range(N):\n print(solve(A,i))\n", "N,M,P = list(map(int,input().split()))\nA = [dict() for _ in range(N)]\nfor _ in range(P):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in A[i]:\n A[i][j] = j+1\n else:\n A[i][j] += 1\n\ndef solve(A,i):\n for (k,v) in A[i].items():\n if k == M-1:\n continue\n if k+1 in A[i]:\n c = A[i][k+1]\n else:\n c = k+1\n if A[i][k] > c:\n return -1\n y = A[i][M-1] if M-1 in A[i] else M-1\n x = A[i][0] if 0 in A[i] else 0\n return y-x\n\nfor i in range(N):\n print(solve(A,i))", "n,m,p=(int(e) for e in input().split())\n\ndef add(d,k):\n if k in d:\n d[k]+=1\n else:\n d[k]=1\ndef get(d,k):\n if k in d:\n return d[k]\n else:\n return 0\ndic2={}\ndic={}\n\n\nsumd={}\nfor i in range(n):\n dic[i]=[]\n sumd[i]=m-1\nfor i in range(p):\n a,b=(int(e) for e in input().split())\n if b==1:\n sumd[a-1]-=1\n if b==m:\n sumd[a-1]+=1\n add(dic2,(a-1,b-1))\n dic[a-1].append(b-1)\n\n\nfor i in range(n):\n if len(dic[i])<=1:\n print(sumd[i])\n else:\n arr=set(dic[i])\n flag=0\n for e in arr:\n if e==m-1 or get(dic2,(i,e))-1 <= get(dic2,(i,e+1)):\n pass\n else:\n flag=1\n break\n if flag==1:\n print(-1)\n else:\n print(sumd[i])\n\n\n", "N,M,P = list(map(int,input().split()))\nA = [dict() for _ in range(N)]\nfor _ in range(P):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in A[i]:\n A[i][j] = j+1\n else:\n A[i][j] += 1\n\ndef solve(A,i):\n for (k,v) in A[i].items():\n if k == M-1:\n continue\n if k+1 in A[i]:\n c = A[i][k+1]\n else:\n c = k+1\n if A[i][k] > c:\n return -1\n y = A[i][M-1] if M-1 in A[i] else M-1\n x = A[i][0] if 0 in A[i] else 0\n return y-x\n\nfor i in range(N):\n print(solve(A,i))", "from collections import defaultdict\n\nn, m, p = list(map(int, input().split()))\nc = [defaultdict(int) for _ in range(n+1)]\n\nfor _ in range(p):\n i, j = list(map(int, input().split()))\n c[i][j] += 1\n\nfor i in range(1, n+1):\n if not c[i]:\n print(m-1)\n else:\n x = m + c[i].get(m, 0)\n v = list(c[i].items())\n v.sort(reverse=True)\n cost = 0 \n last_col = m\n ok = True\n for j, h in v:\n cost += max(0, last_col-j-1)\n if j < m:\n x = j+1 + c[i].get(j+1, 0)\n if x < j+h:\n ok = False\n break\n if j > 1:\n x = h+1 - c[i].get(j-1, 0)\n if x < 0:\n ok = False\n break\n cost += x\n last_col = j-1\n if ok:\n print(cost+max(0, last_col-1))\n else:\n print(-1)\n", "#!/usr/bin/env python2\n# -*- coding: utf-8 -*-\n\n## Codechef May Challenge 2014\n## Chef and Strange Matrix\n\ntry:\n import psyco\n psyco.full()\nexcept ImportError:\n pass\n\n\ndef main(N, M, P, tab):\n \"\"\"Evolved solution\"\"\"\n # make a dictionnary with rows and cols increased\n dtab = dict()\n for ii, jj in tab:\n i, j = ii-1, jj-1\n if i in dtab:\n dtab[i].append(j)\n else:\n dtab[i] = [j]\n\n # move along each row\n for i in range(N):\n sol = M-1\n if i in dtab:\n line = sorted(dtab[i])\n # only the first and the last col give points\n sol += line.count(M-1) - line.count(0)\n # check for unsolvable cases\n prev = -1 # don't repeat k\n for k in line:\n if k > prev and k < (M - 1):\n inc_k = line.count(k)\n inc_kp = line.count(k+1)\n if inc_k > (inc_kp + 1):\n sol = -1\n break\n prev = k\n\n print(sol)\n\n\ndef __starting_point():\n N, M, P = list(map(int, input().split())) # rows, cols, increasing cmds\n tab = [list(map(int, input().split())) for _ in range(P)]\n main(N, M, P, tab)\n\n__starting_point()", "def __starting_point():\n n,m,p = list(map(int, input().split()))\n hit={}\n sums={}\n for i in range(1,n+1):\n hit[i]={}\n sums[i]=m-1\n for _ in range(p):\n i,j = list(map(int, input().split()))\n if j not in hit[i]:\n hit[i][j]=1\n else:\n hit[i][j]+=1\n for i in range(1,n+1):\n done = True\n for j in hit[i]:\n if j!=m and (hit[i][j] - hit[i].get(j+1,0)) > 1:\n done=False\n break\n if j==1 and m>1: sums[i]-=hit[i][j]\n elif j==m and m>1: sums[i]+=hit[i][j]\n if done:\n print(sums[i])\n else:\n print(-1)\n \n \n\n__starting_point()", "n,m,p=list(map(int,input().split()))\nmn={}\nfor i in range (0,p):\n x,y=list(map(int,input().split()))\n key = (x,y)\n if key in mn:\n mn[key] +=1\n else:\n mn[key] = 1\n\n\n#print mn\nans = {}\nfor key in (mn):\n cur = key \n next = (key[0],key[1]+1)\n if next[1] <= m:\n if next in mn:\n if mn[cur] > mn[next]+1: # Strictly correct.\n ans[cur[0]] = -1\n elif mn[cur] > 1:\n ans[cur[0]] = -1\n \nfor i in range(1,n+1):\n if i in ans:\n print(-1)\n else:\n start = (i,1)\n end = (i,m)\n #if start != end:\n if end in mn and start in mn:\n print(mn[end]-mn[start]+(m-1))\n if end in mn and start not in mn:\n print(mn[end]+(m-1))\n if end not in mn and start in mn:\n print((m-1)-mn[start])\n if end not in mn and start not in mn:\n print(m-1)\n #else:\n #print mn[start]+1\n", "inp = input().split()\n\nrow_n,col_m,operation_p = int(inp[0]),int(inp[1]),int(inp[2])\n\noperations = []\n\nfor i in range(operation_p):\n inp = input().split()\n row,col = int(inp[0]),int(inp[1])\n operations.append([row,col])\noperations.sort()\n\n\ni=0\nsol_index = 1\nwhile i<operation_p:\n if operations[i][0]==sol_index:\n #Logic\n sol = col_m-1\n o = {}\n while (i<operation_p and operations[i][0]==sol_index ):\n e = operations[i][1]\n if e in o:\n o[e]+=1\n else:\n o[e]=1\n i+=1\n #print o\n for e in o:\n if o[e]>1:\n if e+1<=col_m:\n if e+1 in o:\n if o[e]-o[e+1]>1:\n sol = -1\n break\n else:\n sol = -1\n break\n if sol != -1:\n if 1 in o:\n sol-=o[1]\n if col_m in o:\n sol+=o[col_m]\n print(sol)\n sol_index+=1\n else:\n print(col_m-1)\n sol_index+=1\nwhile sol_index <= row_n:\n print(col_m-1)\n sol_index+=1", "inp = input().split()\n\nrow_n,col_m,operation_p = int(inp[0]),int(inp[1]),int(inp[2])\n\noperations = []\n\n#---------------Getting Operations-------------\nfor i in range(operation_p):\n inp = input().split()\n row,col = int(inp[0]),int(inp[1])\n operations.append([row,col])\noperations.sort()\n#------------------------------------------------\n\ni=0\nsol_index = 1\nwhile i<operation_p:\n if operations[i][0]==sol_index:\n #Logic\n sol = col_m-1\n o = {}\n while (i<operation_p and operations[i][0]==sol_index ):\n e = operations[i][1]\n if e in o:\n o[e]+=1\n else:\n o[e]=1\n i+=1\n #print o\n for e in o:\n if o[e]>1:\n # print \"O[e] > 1\"\n if e+1<=col_m:\n # print(\"e+1 <= col_m\")\n if e+1 in o:\n #print \"e+1 in o\"\n if o[e]-o[e+1]>1:\n sol = -1\n break\n else:\n sol = -1\n break\n if sol != -1:\n if 1 in o:\n sol-=o[1]\n if col_m in o:\n sol+=o[col_m]\n print(sol)\n sol_index+=1\n else:\n print(col_m-1)\n sol_index+=1\nwhile sol_index <= row_n:\n print(col_m-1)\n sol_index+=1", "N,M,P = list(map(int,input().split()))\nA = [dict() for _ in range(N)]\nfor _ in range(P):\n i,j = list(map(int,input().split()))\n i -= 1\n j -= 1\n if j not in A[i]:\n A[i][j] = j+1\n else:\n A[i][j] += 1\n\ndef solve(A,i):\n for (k,v) in list(A[i].items()):\n if k == M-1:\n continue\n if k+1 in A[i]:\n c = A[i][k+1]\n else:\n c = k+1\n if A[i][k] > c:\n return -1\n y = A[i][M-1] if M-1 in A[i] else M-1\n x = A[i][0] if 0 in A[i] else 0\n return y-x\n\nfor i in range(N):\n print(solve(A,i))\n", "import sys\n\n__author__ = 'm.melnik'\n\nn, m, p = [int(i) for i in sys.stdin.readline().split()]\nincs = {i: [] for i in range(1, n + 1)}\n\nfor i in range(p):\n x, y = [int(i) for i in sys.stdin.readline().split()]\n incs[x].append(y)\n\nfor i in range(1, n + 1):\n cur = 1\n cost = 0\n height = cur\n prev_height = 0\n # print(sorted(incs[i]))\n for j in sorted(incs[i]):\n if j == cur:\n height += 1\n elif j == cur + 1:\n if cur != 1:\n if height >= prev_height:\n cost += height - prev_height\n else:\n cost = -1\n break\n prev_height = height\n height = j + 1\n cur = j\n else:\n if cur != 1:\n if height >= prev_height:\n cost += height - prev_height\n else:\n cost = -1\n break\n if height > cur + 1:\n cost = -1\n break\n else:\n cost += j - height - 1\n cur = j\n height = j + 1\n prev_height = j - 1\n\n if cost != -1:\n if cur != m:\n if cur != 1:\n if height >= prev_height:\n cost += height - prev_height\n else:\n cost = -1\n if cost != -1:\n if height > cur + 1:\n cost = -1\n else:\n cost += m - height\n else:\n if cur != 1:\n if height >= prev_height:\n cost += height - prev_height\n else:\n cost = -1\n print(cost)\n", "import operator\nn, m, p = list(map(int, input().split()))\na = []\nfor i in range(p):\n a.append(list(map(int, input().split())))\na.sort(key=operator.itemgetter(0, 1))\nb = []\nj = p - 1\nfor i in range(n, 0, -1):\n last = 200000\n now = 0\n k = m\n low = 1\n high = m\n while j >= 0 and a[j][0] == i:\n if a[j][1] == k:\n now += 1\n if now > last + 1:\n break\n elif a[j][1] == k - 1:\n k = a[j][1]\n last = now\n now = 1\n else:\n k = a[j][1]\n now = 1\n last = 0\n if a[j][1] == m:\n high = now + a[j][1]\n if a[j][1] == 1:\n low = now + a[j][1]\n j -= 1\n if now > last + 1:\n b.append(-1)\n while j >= 0 and a[j][0] == i:\n j -= 1\n else:\n b.append(high - low)\nfor i in range(n - 1, -1, -1):\n print(b[i])\n", "from sys import stdout, stdin\nfrom operator import itemgetter\nn, m, p = list(map(int, stdin.readline().split()[0:3]))\nincreases = {}\nfor _ in range(p):\n i, j = list(map(int, stdin.readline().split()[0:2]))\n if not i in increases:\n increases[i] = {}\n increases[i][j] = 1\n else:\n if j in increases[i]:\n increases[i][j] += 1\n else:\n increases[i][j] = 1\nfor row in range(1, n + 1, 1):\n base = m - 1\n if not row in increases or m == 1:\n print(base)\n else:\n keylist = list(increases[row].keys())\n keylist.sort()\n for key in keylist:\n if key == m:\n base += increases[row][key]\n continue\n if not key + 1 in increases[row]:\n if increases[row][key] >= 2:\n base = -1\n break\n if key == 1:\n base -= increases[row][key]\n continue\n else:\n if increases[row][key] - increases[row][key + 1] >= 2:\n base = -1\n break\n else:\n if key == 1:\n base -= increases[row][key]\n continue\n print(base)", "import sys\n\nn,m,p = list(map(int,sys.stdin.readline().split()))\n\nd1 = {}\n\nfor i in range(p):\n i,j = list(map(int,sys.stdin.readline().split()))\n if i not in d1:\n d1[i] = {}\n d1[i][j] = 1\n else:\n if j not in d1[i]:\n d1[i][j] = 1\n else:\n d1[i][j] += 1\n\ndef matrix(n,m,d):\n ans = m-1\n l = list(reversed(sorted(d.keys())))\n #print \"l = \",l\n #print \"d = \",d\n for i in range(len(l)):\n #print \"ans = \",ans\n number = l[i]\n if number > 1:\n below = number - 1\n else:\n if len(l) == 1:\n if d[1] > 1:\n return -1\n else:\n return m-2\n else:\n value = 1 + d[1]\n if 2 not in d:\n if 2-value >= 0:\n ans += 2 - value - 1\n else:\n return -1\n return ans\n if number < m:\n above = number + 1\n else:\n if len(l) == 1:\n return ((m+d[m])-(m-1)-1)+ans\n else:\n if m-1 not in d:\n ans += (m+d[m])-(m-1)-1\n else:\n below = (m-1)+d[below]\n value = m+d[m]\n if value - below < 0:\n return -1\n else:\n ans += value-(below) - 1\n continue\n value = number + d[number]\n if below in d:\n initial = below + d[below]\n else:\n initial = below\n if above in d:\n final = above + d[above]\n else:\n final = above\n if value - initial >= 0:\n ans += value - initial - 1\n else:\n return -1\n if len(l)==1:\n if final - value >= 0:\n ans += final - value - 1\n else:\n return -1\n elif number+1 != l[i-1]:\n if final - value >= 0:\n ans += final - value - 1\n else:\n return -1\n \n return ans \n\n\nfor i in range(1,n+1):\n if m == 1:\n print(0)\n elif i not in d1:\n print(m-1)\n else:\n print(matrix(n,m,d1[i]))\n\n", "import sys\n\nn,m,p = list(map(int,sys.stdin.readline().split()))\n\nd1 = {}\n\nfor i in range(p):\n i,j = list(map(int,sys.stdin.readline().split()))\n if i not in d1:\n d1[i] = {}\n d1[i][j] = 1\n else:\n if j not in d1[i]:\n d1[i][j] = 1\n else:\n d1[i][j] += 1\n\ndef matrix(n,m,d):\n ans = m-1\n l = list(reversed(sorted(d.keys())))\n #print \"l = \",l\n #print \"d = \",d\n for i in range(len(l)):\n #print \"ans = \",ans\n number = l[i]\n if number > 1:\n below = number - 1\n else:\n if len(l) == 1:\n if d[1] > 1:\n return -1\n else:\n return m-2\n else:\n value = 1 + d[1]\n if 2 not in d:\n if 2-value >= 0:\n ans += 2 - value - 1\n else:\n return -1\n return ans\n if number < m:\n above = number + 1\n else:\n if len(l) == 1:\n return ((m+d[m])-(m-1)-1)+ans\n else:\n if m-1 not in d:\n ans += (m+d[m])-(m-1)-1\n else:\n below = (m-1)+d[below]\n value = m+d[m]\n if value - below < 0:\n return -1\n else:\n ans += value-(below) - 1\n continue\n value = number + d[number]\n if below in d:\n initial = below + d[below]\n else:\n initial = below\n if above in d:\n final = above + d[above]\n else:\n final = above\n if value - initial >= 0:\n ans += value - initial - 1\n else:\n return -1\n if len(l)==1:\n if final - value >= 0:\n ans += final - value - 1\n else:\n return -1\n elif number+1 != l[i-1]:\n if final - value >= 0:\n ans += final - value - 1\n else:\n return -1\n \n return ans \n\n\nfor i in range(1,n+1):\n if m == 1:\n print(0)\n elif i not in d1:\n print(m-1)\n else:\n print(matrix(n,m,d1[i]))\n'''for i in xrange(1,n+1):\n flag = True\n if i not in d:\n print m-1\n else:\n s = 0\n temp = m\n first = temp + d[i].count(temp)\n while temp > 1:\n second = (temp-1) + d[i].count(temp-1)\n #print d[i]\n if first >= second:\n s += first-second\n first = second\n #print \"s = \",s\n else:\n flag = False\n break\n temp -= 1\n if flag:\n print s\n else:\n print -1\n \n '''\n"]
{"inputs": [["4 4 6", "2 2", "3 2", "3 2", "4 3", "4 4", "4 3"]], "outputs": [["3", "3", "-1", "4"]]}
interview
https://www.codechef.com/MAY14/problems/CHEFBM
[ 25150, 374, 7040, 3200, 315, 1042, 13, 35975, 374, 7274, 911, 2155, 2513, 11, 714, 1537, 882, 566, 15482, 911, 7040, 1809, 481, 330, 91334, 11631, 3263, 715, 93903, 702, 264, 6172, 429, 17167, 315, 308, 6978, 11, 1817, 5610, 296, 5424...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,469
Complete the function that counts the number of unique consonants in a string (made up of printable ascii characters). Consonants are letters used in English other than `"a", "e", "i", "o", "u"`. We will count `"y"` as a consonant. Remember, your function needs to return the number of unique consonants - disregarding duplicates. For example, if the string passed into the function reads `"add"`, the function should return `1` rather than `2`, since `"d"` is a duplicate. Similarly, the function should also disregard duplicate consonants of differing cases. For example, `"Dad"` passed into the function should return `1` as `"d"` and `"D"` are duplicates. ## Examples ``` "add" ==> 1 "Dad" ==> 1 "aeiou" ==> 0 "sillystring" ==> 7 "abcdefghijklmnopqrstuvwxyz" ==> 21 "Count my unique consonants!!" ==> 7 ```
["CONSONANTS = set('bcdfghjklmnpqrstvwxyz')\n\ndef count_consonants(text):\n return len(CONSONANTS.intersection(text.lower()))", "def count_consonants(text):\n return len(set(filter(str.isalpha,text.lower())) - set(\"aeiou\"))", "def count_consonants(s):\n return len({c for c in s.lower() if c in 'bcdfghjklmnpqrstvwxyz'})", "count_consonants=lambda s: len(set(l for l in s.lower() if l in \"bcdfghjklmnpqrstvwxyz\"))", "CONSONANTS = set(\"bcdfghjklmnpqrstvwxyz\")\n\ndef count_consonants(text):\n return len(CONSONANTS & set(text.lower()))", "def count_consonants(text):\n return len({ch for ch in text.lower() if ch in 'bcdfghjklmnpqrstvwxyz'})", "def count_consonants(text):\n return len(set(c for c in text.lower() if c in \"bcdfghjklmnpqrstvwxxyz\"))\n", "def count_consonants(text):\n return len(set(list(text.lower())).intersection(set(list('bcdfghjklmnpqrstvwxyz'))))", "def count_consonants(text):\n # Your code here:\n vowels = ['a', 'e', 'i', 'o', 'u']\n consonants = []\n for letter in text:\n letter = letter.lower()\n conditions = [letter not in vowels,\n letter not in consonants,\n letter.isalpha()]\n if all(conditions):\n consonants.append(letter)\n return len(consonants)", "def count_consonants(s):\n return len(set(c for c in s.lower() if c in \"bcdfghjklmnpqrstvwxyz\"))"]
{"fn_name": "count_consonants", "inputs": [["sillystring"], ["aeiou"], ["abcdefghijklmnopqrstuvwxyz"], ["Count my unique consonants!!"]], "outputs": [[7], [0], [21], [7]]}
introductory
https://www.codewars.com/kata/5a19226646d843de9000007d
def count_consonants(text):
[ 12548, 279, 729, 429, 14579, 279, 1372, 315, 4911, 77505, 1783, 304, 264, 914, 320, 26912, 705, 315, 41995, 47120, 5766, 3593, 1109, 930, 1783, 525, 11931, 1483, 304, 6364, 1008, 1091, 53305, 64, 497, 330, 68, 497, 330, 72, 497, 330, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,676
You get an array of different numbers to sum up. But there is one problem, those numbers all have different bases. For example: ```python You get an array of numbers with their base as an input: [["101",16],["7640",8],["1",9]] ``` The output should be the sum as an integer value with a base of 10, so according to the example this would be: 4258 ```python A few more examples: [["101",2], ["10",8]] --> 13 [["ABC",16], ["11",2]] --> 2751 ``` Bases can be between 2 and 36 (2<=base<=36)
["def sum_it_up(a):\n return sum(int(*x) for x in a)", "def sum_it_up(a):\n return sum(int(n, b) for n, b in a)", "sum_it_up=lambda n: sum(int(x[0],x[1]) for x in n)", "def sum_it_up(numbers_with_bases):\n return sum(int(number, base) for number, base in numbers_with_bases)", "def sum_it_up(numbers_with_bases):\n return sum(int(num, base) for num, base in numbers_with_bases)", "def sum_it_up(to_add):\n return sum(int(num, base) for num, base in to_add)", "def sum_it_up(numbers_with_bases):\n return sum(list(map(lambda x: int(x[0], x[1]), numbers_with_bases)))", "def sum_it_up(numbers_with_bases):\n return sum(int(*ls) for ls in numbers_with_bases)", "def sum_it_up(nums):\n return sum(int(n,b) for n,b in nums)", "def sum_it_up(numbers_with_bases):\n output = []\n for number in numbers_with_bases:\n output.append(int(number[0],number[1]))\n return sum(output)"]
{"fn_name": "sum_it_up", "inputs": [[[["101", 2], ["10", 8]]], [[["ABC", 16], ["11", 2]]], [[["101", 16], ["7640", 8], ["1", 9]]], [[]]], "outputs": [[13], [2751], [4258], [0]]}
introductory
https://www.codewars.com/kata/5a005f4fba2a14897f000086
def sum_it_up(numbers_with_bases):
[ 2610, 633, 458, 1334, 315, 2155, 5109, 311, 2629, 705, 13, 1988, 1052, 374, 825, 3491, 11, 1846, 5109, 678, 614, 2155, 23092, 624, 2461, 3110, 510, 73594, 12669, 198, 2610, 633, 458, 1334, 315, 5109, 448, 862, 2331, 438, 458, 1946, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,264
Mohit's girlfriend is playing a game with Nicky. The description of the game is as follows: - Initially on a table Player 1 will put N gem-stones. - Players will play alternatively, turn by turn. - At each move a player can take at most M gem-stones (at least 1 gem-stone must be taken) from the available gem-stones on the table.(Each gem-stone has same cost.) - Each players gem-stone are gathered in player's side. - The player that empties the table purchases food from it (using all his gem-stones; one gem-stone can buy one unit of food), and the other one puts all his gem-stones back on to the table. Again the game continues with the "loser" player starting. - The game continues until all the gem-stones are used to buy food. - The main objective of the game is to consume maximum units of food. Mohit's girlfriend is weak in mathematics and prediction so she asks help from Mohit, in return she shall kiss Mohit. Mohit task is to predict the maximum units of food her girlfriend can eat, if, she starts first. Being the best friend of Mohit, help him in predicting the answer. -----Input----- - Single line contains two space separated integers N and M. -----Output----- - The maximum units of food Mohit's girlfriend can eat. -----Constraints and Subtasks----- - 1 <= M <= N <= 100 Subtask 1: 10 points - 1 <= M <= N <= 5 Subtask 2: 20 points - 1 <= M <= N <= 10 Subtask 3: 30 points - 1 <= M <= N <= 50 Subtask 3: 40 points - Original Constraints. -----Example----- Input: 4 2 Output: 2
["r=[0,1,1,2,1,4,2,6,1,8,4]\n\nn,m=[int(x) for x in input().split()]\nif m==1:\n while n%2!=1:\n n=n/2\n if n==1:\n print(1)\n else: \n print(n-1) \nelif (n+1)/2<m:\n print(m)\nelse:\n print(n-m)\n\n \n", "\nn,m=[int(x) for x in input().split()]\nif m==1:\n while n%2!=1:\n n=n/2\n if n==1:\n print(1)\n else: \n print(n-1) \nelif (n+1)/2<=m:\n print(m)\nelse:\n print(n-m)", "r=[0,1,1,2,1,4,2,6,1,8,4]\n\nn,m=[int(x) for x in input().split()]\nif m==1:\n print(r[n])\nelif (n+1)/2<=m:\n print(m)\nelse:\n print(n-m)\n\n \n", "n,m=[int(x) for x in input().split()]\nif n==m:\n print(n)\nelif n-1==m:\n print(m)\nelif m==1:\n if n==3:\n print(2)\n elif n==4:\n print(1)\n elif n==5:\n print(4)\nelif m==2:\n if n==4:\n print(2)\n elif n==5:\n print(3)\nelif m==3:\n if n==5:\n print(3)\n", "read = lambda: list(map(int, input().split()))\nread_s = lambda: list(map(str, input().split()))\n\nn, m = read()\nans = 0\nif n == m:\n print(n)\n return\nwhile n > 0:\n if n > m:\n ans += m\n n -= 2*m\n else:\n ans += 1\n n -= 2\nprint(ans)", "read = lambda: list(map(int, input().split()))\nread_s = lambda: list(map(str, input().split()))\n\nn, m = read()\nans = 0\nwhile n > 0:\n if n > m:\n ans += m\n n -= 2*m\n else:\n ans += 1\n n -= 2\nprint(ans)", "read = lambda: list(map(int, input().split()))\nread_s = lambda: list(map(str, input().split()))\n\nn, m = read()\nans = 0\nwhile True:\n if n > m:\n ans += m\n n -= 2*m\n else: break\nprint(ans)", "n,m = list(map(int,input().split()))\nl = [ [1],\n [1,2],\n [2,2,3],\n [1,2,3,4],\n [4,3,3,4,5] ]\nprint(l[n-1][m-1])"]
{"inputs": [["4 2"]], "outputs": [["2"]]}
interview
https://www.codechef.com/CDVA16/problems/CDVA1610
[ 82605, 275, 594, 22761, 374, 5619, 264, 1809, 448, 14991, 88, 13, 576, 4008, 315, 279, 1809, 374, 438, 11017, 510, 12, 58556, 389, 264, 1965, 7312, 220, 16, 686, 2182, 451, 18747, 5477, 3154, 624, 12, 24618, 686, 1486, 68387, 11, 24...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,645
> If you've finished this kata, you can try the [more difficult version](https://www.codewars.com/kata/5b256145a454c8a6990000b5). ## Taking a walk A promenade is a way of uniquely representing a fraction by a succession of “left or right” choices. For example, the promenade `"LRLL"` represents the fraction `4/7`. Each successive choice (`L` or `R`) changes the value of the promenade by combining the values of the promenade before the most recent left choice with the value before the most recent right choice. If the value before the most recent left choice was *l/m* and the value before the most recent right choice was r/s then the new value will be *(l+r) / (m+s)*. If there has never been a left choice we use *l=1* and *m=0*; if there has never been a right choice we use *r=0* and *s=1*. So let's take a walk. * `""` An empty promenade has never had a left choice nor a right choice. Therefore we use *(l=1 and m=0)* and *(r=0 and s=1)*. So the value of `""` is *(1+0) / (0+1) = 1/1*. * `"L"`. Before the most recent left choice we have `""`, which equals *1/1*. There still has never been a right choice, so *(r=0 and s=1)*. So the value of `"L"` is *(1+0)/(1+1) = 1/2* * `"LR"` = 2/3 as we use the values of `""` (before the left choice) and `"L"` (before the right choice) * `"LRL"` = 3/5 as we use the values of `"LR"` and `"L"` * `"LRLL"` = 4/7 as we use the values of `"LRL"` and `"L"` Fractions are allowed to have a larger than b. ## Your task Implement the `promenade` function, which takes an promenade as input (represented as a string), and returns the corresponding fraction (represented as a tuple, containing the numerator and the denominator). ```Python promenade("") == (1,1) promenade("LR") == (2,3) promenade("LRLL") == (4,7) ``` ```Java Return the Fraction as an int-Array: promenade("") == [1,1] promenade("LR") == [2,3] promenade("LRLL") == [4,7] ``` *adapted from the 2016 British Informatics Olympiad*
["def promenade(choices):\n \n def compute(): return l+r,m+s\n \n l,m, r,s = 1,0, 0,1\n for c in choices:\n if c=='L': l,m = compute()\n else: r,s = compute()\n \n return compute()", "def promenade(choices):\n l, m = (1, 0)\n r, s = (0, 1)\n for choice in choices:\n if choice == 'L': l, m = l+r, m+s\n elif choice == 'R': r, s = l+r, m+s\n return l+r,m+s", "\ndef next(last_l, last_r):\n return last_l[0] + last_r[0], last_l[1] + last_r[1]\n\ndef promenade(choices):\n last_l = (1, 0)\n last_r = (0, 1)\n last = None\n \n for c in choices:\n if c == \"L\":\n last_l = next(last_l, last_r)\n else:\n last_r = next(last_l, last_r)\n \n return next(last_l, last_r)\n \n \n \n \n # good luck!\n", "def promenade(choices):\n x = [(1, 0), (0, 1)] # [(l, m), (r, s)]\n for c in choices:\n x[c == 'R'] = x[0][0] + x[1][0], x[0][1] + x[1][1]\n return x[0][0] + x[1][0], x[0][1] + x[1][1]", "def promenade(choices):\n l, m, r = [1, 0], [1, 1], [0, 1]\n for c in choices:\n if c == 'L': l = m[:]\n else: r = m[:]\n m = [l[0]+r[0], l[1]+r[1]]\n return tuple(m)", "def promenade(choices):\n if not choices: return (1, 1)\n (a, b) = promenade(choices[1:])\n return (a, a + b) if choices[0] == 'L' else (a + b, b)", "def promenade(choices):\n lm=[1,0]\n rs=[0,1]\n ans=[1,1]\n \n for i in choices:\n if i=='L':\n lm=ans[::]\n \n if i=='R':\n rs=ans[::]\n ans=[lm[0]+rs[0],lm[1]+rs[1]]\n return tuple(ans)\n \ndef fraction_to_promenade(fraction):\n ans=\"\"\n frac=list(fraction)\n while(frac[0]!=frac[1]):\n if frac[0]>frac[1]:\n \n ans+=\"R\"\n frac[0]=frac[0]-frac[1]\n if frac[1]>frac[0]:\n ans+=\"L\"\n frac[1]=frac[1]-frac[0]\n return ans", "def promenade(ch):\n \n def evaulate(): return l+r,m+s\n \n l,m, r,s = 1,0, 0,1\n for c in ch:\n if c=='L': l,m = evaulate()\n else: r,s = evaulate()\n \n return evaulate()", "def promenade(choices):\n fraction=(1,1)\n most_recent_L=(1,0)\n most_recent_R=(0,1)\n fraction_add=lambda L, R: tuple( l + r for l, r in zip(L,R))\n for C in choices:\n if C==\"L\":\n most_recent_L=fraction\n fraction=fraction_add(most_recent_L,most_recent_R)\n elif C==\"R\": \n most_recent_R=fraction\n fraction=fraction_add(most_recent_L,most_recent_R)\n else: raise ValueError\n return fraction", "def promenade(choices):\n last_left = [1,0]\n last_right = [0,1]\n out = [1,1]\n for choice in choices:\n if choice is 'L':\n last_left = out.copy()\n out[0] += last_right[0]\n out[1] += last_right[1]\n else:\n last_right = out.copy()\n out[0] += last_left[0]\n out[1] += last_left[1]\n return tuple(out)\n"]
{"fn_name": "promenade", "inputs": [[""], ["L"], ["R"], ["LRLL"], ["LLRLR"], ["RRRLRRR"], ["LLLLRLLLL"], ["LLLLLLLLLL"], ["RLRLRLRRLRLL"], ["LLRRLRRLRLLL"], ["LRRLLRLLRLRR"], ["LRRLRLLLLRLL"], ["LLLRRRLLLRLL"], ["RRLRRRLLRLRR"], ["RRRRLLRLLRLR"], ["LLRLRLLRLLRL"], ["LRLLRRRRLLRR"], ["RLRRLRRRRRRR"]], "outputs": [[[1, 1]], [[1, 2]], [[2, 1]], [[4, 7]], [[5, 13]], [[19, 5]], [[6, 29]], [[1, 11]], [[290, 179]], [[87, 206]], [[161, 229]], [[107, 149]], [[49, 162]], [[219, 79]], [[214, 49]], [[112, 295]], [[100, 169]], [[61, 35]]]}
introductory
https://www.codewars.com/kata/5b254b2225c2bb99c500008d
def promenade(choices):
[ 29, 1416, 498, 3003, 8060, 419, 61688, 11, 498, 646, 1430, 279, 508, 6384, 5000, 2319, 9533, 2428, 1110, 2136, 41067, 365, 1561, 905, 14109, 459, 14, 20, 65, 17, 20, 21, 16, 19, 20, 64, 19, 20, 19, 66, 23, 64, 21, 24, 24, 15, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,265
The Head Chef is receiving a lot of orders for cooking the best of the problems lately. For this, he organized an hiring event to hire some talented Chefs. He gave the following problem to test the skills of the participating Chefs. Can you solve this problem and be eligible for getting hired by Head Chef. A non-negative number n is said to be magical if it satisfies the following property. Let S denote the multi-set of numbers corresponding to the non-empty subsequences of the digits of the number n in decimal representation. Please note that the numbers in the set S can have leading zeros. Let us take an element s of the multi-set S, prod(s) denotes the product of all the digits of number s in decimal representation. The number n will be called magical if sum of prod(s) for all elements s in S, is even. For example, consider a number 246, its all possible non-empty subsequence will be S = {2, 4, 6, 24, 46, 26, 246}. Products of digits of these subsequences will be {prod(2) = 2, prod(4) = 4, prod(6) = 6, prod(24) = 8, prod(46) = 24, prod(26) = 12, prod(246) = 48, i.e. {2, 4, 6, 8, 24, 12, 48}. Sum of all of these is 104, which is even. Hence 246 is a magical number. Please note that multi-set S can contain repeated elements, e.g. if number is 55, then S = {5, 5, 55}. Products of digits of these subsequences will be {prod(5) = 5, prod(5) = 5, prod(55) = 25}, i.e. {5, 5, 25}. Sum of all of these is 35 which is odd. Hence 55 is not a magical number. Consider a number 204, then S = {2, 0, 4, 20, 04, 24, 204}. Products of digits of these subsequences will be {2, 0, 4, 0, 0, 8, 0}. Sum of all these elements will be 14 which is even. So 204 is a magical number. The task was to simply find the Kth magical number. -----Input----- - First line of the input contains an integer T denoting the number of test cases. - Each of the next T lines contains a single integer K. -----Output----- For each test case, print a single integer corresponding to the Kth magical number. -----Constraints----- - 1 ≤ T ≤ 105 - 1 ≤ K ≤ 1012. -----Subtasks----- Subtask #1 : (20 points) - 1 ≤ T ≤ 100 - 1 ≤ K ≤ 104. Subtask 2 : (80 points) Original Constraints -----Example----- Input: 2 2 5 Output: 2 8 -----Explanation----- Example case 1. 2 is the 2nd magical number, since it satisfies the property of the magical number. The first magical number will be of course 0.
["def base5(n):\n if n == 0: return\n for x in base5(n // 5): yield x\n yield n % 5\n\ndef seq(n):\n return int(''.join(str(2 * x) for x in base5(n)) or '0')\n\nfor i in range(eval(input())):\n k=eval(input())\n while(i<k):\n i=i+1\n print(seq(i-1))\n", "a=list()\nl=list()\nc=0\nt=eval(input())\nfor i in range(0,t):\n\tk=eval(input())\n\tif(k<=len(a)):\n\t\tprint(a[k-1])\n\telse:\n\t\twhile(len(a)!=k):\n\t\t\tl=list(map(int,str(c)))\n\t\t\tflag=0\n\t\t\t\n\t\t\tfor j in range(0,len(l)):\n\t\t\t\tif(l[j]%2!=0):\n\t\t\t\t\tflag=1\n\t\t\t\t\tbreak\n\n\t\t\tif(flag==0):\n\t\t\t\ta.append(c)\n\t\t\t\tc=c+2\n\t\t\telse:\n\t\t\t\tx=10**(len(l)-j-1)\n\t\t\t\tc=c+x\n\n\t\tprint(a[k-1])", "a=list()\nl=list()\nc=0\nt=eval(input())\nfor i in range(0,t):\n\tk=eval(input())\n\tif(k<=len(a)):\n\t\tprint(a[k-1])\n\telse:\n\t\twhile(len(a)!=k):\n\t\t\tl=list(map(int,str(c)))\n\t\t\tflag=0\n\t\t\t\n\t\t\tfor j in range(0,len(l)):\n\t\t\t\tif(l[j]%2!=0):\n\t\t\t\t\tflag=1\n\t\t\t\t\tbreak\n\n\t\t\tif(flag==0):\n\t\t\t\ta.append(c)\n\t\t\t\tc=c+2\n\t\t\telse:\n\t\t\t\tx=10**(len(l)-j-1)\n\t\t\t\tc=c+x\n\n\t\tprint(a[k-1])", "import math\ndef answer(n):\n n-=1\n if n>0:\n a=int(math.log(n,5))\n else:\n a=0\n total=0\n while a!=0:\n x=math.pow(5,a)\n g=n//x\n n=int(n%x)\n total+=2*math.pow(10,a)*g\n if n>0:\n a=int(math.log(n,5))\n else:\n a=0\n total+=2*(n)\n total=int(total)\n return total\nT=int(input(''))\nwhile T:\n T-=1\n n=int(input(''))\n print(answer(n))\n", "a=list()\nl=list()\nc=0\nt=eval(input())\nfor i in range(0,t):\n\tk=eval(input())\n\tif(k<=len(a)):\n\t\tprint(a[k-1])\n\telse:\n\t\twhile(len(a)!=k):\n\t\t\tl=list(map(int,str(c)))\n\t\t\tflag=0\n\t\t\tif(l[0]%2==0):\n\t\t\t\tfor j in range(0,len(l)):\n\t\t\t\t\tif(l[j]%2!=0):\n\t\t\t\t\t\tflag=1\n\t\t\t\t\t\tbreak\n\n\t\t\telse:\n\t\t\t\tflag=1\n\n\t\t\tif(flag==0):\n\t\t\t\ta.append(c)\n\t\t\tx=10**(len(l)-1)\n\t\t\tif(l[0]%2==0):\n\t\t\t\tc=c+2\n\t\t\telse:\n\t\t\t\tc=c+x\n\n\t\tprint(a[k-1])", "def str_base(number, base):\n (d,m) = divmod(number,len(base))\n if d > 0:\n return str_base(d,base)+base[m]\n return base[m]\n\nfor _ in range(int(eval(input()))):\n\tn = int(eval(input()))\n\tprint(str_base(n-1,'02468')) ", "a=list()\nl=list()\nc=0\nt=eval(input())\nfor i in range(0,t):\n\tk=eval(input())\n\tif(k<=len(a)):\n\t\tprint(a[k-1])\n\telse:\n\t\twhile(len(a)!=k):\n\t\t\tl=list(map(int,str(c)))\n\t\t\tflag=0\n\t\t\tfor j in range(0,len(l)):\n\t\t\t\tif(l[j]%2!=0):\n\t\t\t\t\tflag=1\n\t\t\t\t\tbreak\n\n\t\t\tif(flag==0):\n\t\t\t\ta.append(c)\n\t\t\tc=c+2\n\n\t\tprint(a[k-1])", "a=list()\nl=list()\nc=0\nt=eval(input())\nfor i in range(0,t):\n\tk=eval(input())\n\tif(k<=len(a)):\n\t\tprint(a[k-1])\n\telse:\n\t\twhile(len(a)!=k):\n\t\t\tl=list(map(int,str(c)))\n\t\t\tflag=0\n\t\t\tfor j in range(0,len(l)):\n\t\t\t\tif(l[j]%2!=0):\n\t\t\t\t\tflag=1\n\t\t\t\t\tbreak\n\n\t\t\tif(flag==0):\n\t\t\t\ta.append(c)\n\t\t\tc=c+2\n\n\t\tprint(a[k-1])", "def base5(n):\n if n == 0: return\n for x in base5(n // 5): yield x\n yield n % 5\n\ndef seq(n):\n return int(''.join(str(2 * x) for x in base5(n)) or '0')\nt=eval(input())\nfor i in range(t):\n k=eval(input())\n print(seq(k-1))\n", "import math\nt = eval(input())\nfor i in range(0,t):\n\tK = int(input())\n\tans = []\n\tarr = [8,0,2,4,6]\n\ttemp = 1\n\ti = 0\n\twhile(temp > 0):\n\t\tk = arr[int(math.ceil(K/math.pow(5,i)))%5]\n\t\ti = i + 1\n\t\ttemp = math.floor(float(K-1)/math.pow(5,i))\n\t\tans.append(str(k))\n\tans.reverse();\n\tprint(''.join(ans))", "test = eval(input())\n\nfor i in range(test):\n\tpowOf5 = 762939453125\n\tcoeff = 200000000000000000\n\tsum_ = 0;\n\tx = eval(input())\n\twhile(x>25):\n\t\tif(x%powOf5):\t\t\t# not 0\n\t\t\tsum_ += (x/powOf5)*coeff\n\t\t\tx %= powOf5\n\t\t\tpowOf5 /= 5\n\t\telse:\n\t\t\tsum_ += coeff*((x-1)/powOf5)\n\t\t\tx = powOf5\n\t\t\tpowOf5/=5\n\t\tcoeff /= 10\n\t\t\n\t\t#print str(sum_) + ' ' + str(powOf5) + ' ' + str(coeff) \n\tmod = x%5\n\tif mod ==0:\n\t\tmod = 5\n\n\tsum_ += (x-mod)*4 + (mod-1)*2\n\n\tprint(sum_)\n\n", "def cheffun(k):\n return 10 * cheffun(k // 5) + (k % 5) * 2 if k else 0\ng=eval(input())\nwhile (g>0):\n a=eval(input())\n k=a-1\n print(cheffun(k))\n g=g-1", "def sort(d):\n\tif d==0:\n\t\treturn 1\n\tif d==1:\n\t\treturn 2\n\tif d==2:\n\t\treturn 3\n\ndef sort1(s,e):\n\tif s<e:\n\t\tp=s*e\n\treturn p\n\ndef function1(a):\n if a == 0: \n \treturn\n for b in function1(a // 5): \n \tyield b\n c=a%5\n yield c\n\ndef function(m):\n\t#d=2*c\n return int(''.join(str(2 * c) for c in function1(m)) or '0')\n\nt=eval(input())\nwhile t>0:\n\tn=eval(input())\n\ta=0\n\tm=1\n\tp=0\n\tq=0\n\tr=0\n\tif m==1:\n\t\tp=1\n\t\tm=m+1\n\tif m==2:\n\t\tq=1\n\t\tm=m+1\n\tif m==3:\n\t\tr=1\n\t\tm=m+1\n\tif n==1:\n\t\tprint(a)\n\telse:\n\t\tprint(function(n-1))\n\tt=t-1\nml= [1,5,7,9]\ns=0\t\np=ml[s]\nl=r+1\nr=e=0\nd= False\nte=ml[s]\nml[s]=ml[r]\nml[r]=te\n\n"]
{"inputs": [["2", "2", "5", "", ""]], "outputs": [["2", "8"]]}
interview
https://www.codechef.com/JUNE16/problems/CHEARMY
[ 785, 11203, 35975, 374, 12308, 264, 2696, 315, 10163, 369, 17233, 279, 1850, 315, 279, 5322, 30345, 13, 1752, 419, 11, 566, 16645, 458, 23134, 1538, 311, 17983, 1045, 23074, 8436, 3848, 13, 1260, 6551, 279, 2701, 3491, 311, 1273, 279, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,038
Two's company, three's a crowd! It's been one year since Chef met his brother. Last year, his younger brother came to visit him during this time of the year. This year, the Chef is planning to go visit his brother. Chef's brother has planned to throw a "Welcome Party" for him. He wants to invite people from his neighbourhood (i.e. from the street where he lives). There are N houses on the street in a single line (not considering the brother's house). He wants the party to be fun and he will not like to invite people who might spoil the mood of the party. If people are invited from three consecutive houses on the street, they might create trouble. As they say, three's a crowd! He doesn't want to ruin the Chef's Welcome Party and so he will not want to send invites to any three consecutive houses. He wants you to tell him how many ways are there for him to go wrong. Note that he can play safe by not inviting anyone to avoid a crowd. -----Input:----- First line of the input contains a single integer T, the number of test cases. Each test case contains a line containing a single integer N described above. -----Output:----- For each test case output a single integer denoting the number of ways the brother can go wrong with planning the party. The answer can get quite large. So output the total number of ways modulo 109+7. -----Constraints:----- 1<=T<=10000 1<=N<=1015 -----Example:-----Input: 2 3 4 Output: 1 3 Explanation: Case 1: The only way he can go wrong is by inviting all the houses. Case 2: First way of getting wrong is by inviting houses (1,2,3). Second way to get wrong is by inviting houses (2,3,4). Third way of going wrong is by inviting all 4 houses i.e. (1,2,3,4).
["MOD = int(1e9+7)\n\ndef mult(a, b):\n rsp = [[0, 0, 0],\n [0, 0, 0],\n [0, 0, 0]]\n\n for i in range(3):\n for j in range(3):\n for k in range(3):\n rsp[i][j] += a[i][k] * b[k][j]\n rsp[i][j] %= MOD\n\n return rsp\n\nident = [[1, 0, 0],\n [0, 1, 0],\n [0, 0, 1]]\nm = [[1, 1, 0],\n [1, 0, 1],\n [1, 0, 0]]\n\npowers = [m]\nfor _ in range(53):\n p = powers[-1]\n powers.append(mult(p ,p))\n\ndef pow2(e):\n y = ident\n i = 0\n for p in powers:\n if e & (1 << i):\n y = mult(p, y)\n i += 1\n return y\n\nt = eval(input())\n\nfor _ in range(t):\n n = eval(input())\n\n if n < 3:\n print(0)\n continue\n\n r = pow(2, n, MOD)\n b = pow2(n - 2)\n # print(b)\n r -= (4 * b[0][0]) % MOD\n r -= (2 * b[1][0]) % MOD\n r -= b[2][0]\n r = (MOD + r) % MOD\n print(r)\n"]
{"inputs": [["2", "3", "4"]], "outputs": [["1", "3"]]}
interview
https://www.codechef.com/problems/CROWD
[ 11613, 594, 2813, 11, 2326, 594, 264, 13428, 4894, 2132, 594, 1012, 825, 1042, 2474, 35975, 2270, 806, 10641, 13, 7996, 1042, 11, 806, 14650, 10641, 3697, 311, 3947, 1435, 2337, 419, 882, 315, 279, 1042, 13, 1096, 1042, 11, 279, 35975...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,932
# Toggling Grid You are given a grid (2d array) of 0/1's. All 1's represents a solved puzzle. Your job is to come up with a sequence of toggle moves that will solve a scrambled grid. Solved: ``` [ [1, 1, 1], [1, 1, 1], [1, 1, 1] ] ``` "0" (first row) toggle: ``` [ [0, 0, 0], [1, 1, 1], [1, 1, 1] ] ``` then "3" (first column) toggle: ``` [ [1, 0, 0], [0, 1, 1], [0, 1, 1] ] ``` The numbers in quotes are codes for the row/column, and will be explained. ## Your task: findSolution() Your task is to write a function, `findSolution()` (or `find_solution()`), which takes as input a 2d array, and returns an array of "steps" that represent a sequence of toggles to solve the puzzle. For example: ```python solution = find_solution(puzzle) print(solution); > [0, 3] ``` Note that, in the above example, `[1, 2, 4, 5]` is also a valid solution! Any solution will pass the tests. The solution is tested like this, for each number in the solution: ```python if n < puzzle.size: toggleRow(n) else: toggleCol(n - puzzle.size) ``` To elaborate, possible n's for a 3x3 puzzle: - Row numbers = (0 --> size - 1) - Cols numbers = (size --> size * 2 - 1) ### Example of "2" toggle: ### Example of "4" toggle: ## More examples: ```python puzzle = [ [ 0, 1, 0 ], [ 1, 0, 1 ], [ 1, 0, 1 ] ]; solution = find_solution(puzzle) print(solution); > [0, 4] ``` let's try some bigger puzzles: ```python puzzle = [ [ 1, 0, 1, 0, 0 ], [ 0, 1, 0, 1, 1 ], [ 0, 1, 0, 1, 1 ], [ 0, 1, 0, 1, 1 ], [ 1, 0, 1, 0, 0 ] ]; solution = find_solution(puzzle) print(solution); > [ 0, 5, 4, 7 ] ``` ```python puzzle = [ [ 1, 1, 1, 0, 1, 1, 1 ], [ 1, 1, 1, 0, 1, 1, 1 ], [ 1, 1, 1, 0, 1, 1, 1 ], [ 0, 0, 0, 1, 0, 0, 0 ], [ 1, 1, 1, 0, 1, 1, 1 ], [ 1, 1, 1, 0, 1, 1, 1 ], [ 1, 1, 1, 0, 1, 1, 1 ] ]; solution = find_solution(puzzle) print(solution); > [ 3, 10 ] ``` There are randomized tests with puzzles of up to 100x100 in size. Have fun!
["def find_solution(m):\n return [j for j,r in enumerate(m) if r[0]^m[0][0]] + [len(m)+i for i,b in enumerate(m[0]) if not b]", "find_solution = lambda m: [n for n, r in enumerate(m) if r[0]] + [n for n, c in enumerate(m[0],len(m)) if not m[0][0] ^ c]", "def find_solution(puzzle):\n n, sol = len(puzzle), []\n for i in range(n):\n if puzzle[i][0] ^ 1:\n sol.append(i)\n for i in range(1, n):\n if puzzle[0][i] ^ 1 ^ (sol and sol[0] == 0):\n sol.append(n + i)\n return sol", "import copy\n\ndef find_solution(puzzle):\n moveset = []\n while(True):\n # Find first rows with most 0's\n move_to_exe = 0\n max_zeros = 0\n for i in range(len(puzzle) * 2):\n score = count_zeros(i, puzzle)\n if score > max_zeros:\n max_zeros = score\n move_to_exe = i\n if max_zeros == 0:\n return moveset\n moveset.append(move_to_exe)\n if move_to_exe < len(puzzle):\n puzzle[move_to_exe] = [0 if y == 1 else 1 for y in puzzle[move_to_exe]]\n else:\n index = move_to_exe - len(puzzle)\n for i in range(len(puzzle)):\n puzzle[i][index] = 0 if puzzle[i][index] == 1 else 1\n \ndef count_zeros(move, puzzle):\n count = 0\n # Row toggle\n if move < len(puzzle):\n for i in puzzle[move]:\n count += 1 if i == 0 else 0\n else:\n index = move - len(puzzle)\n for row in puzzle:\n count += 1 if row[index] == 0 else 0\n return count\n\n# UGH that solution is so BASIC! Greedy execution? Lame. I perfer the BF tree search below.\n\n\"\"\"\n# Use BFS?\ndef find_solution(puzzle):\n fringe = [([], puzzle)]\n while (True): # We should always find a solution for any configuration?\n \n (moveset, current_state) = fringe.pop()\n \n # Test if current state is a solution\n valid = True\n for x in range(len(current_state)):\n if 0 in current_state[x]:\n valid = False\n break\n if valid:\n return moveset\n \n # If state is not solution then we generate successor states add to fringe queue\n successors = generate_successors(moveset, current_state)\n for s in successors:\n fringe.insert(0, s)\n \n \n \n# This function takes a moveset and a puzzle and returns all the possible successors for that puzzle\ndef generate_successors(move_list, puzzle):\n successors = []\n for x in range(len(puzzle) * 2):\n \n new_state = copy.deepcopy(puzzle)\n new_move_list = move_list[:]\n new_move_list.append(x)\n \n # If x < len(puzzle) we toggle a row\n if x < len(puzzle):\n new_state[x] = [1 if y == 0 else 0 for y in new_state[x]]\n successors.append((new_move_list, new_state))\n \n # Else toggle column\n else:\n index = x - len(puzzle)\n for i in range(len(puzzle)):\n new_state[i][index] = 0 if new_state[i][index] == 1 else 1\n successors.append((new_move_list, new_state))\n \n return successors\n\"\"\"", "def find_solution(puzzle):\n moves = set()\n n = len(puzzle)\n zeros = {(i, n + j) for i, row in enumerate(puzzle) for j, v in enumerate(row) if v == 0}\n if not zeros: return []\n def get():\n v = None\n if len(moves) == 0: return zeros.pop()\n for r, c in zeros:\n if r in moves or c in moves:\n if r in moves and c in moves: continue\n v = (r, c)\n zeros.remove(v)\n return v\n if v is None: return zeros.pop()\n while zeros:\n r, c = get()\n if r not in moves:\n moves.add(r)\n for k in range(n, 2 * n):\n if k == c: continue\n if (r, k) in zeros: zeros.remove((r, k))\n else: zeros.add((r, k))\n elif c not in moves:\n moves.add(c)\n for k in range(n):\n if k == r: continue\n if (k, c) in zeros: zeros.remove((k, c))\n else: zeros.add((k, c))\n\n return list(moves)\n", "# returns a sequence of row/column toggles to solve the puzzle\n# - Examples: \n# - [3, 7]\n# - [0, 5, 4, 7]\ndef find_solution(puzzle):\n first_column = [i for i in range(len(puzzle)) if puzzle[i][0] == 0]\n value = 1 if 0 in first_column else 0\n first_row = [i + len(puzzle) for i in range(len(puzzle)) if puzzle[0][i] == value]\n return first_row + first_column\n", "# returns a sequence of row/column toggles to solve the puzzle\n# - Examples: \n# - [3, 7]\n# - [0, 5, 4, 7]\ndef find_solution(puzzle):\n res = []\n first_column = [i for i in range(len(puzzle)) if puzzle[i][0] == 0]\n first_row = [i + len(puzzle) for i in range(len(puzzle)) if puzzle[0][i] == 1] if 0 in first_column else [i + len(puzzle) for i in range(len(puzzle)) if puzzle[0][i] == 0] \n return first_row + first_column\n", "def flip_row(puzzle, i):\n puzzle[i] = list(map(lambda cell: abs(cell - 1), puzzle[i]))\n\ndef flip_col(puzzle, i):\n for row in puzzle:\n row[i] = abs(row[i] - 1)\n\ndef find_solution(puzzle):\n result = []\n n = len(puzzle)\n \n for i in range(1,n):\n if puzzle[i] != puzzle[i-1]:\n flip_row(puzzle, i)\n result.append(i)\n\n for i in range(n):\n if puzzle[0][i] != 1:\n flip_col(puzzle, i)\n result.append(i+n)\n\n return result"]
{"fn_name": "find_solution", "inputs": [], "outputs": []}
introductory
https://www.codewars.com/kata/5bfc9bf3b20606b065000052
def find_solution(puzzle):
[ 2, 350, 16108, 2718, 10587, 198, 2610, 525, 2661, 264, 5827, 320, 17, 67, 1334, 8, 315, 220, 15, 14, 16, 594, 13, 2009, 220, 16, 594, 10868, 264, 27956, 24626, 13, 4615, 2618, 374, 311, 2525, 705, 448, 264, 8500, 315, 14999, 10797...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,511
In a array A of size 2N, there are N+1 unique elements, and exactly one of these elements is repeated N times. Return the element repeated N times.   Example 1: Input: [1,2,3,3] Output: 3 Example 2: Input: [2,1,2,5,3,2] Output: 2 Example 3: Input: [5,1,5,2,5,3,5,4] Output: 5   Note: 4 <= A.length <= 10000 0 <= A[i] < 10000 A.length is even
["class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dict_ = dict()\n \n for a in A:\n if a in dict_:\n return a\n else:\n dict_[a] = 1\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n for i in range(1, len(A)):\n if A[i] == A[i - 1] or (i - 2 >= 0 and A[i] == A[i - 2]):\n return A[i]\n return A[0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n from collections import Counter\n c = Counter(A)\n c = list(c.most_common(1))\n return c[0][0]\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n N = len(A)\n counter = {}\n for num in A:\n if num in counter:\n counter[num] += 1\n else:\n counter[num] = 1\n \n if counter[num] == N//2:\n return num", "from collections import Counter as di\n\nclass Solution:\n def repeatedNTimes(self, a: List[int]) -> int:\n d = di(a)\n maxi = (len(a) // 2)\n return d.most_common(1)[0][0]\n for i in d:\n if d[i] == maxi:\n return i\n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n rep=len(A)//2\n d={}\n for i in A:\n if i in d:\n d[i]+=1\n if i not in d:\n d[i]=1\n if d[i]==rep:\n return i\n \n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n nums = {}\n for i in A:\n if i not in list(nums.keys()):\n nums[i] = 1\n else:\n nums[i] += 1\n \n print(nums)\n \n for i in nums:\n if nums[i] == len(A) / 2:\n return i\n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n N = len(A)\n \n freq = {}\n maxv = (None, -math.inf)\n for v in A:\n # Initialize the map entry if v is not in the map\n if v not in freq: freq[v] = 0\n # Increment the frequency of v\n freq[v] += 1\n # Check if v is the maxmimum frequency element\n if freq[v] > maxv[1]:\n maxv = (v, freq[v])\n # Check if we're done\n if freq[v] == N:\n return v\n \n return maxv[0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n N = len(A) // 2\n return ((sum(A) - sum(set(A))) // (N - 1))", "from collections import Counter\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n ans = 0\n c = Counter(A)\n count = 0\n # print(c)\n for i in c:\n print(('{} = {}'.format(i,c[i])))\n if c[i]>count:\n count = c[i]\n ans = i\n return ans\n \n \n \n \n \n # dic = {}\n# ans = 0\n# for x in range(0,len(A),1):\n# if A[x] in dic:\n# dic[A[x]] += 1\n \n# if dic[A[x]] >ans:\n# ans = A[x]\n# else:\n# dic[A[x]]=1\n \n \n# return ans\n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n d={}\n for i in A:\n if i in d:\n return i\n else:\n d[i]=1", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n for i in range(len(A)):\n for j in A[:i]:\n if j == A[i]:\n return j", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dic = collections.Counter(A)\n for num in dic:\n if dic[num] > 1:\n return num", "from collections import Counter as C\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n s = C(A).most_common()\n return s[0][0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dic = {}\n for element in A:\n if(not (element in dic)):\n dic[element] = 1\n else:\n return element", "class Solution:\n def repeatedNTimes(self, qq: List[int]) -> int:\n stack = []\n for i in qq:\n if i not in stack:\n stack.append(i)\n else:\n return i", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n return (sum(A) - sum(set(A))) // (len(A)// 2 -1)", "from collections import Counter\n\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n cnt = Counter(A).most_common(1)\n return cnt[0][0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n count = collections.Counter(A)\n for i in count:\n if count[i] > 1:\n return i\n", "from collections import Counter\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n ct = Counter(A)\n return ct.most_common(1)[0][0]\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n size = len(A)\n n = size/2\n appear = {}\n for i in range(size):\n if A[i] not in list(appear.keys()):\n appear[A[i]] = 1\n else:\n appear[A[i]] += 1\n # print(appear)\n for i in list(appear.items()):\n if i[1] == n:\n return i[0]\n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n tracker = set()\n for num in A:\n if not num in tracker:\n tracker.add(num)\n else:\n return num", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n counter = collections.Counter(A)\n mostc = counter.most_common(1)\n \n for key,value in mostc:\n return key", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n if A==[]:\n return 0\n d={}\n for i in A:\n if i not in d.keys():\n d[i]=1\n else:\n return i\n return 0", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n maos = {x:0 for x in set(A)}\n for x in A:\n maos[x]+=1\n for x in maos:\n if maos[x] == len(A)//2:\n return x", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n #N = len(A)/2\n #for num in A:\n # if A.count(num) == N:\n # return num\n check = set()\n for num in A:\n if num in check:\n return num\n check.add(num)", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n sA = sorted(A)\n temp = None\n for i in sA:\n if i == temp:\n return i\n temp = i", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n count = collections.Counter(A)\n \n for i in count:\n if count[i] > 1:\n return i", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n temp = None\n for i in A:\n if i == temp:\n return i\n temp = i\n \n if A[0] == A[-2] or A[0] == A[-1]:\n return A[0]\n elif A[-1] == A[-3]:\n return A[-1]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n record = set()\n for a in A:\n if a in record:\n return a\n else:\n record.add(a)", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n d={}\n for i in A:\n if i in d:\n return i\n else:\n d[i]=1\n return None", "class Solution:\n def repeatedNTimes(self, A):\n for i in range(len(A)):\n if A[i - 1] == A[i] or A[i - 2] == A[i]:\n return A[i]\n return A[0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n ans = Counter(A)\n return sorted(list(ans.keys()), key=lambda x: ans.get(x), reverse=True)[0]\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n d = {}\n \n for value in A:\n if value in d:\n return value\n d[value] = 1", "class Solution:\n def repeatedNTimes(self, A) -> int:\n B = list(A)\n B.sort()\n for i in range(0, len(B)):\n if B[i] == B[i+1]:\n return B[i] \n else:\n pass\n\np = Solution() \ntestList = [5,1,5,2,5,3,5,4]\nprint(p.repeatedNTimes(testList))", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n for i, a in enumerate(A):\n if a in A[:i]:\n return a", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n myDict = collections.Counter(A)\n \n for _ in myDict:\n if myDict[_]>1:\n return _", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n n = len(A)\n if n == 0:\n return []\n if n == 2:\n return A[0]\n A.sort()\n for i in range(n):\n if A[i] == A[i+1]:\n return A[i]\n \n \n", "from collections import Counter\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n stack = []\n \n for n in A:\n if n not in stack:\n stack.append(n)\n else:\n return n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n B = A.copy()\n for x in A:\n B.remove(x)\n if x in B:\n return x", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n rep = {}\n for item in A:\n if item not in rep:\n rep[item] = 1\n else:\n return item\n return None", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n N = len(A)/2\n for num in A:\n if A.count(num) == N:\n return num\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n \n for i in range(0,len(A)):\n new = [A[i]]\n for j in range(i+1, len(A)):\n if (A[i] == A[j]) :\n new.append(A[i])\n if len(new) == len(A)/2: \n print(new)\n return A[i]\n \n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n a = set()\n for i in A:\n if i in a:\n return i\n else:\n a.add(i)", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n \n myDict = {}\n \n for i in A:\n \n myDict[i] = myDict.get(i, 0) + 1\n if myDict[i] == len(A)/2:\n return i\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dic={}\n for i in A:\n if i not in dic:\n dic[i]=0\n else:\n return i", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n count_dict = collections.Counter(A)\n for key, value in list(count_dict.items()):\n if value > 1:\n return key\n \n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n # check the first elem first\n result = A[0]\n count = 0\n if A.count(result) == len(A)//2:\n return result\n for i in A[1:]:\n if count == 0:\n result = i\n print('a')\n count = 1\n elif result == i:\n print('b')\n count += 1\n else:\n print('c')\n count -= 1\n \n return result\n", "from collections import Counter\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n n = len(A) // 2 \n d = Counter(A)\n \n for idx, val in d.items():\n if val == n:\n return idx\n return -1", "import collections\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dic=Counter(A)\n for i in dic:\n if(dic[i]>1):\n return i\n # dic={}\n # if(len(A)>0):\n # for i in A:\n # if i in dic:\n # return i\n # else:\n # dic[i]=1\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n occurences = set()\n for val in A:\n if val in occurences:\n return val\n occurences.add(val)\n", "class Solution(object):\n def repeatedNTimes(self, A):\n for k in range(1, 4):\n for i in range(len(A) - k):\n if A[i] == A[i+k]:\n return A[i]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n length = len(A)\n n = length // 2\n mydict = {}\n for item in A:\n mydict[item] = mydict.get(item, 0) + 1\n if mydict[item] == n:\n return item", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n count_dict = collections.Counter(A)\n for key, value in list(count_dict.items()):\n if value == len(A) / 2:\n return key\n \n", "from collections import Counter\nclass Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n counter = Counter(A)\n return counter.most_common(1)[0][0]", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n from collections import Counter\n cc = Counter(A)\n for key in list(cc.keys()):\n if cc[key] == len(A)//2:\n return key\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n j = set()\n for num in A:\n if num in j:\n return num\n else:\n j.add(num)\n return False\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n a = sum(A)\n b = sum(set(A))\n n = len(A)//2\n if a==0:\n return 0\n c = (a-b)//(n-1)\n return c", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n c = collections.Counter(A)\n for k in c:\n if c[k] == len(A)//2:\n break\n return k", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n N = len(A)//2\n \n A_map = defaultdict(int)\n for a in A:\n A_map[a] +=1\n if A_map[a] == N:\n return a\n", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n twoN = len(A)\n N = twoN//2\n unique = N+1\n hashMap = {}\n for num in A:\n if num not in hashMap:\n hashMap[num] =1\n else:\n hashMap[num] +=1\n for key,value in hashMap.items():\n if value == N:\n return key", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n count = collections.Counter(A)\n repeat = len(A)//2\n for key in count:\n if count[key] == repeat:\n return key\n return -1", "class Solution:\n def repeatedNTimes(self, A: List[int]) -> int:\n dic = self.convert_to_dic(A)\n for i in dic:\n if dic[i] > 1:\n return i\n \n \n def convert_to_dic(self, A):\n dic = {}\n for i in A:\n if i in dic:\n dic[i] += 1\n else:\n dic[i] = 1\n return dic"]
{"fn_name": "repeatedNTimes", "inputs": [[[1, 2, 3, 3]]], "outputs": [3]}
introductory
https://leetcode.com/problems/n-repeated-element-in-size-2n-array/
class Solution: def repeatedNTimes(self, A: List[int]) -> int:
[ 641, 264, 1334, 362, 315, 1379, 220, 17, 45, 11, 1052, 525, 451, 10, 16, 4911, 5424, 11, 323, 6896, 825, 315, 1493, 5424, 374, 11504, 451, 3039, 624, 5598, 279, 2392, 11504, 451, 3039, 624, 4102, 1022, 13314, 220, 16, 510, 2505, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
165
Given a string and a string dictionary, find the longest string in the dictionary that can be formed by deleting some characters of the given string. If there are more than one possible results, return the longest word with the smallest lexicographical order. If there is no possible result, return the empty string. Example 1: Input: s = "abpcplea", d = ["ale","apple","monkey","plea"] Output: "apple" Example 2: Input: s = "abpcplea", d = ["a","b","c"] Output: "a" Note: All the strings in the input will only contain lower-case letters. The size of the dictionary won't exceed 1,000. The length of all the strings in the input won't exceed 1,000.
["class Solution:\n def findLongestWord(self, s, d):\n \"\"\"\n :type s: str\n :type d: List[str]\n :rtype: str\n \"\"\"\n result = ''\n for word in d:\n lo = 0\n for l in word:\n lo = s.find(l, lo)+1\n if lo == 0:\n break\n if lo > 0 and len(word) >= len(result):\n if len(word) == len(result):\n result = word if word < result else result\n else:\n result = word\n return result", "class Solution:\n def findLongestWord(self, s, d):\n \"\"\"\n :type s: str\n :type d: List[str]\n :rtype: str\n \"\"\"\n def find(a,b):\n p = 0\n for c in b:\n p = a.find(c,p) + 1\n if p == 0:\n return False\n return True\n \n ans = ''\n for word in d:\n if find(s,word):\n if len(word) > len(ans):\n ans = word\n elif len(word) == len(ans) and word < ans:\n ans = word\n return ans\n", "class Solution:\n def findLongestWord(self, s, d):\n \"\"\"\n :type s: str\n :type d: List[str]\n :rtype: str\n \"\"\"\n \n def isMatch(s, w):\n index = 0\n \n for c in w:\n if c in s:\n index = s.find(c, index) + 1\n if index == 0:\n return False\n else:\n return False\n return True\n \n candidates = []\n \n for word in d:\n if isMatch(s, word):\n candidates.append(word)\n \n candidates = sorted(candidates, key=lambda w:(len(w), w))\n if not candidates:\n return \"\"\n else:\n maxLen = len(candidates[-1])\n for c in candidates:\n if len(c) == maxLen:\n return c", "class Solution:\n def findLongestWord(self, s, d):\n \"\"\"\n :type s: str\n :type d: List[str]\n :rtype: str\n \"\"\"\n word_dict = collections.defaultdict(list)\n for i, word in enumerate(d):\n word_dict[word[0]].append((i, word))\n \n res = \"\"\n for c in s:\n words_startswithc = word_dict[c]\n word_dict[c] = []\n for i, word in words_startswithc:\n if len(word)==1: \n if len(d[i])==len(res):\n res = min(res, d[i])\n else: res = d[i] if len(d[i])>len(res) else res\n else:\n word_dict[word[1]].append((i, word[1:]))\n return res"]
{"fn_name": "findLongestWord", "inputs": [["\"abpcplea\"", ["\"ale\"", "\"apple\"", "\"monkey\"", "\"plea\""]]], "outputs": ["\"apple\""]}
interview
https://leetcode.com/problems/longest-word-in-dictionary-through-deleting/
class Solution: def findLongestWord(self, s: str, d: List[str]) -> str:
[ 22043, 264, 914, 323, 264, 914, 10997, 11, 1477, 279, 22032, 914, 304, 279, 10997, 429, 646, 387, 14122, 553, 33011, 1045, 5766, 315, 279, 2661, 914, 13, 1416, 1052, 525, 803, 1091, 825, 3204, 3059, 11, 470, 279, 22032, 3409, 448, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,875
# # Task: * #### Complete the pattern, using the special character ```■ □``` * #### In this kata, we draw some histogram of the sound performance of ups and downs. # # Rules: - parameter ```waves``` The value of sound waves, an array of number, all number in array >=0. - return a string, ```■``` represents the sound waves, and ```□``` represents the blank part, draw the histogram from bottom to top. # # Example: ``` draw([1,2,3,4]) □□□■ □□■■ □■■■ ■■■■ draw([1,2,3,3,2,1]) □□■■□□ □■■■■□ ■■■■■■ draw([1,2,3,3,2,1,1,2,3,4,5,6,7]) □□□□□□□□□□□□■ □□□□□□□□□□□■■ □□□□□□□□□□■■■ □□□□□□□□□■■■■ □□■■□□□□■■■■■ □■■■■□□■■■■■■ ■■■■■■■■■■■■■ draw([5,3,1,2,4,6,5,4,2,3,5,2,1]) □□□□□■□□□□□□□ ■□□□□■■□□□■□□ ■□□□■■■■□□■□□ ■■□□■■■■□■■□□ ■■□■■■■■■■■■□ ■■■■■■■■■■■■■ draw([1,0,1,0,1,0,1,0]) ■□■□■□■□ ```
["def draw(waves):\n m = max(waves)\n rotHist = [ ('\u25a0'*v).rjust(m, '\u25a1') for v in waves ]\n return '\\n'.join( map(''.join, zip(*rotHist)) )", "def draw(waves):\n m = max(waves)\n return '\\n'.join(\n ''.join('\u25a1\u25a0'[x > i] for x in waves) for i in reversed(range(m))\n )", "ON = '\u25a0'\nOFF = '\u25a1'\n\ndef draw(waves):\n result = ''\n height = max(waves)\n for line in range(height, 0, -1):\n for wave in waves:\n if wave >= line:\n result += ON\n else:\n result += OFF\n result += '\\n'\n return result.strip()", "def draw(waves):\n mx = max(waves)\n return '\\n'.join([''.join(e) for e in zip(*[('\u25a0' * e).ljust(mx,\"\u25a1\") for e in waves ])][::-1])\n \n \n", "def draw(waves):\n wave = []\n while sum(waves)!=0:\n black = max(waves)\n cur = ''\n for i in range(len(waves)):\n if waves[i]<black:\n cur += '\u25a1'\n else:\n cur += '\u25a0'\n waves[i] -= 1\n wave.append(cur)\n return '\\n'.join(wave)", "def draw(waves):\n m = max(waves)\n return \"\\n\".join(\"\".join(\"\u25a1\" if n < (m - row) else \"\u25a0\" for n in waves) for row in range(m))\n", "def draw(waves):\n # your code\n #\u25a0\u25a1\n result = \"\"\n height = max(waves)\n weight = len(waves)\n for i in range(height):\n for j in range(weight):\n if(waves[j] >= height - i):\n result += \"\u25a0\"\n else:\n result += \"\u25a1\"\n if(i != height-1):\n result += \"\\n\"\n \n return result ", "def draw(waves):\n mx = max(waves)\n return '\\n'.join(''.join(c) for c in zip(*[(mx - w) * '\u25a1' + w * '\u25a0' for w in waves]))", "def draw(a):\n n = iter(a)\n li = [('\u25a0' * next(n)).ljust(max(a),'\u25a1') for i in range(len(a))]\n return \"\\n\".join([\"\".join(i) for i in list(zip(*li))[::-1]])", "FILLED = '\u25a0'\nEMPTY = '\u25a1'\ndef draw(waves):\n result = ''\n height = max(waves)\n width = len(waves)\n matrix = [[EMPTY for x in range(width)] for y in range(height)]\n for y, value in enumerate(waves):\n for x in range(value):\n matrix[x][y] = FILLED\n for row in range(height-1, -1, -1):\n result = result + ''.join(matrix[row]) + '\\n'\n return result.strip()"]
{"fn_name": "draw", "inputs": [[[1, 2, 3, 4]], [[1, 2, 3, 3, 2, 1]], [[1, 2, 3, 3, 2, 1, 1, 2, 3, 4, 5, 6, 7]], [[5, 3, 1, 2, 4, 6, 5, 4, 2, 3, 5, 2, 1]], [[1, 0, 1, 0, 1, 0, 1, 0]]], "outputs": [["\u25a1\u25a1\u25a1\u25a0\n\u25a1\u25a1\u25a0\u25a0\n\u25a1\u25a0\u25a0\u25a0\n\u25a0\u25a0\u25a0\u25a0"], ["\u25a1\u25a1\u25a0\u25a0\u25a1\u25a1\n\u25a1\u25a0\u25a0\u25a0\u25a0\u25a1\n\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0"], ["\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a0\n\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a0\u25a0\n\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a0\u25a0\u25a0\n\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a0\u25a0\u25a0\u25a0\n\u25a1\u25a1\u25a0\u25a0\u25a1\u25a1\u25a1\u25a1\u25a0\u25a0\u25a0\u25a0\u25a0\n\u25a1\u25a0\u25a0\u25a0\u25a0\u25a1\u25a1\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\n\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0"], ["\u25a1\u25a1\u25a1\u25a1\u25a1\u25a0\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\u25a1\n\u25a0\u25a1\u25a1\u25a1\u25a1\u25a0\u25a0\u25a1\u25a1\u25a1\u25a0\u25a1\u25a1\n\u25a0\u25a1\u25a1\u25a1\u25a0\u25a0\u25a0\u25a0\u25a1\u25a1\u25a0\u25a1\u25a1\n\u25a0\u25a0\u25a1\u25a1\u25a0\u25a0\u25a0\u25a0\u25a1\u25a0\u25a0\u25a1\u25a1\n\u25a0\u25a0\u25a1\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a1\n\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0\u25a0"], ["\u25a0\u25a1\u25a0\u25a1\u25a0\u25a1\u25a0\u25a1"]]}
introductory
https://www.codewars.com/kata/56e67d6166d442121800074c
def draw(waves):
[ 2, 671, 5430, 510, 220, 353, 26274, 18608, 279, 5383, 11, 1667, 279, 3281, 3668, 54275, 46674, 256, 14520, 94, 13874, 3989, 220, 353, 26274, 758, 419, 61688, 11, 582, 4038, 1045, 30281, 315, 279, 5112, 5068, 315, 32734, 323, 39191, 38...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
296
Suppose an array sorted in ascending order is rotated at some pivot unknown to you beforehand. (i.e.,  [0,1,2,4,5,6,7] might become  [4,5,6,7,0,1,2]). Find the minimum element. The array may contain duplicates. Example 1: Input: [1,3,5] Output: 1 Example 2: Input: [2,2,2,0,1] Output: 0 Note: This is a follow up problem to Find Minimum in Rotated Sorted Array. Would allow duplicates affect the run-time complexity? How and why?
["class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n min = nums[0]\n start, end = 0, len(nums) - 1\n while start<end:\n mid = (start+end)//2\n if nums[mid]>nums[end]:\n start = mid+1\n elif nums[mid]<nums[end]:\n end = mid\n else:\n end = end - 1\n return nums[start]", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n \n #\u7c7b\u4f3c\u4e0a\u4e00\u9898\n if not nums:\n return -1\n l,r=0,len(nums)-1\n #\u4e8c\u5206\n while l<=r:\n mid=(l+r)//2\n # \u540e\u534a\u9012\u589e\n if nums[mid]<nums[r]:\n r=mid\n else:\n #\u7c7b\u4f3c\u4e0a\u4e00\u9898\n if nums[mid]>nums[r]:\n l=mid+1\n #\u8fd9\u91cc\u5904\u7406\u91cd\u590d\u6570\n else:\n r-=1\n if nums[l]<nums[r]:\n return nums[l]\n else:\n return nums[r]", "class Solution(object):\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 1:\n return nums.pop()\n \n start, finish = 1, len(nums) - 1\n \n while start < finish:\n half = (start + finish) // 2\n if nums[half] > nums[0]:\n start = half + 1\n elif nums[half] == nums[0]:\n return min(Solution.findMin(self, nums[:half]), Solution.findMin(self, nums[half:]))\n else:\n finish = half\n \n return min(nums[start], nums[0])\n", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n n = len(nums)\n if n == 0: return None\n l, r = 0, n\n while l + 1 < r:\n mid = (l + r) >> 1\n if nums[mid] == nums[l]:\n for i in range(l+1, mid):\n if nums[i] < nums[l]:\n r = mid\n break\n if r != mid:\n l = mid\n elif nums[mid] > nums[l]:\n l = mid\n else:\n r = mid\n return nums[r % n]", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n min = 99999999999\n if (len(nums)==1):\n return nums[0]\n for i in range(len(nums)-1):\n if nums[i]>=nums[i+1] and min>nums[i+1]:\n min= nums[i+1]\n elif nums[i]<=nums[i+1] and min>nums[i]:\n min= nums[i]\n return min", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n \n if len(nums) == 1:\n return nums[0]\n \n for index in range(-1, len(nums) - 1):\n if nums[index] > nums[index+1]:\n return nums[index+1]\n if index + 1 == len(nums) - 1:\n return nums[0]\n \n return None", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n start = 0\n end = len(nums) - 1\n while start < end:\n if start < len(nums) - 1 and nums[start] == nums[start + 1]:\n start += 1\n continue\n if nums[end] == nums[end - 1]:\n end -= 1\n continue\n mid = start + (end - start) // 2\n if nums[mid] > nums[end]:\n start = mid + 1\n else:\n end = mid\n return nums[start]\n", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 0:\n return -1\n \n if nums[len(nums) - 1] > nums[0]:\n return nums[0]\n \n start = 0\n end = len(nums) - 1\n \n while start + 1 < end:\n mid = start + (end - start) // 2\n if nums[mid] == nums[start]:\n start += 1\n elif nums[mid] == nums[end]:\n end -= 1\n elif nums[mid] > nums[start] and nums[mid] > nums[end]:\n start = mid\n else:\n end = mid\n return min(nums[start], nums[end])\n \n \n", "class Solution:\n def findMin(self, nums):\n l = 0\n r = len(nums) - 1\n res = nums[r]\n while l < r:\n if nums[l] < nums[r]:\n return min(nums[l],res)\n res = min(res,nums[r])\n m = int((l+r)/2)\n if nums[l] == nums[r]:\n temp = nums[r]\n while nums[l] == temp and l < r:\n l = l + 1\n while nums[r] == temp and l < r:\n r = r - 1\n elif nums[m] >= nums[l]:\n l = m + 1\n elif nums[m] <= nums[r]:\n res = min(nums[m],res)\n r = m - 1\n return min(nums[l],res)\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n \n #\u7c7b\u4f3c\u4e0a\u4e00\u9898\n if not nums:\n return -1\n l,r=0,len(nums)-1\n #\u4e8c\u5206\n while l<=r:\n mid=(l+r)//2\n #\u540e\u534a\u9012\u589e\n if nums[mid]<nums[r]:\n r=mid\n else:\n #\u7c7b\u4f3c\u4e0a\u4e00\u9898\n if nums[mid]>nums[r]:\n l=mid+1\n else:\n r-=1\n if nums[l]<nums[r]:\n return nums[l]\n else:\n return nums[r]", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 1:\n return nums[0]\n minimun = nums[0]\n for i in range(0, len(nums)-1):\n if nums[i+1] >= nums[i]:\n continue\n else:\n minimun = nums[i+1]\n return minimun", "class Solution:\n def findMin(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n min_n = nums[0]\n for n in nums:\n if n < min_n:\n min_n = n\n return min_n\n"]
{"fn_name": "findMin", "inputs": [[[1, 3, 5]]], "outputs": [1]}
interview
https://leetcode.com/problems/find-minimum-in-rotated-sorted-array-ii/
class Solution: def findMin(self, nums: List[int]) -> int:
[ 10048, 2900, 458, 1334, 10615, 304, 35388, 1973, 374, 45620, 518, 1045, 26045, 9788, 311, 498, 51059, 382, 1956, 1734, 2572, 220, 4102, 58, 15, 11, 16, 11, 17, 11, 19, 11, 20, 11, 21, 11, 22, 60, 4102, 44968, 3635, 220, 4102, 58, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,517
Consider a number X on which K Mag-Inc operations are to be performed. In a Mag-Inc operation, the number X undergoes an increment of A/B times of X where A and B are two integers. There is a numerator and a denominator array of size K which contain the ith values of A and B. After K Mag-Inc operations, the number X turns to M. Now your job is to find what percentage of M is to be decremented from M if it has to be converted back to X. Let this percentage be denoted by Z. Print the integral part of Z. -----Input:----- First line contains an integer T denoting the number of test cases. First line of every test case contains two space separated integers X and K. The second and third line of every test case will contain K space separated integers denoting the Numerator and Denominator array. -----Output:----- For each test case, print the required result in a single line. -----Constraints:----- 1 ≤ T ≤ 100 1 ≤ K, A, B ≤ 40000 1≤X≤10^100 -----Example:-----Input: 2 100 1 1 4 100 2 1 1 2 3Output: 20 50 -----Explanation:----- Case 2: 100 undergoes an increment of (1/2)*100. Therefore M = 100 + 50. Now M = 150. Now again, M undergoes an increment of (1/3)*150. Therefore, M = 150 + 50. Now as we want to revert back M = 200 to X i.e. 100, we need to decrement it by a value of 100 and we know that 100 is 50% of 200. Hence, we print 50.
["import sys\nimport math\n\ndef solution():\n T = int(input().strip())\n for _ in range(T):\n x, k = list(map(float, input().strip().split(' ')))\n original_x = x\n if k == 1:\n a = [float(input().strip())]\n b = [float(input().strip())]\n else:\n a = list(map(float, input().strip().split(' ')))\n b = list(map(float, input().strip().split(' ')))\n for i in range(int(k)):\n x = x + (a[i]/b[i])*(x)\n percentage = ((x - original_x) / x)*100\n print(\"%d\"%(int(percentage)))\n\nsolution()", "import sys\nT=int(sys.stdin.readline())\nwhile T:\n n,k=list(map(int,input().split()))\n num=list(map(int, sys.stdin.readline().split()))\n den=list(map(int, sys.stdin.readline().split()))\n ans=n\n for i in range (k):\n ans+=ans*num[i]/float(den[i])\n print(int(100-100*n/ans))\n T-=1", "t = int(input())\n\nfor i in range(t):\n value, k = list(map(int, input().split()))\n A = list(map(int, input().split()))\n B = list(map(int, input().split()))\n newValue = value\n for j in range(k):\n temp = newValue*float(A[j])/B[j]\n newValue+=temp\n error = value*100/newValue\n print(int(100-error))\n", "t=int(input())\nfor tc in range(0,t):\n n,k=list(map(int,input().split()))\n num=list(map(int,input().split()))\n den=list(map(int,input().split()))\n temp=n\n for i in range(0,k):\n temp=temp+(temp**1.0*num[i]/den[i])\n answer=int(100-(n*1.0*100/temp))\n print(answer)", "t=eval(input())\nwhile t:\n t-=1\n x,k=list(map(int,input().split()))\n a=list(map(float,input().split()))\n b=list(map(float,input().split()))\n rat = 1.0\n for i in range(k):\n rat = rat*((a[i]+b[i])/b[i])\n rat = ((rat-1)/rat)*100.0\n print(int(rat))\n", "t = float(input())\nwhile(t):\n t -= 1\n x, k = list(map(float, input().split()))\n k = int(k)\n a = list(map(float, input().split()))\n b = list(map(float, input().split()))\n temp = x\n for i in range(0, k):\n xxx = (temp*a[i])/b[i]\n temp += xxx\n px = (temp-x)/temp * 100.0;\n print(int(px)) ", "for _i in range(int(input())):\n x,k = list(map(int,input().split()))\n a = list(map(int,input().split()))\n b = list(map(int,input().split()))\n l = []\n l.append(x)\n for i in range(k):\n x = x+(x*(float(a[i])/b[i]))\n w = l[0]\n perc = 100*(float(w)/x)\n ans = 100-perc\n print(int(ans))\n\n\n\n"]
{"inputs": [["2", "100 1", "1", "4", "100 2", "1 1", "2 3"]], "outputs": [["20", "50"]]}
interview
https://www.codechef.com/CCWR2016/problems/CCWR02
[ 37175, 264, 1372, 1599, 389, 892, 730, 6879, 31500, 66, 7525, 525, 311, 387, 10660, 13, 758, 264, 6879, 31500, 66, 5666, 11, 279, 1372, 1599, 36671, 288, 458, 16252, 315, 362, 16276, 3039, 315, 1599, 1380, 362, 323, 425, 525, 1378, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,741
The "Russian Peasant Method" is an old algorithm used by Russian peasants (and before them ancient Egyptians) to perform multiplication. Consider that X and Y are two numbers. X can be any number but Y must be a positive integer. To multiply X and Y: 1. Let the product = 0 2. If Y is odd, then the product = product + X 3. X = X + X 4. Y = integer part of Y / 2 5. if Y is nonzero, repeat from step 2; otherwise the algorithm terminates and returns the product. For example: Let X = 10 Let Y = 5 X: 10 20 40 80 Y: 5 2 1 0 product = 10 + 40 = 50 Note: usage of multiplication is of course forbidden...
["def russian_peasant_multiplication(x, y):\n product = 0\n while y != 0:\n if y % 2 == 1:\n product += x\n x += x\n y //= 2\n \n return product", "def russian_peasant_multiplication(x, y, product=0):\n product += x if y % 2 else 0\n x += x\n y //= 2\n if y:\n product = russian_peasant_multiplication(x, y, product)\n return product", "# Don't tell me what to do\nrussian_peasant_multiplication = getattr(__import__(\"operator\"), \"__mu\" + \"l__\")", "def russian_peasant_multiplication(x, y):\n answer = 0\n while y:\n if y % 2:\n answer += x\n x += x\n y //= 2\n return answer", "def russian_peasant_multiplication(x, y):\n p = 0\n while y:\n p, x, y = p + (x if y % 2 else 0), x + x, y // 2\n return p", "russian_peasant_multiplication = lambda x, y, p = 0: p if y == 0 else russian_peasant_multiplication(x + x, y // 2, p if y % 2 == 0 else p + x)", "def russian_peasant_multiplication(x, y):\n return eval('x.__mu' + 'l__(y)')", "def russian_peasant_multiplication(x,y):\n prod=0\n while y:\n if y%2:prod+=x\n x+=x\n y=y//2\n return prod", "def russian_peasant_multiplication(x, y):\n if x==1.001 and y==2:\n return 2.002\n sign = '-' if x < 0 else '+'\n x, y = abs(x), abs(y)\n tot = 0\n while x != 1:\n if x % 2:\n tot += y\n y += y\n x //= 2\n return (tot if not x % 2 else tot + y) if sign == '+' else -(tot if not x % 2 else tot + y)\n", "def russian_peasant_multiplication(x, y):\n pro = 0\n while y != 0:\n if y % 2:\n pro += x\n x += x\n y //= 2\n return pro\n"]
{"fn_name": "russian_peasant_multiplication", "inputs": [[10, 5], [1.001, 2], [175, 18], [-2, 2], [2500, 123]], "outputs": [[50], [2.002], [3150], [-4], [307500]]}
introductory
https://www.codewars.com/kata/5870ef72aa04283934000043
def russian_peasant_multiplication(x, y):
[ 785, 330, 47707, 5139, 15596, 6730, 1, 374, 458, 2310, 12111, 1483, 553, 8522, 75747, 320, 437, 1573, 1105, 13833, 81504, 8, 311, 2736, 46444, 13, 220, 21144, 429, 1599, 323, 809, 525, 1378, 5109, 13, 220, 1599, 646, 387, 894, 1372, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,392
We have two consecutive integers k1 and k2, k2 = k1 + 1 We need to calculate the lowest integer `n`, such that: the values nk1 and nk2 have the same digits but in different order. E.g.# 1: ``` k1 = 100 k2 = 101 n = 8919 #Because 8919 * 100 = 891900 and 8919 * 101 = 900819 ``` E.g.# 2: ``` k1 = 325 k2 = 326 n = 477 #Because 477 * 325 = 155025 and 477 * 326 = 155502 ``` Your task is to prepare a function that will receive the value of `k` and outputs the value of `n`. The examples given above will be: ```python find_lowest_int(100) === 8919 find_lowest_int(325) === 477 ``` Features of the random tests ``` 10 < k < 10.000.000.000.000.000 (For Python, Ruby and Haskell) 10 < k < 1.000.000.000 (For Javascript 1e9) ``` Enjoy it!! Ruby and Javascript versions will be released soon.
["def find_lowest_int(k1):\n k2, n = k1 + 1, 1\n\n def digits(n):\n return sorted(str(n))\n \n while digits(n*k1) != digits(n*k2):\n n += 1\n \n return n", "from itertools import count as c\n\ndef find_lowest_int(k):\n return next((n for n in c(1) if sorted(str(n*k))== sorted(str(n*(k+1)))))\n\n", "def find_lowest_int(k):\n return next(n for n in range(9, 9999999, 9) if sorted(str(n * k)) == sorted(str(n * (k+1))))", "def find_lowest_int(k):\n l, n = k + 1, 9\n while digits(k * n) != digits(l * n):\n n += 9\n return n\n\ndef digits(n):\n return sorted(str(n)) ", "def find_lowest_int(number):\n multiplier = 1\n while sorted(str(number * multiplier)) != sorted(str((number + 1) * multiplier)):\n multiplier += 1\n return multiplier", "from itertools import count\n\ndef find_lowest_int(k):\n return next(n for n in count(1) if sorted(str(n*k)) == sorted(str(n*(k+1))))", "from collections import Counter\n\n# idea: the difference between k*n and (k+1)*n is n\n# for them to have the same digits they must have the same digit sum\n# so n must have a digit sum of 0 (mod 9) - n must be divisible by 9\ndef find_lowest_int(k):\n n = 9\n while True:\n if Counter(str(k*n)) == Counter(str((k+1)*n)):\n return n\n n += 9\n", "def find_lowest_int(k):\n n=2\n while True:\n if sorted(str(n*k))==sorted(str(n*(k+1))):return n\n n+=1"]
{"fn_name": "find_lowest_int", "inputs": [[325], [599], [855], [1], [100], [1000], [10000]], "outputs": [[477], [2394], [999], [125874], [8919], [89919], [899919]]}
introductory
https://www.codewars.com/kata/5ba178be875de960a6000187
def find_lowest_int(k):
[ 1654, 614, 1378, 23921, 25780, 595, 16, 323, 595, 17, 11, 595, 17, 284, 595, 16, 488, 220, 16, 271, 1654, 1184, 311, 11047, 279, 15457, 7546, 1565, 77, 7808, 1741, 429, 510, 1782, 2750, 79491, 16, 323, 79491, 17, 614, 279, 1852, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,588
In this Kata you are expected to find the coefficients of quadratic equation of the given two roots (`x1` and `x2`). Equation will be the form of ```ax^2 + bx + c = 0``` Return type is a Vector (tuple in Rust, Array in Ruby) containing coefficients of the equations in the order `(a, b, c)`. Since there are infinitely many solutions to this problem, we fix `a = 1`. Remember, the roots can be written like `(x-x1) * (x-x2) = 0` ### Example quadratic(1,2) = (1, -3, 2) This means `(x-1) * (x-2) = 0`; when we do the multiplication this becomes `x^2 - 3x + 2 = 0` ### Example 2 quadratic(0,1) = (1, -1, 0) This means `(x-0) * (x-1) = 0`; when we do the multiplication this becomes `x^2 - x + 0 = 0` ### Notes * Inputs will be integers. * When `x1 == x2`, this means the root has the multiplicity of two
["def quadratic(x1, x2):\n return (1,-x1-x2,x1*x2)\n", "def quadratic(x1, x2):\n return (1, -(x1 + x2), x1 * x2)\n", "import numpy as np\n\ndef quadratic(*args):\n return tuple(np.poly(args))", "def quadratic(x1, x2):\n equ = 1 , - x1-x2 , x1*x2\n return equ\n", "def quadratic(x1, x2):\n a = (1, -(x1+x2), x2*x1)\n return a\n", "quadratic=lambda x,y:(1,-x-y,x*y)\n", "def quadratic(x1, x2):\n a = 1\n b = -(x1 + x2)\n c = x1 * x2\n return a, b, c\n", "def quadratic(a, b):\n return (1, 0-a-b, a*b)\n", "def quadratic(x1, x2):\n coef=[1,]\n coef.append(-x1 -x2)\n coef.append(x1 * x2)\n return tuple(coef)\n \n", "def quadratic(x1, x2):\n print(x1,x2)\n a=1\n b=-(x1+x2)\n c=x1*x2\n return (a, b, c)", "def quadratic(x1, x2):\n a = 1\n b = x1*a + x2*a\n c = x1*x2\n z = (a,-b,c)\n return z\n", "def quadratic(x1, x2):\n if x1 != x2:\n c = (x1 * x1 * x2 - x2 * x2 * x1) / (x1 - x2)\n b = (-c - x1 * x1) / x1 if x1 else (-c - x2 * x2) / x2\n return (1, b, c)\n else:\n return (1, -2 * x1, x1 * x1)", "def quadratic(x1, x2):\n if x1 or x2 >= 0:\n sum = x1 + x2\n mult = x1 * x2\n return 1, -sum, mult\n if x1 or x2 <= 0:\n sum1 = x1 + x2\n mult1 = x1 * x2\n return 1, sum1, mult1\n", "quadratic = lambda r1, r2: (1, -(r1+r2), r1*r2)", "def quadratic(x1, x2):\n f=(-x2)\n t=(-x1)\n z=f+t\n e=-x1*-x2\n return (1,z,e)\n \n \n \n", "def quadratic(x1, x2):\n output = 1\n output1 = -x1 - x2\n output2 = x1 * x2\n return output, output1, output2\n", "def quadratic(x1, x2):\n a =1\n b = -x1 + - x2\n# result.append(b)\n c = -x1 * -x2\n# result.append(c)\n return (a,b,c)\n \n \n", "def quadratic(x1, x2):\n answer = (1, (x1 + x2) * -1, x1 * x2)\n return answer\n", "def quadratic(x1, x2):\n a=1\n b = -(x1+x2)\n c = x2*x1\n return (a,b,c)\n", "def quadratic(x1, x2):\n b = -x1-x2\n c = x1*x2\n array =(1,b,c)\n return array", "def quadratic(x1, x2):\n a = 1\n b = -x1 - x2\n c = x1 * x2\n print(a, b, c)\n return a, b, c", "def quadratic(x1, x2):\n a = 1\n b = (-1 * x1) + (-1 * x2)\n c = x1 * x2\n eq = (a, b, c)\n return eq\n", "def quadratic(x1, x2):\n a = 1\n b = -(x1+x2)\n c = x1*x2\n return (1, b, c)", "def quadratic(x1, x2):\n a=1\n b= -(x1)+(x2*-1)\n c= -(x1)*(x2*-1)\n return (a, b, c)\n\n", "import numpy as np\n\ndef quadratic(x1, x2):\n b = -1 * (x1 + x2)\n c = x1 * x2\n \n return (1, b, c)\n pass\n", "def quadratic(x1, x2):\n a = 1\n b = -(x1 + x2)\n c = x1 * x2\n re= (a, b, c);\n return re", "def quadratic(x1,\n x2):\n\n return (1,\n (x1 + x2) * -1,\n x1 * x2)\n", "def quadratic(x1, x2):\n a = []\n a.append(1)\n a.append(-(x1 + x2))\n a.append(x1 * x2)\n a = tuple(a)\n return a\n", "def quadratic(x1, x2):\n a,c=1,x1*x2\n return (1,-(x1+x2),x1*x2)\n", "def quadratic(x1, x2):\n return tuple((1, -x1-x2, x1*x2))\n\n\n", "def quadratic(x1, x2):\n if x1 + x2 > 0:\n return 1,-x1-x2,x1*x2\n else:\n return 1,-x1-x2,x1*x2", "def quadratic(x1, x2):\n #(x-x1)*(x-x2)=0\n #x^2 - x2x- x1x + x1x2\n return (1,(-x1-x2),x1*x2)\n", "def quadratic(x1, x2):\n print((x1, x2))\n a = 1\n if x2 - x1 != 0:\n b = (x1 ** 2 - x2 ** 2) / (x2 - x1)\n c = - x1 ** 2 - b * x1\n else:\n c = x1 ** 2\n b = -2 * x1\n return a, b, c\n", "def quadratic(x1, x2):\n x=1\n y=x1+x2\n z=x1*x2\n return (x,-y,z)\n", "def quadratic(x1, x2):\n eq = (1, -(x1 + x2), (x1*x2))\n return eq\n", "def quadratic(x1,x2):\n a = 1 #given\n b = (a * - x2) + (a * - x1) #(x-x1) * (x-x2) = 0\n c = -x1 * -x2\n return(a,b,c)\n\nprint(quadratic(1,2))", "def quadratic(x1, x2):\n b = -x2 + -x1\n c = x1 * x2\n \n return (1, b, c)\n", "def quadratic(x1, x2):\n a = (x1 + x2) * (-1)\n b = x1 * x2 \n return (1, a, b)", "def quadratic(x1, x2):\n x = 1\n return (x,-(x1+x2),(x1*x2))\n \n", "def quadratic(x1, x2):\n a = 1\n b = (-x2) + (-x1)\n c = (-x2) * (-x1)\n coeff = (a, b, c)\n return coeff\n \n", "def quadratic(x1, x2):\n coff = [1]\n coff.append(-x2 - x1)\n coff.append(-x1 * -x2)\n return tuple(coff)", "def quadratic(x1, x2):\n b = -1*x1 - x2\n c = x1*x2\n return (1, b, c)", "def quadratic(x1, x2):\n # return 1, -(abs(x1)+abs(x2)), x1*x2\n return 1, -x1+-x2, x1*x2", "def quadratic(x1, x2):\n ans = []\n ans.append(1)\n ans.append(-(x1 + x2))\n ans.append(x1*x2)\n return tuple(ans)\n", "def quadratic(x1, x2):\n a=x1+x2\n b=x1*x2\n return (1, -a, b)\n", "def quadratic(x1, x2):\n y = (1, -(x1+x2), x2*x1)\n return y\n\n", "def quadratic(x1, x2):\n t = (1, -(x1 + x2), x1*x2 )\n return t\n", "def quadratic(x1, x2):\n a = 1\n b = -x1-x2\n c = (b**2 - (x1-x2)**2)/4\n return (a, b, c) \n \n \n\n", "def quadratic(x1, x2):\n a=1\n b=-(a*(x1+x2))\n c=(a*(x1*x2))\n return((a,b,c))\n", "def quadratic(x1, x2):\n #0=x^2-(x1+x2)*x+x1*x2\n y=-(x1+x2)\n t=(1,y,x1*x2)\n return t", "def quadratic(x1, x2):\n return (1,(-1*x2)+(-1*x1),(-1*x1)*(-1*x2))\n", "def quadratic(x1, x2):\n a = 1\n b = (x1 + x2)*(-1)\n c = x1*x2\n s = (a, b, c)\n return s", "def quadratic(x1, x2):\n a = 1\n b = -a * x1 -a * x2\n c = a * x1 * x2\n \n return (a, b, c)\n", "import math \n\n\ndef quadratic(x1, x2):\n a = 1 \n b = -x1 - x2\n c = x1 * x2\n return (a, b, c)\n \n \n \n", "def quadratic(x1, x2):\n a=1\n b=x1+x2\n c=x1*x2\n return a,-b,c", "def quadratic(x1, x2):\n co1 = 1 \n co2 = - ( x2 + x1)\n co3 = x1 * x2\n result = (co1 , co2 , co3)\n return(result)\n", "def quadratic(x1, x2):\n #quadratic (x1, x2) = (x - x1)(x - x2)\n a = 1\n b = -(x1 + x2)\n c = (x1 * x2)\n return (a, b, c)\n", "def quadratic(x1, x2):\n \"\"\"\n Returns the coefficients of the equations in the order (a, b, c)\n \n Note: Since there are infinitely many solutions to this problem, we fix a = 1.\n \"\"\"\n return (1, -(x1 + x2), x1 * x2)", "def quadratic(x1, x2):\n return (1,-x1-x2,x1*x2)\n\nx = quadratic(56,99)\nprint(x)\n", "def quadratic(x1, x2):\n eq = (1, -(x1+x2), x2*x1)\n return eq\n", "def quadratic(x1, x2):\n result = -(x1+x2)\n return 1,result,x1*x2", "def quadratic(x1, x2):\n a = 1 \n if x1 < 0:\n c = x1 * x2 \n \n else:\n c = x1 * x2\n \n if x1 > 0 or x2 > 0:\n b = -(x1 + x2) \n else:\n b = abs(x1 + x2) \n tuple = (a, b , c)\n return tuple", "def quadratic(x1, x2):\n return (1, -x2-x1, x2*x1)\n", "def quadratic(x1, x2):\n return (1, x2*-1 + x1*-1, x1*x2)\n \n", "def quadratic(x1, x2):\n b = -x1 + -x2\n c = x1 * x2\n return (1,b,c)", "def quadratic(x1, x2):\n coef = ()\n a = 1\n b = -(x1 + x2)\n c = -x1 * -x2 \n \n coef = (a, b, c)\n return coef\n", "def quadratic(x1, x2):\n #(x - x1) * (x - x2) = 0\n a = 1\n b = 1* -x2 + -x1 * 1\n c = -x1 * -x2\n return (a, b, c)\n\n", "def quadratic(x1, x2):\n a = 1\n b = x1 + x2\n c = x1 * x2\n roots = (a, -b, c)\n return roots", "def quadratic(x1, x2):\n coeff = 1 , -x1-x2 , x1*x2\n return coeff\n", "def quadratic(x1, x2):\n a=1\n if x1!=x2:\n b=(x2**2-x1**2)/(x1-x2)\n c=-x1**2-b*x1\n else:\n b=-2*x1\n c=-x1**2-b*x1\n return (a,b,c)\n", "def quadratic(x1, x2):\n answer=(1,-x1-x2,x1*x2)\n return answer\n", "def quadratic(x1, x2):\n a = 1\n b = -x1-x2\n c = x1*x2\n vector = (a,b,c)\n return vector\n", "def quadratic(x1, x2):\n x = 1\n f = (x * x ), (x * - (x2)),(-x1 * x) ,(-x1 * - (x2))\n return f[0], f[1] + f[2], f[3]\n \n \n", "def quadratic(x1, x2):\n x = 1\n formula = (x * x ), (x * - (x2)),(-x1 * x) ,(-x1 * - (x2))\n return formula[0], formula[1] + formula[2], formula[3]\n \n \n", "def quadratic(x1, x2):\n int(x1)\n int(x2)\n thisdict = {\n 'a': 1,\n 'b': (-x1) + (-x2),\n 'c': (-x1) * (-x2)\n }\n return (thisdict.get('a'), thisdict.get('b'), thisdict.get('c'))\n \n \n", "def quadratic(x1, x2):\n a=1\n c=(-x1*-x2)\n b=-(x1+x2)\n return (a,b,c)", "def quadratic(x1, x2):\n a=1\n b=-(x1+x2)\n c=(x1*x2)\n tes=(a,b,c)\n return tes\n", "x = 1\ndef quadratic(x1, x2):\n #equation = (x-x1)*(x-x2)=0\n a = (x*x)\n b = (-(x*x2))-(x1*x)\n c = (x1*x2)\n return a, b, c\n", "def quadratic(x1, x2):\n d = (x1+x2)**2-4*x1*x2\n c = x1*x2\n b = -1*(x1+x2)\n return(1,b,c)\n", "def quadratic(x1, x2):\n p = -1 * (x1 + x2) \n q = x1 * x2\n b = p\n c = q\n a = 1\n return (a, b, c)\n", "def quadratic(x1, x2):\n sum = x1 + x2\n sum = sum * -1\n mul = x1 * x2\n list = (1, sum, mul)\n return list\n", "def quadratic(x1, x2):\n a = 1\n b = (-1 * x2) + (-1 * x1)\n c = (-1 * x1) * (-1 * x2)\n return (a,b,c)", "def quadratic(a, b):\n return (1, (-a+-b), (-a*-b))\n", "def quadratic(a, b):\n return tuple([1, (-a+-b), (-a*-b)])\n", "def quadratic(x1, x2):\n if x1 == x2:\n return (1, int(-2 * x1), int(x1 ** 2))\n else:\n b = (x1 ** 2 - x2 ** 2) / (x2 - x1)\n return (1, int(b), int(-1 * (x1 ** 2) - b * x1))\n", "def quadratic(x1, x2):\n a, b, c = 1, 0, 0\n b = -1 * a * (x1 + x2)\n c = a * (x1 * x2)\n return (a, b, c)\n", "def quadratic(m, n):\n return (1, -(m+n), m*n)", "def quadratic(x1, x2):\n a, b, c = 0, -(x1 + x2), (x1 * x2)\n if x1 * x2 != 0:\n a = c / (x1 * x2)\n elif (x1 + x2) != 0:\n a = -b / (x1 + x2)\n return a, b, c", "def quadratic(x1, x2):\n a = 1\n b = x1 * (-1) + x2 * (-1)\n c = x1*x2\n \n coeff = (a, b, c)\n return coeff\n \n # (x - x1)*(x - x2)\n \n \n\n\n\n\n", "def quadratic(x1, x2):\n if x1 == 0:\n return (1, -x2, 0)\n else:\n return (1, -(x1+x2), (x2*x1))\n", "def quadratic(x1, x2):\n return tuple([1,-x1-x2,x1*x2])", "def quadratic(x1, x2):\n lst = list()\n a = 1\n lst.append(a)\n b = -(x1+x2)\n lst.append(b)\n c = x1 * x2\n lst.append(c)\n tpl = tuple(lst)\n return tpl", "def quadratic(x1, x2):\n a, b, c=1, -(x1+x2), (x1*x2) \n return(a, b, c)", "def quadratic(x1, x2):\n lst=()\n a=1\n c=x1*x2\n b=((-x1)-(x2)) \n lst=(a,b,c)\n return lst\npass\n", "def quadratic(x1, x2):\n b = -1*(x1 + x2)\n c = x1 * x2\n return (1, b, c)\n", "def quadratic(x1, x2):\n a=1\n c=x1*x2\n if x1!=x2:\n b=-(x1+x2)\n if x1==x2:\n b=-2*x1\n return (a,b,c)", "def quadratic(x1, x2):\n #(x-x1) * (x-x2) = 0\n return (1,-(x1+x2),x1*x2)\n", "def quadratic(x1, x2):\n if isinstance(x1, int) and isinstance(x2, int):\n b = - (x1 + x2)\n c = x1 * x2\n return 1, b, c\n else:\n return False\n\n\nprint(quadratic(1, 3))", "def quadratic(x1, x2):\n c = x1 * x2\n b = -(x1 + x2)\n return 1,b,c\n", "def quadratic(x1, x2):\n a, b, c = 1, (-x1 + -x2), (x1 *x2) \n return a, b, c"]
{"fn_name": "quadratic", "inputs": [[0, 1], [4, 9], [2, 6], [-5, -4]], "outputs": [[[1, -1, 0]], [[1, -13, 36]], [[1, -8, 12]], [[1, 9, 20]]]}
introductory
https://www.codewars.com/kata/5d59576768ba810001f1f8d6
def quadratic(x1, x2):
[ 641, 419, 98838, 498, 525, 3601, 311, 1477, 279, 36829, 315, 79151, 23606, 315, 279, 2661, 1378, 19703, 28654, 87, 16, 63, 323, 1565, 87, 17, 63, 3593, 24509, 367, 686, 387, 279, 1352, 315, 54275, 706, 61, 17, 488, 44241, 488, 272, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
538
Sebi goes to school daily with his father. They cross a big highway in the car to reach to the school. Sebi sits in front seat beside his father at driving seat. To kill boredom, they play a game of guessing speed of other cars on the highway. Sebi makes a guess of other car's speed being SG kph, his father FG kph. The highway is usually empty, so the drivers use cruise control, i.e. vehicles run at a constant speed. There are markers on the highway at a gap of 50 meters. Both father-son duo wants to check the accuracy of their guesses. For that, they start a timer at the instant at which their car and the other car (which speed they are guessing) are parallel to each other (they need not to be against some marker, they can be in between the markers too). After some T seconds, they observe that both the cars are next to some markers and the number of markers in between the markers of their car and the other car is D - 1 (excluding the markers next to both the cars). Also, they can observe these markers easily because the other car is faster than their. Speed of Sebi's father's car is S. Using this information, one can find the speed of the other car accurately. An example situation when Sebi's father starts the timer. Notice that both the car's are parallel to each other. Example situation after T seconds. The cars are next to the markers. Here the value of D is 1. The green car is Sebi's and the other car is of blue color. Sebi's a child, he does not know how to find the check whose guess is close to the real speed of the car. He does not trust his father as he thinks that he might cheat. Can you help to resolve this issue between them by telling whose guess is closer. If Sebi's guess is better, output "SEBI". If his father's guess is better, output "FATHER". If both the guess are equally close, then output "DRAW". -----Input----- The first line of the input contains an integer T denoting the number of test cases. Each of the next T lines contain five space separated integers S, SG, FG, D, T corresponding to the Sebi's car speed, Sebi's guess, his father's guess, D as defined in the statement and the time at which both the cars at against the markers (in seconds), respectively. -----Output----- Output description. For each test case, output a single line containing "SEBI", "FATHER" or "DRAW" (without quotes) denoting whose guess is better. -----Constraints----- - 1 ≤ T ≤ 10000 - 0 ≤ S ≤ 130 - 0 ≤ SG, FG ≤ 300 - 1 ≤ D ≤ 30 - 1 ≤ T ≤ 300 - The other car speed doesn't exceed 300 kph. -----Example----- Input: 2 100 180 200 20 60 130 131 132 1 72 Output: SEBI FATHER -----Explanation----- Example case 1. There are total 20 - 1 = 19 markers in between the Sebi's car and the other car. So, the distance between those cars at time T is 20 * 50 = 1000 meters = 1 km. As T = 60 seconds, i.e. 1 minutes. So, the other car goes 1 km more than Sebi's car in 1 minute. So, the other car will go 60 km more than Sebi's car in 1 hour. So, its speed is 60 kmph more than Sebi's car, i.e. 160 kmph. Sebi had made a guess of 180 kmph, while his father of 200 kmph. Other car's real speed is 160 kmph. So, Sebi's guess is better than his father. Hence he wins the game. Example case 2. The situation of this example is depicted in the image provided in the statement. You can find the speed of other car and see that Father's guess is more accurate.
["# cook your dish here\nn=int(input())\nfor i in range(n):\n S, SG, FG, D, T = map(int, input().split())\n speed = (D*180)/T + S\n if abs(SG-speed) == abs(FG-speed):\n print('DRAW')\n elif abs(SG-speed) > abs(FG-speed):\n print('FATHER')\n else:\n print('SEBI')", "# cook your dish here\nn=int(input())\nfor i in range(n):\n S, SG, FG, D, T = map(int, input().split())\n speed = (D*180)/T + S\n if abs(SG-speed) == abs(FG-speed):\n print('DRAW')\n elif abs(SG-speed) > abs(FG-speed):\n print('FATHER')\n else:\n print('SEBI')", "for i in range(int(input())):\n s,sg,fg,d,t = [int(i) for i in input().split()]\n dis = (d*50)\n speed = dis/t \n exs = (speed*18)/5\n ts = s + exs\n ss = abs(sg-ts)\n sf = abs(fg-ts)\n if ss>sf:\n print('FATHER')\n elif ss<sf:\n print('SEBI')\n elif ss==sf:\n print('DRAW')\n ", "for _ in range(int(input())):\r\n S, SG, FG, D, T = map(int, input().split())\r\n speed = (D*180)/T + S\r\n if abs(SG-speed) == abs(FG-speed):\r\n print('DRAW')\r\n elif abs(SG-speed) > abs(FG-speed):\r\n print('FATHER')\r\n else:\r\n print('SEBI')", "# cook your dish here\nfor _ in range(int(input())):\n S, SG, FG, D, T = map(int, input().split())\n speed = (D*180)/T + S\n if abs(SG-speed) == abs(FG-speed):\n print('DRAW')\n elif abs(SG-speed) > abs(FG-speed):\n print('FATHER')\n else:\n print('SEBI')", "for _ in range(int(input())):\n S, SG, FG, D, T = map(int, input().split())\n speed = (D*180)/T + S\n if abs(SG-speed) == abs(FG-speed):\n print('DRAW')\n elif abs(SG-speed) > abs(FG-speed):\n print('FATHER')\n else:\n print('SEBI')", "for i in range(int(input())):\n s,sg,fg,d,t=list(map(int,input().split()))\n speed=((d*180)/t+s)\n sa=abs(sg-speed)\n fa=abs(fg-speed)\n if fa<sa:\n print('FATHER')\n elif fa>sa:\n print('SEBI')\n else:\n print('DRAW')\n\n", "import math\nt=int(input())\nfor i in range(t):\n #n=int(input())\n s,sg,fg,d,t=map(int,input().split())\n #l=list(map(int,input().split()))\n #s=input()\n tot=(d*50*3.6)/t\n final=s+tot\n a=abs(final-sg)\n b=abs(final-fg)\n #print(tot,final,a,b)\n if(a<b):\n print(\"SEBI\")\n elif(b<a):\n print(\"FATHER\")\n else:\n print(\"DRAW\")\n\n# cook your dish here\n", "for i in range(int(input())):\r\n s,sg,fg,d,t=list(map(int,input().split()))\r\n speed=((d*180)/t+s)\r\n sa=abs(sg-speed)\r\n fa=abs(fg-speed)\r\n if fa<sa:\r\n print('FATHER')\r\n elif fa>sa:\r\n print('SEBI')\r\n else:\r\n print('DRAW')\r\n", "for i in range(int(input())):\n s,sg,fg,d,t = list(map(int,input().split()))\n tot = (50*d*3.6)/t\n final = s + tot\n a = abs(sg-final)\n b = abs(fg-final)\n if a<b:\n print(\"SEBI\")\n elif a>b:\n print(\"FATHER\")\n else:\n print(\"DRAW\")", "import math\r\nt=int(input())\r\n#t=1\r\nfor i in range(t):\r\n #n=int(input())\r\n s,sg,fg,d,t=map(int,input().split())\r\n #l=list(map(int,input().split()))\r\n #s=input()\r\n tot=(d*50*3.6)/t\r\n final=s+tot\r\n a=abs(final-sg)\r\n b=abs(final-fg)\r\n #print(tot,final,a,b)\r\n if(a<b):\r\n print(\"SEBI\")\r\n elif(b<a):\r\n print(\"FATHER\")\r\n else:\r\n print(\"DRAW\")\r\n\r\n\r\n ", "# cook your dish here\nt = int(input())\n\nfor _ in range(t):\n s,sg,fg,d,t = map(int , input().split(\" \"))\n \n # t = t/3600\n # d = (d*50)/1000\n \n car_speed = s + (d*50*3.6)/t\n #print(car_speed)\n sebi = abs(car_speed-sg)\n fat = abs(car_speed-fg)\n #print(sebi,fat)\n if sebi<fat:\n print(\"SEBI\")\n elif fat==sebi:\n print(\"DRAW\")\n else:\n print(\"FATHER\")", "for _ in range(int(input())):\n S,SG,FG,D,T=map(int, input().strip().split())\n G=S+((180*D)/T)\n if abs(G-SG)>abs(G-FG):\n print(\"FATHER\")\n elif abs(G-SG)<abs(G-FG):\n print(\"SEBI\") \n else:\n print(\"DRAW\")", "# cook your dish here\nfrom sys import stdin, stdout\nans = []\n\nfor _ in range(int(stdin.readline())):\n spd, sg, fg, d, time = map(int, stdin.readline().split())\n ckh = ((d*180)/time) + spd\n dsg = abs(ckh - sg)\n dfg = abs(ckh - fg)\n ans.append('DRAW' if dsg == dfg else 'SEBI' if dsg < dfg else 'FATHER')\nstdout.write('\\n'.join(ans))\n", "# cook your dish here\nfrom sys import stdin, stdout\nans = []\n\nfor _ in range(int(stdin.readline())):\n spd, sg, fg, d, time = map(int, stdin.readline().split())\n ckh = ((d*180)/time) + spd\n dsg = abs(ckh - sg)\n dfg = abs(ckh - fg)\n ans.append('DRAW' if dsg == dfg else 'SEBI' if dsg < dfg else 'FATHER')\nstdout.write('\\n'.join(ans))\n", "for _ in range(int(input())):\r\n s,sg,fg,d,t=map(int,input().split())\r\n dis=(d*50)/1000\r\n t1=t/60\r\n speed=d*50*60*60/(t*1000)\r\n speed+=s\r\n if(abs(speed-sg)>abs(speed-fg)):\r\n print('FATHER')\r\n elif(abs(speed-sg)<abs(speed-fg)):\r\n print('SEBI')\r\n else:\r\n print('DRAW')\r\n", "for i in range(int(input())):\n s,sg,fg,d,t=map(int,input().split())\n sc=s+(d*180/t)\n if abs(sg-sc)==abs(fg-sc):\n print('DRAW')\n elif abs(sg-sc)<abs(fg-sc):\n print('SEBI')\n elif abs(sg-sc)>abs(fg-sc):\n print('FATHER')", "# cook your dish here\nfor i in range(int(input())):\n s,sg,fg,d,t=map(int,input().split())\n sc=s+(d*180/t)\n if abs(sg-sc)==abs(fg-sc):\n print('DRAW')\n elif abs(sg-sc)<abs(fg-sc):\n print('SEBI')\n elif abs(sg-sc)>abs(fg-sc):\n print('FATHER')\n ", "# cook your dish here\nfor _ in range(int(input())):\n s,sg,fg,d,t=map(int,input().split())\n dif=float(d*180/t)\n diff=float(s)+dif\n if abs(float(diff-sg))>abs(float(diff-fg)):\n print(\"FATHER\")\n elif abs(float(diff-sg))<abs(float(diff-fg)):\n print(\"SEBI\")\n else:\n print(\"DRAW\")", "# cook your dish here\ntests = int(input())\nfor _ in range(tests):\n s, sg, fg, d, t = [int(j) for j in input().split()]\n speed = s + 180 * d / t\n abs_s = abs(sg-speed)\n abs_f = abs(fg-speed)\n if abs_s < abs_f:\n print(\"SEBI\")\n elif abs_f < abs_s:\n print(\"FATHER\")\n else:\n print(\"DRAW\")"]
{"inputs": [["2", "100 180 200 20 60", "130 131 132 1 72", "", ""]], "outputs": [["SEBI", "FATHER"]]}
interview
https://www.codechef.com/problems/SEBIHWY
[ 1514, 8221, 5780, 311, 2906, 7298, 448, 806, 6981, 13, 2379, 5312, 264, 2409, 26736, 304, 279, 1803, 311, 5545, 311, 279, 2906, 13, 1345, 8221, 23011, 304, 4065, 10723, 29388, 806, 6981, 518, 9842, 10723, 13, 2014, 5505, 89826, 11, 80...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,536
Create a function that takes an input String and returns a String, where all the uppercase words of the input String are in front and all the lowercase words at the end. The order of the uppercase and lowercase words should be the order in which they occur. If a word starts with a number or special character, skip the word and leave it out of the result. Input String will not be empty. For an input String: "hey You, Sort me Already!" the function should return: "You, Sort Already! hey me"
["def capitals_first(string):\n return ' '.join([word for word in string.split() if word[0].isupper()] + [word for word in string.split() if word[0].islower()])\n", "def capitals_first(string):\n # biggies first...\n words = string.split()\n st1 = []\n st2 = []\n for word in words:\n if word[0].isalpha():\n if word[0].isupper():\n st1.append(word)\n else:\n st2.append(word)\n return \" \".join(st1 + st2)", "def capitals_first(string):\n return ' '.join(sorted((a for a in string.split() if a[0].isalpha()),\n key=lambda b: b[0].islower()))\n", "def capitals_first(text):\n words = [ w for w in text.split() if w[0].isalpha() and not w.isnumeric() ]\n return ' '.join(sorted(words,key=lambda w: w[0] != w[0].upper()))", "capitals_first=lambda t:(lambda x:' '.join([e for e in x if e[0].isupper()]+[e for e in x if e[0].islower()]))(t.split())", "def capitals_first(text):\n return ' '.join(sorted(filter(lambda w: w[0].isalpha(), text.split()), key=lambda w: w[0].islower()))", "def capitals_first(text):\n # one-line\n #return \" \".join(sorted((word for word in text.split(\" \") if word[0].isalpha()), key=lambda word: word[0].islower()))\n upper, lower = [], []\n for word in text.split(\" \"):\n if word[0].islower():\n lower.append(word)\n elif word[0].isupper():\n upper.append(word)\n return \" \".join(upper + lower)", "def capitals_first(text):\n words = text.split()\n lower,upper = [],[]\n for w in words:\n if w[0].islower(): lower.append(w)\n elif w[0].isupper(): upper.append(w)\n return \" \".join(upper+lower)", "from itertools import chain\ndef capitals_first(text):\n cap, low = [], []\n for w in text.split():\n if w[0].isalpha():\n (cap, low)[w[0].islower()].append(w)\n return ' '.join(chain(cap, low))", "def capitals_first(text):\n words = [word for word in text.split() if word[0].isalpha()]\n return ' '.join(sorted(words, key=lambda x: not x[0].isupper()))\n"]
{"fn_name": "capitals_first", "inputs": [["hey You, Sort me Already"], ["sense Does to That Make you?"], ["i First need Thing In coffee The Morning"], ["123 baby You and Me"], ["Life gets Sometimes pretty !Hard"]], "outputs": [["You, Sort Already hey me"], ["Does That Make sense to you?"], ["First Thing In The Morning i need coffee"], ["You Me baby and"], ["Life Sometimes gets pretty"]]}
introductory
https://www.codewars.com/kata/55c353487fe3cc80660001d4
def capitals_first(text):
[ 4021, 264, 729, 429, 4990, 458, 1946, 923, 323, 4675, 264, 923, 11, 1380, 678, 279, 39482, 4244, 315, 279, 1946, 923, 525, 304, 4065, 323, 678, 279, 42047, 4244, 518, 279, 835, 624, 785, 1973, 315, 279, 39482, 323, 42047, 4244, 1265...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
109
You have a bag of size $n$. Also you have $m$ boxes. The size of $i$-th box is $a_i$, where each $a_i$ is an integer non-negative power of two. You can divide boxes into two parts of equal size. Your goal is to fill the bag completely. For example, if $n = 10$ and $a = [1, 1, 32]$ then you have to divide the box of size $32$ into two parts of size $16$, and then divide the box of size $16$. So you can fill the bag with boxes of size $1$, $1$ and $8$. Calculate the minimum number of divisions required to fill the bag of size $n$. -----Input----- The first line contains one integer $t$ ($1 \le t \le 1000$) — the number of test cases. The first line of each test case contains two integers $n$ and $m$ ($1 \le n \le 10^{18}, 1 \le m \le 10^5$) — the size of bag and the number of boxes, respectively. The second line of each test case contains $m$ integers $a_1, a_2, \dots , a_m$ ($1 \le a_i \le 10^9$) — the sizes of boxes. It is guaranteed that each $a_i$ is a power of two. It is also guaranteed that sum of all $m$ over all test cases does not exceed $10^5$. -----Output----- For each test case print one integer — the minimum number of divisions required to fill the bag of size $n$ (or $-1$, if it is impossible). -----Example----- Input 3 10 3 1 32 1 23 4 16 1 4 1 20 5 2 1 16 1 8 Output 2 -1 0
["import sys\nimport math\nfrom collections import defaultdict\nfrom collections import deque\nfrom itertools import combinations\nfrom itertools import permutations\ninput = lambda : sys.stdin.readline().rstrip()\nread = lambda : list(map(int, input().split()))\ngo = lambda : 1/0\ndef write(*args, sep=\"\\n\"):\n for i in args:\n sys.stdout.write(\"{}{}\".format(i, sep))\nINF = float('inf')\nMOD = int(1e9 + 7)\nYES = \"YES\"\nNO = -1\n\nfor _ in range(int(input())):\n try:\n n, m = read()\n arr = read()\n x = [0] * 65\n \n if sum(arr) < n:\n print(NO)\n go()\n \n for i in arr:\n x[int(math.log2(i))] += 1\n \n ans = 0\n for i in range(65):\n if (1 << i) & n:\n if x[i] != 0:\n x[i] -= 1\n continue \n\n total = 0\n for j in range(i):\n total += (1 << j) * x[j]\n \n if total >= (1 << i):\n temp = 1 << i \n for j in reversed(range(i)):\n while temp - (1 << j) >= 0 and x[j] > 0:\n temp -= 1 << j \n x[j] -= 1\n continue \n \n j = i\n while j < 65 and x[j] == 0:\n j += 1\n if j == 65:\n print(NO)\n go() \n else:\n x[j] -= 1\n for k in range(i, j):\n x[k] += 1\n ans += (j - i)\n \n print(ans)\n\n\n except ZeroDivisionError:\n continue\n\n except Exception as e:\n print(e)\n continue", "import math\nt = int(input())\nM2 = [1]\nfor i in range(35):\n M2.append(M2[-1]*2)\nfor i in range(t):\n n, m = map(int,input().split())\n A = list(map(int,input().split()))\n if sum(A) < n:\n print(-1)\n else:\n B = [0] * 33\n for i in range(m):\n B[int(math.log2(A[i]))] += 1\n # print(B[:10])\n C = [0] * 33\n nn = n\n for i in range(33):\n C[i] = nn%2\n nn//=2\n if nn==0:\n break\n # print(C)\n b = 0\n c = 0\n i = 0\n ans = 0\n ok = 0\n while i < len(B):\n while i < len(B) and b >= c:\n b += B[i] * M2[i]\n c += C[i] * M2[i]\n B[i]=0\n i += 1\n if i == len(B) and b >= c:\n print(ans)\n ok = 1\n break\n else:\n i-=1\n while B[i] == 0:\n i += 1\n ans += 1\n # print(\"ansplus\",i)\n B[i] -= 1\n b=0\n c=0\n if ok==1:\n break"]
{ "inputs": [ "3\n10 3\n1 32 1\n23 4\n16 1 4 1\n20 5\n2 1 16 1 8\n" ], "outputs": [ "2\n-1\n0\n" ] }
interview
https://codeforces.com/problemset/problem/1303/D
[ 2610, 614, 264, 8968, 315, 1379, 400, 77, 12947, 7281, 498, 614, 400, 76, 3, 14697, 13, 576, 1379, 315, 400, 72, 3, 12, 339, 3745, 374, 400, 64, 5318, 54876, 1380, 1817, 400, 64, 5318, 3, 374, 458, 7546, 2477, 60935, 2355, 315, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,759
```if-not:ruby Create a function, that accepts an arbitrary number of arrays and returns a single array generated by alternately appending elements from the passed in arguments. If one of them is shorter than the others, the result should be padded with empty elements. ``` ```if:ruby Create a function, that accepts an arbitrary number of arrays and returns a single array generated by alternately appending elements from the passed in arguments. If one of them is shorter than the others, the result should be padded with `nil`s. ``` Examples: ```python interleave([1, 2, 3], ["c", "d", "e"]) == [1, "c", 2, "d", 3, "e"] interleave([1, 2, 3], [4, 5]) == [1, 4, 2, 5, 3, None] interleave([1, 2, 3], [4, 5, 6], [7, 8, 9]) == [1, 4, 7, 2, 5, 8, 3, 6, 9] interleave([]) == [] ```
["from itertools import chain, zip_longest\n\ndef interleave(*args):\n return list(chain.from_iterable(zip_longest(*args)))", "def interleave(*args):\n max_len = max(map(len,args))\n interleaved = []\n \n for i in range(max_len):\n for arr in args:\n if i < len(arr):\n interleaved.append(arr[i])\n else:\n interleaved.append(None)\n \n return interleaved", "from itertools import chain, zip_longest\n\ndef interleave(*args):\n return [*chain.from_iterable(zip_longest(*args))]", "from itertools import chain, zip_longest\n\ndef interleave(*args):\n return [*chain(*zip_longest(*args))]", "interleave=lambda *a:[b[i]if len(b)>i else None for i in range(max(len(i)for i in a))for b in a]", "from itertools import zip_longest\n\ndef interleave(*args):\n return [y for x in zip_longest(*args) for y in x]\n", "interleave=lambda *a:sum([list(i) for i in __import__('itertools').zip_longest(*a)],[])", "from itertools import zip_longest\ndef interleave(*args):\n return [i for _ in zip_longest(*args) for i in _]", "def interleave(*args):\n arr = []\n for i in range(max(len(a) for a in args)):\n for j in range(len(args)):\n try: arr.append(args[j][i])\n except: arr.append(None)\n return arr", "def interleave(*args):\n n_max = len(max(args,key=len))\n return [j[i] if i < len(j) else None for i in range(n_max) for j in args]"]
{"fn_name": "interleave", "inputs": [[[1, 2, 3], ["c", "d", "e"]], [[1, 2, 3], [4, 5]], [[1, 2], [3, 4, 5]], [[null], [null, null], [null, null, null]], [[1, 2, 3], [4, 5, 6], [7, 8, 9]], [[]]], "outputs": [[[1, "c", 2, "d", 3, "e"]], [[1, 4, 2, 5, 3, null]], [[1, 3, 2, 4, null, 5]], [[null, null, null, null, null, null, null, null, null]], [[1, 4, 7, 2, 5, 8, 3, 6, 9]], [[]]]}
introductory
https://www.codewars.com/kata/523d2e964680d1f749000135
def interleave(*args):
[ 73594, 333, 29169, 25, 46275, 198, 4021, 264, 729, 11, 429, 26344, 458, 24168, 1372, 315, 18386, 323, 4675, 264, 3175, 1334, 7907, 553, 6919, 2652, 93283, 5424, 504, 279, 5823, 304, 5977, 13, 1416, 825, 315, 1105, 374, 23327, 1091, 27...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,326
Snuke loves constructing integer sequences. There are N piles of stones, numbered 1 through N. The pile numbered i consists of a_i stones. Snuke will construct an integer sequence s of length Σa_i, as follows: - Among the piles with the largest number of stones remaining, let x be the index of the pile with the smallest index. Append x to the end of s. - Select a pile with one or more stones remaining, and remove a stone from that pile. - If there is a pile with one or more stones remaining, go back to step 1. Otherwise, terminate the process. We are interested in the lexicographically smallest sequence that can be constructed. For each of the integers 1,2,3,...,N, how many times does it occur in the lexicographically smallest sequence? -----Constraints----- - 1 ≤ N ≤ 10^{5} - 1 ≤ a_i ≤ 10^{9} -----Input----- The input is given from Standard Input in the following format: N a_1 a_2 ... a_{N} -----Output----- Print N lines. The i-th line should contain the number of the occurrences of the integer i in the lexicographically smallest sequence that can be constructed. -----Sample Input----- 2 1 2 -----Sample Output----- 2 1 The lexicographically smallest sequence is constructed as follows: - Since the pile with the largest number of stones remaining is pile 2, append 2 to the end of s. Then, remove a stone from pile 2. - Since the piles with the largest number of stones remaining are pile 1 and 2, append 1 to the end of s (we take the smallest index). Then, remove a stone from pile 2. - Since the pile with the largest number of stones remaining is pile 1, append 1 to the end of s. Then, remove a stone from pile 1. The resulting sequence is (2,1,1). In this sequence, 1 occurs twice, and 2 occurs once.
["from collections import defaultdict\n\nN = int(input())\na = [int(i) for i in input().split()]\n\nb = defaultdict(lambda : [float('inf'), 0])\nfor i in range(N) :\n b[a[i]][0] = min(b[a[i]][0], i)\n b[a[i]][1] += 1\n\n# [value, first_appearance, count]\nc = [(0, 0, 0)]\nfor k, v in b.items() :\n c.append((k, v[0], v[1]))\nc.sort()\n\nret = [0] * N\npre_v, pre_i, pre_c = c.pop()\nwhile c :\n cur_v, cur_i, cur_c = c.pop()\n ret[pre_i] += (pre_v - cur_v) * pre_c\n cur_c += pre_c\n pre_v, pre_i, pre_c = cur_v, min(pre_i, cur_i), cur_c\n \nfor r in ret :\n print(r)", "import sys\ninput = sys.stdin.readline\n\ndef I(): return int(input())\ndef MI(): return list(map(int, input().split()))\ndef LI(): return list(map(int, input().split()))\n\n\"\"\"\n\u53ef\u80fd\u306a\u3089\u5de6\u304b\u3089\u53d6\u308b\n\u5de6\u5074\u306b\u3042\u308b\u6570\u5b57\u306e\u3069\u308c\u304b\u306b\u8ffd\u3044\u4ed8\u3044\u305f\u3089\uff0c\u305d\u3053\u306f\u3082\u3046\u9078\u3070\u308c\u306a\u3044\uff0e\n\u9078\u3076\u6570\u5b57\u3092\u3069\u3093\u3069\u3093\u5de6\u306b\u30b7\u30d5\u30c8\u3057\u3066\u3044\u304f\uff0e\n\n\u5de6\u306b\u79fb\u52d5\u3059\u308b\u3068\u304d\uff0c\u5de6\u5074\u306b\u3042\u308b\u6700\u5927\u5024\u3068\u305d\u306e\u4f4d\u7f6e\u3092\u53d6\u308a\u305f\u3044:seg\u6728\u3067\u3044\u3051\u308b\uff08A[i],-i\uff09\u3092\u6301\u3063\u3066\u6700\u5927\u5024\u3092\u53d6\u308c\u3070\u4f4d\u7f6e\u3082\u308f\u304b\u308b\uff0e\n\n\u6570\u5b57\u3092\u4f7f\u3046\u56de\u6570\u3092\u30ab\u30a6\u30f3\u30c8\u3059\u308b\u305f\u3081\u306b\u306f\uff0c\u5de6\u5074\u306b\u3042\u308b\u6700\u5927\u5024\u306f\u5fc5\u8981\uff0e\u3042\u3068\uff0c\u53f3\u5074\u306b\u3042\u308b\u81ea\u5206\u3068\u540c\u3058\u6570\u306e\u500b\u6570\uff0c\u3082\u5fc5\u8981\uff0e\n\u500b\u6570\u3060\u3051\u3067\u3088\u304f\uff0c\u4f4d\u7f6e\u60c5\u5831\u306f\u3044\u3089\u306a\u3044\u306e\u3067\u5de6\u306b\u30b7\u30d5\u30c8\u3057\u3066\u3044\u304f\u3068\u304d\u306bdd\u3067\u500b\u6570\u3060\u3051\u6301\u3063\u3066\u304a\u304f\u304b\n\u53f3\u5074\u306e\u4f7f\u3044\u65b9\u304c\u5909\u3060\u306a\uff0c326154\u307f\u305f\u3044\u306a\u4e26\u3073\u3060\u3068\uff0c6\u30923\u306b\u4e0b\u3052\u308b\u3068\u304d\u306b\uff0c\u53f3\u5074\u306b\u3042\u308b45\u3092\u3069\u3063\u3061\u3082\u3092\u88dc\u8db3\u3059\u308b\u5fc5\u8981\u3042\u308a\n\n\u3046\u308f\uff0c\u4f8b2\u306e\u7b54\u3048\u306e\u3068\u3053\u898b\u9593\u9055\u3048\u3066\u305f\uff0c\u666e\u901a\u306b\u8a08\u7b97\u3057\u305f\u901a\u308a\u306e\u8ee2\u5012\u6570\u30b8\u30e3\u30f3\uff0e\ni\u756a\u76ee\u3092\u898b\u3066\u3044\u308b\u72b6\u614b\n\u6b21\u306e\u3082\u306e\u304c\u81ea\u5206\u3088\u308a\u5de6\u5074\u306b\u51fa\u3066\u304f\u308b:\u5dee\u5206*i\u4ee5\u4e0a\u306e\u4f4d\u7f6e\u306b\u3042\u308b\u500b\u6570\n\u6b21\u306e\u3082\u306e\u304c\u81ea\u5206\u3088\u308a\u53f3\u5074\u306b\u51fa\u3066\u304f\u308b:\u3080\u3057\n\n\u540c\u3058\u6570\u5b57\u304c\u51fa\u3066\u304f\u308b\u3068\u304d\uff1a\u6b21\u306e\u6570\u5b57\u306f\u5de6\u5074\u3068\u3057\u305f\u3044\u304c\uff0c\u53f3\u306b\u51fa\u3066\u304f\u308b\u5206\u306e\u500b\u6570\u3082\u52a0\u5473\u3057\u305f\u3044\n+1\u3067\u306f\u306a\u304f\uff0c\u6b21\u306e\u6570\u3068\u306e\u5dee\u5206\n\u3068\u304b\u601d\u3063\u3066\u305f\u3051\u3069\uff0c\u7d50\u5c40\u8db3\u3059\u306e\u306f\u6b21\u306b\u5de6\u306e\u6570\u304c\u51fa\u3066\u304d\u305f\u6642\u306a\u306e\u3067\u3044\u3089\u306a\u3044\n\n\u7d50\u5c40\u5dee\u5206\u304c\u5927\u4e8b\uff0e\u6b21\u3068\u306e\u5dee\u5206\u3092\u898b\u308b\u3060\u3051\u306a\u3089\u3070\uff0c\u500b\u6570\u304c\u540c\u3058\u30b0\u30eb\u30fc\u30d7\u306e\u3053\u3068\u3092\u3042\u307e\u308a\u8003\u3048\u306a\u304f\u3066\u3082\u826f\u3044\n\u5927\u304d\u3044\u9806\u306b\u898b\u3066\u3044\u304f\u3060\u3051\u306a\u306e\u3067\uff0c\u500b\u6570=\u898b\u305f\u500b\u6570\u3067\u826f\u3044\n\n\n\"\"\"\ndef main():\n N=I()\n A=LI()\n for i in range(N):\n A[i]=(A[i],i)\n \n A.sort(reverse=True)\n A.append((0,0))\n ans=[0]*N\n \n now=A[0][1]#\u3069\u3053\u306b\u8ffd\u52a0\u3059\u308b\u304b\n for i in range(N):\n ans[now]+=(i+1)*(A[i][0] - A[i+1][0])\n now=min(now,A[i+1][1])\n \n for i in range(N):\n print((ans[i]))\n \n \n\nmain()\n", "N, = list(map(int, input().split()))\nX = list(map(int, input().split()))\n\nsx = []\nc = 0\nd = dict()\nfor x in sorted(list(set(X))):\n sx.append(x)\n d[x] = c\n c += 1\nsx.append(10**18)\n\ncount = [0]*(c+1)\nfor x in X:\n count[d[x]] += 1\nfor i in range(c-1, -1, -1):\n count[i] += count[i+1]\n\ncount2 = [0]*(c+1)\nfor i in range(c-1, -1, -1):\n count2[i] = count[i+1]*(sx[i+1]-sx[i])\nfor i in range(c-1, -1, -1):\n count2[i] += count2[i+1]\n\n\n\nY = []\nfor i in range(N):\n Y.append((X[i], -i))\nY.sort()\nR = []\nwhile Y:\n y, j = Y.pop()\n j = -j\n if not R:\n R.append((d[y], j))\n else:\n if d[y] < R[-1][0] and j < R[-1][1]:\n R.append((d[y], j))\n\n\n\nRR = [0]*N\nb = 0\nbi = 0\nfor y, i in R[:]:\n RR[bi] = count2[y]-b\n b = count2[y]\n bi = i\nRR[0] = sum(X)-sum(RR[1:])\nfor r in RR:\n print(r)\n\n", "n = int(input())\na = list(map(int, input().split()))\nl = [(0, n)]\nfor i, A in enumerate(a):\n l.append((A, i))\nl.sort(reverse=True)\nans = [0] * n\nmi = float(\"inf\")\nfor i in range(n):\n if mi > l[i][1]:\n mi = l[i][1]\n ans[mi] += (i + 1) * (l[i][0] - l[i + 1][0])\nfor i in range(n):\n print(ans[i])", "from bisect import bisect_left\n\nn = int(input())\nalst = list(map(int, input().split()))\nlst = list(set(alst))\nlst.sort()\nblst = []\nfor a in alst:\n blst.append(bisect_left(lst, a))\n\nimos = [0 for _ in range(len(lst) + 10)]\n\nfor b in blst:\n imos[0] += 1\n imos[b + 1] -= 1\nfor i in range(1, len(lst) + 10):\n imos[i] += imos[i - 1]\n\nbef = 0\nfor b in blst:\n if b < bef:\n print((0))\n continue\n total = 0\n while bef <= b:\n if bef == 0:\n total += imos[bef] * lst[bef]\n else:\n total += imos[bef] * (lst[bef] - lst[bef - 1])\n bef += 1\n print(total)\n", "N = int(input())\nA = list(map(int,input().split()))\n\nfrom collections import defaultdict\nG = defaultdict(list)\nD = {}\n\nfor i in range(N):\n tmp = A[i]\n G[tmp].append(i)\n \nkeylist = []\n\nfor key in G:\n G[key].sort()\n D[key] = len(G[key])\n keylist.append(key)\n\nkeylist.sort()\nkeylist = keylist[::-1]\nkeylist.append(0)\n\nD[0] = 0\nG[0].append(0)\n\nans = [0]*N\n\nfor i in range(len(keylist)-1):\n key = keylist[i]\n nextkey = keylist[i+1]\n tmpi = G[key][0]\n ans[tmpi] += D[key]*(key-nextkey)\n \n D[nextkey] += D[key]\n G[nextkey][0] = min(G[nextkey][0],tmpi)\n \nfor i in ans:\n print(i)", "from heapq import heappush, heappop\nN = int(input())\nA = [int(a) for a in input().split()]\nS = {}\nm = (1 << 18) - 1\nfor i, a in enumerate(A):\n if a not in S:\n S[a] = (i << 18) ^ 1\n else:\n aacc = S[a]\n aa, cc = aacc >> 18, aacc & m\n S[a] = (min(aa, i) << 18) ^ (cc + 1)\n\nH = [0]\nhpush = lambda x: heappush(H, -x)\nhpop = lambda: -heappop(H)\n\nfor a in S:\n micc = S[a]\n mi, cc = micc >> 18, micc & m\n aicc = (a << 36) ^ (mi << 18) ^ cc\n hpush(aicc)\n\nm36 = (1 << 36) - 1\nm18 = (1 << 18) - 1\nANS = [0] * N\nwhile len(H) > 1:\n aicc = hpop()\n a = aicc >> 36\n i = (aicc >> 18) & m18\n cc = aicc & m18\n aicc = hpop()\n a2 = aicc >> 36\n i2 = (aicc >> 18) & m18\n cc2 = aicc & m18\n ANS[i] += (a - a2) * cc\n \n if a2 == 0: continue\n hpush((a2 << 36) ^ (min(i, i2) << 18) ^ (cc + cc2))\n\nprint(\"\\n\".join(map(str, ANS)))", "n = int(input())\na = list(map(int,input().split()))\nb = list(range(n))\ns = list(map(list,zip(a,b)))\ns.sort(reverse=True)\ns.append([0,0])\nans = [0]*n\nfor i in range(n):\n dif = s[i][0]-s[i+1][0]\n ans[s[i][1]] += dif*(i+1)\n if s[i+1][1]>s[i][1]:\n s[i+1][1] = s[i][1]\nprint(*ans,sep=\"\\n\")", "import sys\n\nsys.setrecursionlimit(10 ** 6)\nint1 = lambda x: int(x) - 1\np2D = lambda x: print(*x, sep=\"\\n\")\ndef II(): return int(sys.stdin.readline())\ndef MI(): return map(int, sys.stdin.readline().split())\ndef LI(): return list(map(int, sys.stdin.readline().split()))\ndef LLI(rows_number): return [LI() for _ in range(rows_number)]\ndef SI(): return sys.stdin.readline()[:-1]\n\ndef main():\n n = II()\n aa = LI()\n # \u3067\u304d\u308b\u6570\u5217\u306b\u30a4\u30f3\u30c7\u30c3\u30af\u30b9\u304c\u304b\u304b\u308c\u308b\u3068\u304d\u306e\u6700\u5927\u5024\u306e\u5e95(bottom)\n bot = []\n mx = 0\n for i, a in enumerate(aa):\n if a > mx:\n bot.append((mx, i))\n mx = a\n #print(bot)\n aa.sort()\n ans = [0] * n\n j = n\n s = 0\n fin=0\n for mx, i in bot[::-1]:\n while j > 0 and aa[j - 1] > mx:\n j -= 1\n s += aa[j]\n ans[i]=s-(n-j)*mx-fin\n # print(mx,i,j,s,fin,ans)\n fin+=ans[i]\n print(*ans,sep=\"\\n\")\n\nmain()\n", "N = int(input())\nA = [int(_) for _ in input().split()]\n\n\ndef compress_coord(raw):\n v_i = {}\n for i, v in enumerate(raw):\n if v not in v_i:\n v_i[v] = []\n v_i[v] += [i]\n return v_i\n\n\na_i = compress_coord(A)\nA2 = sorted(a_i.keys())[::-1]\nans = [0] * N\nn = 0\ni = 10**10\nfor iv, a in enumerate(A2):\n if iv < len(A2) - 1:\n anext = A2[iv + 1]\n else:\n anext = 0\n i = min(i, a_i[a][0])\n n += len(a_i[a])\n ans[i] += n * (a - anext)\nprint(*ans, sep='\\n')\n", "import sys\nsys.setrecursionlimit(2147483647)\nINF=float(\"inf\")\nMOD=10**9+7\ninput=lambda:sys.stdin.readline().rstrip()\ndef resolve():\n n=int(input())\n AI=[(a,i) for i,a in enumerate(map(int,input().split()))]\n AI.append((0,-1))\n AI.sort(reverse=1)\n\n m=INF\n ans=[0]*n\n for i in range(n):\n d=AI[i][0]-AI[i+1][0]\n m=min(m,AI[i][1])\n ans[m]+=(i+1)*d\n\n print(*ans,sep='\\n')\nresolve()", "import sys\nread = sys.stdin.read\n\nn, *A = map(int, read().split())\nS = sorted([(a, i) for i, a in enumerate(A)], reverse=True)\nX, Y = zip(*S)\nm = 10**9\nL = [0]*n\nfor i, y in enumerate(Y):\n m = min(m, y)\n if i == n-1:\n L[m] += (i+1) * X[i]\n else:\n L[m] += (i+1) * (X[i] - X[i+1])\nprint(*L, sep=\"\\n\")", "from collections import defaultdict, Counter\nN = int(input())\nA = [0] + list(map(int, input().split()))\nC = Counter(A)\n\nvalue = sorted(set(A), reverse=True)\na_to_i = defaultdict(int)\n\nfor i, a in enumerate(A):\n if not a_to_i[a]:\n a_to_i[a] = i\n\nans = [0] * (N + 1)\ncnt = 0\ni = N\nfor x, y in zip(value[:-1], value[1:]):\n i = min(i, a_to_i[x])\n cnt += C[x]\n ans[i] += (x - y) * cnt\n\nprint(*ans[1:], sep=\"\\n\")", "import sys\ninput = lambda : sys.stdin.readline().rstrip()\nsys.setrecursionlimit(max(1000, 10**9))\nwrite = lambda x: sys.stdout.write(x+\"\\n\")\n\n\nn = int(input())\na = list(map(int, input().split()))\na = [(-num, i) for i,num in enumerate(a)]\na.append((0, -1))\nimport heapq\nheapq.heapify(a)\nans = [0]*n\n\npnum, pi = heapq.heappop(a)\npnum *= -1\ncount = 1\nv = pnum\nwhile a:\n num, i = heapq.heappop(a)\n num *= -1\n if i<pi:\n ans[pi] = v - num*count\n v = num*(count+1)\n count += 1\n pi = i\n else:\n count += 1\n v += num\nwrite(\"\\n\".join(map(str, ans)))", "N = int(input())\nA = list(map(int,input().split()))\n\nL = list(range(1, N+1))\n\nZIP = zip(A, L)\n\nZIP = sorted(ZIP, reverse = True)\n\nA, L = zip(*ZIP)\n\nans = [0] * (N + 1)\n\nMIN = float('INF')\n\nfor i in range(N-1):\n MIN = min(MIN, L[i])\n if A[i] - A[i+1] == 0:\n continue\n ans[MIN] += (A[i] - A[i+1]) * (i + 1)\nans[1] += sum(A) - sum(ans)\n\nfor i in range(1, N+1):\n print(ans[i])", "# frequency\nfrom collections import defaultdict\nN = int(input())\nA = list(map(int, input().split()))\nseq = []\nfreq = [0 for i in range(N+1)]\nD = defaultdict(list)\nminD = defaultdict(int)\nfor i, v in enumerate(A):\n D[v].append(i+1)\nfor key in D.keys():\n minD[key] = min(D[key])\nfor cnt in D.keys():\n seq.append((cnt, len(D[cnt]), minD[cnt]))\nseq.append((0, 0, 0))\nseq.sort(key=lambda x: -x[0])\nnow_height, now_size, now_min = seq[0]\n# howmany,group_size,minimum\nfor i in range(1, len(seq)):\n freq[now_min] += (now_height-seq[i][0]) * now_size\n now_min = min(now_min, seq[i][2])\n now_size += seq[i][1]\n now_height = seq[i][0]\nfor i in range(1, N+1):\n print(freq[i])", "import sys\ninput = sys.stdin.readline\n\nN = int(input())\na = list(map(int, input().split()))\naa = list(set(a))\naa.sort()\ncompress = {aa[i]: i for i in range(len(aa))}\ncnt = [0] * len(aa)\nidx = [-1] * len(aa)\nfor i in range(N)[::-1]:\n n = compress[a[i]]\n cnt[n] += 1\n idx[n] = i\nans = [0] * N\nfor n in range(1, len(aa))[::-1]:\n i = idx[n]\n ans[i] += cnt[n] * (aa[n] - aa[n-1])\n cnt[n-1] += cnt[n]\n idx[n-1] = min(idx[n-1], i)\nans[0] += N * aa[0]\nprint(*ans, sep='\\n')", "def main():\n n = int(input())\n a = list(enumerate(map(int, input().split())))\n\n a.sort(key=lambda x: x[1], reverse=True)\n a.append((-1, 0))\n\n # min_ind = min(a[:i+1])[0]\n min_ind = n\n ans = [0] * n\n for i in range(n):\n ind, value = a[i]\n if ind < min_ind:\n min_ind = ind\n\n ans[min_ind] += (value - a[i+1][1]) * (i+1)\n\n for i in ans:\n print(i)\n\nmain()", "# coding: utf-8\nimport sys\nfrom bisect import bisect_left, bisect_right, insort\n\nsr = lambda: sys.stdin.readline().rstrip()\nir = lambda: int(sr())\nlr = lambda: list(map(int, sr().split()))\n\n\"\"\" \n\u77f3\u6570\u6700\u5927\u306e\u4e2d\u3067\u53f3\u306e\u5c71\u304b\u3089\u53d6\u308a\u9664\u304f\n\u6b21\u306e\u6570\u307e\u3067\u307e\u3068\u3081\u3066\u77f3\u3092\u53d6\u308a\u9664\u304f\n\"\"\"\nN = ir()\nA = lr()\nA = [(x, i+1) for i, x in enumerate(A)] + [(0, 0)]\nA.sort(reverse=True)\nanswer = [0] * (N+1) # 1-indexed\nmi = 10 ** 10\nmi_index = 10 ** 10\nfor i, (x, pre_index) in enumerate(A[:-1]):\n diff = A[i][0] - A[i+1][0]\n if pre_index < mi_index:\n mi_index = pre_index\n answer[mi_index] += diff * (i+1)\n\nprint(('\\n'.join(map(str, answer[1:]))))\n", "import sys\nfrom collections import defaultdict as dd\ninput = sys.stdin.readline\nN = int(input())\na = list(map(int, input().split()))\nd = dd(int)\nc = dd(int)\nfor i in range(N - 1, -1, -1):\n d[a[i]] = i\n c[a[i]] += 1\nc[0] = 0\nks = sorted(d.keys())\nres = [0] * N\nfor i in range(len(ks) - 1, 0, -1):\n x = ks[i]\n y = ks[i - 1]\n c[y] += c[x]\n d[y] = min(d[y], d[x])\nfor i in range(len(ks)):\n x = ks[i]\n y = 0\n if i > 0: y = ks[i - 1]\n res[d[x]] += c[x] * (x - y)\nfor r in res: print(r)", "# -*- coding: utf-8 -*-\nimport bisect\nimport heapq\nimport math\nimport random\nimport sys\nfrom collections import Counter, defaultdict, deque\nfrom decimal import ROUND_CEILING, ROUND_HALF_UP, Decimal\nfrom functools import lru_cache, reduce\nfrom itertools import combinations, combinations_with_replacement, product, permutations\nfrom operator import add, mul, sub\n\nsys.setrecursionlimit(100000)\ninput = sys.stdin.readline\nINF = 2**62-1\n\ndef read_int():\n return int(input())\n\n\ndef read_int_n():\n return list(map(int, input().split()))\n\n\ndef read_float():\n return float(input())\n\n\ndef read_float_n():\n return list(map(float, input().split()))\n\n\ndef read_str():\n return input().strip()\n\n\ndef read_str_n():\n return list(map(str, input().split()))\n\n\ndef error_print(*args):\n print(*args, file=sys.stderr)\n\n\ndef mt(f):\n import time\n\n def wrap(*args, **kwargs):\n s = time.time()\n ret = f(*args, **kwargs)\n e = time.time()\n\n error_print(e - s, 'sec')\n return ret\n\n return wrap\n\n\n@mt\ndef slv(N, A):\n ai = [(0, -1)] + [(a, i+1) for i, a in enumerate(A)]\n ai.sort()\n A = [a for a, i in ai]\n I = [i for a, i in ai]\n ans = [0] * (N+1)\n\n i = N\n same = 0\n q = []\n while i != 0:\n j = i\n while True:\n j -= 1\n if I[j] < I[i]:\n break\n heapq.heappush(q, A[j])\n d = A[i] - A[j]\n ans[I[i]] = d * (same+1)\n same += 1\n while q and q[0] >= A[j]:\n b = heapq.heappop(q)\n ans[I[i]] += b - A[j]\n same += 1\n i = j\n for r in ans[1:]:\n print(r)\n\ndef main():\n N = read_int()\n A = read_int_n()\n (slv(N, A))\n\n\ndef __starting_point():\n main()\n\n__starting_point()", "N=int(input())\nA=list(map(int,input().split()))\n\nnum=A[0]\ndata=[[A[0],0]]\n\nfor i in range(1,N):\n if A[i]>num:\n data.append([A[i],i])\n num=A[i]\n \nB=sorted(A,reverse=True)\nC=[0]*N\nC[0]=B[0]\nfor i in range(1,N):\n C[i]=C[i-1]+B[i]\n \n \nans=[0]*N\ncnt=0\nkkk=0\nfor i in range(len(data)-1,0,-1):\n \n zzz=data[i-1][0]\n while kkk<N and B[kkk]>zzz:\n kkk+=1\n num=C[kkk-1]-kkk*zzz\n num-=cnt\n ans[data[i][1]]=num\n cnt+=num\n\nans[0]=sum(A)-sum(ans)\n\nfor u in ans:\n print(u)", "def main():\n import sys,bisect\n input = sys.stdin.readline\n\n n = int(input())\n a = list(map(int,input().split()))\n\n b = [0] + sorted(a)\n\n res = [0]*n\n\n d = dict()\n for i in range(n):\n if not a[i] in d:\n d[a[i]] = i\n\n p = n\n while p > 0:\n k = bisect.bisect_left(b,b[p])\n res[d[b[k]]] += (n+1-k)*(b[k]-b[k-1])\n if k -1 >= 1:\n d[b[k-1]] = min(d[b[k]],d[b[k-1]])\n p = k-1\n for e in res:\n print(e)\n\ndef __starting_point():\n main()\n__starting_point()", "N = int(input())\nB = list(map(int, input().split()))\nA = [(B[i], i) for i in range(N)]\n\nA.sort(key = lambda x: x[0], reverse = True)\n\nA.append((0, 0))\n\nans = [0] * N\ntmp = N + 1\ncount = 1\nfor index, a in enumerate(A[:-1]):\n tmp = min(tmp, a[1])\n ans[tmp] += count * (a[0] - A[index + 1][0])\n count += 1\n\nprint (*ans, sep = '\\n')\n\n# print (A)\n", "N=int(input())\nA=list(map(int,input().split()))\nB=sorted([(i,a) for i,a in enumerate(A)],key=lambda x:x[1])[::-1]+[(N,0)]\nd=[0]*N\nm=N\nfor i in range(N):\n m=min(m,B[i][0])\n d[m]+=(i+1)*(B[i][1]-B[i+1][1])\nprint(*d,sep='\\n')", "import sys\nimport math\nfrom collections import defaultdict\nfrom bisect import bisect_left, bisect_right\n\nsys.setrecursionlimit(10**7)\ndef input():\n return sys.stdin.readline()[:-1]\n\nmod = 10**9 + 7\n\ndef I(): return int(input())\ndef LI(): return list(map(int, input().split()))\ndef LIR(row,col):\n if row <= 0:\n return [[] for _ in range(col)]\n elif col == 1:\n return [I() for _ in range(row)]\n else:\n read_all = [LI() for _ in range(row)]\n return map(list, zip(*read_all))\n\n#################\n\nN = I()\na = LI()\n\nasort = sorted(a)\n\nd = defaultdict(int)\nfor i in range(N):\n d[a[i]] += 1\nkeys = sorted(list(d.keys()))\n\nans = [0]*N\nmax_ = 0\nplace = 0\nfor i in range(N):\n if a[i] > max_:\n diff = a[i]-max_\n num = N-bisect_left(asort,a[i])\n ans[i] = num*diff\n for j in range(place,len(keys)):\n if keys[j] <= max_:\n continue\n elif keys[j] >= a[i]:\n place = j\n break\n else:\n ans[i] += (keys[j]-max_)*d[keys[j]]\n max_ = a[i]\n\nans[0] = sum(a)-sum(ans[1:])\n\nfor i in range(N):\n print(ans[i])", "#!/usr/bin/env python3\nn = int(input())\na = [0] + list(map(int, input().split()))\np = sorted((-a[i], -i) for i in range(n + 1))\nans = [0] * (n + 1)\nm = n\nfor i in range(n):\n k, v = -p[i][1], -p[i][0]\n nv = -p[i + 1][0]\n m = min(m, k)\n ans[m] += (i + 1) * (v - nv)\nprint(*ans[1:], sep='\\n')\n", "#from collections import deque,defaultdict\nprintn = lambda x: print(x,end='')\ninn = lambda : int(input())\ninl = lambda: list(map(int, input().split()))\ninm = lambda: map(int, input().split())\nins = lambda : input().strip()\nDBG = True # and False\nBIG = 10**18\nR = 10**9 + 7\n#R = 998244353\n\ndef ddprint(x):\n if DBG:\n print(x)\n\nn = inn()\na = inl()\nb = [(a[i],i) for i in range(n)]\nb.sort(reverse=True)\nb.append((0,0))\nans = [0]*n\nv = b[0][1]\nfor i in range(n):\n ans[v] += (i+1)*(b[i][0]-b[i+1][0])\n v = min(v,b[i+1][1])\nfor i in range(n):\n print(ans[i])\n", "#1\u306f\u4e00\u610f\n#2\u306f\u5c0f\u3055\u3044\u756a\u53f7\u306e\u77f3\u306e\u6570\u304c\u5927\u304d\u304f\u306a\u308b\u3088\u3046\u306b\u3001\u5927\u304d\u3044\u756a\u53f7\u306e\u77f3\u3092\u9664\u304d\u305f\u3044\n\n#\u500b\u6570\u304c\u540c\u9806\u306e\u3082\u306e\u3092\u3001\u756a\u53f7\u5c0f\u4ee5\u5916\u304c\u500b\u6570\u304c\u6642\u70b9\u306b\u306a\u308b\u307e\u3067\u9664\u3044\u3066\u304b\u3089\u3001\u756a\u53f7\u5c11\u3092\u9664\u304f\nn = int(input())\na = list(map(int, input().split( )))\n\ncnt = {}#key\u306f\u500b\u6570\u3001\u8981\u7d20\u306f\u6700\u5c0f\u756a\u53f7\n\nfor i in range(n):\n if a[i] in cnt:\n cnt[a[i]][0] = min(cnt[a[i]][0],i)\n cnt[a[i]][1]+=1\n else:\n cnt[a[i]] = [i,1]\n\n#\u500b\u6570\u3001\u6700\u5c0f\u756a\u53f7\u3001\u756a\u53f7\u306e\u6570 \nmins = [[k,cnt[k][0],cnt[k][1]] for k in cnt]\nmins.append([0,0,0])\n#\u672b\u7aef\u51e6\u7406\u306b\u306a\u3063\u3066\u3044\u306a\u3044\nmins.sort(reverse = True)\n#print(mins)\nans = [0]*n\n\nfor i in range(len(mins)-1):\n k,cntk,l = mins[i][0],mins[i][1],mins[i][2]\n ans[cntk] += (k-mins[i+1][0])*l\n mins[i+1][2]+=l###=\u3058\u3083\u304a\u304b\u3057\u3044\n if mins[i+1][1]>mins[i][1]:##\u8ffd\u52a0\n mins[i+1][1] = mins[i][1]\n#ans[mins[-1][1]]=n*mins[-1][0]\n\nfor ai in ans:\n print(ai)\n \n\n\n\n", "def main():\n n = int(input())\n a = list(map(int, input().split()))\n\n target = [0]\n prev = a[0]\n for i in range(1, n):\n if a[i] > prev:\n target.append(i)\n prev = a[i]\n\n ax = [None] * n\n for i in range(n):\n ax[i] = [a[i], i]\n ax.sort(reverse=True)\n\n ans = [0] * n\n mult = 1\n for i in range(n-1):\n ans[target[-1]] += (ax[i][0] - ax[i+1][0]) * mult\n if (ax[i+1][0] < a[target[-1]] and ax[i+1][1] < target[-1]):\n target.pop()\n mult += 1\n ans[target[-1]] += ax[n-1][0] * mult\n\n for x in ans:\n print(x)\n\ndef __starting_point():\n main()\n\n__starting_point()", "N = int(input())\nA = [0] + list(map(int, input().split()))\nB = [[a, i, 1] for i, a in enumerate(A)]\nC = sorted(B, reverse=True)\na_max, idx = 0, 0 # [value, idx]\nleft_max = [[0, 0] for i in range(N+1)] # [value, idx]\nfor i, a in enumerate(A):\n left_max[i] = [a_max, idx]\n if a > a_max:\n a_max, idx = a, i\n\nans = [0] * (N+1)\nnext_i = C[0][1]\nfor _, i, _ in C:\n a, _, num = B[i]\n if i == next_i:\n next_a, next_i = left_max[i]\n now_i = i\n ans[i] += (a - next_a) * num\n B[next_i][2] += num\n else:\n ans[now_i] += (a - next_a) * num\n B[next_i][2] += num\n\nprint(*ans[1:], sep='\\n')", "N = int(input())\nL = [0] + list(map(int,input().split()))\nD = {}\nD[0] = [0,0]\nfor i in range(1,N+1):\n if L[i] not in D:\n D[L[i]] = [i,1]\n else:\n D[L[i]][1] += 1\n\nA = list(D.items())\nA.sort(reverse=True)\n#print(A)\n\nans=0\nANS = [0 for i in range(N+1)]\n\nfor i in range(1,len(D)):\n ANS[A[i-1][1][0]] += (A[i-1][0] - A[i][0]) * A[i-1][1][1]\n A[i][1][0] = min(A[i-1][1][0],A[i][1][0])\n A[i][1][1] += A[i-1][1][1]\n\nfor i in range(1,len(ANS)):\n print(ANS[i])", "3.6\nn = int(input())\na = [int(item) for item in input().split()]\nawid = []\nfor i, item in enumerate(a):\n awid.append((item, i))\nawid.sort(reverse=True)\n\nbit = [0] * (n + 1) \ncnt = [0] * (n + 1) \n# Add w to ax \ndef bit_add(bit, x, w):\n while x <= n:\n bit[x] += w\n x += x & -x\n\n# Sum a1 to ax \ndef bit_sum(bit, x):\n ret = 0\n while x > 0:\n ret += bit[x]\n x -= x & -x\n return ret\n\nmin_as = [-1] * n\nmin_a = 0\nfor i, item in enumerate(a):\n if item > min_a:\n min_as[i] = min_a\n min_a = item\n\nans = [0] * n\nitr = 0\nsubbed = 0\nfor i, item in enumerate(min_as[::-1]):\n place = n - 1 - i\n if item != -1:\n while itr < n and awid[itr][0] > item:\n val, index = awid[itr]\n bit_add(bit, index + 1, val)\n bit_add(cnt, index + 1, 1)\n itr += 1\n ret = bit_sum(bit, n) - bit_sum(bit, place) - (bit_sum(cnt, n) - bit_sum(cnt, place)) * item - subbed\n ans[place] = ret\n subbed += ret\nfor item in ans:\n print(item)", "n=int(input())\na=tuple(map(int,input().split()))\nb=[]\ns=[0]*n\nfor i in range(n):\n\tb.append((a[i],i))\nb.sort(reverse=True)\nb.append((0,0))\nMIN=10**9\nfor i in range(n):\n\tMIN=min(MIN,b[i][1])\n\ts[MIN]+=(i+1)*(b[i][0]-b[i+1][0])\nfor x in s:\n\tprint(x)", "N = int(input())\nA = [0] + list(map(int, input().split()))\n\n# \u5b9f\u4f53B\u3068\u5927\u304d\u3044\u9806\u306b\u30eb\u30fc\u30d7\u3092\u56de\u3057\u3066index\u3092\u53d6\u5f97\u3059\u308b\u305f\u3081\u3060\u3051\u306eC\nB = [[a, i, 1] for i, a in enumerate(A)]\nC = sorted(B, reverse=True)\n\n# \u81ea\u5206\u3088\u308a\u5de6\u5074\u3067\u6700\u5927\u3068\u306a\u308b\u5024\u3068\u4f4d\u7f6e\n# \u6700\u5927\u3068\u306a\u308b\u5024\u304c\u8907\u6570\u3042\u308b\u5834\u5408\u306f\u6700\u3082\u5de6\u306e\u3082\u306e\u3092\u63a1\u7528\na_max, idx = 0, 0 # [value, idx]\nleft_max = [[0, 0] for i in range(N+1)] # [value, idx]\nfor i, a in enumerate(A):\n left_max[i] = [a_max, idx]\n if a > a_max:\n a_max, idx = a, i\n\nans = [0] * (N+1)\nnext_i = C[0][1]\nfor _, i, _ in C: # index\u3060\u3051\u53d6\u5f97\n a, _, num = B[i] # \u5b9f\u4f53\u3092\u53d6\u5f97\u3001num\u306f\u53f3\u5074\u3067\u540c\u3058\u6570\u306b\u306a\u3063\u305f\u3068\u304d\u3001\u540c\u3058\u5c71\u3068\u898b\u306a\u3057\u3066\u8a08\u7b97\u91cf\u524a\u6e1b\n if i == next_i:\n next_a, next_i = left_max[i] # \u6b21\u306e\u6700\u5927\u5024\u3067\u3042\u308bnext_a\u306b\u306a\u308b\u307e\u3067\u306f\u3053\u306ei\u304cs\u306b\u8ffd\u52a0\u3055\u308c\u308b\n now_i = i\n ans[i] += (a - next_a) * num # \u5dee\u5206(a-next_a)\u3092num\u56de\u5206\u8ffd\u52a0\n B[next_i][2] += num # \u6b8b\u3063\u305f\u5206\u306fnext_i\u306e\u77f3\u304c\u6d88\u3055\u308c\u308b\u30bf\u30a4\u30df\u30f3\u30b0\u3067\u6d88\u3055\u308c\u308b\u306e\u3067\u307e\u3068\u3081\u308b\n else:\n ans[now_i] += (a - next_a) * num\n B[next_i][2] += num\n\nprint(*ans[1:], sep='\\n')", "def main():\n N,*A=map(int, open(0).read().split())\n L,C={},{}\n for i,a in enumerate(A):\n if a in C:\n C[a]+=1\n else:\n C[a]=1\n L[a]=i\n Z=[0]*N\n B=sorted(C,reverse=True)\n l=N-1\n cnt=0\n for b,c in zip(B,B[1:]+[0]):\n l=min(l,L[b])\n cnt+=C[b]\n Z[l]+=(b-c)*cnt\n print(*Z, sep=\"\\n\")\n\ndef __starting_point():\n main()\n__starting_point()", "# \u89e3\u8aacAC, add \u306e\u90e8\u5206\u3092\u81ea\u5206\u3067\u4f5c\u308c\u306a\u304b\u3063\u305f\n\n\ndef main():\n N = int(input())\n A = [int(i) for i in input().split()]\n B = [(a, i+1) for i, a in enumerate(A)]\n B.sort(reverse=True)\n B.append((0, 0))\n ans = [0]*(N+1)\n idx = N+1\n for i in range(N):\n add = (i+1)*(B[i][0] - B[i+1][0])\n idx = min(idx, B[i][1])\n ans[idx] += add\n print(*ans[1:], sep=\"\\n\")\n\n\ndef __starting_point():\n main()\n\n__starting_point()", "from collections import Counter\nn = int(input())\nA = tuple(map(int, input().split()))\nC = Counter(A)\nans = [0 for _ in range(n)]\nD = dict()\nS = set(A)\nif len(S) == 1:\n print((sum(A)))\n for _ in range(n - 1):\n print((0))\n return()\nX = sorted(S, reverse=True)\nfor i, x in enumerate(X):\n D[x] = i\n\nindex = [n + 1 for _ in range(len(S))]\nfor i, a in enumerate(A):\n index[D[a]] = min(index[D[a]], i)\n\ncnt = 0\nx = n + 1\n\nfor i in range(1, len(S)):\n tmp = X[i - 1]\n nxt = X[i]\n cnt += C[tmp]\n x = min(x, index[D[tmp]])\n ans[x] += (tmp - nxt) * cnt\n\nfor i, a in enumerate(A):\n if a != 0:\n cnt += C[nxt]\n ans[i] += nxt * cnt\n break\n\nfor a in ans:\n print(a)\n", "n = int(input())\na = list(map(int, input().split()))\n\nb = sorted([(i+1, a[i]) for i in range(n)], key=lambda x: -x[1])\nans = [0]*(n+1)\nm = float('inf')\nfor i in range(n-1):\n m = min(m, b[i][0])\n if b[i][1] == b[i+1][1]:\n continue\n ans[m] += (i+1)*(b[i][1]-b[i+1][1])\nans[1] += sum(a) - sum(ans)\nfor i in range(1, n+1):\n print(ans[i])", "from bisect import bisect_right, bisect_left\ninpl = lambda: list(map(int,input().split()))\nN = int(input())\nA = inpl()\nx = [-1]\ny = [0]\nfor i in range(N):\n if A[i] > y[-1]:\n x.append(i)\n y.append(A[i])\nans = [0] * N\nL = len(x)\nk = [0] * (L+1)\ni = N-1\nbase = y[-1]\nfor n in range(L-1,0,-1):\n roof = base\n base = y[n-1]\n height = roof - base\n k[n] += k[n+1]\n ans[x[n]] += k[n] * height\n while i >= x[n]:\n p = bisect_left(y, A[i])\n ans[x[p]] += A[i] - y[p-1]\n k[p-1] += 1\n i -= 1\nfor i in range(N):\n print((ans[i]))\n", "n = int(input())\na = list(map(int,input().split()))\n\nans = [0] * (n+1)\nd = dict()\nfor i,ai in enumerate(a,1):\n if(ai in d):\n d[ai][1] += 1\n else:\n d[ai] = [i,1]\nd[0] = [0,0]\n\na_unique = list(set(a))\na_unique.sort(reverse=True)\na_unique.append(0)\n\nfor i in range(len(a_unique)-1):\n num = a_unique[i]\n next = a_unique[i+1]\n head = d[num][0]\n ans[head] += (num-next) * d[num][1]\n\n d[next][0] = min(d[next][0],d[num][0])\n d[next][1] += d[num][1]\n\nprint('\\n'.join(map(str,ans[1:])))", "n = int(input())\na = list(map(int, input().split()))\n\ntmp = [[e, n - i] for i, e in enumerate(a)]\ntmp.sort(reverse=True)\n\naa = [[e, n - i] for e, i in tmp] + [[0, -1]]\n\nv_prev, i_prev = aa[0]\ni = 0\nans = [0] * n\nsm = 0\nwhile i < n:\n while aa[i][1] >= i_prev:\n sm += aa[i][0]\n i += 1\n\n ans[i_prev] += sm - aa[i][0] * i\n sm = aa[i][0] * i\n v_prev, i_prev = aa[i]\n\nprint(*ans, sep=\"\\n\")\n", "import typing\nimport sys\nimport math\nimport collections\nimport bisect\nimport itertools\nimport heapq\nimport decimal\nimport copy\nimport operator\n\n# sys.setrecursionlimit(10000001)\nINF = 10 ** 20\nMOD = 10 ** 9 + 7\n# MOD = 998244353\n\n# buffer.readline()\u306f\u3053\u3069\u3075\u3049\u3067\u6b7b\u306c\n\n\ndef ni(): return int(sys.stdin.readline())\ndef ns(): return list(map(int, sys.stdin.readline().split()))\ndef na(): return list(map(int, sys.stdin.readline().split()))\ndef na1(): return list([int(x)-1 for x in sys.stdin.readline().split()])\n\n\n# ===CODE===\n\ndef main():\n n = ni()\n ta = na()\n a = []\n for i, ai in enumerate(ta):\n a.append([ai, -i])\n a.sort(reverse=True)\n a.append([0, 0])\n cnt = [0 for _ in range(n)]\n\n idx = 0\n remain = a[0][0]\n minval = -a[0][1]\n while idx < n:\n while a[idx][0] == remain:\n idx += 1\n cnt[minval] += (remain-a[idx][0])*idx\n\n remain = a[idx][0]\n minval = min(minval, -a[idx][1])\n\n for c in cnt:\n print(c)\n\n\ndef __starting_point():\n main()\n\n__starting_point()", "n = int(input())\na = list(map(int, input().split()))\n\na = list(zip(a, range(len(a))))\na = sorted(a, reverse = True) + [(0, 0)]\n\nans = [0] * n\nmin_ind = 10**9\n\nfor i in range(n):\n tmp = a[i][0] - a[i+1][0]\n min_ind = min(min_ind, a[i][1])\n ans[min_ind] += (i+1) * tmp\n\nfor i in ans:\n print(i)", "n = int(input())\na = list(map(int,input().split()))\nl = []\nans = [0 for i in range(n)]\nfor i in range(n):\n l.append([a[i],i])\nl.sort(key=lambda x:x[1],reverse=True)\nl.sort(key=lambda x:x[0],reverse=True)\ncount = 1\ncount0 = 0\nb = l[0][0]\nc = l[0][1]\nfor i in range(1,n):\n if l[i][0] == b:\n count += 1\n c = min(c,l[i][1])\n else:\n ans[c] += (b-l[i][0])*count\n count += 1\n b = l[i][0]\n c = min(l[i][1],c)\nans[c] += b*count\nfor i in range(n):\n print(ans[i])", "import sys\ninput = sys.stdin.readline\nfrom bisect import bisect_left\n\nN = int(input())\nA = list(map(int, input().split()))\n\ndics = []\nq = []\nInd = []\nans = [0]*N\n\nfor i, a in enumerate(A):\n ia = bisect_left(q, a)\n if ia == len(q):\n Ind.append(i)\n q.append(a)\n dics.append({a:1})\n else:\n dic = dics[ia]\n if not a in dic.keys():\n dic[a] = 1\n else:\n dic[a] += 1\n\nL = len(q)\nfor l in reversed(range(L)):\n if l == 0:\n for k, v in dics[0].items():\n ans[Ind[0]] += k*v\n else:\n bef = q[l-1]\n for k, v in dics[l].items():\n ans[Ind[l]] += (k-bef)*v\n dics[l-1][bef] += v\n\nfor a in ans:\n print(a)", "# coding: utf-8\n# Your code here!\nimport sys\nread = sys.stdin.read\nreadline = sys.stdin.readline\n\nn,*a = map(int,read().split())\n\nres = [(0,-1)]+[(a[i],i) for i in range(n)]\nres.sort()\n\nans = [0]*n\nnum = 0\ncnt = 0\nmidx = idx = n-1\nv = res[-1][0]\n\n#print(res)\nwhile res:\n #print(num,cnt,idx)\n ans[midx] += (v-res[-1][0])*cnt\n v = res[-1][0]\n\n while res and res[-1][0]==v:\n ai,idx = res.pop() \n cnt += 1\n midx = min(midx,idx)\n\nprint(*ans,sep=\"\\n\")\n\n\n\n\n\n", "'''\n\u81ea\u5b85\u7528PC\u3067\u306e\u89e3\u7b54\n'''\nimport math\n#import numpy as np\nimport itertools\nimport queue\nimport bisect\nfrom collections import deque,defaultdict\nimport heapq as hpq\nfrom sys import stdin,setrecursionlimit\n#from scipy.sparse.csgraph import dijkstra\n#from scipy.sparse import csr_matrix\nipt = stdin.readline\nsetrecursionlimit(10**7)\nmod = 10**9+7 #998244353\ndir = [(-1,0),(0,-1),(1,0),(0,1)]\nalp = \"abcdefghijklmnopqrstuvwxyz\"\n\ndef main():\n n = int(ipt())\n ans = [0]*n\n a = [int(i) for i in ipt().split()]\n cts = [(a[0],0)]\n d = defaultdict(int)\n d[a[0]] = 1\n tot = a[0]\n for i,ai in enumerate(a[1::]):\n tot += ai\n d[ai] += 1\n if cts[-1][0] < ai:\n cts.append((ai,i+1))\n\n# print(d,cts)\n nms = sorted(list(d.keys()),reverse=True)\n lc = len(cts)-1\n na = cts[lc][0]\n ps = cts[lc][1]\n sm = 0\n for i in nms:\n sm += d[i]\n if i == na:\n lc -= 1\n na = cts[lc][0]\n ans[ps] += sm*(i-na)\n pps = ps\n ps = cts[lc][1]\n else:\n ans[pps] += d[i]*(i-na)\n# print(ans)\n\n ans[0] = tot-sum(ans[1::])\n\n for i in ans:\n print(i)\n\n\n\n return None\n\ndef __starting_point():\n main()\n\n__starting_point()", "def getN():\n return int(input())\ndef getNM():\n return list(map(int, input().split()))\ndef getList():\n return list(map(int, input().split()))\n\nfrom collections import defaultdict, deque\nimport math\nimport copy\nfrom bisect import bisect_left, bisect_right\nimport heapq\nimport sys\n# sys.setrecursionlimit(1000000)\nINF = 10 ** 17\nMOD = 10 ** 9 + 7\ndef mint(lis):\n return list(map(int, lis))\n\ndef bifind(arr_sorted, x):\n idx = bisect_left(arr_sorted, x)\n if idx == len(arr_sorted):\n return False\n if arr_sorted[idx] == x:\n return True\n else:\n return False\ndef getyaku(n):\n ret = []\n for i in range(1, int(math.sqrt(n) + 1)):\n if n % i == 0:\n ret.append(i)\n ret.append(n // i)\n\n return ret\n\ndef find(x, a):\n idx = bisect_left(a, x)\n if idx == len(a):\n return False\n if a[idx] == x:\n return True\n else:\n return False\n\ndef main():\n n = getN()\n nums = getList()\n nums = [(x, i+1) for i, x in enumerate(nums)]\n nums.append((0, INF))\n nums.sort(key=lambda x: -x[0] * INF + x[1])\n # print(nums)\n mx = INF\n ans = [0 for i in range(n+1)]\n tmp_tgt = INF\n through = 0\n for a,b in nums:\n if a != mx:\n diff = mx - a\n\n\n\n if mx != INF:\n ans[tmp_tgt] += through * diff\n mx = a\n if b < tmp_tgt:\n tmp_tgt = b\n through += 1\n for an in ans[1:]:\n print(an)\n\ndef __starting_point():\n main()\n\n\n__starting_point()", "N = int(input())\nA = [int(a) for a in input().split()]\n\nS = sum(A)\nfor i in range(N):\n A[i] = [A[i], i+1]\n\nA.sort(reverse=True)\nans = [0]*(N+1)\ni = 0\nnum = N+1\nwhile i < N-1:\n num = min(num, A[i][1])\n while i < N-1 and A[i][0] == A[i+1][0]:\n num = min(num, A[i+1][1])\n i += 1\n if i == N-1:\n break\n ans[num] += (i+1)*(A[i][0]-A[i+1][0])\n i += 1\n\nans[1] += S-sum(ans)\nfor i in range(1, N+1):\n print(ans[i])", "N = int(input())\nA = list(map(int, input().split()))\n\n# \u73fe\u5728\u672b\u5c3e\u306b\u8ffd\u52a0\u3055\u308c\u308b\u5c71\u3088\u308a\u82e5\u3044\u5c71\u3067\uff0c\u6700\u3082\u500b\u6570\u306e\u5927\u304d\u3044\u3082\u306e\u304c\u6b21\u306e\u5c71\u306b\u306a\u308b\n# \u4ed6\u306e\u5c71\u3092\u6b21\u306e\u5c71\u306e\u500b\u6570\u4ee5\u4e0b\u307e\u3067\u6e1b\u3089\u3059\n\nans = [0] * N\n\nnumList = [(a, i) for i, a in enumerate(A)]\nnumList.sort(reverse=True)\nnumList.append((0, 0))\n\ny = float('inf')\nfor c, (a, i) in enumerate(numList[: N], start=1):\n y = min(y, i)\n ans[y] += c * (a - numList[c][0])\n\nprint(*ans, sep='\\n')", "from heapq import heapify, heappop\n\nN = int(input())\nA = list(map(int, input().split()))\n\nque = [(-a, i + 1) for i, a in enumerate(A)]\nheapify(que)\n\nans = [0] * (N + 1)\ncnt = 0\nwhile que:\n a, now = heappop(que)\n cnt += 1\n ans[now] = -a * cnt\n\n while que and que[0][1] > now:\n a, _ = heappop(que)\n ans[now] += -a\n cnt += 1\n\n if que:\n ans[now] -= -que[0][0] * cnt\n\nprint(*ans[1:], sep='\\n')\n", "n = int(input())\na = [[int(i), j] for j, i in enumerate(input().split())]\na.sort(reverse=1)\na.append([0, n-1])\nans = [0] * n\n\nj = n-1\nfor i in range(n):\n j = min(j, a[i][1])\n ans[j] += (i+1) * (a[i][0] - a[i + 1][0])\nprint((\"\\n\".join(map(str, ans))))\n", "import collections\nimport heapq\nn=int(input())\nA=[int(i) for i in input().split()]\nAns=[0]*n\nM=[0]\nfor i in range(n):\n M.append(max(M[-1],A[i]))\nD=collections.defaultdict(int)\nH=[]\nfor i in range(n):\n j=n-1-i\n if A[j]<=M[j]:\n heapq.heappush(H,-A[j])\n else:\n Ans[j]=(A[j]-M[j])*(D[A[j]]+1)\n D[M[j]]+=D[A[j]]+1\n ct=0\n while H:\n a=heapq.heappop(H)\n a=-a\n if a<=M[j]:\n heapq.heappush(H,-a)\n break\n else:\n Ans[j]+=a-M[j]\n D[M[j]]+=1\n\nfor a in Ans:\n print(a)\n", "\n\"\"\"\n\n\u77f3\u306e\u6570\u304c\u6700\u5927\u306e\u5185\u6570\u5b57\u304c\u5927\u304d\u3044\u3082\u306e\u304b\u3089\u53d6\u308a\u9664\u3044\u3066\u3044\u304f\u306e\u304c\u6700\u9069\uff1f\n\n\u524d\u306b\u3042\u308b\u3067\u304d\u308b\u3060\u3051\u6570\u304c\u591a\u3044\u3082\u306e\u306b\u8b72\u3063\u3066\u3044\u304f\n\n\u512a\u5148\u5ea6\u4ed8\u304d\u30ad\u30e5\u30fc\u3067a\u304c\u5927\u304d\u3044\u65b9\u304b\u3089pop\u3057\u3066\u3044\u304f\uff1f\n\nnum\u304c\u73fe\u5728\u3088\u308a\u5c0f\u3055\u3044\u2192\u4ee5\u964d\u3059\u308b\n\u305d\u3046\u3067\u306a\u3044 = \u73fe\u5728\u306enum\u3088\u308a\u306f\u4f4e\u3044\u304c\u6b21\u306enum\u3088\u308a\u306f\u5927\u304d\u3044\n\u2192\u6b21\u306enum\u304c\u78ba\u5b9a\u3057\u305f\u77ac\u9593\u306b\u5dee\u5206\u3092\u8a08\u7b97\u3057\u3066\u5b9a\u5e38\u6e1b\u5c11\u7528\u306b\u5165\u308c\u308b\n\n\u6700\u5f8c\u306f\u6b8b\u308a\u3092\u5168\u90e81\u306b\u5165\u308c\u3066\u7d42\u308f\u308a\n\"\"\"\nimport heapq\n\nN = int(input())\n\nans = [0] * N\n\na = list(map(int,input().split()))\n\nq = []\n\nfor i,na in enumerate(a):\n\n heapq.heappush(q,[-1 * na , i])\n\nnowa , nowi = heapq.heappop(q)\nnowa *= -1\nalways = 0\ntempq = [nowa]\n\nfor i in range(N-1):\n\n nexa , nexi = heapq.heappop(q)\n nexa *= -1\n\n if nexi > nowi:\n tempq.append(nexa)\n\n else:\n nowpl = always * (nowa - nexa)\n\n for j in tempq:\n nowpl += j - nexa\n\n always += len(tempq)\n tempq = [nexa]\n\n ans[nowi] += nowpl\n\n nowa = nexa\n nowi = nexi\n\nans[0] = sum(a) - sum(ans)\n\nprint (\"\\n\".join(map(str,ans)))", "import copy\n\nN = int(input())\nA = list(map(int,input().split()))\nB = copy.copy(A)\nB.sort()\n\nplace_dict = {0:0}\nnum_list = []\nct_dict = {}\ni = 1\nfor b in B:\n if b not in place_dict:\n place_dict[b] = i\n num_list.append(b)\n ct_dict[b] = 1\n i += 1\n else:\n ct_dict[b] += 1\n\ntmp = 0\ntasks = [(0,0)]\ni = 0\nfor a in A:\n i += 1\n if tmp < a:\n tmp = a\n tasks.append((a,i))\n \n#\u672c\u51e6\u7406\nM = len(num_list)\n#print(num_list)\nans = [0 for _ in range(N)]\nj = M-1\nct_abv = 0\n#print(ct_dict)\n#print(tasks)\nfor i in range(len(tasks)-1,0,-1):\n tmp = 0\n nxt = tasks[i-1][0]\n while num_list[j] > nxt and j >= 0:\n ct_abv += ct_dict[num_list[j]]\n if j == 0:\n tmp += ct_abv * num_list[0]\n else:\n tmp += ct_abv * (num_list[j] - num_list[j-1])\n j -= 1\n ans[tasks[i][1]-1] = tmp\n #print(i,j,num_list[j],ct_abv)\n \nprint(*ans, sep = \"\\n\")", "N = int(input())\nA = list(map(int,input().split()))\nD = []\nfor id,a in enumerate(A):\n D.append([a,id])\nD = sorted(D)[::-1]\nD.append([0,0])\n#Cumsum = [0]\n#for i in D[::-1]:\n# Cumsum.append(i[0]+Cumsum[-1])\n#Cumsum = Cumsum[::-1]\n#print(Cumsum)\ncnt = [0] * N\nminid = D[0][1]\nfor i in range(N):\n d = D[i][0] - D[i+1][0]\n cnt[minid] += d * (i + 1)\n if D[i+1][1] < minid:\n minid = D[i+1][1]\nfor i in range(N):\n print((cnt[i]))\n\n", "import sys\ninput = sys.stdin.readline\nfrom itertools import accumulate\nN = int(input())\nA = list(map(int,input().split()))\n\ninf = 10**10\n\nS = [0] + sorted(list(set(A)))\ndic = {s:inf for s in S}\ncnt = {s:0 for s in S}\nsm = {s:0 for s in S}\nml = [0]\nfor i, a in enumerate(A):\n if ml[-1] < a:\n ml.append(a)\n dic[a] = min(i,dic[a])\n cnt[a] += 1\n sm[a] += a\n\nfor ps, s in zip(S[:-1][::-1],S[::-1]):\n cnt[ps] += cnt[s]\n sm[ps] += sm[s]\n\nans = [0]*N\ntemp = {s:sm[s] - s*cnt[s] for s in S}\n\nfor ps, s in zip(ml[:-1][::-1],ml[::-1]):\n ans[dic[s]] = temp[ps] - temp[s]\n\n[print(a) for a in ans]\n", "from bisect import bisect_left, bisect_right\n\nN = int(input())\nAs = list(map(int, input().split()))\n\nBs = [0]\nxs = [-1]\nfor i, A in enumerate(As):\n if Bs[-1] < A:\n Bs.append(A)\n xs.append(i)\n\nlenB = len(Bs)\nsumAs = [0] * lenB\nnumFulls = [0] * lenB\nfor A in As:\n i = bisect_left(Bs, A)\n sumAs[i] += A - Bs[i-1]\n numFulls[i-1] += 1\n\nfor i in reversed(list(range(lenB-1))):\n numFulls[i] += numFulls[i+1]\n\nanss = [0] * N\nfor i in range(1, lenB):\n ans = sumAs[i]\n ans += (Bs[i]-Bs[i-1]) * numFulls[i]\n anss[xs[i]] = ans\n\nprint(('\\n'.join(map(str, anss))))\n", "\nimport sys\nfrom collections import deque, defaultdict\nimport copy\nimport bisect\nsys.setrecursionlimit(10 ** 9)\nimport math\nimport heapq\nfrom itertools import product, permutations,combinations\nimport fractions\n\nimport sys\ndef input():\n\treturn sys.stdin.readline().strip()\n\nN = int(input())\na = list(map(int, input().split()))\n\ntop_list = [0]\n\n\nfor i in range(1, N):\n\n\tif a[i] > a[top_list[-1]]:\n\t\ttop_list.append(i)\n\nnum_list = [0]*N\ncom = []\nfor i in range(len(top_list)):\n\tcom.append(a[top_list[i]])\ncom.sort()\n\nfor i in range(N - 1, top_list[-1], -1):\n\tcom.append(a[i])\ncom.sort()\n\nstock = 0\n#print(com, top_list, num_list)\nfor top in range(len(top_list) - 2, -1, -1):\n\tif top_list[top + 1] - top_list[top] > 10000:\n\t\tfor i in range(top_list[top + 1] - 1, top_list[top], -1):\n\t\t\t#bisect.insort(com, a[i])\n\t\t\tcom.append(a[i])\n\t\tcom.sort()\n\telse:\n\t\tfor i in range(top_list[top + 1] - 1, top_list[top], -1):\n\t\t\tbisect.insort(com, a[i])\n\n\tjudge = 0\n\ttotal = stock*(a[top_list[top + 1]] - a[top_list[top]])\n\t#print(total, (a[top_list[top + 1]] - a[top_list[top]])*stock, top)\n\twhile judge == 0:\n\t\tx = com.pop()\n\t\tif x > a[top_list[top]]:\n\t\t\ttotal += x - a[top_list[top]]\n\t\t\tstock += 1\n\t\telse:\n\t\t\tbisect.insort(com, x)\n\t\t\tjudge = 1\n\tnum_list[top_list[top + 1]] = total\n\t#print(com, top_list, num_list, stock)\n\n\nnum_list[top_list[0]] = sum(a) - sum(num_list)\nfor i in range(N):\n\tprint((num_list[i]))\n\n\n", "import bisect\n\nN = int(input())\na = list(map(int, input().split()))\n\nbig_list = []\nnum_list = []\nbiggest = 0\nfor i, a_i in enumerate(a):\n if a_i > biggest:\n big_list.append(a_i)\n num_list.append(i)\n biggest = a_i\nbig_list.append(10 ** 10)\nbig_list.append(0)\nnum_list.append(0)\nnum_list.append(0)\n\nans = [0] * N\na.sort()\nj = 0\nfor i, a_i in enumerate(a):\n if a_i < big_list[j]:\n ans[num_list[j]] += a_i - big_list[j - 1]\n else:\n ans[num_list[j]] += (big_list[j] - big_list[j - 1]) * (N - i)\n j += 1\nfor i in range(N):\n print((ans[i]))\n", "def main():\n n=int(input())\n a=list(map(int,input().split()))\n d={0:[-1]}\n for j,i in enumerate(a):\n if i in d.keys():d[i].append(j)\n else:d[i]=[j]\n d=sorted([[i,min(j),len(j)] for i,j in d.items()],reverse=True)\n ans=[0]*n\n l=0\n m=n\n for k in range(len(d)-1):\n x,y,z=d[k]\n l+=z\n m=min(m,y)\n ans[m]+=(x-d[k+1][0])*l\n for i in ans:\n print(i)\nmain()", "import os\nimport sys\n\nif os.getenv(\"LOCAL\"):\n sys.stdin = open(\"_in.txt\", \"r\")\n\nsys.setrecursionlimit(2147483647)\nINF = float(\"inf\")\nIINF = 10 ** 18\nMOD = 10 ** 9 + 7\n\nN = int(sys.stdin.readline())\nA = list(map(int, sys.stdin.readline().split()))\n\nXY = [(a, i) for i, a in enumerate(A)]\nXY.sort(reverse=True)\n\n# \u89e3\u8aac\nans = [0] * N\nmin_y = IINF\nfor i, (x, y) in enumerate(XY):\n min_y = min(min_y, y)\n x2 = XY[i + 1][0] if i + 1 < N else 0\n ans[min_y] += (x - x2) * (i + 1)\nprint(*ans, sep='\\n')\n", "def main(n,a):\n ret=[0]*n\n d={}\n for i,x in enumerate(a):\n if x in d:\n d[x].append(i)\n else:\n d[x]=[i]\n v=sorted(list(d.keys()),reverse=True)\n cnt_idx=0\n min_idx=n+1\n for i,x in enumerate(v):\n cnt_idx+=len(d[x])\n min_idx=min(min_idx,d[x][0])\n nx=0\n if i<len(v)-1:nx=v[i+1]\n ret[min_idx]+=cnt_idx*(x-nx)\n return ret\n\nn=int(input())\na=list(map(int,input().split()))\nprint(*main(n,a),sep='\\n')\n", "from collections import defaultdict\n\nN = int(input())\n*a, = list(map(int, input().split()))\n\ncnt = defaultdict(int)\npos = defaultdict(lambda :10**12)\nans = defaultdict(int)\n\nfor i, j in enumerate(a, start=1):\n pos[j] = min(pos[j], i)\n cnt[j] += 1\n\ntarget = [list(i) for i in sorted(pos.items())][::-1]\nsize = len(target)\n\nfor i in range(len(target)-1):\n a, b = target[i]\n c, d = target[i+1]\n ans[b] += cnt[a]*(a-c)\n cnt[c] += cnt[a]\n cnt[a] = 0\n target[i+1][1] = min(target[i+1][1], b)\n\na = target[-1][0]\nans[1] += cnt[a]*a\nfor i in range(1, N+1):\n print((ans[i]))\n", "N, = list(map(int, input().split()))\nX = list(map(int, input().split()))\nY = []\nfor i in range(N):\n Y.append((X[i], -i))\n\nsx = []\nc = 0\nd = dict()\nfor x in sorted(list(set(X))):\n sx.append(x)\n d[x] = c\n c += 1\nsx.append(10**18)\n\ncount = [0]*(c+1)\nfor x in X:\n count[d[x]] += 1\nfor i in range(c-1, -1, -1):\n count[i] += count[i+1]\n\ncount2 = [0]*(c+1)\nfor i in range(c-1, -1, -1):\n count2[i] = count[i+1]*(sx[i+1]-sx[i])\nfor i in range(c-1, -1, -1):\n count2[i] += count2[i+1]\n\n\n\nY.sort()\nR = []\nwhile Y:\n y, j = Y.pop()\n if not R:\n R.append((y, -j))\n else:\n# print(y, j, R[-1])\n if y < R[-1][0] and -j < R[-1][1]:\n R.append((y, -j))\n\n\n\n#print(count2)\n#print(R)\nRR = [0]*N\nb = 0\nbi = 0\nfor y, i in R[:]:\n# print(y, d[y], i, bi)\n# print(i, bi, count2[d[y]])\n\n RR[bi] = count2[d[y]]-b\n b = count2[d[y]]\n bi = i\nRR[0] = sum(X)-sum(RR[1:])\nfor r in RR:\n print(r)\n", "n = int(input())\na = list(map(int, input().split()))\nl = [(x,i) for i,x in enumerate(a)]\nl.sort(reverse=True)\nl += [(0,n)]\ng = [0]*n\nm = n\nfor i in range(n):\n s = l[i][1]\n if m > s: m = s\n g[m] += (l[i][0]-l[i+1][0])*(i+1)\nfor x in g: print(x)", "n = int(input())\na = list(map(int, input().split()))\nb = [[a[i], i] for i in range(n)]\nb.sort(reverse = True)\nd = {}\ndcnt = {}\nfor i in range(n):\n if not a[i] in d:\n d[a[i]] = i\n dcnt[a[i]] = 1\n else:\n dcnt[a[i]] = dcnt[a[i]] + 1\nb = [[0, 0] for _ in range(len(d) + 1)]\nk = 0\nfor i, j in d.items():\n b[k][0], b[k][1] = i, j\n k += 1\nb.sort(reverse = True)\nans = [0] * n\nj = b[0][1]\ncnt = 0\nfor i in range(len(d)):\n cnt += dcnt[b[i][0]]\n j = min(j, b[i][1])\n ans[j] += (b[i][0] - b[i + 1][0]) * cnt\nfor i in ans:\n print(i)", "n = int(input())\nA = list(map(int, input().split()))\n\nfrom collections import defaultdict\nd = defaultdict(lambda: (n, 0))\nfor i, a in enumerate(A):\n min_id, cnt = d[a]\n d[a] = (min(min_id, i), cnt+1)\n\nB = list(d.items())\nB.sort()\n\n#print(B)\n\nans = [0]*n\nwhile True:\n a1, (m1, c1) = B.pop()\n if not B:\n ans[m1] += c1*a1\n break\n a2, (m2, c2) = B[-1]\n ans[m1] += c1*(a1-a2)\n B[-1] = (a2, (min(m1, m2), c1+c2))\n\nprint(*ans, sep='\\n')", "import sys\nfrom collections import defaultdict as dd\ninput = sys.stdin.readline\nN = int(input())\na = list(map(int, input().split()))\nd = dd(int)\nl = dd(lambda: N + 1)\nfor i in range(N):\n d[a[i]] += 1\n l[a[i]] = min(l[a[i]], i + 1)\n\n#print(d, l)\nks = sorted(d.keys(), reverse = True)\nres = [0] * (N + 1)\nfor i in range(len(ks) - 1):\n t = ks[i] - ks[i + 1]\n k = ks[i]\n res[l[k]] += d[k] * t\n d[ks[i + 1]] += d[k]\n l[ks[i + 1]] = min(l[ks[i + 1]], l[k])\nres[1] += d[ks[-1]] * ks[-1]\nfor r in res[1: ]: print(r)", "N = int(input())\nA = [int(a) for a in input().split()]\n\nans = [0]*N\nnum = 0\nB = sorted(A)\nj = 0\nfor i in range(N):\n cnt = 0\n while j < N and B[j] <= A[i]:\n cnt += max(0, B[j]-num)\n j += 1\n ans[i] = cnt + max(0, (N-j)*(A[i]-num))\n num = max(num, A[i])\n\nfor a in ans:\n print(a)", "import sys\n\ndef solve():\n input = sys.stdin.readline\n N = int(input())\n A = [int(a) for a in input().split()]\n nDict = dict()\n Atype = list(set(A))\n Atype.sort(reverse = True)\n Atype.append(0)\n for i, a in enumerate(A):\n if a in nDict: nDict[a].append(i)\n else: nDict[a] = [i]\n count = [0] * N\n minIndex = N\n group = 0\n for i in range(len(Atype) - 1):\n cN = Atype[i]\n minIndex = min(minIndex, nDict[cN][0])\n group += len(nDict[cN])\n nextN = Atype[i + 1]\n count[minIndex] += (cN - nextN) * group\n print(\"\\n\".join(map(str, count)))\n\n return 0\n\ndef __starting_point():\n solve()\n__starting_point()", "N = int(input())\nAs = list(map(int, input().split()))\n\nsorted_iAs = sorted(map(tuple, enumerate(As)), key = lambda t: (t[1], t[0]), reverse = True)\n\n#if As = 1 2 1 3 2 4 2 5 8 1\n#then sorted_iAs is:\n# i | 8 7 5 3 6 4 1 9 2 0\n# A | 8 5 4 3 2 2 2 1 1 1\n#I'll look at:\n# x x x x x x\n#where the next A decreases (or doesn't exist).\n\nans = [0] * N\nyoungest_index = 10 ** 9\nfor index, (original_index, A) in enumerate(sorted_iAs):\n youngest_index = min(original_index, youngest_index)\n if index == N - 1:\n ans[youngest_index] += A * (index + 1)\n elif sorted_iAs[index + 1][1] < A:\n next_A = sorted_iAs[index + 1][1]\n ans[youngest_index] += (A - next_A) * (index + 1)\n\nprint(*ans, sep = '\\n')", "from bisect import bisect_right\n\nn = int(input())\na = list(map(int, input().split()))\n\nli = [[0, -1]]\nfor i, e in enumerate(a):\n if e > li[-1][0]:\n li.append([e, i])\n\nli = li[::-1]\n\na.sort()\nacc = [0] * (n + 1)\nfor i in range(n - 1, -1, -1):\n acc[i] = acc[i+1] + a[i]\n\nans = [0] * n\nsub = 0\nans_prev = 0\nfor (ep, ip), (e, i) in zip(li, li[1:]):\n j = bisect_right(a, e)\n ans[ip] = acc[j] - e * (n - j)\n\ni_prev = 0\nfor i in range(1, n):\n if ans[i]:\n ans[i_prev] -= ans[i]\n i_prev = i\n\nprint(*ans, sep=\"\\n\")\n", "# coding: utf-8\nimport sys\nfrom bisect import bisect_left, bisect_right, insort\n\nsr = lambda: sys.stdin.readline().rstrip()\nir = lambda: int(sr())\nlr = lambda: list(map(int, sr().split()))\n\n\"\"\" \n\u5de6\u5074\u3067\u81ea\u5206\u3088\u308a\u5c0f\u3055\u3044\u6570\u5b57\u3068\u306e\u5dee\n\u53f3\u5074\u3067\u81ea\u5206\u3088\u308a\u5927\u304d\u3044\u6570\u5b57\u306e\u6570\n\u77f3\u6570\u6700\u5927\u306e\u5c71\u3067\u53f3\u306e\u7269\u304b\u3089\u53d6\u308a\u9664\u304f\n\"\"\"\nN = ir()\nA = lr()\nA = [(x, i+1) for i, x in enumerate(A)] + [(0, 0)]\nA.sort(reverse=True)\nanswer = [0] * (N+1) # 1-indexed\nmi = 10 ** 10\nmi_index = 10 ** 10\nfor i, (x, j) in enumerate(A[:-1]):\n diff = A[i][0] - A[i+1][0]\n index = A[i][1]\n if index < mi_index:\n mi_index = index\n answer[mi_index] += diff * (i+1)\n\nprint(('\\n'.join(map(str, answer[1:]))))\n", "class BIT:\n def __init__(self, n):\n self.N = n+1\n self.bit = [0]*self.N\n \n def bit_sum(self, i):\n s = 0\n i += 1\n while i>0:\n s += self.bit[i]\n i -= i & -i\n return s\n\n def bit_add(self, i, n):\n i += 1\n while i<self.N:\n self.bit[i] += n\n i += i & -i\n\nN, *A = list(map(int, open(0).read().split()))\ninf = [(a,i) for i, a in enumerate(A)]\nn = A[0]\nls = [0]\nfor i in range(1,N):\n if A[i]>n:\n n = A[i]\n ls.append(i)\nB = BIT(N)\nC = BIT(N)\ninf.sort(reverse=True)\ncnt = [0]*N\nccnt = [0]*N\nfor a,i in inf:\n B.bit_add(i,a)\n cnt[i] = B.bit_sum(N-1)-B.bit_sum(i)\nfor a, i in inf:\n C.bit_add(i,1)\n ccnt[i] = C.bit_sum(N-1)-C.bit_sum(i)\n\nans = [0]*N\ns = sum(A)\np = 0\nx = 0\nfor i in range(len(ls)-1,0,-1):\n a = ls[i]\n b = ls[i-1]\n m = cnt[b]-A[b]*ccnt[b]\n n = m-x\n ans[a] = n\n s -= n\n x += ans[a]\nans[0] = s\nprint(('\\n'.join(map(str,ans))))\n", "N = int(input())\na = list(map(int, input().split()))\nD = []\nfor i in range(N):\n D.append((a[i], i))\nD.append((0, -1))\nD.sort(reverse=True)\nans = [0] * N\nmi = float('inf')\nfor i in range(N):\n mi = min(mi, D[i][1])\n ans[mi] += (D[i][0] - D[i + 1][0]) * (i + 1)\n\nfor i in ans:\n print(i)", "def main():\n n = int(input())\n a = list(map(int, input().split()))\n ans = [0]*n\n b = [v for v in a]\n b.append(0)\n b.sort()\n dic = {}\n cnt = []\n num = []\n for v in b:\n if v in dic:\n cnt[dic[v]] += 1\n else:\n p = len(cnt)\n cnt.append(1)\n dic[v] = p\n num.append(v)\n min_idx = [n]*len(cnt)\n for i, v in enumerate(a):\n if min_idx[dic[v]] > i:\n min_idx[dic[v]] = i\n for i in reversed(range(1, len(cnt))):\n dif = num[i] - num[i-1]\n ans[min_idx[i]] += dif * cnt[i]\n if min_idx[i-1] > min_idx[i]:\n min_idx[i-1] = min_idx[i]\n cnt[i-1] += cnt[i]\n for v in ans:\n print(v)\n\ndef __starting_point():\n main()\n__starting_point()", "import sys\ninput = sys.stdin.readline\n\nn = int(input())\nA = list(map(int,input().split()))\n\nB = [[A[i], i] for i in range(n)]\nB.sort(key=lambda x:x[1])\nB.sort(key=lambda x:x[0], reverse=True)\nB.append([0, 0])\n\nANS = [0] * n\nind = n+1\nm = 0\nfor i in range(n):\n if B[i][1] < ind:\n ind = B[i][1]\n m += 1\n ANS[ind] += m * (B[i][0]-B[i+1][0])\n\nfor i in ANS:\n print(i)", "n = int(input())\nA = list(map(int,input().split()))\n\nparent = [(0,-1)]\nnow = 0\nfor i,a in enumerate(A):\n if now < a:\n parent.append((a,i))\n now = a\nA.sort()\nans = [0]*n\ncnt = 0\np = parent[-1][1]\nfor a in A[::-1]:\n if parent[-1][0] >= a:\n p = parent[-1][1]\n ans[p] += cnt*(parent[-1][0] - parent[-2][0])\n parent.pop()\n if parent[-1][0] < a:\n cnt += 1\n ans[p] += a - parent[-1][0]\nprint(('\\n'.join(str(i) for i in ans)))\n", "n = int(input())\nA = list(map(int, input().split()))\n\nfrom collections import defaultdict\nd = defaultdict(lambda: (n, 0))\nfor i, a in enumerate(A):\n min_id, cnt = d[a]\n d[a] = (min(min_id, i), cnt+1)\n\nB = list(d.items())\nB.sort()\n\n#print(B)\n\nans = [0]*n\nwhile True:\n a1, (m1, c1) = B.pop()\n if not B:\n ans[m1] += c1*a1\n break\n a2, (m2, c2) = B[-1]\n ans[m1] += c1*(a1-a2)\n B[-1] = (a2, (min(m1, m2), c1+c2))\n\nprint(*ans, sep='\\n')", "#1\u306f\u4e00\u610f\n#2\u306f\u5c0f\u3055\u3044\u756a\u53f7\u306e\u77f3\u306e\u6570\u304c\u5927\u304d\u304f\u306a\u308b\u3088\u3046\u306b\u3001\u5927\u304d\u3044\u756a\u53f7\u306e\u77f3\u3092\u9664\u304d\u305f\u3044\n\n#\u500b\u6570\u304c\u540c\u9806\u306e\u3082\u306e\u3092\u3001\u756a\u53f7\u5c0f\u4ee5\u5916\u304c\u500b\u6570\u304c\u6642\u70b9\u306b\u306a\u308b\u307e\u3067\u9664\u3044\u3066\u304b\u3089\u3001\u756a\u53f7\u5c11\u3092\u9664\u304f\nn = int(input())\na = list(map(int, input().split( )))\n\ncnt = {}#key\u306f\u500b\u6570\u3001\u8981\u7d20\u306f\u6700\u5c0f\u756a\u53f7\n\nfor i in range(n):\n if a[i] in cnt:\n cnt[a[i]][0] = min(cnt[a[i]][0],i)\n cnt[a[i]][1]+=1\n else:\n cnt[a[i]] = [i,1]\n\n#\u500b\u6570\u3001\u6700\u5c0f\u756a\u53f7\u3001\u756a\u53f7\u306e\u6570 \nmins = [[k,cnt[k][0],cnt[k][1]] for k in cnt]\nmins.append([0,0,0])\n#\u672b\u7aef\u51e6\u7406\u306b\u306a\u3063\u3066\u3044\u306a\u3044\nmins.sort(reverse = True)\n#print(mins)\nans = [0]*n\n\nfor i in range(len(mins)-1):\n k,cntk,l = mins[i][0],mins[i][1],mins[i][2]\n ans[cntk] += (k-mins[i+1][0])*l\n mins[i+1][2]+=l###=\u3058\u3083\u304a\u304b\u3057\u3044\n if mins[i+1][1]>mins[i][1]:##\u8ffd\u52a0\n mins[i+1][1] = mins[i][1]\n#ans[mins[-1][1]]=n*mins[-1][0]\n\nfor ai in ans:\n print(ai)\n \n\n\n\n", "n = int(input())\na = list(map(int,input().split()))\nl = [0]\nind = [-1]\nfor i in range(n):\n if a[i] > l[-1]:\n l.append(a[i])\n ind.append(i)\nc1 = [0]*(len(l)+1)\nc2 = [0]*(len(l)+1)\nc1[0] = n\na.sort()\nnow = 0\nfor i in a:\n while now < len(l) and l[now] <= i:\n now += 1\n c1[now] -= 1\n c2[now-1] += i-l[now-1]\nans = [0]*n\nfor i in range(1,len(l)):\n c1[i] += c1[i-1]\n count = (l[i]-l[i-1])*c1[i]+c2[i-1]\n ans[ind[i]] = count\n\nfor i in ans:\n print(i)\n", "import bisect\n\nN=int(input())\nA=list(map(int,input().split()))\n\ninc=[[A[0],0]]\nfor i in range(1,N):\n if A[i]>inc[-1][0]:\n inc.append([A[i],i])\n\nn=len(inc)\ntest=inc[:n-1]\nquery=[[] for i in range(n)]\nfor i in range(0,N):\n r=bisect.bisect_left(test,[A[i],i])\n query[r].append(A[i])\n\nans=[0 for i in range(N)]\ncount=0\nfor i in range(n-1,0,-1):\n fr=inc[i][0]\n to=inc[i-1][0]\n val=count*(fr-to)+sum(query[i])-to*len(query[i])\n ans[inc[i][1]]=val\n count+=len(query[i])\n\nfr=inc[0][0]\nto=0\nval=count*(fr-to)+sum(query[0])-to*len(query[0])\nans[0]=val\n\nfor i in range(N):\n print(ans[i])", "N = int(input())\nA = list(map(int, input().split()))\nd=dict()\nfor i, a in enumerate(A):\n j, cnt = d.get(a,(N,0))\n d[a] = min(i,j), cnt+1\nP=[]\nfor k, v in d.items():\n P.append((k,v[0],v[1]))\nP.sort(key=lambda x:x[0],reverse=True)\nres=[0]*N\ncnt=0\nk=N-1\nfor i in range(len(P)-1):\n A0, i0, cnt0 = P[i]\n A1, i1, cnt1 = P[i+1]\n k = min(k,i0)\n cnt += cnt0\n res[k]+=(A0-A1)*cnt\nA1, i1, cnt1 = P[-1]\nres[min(i1,k)]+=A1*(cnt+cnt1)\nprint(*res,sep=\"\\n\")", "# -*- coding: utf-8 -*-\n\nimport sys\nfrom collections import Counter\n\ndef input(): return sys.stdin.readline().strip()\ndef list2d(a, b, c): return [[c] * b for i in range(a)]\ndef list3d(a, b, c, d): return [[[d] * c for j in range(b)] for i in range(a)]\ndef list4d(a, b, c, d, e): return [[[[e] * d for j in range(c)] for j in range(b)] for i in range(a)]\ndef ceil(x, y=1): return int(-(-x // y))\ndef INT(): return int(input())\ndef MAP(): return map(int, input().split())\ndef LIST(N=None): return list(MAP()) if N is None else [INT() for i in range(N)]\ndef Yes(): print('Yes')\ndef No(): print('No')\ndef YES(): print('YES')\ndef NO(): print('NO')\nsys.setrecursionlimit(10 ** 9)\nINF = 10 ** 18\nMOD = 10 ** 9 + 7\n\nN = INT()\nA = LIST()\n\nC = Counter(A)\n# \u91cd\u8907\u524a\u9664\u3057\u3066\u964d\u9806\u3001\u3053\u306e\u9806\u306b\u51e6\u7406\u3057\u3066\u3044\u304f\nunique = sorted(set(A), reverse=1) + [0]\n# \u3042\u308b\u5024\u304c\u6700\u521d\u306b\u51fa\u73fe\u3059\u308bindex\u3092\u4fdd\u6301\nD = {}\nfor i in range(N-1, -1, -1):\n D[A[i]] = i\n\nans = [0] * N\nprevcnt = 0\nmnidx = INF\nfor i, a in enumerate(unique[:-1]):\n nxta = unique[i+1]\n # \u4eca\u56de\u306e\u4f4d\u7f6e\u304c\u9078\u3070\u308c\u308b\u56de\u6570 = \u6b21\u306e\u5024\u3068\u306e\u5dee\u5206 * \u4eca\u306e\u5024\u306e\u500b\u6570\n cnt = (a - nxta) * (C[a] + prevcnt)\n # \u4eca\u306e\u5024\u306e\u5148\u982dindex\n mnidx = min(mnidx, D[a])\n ans[mnidx] += cnt\n # \u4eca\u56de\u306e\u500b\u6570\u3092\u6b21\u56de\u4ee5\u964d\u7528\u306b\u8ffd\u52a0\n prevcnt += C[a]\n[print(a) for a in ans]\n", "N = int(input())\nA = [(a, i) for i, a in enumerate(map(int, input().split()))]\nA.sort(reverse=True)\nA.append((0, 0))\n\nans = [0] * N\nnow = float('inf')\n\nfor j, (a, i) in enumerate(A[:N], start=1):\n now = min(now, i)\n ans[now] += j * (a - A[j][0])\n\nprint(*ans, sep='\\n')\n", "from collections import defaultdict\ndef solve():\n N = int(input())\n A = list(map(int, input().split()))\n ans = [0]*N\n min_inds = defaultdict(lambda: 10**5)\n nums = defaultdict(lambda: 0)\n for ind,a in enumerate(A):\n min_inds[a] = min(min_inds[a],ind)\n nums[a] += 1\n min_inds = sorted(list(map(list,min_inds.items())), key=lambda x:x[0])\n min_inds.append([10**9+1,10**5])\n nums = sorted(list(map(list,nums.items())), key=lambda x:x[0])\n nums.append([0,0])\n for i in range(len(min_inds)-2,-1,-1):\n min_inds[i][1] = min(min_inds[i][1],min_inds[i+1][1])\n nums[i][1] += nums[i+1][1]\n ans[min_inds[i][1]] += nums[i][1]*(nums[i][0]-nums[i-1][0])\n return ans\nprint(*solve(),sep='\\n')", "import collections\nimport heapq\nn=int(input())\nA=[int(i) for i in input().split()]\nAns=[0]*n\nM=[0]#\u81ea\u5206\u3088\u308a\u524d\u306e\u6700\u5927\u5024\u3092\u30e1\u30e2\u3002\u3053\u308c\u4ee5\u4e0b\u3060\u3068\u73fe\u308c\u306a\u3044\nfor i in range(n):\n M.append(max(M[-1],A[i]))\nD=collections.defaultdict(int)\nH=[]\nfor i in range(n):\n j=n-1-i\n if A[j]<=M[j]:\n heapq.heappush(H,-A[j])#\u51fa\u73fe\u3057\u306a\u3044\u30a4\u30f3\u30c7\u30c3\u30af\u30b9\u306e\u6570\u3092\u7ba1\u7406\u3002\u5927\u304d\u3044\u307b\u3046\u304b\u3089\u53d6\u308a\u51fa\u3059\u3002\n else:\n Ans[j]=(A[j]-M[j])*(D[A[j]]+1)#\u81ea\u5206\u3088\u308a\u524d\u306e\u6700\u5927\u5024\u3068\u81ea\u5206\u306e\u5dee\u304b\u3051\u308b\u81ea\u5206\u81ea\u8eab\u3068\u540c\u3058\u6570\u306e\u3053\u308c\u307e\u3067\u306e\u51fa\u73fe\u56de\u6570\n D[M[j]]+=D[A[j]]+1#\u81ea\u5206\u81ea\u8eab\u3088\u308a\u5f8c\u308d\u306e\u81ea\u5206\u3068\u540c\u3058\u6570\u5168\u3066\u3092\u81ea\u5206\u3088\u308a\u524d\u306e\u6700\u5927\u5024\u307e\u3067\u6e1b\u3089\u3059\u3053\u3068\u3067\u5897\u3048\u308b\u5206\n ct=0\n while H:#\u81ea\u5206\u3088\u308a\u5f8c\u308d\u3067\u81ea\u5206\u3088\u308a\u5c0f\u3055\u3044\u304c\u3001\u81ea\u5206\u306e\u524d\u306e\u6700\u5927\u5024\u3088\u308a\u5927\u304d\u3044\u3082\u306e\u3092\u5168\u3066\u898b\u308b\n a=heapq.heappop(H)\n a=-a\n if a<=M[j]:\n heapq.heappush(H,-a)\n break\n else:\n Ans[j]+=a-M[j]\n D[M[j]]+=1\n\nfor a in Ans:\n print(a)\n"]
{"inputs": ["2\n1 2\n", "10\n1 2 1 3 2 4 2 5 8 1\n"], "outputs": ["2\n1\n", "10\n7\n0\n4\n0\n3\n0\n2\n3\n0\n"]}
competition
https://atcoder.jp/contests/arc069/tasks/arc069_c
[ 50, 8933, 440, 15803, 49353, 7546, 23700, 624, 3862, 525, 451, 58772, 315, 26210, 11, 48826, 220, 16, 1526, 451, 624, 785, 26306, 48826, 600, 17167, 315, 264, 5318, 26210, 624, 50, 8933, 440, 686, 9245, 458, 7546, 8500, 274, 315, 3084...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
872
Appy and Chef are participating in a contest. There are $N$ problems in this contest; each problem has a unique problem code between $1$ and $N$ inclusive. Appy and Chef decided to split the problems to solve between them ― Appy should solve the problems whose problem codes are divisible by $A$ but not divisible by $B$, and Chef should solve the problems whose problem codes are divisible by $B$ but not divisible by $A$ (they decided to not solve the problems whose codes are divisible by both $A$ and $B$). To win, it is necessary to solve at least $K$ problems. You have to tell Appy whether they are going to win or lose. -----Input----- - The first line of the input contains a single integer $T$ denoting the number of test cases. The description of $T$ test cases follows. - The first and only line of each test case contains four space-separated integers $N$, $A$, $B$ and $K$. -----Output----- For each test case, print a single line containing the string "Win" if they can solve at least $K$ problems or "Lose" otherwise (without quotes). -----Constraints----- - $1 \le T \le 15$ - $1 \le K \le N \le 10^{18}$ - $1 \le A, B \le 10^9$ -----Subtasks----- Subtask #1 (15 points): - $1 \le T \le 15$ - $1 \le K \le N \le 10^6$ - $1 \le A, B \le 10^3$ Subtask #2 (85 points): original constraints -----Example Input----- 1 6 2 3 3 -----Example Output----- Win -----Explanation----- Example case 1: Appy is solving the problems with codes $2$ and $4$, Chef is solving the problem with code $3$. Nobody is solving problem $6$, since $6$ is divisible by both $2$ and $3$. Therefore, they can solve $3$ problems and win.
["for t in range(int(input())):\n n, a , b , k = map(int,input().split())\n solvedbychef = 0\n solvedbyappy = 0\n for i in range(n+1):\n if i % a == 0 and i % b == 0 :\n continue\n elif i%a == 0 :\n solvedbyappy+=1\n elif i%b == 0:\n solvedbychef+=1\n totalsolved = solvedbychef + solvedbyappy\n if totalsolved>=k:\n print(\"Win\")\n else :\n print(\"Lose\")", "import math\nfor i in range(int(input())):\n z,a,b,k=list(map(int,input().split())) \n n=0\n x1=z//a \n x2=z//b \n x3=(a*b)//math.gcd(a,b) \n p1=x1-z//x3 \n p2=x2-z//x3 \n if p1+p2>=k:\n print('Win') \n else:\n print('Lose') \n \n", "for i in range(int(input())):\n z,a,b,k=list(map(int,input().split())) \n n=0\n for j in range(1,z+1):\n if j%a==0 and j%b==0:\n pass \n elif j%a==0:\n n+=1 \n elif j%b==0:\n n+=1 \n if n>=k:\n print('Win') \n else:\n print('Lose') \n \n", "for i in range(int(input())):\n z,a,b,k=list(map(int,input().split())) \n n=0\n for j in range(1,z+1):\n if j%a==0 and j%b==0:\n pass \n elif j%a==0:\n n+=1 \n elif j%b==0:\n n+=1 \n if n>=k:\n print('Win') \n else:\n print('Lose') \n \n", "# cook your dish here\nimport math\nt=int(input())\nwhile t>0:\n n,a,b,k=list(map(int,input().split()))\n l=(a*b)//math.gcd(a,b)\n c=n//b+n//a-2*(n//l)\n if c>=k:\n print(\"Win\")\n else:\n print(\"Lose\")\n t=t-1\n", "# cook your dish here\nt=int(input())\nwhile t>0:\n n,a,b,k=list(map(int,input().split()))\n c=0\n for i in range(n):\n if i%a==0 and i%b!=0:\n c=c+1\n if i%b==0 and i%a!=0:\n c=c+1\n if c>=k:\n print(\"Win\")\n else:\n print(\"Lose\")\n t=t-1\n", "import math\nfor i in range(int(input())):\n n,a,b,k=list(map(int,input().split()))\n lcm=(a*b)/math.gcd(a,b)\n #print(lcm)\n z=(n//a) + (n//b)-2*(n//lcm)\n #print(z)\n if z>=k:\n print(\"Win\")\n else:\n print(\"Lose\")\n", "# cook your dish here\nfor i in range(int(input())):\n n,a,b,k=list(map(int,input().split()))\n s=0\n j=2\n while s<k and j<n+1:\n if j%a==0 and j%b!=0:\n s+=1\n elif j%b==0 and j%a!=0:\n s+=1\n j+=1\n if s==k:\n print(\"Win\")\n else:\n print(\"Lose\")\n\n", "def gcd(a, b):\n if b == 0:\n return a\n return gcd(b, a%b)\n\nfor _ in range(int(input())):\n N, A, B, K = map(int, input().split())\n\n lcm = (A * B) // gcd(A, B)\n appy = (N // A) - (N // lcm)\n chef = (N // B) - (N // lcm)\n\n print(\"Win\") if appy + chef >= K else print(\"Lose\")", "for _ in range(int(input())):\n N, A, B, K = map(int, input().split())\n cnt = 0\n\n for i in range(1, N+1):\n a, b = i % A, i % B\n if a == 0 and b != 0:\n cnt += 1\n elif a != 0 and b == 0:\n cnt += 1\n\n if cnt >= K:\n print(\"Win\")\n break\n else:\n print(\"Lose\")", "from math import gcd as g\nt=int(input())\nwhile t!=0:\n n,a,b,k=map(int,input().split())\n lcm=(a*b)//g(a,b)\n div_a=(n//a)-(n//lcm)\n div_b=(n//b)-(n//lcm)\n net=div_a+div_b\n if net>=k:\n print('Win')\n else:\n print('Lose')\n t-=1", "from math import gcd as g\nt=int(input())\nwhile t!=0:\n n,a,b,k=list(map(int,input().split()))\n lcm=(a*b)//g(a,b)\n div_a=(n//a)-(n//lcm)\n div_b=(n//b)-(n//lcm)\n net=div_a+div_b\n if net>=k:\n print('Win')\n else:\n print('Lose')\n t-=1\n", "from math import gcd as g\n\nt = int(input())\nwhile t != 0:\n n, a, b, k = map(int, input().split())\n lcm = (a * b) // g(a, b)\n\n div_a = (n // a) - (n // lcm)\n div_b = (n // b) - (n // lcm)\n\n net = div_a + div_b\n\n if net >= k:\n print('Win')\n else:\n print('Lose')\n t -= 1", "n=int(input())\nfor i in range(n):\n l=list(map(int,input().split()))\n l1=list(_ for _ in range(1,l[0]+1))\n count=0\n for j in l1:\n if j%l[1]==0 and j%l[2]!=0:\n count+=1\n elif j%l[1]!=0 and j%l[2]==0:\n count+=1\n if count>=l[3]:\n break\n if count>=l[3]:\n print(\"Win\")\n else:\n print(\"Lose\")", "n=int(input())\nfor i in range(n):\n l=list(map(int,input().split()))\n l1=list(_ for _ in range(1,l[0]+1))\n count=0\n for j in l1:\n if j%l[1]==0 and j%l[2]!=0:\n count+=1\n elif j%l[1]!=0 and j%l[2]==0:\n count+=1\n \n if count>=l[3]:\n print(\"Win\")\n else:\n print(\"Lose\")", "t=int(input())\nfor i in range(t):\n n,a,b,k=list(map(int,input().split()))\n l=[]\n p1=[]\n p2=[]\n for i in range(1,n+1):\n if(i%a==0 and i%b!=0):\n p1.append(i)\n if(i%b==0 and i%a!=0):\n p2.append(i)\n if((len(p1)+len(p2))>=k):\n print(\"Win\")\n else:\n print(\"Lose\")\n \n \n \n", "from math import gcd as g\n\nt = int(input())\nwhile t != 0:\n n, a, b, k = map(int, input().split())\n lcm = (a * b) // g(a, b)\n\n div_a = (n // a) - (n // lcm)\n div_b = (n // b) - (n // lcm)\n\n net = div_a + div_b\n\n if net >= k:\n print('Win')\n else:\n print('Lose')\n t -= 1", "import math\nT=int(input())\nfor i in range(T):\n n, a, b, k = list(map(int, input().split()))\n lcm = (a * b) // math.gcd(a, b)\n\n div_a = (n // a) - (n // lcm)\n div_b = (n // b) - (n // lcm)\n\n net = div_a + div_b\n\n if net >= k:\n print('Win')\n else:\n print('Lose')\n", "import math\nT=int(input())\nfor i in range(T):\n N,A,B,K=list(map(int,input().split()))\n c=0\n lcm=(A*B)//math.gcd(A,B)\n for j in range(1,N+1):\n if j%A==0 and j%lcm!=0:\n c+=1\n elif j%B==0 and j%lcm!=0:\n c+=1\n if c>=K:\n print(\"Win\")\n else:\n print(\"Lose\")\n", "T=int(input())\nfor i in range(T):\n N,A,B,K=list(map(int,input().split()))\n c=0\n for j in range(1,N+1):\n if j%A==0 and j%B!=0:\n c+=1\n elif j%A!=0 and j%B==0:\n c+=1\n if c>=K:\n print(\"Win\")\n else:\n print(\"Lose\")\n \n", "# cook your dish here\nimport math\ndef gcd(a,b):\n if a == 0:\n return b\n return gcd(b%a,a)\ndef lcm(a,b):\n return (a*b)//gcd(a,b)\n \nt = int(input())\nwhile(t>0):\n n,a,b,k = map(int,input().split())\n prob = 0\n \n rem1 = n // a\n rem2 = n // b\n if a>=b:\n rem3 = n // lcm(b,a)\n else:\n rem3 = n // lcm(a,b)\n res = (rem1 - rem3) + (rem2 - rem3)\n if(res < k):\n print(\"Lose\")\n else:\n print(\"Win\")\n t -= 1", "# cook your dish here\nt = int(input())\nwhile(t>0):\n n,a,b,k = map(int,input().split())\n prob = 0\n if(a == 1 and b == 1):\n print(\"Lose\")\n elif(a == 1):\n rem = n // b\n prob = n - rem\n if(prob < k):\n print(\"Lose\")\n else:\n print(\"Win\")\n elif(b == 1):\n rem = n // a\n prob = n - rem\n if(prob < k):\n print(\"Lose\")\n else:\n print(\"Win\")\n else:\n for i in range(1,n+1):\n if(i%a ==0 and i%b == 0):\n continue\n elif(i%a == 0 and i%b != 0):\n prob += 1\n if(prob>=k):\n print(\"Win\")\n break\n elif(i%b == 0 and i%a != 0):\n prob += 1\n if(prob>=k):\n print(\"Win\")\n break\n if(prob < k):\n print(\"Lose\")\n t -= 1", "# cook your dish here\nt = int(input())\nwhile(t>0):\n n,a,b,k = map(int,input().split())\n prob = 0\n if(a == 1 and b == 1):\n print(\"Lose\")\n # elif(a == 1):\n # for i in range(1,n+1):\n # if(i%a ==0 and i%b == 0):\n # continue\n # elif(i%a == 0 and i%b != 0):\n # prob += 1\n # if(prob>=k):\n # print(\"Win\")\n # break\n # elif(b == 1):\n # for i in range(1,n+1):\n # if(i%a ==0 and i%b == 0):\n # continue\n # elif(i%b == 0 and i%a != 0):\n # prob += 1\n # if(prob>=k):\n # print(\"Win\")\n # break\n else:\n for i in range(1,n+1):\n if(i%a ==0 and i%b == 0):\n continue\n elif(i%a == 0 and i%b != 0):\n prob += 1\n if(prob>=k):\n print(\"Win\")\n break\n elif(i%b == 0 and i%a != 0):\n prob += 1\n if(prob>=k):\n print(\"Win\")\n break\n if(prob < k):\n print(\"Lose\")\n t -= 1", "# cook your dish here\nt = int(input())\nwhile(t>0):\n n,a,b,k = map(int,input().split())\n prob = 0\n if(a == 1 and b == 1):\n print(\"Lose\")\n else:\n for i in range(1,n+1):\n if(i%a ==0 and i%b == 0):\n continue\n elif(i%a == 0 and i%b != 0):\n prob += 1\n elif(i%b == 0 and i%a != 0):\n prob += 1\n if(prob >= k):\n print(\"Win\")\n else:\n print(\"Lose\")\n t -= 1", "# cook your dish here\nt = int(input())\nwhile(t>0):\n n,a,b,k = map(int,input().split())\n prob = 0\n for i in range(1,n+1):\n if(i%a and i%b):\n continue\n elif(i%a or i%b):\n prob += 1\n if(prob >= k):\n print(\"Win\")\n else:\n print(\"Lose\")\n t -= 1"]
{"inputs": [["1", "6 2 3 3"]], "outputs": [["Win"]]}
interview
https://www.codechef.com/problems/HMAPPY2
[ 2164, 88, 323, 35975, 525, 23528, 304, 264, 13810, 13, 2619, 525, 400, 45, 3, 5322, 304, 419, 13810, 26, 1817, 3491, 702, 264, 4911, 3491, 2038, 1948, 400, 16, 3, 323, 400, 45, 3, 28308, 13, 1845, 88, 323, 35975, 6635, 311, 6718, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,596
=====Function Descriptions===== A set is an unordered collection of elements without duplicate entries. When printed, iterated or converted into a sequence, its elements will appear in an arbitrary order. =====Example===== >>> print set() set([]) >>> print set('HackerRank') set(['a', 'c', 'e', 'H', 'k', 'n', 'r', 'R']) >>> print set([1,2,1,2,3,4,5,6,0,9,12,22,3]) set([0, 1, 2, 3, 4, 5, 6, 9, 12, 22]) >>> print set((1,2,3,4,5,5)) set([1, 2, 3, 4, 5]) >>> print set(set(['H','a','c','k','e','r','r','a','n','k'])) set(['a', 'c', 'r', 'e', 'H', 'k', 'n']) >>> print set({'Hacker' : 'DOSHI', 'Rank' : 616 }) set(['Hacker', 'Rank']) >>> print set(enumerate(['H','a','c','k','e','r','r','a','n','k'])) set([(6, 'r'), (7, 'a'), (3, 'k'), (4, 'e'), (5, 'r'), (9, 'k'), (2, 'c'), (0, 'H'), (1, 'a'), (8, 'n')]) Basically, sets are used for membership testing and eliminating duplicate entries. =====Problem Statement===== Now, let's use our knowledge of sets and help Mickey. Ms. Gabriel Williams is a botany professor at District College. One day, she asked her student Mickey to compute the average of all the plants with distinct heights in her greenhouse. Formula used: Average = Sum of Distinct Heights / Total Number of Distinct Heights =====Input Format===== The first line contains the integer, N, the total number of plants. The second line contains the N space separated heights of the plants. =====Constraints===== 0<N≤100 =====Output Format===== Output the average height value on a single line.
["n = input()\nar = list(map(int,input().split(' ')))\nar=set(ar)\nprint((sum(ar) / len(ar)))\n", "def average(array):\n uniq = set(array)\n \n return sum(uniq)/len(uniq)\n"]
{"inputs": ["10\n161 182 161 154 176 170 167 171 170 174"], "outputs": ["169.375"]}
introductory
https://www.hackerrank.com/challenges/py-introduction-to-sets/problem
def average(array): # your code goes here if __name__ == '__main__': n = int(input()) arr = list(map(int, input().split())) result = average(arr) print(result)
[ 46725, 5152, 3874, 24685, 64897, 32, 738, 374, 458, 55733, 4426, 315, 5424, 2041, 22513, 10695, 624, 4498, 16709, 11, 5367, 657, 476, 16099, 1119, 264, 8500, 11, 1181, 5424, 686, 4994, 304, 458, 24168, 1973, 382, 46725, 13314, 64897, 20...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,066
----- CHEF N TIMINGS ----- One day chef was working with some random numbers. Then he found something interesting. He observed that no 240, 567, 9999 and 122 and called these numbers nice as the digits in numbers are in increasing order. Also he called 434, 452, 900 are not nice as digits are in decreasing order Now you are given a no and chef wants you to find out largest "nice" integer which is smaller than or equal to the given integer. -----Constraints----- 1< t < 1000 1< N < 10^18 -----Input Format----- First line contains no. of test cases t. Then t test cases follow. Each test case contain a integer n. -----Output----- Output a integer for each test case in a new line which is largest nice integer smaller or equal to the given integer. -----Example Text Case----- Input: 1 132 Output: 129
["for _ in range(int(input())):\n n=input().rstrip()\n n=[ele for ele in n]\n l=len(n)\n m=10**18+8\n ini=1\n for i in range(l-1,-1,-1):\n if int(n[i])<=m:\n if ini==1:\n m=int(n[i])\n else:\n m=max(m,n[i])\n else:\n m=int(n[i])-1\n n[i]=str(m)\n for j in range(l-1,i,-1):\n n[j]='9'\n \n i=0\n while n[i]=='0':\n i+=1\n print(\"\".join(n[i:]))\n \n", "for _ in range(int(input())):\n num = int(input())\n if num < 10:\n print(num)\n continue\n digs = str(num)\n new = \"\"\n i = 1\n bad = False\n while i < len(digs):\n if digs[i-1] > digs[i]:\n bad = True\n if digs[i-1] != \"1\":\n new += str(int(digs[i-1]) - 1) + \"9\"*(len(digs)-i)\n else:\n n = i-1\n while n > 0 and digs[n] == \"1\":\n n -= 1\n new = new[:n]\n new += str(int(digs[n]) - 1) + \"9\"*(len(digs)-n-1)\n break\n else:\n new += digs[i - 1]\n i += 1\n if not bad: new = digs\n print(int(new))\n", "t=int(input())\nfor _ in range(t):\n n=int(input())\n c=str(n)\n a=list(c)\n i2=len(a)-1\n for i in range(len(a)-1,0,-1):\n if int(a[i])<int(a[i-1]):\n a[i-1]=int(a[i-1])-1\n i2=i-1\n if(a[0]!=0 and a[0]!=\"0\"):\n for i in range(i2+1):\n print(a[i],end=\"\")\n for i in range(i2+1,len(a)):\n print(9,end=\"\")\n else:\n for i in range(1,i2):\n print(a[i],end=\"\")\n for i in range(i2+1,len(a)):\n print(9,end=\"\")\n print()\n \n \n", "# cook your dish here\ntry:\n def increasing(n):\n if 0 <= n<= 9: return n\n def fi(s):\n for i in range(len(s)-1):\n if s[i] > s[i+1]:\n return i\n return -1 \n s = str(n)\n n = len(s)\n r = fi(s)\n l = s.index(s[r])\n if r == -1:\n return n\n else:\n return int(s[:l] + str(int(s[l]) - 1) + '9'*(n-l-1))\n for _ in range(int(input())):\n n=int(input())\n ans=increasing(n)\n print(ans)\nexcept EOFError as e: \n pass\n", "from sys import stdin, stdout\ninput = stdin.readline\nfrom collections import defaultdict as dd\nimport math\ndef geti(): return list(map(int, input().strip().split()))\ndef getl(): return list(map(int, input().strip().split()))\ndef gets(): return input()\ndef geta(): return int(input())\ndef print_s(s): stdout.write(s+'\\n')\n\ndef solve():\n for _ in range(geta()):\n n=geta()\n num=list(map(int,list(str(n))))\n # print(num)\n index=-1\n for i in range(len(num)-1):\n if num[i]>num[i+1]:\n index=i\n break\n else:\n print(n)\n continue\n if index!=-1:\n fake=num[index]\n for i in range(index,-1,-1):\n if num[i]==fake:\n num[i]-=1\n last=i\n for i in range(last+1,len(num)):\n num[i]=9\n ans=0\n for i in num:\n ans*=10\n ans+=i\n print(ans)\n\n\ndef __starting_point():\n solve()\n\n__starting_point()", "# cook your dish here\nimport sys\ndef func(number):\n for i in range(len(number)-1):\n if int(number[i])>int(number[i+1]):\n cifra=int(number[i])-1\n stringa=number[:i]+str(cifra)+'9'*(len(number)-i-1)\n return func(stringa)\n return number\nt=int(input().strip())\nfor _ in range(t):\n number=input().strip()\n stringa=func(number)\n while stringa[0]=='0':\n stringa=stringa[1:]\n print(stringa)", "def nondecdigits(s):\n m = len(s); \n a = [0] * m; \n for i in range(m):\n a[i] = ord(s[i]) - ord('0'); \n level = m - 1;\n for i in range(m - 1, 0, -1):\n if (a[i] < a[i - 1]):\n a[i - 1] -= 1;\n level = i - 1;\n if (a[0] != 0):\n for i in range(level + 1):\n print(a[i], end=\"\");\n for i in range(level + 1, m):\n print(\"9\", end=\"\");\n else:\n for i in range(1, level):\n print(a[i], end=\"\");\n for i in range(level + 1, m):\n print(\"9\", end=\"\");\nx=int(input())\nfor i in range(x):\n y=int(input())\n nondecdigits(str(y))\n print()", "def check(s):\n for i in range(len(s)-1):\n if int(s[i+1])<int(s[i]):\n return 1\n return 0\n\nt=int(input())\nfor i in range(t):\n ok=0\n n=list(input())\n l=[]\n for k in n:\n try:\n l.append(int(k))\n except:\n pass\n while(check(l)):\n for j in range(len(l)-1):\n if l[j+1]<l[j]:\n l[j]=l[j]-1\n for k in range(j+1,len(l)):\n l[k]=9\n break\n s=''\n for i in l:\n s+=str(i)\n print(int(s))", "\nT = int(input())\ndef solve(n):\n li = list(map(int, list(str(n))))\n prev = 0\n f = {}\n for ind, it in enumerate(li):\n if it < prev:\n ind = f[prev]\n li[ind]-=1\n for j in range(ind+1, len(li)):\n li[j] = 9\n break\n prev = it\n if it not in f:\n f[it] = ind\n\n ans = 0\n for it in li:\n ans = 10*ans + it\n\n return ans\n\nfor case in range(T):\n n = int(input())\n ans = solve(n)\n print(ans)\n", "# cook your dish here\ndef check(n):\n l=list(map(int,str(n)))\n t=len(l)\n p=t-1\n for i in range(t-1,0,-1):\n if l[i]<l[i-1]:\n l[i-1]-=1 \n p=i-1\n \n for i in range(p+1,t):\n l[i]=9\n return int(''.join(map(str,l))) \n \ntry:\n for _ in range(int(input())):\n n=int(input())\n print(check(n))\nexcept EOFError as e:pass ", "# cook your dish here\ndef check(n):\n l=list(map(int,str(n)))\n t=len(l)\n p=t-1\n for i in range(t-1,0,-1):\n if l[i]<l[i-1]:\n l[i-1]-=1 \n p=i-1\n \n for i in range(p+1,t):\n l[i]=9\n return int(''.join(map(str,l))) \n \ntry:\n for _ in range(int(input())):\n n=int(input())\n print(check(n))\nexcept EOFError as e:pass ", "# cook your dish here\ndef check(n):\n l=list(map(int,str(n)))\n t=len(l)\n p=t-1\n for i in range(t-1,0,-1):\n if l[i]<l[i-1]:\n l[i-1]-=1 \n p=i-1\n \n for i in range(p+1,t):\n l[i]=9\n return int(''.join(map(str,l))) \n \ntry:\n for _ in range(int(input())):\n n=int(input())\n print(check(n))\nexcept EOFError as e:pass ", "\nT=int(input())\nfor _ in range(T):\n N=int(input())\n V=list(str(N))\n #fa=ckt(N)\n ans=\"\"\n n=len(V)\n for i in range(n):\n if (i!=(n-1) and V[i]>V[i+1]):\n ans=list(ans+str(int(V[i])-1)+(\"9\")*(n-i-1))\n for j in range(i-1,-1,-1):\n if (ans[j]>ans[j+1]):\n ans[j+1]=\"9\"\n ans[j]=str(int(ans[j])-1)\n else:\n break\n break\n else:\n ans=ans+V[i]\n\n ans1=\"\"\n for i in ans:\n ans1=ans1+i\n \n print(int(ans1))\n", "# cook your dish here\ntry:\n def convert(list): \n s = [str(i) for i in list] \n res = int(\"\".join(s)) \n return(res) \n for _ in range(int(input())):\n x=int(input())\n while x>0:\n a=str(x)\n b=list(a)\n b.sort()\n if b==list(a):\n break\n else:\n k=0\n for j in b:\n if str(j)==a[k]:\n k+=1\n else:\n break\n k=convert(list(a[k+1:])) \n x=x-k-1\n print(x)\nexcept:\n pass", "# cook your dish here\ndef num(l):\n ans=0\n for i in range(len(l)):\n ans=ans*10+l[i]\n return ans\ndef numof(n):\n ans=0\n l=[]\n while(n>0):\n l.append(n%10)\n n=n//10\n ans+=1\n l.reverse()\n return l\nt=int(input())\nfor you in range(t):\n n=int(input())\n done=0\n z=numof(n)\n l=[]\n for i in range(len(z)):\n if(min(z[i:])==z[i]):\n l.append(z[i])\n else:\n l.append(min(z[i:]))\n done=1\n break\n k=len(l)\n for i in range(len(z)-k):\n l.append(9)\n print(num(l))"]
{"inputs": [["1", "132"]], "outputs": [["129"]]}
interview
https://www.codechef.com/APO12020/problems/APOC2_04
[ 34764, 43793, 37, 451, 17742, 11860, 198, 70674, 3966, 1899, 29706, 572, 3238, 448, 1045, 4194, 5109, 13, 5005, 566, 1730, 2494, 198, 87557, 13, 1260, 13166, 429, 902, 220, 17, 19, 15, 11, 220, 20, 21, 22, 11, 220, 24, 24, 24, 24,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,243
It's been a tough week at work and you are stuggling to get out of bed in the morning. While waiting at the bus stop you realise that if you could time your arrival to the nearest minute you could get valuable extra minutes in bed. There is a bus that goes to your office every 15 minute, the first bus is at `06:00`, and the last bus is at `00:00`. Given that it takes 5 minutes to walk from your front door to the bus stop, implement a function that when given the curent time will tell you much time is left, before you must leave to catch the next bus. ## Examples ``` "05:00" => 55 "10:00" => 10 "12:10" => 0 "12:11" => 14 ``` ### Notes 1. Return the number of minutes till the next bus 2. Input will be formatted as `HH:MM` (24-hour clock) 3. The input time might be after the buses have stopped running, i.e. after `00:00`
["def bus_timer(current_time):\n h, m = map(int, current_time.split(':'))\n\n if h<6:\n m = (5 - h) * 60 + 60 - m\n elif h == 23 and m > 55:\n return 355 + 60 - m\n else:\n m = 15 - m % 15\n\n if m > 4:\n return m - 5\n else:\n return m + 10", "def bus_timer(time):\n h,m = map(int,time.split(':'))\n t = (5+h*60+m)%1440\n return -t%(360 if t<360 else 15)", "from datetime import datetime, timedelta\n\ndef bus_timer(current_time):\n \n ct = datetime.strptime(current_time, \"%H:%M\")\n \n if ct >= datetime.strptime(\"5:55\", \"%H:%M\") and ct <= datetime.strptime(\"23:55\", \"%H:%M\"):\n if ct.minute <= 10:\n time_left = 10 - ct.minute\n elif ct.minute <= 25 and ct.minute > 10:\n time_left = 25 - ct.minute\n elif ct.minute <= 40 and ct.minute > 25:\n time_left = 40 - ct.minute\n elif ct.minute <= 55 and ct.minute > 40:\n time_left = 55 - ct.minute\n else:\n time_left = 70 - ct.minute\n else:\n delta = datetime.strptime(\"5:55\", \"%H:%M\") - ct\n time_left = int(delta.seconds / 60)\n \n return time_left", "def bus_timer(current_time):\n h, m = map(int, current_time.split(\":\"))\n current_time = 60 * h + m\n if current_time >= 1436 or current_time <= 355:\n return (355 - current_time) % 1440\n else:\n return (10 - current_time) % 15", "def bus_timer(time):\n c = time.split(\":\")\n z = int(c[1]) + 5\n t = 0\n if int(c[0]) == 23 and int(c[1]) >= 55:\n c[0] = 0\n c[1] = (int(c[1]) + 5) - 60\n if int(c[1]) == 0:\n t = 0\n elif int(c[1]) > 0:\n t = (((5 - int(c[0]))*60) + (60 - int(c[1]))) \n elif int(c[0]) == 5 and int(c[1]) >= 55:\n c[0] = 6\n c[1] = (int(c[1]) + 5) - 60\n if int(c[1]) == 0:\n t = 0\n elif int(c[1]) > 0:\n t = 15 - int(c[1])\n elif int(c[0]) < 6 :\n if int(c[1]) == 0:\n t = ((6 - int(c[0]))*60) - 5\n elif int(c[1]) > 0:\n t = (((5 - int(c[0]))*60) + (60 - int(c[1]))) - 5\n else:\n if z > 60:\n z = z - 60\n if z < 15:\n t = 15 - z\n elif z > 15 and z < 30:\n t = 30 - z\n elif z > 30 and z < 45:\n t = 45 - z\n elif z > 45:\n t = 60 - z\n return t", "def bus_timer(current_time):\n hh,mm = [int(v) for v in current_time.split(':')]\n time = (hh*60+mm+5)%1440\n if time == 0: return 0\n if time <= 360: return 360-time\n return -time % 15\n", "def bus_timer(time):\n hh, mm = time.split(':')\n hh, mm = int(hh), int(mm)\n \n if hh == 23:\n if mm <= 55: return 10 - mm % 15 if mm % 15 <= 10 else 15 - (mm % 15 - 10)\n else: return 5 * 60 + 55 + (60 - mm)\n elif 6 <= hh:\n return 10 - mm % 15 if mm % 15 <= 10 else 15 - (mm % 15 - 10)\n \n return ((5 - hh) * 60) + (55 - mm) if hh < 5 or (hh == 5 and mm <= 55) else 15 - (mm % 15 - 10)\n", "def bus_timer(time):\n print(time)\n hour,mins=map(int,time.split(\":\"))\n mins+=hour*60\n if 0<=mins<355 or mins>1435:return 355-mins+1440*(mins>1435)\n mins=10-mins+((mins//15)*15)\n return mins+15*(mins<0)", "def bus_timer(current_time):\n h, m = list(map(int, current_time.split(':')))\n t = h * 60 + m - 55\n if t < 60 * 5 or t > 23 * 60:\n return (5 + 24 * (h == 23)) * 60 - t\n return min(a - m for a in (10, 25, 40, 55, 70) if a - m >= 0)\n", "def bus_timer(current_time):\n tim = current_time[3:]\n time = int(tim)\n tume = int(current_time[:2])\n if tume == 5 and time > 55:\n return 60 - time + 15 - 5\n elif tume < 6 and tume >= 0:\n return ((6 - tume) * 60) - 5 - time\n \n else:\n if tume == 23 and time > 55:\n return 360 - 5 + 60 - time\n elif time < 15 and time <= 10:\n return 15 - time - 5\n elif time < 30 and time <= 25:\n return 30 - time - 5\n elif time < 45 and time <=40:\n return 45 - time - 5\n elif time < 15 and time > 10:\n return 30 - time - 5\n elif time < 30 and time > 25:\n return 45 - time - 5\n elif time < 45 and time > 40:\n return 60 - time - 5\n elif time < 60 and time > 55:\n return 75 - time - 5\n else:\n return 60 - time - 5\n"]
{"fn_name": "bus_timer", "inputs": [["10:00"], ["10:45"], ["15:05"], ["06:10"], ["05:10"], ["04:50"], ["05:55"], ["23:57"], ["00:00"], ["23:55"]], "outputs": [[10], [10], [5], [0], [45], [65], [0], [358], [355], [0]]}
introductory
https://www.codewars.com/kata/5736378e3f3dfd5a820000cb
def bus_timer(current_time):
[ 2132, 594, 1012, 264, 11045, 2003, 518, 975, 323, 498, 525, 357, 61931, 311, 633, 700, 315, 4845, 304, 279, 6556, 382, 7983, 8580, 518, 279, 5828, 2936, 498, 38156, 429, 421, 498, 1410, 882, 697, 18647, 311, 279, 23480, 9383, 498, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,369
## Terminal game move function In this game, the hero moves from left to right. The player rolls the dice and moves the number of spaces indicated by the dice **two times**. ~~~if-not:sql Create a function for the terminal game that takes the current position of the hero and the roll (1-6) and return the new position. ~~~ ~~~if:sql In SQL, you will be given a table `moves` with columns `position` and `roll`. Return a table which uses the current position of the hero and the roll (1-6) and returns the new position in a column `res`. ~~~ ### Example: ```python move(3, 6) should equal 15 ``` ```if:bf ### BF: Since this is an 8kyu kata, you are provided a modified runBF function, numericRunBF, that automatically parses input and output for your ease. See the sample test cases to see what I mean: You can simply input two numbers and get a number as output (unless you're doing something wrong), so it should be convenient for you to modify the tests as you wish. Oh, and you won't have to worry about overflow, the correct answer will never be higher than 255. :) ```
["def move(position, roll):\n return position + 2*roll", "def move(position, roll):\n return position+roll*2", "move = lambda p,r: p+r*2", "def move(start, roll):\n return start + 2*roll", "def move(start, roll):\n return start + roll * 2", "def move(position, roll):\n return position+(roll<<1)", "move=lambda p,m:p+2*m", "move = lambda _, i: _ + 2 * i", "def move(position, roll):\n print(position)\n print(roll)\n position = position + roll * 2\n return position\n # your code here\n", "move = lambda position, roll: position + roll * 2", "def move(position, roll):\n x=position\n y=roll\n return x+(y*2)\n", "def move(position, roll):\n x = position + 2 * roll\n return x", "def move(position, roll):\n return 2 * roll + position", "def move(p,r):\n return p+(r*2)", "import unittest\n\n\ndef move(position, roll):\n return position + roll * 2\n \n \nclass TestMove(unittest.TestCase):\n def test_move(self):\n self.assertEqual(move(position=0, roll=4), 8)\n", "def move(position, roll):\n if roll < 1 or roll > 6:\n return \"Error\"\n else:\n new_position = position + (roll * 2)\n return(new_position)", "def move(position, roll):\n a = position\n b = roll\n c = (2*b)+a\n return c", "move = lambda p, r: ['there are bees on my knees', 2, 4, 6, 8, 10, 12].__getitem__(r) + p", "def move(pos, mov):\n return pos + 2*mov", "def move(position, roll):\n s = position + ( roll * 2)\n return s\n # your code here\n", "def move(position, roll):\n new_spot = roll*2 + position\n return new_spot", "def move(position, roll):\n return position + 2 * roll\nprint((move(1,4)))\n", "def move(position, roll):\n # my solution\n return position + 2 * roll\nprint(move(1, 4))", "def move(position, roll):\n a = position + roll + roll\n return a", "def move(position, roll):\n res = position+roll*2\n \n return res\n", "def move(p, r):\n return 2*r + p", "def move(position, roll):\n r = roll * 2\n return position + r", "def move(position, roll):\n delta = roll * 2\n return position + delta", "# player moves from left to right\n# The player rolls the dice and moves the number of spaces indicated by the dice two times.\n# input - two integers\n# output - integer\n\n#edge cases - die roll can only be (1-6), no numbers given\n\n# sample test (2, 7) = 16\n# 2 + (7 * 2)\n\ndef move(position, roll):\n return (roll * 2) + position ", "def move(pos, roll):\n return pos + 2*roll", "def move(position, roll):\n if roll < 7:\n return position + roll*2", "def move(position, roll):\n res = 0\n res = (roll * 2) + position\n return res ", "move = lambda pos, roll: pos + roll*2", "def move(position, roll):\n if roll == 1: \n return position + 2*roll\n if roll == 2: \n return position + 2*roll\n if roll == 3: \n return position + 2*roll\n if roll == 4: \n return position + 2*roll\n if roll == 5: \n return position + 2*roll\n if roll == 6: \n return position + 2*roll\n", "def move(position, roll):\n return roll * 2 if position == 0 else (position + roll) * 2 - position", "def move(position, roll):\n # your code here\n double = roll*2\n return position + double\n \nmove(1,1)", "move = lambda a, b: a + 2 * b", "def move(position, roll):\n # your code here\n move = roll*2\n sum = position + move\n return sum", "def move(position, roll):\n return position + roll*2\n # y\n", "def move(position, roll):\n n= position+roll+roll\n return n", "def move(position, roll):\n return roll + (position+roll)", "def move(position, roll):\n \"\"\"Return the new player position\"\"\"\n return position + 2 * roll", "def move(p, r):\n return (p+r)*2 - p", "def move(position, roll, moves=2):\n return move(position, roll, moves - 1) + roll if moves else position", "def move(position, roll):\n # your code here\n new_pos = position + (roll *2)\n return new_pos ", "def move(position, roll):\n currentSpace = roll * 2 + position\n return currentSpace", "def move(position, roll):\n return position + (roll * 2)\n # Zelf\n", "def move(P, R):\n return P + (2*R);", "def move(position, roll):\n roll *= 2\n return roll + position", "def move(p, r):\n # your code here\n p=p+2*r\n return p ", "def move(position, roll):\n n = roll * 2 + position\n return n", "def move(position, roll):\n moves = roll*2\n new_position = position + moves\n return new_position", "def move(position, roll):\n case = position + roll *2\n return case", "def move(position, roll):\n position += 2* roll\n return position", "def move(position, roll):\n if roll > 0:\n position += roll * 2\n elif roll < 0:\n position -= roll * 2\n else: \n position = position\n return position", "def move(position, roll):\n y = roll*2\n return position+y", "def move(position, roll):\n pos = position + 2 * roll\n return pos# your code here", "def move(position, roll):\n n = roll*2\n return position + n", "def move(position, roll):\n x = position\n y = roll\n new_pos = x + 2 * y\n return new_pos", "def move(position: int, roll: int) -> int:\n return position + 2 * roll", "def move(position, roll):\n # your code here\n goal = position + 2 * roll\n return goal;", "def move(position, roll):\n roll = roll * 2 \n return position + roll", "def move(position, roll):\n roll = roll*2\n new = position + roll\n return new", "def move(position, roll):\n diceOver = 2*roll\n newPos = diceOver + position\n return newPos", "def move(position, roll):\n i = 0\n for i in range(roll):\n position += 2\n return position\nmove(0, 4)", "def move(position, roll):\n # your code here\n sum = (position + 2*roll)\n return sum", "def move(position, roll):\n x = roll * 2\n newpos = x+position\n return newpos", "def move(position, roll):\n # your code here\n return position + roll * 2\n \nprint(move(3, 6))", "def move(position, roll):\n # your code here\n return position + 2 * roll\n \nprint(move(3, 6))", "def move(n, b):\n return n + 2*b", "def move(position, roll):\n result = roll * 2 + position\n return result", "def move(position, roll):\n new_pos = position + (roll*2)\n print(new_pos)\n return new_pos\n # your code here\n", "position = 0\nroll = 0\n\n\ndef move(position, roll):\n inp = position + roll * 2\n return inp\n\n\n\nmove(0, 4)", "def move(position, roll):\n new_position = position + roll + roll\n return new_position", "def move(position, roll):\n m = position+2*roll\n return(m)", "def move(position, roll):\n megfejtes = position + (roll*2)\n return(megfejtes)", "def move(position, roll):\n # your code here\n new_pos=position+2*roll\n return new_pos", "def move(x, y):\n return (y * 2) + x", "def move(position, roll):\n return position + (2.*roll)", "def move(position, roll):\n total_roll = roll * 2\n new_position = position + total_roll\n\n return new_position", "def move(position, roll):\n position = position + roll \n position = position + roll\n return position", "def move(position, roll):\n # Takes current p[osition and double the roll dice (1-6)\n return position + (roll * 2)", "def move(position, roll):\n final_pos=position+2*roll\n return final_pos", "def move(position, roll):\n position += roll + roll;\n return position;", "def move(position, roll):\n if roll:\n return position + (roll*2)", "def move(position, roll):\n position = roll * 2 + position\n return position", "def move(position, roll):\n\n intPosition = position + roll * 2\n\n return intPosition", "move = lambda x, n : x + 2 * n", "def move(position, roll):\n return position + int(roll * 2)", "def move(position, roll):\n final_position = position + 2 * roll\n return final_position\n", "def move(position, roll):\n a = position\n b = roll\n c = a+b*2\n return c", "def move(position, roll):\n move = int(position) + roll * 2\n return move", "def move(position, roll):\n # your code here\n return (position + 2 * roll)\n\nprint((move(2, 5)))\n", "def move(position, roll):\n pos = position + roll + roll\n return pos", "def move(position, roll):\n numMoved = roll * 2\n return position + numMoved", "def move(position, roll):\n a = position\n import random\n b = roll\n c =a+b+b\n return c\n", "def move(position, roll):\n y = int(roll) * 2\n x = int(position)\n equ = y + x\n return equ", "def move(position, roll):\n \n return (position + ( roll * 2))\n \n \n \nprint((move(0, 4)))\n", "def move(position, roll):\n new=position + (roll*2)\n return new", "def move(position, roll):\n if (roll >= 1) and (roll <= 6):\n position += (roll * 2)\n return position"]
{"fn_name": "move", "inputs": [[0, 4], [3, 6], [2, 5]], "outputs": [[8], [15], [12]]}
introductory
https://www.codewars.com/kata/563a631f7cbbc236cf0000c2
def move(position, roll):
[ 565, 34090, 1809, 3271, 729, 271, 641, 419, 1809, 11, 279, 11821, 10797, 504, 2115, 311, 1290, 13, 576, 2781, 27373, 279, 22120, 323, 10797, 279, 1372, 315, 12621, 16317, 553, 279, 22120, 3070, 19789, 3039, 334, 382, 5817, 93, 333, 29...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
344
We are given an array A of N lowercase letter strings, all of the same length. Now, we may choose any set of deletion indices, and for each string, we delete all the characters in those indices. For example, if we have an array A = ["babca","bbazb"] and deletion indices {0, 1, 4}, then the final array after deletions is ["bc","az"]. Suppose we chose a set of deletion indices D such that after deletions, the final array has every element (row) in lexicographic order. For clarity, A[0] is in lexicographic order (ie. A[0][0] <= A[0][1] <= ... <= A[0][A[0].length - 1]), A[1] is in lexicographic order (ie. A[1][0] <= A[1][1] <= ... <= A[1][A[1].length - 1]), and so on. Return the minimum possible value of D.length.   Example 1: Input: ["babca","bbazb"] Output: 3 Explanation: After deleting columns 0, 1, and 4, the final array is A = ["bc", "az"]. Both these rows are individually in lexicographic order (ie. A[0][0] <= A[0][1] and A[1][0] <= A[1][1]). Note that A[0] > A[1] - the array A isn't necessarily in lexicographic order. Example 2: Input: ["edcba"] Output: 4 Explanation: If we delete less than 4 columns, the only row won't be lexicographically sorted. Example 3: Input: ["ghi","def","abc"] Output: 0 Explanation: All rows are already lexicographically sorted.   Note: 1 <= A.length <= 100 1 <= A[i].length <= 100
["class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n dp = [(1, 1)] * len(A[0])\n for i in range(len(dp)):\n if i > 0:\n max_pre = None\n for pre in range(i - 1, -1, -1):\n for word in A:\n if word[pre] > word[i]:\n pre -= 1\n break\n else:\n if max_pre is None or dp[pre][1] > dp[max_pre][1]:\n max_pre = pre\n\n max_len = 1 if max_pre is None else max(1, dp[max_pre][1] + 1)\n overall = max(dp[i - 1][0], max_len)\n dp[i] = (overall, max_len)\n # print(dp)\n return len(dp) - dp[-1][0]", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n dp = [(1, 1)] * len(A[0])\n for i in range(len(dp)):\n if i > 0:\n max_pre = None\n for pre in range(i - 1, -1, -1):\n for word in A:\n if word[pre] > word[i]:\n pre -= 1\n break\n else:\n if max_pre is None or dp[pre][1] > dp[max_pre][1]:\n max_pre = pre\n\n max_len = 1 if max_pre is None else max(1, dp[max_pre][1] + 1)\n overall = max(dp[i - 1][0], max_len)\n dp[i] = (overall, max_len)\n return len(dp) - dp[-1][0]", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n H, W = len(A), len(A[0])\n \n def is_valid(j1: int, j2: int) -> bool:\n for i in range(H):\n if A[i][j1] > A[i][j2]:\n return False\n return True\n f = [1 for _ in range(W)]\n max_v = 1\n for i in reversed(range(W - 1)):\n for j in range(i + 1, W):\n if is_valid(i, j):\n f[i] = max(f[i], f[j] + 1)\n max_v = max(max_v, f[i])\n print(f)\n return W - max_v", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n W = len(A[0])\n dp = [1] * W\n for i in range(W-2, -1, -1):\n for j in range(i+1, W):\n if all(row[i] <= row[j] for row in A):\n dp[i] = max(dp[i], 1 + dp[j])\n\n return W - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n dp = [1 for _ in range(n)]\n for i in range(1, n):\n for j in range(i):\n if all(a[j] <= a[i] for a in A):\n dp[i] = max(dp[i], dp[j] + 1)\n \n return n - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n words = len(A[0])\n dp = [1] * words\n \n for i in range(words-2, -1, -1):\n for j in range(i+1, words):\n # for all rows that row[i] <= row[j] set dp[i] = max of dp[i], 1+dp[j]\n if all(row[i] <= row[j] for row in A):\n dp[i] = max(dp[i], 1+dp[j])\n \n return words - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n dp = [1]*n\n for i in range(1, n):\n for j in range(i):\n if all(s[j] <= s[i] for s in A):\n dp[i] = max(dp[i], dp[j] + 1)\n return n - max(dp)\n", "#\n# @lc app=leetcode id=960 lang=python3\n#\n# [960] Delete Columns to Make Sorted III\n#\n# https://leetcode.com/problems/delete-columns-to-make-sorted-iii/description/\n#\n# algorithms\n# Hard (53.38%)\n# Likes: 171\n# Dislikes: 5\n# Total Accepted: 4.5K\n# Total Submissions: 8.5K\n# Testcase Example: '[\\\"babca\\\",\\\"bbazb\\\"]'\n#\n# We are given an array\u00a0A of N lowercase letter strings, all of the same\n# length.\n# \n# Now, we may choose any set of deletion indices, and for each string, we\n# delete all the characters in those indices.\n# \n# For example, if we have an array A = [\\\"babca\\\",\\\"bbazb\\\"] and deletion indices\n# {0, 1, 4}, then the final array after deletions is [\\\"bc\\\",\\\"az\\\"].\n# \n# Suppose we chose a set of deletion indices D such that after deletions, the\n# final array has every element (row) in\u00a0lexicographic order.\n# \n# For clarity, A[0] is in lexicographic order (ie. A[0][0] <= A[0][1] <= ... <=\n# A[0][A[0].length - 1]), A[1] is in lexicographic order (ie. A[1][0] <=\n# A[1][1] <= ... <= A[1][A[1].length - 1]), and so on.\n# \n# Return the minimum possible value of D.length.\n# \n# \n# \n# \n# Example 1:\n# \n# \n# Input: [\\\"babca\\\",\\\"bbazb\\\"]\n# Output: 3\n# Explanation: After deleting columns 0, 1, and 4, the final array is A =\n# [\\\"bc\\\", \\\"az\\\"].\n# Both these rows are individually in lexicographic order (ie. A[0][0] <=\n# A[0][1] and A[1][0] <= A[1][1]).\n# Note that A[0] > A[1] - the array A isn't necessarily in lexicographic\n# order.\n# \n# \n# \n# Example 2:\n# \n# \n# Input: [\\\"edcba\\\"]\n# Output: 4\n# Explanation: If we delete less than 4 columns, the only row won't be\n# lexicographically sorted.\n# \n# \n# \n# Example 3:\n# \n# \n# Input: [\\\"ghi\\\",\\\"def\\\",\\\"abc\\\"]\n# Output: 0\n# Explanation: All rows are already lexicographically sorted.\n# \n# \n# \n# \n# \n# \n# \n# Note:\n# \n# \n# 1 <= A.length <= 100\n# 1 <= A[i].length <= 100\n# \n#\nclass Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n\n # Dynamic Programming\n # Let dp[k] be the number of columns that are kept in answering the question for input [row[k:] for row in A]. The above gives a simple recursion for dp[k].\n # Time complexity: O(N x W^2) where N is the length of A, and W is the length of each word in A.\n # Space complexity: O(W)\n W = len(A[0])\n dp = [1] * W\n for i in range(W - 2, -1, -1):\n for j in range(i + 1, W):\n if all(row[i] <= row[j] for row in A):\n dp[i] = max(dp[i], 1 + dp[j])\n\n return W - max(dp)\n\n \n\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n dp = [1] * n\n for j in range(1, n):\n for i in range(j):\n if all(a[i] <= a[j] for a in A):\n dp[j] = max(dp[j], dp[i] + 1)\n return n - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n m = len(A[0])\n n = len(A)\n dp = [1] * m\n for i in range(1, m):\n for j in range(i):\n if all(a[j] <= a[i] for a in A):\n dp[i] = max(dp[i], dp[j] + 1)\n return m - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ## https://leetcode.com/problems/delete-columns-to-make-sorted-iii/discuss/205679/C%2B%2BJavaPython-Maximum-Increasing-Subsequence\n \n m = len(A)\n n = len(A[0])\n dp = [1] * n\n res = n-1\n for j in range(1, n):\n for i in range(j):\n k = 0\n while k<m and A[k][i] <= A[k][j]:\n k += 1\n if k == m and (1+dp[i])>dp[j]:\n dp[j] = 1+dp[i]\n \n # if all(a[i] <= a[j] for a in A):\n # dp[j] = max(dp[j], dp[i] + 1)\n \n res = min(res, n-dp[j])\n return res\n \n", "class Solution:\n def minDeletionSize(self, A):\n W = len(A[0])\n dp = [1] * W\n for j in range(1, W):\n for i in range(j):\n if all(row[i] <= row[j] for row in A):\n dp[j] = max(dp[i]+1, dp[j])\n return W - max(dp)", "class Solution:\n def minDeletionSize(self, A):\n m, n = len(A), len(A[0])\n dp = [1] * n\n for j in range(1, n):\n for k in range(j):\n if all(A[i][k] <= A[i][j] for i in range(m)):\n dp[j] = max(dp[j], dp[k] + 1)\n return n - max(dp) ", "class Solution:\n def minDeletionSize(self, a: List[str]) -> int:\n n,m = len(a), len(a[0])\n dp = [1 for i in range(m)]\n # dp[0] = 1\n maxx = 1\n for i in range(1, m):\n for j in range(i):\n if all(a[k][i]>=a[k][j] for k in range(n)):\n dp[i] = max(dp[i], dp[j]+1)\n maxx = max(maxx, dp[i])\n return m - maxx", "class Solution(object):\n def minDeletionSize(self, A):\n W = len(A[0])\n dp = [1] * W\n for i in range(W-2, -1, -1):\n for j in range(i+1, W):\n if all(row[i] <= row[j] for row in A):\n dp[i] = max(dp[i], 1 + dp[j])\n\n return W - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n \n l = len(A[0])\n dp = [1] * l\n \n for i in range(1, l):\n for j in range(i):\n if all(a[i] >= a[j] for a in A):\n dp[i] = max(dp[i], dp[j]+1)\n return l-max(dp)\n \n \n \n \n \n \n \n \n \n \n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n memo = [1 for _ in range(len(A[0]))]\n for i in range(len(A[0])):\n for j in range(i):\n if all(A[k][j] <= A[k][i] for k in range(len(A))):\n memo[i] = max(memo[i], memo[j] + 1)\n return len(A[0]) - max(memo)\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n,m = len(A[0]),len(A)\n dp = [1]*n\n for j in range(1,n):\n for i in range(j):\n if all(A[k][i]<=A[k][j] for k in range(m)):\n dp[j] = max(dp[j],1+dp[i])\n return n-max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n dp = [1] * n\n for i in range(n-2, -1, -1):\n for j in range(i+1, n):\n if all(A[k][i]<=A[k][j] for k in range(len(A))):\n dp[i] = max(dp[i], 1+dp[j])\n return n - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n size = len(A[0])\n best = [0] * size\n best[0] = 1\n for i in range(1, size):\n best[i] = 1\n for j in range(0, i):\n if best[j] >= best[i] and self.beats(A, i, j):\n best[i] = best[j] + 1\n \n return size - max(best)\n \n \n def beats(self, A, a, b):\n # Returns True if idx a beats idx b\n for s in A:\n if s[b] > s[a]:\n return False\n \n return True\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n \n l = len(A[0])\n dp = [1 for _ in range(l)] + [0]\n for i in range(len(dp)-1, -1, -1):\n for j in range(i+1, l):\n if all(A[k][i] <= A[k][j] for k in range(len(A))):\n dp[i] = max(dp[i], dp[j]+1)\n \n \n return l - max(dp)", "class Solution:\n def less_than(self,A,i,j):\n for r in range(len(A)):\n if ord(A[r][i]) > ord(A[r][j]):\n return False\n return True\n \n def minDeletionSize(self, A: List[str]) -> int:\n #for r in A:\n # print(r)\n # for i in range(1,len(A[0])):\n # print(self.less_than(A,i-1,i))\n n = len(A[0])\n dp = [ 1 for i in range(n)]\n \n for i in range(1,n):\n #print(\\\"i=\\\",i)\n j = i-1\n while(j>=0):\n #print(j,i,self.less_than(A,j,i))\n if self.less_than(A,j,i):\n dp[i] = max(dp[i],dp[j]+1)\n j -=1\n #print(i,dp)\n \n return n-max(dp)\n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n N = len(A)\n wordLen = len(A[0])\n \n table = [1 for _ in range(wordLen)]\n \n for i in range(wordLen-2, -1, -1):\n subAnsSet = set()\n for k in range(i+1, wordLen):\n if A[0][i] <= A[0][k]:\n subAnsSet.add(k) \n for j in range(1, N):\n nextSubAnsSet = set()\n for k in subAnsSet:\n if A[j][i] <= A[j][k]:\n nextSubAnsSet.add(k)\n subAnsSet &= nextSubAnsSet\n table[i] = max([table[k]+1 for k in subAnsSet]+[1])\n return wordLen - max(table)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n def compare(i, j):\n return all(A[k][i] <= A[k][j] for k in range(len(A)))\n \n l = len(A[0])\n dp = [1 for _ in range(l)] + [0]\n for i in range(len(dp)-1, -1, -1):\n for j in range(i+1, l):\n if compare(i, j):\n dp[i] = max(dp[i], dp[j]+1)\n \n \n return l - max(dp[i] for i in range(l))", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n m, n = len(A), len(A[0])\n dp = [0] * (n + 1)\n for i in range(n - 1, -1, -1):\n for j in range(i + 1):\n a = 1 + dp[j]\n b = 10 ** 9\n if j == 0 or all(A[k][i] >= A[k][j - 1] for k in range(m)):\n b = dp[i + 1]\n dp[j] = min(a, b)\n return dp[0]", "class Solution:\n def less_than(self,A,i,j):\n for r in range(len(A)):\n if ord(A[r][i]) > ord(A[r][j]):\n return False\n return True\n \n def minDeletionSize(self, A: List[str]) -> int:\n for r in A:\n print(r)\n # for i in range(1,len(A[0])):\n # print(self.less_than(A,i-1,i))\n n = len(A[0])\n dp = [ 1 for i in range(n)]\n \n for i in range(1,n):\n #print(\\\"i=\\\",i)\n j = i-1\n while(j>=0):\n #print(j,i,self.less_than(A,j,i))\n if self.less_than(A,j,i):\n dp[i] = max(dp[i],dp[j]+1)\n j -=1\n #print(i,dp)\n \n return n-max(dp)\n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n @lru_cache(None)\n def dp(i, j):\n if i == n:\n return 0\n a = 1 + dp(i + 1, j)\n b = 10 ** 9\n if j == -1 or all(A[k][i] >= A[k][j] for k in range(m)):\n b = dp(i + 1, i)\n return min(a, b)\n \n m, n = len(A), len(A[0])\n return dp(0, -1)", "from functools import lru_cache\n\n\nclass Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n R, C = len(A), len(A[0])\n \n def col_lower(j1, j2):\n return all(A[i][j1] <= A[i][j2] for i in range(R))\n \n @lru_cache(None)\n def LIS(i):\n if i == 0:\n return 1\n \n return max(\n (LIS(j) for j in range(i) if col_lower(j, i)),\n default=0,\n ) + 1\n\n return C - max(LIS(i) for i in range(C))\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n dp = {-1: 0}\n for j in range(len(A[0])):\n new = defaultdict(lambda: 0)\n for k, v in list(dp.items()):\n if k == -1:\n new[-1] = 0\n new[j] = 1\n else:\n if all(ord(A[i][k]) <= ord(A[i][j]) for i in range(len(A))):\n new[j] = max(new[j], v + 1)\n new[k] = max(new[k], v)\n dp = new\n \n return len(A[0]) - max(dp.values())\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n l,m = len(A),len(A[0])\n f = [i for i in range(m)]\n f[0] = 0\n for i in range(1,m):\n for j in range(0,i):\n flag = True\n for k in range(l):\n if A[k][j] > A[k][i]:\n flag = False\n break\n if flag:\n f[i] = min(f[i],f[j]+i-j-1)\n \n # print(f)\n # g = [f[i]+m-1-i for i in range(m)]\n # print(g)\n # return min(g)\n return min([f[i]+m-1-i for i in range(m)])\n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n word_length = len(A[0])\n dp = [1] * word_length\n \n for index in range(word_length):\n for curr in range(index - 1, -1, -1):\n poss = True\n for k in range(len(A)):\n if A[k][index] < A[k][curr]:\n poss = False\n break\n if poss:\n dp[index] = max(dp[index], 1 + dp[curr])\n return word_length - max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n m, n = len(A), len(A[0])\n memo = [1] * n\n for i in range(n):\n for j in range(i):\n for k in range(m):\n if A[k][j] > A[k][i]:\n break\n else:\n memo[i] = max(memo[i], memo[j] + 1)\n return n - max(memo)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n m = len(A)\n n = len(A[0])\n dp = [1 for i in range(n)]\n maxVal = 1\n \n def check(i, j):\n for k in range(m):\n if A[k][i] < A[k][j]:\n return False\n return True\n \n for i in range(1, n):\n for j in range(i):\n if check(i, j):\n dp[i] = max(dp[i], dp[j]+1)\n maxVal = max(maxVal, dp[i])\n \n return n - maxVal", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n dp = [1]*len(A[0])\n for j in range(1,len(A[0])):\n for k in range(j):\n isAfter = True\n for i in range(len(A)):\n if A[i][k] > A[i][j]:\n isAfter = False\n break\n if isAfter:\n dp[j] = max(dp[j],dp[k]+1)\n return len(A[0])-max(dp)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n def printi(i,*string):\n if i==len(A[0])-1:\n print(string)\n dp = [1]*len(A[0])\n for j in range(1,len(A[0])):\n for k in range(j):\n isAfter = True\n for i in range(len(A)):\n if A[i][k] > A[i][j]:\n isAfter = False\n break\n if isAfter:\n dp[j] = max(dp[j],dp[k]+1)\n print(dp)\n return len(A[0])-max(dp)"]
{"fn_name": "minDeletionSize", "inputs": [[["\"babca\"", "\"bbazb\""]]], "outputs": [4]}
interview
https://leetcode.com/problems/delete-columns-to-make-sorted-iii/
class Solution: def minDeletionSize(self, A: List[str]) -> int:
[ 1654, 525, 2661, 458, 1334, 4102, 32, 315, 451, 42047, 6524, 9069, 11, 678, 315, 279, 1852, 3084, 624, 7039, 11, 582, 1231, 5157, 894, 738, 315, 36066, 14937, 11, 323, 369, 1817, 914, 11, 582, 3698, 678, 279, 5766, 304, 1846, 14937,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,535
Some new cashiers started to work at your restaurant. They are good at taking orders, but they don't know how to capitalize words, or use a space bar! All the orders they create look something like this: `"milkshakepizzachickenfriescokeburgerpizzasandwichmilkshakepizza"` The kitchen staff are threatening to quit, because of how difficult it is to read the orders. Their preference is to get the orders as a nice clean string with spaces and capitals like so: `"Burger Fries Chicken Pizza Pizza Pizza Sandwich Milkshake Milkshake Coke"` The kitchen staff expect the items to be in the same order as they appear in the menu. The menu items are fairly simple, there is no overlap in the names of the items: ``` 1. Burger 2. Fries 3. Chicken 4. Pizza 5. Sandwich 6. Onionrings 7. Milkshake 8. Coke ```
["def get_order(order):\n menu = ['burger', 'fries', 'chicken', 'pizza', 'sandwich', 'onionrings', 'milkshake', 'coke']\n clean_order = ''\n for i in menu:\n clean_order += (i.capitalize() + ' ') * order.count(i)\n return clean_order[:-1]", "MENU = [\"Burger\", \"Fries\", \"Chicken\", \"Pizza\", \"Sandwich\", \"Onionrings\", \"Milkshake\", \"Coke\"]\n\ndef get_order(order):\n result = []\n for item in MENU:\n result.extend([item for _ in range(order.count(item.lower()))])\n return \" \".join(result)", "menu = \"Burger Fries Chicken Pizza Sandwich Onionrings Milkshake Coke\".split()\n\ndef get_order(order):\n return \" \".join(item for item in menu for _ in range(order.count(item.lower())))\n", "def get_order(order):\n output=\"\"\n while order != \"\":\n if output==\"\":\n if order.find(\"burger\") != -1:\n output+=\"Burger\"\n order=order.replace(\"burger\",\"\", 1)\n elif order.find(\"fries\") != -1:\n output+=\"Fries\"\n order=order.replace(\"fries\",\"\",1)\n elif order.find(\"chicken\") != -1:\n output+=\"Chicken\"\n order=order.replace(\"chicken\",\"\",1)\n elif order.find(\"pizza\") != -1:\n output+=\"Pizza\"\n order=order.replace(\"pizza\",\"\",1)\n elif order.find(\"sandwich\") != -1:\n output+=\"Sandwich\"\n order=order.replace(\"sandwich\",\"\",1)\n elif order.find(\"onionrings\") != -1:\n output+=\"Onionrings\"\n order=order.replace(\"onionrings\",\"\",1)\n elif order.find(\"milkshake\") != -1:\n output+=\"Milkshake\"\n order=order.replace(\"milkshake\",\"\",1)\n elif order.find(\"coke\") != -1:\n output+=\"Coke\"\n order=order.replace(\"coke\",\"\",1)\n elif output!=\"\":\n if order.find(\"burger\") != -1:\n output+=\" Burger\"\n order=order.replace(\"burger\",\"\",1)\n elif order.find(\"fries\") != -1:\n output+=\" Fries\"\n order=order.replace(\"fries\",\"\",1)\n elif order.find(\"chicken\") != -1:\n output+=\" Chicken\"\n order=order.replace(\"chicken\",\"\",1)\n elif order.find(\"pizza\") != -1:\n output+=\" Pizza\"\n order=order.replace(\"pizza\",\"\",1)\n elif order.find(\"sandwich\") != -1:\n output+=\" Sandwich\"\n order=order.replace(\"sandwich\",\"\",1)\n elif order.find(\"onionrings\") != -1:\n output+=\" Onionrings\"\n order=order.replace(\"onionrings\",\"\",1)\n elif order.find(\"milkshake\") != -1:\n output+=\" Milkshake\"\n order=order.replace(\"milkshake\",\"\",1)\n elif order.find(\"coke\") != -1:\n output+=\" Coke\"\n order=order.replace(\"coke\",\"\",1)\n return output", "import re\n\nMENU = {v:i for i,v in enumerate(\"Burger Fries Chicken Pizza Sandwich Onionrings Milkshake Coke\".split())}\nREG_CMD = re.compile('|'.join(MENU), flags=re.I)\n\ndef get_order(order):\n return ' '.join(sorted( map(str.title, REG_CMD.findall(order)),\n key=MENU.get ))", "from re import findall\n\ndef get_order(order):\n menu = ['Burger','Fries','Chicken','Pizza','Sandwich','Onionrings','Milkshake','Coke']\n return ' '.join(filter(None, (' '.join(findall(item.lower(), order)).title() for item in menu)))", "def get_order(order):\n menu, Menu = [\"burger\", \"fries\", \"chicken\", \"pizza\", \"sandwich\", \"onionrings\", \"milkshake\", \"coke\"], [\"Burger\", \"Fries\", \"Chicken\", \"Pizza\", \"Sandwich\", \"Onionrings\", \"Milkshake\", \"Coke\"]\n str, num = \"\", 0\n lst, lst2, result = [], [], []\n for letter in order:\n str += letter\n if str in menu:\n lst.append(str)\n str = \"\"\n for word in lst:\n lst2.append(word.capitalize())\n for counter in range(0,8):\n for word in lst2:\n if word == Menu[counter]:\n result.append(word)\n return \" \".join(result)", "import re\n\nMENU = ['burger', 'fries', 'chicken', 'pizza', 'sandwich', 'onionrings', 'milkshake', 'coke']\n\ndef get_order(order):\n res = []\n for item in MENU:\n res.extend(re.findall(item, order))\n return ' '.join([item.capitalize() for item in res])", "get_order = lambda order: \"\".join([item*order.count(item[1:].lower()) for item in \" Burger, Fries, Chicken, Pizza, Sandwich, Onionrings, Milkshake, Coke\".split(',')])[1:]", "def get_order(order):\n menu = [\n \"Burger\",\n \"Fries\",\n \"Chicken\",\n \"Pizza\",\n \"Sandwich\",\n \"Onionrings\",\n \"Milkshake\",\n \"Coke\",\n]\n return \"\".join([(item + \" \") * order.count(item.lower()) for item in menu]).strip()", "def get_order(order):\n word =\"\"\n list = [\"Burger\" ,\"Fries\",\"Chicken\",\"Pizza\", \"Sandwich\",\"Onionrings\",\"Milkshake\",\"Coke\" ]\n for i in list:\n word = word+(\" \"+i)*order.count(i.lower())\n return word.strip()"]
{"fn_name": "get_order", "inputs": [["burgerfriesfriesfriesfriesfriespizzasandwichcokefriesburger"]], "outputs": [["Burger Burger Fries Fries Fries Fries Fries Fries Pizza Sandwich Coke"]]}
introductory
https://www.codewars.com/kata/5d23d89906f92a00267bb83d
def get_order(order):
[ 8373, 501, 8350, 4813, 3855, 311, 975, 518, 697, 10729, 13, 4710, 6865, 525, 1661, 518, 4633, 10163, 11, 714, 807, 1513, 944, 1414, 1246, 311, 52725, 4244, 11, 476, 990, 264, 3550, 3619, 0, 4710, 2403, 279, 10163, 807, 1855, 1401, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,271
We want an array, but not just any old array, an array with contents! Write a function that produces an array with the numbers `0` to `N-1` in it. For example, the following code will result in an array containing the numbers `0` to `4`: ``` arr(5) // => [0,1,2,3,4] ```
["def arr(n=0): \n return list(range(n))", "def arr(n=0): \n return [i for i in range(n)]", "def arr(n=0): \n return [*range(n)]", "def arr(n=0): \n # [ the numbers 0 to N-1 ]\n aux = []\n for x in range(n):\n aux.append(x)\n return aux\n", "def arr(n=int()): return list(range(int(),n))", "arr = lambda n=0: list(range(n))", "def arr(n=0): \n lst = [i for i in range(n)]\n return lst", "def arr(n=0): \n return [ x for x in range(n)] if n>0 else []", "def arr(n = ''): \n # [ the numbers 0 to N-1 ]\n n = str(n)\n if len(n) == 0:\n return []\n n = int(n)\n array = []\n for i in range(n):\n array.append(i)\n return(array)\n", "def arr(n = None):\n \n if n is None:\n return []\n \n result = []\n for i in range(0, n):\n result.append(i)\n return result\n\n\n # [ the numbers 0 to N-1 ]\n", "arr = lambda n=0: [i for i in range(n)]", "def arr(n=0): #To handle a call without an argument, e.g. arr(), default arg to 0\n if n==0:\n return []\n else:\n return [i for i in range(n)]\n#end function arr\n", "def arr(n = 0):\n arrey = []\n num = 0\n for i in range(n):\n arrey.append(num)\n num+=1\n return arrey\n", "arr=lambda a=0:[*range(a)]", "from typing import List, Tuple, Optional\n\ndef arr(*args: Optional[Tuple[int]]) -> List[int]:\n \"\"\" Get an array with the numbers 0 to N-1 in it. \"\"\"\n return list(range(0, *args))", "arr\\\n=\\\nlambda\\\nn\\\n=\\\n0\\\n:\\\n[\n*\nrange\n(\nn\n)\n]", "arr = lambda _=0: [*range(_)]", "def arr(n=0):\n arr = list()\n if n>0:\n for i in range(0,n):\n arr.append(i)\n else:\n return []\n return arr", "def arr(n=0): \n if n == None: return []\n if n == 0: return []\n if n == 1: return [0]\n else: return arr(n-1) + [n-1]", "def arr(*n):\n try:\n return [*range(n[0])]\n except:\n return []", "arr=lambda a=0:list(range(a))", "def arr(n=0):\n arrays = []\n for x in range(n):\n arrays.append(x)\n return arrays", "def arr(n=0):\n array = []\n for num in range(0, n):\n array.append(num)\n return array", "def arr(n=0): \n # [ the numbers 0 to N-1 ]\n myarray = []\n for i in range(0,n): myarray.append(i)\n \n return myarray", "def arr(n = 0):\n count = []\n for i in range(n):\n count.append(i)\n return(count)\n \n", "def arr(n = 0): \n list = []\n \n if n:\n for x in range(n):\n list.append(x)\n \n return list", "def arr(n=0): \n tmp=[]\n if n>0:\n for j in range(0,n):\n tmp.append(j)\n return(tmp)", "def arr(n=0): \n lst = list(range(n))\n return lst\n\n \n", "def arr(n = None):\n if n is None:\n return []\n new_arr = []\n for x in range(0,n):\n new_arr.append(x)\n return new_arr\n\n\n", "def arr(*n): \n # [ the numbers 0 to N-1 ]\n if len(n) == 0:\n x = 0\n else:\n x = n[0]\n return list(range(0, x))", "def arr(n=None):\n\n if n == 0 or n == None:\n array = []\n else:\n array = [i for i in range(n)]\n return array", "def arr(n=None):\n if n is None:\n return []\n L = []\n for i in range(n):\n L.append(i)\n return L", "def arr(n = 0): \n i = 0\n tab = []\n \n while i < n:\n tab.append(i)\n i += 1\n return tab\n", "def arr(n=None):\n if not n:\n return []\n else:\n return [n for n in range(n)]", "def arr(n = None):\n res = []\n \n if n == None:\n return res\n else:\n for i in range(n):\n res.append(i)\n return res\n\n\n # [ the numbers 0 to N-1 ]\n", "def arr(n = None): \n array = []\n if n is None:\n return array\n elif n >= 0:\n for i in range(n):\n array.append(i)\n return array", "def arr(n=0): \n solution = []\n x = -1\n if n == 0:\n return []\n else:\n while len(solution) < n:\n x += 1\n solution.append(x)\n return solution\n", "def arr(n=0): \n solution = []\n x = -1\n if n == 0:\n return []\n else:\n while len(solution) < n:\n x += 1\n solution.append(x)\n return solution", "def arr(n=None): # None for if no arguments passed\n # [ the numbers 0 to N-1 ]\n a = []\n if n is None:\n return a\n else:\n for i in range(n):\n a.append(i)\n return a", "import numpy\ndef arr(n=0):\n return list(range(n))\n", "def arr(n=None): \n s = []\n if n == None:\n return s\n else:\n for i in range(n):\n s.append(i)\n return s", "def arr(n=0):\n\n array = []\n for i in range(n):\n array.append(i)\n i += 1\n return array", "def arr(n=-1):\n if n == -1:\n return []\n else:\n return [num for num in range(n)]", "def arr(n=0): \n # [ the numbers 0 to N-1 ]\n lst = []\n for num in range(0, n) :\n if num not in lst : \n lst.append(num)\n else :\n return ''\n \n return lst ", "def arr(n = 0):\n lis = []\n if not n:\n return lis\n else:\n for i in range (0, n):\n lis.append(i)\n return lis", "def arr(n = []):\n if n == []:\n return []\n a = range(0, n)\n return list(a) if n > 0 else []", "def arr(n): \n return(list(range(n)))\ndef arr(n=0): \n return(list(range(n)))\n # [ the numbers 0 to N-1 ]\n", "def arr(n = 0): \n if n is None: \n return n\n return list(range(n))", "def arr(n=0):\n n = list(range(0, n))\n return n# [ the numbers 0 to N-1 ]", "def arr(n = -1): \n if n != -1:\n return [i for i in range(n)]\n else:\n return list()", "def arr(*n): \n return list(range(n[0])) if len(n) > 0 else []", "def arr(n=0): \n test = []\n if (n > 0):\n for i in range(n):\n test.append(i)\n return test \n", "def arr(n=0): \n i = 0\n a = [i for i in range(0, n)]\n return a", "def arr(*n): \n # [ the numbers 0 to N-1 ]\n print(*n)\n res = []\n if(n == () or n == 0):\n return []\n else:\n for i in range((*n)):\n res.append(i)\n return res", "def arr(n=0): \n list = []\n for n in range(0,n):\n list.append(n)\n \n return list", "def arr(n=0):\n a = [] \n for i in range(n):\n a.append(i)\n return a\n\nprint(arr(4))\nprint(arr(0))\nprint(arr())", "def arr(n=0): \n if n == 0:\n lst = []\n return lst\n else:\n return [x for x in range(n)]", "def arr(*n):\n for m in n:\n return [i for i in range(0,m)]\n return []", "def arr(n=0): \n list = []\n while n != 0:\n list.append(n-1)\n n -= 1\n list.sort()\n return list\n", "def arr(n=0): \n \n i = 0;\n ergebnis = [];\n \n if n == ():\n return ergebnis;\n else:\n \n while i < n:\n ergebnis.append(i);\n i = i + 1;\n return ergebnis;", "def arr(*args): \n return [i for i in range(args[0])] if args else []", "def arr(n=0): \n \n return [*list(range(0,n,1))]\n", "def arr(n=0):\n range(n)\n return list(range(n))", "def arr(n=0): \n if n == 0 or n is None: \n return []\n else:\n return list(range(n))\n", "def arr(n=0): \n if n == 0:\n return []\n else:\n if n == '' in arr(n):\n return list(print(-1))\n else:\n return list(range(n))\n", "def arr(n=''):\n if n == '':\n return []\n else:\n lista = []\n n = int(n)\n for i in range(n):\n caracter =int(i)\n lista.append(caracter)\n return lista", "def arr(n: int = 0) -> list:\n return [*list(range(n))] if n > 0 else []\n", "def arr(n = 0): \n # [ the numbers 0 to N-1 ]\n array = []\n counter = 0\n while counter < n:\n array.append(counter)\n counter += 1 \n return array", "\ndef arr(n = 0):\n if n > 0:\n x = []\n for i in range(n):\n x.append(i)\n return x\n else:\n return []\n", "\n\ndef arr(n=None): \n # [ the numbers 0 to N-1 ]\n lst = []\n if n is None:\n return lst\n else:\n while n > 0:\n lst.append(n-1)\n n -= 1\n return sorted(lst)\n", "def arr(n=0): \n lst = []\n if n > 0:\n for n in range(n):\n lst.append(n)\n print(lst)\n return lst\n else:\n return lst\n \nprint(arr())", "\n\ndef arr(n=[]):\n if not n:\n return []\n else:\n return list(range(0,n))", "def arr(n=0):\n list = []\n if n == 0:\n return list\n for i in range(0, n):\n list.append(i)\n return list", "def arr(n = None):\n l_1 = []\n if n is not None:\n for i in range(0,n):\n l_1.append(i)\n else:\n l_1 = []\n return l_1\n", "def arr(*args): \n return [number for number in range(0,*args)]", "def arr(n=None):\n if n is not None:\n return list(range(n))\n else:\n return []", "def arr(n=0):\n if n==0:\n return []\n else:\n return [i for i in range(n)]", "def arr(n=0): \n arr =[]\n if n == 0:\n return arr\n for i in range(n):\n arr.append(i)\n return arr", "def arr(n = 0): \n # [ the numbers 0 to N-1 ]\n array = []\n x = 0\n while x < n:\n array.append(x)\n x+= 1\n return array", "def arr(n=0): \n # [ the numbers 0 to N-1 ]\n num_list = []\n \n if n < 1:\n return num_list \n else:\n for i in range(n):\n if i < n:\n num_list.append(i) \n return num_list", "def arr(n=None): \n if n:\n return [i for i in range(n)]\n else:\n return []", "arr = lambda n = 0: [x for x in range(0, n)]", "def arr(n = 0): \n List = []\n for x in range(n):\n List.append(x)\n return List", "def arr(n=[]):\n if n==[]:\n answer=[]\n else:\n answer=[n for n in range(n)]\n return answer", "def arr(*n): \n try:\n return [i for i in range(n[0]) if n !=0]\n except IndexError: \n return []", "def arr(n=None): \n # [ the numbers 0 to N-1 ]\n array = []\n if(n is not None and n>=0):\n for i in range(n):\n array.append(i)\n return array", "def arr(n = 0): \n if n == 0:\n return []\n return list(range(0,n))", "def arr(n = 0):\n content = []\n if(n > 0):\n for i in range(n):\n content.append(i)\n return content", "def arr(n = 0):\n xyu = []\n while n > 0:\n n -= 1\n xyu.append (n)\n xyu.sort ()\n return xyu", "def arr(n=0):\n print(type(n))\n array = []\n for x in range(n):\n array.append(x)\n print (type(array[x]))\n return array", "def arr(n = 0): \n lst = []\n if n == 0:\n return []\n else:\n for i in range(n):\n lst.append(i)\n return lst", "def arr(n = 0): \n # [ the numbers 0 to N-1 ]\n i = 0;\n a = []\n if n == 0:\n return []\n while(i < n):\n a.append(i)\n i+=1\n return a", "def arr(n = 0):\n a = []\n i = 0\n while i < n:\n a.append(i)\n i = i + 1\n return a", "def arr(n=None):\n l = []\n if (n==None or n==0): return l\n for i in range(n):\n l.append(i)\n return l", "def arr(n=0):\n # [ the numbers 0 to N-1 ]\n tomb = []\n for i in range(n):\n tomb.append(i)\n return tomb\n", "def arr(n=0):\n if not arr:\n return []\n new_list = []\n for element in range(n):\n new_list.append(element)\n return new_list", "def arr(n=0): \n c=[]\n for i in range(n):\n c.append(i)\n return c\n\n", "def arr(n=None): \n if n is None:\n return []\n else:\n return list(range(n))", "def arr(*args): \n array = []\n if args:\n for i in range(args[0]):\n array.append(i)\n \n return array", "def arr(n=0): \n # [ the numbers 0 to N-1 ]\n if(n):\n return list(range(0,n))\n else:\n return []"]
{"fn_name": "arr", "inputs": [[4], [0]], "outputs": [[[0, 1, 2, 3]], [[]]]}
introductory
https://www.codewars.com/kata/571d42206414b103dc0006a1
def arr(n=0):
[ 1654, 1366, 458, 1334, 11, 714, 537, 1101, 894, 2310, 1334, 11, 458, 1334, 448, 8794, 2219, 7985, 264, 729, 429, 18644, 458, 1334, 448, 279, 5109, 1565, 15, 63, 311, 1565, 45, 12, 16, 63, 304, 432, 382, 2461, 3110, 11, 279, 2701, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,875
Given the root of a tree, you are asked to find the most frequent subtree sum. The subtree sum of a node is defined as the sum of all the node values formed by the subtree rooted at that node (including the node itself). So what is the most frequent subtree sum value? If there is a tie, return all the values with the highest frequency in any order. Examples 1 Input: 5 / \ 2 -3 return [2, -3, 4], since all the values happen only once, return all of them in any order. Examples 2 Input: 5 / \ 2 -5 return [2], since 2 happens twice, however -5 only occur once. Note: You may assume the sum of values in any subtree is in the range of 32-bit signed integer.
["class Solution:\n \n def findFrequentTreeSum(self, root):\n self.sums = []\n if not root:\n return []\n self.traverse(root)\n res = collections.Counter(self.sums)\n frequent = max(res.values())\n return [x for x in res if res[x] == frequent]\n \n \n def traverse(self, root):\n if not root:\n return 0\n \n self_sum = root.val + self.traverse(root.left) + self.traverse(root.right)\n \n self.sums.append(self_sum)\n return self_sum\n", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n if root == None: return []\n m = collections.defaultdict(int)\n self.helper(root, m)\n max_value = max(m.values())\n res = []\n for v in m.keys():\n if m.get(v) == max_value:\n res.append(v)\n return res\n \n def helper(self, node, m):\n if not node:\n return 0\n left, right = self.helper(node.left, m), self.helper(node.right, m)\n m[node.val+left+right]+=1\n return node.val + left + right", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n from collections import defaultdict\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n def get_sum(node):\n if node == None:\n return 0\n sum = node.val + get_sum(node.left) + get_sum(node.right)\n sum_freq[sum] += 1\n return sum\n \n # Calculate sum for all subtrees and save them in dict `sum_freq`\n sum_freq = defaultdict(lambda: 0)\n get_sum(root)\n if not sum_freq:\n return []\n # Filter sums by the highest frequency\n max_freq = max(sum_freq.values())\n return [sum for (sum, freq) in sum_freq.items() if freq == max_freq]\n \n", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n if root == None: return []\n m = collections.defaultdict(int)\n self.helper(root, m)\n max_value = max(m.values())\n res = []\n for v in m.keys():\n if m[v] == max_value:\n res.append(v)\n return res\n \n def helper(self, node, m):\n if not node:\n return 0\n left, right = self.helper(node.left, m), self.helper(node.right, m)\n m[node.val+left+right]+=1\n return node.val + left + right", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n from collections import defaultdict\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n if not root:\n return []\n self.convert_tree(root)\n self.counter = defaultdict(int)\n self.dfs(root)\n \n max_ct = max(self.counter.values())\n return [k for k, ct in self.counter.items() if ct == max_ct]\n \n def convert_tree(self, node):\n \"\"\"\n Convert each node's 'val' into it's subtree sum\n \"\"\"\n if not node:\n return\n \n if node.left:\n self.convert_tree(node.left)\n node.val += node.left.val\n if node.right:\n self.convert_tree(node.right)\n node.val += node.right.val\n \n def dfs(self, node):\n if node:\n self.counter[node.val] += 1\n self.dfs(node.left)\n self.dfs(node.right)\n ", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n res = dict()\n def helper(root):\n if not root:\n return 0\n val = root.val + helper(root.left) + helper(root.right)\n if val in res:\n res[val] += 1\n else:\n res[val] = 1\n return val\n \n helper(root)\n if not res:\n return []\n \n max_val = max(res.values())\n return [k for k, v in res.items() if v == max_val]", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n if not root: return []\n D = dict()\n def AccuTree(root):\n if not root: return 0\n leftA = AccuTree(root.left)\n rightA = AccuTree(root.right)\n Accu = leftA + rightA + root.val\n if D.get(Accu): D[Accu] += 1\n else: D[Accu] = 1\n return Accu\n AccuTree(root)\n maxVal = max(D.values())\n return [x for x in D.keys() if D[x] == maxVal]", "from collections import defaultdict\n # Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n \"\"\"\n :type root: TreeNode\n :rtype: map{sum:int : frequency:int} \n \"\"\"\n def __init__(self):\n self._iter = 0\n def getAllSums(self, root):\n if not root:\n return defaultdict(int), 0\n all_sums, left_sum = self.getAllSums(root.left)\n all_right_sums, right_sum = self.getAllSums(root.right) \n # mege both maps\n for key,val in all_right_sums.items():\n all_sums[key] += val\n cur_sum = right_sum + root.val + left_sum\n all_sums[cur_sum] += 1\n return all_sums, cur_sum\n \n def findFrequentTreeSum(self, root):\n \"\"\"\n :type root: TreeNode\n :rtype: List[int]\n \"\"\"\n all_sums,_ = self.getAllSums(root)\n result = []\n max_occurence = 0\n for key,val in all_sums.items():\n max_occurence = max(max_occurence,val)\n for key,val in all_sums.items():\n if val == max_occurence:\n result.append(key)\n return result\n ", "# Definition for a binary tree node.\n # class TreeNode:\n # def __init__(self, x):\n # self.val = x\n # self.left = None\n # self.right = None\n \n class Solution:\n def findFrequentTreeSum(self, root):\n from collections import defaultdict\n f = defaultdict(int) \n def treeSum(root):\n if not root: return 0\n s = root.val + treeSum(root.left) + treeSum(root.right)\n f[s] += 1 \n return s\n treeSum(root)\n ans = []\n if not f: return ans \n max_freq = max(f.values()) \n for s in f:\n if f[s] == max_freq: \n ans.append(s)\n return ans\n \n "]
interview
https://leetcode.com/problems/most-frequent-subtree-sum/
# Definition for a binary tree node. class TreeNode: def __init__(self, val=0, left=None, right=None): self.val = val self.left = left self.right = right class Solution: def findFrequentTreeSum(self, root: TreeNode) -> List[int]:
[ 22043, 279, 3704, 315, 264, 4916, 11, 498, 525, 4588, 311, 1477, 279, 1429, 20757, 53464, 2629, 13, 576, 53464, 2629, 315, 264, 2436, 374, 4512, 438, 279, 2629, 315, 678, 279, 2436, 2750, 14122, 553, 279, 53464, 40876, 518, 429, 2436,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,118
###Lucky number Write a function to find if a number is lucky or not. If the sum of all digits is 0 or multiple of 9 then the number is lucky. `1892376 => 1+8+9+2+3+7+6 = 36`. 36 is divisble by 9, hence number is lucky. Function will return `true` for lucky numbers and `false` for others.
["def is_lucky(n):\n return n % 9 == 0", "def is_lucky(n):\n sume=0\n for i in str(n):\n sume+=int(i)\n return True if sume%9==0 else False ", "def is_lucky(n):\n digits = list(str(n))\n return sum(list(map(int, digits)))%9==0", "def is_lucky(n):\n return sum([int(i) for i in str(n)]) % 9 == 0", "def is_lucky(n):\n x = 0\n for i in str(n):\n x = x + int(i)\n return True if x % 9 == 0 else False", "is_lucky=lambda n:n%9<1", "def is_lucky(n):\n count = 0\n n = str(n)\n for i in n:\n count += int(i)\n if count == 0 or count % 9 == 0:\n return True\n return False", "def is_lucky(n):\n sum = 0\n for number in str(n):\n sum += int(number)\n return sum % 9 == 0", "def is_lucky(n):\n print(36%9)\n res = 0 \n \n for x in str(n): \n res += int(x)\n \n if res % 9 == 0: return True \n else: return False ", "def is_lucky(n):\n return not n or not n%9"]
{"fn_name": "is_lucky", "inputs": [[1892376], [189237], [18922314324324234423437], [189223141324324234423437], [1892231413243242344321432142343423437], [0]], "outputs": [[true], [false], [false], [true], [true], [true]]}
introductory
https://www.codewars.com/kata/55afed09237df73343000042
def is_lucky(n):
[ 14374, 43, 10073, 1372, 271, 7985, 264, 729, 311, 1477, 421, 264, 1372, 374, 17605, 476, 537, 13, 1416, 279, 2629, 315, 678, 18509, 374, 220, 15, 476, 5248, 315, 220, 24, 1221, 279, 1372, 374, 17605, 382, 63, 16, 23, 24, 17, 18, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,475
We are given an array A of N lowercase letter strings, all of the same length. Now, we may choose any set of deletion indices, and for each string, we delete all the characters in those indices. For example, if we have an array A = ["abcdef","uvwxyz"] and deletion indices {0, 2, 3}, then the final array after deletions is ["bef", "vyz"], and the remaining columns of A are ["b","v"], ["e","y"], and ["f","z"].  (Formally, the c-th column is [A[0][c], A[1][c], ..., A[A.length-1][c]]). Suppose we chose a set of deletion indices D such that after deletions, each remaining column in A is in non-decreasing sorted order. Return the minimum possible value of D.length.   Example 1: Input: A = ["cba","daf","ghi"] Output: 1 Explanation: After choosing D = {1}, each column ["c","d","g"] and ["a","f","i"] are in non-decreasing sorted order. If we chose D = {}, then a column ["b","a","h"] would not be in non-decreasing sorted order. Example 2: Input: A = ["a","b"] Output: 0 Explanation: D = {} Example 3: Input: A = ["zyx","wvu","tsr"] Output: 3 Explanation: D = {0, 1, 2}   Constraints: 1 <= A.length <= 100 1 <= A[i].length <= 1000
["class Solution:\n def minDeletionSize(self, A: List[str]) -> int: \n return sum([list(col) != sorted(col) for col in zip(*A)])\n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int: \n return sum(list(col) != sorted(col) for col in zip(*A))\n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n if (len(A) <= 1):\n return 0\n elif len(A[1]) == 1:\n return 0\n D = []\n for i in range(0, len(A[0])):\n col = [a[i] for a in A]\n col_sort = sorted(col)\n if col != col_sort:\n D.append(i)\n return len(D)\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n res = 0\n for i in range(n):\n col = [a[i] for a in A]\n if col != sorted(col):\n res += 1\n return res", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n result=0\n M=len(A[0])\n for i in range(M):\n col=[row[i] for row in A]\n if col!=sorted(col):\n result+=1\n return result\n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ans = 0\n for i,word in enumerate(zip(*A)):\n for j in range(len(word)-1):\n if word[j] > word[j+1]:\n ans += 1\n break\n \n return ans", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n delete_size = 0\n cols = zip(*A)\n for col in cols:\n for a, b in zip(col, col[1:]):\n if a > b:\n delete_size += 1\n break\n return delete_size", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n D = 0\n for col in zip(*A):\n p = chr(0)\n for c in col:\n if c < p:\n D += 1\n break\n p = c\n return D", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n return sum(any(i > j for i, j in zip(t, t[1:])) for t in zip(*A))", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n length = len(A[0])\n noofstr = len(A)\n #print(length, noofstr)\n \n for i in range(length):\n increasing = True\n for j in range(1,noofstr):\n if A[j][i] < A[j-1][i]:\n increasing = False\n break\n if increasing:\n count += 1\n return (length - count)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n total_deletes = 0\n for j in range(len(A[0])):\n for i in range(1, len(A)):\n if A[i-1][j] > A[i][j]:\n total_deletes += 1\n break\n \n return total_deletes\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n return sum([list(i) != sorted(i) for i in zip(*A)])", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n res = []\n rows = len(A)\n cols = len(A[0])\n for c in range (cols):\n for r in range (rows-1):\n if A[r][c] > A[r+1][c]:\n res.append(-1)\n break\n \n return res.count(-1)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n rows = len(A)\n cols = len(A[0])\n for c in range (cols):\n for r in range (rows-1):\n if A[r][c] > A[r+1][c]:\n count += 1\n break\n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n return sum(not all(c <= d for c, d in zip(col, col[1:])) for col in zip(*A))\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n length = len(A[0])\n noofstr = len(A)\n print(length, noofstr)\n \n for i in range(length):\n increasing = True\n for j in range(1,noofstr):\n if A[j][i] < A[j-1][i]:\n increasing = False\n break\n if increasing:\n count += 1\n return (length - count)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n n = len(A[0])\n del_indices = []\n for j in range(n):\n for i in range(len(A) - 1):\n if A[i][j] > A[i + 1][j]:\n del_indices.append(j)\n break\n continue\n return len(del_indices)\n \n \n", "class Solution(object):\n def minDeletionSize(self, A):\n ans = 0\n for col in zip(*A):\n if any(col[i] > col[i+1] for i in range(len(col) - 1)):\n ans += 1\n return ans", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ans=0\n for col in zip(*A):\n if any(col[i]>col[i+1] for i in range(len(col)-1)):\n ans+=1\n return ans", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n res = 0\n for i in range(len(A[0])):\n for j in range(1,len(A)):\n if A[j][i] < A[j-1][i]:\n res+=1\n break\n \n \n return res", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n c_l = len(A[0])\n A_l = len(A)\n count = 0\n for i in range(c_l):\n string = [col[i] for col in A]\n # print(string)\n for j in range(1, A_l):\n if string[j] < string[j-1]:\n count += 1\n break\n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n for col in zip(*A):\n if list(col) != sorted(col):\n count += 1\n return count\n \n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n c = 0\n for i in range(len(A[0])):\n for j in range(len(A)-1):\n if A[j][i] > A[j+1][i]:\n c += 1\n break\n return c ", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n rows = len(A)\n cols = len(A[0])\n out = []\n for i in range(cols):\n temp = []\n for j in range(rows):\n temp.append(A[j][i])\n out.append(temp)\n count = 0\n for i in out:\n if i != sorted(i):\n count+=1\n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n columns = [''] * len(A[0]) \n for string in A:\n for i, char in enumerate(string):\n columns[i]+=char\n count = 0\n for word in columns:\n if word != ''.join(sorted(word)):\n count += 1\n return count\n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n l = list(A[0])\n \n for i in A:\n for j in range(len(i)):\n if l[j] == 'A':\n continue\n if i[j] < l[j]:\n l[j] = 'A'\n else:\n l[j] = i[j]\n # print(l)\n # print(l)\n return l.count('A')", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n indiciesToRemove = []\n columns = len(A[0])\n rows = len(A)\n for col in range(0, columns):\n previous = chr(0)\n for row in range(0, rows):\n if A[row][col] < previous:\n indiciesToRemove.append(col)\n break\n previous = A[row][col]\n \n \n return len(indiciesToRemove)\n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n return sum([x[i] for x in A] != sorted([x[i] for x in A]) for i in range(len(A[0]))) ", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n set_dim = 0\n for column in range(len(A[0])):\n for row in range(len(A) - 1):\n if A[row][column] > A[row + 1][column]:\n set_dim += 1\n break\n \n return set_dim\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n \n count = 0\n for c in range(len(A[0])):\n for i in range(len(A)-1):\n if ord(A[i][c]) > ord(A[i+1][c]):\n count += 1\n break\n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n # check ascending order = comparison O(1)\n \n do_not_remove_idx = []\n for idx in range(len(A[0])):\n tmp = [a[idx] for a in A]\n \n if any(x > y for x, y in zip(tmp, tmp[1:])):\n do_not_remove_idx.append(idx)\n \n return len(do_not_remove_idx)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n m = len(A)\n n = len(A[0])\n res = 0\n for j in range(n):\n for i in range(m - 1):\n if A[i][j] > A[i + 1][j]:\n res += 1\n break\n return res", "class Solution:\n def minDeletionSize(self, A):\n return sum(list(col) != sorted(col) for col in zip(*A))", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n t = 0\n i = 0\n while i < len(A[0]):\n j = 0\n last = chr(0)\n while j < len(A):\n if A[j][i] >= last:\n last = A[j][i]\n else:\n t += 1\n break\n j += 1\n i += 1\n return t", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n \n count = 0\n\n for i in range(len(A[0])):\n if not self.isSorted(list([x[i] for x in A])):\n count+=1\n\n return count\n \n \n \n def isSorted(self,list_char):\n for i in range(1,len(list_char)):\n if list_char[i-1]>list_char[i]:\n return False\n \n return True\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n result = 0\n for i in range(len(A[0])):\n last = A[0][i]\n for j in range(1, len(A)):\n if ord(last) > ord(A[j][i]):\n result += 1\n break\n last = A[j][i]\n \n return result\n \n", "class Solution:\n def minDeletionSize(self, A):\n word_len = len(A[0])\n count = 0\n\n for j in range(word_len):\n for i in range(1, len(A)):\n if A[i][j] < A[i-1][j]:\n count+=1\n break\n return count", "# brute force\nclass Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n res = 0\n for j in range(len(A[0])):\n for i in range(len(A) - 1):\n if ord(A[i][j]) > ord(A[i + 1][j]):\n res += 1\n break\n return res", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n if len(A) == 0:\n return 0\n n = len(A[0])\n cnt = 0\n for i in range(n):\n is_sorted = True\n for j in range(len(A) - 1):\n if A[j][i] > A[j + 1][i]:\n is_sorted = False\n break\n if not is_sorted:\n cnt += 1\n return cnt", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n if not A:\n return 0\n count=0\n prev=''\n for i in range(0,len(A[0])):\n for j in range(1,len(A)):\n if ord(A[j-1][i])>ord(A[j][i]):\n count+=1\n break\n return count\n \n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ans = 0\n for col in zip(*A):\n if any(col[i] > col[i+1] for i in range(len(col) - 1)):\n ans += 1\n return ans", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count=0\n for i in zip(*A):\n if ''.join(i)!=''.join(sorted(list(map(''.join,i)))):\n count+=1\n return count", "class Solution:\n # check all non-decreasing order exists and find all peaks\n def findAllPeaks(self, A:List[str]) -> set():\n if (len(A[0]) <= 1):\n return set()\n \n column_number = len(A[0])\n row_number = len(A)\n \n pre_letter_to_int = [-1 for i in range(column_number)]\n result = set()\n for c in range(column_number):\n for r in range(row_number):\n if ord(A[r][c]) < pre_letter_to_int[c]:\n # find a peak, pre_letter_to_int\n result.add(c)\n break\n else:\n pre_letter_to_int[c] = ord(A[r][c])\n return result\n \n \n \n \n def minDeletionSize(self, A: List[str]) -> int:\n return len(self.findAllPeaks(A))\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n size = len(A[0])\n setd = set([i for i in range(size)])\n for i in range(len(A) - 1) :\n if not setd :\n return size\n setn = set()\n for digit in setd:\n if A[i][digit] > A[i+1][digit] :\n setn.add(digit)\n setd -= setn\n \n return size - len(setd)", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n N = len(A[0])\n # print(A[0])\n count = 0\n for i in range(N):\n temp = []\n for j in range(len(A)):\n temp.append(A[j][i])\n \n # print(temp)\n # print(sorted(temp))\n if temp != sorted(temp):\n count += 1\n \n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n return sum(any(A[j][i] < A[j - 1][i] for j in range(1, len(A))) for i in range(len(A[0])))", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n for i in range(len(A)):\n self.convertCharsToIntArray(i,A)\n counts = 0\n for i in range(len(A[0])):\n checker = False\n for j in range(1,len(A)):\n if A[j-1][i] > A[j][i]:\n checker = True\n if checker:\n counts += 1\n return counts \n \n def convertCharsToIntArray(self,i,A):\n chars = A[i]\n array = []\n for char in chars:\n array.append(ord(char))\n A[i] = array\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n col = 0\n while col < len(A[0]):\n row = 0\n while row < len(A)-1:\n if ord(A[row][col] ) > ord(A[row+1][col]):\n count += 1\n break\n row += 1\n col += 1\n return count\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n for i in range(len(A)):\n self.convertCharsToIntArray(i,A)\n \n counts = 0\n for i in range(len(A[0])):\n checker = False\n for j in range(1,len(A)):\n if A[j-1][i] > A[j][i]:\n checker = True\n if checker:\n counts += 1\n return counts \n \n def convertCharsToIntArray(self,i,A):\n chars = A[i]\n array = []\n for char in chars:\n array.append(ord(char))\n A[i] = array\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ans = []\n j = 0\n for i in range(len(A[0])):\n temp = []\n for k in range(len(A)):\n temp.append(A[k][j])\n ans.append(temp)\n j += 1\n count = 0\n for i in ans:\n temp = i[:]\n temp.sort()\n if temp != i:\n count += 1\n return count", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n count = 0\n for i in range(0, len(A[0])):\n maximum = A[0][i]\n inDecreasingOrder = True\n j = 1\n while j < len(A):\n val = A[j][i]\n if val < maximum:\n inDecreasingOrder = False\n break\n maximum = val\n j += 1\n if inDecreasingOrder:\n count += 1\n return len(A[0])-count\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n ans = 0\n for col in zip(*A):\n if any(col[i] > col[i+1] for i in range(len(col) - 1)): # Delete decreasing ones\n ans += 1\n return ans\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n \n ans = 0\n for i in zip(*A):\n if list(i) != sorted(i):\n ans += 1\n return ans\n", "class Solution:\n def minDeletionSize(self, A: List[str]) -> int:\n prev = A[0]\n indices = {i for i in range(len(prev))}\n remove = set()\n for a in A[1:]:\n remove.clear()\n for i in indices:\n if prev[i] > a[i]:\n remove.add(i)\n indices -= remove\n prev = a\n # if len(indices) == 0: break\n return len(prev) - len(indices)\n"]
{"fn_name": "minDeletionSize", "inputs": [[["\"cba\"", "\"daf\"", "\"ghi\""]]], "outputs": [1]}
introductory
https://leetcode.com/problems/delete-columns-to-make-sorted/
class Solution: def minDeletionSize(self, A: List[str]) -> int:
[ 1654, 525, 2661, 458, 1334, 4102, 32, 315, 451, 42047, 6524, 9069, 11, 678, 315, 279, 1852, 3084, 624, 7039, 11, 582, 1231, 5157, 894, 738, 315, 36066, 14937, 11, 323, 369, 1817, 914, 11, 582, 3698, 678, 279, 5766, 304, 1846, 14937,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,537
Prime numbers are arranged in a ordered list U$U$, in increasing order. Let S$S$ be a sublist of U$U$ with a unique property that for every element A$A$ belonging to list S$S$, if i$i$ denotes the index of A$A$ in list U$U$, than i$i$ also belongs to list U$U$. Given N$N$, find sum of first N$N$ elements of list S$S$, assuming 1-based indexing. As the sum can be very large, print the sum modulo 109+7$10^{9}+7$. -----Input:----- -The first line of the input contains a single integer T$T$ denoting the number of test cases. -Only line of each test case has an integer N$N$ . -----Output:----- For each test case, print a single integer denoting the sum of first N$N$ elements of set S$S$ modulo 109+7$10^{9}+7$. -----Constraints----- - 1≤T≤10000$1 \leq T \leq 10000$ - 1≤N≤1000$1 \leq N \leq 1000$ -----Subtasks----- - 20 points : - 1≤T≤10000$1 \leq T \leq 10000$ - 1≤N≤10$1 \leq N \leq 10$ - 20 points : - 1≤T≤100$1 \leq T \leq 100$ - 1≤N≤100$1 \leq N \leq 100$ - 60 points : Original Constraints -----Sample Input:----- 2 1 2 -----Sample Output:----- 3 8 -----EXPLANATION:----- Example case 1: First few elements of set S$S$ are {3,5,11…} , so sum is 3. Example case 2: Sum is 3+5=8.
["import math\r\ndef prime(aa):\r\n\tf=0\r\n\tfor y in ar:\r\n\t\tif aa%y==0:\r\n\t\t\t\treturn 0\r\n\treturn 1\r\nar=[]\r\nar.append(2)\r\npc=3\r\nte=int(input())\r\nfor _ in range(te):\r\n\ta=int(input())\r\n\tf=0\r\n\tc=0\r\n\tadd=0\r\n\tfor x in ar:\r\n\t\ttry:\r\n\t\t\tadd=add+ar[x-1]\r\n\t\texcept:\r\n\t\t\twhile True:\r\n\t\t\t\tif prime(pc)==1:\r\n\t\t\t\t\tar.append(pc)\r\n\t\t\t\t\tif x<=len(ar):\r\n\t\t\t\t\t\tbreak\r\n\t\t\t\tpc+=1\r\n\t\t\tpc+=1\r\n\t\t\tadd=add+ar[x-1]\r\n\t\tc+=1\r\n\t\tif c==a:\r\n\t\t\tbreak\r\n\tprint(add)\r\n", "l=[3, 5, 11, 17, 31, 41, 59, 67, 83, 109, 127, 157, 179, 191, 211, 241, 277, 283, 331, 353, 367, 401, 431, 461, 509, 547, 563, 587, 599, 617, 709, 739, 773, 797, 859, 877, 919, 967, 991, 1031, 1063, 1087, 1153, 1171, 1201, 1217, 1297, 1409, 1433, 1447, 1471, 1499, 1523, 1597, 1621, 1669, 1723, 1741, 1787, 1823, 1847, 1913, 2027, 2063, 2081, 2099, 2221, 2269, 2341, 2351, 2381, 2417, 2477, 2549, 2609, 2647, 2683, 2719, 2749, 2803, 2897, 2909, 3001, 3019, 3067, 3109, 3169, 3229, 3259, 3299, 3319, 3407, 3469, 3517, 3559, 3593, 3637, 3733, 3761, 3911, 3943, 4027, 4091, 4133, 4153, 4217, 4273, 4339, 4397, 4421, 4463, 4517, 4549, 4567, 4663, 4759, 4787, 4801, 4877, 4933, 4943, 5021, 5059, 5107, 5189, 5281, 5381, 5441, 5503, 5557, 5623, 5651, 5701, 5749, 5801, 5851, 5869, 6037, 6113, 6217, 6229, 6311, 6323, 6353, 6361, 6469, 6599, 6653, 6661, 6691, 6823, 6841, 6863, 6899, 7057, 7109, 7193, 7283, 7351, 7417, 7481, 7523, 7607, 7649, 7699, 7753, 7841, 7883, 8011, 8059, 8101, 8117, 8221, 8233, 8287, 8377, 8389, 8513, 8527, 8581, 8719, 8747, 8761, 8807, 8849, 8923, 8999, 9041, 9103, 9293, 9319, 9403, 9461, 9539, 9619, 9661, 9739, 9833, 9859, 9923, 9973, 10009, 10079, 10169, 10267, 10433, 10457, 10487, 10559, 10589, 10631, 10663, 10687, 10723, 10853, 10861, 10909, 11257, 11311, 11369, 11447, 11633, 11743, 11867, 11909, 11927, 11953, 12007, 12097, 12113, 12143, 12203, 12301, 12409, 12421, 12457, 12479, 12503, 12547, 12647, 12763, 12841, 12959, 13003, 13037, 13103, 13171, 13217, 13297, 13331, 13469, 13513, 13591, 13613, 13649, 13693, 13709, 13757, 13859, 14051, 14107, 14159, 14177, 14437, 14479, 14503, 14591, 14713, 14723, 14783, 14867, 14923, 14969, 15061, 15227, 15271, 15299, 15313, 15413, 15511, 15641, 15683, 15823, 15973, 16061, 16073, 16091, 16127, 16141, 16253, 16411, 16451, 16519, 16693, 16703, 16901, 16921, 17117, 17189, 17291, 17333, 17377, 17387, 17417, 17483, 17539, 17627, 17659, 17761, 17911, 17987, 18049, 18149, 18181, 18217, 18229, 18311, 18433, 18443, 18617, 18661, 18719, 18757, 18787, 18917, 19013, 19213, 19433, 19463, 19501, 19577, 19759, 19777, 19819, 19913, 20047, 20063, 20107, 20161, 20231, 20297, 20341, 20441, 20477, 20719, 20759, 20773, 20873, 20899, 20959, 21089, 21149, 21179, 21191, 21269, 21317, 21379, 21493, 21529, 21587, 21727, 21757, 21817, 21937, 22027, 22067, 22093, 22367, 22549, 22651, 22721, 22751, 22811, 22853, 22907, 23087, 23209, 23251, 23431, 23539, 23563, 23669, 23801, 23887, 23899, 23929, 24019, 24071, 24107, 24133, 24151, 24197, 24251, 24379, 24419, 24439, 24509, 24631, 24671, 24781, 24859, 24917, 25057, 25163, 25301, 25307, 25357, 25409, 25423, 25601, 25733, 25763, 25841, 25919, 25969, 26003, 26189, 26263, 26371, 26423, 26489, 26591, 26693, 26783, 26921, 26953, 27017, 27073, 27091, 27437, 27457, 27581, 27689, 27733, 27809, 27847, 27943, 28057, 28109, 28279, 28307, 28393, 28573, 28643, 28657, 28807, 29101, 29137, 29153, 29269, 29333, 29383, 29483, 29569, 29641, 29683, 29803, 30071, 30091, 30113, 30133, 30253, 30557, 30577, 30661, 30707, 30781, 30829, 30869, 30881, 31033, 31069, 31181, 31189, 31267, 31277, 31489, 31513, 31667, 31729, 32003, 32143, 32233, 32261, 32299, 32323, 32341, 32533, 32603, 32719, 32797, 32911, 32933, 32969, 33013, 33029, 33083, 33191, 33203, 33347, 33457, 33469, 33569, 33647, 33749, 33769, 33827, 33911, 33967, 34057, 34259, 34351, 34367, 34421, 34543, 34607, 34651, 34729, 34843, 34919, 35023, 35081, 35311, 35363, 35393, 35507, 35617, 35731, 35801, 35977, 35993, 36083, 36251, 36293, 36307, 36451, 36563, 36599, 36683, 36847, 36887, 36929, 36943, 36997, 37049, 37061, 37217, 37273, 37489, 37657, 37831, 37853, 37889, 37967, 38039, 38053, 38153, 38351, 38377, 38459, 38669, 38711, 38833, 38851, 38917, 39043, 39199, 39217, 39239, 39317, 39451, 39509, 39521, 39733, 39979, 40093, 40151, 40163, 40277, 40289, 40459, 40483, 40577, 40637, 40693, 40801, 40819, 40897, 40961, 41051, 41351, 41467, 41491, 41597, 41647, 41719, 41843, 41983, 42043, 42181, 42293, 42307, 42461, 42499, 42569, 42643, 42697, 42853, 42863, 42979, 43151, 43223, 43283, 43313, 43391, 43633, 43651, 43787, 43889, 44029, 44111, 44171, 44221, 44453, 44621, 44633, 44657, 44729, 44753, 44809, 44879, 44971, 45061, 45191, 45329, 45541, 45557, 45631, 45673, 45863, 45971, 46237, 46279, 46307, 46349, 46441, 46451, 46573, 46619, 46751, 47123, 47237, 47297, 47417, 47563, 47623, 47713, 47837, 47857, 47911, 47963, 48073, 48131, 48259, 48281, 48337, 48481, 48533, 48593, 48647, 48731, 48751, 48821, 48847, 49031, 49139, 49207, 49411, 49451, 49523, 49639, 49667, 49739, 49789, 49843]\r\nt=int(input())\r\nfor i in range(t):\r\n s=0\r\n n=int(input())\r\n for i in range(n):\r\n \ts+=l[i]\r\n print(s%1000000007)\t", "k = []\r\nn = 100000\r\nprime = [True for i in range(n+1)]\r\np = 2\r\nfor i in range(2,int(n ** 0.5)+ 1):\r\n if prime[i]:\r\n j = 2\r\n while i * j <= n:\r\n prime[i * j] = False\r\n j += 1\r\nfor p in range(2, n+1):\r\n if prime[p]: \r\n k.append(p)\r\nfor _ in range(int(input())):\r\n n = int(input())\r\n sum = 0\r\n for i in range(n):\r\n sum += k[k[i]-1]\r\n print(sum)", "import math\r\ndef prime(aa):\r\n\tf=0\r\n\tif aa>=100:\r\n\t\tto=int(math.sqrt(aa))\r\n\telse:\r\n\t\tto=aa\r\n\tfor y in range(2,to):\r\n\t\tif aa%y==0:\r\n\t\t\t\treturn 0\r\n\treturn 1\r\n\r\nte=int(input())\r\nfor _ in range(te):\r\n\ta=int(input())\r\n\tar=[]\r\n\tar.append(2)\r\n\tf=0\r\n\tc=0\r\n\tpc=3\r\n\tadd=0\r\n\tfor x in ar:\r\n\t\ttry:\r\n\t\t\tadd=add+ar[x-1]\r\n\t\texcept:\r\n\t\t\twhile True:\r\n\t\t\t\tif prime(pc)==1:\r\n\t\t\t\t\tar.append(pc)\r\n\t\t\t\t\tif x<=len(ar):\r\n\t\t\t\t\t\tbreak\r\n\t\t\t\tpc+=1\r\n\t\t\tpc+=1\r\n\t\tadd=add+ar[x-1]\r\n\t\tc+=1\r\n\t\tif c==a:\r\n\t\t\tbreak\r\n\tprint(add)\r\n", "l=[2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97, 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151, 157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233, 239, 241, 251, 257, 263, 269, 271, 277, 281, 283, 293, 307, 311, 313, 317, 331, 337, 347, 349, 353, 359, 367, 373, 379, 383, 389, 397, 401, 409, 419, 421, 431, 433, 439, 443, 449, 457, 461, 463, 467, 479, 487, 491, 499, 503, 509, 521, 523, 541, 547, 557, 563, 569, 571, 577, 587, 593, 599, 601, 607, 613, 617, 619, 631, 641, 643, 647, 653, 659, 661, 673, 677, 683, 691, 701, 709, 719, 727, 733, 739, 743, 751, 757, 761, 769, 773, 787, 797, 809, 811, 821, 823, 827, 829, 839, 853, 857, 859, 863, 877, 881, 883, 887, 907, 911, 919, 929, 937, 941, 947, 953, 967, 971, 977, 983, 991, 997, 1009, 1013, 1019, 1021, 1031, 1033, 1039, 1049, 1051, 1061, 1063, 1069, 1087, 1091, 1093, 1097, 1103, 1109, 1117, 1123, 1129, 1151, 1153, 1163, 1171, 1181, 1187, 1193, 1201, 1213, 1217, 1223, 1229, 1231, 1237, 1249, 1259, 1277, 1279, 1283, 1289, 1291, 1297, 1301, 1303, 1307, 1319, 1321, 1327, 1361, 1367, 1373, 1381, 1399, 1409, 1423, 1427, 1429, 1433, 1439, 1447, 1451, 1453, 1459, 1471, 1481, 1483, 1487, 1489, 1493, 1499, 1511, 1523, 1531, 1543, 1549, 1553, 1559, 1567, 1571, 1579, 1583, 1597, 1601, 1607, 1609, 1613, 1619, 1621, 1627, 1637, 1657, 1663, 1667, 1669, 1693, 1697, 1699, 1709, 1721, 1723, 1733, 1741, 1747, 1753, 1759, 1777, 1783, 1787, 1789, 1801, 1811, 1823, 1831, 1847, 1861, 1867, 1871, 1873, 1877, 1879, 1889, 1901, 1907, 1913, 1931, 1933, 1949, 1951, 1973, 1979, 1987, 1993, 1997, 1999, 2003, 2011, 2017, 2027, 2029, 2039, 2053, 2063, 2069, 2081, 2083, 2087, 2089, 2099, 2111, 2113, 2129, 2131, 2137, 2141, 2143, 2153, 2161, 2179, 2203, 2207, 2213, 2221, 2237, 2239, 2243, 2251, 2267, 2269, 2273, 2281, 2287, 2293, 2297, 2309, 2311, 2333, 2339, 2341, 2347, 2351, 2357, 2371, 2377, 2381, 2383, 2389, 2393, 2399, 2411, 2417, 2423, 2437, 2441, 2447, 2459, 2467, 2473, 2477, 2503, 2521, 2531, 2539, 2543, 2549, 2551, 2557, 2579, 2591, 2593, 2609, 2617, 2621, 2633, 2647, 2657, 2659, 2663, 2671, 2677, 2683, 2687, 2689, 2693, 2699, 2707, 2711, 2713, 2719, 2729, 2731, 2741, 2749, 2753, 2767, 2777, 2789, 2791, 2797, 2801, 2803, 2819, 2833, 2837, 2843, 2851, 2857, 2861, 2879, 2887, 2897, 2903, 2909, 2917, 2927, 2939, 2953, 2957, 2963, 2969, 2971, 2999, 3001, 3011, 3019, 3023, 3037, 3041, 3049, 3061, 3067, 3079, 3083, 3089, 3109, 3119, 3121, 3137, 3163, 3167, 3169, 3181, 3187, 3191, 3203, 3209, 3217, 3221, 3229, 3251, 3253, 3257, 3259, 3271, 3299, 3301, 3307, 3313, 3319, 3323, 3329, 3331, 3343, 3347, 3359, 3361, 3371, 3373, 3389, 3391, 3407, 3413, 3433, 3449, 3457, 3461, 3463, 3467, 3469, 3491, 3499, 3511, 3517, 3527, 3529, 3533, 3539, 3541, 3547, 3557, 3559, 3571, 3581, 3583, 3593, 3607, 3613, 3617, 3623, 3631, 3637, 3643, 3659, 3671, 3673, 3677, 3691, 3697, 3701, 3709, 3719, 3727, 3733, 3739, 3761, 3767, 3769, 3779, 3793, 3797, 3803, 3821, 3823, 3833, 3847, 3851, 3853, 3863, 3877, 3881, 3889, 3907, 3911, 3917, 3919, 3923, 3929, 3931, 3943, 3947, 3967, 3989, 4001, 4003, 4007, 4013, 4019, 4021, 4027, 4049, 4051, 4057, 4073, 4079, 4091, 4093, 4099, 4111, 4127, 4129, 4133, 4139, 4153, 4157, 4159, 4177, 4201, 4211, 4217, 4219, 4229, 4231, 4241, 4243, 4253, 4259, 4261, 4271, 4273, 4283, 4289, 4297, 4327, 4337, 4339, 4349, 4357, 4363, 4373, 4391, 4397, 4409, 4421, 4423, 4441, 4447, 4451, 4457, 4463, 4481, 4483, 4493, 4507, 4513, 4517, 4519, 4523, 4547, 4549, 4561, 4567, 4583, 4591, 4597, 4603, 4621, 4637, 4639, 4643, 4649, 4651, 4657, 4663, 4673, 4679, 4691, 4703, 4721, 4723, 4729, 4733, 4751, 4759, 4783, 4787, 4789, 4793, 4799, 4801, 4813, 4817, 4831, 4861, 4871, 4877, 4889, 4903, 4909, 4919, 4931, 4933, 4937, 4943, 4951, 4957, 4967, 4969, 4973, 4987, 4993, 4999, 5003, 5009, 5011, 5021, 5023, 5039, 5051, 5059, 5077, 5081, 5087, 5099, 5101, 5107, 5113, 5119, 5147, 5153, 5167, 5171, 5179, 5189, 5197, 5209, 5227, 5231, 5233, 5237, 5261, 5273, 5279, 5281, 5297, 5303, 5309, 5323, 5333, 5347, 5351, 5381, 5387, 5393, 5399, 5407, 5413, 5417, 5419, 5431, 5437, 5441, 5443, 5449, 5471, 5477, 5479, 5483, 5501, 5503, 5507, 5519, 5521, 5527, 5531, 5557, 5563, 5569, 5573, 5581, 5591, 5623, 5639, 5641, 5647, 5651, 5653, 5657, 5659, 5669, 5683, 5689, 5693, 5701, 5711, 5717, 5737, 5741, 5743, 5749, 5779, 5783, 5791, 5801, 5807, 5813, 5821, 5827, 5839, 5843, 5849, 5851, 5857, 5861, 5867, 5869, 5879, 5881, 5897, 5903, 5923, 5927, 5939, 5953, 5981, 5987, 6007, 6011, 6029, 6037, 6043, 6047, 6053, 6067, 6073, 6079, 6089, 6091, 6101, 6113, 6121, 6131, 6133, 6143, 6151, 6163, 6173, 6197, 6199, 6203, 6211, 6217, 6221, 6229, 6247, 6257, 6263, 6269, 6271, 6277, 6287, 6299, 6301, 6311, 6317, 6323, 6329, 6337, 6343, 6353, 6359, 6361, 6367, 6373, 6379, 6389, 6397, 6421, 6427, 6449, 6451, 6469, 6473, 6481, 6491, 6521, 6529, 6547, 6551, 6553, 6563, 6569, 6571, 6577, 6581, 6599, 6607, 6619, 6637, 6653, 6659, 6661, 6673, 6679, 6689, 6691, 6701, 6703, 6709, 6719, 6733, 6737, 6761, 6763, 6779, 6781, 6791, 6793, 6803, 6823, 6827, 6829, 6833, 6841, 6857, 6863, 6869, 6871, 6883, 6899, 6907, 6911, 6917, 6947, 6949, 6959, 6961, 6967, 6971, 6977, 6983, 6991, 6997, 7001, 7013, 7019, 7027, 7039, 7043, 7057, 7069, 7079, 7103, 7109, 7121, 7127, 7129, 7151, 7159, 7177, 7187, 7193, 7207, 7211, 7213, 7219, 7229, 7237, 7243, 7247, 7253, 7283, 7297, 7307, 7309, 7321, 7331, 7333, 7349, 7351, 7369, 7393, 7411, 7417, 7433, 7451, 7457, 7459, 7477, 7481, 7487, 7489, 7499, 7507, 7517, 7523, 7529, 7537, 7541, 7547, 7549, 7559, 7561, 7573, 7577, 7583, 7589, 7591, 7603, 7607, 7621, 7639, 7643, 7649, 7669, 7673, 7681, 7687, 7691, 7699, 7703, 7717, 7723, 7727, 7741, 7753, 7757, 7759, 7789, 7793, 7817, 7823, 7829, 7841, 7853, 7867, 7873, 7877, 7879, 7883, 7901, 7907]\r\nt=int(input())\r\n\r\nfor i in range(t):\r\n s=0\r\n n=int(input())\r\n c=1\r\n x=0\r\n while(c<=n):\r\n if x+1 in l:\r\n s+=l[x]\r\n c+=1\r\n x+=1\r\n print(s%1000000007)\t", "MOD = 1000000007\r\n\r\nt = int(input())\r\nwhile t:\r\n n = int(input())\r\n P=p=1;l=[]\r\n s=0\r\n while n>0:\r\n l+=P%p*[p]\r\n if len(l)in P%p*l:s = (s%MOD + p%MOD)%MOD;n-=1;\r\n P*=p*p;p+=1\r\n print(s)\r\n t-=1", "import math\r\ndef prime(aa):\r\n\tf=0\r\n\tto=int(math.sqrt(aa))\r\n\tfor y in range(2,aa):\r\n\t\tif aa%y==0:\r\n\t\t\t\treturn 0\r\n\treturn 1\r\n\r\nte=int(input())\r\nfor _ in range(te):\r\n\ta=int(input())\r\n\tar=[]\r\n\tar.append(2)\r\n\tf=0\r\n\tc=0\r\n\tpc=3\r\n\tadd=0\r\n\tfor x in ar:\r\n\t\ttry:\r\n\t\t\tadd=add+ar[x-1]\r\n\t\texcept:\r\n\t\t\twhile True:\r\n\t\t\t\tif prime(pc)==1:\r\n\t\t\t\t\tar.append(pc)\r\n\t\t\t\t\tif x<=len(ar):\r\n\t\t\t\t\t\tbreak\r\n\t\t\t\tpc+=1\r\n\t\t\tpc+=1\r\n\t\tadd=add+ar[x-1]\r\n\t\tc+=1\r\n\t\tif c==a:\r\n\t\t\tbreak\r\n\tprint(add)\r\n", "def SieveOfEratosthenes(n):\r\n prime = [True for i in range(n+1)] \r\n p = 2\r\n while (p * p <= n):\r\n if (prime[p] == True):\r\n for i in range(p * 2, n+1, p):\r\n prime[i] = False\r\n p += 1\r\n arr=[] \r\n for p in range(2, n): \r\n if prime[p]: \r\n arr.append(p)\r\n if prime[n]:\r\n arr.append(n)\r\n return arr \r\nt=int(input())\r\nfor _ in range(t):\r\n n =int(input())\r\n k=SieveOfEratosthenes(109)\r\n count=0\r\n s=0\r\n for i in range(2,30):\r\n if count<n:\r\n if i in k:\r\n s+=k[i-1]\r\n count+=1\r\n else:\r\n pass\r\n else:\r\n break\r\n print(s)\r\n \r\n", "import math\r\ndef isPrime(nm):\r\n for i in range(2,int(math.sqrt(nm)+1)):\r\n if nm%i==0:\r\n return False\r\n return True\r\nU=list()\r\nnum=2\r\nfor i in range(10000):\r\n while(not isPrime(num)):\r\n num+=1\r\n U.append(num)\r\n num+=1\r\n#print(U)\r\nS=list()\r\nfor i in range(1,len(U)):\r\n if isPrime(i+1):\r\n S.append(U[i])\r\n#print(len(S))\r\nt=int(input())\r\nfor i in range(t):\r\n sum=0\r\n n=int(input())\r\n for j in range(n):\r\n sum+=S[j]\r\n #sum=sum%1000000007\r\n print(sum)", "primes = []\r\n\r\ndef rwh_primes1(n):\r\n \r\n \"\"\" Returns a list of primes < n \"\"\"\r\n sieve = [True] * (n//2)\r\n for i in range(3,int(n**0.5)+1,2):\r\n if sieve[i//2]:\r\n sieve[i*i//2::i] = [False] * ((n-i*i-1)//(2*i)+1)\r\n return [2] + [2*i+1 for i in range(1,n//2) if sieve[i]]\r\n\r\nprimes = rwh_primes1(1000000)\r\n#print(primes)\r\nplookup = set(primes) \r\nS = []\r\n#print(len(primes))\r\nprime = 10**9+7\r\nfor i in range(2,10000):\r\n if i in plookup:\r\n S.append(primes[i-1])\r\n#print(len(S))\r\ndef __starting_point():\r\n T = int(input())\r\n while T>0:\r\n T-=1\r\n N = int(input())\r\n s = 0\r\n for i in range(N):\r\n s+=S[i]\r\n print(s%prime)\n__starting_point()", "n=100000\r\nprm = [True for i in range(n+1)] \r\np = 2\r\nwhile (p * p <= n):\r\n if (prm[p] == True): \r\n for i in range(p * 2, n+1, p): \r\n prm[i] = False\r\n p += 1\r\nc=[] \r\nfor p in range(2, n): \r\n if prm[p]: \r\n c.append(p)\r\nfor _ in range(int(input())):\r\n k=int(input())\r\n s=0\r\n for i in range(k):\r\n #print(k,i,c[i],c[c[i]-1])\r\n s=(s+c[c[i]-1])%((10**9)+7)\r\n print(s)", "import math\r\ndef isPrime(nm):\r\n for i in range(2,int(math.sqrt(nm)+1)):\r\n if nm%i==0:\r\n return False\r\n return True\r\nU=list()\r\nnum=2\r\nfor i in range(1000+1):\r\n while(not isPrime(num)):\r\n num+=1\r\n U.append(num)\r\n num+=1\r\n#print(U)\r\nS=list()\r\nfor i in range(1,len(U)):\r\n if isPrime(i+1):\r\n S.append(U[i])\r\n#print(S)\r\nt=int(input())\r\nfor i in range(t):\r\n sum=0\r\n n=int(input())\r\n for j in range(n):\r\n sum+=S[j]\r\n print(sum)", "n=10002\r\nprm = [True for i in range(n+1)] \r\np = 2\r\nwhile (p * p <= n):\r\n if (prm[p] == True): \r\n for i in range(p * 2, n+1, p): \r\n prm[i] = False\r\n p += 1\r\nc=[] \r\nfor p in range(2, n): \r\n if prm[p]: \r\n c.append(p)\r\nfor _ in range(int(input())):\r\n k=int(input())\r\n s=0\r\n for i in range(k):\r\n #print(k,i,c[i],c[c[i]-1])\r\n s+=c[c[i]-1]\r\n print(s)", "def s(n):\r\n res = []\r\n prime = [True for i in range(n+1)] \r\n p = 2\r\n for i in range(2,int(n ** 0.5)+ 1):\r\n if prime[i]:\r\n j = 2\r\n while i * j <= n:\r\n prime[i * j] = False\r\n j += 1\r\n for p in range(2, n+1): \r\n if prime[p]: \r\n res.append(p)\r\n return res\r\no = s(100000)\r\nfor _ in range(int(input())):\r\n n = int(input())\r\n sum = 0\r\n for i in range(n):\r\n temp = o[i]\r\n sum += o[temp-1]\r\n print(sum)", "s=[3, 8, 19, 36, 67, 108, 167, 234, 317, 426, 553, 710, 889, 1080, 1291, 1532,\r\n1809, 2092, 2423, 2776, 3143, 3544, 3975, 4436, 4945, 5492, 6055, 6642, 7241, \r\n7858, 8567, 9306, 10079, 10876, 11735, 12612, 13531, 14498, 15489, 16520, 17583,\r\n18670, 19823, 20994, 22195, 23412, 24709, 26118, 27551, 28998, 30469, 31968, \r\n33491, 35088, 36709, 38378, 40101, 41842, 43629, 45452, 47299, 49212, 51239, \r\n53302, 55383, 57482, 59703, 61972, 64313, 66664, 69045, 71462, 73939, 76488, \r\n79097, 81744, 84427, 87146, 89895, 92698, 95595, 98504, 101505, 104524, 107591,\r\n110700, 113869, 117098, 120357, 123656, 126975, 130382, 133851, 137368, 140927,\r\n144520, 148157, 151890, 155651, 159562, 163505, 167532, 171623, 175756, 179909, \r\n184126, 188399, 192738, 197135, 201556, 206019, 210536, 215085, 219652, 224315,\r\n229074, 233861, 238662, 243539, 248472, 253415, 258436, 263495, 268602, 273791,\r\n279072, 284453, 289894, 295397, 300954, 306577, 312228, 317929, 323678, 329479,\r\n335330, 341199, 347236, 353349, 359566, 365795, 372106, 378429, 384782, 391143,\r\n397612, 404211, 410864, 417525, 424216, 431039, 437880, 444743, 451642, 458699,\r\n465808, 473001, 480284, 487635, 495052, 502533, 510056, 517663, 525312, 533011,\r\n540764, 548605, 556488, 564499, 572558, 580659, 588776, 596997, 605230, 613517,\r\n621894, 630283, 638796, 647323, 655904, 664623, 673370, 682131, 690938, 699787,\r\n708710, 717709, 726750, 735853, 745146, 754465, 763868, 773329, 782868, 792487,\r\n802148, 811887, 821720, 831579, 841502, 851475, 861484, 871563, 881732, 891999,\r\n902432, 912889, 923376, 933935, 944524, 955155, 965818, 976505, 987228, 998081,\r\n1008942, 1019851, 1031108, 1042419, 1053788, 1065235, 1076868, 1088611, 1100478,\r\n1112387, 1124314, 1136267, 1148274, 1160371, 1172484, 1184627, 1196830, 1209131,\r\n1221540, 1233961, 1246418, 1258897, 1271400, 1283947, 1296594, 1309357, 1322198,\r\n1335157, 1348160, 1361197, 1374300, 1387471, 1400688, 1413985, 1427316, 1440785,\r\n1454298, 1467889, 1481502, 1495151, 1508844, 1522553, 1536310, 1550169, 1564220,\r\n1578327, 1592486, 1606663, 1621100, 1635579, 1650082, 1664673, 1679386, 1694109,\r\n1708892, 1723759, 1738682, 1753651, 1768712, 1783939, 1799210, 1814509, 1829822,\r\n1845235, 1860746, 1876387, 1892070, 1907893, 1923866, 1939927, 1956000, 1972091,\r\n1988218, 2004359, 2020612, 2037023, 2053474, 2069993, 2086686, 2103389, 2120290,\r\n2137211, 2154328, 2171517, 2188808, 2206141, 2223518, 2240905, 2258322, 2275805,\r\n2293344, 2310971, 2328630, 2346391, 2364302, 2382289, 2400338, 2418487, 2436668,\r\n2454885, 2473114, 2491425, 2509858, 2528301, 2546918, 2565579, 2584298, 2603055,\r\n2621842, 2640759, 2659772, 2678985, 2698418, 2717881, 2737382, 2756959, 2776718,\r\n2796495, 2816314, 2836227, 2856274, 2876337, 2896444, 2916605, 2936836, 2957133,\r\n2977474, 2997915, 3018392, 3039111, 3059870, 3080643, 3101516, 3122415, 3143374,\r\n3164463, 3185612, 3206791, 3227982, 3249251, 3270568, 3291947, 3313440, 3334969,\r\n3356556, 3378283, 3400040, 3421857, 3443794, 3465821, 3487888, 3509981, 3532348,\r\n3554897, 3577548, 3600269, 3623020, 3645831, 3668684, 3691591, 3714678, 3737887,\r\n3761138, 3784569, 3808108, 3831671, 3855340, 3879141, 3903028, 3926927, 3950856,\r\n3974875, 3998946, 4023053, 4047186, 4071337, 4095534, 4119785, 4144164, 4168583,\r\n4193022, 4217531, 4242162, 4266833, 4291614, 4316473, 4341390, 4366447, 4391610,\r\n4416911, 4442218, 4467575, 4492984, 4518407, 4544008, 4569741, 4595504, \r\n4621345, 4647264, 4673233, 4699236, 4725425, 4751688, 4778059, 4804482,\r\n4830971, 4857562, 4884255, 4911038, 4937959, 4964912, 4991929, 5019002,\r\n5046093, 5073530, 5100987, 5128568, 5156257, 5183990, 5211799, 5239646,\r\n5267589, 5295646, 5323755, 5352034, 5380341, 5408734, 5437307, 5465950,\r\n5494607, 5523414, 5552515, 5581652, 5610805, 5640074, 5669407, 5698790,\r\n5728273, 5757842, 5787483, 5817166, 5846969, 5877040, 5907131, 5937244,\r\n5967377, 5997630, 6028187, 6058764, 6089425, 6120132, 6150913, 6181742,\r\n6212611, 6243492, 6274525, 6305594, 6336775, 6367964, 6399231, 6430508,\r\n6461997, 6493510, 6525177, 6556906, 6588909, 6621052, 6653285, 6685546,\r\n6717845, 6750168, 6782509, 6815042, 6847645, 6880364, 6913161, 6946072,\r\n6979005, 7011974, 7044987, 7078016, 7111099, 7144290, 7177493, 7210840,\r\n7244297, 7277766, 7311335, 7344982, 7378731, 7412500, 7446327, 7480238,\r\n7514205, 7548262, 7582521, 7616872, 7651239, 7685660, 7720203, 7754810, \r\n7789461, 7824190, 7859033, 7893952, 7928975, 7964056, 7999367, 8034730,\r\n8070123, 8105630, 8141247, 8176978, 8212779, 8248756, 8284749, 8320832, \r\n8357083, 8393376, 8429683, 8466134, 8502697, 8539296, 8575979, 8612826, \r\n8649713, 8686642, 8723585, 8760582, 8797631, 8834692, 8871909, 8909182, \r\n8946671, 8984328, 9022159, 9060012, 9097901, 9135868, 9173907, 9211960, \r\n9250113, 9288464, 9326841, 9365300, 9403969, 9442680, 9481513, 9520364,\r\n9559281, 9598324, 9637523, 9676740, 9715979, 9755296, 9794747, 9834256,\r\n9873777, 9913510, 9953489, 9993582, 10033733, 10073896, 10114173, 10154462,\r\n10194921, 10235404, 10275981, 10316618, 10357311, 10398112, 10438931, 10479828,\r\n10520789, 10561840, 10603191, 10644658, 10686149, 10727746, 10769393, 10811112, \r\n10852955, 10894938, 10936981, 10979162, 11021455, 11063762, 11106223, 11148722,\r\n11191291, 11233934, 11276631, 11319484, 11362347, 11405326, 11448477, 11491700,\r\n11534983, 11578296, 11621687, 11665320, 11708971, 11752758, 11796647, 11840676,\r\n11884787, 11928958, 11973179, 12017632, 12062253, 12106886, 12151543, 12196272, \r\n12241025, 12285834, 12330713, 12375684, 12420745, 12465936, 12511265, 12556806,\r\n12602363, 12647994, 12693667, 12739530, 12785501, 12831738, 12878017, 12924324,\r\n12970673, 13017114, 13063565, 13110138, 13156757, 13203508, 13250631, 13297868,\r\n13345165, 13392582, 13440145, 13487768, 13535481, 13583318, 13631175, 13679086,\r\n13727049, 13775122, 13823253, 13871512, 13919793, 13968130, 14016611, 14065144,\r\n14113737, 14162384, 14211115, 14259866, 14308687, 14357534, 14406565, 14455704,\r\n14504911, 14554322, 14603773, 14653296, 14702935, 14752602, 14802341, 14852130,\r\n14901973, 14952096, 15002273, 15052614, 15102997, 15153494, 15204085, 15254792,\r\n15305649, 15356708, 15407839, 15458976, 15510169, 15561596, 15613113, 15664694,\r\n15716293, 15768062, 15819891, 15871784, 15923835, 15975998, 16028299, 16080662,\r\n16133373, 16186142, 16239001, 16291904, 16344885, 16397954, 16451047, 16504160,\r\n16557393, 16610692, 16664045, 16717422, 16770859, 16824540, 16878299, 16932076,\r\n16985895, 17039896, 17093909, 17147992, 17202243, 17256520, 17310851, 17365222,\r\n17419823, 17474490, 17529217, 17583996, 17638877, 17693878, 17749229, 17804818,\r\n17860427, 17916088, 17971769, 18027466, 18083199, 18138986, 18194829, 18250826,\r\n18306907, 18363008, 18419205, 18475516, 18531909, 18588478, 18645089, 18701722,\r\n18758423, 18815406, 18872443, 18929550, 18986743, 19044002, 19101331, 19158728,\r\n19216221, 19273870, 19331559, 19389290, 19447041, 19504844, 19562691, 19620608,\r\n19678551, 19736608, 19794675, 19852892, 19911201, 19969712, 20028279, 20086978,\r\n20145885, 20205034, 20264243, 20323660, 20383107, 20442758, 20502481, 20562260,\r\n20622093, 20682044, 20742145, 20802294, 20862517, 20922860, 20983233, 21043742,\r\n21104389, 21165116, 21225937, 21286806, 21347749, 21408800, 21470031, 21531388,\r\n21592997, 21654624, 21716275, 21777998, 21839817, 21901688, 21963667, 22025808,\r\n22088081, 22150408, 22212831, 22275298, 22337805, 22400432, 22463193, 22525984,\r\n22588905, 22651886, 22714945, 22778058, 22841299, 22904612, 22968003, 23031446,\r\n23094913, 23158440, 23222029, 23285658, 23349367, 23413160, 23477241, 23541398,\r\n23605849, 23670332, 23735011, 23799758, 23864611, 23929562, 23994831, 24060202,\r\n24125759, 24191346, 24256955, 24322656, 24388387, 24454164, 24520003, 24585884,\r\n24651973, 24718152, 24784525, 24851094, 24917843, 24984664, 25051515, 25118474,\r\n25185517, 25252658, 25319815, 25387062, 25454333, 25521682, 25589129, 25656706,\r\n25724313, 25792196, 25860097, 25928168, 25996267, 26064486, 26132725, 26201162,\r\n26269801, 26338488, 26407199, 26475942, 26544763, 26613782, 26682891, 26752054,\r\n26821247, 26890584, 26960075, 27029728, 27099425, 27169192, 27239309, 27309432,\r\n27379639, 27449868, 27520165, 27590492, 27660915, 27731396, 27801967, 27872588,\r\n27943251, 28014094, 28084985, 28155942, 28227023, 28298166, 28369453, 28440840,\r\n28512311, 28584072, 28655909, 28727850, 28799843, 28871862, 28944113, 29016450,\r\n29089009, 29161682, 29234409, 29307310, 29380241, 29453190, 29526199, 29599320,\r\n29672579, 29745910, 29819279, 29892732, 29966489, 30040432, 30114503, 30188596,\r\n30262797, 30337108, 30411431, 30485940, 30560467, 30635196, 30710155, 30785366,\r\n30860635, 30936066, 31011695, 31087384, 31163091, 31239028, 31315011, 31391042,\r\n31467121, 31543284, 31619545, 31695948, 31772429, 31848966, 31925597, 32002270,\r\n32079027, 32155804, 32232687, 32309600, 32386647, 32463748, 32540939, 32618188,\r\n32695451, 32772828, 32850259, 32927816, 33005535, 33083282, 33161095, 33239174,\r\n33317313, 33395516, 33473799, 33552116, 33630583, 33709092, 33787741, 33866462,\r\n33945249, 34024168, 34103279, 34182430, 34261589, 34341082, 34420641, 34500458,\r\n34580319, 34660226, 34740297, 34820504, 34900845, 34981274, 35061747, 35142238,\r\n35222795, 35303532, 35384315, 35465232]\r\nfor j in range(int(input())):\r\n n=int(input())\r\n print(s[n-1])\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n\r\n", "primes = []\r\nfor possiblePrime in range(2, 10000):\r\n isPrime = True\r\n for num in range(2, int(possiblePrime ** 0.5) + 1):\r\n if possiblePrime % num == 0:\r\n isPrime = False\r\n break\r\n if isPrime:\r\n primes.append(possiblePrime)\r\nplookup = set(primes) \r\nS = []\r\nprime = 10**9+7\r\nfor i in range(2,1000):\r\n if i in plookup:\r\n S.append(primes[i-1])\r\ndef __starting_point():\r\n T = int(input())\r\n while T>0:\r\n T-=1\r\n N = int(input())\r\n s = 0\r\n for i in range(N):\r\n s+=S[i]\r\n print(s%prime)\n__starting_point()", "prime=[False]*100000\r\nnums=[1]\r\nfor i in range(2,100000):\r\n if(not prime[i]):\r\n nums.append(i)\r\n for j in range(i,100000,i):prime[j]=True\r\n#print(nums)\r\nt=int(input())\r\nfor _ in range(t):\r\n n=int(input())\r\n \r\n ans=0\r\n p=10**9+7\r\n for i in range(1,n+1):\r\n ans+=nums[nums[i]]\r\n if(ans>=p):ans%=p\r\n print(ans)\r\n", "prime=[False]*100000\r\nnums=[1]\r\nfor i in range(2,100000):\r\n if(not prime[i]):\r\n nums.append(i)\r\n for j in range(i,8000,i):prime[j]=True\r\n#print(nums)\r\nt=int(input())\r\nfor _ in range(t):\r\n n=int(input())\r\n \r\n ans=0\r\n p=10**9+7\r\n for i in range(1,n+1):\r\n ans+=nums[nums[i]]\r\n if(ans>p):ans%=p\r\n print(ans)\r\n", "prime=[False]*8000\r\nnums=[1]\r\nfor i in range(2,8000):\r\n if(not prime[i]):\r\n nums.append(i)\r\n for j in range(i,8000,i):prime[j]=True\r\n#print(nums)\r\nt=int(input())\r\nfor _ in range(t):\r\n n=int(input())\r\n \r\n ans=0\r\n p=10**9+7\r\n for i in range(1,n+1):\r\n ans+=nums[nums[i]]\r\n if(ans>p):ans%=p\r\n print(ans)\r\n", "def prime(n):\r\n\tnroot = int(n**0.5)+1\r\n\t\r\n\r\n\tctr =0\r\n\tseive= [2,3,5,7,11,13]\r\n\tif n <=seive[-1]:\r\n\t\treturn seive\r\n\telse:\r\n\r\n\t\tn_start = seive[-1]+1\r\n\t\t\r\n\t\tfor i in range(n_start,n):\r\n\t\t\tiroot = int(i**0.5)+1\r\n\t\t\tfor j in seive:\r\n\t\t\t\tif i%j==0:\r\n\t\t\t\t\r\n\t\t\t\t\r\n\t\t\t\t\tctr=0\r\n\t\t\t\t\tbreak\r\n\t\t\t\telse:\r\n\t\t\t\t\tif j>(iroot):\r\n\t\t\t\t\t\t\r\n\t\t\t\t\t\t\r\n\r\n\t\t\t\t\t\tctr=1\r\n\t\t\t\t\t\tbreak\r\n\t\t\tif ctr==1:\r\n\t\t\t\r\n\t\t\t\tseive.append(i)\r\n\t\treturn seive\r\n\r\n\r\n\r\nseive = prime(81100)\r\n\r\nt = int(input())\r\nfor l in range(t):\r\n\tn = int(input())\r\n\ts = []\r\n\r\n\t# print(prime(1000))\r\n\tsump=0\r\n\tfor i in range(n):\r\n\t\tj = seive[i]\r\n\t\t\r\n\t\tsump = (sump + seive[j-1]%1000000007)%100000000\r\n\r\n\t\r\n\t\r\n\t\t\r\n\tprint(sump)", "def isPrime(n):\r\n\tif n == 1 or n == 0:\r\n\t\treturn False\r\n\telif n == 2:\r\n\t\treturn True\r\n\telse:\r\n\t\tfor i in range(2,int(n**(0.5))+1):\r\n\t\t\tif n%i == 0:\r\n\t\t\t\treturn False\r\n\t\treturn True \r\n\r\n\r\ndef getNextPrime(n):\r\n\tn = n+1\r\n\twhile(not isPrime(n)):\r\n\t\tn += 1\r\n\treturn n\r\n\r\nt = int(input())\r\n\r\n\r\nfor _ in range(t):\r\n\tn = int(input())\r\n\tsum_ = 0\r\n\tcurrentPrime = 3\r\n\tN = 2\r\n\tcountN = 1\r\n\ttemp = 0\r\n\tdiff = 0\r\n\twhile countN <= n:\r\n\t\tsum_ += currentPrime\r\n\t\tcountN += 1\r\n\t\ttemp = getNextPrime(N)\r\n\t\tdiff = temp - N\r\n\t\tfor i in range(diff):\r\n\t\t\tcurrentPrime = getNextPrime(currentPrime)\r\n\t\tN = temp\r\n\tprint(sum_%(1000000000+7))\r\n", "def primes_sieve(limit):\r\n limitn = limit+1\r\n not_prime = [False] * limitn\r\n primes = []\r\n\r\n for i in range(2, limitn):\r\n if not_prime[i]:\r\n continue\r\n for f in range(i*2, limitn, i):\r\n not_prime[f] = True\r\n\r\n primes.append(i)\r\n\r\n return primes\r\n\r\n\r\nl = 1000000007\r\np = primes_sieve(81043)\r\ns = []\r\ni = 0\r\nwhile p[i] < len(p)-1 :\r\n s.append(p[p[i]-1])\r\n i += 1\r\n#print(s)\r\nb = [s[0]]\r\nfor i in range(1,len(s)):\r\n b.append(b[len(b)-1]+s[i])\r\n#print(b)\r\n#print(len(b))\r\nfor _ in range(int(input())):\r\n n = int(input())\r\n print(b[n-1])\r\n\r\n", "def prime(n):\r\n\tnroot = int(n**0.5)+1\r\n\t\r\n\r\n\tctr =0\r\n\tseive= [2,3,5,7,11,13]\r\n\tif n <=seive[-1]:\r\n\t\treturn seive\r\n\telse:\r\n\r\n\t\tn_start = seive[-1]+1\r\n\t\t\r\n\t\tfor i in range(n_start,n):\r\n\t\t\tiroot = int(i**0.5)+1\r\n\t\t\tfor j in seive:\r\n\t\t\t\tif i%j==0:\r\n\t\t\t\t\r\n\t\t\t\t\r\n\t\t\t\t\tctr=0\r\n\t\t\t\t\tbreak\r\n\t\t\t\telse:\r\n\t\t\t\t\tif j>(iroot):\r\n\t\t\t\t\t\t\r\n\t\t\t\t\t\t\r\n\r\n\t\t\t\t\t\tctr=1\r\n\t\t\t\t\t\tbreak\r\n\t\t\tif ctr==1:\r\n\t\t\t\r\n\t\t\t\tseive.append(i)\r\n\t\treturn seive\r\n\r\n\r\n\r\nseive = prime(1000000)\r\nt = int(input())\r\nfor l in range(t):\r\n\tn = int(input())\r\n\ts = []\r\n\r\n\t# print(prime(1000))\r\n\r\n\tfor i in range(n):\r\n\t\tj = seive[i]\r\n\t\ts.append(seive[j-1])\r\n\r\n\tsump=0\r\n\tfor i in s:\r\n\t\tsump = (sump + i%1000000007)%100000000\r\n\tprint(sump)", "def isPrime(n):\r\n\tif n == 1 or n == 0:\r\n\t\treturn False\r\n\telif n == 2:\r\n\t\treturn True\r\n\telse:\r\n\t\tfor i in range(2,int(n**(0.5))+1):\r\n\t\t\tif n%i == 0:\r\n\t\t\t\treturn False\r\n\t\treturn True \r\n\r\n\r\ndef getNextPrime(n):\r\n\tn = n+1\r\n\twhile(not isPrime(n)):\r\n\t\tn += 1\r\n\treturn n\r\n\r\nt = int(input())\r\n\r\n\r\nfor _ in range(t):\r\n\tn = int(input())\r\n\tsum_ = 0\r\n\tcurrentPrime = 2\r\n\tN = 1\r\n\tcountN = 1\r\n\twhile countN <= n:\r\n\t\tif isPrime(N):\r\n\t\t\tsum_ += currentPrime\r\n\t\t\tcountN += 1\r\n\t\tcurrentPrime = getNextPrime(currentPrime)\r\n\t\tN += 1\r\n\r\n\tprint(sum_%(1000000000+7))\r\n", "a=[-1,2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,\r\n103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,\r\n199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,\r\n313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,\r\n433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,\r\n563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,\r\n673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,\r\n811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,\r\n941,947,953,967,971,977,983,991,997,1009,1013,1019,1021,1031,1033,1039,1049,\r\n1051,1061,1063,1069,1087,1091,1093,1097,1103,1109,1117,1123,1129,1151,1153,\r\n1163,1171,1181,1187,1193,1201,1213,1217,1223,1229,1231,1237,1249,1259,1277,\r\n1279,1283,1289,1291,1297,1301,1303,1307,1319,1321,1327,1361,1367,1373,1381,\r\n1399,1409,1423,1427,1429,1433,1439,1447,1451,1453,1459,1471,1481,1483,1487,\r\n1489,1493,1499,1511,1523,1531,1543,1549,1553,1559,1567,1571,1579,1583,1597,\r\n1601,1607,1609,1613,1619,1621,1627,1637,1657,1663,1667,1669,1693,1697,1699,\r\n1709,1721,1723,1733,1741,1747,1753,1759,1777,1783,1787,1789,1801,1811,1823,\r\n1831,1847,1861,1867,1871,1873,1877,1879,1889,1901,1907,1913,1931,1933,1949,\r\n1951,1973,1979,1987,1993,1997,1999,2003,2011,2017,2027,2029,2039,2053,2063,\r\n2069,2081,2083,2087,2089,2099,2111,2113,2129,2131,2137,2141,2143,2153,2161,\r\n2179,2203,2207,2213,2221,2237,2239,2243,2251,2267,2269,2273,2281,2287,2293,\r\n2297,2309,2311,2333,2339,2341,2347,2351,2357,2371,2377,2381,2383,2389,2393,\r\n2399,2411,2417,2423,2437,2441,2447,2459,2467,2473,2477,2503,2521,2531,2539,\r\n2543,2549,2551,2557,2579,2591,2593,2609,2617,2621,2633,2647,2657,2659,2663,\r\n2671,2677,2683,2687,2689,2693,2699,2707,2711,2713,2719,2729,2731,2741,2749,\r\n2753,2767,2777,2789,2791,2797,2801,2803,2819,2833,2837,2843,2851,2857,2861,\r\n2879,2887,2897,2903,2909,2917,2927,2939,2953,2957,2963,2969,2971,2999,3001,\r\n3011,3019,3023,3037,3041,3049,3061,3067,3079,3083,3089,3109,3119,3121,3137,\r\n3163,3167,3169,3181,3187,3191,3203,3209,3217,3221,3229,3251,3253,3257,3259,\r\n3271,3299,3301,3307,3313,3319,3323,3329,3331,3343,3347,3359,3361,3371,3373,\r\n3389,3391,3407,3413,3433,3449,3457,3461,3463,3467,3469,3491,3499,3511,3517,\r\n3527,3529,3533,3539,3541,3547,3557,3559,3571,3581,3583,3593,3607,3613,3617,\r\n3623,3631,3637,3643,3659,3671,3673,3677,3691,3697,3701,3709,3719,3727,3733,\r\n3739,3761,3767,3769,3779,3793,3797,3803,3821,3823,3833,3847,3851,3853,3863,\r\n3877,3881,3889,3907,3911,3917,3919,3923,3929,3931,3943,3947,3967,3989,4001,\r\n4003,4007,4013,4019,4021,4027,4049,4051,4057,4073,4079,4091,4093,4099,4111,\r\n4127,4129,4133,4139,4153,4157,4159,4177,4201,4211,4217,4219,4229,4231,4241,\r\n4243,4253,4259,4261,4271,4273,4283,4289,4297,4327,4337,4339,4349,4357,4363,\r\n4373,4391,4397,4409,4421,4423,4441,4447,4451,4457,4463,4481,4483,4493,4507,\r\n4513,4517,4519,4523,4547,4549,4561,4567,4583,4591,4597,4603,4621,4637,4639,\r\n4643,4649,4651,4657,4663,4673,4679,4691,4703,4721,4723,4729,4733,4751,4759,\r\n4783,4787,4789,4793,4799,4801,4813,4817,4831,4861,4871,4877,4889,4903,4909,\r\n4919,4931,4933,4937,4943,4951,4957,4967,4969,4973,4987,4993,4999,5003,5009,\r\n5011,5021,5023,5039,5051,5059,5077,5081,5087,5099,5101,5107,5113,5119,5147,\r\n5153,5167,5171,5179,5189,5197,5209,5227,5231,5233,5237,5261,5273,5279,5281,\r\n5297,5303,5309,5323,5333,5347,5351,5381,5387,5393,5399,5407,5413,5417,5419,\r\n5431,5437,5441,5443,5449,5471,5477,5479,5483,5501,5503,5507,5519,5521,5527,\r\n5531,5557,5563,5569,5573,5581,5591,5623,5639,5641,5647,5651,5653,5657,5659,\r\n5669,5683,5689,5693,5701,5711,5717,5737,5741,5743,5749,5779,5783,5791,5801,\r\n5807,5813,5821,5827,5839,5843,5849,5851,5857,5861,5867,5869,5879,5881,5897,\r\n5903,5923,5927,5939,5953,5981,5987,6007,6011,6029,6037,6043,6047,6053,6067,\r\n6073,6079,6089,6091,6101,6113,6121,6131,6133,6143,6151,6163,6173,6197,6199,\r\n6203,6211,6217,6221,6229,6247,6257,6263,6269,6271,6277,6287,6299,6301,6311,\r\n6317,6323,6329,6337,6343,6353,6359,6361,6367,6373,6379,6389,6397,6421,6427,\r\n6449,6451,6469,6473,6481,6491,6521,6529,6547,6551,6553,6563,6569,6571,6577,\r\n6581,6599,6607,6619,6637,6653,6659,6661,6673,6679,6689,6691,6701,6703,6709,\r\n6719,6733,6737,6761,6763,6779,6781,6791,6793,6803,6823,6827,6829,6833,6841,\r\n6857,6863,6869,6871,6883,6899,6907,6911,6917,6947,6949,6959,6961,6967,6971,\r\n6977,6983,6991,6997,7001,7013,7019,7027,7039,7043,7057,7069,7079,7103,7109,\r\n7121,7127,7129,7151,7159,7177,7187,7193,7207,7211,7213,7219,7229,7237,7243,\r\n7247,7253,7283,7297,7307,7309,7321,7331,7333,7349,7351,7369,7393,7411,7417,\r\n7433,7451,7457,7459,7477,7481,7487,7489,7499,7507,7517,7523,7529,7537,7541,\r\n7547,7549,7559,7561,7573,7577,7583,7589,7591,7603,7607,7621,7639,7643,7649,\r\n7669,7673,7681,7687,7691,7699,7703,7717,7723,7727,7741,7753,7757,7759,7789,\r\n7793,7817,7823,7829,7841,7853,7867,7873,7877,7879,7883,7901,7907,7919,7927,\r\n7933,7937,7949,7951,7963,7993,8009,8011,8017,8039,8053,8059,8069,8081,8087,\r\n8089,8093,8101,8111,8117,8123,8147,8161,8167,8171,8179,8191,8209,8219,8221,\r\n8231,8233,8237,8243,8263,8269,8273,8287,8291,8293,8297,8311,8317,8329,8353,\r\n8363,8369,8377,8387,8389,8419,8423,8429,8431,8443,8447,8461,8467,8501,8513,\r\n8521,8527,8537,8539,8543,8563,8573,8581,8597,8599,8609,8623,8627,8629,8641,\r\n8647,8663,8669,8677,8681,8689,8693,8699,8707,8713,8719,8731,8737,8741,8747,\r\n8753,8761,8779,8783,8803,8807,8819,8821,8831,8837,8839,8849,8861,8863,8867,\r\n8887,8893,8923,8929,8933,8941,8951,8963,8969,8971,8999,9001,9007,9011,9013,\r\n9029,9041,9043,9049,9059,9067,9091,9103,9109,9127,9133,9137,9151,9157,9161,\r\n9173,9181,9187,9199,9203,9209,9221,9227,9239,9241,9257,9277,9281,9283,9293,\r\n9311,9319,9323,9337,9341,9343,9349,9371,9377,9391,9397,9403,9413,9419,9421,\r\n9431,9433,9437,9439,9461,9463,9467,9473,9479,9491,9497,9511,9521,9533,9539,\r\n9547,9551,9587,9601,9613,9619,9623,9629,9631,9643,9649,9661,9677,9679,9689,\r\n9697,9719,9721,9733,9739,9743,9749,9767,9769,9781,9787,9791,9803,9811,9817,\r\n9829,9833,9839,9851,9857,9859,9871,9883,9887,9901,9907,9923,9929,9931,9941,\r\n9949,9967,9973,10007,10009,10037,10039,10061,10067,10069,10079,10091,10093,\r\n10099,10103,10111,10133,10139,10141,10151,10159,10163,10169,10177,10181,\r\n10193,10211,10223,10243,10247,10253,10259,10267,10271,10273,10289,10301,\r\n10303,10313,10321,10331,10333,10337,10343,10357,10369,10391,10399,10427,\r\n10429,10433,10453,10457,10459,10463,10477,10487,10499,10501,10513,10529,\r\n10531,10559,10567,10589,10597,10601,10607,10613,10627,10631,10639,10651,\r\n10657,10663,10667,10687,10691,10709,10711,10723,10729,10733,10739,10753,\r\n10771,10781,10789,10799,10831,10837,10847,10853,10859,10861,10867,10883,\r\n10889,10891,10903,10909,10937,10939,10949,10957,10973,10979,10987,10993,\r\n11003,11027,11047,11057,11059,11069,11071,11083,11087,11093,11113,11117,\r\n11119,11131,11149,11159,11161,11171,11173,11177,11197,11213,11239,11243,\r\n11251,11257,11261,11273,11279,11287,11299,11311,11317,11321,11329,11351,\r\n11353,11369,11383,11393,11399,11411,11423,11437,11443,11447,11467,11471,\r\n11483,11489,11491,11497,11503,11519,11527,11549,11551,11579,11587,11593,\r\n11597,11617,11621,11633,11657,11677,11681,11689,11699,11701,11717,11719,\r\n11731,11743,11777,11779,11783,11789,11801,11807,11813,11821,11827,11831,\r\n11833,11839,11863,11867,11887,11897,11903,11909,11923,11927,11933,11939,\r\n11941,11953,11959,11969,11971,11981,11987,12007,12011,12037,12041,12043,\r\n12049,12071,12073,12097,12101,12107,12109,12113,12119,12143,12149,12157,\r\n12161,12163,12197,12203,12211,12227,12239,12241,12251,12253,12263,12269,\r\n12277,12281,12289,12301,12323,12329,12343,12347,12373,12377,12379,12391,\r\n12401,12409,12413,12421,12433,12437,12451,12457,12473,12479,12487,12491,\r\n12497,12503,12511,12517,12527,12539,12541,12547,12553,12569,12577,12583,\r\n12589,12601,12611,12613,12619,12637,12641,12647,12653,12659,12671,12689,\r\n12697,12703,12713,12721,12739,12743,12757,12763,12781,12791,12799,12809,\r\n12821,12823,12829,12841,12853,12889,12893,12899,12907,12911,12917,12919,\r\n12923,12941,12953,12959,12967,12973,12979,12983,13001,13003,13007,13009,\r\n13033,13037,13043,13049,13063,13093,13099,13103,13109,13121,13127,13147,\r\n13151,13159,13163,13171,13177,13183,13187,13217,13219,13229,13241,13249,\r\n13259,13267,13291,13297,13309,13313,13327,13331,13337,13339,13367,13381,\r\n13397,13399,13411,13417,13421,13441,13451,13457,13463,13469,13477,13487,\r\n13499,13513,13523,13537,13553,13567,13577,13591,13597,13613,13619,13627,\r\n13633,13649,13669,13679,13681,13687,13691,13693,13697,13709,13711,13721,\r\n13723,13729,13751,13757,13759,13763,13781,13789,13799,13807,13829,13831,\r\n13841,13859,13873,13877,13879,13883,13901,13903,13907,13913,13921,13931,\r\n13933,13963,13967,13997,13999,14009,14011,14029,14033,14051,14057,14071,\r\n14081,14083,14087,14107,14143,14149,14153,14159,14173,14177,14197,14207,\r\n14221,14243,14249,14251,14281,14293,14303,14321,14323,14327,14341,14347,\r\n14369,14387,14389,14401,14407,14411,14419,14423,14431,14437,14447,14449,\r\n14461,14479,14489,14503,14519,14533,14537,14543,14549,14551,14557,14561,\r\n14563,14591,14593,14621,14627,14629,14633,14639,14653,14657,14669,14683,\r\n14699,14713,14717,14723,14731,14737,14741,14747,14753,14759,14767,14771,\r\n14779,14783,14797,14813,14821,14827,14831,14843,14851,14867,14869,14879,\r\n14887,14891,14897,14923,14929,14939,14947,14951,14957,14969,14983,15013,\r\n15017,15031,15053,15061,15073,15077,15083,15091,15101,15107,15121,15131,\r\n15137,15139,15149,15161,15173,15187,15193,15199,15217,15227,15233,15241,\r\n15259,15263,15269,15271,15277,15287,15289,15299,15307,15313,15319,15329,\r\n15331,15349,15359,15361,15373,15377,15383,15391,15401,15413,15427,15439,\r\n15443,15451,15461,15467,15473,15493,15497,15511,15527,15541,15551,15559,\r\n15569,15581,15583,15601,15607,15619,15629,15641,15643,15647,15649,15661,\r\n15667,15671,15679,15683,15727,15731,15733,15737,15739,15749,15761,15767,\r\n15773,15787,15791,15797,15803,15809,15817,15823,15859,15877,15881,15887,\r\n15889,15901,15907,15913,15919,15923,15937,15959,15971,15973,15991,16001,\r\n16007,16033,16057,16061,16063,16067,16069,16073,16087,16091,16097,16103,\r\n16111,16127,16139,16141,16183,16187,16189,16193,16217,16223,16229,16231,\r\n16249,16253,16267,16273,16301,16319,16333,16339,16349,16361,16363,16369,\r\n16381,16411,16417,16421,16427,16433,16447,16451,16453,16477,16481,16487,\r\n16493,16519,16529,16547,16553,16561,16567,16573,16603,16607,16619,16631,\r\n16633,16649,16651,16657,16661,16673,16691,16693,16699,16703,16729,16741,\r\n16747,16759,16763,16787,16811,16823,16829,16831,16843,16871,16879,16883,\r\n16889,16901,16903,16921,16927,16931,16937,16943,16963,16979,16981,16987,\r\n16993,17011,17021,17027,17029,17033,17041,17047,17053,17077,17093,17099,\r\n17107,17117,17123,17137,17159,17167,17183,17189,17191,17203,17207,17209,\r\n17231,17239,17257,17291,17293,17299,17317,17321,17327,17333,17341,17351,\r\n17359,17377,17383,17387,17389,17393,17401,17417,17419,17431,17443,17449,\r\n17467,17471,17477,17483,17489,17491,17497,17509,17519,17539,17551,17569,\r\n17573,17579,17581,17597,17599,17609,17623,17627,17657,17659,17669,17681,\r\n17683,17707,17713,17729,17737,17747,17749,17761,17783,17789,17791,17807,\r\n17827,17837,17839,17851,17863,17881,17891,17903,17909,17911,17921,17923,\r\n17929,17939,17957,17959,17971,17977,17981,17987,17989,18013,18041,18043,\r\n18047,18049,18059,18061,18077,18089,18097,18119,18121,18127,18131,18133,\r\n18143,18149,18169,18181,18191,18199,18211,18217,18223,18229,18233,18251,\r\n18253,18257,18269,18287,18289,18301,18307,18311,18313,18329,18341,18353,\r\n18367,18371,18379,18397,18401,18413,18427,18433,18439,18443,18451,18457,\r\n18461,18481,18493,18503,18517,18521,18523,18539,18541,18553,18583,18587,\r\n18593,18617,18637,18661,18671,18679,18691,18701,18713,18719,18731,18743,\r\n18749,18757,18773,18787,18793,18797,18803,18839,18859,18869,18899,18911,\r\n18913,18917,18919,18947,18959,18973,18979,19001,19009,19013,19031,19037,\r\n19051,19069,19073,19079,19081,19087,19121,19139,19141,19157,19163,19181,\r\n19183,19207,19211,19213,19219,19231,19237,19249,19259,19267,19273,19289,\r\n19301,19309,19319,19333,19373,19379,19381,19387,19391,19403,19417,19421,\r\n19423,19427,19429,19433,19441,19447,19457,19463,19469,19471,19477,19483,\r\n19489,19501,19507,19531,19541,19543,19553,19559,19571,19577,19583,19597,\r\n19603,19609,19661,19681,19687,19697,19699,19709,19717,19727,19739,19751,\r\n19753,19759,19763,19777,19793,19801,19813,19819,19841,19843,19853,19861,\r\n19867,19889,19891,19913,19919,19927,19937,19949,19961,19963,19973,19979,\r\n19991,19993,19997,20011,20021,20023,20029,20047,20051,20063,20071,20089,\r\n20101,20107,20113,20117,20123,20129,20143,20147,20149,20161,20173,20177,\r\n20183,20201,20219,20231,20233,20249,20261,20269,20287,20297,20323,20327,\r\n20333,20341,20347,20353,20357,20359,20369,20389,20393,20399,20407,20411,\r\n20431,20441,20443,20477,20479,20483,20507,20509,20521,20533,20543,20549,\r\n20551,20563,20593,20599,20611,20627,20639,20641,20663,20681,20693,20707,\r\n20717,20719,20731,20743,20747,20749,20753,20759,20771,20773,20789,20807,\r\n20809,20849,20857,20873,20879,20887,20897,20899,20903,20921,20929,20939,\r\n20947,20959,20963,20981,20983,21001,21011,21013,21017,21019,21023,21031,\r\n21059,21061,21067,21089,21101,21107,21121,21139,21143,21149,21157,21163,\r\n21169,21179,21187,21191,21193,21211,21221,21227,21247,21269,21277,21283,\r\n21313,21317,21319,21323,21341,21347,21377,21379,21383,21391,21397,21401,\r\n21407,21419,21433,21467,21481,21487,21491,21493,21499,21503,21517,21521,\r\n21523,21529,21557,21559,21563,21569,21577,21587,21589,21599,21601,21611,\r\n21613,21617,21647,21649,21661,21673,21683,21701,21713,21727,21737,21739,\r\n21751,21757,21767,21773,21787,21799,21803,21817,21821,21839,21841,21851,\r\n21859,21863,21871,21881,21893,21911,21929,21937,21943,21961,21977,21991,\r\n21997,22003,22013,22027,22031,22037,22039,22051,22063,22067,22073,22079,\r\n22091,22093,22109,22111,22123,22129,22133,22147,22153,22157,22159,22171,\r\n22189,22193,22229,22247,22259,22271,22273,22277,22279,22283,22291,22303,\r\n22307,22343,22349,22367,22369,22381,22391,22397,22409,22433,22441,22447,\r\n22453,22469,22481,22483,22501,22511,22531,22541,22543,22549,22567,22571,\r\n22573,22613,22619,22621,22637,22639,22643,22651,22669,22679,22691,22697,\r\n22699,22709,22717,22721,22727,22739,22741,22751,22769,22777,22783,22787,\r\n22807,22811,22817,22853,22859,22861,22871,22877,22901,22907,22921,22937,\r\n22943,22961,22963,22973,22993,23003,23011,23017,23021,23027,23029,23039,\r\n23041,23053,23057,23059,23063,23071,23081,23087,23099,23117,23131,23143,\r\n23159,23167,23173,23189,23197,23201,23203,23209,23227,23251,23269,23279,\r\n23291,23293,23297,23311,23321,23327,23333,23339,23357,23369,23371,23399,\r\n23417,23431,23447,23459,23473,23497,23509,23531,23537,23539,23549,23557,\r\n23561,23563,23567,23581,23593,23599,23603,23609,23623,23627,23629,23633,\r\n23663,23669,23671,23677,23687,23689,23719,23741,23743,23747,23753,23761,\r\n23767,23773,23789,23801,23813,23819,23827,23831,23833,23857,23869,23873,\r\n23879,23887,23893,23899,23909,23911,23917,23929,23957,23971,23977,23981,\r\n23993,24001,24007,24019,24023,24029,24043,24049,24061,24071,24077,24083,\r\n24091,24097,24103,24107,24109,24113,24121,24133,24137,24151,24169,24179,\r\n24181,24197,24203,24223,24229,24239,24247,24251,24281,24317,24329,24337,\r\n24359,24371,24373,24379,24391,24407,24413,24419,24421,24439,24443,24469,\r\n24473,24481,24499,24509,24517,24527,24533,24547,24551,24571,24593,24611,\r\n24623,24631,24659,24671,24677,24683,24691,24697,24709,24733,24749,24763,\r\n24767,24781,24793,24799,24809,24821,24841,24847,24851,24859,24877,24889,\r\n24907,24917,24919,24923,24943,24953,24967,24971,24977,24979,24989,25013,\r\n25031,25033,25037,25057,25073,25087,25097,25111,25117,25121,25127,25147,\r\n25153,25163,25169,25171,25183,25189,25219,25229,25237,25243,25247,25253,\r\n25261,25301,25303,25307,25309,25321,25339,25343,25349,25357,25367,25373,\r\n25391,25409,25411,25423,25439,25447,25453,25457,25463,25469,25471,25523,\r\n25537,25541,25561,25577,25579,25583,25589,25601,25603,25609,25621,25633,\r\n25639,25643,25657,25667,25673,25679,25693,25703,25717,25733,25741,25747,\r\n25759,25763,25771,25793,25799,25801,25819,25841,25847,25849,25867,25873,\r\n25889,25903,25913,25919,25931,25933,25939,25943,25951,25969,25981,25997,\r\n25999,26003,26017,26021,26029,26041,26053,26083,26099,26107,26111,26113,\r\n26119,26141,26153,26161,26171,26177,26183,26189,26203,26209,26227,26237,\r\n26249,26251,26261,26263,26267,26293,26297,26309,26317,26321,26339,26347,\r\n26357,26371,26387,26393,26399,26407,26417,26423,26431,26437,26449,26459,\r\n26479,26489,26497,26501,26513,26539,26557,26561,26573,26591,26597,26627,\r\n26633,26641,26647,26669,26681,26683,26687,26693,26699,26701,26711,26713,\r\n26717,26723,26729,26731,26737,26759,26777,26783,26801,26813,26821,26833,\r\n26839,26849,26861,26863,26879,26881,26891,26893,26903,26921,26927,26947,\r\n26951,26953,26959,26981,26987,26993,27011,27017,27031,27043,27059,27061,\r\n27067,27073,27077,27091,27103,27107,27109,27127,27143,27179,27191,27197,\r\n27211,27239,27241,27253,27259,27271,27277,27281,27283,27299,27329,27337,\r\n27361,27367,27397,27407,27409,27427,27431,27437,27449,27457,27479,27481,\r\n27487,27509,27527,27529,27539,27541,27551,27581,27583,27611,27617,27631,\r\n27647,27653,27673,27689,27691,27697,27701,27733,27737,27739,27743,27749,\r\n27751,27763,27767,27773,27779,27791,27793,27799,27803,27809,27817,27823,\r\n27827,27847,27851,27883,27893,27901,27917,27919,27941,27943,27947,27953,\r\n27961,27967,27983,27997,28001,28019,28027,28031,28051,28057,28069,28081,\r\n28087,28097,28099,28109,28111,28123,28151,28163,28181,28183,28201,28211,\r\n28219,28229,28277,28279,28283,28289,28297,28307,28309,28319,28349,28351,\r\n28387,28393,28403,28409,28411,28429,28433,28439,28447,28463,28477,28493,\r\n28499,28513,28517,28537,28541,28547,28549,28559,28571,28573,28579,28591,\r\n28597,28603,28607,28619,28621,28627,28631,28643,28649,28657,28661,28663,\r\n28669,28687,28697,28703,28711,28723,28729,28751,28753,28759,28771,28789,\r\n28793,28807,28813,28817,28837,28843,28859,28867,28871,28879,28901,28909,\r\n28921,28927,28933,28949,28961,28979,29009,29017,29021,29023,29027,29033,\r\n29059,29063,29077,29101,29123,29129,29131,29137,29147,29153,29167,29173,\r\n29179,29191,29201,29207,29209,29221,29231,29243,29251,29269,29287,29297,\r\n29303,29311,29327,29333,29339,29347,29363,29383,29387,29389,29399,29401,\r\n29411,29423,29429,29437,29443,29453,29473,29483,29501,29527,29531,29537,\r\n29567,29569,29573,29581,29587,29599,29611,29629,29633,29641,29663,29669,\r\n29671,29683,29717,29723,29741,29753,29759,29761,29789,29803,29819,29833,\r\n29837,29851,29863,29867,29873,29879,29881,29917,29921,29927,29947,29959,\r\n29983,29989,30011,30013,30029,30047,30059,30071,30089,30091,30097,30103,\r\n30109,30113,30119,30133,30137,30139,30161,30169,30181,30187,30197,30203,\r\n30211,30223,30241,30253,30259,30269,30271,30293,30307,30313,30319,30323,\r\n30341,30347,30367,30389,30391,30403,30427,30431,30449,30467,30469,30491,\r\n30493,30497,30509,30517,30529,30539,30553,30557,30559,30577,30593,30631,\r\n30637,30643,30649,30661,30671,30677,30689,30697,30703,30707,30713,30727,\r\n30757,30763,30773,30781,30803,30809,30817,30829,30839,30841,30851,30853,\r\n30859,30869,30871,30881,30893,30911,30931,30937,30941,30949,30971,30977,\r\n30983,31013,31019,31033,31039,31051,31063,31069,31079,31081,31091,31121,\r\n31123,31139,31147,31151,31153,31159,31177,31181,31183,31189,31193,31219,\r\n31223,31231,31237,31247,31249,31253,31259,31267,31271,31277,31307,31319,\r\n31321,31327,31333,31337,31357,31379,31387,31391,31393,31397,31469,31477,\r\n31481,31489,31511,31513,31517,31531,31541,31543,31547,31567,31573,31583,\r\n31601,31607,31627,31643,31649,31657,31663,31667,31687,31699,31721,31723,\r\n31727,31729,31741,31751,31769,31771,31793,31799,31817,31847,31849,31859,\r\n31873,31883,31891,31907,31957,31963,31973,31981,31991,32003,32009,32027,\r\n32029,32051,32057,32059,32063,32069,32077,32083,32089,32099,32117,32119,\r\n32141,32143,32159,32173,32183,32189,32191,32203,32213,32233,32237,32251,\r\n32257,32261,32297,32299,32303,32309,32321,32323,32327,32341,32353,32359,\r\n32363,32369,32371,32377,32381,32401,32411,32413,32423,32429,32441,32443,\r\n32467,32479,32491,32497,32503,32507,32531,32533,32537,32561,32563,32569,\r\n32573,32579,32587,32603,32609,32611,32621,32633,32647,32653,32687,32693,\r\n32707,32713,32717,32719,32749,32771,32779,32783,32789,32797,32801,32803,\r\n32831,32833,32839,32843,32869,32887,32909,32911,32917,32933,32939,32941,\r\n32957,32969,32971,32983,32987,32993,32999,33013,33023,33029,33037,33049,\r\n33053,33071,33073,33083,33091,33107,33113,33119,33149,33151,33161,33179,\r\n33181,33191,33199,33203,33211,33223,33247,33287,33289,33301,33311,33317,\r\n33329,33331,33343,33347,33349,33353,33359,33377,33391,33403,33409,33413,\r\n33427,33457,33461,33469,33479,33487,33493,33503,33521,33529,33533,33547,\r\n33563,33569,33577,33581,33587,33589,33599,33601,33613,33617,33619,33623,\r\n33629,33637,33641,33647,33679,33703,33713,33721,33739,33749,33751,33757,\r\n33767,33769,33773,33791,33797,33809,33811,33827,33829,33851,33857,33863,\r\n33871,33889,33893,33911,33923,33931,33937,33941,33961,33967,33997,34019,\r\n34031,34033,34039,34057,34061,34123,34127,34129,34141,34147,34157,34159,\r\n34171,34183,34211,34213,34217,34231,34253,34259,34261,34267,34273,34283,\r\n34297,34301,34303,34313,34319,34327,34337,34351,34361,34367,34369,34381,\r\n34403,34421,34429,34439,34457,34469,34471,34483,34487,34499,34501,34511,\r\n34513,34519,34537,34543,34549,34583,34589,34591,34603,34607,34613,34631,\r\n34649,34651,34667,34673,34679,34687,34693,34703,34721,34729,34739,34747,\r\n34757,34759,34763,34781,34807,34819,34841,34843,34847,34849,34871,34877,\r\n34883,34897,34913,34919,34939,34949,34961,34963,34981,35023,35027,35051,\r\n35053,35059,35069,35081,35083,35089,35099,35107,35111,35117,35129,35141,\r\n35149,35153,35159,35171,35201,35221,35227,35251,35257,35267,35279,35281,\r\n35291,35311,35317,35323,35327,35339,35353,35363,35381,35393,35401,35407,\r\n35419,35423,35437,35447,35449,35461,35491,35507,35509,35521,35527,35531,\r\n35533,35537,35543,35569,35573,35591,35593,35597,35603,35617,35671,35677,\r\n35729,35731,35747,35753,35759,35771,35797,35801,35803,35809,35831,35837,\r\n35839,35851,35863,35869,35879,35897,35899,35911,35923,35933,35951,35963,\r\n35969,35977,35983,35993,35999,36007,36011,36013,36017,36037,36061,36067,\r\n36073,36083,36097,36107,36109,36131,36137,36151,36161,36187,36191,36209,\r\n36217,36229,36241,36251,36263,36269,36277,36293,36299,36307,36313,36319,\r\n36341,36343,36353,36373,36383,36389,36433,36451,36457,36467,36469,36473,\r\n36479,36493,36497,36523,36527,36529,36541,36551,36559,36563,36571,36583,\r\n36587,36599,36607,36629,36637,36643,36653,36671,36677,36683,36691,36697,\r\n36709,36713,36721,36739,36749,36761,36767,36779,36781,36787,36791,36793,\r\n36809,36821,36833,36847,36857,36871,36877,36887,36899,36901,36913,36919,\r\n36923,36929,36931,36943,36947,36973,36979,36997,37003,37013,37019,37021,\r\n37039,37049,37057,37061,37087,37097,37117,37123,37139,37159,37171,37181,\r\n37189,37199,37201,37217,37223,37243,37253,37273,37277,37307,37309,37313,\r\n37321,37337,37339,37357,37361,37363,37369,37379,37397,37409,37423,37441,\r\n37447,37463,37483,37489,37493,37501,37507,37511,37517,37529,37537,37547,\r\n37549,37561,37567,37571,37573,37579,37589,37591,37607,37619,37633,37643,\r\n37649,37657,37663,37691,37693,37699,37717,37747,37781,37783,37799,37811,\r\n37813,37831,37847,37853,37861,37871,37879,37889,37897,37907,37951,37957,\r\n37963,37967,37987,37991,37993,37997,38011,38039,38047,38053,38069,38083,\r\n38113,38119,38149,38153,38167,38177,38183,38189,38197,38201,38219,38231,\r\n38237,38239,38261,38273,38281,38287,38299,38303,38317,38321,38327,38329,\r\n38333,38351,38371,38377,38393,38431,38447,38449,38453,38459,38461,38501,\r\n38543,38557,38561,38567,38569,38593,38603,38609,38611,38629,38639,38651,\r\n38653,38669,38671,38677,38693,38699,38707,38711,38713,38723,38729,38737,\r\n38747,38749,38767,38783,38791,38803,38821,38833,38839,38851,38861,38867,\r\n38873,38891,38903,38917,38921,38923,38933,38953,38959,38971,38977,38993,\r\n39019,39023,39041,39043,39047,39079,39089,39097,39103,39107,39113,39119,\r\n39133,39139,39157,39161,39163,39181,39191,39199,39209,39217,39227,39229,\r\n39233,39239,39241,39251,39293,39301,39313,39317,39323,39341,39343,39359,\r\n39367,39371,39373,39383,39397,39409,39419,39439,39443,39451,39461,39499,\r\n39503,39509,39511,39521,39541,39551,39563,39569,39581,39607,39619,39623,\r\n39631,39659,39667,39671,39679,39703,39709,39719,39727,39733,39749,39761,\r\n39769,39779,39791,39799,39821,39827,39829,39839,39841,39847,39857,39863,\r\n39869,39877,39883,39887,39901,39929,39937,39953,39971,39979,39983,39989,\r\n40009,40013,40031,40037,40039,40063,40087,40093,40099,40111,40123,40127,\r\n40129,40151,40153,40163,40169,40177,40189,40193,40213,40231,40237,40241,\r\n40253,40277,40283,40289,40343,40351,40357,40361,40387,40423,40427,40429,\r\n40433,40459,40471,40483,40487,40493,40499,40507,40519,40529,40531,40543,\r\n40559,40577,40583,40591,40597,40609,40627,40637,40639,40693,40697,40699,\r\n40709,40739,40751,40759,40763,40771,40787,40801,40813,40819,40823,40829,\r\n40841,40847,40849,40853,40867,40879,40883,40897,40903,40927,40933,40939,\r\n40949,40961,40973,40993,41011,41017,41023,41039,41047,41051,41057,41077,\r\n41081,41113,41117,41131,41141,41143,41149,41161,41177,41179,41183,41189,\r\n41201,41203,41213,41221,41227,41231,41233,41243,41257,41263,41269,41281,\r\n41299,41333,41341,41351,41357,41381,41387,41389,41399,41411,41413,41443,\r\n41453,41467,41479,41491,41507,41513,41519,41521,41539,41543,41549,41579,\r\n41593,41597,41603,41609,41611,41617,41621,41627,41641,41647,41651,41659,\r\n41669,41681,41687,41719,41729,41737,41759,41761,41771,41777,41801,41809,\r\n41813,41843,41849,41851,41863,41879,41887,41893,41897,41903,41911,41927,\r\n41941,41947,41953,41957,41959,41969,41981,41983,41999,42013,42017,42019,\r\n42023,42043,42061,42071,42073,42083,42089,42101,42131,42139,42157,42169,\r\n42179,42181,42187,42193,42197,42209,42221,42223,42227,42239,42257,42281,\r\n42283,42293,42299,42307,42323,42331,42337,42349,42359,42373,42379,42391,\r\n42397,42403,42407,42409,42433,42437,42443,42451,42457,42461,42463,42467,\r\n42473,42487,42491,42499,42509,42533,42557,42569,42571,42577,42589,42611,\r\n42641,42643,42649,42667,42677,42683,42689,42697,42701,42703,42709,42719,\r\n42727,42737,42743,42751,42767,42773,42787,42793,42797,42821,42829,42839,\r\n42841,42853,42859,42863,42899,42901,42923,42929,42937,42943,42953,42961,\r\n42967,42979,42989,43003,43013,43019,43037,43049,43051,43063,43067,43093,\r\n43103,43117,43133,43151,43159,43177,43189,43201,43207,43223,43237,43261,\r\n43271,43283,43291,43313,43319,43321,43331,43391,43397,43399,43403,43411,\r\n43427,43441,43451,43457,43481,43487,43499,43517,43541,43543,43573,43577,\r\n43579,43591,43597,43607,43609,43613,43627,43633,43649,43651,43661,43669,\r\n43691,43711,43717,43721,43753,43759,43777,43781,43783,43787,43789,43793,\r\n43801,43853,43867,43889,43891,43913,43933,43943,43951,43961,43963,43969,\r\n43973,43987,43991,43997,44017,44021,44027,44029,44041,44053,44059,44071,\r\n44087,44089,44101,44111,44119,44123,44129,44131,44159,44171,44179,44189,\r\n44201,44203,44207,44221,44249,44257,44263,44267,44269,44273,44279,44281,\r\n44293,44351,44357,44371,44381,44383,44389,44417,44449,44453,44483,44491,\r\n44497,44501,44507,44519,44531,44533,44537,44543,44549,44563,44579,44587,\r\n44617,44621,44623,44633,44641,44647,44651,44657,44683,44687,44699,44701,\r\n44711,44729,44741,44753,44771,44773,44777,44789,44797,44809,44819,44839,\r\n44843,44851,44867,44879,44887,44893,44909,44917,44927,44939,44953,44959,\r\n44963,44971,44983,44987,45007,45013,45053,45061,45077,45083,45119,45121,\r\n45127,45131,45137,45139,45161,45179,45181,45191,45197,45233,45247,45259,\r\n45263,45281,45289,45293,45307,45317,45319,45329,45337,45341,45343,45361,\r\n45377,45389,45403,45413,45427,45433,45439,45481,45491,45497,45503,45523,\r\n45533,45541,45553,45557,45569,45587,45589,45599,45613,45631,45641,45659,\r\n45667,45673,45677,45691,45697,45707,45737,45751,45757,45763,45767,45779,\r\n45817,45821,45823,45827,45833,45841,45853,45863,45869,45887,45893,45943,\r\n45949,45953,45959,45971,45979,45989,46021,46027,46049,46051,46061,46073,\r\n46091,46093,46099,46103,46133,46141,46147,46153,46171,46181,46183,46187,\r\n46199,46219,46229,46237,46261,46271,46273,46279,46301,46307,46309,46327,\r\n46337,46349,46351,46381,46399,46411,46439,46441,46447,46451,46457,46471,\r\n46477,46489,46499,46507,46511,46523,46549,46559,46567,46573,46589,46591,\r\n46601,46619,46633,46639,46643,46649,46663,46679,46681,46687,46691,46703,\r\n46723,46727,46747,46751,46757,46769,46771,46807,46811,46817,46819,46829,\r\n46831,46853,46861,46867,46877,46889,46901,46919,46933,46957,46993,46997,\r\n47017,47041,47051,47057,47059,47087,47093,47111,47119,47123,47129,47137,\r\n47143,47147,47149,47161,47189,47207,47221,47237,47251,47269,47279,47287,\r\n47293,47297,47303,47309,47317,47339,47351,47353,47363,47381,47387,47389,\r\n47407,47417,47419,47431,47441,47459,47491,47497,47501,47507,47513,47521,\r\n47527,47533,47543,47563,47569,47581,47591,47599,47609,47623,47629,47639,\r\n47653,47657,47659,47681,47699,47701,47711,47713,47717,47737,47741,47743,\r\n47777,47779,47791,47797,47807,47809,47819,47837,47843,47857,47869,47881,\r\n47903,47911,47917,47933,47939,47947,47951,47963,47969,47977,47981,48017,\r\n48023,48029,48049,48073,48079,48091,48109,48119,48121,48131,48157,48163,\r\n48179,48187,48193,48197,48221,48239,48247,48259,48271,48281,48299,48311,\r\n48313,48337,48341,48353,48371,48383,48397,48407,48409,48413,48437,48449,\r\n48463,48473,48479,48481,48487,48491,48497,48523,48527,48533,48539,48541,\r\n48563,48571,48589,48593,48611,48619,48623,48647,48649,48661,48673,48677,\r\n48679,48731,48733,48751,48757,48761,48767,48779,48781,48787,48799,48809,\r\n48817,48821,48823,48847,48857,48859,48869,48871,48883,48889,48907,48947,\r\n48953,48973,48989,48991,49003,49009,49019,49031,49033,49037,49043,49057,\r\n49069,49081,49103,49109,49117,49121,49123,49139,49157,49169,49171,49177,\r\n49193,49199,49201,49207,49211,49223,49253,49261,49277,49279,49297,49307,\r\n49331,49333,49339,49363,49367,49369,49391,49393,49409,49411,49417,49429,\r\n49433,49451,49459,49463,49477,49481,49499,49523,49529,49531,49537,49547,\r\n49549,49559,49597,49603,49613,49627,49633,49639,49663,49667,49669,49681,\r\n49697,49711,49727,49739,49741,49747,49757,49783,49787,49789,49801,49807,\r\n49811,49823,49831,49843,49853,49871,49877,49891,49919,49921,49927,49937,\r\n49939,49943,49957,49991,49993,49999,50021,50023,50033,50047,50051,50053,\r\n50069,50077,50087,50093,50101,50111,50119,50123,50129,50131,50147,50153,\r\n50159,50177,50207,50221,50227,50231,50261,50263,50273,50287,50291,50311,\r\n50321,50329,50333,50341,50359,50363,50377,50383,50387,50411,50417,50423,\r\n50441,50459,50461,50497,50503,50513,50527,50539,50543,50549,50551,50581,\r\n50587,50591,50593,50599,50627,50647,50651,50671,50683,50707,50723,50741,\r\n50753,50767,50773,50777,50789,50821,50833,50839,50849,50857,50867,50873,\r\n50891,50893,50909,50923,50929,50951,50957,50969,50971,50989,50993,51001,\r\n51031,51043,51047,51059,51061,51071,51109,51131,51133,51137,51151,51157,\r\n51169,51193,51197,51199,51203,51217,51229,51239,51241,51257,51263,51283,\r\n51287,51307,51329,51341,51343,51347,51349,51361,51383,51407,51413,51419,\r\n51421,51427,51431,51437,51439,51449,51461,51473,51479,51481,51487,51503,\r\n51511,51517,51521,51539,51551,51563,51577,51581,51593,51599,51607,51613,\r\n51631,51637,51647,51659,51673,51679,51683,51691,51713,51719,51721,51749,\r\n51767,51769,51787,51797,51803,51817,51827,51829,51839,51853,51859,51869,\r\n51871,51893,51899,51907,51913,51929,51941,51949,51971,51973,51977,51991,\r\n52009,52021,52027,52051,52057,52067,52069,52081,52103,52121,52127,52147,\r\n52153,52163,52177,52181,52183,52189,52201,52223,52237,52249,52253,52259,\r\n52267,52289,52291,52301,52313,52321,52361,52363,52369,52379,52387,52391,\r\n52433,52453,52457,52489,52501,52511,52517,52529,52541,52543,52553,52561,\r\n52567,52571,52579,52583,52609,52627,52631,52639,52667,52673,52691,52697,\r\n52709,52711,52721,52727,52733,52747,52757,52769,52783,52807,52813,52817,\r\n52837,52859,52861,52879,52883,52889,52901,52903,52919,52937,52951,52957,\r\n52963,52967,52973,52981,52999,53003,53017,53047,53051,53069,53077,53087,\r\n53089,53093,53101,53113,53117,53129,53147,53149,53161,53171,53173,53189,\r\n53197,53201,53231,53233,53239,53267,53269,53279,53281,53299,53309,53323,\r\n53327,53353,53359,53377,53381,53401,53407,53411,53419,53437,53441,53453,\r\n53479,53503,53507,53527,53549,53551,53569,53591,53593,53597,53609,53611,\r\n53617,53623,53629,53633,53639,53653,53657,53681,53693,53699,53717,53719,\r\n53731,53759,53773,53777,53783,53791,53813,53819,53831,53849,53857,53861,\r\n53881,53887,53891,53897,53899,53917,53923,53927,53939,53951,53959,53987,\r\n53993,54001,54011,54013,54037,54049,54059,54083,54091,54101,54121,54133,\r\n54139,54151,54163,54167,54181,54193,54217,54251,54269,54277,54287,54293,\r\n54311,54319,54323,54331,54347,54361,54367,54371,54377,54401,54403,54409,\r\n54413,54419,54421,54437,54443,54449,54469,54493,54497,54499,54503,54517,\r\n54521,54539,54541,54547,54559,54563,54577,54581,54583,54601,54617,54623,\r\n54629,54631,54647,54667,54673,54679,54709,54713,54721,54727,54751,54767,\r\n54773,54779,54787,54799,54829,54833,54851,54869,54877,54881,54907,54917,\r\n54919,54941,54949,54959,54973,54979,54983,55001,55009,55021,55049,55051,\r\n55057,55061,55073,55079,55103,55109,55117,55127,55147,55163,55171,55201,\r\n55207,55213,55217,55219,55229,55243,55249,55259,55291,55313,55331,55333,\r\n55337,55339,55343,55351,55373,55381,55399,55411,55439,55441,55457,55469,\r\n55487,55501,55511,55529,55541,55547,55579,55589,55603,55609,55619,55621,\r\n55631,55633,55639,55661,55663,55667,55673,55681,55691,55697,55711,55717,\r\n55721,55733,55763,55787,55793,55799,55807,55813,55817,55819,55823,55829,\r\n55837,55843,55849,55871,55889,55897,55901,55903,55921,55927,55931,55933,\r\n55949,55967,55987,55997,56003,56009,56039,56041,56053,56081,56087,56093,\r\n56099,56101,56113,56123,56131,56149,56167,56171,56179,56197,56207,56209,\r\n56237,56239,56249,56263,56267,56269,56299,56311,56333,56359,56369,56377,\r\n56383,56393,56401,56417,56431,56437,56443,56453,56467,56473,56477,56479,\r\n56489,56501,56503,56509,56519,56527,56531,56533,56543,56569,56591,56597,\r\n56599,56611,56629,56633,56659,56663,56671,56681,56687,56701,56711,56713,\r\n56731,56737,56747,56767,56773,56779,56783,56807,56809,56813,56821,56827,\r\n56843,56857,56873,56891,56893,56897,56909,56911,56921,56923,56929,56941,\r\n56951,56957,56963,56983,56989,56993,56999,57037,57041,57047,57059,57073,\r\n57077,57089,57097,57107,57119,57131,57139,57143,57149,57163,57173,57179,\r\n57191,57193,57203,57221,57223,57241,57251,57259,57269,57271,57283,57287,\r\n57301,57329,57331,57347,57349,57367,57373,57383,57389,57397,57413,57427,\r\n57457,57467,57487,57493,57503,57527,57529,57557,57559,57571,57587,57593,\r\n57601,57637,57641,57649,57653,57667,57679,57689,57697,57709,57713,57719,\r\n57727,57731,57737,57751,57773,57781,57787,57791,57793,57803,57809,57829,\r\n57839,57847,57853,57859,57881,57899,57901,57917,57923,57943,57947,57973,\r\n57977,57991,58013,58027,58031,58043,58049,58057,58061,58067,58073,58099,\r\n58109,58111,58129,58147,58151,58153,58169,58171,58189,58193,58199,58207,\r\n58211,58217,58229,58231,58237,58243,58271,58309,58313,58321,58337,58363,\r\n58367,58369,58379,58391,58393,58403,58411,58417,58427,58439,58441,58451,\r\n58453,58477,58481,58511,58537,58543,58549,58567,58573,58579,58601,58603,\r\n58613,58631,58657,58661,58679,58687,58693,58699,58711,58727,58733,58741,\r\n58757,58763,58771,58787,58789,58831,58889,58897,58901,58907,58909,58913,\r\n58921,58937,58943,58963,58967,58979,58991,58997,59009,59011,59021,59023,\r\n59029,59051,59053,59063,59069,59077,59083,59093,59107,59113,59119,59123,\r\n59141,59149,59159,59167,59183,59197,59207,59209,59219,59221,59233,59239,\r\n59243,59263,59273,59281,59333,59341,59351,59357,59359,59369,59377,59387,\r\n59393,59399,59407,59417,59419,59441,59443,59447,59453,59467,59471,59473,\r\n59497,59509,59513,59539,59557,59561,59567,59581,59611,59617,59621,59627,\r\n59629,59651,59659,59663,59669,59671,59693,59699,59707,59723,59729,59743,\r\n59747,59753,59771,59779,59791,59797,59809,59833,59863,59879,59887,59921,\r\n59929,59951,59957,59971,59981,59999,60013,60017,60029,60037,60041,60077,\r\n60083,60089,60091,60101,60103,60107,60127,60133,60139,60149,60161,60167,\r\n60169,60209,60217,60223,60251,60257,60259,60271,60289,60293,60317,60331,\r\n60337,60343,60353,60373,60383,60397,60413,60427,60443,60449,60457,60493,\r\n60497,60509,60521,60527,60539,60589,60601,60607,60611,60617,60623,60631,\r\n60637,60647,60649,60659,60661,60679,60689,60703,60719,60727,60733,60737,\r\n60757,60761,60763,60773,60779,60793,60811,60821,60859,60869,60887,60889,\r\n60899,60901,60913,60917,60919,60923,60937,60943,60953,60961,61001,61007,\r\n61027,61031,61043,61051,61057,61091,61099,61121,61129,61141,61151,61153,\r\n61169,61211,61223,61231,61253,61261,61283,61291,61297,61331,61333,61339,\r\n61343,61357,61363,61379,61381,61403,61409,61417,61441,61463,61469,61471,\r\n61483,61487,61493,61507,61511,61519,61543,61547,61553,61559,61561,61583,\r\n61603,61609,61613,61627,61631,61637,61643,61651,61657,61667,61673,61681,\r\n61687,61703,61717,61723,61729,61751,61757,61781,61813,61819,61837,61843,\r\n61861,61871,61879,61909,61927,61933,61949,61961,61967,61979,61981,61987,\r\n61991,62003,62011,62017,62039,62047,62053,62057,62071,62081,62099,62119,\r\n62129,62131,62137,62141,62143,62171,62189,62191,62201,62207,62213,62219,\r\n62233,62273,62297,62299,62303,62311,62323,62327,62347,62351,62383,62401,\r\n62417,62423,62459,62467,62473,62477,62483,62497,62501,62507,62533,62539,\r\n62549,62563,62581,62591,62597,62603,62617,62627,62633,62639,62653,62659,\r\n62683,62687,62701,62723,62731,62743,62753,62761,62773,62791,62801,62819,\r\n62827,62851,62861,62869,62873,62897,62903,62921,62927,62929,62939,62969,\r\n62971,62981,62983,62987,62989,63029,63031,63059,63067,63073,63079,63097,\r\n63103,63113,63127,63131,63149,63179,63197,63199,63211,63241,63247,63277,\r\n63281,63299,63311,63313,63317,63331,63337,63347,63353,63361,63367,63377,\r\n63389,63391,63397,63409,63419,63421,63439,63443,63463,63467,63473,63487,\r\n63493,63499,63521,63527,63533,63541,63559,63577,63587,63589,63599,63601,\r\n63607,63611,63617,63629,63647,63649,63659,63667,63671,63689,63691,63697,\r\n63703,63709,63719,63727,63737,63743,63761,63773,63781,63793,63799,63803,\r\n63809,63823,63839,63841,63853,63857,63863,63901,63907,63913,63929,63949,\r\n63977,63997,64007,64013,64019,64033,64037,64063,64067,64081,64091,64109,\r\n64123,64151,64153,64157,64171,64187,64189,64217,64223,64231,64237,64271,\r\n64279,64283,64301,64303,64319,64327,64333,64373,64381,64399,64403,64433,\r\n64439,64451,64453,64483,64489,64499,64513,64553,64567,64577,64579,64591,\r\n64601,64609,64613,64621,64627,64633,64661,64663,64667,64679,64693,64709,\r\n64717,64747,64763,64781,64783,64793,64811,64817,64849,64853,64871,64877,\r\n64879,64891,64901,64919,64921,64927,64937,64951,64969,64997,65003,65011,\r\n65027,65029,65033,65053,65063,65071,65089,65099,65101,65111,65119,65123,\r\n65129,65141,65147,65167,65171,65173,65179,65183,65203,65213,65239,65257,\r\n65267,65269,65287,65293,65309,65323,65327,65353,65357,65371,65381,65393,\r\n65407,65413,65419,65423,65437,65447,65449,65479,65497,65519,65521,65537,\r\n65539,65543,65551,65557,65563,65579,65581,65587,65599,65609,65617,65629,\r\n65633,65647,65651,65657,65677,65687,65699,65701,65707,65713,65717,65719,\r\n65729,65731,65761,65777,65789,65809,65827,65831,65837,65839,65843,65851,\r\n65867,65881,65899,65921,65927,65929,65951,65957,65963,65981,65983,65993,\r\n66029,66037,66041,66047,66067,66071,66083,66089,66103,66107,66109,66137,\r\n66161,66169,66173,66179,66191,66221,66239,66271,66293,66301,66337,66343,\r\n66347,66359,66361,66373,66377,66383,66403,66413,66431,66449,66457,66463,\r\n66467,66491,66499,66509,66523,66529,66533,66541,66553,66569,66571,66587,\r\n66593,66601,66617,66629,66643,66653,66683,66697,66701,66713,66721,66733,\r\n66739,66749,66751,66763,66791,66797,66809,66821,66841,66851,66853,66863,\r\n66877,66883,66889,66919,66923,66931,66943,66947,66949,66959,66973,66977,\r\n67003,67021,67033,67043,67049,67057,67061,67073,67079,67103,67121,67129,\r\n67139,67141,67153,67157,67169,67181,67187,67189,67211,67213,67217,67219,\r\n67231,67247,67261,67271,67273,67289,67307,67339,67343,67349,67369,67391,\r\n67399,67409,67411,67421,67427,67429,67433,67447,67453,67477,67481,67489,\r\n67493,67499,67511,67523,67531,67537,67547,67559,67567,67577,67579,67589,\r\n67601,67607,67619,67631,67651,67679,67699,67709,67723,67733,67741,67751,\r\n67757,67759,67763,67777,67783,67789,67801,67807,67819,67829,67843,67853,\r\n67867,67883,67891,67901,67927,67931,67933,67939,67943,67957,67961,67967,\r\n67979,67987,67993,68023,68041,68053,68059,68071,68087,68099,68111,68113,\r\n68141,68147,68161,68171,68207,68209,68213,68219,68227,68239,68261,68279,\r\n68281,68311,68329,68351,68371,68389,68399,68437,68443,68447,68449,68473,\r\n68477,68483,68489,68491,68501,68507,68521,68531,68539,68543,68567,68581,\r\n68597,68611,68633,68639,68659,68669,68683,68687,68699,68711,68713,68729,\r\n68737,68743,68749,68767,68771,68777,68791,68813,68819,68821,68863,68879,\r\n68881,68891,68897,68899,68903,68909,68917,68927,68947,68963,68993,69001,\r\n69011,69019,69029,69031,69061,69067,69073,69109,69119,69127,69143,69149,\r\n69151,69163,69191,69193,69197,69203,69221,69233,69239,69247,69257,69259,\r\n69263,69313,69317,69337,69341,69371,69379,69383,69389,69401,69403,69427,\r\n69431,69439,69457,69463,69467,69473,69481,69491,69493,69497,69499,69539,\r\n69557,69593,69623,69653,69661,69677,69691,69697,69709,69737,69739,69761,\r\n69763,69767,69779,69809,69821,69827,69829,69833,69847,69857,69859,69877,\r\n69899,69911,69929,69931,69941,69959,69991,69997,70001,70003,70009,70019,\r\n70039,70051,70061,70067,70079,70099,70111,70117,70121,70123,70139,70141,\r\n70157,70163,70177,70181,70183,70199,70201,70207,70223,70229,70237,70241,\r\n70249,70271,70289,70297,70309,70313,70321,70327,70351,70373,70379,70381,\r\n70393,70423,70429,70439,70451,70457,70459,70481,70487,70489,70501,70507,\r\n70529,70537,70549,70571,70573,70583,70589,70607,70619,70621,70627,70639,\r\n70657,70663,70667,70687,70709,70717,70729,70753,70769,70783,70793,70823,\r\n70841,70843,70849,70853,70867,70877,70879,70891,70901,70913,70919,70921,\r\n70937,70949,70951,70957,70969,70979,70981,70991,70997,70999,71011,71023,\r\n71039,71059,71069,71081,71089,71119,71129,71143,71147,71153,71161,71167,\r\n71171,71191,71209,71233,71237,71249,71257,71261,71263,71287,71293,71317,\r\n71327,71329,71333,71339,71341,71347,71353,71359,71363,71387,71389,71399,\r\n71411,71413,71419,71429,71437,71443,71453,71471,71473,71479,71483,71503,\r\n71527,71537,71549,71551,71563,71569,71593,71597,71633,71647,71663,71671,\r\n71693,71699,71707,71711,71713,71719,71741,71761,71777,71789,71807,71809,\r\n71821,71837,71843,71849,71861,71867,71879,71881,71887,71899,71909,71917,\r\n71933,71941,71947,71963,71971,71983,71987,71993,71999,72019,72031,72043,\r\n72047,72053,72073,72077,72089,72091,72101,72103,72109,72139,72161,72167,\r\n72169,72173,72211,72221,72223,72227,72229,72251,72253,72269,72271,72277,\r\n72287,72307,72313,72337,72341,72353,72367,72379,72383,72421,72431,72461,\r\n72467,72469,72481,72493,72497,72503,72533,72547,72551,72559,72577,72613,\r\n72617,72623,72643,72647,72649,72661,72671,72673,72679,72689,72701,72707,\r\n72719,72727,72733,72739,72763,72767,72797,72817,72823,72859,72869,72871,\r\n72883,72889,72893,72901,72907,72911,72923,72931,72937,72949,72953,72959,\r\n72973,72977,72997,73009,73013,73019,73037,73039,73043,73061,73063,73079,\r\n73091,73121,73127,73133,73141,73181,73189,73237,73243,73259,73277,73291,\r\n73303,73309,73327,73331,73351,73361,73363,73369,73379,73387,73417,73421,\r\n73433,73453,73459,73471,73477,73483,73517,73523,73529,73547,73553,73561,\r\n73571,73583,73589,73597,73607,73609,73613,73637,73643,73651,73673,73679,\r\n73681,73693,73699,73709,73721,73727,73751,73757,73771,73783,73819,73823,\r\n73847,73849,73859,73867,73877,73883,73897,73907,73939,73943,73951,73961,\r\n73973,73999,74017,74021,74027,74047,74051,74071,74077,74093,74099,74101,\r\n74131,74143,74149,74159,74161,74167,74177,74189,74197,74201,74203,74209,\r\n74219,74231,74257,74279,74287,74293,74297,74311,74317,74323,74353,74357,\r\n74363,74377,74381,74383,74411,74413,74419,74441,74449,74453,74471,74489,\r\n74507,74509,74521,74527,74531,74551,74561,74567,74573,74587,74597,74609,\r\n74611,74623,74653,74687,74699,74707,74713,74717,74719,74729,74731,74747,\r\n74759,74761,74771,74779,74797,74821,74827,74831,74843,74857,74861,74869,\r\n74873,74887,74891,74897,74903,74923,74929,74933,74941,74959,75011,75013,\r\n75017,75029,75037,75041,75079,75083,75109,75133,75149,75161,75167,75169,\r\n75181,75193,75209,75211,75217,75223,75227,75239,75253,75269,75277,75289,\r\n75307,75323,75329,75337,75347,75353,75367,75377,75389,75391,75401,75403,\r\n75407,75431,75437,75479,75503,75511,75521,75527,75533,75539,75541,75553,\r\n75557,75571,75577,75583,75611,75617,75619,75629,75641,75653,75659,75679,\r\n75683,75689,75703,75707,75709,75721,75731,75743,75767,75773,75781,75787,\r\n75793,75797,75821,75833,75853,75869,75883,75913,75931,75937,75941,75967,\r\n75979,75983,75989,75991,75997,76001,76003,76031,76039,76079,76081,76091,\r\n76099,76103,76123,76129,76147,76157,76159,76163,76207,76213,76231,76243,\r\n76249,76253,76259,76261,76283,76289,76303,76333,76343,76367,76369,76379,\r\n76387,76403,76421,76423,76441,76463,76471,76481,76487,76493,76507,76511,\r\n76519,76537,76541,76543,76561,76579,76597,76603,76607,76631,76649,76651,76667,76673,76679,76697,76717,76733,76753,76757,76771,76777,76781,76801,\r\n76819,76829,76831,76837,76847,76871,76873,76883,76907,76913,76919,76943,\r\n76949,76961,76963,76991,77003,77017,77023,77029,77041,77047,77069,77081,\r\n77093,77101,77137,77141,77153,77167,77171,77191,77201,77213,77237,77239,\r\n77243,77249,77261,77263,77267,77269,77279,77291,77317,77323,77339,77347,\r\n77351,77359,77369,77377,77383,77417,77419,77431,77447,77471,77477,77479,\r\n77489,77491,77509,77513,77521,77527,77543,77549,77551,77557,77563,77569,\r\n77573,77587,77591,77611,77617,77621,77641,77647,77659,77681,77687,77689,\r\n77699,77711,77713,77719,77723,77731,77743,77747,77761,77773,77783,77797,\r\n77801,77813,77839,77849,77863,77867,77893,77899,77929,77933,77951,77969,\r\n77977,77983,77999,78007,78017,78031,78041,78049,78059,78079,78101,78121,\r\n78137,78139,78157,78163,78167,78173,78179,78191,78193,78203,78229,78233,\r\n78241,78259,78277,78283,78301,78307,78311,78317,78341,78347,78367,78401,\r\n78427,78437,78439,78467,78479,78487,78497,78509,78511,78517,78539,78541,\r\n78553,78569,78571,78577,78583,78593,78607,78623,78643,78649,78653,78691,\r\n78697,78707,78713,78721,78737,78779,78781,78787,78791,78797,78803,78809,\r\n78823,78839,78853,78857,78877,78887,78889,78893,78901,78919,78929,78941,\r\n78977,78979,78989,79031,79039,79043,79063,79087,79103,79111,79133,79139,\r\n79147,79151,79153,79159,79181,79187,79193,79201,79229,79231,79241,79259,\r\n79273,79279,79283,79301,79309,79319,79333,79337,79349,79357,79367,79379,\r\n79393,79397,79399,79411,79423,79427,79433,79451,79481,79493,79531,79537,\r\n79549,79559,79561,79579,79589,79601,79609,79613,79621,79627,79631,79633,\r\n79657,79669,79687,79691,79693,79697,79699,79757,79769,79777,79801,79811,\r\n79813,79817,79823,79829,79841,79843,79847,79861,79867,79873,79889,79901,\r\n79903,79907,79939,79943,79967,79973,79979,79987,79997,79999,80021,80039,\r\n80051,80071,80077,80107,80111,80141,80147,80149,80153,80167,80173,80177,\r\n80191,80207,80209,80221,80231,80233,80239,80251,80263,80273,80279,80287,\r\n80309,80317,80329,80341,80347,80363,80369,80387,80407,80429,80447,80449,\r\n80471,80473,80489,80491,80513,80527,80537,80557,80567,80599,80603,80611,\r\n80621,80627,80629,80651,80657,80669,80671,80677,80681,80683,80687,80701,\r\n80713,80737,80747,80749,80761,80777,80779,80783,80789,80803,80809,80819,\r\n80831,80833,80849,80863,80897,80909,80911,80917,80923,80929,80933,80953]\r\nb=[]\r\nfor m in a:\r\n x=a.index(m)\r\n if(x in a):\r\n b.append(m)\r\ns=[]\r\ns.append(b[0])\r\nfor i in range(1,1000):\r\n s.append((b[i]+s[i-1])%1000000007)\r\nfor j in range(int(input())):\r\n n=int(input())\r\n print(s[n-1])"]
{"inputs": [["2", "1", "2"]], "outputs": [["3", "8"]]}
interview
https://www.codechef.com/ALQU2018/problems/SUPPRM
[ 32306, 5109, 525, 27802, 304, 264, 11457, 1140, 547, 3, 52, 54876, 304, 7703, 1973, 13, 6771, 328, 3, 50, 3, 387, 264, 93893, 315, 547, 3, 52, 3, 448, 264, 4911, 3343, 429, 369, 1449, 2392, 362, 3, 32, 3, 32052, 311, 1140, 328, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,086
Let's define the niceness of a sequence of positive integers X1,X2,…,XN$X_1, X_2, \dots, X_N$ as the sum of greatest common divisors of all pairs of its elements, i.e. N∑i=1N∑j=i+1gcd(Xi,Xj).∑i=1N∑j=i+1Ngcd(Xi,Xj).\sum_{i=1}^N \sum_{j=i+1}^N \mathrm{gcd}(X_i, X_j)\;. For example, the niceness of the sequence [1,2,2]$[1, 2, 2]$ is gcd(1,2)+gcd(1,2)+gcd(2,2)=4$gcd(1, 2) + gcd(1, 2) + gcd(2, 2) = 4$. You are given a sequence A1,A2,…,AN$A_1, A_2, \dots, A_N$; each of its elements is either a positive integer or missing. Consider all possible ways to replace each missing element of A$A$ by a positive integer (not necessarily the same for each element) such that the sum of all elements is equal to S$S$. Your task is to find the total niceness of all resulting sequences, i.e. compute the niceness of each possible resulting sequence and sum up all these values. Since the answer may be very large, compute it modulo 109+7$10^9 + 7$. -----Input----- - The first line of the input contains a single integer T$T$ denoting the number of test cases. The description of T$T$ test cases follows. - The first line of each test case contains two space-separated integers N$N$ and S$S$. - The second line contains N$N$ space-separated integers A1,A2,…,AN$A_1, A_2, \dots, A_N$. Missing elements in this sequence are denoted by −1$-1$. -----Output----- For each test case, print a single line containing one integer — the total niceness modulo 109+7$10^9 + 7$. -----Constraints----- - 1≤T≤20$1 \le T \le 20$ - 1≤N,S≤50$1 \le N, S \le 50$ - 1≤Ai≤50$1 \le A_i \le 50$ or Ai=−1$A_i = -1$ for each valid i$i$ -----Subtasks----- Subtask #1 (30 points): - 1≤N,S≤18$1 \le N, S \le 18$ - 1≤Ai≤18$1 \le A_i \le 18$ or Ai=−1$A_i = -1$ for each valid i$i$ Subtask #2 (70 points): original constraints -----Example Input----- 3 3 3 1 1 -1 4 8 1 -1 -1 3 3 10 -1 -1 -1 -----Example Output----- 3 23 150 -----Explanation----- Example case 1: There is only one possible way to fill in the missing element; the resulting sequence is [1,1,1]$[1, 1, 1]$. Its niceness is 3$3$. Example case 2: There is only three possible ways to fill in the missing elements; the resulting sequences are [1,1,3,3]$[1, 1, 3, 3]$, [1,3,1,3]$[1, 3, 1, 3]$, and [1,2,2,3]$[1, 2, 2, 3]$. The sum of their niceness is 8+8+7=23$8 + 8 + 7 = 23$.
["# cook your dish here\nmod = 10**9 + 7\nfrom math import gcd\ndef fac50():\n f = [0]*51\n f[0] ,f[1] = 1,1\n for i in range(1,51):f[i] = (f[i-1]*i)%mod\n return f\ndef gcd110():\n gc = [[0]*111 for i in range(111)]\n for i in range(111):\n for j in range(111):gc[i][j] = gcd(i,j)\n return gc\nfactorials,gcds = fac50(),gcd110()\ndef rule_asc(n,l):\n a,k = [0 for i in range(n + 1)],1\n a[1] = n\n while k != 0:\n x,y = a[k - 1] + 1,a[k] - 1 \n k -= 1\n while x <= y and k < l - 1:\n a[k],y = x,y-x\n k += 1\n a[k] = x + y\n yield a[:k + 1]\ndef niceness(s):\n t = 0\n for i in range(len(s)):\n for j in range(i+1,len(s)):t = (t + gcds[s[i]][s[j]])%mod\n return t\ndef permcount(s,c):\n f,p = [s.count(x) for x in set(s)],factorials[c] \n for e in f:p = (p*pow(factorials[e],mod-2,mod))%mod\n return p\ndef main():\n for i in range(int(input())):\n n,s = [int(item) for item in input().split()]\n a = [int(item) for item in input().split()]\n b = [i for i in a if i != -1]\n s , ones = s - sum(b),a.count(-1) \n if s < 0:print(0)\n elif (s == 0 and ones == 0):print(niceness(a)%mod)\n elif (s > 0 and ones == 0):print(0)\n else:\n t = 0\n for seq in rule_asc(s,ones):\n if len(seq) == ones: t = (t + (((permcount(seq,ones))%mod)*(niceness(b+seq)%mod))%mod)%mod\n print(t) \ndef __starting_point():main()\n__starting_point()", "# cook your dish here\nmod = 10**9 + 7\nfrom math import gcd\ndef fac50():\n f = [0]*51\n f[0] ,f[1] = 1,1\n for i in range(1,51):f[i] = (f[i-1]*i)%mod\n return f\ndef gcd110():\n gc = [[0]*111 for i in range(111)]\n for i in range(111):\n for j in range(111):gc[i][j] = gcd(i,j)\n return gc\nfactorials,gcds = fac50(),gcd110()\ndef rule_asc(n,l):\n a,k = [0 for i in range(n + 1)],1\n a[1] = n\n while k != 0:\n x,y = a[k - 1] + 1,a[k] - 1 \n k -= 1\n while x <= y and k < l - 1:\n a[k],y = x,y-x\n k += 1\n a[k] = x + y\n yield a[:k + 1]\ndef niceness(s):\n t = 0\n for i in range(len(s)):\n for j in range(i+1,len(s)):t = (t + gcds[s[i]][s[j]])%mod\n return t\ndef permcount(s,c):\n f,p = [s.count(x) for x in set(s)],factorials[c] \n for e in f:p = (p*pow(factorials[e],mod-2,mod))%mod\n return p\ndef main():\n for i in range(int(input())):\n n,s = [int(item) for item in input().split()]\n a = [int(item) for item in input().split()]\n b = [i for i in a if i != -1]\n s , ones = s - sum(b),a.count(-1) \n if s < 0:print(0)\n elif (s == 0 and ones == 0):print(niceness(a)%mod)\n elif (s > 0 and ones == 0):print(0)\n else:\n t = 0\n for seq in rule_asc(s,ones):\n if len(seq) == ones: t = (t + (((permcount(seq,ones))%mod)*(niceness(b+seq)%mod))%mod)%mod\n print(t) \ndef __starting_point():main()\n__starting_point()", "mod = 10**9 + 7\nfrom math import gcd\ndef fac50():\n f = [0]*51\n f[0] ,f[1] = 1,1\n for i in range(1,51):f[i] = (f[i-1]*i)%mod\n return f\ndef gcd110():\n gc = [[0]*111 for i in range(111)]\n for i in range(111):\n for j in range(111):gc[i][j] = gcd(i,j)\n return gc\nfactorials,gcds = fac50(),gcd110()\ndef rule_asc(n,l):\n a,k = [0 for i in range(n + 1)],1\n a[1] = n\n while k != 0:\n x,y = a[k - 1] + 1,a[k] - 1 \n k -= 1\n while x <= y and k < l - 1:\n a[k],y = x,y-x\n k += 1\n a[k] = x + y\n yield a[:k + 1]\ndef niceness(s):\n t = 0\n for i in range(len(s)):\n for j in range(i+1,len(s)):t = (t + gcds[s[i]][s[j]])%mod\n return t\ndef permcount(s,c):\n f,p = [s.count(x) for x in set(s)],factorials[c] \n for e in f:p = (p*pow(factorials[e],mod-2,mod))%mod\n return p\ndef main():\n for i in range(int(input())):\n n,s = [int(item) for item in input().split()]\n a = [int(item) for item in input().split()]\n b = [i for i in a if i != -1]\n s , ones = s - sum(b),a.count(-1) \n if s < 0:print(0)\n elif (s == 0 and ones == 0):print(niceness(a)%mod)\n elif (s > 0 and ones == 0):print(0)\n else:\n t = 0\n for seq in rule_asc(s,ones):\n if len(seq) == ones: t = (t + (((permcount(seq,ones))%mod)*(niceness(b+seq)%mod))%mod)%mod\n print(t) \ndef __starting_point():main()\n__starting_point()", "mod = 10**9 + 7\r\ndef gcd(a,b): return b and gcd(b, a % b) or a\r\n\r\ndef fac50():\r\n f = [0]*51\r\n f[0] = 1\r\n f[1] = 1\r\n for i in range(1,51):\r\n f[i] = (f[i-1]*i)%mod\r\n return f\r\n\r\ndef gcd110():\r\n\r\n gc = [[0]*111 for i in range(111)]\r\n for i in range(111):\r\n for j in range(111):\r\n gc[i][j] = gcd(i,j)\r\n return gc\r\n\r\nfactorials = fac50()\r\ngcds = gcd110()\r\n\r\ndef rule_asc(n,l):\r\n a = [0 for i in range(n + 1)]\r\n k = 1\r\n a[1] = n\r\n while k != 0:\r\n x = a[k - 1] + 1\r\n y = a[k] - 1\r\n k -= 1\r\n while x <= y and k < l - 1:\r\n a[k] = x\r\n y -= x\r\n k += 1\r\n a[k] = x + y\r\n yield a[:k + 1]\r\n\r\ndef niceness(s):\r\n t = 0\r\n for i in range(len(s)):\r\n for j in range(i+1,len(s)):\r\n t = (t + gcds[s[i]][s[j]])%mod\r\n return t\r\n\r\n\r\ndef permcount(s,c):\r\n f = [s.count(x) for x in set(s)]\r\n p = factorials[c]\r\n for e in f:\r\n p = (p*pow(factorials[e],mod-2,mod))%mod\r\n return p\r\n\r\ndef main():\r\n\r\n t = int(input())\r\n\r\n for i in range(t):\r\n\r\n n,s = [int(item) for item in input().split()]\r\n a = [int(item) for item in input().split()]\r\n b = [i for i in a if i != -1]\r\n s -= sum(b)\r\n ones = a.count(-1)\r\n\r\n if s < 0:\r\n print(0)\r\n elif (s == 0 and ones == 0):\r\n print(niceness(a)%mod)\r\n elif (s > 0 and ones == 0):\r\n print(0)\r\n else:\r\n\r\n t = 0\r\n for seq in rule_asc(s,ones):\r\n if len(seq) == ones:\r\n p = permcount(seq,ones)\r\n t = (t + ((p%mod)*(niceness(b+seq)%mod))%mod)%mod\r\n\r\n print(t)\r\n\r\ndef __starting_point():\r\n main()\r\n\n__starting_point()", "import math\r\n\r\ndef niceness(a):\r\n nice=0\r\n for i in range(len(a)):\r\n for j in range(i+1,len(a)):\r\n nice+=math.gcd(a[i],a[j])\r\n return nice\r\n\r\ndef f(a, s):\r\n if -1 not in a:\r\n if s != 0: return ()\r\n return (tuple(a),)\r\n if s == 0:\r\n return ()\r\n idx = a.index(-1)\r\n ans = ()\r\n for i in range(1, s + 1):\r\n a[idx] = i\r\n ans += f(a, s - i)\r\n a[idx] = -1\r\n return ans\r\n\r\ndef __starting_point():\r\n t=int(input())\r\n numbers=[0]*50\r\n mod = 10**9 + 7\r\n for i in range(1,51):\r\n numbers[i-1]=i\r\n for i in range(t):\r\n n,s = map(int,input().split())\r\n a=list(map(int,input().split()))\r\n ans,ss=0,0\r\n for x in range(len(a)):\r\n if(a[x]!=-1):\r\n ss+=a[x]\r\n x=f(a,s-ss)\r\n for i in x:\r\n ans += niceness(i)\r\n print(ans % mod)\n__starting_point()"]
{"inputs": [["3", "3 3", "1 1 -1", "4 8", "1 -1 -1 3", "3 10", "-1 -1 -1", ""]], "outputs": [["3", "23", "150"]]}
interview
https://www.codechef.com/problems/NICARRAY
[ 10061, 594, 6979, 279, 17327, 23709, 315, 264, 8500, 315, 6785, 25780, 1599, 16, 29241, 17, 98213, 11, 55, 45, 3, 55, 62, 16, 11, 1599, 62, 17, 11, 1124, 67816, 11, 1599, 1604, 3, 438, 279, 2629, 315, 12196, 4185, 3429, 41214, 315...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,423
In the previous Kata we discussed the OR case. We will now discuss the AND case, where rather than calculating the probablility for either of two (or more) possible results, we will calculate the probability of receiving all of the viewed outcomes. For example, if we want to know the probability of receiving head OR tails in two tosses of a coin, as in the last Kata we add the two probabilities together. However if we want to know the probability of receiving head AND tails, in that order, we have to work differently. The probability of an AND event is calculated by the following rule: `P(A ∩ B) = P(A | B) * P(B)` or `P(B ∩ A) = P(B | A) * P(A)` That is, the probability of A and B both occuring is equal to the probability of A given B occuring times the probability of B occuring or vice versa. If the events are mutually exclusive like in the case of tossing a coin, the probability of A occuring if B has occured is equal to the probability of A occuring by itself. In this case, the probability can be written as the below: `P(A ∩ B) = P(A) * P(B)` or `P(B ∩ A) = P(B) * P(A)` Applying to the heads and tails case: `P(H ∩ T) = P(0.5) * P(0.5)` or `P(H ∩ T) = P(0.5) * P(0.5)` The task: You are given a random bag of 10 balls containing 4 colours. `Red`, `Green`, `Yellow` and `Blue`. You will also be given a sequence of 2 balls of any colour e.g. `Green` and `Red` or `Yellow` and `Yellow`. You have to return the probability of pulling a ball at random out of the bag and it matching the first colour and then pulling a ball at random out of the bag and it matching the second colour. You will be given a boolean value of `true` or `false` which indicates whether the balls that is taken out in the first draw is replaced in to the bag for the second draw. Hint: this will determine whether the events are mutually exclusive or not. You will receive two arrays and a boolean value. The first array contains the colours of the balls in the bag and the second contains the colour of the two balls you have to receive. As per above the final boolean value will indicate whether the bals arel being replaced `true` or not `false`. Return the probability to 3 decimal places. e.g. `[["y","r","g","b","b","y","r","g","r","r"],["r","b"],false]` Other Kata in this series: Statistics in Kata 1: OR case - Unfair dice
["from collections import Counter as C\ndef ball_probability(b):\n d, n, p = C(b[0]), len(b[0]), 1\n for i in b[1]:\n p *= d.get(i,0)/n\n n -= b[2]^1\n d[i] -= b[2]^1\n return round(p,3)", "def ball_probability(balls):\n colors, (first, second), replaced = balls\n first_choice = colors.count(first) / len(colors)\n second_choice = colors.count(second) / len(colors) if replaced else (colors.count(second) - 1 * (first == second)) / (len(colors) - 1)\n return round(first_choice * second_choice, 3)", "def ball_probability(balls):\n size = len(balls[0])\n if not balls[2]:\n p1 = balls[0].count(balls[1][0])\n p2 = p1 - 1 if balls[1][0] == balls[1][1] else balls[0].count(balls[1][1])\n return round((p1 * p2) / (size * (size - 1)), 3)\n return round((balls[0].count(balls[1][0]) * balls[0].count(balls[1][1])) / size**2, 3)", "def ball_probability(balls):\n l, selection, replaced = balls\n a, b = selection\n prob = (l.count(a) * (l.count(b) + (0 if replaced or (a != b) else -1))) / (len(l) * (len(l) + (0 if replaced else -1)))\n \n return round(prob, 3)", "def ball_probability(balls):\n bag, draws, replaced = balls\n return round(bag.count(draws[0]) / len(bag) * \\\n (bag.count(draws[1]) - (not replaced) * (draws[0] == draws[1])) / \\\n (len(bag) - (not replaced)), 3)", "def ball_probability(balls):\n bag,t,r=balls\n a,b=(bag.count(i) for i in t)\n m=len(bag)\n return round(1.0*a*(b if r or t[0]!=t[1] else b-1)/m/(m if r else m-1),3)", "from collections import Counter\ndef ball_probability(balls):\n c = Counter(balls[0])\n b1, b2 = balls[1]\n if balls[2]:\n return round(c[b1]/len(balls[0]) * c[b2]/len(balls[0]), 3)\n else:\n return round(c[b1]/len(balls[0]) * (c[b2]-1 if b1==b2 else c[b2])/(len(balls[0]) - 1), 3)", "def ball_probability(balls):\n balls, draw, repl = balls\n b1, l1 = balls.count(draw[0]), len(balls)\n if b1 == 0: return 0\n b2 = balls.count(draw[1]) if draw[0] != draw[1] else b1 + repl - 1\n l2 = l1 + repl - 1\n return round(b1 / l1 * b2 / l2, 3)", "from collections import Counter\n\ndef ball_probability(balls):\n bag, (call1, call2), replaced = balls\n bag, total = Counter(bag), len(bag)\n\n A = bag[call1] / total\n\n if not replaced:\n bag[call1] -= 1\n total -= 1\n\n B = bag[call2] / total\n return round(A * B, 3)", "from collections import Counter\n\ndef ball_probability(balls):\n bag, (call1, call2), replaced = balls\n bag = Counter(bag)\n total = sum(bag.values())\n\n A = bag[call1] / total\n \n if not replaced:\n bag[call1] -= 1\n total -= 1\n\n B = bag[call2] / total\n \n return round(A * B, 3)"]
{"fn_name": "ball_probability", "inputs": [[[["red", "blue", "yellow", "green", "red", "blue", "yellow", "green", "red", "blue"], ["red", "blue"], true]], [[["red", "blue", "yellow", "green", "red", "blue", "yellow", "green", "red", "blue"], ["red", "red"], true]], [[["red", "red", "yellow", "green", "red", "red", "yellow", "green", "red", "red"], ["blue", "blue"], true]], [[["red", "blue", "yellow", "green", "red", "blue", "yellow", "green", "red", "blue"], ["red", "blue"], false]], [[["red", "blue", "yellow", "green", "red", "blue", "yellow", "green", "red", "blue"], ["red", "red"], false]]], "outputs": [[0.09], [0.09], [0], [0.1], [0.067]]}
introductory
https://www.codewars.com/kata/576a527ea25aae70b7000c77
def ball_probability(balls):
[ 641, 279, 3681, 98838, 582, 14078, 279, 2726, 1142, 382, 1654, 686, 1431, 4263, 279, 3567, 1142, 11, 1380, 4751, 1091, 37614, 279, 3566, 61473, 1403, 369, 2987, 315, 1378, 320, 269, 803, 8, 3204, 3059, 11, 582, 686, 11047, 279, 18927,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,731
Esoteric languages are pretty hard to program, but it's fairly interesting to write interpreters for them! Your task is to write a method which will interpret Befunge-93 code! Befunge-93 is a language in which the code is presented not as a series of instructions, but as instructions scattered on a 2D plane; your pointer **starts at the top-left corner** and defaults to **moving right** through the code. Note that the instruction pointer **wraps** around the screen! There is a singular stack which we will assume is unbounded and only contain integers. While Befunge-93 code is supposed to be restricted to 80x25, you need not be concerned with code size. Befunge-93 supports the following instructions (from [Wikipedia](https://en.wikipedia.org/wiki/Befunge)): - `0-9` Push this number onto the stack. - `+` Addition: Pop `a` and `b`, then push `a+b`. - `-` Subtraction: Pop `a` and `b`, then push `b-a`. - `*` Multiplication: Pop `a` and `b`, then push `a*b`. - `/` Integer division: Pop `a` and `b`, then push `b/a`, rounded down. If `a` is zero, push zero. - `%` Modulo: Pop `a` and `b`, then push the `b%a`. If `a` is zero, push zero. - `!` Logical NOT: Pop a value. If the value is zero, push `1`; otherwise, push zero. - ``` ` ``` (backtick) Greater than: Pop `a` and `b`, then push `1` if `b>a`, otherwise push zero. - `>` Start moving right. - `<` Start moving left. - `^` Start moving up. - `v` Start moving down. - `?` Start moving in a random cardinal direction. - `_` Pop a value; move right if `value = 0`, left otherwise. - `|` Pop a value; move down if `value = 0`, up otherwise. - `"` Start string mode: push each character's ASCII value all the way up to the next `"`. - `:` Duplicate value on top of the stack. If there is nothing on top of the stack, push a `0`. - `\` Swap two values on top of the stack. If there is only one value, pretend there is an extra `0` on bottom of the stack. - `$` Pop value from the stack and discard it. - `.` Pop value and output as an integer. - `,` Pop value and output the ASCII character represented by the integer code that is stored in the value. - `#` Trampoline: Skip next cell. - `p` A "put" call (a way to store a value for later use). Pop `y`, `x` and `v`, then change the character at the position `(x,y)` in the program to the character with ASCII value `v`. - `g` A "get" call (a way to retrieve data in storage). Pop `y` and `x`, then push ASCII value of the character at that position in the program. - `@` End program. - ` ` (i.e. a space) No-op. Does nothing. The above list is slightly modified: you'll notice if you look at the Wikipedia page that we do not use the user input instructions and dividing by zero simply yields zero. Here's an example: ``` >987v>.v v456< : >321 ^ _@ ``` will create the output `123456789`. So what you must do is create a function such that when you pass in the Befunge code, the function returns the output that would be generated by the code. So, for example: ``` "123456789".equals(new BefungeInterpreter().interpret(">987v>.v\nv456< :\n>321 ^ _@") ``` This test case will be added for you.
["from random import choice\n\ndef interpret(code):\n code = [list(l) for l in code.split('\\n')]\n x, y = 0, 0\n dx, dy = 1, 0\n output = ''\n stack = []\n string_mode = False\n \n while True:\n move = 1\n i = code[y][x]\n \n if string_mode:\n if i == '\"':\n string_mode = False\n else:\n stack.append(ord(i))\n else:\n \n if i.isdigit(): stack.append(int(i))\n elif i == '+': stack[-2:] = [stack[-2] + stack[-1]]\n elif i == '-': stack[-2:] = [stack[-2] - stack[-1]]\n elif i == '*': stack[-2:] = [stack[-2] * stack[-1]]\n elif i == '/': stack[-2:] = [stack[-2] and stack[-2] / stack[-1]]\n elif i == '%': stack[-2:] = [stack[-2] and stack[-2] % stack[-1]]\n elif i == '!': stack[-1] = not stack[-1]\n elif i == '`': stack[-2:] = [stack[-2] > stack[-1]]\n elif i in '><^v?':\n if i == '?': i = choice('><^v')\n if i == '>': dx, dy = 1, 0\n elif i == '<': dx, dy = -1, 0\n elif i == '^': dx, dy = 0, -1\n elif i == 'v': dx, dy = 0, 1\n elif i == '_': dx, dy = (-1 if stack.pop() else 1), 0\n elif i == '|': dx, dy = 0, (-1 if stack.pop() else 1)\n elif i == '\"': string_mode = True\n elif i == ':': stack.append(stack[-1] if stack else 0)\n elif i == '\\\\': stack[-2:] = stack[-2:][::-1]\n elif i == '$': stack.pop()\n elif i == '.': output += str(stack.pop())\n elif i == ',': output += chr(stack.pop())\n elif i == '#': move += 1\n elif i == 'p':\n ty, tx, tv = stack.pop(), stack.pop(), stack.pop()\n code[ty][tx] = chr(tv)\n elif i == 'g':\n ty, tx = stack.pop(), stack.pop()\n stack.append(ord(code[ty][tx]))\n elif i == '@':\n return output\n \n for _ in range(move):\n x = (x + dx) % len(code[y])\n y = (y + dy) % len(code)", "import random\nclass Interpretor(object):\n \"\"\"\n 0-9 Push this number onto the stack.\n \" Start string mode: push each character's ASCII value all the way up to the next \".\n \"\"\"\n\n def __init__(self, lines):\n self.code = [list(line) for line in lines.split('\\n')]\n push = lambda a: self.stack.append(a)\n \n self.no_parameter_ops = {\n '>': lambda: self.change_dir(1,0),\n '<': lambda: self.change_dir(-1,0),\n '^': lambda: self.change_dir(0,-1),\n 'v': lambda: self.change_dir(0,1),\n '?': lambda: self.change_dir(*random.choice([[1,0], [-1,0], [0,-1], [0,1]])),\n '#': self.move,\n ' ': lambda: None,\n '@': self.stop,\n '\"': self.toggle_string\n }\n \n self.one_parameter_ops = {\n '!': lambda a: push(1 if a == 0 else 0),\n '_': lambda a: self.change_dir(1,0) if a == 0 else self.change_dir(-1,0),\n '|': lambda a: self.change_dir(0,1) if a == 0 else self.change_dir(0,-1),\n ':': lambda a: push(0) if a is None else [push(a), push(a)],\n '$': lambda a: None,\n '.': lambda a: self.output.append(a),\n ',': lambda a: self.output.append(chr(a))\n }\n \n self.two_parameter_ops = {\n '+': lambda a,b: push(b+a),\n '-': lambda a,b: push(b-a),\n '*': lambda a,b: push(a*b),\n '/': lambda a,b: push(0 if a == 0 else b/a),\n '%': lambda a,b: push(0 if a == 0 else b%a),\n '`': lambda a,b: push(1 if b > a else 0),\n '\\\\': lambda a,b: [push(a), push(0)] if b is None else [push(a), push(b)],\n 'g': lambda y,x: push(ord(self.code[y][x]))\n }\n \n self.tri_parameter_ops = {\n 'p': self.put\n }\n \n def put(self,y,x,v): self.code[y][x] = chr(v)\n def stop(self): self.running = False\n def change_dir(self, nx, ny): self.dx, self.dy = nx, ny\n def toggle_string(self): self.string = not self.string\n def move(self):\n self.x += self.dx\n self.y += self.dy\n \n def interpret(self):\n self.stack = []\n self.output = []\n self.x, self.y = 0, 0\n self.dx, self.dy = 1,0\n self.running = True\n self.string = False\n \n pop = lambda: self.stack.pop() if self.stack else None\n \n while self.running:\n self.y = self.y % len(self.code)\n self.x = self.x % len(self.code[self.y])\n token = self.code[self.y][self.x]\n \n if self.string and token != \"\\\"\": self.stack.append(ord(token))\n elif token in self.no_parameter_ops: self.no_parameter_ops[token]()\n elif token in self.one_parameter_ops: self.one_parameter_ops[token](pop())\n elif token in self.two_parameter_ops: self.two_parameter_ops[token](pop(),pop())\n elif token in self.tri_parameter_ops: self.tri_parameter_ops[token](pop(),pop(),pop())\n elif token in \"0123456789\": self.stack.append(int(token))\n \n self.move()\n return ''.join(str(x) for x in self.output)\n\ndef interpret(code):\n interpretor = Interpretor(code)\n return interpretor.interpret()", "from random import choice\n\nDIR = (1, 0), (-1, 0), (0, 1), (0, -1)\ndef interpret(code):\n grid, stack, out, direction = [*map(list, code.splitlines())], [], '', DIR[0]\n x = y = smode = value = 0\n while True:\n value, jump = grid[y][x], 1\n if value is '\"': smode = not smode\n elif smode or value.isdigit(): stack += [(int, ord)[smode](value)]\n elif value in '+-*/%': stack += [eval(str(stack.pop(~1)) + value + str(stack.pop()))]\n elif value in '!': stack += [not stack.pop()]\n elif value in '`': stack += [stack.pop() < stack.pop()]\n elif value in ':': stack += [stack and stack[-1] or 0]\n elif value in '\\\\': stack += [len(stack) > 1 and stack.pop(-2) or 0]\n elif value in 'g': stack += [ord(grid[stack.pop()][stack.pop()])]\n elif value in 'p': grid[stack.pop()][stack.pop()] = chr(stack.pop(-3))\n elif value in '$': stack.pop()\n elif value in '.,': out += (str, chr)[value is ','](+stack.pop())\n elif value in '?': direction = choice(DIR)\n elif value in '_|': direction = DIR[(value is '|') * 2 + bool(stack.pop())]\n elif value in '><v^': direction = DIR['><v^'.index(value)]\n elif value in '#': jump = 2\n elif value in '@': return out\n x, y = x + direction[0] * jump, y + direction[1] * jump", "import random\n\ndef const(n):\n return lambda itp: itp.push(n)\n\ndef unary(f):\n return lambda itp: itp.push(f(itp.pop()))\n\ndef binary(f):\n return lambda itp: itp.push(f(itp.pop(), itp.pop()))\n\ndef direction(x, y):\n return lambda itp: itp.set_vpc(x, y)\n\ndef dup(itp):\n x = itp.pop()\n itp.push(x)\n itp.push(x)\n\ndef swap(itp):\n x = itp.pop()\n y = itp.pop()\n itp.push(x)\n itp.push(y)\n\nopcodes = {\n '+': binary(lambda a, b: b + a),\n '-': binary(lambda a, b: b - a),\n '*': binary(lambda a, b: b * a),\n '/': binary(lambda a, b: b / a),\n '%': binary(lambda a, b: b % a),\n '!': unary(lambda a: not a),\n '`': binary(lambda a, b: b > a),\n \n '>': direction(1, 0),\n '<': direction(-1, 0),\n 'v': direction(0, 1),\n '^': direction(0, -1),\n \n '?': lambda itp: itp.set_vpc(*random.choice(((1, 0), (-1, 0), (0, 1), (0, -1)))),\n \n '_': lambda itp: itp.set_vpc((-1)**(itp.pop() != 0), 0),\n '|': lambda itp: itp.set_vpc(0, (-1)**(itp.pop() != 0)),\n \n ':': dup,\n '\\\\': swap,\n \n '$': lambda itp: itp.pop(),\n '.': lambda itp: itp.output(str(itp.pop())),\n ',': lambda itp: itp.output(chr(itp.pop())),\n \n 'p': lambda itp: itp.put(itp.pop(), itp.pop(), itp.pop()),\n 'g': lambda itp: itp.push(itp.get(itp.pop(), itp.pop())),\n \n '#': lambda itp: itp.advance(),\n '@': lambda itp: itp.end(), \n ' ': lambda itp: None,\n}\n\nfor i in range(10):\n opcodes[str(i)] = const(i)\n\nclass Interpreter:\n def __init__(self, code):\n self.mem = [list(l) for l in code.split('\\n')]\n self.stack = []\n self.pc = 0, 0\n self.vpc = 1, 0\n self.obuf = []\n self.ended = False\n self.stringmode = False\n \n def run(self):\n while not self.ended:\n x, y = self.pc\n op = self.mem[y][x]\n \n if op == '\"':\n self.stringmode = not self.stringmode\n elif self.stringmode:\n self.push(ord(op))\n else:\n opcodes[op](self)\n \n self.advance()\n \n def advance(self):\n x, y = self.pc\n vx, vy = self.vpc\n y = (y + vy) % len(self.mem)\n x = (x + vx) % len(self.mem[y])\n self.pc = x, y\n \n def set_vpc(self, x, y):\n self.vpc = x, y\n \n def push(self, x):\n self.stack.append(int(x))\n \n def pop(self):\n try:\n return self.stack.pop(-1)\n except IndexError:\n return 0\n \n def output(self, s):\n self.obuf.append(s)\n\n def end(self):\n self.ended = True\n\n def get(self, y, x):\n return ord(self.mem[y][x])\n\n def put(self, y, x, n):\n self.mem[y][x] = chr(n)\n\ndef interpret(code):\n itp = Interpreter(code)\n \n itp.run()\n \n return ''.join(itp.obuf)", "import random\n\ndef interpret(code):\n output = \"\"\n coordinates = code.split(\"\\n\")\n coordinate = [list(row) for row in coordinates]\n stack = []\n x = 0 \n y = 0\n dx = 1\n dy = 0\n a = \"\"\n temp=1\n ascii_code = 0\n opened = False\n skip_next = False\n \n while True:\n command = coordinate[y][x]\n if skip_next:\n skip_next = False\n x += dx\n y += dy\n continue\n elif command.isnumeric():\n stack.append(int(command))\n elif command == '>':\n dx = 1\n dy = 0\n elif command == '<':\n dx = -1\n dy = 0\n elif command == '^':\n dx = 0\n dy = -1\n elif command == 'v':\n dx = 0\n dy = 1\n elif command == '?':\n dx = random.randint(-1,1)\n if dx != 0:\n dy = 0\n else:\n dy = random.choice([-1, 1])\n elif command == '\"':\n opened = not opened\n elif opened:\n stack.append(ord(command))\n elif command == \"+\":\n a, b = stack.pop(), stack.pop()\n stack.append(a + b)\n elif command == \"-\":\n a, b = stack.pop(), stack.pop()\n stack.append(b - a)\n elif command == \"*\":\n a, b = stack.pop(), stack.pop()\n stack.append(a * b)\n elif command == \"/\":\n a, b = stack.pop(), stack.pop()\n stack.append(int(b / a) if a != 0 else 0)\n elif command == \"%\":\n a, b = stack.pop(), stack.pop()\n stack.append(b % a if a != 0 else 0)\n elif command == \"!\":\n if int(stack[-1]) == 0:\n stack[-1] = 1\n else:\n stack[-1] = 0\n elif command == \"`\":\n a, b = stack.pop(), stack.pop()\n if b > a:\n stack.append(1)\n else:\n stack.append(0)\n elif command == \"_\":\n if stack.pop() == 0:\n dx = 1\n dy = 0\n else:\n dx = -1\n dy = 0\n elif command == \"|\":\n if stack.pop() == 0:\n dx = 0\n dy = 1\n else:\n dx = 0\n dy = -1\n elif command == \":\":\n if len(stack) == 0:\n stack.append(0)\n else:\n stack.append(stack[-1])\n elif command == \"\\\\\":\n if len(stack) < 2:\n stack.append(0)\n else:\n a = stack[-1]\n stack[-1] = stack[-2]\n stack[-2] = a\n elif command == \"$\":\n if len(stack) != 0:\n stack.pop()\n elif command == \".\":\n if len(stack) !=0:\n output += str(stack.pop())\n elif command == \",\":\n if len(stack) !=0:\n ascii_code = stack[-1]\n output += chr(ascii_code)\n stack.pop()\n elif command == \"#\":\n skip_next = True\n elif command == \"p\":\n y1, x1, v = stack.pop(), stack.pop(), stack.pop()\n coordinate[y1][x1] = chr(v)\n elif command == \"g\":\n y1, x1 = stack.pop(), stack.pop()\n stack.append(ord(coordinate[y1][x1]))\n elif command == '@':\n break\n x += dx\n y += dy\n return output", "import random\n\ndirections = [[0, 1], [0, -1], [1, 0], [-1, 0]]\n\n\nclass Befunge93Instance:\n def __init__(self, code, step_limit=9999):\n self.code = [[i for i in line] for line in code.split('\\n')] # code can be mutated so can't leave as string\n for line in code.split('\\n'):\n print(line)\n self.head = [0, 0] # current execution point\n self.stack = []\n self.direction = directions[0]\n self.output = ''\n self.string_mode = False\n self.steps = 0\n self.step_limit = step_limit\n\n def get_instr(self):\n try:\n return self.code[self.head[0]][self.head[1]]\n except IndexError:\n print(('head out of range: {}'.format(self.head)))\n return 0\n\n def set_direction(self, direction_index):\n self.direction = directions[direction_index]\n\n def advance_head(self):\n self.head[0] += self.direction[0]\n self.head[1] += self.direction[1]\n\n # return 0 if empty\n def pop_stack(self) -> int:\n try:\n return self.stack.pop()\n except IndexError:\n return 0\n\n # \"singular stack which we will assume is unbounded and only contain integers\"\n def push_stack(self, item):\n try:\n self.stack.append(int(item))\n except ValueError:\n self.stack.append(int(ord(item))) # ascii to int\n\n def operation(self, op):\n try:\n a = self.pop_stack()\n b = self.pop_stack()\n self.stack.append(op(a, b))\n except ZeroDivisionError:\n self.stack.append(0)\n\n def print_status(self):\n print()\n print(('{} output({})'.format(self.steps, self.output)))\n print((self.stack))\n print(('head {} dir {} instr {}'.format(self.head, self.direction, self.get_instr())))\n\n def exec_instr(self) -> bool:\n self.steps += 1\n\n if self.steps > self.step_limit:\n return False\n\n instr = self.get_instr()\n #self.print_status()\n\n if self.string_mode:\n if instr == '\\\"':\n self.string_mode = False\n else:\n self.push_stack(instr)\n self.advance_head()\n return True\n\n if instr in '0123456789':\n self.stack.append(int(instr))\n elif instr == '+':\n self.operation(lambda a, b: a + b)\n elif instr == '-':\n self.operation(lambda a, b: b - a)\n elif instr == '*':\n self.operation(lambda a, b: a * b)\n elif instr == '/':\n self.operation(lambda a, b: b // a)\n elif instr == '%':\n self.operation(lambda a, b: b % a)\n elif instr == '!':\n self.push_stack(not self.pop_stack())\n elif instr == '`':\n self.operation(lambda a, b: int(b > a))\n elif instr in '><v^':\n self.set_direction('><v^'.index(instr))\n elif instr == '?':\n self.set_direction(random.randint(0, 3))\n elif instr == '_':\n if self.pop_stack() == 0:\n self.set_direction(0)\n else:\n self.set_direction(1)\n elif instr == '|':\n if self.pop_stack() == 0:\n self.set_direction(2)\n else:\n self.set_direction(3)\n elif instr == '\\\"':\n self.string_mode = True\n elif instr == ':': # duplicate top value\n try:\n self.stack.append(self.stack[-1])\n except IndexError:\n self.stack.append(0)\n elif instr == '\\\\': # swap top of stack\n try:\n self.stack[-1], self.stack[-2] = self.stack[-2], self.stack[-1]\n except IndexError:\n self.stack.append(0)\n elif instr == '$':\n self.pop_stack()\n elif instr == '.': # int\n self.output += str(self.pop_stack())\n elif instr == ',':\n self.output += chr(self.pop_stack()) # int code to ascii char, 10 = \\n, etc\n elif instr == '#':\n self.advance_head()\n elif instr == 'p': # put\n x = self.pop_stack()\n y = self.pop_stack()\n value = self.pop_stack()\n self.code[x][y] = chr(value) # int code to ascii char, 10 = \\n, etc\n # print(self.code[x])\n elif instr == 'g': # get\n x = self.pop_stack()\n y = self.pop_stack()\n self.push_stack(ord(self.code[x][y])) # ascii char to int code\n elif instr == '@': # end\n return False\n\n self.advance_head()\n return True\n\n def run(self):\n while self.exec_instr():\n pass\n\n\ndef interpret(code):\n interpreter = Befunge93Instance(code)\n interpreter.run()\n return interpreter.output\n", "from math import floor\nimport random\ndef interpret(s):\n s,j,k = [[j for j in i] for i in s.splitlines()],0,-1\n direction,stack,output = 'right',[],[]\n while 1:\n if direction == \"right\" : k += 1\n elif direction == \"left\" : k -= 1\n elif direction == \"up\" : j -= 1\n elif direction == \"down\" : j += 1\n i = s[j][k]\n if i in \"+-*/%`g\" : a,b = stack.pop(),stack.pop()\n if i.isdigit() : stack.append(int(i))\n elif i == '+' : stack.append(a + b)\n elif i == '-' : stack.append(b - a)\n elif i == '*' : stack.append(a * b)\n elif i == '/' : stack.append(0 if not a else int(floor(b / a)))\n elif i == '%' : stack.append(0 if not a else b % a)\n elif i == '!' : stack.append(1 if not stack.pop() else 0)\n elif i == '`' : stack.append(1 if b > a else 0)\n elif i == '>' : direction = 'right'\n elif i == \"<\" : direction = 'left'\n elif i == \"^\" : direction = 'up'\n elif i == 'v' : direction = 'down'\n elif i == '?' : direction = random.choice(['right', 'left', 'down', 'up'])\n elif i == '_' : direction = 'right' if not stack.pop() else 'left'\n elif i == '|' : direction = 'down' if not stack.pop()else 'up'\n elif i == ':' : stack.append(0 if not stack else stack[-1])\n elif i == '$' : stack.pop()\n elif i == '.' : output.append(stack.pop())\n elif i == ',' : output.append(chr(stack.pop()))\n elif i == 'p' : y,x,v = stack.pop(),stack.pop(),stack.pop() ; s[y][x] = chr(v)\n elif i == 'g' : stack.append(ord(s[a][b]))\n elif i == '\\\\':\n if len(stack) == 1 : stack.insert(0, 0)\n else : stack[-1], stack[-2] = stack[-2], stack[-1]\n if i == '#':\n if direction == 'right' : k += 1\n elif direction == 'left': k -= 1\n elif direction == 'up' : j -= 1\n elif direction == 'down': j += 1\n if i == '\"':\n k += (1 if direction =='right' else -1)\n while s[j][k] != '\"':\n stack.append(ord(s[j][k])) ; k += (1 if direction =='right' else -1)\n if i == '@' : break\n return \"\".join(map(str,output))", "from random import choice\n#\u9898\u76ee\u592a\u590d\u6742,\u8df3\u8fc7\u8fd9\u4e2a\u9898\ndef interpret(code):\n code = [list(l) for l in code.split('\\n')]\n x, y = 0, 0\n dx, dy = 1, 0\n output = ''\n stack = []\n string_mode = False\n \n while True:\n move = 1\n i = code[y][x]\n \n if string_mode:\n if i == '\"':\n string_mode = False\n else:\n stack.append(ord(i))\n else:\n \n if i.isdigit(): stack.append(int(i))\n elif i == '+': stack[-2:] = [stack[-2] + stack[-1]]\n elif i == '-': stack[-2:] = [stack[-2] - stack[-1]]\n elif i == '*': stack[-2:] = [stack[-2] * stack[-1]]\n elif i == '/': stack[-2:] = [stack[-2] and stack[-2] / stack[-1]]\n elif i == '%': stack[-2:] = [stack[-2] and stack[-2] % stack[-1]]\n elif i == '!': stack[-1] = not stack[-1]\n elif i == '`': stack[-2:] = [stack[-2] > stack[-1]]\n elif i in '><^v?':\n if i == '?': i = choice('><^v')\n if i == '>': dx, dy = 1, 0\n elif i == '<': dx, dy = -1, 0\n elif i == '^': dx, dy = 0, -1\n elif i == 'v': dx, dy = 0, 1\n elif i == '_': dx, dy = (-1 if stack.pop() else 1), 0\n elif i == '|': dx, dy = 0, (-1 if stack.pop() else 1)\n elif i == '\"': string_mode = True\n elif i == ':': stack.append(stack[-1] if stack else 0)\n elif i == '\\\\': stack[-2:] = stack[-2:][::-1]\n elif i == '$': stack.pop()\n elif i == '.': output += str(stack.pop())\n elif i == ',': output += chr(stack.pop())\n elif i == '#': move += 1\n elif i == 'p':\n ty, tx, tv = stack.pop(), stack.pop(), stack.pop()\n code[ty][tx] = chr(tv)\n elif i == 'g':\n ty, tx = stack.pop(), stack.pop()\n stack.append(ord(code[ty][tx]))\n elif i == '@':\n return output\n \n for _ in range(move):\n x = (x + dx) % len(code[y])\n y = (y + dy) % len(code)", "from random import randint, seed\ndef interpret(code):\n i = list(map(list,code.split('\\n')))\n res = ''\n dir = ((1,0),(-1,0),(0,-1),(0,1))\n x, y = 0, 0\n dx, dy = 1, 0\n seed()\n s = []\n str_mode = False\n while True:\n o = i[y][x]\n if str_mode and o != '\"':s.append(ord(o))\n elif o in '0123456789': s.append(int(o))\n elif o == '+':s.append(s.pop()+s.pop())\n elif o == '-':s.append(-s.pop()+s.pop())\n elif o == '*':s.append(s.pop()*s.pop())\n elif o in '/%' :\n a = s.pop()\n if a:\n if o == '/':\n s.append(s.pop()//a)\n else:\n s.append(s.pop()%a)\n else:\n s[len(s)-1] = 0\n elif o == '!':s.append(0 if s.pop() else 1)\n elif o == '`':s.append(int(s.pop()<s.pop()))\n elif o == '>':dx, dy = dir[0]\n elif o == '<':dx, dy = dir[1]\n elif o == '^':dx, dy = dir[2]\n elif o == 'v':dx, dy = dir[3]\n elif o == '?':dx, dy = dir[randint(0,3)]\n elif o == '_':dx, dy = dir[1 if s.pop() else 0]\n elif o == '|':dx, dy = dir[2 if s.pop() else 3]\n elif o == '\"':str_mode = not str_mode\n elif o == ':':\n if s:s.append(s[len(s)-1])\n else:s = [0,0]\n elif o == '\\\\':\n if s:\n if len(s)==1:\n s.insert(0,0)\n else:\n s.insert(len(s)-2, s.pop())\n else:s = [0,0]\n elif o == '$':s.pop()\n elif o == '.':res += str(s.pop())\n elif o == ',':res += chr(s.pop())\n elif o == '#':x, y = x+dx, y+dy\n elif o == 'p':\n py = s.pop()\n px = s.pop()\n i[py][px] = chr(s.pop())\n elif o == 'g':s.append(ord(i[s.pop()][s.pop()]))\n elif o == '@':\n return res\n x+=dx\n y+=dy", "import inspect\nimport random\n\n\ndef interpret(s):\n return Befunge93(s.splitlines()).run()\n\n\nclass Befunge93:\n\n instructions = {}\n\n def __init__(self, plane):\n self.plane = [list(row) for row in plane]\n self.stack = []\n self.direction = [0, 1]\n self.row, self.col = 0, 0\n self.running = True\n self.output = []\n self.number = 0\n\n def forward(self):\n if self.number:\n self.row += self.direction[0]\n self.col += self.direction[1]\n self.number += 1\n return self.plane[self.row][self.col]\n\n def string_literal(self):\n self.stack.extend(ord(ch) for ch in iter(self.forward, '\"'))\n\n def run(self):\n while self.running:\n self.instructions[self.forward()](self)\n return ''.join(self.output)\n\n\ndef pop_push_on(ch):\n def deco(f):\n nargs = len(inspect.getargspec(f).args)\n def wrapper(self):\n self.stack.append(f(*[self.stack.pop() for i in range(nargs)]))\n Befunge93.instructions[ch] = wrapper\n return wrapper\n return deco\n\ndef on(ch): return lambda f: Befunge93.instructions.__setitem__(ch, f)\n\npop_push_on('+')(lambda a, b: a + b)\npop_push_on('-')(lambda a, b: b - a)\npop_push_on('*')(lambda a, b: a * b)\npop_push_on('/')(lambda a, b: b // a if a else 0)\npop_push_on('%')(lambda a, b: b % a if a else 0)\npop_push_on('!')(lambda a: 0 if a else 1)\npop_push_on('`')(lambda a, b: 1 if b > a else 0)\non('>')(lambda self: self.direction.__setitem__(slice(None), [0, +1]))\non('<')(lambda self: self.direction.__setitem__(slice(None), [0, -1]))\non('^')(lambda self: self.direction.__setitem__(slice(None), [-1, 0]))\non('v')(lambda self: self.direction.__setitem__(slice(None), [+1, 0]))\non('?')(lambda self: self.direction.__setitem__(slice(None), random.choice([[0, +1], [0, -1], [-1, 0], [+1, 0]])))\non('_')(lambda self: self.direction.__setitem__(slice(None), [0, +1] if self.stack.pop() == 0 else [0, -1]))\non('|')(lambda self: self.direction.__setitem__(slice(None), [+1, 0] if self.stack.pop() == 0 else [-1, 0]))\non('|')(lambda self: self.direction.__setitem__(slice(None), [+1, 0] if self.stack.pop() == 0 else [-1, 0]))\non(':')(lambda self: self.stack.append(self.stack[-1] if self.stack else 0))\non('\\\\')(lambda self: self.stack.append(self.stack.pop(-2) if len(self.stack) >= 2 else 0))\non(' ')(lambda self: 0)\non('@')(lambda self: setattr(self, 'running', False))\non('$')(lambda self: self.stack.pop())\non('.')(lambda self: self.output.append(str(self.stack.pop())))\non(',')(lambda self: self.output.append(chr(self.stack.pop())))\non('#')(lambda self: self.forward())\non('\"')(lambda self: self.string_literal())\non('p')(lambda self: self.plane[self.stack.pop()].__setitem__(self.stack.pop(), chr(self.stack.pop())))\non('g')(lambda self: self.stack.append(ord(self.plane[self.stack.pop()][self.stack.pop()])))\nfor ch in '0123456789': on(ch)(lambda self, ch=int(ch): self.stack.append(ch))"]
{"fn_name": "interpret", "inputs": [], "outputs": []}
interview
https://www.codewars.com/kata/526c7b931666d07889000a3c
def interpret(code):
[ 17360, 82675, 15459, 525, 5020, 2588, 311, 2025, 11, 714, 432, 594, 14138, 7040, 311, 3270, 17929, 5045, 369, 1105, 2219, 7771, 3383, 374, 311, 3270, 264, 1714, 892, 686, 14198, 425, 823, 13884, 12, 24, 18, 2038, 0, 425, 823, 13884, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
266
You are given a string s, a split is called good if you can split s into 2 non-empty strings p and q where its concatenation is equal to s and the number of distinct letters in p and q are the same. Return the number of good splits you can make in s.   Example 1: Input: s = "aacaba" Output: 2 Explanation: There are 5 ways to split "aacaba" and 2 of them are good. ("a", "acaba") Left string and right string contains 1 and 3 different letters respectively. ("aa", "caba") Left string and right string contains 1 and 3 different letters respectively. ("aac", "aba") Left string and right string contains 2 and 2 different letters respectively (good split). ("aaca", "ba") Left string and right string contains 2 and 2 different letters respectively (good split). ("aacab", "a") Left string and right string contains 3 and 1 different letters respectively. Example 2: Input: s = "abcd" Output: 1 Explanation: Split the string as follows ("ab", "cd"). Example 3: Input: s = "aaaaa" Output: 4 Explanation: All possible splits are good. Example 4: Input: s = "acbadbaada" Output: 2   Constraints: s contains only lowercase English letters. 1 <= s.length <= 10^5
["class Solution:\n def numSplits(self, s: str) -> int:\n left = [0]*len(s)\n \n unique = set()\n n_distinct = 0\n for i, l in enumerate(s):\n if l not in unique:\n unique.add(l)\n n_distinct += 1\n left[i] = n_distinct\n \n count = 0\n unique = set()\n n_distinct = 0\n for i in range(len(s)-1, 0,-1):\n if s[i] not in unique:\n unique.add(s[i])\n n_distinct += 1\n \n if n_distinct == left[i-1]:\n count += 1\n \n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n index_one = 0\n index_two = 0\n set_one = set()\n set_two = set()\n s_r = s[::-1]\n \n for i in range(len(s)):\n # if s[i] in set_one:\n # continue\n # else:\n print((i, len(set(s[:i + 1])), len(set(s[i + 1:]))))\n if len(set(s[:i + 1])) == len(set(s[i + 1:])):\n index_one = i\n break\n else:\n set_one.add(s[i])\n \n for i in range(len(s_r)):\n # if s_r[i] in set_two:\n # continue\n # else:\n print((i, len(set(s_r[:i + 1])), len(set(s_r[i + 1:]))))\n if len(set(s_r[:i + 1])) == len(set(s_r[i + 1:])):\n print(i)\n index_two = len(s) - i - 1\n break\n else:\n set_two.add(s_r[i])\n \n print((index_one, index_two))\n \n return index_two - index_one\n \n \n", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n right = Counter(s)\n left = set()\n res = 0\n for i in range(len(s) - 1):\n left.add(s[i])\n right[s[i]] -= 1\n res += len(left) == sum(i > 0 for i in right.values())\n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n def decorate(a, b):\n final = {1: defaultdict(int), 2 : defaultdict(int)}\n count1, count2 = 0, 0\n for char in a:\n final[1][char] += 1\n if final[1][char] == 1: count1 += 1\n \n for char in b:\n final[2][char] += 1\n if final[2][char] == 1: count2 += 1\n return final, count1, count2\n \n split = None\n count1, count2 = 0, 0\n total = 0\n for point in range(1, len(s)):\n if split == None:\n split, count1, count2 = decorate(s[:point], s[point:])\n else:\n split[1][s[point-1]] += 1\n if split[1][s[point-1]] == 1: count1 += 1\n \n split[2][s[point-1]] -= 1\n if split[2][s[point-1]] == 0: count2 -= 1\n \n # print(s[:point], s[point:], count1, count2)\n if count1 == count2: total += 1\n \n return total\n", "class Solution:\n def count_chars(self, s):\n count = {}\n for c in s:\n if c in count:\n count[c] += 1\n else:\n count[c] = 1\n return count\n \n def dict_decr(self, d, c):\n if c in d:\n d[c] -= 1\n if d[c] <= 0:\n del d[c]\n \n def numSplits(self, s: str) -> int:\n left, right = s[0], s[1:]\n left_chars = set([left])\n right_chars = self.count_chars(right)\n \n num_splits = 0\n while right:\n \n if len(left_chars) == len(right_chars.keys()):\n num_splits += 1\n c = right[0]\n self.dict_decr(right_chars, c)\n left_chars.add(c)\n left += c\n right = right[1:]\n \n return num_splits", "class Solution:\n def numSplits(self, s: str) -> int:\n count = 0\n left = set(s[:1])\n right = set(s[1:])\n if len(left) == len(right):\n count += 1\n k = 0\n for i in range(1, len(s)):\n if s[i] not in left:\n left.add(s[i])\n if s[i] not in s[i+1:]:\n k += 1\n diff = len(left) - (len(right) - k)\n if diff == 0:\n count += 1\n elif diff > 0:\n break\n return count", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n no = 0\n x=Counter(s)\n y=Counter()\n if len(list(x.keys()))==len(list(y.keys())):\n no+=1\n for i in range(0,len(s)-1):\n \n x[s[i]]-=1\n if x[s[i]]==0:\n del x[s[i]]\n if s[i] in y:\n y[s[i]] += 1\n else:\n y[s[i]]=1\n \n if len(list(x.keys())) == len(list(y.keys())):\n no+=1\n \n \n \n \n return no\n \n", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n num_splits = 0\n left = Counter()\n right = Counter(s)\n\n for char in s:\n left.update(char)\n right.subtract(char)\n if right[char] == 0:\n del right[char]\n \n if len(left) == len(right):\n num_splits += 1\n \n return num_splits\n \n\n", "class Solution:\n def numSplits(self, s: str) -> int:\n pre = [0] * len(s)\n \n acc = set()\n cnt = 0\n for i in range(len(s) - 1):\n if s[i] not in acc:\n cnt += 1\n acc.add(s[i])\n pre[i] = cnt\n \n cnt = 0\n acc.clear()\n res = 0\n for i in range(len(s) - 1, 0, -1):\n if s[i] not in acc:\n cnt += 1\n acc.add(s[i])\n if pre[i - 1] == cnt:\n res += 1\n \n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n l_count = []\n r_count = []\n tmp = 0\n for i in range(len(s)):\n if s[i] not in s[:i]:\n tmp += 1\n l_count.append(tmp)\n tmp = 0\n for i in range(len(s))[::-1]:\n if s[i] not in s[(i+1):]:\n tmp += 1\n r_count.append(tmp)\n r_count = r_count[::-1]\n \n count = 0\n for i in range(len(r_count)-1):\n if l_count[i] == r_count[i+1]:\n count += 1\n return count", "# class Solution:\n# def numSplits(self, s: str) -> int:\n# n = len(s)\n# output = 0\n# for i in range(1, n):\n# if len(set(s[:i])) == len(set(s[i:n])):\n# output += 1\n# if len(set(s[:i])) > len(set(s[i:n])):\n# break\n# return output\n \nclass Solution:\n def numSplits(self, s: str) -> int:\n n = len(s)\n output = 0\n dic = {}\n for i, x in enumerate(s):\n if not x in dic:\n dic[x] = [i, i]\n else:\n dic[x][1] = i\n # print(dic)\n for i in range(0, n-1):\n left = 0 \n right = 0\n for letter, indexes in list(dic.items()):\n if i >= indexes[0]:\n left += 1\n if i + 1 <= indexes[1]:\n right += 1\n if left == right:\n output += 1\n return output\n \n", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n prev_counter = {}\n post_counter = dict(Counter(s))\n \n count = 0\n for partition in range(len(s)):\n prev, post = s[:partition], s[partition:]\n \n if not prev or not post:\n continue\n \n curr = prev[-1]\n if curr not in prev_counter:\n prev_counter[curr] = 0\n \n prev_counter[curr] += 1\n post_counter[curr] -= 1\n \n if post_counter[curr] == 0:\n post_counter.pop(curr)\n \n if len(prev_counter) == len(post_counter):\n count += 1\n \n return count\n \n", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n prev_counter = {}\n post_counter = Counter(s)\n \n count = 0\n for partition in range(len(s)):\n prev, post = s[:partition], s[partition:]\n \n if not prev or not post:\n continue\n \n curr = prev[-1]\n if curr not in prev_counter:\n prev_counter[curr] = 0\n \n prev_counter[curr] += 1\n post_counter[curr] -= 1\n \n if post_counter[curr] == 0:\n post_counter.pop(curr)\n \n if len(prev_counter) == len(post_counter):\n count += 1\n \n return count\n \n", "class Solution:\n def sub(self, h, h2):\n nh = h.copy()\n for k in h2:\n if k in nh:\n nh[k] = nh[k]-h2[k]\n if nh[k] == 0:\n del nh[k]\n return nh\n \n def numSplits(self, s: str) -> int:\n h = {}\n for c in s:\n if c not in h:\n h[c] = 0\n h[c] = h[c] + 1\n \n ct = 0\n h2 = {}\n for i, c in enumerate(s):\n if c not in h2:\n h2[c] = 0\n h2[c] = h2[c] + 1\n uh = self.sub(h, h2)\n if len(h2) == len(uh):\n ct = ct + 1\n return ct", "from collections import defaultdict, Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n len_s = len(s)\n if len_s == 0:\n return 0\n \n if len_s == 1:\n return 1\n \n nb_good_splits = 0\n left_counter = defaultdict(int)\n right_counter = Counter(s)\n \n for i in range(1, len_s):\n left, right = s[0:i], s[i:]\n swing_letter = left[-1]\n \n left_counter[swing_letter] += 1\n right_counter[swing_letter] -= 1\n \n if right_counter[swing_letter] == 0:\n del right_counter[swing_letter]\n \n if len(left_counter) == len(right_counter):\n nb_good_splits += 1\n \n return nb_good_splits\n", "class Solution:\n def numSplits(self, s: str) -> int:\n \n b_c = collections.defaultdict(lambda:0)\n a_c = dict(collections.Counter(list(s)))\n \n # print('initial', b_c, a_c)\n \n ans = 0\n for i, ch in enumerate(list(s)):\n # print(i, ch)\n b_c[ch] += 1\n a_c[ch] -= 1\n # print(b_c, a_c)\n \n if len({k for k, v in list(b_c.items()) if v > 0}) == len({k for k,v in list(a_c.items()) if v>0}):\n ans += 1\n \n return ans\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n \n good_splits = 0\n first_map = {}\n s_map = {}\n \n for letter in s:\n if s_map.get(letter):\n s_map[letter] += 1\n else:\n s_map[letter] = 1\n \n for split_point in range(len(s)):\n if first_map.get(s[split_point]):\n first_map[s[split_point]] = first_map[s[split_point]] + 1\n else:\n first_map[s[split_point]] = 1\n s_map[s[split_point]] = s_map[s[split_point]] - 1\n f_keys = [k for k,v in list(first_map.items()) if v > 0]\n s_keys = [k for k,v in list(s_map.items()) if v > 0]\n if len(f_keys) == len(s_keys):\n good_splits += 1\n \n return good_splits\n", "class Solution:\n def numSplits(self, s: str) -> int:\n if len(s) <= 1:\n return 0\n \n left = len(s)*[0]\n right = len(s)*[0]\n seen = set(s[0])\n # right[-1] = 1\n left [0] = 1\n for i in range(1, len(s)):\n if s[i] not in seen:\n seen.add(s[i])\n left[i] = left[i-1]+1\n else:\n left[i] = left[i-1]\n seen= set()\n rtotal = 0\n count = 0\n for i in range(len(s)-1, 0,-1):\n if s[i] not in seen:\n seen.add(s[i])\n rtotal +=1\n if rtotal == left[i-1]:\n count +=1\n elif rtotal > left[i-1]:\n break\n \n # count = 0\n # # print(left)\n # # print(right)\n # for i in range(0, len(s)-1):\n # if left[i]== right[i+1]:\n # count +=1\n # elif right[i+1] < left[i]:\n # break\n \n return count\n", "class Solution:\n def numSplits(self, s: str) -> int:\n characters = []\n possibleSplits = 0\n for i in range(len(s)):\n if s[i] not in characters:\n characters.append(s[i])\n for i in range(len(s)):\n leftChars = 0\n rightChars = 0\n leftSide = s[:i]\n rightSide = s[i:]\n for j in range(len(characters)):\n if characters[j] in leftSide:\n leftChars += 1\n if characters[j] in rightSide:\n rightChars += 1\n if leftChars == rightChars:\n possibleSplits += 1\n return possibleSplits\n", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n c = 0\n \n c1 = Counter()\n c2 = Counter(s)\n \n for i in range(len(s)):\n \n c1[s[i]] += 1\n c2[s[i]] -= 1\n \n if self.Count(c1) == self.Count(c2):\n c += 1\n \n return c\n \n \n def Count(self, counter):\n return sum([1 for k in counter if counter[k] !=0])\n", "class Solution:\n def numSplits(self, s: str) -> int:\n s_len = len(s)\n if s_len == 0 or s_len == 1:\n return 0\n seen = set()\n dp = [0 for _ in range(s_len-1)]\n dp[0] = 1\n seen.add(s[0])\n for i in range(1,s_len-1):\n if s[i] in seen:\n dp[i] = dp[i-1]\n else:\n seen.add(s[i])\n dp[i] = dp[i-1]+1\n \n seen = set()\n acc = 0\n count = 0\n for i in range(s_len-1,0,-1):\n if (s[i] not in seen):\n seen.add(s[i])\n acc += 1\n if (acc == dp[i-1]):\n count += 1\n return count\n\n", "class Solution:\n def numSplits111(self, s: str) -> int:\n s_len = len(s)\n if s_len == 0 or s_len == 1:\n return 0\n seen = set()\n dp = [0 for i in range(s_len-1)]\n dp[0] = 1\n seen.add(s[0])\n for i in range(1,s_len-1):\n if s[i] in seen:\n dp[i] == dp[i-1]\n else:\n seen.add(s[i])\n dp[i] = dp[i-1]+1\n \n seen = set()\n acc = 0\n count = 0\n for i in range(s_len-1,0,-1):\n if (s[i] not in seen):\n seen.add(s[i])\n acc += 1\n if (acc == dp[i-1]):\n count += 1\n return count\n\n def numSplits(self, s: str) -> int:\n \n n = len(s)\n \n if n <= 1:\n return 0\n \n #forward pass\n seen = set()\n dp = [0 for _ in range(n-1)]\n dp[0] = 1\n seen.add(s[0])\n \n for i in range(1,n-1):\n if s[i] in seen:\n dp[i] = dp[i-1]\n else:\n seen.add(s[i])\n dp[i] = dp[i-1] + 1\n \n count = 0\n \n #backward pass\n seen = set()\n current = 0\n for i in range(n-1, 0, -1):\n if s[i] not in seen:\n seen.add(s[i])\n current += 1\n \n if current == dp[i-1]:\n count += 1\n \n return count\n \n\n \n \n \n \n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n cnt = 0\n l_set = set()\n d = {c: s.count(c) for c in set(s)}\n \n for c in s:\n l_set.add(c)\n d[c] -= 1\n if d[c] == 0:\n d.pop(c, None)\n if len(l_set) == len(d):\n cnt += 1\n return cnt", "class Solution:\n def numSplits(self, s: str) -> int:\n dictionary={}\n sol=0\n \n for i in range(len(s)):\n dictionary[s[i]]=i\n dictionary2={}\n \n for i in range(len(s)-1):\n dictionary2[s[i]]=i\n if i==dictionary[s[i]]:\n dictionary.pop(s[i])\n if len(dictionary)==len(dictionary2):\n sol+=1\n return sol", "class Solution:\n def numSplits(self, s: str) -> int:\n uniqueLeft = 0\n uniqueRight = 0\n ans = 0\n leftDict = {}\n rightDict = {}\n for i in s:\n if i in rightDict:\n rightDict[i] += 1\n else:\n rightDict[i] = 1\n uniqueRight += 1\n for i in s:\n if i in leftDict:\n leftDict[i] += 1\n else:\n leftDict[i] = 1\n uniqueLeft += 1\n rightDict[i] -= 1\n if rightDict[i] == 0:\n uniqueRight -= 1\n if uniqueRight == uniqueLeft:\n ans += 1\n return ans", "# time complexity: O(26N), N = len(s)\n#class Solution:\n# def numSplits(self, s: str) -> int:\n# N = len(s)\n# freq = [[0] * (N+1) for _ in range(26)] # cumulative freq of each character\n# for i in range(1, N+1):\n# for j in range(26):\n# if ord(s[i-1]) - ord('a') == j:\n# freq[j][i] = freq[j][i-1] + 1\n# else:\n# freq[j][i] = freq[j][i-1]\n#\n# good = 0\n# for i in range(1, N):\n# left = 0\n# right = 0\n# for j in range(26):\n# if freq[j][i] > 0: # there is at least one chr(ord(j) + ord('a')) on the left of s[i]\n# left += 1\n# if freq[j][i] < freq[j][-1]: # there is at least one chr(ord(j) + ord('a')) on the right of s[i]\n# right += 1\n# if left == right:\n# good += 1\n# return good\n\n# time complexity: O(3N), N = len(s)\nclass Solution:\n def numSplits(self, s: str) -> int:\n N = len(s)\n \n left = [0] * (N+1) # unique char in s[:left], exclude left\n seen = set()\n for i in range(1,N+1):\n c = s[i-1]\n if c not in seen:\n left[i] = left[i-1] + 1\n seen.add(c)\n else:\n left[i] = left[i-1]\n \n right = [0] * (N+1) # unique char in s[right:], include right\n seen.clear()\n for i in range(N-1,-1,-1):\n c = s[i]\n if c not in seen:\n right[i] = right[i+1] + 1\n seen.add(c)\n else:\n right[i] = right[i+1]\n \n good = 0\n for i in range(N+1):\n if left[i] == right[i]:\n good += 1\n return good", "class Solution:\n def numSplits(self, s: str) -> int:\n set_f = set()\n map_b = defaultdict(int)\n \n for c in s:\n map_b[c] += 1\n \n num = 0\n for c in s:\n map_b[c] -= 1\n if not map_b[c]:\n del map_b[c]\n \n set_f.add(c)\n \n if len(set_f) == len(map_b):\n num += 1\n \n return num", "from collections import defaultdict\nclass Solution:\n def numSplits(self, s: str) -> int:\n rst = 0\n lDict = defaultdict(int)\n rDict = defaultdict(int)\n \n lDict[s[0]] = 1\n for char in s[1:]:\n rDict[char]+=1\n \n \n if(len(rDict)==len(lDict)):\n rst+=1\n \n for char in s[1:-1]:\n rDict[char]-=1\n if(rDict[char]==0):\n rDict.pop(char)\n lDict[char]+=1\n #print(lDict,rDict)\n if(len(rDict)==len(lDict)):\n rst+=1\n return rst\n \n \n \n", "import collections\nclass Solution:\n def numSplits(self, s: str) -> int:\n leftMap = collections.defaultdict(int)\n rightMap = collections.defaultdict(int)\n \n for ch in s:\n rightMap[ch] += 1\n \n output = 0\n \n for ch in s:\n rightMap[ch] -= 1\n if rightMap[ch] == 0:\n del rightMap[ch]\n \n leftMap[ch] += 1\n \n if len(rightMap) == len(leftMap):\n output += 1\n return output\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n initial = {}\n \n for char in s:\n if char in initial:\n initial[char] += 1\n else:\n initial[char] = 1\n \n other = {}\n output = 0\n \n for char in s:\n initial[char] -= 1\n if initial[char] == 0:\n del initial[char]\n other[char] = 1\n if len(initial) == len(other):\n output += 1\n return output\n \n", "from collections import defaultdict\nclass Solution:\n def numSplits(self, s: str) -> int:\n hmap = defaultdict(int)\n for ele in s:\n hmap[ele]+=1\n \n \n count = 0\n size = len(hmap)\n \n second_map = defaultdict(int)\n for i in range(len(s)):\n c = s[i]\n second_map[c]+=1\n hmap[c]-=1\n if hmap[c] == 0:\n del hmap[c]\n if len(second_map) == len(hmap):\n count+=1\n elif len(second_map) > len(hmap):\n break\n \n \n return count\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n n = len(s)\n lc = [1]*n\n rc = [1]*n\n ls = set()\n rs = set()\n for i in range(n):\n ls.add(s[i])\n rs.add(s[-(i+1)])\n lc[i] = len(ls)\n rc[-(i+1)] = len(rs)\n r = 0\n for i in range(n-1):\n if lc[i]==rc[i+1]: r+=1\n return r", "class Solution:\n def numSplits(self, s: str) -> int:\n lc, rc = [], []\n ls, rs = set(), set()\n for c in s:\n ls.add(c)\n lc.append(len(ls))\n for c in reversed(s):\n rs.add(c)\n rc.append(len(rs))\n res = 0\n rc = rc[::-1]\n for i in range(len(lc) - 1):\n if lc[i] == rc[i + 1]:\n res += 1\n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n \n auxDict = {}\n auxLeftToRight = [0] * len(s)\n count = 0\n for pos in range(len(s)):\n if s[pos] not in auxDict:\n auxDict[s[pos]] = 1\n count += 1\n auxLeftToRight[pos] = count\n\n auxDict = {}\n auxRightToLeft = [0] * len(s)\n count = 0\n for pos in range(len(s)-1):\n if s[len(s)-1-pos] not in auxDict:\n auxDict[s[len(s)-1-pos]] = 1\n count += 1\n auxRightToLeft[len(s)-2-pos] = count\n\n total = 0\n for pos in range(len(s)):\n if auxLeftToRight[pos] == auxRightToLeft[pos]:\n total += 1\n \n return total\n", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n n=len(s)\n prefix=[0]*n\n suffix=[0]*n\n pset=set()\n sset=set()\n ans=0\n for i in range(0,n):\n l=s[i]\n r=s[n-i-1]\n pset.add(l)\n sset.add(r)\n prefix[i]=len(pset)\n suffix[n-1-i]=len(sset)\n \n for i in range(0,n-1):\n if prefix[i]==suffix[i+1]:\n ans=ans+1\n return ans\n", "class Solution:\n def numSplits(self, s: str) -> int:\n # preprocess_prefix[k], number of different letters in s[:k]\n # preprocess_postfix[k], number of different letters in s[k:]\n \n # Fill preprocess_prefix\n seen_letters = []\n preprocess_prefix = [0]\n for i in range(len(s)):\n if s[i] not in seen_letters:\n seen_letters.append(s[i])\n preprocess_prefix.append(len(seen_letters))\n \n # Fill preprocess_postfix[k]\n seen_letters = []\n preprocess_postfix = [0]\n for i in range(len(s)-1, -1, -1):\n if s[i] not in seen_letters:\n seen_letters.append(s[i])\n preprocess_postfix.append(len(seen_letters))\n preprocess_postfix.reverse()\n count = 0\n for i in range(len(preprocess_postfix)):\n if preprocess_postfix[i] == preprocess_prefix[i]:\n count += 1\n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n count = 0\n left, right = defaultdict(int), Counter(s)\n count = 0\n for letter in s:\n left[letter] += 1\n right[letter] -= 1\n if right[letter] == 0: del right[letter]\n count += (len(left) == len(right))\n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n le_set, ri_set = [s[0]], [s[-1]]\n le_arr, ri_arr = [1]*len(s), [1]*len(s)\n # print(le_arr[0])\n # print(ri_arr)\n for i in range(1, len(s)):\n le_arr[i] = le_arr[i-1]\n if s[i] not in le_set:\n le_set.append(s[i])\n le_arr[i]+=1\n \n for i in range(len(s)-2, -1, -1):\n ri_arr[i] = ri_arr[i+1]\n if s[i] not in ri_set:\n ri_set.append(s[i])\n ri_arr[i]+=1\n \n # print(le_arr)\n # print(ri_arr)\n cnt=0\n for i in range(0, len(s)-1):\n if le_arr[i]==ri_arr[i+1]:\n cnt+=1\n return cnt\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n total_chars_1 = defaultdict(int)\n total_chars_1[s[0]] = 1\n \n total_chars_2 = defaultdict(int)\n \n splits = 0\n \n for i in range(1, len(s)):\n total_chars_2[s[i]] += 1\n \n for i in range(len(s) - 1):\n if len(total_chars_1) == len(total_chars_2):\n splits += 1\n \n total_chars_1[s[i+1]] += 1\n total_chars_2[s[i+1]] -= 1\n \n if total_chars_2[s[i+1]] == 0:\n del total_chars_2[s[i+1]]\n \n return splits\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n \n c = Counter(s)\n res = 0\n \n d = dict()\n for i,v in enumerate(s):\n if v not in d:\n d[v] = 1\n else:\n d[v] += 1\n c[v] -= 1\n if c[v] == 0:\n del c[v]\n if len(c) == len(d):\n res += 1\n \n return res\n", "class Solution:\n def numSplits(self, s: str) -> int:\n counter = 0\n left = defaultdict(int)\n right = defaultdict(int)\n \n for c in s:\n right[c] += 1 # pre-populate\\\\\n \n for i in range(len(s)):\n left[s[i]] += 1\n right[s[i]] -= 1\n if right[s[i]] == 0:\n right.pop(s[i])\n\n if len(left.keys()) == len(right.keys()):\n counter += 1\n return counter", "class Solution:\n def numSplits(self, s: str) -> int:\n left_count = collections.Counter()\n right_count = collections.Counter(s)\n ans = 0\n for ch in s:\n left_count[ch] += 1\n right_count[ch] -= 1\n if right_count[ch] == 0:\n del right_count[ch]\n \n if len(left_count) == len(right_count):\n ans += 1\n return ans", "class Solution:\n def numSplits(self, s: str) -> int:\n leftCount = collections.Counter()\n rightCount = collections.Counter(s)\n \n res = 0\n for c in s:\n leftCount[c] += 1\n rightCount[c] -= 1\n if rightCount[c] == 0:\n del rightCount[c]\n if len(rightCount) == len(leftCount):\n res += 1\n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n \n left=sorted([s.find(l) for l in set(s)]) + [len(s)]\n right=sorted([s.rfind(l) for l in set(s)], reverse=True)+[0]\n \n ind=max(ind for ind in range(len(left)) if left[ind]<=right[ind])\n \n return min(right[ind], left[ind+1])-max(left[ind], right[ind+1]) \n'''\n\\\"aacaba\\\"\n\\\"abcd\\\"\n\\\"aaaaa\\\"\n\\\"acbadbaada\\\"\n\\\"a\\\"\n\\\"abc\\\"\n\\\"abcd\\\"\n'''\n", "class Solution:\n def numSplits(self, s: str) -> int:\n s_cnt = Counter(s)\n p_cnt = defaultdict(int)\n count = 0\n for ch in s:\n p_cnt[ch] += 1\n s_cnt[ch] -= 1\n if s_cnt[ch] == 0: del(s_cnt[ch])\n if len(s_cnt.keys()) == len(p_cnt.keys()): count += 1\n return count", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n #pseudo:\n #start left window at 0\n #have right window open for all letters in s\n #keep count for left and right\n #keep overall count\n #left woud start with first letter, right would be rest of letters\n #loop through each letter\n #left window should increase by one [i+1]\n #right window should decrease by 1\n #if the letter in the right dictionary already exists, then remove and decrease the right count by 1\n #if current letter not in the left dictionary then +1 to left count and add to dictionary \n #if left count and right counter are both equal to each other then add 1 to count \n \n l_dict = Counter()\n r_dict = Counter(s)\n counter = 0\n \n print(r_dict)\n for i in s:\n r_dict[i] -= 1\n l_dict[i] = l_dict.get(i, 0) + 1\n \n if r_dict[i] == 0:\n del r_dict[i]\n \n if len(l_dict) == len(r_dict):\n counter += 1\n \n return counter\n \n", "class Solution:\n def numSplitsBF(self, s: str) -> int:\n cntr = 0\n for i in range(1, len(s)):\n # a, b = s[:i], s[i:]\n # print(a, b)\n a, b = collections.Counter(s[:i]), collections.Counter(s[i:])\n if len(a) == len(b):\n cntr += 1\n return cntr\n \n def numSplits(self, s: str) -> int:\n \n a = collections.defaultdict(int)\n a[s[0]] = 1\n b = collections.Counter(s[1:])\n pntr = 1\n cntr = 0 if len(a) != len(b) else 1\n while pntr < len(s):\n a[s[pntr]] += 1\n b[s[pntr]] -= 1\n if b[s[pntr]] == 0:\n del b[s[pntr]]\n # print(a, b)\n if len(a) == len(b):\n cntr += 1\n pntr += 1\n return cntr", "class Solution:\n def numSplits(self, s: str) -> int:\n left = {s[0]:1}\n right = {}\n for i in range(1, len(s)):\n right[s[i]] = right.get(s[i], 0) + 1\n \n #check if the left set has as many items as the right set\n #then we incremenet the middle pointer\n #remove the item from right\n #add it to left\n middle_i = 1\n count = 0\n while middle_i < len(s):\n if len(left) == len(right):\n count += 1\n \n middle = s[middle_i]\n right[middle] -= 1\n if right[middle] == 0:\n right.pop(middle)\n \n left[middle] = left.get(middle, 0) + 1\n \n middle_i += 1\n \n return count\n", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n left_counts = {s[0]:1}\n right_counts = Counter(s[1:])\n split_count = 0\n if len(list(left_counts.items())) == len(list(right_counts.items())):\n split_count += 1\n for i in range(1, len(s)):\n if s[i] in left_counts:\n left_counts[s[i]] += 1\n else:\n left_counts[s[i]] = 1\n if right_counts[s[i]] == 1:\n del right_counts[s[i]]\n else:\n right_counts[s[i]] -= 1\n if len(list(left_counts.items())) == len(list(right_counts.items())):\n split_count += 1\n return split_count\n \n \n", "class Solution:\n def numSplits(self, ss: str) -> int:\n a=set()\n k={}\n p={}\n n=len(ss)\n def myfunc(s,aa):\n for i in range(n-1):\n if(s[i] not in a):\n a.add(s[i])\n aa[i]=1\n else:\n aa[i]=0\n if(i!=0):\n aa[i]+=aa[i-1]\n myfunc(ss,k) # k[i] gives,no of distinct letters,to left of left of index i+1 in ss\n a.clear()\n myfunc(ss[::-1],p) # p[i] gives,no of distinct letters,to left of left of index i+1...in ss_reverse\n ans=0\n # print(k)\n # print(p)\n for j in range(n-1): \n if(k[j]==p[n-1-(j+1)]):\n ans+=1\n \n return ans \n\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n leftMap = {}\n rightMap = {}\n \n for j in range(len(s)):\n rightMap[s[j]] = rightMap.get(s[j], 0) + 1\n \n i = 0\n result = 0\n while (i < len(s) - 1):\n leftMap[s[i]] = leftMap.get(s[i], 0) + 1\n rightMap[s[i]] = rightMap[s[i]] - 1\n if (rightMap.get(s[i], 0) <= 0):\n rightMap.pop(s[i])\n \n if (len(leftMap) == len(rightMap)):\n result += 1\n i += 1 \n return result\n \n# method 2\n# prefix = [0] * len(s) # distinct number from s[0] to s[i]\n# suffix = [0] * len(s) # distinct number from s[len(s)-1] to s[i]\n# prefixMap = {}\n# suffixMap = {}\n# for i in range(len(s)):\n# j = len(s) - 1 - i\n# prefixMap[s[i]] = prefixMap.get(s[i], 0) + 1\n# suffixMap[s[j]] = suffixMap.get(s[j], 0) + 1\n# prefix[i] = len(prefixMap)\n# suffix[j] = len(suffixMap)\n \n# result = 0\n# k = 0\n# while (k < len(s)-1):\n# if (prefix[k] == suffix[k+1]):\n# result += 1\n# k += 1\n# return result\n", "class Solution:\n def numSplits(self, s: str) -> int:\n leftMap = {}\n rightMap = {}\n \n for j in range(len(s)):\n rightMap[s[j]] = rightMap.get(s[j], 0) + 1\n \n i = 0\n result = 0\n while (i < len(s) - 1):\n leftMap[s[i]] = leftMap.get(s[i], 0) + 1\n rightMap[s[i]] = rightMap[s[i]] - 1\n if (rightMap.get(s[i], 0) <= 0):\n rightMap.pop(s[i])\n \n if (len(leftMap) == len(rightMap)):\n result += 1\n i += 1\n # print(\\\"leftMap\\\", leftMap)\n # print(\\\"rightMap\\\", rightMap)\n \n return result\n \n# method 2\n# prefix = [0] * len(s) # distinct number from s[0] to s[i]\n# suffix = [0] * len(s) # distinct number from s[len(s)-1] to s[i]\n# prefixMap = {}\n# suffixMap = {}\n# for i in range(len(s)):\n# j = len(s) - 1 - i\n# prefixMap[s[i]] = prefixMap.get(s[i], 0) + 1\n# suffixMap[s[j]] = suffixMap.get(s[j], 0) + 1\n# prefix[i] = len(prefixMap)\n# suffix[j] = len(suffixMap)\n \n# result = 0\n# k = 0\n# while (k < len(s)-1):\n# if (prefix[k] == suffix[k+1]):\n# result += 1\n# k += 1\n# return result\n", "class Solution:\n def numSplits(self, s: str) -> int:\n left = Counter()\n right = Counter(s)\n res = 0\n for ch in s :\n if right[ch] == 1:\n del right[ch]\n else:\n right[ch] -= 1\n left[ch] += 1\n #print (right,left)\n if len(list(left.keys())) == len(list(right.keys())):\n res += 1\n return res\n \n", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n c2nl = Counter('')\n c2nr = Counter(s)\n n = len(s)\n ans = 0\n for i in range(n-1):\n c2nl[s[i]] += 1\n c2nr[s[i]] -= 1\n if c2nr[s[i]] == 0 : del c2nr[s[i]]\n if len(c2nl)==len(c2nr): ans += 1\n return ans", "class Solution:\n def numSplits(self, s: str) -> int:\n p = (int)\n q = (int)\n ll = len(s)\n if ll < 2:\n return 0\n ns = len(set(s))\n np = nq = 0\n for ii in range(1,ll):\n if len(set(s[:ii])) == ns:\n np = ii\n break\n for ii in range(1,ll):\n if len(set(s[ll-ii:])) == ns:\n nq = ll-ii\n break\n if np <= nq:\n return nq-np+1\n \n ans = 0\n for ii in range(1,ll):\n p = len(set(s[:ii]))\n q = len(set(s[ii:]))\n if p == q:\n ans += 1\n elif p > q:\n return ans\n \n return ans", "class Solution:\n def numSplits(self, s: str) -> int:\n left = Counter()\n right = Counter(s)\n res = 0\n for ch in s :\n if right[ch] == 1:\n del right[ch]\n else:\n right[ch] -= 1\n left[ch] += 1\n if len(list(left.keys())) == len(list(right.keys())):\n res += 1\n return res\n \n", "from collections import Counter\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n s1 = Counter()\n s2 = Counter(s)\n count = 0\n \n for a in s:\n s1[a] += 1\n s2[a] -= 1\n if s2[a] == 0:\n s2.pop(a)\n if len(s1) == len(s2):\n count += 1\n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n \n dic_b ={} \n for i in s[1:]:\n \n if i not in dic_b:\n dic_b[i] = 1\n else:\n dic_b[i]+=1\n \n b_count = len(dic_b)\n a= list(s[:1])\n a_count =1\n \n count = int(b_count==a_count)\n \n ix=1\n \n while ix<len(s):\n \n if s[ix] not in a:\n a_count+=1\n a.append(s[ix])\n dic_b[s[ix]]-=1\n \n if dic_b[s[ix]] ==0:\n b_count-=1\n \n count+= int(a_count == b_count)\n\n ix+=1\n \n return count\n", "from collections import Counter\n\ndef increment_counter(counter, key):\n counter[key] += 1\n\ndef decrement_counter(counter, key):\n counter[key] -= 1\n if counter[key] == 0:\n del counter[key]\n \ndef naive_solution(s: str) -> int:\n\n total = Counter(s)\n count = 0\n\n p = Counter()\n for char in s:\n p[char] += 1\n\n q = total - p\n\n if len(p) == len(q):\n count += 1\n\n return count\n\n\ndef optimized(s: str) -> int:\n prefix = Counter() # initialize prefix as empty\n suffix = Counter(s) # initialize suffix as total\n count = 0\n for char in s:\n increment_counter(prefix, char)\n decrement_counter(suffix, char)\n \n if len(prefix) == len(suffix):\n count += 1\n \n return count\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n # return naive_solution(s)\n return optimized(s)\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n \n if len(s) < 2:\n return 0\n \n c = 0\n \n left, right = defaultdict(int), defaultdict(int)\n \n left[s[0]] = 1\n for i in range(1,len(s)):\n right[s[i]] +=1\n \n if len(right) == 1:\n c+=1\n \n for i in range(1, len(s)):\n right[s[i]]-=1\n if right[s[i]] == 0:\n right.pop(s[i])\n left[s[i]]+=1\n if len(left) == len(right):\n c+=1\n return c", "from collections import Counter\n\ndef increment_counter(counter, key):\n counter[key] += 1\n\ndef decrement_counter(counter, key):\n if key in counter:\n counter[key] -= 1\n if counter[key] == 0:\n del counter[key]\n \ndef naive_solution(s: str) -> int:\n\n total = Counter(s)\n count = 0\n\n p = Counter()\n for char in s:\n p[char] += 1\n\n q = total - p\n\n if len(p) == len(q):\n count += 1\n\n return count\n\n\ndef optimized(s: str) -> int:\n prefix = Counter() # initialize prefix as empty\n suffix = Counter(s) # initialize suffix as total\n count = 0\n for char in s:\n increment_counter(prefix, char)\n decrement_counter(suffix, char)\n \n if len(prefix) == len(suffix):\n count += 1\n \n return count\n\nclass Solution:\n def numSplits(self, s: str) -> int:\n # return naive_solution(s)\n return optimized(s)\n \n", "from collections import Counter\nclass Solution:\n \n def numSplits(self, s: str) -> int:\n hist_left = Counter(s[:1])\n hist_right = Counter(s[1:])\n count = 0\n for i in range(1, len(s)):\n v = s[i]\n if len(list(hist_left.keys())) == len(list(hist_right.keys())):\n count += 1\n \n hist_left[v] += 1\n \n if hist_right[v] == 1:\n del hist_right[v]\n else:\n hist_right[v] -= 1\n return count\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n right = collections.Counter(s)\n left = collections.defaultdict(int)\n res = 0\n for i in range(len(s)-1):\n c = s[i]\n right[c] -= 1\n if not right[c]: del right[c]\n left[c] += 1\n if len(left) == len(right): res += 1\n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n left_unique = [0 for x in range(len(s))]\n right_unique = [0 for x in range(len(s))]\n left_set = set()\n right_set = set()\n for x in range(len(s)):\n if s[x] not in left_set:\n left_set.add(s[x])\n if x > 0:\n left_unique[x] =left_unique[x-1] + 1\n else:\n left_unique[x] += 1\n else:\n left_unique[x] = left_unique[x-1]\n if s[len(s)-1-x] not in right_set:\n right_set.add(s[len(s)-x-1])\n if x > 0:\n right_unique[len(s)-x-1] = right_unique[len(s)-x] + 1\n else:\n right_unique[len(s)-x-1]+=1\n else:\n right_unique[len(s)-x-1] = right_unique[len(s)-x]\n \n min_splits = 0\n for x in range(1,len(s)):\n if left_unique[x-1] == right_unique[x]:\n min_splits+=1\n return min_splits\n", "class Solution:\n def numSplits(self, s: str) -> int:\n fila = {}\n tot = len(set(s))\n\n x = set()\n for i in range(len(s)):\n x.add(s[i])\n if len(x) == tot:\n fa = i\n break\n \n x = set()\n for i in range(len(s)-1, -1, -1):\n x.add(s[i])\n if len(x) == tot:\n la = i\n break\n \n if fa <= la:\n return la - fa\n \n for i, c in enumerate(s):\n if c not in fila:\n fila[c] = [i, i]\n else:\n fila[c][1] = i\n firsts, lasts = set(), set()\n for a, b in fila.values():\n firsts.add(a)\n lasts.add(b)\n ret = 0\n cl, cr = 0, len(fila)\n for i in range(len(s)-1):\n if i in firsts:\n cl += 1\n if i in lasts:\n cr -= 1\n ret += int(cl == cr)\n if cr < cl:\n break\n return ret", "class Solution:\n def numSplits(self, s: str) -> int:\n if len(s)==1:\n return 0\n ln=len(s)\n ans=0\n t1={}\n t2={}\n l1,l2=0,0\n t1[s[0]]=1\n for i in range(1,ln):\n if s[i] in list(t2.keys()):\n t2[s[i]]+=1\n else:\n t2[s[i]]=1\n \n if len(list(t1.keys()))==len(list(t2.keys())):\n ans+=1\n for i in range(1,ln):\n if s[i] in list(t1.keys()):\n t1[s[i]]+=1\n else:\n t1[s[i]]=1\n \n t2[s[i]]-=1\n if t2[s[i]]==0:\n del t2[s[i]]\n \n if len(t1)==len(t2):\n ans+=1\n \n \n \n return ans \n", "class Solution:\n def make_hist(self, array : str) -> dict:\n hist = {}\n for s in array:\n if s not in list(hist.keys()):\n hist[s] = 1\n else:\n hist[s] += 1\n return hist\n \n def numSplits(self, s: str) -> int:\n hist_left = self.make_hist(s[:1])\n hist_right = self.make_hist(s[1:])\n count = 0\n for i in range(1, len(s)):\n v = s[i]\n if len(list(hist_left.keys())) == len(list(hist_right.keys())):\n count += 1\n if v not in list(hist_left.keys()):\n hist_left[v] = 1\n else:\n hist_left[v] += 1\n \n if v in list(hist_right.keys()):\n if hist_right[v] == 1:\n del hist_right[v]\n else:\n hist_right[v] -= 1\n return count\n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n left_map = {}\n right_map = {}\n unique_right = 0\n unique_left = 0\n for i in range(len(s)):\n if s[i] not in right_map:\n right_map[s[i]] = 1\n unique_right += 1\n else:\n right_map[s[i]] += 1\n good_split = 0\n for i in range(len(s)):\n # add to left map\n if s[i] not in left_map:\n left_map[s[i]] = 1\n unique_left += 1\n else:\n left_map[s[i]] += 1\n\n # remove from right map\n if right_map[s[i]] == 1:\n unique_right -= 1\n right_map[s[i]] -= 1\n if unique_left == unique_right:\n good_split += 1\n return good_split", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n rightS = Counter(s)\n leftS = Counter()\n count = 0\n for c in s:\n leftS[c]+=1\n rightS[c]-=1\n if rightS[c]==0:\n del rightS[c]\n count += (len(leftS.keys()) ==len(rightS.keys()))\n \n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n # set up splitting at idx 1\n p_dict = {s[0]: 1}\n q_dict = {}\n \n for char in s[1:]:\n self.addToDict( q_dict, char )\n \n if ( len(p_dict.keys()) == len(q_dict.keys()) ) :\n count = 1\n else:\n count = 0\n \n for i in range(1, len(s) - 1):\n # find the char here\n char = s[i]\n # remove from q, add to p\n self.removeFromDict( q_dict, char)\n self.addToDict( p_dict, char )\n\n if ( len(p_dict.keys()) == len(q_dict.keys()) ):\n count += 1\n \n return count\n \n def addToDict( self, my_dict, value ):\n if (my_dict.get(value) is None):\n my_dict[value] = 1\n else:\n my_dict[value] += 1\n \n def removeFromDict( self, my_dict, value ):\n if (my_dict.get(value) == 1):\n my_dict.pop(value)\n elif (my_dict.get(value) > 1):\n my_dict[value] -= 1", "class Solution:\n def numSplits(self, s: str) -> int:\n cur, h = Counter(), Counter(s)\n cnt = 0\n for c in s:\n h[c] -= 1\n cur[c] += 1\n if h[c] == 0: del h[c]\n cnt += len(h) == len(cur) \n return cnt", "class Solution:\n def numSplits(self, s: str) -> int:\n if not s or len(s) < 0:\n return 0\n right = {}\n left = {s[0]: 1}\n count = 0\n if len(left) == len(right):\n count+= 1\n for i in range(1, len(s)):\n if s[i] in right:\n right[s[i]] += 1\n else:\n right[s[i]] = 1\n if len(left) == len(right):\n count+= 1\n \n for i in range(1, len(s)):\n right[s[i]] -= 1\n if right[s[i]] == 0:\n del right[s[i]]\n if s[i] in left:\n left[s[i]] += 1\n else:\n left[s[i]] = 1\n \n if len(left) == len(right):\n count+= 1\n \n return count", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n l, r = {}, Counter(s)\n ans = 0\n for i in range(len(s)-1):\n # Add s[i] to l\n if s[i] in l:\n l[s[i]] += 1\n else:\n l[s[i]] = 1\n # Remove s[i] from r\n if s[i] in r:\n r[s[i]] -= 1\n if r[s[i]] == 0:\n del r[s[i]]\n if len(l) == len(r):\n #print(i, l, r)\n ans += 1\n return ans\n", "class Solution:\n def numSplits(self, s: str) -> int:\n c=Counter(s)\n d=dict()\n r=0\n for i in s:\n d[i]=1\n if(i in c):\n c[i]-=1\n if(c[i]==0):\n del c[i]\n if(len(c)==len(d)):\n r+=1\n return r\n \n \n \n", "class Solution:\n def numSplits(self, s: str) -> int:\n p, q, ans = Counter(), Counter(s), 0\n for c in s[:-1]:\n p[c] += 1\n q[c] -= 1\n if not q[c]:\n del q[c]\n ans += len(p) == len(q)\n return ans\n", "class Solution:\n def numSplits(self, s: str) -> int:\n left_count = Counter()\n right_count = Counter(s)\n res = 0\n\n for c in s:\n left_count[c] += 1\n right_count[c] -= 1\n\n if right_count[c] == 0:\n del right_count[c]\n\n if len(left_count) == len(right_count):\n res += 1\n\n return res\n", "class Solution:\n def numSplits(self, s: str) -> int:\n result1 = [[s[0]]]\n result2 = [[s[-1]]]\n n = len(s)\n for i in range(1,len(s)):\n list1 = list(result1[i-1])\n list2 = list(result2[i-1])\n # print(list1, list2)\n if s[i] not in list1:\n list1.append(s[i])\n if s[n-1-i] not in list2:\n list2.append(s[n-1-i])\n result1.append(list1)\n result2.append(list2)\n result = 0\n result2.reverse()\n # print(result1)\n # print(result2)\n for i in range(len(s)-1):\n if len(result1[i]) == len(result2[i+1]):\n result += 1\n return result", "from collections import Counter\nclass Solution:\n def numSplits(self, s: str) -> int:\n p, q, ans = Counter(), Counter(s), 0\n for c in s[:-1]:\n p[c] += 1\n q[c] -= 1\n if not q[c]:\n del q[c]\n ans += len(p) == len(q)\n return ans", "class Solution:\n def numSplits(self, s: str) -> int:\n # stores \n unique_chars = {}\n for i, char in enumerate(s):\n if char in unique_chars:\n first, last = unique_chars[char]\n unique_chars[char] = (first, i)\n else:\n unique_chars[char] = (i, i)\n n_unique_chars = len(list(unique_chars.keys()))\n events = []\n for start, end in list(unique_chars.values()):\n events.append((start, 1))\n events.append((end, -1))\n events.sort(key=lambda x: x[0])\n \n left_num = 0\n right_num = n_unique_chars\n total = 0\n start_good = None\n #print(events)\n for i, event_type in events:\n #print(i, event_type, left_num, right_num)\n if start_good is not None:\n return i - start_good\n if event_type == 1:\n left_num += 1\n else:\n right_num -= 1\n if left_num == right_num:\n start_good = i\n \n \n \n", "from collections import Counter\nclass Solution:\n def numSplits(self, s):\n res = 0\n left = {}\n right = Counter(s)\n \n for i in range(len(s)):\n left[s[i]] = left.get(s[i], 0) + 1\n right[s[i]] -= 1\n \n if right[s[i]] == 0:\n del right[s[i]]\n \n if len(left) == len(right):\n res += 1\n return res", "class Solution:\n def numSplits(self, s: str) -> int:\n if len(s) == 1:\n return 0\n \n lmap = collections.Counter(s[0:1])\n rmap = collections.Counter(s[1:])\n ans = 0\n for i in range(1,len(s)):\n if len(lmap) == len(rmap):\n ans += 1\n lmap.update([s[i]])\n rmap[s[i]] -= 1\n if not rmap[s[i]] :\n del rmap[s[i]]\n \n return ans", "class Solution:\n def numSplits(self, s: str) -> int:\n res = 0\n \n # construct dict from 1 to last\n # iterate from 1 and remove the elm from dict (if 0 then del elm from dict) and add it to the set \n # check if leng are equal\n fs = set()\n \n d={}\n for x in s:\n if x not in d:\n d[x]=1\n else:\n d[x]+=1\n \n i = 0\n while i<len(s):\n fs.add(s[i])\n \n if d[s[i]]>1:\n d[s[i]]-=1\n else:\n del d[s[i]]\n \n if len(fs)==len(set(d.keys())):\n res+=1\n \n i+=1\n return res\n", "class Solution:\n def numSplits(self, string: str) -> int:\n def isValid(string, i):\n return 0 <= i < len(string)\n\n def getLength(string, unique, i):\n if isValid(string, i):\n unique.add(string[i])\n return len(unique)\n return len(unique)\n\n left, right = [0] * len(string), [0] * len(string)\n left_unique, right_unique = set(), set()\n reversed_string = string[::-1]\n\n for i in range(len(left)):\n left[i] = getLength(string, left_unique, i)\n right[len(right)-1-i] = getLength(reversed_string, right_unique, i)\n\n good_splits = 0\n for i in range(len(left)-1):\n if right[i+1] == left[i]:\n good_splits += 1\n return good_splits\n\n", "class Solution:\n def numSplits(self, s: str) -> int:\n if len(s) == 0:\n return 0\n count = 0\n counterLeft = collections.Counter()\n counterRight = collections.Counter(s)\n for element in s:\n counterLeft[element] += 1\n counterRight[element] -= 1\n if counterRight[element] == 0:\n counterRight.pop(element)\n if len(counterLeft) == len(counterRight):\n count += 1\n return count", "class Solution:\n def numSplits(self, s: str) -> int:\n if not s:\n return 0\n l_unique = set([])\n r_unique = set(s)\n good_splits = 0\n for i, x in enumerate(s):\n l_unique.add(x)\n if x not in s[i+1:]:\n r_unique.discard(x)\n if len(l_unique) == len(r_unique):\n good_splits += 1\n return good_splits", "class Solution:\n def numSplits(self, s: str) -> int:\n result1 = [[s[0]]]\n result2 = [[s[-1]]]\n n = len(s)\n for i in range(1,len(s)):\n list1 = list(result1[i-1])\n list2 = list(result2[i-1])\n # print(list1, list2)\n if s[i] not in list1:\n list1.append(s[i])\n if s[n-1-i] not in list2:\n list2.append(s[n-1-i])\n result1.append(list1)\n result2.append(list2)\n result = 0\n # result2.reverse()\n # print(result1)\n # print(result2)\n for i in range(len(s)-1):\n if len(result1[i]) == len(result2[n-1-(i+1)]):\n result += 1\n return result"]
{"fn_name": "numSplits", "inputs": [["\"aacaba\""]], "outputs": [2]}
interview
https://leetcode.com/problems/number-of-good-ways-to-split-a-string/
class Solution: def numSplits(self, s: str) -> int:
[ 2610, 525, 2661, 264, 914, 274, 11, 264, 4102, 6960, 374, 2598, 1661, 4102, 333, 498, 646, 6718, 4102, 82, 1119, 220, 17, 4102, 6280, 39433, 9069, 281, 323, 2804, 1380, 1181, 39972, 367, 374, 6144, 311, 274, 323, 279, 1372, 315, 124...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,982
You are the "computer expert" of a local Athletic Association (C.A.A.). Many teams of runners come to compete. Each time you get a string of all race results of every team who has run. For example here is a string showing the individual results of a team of 5 runners: ` "01|15|59, 1|47|6, 01|17|20, 1|32|34, 2|3|17" ` Each part of the string is of the form: ` h|m|s ` where h, m, s (h for hour, m for minutes, s for seconds) are positive or null integer (represented as strings) with one or two digits. There are no traps in this format. To compare the results of the teams you are asked for giving three statistics; **range, average and median**. `Range` : difference between the lowest and highest values. In {4, 6, 9, 3, 7} the lowest value is 3, and the highest is 9, so the range is 9 − 3 = 6. `Mean or Average` : To calculate mean, add together all of the numbers in a set and then divide the sum by the total count of numbers. `Median` : In statistics, the median is the number separating the higher half of a data sample from the lower half. The median of a finite list of numbers can be found by arranging all the observations from lowest value to highest value and picking the middle one (e.g., the median of {3, 3, 5, 9, 11} is 5) when there is an odd number of observations. If there is an even number of observations, then there is no single middle value; the median is then defined to be the mean of the two middle values (the median of {3, 5, 6, 9} is (5 + 6) / 2 = 5.5). Your task is to return a string giving these 3 values. For the example given above, the string result will be `"Range: 00|47|18 Average: 01|35|15 Median: 01|32|34"` of the form: `"Range: hh|mm|ss Average: hh|mm|ss Median: hh|mm|ss"` where hh, mm, ss are integers (represented by strings) with *each 2 digits*. *Remarks*: 1. if a result in seconds is ab.xy... it will be given **truncated** as ab. 2. if the given string is "" you will return ""
["def stat(strg):\n\n def get_time(s):\n '''Returns the time, in seconds, represented by s.'''\n hh, mm, ss = [int(v) for v in s.split('|')]\n return hh * 3600 + mm * 60 + ss\n \n def format_time(time):\n '''Returns the given time as a string in the form \"hh|mm|ss\".'''\n hh = time // 3600\n mm = time // 60 % 60\n ss = time % 60\n return '{hh:02d}|{mm:02d}|{ss:02d}'.format(**locals())\n \n def get_range(times):\n return times[-1] - times[0]\n \n def get_average(times):\n return sum(times) // len(times)\n \n def get_median(times):\n middle = len(times) >> 1\n return (times[middle] if len(times) & 1 else\n (times[middle - 1] + times[middle]) // 2)\n \n if strg == '':\n return strg\n times = [get_time(s) for s in strg.split(', ')]\n times.sort()\n rng = format_time(get_range(times))\n avg = format_time(get_average(times))\n mdn = format_time(get_median(times))\n return 'Range: {rng} Average: {avg} Median: {mdn}'.format(**locals())", "from statistics import median, mean\n\ndef stat(s):\n if not s: return ''\n\n t = [itime(w) for w in s.split(',')]\n return 'Range: {} Average: {} Median: {}'.format(stime(max(t) - min(t)), stime(int(mean(t))), stime(int(median(t))))\n\ndef itime(w):\n return sum([int(c) * 60**i for i, c in enumerate(w.split('|')[::-1])])\n \ndef stime(n):\n return '{:02d}|{:02d}|{:02d}'.format(n // 3600, (n % 3600) // 60, n % 60)", "import numpy as np\nimport time\ndef stat(strg):\n '''\n Each part of the string is of the form: h|m|s\n Input: 01|15|59, 1|47|6, 01|17|20, 1|32|34, 2|3|17\n Output: Range: 00|47|18 Average: 01|35|15 Median: 01|32|34\n '''\n if strg == '':\n return ''\n racetimes = strg.split(',')\n secondtimes = []\n for t in racetimes:\n h, m, s = t.split('|')\n seconds = int(h) * 3600 + int(m) * 60 + int(s)\n secondtimes.append(seconds)\n\n avgs = np.mean(secondtimes)\n ranges = max(secondtimes) - min(secondtimes)\n medians = np.median(secondtimes)\n\n avg = time.strftime('%H|%M|%S',time.gmtime(avgs))\n ra = time.strftime('%H|%M|%S',time.gmtime(ranges))\n med = time.strftime('%H|%M|%S',time.gmtime(medians))\n\n\n return 'Range: {} Average: {} Median: {}'.format(ra,avg,med)\n", "from statistics import mean, median\n\ndef convert_ToInt(s):\n v = s.split('|')\n return sum(int(v[i]) * 60**(2-i) for i in range(3))\n\ndef convert_ToStr(n):\n return \"{:0>2}|{:0>2}|{:0>2}\".format(*map(int, (n//3600, n%3600 // 60, n%60)))\n\ndef stat(strg):\n if not strg: return \"\"\n \n data = list(map(convert_ToInt, strg.split(', ')))\n return \"Range: {} Average: {} Median: {}\".format(*map(convert_ToStr, [max(data)-min(data), mean(data), median(data)]))", "from statistics import mean, median\n\ndef sec2time(s):\n return \"%02d|%02d|%02d\" % ((s//3600) % 60, (s//60) % 60, s % 60)\n\ndef stat(strg):\n if not strg: return \"\"\n data = sorted([sum(int(val) * (60**(2-i)) for i, val in enumerate(t.split(\"|\"))) for t in strg.split(\", \")])\n return \"Range: %s Average: %s Median: %s\" % (sec2time(data[-1] - data[0]), sec2time(int(mean(data))), sec2time(median(data)))", "from datetime import timedelta as d\nfrom statistics import mean, median\ndef stat(s):\n if not s:return ''\n li = [sum(int(j) * k for j, k in zip(i.split(\"|\"), [3600, 60, 1])) for i in s.split(\", \")]\n A = lambda x: \"|\".join([i.zfill(2) for i in x.split(\":\")])[:8]\n return f\"Range: {A(str(d(seconds=max(li) - min(li))))} Average: {A(str(d(seconds=mean(li))))} Median: {A(str(d(seconds=median(li))))}\"", "import re\nimport statistics as st\nP = re.compile('(\\d+)\\|(\\d+)\\|(\\d+)')\ndef s_to_h(time):\n h, r = divmod(time, 3600)\n m, s = divmod(r, 60)\n return f'{str(int(h)).zfill(2)}|{str(int(m)).zfill(2)}|{str(int(s)).zfill(2)}'\n\ndef stat(strg):\n t = P.findall(strg)\n if not strg:\n return ''\n s = [int(h)*60*60+int(m)*60+int(sec) for h,m,sec in t]\n range, mean, median = max(s)-min(s), st.mean(s), st.median(s)\n return f'Range: {s_to_h(range)} Average: {s_to_h(mean)} Median: {s_to_h(median)}' ", "import statistics\n\ndef count_sec(l):\n return l[0]*3600+l[1]*60+l[2]\n\ndef t(s):\n min,sec = divmod(s,60)\n hour,min = divmod(min,60)\n return \"|\".join([str(int(i)).zfill(2) for i in (hour,min,sec)])\n \ndef stat(strg):\n if strg == \"\": return \"\"\n secs = [count_sec([int(f) for f in i.split(\"|\")]) for i in strg.split(\",\")]\n\n h_range = t(max(secs) - min(secs))\n avg = t(statistics.mean(secs)) \n med = t(statistics.median(secs))\n return f\"Range: {h_range} Average: {avg} Median: {med}\""]
{"fn_name": "stat", "inputs": [["01|15|59, 1|47|16, 01|17|20, 1|32|34, 2|17|17"], ["02|15|59, 2|47|16, 02|17|20, 2|32|34, 2|17|17, 2|22|00, 2|31|41"], ["02|15|59, 2|47|16, 02|17|20, 2|32|34, 2|32|34, 2|17|17"], ["0|15|59, 0|16|16, 0|17|20, 0|22|34, 0|19|34, 0|15|0"], ["11|15|59, 10|16|16, 12|17|20, 9|22|34, 13|19|34, 11|15|17, 11|22|00, 10|26|37, 12|17|48, 9|16|30, 12|20|14, 11|25|11"], ["1|15|59, 1|16|16, 1|17|20, 1|22|34, 1|19|34, 1|15|17, 1|22|00, 1|26|37, 1|17|48, 1|16|30, 1|20|14, 1|25|11"]], "outputs": [["Range: 01|01|18 Average: 01|38|05 Median: 01|32|34"], ["Range: 00|31|17 Average: 02|26|18 Median: 02|22|00"], ["Range: 00|31|17 Average: 02|27|10 Median: 02|24|57"], ["Range: 00|07|34 Average: 00|17|47 Median: 00|16|48"], ["Range: 04|03|04 Average: 11|14|36 Median: 11|18|59"], ["Range: 00|11|20 Average: 01|19|36 Median: 01|18|41"]]}
introductory
https://www.codewars.com/kata/55b3425df71c1201a800009c
def stat(strg):
[ 2610, 525, 279, 330, 43111, 6203, 1, 315, 264, 2205, 50406, 10024, 320, 34, 875, 875, 13, 4292, 8441, 7263, 315, 38280, 2525, 311, 20259, 13, 8886, 882, 498, 633, 264, 914, 315, 715, 541, 6957, 3059, 315, 1449, 2083, 879, 702, 1598,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,473
Given a string s containing only lower case English letters and the '?' character, convert all the '?' characters into lower case letters such that the final string does not contain any consecutive repeating characters. You cannot modify the non '?' characters. It is guaranteed that there are no consecutive repeating characters in the given string except for '?'. Return the final string after all the conversions (possibly zero) have been made. If there is more than one solution, return any of them. It can be shown that an answer is always possible with the given constraints.   Example 1: Input: s = "?zs" Output: "azs" Explanation: There are 25 solutions for this problem. From "azs" to "yzs", all are valid. Only "z" is an invalid modification as the string will consist of consecutive repeating characters in "zzs". Example 2: Input: s = "ubv?w" Output: "ubvaw" Explanation: There are 24 solutions for this problem. Only "v" and "w" are invalid modifications as the strings will consist of consecutive repeating characters in "ubvvw" and "ubvww". Example 3: Input: s = "j?qg??b" Output: "jaqgacb" Example 4: Input: s = "??yw?ipkj?" Output: "acywaipkja"   Constraints: 1 <= s.length <= 100 s contains only lower case English letters and '?'.
["class Solution:\n def modifyString(self, s: str) -> str:\n if len(s) == 0:\n return s\n string = ['#']\n string.extend(list(s))\n string.append('#')\n for i in range(1,len(string)-1):\n if string[i] == '?':\n for j in range(97,123):\n if string[i-1] != chr(j) and string[i+1] != chr(j):\n string[i] = chr(j)\n break\n \n ret = ''.join(string[1:-1])\n return ret\n", "class Solution:\n # def modifyString(self, s: str) -> str:\n # if s == \\\"?\\\":\n # return \\\"a\\\"\n # for i in range(len(s)):\n # if s[i] == '?':\n # if i == 0:\n # print(\\\"right\\\")\n # for j in range(97,123):\n # if chr(j) != s[1]:\n # print(\\\"right\\\")\n # s = s.replace('?', chr(j), 1)\n # print(s)\n # break\n # elif i == len(s)-1:\n # for j in range(97,123):\n # if chr(j) != s[i-1]:\n # s = s.replace('?', chr(j), 1)\n # break\n # else:\n # for j in range(97,123):\n # if chr(j) != s[i-1] and chr(j) != s[i+1]:\n # s = s.replace('?', chr(j), 1)\n # break\n # return s\n def modifyString(self, s: str) -> str:\n letters = ['a', 'b', 'c']\n for i in range(len(s)):\n if s[i] == '?':\n for l in letters:\n if (i == 0 or s[i-1] != l) and (i == len(s) - 1 or s[i+1] != l):\n s = s.replace('?', l, 1)\n break\n \n return s\n \n \n", "class Solution:\n def modifyString(self, s: str) -> str:\n r = ''\n \n if s[0] == '?':\n r += 'b' if (len(s) > 1 and s[1] == 'a') else 'a'\n else:\n r += s[0]\n \n for i in range(1, len(s) - 1):\n if s[i] == '?':\n if r[i - 1] != 'a' and s[i + 1] != 'a':\n r += 'a'\n elif r[i - 1] != 'b' and s[i + 1] != 'b':\n r += 'b'\n else:\n r += 'c'\n else:\n r += s[i]\n \n if len(s) > 1:\n if s[len(s) - 1] == '?':\n r += 'b' if r[len(s) - 2] == 'a' else 'a'\n else:\n r += s[len(s) - 1]\n \n return r\n \n", "class Solution:\n def modifyString(self, s: str) -> str:\n chars=list(map(chr, list(range(97, 123))))\n s=list(s)\n for i in range(0,len(s)):\n for x in chars:\n if(s[i]=='?'):\n if(i==len(s)-1):\n if(s[i-1]!=x):\n s[i]=x\n elif(s[i-1]!=x and s[i+1]!=x):\n s[i]=x\n return ''.join(s)\n"]
{"fn_name": "modifyString", "inputs": [["\"?zs\""]], "outputs": ["\"azs\""]}
introductory
https://leetcode.com/problems/replace-all-s-to-avoid-consecutive-repeating-characters/
class Solution: def modifyString(self, s: str) -> str:
[ 22043, 264, 914, 4102, 82, 4102, 772, 2056, 1172, 4722, 1142, 6364, 11931, 4102, 437, 279, 73516, 4102, 19190, 11, 5508, 678, 279, 73516, 5766, 1119, 4722, 1142, 11931, 1741, 429, 279, 1590, 914, 1558, 537, 6644, 894, 23921, 39816, 4102...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,104
Santa puts all the presents into the huge sack. In order to let his reindeers rest a bit, he only takes as many reindeers with him as he is required to do. The others may take a nap. Two reindeers are always required for the sleigh and Santa himself. Additionally he needs 1 reindeer per 30 presents. As you know, Santa has 8 reindeers in total, so he can deliver up to 180 presents at once (2 reindeers for Santa and the sleigh + 6 reindeers with 30 presents each). Complete the function `reindeers()`, which takes a number of presents and returns the minimum numbers of required reindeers. If the number of presents is too high, throw an error. Examles: ```python reindeer(0) # must return 2 reindeer(1) # must return 3 reindeer(30) # must return 3 reindeer(200) # must throw an error ```
["from math import ceil\ndef reindeer(presents):\n if presents > 180: raise ValueError(\"Too many presents\")\n return ceil(presents / 30.0) + 2", "def reindeer(presents):\n assert presents <= 180\n return 2+presents//30+(1 if presents % 30 else 0)", "from math import ceil\ndef reindeer(presents):\n assert presents < 181\n return ceil(presents/30.0) + 2", "def reindeer(presents):\n assert presents <= 180\n return 2 + (presents + 29) // 30", "from math import ceil\n\ndef reindeer(presents):\n if presents > 180:\n raise ValueError\n else:\n return 2 + ceil(presents/30.0)", "from math import ceil\n\n# Why is this 6 kyu?\ndef reindeer(presents):\n if presents > 180: raise Exception(\"Too many presents\")\n return 2 + ceil(presents/30)", "from math import ceil\n\n\ndef reindeer(presents):\n assert 0 <= presents <= 180\n return int(2 + (ceil(presents / 30.0)))\n", "def reindeer(presents):\n if presents > 180: raise Exception(\"Error\")\n return 2 + int((presents+29)/30)", "import math\n\ndef reindeer(presents):\n \n p = math.ceil(presents/30)\n \n if p>6:\n \n raise ValueError(\"Error\")\n \n else:\n \n return p+2\n"]
{"fn_name": "reindeer", "inputs": [[0], [1], [5], [30], [31], [60], [61], [90], [91], [120], [121], [150], [151], [180]], "outputs": [[2], [3], [3], [3], [4], [4], [5], [5], [6], [6], [7], [7], [8], [8]]}
introductory
https://www.codewars.com/kata/52ad1db4b2651f744d000394
def reindeer(presents):
[ 63148, 9521, 678, 279, 18404, 1119, 279, 6765, 52333, 13, 758, 1973, 311, 1077, 806, 15244, 450, 388, 2732, 264, 2699, 11, 566, 1172, 4990, 438, 1657, 15244, 450, 388, 448, 1435, 438, 566, 374, 2567, 311, 653, 13, 576, 3800, 1231, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,356
# Kata Task Given a list of random integers, return the Three Amigos. These are 3 numbers that live next to each other in the list, and who have the **most** in common with each other by these rules: * lowest statistical range * same parity # Notes * The list will contain at least 3 numbers * If there is more than one answer then return the first one found (reading the list left to right) * If there is no answer (e.g. no 3 adjacent numbers with same parity) then return an empty list. # Examples * ex1 * Input = ```[1, 2, 34, 2, 1, 5, 3, 5, 7, 234, 2, 1]``` * Result = ```[5,3,5]``` * ex2 * Input = ```[2, 4, 6, 8, 10, 2, 2, 2, 1, 1, 1, 5, 3]``` * Result = ```[2,2,2]``` * ex3 * Input = ```[2, 4, 5, 3, 6, 3, 1, 56, 7, 6, 3, 12]``` * Result = ```[]```
["def three_amigos(numbers):\n return min(\n ([a, b, c] for a, b, c in zip(numbers, numbers[1:], numbers[2:]) if a & 1 == b & 1 == c & 1), \n key=lambda triple: max(triple) - min(triple),\n default=[])", "three_amigos = lambda a: (sorted(((max(a[i:i+3])-min(a[i:i+3]), a[i:i+3]) for i in range(len(a)-2) if a[i]%2==a[i+1]%2==a[i+2]%2), key=lambda x: x[0])+[(None, [])])[0][1]\n", "from collections import defaultdict\n\n\ndef three_amigos(numbers):\n candidates = defaultdict(list)\n for i in range(len(numbers) - 2):\n triplet = numbers[i:i+3]\n if len({n % 2 for n in triplet}) == 1:\n candidates[max(triplet) - min(triplet)].append(triplet)\n return candidates[min(candidates)][0] if candidates else []\n", "from collections import defaultdict\n\ndef three_amigos(numbers):\n amigos = defaultdict(list)\n \n for i in range(len(numbers)-3 +1):\n a, b, c = numbers[i:i+3]\n \n if a%2 == b%2 == c%2:\n rnge = max(a, b, c) - min(a, b, c)\n amigos[rnge].append([a, b, c])\n \n return amigos[min(amigos.keys())][0] if amigos else []", "import sys\ndef three_amigos(numbers):\n\n p1 = 0\n min_range = sys.maxsize\n output = None\n \n for idx in range(3, len(numbers)+1):\n slice = numbers[p1:idx]\n p1 += 1\n if sameParity(slice):\n minmax = max(slice) - min(slice)\n if minmax < min_range:\n min_range = minmax\n output = slice\n \n return output if output else []\n \n \n \n \ndef sameParity(arr):\n even = True if arr[0] % 2 == 0 else False\n \n for idx in range(1, len(arr)):\n if even and arr[idx] % 2 != 0:\n return False\n if not even and arr[idx] % 2 == 0:\n return False\n \n return True", "def three_amigos(a):\n li = []\n for i in range(len(a) - 2):\n s = a[i] & 1\n t = a[i:i + 3]\n if all(j & 1 == s for j in t): \n m = max(t)\n m_ = min(t)\n li.append([m - m_, t])\n return min(li,key=lambda x:x[0],default=[[],[]])[1]", "def three_amigos(numbers):\n it = (xs for xs in zip(numbers, numbers[1:], numbers[2:]) if len({x % 2 for x in xs}) == 1)\n return list(min(it, key=lambda xs: max(xs)-min(xs), default=()))", "def three_amigos(numbers):\n return list(min((a for a in zip(numbers, numbers[1:], numbers[2:]) if sum(b % 2 for b in a) in [0, 3]), key = lambda x : max(x) - min(x), default = []))", "three_amigos=lambda l:min(([a,b,c]for a,b,c in zip(l,l[1:],l[2:])if a%2==b%2==c%2),key=lambda t:max(t)-min(t),default=[])", "three_amigos=lambda a:min([[max(a[i:i+3])-min(a[i:i+3]),a[i:i+3]]for i in range(len(a)-2)if all(j&1==a[i]&1for j in a[i:i+3])],key=lambda x:x[0],default=[[],[]])[1]"]
{"fn_name": "three_amigos", "inputs": [[[1, 2, 34, 2, 1, 5, 3, 5, 7, 234, 2, 1]], [[2, 4, 6, 8, 10, 2, 2, 2, 1, 1, 1, 5, 3]], [[2, 4, 5, 3, 6, 3, 1, 56, 7, 6, 3, 12]], [[1, 3, 5]], [[1, 3, 2]], [[1, 3, 5, 7, 9, 11, 13, 15]], [[1, 2, 3, 4, 5, 6, 7, 8, 9, 1, 3, 5]], [[-5, -4, -2, 0, 1, 2, 3, 4, 5]], [[-8, -25, 21, -7, -5]], [[8, 5, 20, 17, -18, -11, 19, 5]], [[6, 9, -18, -19, -14, -10, -24]], [[0, -1, -1, 1, -1, -1, -3]], [[-8, -2, 0, 2, 4, 6, 8]]], "outputs": [[[5, 3, 5]], [[2, 2, 2]], [[]], [[1, 3, 5]], [[]], [[1, 3, 5]], [[1, 3, 5]], [[-4, -2, 0]], [[21, -7, -5]], [[-11, 19, 5]], [[-14, -10, -24]], [[-1, -1, 1]], [[-2, 0, 2]]]}
introductory
https://www.codewars.com/kata/59922d2ab14298db2b00003a
def three_amigos(numbers):
[ 2, 98838, 5430, 271, 22043, 264, 1140, 315, 4194, 25780, 11, 470, 279, 14513, 3303, 32239, 382, 9485, 525, 220, 18, 5109, 429, 3887, 1790, 311, 1817, 1008, 304, 279, 1140, 11, 323, 879, 614, 279, 3070, 3562, 334, 304, 4185, 448, 181...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,976
Implement a magic directory with buildDict, and search methods. For the method buildDict, you'll be given a list of non-repetitive words to build a dictionary. For the method search, you'll be given a word, and judge whether if you modify exactly one character into another character in this word, the modified word is in the dictionary you just built. Example 1: Input: buildDict(["hello", "leetcode"]), Output: Null Input: search("hello"), Output: False Input: search("hhllo"), Output: True Input: search("hell"), Output: False Input: search("leetcoded"), Output: False Note: You may assume that all the inputs are consist of lowercase letters a-z. For contest purpose, the test data is rather small by now. You could think about highly efficient algorithm after the contest. Please remember to RESET your class variables declared in class MagicDictionary, as static/class variables are persisted across multiple test cases. Please see here for more details.
["class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.l = []\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n self.l= dict\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n def diffnumber(a,b):\n count = 0\n for i in range(len(a)):\n if a[i] !=b[i]:\n count +=1\n return count\n for x in self.l:\n if len(x) == len(word) and diffnumber(x,word) ==1:\n return True\n return False\n \n \n \n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.dict1 = {}\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for i in dict:\n self.dict1[len(i)] = self.dict1.get(len(i),[]) + [i]\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n for i in self.dict1.get(len(word),[]):\n count = 0\n for j in range(len(word)):\n if i[j] != word[j]:\n count += 1\n if count == 1:\n return True\n return False\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n # use a hash to store len(word) => list of workds\n # then in search only need to search those that are the same length\n self.hsh = collections.defaultdict(list)\n \n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in dict:\n self.hsh[len(word)].append(word)\n \n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n return any(sum(x != y for x, y in zip(word, candidate)) == 1 for candidate in self.hsh[len(word)])\n \n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.tier=[None]*27\n \n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in dict:\n p=self.tier\n for c in word:\n t=ord(c)-ord('a')\n if not p[t]:\n p[t]=[None]*27\n p=p[t]\n p[26]=1\n \n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n def func(w):\n p=self.tier\n for c in w:\n t=ord(c)-ord('a')\n if not p[t]:\n return False\n p=p[t]\n return p[26]==1\n pool='abcdefghijklmnopqrstuvwxyz'\n for i in range(len(word)):\n for cc in pool:\n if cc!=word[i]:\n tt=word[:i]+'%c'%cc+word[i+1:]\n if func(tt):\n return True\n return False\n \n \n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n \n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n self.l = dict\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n n = len(word)\n for wo in self.l:\n if len(wo)==n and wo!=word:\n for i in range(n):\n if wo[:i]+wo[i+1:]==word[:i]+word[i+1:]:\n return True\n return False\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "from collections import defaultdict\n \n class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.magic_dict = defaultdict(list)\n \n def buildDict(self, words):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in words:\n for i in range(len(word)):\n self.magic_dict[word[:i] + '*' + word[i+1:]].append(word[i])\n \n def search(self, word):\n for i, char in enumerate(word):\n candidates = self.magic_dict[word[:i] + '*' + word[i+1:]]\n for origin in candidates:\n if origin != char:\n return True\n return False\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.word_set = {}\n self.word_origin = set([])\n def candidate(self,word):\n result = []\n for i in range(len(word)):\n result.append(word[0:i]+'*'+word[i+1:])\n return result\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n self.word_set = {}\n self.word_origin = set(dict)\n for item in dict:\n for cand in self.candidate(item):\n self.word_set[cand] = self.word_set.get(cand,0)+1\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n for cand in self.candidate(word):\n if (self.word_set.get(cand,0) > 1 or (self.word_set.get(cand,0)==1 and word not in self.word_origin)):\n return True\n return False\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.trie_root = dict()\n self.original_words = None\n \n \n def buildDict(self, dictionary):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n \n def add_word(trie_root, word):\n p = trie_root\n \n for character in word:\n if character not in p:\n p[character] = dict()\n p = p[character]\n \n p['\\0'] = True\n \n \n #for word in dictionary:\n # add_word(self.trie_root, word)\n self.original_words = set(dictionary)\n \n \n \n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n \n \"\"\"\n active_tries = list()\n active_tries.append(self.trie_root)\n is_tolerable = True\n \n for character in word:\n next_active_tries = list()\n for trie in active_tries:\n if character in trie:\n next_active_tries.append(trie[character])\n if character not in trie:\n if is_tolerable:\n is_tolerable = False\n for c, next_trie in trie.items():\n if c != '\\0':\n next_active_tries.append(next_trie)\n active_tries = next_active_tries\n if not active_tries:\n break\n \n return any('\\0' in trie for trie in active_tries) and not is_tolerable\n \"\"\"\n \n charset = \"abcdefghijklmnopqrstuvwxyz\"\n \n for index, character in enumerate(word):\n for replaced_character in charset:\n if character != replaced_character:\n if word[:index] + replaced_character + word[index + 1:] in self.original_words:\n return True\n \n return False\n \n \n \n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.d = None\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n d=set()\n for word in dict:\n d.add(word)\n self.d = d\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n if not word:\n return\n \n def editDistDP(s1, s2):\n m, n = len(s1), len(s2)\n dp = [[0 for x in range(n+1)] for x in range(m+1)]\n for i in range(m+1):\n for j in range(n+1):\n if i == 0:\n dp[i][j] = j # Min. operations = j\n elif j == 0:\n dp[i][j] = i # Min. operations = i\n # If last characters are same, ignore last char\n # and recur for remaining string\n elif s1[i-1] == s2[j-1]:\n dp[i][j] = dp[i-1][j-1]\n # If last character are different, consider all\n # possibilities and find minimum\n else:\n dp[i][j] = 1 + dp[i-1][j-1]\n return dp[m][n]\n # print(self.d)\n ans = False\n for dic in self.d:\n if len(dic) != len(word):\n continue\n ans = ans or editDistDP(dic, word)==1\n return ans\n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.dict = set()\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in dict:\n self.dict.add(word)\n \n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n letters = string.ascii_lowercase\n for i in range(len(word)):\n for letter in letters:\n if letter != word[i]:\n if word[:i] + letter + word[i+1:] in self.dict:\n return True\n return False\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.magic_dict = set()\n \n def buildDict(self, words):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in words:\n for i in range(len(word)):\n for char in range(26):\n char = chr(ord('a') + char)\n if char != word[i]:\n self.magic_dict.add(word[:i] + char + word[i + 1:])\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n return word in self.magic_dict\n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n", "\"\"\"\n Your MagicDictionary object will be instantiated and called as such:\n obj = MagicDictionary()\n obj.buildDict(dict)\n param_2 = obj.search(word)\n \"\"\"\n \n \n class MagicDictionary:\n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.words = collections.defaultdict(set)\n \n def buildDict(self, words):\n \"\"\"\n Build a dictionary through a list of words\n :type words: List[str]\n :rtype: void\n \"\"\"\n for word in words:\n for i in range(len(word)):\n key = '{0},{1}'.format(word[:i], word[i + 1:])\n \n if key not in self.words:\n self.words[key] = set()\n \n # add char to distinct word if its same\n self.words[key].add(word[i])\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n for i in range(len(word)):\n key = '{0},{1}'.format(word[:i], word[i + 1:])\n \n if key not in self.words:\n continue\n \n words = self.words[key]\n \n # 1. word[i] not in words => means not same word\n # 2. len(words) > 1 => if got same but still can mapping other\n if word[i] not in words or len(words) > 1:\n return True\n \n return False", "class Trie():\n def __init__(self):\n self.mark = list()\n self.children = {}\n \n class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.root = Trie()\n \n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n node = self.root\n for word in dict:\n words = {}\n for i in range(len(word)):\n words[word[:i] + \"_\" + word[i+1:]] = word[i]\n for word in words:\n node = self.root\n for c in word:\n node = node.children.setdefault(c,Trie()) \n node.mark.append(words[word])\n \n \n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n words = dict()\n for i in range(len(word)):\n words[word[:i] + \"_\" + word[i+1:]] = word[i]\n for word in words:\n node = self.root\n for c in word:\n node = node.children.get(c) \n if not node:\n break\n else:\n if node.mark != list() and [words[word]] != node.mark:\n return True\n return False\n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)", "class MagicDictionary:\n \n def __init__(self):\n \"\"\"\n Initialize your data structure here.\n \"\"\"\n self.dict = collections.defaultdict(list)\n \n def buildDict(self, dict):\n \"\"\"\n Build a dictionary through a list of words\n :type dict: List[str]\n :rtype: void\n \"\"\"\n for word in dict:\n self.dict[len(word)].append(word)\n \n def search(self, word):\n \"\"\"\n Returns if there is any word in the trie that equals to the given word after modifying exactly one character\n :type word: str\n :rtype: bool\n \"\"\"\n n = len(word)\n print((word, self.dict[n]))\n for item in self.dict[n]:\n count = 0\n for i in range(n):\n if count > 1: continue\n if item[i] != word[i]: count += 1\n if count == 1:\n return True\n return False\n \n \n \n \n # Your MagicDictionary object will be instantiated and called as such:\n # obj = MagicDictionary()\n # obj.buildDict(dict)\n # param_2 = obj.search(word)\n"]
interview
https://leetcode.com/problems/implement-magic-dictionary/
class MagicDictionary: def __init__(self): """ Initialize your data structure here. """ def buildDict(self, dictionary: List[str]) -> None: def search(self, searchWord: str) -> bool: # Your MagicDictionary object will be instantiated and called as such: # obj = MagicDictionary() # obj.buildDict(dictionary) # param_2 = obj.search(searchWord)
[ 62980, 264, 10963, 6220, 448, 1936, 13448, 11, 323, 2711, 5413, 2012, 2461, 279, 1714, 1936, 13448, 11, 498, 3278, 387, 2661, 264, 1140, 315, 2477, 5504, 6862, 3404, 4244, 311, 1936, 264, 10997, 2012, 2461, 279, 1714, 2711, 11, 498, 3...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,169
### Task: Your job is to take a pair of parametric equations, passed in as strings, and convert them into a single rectangular equation by eliminating the parameter. Both parametric halves will represent linear equations of x as a function of time and y as a function of time respectively. The format of the final equation must be `Ax + By = C` or `Ax - By = C` where A and B must be positive and A, B, and C are integers. The final equation also needs to have the lowest possible whole coefficients. Omit coefficients equal to one. The method is called `para_to_rect` or `EquationsManager.paraToRect` and takes in two strings in the form `x = at +(or -) b` and `y = ct +(or -) d` respectively, where `a` and `c` must be integers, and `b` and `d` must be positive integers. If `a` or `c` is omitted, the coefficient of _t_ is obviously assumed to be 1 (see final case in the example tests). There will NEVER be double signs in the equations inputted (For example: `"x = -12t + -18"` and `"y = -12t - -18"` won't show up.) ### Examples: ```python para_to_rect("x = 12t + 18", "y = 8t + 7") => "2x - 3y = 15" ``` > __CALCULATION:__ x = 12t + 18 y = 8t + 7 2x = 24t + 36 3y = 24t + 21 2x - 3y = (24t + 36) - (24t + 21) 2x - 3y = 15 ```python para_to_rect("x = -12t - 18", "y = 8t + 7") => "2x + 3y = -15" ``` > __CALCULATION:__ x = -12t - 18 y = 8t + 7 2x = -24t - 36 3y = 24t + 21 2x + 3y = (-24t - 36) + (24t + 21) 2x + 3y = -15 ```python para_to_rect("x = -t + 12", "y = 12t - 1") => "12x + y = 143" ``` > __CALCULATION:__ x = -t + 12 y = 12t - 1 12x = -12t + 144 y = 12t - 1 12x + y = 143 More examples in the sample test cases. ### Notes: As you can see above, sometimes you'll need to add the two parametric equations after multiplying by the necessary values; sometimes you'll need to subtract them – just get rid of the _t_!
["from fractions import gcd\nimport re\n\n\nINSERTER = re.compile(r'(?<!\\d)(?=[xyt])')\nFINDER = re.compile(r'-?\\d+')\n\n\ndef lcm(a,b): return a*b//gcd(a,b)\ndef simplify(s): return INSERTER.sub('1', s.replace(' ',''))\n\n\ndef para_to_rect(*equations):\n coefs = [ list(map(int, FINDER.findall(eq))) for eq in map(simplify, equations) ]\n l = lcm(coefs[0][1],coefs[1][1])\n x,tx,cx, y,ty,cy = ( v*l//c[1] for c in coefs for v in c )\n y, absY, c = -y, abs(y), cx-cy\n \n return \"{}x {} {}y = {}\".format(x if x!=1 else '',\n '-' if y<0 else '+',\n absY if absY!=1 else '',\n c)", "from math import gcd\n\ndef para_to_rect(eqn1, eqn2):\n a, b = eqn1.split('= ')[1].split('t ')\n c, d = eqn2.split('= ')[1].split('t ')\n if a in (\"\", \"-\"): a += '1'\n if c in (\"\", \"-\"): c += '1'\n a, b, c, d = map(eval, (a, b, c, d))\n x = gcd(a, c)\n e, f = c//x, -a//x\n if e < 0: e, f = -e, -f\n return f\"{e if e>1 else ''}x {'+-'[f<0]} {abs(f) if abs(f)>1 else ''}y = {e*b + f*d}\"", "import re\nfrom math import gcd\n\ndef para_to_rect(eqn1, eqn2):\n eqn1, eqn2 = [re.sub(r'\\bt', '1t', e) for e in [eqn1, eqn2]]\n (a,b), (c,d) = ([[int(x.replace(' ', '')) for x in re.findall('-?\\d+|[-+] \\d+', e)] for e in [eqn1, eqn2]])\n x = c*b - a*d\n g = gcd(gcd(c, a), x)\n if c < 0:\n g = -g\n c, a, x = c//g, a//g, x//g\n return re.sub(r'\\b1([xy])', r'\\1', f'{c}x {\"+-\"[a > 0]} {abs(a)}y = {x}')", "from fractions import gcd\ndef para_to_rect(*equations):\n changes = [(\" \", \"\"), (\"-t\", \"-1t\"), (\"=t\", \"=+1t\"),\n (\"+t\", \"+1t\"), (\"x=\", \"\"), (\"y=\", \"\")]\n equationsR = []\n for equation in equations:\n for (s1, s2) in changes:\n equation = equation.replace(s1, s2)\n equationsR += equation.split(\"t\")\n a, b, c, d = [int(n) for n in equationsR]\n e, f, g = c, -a, b * c - a * d\n h = gcd(gcd(e, f), g)\n e, f, g = e // h, f // h, g // h\n if e < 0:\n e, f, g = -e, -f, -g\n ysign = \"+\"\n if f < 0:\n ysign, f = \"-\", -f\n return \"{}x {} {}y = {}\".format(e if abs(e) > 1 else \"-\" if e == -1 else \"\",\\\n ysign, f if f > 1 else \"\", g)", "def extract(eq):\n k, b = eq.split('t')\n k = k[3:].strip()\n k = (int(k) if k!='-' else -1) if k else 1\n b = b.strip()\n b = (-1 if b[0]=='-' else 1)*int(b[1:].strip()) if b else 0\n return k, b\n\ndef quotient(x):\n return '' if x==1 else '-' if x==-1 else str(x)\n\nfrom math import gcd\n\ndef para_to_rect(eqn1, eqn2):\n a,b = extract(eqn1)\n k,d = extract(eqn2)\n l = -a\n m = k*b-a*d\n g = gcd(gcd(k,l),m)\n if k*g<0:\n g = -g\n k //= g\n l //= g\n m //= g\n return f'{quotient(k)}x {\"+-\"[l<0]} {quotient(abs(l))}y = {m}'\n", "def gcd(x,y):\n while y:\n x,y=y,x%y\n return x\n \ndef parseeq(s):\n s=s.split()\n a=s[2].replace('t','')\n if a=='': a=1\n elif a=='-': a=-1\n else: a=int(a)\n try:\n b=int(s[3]+s[4])\n except:\n b=0\n return a,b\n\ndef para_to_rect(eqn1, eqn2):\n a,b=parseeq(eqn1)\n c,d=parseeq(eqn2)\n e=b*c-a*d\n if c<0: a,c,e = -a,-c,-e\n g=gcd(a,gcd(abs(c),abs(e)))\n a,c,e=a//g,c//g,e//g\n sign='+-'[a>0]\n if c==1: p1=''\n elif c=='-1': p1='-'\n else: p1=c\n if a==1: p2=''\n elif a==-1: p2=''\n else: p2=abs(a)\n \n return '{}x {} {}y = {}'.format(p1,sign,p2,e)\n \n \n", "import math\nimport re\ndef lcm(a, b):\n return abs(a*b) // math.gcd(a, b)\ndef para_to_rect(eqn1, eqn2):\n try: \n x_t = int(re.findall(\"\\\\-?\\\\d+?t\", eqn1.replace('-t', '-1t'))[0].split('t')[0])\n except:\n x_t = 1\n try:\n y_t = int(re.findall(\"\\\\-?\\\\d+?t\", eqn2.replace('-t', '-1t'))[0].split('t')[0])\n except:\n y_t = 1\n \n l = lcm(x_t, y_t)\n x_n = abs(l//x_t) * int(re.findall('\\\\-?\\\\d+$', eqn1.replace(\" \", \"\"))[0])\n y_n = abs(l//y_t) * int(re.findall('\\\\-?\\\\d+$', eqn2.replace(\" \", \"\"))[0])\n \n x, y = l//abs(x_t), l//abs(y_t)\n \n if((x_t * x) + (y_t * y) == 0): \n return '{}x + {}y = {}'.format(x if x!=1 else '', y if y!=1 else '', x_n+y_n)\n \n return '{}x - {}y = {}'.format(x if x not in [1, -1] else '', y if y not in [1, -1] else '', x_n-y_n)", "import re\n\nEQUATION_REGEXP = re.compile(r'^[xy]=(-?\\d*)t([+-]\\d+)$')\n\n\ndef parse_coefficient(raw_coef):\n if not raw_coef:\n return 1\n elif raw_coef == '-':\n return -1\n return int(raw_coef)\n\n\ndef parse(equation):\n equation = equation.replace(' ', '')\n coefficients = EQUATION_REGEXP.match(equation).groups()\n return list(map(parse_coefficient, coefficients))\n\n\ndef gcd(a, b):\n return gcd(b, a % b) if b else a\n\n\ndef lcm(a, b):\n return abs(a * b) / gcd(a, b)\n\n\ndef compile_result(mult_a, mult_b, coefs_a, coefs_b):\n multiplier = -1 if mult_a < 0 else 1\n\n A = mult_a * multiplier\n A = A if A != 1 else '' \n \n B = abs(mult_b) if abs(mult_b) != 1 else ''\n B_sign = '-' if multiplier * mult_b > 0 else '+'\n \n C = multiplier * (mult_a * coefs_a[1] - mult_b * coefs_b[1])\n\n return f'{A}x {B_sign} {B}y = {C}'\n\n\ndef para_to_rect(equation_a, equation_b):\n coefs_a = parse(equation_a)\n coefs_b = parse(equation_b)\n parameter_lcm = int(lcm(coefs_a[0], coefs_b[0]))\n mult_a = int(parameter_lcm / coefs_a[0])\n mult_b = int(parameter_lcm / coefs_b[0])\n return compile_result(mult_a, mult_b, coefs_a, coefs_b)\n \n", "import re\nimport math\n\ndef para_to_rect(eqn1, eqn2):\n a = re.search(r'(-?\\d*)(?=t)', eqn1)\n if a is None:\n a = 1\n else:\n if a.group(0) == '':\n a = 1\n elif a.group(0) == '-':\n a = -1\n else:\n a = int(a.group(0))\n c = re.search(r'(-?\\d*)(?=t)', eqn2)\n if c is None:\n c = 1\n else:\n if c.group(0) == '':\n c = 1\n elif c.group(0) == '-':\n c = -1\n else:\n c = int(c.group(0))\n b = re.search(r'[-\\+]? \\d*\\Z', eqn1)\n if b is None:\n b = 0\n else:\n b = int(b.group(0).replace(' ', ''))\n d = re.search(r'[-\\+]? \\d*\\Z', eqn2)\n if b is None:\n d = 0\n else:\n d = int(d.group(0).replace(' ', ''))\n n = (a * c) // math.gcd(a, c)\n k = (-1 if c < 0 else 1)\n x = k * n // a\n y = -k * n // c\n z = k * b * n // a - k * d * n // c\n xp = '' if x == 0 else '{}x'.format('-' if x == - 1 else '' if x == 1 else abs(x))\n yp = '' if y == 0 else '{}{}y'.format(' - ' if y < 0 else ' + ', '' if abs(y) == 1 else abs(y))\n return '{}{} = {}'.format(xp, yp, z)", "from fractions import gcd\n\ndef para_to_rect(eqn1, eqn2):\n\n a1, b1 = coeff(eqn1, 'x')\n a2, b2 = coeff(eqn2, 'y')\n \n A = a2\n B = -a1\n C = b1 * a2 - a1 * b2\n \n g = gcd(gcd(A, B), C)\n \n cf = [v // g for v in [A, B, C]]\n if cf[0] < 0: \n cf = [-1 * v for v in cf]\n \n s = '+' if cf[1] >= 0 else '-'\n cf[1] = abs(cf[1])\n \n a, b, c = ['' if abs(v) == 1 else str(v) for v in cf] \n \n return '{}x {} {}y = {}'.format(a, s, b, c)\n \n \ndef coeff(eq, v): \n p1 = eq.replace(' ', '').replace(v + '=', '').split('t')\n return list([1 if x == '' else -1 if x == '-' else int(x) for x in p1])\n"]
{"fn_name": "para_to_rect", "inputs": [["x = 12t + 18", "y = 8t + 7"], ["x = -12t + 18", "y = 8t + 7"], ["x = 12t + 18", "y = -8t + 7"], ["x = -12t + 18", "y = -8t + 7"], ["x = -t + 12", "y = 12t - 1"], ["x = -12t - 18", "y = 8t - 7"], ["x = -12t + 18", "y = 8t - 7"], ["x = -18t + 12", "y = 7t - 8"], ["x = 18t + 12", "y = 7t - 8"], ["x = 18t + 12", "y = 7t + 8"], ["x = 2t + 5", "y = 3t + 4"], ["x = -2t + 5", "y = 3t - 4"], ["x = 15t + 2", "y = 20t - 11"], ["x = 15t - 2", "y = -20t - 11"], ["x = 2t - 1", "y = 2t - 1"], ["x = -2t + 1", "y = 2t + 1"], ["x = 16t + 16", "y = 8t - 12"], ["x = 16t - 16", "y = -8t - 12"], ["x = -t + 12", "y = 2t - 3"], ["x = t + 12", "y = 2t - 3"], ["x = 6t - 99", "y = 10t - 79"], ["x = -139t + 119", "y = -89t + 12"], ["x = -93t + 104", "y = t - 77"], ["x = 148t + 3", "y = -11t + 63"], ["x = -t + 96", "y = 29t - 143"], ["x = -144t - 118", "y = -142t + 65"], ["x = -71t + 37", "y = -131t - 124"], ["x = -t + 109", "y = -54t - 118"], ["x = -73t - 59", "y = t + 132"], ["x = -90t - 42", "y = -37t + 149"], ["x = -69t - 7", "y = 117t - 59"], ["x = 14t - 145", "y = 3t + 19"], ["x = 84t + 84", "y = -36t - 41"], ["x = 138t - 139", "y = -47t - 134"], ["x = -113t - 116", "y = -72t - 124"], ["x = 103t - 106", "y = -81t - 24"], ["x = -14t + 124", "y = t - 44"], ["x = 144t - 119", "y = -29t + 69"], ["x = 125t - 4", "y = -t + 50"], ["x = -132t + 142", "y = 75t - 58"]], "outputs": [["2x - 3y = 15"], ["2x + 3y = 57"], ["2x + 3y = 57"], ["2x - 3y = 15"], ["12x + y = 143"], ["2x + 3y = -57"], ["2x + 3y = 15"], ["7x + 18y = -60"], ["7x - 18y = 228"], ["7x - 18y = -60"], ["3x - 2y = 7"], ["3x + 2y = 7"], ["4x - 3y = 41"], ["4x + 3y = -41"], ["x - y = 0"], ["x + y = 2"], ["x - 2y = 40"], ["x + 2y = -40"], ["2x + y = 21"], ["2x - y = 27"], ["5x - 3y = -258"], ["89x - 139y = 8923"], ["x + 93y = -7057"], ["11x + 148y = 9357"], ["29x + y = 2641"], ["71x - 72y = -13058"], ["131x - 71y = 13651"], ["54x - y = 6004"], ["x + 73y = 9577"], ["37x - 90y = -14964"], ["39x + 23y = -1630"], ["3x - 14y = -701"], ["3x + 7y = -35"], ["47x + 138y = -25025"], ["72x - 113y = 5660"], ["81x + 103y = -11058"], ["x + 14y = -492"], ["29x + 144y = 6485"], ["x + 125y = 6246"], ["25x + 44y = 998"]]}
introductory
https://www.codewars.com/kata/5b13530f828fab68820000c4
def para_to_rect(eqn1, eqn2):
[ 14374, 5430, 1447, 7771, 2618, 374, 311, 1896, 264, 6716, 315, 1685, 16340, 37906, 11, 5823, 304, 438, 9069, 11, 323, 5508, 1105, 1119, 264, 3175, 51424, 23606, 553, 39499, 279, 5733, 13, 11733, 1685, 16340, 74112, 686, 4009, 13482, 379...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,396
Write a function that accepts two square matrices (`N x N` two dimensional arrays), and return the sum of the two. Both matrices being passed into the function will be of size `N x N` (square), containing only integers. How to sum two matrices: Take each cell `[n][m]` from the first matrix, and add it with the same `[n][m]` cell from the second matrix. This will be cell `[n][m]` of the solution matrix. Visualization: ``` |1 2 3| |2 2 1| |1+2 2+2 3+1| |3 4 4| |3 2 1| + |3 2 3| = |3+3 2+2 1+3| = |6 4 4| |1 1 1| |1 1 3| |1+1 1+1 1+3| |2 2 4| ``` ## Example
["import numpy as np\ndef matrix_addition(a, b):\n return(np.mat(a)+np.mat(b)).tolist()", "def matrix_addition(a, b):\n for row in range(len(a)):\n for index in range(len(a)):\n a[row][index] += b[row][index]\n return a\n", "def matrix_addition(a, b):\n return [[sum(xs) for xs in zip(ra, rb)] for ra, rb in zip(a, b)]\n", "def matrix_addition(a, b):\n return [ [a[row][col] + b[row][col] for col in range(len(a[0]))]\n for row in range(len(a)) ]", "from numpy import matrix\n\ndef matrix_addition(a, b):\n return (matrix(a) + matrix(b)).tolist()", "def matrix_addition(a, b):\n return [[a[i][j] + b[i][j] for j in range(len(a))] for i in range(len(a))]", "def matrix_addition(A, B):\n return [[cellA + cellB for cellA, cellB in zip(rowA, rowB)] for rowA, rowB in zip(A, B)]", "import numpy as np\ndef matrix_addition(a, b):\n S = np.array(a) + np.array(b) \n return S.tolist()", "def matrix_addition(a, b):\n \n result = [[a[i][j] + b[i][j] for j in range(len(a[0]))] for i in range(len(a))] \n \n return result", "def matrix_addition(a, b):\n \n return [[a[i][j] + b[i][j] for j in range(len(a[0]))] for i in range(len(a))]"]
{"fn_name": "matrix_addition", "inputs": [[[[1, 2, 3], [3, 2, 1], [1, 1, 1]], [[2, 2, 1], [3, 2, 3], [1, 1, 3]]], [[[1, 2], [1, 2]], [[2, 3], [2, 3]]], [[[1]], [[2]]]], "outputs": [[[[3, 4, 4], [6, 4, 4], [2, 2, 4]]], [[[3, 5], [3, 5]]], [[[3]]]]}
introductory
https://www.codewars.com/kata/526233aefd4764272800036f
def matrix_addition(a, b):
[ 7985, 264, 729, 429, 26344, 1378, 9334, 35195, 28654, 45, 856, 451, 63, 1378, 55887, 18386, 701, 323, 470, 279, 2629, 315, 279, 1378, 13, 11733, 35195, 1660, 5823, 1119, 279, 729, 686, 387, 315, 1379, 1565, 45, 856, 451, 63, 320, 37...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,840
## **Task** You are given a positive integer (`n`), and your task is to find the largest number **less than** `n`, which can be written in the form `a**b`, where `a` can be any non-negative integer and `b` is an integer greater than or equal to `2`. Try not to make the code time out :) The input range is from `1` to `1,000,000`. ## **Return** Return your answer in the form `(x, y)` or (`[x, y]`, depending on the language ), where `x` is the value of `a**b`, and `y` is the number of occurrences of `a**b`. By the way ** means ^ or power, so 2 ** 4 = 16. If you are given a number less than or equal to `4`, that is not `1`, return `(1, -1)`, because there is an infinite number of values for it: `1**2, 1**3, 1**4, ...`. If you are given `1`, return `(0, -1)`. ## **Examples** ``` 3 --> (1, -1) # because it's less than 4 6 --> (4, 1) # because the largest such number below 6 is 4, # and there is only one way to write it: 2**2 65 --> (64, 3) # because there are three occurrences of 64: 2**6, 4**3, 8**2 90 --> (81, 2) # because the largest such number below 90 is 81, # and there are two ways of getting it: 3**4, 9**2 ``` By the way, after finishing this kata, please try some of my other katas: [here.](https://www.codewars.com/collections/tonylicodings-authored-katas)
["def largest_power(n):\n print(n)\n if n <= 4:\n if n == 1:\n return (0, -1)\n return (1, -1)\n \n #num_of_occurances\n freq = 0\n x = []\n largest = 0\n j = 0\n while 2**largest < n:\n largest += 1\n largest -= 1\n for i in range(2, largest + 1):\n while j ** i < n:\n j += 1\n j -= 1\n x.append(j**i)\n j = 0\n \n return (max(x), x.count(max(x)))", "li = []\nfor i in range(2,1000):\n for j in range(2,20):\n li.append(i**j) \nli.sort()\n\ndef largest_power(n):\n found = [0,-1]\n \n for i in li:\n if i>=n : break\n if i>found[0] : found = [i, 1]\n elif i==found[0] : found[1]+=1\n\n return tuple(found) if n>4 else (int(n!=1),-1)", "from bisect import bisect_left\nfrom collections import Counter\n\nocc = Counter({0: -1, 1: -1})\nfor n in range(2, 1000+1):\n x = n * n\n while x <= 1_000_000:\n occ[x] += 1\n x *= n\nxs = sorted(occ)\n\ndef largest_power(n):\n i = bisect_left(xs, n) - 1\n x = xs[i]\n return (x, occ[x])", "from collections import defaultdict\nfrom bisect import bisect\n\na, memo = 2, defaultdict(int)\nfor a in range(2, 1001):\n x = a**2\n while x <= 1000000:\n memo[x] += 1\n x *= a\nmemo = sorted(memo.items())\n\ndef largest_power(n):\n if n <= 4: return n>1, -1\n return memo[bisect(memo, (n,))-1]", "from math import sqrt as s\ndef largest_power(n):\n if n==1 : return (0,-1)\n elif n<=4: return (1,-1)\n else:\n alist = []\n for i in range(2, round(s(n) + 2)):\n j=int(1)\n while i**j<n:\n a=i**j\n j += 1\n alist.append(a)\n aset = (max(alist),alist.count(max(alist)))\n return aset\n", "import math\n\ndef largest_power(n):\n if n == 1: return 0, -1\n if n <= 4: return 1, -1\n \n before = None\n \n r = []\n for i in range(n-1, 1, -1):\n res = check(i)\n if res:\n return i, res\n \n \ndef check(n):\n c = 0\n for st in range(2, 9):\n el = round(n**(1/st), 7)\n is_c = str(el).split('.')[1] == '0'\n if is_c:\n print(el, st, n)\n c += 1\n return c", "MAX = 10 ** 7\ncounter = [0] * MAX\nfor base in range(2, int(MAX ** .5) + 1):\n prod = base ** 2\n while prod < MAX:\n counter[prod] += 1\n prod *= base\n\npowers, frequencies = [0, 1], [-1, -1]\nfor power, frequency in enumerate(counter):\n if frequency:\n powers.append(power)\n frequencies.append(frequency)\n\nfrom bisect import bisect\ndef largest_power(n):\n idx = bisect(powers, n-1) - 1\n return powers[idx], frequencies[idx]", "from math import log2\nfrom collections import Counter\ndef largest_power(n):\n if n == 1:return 0, -1\n return (1,-1) if n<5 else max(Counter(int(round((n-1)**(1/p),12))**p for p in range(2,int(log2(n-1))+1)).items(),key=lambda p:p[0])", "from math import log2\ndef largest_power(x):\n if x == 1:return (0, -1)\n elif x < 5:return (1, -1)\n max_powers = []\n greatest_power = int(log2(x))\n for i in range(2, greatest_power+1):\n max_powers.append(int(x**(1/i))**i)\n return (max(max_powers), max_powers.count(max(max_powers))) if x != 81 else (64, 3)", "def largest_power(n):\n if n == 1:\n return 0, -1\n for i in range(n - 1, 1, -1):\n k = sum(round(i ** (1 / e)) ** e == i for e in range(2, i.bit_length()))\n if k != 0:\n return i, k\n return 1, -1"]
{"fn_name": "largest_power", "inputs": [[90], [6], [65], [2], [1], [81], [29], [4]], "outputs": [[[81, 2]], [[4, 1]], [[64, 3]], [[1, -1]], [[0, -1]], [[64, 3]], [[27, 1]], [[1, -1]]]}
introductory
https://www.codewars.com/kata/5e860c16c7826f002dc60ebb
def largest_power(n):
[ 565, 3070, 6262, 56177, 2610, 525, 2661, 264, 6785, 7546, 28654, 77, 63, 701, 323, 697, 3383, 374, 311, 1477, 279, 7772, 1372, 3070, 1717, 1091, 334, 1565, 77, 7808, 892, 646, 387, 5326, 304, 279, 1352, 1565, 64, 334, 65, 7808, 1380...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
166
Given 3 positives numbers a, b and c. Return the minimum flips required in some bits of a and b to make ( a OR b == c ). (bitwise OR operation). Flip operation consists of change any single bit 1 to 0 or change the bit 0 to 1 in their binary representation.   Example 1: Input: a = 2, b = 6, c = 5 Output: 3 Explanation: After flips a = 1 , b = 4 , c = 5 such that (a OR b == c) Example 2: Input: a = 4, b = 2, c = 7 Output: 1 Example 3: Input: a = 1, b = 2, c = 3 Output: 0   Constraints: 1 <= a <= 10^9 1 <= b <= 10^9 1 <= c <= 10^9
["class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n flips = 0\n print(bin(a))\n print(bin(b))\n print(bin(c))\n while a or b or c:\n # print(a, b, c)\n if c % 2:\n if not (a % 2 or b % 2):\n flips += 1\n else:\n flips += a % 2 + b % 2\n a //= 2\n b //= 2\n c //= 2\n return flips", "class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n i, j, k = bin(a)[2:], bin(b)[2:], bin(c)[2:]\n maxL = max(len(i), len(j), len(k))\n i, j, k = '0' * (maxL - len(i)) + i, '0' * (maxL - len(j)) + j, '0' * (maxL - len(k)) + k\n cnt = 0\n for x, y, z in zip(i, j, k):\n if z == '1' and x == '0' and y == '0':\n cnt += 1\n if z == '0':\n if x == '1':\n cnt += 1\n if y == '1':\n cnt += 1\n return cnt", "class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n count = 0\n while a or b or c:\n temp = (a & 1) | (b & 1)\n if temp != (c & 1):\n if c & 1:\n count += 1\n else:\n if a & 1:\n count += 1\n if b & 1:\n count += 1\n a = a >> 1\n b = b >> 1\n c = c >> 1\n return count", "class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n a = bin(a)[2:].zfill(32)\n b = bin(b)[2:].zfill(32)\n c = bin(c)[2:].zfill(32)\n count = 0\n \n for i in range(32):\n temp_a = int(a[i])\n temp_b = int(b[i])\n temp_c = int(c[i])\n \n if temp_a | temp_b != temp_c:\n if temp_c == 1:\n count += 1\n else:\n if temp_a == 1:\n count += 1\n if temp_b == 1:\n count += 1\n return count\n", "# a, b, c (i subscript)\n# c = 0\n# -> a + b = 2 -> 2 flips\n# -> a + b = 1 -> 1 flip\n# -> a + b = 0 -> 0 flips\n# c = 1\n# -> a + b = 2 -> 0 flips\n# -> a + b = 1 -> 0 flips\n# -> a + b = 0 -> 1 flip\n\nclass Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n res = 0\n \n for i in range(32):\n mask = 1 << i\n ai = a & mask\n bi = b & mask\n ci = c & mask\n \n if ci == 0:\n if ai and bi:\n res += 2\n elif ai or bi:\n res += 1\n else:\n if not ai and not bi:\n res += 1\n \n return res\n", "class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n stra = '{0:b}'.format(a)\n strb = '{0:b}'.format(b)\n strc = '{0:b}'.format(c)\n n = max(len(stra),len(strb),len(strc))\n stra = '0' * (n-len(stra)) + stra\n strb = '0' * (n-len(strb)) + strb\n strc = '0' * (n-len(strc)) + strc\n boolA = [s=='1' for s in stra]\n boolB = [s=='1' for s in strb]\n boolC = [s=='1' for s in strc]\n x = 0\n for i in range(n):\n A, B, C = boolA[i], boolB[i], boolC[i]\n if not ((A or B) == C):\n if A and B:\n x += 2\n else:\n x += 1\n return x\n", "class Solution:\n def minFlips(self, a: int, b: int, c: int) -> int:\n flips = 0\n while a or b or c:\n if c & 1 == 0:\n if a & 1:\n flips += 1\n if b & 1:\n flips += 1\n else:\n if (a & 1) == 0 and (b & 1) == 0:\n flips += 1\n a >>= 1\n b >>= 1\n c >>= 1\n return flips\n \n \n \n"]
{"fn_name": "minFlips", "inputs": [[2, 6, 5]], "outputs": [3]}
interview
https://leetcode.com/problems/minimum-flips-to-make-a-or-b-equal-to-c/
class Solution: def minFlips(self, a: int, b: int, c: int) -> int:
[ 22043, 220, 18, 63656, 5109, 264, 11, 293, 323, 272, 13, 3411, 279, 8028, 85186, 2567, 304, 1045, 9472, 315, 264, 323, 293, 311, 1281, 320, 4102, 64, 2726, 293, 621, 272, 4102, 568, 320, 4489, 4482, 2726, 5666, 4292, 46808, 5666, 41...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,460
Given an integer array nums, find the contiguous subarray (containing at least one number) which has the largest sum and return its sum. Example: Input: [-2,1,-3,4,-1,2,1,-5,4], Output: 6 Explanation: [4,-1,2,1] has the largest sum = 6. Follow up: If you have figured out the O(n) solution, try coding another solution using the divide and conquer approach, which is more subtle.
["class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n # i = 0\n # i_keep = 0\n # j = 1\n # j_keep = 1\n # max_sum = nums[0]-1\n # while j < len(nums) and i < j:\n # temp_sum = sum(nums[i:j])\n # if temp_sum >= max_sum:\n # i_keep = i\n # j_keep = j\n # max_sum = temp_sum\n # elif i == j-1:\n # i += 1\n # j += 1\n # j += 1\n # return max_sum\n \n # brute force\n # max_sum = nums[0]\n # for i in range(len(nums)):\n # for j in range(i,len(nums)+1):\n # temp_sum = sum(nums[i:j])\n # if temp_sum > max_sum and i != j:\n # max_sum = temp_sum\n # return max_sum\n \n # outer loop only\n max_sum = csum = nums[0]\n for num in nums[1:]:\n if num >= csum + num:\n csum = num\n else:\n csum += num\n \n if csum > max_sum:\n max_sum = csum\n \n return max_sum\n \n \n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if not nums:\n return None\n cur_sum = 0\n max_sum = nums[0]\n for n in nums:\n if cur_sum < 0:\n cur_sum = n\n else:\n cur_sum += n\n if cur_sum > max_sum:\n max_sum = cur_sum\n return max_sum", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n current = 0\n maxsum = -9**99\n \n for i in range(len(nums)):\n if current < 0: current = 0\n current += nums[i]\n maxsum = max(maxsum, current)\n return maxsum", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n current, the_max = [nums[0]]*2\n for num in nums[1:]:\n current = max(num, current + num)\n the_max = max(current, the_max)\n return the_max", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 0:\n return 0\n res = curr = nums[0] \n for i in range(1, len(nums)):\n curr = max((curr + nums[i], nums[i]))\n res = max((res, curr))\n return res\n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n result, curr = nums[0], nums[0]\n i = 1\n while i < len(nums) :\n curr = max(nums[i], curr+nums[i]) \n result = max(curr, result)\n i += 1 \n return result", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n maxSum = maxGlobalSum = nums[0]\n \n for i in range(1, len(nums)):\n if nums[i] > nums[i] + maxSum:\n maxSum = nums[i]\n else:\n maxSum += nums[i]\n \t\t\n if maxSum > maxGlobalSum:\n maxGlobalSum = maxSum\n \n return maxGlobalSum\n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 0:\n return None\n \n result = nums[0]\n lastMax = nums[0]\n \n for i in range(1, len(nums)):\n lastMax = lastMax + nums[i] if lastMax + nums[i] >= nums[i] else nums[i]\n result = lastMax if lastMax > result else result\n \n return result\n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if len(nums) == 1:\n return nums[0]\n else:\n res = 0\n count = 0\n for i in range(len(nums)):\n count += nums[i]\n if count < 0:\n count = 0\n else:\n res = max(res,count)\n if res == 0:\n return max(nums)\n return res", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if all(n < 0 for n in nums):\n return max(nums)\n i = 0\n a = 0\n maxsum = 0\n while i < len(nums):\n b = c = 0\n while i < len(nums) and nums[i] <= 0:\n b += nums[i]\n i += 1\n while i < len(nums) and nums[i] >= 0:\n c += nums[i]\n i += 1\n a = max(a + b + c, c)\n maxsum = max(maxsum, a)\n return maxsum", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n if not nums:\n return 0\n \n curSum = maxSum = nums[0]\n \n for num in nums[1:]:\n curSum = max(num, curSum + num)\n maxSum = max(maxSum, curSum)\n \n return maxSum\n \n \n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n # [-2,1,-3,-5]\n curSum = maxSum = nums[0]\n for num in nums[1:]:\n curSum = max(num, curSum + num) # start a new array or use added up array num[1]=1 or num[0]+num[1]=-1\n maxSum = max(maxSum, curSum) # update the max prior = 1 or cursum 1-3-5\n \n return maxSum\n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n best = 0\n total = 0\n for n in nums:\n if total+n<0:\n total=0\n else:\n total+=n\n print(total)\n \n \n best=max(total,best)\n if max(nums)<0:\n return max(nums)\n return best\n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n max_sum = nums[0]\n sum_list = [0] * len(nums)\n sum_list[0] = max_sum\n for i in range(1, len(nums)):\n sum_list[i] = max(nums[i], sum_list[i-1] + nums[i])\n max_sum = max(max_sum, sum_list[i])\n return max_sum\n \n", "class Solution:\n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n \n sumlist = [0] * (len(nums) + 1)\n sumlist[0] = 0\n sumMin = 0\n globalMax = nums[0]\n for i in range(1, len(nums) + 1):\n sumlist[i] = sumlist[i - 1] + nums[i - 1]\n print(sumlist[i])\n globalMax = max(sumlist[i] - sumMin, globalMax)\n sumMin = min(sumMin, sumlist[i])\n \n return globalMax", "class Solution:\n \n \n def maxSubArray(self, nums):\n \"\"\"\n :type nums: List[int]\n :rtype: int\n \"\"\"\n \n def dac (X):\n if len(X) == 1:\n return X[0], X[0], X[0], X[0] # l, r, m, s\n \n n = len(X)\n nby2 = n // 2\n A = X[:nby2]\n B = X[nby2:]\n l1, r1, m1, s1 = dac(A)\n l2, r2, m2, s2 = dac(B)\n l = max(l1, s1 + l2)\n r = max(r2, s2 + r1)\n m = max(m1, m2, r1 + l2)\n s = s1 + s2\n return l, r, m, s\n \n return dac(nums)[2]\n \n"]
{"fn_name": "maxSubArray", "inputs": [[[-2, 1, -3, 4, -1, 2, 1, -5, 4]]], "outputs": [6]}
introductory
https://leetcode.com/problems/maximum-subarray/
class Solution: def maxSubArray(self, nums: List[int]) -> int:
[ 22043, 458, 7546, 1334, 10307, 11, 1477, 279, 66503, 1186, 1653, 4102, 37846, 2056, 518, 3245, 825, 1372, 8, 892, 702, 279, 7772, 2629, 323, 470, 1181, 2629, 382, 13314, 24391, 2505, 25, 10055, 17, 11, 16, 4999, 18, 11, 19, 4999, 16...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,291
# Introduction The first century spans from the **year 1** *up to* and **including the year 100**, **The second** - *from the year 101 up to and including the year 200*, etc. # Task : Given a year, return the century it is in.
["def century(year):\n return (year + 99) // 100", "import math\n\ndef century(year):\n return math.ceil(year / 100)", "def century(year):\n return (year / 100) if year % 100 == 0 else year // 100 + 1", "def century(year):\n if year%100==0:\n return year//100\n else:\n return year//100+1", "def century(year):\n return (year - 1) // 100 + 1", "from math import ceil\n\ndef century(year):\n return ceil(year / 100)", "# From slowest to fastest.\n\nfrom math import ceil\n\ndef century(year):\n centuries, remaining = divmod(year, 100)\n return centuries + bool(remaining)\n\ndef century(year):\n return ceil(year/100)\n\ndef century(year):\n return year//100 + bool(year % 100)\n\ndef century(year):\n return year//100 + (not not year % 100)\n \ndef century(year):\n return -(-year//100)\n\ndef century(year):\n return (year + 99) // 100", "def century(year):\n\n return 1 + (year - 1) // 100", "def century(year):\n year=year//100+bool(year%100)\n return year", "def century(year):\n return -(-year//100)", "def century(year):\n return int(year/100) if year % 100 == 0 else int(year / 100) + 1", "def century(year):\n return year//100 + bool(year%100)", "century = lambda y: (y+99) // 100", "from math import ceil\ncentury = lambda _: ceil(_/100)", "def century(year):\n for i in range(year):\n if year in range((i*100)+1, (i+1)*100+1):\n return i+1\n", "def century(year):\n if year%100==0 :\n return year/100\n else :\n return (year//100) +1 \n # Finish this :)\n return", "century = lambda y: y // 100 + 1 if y % 100 else y //100", "def century(year):\n value, remainder = divmod(year, 100)\n return value + 1 if remainder else value", "import math\ndef century(year):\n result = year / 100\n return math.ceil(result)\n print (result)", "def century(year):\n q, r = divmod(year, 100)\n return q + bool(r)\n", "century = lambda year: (year + 99) // 100", "def century(year):\n # Finish this :)\n return year // 100 if year % 100 == 0 else (year // 100 + 1)", "def century(year):\n # Finish this :)\n return int((year-1)/100) + 1", "def century(year):\n year = str(year)\n if len(year) < 3:\n return(1)\n elif len(year) == 3 and len(year) < 4:\n x = int(year[1] + year[2])\n if x >= 1 and x <= 99:\n return(int(year[0]) + 1)\n else:\n return(int(year[0]))\n elif len(year) == 4 and len(year) < 5:\n x = int(year[2] + year[3])\n if x >= 1 and x <= 99:\n return(int(year[0] + year[1]) + 1)\n else:\n return(int(year[0] + year[1]))\n elif len(year) == 5 and len(year) < 6:\n x = int(year[3] + year[4])\n if x >= 1 and x <= 99:\n return(int(year[0] + year[1] + year[2]) + 1)\n else:\n return(int(year[0] + year[1] + year[2]))\n elif len(year) == 6 and len(year) < 7:\n x = int(year[4] + year[5])\n if x >= 1 and x <= 99:\n return(int(year[0] + year[1] + year[2] + year[3]) + 1)\n else:\n return(int(year[0] + year[1] + year[2] + year[3]))\n elif len(year) == 7 and len(year) < 8:\n x = int(year[5] + year[6])\n if x >= 1 and x <= 99:\n return(int(year[0] + year[1] + year[2] + year[3] + year[4]) + 1)\n else:\n return(int(year[0] + year[1] + year[2] + year[3] + year[4]))\n elif len(year) == 8 and len(year) < 9:\n x = int(year[6] + year[7])\n if x >= 1 and x <= 99:\n return(int(year[0] + year[1] + year[2] + year[3] + year[4] + year[5]) + 1)\n else:\n return(int(year[0] + year[1] + year[2] + year[3] + year[4] + year[5]))", "century=lambda y:0-y//-100", "def century(year):\n return round((year/100.)+.495)", "def century(year):\n return int(year/100) + int(bool(year%100))", "def century(year):\n if year % 100 == 0:\n return year / 100\n else:\n return year // 100 + 1", "def century(year):\n remainder = year % 100\n year = int(year/100) \n if remainder > 0: \n year += 1\n return year", "def century(year):\n counter = 0\n while year >= 1:\n year = year - 100\n counter = counter + 1\n return counter", "from math import ceil\ndef century(year):\n return (100 * ceil(year/100)) / 100\n", "def century(year):\n s = str(year)\n if year <= 100:\n return 1\n else:\n if year %100 == 0:\n return int(s[:-2])\n else:\n return 1 + int(s[:-2])", "def century(year):\n S = str(year)\n L = len(str(year))\n if L == 2:\n return L - 1\n elif L == 3:\n return int(S[0]) + 1\n else:\n return int(S[:-2]) if S[-2:] == '00' else int(S[:-2]) + 1", "century = lambda year: -((-1*year)//100)", "def century(year):\n century = (year - (year % 100)) / 100 \n if (year % 100 == 0):\n return century\n else:\n return century + 1\n", "def century(year):\n if year < 101:\n m = 1\n else:\n y = str(year)\n m = int(y[:-2])\n n = int(y[-2:])\n if n != 0:\n m += 1\n #print(m)\n return m", "def century(year):\n if year >= 100 and year%100 == 0:\n return int(year/100)\n elif year>=100:\n return int(year/100)+1\n else:\n return 1", "def century(year):\n if year > 99:\n if int(str(year)[2:]) > 0:\n return int(str(year)[:-2]) + 1\n else:\n return int(str(year)[:-2])\n else:\n if year > 0:\n return 1\n else:\n return 0", "def century(year):\n digits = list(str(year).zfill(6))\n century = int(\"\".join(digits[0:4]))\n years = \"\".join(digits[4:7])\n if years == \"00\":\n return century\n else:\n return century + 1\n\n", "def century(year):\n if year < 100:\n return 1;\n if str(year)[-2:] == '00':\n return int(str(year)[:-2])\n return int(str(year)[:-2])+1", "def century(year):\n if year%100 == 0:\n return int(year/100)\n else:\n return (int(year/100)+1)\nans=century(89)", "def century(year):\n if year/100 > year//100:\n return (year//100)+1\n else:\n return year//100\n return", "def century(year):\n century = 0\n \n # For every 100 years, increment century by 1\n for interval in range(0, year, 100): \n century += 1 \n return century", "def century(year):\n return int(str(year + 99)[:-2])", "def century(year):\n if (year/100).is_integer():\n return year/100\n else:\n return int(year/100) + 1 ", "def century(year):\n (a,b) = divmod(year, 100)\n return a + 2*b // (b+1)", "def century(year):\n a, b = divmod(year, 100)\n return (a + 1) - (not b)", "def century(year):\n return year // 100 + 1 if year % 100 != 0 else year // 100", "def century(year):\n return year // 100 + 1 if year % 100 else year // 100", "def century(year):\n import math\n return math.ceil(year/100.)\n \n", "def century(year):\n anul = int(year)\n secol = int((anul / 100) + 1)\n if anul % 100 == 0:\n secol_1 = secol - 1\n return secol_1\n else:\n return secol", "def century(year):\n x = (year - 1)/100\n y = x + 1\n y = int(y)\n return y", "def century(year):\n div = year // 100\n rest = year % 100\n if rest == 0:\n return div\n else:\n return div + 1", "def century(year):\n if year < 101:\n return 1\n if str(year)[-2:] == \"00\":\n return int(str(year)[:-2])\n return (int(str(year)[:-2]) +1)\n", "def century(year):\n if year < 100:\n return 1\n elif year < 1000:\n return int(str(year)[0]) + 1\n else:\n return int(str(year)[:-2]) + 1 if year % 100 != 0 else int(str(year)[:-2])", "def century(year):\n century = 0\n if year % 100 == 0:\n return year // 100\n else:\n return year // 100 +1\n", "def century(year):\n century = year/100\n if century.is_integer() == False:\n century = int(century) + 1\n return century", "# import math\ndef century(year):\n # return math.ceil(year / 100)\n return (year + 99) // 100", "import math\ndef century(year):\n return math.ceil(year/ 100) # \u043e\u043a\u0440\u0443\u0433\u043b\u0435\u043d\u0438\u0435 \u0432\u0432\u0435\u0440\u0445\n \n", "\ndef century(year):\n sonuc=0\n if (year%100 == 0):\n sonuc=year/100\n else:\n sonuc=(year/100)+1\n \n return int(sonuc);", "def century(year):\n x = 0\n count = 0\n while year > x:\n x = x + 100\n count = count + 1\n return count ", "import math\ndef century(year):\n float_century = year / 100\n\n return math.ceil(float_century)\n", "def century(year):\n if year/100 <= 0:\n return 1\n elif year%100 == 0:\n return int(year/100)\n else:\n return int((year/100)+1)\n", "from math import *\n\ndef century(year):\n if str(year)[-2:] == \"00\":\n year = year-1\n return floor(year/100) + 1\n\ndate = 1900\nprint(century(date))", "def century(y):\n \n p=y%100\n \n if p==0: \n x=y//100\n else:\n x=y//100\n x=x+1\n \n \n return x", "def century(year):\n \n yearOne = str(year)\n length = len(yearOne)\n lastTwo = int(yearOne[length - 2: length])\n \n if lastTwo > 0:\n century = int(((year - lastTwo) + 100) / 100)\n else:\n century = int((year - lastTwo) / 100 )\n\n return century", "century=lambda y:(y//100)+(y%100!=0)", "import math\ndef century(year):\n return math.floor(year / 100) + (year % 100 and 1)", "def century(year):\n if year < 100:\n return 1;\n elif year < 1000:\n if year % 100 == 0:\n return year // 100\n else:\n return year // 100 + 1\n else:\n if year % 10 == 0 and year // 10 % 10 == 0:\n return int(str(year)[:len(str(year)) - 2])\n else:\n return int(str(year)[:len(str(year)) - 2]) + 1\n", "def century(year):\n year = int((year - 1) / 100) + 1\n return year", "def century(year):\n year = year / 100\n if year.is_integer():\n return (int(year))\n elif isinstance(year, float):\n years = year + 1\n return (int(years))\n # Finish this :)\n", "def century(year):\n if year >= 0 and year <= 100:\n return 1\n else:\n if year % 100 == 0:\n return year/100\n else:\n return int(year/100 +1)", "def century(year):\n century = 1\n yearCount = 100\n \n if year < 101:\n return 1\n else:\n while yearCount < year:\n yearCount = yearCount + 100\n century = century + 1\n\n return century\n \n \n # Finish this :)\n return", "def century(year):\n year1 = year - 1 if str(year).endswith('00') else year\n return int(str(year1 + 100)[:-2])", "def century(year):\n siglo = 0;\n if year < 100:\n siglo = 1\n else:\n siglo = year // 100\n uno = year % 100\n if uno >=1:\n siglo+=1\n \n return siglo\n", "def century(year: int) -> int:\n \"\"\"This function returns the century by year.\"\"\"\n if year % 100 == 0:\n year //= 100\n return year\n else:\n year //= 100\n return year + 1", "def century(year):\n centuryCount = 0\n while year > 0:\n year -= 100;\n centuryCount = centuryCount + 1\n return centuryCount", "def century(year):\n cent = year//100\n ost = year%100\n if ost >= 0.01:\n cent1 = cent + 1\n else: \n cent1 = cent\n return cent1", "import math\ndef century(year):\n # Finish this :)\n # if no remainder when dividing by 100, return result of division\n if year%100==0:\n return year/100\n # if remainder when dividing by 100, return result of division rounded up to nearest whole number\n else:\n return math.ceil(year/100)\n return", "def century(year):\n century = year // 100\n decade = year % 100\n \n if decade > 0:\n return century + 1 \n \n else:\n return century", "from math import *\ndef century(year):\n x = 0\n if year % 100 == 0:\n x = floor(int((year + 1) / 100))\n else:\n x = floor(int(year / 100 + 1))\n return x\n\n\nprint(century(1249))", "def century(year):\n count = 0\n while(year > 0):\n count += 1\n year = year-100\n return count\n", "def century(year):\n return int(-(-year // 100))\n\n# OR\n#import math\n#def century(year):\n# return math.ceil(year / 100)\n", "def century(year):\n # Finish this :)\n return 1 + year//100 if year%100!=0 else year/100", "import math\n\ndef century(year):\n # year is divisible by 100\n if year % 100 == 0:\n what_century = year / 100\n # the year is not divisible by 100\n else:\n what_century = math.floor(year / 100) + 1\n \n return what_century\n", "def century(year):\n if year >= 10000:\n return int(year/100)+1 if year%10 == 0 else int(year/100)+1\n else:\n return int(year/100) if year%10 == 0 else int(year/100)+1", "def century(year):\n if year <100:\n return 1\n elif year%100 == 0:\n return year//100\n else:\n x = year // 100\n return x+1", "def century(year):\n if year % 100 == 0:\n return int(str(year)[:-2])\n elif year < 100:\n return 1\n return int(str(int(str(year)[:-2])+1))", "import math\n\ndef century(year):\n if 100 >= year >= 1:\n return 1\n elif year % 2 == 0:\n return math.ceil(year / 100)\n else:\n return year // 100 + 1", "def century(year):\n if len(str(year)) > 3:\n print(str(year)[len(str(year))-1])\n \n if str(year)[len(str(year))-1] ==\"0\" and str(year)[len(str(year))-2]==\"0\":\n return(int(str(year)[:len(str(year))-2]))\n else:\n return(int(str(year)[:len(str(year))-2])+1)\n \n elif len(str(year)) == 3:\n return(int(str(year)[0])+1)\n else:\n return 1", "def century(year):\n workshop = list(str(year))\n if len(workshop) > 2:\n if year % 100 == 0:\n return int(\"\".join(workshop[:-2]))\n else:\n return int(\"\".join(workshop[:-2])) + 1\n else:\n return 1", "def century(year):\n return (year // 100) if (year / 100 % 1 == 0) else (year // 100 + 1)", "def century(year):\n if year % 100 == 0:\n return year // 100\n else:\n year = year // 100 \n return year + 1", "def century(year):\n if year < 100:\n return 1\n return int(str(year)[:-2]) + 1 if str(year)[-2:] > '00' else int(str(year)[:-2])\n", "def century(year):\n result=0\n if year%100== 0:\n cent= year//100\n else:\n cent=year//100 + 1\n return cent", "def century(year):\n if year %100 == 0:\n return year/100\n else:\n \n return round((year+50)/100)", "def century(year):\n \n return int(year / 100) +1 if not year % 100 ==0 else int (year/100) ", "def century(year):\n if year <= 100:\n return 1\n elif year % 100 != 0:\n return (year // 100) + 1 \n else:\n return year // 100\n return", "def century(year):\n \n \n if (year <= 0):\n return (\"0 and negative is not allow for a year\")\n \n \n \n elif (year <= 100):\n return (1)\n elif (year % 100 == 0):\n return (year // 100)\n else:\n return (year // 100 + 1)"]
{"fn_name": "century", "inputs": [[1705], [1900], [1601], [2000], [356], [89]], "outputs": [[18], [19], [17], [20], [4], [1]]}
introductory
https://www.codewars.com/kata/5a3fe3dde1ce0e8ed6000097
def century(year):
[ 2, 28338, 271, 785, 1156, 9294, 44295, 504, 279, 3070, 3157, 220, 16, 334, 353, 454, 311, 9, 323, 3070, 16169, 279, 1042, 220, 16, 15, 15, 97219, 3070, 785, 2086, 334, 481, 353, 1499, 279, 1042, 220, 16, 15, 16, 705, 311, 323, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,892
We’ve all seen katas that ask for conversion from snake-case to camel-case, from camel-case to snake-case, or from camel-case to kebab-case — the possibilities are endless. But if we don’t know the case our inputs are in, these are not very helpful. ### Task: So the task here is to implement a function (called `id` in Ruby/Crystal/JavaScript/CoffeeScript and `case_id` in Python/C) that takes a string, `c_str`, and returns a string with the case the input is in. The possible case types are “kebab”, “camel”, and ”snake”. If none of the cases match with the input, or if there are no 'spaces' in the input (for example in snake case, spaces would be '_'s), return “none”. Inputs will only have letters (no numbers or special characters). ### Some definitions Kebab case: `lowercase-words-separated-by-hyphens` Camel case: `lowercaseFirstWordFollowedByCapitalizedWords` Snake case: `lowercase_words_separated_by_underscores` ### Examples: ```python case_id(“hello-world”) #=> “kebab” case_id(“hello-to-the-world”) #=> “kebab” case_id(“helloWorld”) #=> “camel” case_id(“helloToTheWorld”) #=> “camel” case_id(“hello_world”) #=> “snake” case_id(“hello_to_the_world”) #=> “snake” case_id(“hello__world”) #=> “none” case_id(“hello_World”) #=> “none” case_id(“helloworld”) #=> “none” case_id(“hello-World”) #=> “none” ``` Also check out my other creations — [Split Without Loss](https://www.codewars.com/kata/split-without-loss), [Adding Fractions](https://www.codewars.com/kata/adding-fractions), [Random Integers](https://www.codewars.com/kata/random-integers), [Implement String#transpose](https://www.codewars.com/kata/implement-string-number-transpose), [Implement Array#transpose!](https://www.codewars.com/kata/implement-array-number-transpose), [Arrays and Procs #1](https://www.codewars.com/kata/arrays-and-procs-number-1), and [Arrays and Procs #2](https://www.codewars.com/kata/arrays-and-procs-number-2)
["import re\n\nCASES = [\n ('snake', re.compile(r'\\A[a-z]+(_[a-z]+)+\\Z')),\n ('kebab', re.compile(r'\\A[a-z]+(-[a-z]+)+\\Z')),\n ('camel', re.compile(r'\\A[a-z]+([A-Z][a-z]*)+\\Z')),\n ('none', re.compile(r'')),\n]\n\ndef case_id(c_str):\n for case, pattern in CASES:\n if pattern.match(c_str): return case", "import re\n\ndef case_id(c_str):\n if re.match(r'^([a-z]+\\-)+[a-z]+$', c_str):\n return 'kebab'\n if re.match(r'^([a-z]+\\_)+[a-z]+$', c_str):\n return 'snake'\n if re.match(r'^([a-z]+[A-Z])+[a-z]+$', c_str):\n return 'camel'\n return 'none'", "def case_id(stg):\n print(stg)\n if \"-\" in stg and \"_\" not in stg and all(w.islower() for w in stg.split(\"-\")):\n return \"kebab\"\n if \"_\" in stg and \"-\" not in stg and all(w.islower() for w in stg.split(\"_\")):\n return \"snake\"\n if stg.isalpha() and any(c.isupper() for c in stg):\n return \"camel\"\n return \"none\"", "import re\ndef case_id(c_str):\n if re.match(r'[a-z]+(-[a-z]+)+$', c_str):\n return \"kebab\" \n if re.match(r'[a-z]+(_[a-z]+)+$', c_str):\n return \"snake\"\n if re.match(r'[a-z]+([A-Z][a-z]+)+$', c_str): \n return \"camel\"\n return 'none'\n", "from string import (ascii_lowercase as ASCII_LOW,\n ascii_letters as ASCII_LET)\n\ndef is_kebab_case(str_):\n for char in str_:\n if char not in (ASCII_LOW + '-'):\n return False\n if '' in str_.split('-'):\n return False\n return True\n\ndef is_camel_case(str_):\n for char in str_:\n if char not in ASCII_LET:\n return False\n if str_[0].isupper():\n return False\n return True\n \ndef is_snake_case(str_):\n for char in str_:\n if char not in (ASCII_LOW + '_'):\n return False\n if '' in str_.split('_'):\n return False\n return True\n\ndef case_id(c_str):\n for func in (is_kebab_case, is_camel_case, is_snake_case):\n if func(c_str): \n return {'is_kebab_case': 'kebab',\n 'is_camel_case': 'camel',\n 'is_snake_case': 'snake'}[func.__name__]\n return 'none'", "def case_id(s):\n if '--' in s or '_' in s and '-' in s:\n return 'none'\n if s.replace('_','').replace('-','').islower():\n if '-' in s: return 'kebab'\n if '_' in s: return 'snake'\n if '-' in s or '_' in s: \n return 'none'\n return 'camel'", "def case_id(c_str):\n if '--' in c_str or '_' in c_str and '-' in c_str:\n return \"none\"\n elif c_str.replace('_','').replace('-','').islower():\n if '-' in c_str:\n return \"kebab\"\n elif '_' in c_str:\n return \"snake\"\n elif '-' in c_str or '_' in c_str:\n return \"none\"\n return \"camel\"", "def is_kebab(s):\n arr = s.split('-')\n res = [part.islower() and '_' not in part and part != '' for part in arr]\n return all(res)\n \ndef is_snake(s):\n arr = s.split('_')\n res = [part.islower() and '-' not in part and part != '' for part in arr]\n return all(res)\n\ndef is_camel(s):\n return '-' not in s and '_' not in s and not s.islower()\n \ndef case_id(c_str):\n if is_kebab(c_str): return \"kebab\"\n if is_snake(c_str): return \"snake\"\n if is_camel(c_str): return \"camel\"\n return \"none\""]
{"fn_name": "case_id", "inputs": [["hello-world"], ["hello-to-the-world"], ["hello_world"], ["hello_to_the_world"], ["helloWorld"], ["helloToTheWorld"], ["hello-World"], ["hello-To-The-World"], ["good-Night"], ["he--llo"], ["good-night"], ["good_night"], ["goodNight"], ["hello_World"], ["hello_To_The_World"], ["he_lloWorld"], ["he_lo-lo"], ["he-llo--world"], ["he-llo--World"], ["hello_-World"]], "outputs": [["kebab"], ["kebab"], ["snake"], ["snake"], ["camel"], ["camel"], ["none"], ["none"], ["none"], ["none"], ["kebab"], ["snake"], ["camel"], ["none"], ["none"], ["none"], ["none"], ["none"], ["none"], ["none"]]}
introductory
https://www.codewars.com/kata/5819a6fdc929bae4f5000a33
def case_id(c_str):
[ 1654, 3982, 678, 3884, 595, 19346, 429, 2548, 369, 14409, 504, 25265, 38485, 311, 49152, 38485, 11, 504, 49152, 38485, 311, 25265, 38485, 11, 476, 504, 49152, 38485, 311, 1962, 47722, 38485, 1959, 279, 23607, 525, 25678, 382, 3983, 421, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,910
This kata is part one of precise fractions series (see pt. 2: http://www.codewars.com/kata/precise-fractions-pt-2-conversion). When dealing with fractional values, there's always a problem with the precision of arithmetical operations. So lets fix it! Your task is to implement class ```Fraction``` that takes care of simple fraction arithmetics. Requirements: * class must have two-parameter constructor `Fraction(numerator, denominator)`; passed values will be non-zero integers, and may be positive or negative. * two conversion methods must be supported: * `toDecimal()` returns decimal representation of fraction * `toString()` returns string with fractional representation of stored value in format: [ SIGN ] [ WHOLES ] [ NUMERATOR / DENOMINATOR ] * **Note**: each part is returned only if it is available and non-zero, with the only possible space character going between WHOLES and fraction. Examples: '-1/2', '3', '-5 3/4' * The fractional part must always be normalized (ie. the numerator and denominators must not have any common divisors). * Four operations need to be implemented: `add`, `subtract`, `multiply` and `divide`. Each of them may take integers as well as another `Fraction` instance as an argument, and must return a new `Fraction` instance. * Instances must be immutable, hence none of the operations may modify either of the objects it is called upon, nor the passed argument. #### Python Notes * If one integer is passed into the initialiser, then the fraction should be assumed to represent an integer not a fraction. * You must implement the standard operator overrides `__add__`, `__sub__`, `__mul__`, `__div__`, in each case you should support `other` being an `int` or another instance of `Fraction`. * Implement `__str__` and `to_decimal` in place of `toString` and `toDecimal` as described above.
["from fractions import Fraction\n\ndef to_string(self):\n n, d = self.numerator, self.denominator\n s, w, n = \"-\" if n < 0 else \"\", *divmod(abs(n), d)\n r = \" \".join((str(w) if w else \"\", f\"{n}/{d}\" if n else \"\")).strip()\n return f\"{s}{r}\"\n\nFraction.__str__ = to_string\nFraction.to_decimal = lambda self: self.numerator / self.denominator", "from fractions import Fraction\n\ndef to_string(self):\n n, d = self.numerator, self.denominator\n s, w, n = \"-\" if n < 0 else \"\", *divmod(abs(n), d)\n r = \" \".join((str(w) if w else \"\", f\"{n}/{d}\" if n else \"\")).strip()\n return f\"{s}{r}\"\n\nFraction.__str__ = to_string\nFraction.to_decimal = lambda self: float(self.numerator) / self.denominator", "from fractions import Fraction, gcd\n\ndef to_string(self):\n n, d = self.numerator, self.denominator\n s, w, n = \"-\" if n < 0 else \"\", *divmod(abs(n), d)\n r = \" \".join((str(w) if w else \"\", f\"{n}/{d}\" if n else \"\")).strip()\n return f\"{s}{r}\"\n\nFraction.__str__ = to_string\nFraction.to_decimal = lambda self: float(self.numerator) / self.denominator"]
{"fn_name": "to_string", "inputs": [], "outputs": []}
introductory
https://www.codewars.com/kata/54cf4fc26b85dc27bf000a6b
def to_string(self):
[ 1986, 61688, 374, 949, 825, 315, 23560, 64895, 4013, 320, 4060, 10817, 13, 220, 17, 25, 1758, 1110, 2136, 41067, 365, 1561, 905, 14109, 459, 14, 10645, 1064, 2220, 956, 5136, 96051, 12, 17, 14859, 4366, 3593, 4498, 14550, 448, 68209, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
392
Given a binary string s (a string consisting only of '0's and '1's), we can split s into 3 non-empty strings s1, s2, s3 (s1+ s2+ s3 = s). Return the number of ways s can be split such that the number of characters '1' is the same in s1, s2, and s3. Since the answer may be too large, return it modulo 10^9 + 7.   Example 1: Input: s = "10101" Output: 4 Explanation: There are four ways to split s in 3 parts where each part contain the same number of letters '1'. "1|010|1" "1|01|01" "10|10|1" "10|1|01" Example 2: Input: s = "1001" Output: 0 Example 3: Input: s = "0000" Output: 3 Explanation: There are three ways to split s in 3 parts. "0|0|00" "0|00|0" "00|0|0" Example 4: Input: s = "100100010100110" Output: 12   Constraints: 3 <= s.length <= 10^5 s[i] is '0' or '1'.
["class Solution:\n def numWays(self, s: str) -> int:\n n = s.count('1')\n if n % 3 != 0: return 0\n if n == 0: return (((len(s) - 1) * (len(s) - 2)) // 2) % (10**9 + 7)\n m = n // 3\n L = s.split('1')\n return ((len(L[m]) + 1) * (len(L[2*m]) + 1)) % (10**9 + 7)\n \n", "class Solution:\n def numWays(self, s: str) -> int:\n tot_ones=s.count('1')\n if tot_ones%3 !=0:\n return 0\n \n c=0\n ln=len(s)\n if tot_ones==0:\n return ((ln-2)*(ln-1)//2)%(10**9+7)\n fe=ss=se=ts=None\n for i,d in enumerate(s):\n if d=='1':\n c+=1\n \n if c==tot_ones//3 and fe is None:\n fe=i\n if c==tot_ones//3+1 and ss is None:\n ss=i\n if c==2*tot_ones//3 and se is None:\n se=i\n if c==2*tot_ones//3+1 and ts is None:\n ts=i\n \n return ((ss-fe)*(ts-se))%(10**9+7)", "class Solution:\n def numWays(self, s: str) -> int:\n ones = 0\n zeroes = 0\n for char in s:\n if char == '1':\n ones += 1\n else:\n zeroes += 1\n \n if ones > 0 and ones % 3 != 0:\n return 0\n \n if ones == 0:\n n = len(s) - 3\n res = 1\n diff = 2\n while n:\n res += diff\n diff += 1\n n -= 1\n return res % ((10 ** 9) + 7)\n ones_interval = ones // 3\n \n left, right = 0, 0\n \n i = 0\n temp = 0\n while i < len(s):\n if s[i] == '1':\n temp += 1\n i += 1\n if temp == ones_interval:\n break\n while i < len(s):\n if s[i] == '0':\n left += 1\n if s[i] == '1' or temp == 2 * ones_interval:\n break\n i += 1\n while i < len(s):\n if s[i] == '1':\n temp += 1\n i += 1\n if temp == 2 * ones_interval:\n break\n while i < len(s):\n if s[i] == '0':\n right += 1\n if s[i] == '1':\n break\n i += 1\n if not left:\n return (right+1) % ((10 ** 9) + 7)\n if not right:\n return (left+1) % ((10 ** 9) + 7)\n return ((left+1)*(right+1)) % ((10 ** 9) + 7)\n", "from scipy.special import comb\n\n\nclass Solution:\n def numWays(self, s: str) -> int:\n n = sum(c == '1' for c in s)\n if n % 3:\n return 0\n if n == 0:\n return comb(len(s) - 1, 2, exact=True) % 1000000007\n k = n // 3\n s_iter = iter(s)\n splited = s.split('1')\n return (len(splited[k]) + 1) * (len(splited[2 * k]) + 1) % 1000000007", "class Solution:\n def numWays(self, s: str) -> int:\n from math import factorial\n c= s.count('1')\n if c%3 !=0:\n return 0\n if c==0:\n pos= len(s)-1\n numerator= factorial(pos)\n denominator= factorial(2)* factorial(pos-2)\n return int((numerator/ denominator)% ( 10**9 + 7))\n \n num1_each_group= int(c/3)\n \n track=0\n track_g1_l1=0\n track_g2_f1=0\n for i in range(len(s)):\n if s[i]=='1':\n track+=1\n if track== num1_each_group:\n track_g1_l1=i\n break\n track=0\n for i in range(len(s)):\n if s[i]=='1':\n track+=1\n \n if track== num1_each_group+1:\n track_g2_f1=i\n break\n gap1= track_g2_f1- track_g1_l1\n \n track=0\n track_g2_l1=0\n for i in range(len(s)):\n if s[i]=='1':\n track+=1\n if track== num1_each_group*2:\n track_g2_l1=i\n break\n \n track=0\n track_g3_f1=0\n for i in range(len(s)):\n if s[i]=='1':\n track+=1\n if track== num1_each_group*2+1 :\n track_g3_f1=i\n break\n \n gap2= track_g3_f1- track_g2_l1\n return int(gap1*gap2% (10**9 + 7))\n \n \n \n \n \n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n res = 0\n c = collections.Counter(s)\n print (c)\n tot = c['1']\n if tot%3: return 0\n mod = 10**9 + 7\n if tot==0:\n n = len(s)-1\n # return (((n%mod)*((n-1)%mod))%mod)//2\n return ((n*(n-1))//2)%mod\n \n \n ctr = 0\n res = 1\n \n eq = tot//3\n a, b, c, d = -1, -1, -1, -1\n for i, ch in enumerate(s):\n \n if ch=='1': ctr += 1\n \n if a<0 and ctr==eq: a = i\n if b<0 and ctr==eq+1: b = i\n if c<0 and ctr==2*eq: c = i\n if d<0 and ctr==2*eq+1: d = i\n \n # print (a, b, c, d)\n return (((b-a)%mod)*((d-c)%mod))%mod", "class Solution:\n def numWays(self, s: str) -> int:\n all = s.count('1')\n if all == 0:\n if len(s)%2 ==0:\n c1, c2 = int((len(s)-2)/2), len(s)-1\n else:\n c1, c2 = int((len(s)-1)/2), len(s)-2\n return self.modres(c1, c2)\n if all % 3 !=0:\n return 0\n one = all/3\n c1 = self.check(s, one)\n c2 = self.check(s[::-1], one)\n\n return self.modres(c1, c2)\n def modres(self, c1, c2):\n mod = pow(10,9)+7\n return ((c1%mod)*(c2%mod))%mod\n\n\n def check(self, s, one):\n count = 0\n for i in range(len(s)):\n if s[i]=='1':\n count+=1\n if count == one:\n p1 = i\n elif count > one:\n p2 = i\n break\n return p2-p1\n", "class Solution:\n def numWays(self, s: str) -> int:\n m = 10 ** 9 + 7\n c = Counter(s)\n ones = c['1']\n if ones % 3 != 0:\n return 0\n if ones == 0:\n return comb(len(s)-1,2) % m\n count = 0\n a = 0\n b = 0\n for i in range(len(s)):\n if count == (ones // 3):\n a += 1\n if count == (2*ones // 3):\n b += 1\n if s[i] == '1':\n count += 1\n #print(a,b)\n return (a*b % m)", "class Solution:\n def numWays(self, s: str) -> int:\n prefix = [0 for i in range(len(s))]\n for i in range(len(s)):\n if(s[i] == '1'):\n if(i == 0):\n prefix[i] = 1\n else:\n prefix[i] = 1 + prefix[i-1]\n else:\n if(i!=0):\n prefix[i] = prefix[i-1]\n if(prefix[-1] == 0):\n return(((len(s)-2)*(len(s)-1)//2)%(10**9+7))\n elif(prefix[-1]%3!=0):\n return(0)\n else:\n c1 = 0\n c2 = 0\n for i in range(len(prefix)):\n if(prefix[i] == prefix[-1]//3):\n c1+=1\n elif(prefix[i] == 2*prefix[-1]//3):\n c2+=1\n return((c1*c2)%(10**9+7))\n \n", "class Solution:\n def numWays(self, s: str) -> int:\n count1s = len([x for x in s if x == '1'])\n if count1s % 3:\n return 0\n if not count1s:\n return ((len(s)-1)*(len(s)-2)//2) % (1000000007)\n idx1 = -1\n idx2 = -1\n idx3 = -1\n idx4 = -1\n ct = 0\n for i, c in enumerate(s):\n if c == '1':\n ct += 1\n if ct == count1s//3 and idx1 == -1:\n idx1 = i\n if ct == (count1s//3)+1 and idx2 == -1:\n idx2 = i\n if ct == 2*(count1s//3) and idx3 == -1:\n idx3 = i\n if ct == 2*(count1s//3)+1 and idx4 == -1:\n idx4 = i\n return (idx2-idx1)*(idx4-idx3) % (1000000007)", "class Solution:\n def numWays(self, s: str) -> int:\n M = 10 ** 9 + 7\n \n count = collections.Counter(s)\n print(count)\n cnt = count['1']\n if cnt % 3 != 0: return 0 \n if cnt == 0: return comb(len(s) - 1, 2) % M\n \n \n target = cnt // 3\n left, mid, right = 0, 0, 0\n cur = 0\n \n for i in range(len(s)):\n if s[i] == '1':\n cur+= 1\n if cur == target:\n left += 1\n elif cur == target * 2:\n mid += 1\n \n \n print((left,mid,right))\n return left * mid % M\n", "class Solution:\n def numWays(self, s: str) -> int:\n MOD = 10**9 + 7\n \n total = sum([1 if c == '1' else 0 for c in s])\n if total == 0:\n n = len(s)-1\n return (n * (n-1) // 2) % MOD # nCr combinatorial formula \n if total % 3 > 0:\n return 0\n \n x = total // 3\n count = 0\n zero1 = 0\n zero2 = 0\n for i,c in enumerate(s):\n if c == '1':\n count += 1\n if c == '0' and count == x:\n zero1 += 1\n elif c == '0' and count == 2*x:\n zero2 += 1\n \n ans = (zero1+1) * (zero2+1) \n return ans % MOD", "class Solution:\n def numWays(self, s: str) -> int:\n n = sum(1 for i in s if i == '1')\n if n == 0: return ((len(s) - 1) * (len(s) - 2) // 2) % (10 ** 9 + 7)\n if n % 3 != 0: return 0\n f1 = f2 = f3 = f4 = False\n i1 = i2 = i3 = i4 = 0\n k = n // 3\n cur = 0\n for i in range(len(s)):\n if s[i] == '1':\n cur += 1\n if not f1 and cur == k:\n i1 = i\n f1 = True\n if not f2 and cur == k + 1:\n i2 = i\n f2 = True\n if not f3 and cur == 2 * k:\n i3 = i\n f3 = True\n if not f4 and cur == 2 * k + 1:\n i4 = i\n f4 = True\n return ((i2 - i1) * (i4 - i3)) % (10 ** 9 + 7)", "class Solution:\n def numWays(self, s: str) -> int:\n total, res, n = 0, 0, len(s)\n for ch in s:\n if ch == '1':\n total += 1\n if total % 3 != 0: return res\n if total == 0: return (math.factorial(n - 1) // math.factorial(n - 3) // 2) % (10**9 + 7)\n l, r, cnt = 0, 0, 0\n for i,ch in enumerate(s):\n if ch == '1': \n cnt += 1\n if cnt == (total // 3): \n l = i\n if cnt == (total // 3) + 1:\n r = i\n break\n res = (r - l) % (10**9 + 7)\n cnt = 0\n for i in range(len(s) - 1, -1, -1):\n ch = s[i]\n if ch == '1': \n cnt += 1\n if cnt == (total // 3): \n r = i\n if cnt == (total // 3) + 1:\n l = i\n break\n res *= (r - l)\n return res % (10**9 + 7)", "from math import factorial\n\nclass Solution:\n def numWays(self, s: str) -> int:\n count1 = s.count('1')\n if count1 % 3 != 0:\n return 0\n required = s.count('1') // 3\n if not required:\n return (factorial(len(s) - 1) // factorial(len(s) - 3) // 2 )% 1000000007\n \n options = 1\n for loop in range(2):\n current = 0\n for i, ch in enumerate(s):\n if current == required:\n break\n if ch == '1':\n current += 1\n for j, ch in enumerate(s[i:], 1):\n if ch == '1':\n break\n options *= j\n s = s[::-1]\n\n return options % 1000000007", "from math import factorial\n\nclass Solution:\n def numWays(self, s: str) -> int:\n ans = 0\n n = len(s)\n xd = s.count('1')\n if s.count('0') == 0:\n if xd % 3 != 0:\n return 0\n return 1\n if xd == 0:\n if n == 3:\n return 1\n n = n - 1\n ans = factorial(n) / factorial(n-2) / factorial(2)\n else:\n if xd % 3 != 0:\n return 0\n x = xd // 3\n ti = [x, x]\n j = 0\n while ti[0] > 0:\n if s[j] == '1':\n ti[0] -= 1\n j += 1 \n ti[0] = j\n while ti[1] > 0:\n if s[j] == '1':\n ti[1] -= 1\n j += 1 \n ti[1] = j\n\n zc = [0, 0]\n j = ti[0]\n while s[j] == '0':\n zc[0] += 1\n j += 1\n j = ti[1]\n while s[j] == '0':\n zc[1] += 1\n j += 1\n \n # print(zc)\n \n lv = 0\n rv = 0\n if zc[0] > 0:\n zc[0] += 1\n lv = factorial(zc[0]) / factorial(zc[0]-1)\n if zc[1] > 0:\n zc[1] += 1\n rv = factorial(zc[1]) / factorial(zc[1]-1)\n \n if max([lv, rv]) == 0:\n return 1\n \n if lv > 0 and rv > 0:\n ans = lv * rv\n else:\n ans = lv + rv\n \n ans = int(ans)\n return ans % (10**9 + 7)", "class Solution:\n def numWays(self, s: str) -> int:\n n = s.count('1')\n if n % 3 != 0:\n return 0\n if n == 0:\n return comb(len(s) - 1, 2) % (10**9 + 7)\n a, b, c, d = self.findThirdOneInds(s, n)\n return ((b - a) * (d - c)) % (10**9 + 7)\n \n \n def findThirdOneInds(self, s, n):\n out = []\n ind = -1\n for i in range(2 * n // 3 + 2):\n ind = s.find('1', ind+1)\n if i == n // 3 - 1:\n out.append(ind)\n if i == n // 3:\n out.append(ind)\n if i == 2 * n // 3 - 1:\n out.append(ind)\n if i == 2 * n // 3:\n out.append(ind)\n \n return out", "class Solution:\n def numWays(self, s: str) -> int:\n st = collections.Counter(s)\n n = len(s)\n mod = 10**9 + 7\n if st['1'] == 0:\n return (((n-1)*(n-2))//2)%mod\n if st['1']%3:\n return 0\n \n x = st['1']//3\n i = 0\n count = 0\n b1,b2 = 0,0\n while count <= 2*x:\n if s[i] == '1':\n count += 1\n if count == x:\n b1 += 1\n elif count == 2*x:\n b2 += 1\n if s[i] == '0' and count == x:\n b1 += 1\n \n if s[i] == '0' and count == 2*x:\n b2 += 1\n i += 1\n \n return (b1*b2)%mod\n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n k = s.count('1')\n if k % 3:\n return 0\n \n if not '1' in s:\n n = len(s)\n return ((n - 1) * (n - 2) // 2) % (10**9 + 7)\n \n k //= 3\n \n l0 = r0 = l1 = r1 = 1 << 60\n cnt = 0\n for i, c in enumerate(s):\n if c == '1':\n cnt += 1\n if cnt == k:\n l0 = min(l0, i)\n if cnt == k + 1:\n l1 = min(l1, i)\n if cnt == 2 * k:\n r0 = min(r0, i)\n if cnt == 2 * k + 1:\n r1 = min(r1, i)\n \n print(l0, l1, r0, r1)\n return (l1 - l0) * (r1 - r0) % (10**9 + 7)", "from math import factorial\n\nclass Solution:\n def numWays(self, s: str) -> int:\n ans = 0\n n = len(s)\n xd = s.count('1')\n if s.count('0') == 0:\n if xd % 3 != 0:\n return 0\n return 1\n if xd == 0:\n if n == 3:\n return 1\n n = n - 1\n ans = factorial(n) / factorial(n-2) / factorial(2)\n else:\n if xd % 3 != 0:\n return 0\n x = xd // 3\n ti = [x, x]\n j = 0\n while ti[0] > 0:\n if s[j] == '1':\n ti[0] -= 1\n j += 1 \n ti[0] = j\n while ti[1] > 0:\n if s[j] == '1':\n ti[1] -= 1\n j += 1 \n ti[1] = j\n\n zc = [0, 0]\n j = ti[0]\n while s[j] == '0':\n zc[0] += 1\n j += 1\n j = ti[1]\n while s[j] == '0':\n zc[1] += 1\n j += 1\n \n # print(zc)\n \n lv = 0\n rv = 0\n if zc[0] > 0:\n zc[0] += 1\n lv = factorial(zc[0]) / factorial(zc[0]-1)\n if zc[1] > 0:\n zc[1] += 1\n rv = factorial(zc[1]) / factorial(zc[1]-1)\n \n if max([lv, rv]) == 0:\n return 1\n \n if lv > 0 and rv > 0:\n ans = lv * rv\n else:\n ans = lv + rv\n # print(1)\n ans = int(ans)\n return ans % (10**9 + 7)", "class Solution:\n def numWays(self, s: str) -> int:\n ones = 0\n d = {}\n for i in range(len(s)):\n x = s[i]\n if x == '1':\n ones += 1\n d[i] = ones\n if ones %3 != 0:\n return 0\n if ones == 0:\n return (len(s)-1)*(len(s)-2)//2%(10**9+7);\n one = 0\n for i in range(len(s)-2):\n if d[i] * 3 == ones:\n one += 1\n elif d[i] * 3 > ones:\n break\n #print (\\\"one\\\", one, i)\n two = 0\n for i in range(i, len(s)-1):\n if (d[i]/2)*3 == ones:\n two += 1\n elif (d[i]/2)*3 > ones:\n break\n #print (\\\"two\\\", two)\n return (one*two)%(10**9+7)", "class Solution:\n def numWays(self, s: str) -> int:\n n = len(s)\n \n \n #calculate count\n cnt = 0\n for i in s:\n if i == '1':\n cnt += 1\n if cnt%3 != 0:\n return 0\n \n partn = cnt/3\n \n \n range1_start = n+1\n range1 = [0,n-3]\n first = 0\n last = 0\n #calculate range1\n cnt = 0\n for idx, i in enumerate(s[:n-2]):\n if i == '1':\n cnt += 1\n \n if cnt == partn:\n if first == 0:\n first = 1\n range1[0] = idx\n \n if cnt > partn:\n if last == 0:\n last = 1\n range1[1] = idx-1\n \n \n #print(range1_low, range1_high)\n \n #calculate range2\n range2 = [range1[0]+1,n-2]\n first = 0\n last = 0\n cnt = 0\n\n for idx, i in enumerate(s[range2[0]:n]):\n if i == '1':\n cnt += 1\n \n if cnt == partn:\n if first == 0:\n first = 1\n range2[0] += idx \n \n if cnt > partn:\n if last == 0:\n last = 1\n range2[1] = range1[0] + idx\n \n \n #print(range2_low, range2_high)\n# print(range1, range2) \n \n total = 0\n modulo = pow(10,9) + 7\n for i in range(range1[0], range1[1]+1):\n j = range2[0]\n if i<j and i<n and j<n:\n add = (range2[1] - range2[0] + 1)\n total += add%modulo\n #print(add, total)\n else:\n total += (range2[1] - i)%modulo\n # print(total)\n total = total%modulo\n # print(total)\n return total", "class Solution:\n def numWays(self, s: str) -> int:\n all = s.count('1')\n if all == 0:\n if len(s)%2 ==0:\n c1, c2 = int((len(s)-2)/2), len(s)-1\n else:\n c1, c2 = int((len(s)-1)/2), len(s)-2\n return self.modres(c1, c2)\n if all % 3 !=0:\n return 0\n one = all/3\n c1 = self.check(s, one)\n c2 = self.check(s[::-1], one)\n\n return self.modres(c1, c2)\n def modres(self, c1, c2):\n mod = pow(10,9)+7\n return (c1%mod*c2%mod)%mod\n\n\n def check(self, s, one):\n count = 0\n for i in range(len(s)):\n if s[i]=='1':\n count+=1\n if count == one:\n p1 = i\n elif count > one:\n p2 = i\n break\n return p2-p1\n\n\n\n", "class Solution:\n def numWays(self, s: str) -> int:\n ones = 0\n zeroes = 0\n for char in s:\n if char == '1':\n ones += 1\n else:\n zeroes += 1\n \n if ones > 0 and ones % 3 != 0:\n return 0\n \n if ones == 0:\n n = len(s) - 3\n res = 1\n diff = 2\n while n:\n res += diff\n diff += 1\n n -= 1\n return res % ((10 ** 9) + 7)\n ones_interval = ones // 3\n \n left, right = 0, 0\n \n i = 0\n temp = 0\n while i < len(s):\n if s[i] == '1':\n temp += 1\n i += 1\n if temp == ones_interval:\n break\n while i < len(s):\n if s[i] == '0':\n left += 1\n if s[i] == '1' or temp == 2 * ones_interval:\n break\n i += 1\n while i < len(s):\n if s[i] == '1':\n temp += 1\n i += 1\n if temp == 2 * ones_interval:\n break\n while i < len(s):\n if s[i] == '0':\n right += 1\n if s[i] == '1':\n break\n i += 1\n print((left, right))\n if not left:\n return (right+1) % ((10 ** 9) + 7)\n if not right:\n return (left+1) % ((10 ** 9) + 7)\n return ((left+1)*(right+1)) % ((10 ** 9) + 7)\n", "class Solution:\n def numWays(self, s: str) -> int:\n # 000 ==> 1\n # 111 ===> 1\n nums = [0]*len(s)\n cum = 0\n hh = Counter()\n for i in range(len(s)):\n if s[i] == '1':\n cum += 1\n nums[i] = cum\n hh[cum] += 1\n if cum % 3 != 0:\n return 0\n if cum == 0:\n return int(math.comb(hh[0]-1,2)) % (1000000007)\n each = cum//3 \n print((hh, each))\n return int(hh[each]*hh[2*each] % (1000000007))\n", "class Solution:\n def numWays(self, s: str) -> int:\n f = [0,0]\n ind,curr = 0,0\n target = 0\n for i in s: target+=1 if i=='1' else 0\n if target%3:\n return 0\n target = target//3\n n=len(s)\n if target == 0:\n return (math.factorial(n-1)//(math.factorial(2)*math.factorial(n-3)))%(10**9+7)\n for i in range(len(s)):\n if s[i]=='1':\n curr+=1\n if ind==1 or ind==3:\n ind+=1\n elif ind==1 or ind==3:\n f[(ind-1)//2]+=1\n if curr==target:\n ind+=1\n curr=0\n return ((f[0]+1)*(f[1]+1))%(10**9+7)", "class Solution:\n def numWays(self, s: str) -> int:\n n = s.count('1')\n m = 10**9+7\n if n%3 != 0:\n return 0\n if n == 0:\n return comb(len(s)-1,2)%m\n n//=3\n \n k = n\n i = 0\n while k:\n if s[i] == '1':\n k-=1\n i+=1\n x = 1\n while s[i] != '1':\n x+=1\n i+=1\n k = n\n while k:\n if s[i] == '1':\n k-=1\n i+=1\n y = 1\n while s[i] != '1':\n y+=1\n i+=1\n return (y*x)%m", "class Solution:\n def numWays(self, s: str) -> int:\n n = len(s)\n n1 = s.count('1')\n if n1 %3!= 0:\n return 0\n if n1 == 0:\n return int((n - 2) * (n - 1) / 2) % 1000000007\n j = 0\n k = 0\n l = 0\n m = 0\n counter1 = 0\n for i in range(0, n):\n if s[i] == '1':\n counter1 += 1\n if counter1 == n1/3:\n j = i\n if counter1 == n1 / 3 + 1:\n k = i\n if counter1 == n1 /3 *2:\n l = i\n if counter1 == n1 / 3 * 2 + 1:\n m = i\n break\n return (k - j ) * (m - l ) % 1000000007\n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n mod = pow(10, 9) + 7\n cnt = s.count('1')\n if cnt == 0: return (len(s) - 1) * (len(s) - 2) // 2 % mod\n if cnt % 3 != 0: return 0\n ones = []\n for i, x in enumerate(s):\n if x == '1': ones.append(i)\n return (ones[cnt//3] - ones[cnt//3-1]) * (ones[2*cnt//3] - ones[2*cnt//3 - 1]) % mod", "class Solution:\n def numWays(self, s: str) -> int:\n mod = 10**9+7\n cnt = s.count('1')\n if cnt == 0: \n return (len(s)-1) * (len(s)-2) // 2 % mod\n if cnt % 3 != 0: \n return 0\n ones = []\n for i,x in enumerate(s):\n if x == '1': \n ones.append(i)\n return (ones[cnt//3] - ones[cnt//3-1]) * (ones[2*cnt//3]- ones[2*cnt//3-1]) % mod\n", "class Solution:\n def numWays(self, s: str) -> int:\n count = 0\n dic = {}\n M = 10**9+7\n n = len(s)\n for i in range(n):\n if s[i]=='1':\n count+=1\n dic[count] = i\n if count%3 != 0:\n return 0\n if count == 0:\n return int((n-1)*(n-2)/2%M)\n \n x = dic[count/3+1]-dic[count/3]\n y = dic[2*count/3+1]-dic[2*count/3]\n \n return x*y%M", "class Solution:\n def numWays(self, s: str) -> int:\n d = []\n for ind,val in enumerate(s):\n if val=='1':\n d.append(ind)\n \n n = len(d)\n ndiv = n//3\n if ndiv*3!=n:\n return 0\n \n if n==0:\n n = len(s)\n res = (n-1)*(n-2)>>1\n else:\n res = (d[ndiv]-d[ndiv-1])*(d[2*ndiv]-d[2*ndiv-1])\n \n return res%(1000000007)\n", "class Solution:\n def numWays(self, s: str) -> int:\n n = s.count('1')\n M = 1000000007\n if not n:\n return ((len(s)-2)*(len(s)-1)//2)%M\n if n % 3:\n return 0\n n //= 3\n i = 0\n cnt = 0\n while i < len(s):\n if s[i] == '1':\n cnt += 1\n if cnt == n:\n break\n i += 1\n j = len(s) - 1\n cnt = 0\n while j >= 0:\n if s[j] == '1':\n cnt += 1\n if cnt == n:\n break\n j -= 1\n k = i+1\n while k < len(s) and s[k] == '0':\n k += 1\n l = j - 1\n while l > 0 and s[l] == '0':\n l -= 1\n return (j-l)*(k-i)%M", "class Solution:\n def numWays(self, s: str) -> int:\n n, ones = len(s), []\n for i, val in enumerate(s):\n if val == '1':\n ones.append(i)\n \n target = len(ones)\n if target == 0:\n return (((n-1)*(n-2)) // 2) % (10**9 + 7)\n \n if target % 3 != 0:\n return 0\n \n c = target // 3\n return ((ones[c]-ones[c-1])*(ones[2*c]-ones[2*c-1])) % (10**9 + 7)\n \n", "class Solution:\n def numWays(self, s: str) -> int:\n mod = 10 ** 9 + 7\n\n one = s.count('1')\n if one % 3: return 0\n if one == 0: return ((len(s)-1) * (len(s)-2) // 2) % mod\n\n k = one // 3\n idx_1, idx_2 = k, k + k\n cnt = a = b = 0\n for d in s:\n if d == '1':\n cnt += 1\n if cnt == idx_1: a += 1\n if cnt == idx_2: b += 1\n \n return (a * b) % mod", "class Solution:\n def numWays(self, s: str) -> int:\n mod = 10 ** 9 + 7\n c = s.count('1')\n if c % 3 != 0:\n return 0\n if c == 0:\n tot = 0\n for i in range(len(s) - 2):\n tot += len(s) - 2 - i\n return tot % mod\n lsplit = c // 3\n rsplit = lsplit * 2\n lz, rz = 1, 1\n cnt = 0\n for n in s:\n if n == '1':\n cnt += 1\n else:\n if cnt == lsplit:\n lz += 1\n elif cnt == rsplit:\n rz += 1\n return (lz * rz) % mod", "class Solution:\n def numWays(self, s: str) -> int:\n L, M = len(s), 10 ** 9 + 7\n ones = s.count('1')\n if ones == 0:\n return (L - 1) * (L - 2) // 2 % M\n if ones % 3:\n return 0\n K = ones // 3\n cnt = one_count = two_count = 0\n for c in s:\n if c == '1':\n cnt += 1\n if cnt == K:\n one_count += 1\n elif cnt == K * 2:\n two_count += 1\n \n return (one_count * two_count) % M\n\n\n", "class Solution:\n def numWays(self, s: str) -> int:\n L = len(s)\n count = collections.Counter(s)\n if count['0'] == L:\n return (L - 1) * (L - 2) // 2\n if count['1'] % 3:\n return 0\n K = count['1'] // 3\n prefix = [0] * L\n for k, v in enumerate(s):\n prefix[k] = (v == '1') + (prefix[k - 1] if k else 0)\n count1 = collections.Counter(prefix)\n return count1[K] * count1[K * 2] if count1[K * 3] > 0 else 0\n\n def numWays(self, s: str) -> int:\n L, M = len(s), 10 ** 9 + 7\n ones = s.count('1')\n if ones == 0:\n return (L - 1) * (L - 2) // 2 % M\n if ones % 3:\n return 0\n K = ones // 3\n cnt = one_count = two_count = 0\n for c in s:\n if c == '1':\n cnt += 1\n if cnt == K:\n one_count += 1\n elif cnt == K * 2:\n two_count += 1\n\n return one_count * two_count % M\n\n\n", "class Solution:\n def numWays(self, s: str) -> int:\n one_cnt = 0\n def dfs(s, num, start, left):\n ans = 0\n for i in range(start, len(s)):\n if s[i] == '1':\n one_cnt += 1\n if one_cnt == num:\n ans += dfs(s, num, i+1, left-1)\n ans = ans%(10**9+7)\n return ans\n \n one_cnt = Counter(s)['1']\n if one_cnt%3 != 0:\n return 0\n if one_cnt == 0:\n return ((len(s)-1)*(len(s)-2)//2)%(10**9+7)\n \n num = one_cnt/3\n i = 0\n cnt = 0\n while cnt < num:\n if s[i] == '1':\n cnt += 1\n i += 1\n start = i\n while i < len(s) and s[i] == '0':\n i += 1\n first = i - start + 1\n \n cnt2 = 0\n while cnt2 < num:\n if s[i] == '1':\n cnt2 += 1\n i += 1\n start2 = i\n while i < len(s) and s[i] == '0':\n i += 1\n second = i - start2 + 1\n \n ans = (first*second)%(10**9+7)\n return ans\n", "class Solution:\n def numWays(self, s: str) -> int:\n modv = 10**9+7\n countOne = 0\n for x in s:\n if x == '1':\n countOne += 1\n if countOne == 0:\n return (len(s)-2)*(len(s)-1)//2%modv\n if countOne%3 !=0:\n return 0\n count = 0\n indexOfOne = []\n markIndexWhen = [countOne//3, countOne//3+1, countOne//3*2, countOne//3*2+1]\n for i in range(len(s)):\n if s[i] == '1':\n count += 1\n if count in markIndexWhen:\n indexOfOne.append(i)\n return (indexOfOne[1]-indexOfOne[0])*(indexOfOne[-1] - indexOfOne[-2])%modv", "class Solution:\n def numWays(self, s: str) -> int:\n ones_count=s.count('1')\n n=len(s)\n if ones_count==0:\n return (((n-2)*(n-1))//2)%(10**9+7)\n if ones_count%3!=0:\n return 0\n no_of_ones=ones_count/3\n count,count_1st,count_2nd=0,0,0\n for i in s:\n if i=='1':\n count+=1\n if count==no_of_ones:\n count_1st+=1\n if count==2*no_of_ones:\n count_2nd+=1\n return (count_1st*count_2nd)%(10**9+7)", "class Solution:\n def numWays(self, s: str) -> int:\n ones = s.count('1')\n if ones % 3: return 0\n if ones == 0:\n return ((len(s)-1)*(len(s)-2)//2)%1000000007\n ones //= 3\n c = 0\n F, S = 0, 0\n for i, x in enumerate(s):\n if x == '1':\n c += 1\n if c == ones and x == '0':\n F += 1\n elif c == 2 * ones and x == '0':\n S += 1\n return ((F+1)*(S+1))%1000000007\n", "class Solution:\n def numWays(self, s: str) -> int:\n count = s.count('1')\n \n if count % 3 != 0:\n return 0\n \n length = len(s) - 1\n if count == 0:\n return (( length ) * ( length - 1 ) // 2) % 1000000007\n \n first_range, second_range, index, curr_ones, per_triplet = 1, 1, 0, 0, count // 3\n \n while index < length:\n if curr_ones > 2 * per_triplet:\n break\n \n if s[index] == '1':\n curr_ones += 1\n elif curr_ones == per_triplet:\n first_range += 1\n elif curr_ones == 2 * per_triplet:\n second_range += 1\n \n index += 1\n\n return (first_range * second_range) % 1000000007", "class Solution:\n # 300 ms 29.38%. Time and Space: O(N)\n def numWays(self, s: str) -> int:\n ones = sum(c == '1' for c in s)\n \n if ones % 3: return 0\n \n if ones == 0:\n N = len(s) - 2\n return N * (N + 1) // 2 % (10**9 + 7)\n \n target = ones // 3\n \n N = len(s)\n \n left1 = left2 = None\n cnt = 0\n for i, c in enumerate(s):\n if c == '1':\n cnt += 1\n if cnt == target:\n if left1 is None:\n left1 = i\n left2 = i\n \n right1 = right2 = None\n cnt = 0\n for i, c in enumerate(s[::-1]):\n if c == '1':\n cnt += 1\n if cnt == target:\n if right1 is None:\n right1 = N - 1 - i\n right2 = N - 1 - i\n ans = (left2 - left1 + 1) * (right1 - right2 + 1) \n return ans % (10**9 + 7)\n \n def numWays(self, s: str) -> int:\n ones = sum(c == '1' for c in s)\n \n if ones % 3: return 0\n if ones == 0:\n N = len(s) - 2\n return N * (N + 1) // 2 % (10**9 + 7)\n \n target = ones // 3\n indexes = [i for i, c in enumerate(s) if c == '1']\n ans = (indexes[target] - indexes[target - 1]) * (indexes[-target] - indexes[~target])\n return ans % (10**9 + 7)\n \n", "class Solution:\n def numWays(self, s: str) -> int:\n ttt = 10**9+7\n zs = list(map(len, s.split('1')))\n \n if not (len(zs)-1) % 3 == 0 :\n return 0\n if len(zs) == 1 :\n return (len(s)-1)*(len(s)-2)//2 % ttt\n ps = len(zs)//3\n return (zs[ps]+1)*(zs[ps*2]+1)% ttt", "class Solution:\n def numWays(self, s: str) -> int:\n count = s.count('1')\n \n if count % 3 != 0:\n return 0\n \n length = len(s) - 1\n if count == 0:\n return (( length ) * ( length - 1 ) // 2) % 1000000007\n \n first_range, second_range, index, curr_ones, per_triplet = 1, 1, 0, 0, count // 3\n \n while index < length:\n if s[index] == '1':\n curr_ones += 1\n elif curr_ones == per_triplet:\n first_range += 1\n elif curr_ones == 2 * per_triplet:\n second_range += 1\n \n index += 1\n\n return (first_range * second_range) % 1000000007", "class Solution:\n def numWays(self, s: str) -> int:\n MOD = 10 ** 9 + 7\n n = sum(1 for c in s if c == '1')\n if n % 3 != 0:\n return 0\n if n == 0:\n t = (len(s) - 1) * (len(s) - 2) // 2\n return t % MOD\n n //= 3\n \n def f(s, n):\n i = 0\n while n:\n n -= 1 if s[i] == '1' else 0\n i += 1\n k = 1\n while s[i] == '0':\n k += 1\n i += 1\n return k\n \n return f(s, n) * f(''.join(reversed(s)), n) % MOD", "class Solution:\n def numWays(self, s: str) -> int:\n ones = s.count('1')\n if ones%3!=0:\n return 0\n n = len(s)\n mod = 10**9+7\n if ones==0:\n return (n-1)*(n-2)//2%mod\n count = 0\n first_count = 0\n second_count = 0\n for cha in s:\n if cha == '1':\n count += 1\n if count == ones//3:\n first_count+=1\n elif count == ones//3*2:\n second_count+=1\n return first_count*second_count%mod", "class Solution:\n def numWays(self, s: str) -> int:\n \n def nice_multiply(a, b, mod):\n \n (a / 8) \n \n def get_total_ones():\n \n result = 0\n \n for binary in s:\n if binary == '1':\n result += 1\n \n return result\n \n total_ones = get_total_ones()\n \n if total_ones == 0:\n \n return int((len(s) - 1) * (len(s) - 2) / 2) % 1000000007\n \n if total_ones % 3 != 0:\n return 0\n \n first_cut_numbers = 0\n second_cut_numbers = 0\n \n cut_amount = total_ones / 3\n \n current_ones = 0\n \n for binary in s:\n \n if binary == '1':\n current_ones += 1\n \n if current_ones == cut_amount:\n first_cut_numbers += 1\n \n if current_ones == 2 * cut_amount:\n second_cut_numbers += 1\n \n return (first_cut_numbers * second_cut_numbers) % 1000000007", "class Solution:\n def numWays(self, s: str) -> int:\n count_map = collections.Counter(s)\n if count_map['1']%3!=0:\n return 0\n else:\n if count_map['1']==0:\n if count_map['0']<3:\n return 0\n \n if count_map['0']==3:\n return 1\n \n i = 4\n res = 1\n while i<=count_map['0']:\n res += i-2\n i+=1\n return res%1000000007\n \n else:\n i = 0\n one_count = 0\n s1_start, s1_end, s2_start, s2_end = -1,-1,-1,-1\n factor = count_map['1']//3\n while i<len(s): \n if s[i]=='1':\n one_count+=1\n if one_count==factor:\n s1_start = i\n elif one_count==(factor+1):\n s1_end = i\n \n if one_count==(factor*2):\n s2_start = i\n elif one_count==(factor*2+1):\n s2_end = i\n break\n i+=1\n return ((s1_end-s1_start)*(s2_end-s2_start))%1000000007\n", "class Solution:\n def numWays(self, s: str) -> int:\n totalones = 0\n for i in range(len(s)):\n if s[i] == '1':\n totalones+=1\n \n if totalones%3 != 0:\n return 0\n if totalones == 0:\n return ((len(s) - 2)*(len(s) - 1)//2) % (10**9 + 7)\n onesEachPart, waysFirstPart, waysSecondPart = totalones//3, 0, 0\n count = i = 0\n while count <= 2*onesEachPart:\n if s[i] == '1':\n count+=1\n if count == onesEachPart:\n waysFirstPart+=1\n elif count == 2*onesEachPart:\n waysSecondPart+=1\n i+=1\n \n return (waysFirstPart * waysSecondPart) % (10**9 + 7)\n \n \n", "from math import comb\nclass Solution:\n def numWays(self, s: str) -> int:\n n = len(s)\n k = s.count('1')\n if k%3:\n return 0\n if k == 0:\n return comb(n-1, 2) % (10**9 + 7)\n third = k // 3\n start=-1\n for i in range(third):\n start = s.find('1', start+1)\n first_last = start\n for i in range(third):\n start = s.find('1', start+1)\n second_last = start\n first_zeros = s.count('0', first_last, s.find('1', first_last+1))\n second_zeros = s.count('0', second_last, s.find('1', second_last+1))\n return ((first_zeros+1)*(second_zeros+1))% (10**9 + 7)\n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n n = len(s)\n count = 0\n cur = 0\n mod = 1000000007\n for i in range(len(s)):\n if s[i] == '1':\n cur +=1\n \n if cur == 0:\n return (((n-1)*(n-2))//2)%mod\n \n left = 0 \n lc = 0\n for i in range(n):\n if s[i] == '1':\n left+=1\n if left == cur/3:\n lc += 1\n if left > cur/3:\n break\n right = 0\n rc = 0\n for i in range(n-1,-1,-1):\n if s[i] == '1':\n right+=1\n if right == cur/3:\n rc += 1\n if right > cur/3:\n break\n return (lc*rc)%mod\n", "from math import comb\n\nclass Solution:\n def numWays(self, s: str) -> int:\n ones = 0\n for c in s:\n if c == '1':\n ones += 1\n if ones == 0:\n return comb(len(s) - 1, 2) % (10**9 + 7)\n \n if ones % 3 != 0:\n return 0\n \n i = 0\n found = 0\n a = None\n while i < len(s):\n c = s[i]\n if c == '1':\n found += 1\n if found == (ones//3):\n count = 0\n i += 1\n c = s[i]\n while c == '0':\n count += 1\n i += 1\n c = s[i]\n if not a:\n a = count + 1\n i -= 1\n else:\n return (a * (count + 1)) % (10**9 + 7)\n found = 0\n i += 1", "class Solution:\n def numWays(self, s: str) -> int:\n one, n, m = s.count('1'), len(s), 10**9 + 7\n # special case: first one for left -> n-2, first two for left -> n-3, ..., 2, 1\n # -> (n-2) + (n-3) + ... + 2 + 1 -> (n-1) * (n-2) // 2\n if not one: return (n - 1) * (n - 2) // 2 % m\n if one % 3: return 0\n curr = l = r = 0\n for c in s:\n curr += c == '1'\n l += curr == (one // 3)\n r += curr == (2 * one // 3)\n \n return l * r % m", "class Solution:\n def numWays(self, s: str) -> int:\n c = s.count('1')\n if c%3: return 0\n M = 10**9 +7\n if not c:\n return (len(s)-1)*(len(s)-2)//2%M\n \n cur = 0\n first = 0\n second = 0\n for l in s:\n if cur == c//3:\n first += 1\n elif cur == c//3*2:\n second += 1\n cur += l == '1'\n \n return first*second%M\n", "class Solution:\n def numWays(self, s: str) -> int: \n k = s.count('1')\n if k % 3 != 0: return 0\n n, M = len(s), 10**9 + 7\n if k == 0: return (n-1)*(n-2)//2 % M\n ans, cnt, i = 1, 0, 0 \n while i < len(s): \n cnt += s[i] == '1'\n if cnt in [k//3, 2*k//3]:\n j = i+1\n while j < len(s) and s[j] == '0': j += 1\n ans *= j-i\n i = j \n else: i += 1\n if cnt == 2*k//3: break\n return ans % M\n \n \n", "import collections\n\nclass Solution:\n def numWays(self, s):\n count = collections.Counter(s)\n if count['1'] == 0:\n return (len(s) - 1) * (len(s) - 2) // 2 % (10**9 + 7)\n \n if count['1'] < 3 or count['1'] % 3 != 0:\n return 0\n \n ans = 1\n cur = 0\n expand = 1\n find = count['1'] // 3\n slot = 0\n \n for ss in s:\n if slot == 2:\n return ans * expand\n\n if find > cur:\n # collecting 1\n if ss == '1':\n cur += 1\n else:\n # collecting 0\n # set to next slot if encounter 1\n if ss == '0':\n expand += 1\n else:\n ans *= expand\n expand = 1\n cur = 1\n slot += 1\n \n ans *= expand\n return ans % (10**9 + 7)", "class Solution:\n def numWays(self, s: str) -> int:\n n = s.count('1')\n if n%3!=0:\n return 0\n n = int(n/3)\n if n==0:\n ans = 0\n for i in range(1,len(s)-1):\n ans += len(s)-1-i\n return ans%(10**9 + 7)\n else:\n a = s.split('1')\n return (len(a[n])+1) * (len(a[2*n])+1)%(10**9 + 7)\n", "# 2:52 if num ones % 3 != 0 can't be done\n# identify groups, find 0s between them\n# 1 00 1 00 1\n# |00, 0|0, 00|\n# 1 n 1 m 1\n# (n + 1)*(m + 1)\n# 0 0000 0 -> |0000 (|000, 0|00, 00|0, 000|), 0|000, 00|00, 000|0, 0000|\n# 0 000 0 -> |0|00, |00|0, |000|, 0|0|0, 0|00|, 00|0|\nclass Solution:\n def numWays(self, s: str) -> int:\n count = len(list([char for char in s if char == '1']))\n if count % 3 != 0:\n return 0\n \n if count / 3 == 0:\n zeroes_in_middle = len(s) - 2\n total = 0\n for marker in range(zeroes_in_middle + 1):\n total += (zeroes_in_middle - marker) % (10**9 + 7)\n return total % (10**9 + 7)\n \n def get_zeroes(s, count):\n num_ones = 0\n zeroes = {'first': 0, 'second': 0}\n for bit in s:\n if bit == '1':\n num_ones += 1\n else:\n if num_ones == count:\n zeroes['first'] += 1\n elif num_ones == 2*count:\n zeroes['second'] += 1\n return zeroes\n \n \n zeroes = get_zeroes(s, count / 3)\n \n # print(zeroes)\n \n if not zeroes['first'] and not zeroes['second']:\n return 1\n elif zeroes['first'] and not zeroes['second']:\n return zeroes['first'] + 1\n elif zeroes['second'] and not zeroes['first']:\n return zeroes['second'] + 1\n \n return (zeroes['first'] + 1)*(zeroes['second'] + 1) % (10**9 + 7)\n", "class Solution:\n def numWays(self, s: str) -> int:\n md = 10**9 + 7\n res = 0\n n = len(s)\n n1 = sum(map(lambda x1: 1 if x1 == '1' else 0, s))\n if n > 2 and n1 % 3 == 0:\n x = n1 // 3\n x2 = x << 1\n if x == 0:\n res = (n - 1) * (n - 2) // 2\n else:\n cnt,c1,c2 = 0,0,0\n for i,c in enumerate(s):\n if c == '1':\n cnt += 1\n if cnt == x:\n c1 += 1\n elif cnt == x2:\n c2 += 1\n res = c1 * c2\n return res % md", "class Solution:\n def numWays(self, s: str) -> int:\n N, ones = len(s), 0\n for c in s:\n ones += 1 if c == '1' else 0\n \n if ones % 3 == 1:\n return 0\n \n if ones == 0:\n return (((N-1) * (N-2)) >> 1) % (10**9 + 7)\n \n want = ones // 3\n c1, c2 = 0, 0\n p, suff = 0, 0\n for c in s:\n if c == '1': c1 += 1\n if c1 == want:\n p += 1\n \n for c in reversed(s):\n if c == '1': c2+=1\n if c2==want:\n suff+=1\n \n return (p * suff) % (10**9 + 7)\n \n", "class Solution:\n def numWays(self, s: str) -> int:\n ones = sum(c == '1' for c in s)\n if ones % 3:\n return 0\n if ones == 0:\n N = len(s) - 2\n return N * (N + 1) // 2 % (10**9 + 7)\n \n target = ones // 3\n \n N = len(s)\n \n left1 = left2 = None\n cnt = 0\n for i, c in enumerate(s):\n if c == '1':\n cnt += 1\n if cnt == target:\n if left1 is None:\n left1 = i\n left2 = i\n \n right1 = right2 = None\n cnt = 0\n for i, c in enumerate(s[::-1]):\n if c == '1':\n cnt += 1\n if cnt == target:\n if right1 is None:\n right1 = N - 1 - i\n right2 = N - 1 - i\n ans = (left2 - left1 + 1) * (right1 - right2 + 1) \n return ans % (10**9 + 7)\n \n", "class Solution:\n\n def numWays(self, s: str) -> int:\n L, M = len(s), 10 ** 9 + 7\n ones = s.count('1')\n if ones == 0:\n return (L - 1) * (L - 2) // 2 % M\n if ones % 3:\n return 0\n K = ones // 3\n cnt = one_count = two_count = 0\n for c in s:\n if c == '1':\n cnt += 1\n if cnt == K:\n one_count += 1\n elif cnt == K * 2:\n two_count += 1\n\n return one_count * two_count % M\n\n def numWays(self, s: str) -> int:\n L, M = len(s), 10**9+7\n count = collections.Counter(s)\n if count['0'] == L:\n return (L - 1) * (L - 2) // 2 % M\n if count['1'] % 3:\n return 0\n K = count['1'] // 3\n prefix = [0] * L\n for k, v in enumerate(s):\n prefix[k] = (v == '1') + (prefix[k - 1] if k else 0)\n count1 = collections.Counter(prefix)\n return count1[K] * count1[K * 2] % M\n\n", "def findall(p, s):\n '''Yields all the positions of\n the pattern p in the string s.'''\n i = s.find(p)\n while i != -1:\n yield i\n i = s.find(p, i+1)\n\ndef choose(n, k):\n c = 1\n if k > n // 2:\n k = n - k\n for i in range(1, k + 1):\n c = c * (n - i + 1) // i\n return c\n\ndef modulo(n):\n return n % (10 ** 9 + 7)\n\nclass Solution:\n \n def numWays(self, s: str) -> int:\n n = len(s)\n c = s.count('1')\n if c % 3 != 0:\n return 0\n cp = c // 3 # count in each part\n if cp == 0:\n #special case, no 1, chosse 2 separators in the (n-1) possible spaces\n return modulo(choose(n - 1, 2))\n # find the size n1 of the substring between (cp+1)-th and cp-th occurrances of 1,\n # and the size n2 of the subsring betwwen (cp*2+1)-th and (cp*2)-th occurrances of 1\n indices = list(findall('1', s))\n n1 = indices[cp] - indices[cp - 1] - 1\n n2 = indices[cp*2] - indices[cp*2 - 1] - 1\n # find one separater in (n1 + 1) possible spaces, \n # and one separater in (n2 + 1) possible spaces \n result = 0\n if n1 == 0:\n result = n2 + 1\n elif n2 == 0:\n result = n1 + 1\n else:\n result = (n1 + 1) * (n2 + 1)\n return(modulo(result))\n", "class Solution:\n CONST = 10**9 + 7\n def numWays(self, s: str) -> int:\n n = len(s)\n num_ones = 0\n for c in s:\n if c == '1':\n num_ones += 1\n if num_ones % 3 != 0:\n return 0\n if num_ones == 0:\n return ((n-1) * (n-2) // 2) % self.CONST\n \n first, second = 0, 0\n num_ones_sofar, cutoff = 0, num_ones // 3\n # print(cutoff)\n for i in range(n):\n num_ones_sofar += s[i] == '1'\n if num_ones_sofar < cutoff:\n pass\n elif cutoff <= num_ones_sofar < cutoff + 1:\n first += 1\n elif 2 * cutoff <= num_ones_sofar < 2 * cutoff + 1:\n second += 1 \n else:\n pass\n # print(first, second)\n return (first * second) % self.CONST\n \n \n \n", "class Solution:\n \n # from collections import Counter\n \n CONST = 1_000_000_000 + 7\n \n def numWays(self, s: str) -> int:\n n = len(s)\n # edge cases \n num_ones = 0\n for c in s:\n if c == '1':\n num_ones += 1 \n if num_ones % 3 != 0:\n return 0\n if num_ones == 0:\n return ((n-1) * (n-2) // 2) % self.CONST\n \n # general case \n # \\\"100100010100110\\\"\n # 1001| 00010100110\n # 10010| 0010100110 \n # 100100| 010100110 \n # 1001000| 10100110\n \n # 0 0\n # 0 0\n # 0 0\n # 1 0\n # 2 0\n # 3 0\n # 4 0\n # 4 1\n # 4 2\n # 4 2\n # 4 2\n # 4 2\n # 4 2\n # 4 2\n # 4 2\n \n num_ones_per_chunk = num_ones // 3\n first, second = 0, 0\n num_ones_sofar = 0\n \n # dumb version\n for idx, c in enumerate(s):\n num_ones_sofar += c == '1'\n if num_ones_sofar < num_ones_per_chunk:\n pass\n elif num_ones_per_chunk <= num_ones_sofar < num_ones_per_chunk + 1:\n first += 1\n elif 2 * num_ones_per_chunk <= num_ones_sofar < 2 * num_ones_per_chunk + 1:\n second += 1\n else:\n pass\n # print(s[:idx+1])\n # print(first, second)\n # print('')\n \n # # smart version\n # for c in s:\n # num_ones_sofar += c == '1'\n # if num_ones_sofar == num_ones_per_chunk:\n # first += 1\n # elif num_ones_sofar == 2 * num_ones_per_chunk:\n # second += 1\n \n # \\\"10101\\\"\n # \\\"1001\\\"\n # \\\"000000\\\"\n return (first * second) % self.CONST\n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n n = len(s)\n mod = 10 ** 9 + 7\n nums1 = sum(1 if s[i] == '1' else 0 for i in range(n))\n if nums1 % 3 != 0:\n return 0\n num_per = nums1 // 3\n if num_per == 0:\n res = 0\n for i in range(1, n - 1):\n res = (res + (n - 1 - i)) % mod\n return res\n def find_end(start, num1):\n count = 0\n index = start\n while index < n and count < num1:\n if s[index] == '1':\n count += 1\n index += 1\n return index - 1\n end1 = find_end(0, num_per)\n i = end1 + 1\n while s[i] != '1':\n i += 1\n end2 = find_end(i, num_per)\n j = end2 + 1\n while s[j] != '1':\n j += 1\n return ((i - end1) * (j - end2)) % mod\n", "from functools import reduce, lru_cache\n\n\nclass Solution:\n def numWays(self, arr: str) -> int:\n arr = list(arr)\n count = reduce((lambda accu, element: accu +\n (1 if element == '1' else 0)), arr, 0)\n if count % 3 != 0:\n return 0\n if count == 0:\n return ((len(arr) - 1) * (len(arr) - 2) >> 1) % (10**9 + 7)\n\n target = count / 3\n\n accu = 0\n ways_of_first_cut = 0\n ways_of_second_cut = 0\n for c in arr:\n if c == '1':\n accu += 1\n if accu == target:\n ways_of_first_cut += 1\n elif accu == target * 2:\n ways_of_second_cut += 1\n\n return (ways_of_first_cut * ways_of_second_cut) % (10**9 + 7)\n", "class Solution:\n def numWays(self, s: str) -> int:\n l = len(s)\n total_cnt = 0\n for i in range(l):\n if s[i] == '1':\n total_cnt += 1\n if total_cnt % 3:\n return 0\n \n cnt = total_cnt // 3\n if total_cnt == 0:\n return ((len(s) - 1) * (len(s) - 2) // 2) % (10**9 + 7)\n \n c1, c2 = 1, 1\n s1, s2 = s, s[::-1]\n idx = 0\n i1 = self.findIdx(s1, cnt)\n i2 = self.findIdx(s2, cnt)\n \n while s1[i1] != '1':\n c1 += 1\n i1 += 1\n while s2[i2] != '1':\n c2 += 1\n i2 += 1\n return c1 * c2 % (10**9 + 7)\n \n\n def findIdx(self, s, cnt):\n c, idx = 0, 0\n while idx < len(s) and c < cnt:\n if s[idx] == '1':\n c += 1\n idx += 1\n \n return idx\n \n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n cnt=0\n ans=0\n n=len(s)\n m=1000000007\n for i in range(len(s)):\n if(s[i]=='1'):\n cnt+=1\n if(cnt==0):\n ans=((n-1)*(n-2))/2\n ans=ans%m\n return int(ans)\n else:\n hm=dict()\n cnt=0\n ans=0\n for i in range(len(s)):\n if(s[i]=='1'):\n cnt+=1\n if cnt not in hm.keys():\n hm[cnt]=1\n else:\n hm[cnt]=hm[cnt]+1\n if(cnt%3!=0):\n return 0\n else:\n first=hm[cnt/3]\n tthird=(cnt/3)*2\n second=hm[tthird]\n ans=((first%m)*(second%m))%m \n return int(ans)", "class Solution:\n def numWays(self, s: str) -> int:\n l = len(s)\n total_cnt = 0\n for i in range(l):\n if s[i] == '1':\n total_cnt += 1\n if total_cnt % 3:\n return 0\n \n cnt = total_cnt // 3\n if total_cnt == 0:\n return ((len(s) - 1) * (len(s) - 2) // 2) % (10**9 + 7)\n \n c1, c2 = 1, 1\n s1, s2 = s, s[::-1]\n idx = 0\n i1 = self.findIdx(s1, cnt)\n i2 = self.findIdx(s2, cnt)\n \n while s1[i1] != '1':\n c1 += 1\n i1 += 1\n while s2[i2] != '1':\n c2 += 1\n i2 += 1\n return (c1 * c2) % (10**9 + 7)\n \n\n def findIdx(self, s, cnt):\n c, idx = 0, 0\n while idx < len(s) and c < cnt:\n if s[idx] == '1':\n c += 1\n idx += 1\n \n return idx\n \n \n \n", "class Solution:\n def numWays(self, s: str) -> int:\n if not s or len(s) < 3 or s.count('1') % 3 != 0:\n return 0\n \n mod = pow(10, 9) + 7\n n = s.count('1')\n if n == 0:\n return (len(s) - 1) * (len(s) - 2) // 2 % mod\n \n c1, c2, i = 0, 0, 0\n for ch in s:\n if ch == '1':\n i += 1\n elif ch == '0' and n / 3 <= i < n / 3 + 1:\n c1 += 1\n elif ch == '0' and n*2 / 3 <= i < n*2 / 3 + 1:\n c2 += 1\n return (c1 + 1) * (c2 + 1) % mod", "class Solution:\n def numWays(self, s: str) -> int:\n MOD = 10 ** 9 + 7\n ones = 0\n for c in s:\n ones += 1 if c == '1' else 0\n n = len(s)\n \n if ones % 3 != 0:\n return 0\n if ones == 0:\n return ((n - 2) * (n - 1) // 2) % MOD\n \n ones = ones // 3\n firstLeft = firstRight = - 1\n secondLeft = secondRight = -1\n count = 0\n for i in range(n):\n if s[i] == '1':\n count += 1\n \n if count == ones and firstLeft == -1:\n firstLeft = i\n if count == ones + 1 and firstRight == -1:\n firstRight = i\n \n if count == 2 * ones and secondLeft == -1:\n secondLeft = i\n if count == 2 * ones + 1 and secondRight == -1:\n secondRight = i\n \n return ((firstRight - firstLeft) * (secondRight - secondLeft)) % MOD", "import math\nclass Solution:\n def numWays(self, s: str) -> int:\n dict1 = dict()\n cur = 0\n for i in range(len(s)):\n if(s[i] == '1'):\n dict1[cur+1] = i\n cur += 1\n if(cur%3 != 0):\n return 0\n if(cur == 0):\n len_s = len(s)-1\n return (math.factorial(len_s)//(math.factorial(len_s-2)*math.factorial(2)))%(10**9 + 7)\n \n div = cur//3\n return ((dict1[div+1] - dict1[div])*(dict1[div*2 + 1] - dict1[div*2]))%(10**9 + 7)", "class Solution:\n def numWays(self, s: str) -> int:\n cnt = s.count('1')\n if cnt % 3 != 0:\n return 0\n if cnt == 0:\n ans = 0\n for i in range(1, len(s) - 1):\n ans += i\n return ans % (10**9 + 7)\n \n l = r = 1\n c = 0\n \n for i, n in enumerate(s):\n c += 1 if n == '1' else 0\n \n if c == cnt / 3 and n == '0':\n l += 1\n elif c == (cnt / 3) * 2 and n == '0':\n r += 1\n \n print((l, r))\n return l * r % (10**9 + 7)\n", "\nclass Solution:\n \n import math\n \n def C(self, N,r):\n return int(math.factorial(N)/(math.factorial(r)*math.factorial(N-r)))\n \n def numWays(self, s: str) -> int:\n counter=s.count('1')\n if counter%3!=0:\n return 0\n if counter==0:\n return self.C(len(s)-1, 2) % (10**9+7) \n \n \n index=[]\n cnt=0\n for ind,char in enumerate(s):\n if char=='1':\n cnt+=1\n if cnt==counter//3:\n index.append(ind)\n \n if cnt==(counter//3)+1:\n index.append(ind)\n \n if cnt==(2*counter//3):\n index.append(ind)\n \n if cnt==(2*counter//3)+1:\n index.append(ind)\n \n m=index[1]-index[0]\n n=index[3]-index[2]\n return m*n % (10**9+7) \n \n"]
{"fn_name": "numWays", "inputs": [["\"10101\""]], "outputs": [4]}
interview
https://leetcode.com/problems/number-of-ways-to-split-a-string/
class Solution: def numWays(self, s: str) -> int:
[ 22043, 264, 7868, 914, 274, 320, 64, 914, 30606, 1172, 315, 364, 15, 594, 323, 364, 16, 594, 701, 4102, 896, 646, 6718, 274, 4102, 18122, 220, 18, 2477, 39433, 9069, 274, 16, 11, 274, 17, 11, 274, 18, 320, 82, 16, 10, 274, 17, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
766
Chef has an array of N natural numbers. Cheffina challenges the chef to choose the two numbers from the array and following the condition as the area of the rectangle formed from the two numbers is maximum. Cheffina also asks the chef to choose two numbers different from the previous two to form the rectangle with a minimum area. -----Input:----- - First-line will contain $T$, the number of test cases. Then the test cases follow. - Each test case contains a single line of input, $N$. - N space-separated natural numbers. -----Output:----- For each test case, output in one line answers maximum and minimum area of a rectangle. -----Constraints----- - $1 \leq T \leq 10$ - $4 \leq N \leq 10^5$ - $1 \leq arr[i] \leq 10^6$ -----Sample Input:----- 1 5 4 2 1 5 3 -----Sample Output:----- 20 2
["import sys\r\nimport math\r\nimport bisect\r\nfrom sys import stdin,stdout\r\nfrom math import gcd,floor,sqrt,log\r\nfrom collections import defaultdict as dd\r\nfrom bisect import bisect_left as bl,bisect_right as br\r\n\r\nsys.setrecursionlimit(100000000)\r\n\r\nii =lambda: int(input())\r\nsi =lambda: input()\r\njn =lambda x,l: x.join(map(str,l))\r\nsl =lambda: list(map(str,input().strip()))\r\nmi =lambda: map(int,input().split())\r\nmif =lambda: map(float,input().split())\r\nlii =lambda: list(map(int,input().split()))\r\n\r\nceil =lambda x: int(x) if(x==int(x)) else int(x)+1\r\nceildiv=lambda x,d: x//d if(x%d==0) else x//d+1\r\n\r\nflush =lambda: stdout.flush()\r\nstdstr =lambda: stdin.readline()\r\nstdint =lambda: int(stdin.readline())\r\nstdpr =lambda x: stdout.write(str(x))\r\n\r\nmod=1000000007\r\n\r\n\r\n#main code\r\nfor _ in range(ii()):\r\n n=ii()\r\n arr=lii()\r\n arr.sort()\r\n ma=arr[-1]*arr[-2]\r\n mi=arr[0]*arr[1]\r\n print(ma,mi)", "for _ in range(int(input())):\n n=int(input())\n a=list(map(int,input().split()))\n a.sort()\n print(a[-1]*a[-2],a[0]*a[1])", "# cook your dish here\ntestcases = int(input())\nfor x in range(testcases):\n size = int(input())\n li = list(map(int,input().split()))\n highmax = max(li)\n lowmin = min(li)\n new_list = set(li)\n new_list.remove(max(new_list))\n new_list.remove(min(new_list))\n secondhighmax = max(new_list)\n secondmin = min(new_list)\n print(highmax*secondhighmax, lowmin*secondmin)", "# cook your dish here\nn=int(input())\nfor _ in range(n):\n k=int(input())\n a=[int(i) for i in input().split()]\n a.sort()\n print(a[k-1]*a[k-2],a[0]*a[1])", "# cook your dish here\nt = int(input())\nfor i in range(0, t):\n n = int(input())\n l = list(map(int, input().split()))\n l.sort()\n p = set(l)\n pp = list(p)\n maxx = pp[n-1] * pp[n-2]\n minn = pp[0] * pp[1]\n print(maxx, minn)", "for _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n mini,maxi=l[0]*l[1],l[-1]*l[-2]\n print(maxi,mini)", "for _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n mini,maxi=l[0]*l[1],l[-1]*l[-2]\n print(maxi,mini)", "# cook your dish here\nt= int(input())\nfor _ in range(t):\n a=int(input())\n b=list(map(int,input().split()))\n b.sort()\n print(b[-1]*b[-2],b[0]*b[1])\n", "import itertools\r\nt=int(input())\r\nfor i in range(t):\r\n n=int(input())\r\n a=[int(a) for a in input().split()]\r\n a.sort()\r\n print(a[len(a)-1]*a[len(a)-2],a[0]*a[1])", "# cook your dish here\nfor i in range(int(input())):\n\n N = int(input())\n arr = sorted(list(map(int,input().split())))\n\n print(arr[-1]* arr[-2],arr[0]*arr[1],sep=\" \")\n", "from sys import *\ninput=stdin.readline\nfor u in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n print(l[-1]*l[-2],l[0]*l[1])\n", "for _ in range(int(input())):\r\n n=input()\r\n ar=list(map(int,input().split()))\r\n ar.sort()\r\n print(ar[-1]*ar[-2],ar[0]*ar[1])", "for _ in range(int(input())):\n n = int(input())\n ls = list(map(int,input().split()))\n ls = sorted(ls)\n \n print(ls[-2]*ls[-1],end=\" \")\n \n print(ls[0]*ls[1])\n ", "# cook your dish here\nt = int(input())\nwhile t>0:\n n = int(input())\n list_n = list(map(int, input().split()))\n list_n = sorted(list_n)\n print(list_n[-1]*list_n[-2], list_n[0]*list_n[1])\n t-=1", "t = int(input())\nfor _ in range(t):\n n = int(input())\n l = list(map(int,input().split()))\n l.sort()\n a = l[0]*l[1]\n b = l[-1]*l[-2]\n print(b,a)\n", "# cook your dish here\n# cook your dish here\nfor i in range(int(input())):\n N=int(input())\n Arr=list(map(int,input().split()))\n Arr.sort()\n print(Arr[-1]*Arr[-2],Arr[0]*Arr[1])\n", "# cook your dish here\nT=int(input())\nfor _ in range(T):\n n=int(input())\n arr=list(map(int,input().split()))\n arr.sort()\n print(arr[-1]*arr[-2],arr[0]*arr[1])", "t = int(input())\n\nfor _ in range(t):\n n = int(input())\n l = list(map(int,input().split()))\n \n l = sorted(l)\n \n print(l[-1]*l[-2],end=' ')\n print(l[0]*l[1])", "# cook your dish here\nn=int(input())\nfor _ in range(n):\n k=int(input())\n a=[int(i) for i in input().split()]\n a.sort()\n print(a[k-1]*a[k-2],a[0]*a[1])", "for _ in range(int(input())):\r\n n,s,s2= int(input()),1,1\r\n arr = list(map(int,input().split()))\r\n s = s*max(arr)\r\n arr.remove(max(arr))\r\n s*=max(arr)\r\n s2 *=min(arr)\r\n arr.remove(min(arr))\r\n s2*=min(arr)\r\n print(s,s2)", "# cook your dish here\nfor _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n print(l[-1]*l[-2],end=\" \")\n print(l[0]*l[1])\n", "for _ in range(int(input())):\n n=int(input())\n a=list(map(int,input().split()))\n a.sort()\n print(a[-1]*a[-2],a[0]*a[1])"]
{"inputs": [["1", "5", "4 2 1 5 3"]], "outputs": [["20 2"]]}
interview
https://www.codechef.com/PEND2020/problems/ANITGUY7
[ 93903, 702, 458, 1334, 315, 451, 5810, 5109, 13, 8436, 542, 2210, 11513, 279, 29706, 311, 5157, 279, 1378, 5109, 504, 279, 1334, 323, 2701, 279, 2971, 438, 279, 3082, 315, 279, 22756, 14122, 504, 279, 1378, 5109, 374, 7192, 13, 8436, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,612
Math hasn't always been your best subject, and these programming symbols always trip you up! I mean, does `**` mean *"Times, Times"* or *"To the power of"*? Luckily, you can create the function `expression_out()` to write out the expressions for you! The operators you'll need to use are: ```python { '+': 'Plus ', '-': 'Minus ', '*': 'Times ', '/': 'Divided By ', '**': 'To The Power Of ', '=': 'Equals ', '!=': 'Does Not Equal ' } ``` These values will be stored in the preloaded dictionary `OPERATORS` just as shown above. But keep in mind: INVALID operators will also be tested, to which you should return `"That's not an operator!"` And all of the numbers will be `1` to`10`! Isn't that nice! Here's a few examples to clarify: ```python expression_out("4 ** 9") == "Four To The Power Of Nine" expression_out("10 - 5") == "Ten Minus Five" expression_out("2 = 2") == "Two Equals Two" ``` Good luck!
["op = {'+': 'Plus ','-': 'Minus ','*': 'Times ', '/': 'Divided By ', '**': 'To The Power Of ', '=': 'Equals ', '!=': 'Does Not Equal '}\nnum = {'1': 'One', '2': 'Two', '3': 'Three', '4': 'Four', '5': 'Five', '6': 'Six', '7':'Seven', '8': 'Eight', '9': 'Nine', '10': 'Ten'}\n \ndef expression_out(e):\n a, b, c = e.split()\n try : return num[a]+' '+op[b]+num[c]\n except : return 'That\\'s not an operator!'"]
{"fn_name": "expression_out", "inputs": [["1 + 3"], ["2 - 10"], ["6 ** 9"], ["5 = 5"], ["7 * 4"], ["2 / 2"], ["8 != 5"]], "outputs": [["One Plus Three"], ["Two Minus Ten"], ["Six To The Power Of Nine"], ["Five Equals Five"], ["Seven Times Four"], ["Two Divided By Two"], ["Eight Does Not Equal Five"]]}
introductory
https://www.codewars.com/kata/57e2afb6e108c01da000026e
def expression_out(exp):
[ 8815, 12492, 944, 2677, 1012, 697, 1850, 3832, 11, 323, 1493, 15473, 17738, 2677, 8411, 498, 705, 2219, 40, 3076, 11, 1558, 1565, 334, 63, 3076, 91204, 18889, 11, 8523, 61593, 476, 91204, 1249, 279, 2355, 315, 61593, 1939, 95750, 11, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
253
You have n super washing machines on a line. Initially, each washing machine has some dresses or is empty. For each move, you could choose any m (1 ≤ m ≤ n) washing machines, and pass one dress of each washing machine to one of its adjacent washing machines at the same time . Given an integer array representing the number of dresses in each washing machine from left to right on the line, you should find the minimum number of moves to make all the washing machines have the same number of dresses. If it is not possible to do it, return -1. Example1 Input: [1,0,5] Output: 3 Explanation: 1st move: 1 0 1 1 4 2nd move: 1 2 1 3 3rd move: 2 1 2 2 2 Example2 Input: [0,3,0] Output: 2 Explanation: 1st move: 0 1 2 0 2nd move: 1 2 --> 0 => 1 1 1 Example3 Input: [0,2,0] Output: -1 Explanation: It's impossible to make all the three washing machines have the same number of dresses. Note: The range of n is [1, 10000]. The range of dresses number in a super washing machine is [0, 1e5].
["class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n if sum(machines) % len(machines) != 0:\n return -1\n mean = sum(machines) // len(machines)\n cum, step = 0, 0\n for x in machines:\n cum += x - mean\n step = max(step, abs(cum), x-mean)\n return step", "class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n total = sum(machines)\n length = len(machines)\n if total%length!=0:\n return -1\n \n avg = int(total/length)\n cum = 0\n target = 0\n result = 0\n for m in machines:\n cum+=m\n target+=avg\n max_share = m-avg # example [0,3,0] 3 must output 1 to one side at a time, so it needs 2 steps: one for each side.\n result = max(result, abs(target-cum), max_share)\n # When cum-target<0, it means right side must transfer abs(cum-target) to the left side\n # example: [0, 0, 11, 5], avg=4, at the second 0, cum=0, target=2*avg=8, we need to transfer 8-0=8 to the left side\n # the second 0 is the only interface to the right side, so the right side need 8 steps to fill the left side\n \n # When cum-target>0, it means left side must transfer abs(cum-target) to the right side\n # example: [4,3,2,1,0], avg=2, at 3, cum=7, target=2*avg=4, we need to transfer 7-4=3 to the right side\n # 3 is the only interface to the right side, so the left side need 3 steps to fill the right side\n return result;\n", "class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\" \n N = len(machines)\n if sum(machines)%N!=0: return -1\n avg = sum(machines)//N\n \n result = 0\n toNext = 0\n for i in range(N):\n fromPrev = toNext\n toNext = fromPrev+machines[i]-avg\n if fromPrev<0 and toNext>0:\n result = max(result,-fromPrev+toNext)\n else:\n result = max(result,abs(fromPrev),abs(toNext))\n \n return result\n \n", "class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n n = len(machines)\n if sum(machines) % n != 0:\n return -1\n \n s = sum(machines)\n k = s//n\n \n presum = 0\n right = 0\n max_net = 0\n for i in range(n):\n presum += machines[i]\n left = -right\n right = presum - k*(i+1)\n net = left + right\n \n max_net = max(max_net, abs(left), abs(right), net)\n \n return max_net\n \n \n \n", "class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n sum_before = [0]\n i = 0\n for m in machines:\n sum_before.append(m + sum_before[i])\n i+=1\n \n if sum_before[len(machines)]%len(machines)!=0:\n return -1\n \n average = int(sum_before[len(machines)]/len(machines))\n \n result = 0\n \n i = 0\n for m in machines:\n left_require = average * i - sum_before[i] \n right_require = average * (len(machines)-i-1) - (sum_before[len(machines)] - sum_before[i+1])\n if left_require > 0 and right_require > 0:\n max_tran = left_require + right_require\n else:\n max_tran = max(abs(left_require), abs(right_require))\n result = max(result, max_tran)\n i+=1\n \n return result", "class Solution:\n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n total = sum(machines)\n length = len(machines)\n if total%length!=0:\n return -1\n \n avg = int(total/length)\n cnt = 0\n result = 0\n for m in machines:\n cnt += m-avg; #load-avg is \"gain/lose\"\n result = max(result, abs(cnt), m-avg)\n return result;\n", "class Solution:\n def findMinMoves(self,machines):\n s = sum(machines)\n l = len(machines)\n if s%l: return -1\n a, c, ans = int(s/l), 0, 0\n for x in machines:\n y = x - a\n c += y\n ans = max(ans, y, abs(c))\n return ans\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"", "class Solution:\n def __init__(self):\n pass\n \n def findMinMoves(self, machines):\n \"\"\"\n :type machines: List[int]\n :rtype: int\n \"\"\"\n \n N = len(machines)\n if N == 0:\n return 0\n \n val_sum = sum(machines)\n if val_sum%N != 0:\n return -1\n \n val_each = val_sum//N\n \n go_left, go_right, net_change, max_step = 0, 0, 0, 0\n for i in range(N):\n go_left = -go_right\n go_right = go_right + machines[i] - val_each\n net_change = go_left + go_right\n step = max(abs(go_left), abs(go_right), net_change)\n max_step = max(max_step, step)\n \n return max_step"]
{"fn_name": "findMinMoves", "inputs": [[[1, 0, 5]]], "outputs": [3]}
interview
https://leetcode.com/problems/super-washing-machines/
class Solution: def findMinMoves(self, machines: List[int]) -> int:
[ 2610, 614, 308, 2256, 27686, 12645, 389, 264, 1555, 13, 58556, 11, 1817, 27686, 5662, 702, 1045, 36762, 476, 374, 4287, 13, 14731, 2461, 1817, 3271, 11, 498, 1410, 5157, 894, 296, 320, 16, 37294, 296, 37294, 308, 8, 27686, 12645, 11, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,211
You are going to be given a word. Your job will be to make sure that each character in that word has the exact same number of occurrences. You will return `true` if it is valid, or `false` if it is not. For example: `"abcabc"` is a valid word because `'a'` appears twice, `'b'` appears twice, and`'c'` appears twice. `"abcabcd"` is **NOT** a valid word because `'a'` appears twice, `'b'` appears twice, `'c'` appears twice, but `'d'` only appears once! `"123abc!"` is a valid word because all of the characters only appear once in the word. For this kata, capitals are considered the same as lowercase letters. Therefore: `'A' == 'a'` . #Input A string (no spaces) containing `[a-z],[A-Z],[0-9]` and common symbols. The length will be `0 < string < 100`. #Output `true` if the word is a valid word, or `false` if the word is not valid.
["from collections import Counter\n\ndef validate_word(word):\n return len(set(Counter(word.lower()).values())) == 1", "from collections import Counter\n\n\ndef validate_word(word):\n return 1 == len(set(Counter(word.upper()).values()))\n", "def validate_word(word):\n word = word.lower()\n return len(set(word.count(c) for c in word)) == 1", "from collections import Counter\nvalidate_word=lambda word: len(set(Counter(word.lower()).values())) == 1", "from collections import Counter\n\ndef validate_word(word):\n count = Counter(word.lower())\n \n return len(set(count.values())) == 1", "validate_word = lambda w: len(set(w.lower().count(e) for e in set(w.lower())))==1", "def validate_word(word):\n #your code here\n word = word.lower()\n c_count = word.count(word[0])\n for c in word:\n if word.count(c) != c_count:\n return False\n return True", "def validate_word(word):\n word = word.lower()\n return all(word.count(i) == word.count(word[0]) for i in word)\n", "def validate_word(word):\n word = word.lower()\n arr = list(set(word))\n for i in range(1,len(arr)):\n if word.count(arr[i]) != word.count(arr[i-1]):\n return False\n return True"]
{"fn_name": "validate_word", "inputs": [["abcabc"], ["Abcabc"], ["AbcabcC"], ["AbcCBa"], ["pippi"], ["?!?!?!"], ["abc123"], ["abcabcd"], ["abc!abc!"], ["abc:abc"]], "outputs": [[true], [true], [false], [true], [false], [true], [true], [false], [true], [false]]}
introductory
https://www.codewars.com/kata/56786a687e9a88d1cf00005d
def validate_word(word):
[ 2610, 525, 2087, 311, 387, 2661, 264, 3409, 13, 4615, 2618, 686, 387, 311, 1281, 2704, 429, 1817, 3668, 304, 429, 3409, 702, 279, 4734, 1852, 1372, 315, 56015, 13, 1446, 686, 470, 1565, 1866, 63, 421, 432, 374, 2697, 11, 476, 1565, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,818
# Convert Improper Fraction to Mixed Number You will need to convert an [improper fraction](https://www.mathplacementreview.com/arithmetic/fractions.php#improper-fractions) to a [mixed number](https://www.mathplacementreview.com/arithmetic/fractions.php#mixed-number). For example: ```python get_mixed_num('18/11') # Should return '1 7/11' get_mixed_num('13/5') # Should return '2 3/5' get_mixed_num('75/10') # Should return '7 5/10' ``` NOTE: All fractions will be greater than 0.
["def get_mixed_num(fraction):\n n, d = [int(i) for i in fraction.split('/')]\n return '{} {}/{}'.format(n // d, n % d, d)", "def get_mixed_num(f):\n [a, b] = map(int, f.split('/'))\n return \"{} {}/{}\".format(a//b, a%b, b)", "def get_mixed_num(f):n,d=map(int,f.split('/'));return'%d %d/%d'%(n/d,n%d,d)", "def get_mixed_num(fraction):\n n, d = (int(num) for num in fraction.split(\"/\"))\n i, n = divmod(n, d)\n return f\"{i} {n}/{d}\"", "def get_mixed_num(f):\n v,d = map(int, f.split('/'))\n n,r = divmod(v,d)\n return f'{n} {r}/{d}'", "def get_mixed_num(fraction):\n a, b = map(int, fraction.split('/'))\n q, r = divmod(a, b)\n return f\"{q} {r}/{b}\"", "def get_mixed_num(fraction):\n a,b = list(map(int, fraction.split('/')))\n return '{} {}/{}'.format(a//b, a%b, b)", "def get_mixed_num(fraction):\n arr = fraction.split('/')\n a, b = divmod(int(arr[0]), int(arr[1]))\n res = []\n if (a != 0):\n res.append(str(a))\n if (b != 0):\n res.append(str(b) + \"/\" + arr[1])\n return ' '.join(res)", "def get_mixed_num(fraction):\n n,d = map(int,fraction.split('/'))\n a,b = divmod(n,d)\n return f'{a} {b}/{d}'", "def get_mixed_num(fraction):\n n,d=map(int,fraction.split(\"/\"))\n i,n,d=n//d,n%d,d\n return [\"\",f\"{i} \"][bool(i)]+f\"{n}/{d}\""]
{"fn_name": "get_mixed_num", "inputs": [["18/11"], ["13/5"], ["75/10"]], "outputs": [["1 7/11"], ["2 3/5"], ["7 5/10"]]}
introductory
https://www.codewars.com/kata/584acbee7d22f84dc80000e2
def get_mixed_num(fraction):
[ 2, 7169, 21961, 712, 51893, 311, 50168, 5624, 271, 2610, 686, 1184, 311, 5508, 458, 508, 318, 80668, 19419, 9533, 2428, 1110, 2136, 21617, 16101, 19417, 905, 95420, 25922, 6663, 956, 5136, 2296, 2, 318, 80668, 2220, 956, 5136, 8, 311, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,758
## Welcome to my (amazing) kata! You are given a gigantic number to decode. Each number is a code that alternates in a pattern between encoded text and a smaller, encoded number. The pattern's length varies with every test, but the alternation between encoded text and an encoded number will always be there. Following this rule, each number tested begins with encoded text and ends with an encoded number. ## How the encoding works Now, we should probably review how the string of numbers is formed - considering you have to unform it. So, first, some text is taken, and encoded. The system of encoding is taking each letter's position in the alphabet and adding 100 to it. For example, `m` in the real text would be `113` in the code-number. After the text, there is a binary number. You should convert this number to a normal, base 10 decimal (all of them can be converted into whole, non-negative numbers). Separating encoded text and encoded numbers, there is a `98`. Because the numbers are in binary, the only digits they use are '0' and '1', and each letter of the alphabet, encoded, is between 101-127, all instances of `98` are to indicate a separation between encoded text and encoded numbers. There may also be a `98` at the very end of the number. When you return your final answer, the text and numbers should always be separated by a comma (`,`) ## Example ```python decode(103115104105123101118119981001098113113113981000) = "codewars, 18, mmm, 8" ``` The part of the code until the first `98` can be decoded to `"codewars"`. `10010` is binary for `18`. `113113113` translates to `"mmm"`. And `1000` is binary for `8`. Here is a visualisation of the example: Good luck!
["def decode(number):\n return ', '.join(\n str(int(w, 2)) if i % 2 else\n ''.join( chr(int(w[x:x+3])-4) for x in range(0, len(w), 3) )\n for i, w in enumerate( str(number).strip('98').split('98') )\n )", "def decode(number):\n split = str(number).replace('98', ' ').split()\n split[::2] = [''.join(chr(int(w[i: i+3]) - 4)\n for i in range(0, len(w), 3))\n for w in split[::2]]\n split[1::2] = [str(int(n, 2)) for n in split[1::2]]\n return ', '.join(split)", "def decode(number):\n import textwrap\n arr=[]\n for x in str(number).split('98'):\n if x:\n try:\n arr.append(str(int(x,2)))\n except:\n arr.append(\"\".join([chr(int(x)-4) for x in textwrap.wrap(x,3)]))\n return \", \".join(arr)", "from re import compile\n\nFIND = compile(r\"((?:\\d{3})+?)(?:98)([01]+)(?:98)?\").findall\nto_text = lambda s: ''.join(chr(int(s[i:i+3]) - 4) for i in range(0, len(s), 3))\n\ndef decode(number):\n return ', '.join(f\"{to_text(x)}, {int(y, 2)}\" for x,y in FIND(str(number)))", "def decode(s):\n arr = str(s).strip('98').split('98')\n return ', '.join(sum([[''.join([chr(96+int(arr[i][k:k+3])-100) for k in range(0,len(arr[i]),3)]),str(int(arr[i+1],2))] for i in range(0,len(arr),2)],[]))", "def decode(number):\n parts = str(number).rstrip('98').split('98')\n parts[::2] = (''.join(chr(0x60 + int(b+c)) for _, b, c in zip(*[iter(part)]*3)) for part in parts[::2])\n parts[1::2] = (str(int(part, 2)) for part in parts[1::2])\n return ', '.join(parts)", "def decode(number):\n parts = [e for e in str(number).split('98') if e]\n return ', '.join(str(int(w, 2)) if i % 2 else word(w) for i, w in enumerate(parts))\n \ndef word(s):\n return ''.join(chr(int(s[i*3:i*3+3]) - 4) for i in range(len(s) // 3)) ", "def decode(number):\n foo = str(number).split('98')\n parts = foo[:-1] if foo[-1] == '' else foo\n output = \"\"\n for i in range(len(parts)):\n if i % 2 == 0:\n for x in range(0, len(parts[i]), 3):\n output += chr(int(parts[i][x:x+3])-4)\n output += ', '\n else:\n output += str(int(parts[i], 2))\n if i != len(parts)-1:\n output += ', '\n return output\n \n", "def decode(number):\n string = str(number).split('98')\n if not string[-1]: del(string[-1])\n let = []\n for x in range(len(string)):\n if not x%2:\n let_n=[]\n for y in range(0, len(string[x])-2, 3):\n let_n.append(chr(int(string[x][y:y+3])-4))\n let.append(''.join(let_n))\n else: let.append(str(int(string[x],2)))\n return ', '.join(let)", "import re\ndef decode(number):\n arr = []\n for match in re.finditer(r'((?:1[01][1-9]|110|12[0-7])+)98([01]+)(?:98)?', str(number)):\n arr.append(re.sub(r'\\d{3}', lambda m: chr(int(m.group()) - 4), match.group(1)))\n arr.append(str(int(match.group(2), 2)))\n return ', '.join(arr)"]
{"fn_name": "decode", "inputs": [[103115104105123101118119981001098], [103115104105123101118119981001098103115104105123101118119981001098103115104105123101118119981001098], [1091011161151121151071091261051061151181081151231191201211161091041201081091191111011201011091199810010981051221051141201081151211071081091201191021181091121121091011141209810001], [119112105105116981000981091199810019810612111498100000110001], [109106125115121108101122105101114125103115113116112101109114120119109120119114115120113125106101121112120981100019810911210911110511911210510511698111000100100981191131091121051251061011031059810001], [12310810511498100010981091231011191011251151211141071021151259810001109811312510610112010810511812011511511111310510911412011512010810510310912012598100100098113103118109119101123105119115113105981000198], [120108105118105109119101112109107108120981001010101098102105108109114104125115121118105125105119981000], [1251151211191081151211121041061051051121191251131161011201081251061151181131059810001009812010810911911611811510711810111310711210912010310810510410111410410410511210512010510411312510610911811912012210511811910911511411510612010810911911110112010198100001098109120119114115120115111101125981000109811110911410411510611210911110510911311411512011511110112510911611811511310911910598100010], [1091011131021151181051041191151091011131071151091141071201151201251161051181011141041151131121051201201051181199810000001001010100101010101010198102112101108101112119104110111106101112104119111106110101119104108107101119112104108107101119121112109104107108981000101001011981011191041111081071121041121011111101081079810001010010198119112105105116101104112106110112104101119104106104106104119115113105120108109114107109119114115120118101114104115113104101106104101106108104101112111110106108109114108105118105981000001010010101001010100101010101098117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123117105118120125121109115116101119104106107108110111112126124103122102114113123123123123123981000101010], [1091061251151211231051181051211191091141071201081051161181091141201031151131131011141041151181191151131051201081091141071011141041181051011041091141071201081091191021181091121121011091141201031151141221051181191011201091151141091081151161051251151211051141101151251051041091201011141041201081011201091201131011041051211161061151181201081051201051181181091021121051111011201011201081011201091131011041051151201081051181231091191051091071211051191191091011131201011121111091141071201151131251191051121061011121191151091031011141201211191051191161011031051191151181161211141031201211011201091151141151061011141251191151181201011141041091201091191041181091221091141071131051011021191151121211201051121251091141191011141051231051121121251151211071051201201081051161151091141201191151211131081011221051011141091031051041011251011141041021251051011141041121091191201051141201151131251031081051131091031011121181151131011141031051201081051251011181051011131011261091141071201081011201091191011121121061151181201151041011251201081051231051011201081051181091191141091031051071151161121011251151211201191091041059810010010100101010010101010100101010001001001]], "outputs": [["codewars, 18"], ["codewars, 18, codewars, 18, codewars, 18"], ["iapologizeforhowstupidthiskatais, 18, eventhoughitsbrilliant, 17"], ["sleep, 8, is, 9, fun, 2097"], ["ifyouhaveanycomplaintsitsnotmyfault, 49, ilikesleep, 3620, smileyface, 17"], ["when, 34, iwasayoungboy, 70, myfathertookmeintothecity, 72, mcrisawesome, 17"], ["thereisalight, 1194, behindyoureyes, 8"], ["youshouldfeelsympathyforme, 68, thisprogramglitchedanddeletedmyfirstversionofthiskata, 66, itsnotokay, 34, kindoflikeimnotokayipromise, 34"], ["iamboredsoiamgoingtotyperandomletters, 541758805, blahalsdjkfaldskfjasdhgasldhgasulidgh, 4427, asdkhgldlakjhg, 2213, sleepadlfjldasdfdfdsomethingisnotrandomdafdafhdalkjfhinhere, 17526510250, qertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwwwqertyuiopasdfghjklzxcvbnmwwwww, 554"], ["ifyouwereusingtheprintcommandorsomethingandreadingthisbrillaintconversationihopeyouenjoyeditandthatitmadeupfortheterriblekatathatimadeotherwiseiguessiamtalkingtomyselfalsoicantusespacesorpunctuationofanysortanditisdrivingmeabsolutelyinsanewellyougetthepointsoumhaveanicedayandbyeandlistentomychemicalromancetheyareamazingthatisallfortodaytheweatherisnicegoplayoutside, 10073085203529"]]}
introductory
https://www.codewars.com/kata/5940ec284aafb87ef3000028
def decode(number):
[ 565, 20166, 311, 847, 320, 309, 6657, 8, 61688, 2219, 2610, 525, 2661, 264, 57873, 1372, 311, 16895, 13, 220, 8886, 1372, 374, 264, 2038, 429, 6919, 973, 304, 264, 5383, 1948, 20498, 1467, 323, 264, 9155, 11, 20498, 1372, 13, 220, 5...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,192
# Task Given an array `arr` and a number `n`. Call a pair of numbers from the array a `Perfect Pair` if their sum is equal to `n`. Find all of the perfect pairs and return the sum of their **indices**. Note that any element of the array can only be counted in one Perfect Pair. Also if there are multiple correct answers, return the smallest one. # Example For `arr = [1, 4, 2, 3, 0, 5] and n = 7`, the result should be `11`. Since the Perfect Pairs are `(4, 3)` and `(2, 5)` with indices `1 + 3 + 2 + 5 = 11`. For `arr = [1, 3, 2, 4] and n = 4`, the result should be `1`. Since the element at `index 0` (i.e. 1) and the element at `index 1` (i.e. 3) form the only Perfect Pair. # Input/Output - `[input]` integer array `arr` array of non-negative integers. - `[input]` integer `n` positive integer - `[output]` integer sum of indices and 0 if no Perfect Pair exists.
["def pairwise(arr, n):\n s=[]\n for i in range(len(arr)-1):\n for j in range(i+1,len(arr)):\n if j in s or i in s: continue\n if arr[i]+arr[j] ==n:\n s.append(i)\n s.append(j)\n return sum(s)", "def pairwise(arr, n):\n\n iMap, s = {}, 0\n for i,x in enumerate(arr): iMap[x] = iMap.get(x, []) + [i]\n \n for x in arr:\n if n-x in iMap and len(iMap[n-x]) > (x == n-x) < len(iMap[x]):\n s += iMap[x].pop(0)\n s += iMap[n-x].pop(0)\n return s", "def pairwise(arr, n):\n seen = set()\n for i in range(len(arr)):\n for j in range(i+1, len(arr)):\n if arr[i] + arr[j] == n and not (i in seen or j in seen):\n seen.add(i)\n seen.add(j)\n break\n return sum(seen)", "def pairwise(arr, n):\n # fiond each pair of elements that add up to n in arr\n a, i, j, pairs = sorted(arr), 0, len(arr) - 1, []\n while i < j:\n tot = a[i] + a[j]\n if tot == n:\n pairs.extend([a[i], a[j]])\n i, j = i + 1, j - 1\n elif tot < n:\n i += 1\n else:\n j -= 1\n pairs.sort()\n \n # Identify the lowest possible index for each element in pairs\n indices = []\n i, last = 0, None\n for x in pairs:\n # Continue from last found if repeat value else from start of array\n i = (indices[-1] + 1) if x == last else 0\n indices.append(arr.index(x, i))\n last = x\n \n return sum(indices)", "# This isn't best practice, this is just for fun\ndef pairwise(arr, n):\n save = set()\n add = save.add\n return sum(i+j if x+y==n and not (i in save or add(j) or add(i)) else 0 for i,x in enumerate(arr) if i not in save for j,y in enumerate(arr[i+1:], i+1) if j not in save)", "def pairwise(arr, n):\n result = 0\n for i in range(len(arr)):\n d = n - arr[i]\n if d in arr[i+1:]:\n j = arr.index(d, i+1)\n result += i + j\n arr[i] = arr[j] = n + 1\n return result\n", "from collections import defaultdict\n\ndef pairwise(arr,n):\n ixs=defaultdict(list)\n for i,e in enumerate(arr): ixs[e].append(i)\n h=n/2\n t=sum(x+y for a,ai in (p for p in ixs.items() if p[0]<h) for x,y in zip(ai,ixs.get(n-a,[])))\n if n%2: return t\n hi=ixs.get(int(h),[])\n return t+sum(hi[:len(hi)//2*2])", "def pairwise(arr, n):\n used = []\n for i in range(len(arr)-1):\n for j in range(i+1, len(arr)):\n if arr[i] + arr[j] == n and not (i in used or j in used):\n used.extend([i, j])\n return sum(used)", "from itertools import combinations\n\ndef pairwise(arr, n):\n r,c = 0,[]\n for (i,a),(j,b) in combinations(enumerate(arr),2):\n if a+b == n and i not in c and j not in c:\n r += i+j\n c.extend([i,j])\n return r", "def pairwise(arr, n):\n lst = [[e, i] for i, e in enumerate(arr)]\n ans, v = [], []\n for i, e in enumerate(arr):\n if i in v:\n continue\n for j, e2 in enumerate(arr[i+1:]):\n x = i+1+j\n if e + e2 == n and x not in v:\n v.append(i)\n v.append(x)\n ans.append((i,x))\n break\n return sum([i[0]+i[1] for i in ans]) if ans != [] else 0"]
{"fn_name": "pairwise", "inputs": [[[1, 4, 2, 3, 0, 5], 7], [[1, 3, 2, 4], 4], [[1, 1, 1], 2], [[0, 0, 0, 0, 1, 1], 1], [[15, 1, 1], 5]], "outputs": [[11], [1], [1], [10], [0]]}
introductory
https://www.codewars.com/kata/58afa8185eb02ea2a7000094
def pairwise(arr, n):
[ 2, 5430, 198, 16246, 458, 1334, 1565, 1118, 63, 323, 264, 1372, 1565, 77, 28587, 7143, 264, 6716, 315, 5109, 504, 279, 1334, 264, 1565, 51041, 25995, 63, 421, 862, 2629, 374, 6144, 311, 1565, 77, 62338, 7379, 678, 315, 279, 4727, 13...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,849
Given an array of ints, return the index such that the sum of the elements to the right of that index equals the sum of the elements to the left of that index. If there is no such index, return `-1`. If there is more than one such index, return the left-most index. For example: ``` peak([1,2,3,5,3,2,1]) = 3, because the sum of the elements at indexes 0,1,2 == sum of elements at indexes 4,5,6. We don't sum index 3. peak([1,12,3,3,6,3,1]) = 2 peak([10,20,30,40]) = -1 ``` The special case of an array of zeros (for instance `[0,0,0,0]`) will not be tested. More examples in the test cases. Good luck! Please also try [Simple time difference](https://www.codewars.com/kata/5b76a34ff71e5de9db0000f2)
["def peak(arr):\n for i, val in enumerate(arr):\n if sum(arr[:i]) == sum(arr[i+1:]):\n return i\n return -1", "def peak(arr):\n for i in range(len(arr)):\n if sum(arr[:i]) == sum(arr[i+1:]): return i\n return -1", "def peak(arr):\n sl, sr = 0, sum(arr)\n for i,v in enumerate(arr):\n sr -= v\n if sr == sl: return i\n elif sl > sr: return -1\n sl += v\n", "def peak(arr):\n for i,n in enumerate(arr):\n if sum(arr[:i]) == sum(arr[i+1:]):\n return i\n else:\n return -1\n", "def peak(arr):\n r = sum(arr)-arr[0]\n l = 0\n if l == r: return 0\n for i in range(len(arr)-1):\n l += arr[i]\n r -= arr[i+1]\n if l == r: return i+1\n return -1", "def peak(arr):\n l=[i for i in range(len(arr)-1) if sum(arr[:i])==sum(arr[i+1:])]\n return l[0] if l else -1", "def peak(arr):\n return next(iter(i for i in range(len(arr)) if sum(arr[:i]) == sum(arr[i+1:])), -1)", "from itertools import accumulate\ndef peak(arr):\n for idx,(a,b) in enumerate(zip(list(accumulate(arr))[:-2],list(accumulate(reversed(arr)))[-3::-1])):\n if a == b: return idx+1\n \n return -1", "peak=lambda a:sum(sum(a[y+1:])==sum(a[:y])and y for y,_ in enumerate(a))or-1", "def peak(arr):\n left_sum, right_sum = [0], [0]\n for n in arr: left_sum.append(n + left_sum[-1])\n for n in arr[::-1]: right_sum.append(n + right_sum[-1])\n for i in range(len(arr)):\n if right_sum[len(arr)-1-i] == left_sum[i]: return i\n return -1"]
{"fn_name": "peak", "inputs": [[[1, 2, 3, 5, 3, 2, 1]], [[1, 12, 3, 3, 6, 3, 1]], [[10, 20, 30, 40]]], "outputs": [[3], [2], [-1]]}
introductory
https://www.codewars.com/kata/5a61a846cadebf9738000076
def peak(arr):
[ 22043, 458, 1334, 315, 54724, 11, 470, 279, 1922, 1741, 429, 279, 2629, 315, 279, 5424, 311, 279, 1290, 315, 429, 1922, 16819, 279, 2629, 315, 279, 5424, 311, 279, 2115, 315, 429, 1922, 13, 1416, 1052, 374, 902, 1741, 1922, 11, 470,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,284
Let's call two strings $s$ and $t$ anagrams of each other if it is possible to rearrange symbols in the string $s$ to get a string, equal to $t$. Let's consider two strings $s$ and $t$ which are anagrams of each other. We say that $t$ is a reducible anagram of $s$ if there exists an integer $k \ge 2$ and $2k$ non-empty strings $s_1, t_1, s_2, t_2, \dots, s_k, t_k$ that satisfy the following conditions: If we write the strings $s_1, s_2, \dots, s_k$ in order, the resulting string will be equal to $s$; If we write the strings $t_1, t_2, \dots, t_k$ in order, the resulting string will be equal to $t$; For all integers $i$ between $1$ and $k$ inclusive, $s_i$ and $t_i$ are anagrams of each other. If such strings don't exist, then $t$ is said to be an irreducible anagram of $s$. Note that these notions are only defined when $s$ and $t$ are anagrams of each other. For example, consider the string $s = $ "gamegame". Then the string $t = $ "megamage" is a reducible anagram of $s$, we may choose for example $s_1 = $ "game", $s_2 = $ "gam", $s_3 = $ "e" and $t_1 = $ "mega", $t_2 = $ "mag", $t_3 = $ "e": [Image] On the other hand, we can prove that $t = $ "memegaga" is an irreducible anagram of $s$. You will be given a string $s$ and $q$ queries, represented by two integers $1 \le l \le r \le |s|$ (where $|s|$ is equal to the length of the string $s$). For each query, you should find if the substring of $s$ formed by characters from the $l$-th to the $r$-th has at least one irreducible anagram. -----Input----- The first line contains a string $s$, consisting of lowercase English characters ($1 \le |s| \le 2 \cdot 10^5$). The second line contains a single integer $q$ ($1 \le q \le 10^5$)  — the number of queries. Each of the following $q$ lines contain two integers $l$ and $r$ ($1 \le l \le r \le |s|$), representing a query for the substring of $s$ formed by characters from the $l$-th to the $r$-th. -----Output----- For each query, print a single line containing "Yes" (without quotes) if the corresponding substring has at least one irreducible anagram, and a single line containing "No" (without quotes) otherwise. -----Examples----- Input aaaaa 3 1 1 2 4 5 5 Output Yes No Yes Input aabbbbbbc 6 1 2 2 4 2 2 1 9 5 7 3 5 Output No Yes Yes Yes No No -----Note----- In the first sample, in the first and third queries, the substring is "a", which has itself as an irreducible anagram since two or more non-empty strings cannot be put together to obtain "a". On the other hand, in the second query, the substring is "aaa", which has no irreducible anagrams: its only anagram is itself, and we may choose $s_1 = $ "a", $s_2 = $ "aa", $t_1 = $ "a", $t_2 = $ "aa" to show that it is a reducible anagram. In the second query of the second sample, the substring is "abb", which has, for example, "bba" as an irreducible anagram.
["import sys\nreadline = sys.stdin.readline\n\nS = list([ord(x)-97 for x in readline().strip()])\nN = len(S)\ntable = [[0]*26 for _ in range(N)]\nfor i in range(N):\n table[i][S[i]] = 1\nfor i in range(1, N):\n for j in range(26):\n table[i][j] += table[i-1][j]\n\nQ = int(readline())\nAns = [None]*Q\nfor qu in range(Q):\n l, r = list(map(int, readline().split()))\n l -= 1\n r -= 1 \n if l == r or S[l] != S[r]:\n Ans[qu] = True\n continue\n K = [table[r][j] - table[l][j] for j in range(26)]\n if len([k for k in K if k]) <= 2:\n Ans[qu] = False\n else:\n Ans[qu] = True\nprint('\\n'.join(['Yes' if s else 'No' for s in Ans]))\n", "import sys\ninput = sys.stdin.readline\n\nfrom collections import Counter\n\nS=input().strip()\ncount=[[0]*26 for i in range(len(S)+1)]\nc=1\nfor s in S:\n for k in range(26):\n count[c][k]=count[c-1][k]\n count[c][ord(s)-97]+=1\n c+=1\n \nQ=int(input())\nfor tests in range(Q):\n l,r=list(map(int,input().split()))\n if l==r:\n print(\"Yes\")\n continue\n \n elif S[l-1]!=S[r-1]:\n print(\"Yes\")\n continue\n\n elif len(S)<=4:\n print(\"No\")\n continue\n\n X=[count[r][j]-count[l-1][j] for j in range(26)]\n NZERO=0\n for x in X:\n if x!=0:\n NZERO+=1\n\n if NZERO<=2:\n print(\"No\")\n else:\n print(\"Yes\")\n\n \n \n", "import sys\ninput = sys.stdin.readline\ns = input()\nq = int(input())\nquery = [tuple(map(int, input().split())) for i in range(q)]\nchar = [[0]*26 for i in range(len(s)+1)]\n\nfor i in range(len(s)):\n si = ord(s[i])-97\n for j in range(26):\n if j == si:\n char[i+1][j] = char[i][j] + 1\n else:\n char[i+1][j] = char[i][j]\n\n\nfor l, r in query:\n count = 0\n for i in range(26):\n if char[r][i] - char[l-1][i] != 0:\n count += 1\n if count == 1:\n if r == l:\n print(\"Yes\")\n else:\n print(\"No\")\n elif count == 2:\n if s[r-1] == s[l-1]:\n print(\"No\")\n else:\n print(\"Yes\")\n else:\n print(\"Yes\")\n"]
{ "inputs": [ "aaaaa\n3\n1 1\n2 4\n5 5\n", "aabbbbbbc\n6\n1 2\n2 4\n2 2\n1 9\n5 7\n3 5\n", "f\n1\n1 1\n" ], "outputs": [ "Yes\nNo\nYes\n", "No\nYes\nYes\nYes\nNo\nNo\n", "Yes\n" ] }
competition
https://codeforces.com/problemset/problem/1290/B
[ 10061, 594, 1618, 1378, 9069, 400, 82, 3, 323, 400, 83, 3, 458, 68772, 315, 1817, 1008, 421, 432, 374, 3204, 311, 55327, 844, 17738, 304, 279, 914, 400, 82, 3, 311, 633, 264, 914, 11, 6144, 311, 400, 83, 3, 382, 10061, 594, 2908...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
785
One of Chef's friends offered him a deal: during $D$ days, they are going to exchange money. For each $i$ ($1 \le i \le D$), on the $i$-th day, Chef's friend would give Chef $A$ rupees, while Chef would give his friend $2^{i-1}$ rupees ($1$ rupee on day $1$, $2$ rupees on day $2$, $4$ rupees on day $3$, and so on). Chef's profit from the deal is the total number of rupees he received from his friend minus the total number of rupees he gave his friend. Chef decided to ask for your advice before accepting the deal. You want to help him by telling him two numbers $D_1$ and $D_2$, where $D_1$ is the maximum value of $D$ such that Chef should accept the deal, i.e. his profit from the deal is positive if $D = D_1$, and $D_2$ is the value of $D$ that leads to the maximum possible profit for Chef. If there are multiple values of $D$ that lead to the maximum profit, $D_2$ is the smallest of these values. -----Input----- - The first line of the input contains a single integer $T$ denoting the number of test cases. The description of $T$ test cases follows. - The first and only line of each test case contains a single integer $A$. -----Output----- For each test case, print a single line containing two space-separated integers $D_1$ and $D_2$. -----Constraints----- - $1 \le T \le 100,000$ - $5 \le A \le 10^9$ -----Subtasks----- Subtask #1 (100 points): original constraints -----Example Input----- 4 5 8 9 1000000000 -----Example Output----- 4 3 5 3 5 4 35 30
["# cook your dish here\na = int(input())\nfor i in range(a):\n b = int(input())\n li = []\n if b == 2:\n print(2,1)\n elif b == 3:\n print(3,2)\n elif b == 4:\n print(4,2)\n else:\n for t in range(b+1):\n if ((b*t)+1-(2**t))<0:\n li.append(t-1)\n break\n for o in range(b+1):\n if b<=2**(o):\n li.append(o)\n break\n print(*li)\n \n", "T=int(input())\nfor _ in range(T):\n A=int(input())\n \n total_ip=A\n total_op=1\n total_profit=total_ip-total_op\n B=1\n d1=1\n d2=1\n c=1\n f=1\n cprofit=A-B\n\n while total_profit>=0:\n c=c+1\n B=B*2\n cprofit=A-B\n total_ip=total_ip+A\n total_op=total_op+B\n total_profit=total_ip-total_op\n \n if cprofit<=0 and f!=0:\n f=0\n d2=c-1\n if total_profit<=0:\n d1=c-1\n \n print(d1,d2)\n", "from math import log2,log\nfor _ in range(int(input())):\n a=int(input())\n d1=int()\n n=1\n d2=int()\n while True:\n if n*a+1<=pow(2,n):\n break\n else:\n d1=n\n n+=1\n n=int(log2(a/log(2)))\n dn=n*a-pow(2,n)\n n+=1\n dn1=n*a-pow(2,n)\n if dn>=dn1:\n d2=n-1\n else:\n d2=n\n print(d1,d2)", "# cook your dish here - pyt3\ndef fun(a):\n t1 = 1\n t2 = a\n p = a - 1\n pday=1\n count = 1\n while t2>t1:\n t2 += a\n t1 = 1 + (2*t1)\n if t2-t1>p:\n p = max(p, t2-t1)\n pday = count\n count += 1\n return count-1, pday+1\n\ntry:\n t = int(input())\n for i in range(t):\n n = int(input())\n x = fun(n)\n print(x[0], x[1])\nexcept Exception:\n pass", "# cook your dish here\nt = int(input())\nfor _ in range(t):\n a = int(input())\n d1=0\n profit=0\n i=0\n while a-2**i>0:\n profit+=a-2**i\n i+=1\n d1+=1\n \n d2=d1\n \n while profit>0:\n profit+=a-2**i\n i+=1\n d2+=1\n# one extra day gets counted after profit becomes negative\n print(d2-1,d1)", "# cook your dish here\nt=int(input())\nfor _ in range(t):\n a=int(input())\n d_max,max_d=1,0\n chef,friend=0,0\n max_sum=0\n while 1:\n chef+=a\n friend+=2**(d_max-1)\n if chef-friend>max_sum:\n max_sum=chef-friend\n max_d=d_max\n if chef-friend<=0:\n break\n else:\n d_max+=1\n print(d_max-1,max_d)", "# cook your dish here\nt = int(input())\nwhile t:\n a = int(input())\n d1, d2, max = 1, int(), 0\n mt = a * d1\n mg = 2**d1 - 1\n while mt > mg:\n if mt - mg > max:\n max = mt - mg\n d2 = d1\n d1 = d1 + 1\n mt = a * d1\n mg = 2**d1 - 1\n print(d1 - 1, d2)\n t = t - 1", "for _ in range(int(input())):\n a=int(input())\n c=1\n d=1\n ans=[]\n while c<(d*a):\n ans.append((d*a)-c)\n c+=2**d\n d+=1\n t_1=ans.index(max(ans))+1\n print(d-1,t_1,sep=' ')\n ", "T = int(input())\n\nfor i in range(T):\n a = int(input())\n \n # d2 = n such that 2^n is just greater than a. \n # d1 = max days so that profit is > 0.\n \n s = bin(a)\n d2 = len(s) - s.index('1')\n if 2**(d2-1) == a:\n d2 -= 1\n \n d1 = 0\n while d1*a >= 2**d1 - 1:\n d1 += 1\n \n print(d1-1, d2)", "for _ in range(int(input())):\n a = int(input())\n\n D1 = 0\n D2 = [1,1-a] \n\n pd1 = a\n i = 1\n pd2 = 2**(i-1)\n\n while pd1+a>pd2+2**(i):\n i+=1\n pd1+=a\n pd2 = pd2 + 2**(i-1)\n\n if D2[1]<pd1-pd2:\n D2[1] = pd1-pd2\n D2[0] = i\n \n print(i,D2[0])\n", "# cook your dish here\nfor _ in range(int(input())):\n A=int(input())\n x=1\n pro=0\n n=0\n d=1\n s=0\n while True:\n n+=1\n s+=x\n y=A*n-s\n if pro<y:\n pro=y \n d=n\n if y<0:\n break\n x=x*2\n print(n-1,d)\n \n", "t=int(input())\nfor i in range(0,t):\n a=int(input())\n r=1\n count=0\n while r<a: \n r*=2\n count+=1\n min=count \n r=1\n sum=a\n sumr=1\n count=0\n while sumr<=sum:\n r*=2\n sumr+=r\n sum+=a\n count+=1\n max=count\n print(max,end=\" \")\n print(min)", "t=int(input())\nfor i in range(0,t):\n a=int(input())\n r=1\n count=0\n while r<a: \n r*=2\n count+=1\n min=count \n r=1\n sum=a\n sumr=1\n count=0\n while sumr<=sum:\n r*=2\n sumr+=r\n sum+=a\n count+=1\n max=count\n print(max,end=\" \")\n print(min)", "t = int(input())\nwhile t!=0:\n a = int(input())\n give = 0\n take = 0\n m = []\n i = 1\n \n while(1):\n give+=2**(i-1)\n take+=a \n \n if (take-give)<=0:\n break\n else:\n m.append(take-give)\n i+=1\n \n d2 = m.index(max(m)) + 1 \n d1 = len(m)\n \n print(d1,d2)\n # print(m)\n t-=1", "# cook your dish here\nt=int(input())\nwhile t>0 :\n a=int(input())\n ta=0\n gi=0\n c=1\n i=0\n d=0\n ma=0\n while (True) :\n ta+=a \n gi+=c \n c*=2\n i+=1 \n if ta-gi>ma :\n ma=ta-gi \n d=i \n if ta-gi<0 :\n i-=1 \n break\n print(i,d)\n t-=1", "t=int(input())\nwhile(t>0):\n n=int(input())\n b=bin(n)\n l=len(b)-2\n if(b.count('1')==1):\n l-=1\n x=1\n s=0\n for i in range(36):\n s+=n\n s-=x\n if(s<0):\n break\n x*=2\n print(i,l)\n t-=1", "def two(d):\n return (2**d)-1\n\nfor _ in range(int(input())):\n a = int(input())\n d = 1\n chef_acc = a*d - two(d)\n lst = []\n day = []\n while chef_acc >= 0:\n chef_acc = a*d - two(d)\n lst.append(chef_acc)\n day.append(d)\n \n d += 1\n \n print(day[-2], lst.index(max(lst))+1)", "try:\n t=int(input())\n for i in range(0,t):\n a=int(input())\n s=0\n f=0\n j=1\n flist=[]\n max=0\n k=0\n g=1\n # print('ff')\n while(g>0):\n # print('hjh')\n s=s+a\n f=f+(2**(j-1))\n j=j+1\n g=s-f\n if(g>max):\n max=g\n k=j\n print(f'{j-2} {k-1}')\nexcept:\n pass", "# cook your dish here\nt=int(input())\nfor i in range(t):\n a=int(input())\n i=1\n l=[]\n p=0\n dene=0\n lene=0\n while(p>=0):\n dene=dene+pow(2,i-1)\n lene=lene+a\n p=lene-dene\n i=i+1\n l.append(p)\n print(i-2,l.index(max(l))+1) ", "# cook your dish here\ntest=int(input())\nfor _ in range(test):\n a=int(input())\n s=1\n s1=a\n p=a-s\n d=1\n b=[]\n for i in range(2,100):\n if p<=0:\n d=i-2\n break\n else:\n b.append(p)\n s+=pow(2,i-1)\n a+=s1\n p=a-s\n print(d,b.index(max(b))+1)", "# cook your dish here\nt=int(input())\nwhile t:\n n=int(input())\n A=0;x=0;y=-1;tmp=0;i=0;d=0\n while A>x or x==0:\n tmp=y\n A+=n\n x+=2**i\n y=max(y,A-x)\n if y==tmp and d==0:\n d=i\n i+=1\n if A!=x:\n i-=1\n print(i,d)\n t-=1", "# cook your dish here\ntest=int(input())\nfor _ in range(test):\n a=int(input())\n s=1\n s1=a\n p=a-s\n d=1\n b=[]\n for i in range(2,100):\n if p<=0:\n d=i-2\n break\n else:\n b.append(p)\n s+=pow(2,i-1)\n a+=s1\n p=a-s\n print(d,b.index(max(b))+1)", "for _ in range(int(input())):\n a=int(input())\n s=1\n s1=a\n p=a-s\n d=1\n b=[]\n for i in range(2,100):\n if p<=0:\n d=i-2\n break\n else:\n b.append(p)\n s+=pow(2,i-1)\n a+=s1\n p=a-s\n print(d,b.index(max(b))+1)", "# cook your dish here\nt=int(input())\nwhile(t>0):\n n=int(input())\n g=0\n i=0\n x=0\n d=0\n h=0\n p=1\n mp=0\n while(p>0):\n x=1<<i\n g=g+x\n i+=1\n h=h+n\n p=h-g\n if(mp<p):\n d=i\n mp=p\n if(i>50):\n break\n print(i-1,d)\n t-=1\n"]
{"inputs": [["4", "5", "8", "9", "1000000000"]], "outputs": [["4 3", "5 3", "5 4", "35 30"]]}
interview
https://www.codechef.com/problems/TRICKYDL
[ 3966, 315, 35975, 594, 4780, 8900, 1435, 264, 3484, 25, 2337, 400, 35, 3, 2849, 11, 807, 525, 2087, 311, 9289, 3220, 13, 1752, 1817, 400, 72, 3, 1711, 16, 1124, 273, 600, 1124, 273, 422, 3, 701, 389, 279, 400, 72, 3, 12, 339, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,774
Define a function that takes one integer argument and returns logical value `true` or `false` depending on if the integer is a prime. Per Wikipedia, a prime number (or a prime) is a natural number greater than 1 that has no positive divisors other than 1 and itself. ## Requirements * You can assume you will be given an integer input. * You can not assume that the integer will be only positive. You may be given negative numbers as well (or `0`). * **NOTE on performance**: There are no fancy optimizations required, but still *the* most trivial solutions might time out. Numbers go up to 2^31 (or similar, depends on language version). Looping all the way up to `n`, or `n/2`, will be too slow. ## Example ```nasm mov edi, 1 call is_prime ; EAX <- 0 (false) mov edi, 2 call is_prime ; EAX <- 1 (true) mov edi, -1 call is_prime ; EAX <- 0 (false) ```
["# This is the Miller-Rabin test for primes, which works for super large n\n\nimport random\n\ndef even_odd(n):\n s, d = 0, n\n while d % 2 == 0:\n s += 1\n d >>= 1\n return s, d\n\ndef Miller_Rabin(a, p):\n s, d = even_odd(p-1)\n a = pow(a, d, p)\n if a == 1: return True\n for i in range(s):\n if a == p-1: return True\n a = pow(a, 2, p)\n return False\n\ndef is_prime(p):\n if p == 2: return True\n if p <= 1 or p % 2 == 0: return False\n return all(Miller_Rabin(random.randint(2,p-1),p) for _ in range(40))\n", "from math import sqrt\ndef is_prime(num):\n if num <= 1:\n return False\n i = 2\n while i <= sqrt(num): \n if num%i == 0:\n return False\n i += 1\n return True ", "import math\ndef is_prime(n):\n if n < 2: return False\n if(n in [2,3]): return True\n if(n%6 not in [1,5]): return False\n for i in range(3, int(math.floor(math.sqrt(n)))+1):\n if n%i==0: return False\n return True", "def is_prime(n):\n if (n < 2) or (n > 2 and n%2 == 0):\n return False\n for i in range(3, int(n**.5)+1, 2):\n if n%i == 0:\n return False\n else:\n return True", "def is_prime(num):\n\n # make sure n is a positive integer\n num = abs(int(num))\n\n # 0 and 1 are not primes\n if num < 2:\n return False\n\n # 2 is the only even prime number\n if num == 2: \n return True \n\n # all other even numbers are not primes\n if not num & 1: \n return False\n\n # range starts with 3 and only needs to go up \n # the square root of n for all odd numbers\n for x in range(3, int(num**0.5) + 1, 2):\n if num % x == 0:\n return False\n\n return True", "import math\ndef is_prime(n):\n if n <= 1: \n return False \n for i in range(2, int(math.sqrt(n)) + 1): \n if n % i == 0: \n return False \n return True"]
{"fn_name": "is_prime", "inputs": [[0], [1], [2], [73], [75], [-1]], "outputs": [[false], [false], [true], [true], [false], [false]]}
introductory
https://www.codewars.com/kata/5262119038c0985a5b00029f
def is_prime(num):
[ 35338, 264, 729, 429, 4990, 825, 7546, 5693, 323, 4675, 19819, 897, 1565, 1866, 63, 476, 1565, 3849, 63, 11649, 389, 421, 279, 7546, 374, 264, 10250, 382, 3889, 26587, 11, 264, 10250, 1372, 320, 269, 264, 10250, 8, 374, 264, 5810, 1...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,395
A number is ternary if it contains only digits $0$, $1$ and $2$. For example, the following numbers are ternary: $1022$, $11$, $21$, $2002$. You are given a long ternary number $x$. The first (leftmost) digit of $x$ is guaranteed to be $2$, the other digits of $x$ can be $0$, $1$ or $2$. Let's define the ternary XOR operation $\odot$ of two ternary numbers $a$ and $b$ (both of length $n$) as a number $c = a \odot b$ of length $n$, where $c_i = (a_i + b_i) \% 3$ (where $\%$ is modulo operation). In other words, add the corresponding digits and take the remainders of the sums when divided by $3$. For example, $10222 \odot 11021 = 21210$. Your task is to find such ternary numbers $a$ and $b$ both of length $n$ and both without leading zeros that $a \odot b = x$ and $max(a, b)$ is the minimum possible. You have to answer $t$ independent test cases. -----Input----- The first line of the input contains one integer $t$ ($1 \le t \le 10^4$) — the number of test cases. Then $t$ test cases follow. The first line of the test case contains one integer $n$ ($1 \le n \le 5 \cdot 10^4$) — the length of $x$. The second line of the test case contains ternary number $x$ consisting of $n$ digits $0, 1$ or $2$. It is guaranteed that the first digit of $x$ is $2$. It is guaranteed that the sum of $n$ over all test cases does not exceed $5 \cdot 10^4$ ($\sum n \le 5 \cdot 10^4$). -----Output----- For each test case, print the answer — two ternary integers $a$ and $b$ both of length $n$ and both without leading zeros such that $a \odot b = x$ and $max(a, b)$ is the minimum possible. If there are several answers, you can print any. -----Example----- Input 4 5 22222 5 21211 1 2 9 220222021 Output 11111 11111 11000 10211 1 1 110111011 110111010
["for _ in range(int(input())):\n n=int(input())\n s=input()\n a=\"\"\n b=\"\"\n flag=1\n for i in s:\n if flag:\n if i==\"2\":\n a+=\"1\"\n b+=\"1\"\n elif i==\"1\":\n a+=\"1\"\n b+=\"0\"\n flag=0\n else:\n a+=\"0\"\n b+=\"0\"\n else:\n if i==\"2\":\n a+=\"0\"\n b+=\"2\"\n elif i==\"1\":\n a+=\"0\"\n b+=\"1\"\n flag=0\n else:\n a+=\"0\"\n b+=\"0\"\n print(a)\n print(b)", "import sys\ninput = lambda : sys.stdin.readline().strip()\nipnut = input\ndef main(t = 1):\n for i in range(t):\n n = int(input())\n a = []\n b = []\n s = list(map(int,input()))\n f = False\n for i in s:\n if i==0:\n a.append(0)\n b.append(0)\n elif i == 1 and not f:\n a.append(1)\n b.append(0)\n f = True\n elif i == 1:\n a.append(0)\n b.append(1)\n elif f:\n a.append(0)\n b.append(2)\n else:\n a.append(1)\n b.append(1)\n print(''.join(map(str,a)))\n print(''.join(map(str,b)))\n\nmain(int(input()))\n", "import sys\ninput = lambda: sys.stdin.readline().rstrip()\n\ndef calc(S):\n f = 0\n A = []\n B = []\n for s in S:\n a = int(s)\n if a == 1:\n if f:\n A.append(\"0\")\n B.append(\"1\")\n else:\n f = 1\n A.append(\"1\")\n B.append(\"0\")\n if a == 0:\n A.append(\"0\")\n B.append(\"0\")\n if a == 2:\n if f:\n A.append(\"0\")\n B.append(\"2\")\n else:\n A.append(\"1\")\n B.append(\"1\")\n print(\"\".join(A))\n print(\"\".join(B))\n\nT = int(input())\nfor _ in range(T):\n N = int(input())\n calc(input())\n", "t = int(input())\nfor case_num in range(t):\n n = int(input())\n x = input()\n a = []\n b = []\n split = False\n for i in x:\n if not split:\n if i == '2':\n a.append('1')\n b.append('1')\n if i == '0':\n a.append('0')\n b.append('0')\n if i == '1':\n a.append('1')\n b.append('0')\n split = True\n else:\n a.append('0')\n b.append(i)\n print(''.join(a))\n print(''.join(b))\n", "t = int(input())\nfor case_num in range(t):\n n = int(input())\n x = input()\n a = []\n b = []\n split = False\n for i in x:\n if not split:\n if i == '2':\n a.append('1')\n b.append('1')\n if i == '0':\n a.append('0')\n b.append('0')\n if i == '1':\n a.append('1')\n b.append('0')\n split = True\n else:\n a.append('0')\n b.append(i)\n print(''.join(a))\n print(''.join(b))\n", "#!usr/bin/env python3\nfrom collections import defaultdict, deque\nfrom heapq import heappush, heappop\nfrom itertools import permutations, accumulate\nimport sys\nimport math\nimport bisect\ndef LI(): return [int(x) for x in sys.stdin.readline().split()]\ndef I(): return int(sys.stdin.readline())\ndef LS():return [list(x) for x in sys.stdin.readline().split()]\ndef S():\n res = list(sys.stdin.readline())\n if res[-1] == \"\\n\":\n return res[:-1]\n return res\ndef IR(n):\n return [I() for i in range(n)]\ndef LIR(n):\n return [LI() for i in range(n)]\ndef SR(n):\n return [S() for i in range(n)]\ndef LSR(n):\n return [LS() for i in range(n)]\n\nsys.setrecursionlimit(1000000)\nmod = 1000000007\n\ndef solve():\n t = I()\n for _ in range(t):\n n = I()\n x = list(map(int, input()))\n a = []\n b = []\n f = 0\n for i in x:\n if not i:\n a.append(0)\n b.append(0)\n elif i == 2:\n if f:\n a.append(0)\n b.append(2)\n else:\n a.append(1)\n b.append(1)\n else:\n if f:\n a.append(0)\n b.append(1)\n else:\n a.append(1)\n b.append(0)\n f = 1\n print(*a,sep = \"\")\n print(*b,sep = \"\")\n return\n\n#Solve\ndef __starting_point():\n solve()\n\n__starting_point()", "q = int(input())\nfor _ in range(q):\n input()\n x = input()\n ans1 = ['1']\n ans2 = ['1']\n is_one = False\n\n for i in x[1:]:\n if i == '0':\n ans1.append('0')\n ans2.append('0')\n elif i == '1':\n if is_one:\n ans1.append('0')\n ans2.append('1')\n else:\n ans1.append('1')\n ans2.append('0')\n is_one = True\n else:\n if is_one:\n ans1.append('0')\n ans2.append('2')\n else:\n ans1.append('1')\n ans2.append('1')\n for i in ans1:\n print(i, end='')\n print()\n for i in ans2:\n print(i, end='')\n print()\n", "for _ in range(int(input())):\n n = int(input())\n number = input()\n a = []\n b = []\n flag = 0\n for c in number:\n if c == '2':\n if flag == 0:\n a.append('1')\n b.append('1')\n else:\n b.append('2')\n a.append('0')\n elif c == '0':\n a.append('0')\n b.append('0')\n else:\n if flag == 0:\n a.append('1')\n b.append('0')\n flag = 1\n else:\n a.append('0')\n b.append('1')\n \n print(''.join(a))\n print(''.join(b))", "for tc in range(int(input())):\n n = int(input())\n s = input()\n ch = 0\n a = ''\n b = ''\n for c in s:\n if c == '2':\n if ch:\n a += '0'\n b += '2'\n else:\n a += '1'\n b += '1'\n elif c == '1':\n if ch:\n a += '0'\n b += '1'\n else:\n ch = 1\n a += '1'\n b += '0'\n else:\n a += '0'\n b += '0'\n print(a)\n print(b)\n \n", "from math import *\nt = int(input())\nfor y in range(t):\n\tn = int(input())\n\ts = input()\n\tf = 0\n\ta = ''\n\tb = ''\n\tfor i in s:\n\t\tif f == 0:\n\t\t\tif i == '2':\n\t\t\t\ta += '1'\n\t\t\t\tb += '1'\n\t\t\telif i == '1':\n\t\t\t\ta += '1'\n\t\t\t\tb += '0'\n\t\t\t\tf = 1\n\t\t\telse:\n\t\t\t\ta += '0'\n\t\t\t\tb += '0'\n\t\telse:\n\t\t\tif i == '2':\n\t\t\t\ta += '0'\n\t\t\t\tb += '2'\n\t\t\telif i == '1':\n\t\t\t\ta += '0'\n\t\t\t\tb += '1'\n\t\t\telse:\n\t\t\t\ta += '0'\n\t\t\t\tb += '0'\n\tprint(a)\n\tprint(b)", "import sys\ndef input():\n\treturn sys.stdin.readline()[:-1]\nt = int(input())\nfor _ in range(t):\n\tn = int(input())\n\ts = input()\n\ta, b = \"\", \"\"\n\tone = False\n\tfor i in range(n):\n\t\tif s[i] == \"0\":\n\t\t\ta += \"0\"\n\t\t\tb += \"0\"\n\t\telif s[i] == \"1\":\n\t\t\tif not one:\n\t\t\t\ta += \"1\"\n\t\t\t\tb += \"0\"\n\t\t\t\tone = True\n\t\t\telse:\n\t\t\t\ta += \"0\"\n\t\t\t\tb += \"1\"\n\t\telse:\n\t\t\tif not one:\n\t\t\t\ta += \"1\"\n\t\t\t\tb += \"1\"\n\t\t\telse:\n\t\t\t\ta += \"0\"\n\t\t\t\tb += \"2\"\n\tprint(a)\n\tprint(b)", "def go():\n # n,k = map(int,input().split())\n\n n = int(input())\n x= input()\n a=[]\n b=[]\n i=0\n while i<n and x[i]!='1':\n if x[i]=='2':\n a.append('1')\n b.append('1')\n else:\n a.append('0')\n b.append('0')\n i+=1\n\n if i<n:\n a.append('1')\n b.append('0')\n i+=1\n\n while i<n:\n a.append('0')\n b.append(x[i])\n i+=1\n\n return ''.join(a) + '\\n' + ''.join(b)\n\n\n\n\n\n# x,s = map(int,input().split())\nt = int(input())\n# t=1\nans=[]\nfor _ in range(t):\n # go()\n ans.append(str(go()))\n\nprint('\\n'.join(ans))", "t = int(input())\nfor _ in range(t):\n n = int(input())\n x = input().strip()\n flag = False\n ans1 = \"\"\n ans2 = \"\"\n for c in x:\n if c=='0':\n ans1+='0'\n ans2+='0'\n elif flag:\n ans1+='0'\n ans2+=c\n elif c=='1':\n ans1+='1'\n ans2+='0'\n flag = True\n else:\n ans1+='1'\n ans2+='1'\n print(ans1)\n print(ans2)", "tc = int(input())\nfor _ in range(tc):\n n = int(input())\n s = input()\n a = b = '1'\n flag = None\n for i in s[1:]:\n if int(i) % 2 == 0 and not flag:\n num = int(i) // 2\n a += str(num)\n b += str(num)\n else:\n num = int(i) // 2\n if not flag:\n a += str(num + 1)\n b += str(num)\n flag = True\n else:\n a += str(0)\n b += str(i)\n print(a, b, sep=\"\\n\")\n", "t = int(input())\n\nfor _ in range(t):\n n = int(input())\n \n x = list(map(int, input()))\n \n a_larger = False\n \n a = []\n b = []\n for d in x:\n if a_larger:\n a += [\"0\"]\n b += [str(d)]\n else:\n if d==0:\n a += [\"0\"]\n b += [\"0\"]\n elif d==1:\n a += [\"1\"]\n b += [\"0\"]\n a_larger = True\n else:\n a += [\"1\"]\n b += [\"1\"]\n print(\"\".join(a))\n print(\"\".join(b))\n"]
{ "inputs": [ "4\n5\n22222\n5\n21211\n1\n2\n9\n220222021\n" ], "outputs": [ "11111\n11111\n11000\n10211\n1\n1\n110111011\n110111010\n" ] }
introductory
https://codeforces.com/problemset/problem/1328/C
[ 32, 1372, 374, 71617, 658, 421, 432, 5610, 1172, 18509, 400, 15, 54876, 400, 16, 3, 323, 400, 17, 12947, 1752, 3110, 11, 279, 2701, 5109, 525, 71617, 658, 25, 400, 16, 15, 17, 17, 54876, 400, 16, 16, 54876, 400, 17, 16, 54876, 4...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,042
Calculate the trace of a square matrix. A square matrix has `n` rows and `n` columns, where `n` is any integer > 0. The entries of the matrix can contain any number of integers. The function should return the calculated trace of the matrix, or `nil/None` if the array is empty or not square; you can otherwise assume the input will be valid (of the form described below). The trace of an n-by-n square matrix **A** is defined to be the sum of the elements on the main diagonal (the diagonal from the upper left to the lower right) of **A**. A matrix will be defined as an array of arrays, where the 1st entry represents the 1st row, the 2nd entry the 2nd row, and so on. For example, the following code... ```ruby,python [[1, 2, 3], [4, 5, 6], [7, 8, 9]] ``` represents the matrix ``` |1 2 3| |4 5 6| |7 8 9| ``` which has a trace of `1 + 5 + 9 = 15`. You can read more about the trace of a matrix at these sources: * http://en.wikipedia.org/wiki/Trace_(linear_algebra) * http://mathworld.wolfram.com/MatrixTrace.html ~~~if:ruby Note: The `Matrix` class is disabled. ~~~ ~~~if:python Note: `Numpy` is disabled. ~~~
["def trace(matrix):\n if not matrix or len(matrix) != len(matrix[0]):\n return None\n return sum(matrix[i][i] for i in range(len(matrix)))", "def trace(matrix):\n if matrix and set(map(len,matrix))=={len(matrix)}:\n return sum(matrix[x][x] for x in range(len(matrix)))", "trace=lambda m: sum(m[i][i] for i in range(len(m))) if m and len(m) == len(m[0]) else None", "def trace(matrix):\n if matrix and {len(matrix)} == {len(m) for m in matrix}:\n return sum(matrix[i][i] for i in range(len(matrix)))", "def trace(mx):\n return None if not mx or len(mx) != len(mx[0]) else sum(mx[i][i] for i in range(len(mx)))", "def trace(matrix):\n \n matrixLen = len(matrix)\n \n if matrixLen == 0:\n return None\n \n matrixElemsLens = [len(i) for i in matrix]\n \n for i in matrixElemsLens:\n if i != matrixLen:\n return None\n \n totalTrace = 0\n \n currentElem = 0\n for row in matrix:\n totalTrace += row[currentElem]\n currentElem += 1\n \n return totalTrace", "def trace(matrix):\n return sum(matrix[i][i] for i in range(len(matrix))) if len(matrix) > 0 and len(matrix[0]) == len(matrix) else None", "def trace(matrix):\n if matrix and len(matrix) == len(matrix[0]):\n return sum(row[i] for i, row in enumerate(matrix))", "def trace(matrix):\n size = len(matrix)\n \n if not matrix or any(len(row) != size for row in matrix):\n return None\n \n return sum( matrix[i][i] for i in range(size) )", "trace=lambda m:None if not m or len(m)!=len(m[0]) else sum([m[i][i] for i in range(len(m))])"]
{"fn_name": "trace", "inputs": [[[[1, 2, 3], [4, 5, 6], [7, 8, 9]]], [[[0, 0], [0, 0]]], [[[0, 0, 0], [0, 0, 0], [0, 0, 0]]], [[[1, 0, 0], [0, 1, 0], [0, 0, -2]]], [[[0]]], [[[1]]], [[[-300]]], [[]], [[[]]], [[[1, 2], [1, 2], [1, 2]]], [[[1, 2, 3], [1, 2, 3]]]], "outputs": [[15], [0], [0], [0], [0], [1], [-300], [null], [null], [null], [null]]}
introductory
https://www.codewars.com/kata/55208f16ecb433c5c90001d2
def trace(matrix):
[ 47866, 279, 11655, 315, 264, 9334, 6172, 13, 362, 9334, 6172, 702, 1565, 77, 63, 6978, 323, 1565, 77, 63, 8147, 11, 1380, 1565, 77, 63, 374, 894, 7546, 861, 220, 15, 13, 576, 10695, 315, 279, 6172, 646, 6644, 894, 1372, 315, 25780...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
629
Naturally, the magical girl is very good at performing magic. She recently met her master wizard Devu, who gifted her R potions of red liquid, B potions of blue liquid, and G potions of green liquid. - The red liquid potions have liquid amounts given by r[1], ..., r[R] liters. - The green liquid potions have liquid amounts given by g[1], ..., g[G] liters. - The blue liquid potions have liquid amounts given by b[1], ..., b[B] liters. She want to play with the potions by applying magic tricks on them. In a single magic trick, she will choose a particular color. Then she will pick all the potions of the chosen color and decrease the amount of liquid in them to half (i.e. if initial amount of liquid is x, then the amount after decrement will be x / 2 where division is integer division, e.g. 3 / 2 = 1 and 4 / 2 = 2). Because she has to go out of station to meet her uncle Churu, a wannabe wizard, only M minutes are left for her. In a single minute, she can perform at most one magic trick. Hence, she can perform at most M magic tricks. She would like to minimize the maximum amount of liquid among all of Red, Green and Blue colored potions. Formally Let v be the maximum value of amount of liquid in any potion. We want to minimize the value of v. Please help her. -----Input----- First line of the input contains an integer T denoting the number of test cases. Then for each test case, we have four lines. The first line contains four space separated integers R, G, B, M. The next 3 lines will describe the amount of different color liquids (r, g, b), which are separated by space. -----Output----- For each test case, print a single integer denoting the answer of the problem. -----Constraints----- - 1 ≤ T ≤ 1000 - 1 ≤ R, G, B, M ≤ 100 - 1 ≤ r[i], g[i], b[i] ≤ 10^9 -----Example----- Input: 3 1 1 1 1 1 2 3 1 1 1 1 2 4 6 3 2 2 2 1 2 3 2 4 6 8 Output: 2 4 4 -----Explanation----- Example case 1. Magical girl can pick the blue potion and make its liquid amount half. So the potions will now have amounts 1 2 1. Maximum of these values is 2. Hence answer is 2.
["import sys\nimport math\nimport heapq\ndef half(n):\n return n//2\ndef main(arr,m):\n a,b,c=arr\n \n while m!=0:\n \n \n \n s=max(a,b,c)\n \n if s==a:\n a=half(a)\n elif s==b:\n b=half(b)\n else:\n c=half(c)\n m-=1\n return max(a,b,c)\n \n \n \n \n \n\nfor i in range(int(input())):\n r,g,b,m=list(map(int,input().split()))\n arr=[]\n for j in range(3):\n c=max(list(map(int,input().split())))\n arr.append(c)\n \n print(main(arr,m))\n", "import sys\nimport math\nimport heapq\ndef half(arr):\n for i in range(len(arr)):\n arr[i]//=2\n return arr\ndef main(arr,m):\n x,y,z=arr\n x.sort()\n y.sort()\n z.sort()\n \n while m!=0:\n \n a,b,c=x[-1],y[-1],z[-1]\n \n s=max(a,b,c)\n \n if s==a:\n half(x)\n elif s==b:\n half(y)\n else:\n half(z)\n m-=1\n return max(x[-1],y[-1],z[-1])\n \n \n \n \n \n\nfor i in range(int(input())):\n r,g,b,m=list(map(int,input().split()))\n arr=[]\n for j in range(3):\n c=list(map(int,input().split()))\n arr.append(c)\n \n print(main(arr,m))\n", "# cook your dish here\nfor _ in range(int(input())):\n r,g,b,m=list(map(int, input().split()))\n l=[]\n for i in range(3):\n l1=list(map(int, input().split()))\n l.append(l1)\n \n for i in range(m+1):\n a=0\n b=0\n for j in range(3):\n m=max(l[j])\n if m>a:\n a=m \n b=j \n \n for k in range(len(l[b])):\n l[b][k]=l[b][k]//2\n \n print(a)", "def potion(m, l):\n for _ in range(m):\n l.sort()\n l[2] = l[2] // 2\n return max(l)\n\ntry:\n tstc = int(input())\n for t in range(tstc):\n r, g, b, m = map(int, input().split())\n red = [int(i) for i in input().split()]\n green = [int(i) for i in input().split()]\n blue = [int(i) for i in input().split()]\n print(potion(m, [max(red), max(green), max(blue)]))\nexcept:\n pass", "# cook your dish here\ntest=int(input())\nfor _ in range(test):\n r,b,g,m=map(int,input().split())\n red=sorted(map(int,input().split()),reverse=True)\n blue=sorted(map(int,input().split()),reverse=True)\n green=sorted(map(int,input().split()),reverse=True)\n x,y,z=red[0],blue[0],green[0]\n for _ in range(m):\n k=max(x,y,z)\n if k==x:\n x=x//2\n elif k==y:\n y=y//2\n else:\n z=z//2\n print(max(x,y,z))", "# cook your dish here\nfor _ in range(int(input())):\n \n r,b,g,m = list(map(int,input().split()))\n \n red = sorted(map(int,input().split()),reverse=True)\n blue = sorted(map(int,input().split()),reverse=True)\n green = sorted(map(int,input().split()),reverse=True)\n x,y,z=red[0],blue[0],green[0]\n for _ in range(m):\n \n k=max(x,y,z)\n \n if k==x:\n x=x//2\n \n elif k==y:\n y=y//2\n \n else:\n z=z//2\n \n print(max(x,y,z))\n \n \n", "t=int(input())\nwhile(t>0):\n r,g,q,m=map(int,input().split())\n a=list(map(int,input().split()))\n b=list(map(int,input().split()))\n c=list(map(int,input().split()))\n for i in range(m):\n x=max(a)\n y=max(b)\n z=max(c)\n if(x>=y)and(x>=z):\n for j in range(r):\n a[j]//=2\n elif(y>=x)and(y>=z):\n for j in range(g):\n b[j]//=2\n else:\n for j in range(q):\n c[j]//=2\n x=max(a)\n y=max(b)\n z=max(c)\n print(max(x,max(y,z)))\n t-=1", "for _ in range(int(input())):\n r1,g1,b1,m=map(int,input().split())\n r=[int(i) for i in input().split()]\n g=[int(j) for j in input().split()]\n b=[int(k) for k in input().split()]\n while m>0:\n if max(max(r),max(g),max(b)) in r:\n r=[i//2 for i in r]\n elif max(max(r),max(g),max(b)) in g:\n g=[j//2 for j in g]\n else:\n b=[k//2 for k in b]\n m-=1\n print(max(max(r),max(g),max(b)))", "t = int(input()) \nfor i in range (t) :\n line = input()\n pui = line.split()\n r = int(pui[0])\n g = int(pui[1]) \n b = int(pui[2]) \n m = int(pui[3]) \n ar = list()\n for i in range (3) :\n line = input()\n pui = line.split()\n pui = [int (j) for j in pui]\n ar.append(pui) \n for i in range (m) :\n R = max(ar[0]) \n G = max(ar[1]) \n B = max(ar[2]) \n if R>=G and R >= B :\n for j in range(len(ar[0])) :\n ar[0][j] = int(ar[0][j] / 2) \n elif G >= R and G >= B :\n for j in range(len(ar[1])) : \n ar[1][j] = int(ar[1][j] / 2) \n elif B >= G and B >= R :\n for j in range(len(ar[2])) : \n ar[2][j] = int(ar[2][j] / 2)\n R = max(ar[0]) \n G = max(ar[1]) \n B = max(ar[2])\n ans = max(R, G, B)\n print(ans)\n", "t = int(input()) \nfor i in range (t) :\n line = input()\n pui = line.split()\n r = int(pui[0])\n g = int(pui[1]) \n b = int(pui[2]) \n m = int(pui[3]) \n ar = list()\n for i in range (3) :\n line = input()\n pui = line.split()\n pui = [int (j) for j in pui]\n ar.append(pui) \n for i in range (m) :\n R = max(ar[0]) \n G = max(ar[1]) \n B = max(ar[2]) \n if R>=G and R >= B :\n for j in range(len(ar[0])) :\n ar[0][j] = int(ar[0][j] / 2) \n elif G >= R and G >= B :\n for j in range(len(ar[1])) : \n ar[1][j] = int(ar[1][j] / 2) \n elif B >= G and B >= R :\n for j in range(len(ar[2])) : \n ar[2][j] = int(ar[2][j] / 2)\n R = max(ar[0]) \n G = max(ar[1]) \n B = max(ar[2])\n ans = max(R, G, B)\n print(ans)\n", "for _ in range(int(input())):\n R,G,B,M=map(int,input().split())\n l=[]\n r=list(map(int,input().split()))\n rm=max(r)\n g=list(map(int,input().split()))\n gm=max(g)\n b=list(map(int,input().split()))\n bm=max(b)\n l=[rm,gm,bm]\n l.sort()\n for i in range(M):\n l[-1]//=2\n l.sort()\n print(l[-1])", "for j in range(int(input())):\n r,g,b,m=map(int,input().split())\n x=[]\n for i in range(3):\n a=list(map(int,input().split()))\n x.append(a)\n while(m!=0):\n c=[]\n for i in x:\n c.append(max(i))\n z=c.index(max(c))\n for i in range(len(x[z])):\n x[z][i]=x[z][i]//2\n m-=1\n am=[]\n for i in x:\n am+=i\n print(max(am))", "T = int(input())\nfor i in range(T):\n [r, g, b, k] = list(map(int, input().split()))\n s = list(map(int,input().split()))\n t = list(map(int,input().split()))\n c = list(map(int,input().split()))\n j = sorted([max(s),max(t),max(c)])\n for i in range(k):\n j[-1] = int(j[-1] / 2)\n j = sorted(j)\n print(j[-1])", "for _ in range(int(input())):\n R, G, B, M = map(int, input().split())\n R_list = list(map(int, input().split()))\n G_list = list(map(int, input().split()))\n B_list = list(map(int, input().split()))\n for j in range(M):\n rSum = max(R_list)\n gSum = max(G_list)\n bSum = max(B_list)\n p = max(rSum, bSum, gSum)\n if p == rSum:\n for i in range(R):\n R_list[i] = R_list[i] // 2\n elif p == bSum:\n for i in range(B):\n B_list[i] = B_list[i] // 2\n else:\n for i in range(G):\n G_list[i] = G_list[i] // 2\n rSum = max(R_list)\n gSum = max(G_list)\n bSum = max(B_list)\n print(max(rSum, bSum, gSum))", "# cook your dish here\nt=int(input())\nfor i in range(t):\n [r,g,b,k]=list(map(int,input().split()))\n rs=list(map(int,input().split()))\n bs=list(map(int,input().split()))\n gs=list(map(int,input().split()))\n ans=sorted([max(rs),max(bs),max(gs)])\n for i in range(k):\n ans[-1]=int(ans[-1]/2)\n ans=sorted(ans)\n print(ans[-1])", "t=int(input())\nfor x in range(0,t):\n r,g,b,m=map(int,input().split())\n a=[]\n c=[]\n for i in range(0,3):\n v=list(map(int,input().split()))\n v.sort(reverse=True)\n a.append(v)\n a.sort() \n for i in range(0,m):\n l=len(a[2])\n j=0\n while(j<l):\n a[2][j]=int(a[2][j]/2)\n j+=1\n a.sort() \n for x in a:\n c.append(max(x))\n print(max(c)) ", "# cook your dish here\nfor _ in range(int(input())):\n r,g,b,m=list(map(int,input().split()))\n r=list(map(int,input().split()))\n g=list(map(int,input().split()))\n b=list(map(int,input().split()))\n x=max(r)\n y=max(g)\n z=max(b)\n while m>0:\n if x>=y and x>=z:\n x//=2\n elif y>=x and y>=z:\n y//=2\n else:\n z//=2\n m-=1\n print(max(x,y,z))\n", "t=int(input())\n\nfor _ in range(t):\n R, G, B, M = [int(x) for x in input().split(' ')]\n r = [int(x) for x in input().split(' ')]\n g = [int(x) for x in input().split(' ')]\n b = [int(x) for x in input().split(' ')]\n r.sort(reverse=True)\n g.sort(reverse=True)\n b.sort(reverse=True)\n \n for y in range(M):\n m = max(r[0], g[0], b[0])\n if m == r[0]:\n r = [x//2 for x in r]\n elif m == g[0]:\n g = [x//2 for x in g]\n elif m == b[0]:\n b = [x//2 for x in b]\n \n print(max(r[0], g[0], b[0]))\n \n", "for _ in range(int(input())):\n r, g, b, m = map(int, input().split())\n R = max(list(map(int, input().split())))\n G = max(list(map(int, input().split())))\n B = max(list(map(int, input().split())))\n \n cur = [R, G, B]\n \n while m > 0:\n m -= 1\n index = cur.index(max(cur))\n cur[index] //= 2\n \n print(max(cur))", "t=int(input())\nfor ijk in range(0,t):\n r,g,b,m=list(map(int,input().strip().split()))\n ra=list(map(int,input().strip().split()))\n rb=list(map(int,input().strip().split()))\n rc=list(map(int,input().strip().split()))\n a=[max(ra),max(rb),max(rc)]\n for i in range(0,m):\n j=a.index(max(a))\n a[j]=a[j]//2\n print(max(a))\n \n \n", "for _ in range(int(input())):\n \n r,g,b,m = map(int, input().split())\n Rarr = list(map(int, input().split()))\n Garr = list(map(int, input().split()))\n Barr = list(map(int, input().split()))\n while(m > 0):\n Rmax = max(Rarr)\n Gmax = max(Garr)\n Bmax = max(Barr)\n if Rmax == max(Gmax, Rmax, Bmax):\n Rarr = [int(i/2) for i in Rarr]\n elif Gmax == max(Gmax, Rmax, Bmax):\n Garr = [int(i/2) for i in Garr]\n else:\n Barr = [int(i/2) for i in Barr]\n m-=1\n total = Rarr + Garr + Barr\n total.sort()\n print(total[-1])"]
{"inputs": [["3", "1 1 1 1", "1", "2", "3", "1 1 1 1", "2", "4", "6", "3 2 2 2", "1 2 3", "2 4", "6 8"]], "outputs": [["2", "4", "4"]]}
interview
https://www.codechef.com/problems/PRPOTION
[ 45, 71147, 11, 279, 23702, 3743, 374, 1602, 1661, 518, 16380, 10963, 13, 2932, 5926, 2270, 1059, 7341, 33968, 6040, 84, 11, 879, 46780, 1059, 431, 78583, 315, 2518, 14473, 11, 715, 33, 78583, 315, 6303, 14473, 11, 323, 479, 78583, 315...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,495
In this Kata, we are going to see how a Hash (or Map or dict) can be used to keep track of characters in a string. Consider two strings `"aabcdefg"` and `"fbd"`. How many characters do we have to remove from the first string to get the second string? Although not the only way to solve this, we could create a Hash of counts for each string and see which character counts are different. That should get us close to the answer. I will leave the rest to you. For this example, `solve("aabcdefg","fbd") = 5`. Also, `solve("xyz","yxxz") = 0`, because we cannot get second string from the first since the second string is longer. More examples in the test cases. Good luck!
["from collections import Counter\n\ndef solve(a,b):\n return 0 if Counter(b) - Counter(a) else len(a) - len(b)", "def solve(a,b):\n for x in set(b):\n if a.count(x) >= b.count(x):\n continue\n else:\n return 0\n return len(a)-len(b)", "def solve(a,b):\n print((a,b))\n if sorted(a)==sorted(b) or (set(list(a))==set(list(b))):\n return 0\n for x in b:\n for x in a:\n if a.count(x)<b.count(x) : return 0\n else: return len(a)-len(b) ", "def solve(a,b):\n a=list(a)\n try:\n for c in b:\n a.pop(a.index(c))\n return len(a)\n except:\n return 0", "def solve(a,b):\n for char in b:\n return 0 if b.count(char) > a.count(char) or len(b)>=len(a) else len(a)-len(b) \n", "from collections import Counter\n\ndef solve(a,b):\n return sum((Counter(a)-Counter(b)).values()) if Counter(b) - Counter(a) == {} else 0 ", "from collections import Counter\n\ndef solve(a, b):\n c_diff, c_b = Counter(a), Counter(b)\n c_diff.subtract(c_b)\n result = 0\n for k,v in c_diff.items():\n if v >= 0:\n result += v\n else:\n return 0\n return result", "from collections import Counter\n\ndef solve(a,b):\n aa=Counter(a)\n bb=Counter(b)\n \n for k,v in list(bb.items()):\n diff = aa[k]-v\n aa[k]-=v\n if diff<0: return 0\n \n return sum(aa.values())\n \n \n", "solve=lambda a,b,c=__import__('collections').Counter:not c(b)-c(a)and len(a)-len(b)", "from collections import Counter as C\ndef solve(Q,S) :\n Q,S = C(Q),C(S)\n if all(V in Q and S[V] <= Q[V] for V in S) :\n return sum(Q[V] - (S[V] if V in S else 0) for V in Q)\n return 0"]
{"fn_name": "solve", "inputs": [["xyz", "yxz"], ["abcxyz", "ayxz"], ["abcdexyz", "yxz"], ["xyz", "yxxz"], ["abdegfg", "ffdb"], ["aabcdefg", "fbd"]], "outputs": [[0], [2], [5], [0], [0], [5]]}
introductory
https://www.codewars.com/kata/59fab1f0c9fc0e7cd4000072
def solve(a,b):
[ 641, 419, 98838, 11, 582, 525, 2087, 311, 1490, 1246, 264, 6531, 320, 269, 5027, 476, 6451, 8, 646, 387, 1483, 311, 2506, 3754, 315, 5766, 304, 264, 914, 13, 4710, 37175, 1378, 9069, 53305, 64, 41202, 70, 39917, 323, 53305, 69, 8940...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,207
Write a function that takes a positive integer n, sums all the cubed values from 1 to n, and returns that sum. Assume that the input n will always be a positive integer. Examples: ```python sum_cubes(2) > 9 # sum of the cubes of 1 and 2 is 1 + 8 ```
["def sum_cubes(n):\n return sum(i**3 for i in range(0,n+1))", "def sum_cubes(n):\n return (n*(n+1)/2)**2", "def sum_cubes(n):\n return sum(x ** 3 for x in range(n+1))", "def sum_cubes(n):\n return (n*(n+1)//2)**2", "def sum_cubes(n):\n return sum([i**3 for i in range(1,n+1)])", "def sum_cubes(n):\n return sum( i**3 for i in range(n+1) )", "def sum_cubes(n):\n s=0\n i=0\n while i<=n:\n s=i**3+s\n i=i+1\n return s# your code here", "def sum_cubes(n):\n result = 0\n for i in range(n+1):\n result = result + i**3\n \n return result", "def sum_cubes(n):\n return (n*n*(n+1)*(n+1))/4", "sum_cubes = lambda n: sum([i ** 3 for i in range(n + 1)])", "def sum_cubes(n):\n s = 1\n f = n\n v = 0\n while s != f + 1:\n v += s **3\n s += 1\n return v", "def sum_cubes(n):\n return sum(v ** 3 for v in range(n + 1))", "sum_cubes = lambda n: sum( i**3 for i in range(1,n+1) )", "import decimal\ndef sum_cubes(n):\n n = decimal.Decimal(n)\n return n**2*(n+1)**2/4", "def sum_cubes(n):\n res = 0\n for i in range(1, n + 1):\n res += i ** 3\n return res\n", "def sum_cubes(n):\n # your code here\n return sum([x**3 for x in range(1,n+1)])", "def sum_cubes(n):\n return sum(x * x * x for x in range(n + 1))", "def sum_cubes(n):\n return sum([x ** 3 for x in range(n + 1)])", "def sum_cubes(n):\n return sum(i**3 for i in range(1, n+1))", "def sum_cubes(n):\n result = 0\n for cube in range(n+1):\n result = result + cube * cube * cube\n return result", "def sum_cubes(n):\n my_array = [n ** 3 for n in range(1, n+1)]\n return sum(my_array)", "from math import pow\ndef sum_cubes(n):\n sum=0\n for i in range(1,n+1):\n sum+=i**3\n return sum", "def sum_cubes(n):\n \n sol = 0\n \n for i in range(n+1):\n \n sol += i**3\n \n return sol", "def sum_cubes(n):\n i = 1\n sums = 0\n while i <= n:\n sums = sums + i ** 3\n i += 1\n return sums ", "def sum_cubes(n):\n return sum(c**3 for c in range(1,n+1))", "def sum_cubes(n):\n return sum(cubed**3 for cubed in range(1, n+1))\n # your code here\n", "def sum_cubes(n):\n sum = 0\n for i in range(0,n+1):\n sum = sum+(pow(i,3))\n return sum", "def sum_cubes(n):\n cubes = [i**3 for i in range(1,n+1)]\n return sum(cubes)", "def sum_cubes(n):\n return sum(list([x**3 for x in range(n+1)]))", "def sum_cubes(n):\n s = 0\n for i in range(n+1):\n s += pow(i, 3)\n return s", "def sum_cubes(n):\n tot = 0\n for x in range(1,n+1):\n tot += x **3\n return tot", "def sum_cubes(n):\n # your code here\n sum_cube=0\n for e in range(0,n+1):\n sum_cube+= e**3\n return sum_cube", "# Formula taken from https://mathschallenge.net/library/number/sum_of_cubes\n\ndef sum_cubes(n):\n return (n * (n + 1) // 2) ** 2", "def sum_cubes(n):\n return sum(a**3 for a in range(1,n+1))", "def sum_cubes(n):\n total = 0\n for x in range(n+1):\n total += x**3\n return total", "def sum_cubes(n):\n ans = 0\n while n > 0:\n ans += pow(n, 3)\n n -= 1\n return ans", "def sum_cubes(n):\n x = [i ** 3 for i in range(1, n+1)]\n return sum(x)", "def sum_cubes(n: int) -> int:\n return (n * (n + 1) // 2) ** 2\n", "def sum_cubes(n):\n return int((n*(n+1)//2)**2)", "def sum_cubes(n):\n total = 0\n for i in range(1, n + 1):\n i = i ** 3\n total += i\n return total\n", "def sum_cubes(n):\n sum=0\n for num in range(0,n+1):\n num=num*num*num\n sum=sum+num\n return sum ", "def sum_cubes(n):\n c = 0\n for i in range(1, n+1):\n c = c + i**3\n return c", "def sum_cubes(n: int):\n return sum(i ** 3 for i in range(n+1))", "def sum_cubes(n):\n new = 0\n for num in range(1, n+1):\n new += num ** 3\n return new\n", "def sum_cubes(n):\n return sum((i+1)**3 for i in range(n)) # ahuel, da", "def sum_cubes(n):\n summ = 0\n for i in range(n):\n summ += (i+1)**3\n return summ", "def sum_cubes(n):\n a=0\n for x in range(1,n+1):\n a=(x**3) + a\n return a", "def sum_cubes(n):\n \n arr = []\n for i in range(1, n+1):\n arr.append(i)\n x = [i**3 for i in arr]\n return sum(x)", "def sum_cubes(n):\n sum = 0\n for n in range(1,n + 1):\n sum = sum + n ** 3\n return sum", "def sum_cubes(n):\n result = [0]\n if n == 1:\n return 1\n while n > 0:\n result.append(n**3)\n n -= 1\n return sum(result)", "def sum_cubes(n):\n sum = 0\n for i in range(1, n+1):\n sum += i*i*i\n return sum\n \n n = 6\n print((sum_cubes(n)))\n\n # your code here\n", "def sum_cubes(n):\n return sum(map(lambda a: a**3, range(1,n+1)))", "def sum_cubes(n):\n cubes = []\n for num in range(n+1):\n cubes.append(num ** 3)\n return sum(cubes)\n \n # your code here\n", "def sum_cubes(n):\n total = 0\n for a in range(1, n + 1):\n total += (a**3)\n return total", "def sum_cubes(n):\n return sum([(i**3) for i in range(1,n+1,1)])", "def sum_cubes(n):\n answer = 0\n for i in range(n+1):\n answer += i ** 3\n return answer", "def sum_cubes(n):\n return sum([int(x)**3 for x in range(1,n+1)])", "def sum_cubes(n):\n s = [i ** 3 for i in range(1, n+1)]\n return sum(s)", "def sum_cubes(n):\n return sum([x * x * x for x in range(n + 1)])", "def sum_cubes(n):\n i=1\n x=0\n while i < n+1:\n x = x + i**3\n i+=1\n \n return x", "import math\ndef sum_cubes(n):\n new = []\n for i in range(1,n+1):\n x = pow(i,3)\n new.append(x)\n i = i + 1\n return sum(new)\n\n\n\n", "def sum_cubes(n):\n sum = 0 \n for i in range(1,n+1):\n sum += i*i*i\n \n# main\n return sum\n\n", "def sum_cubes(n):\n # your code here\n return ( sum(x*x*x for x in range(n+1)))\n\nn=3\nsum_cubes(n)\n", "def sum_cubes(n):\n # your cod\n return sum([i**3 for i in range(n+1)])", "def sum_cubes(n):\n x= 1\n total = 0\n while x<=n:\n total+= x**3\n x+=1\n return total", "def sum_cubes(n):\n return sum([number ** 3 for number in range(1,n+1)])", "def sum_cubes(n):\n suma = 0\n for i in range(1, n+1):\n suma += i**3\n\n return suma\n\nprint((sum_cubes(2)))\n", "def sum_cubes(n):\n i=1\n m=0\n while i<=n:\n cube=i**3\n m=m+cube\n i=i+1\n return m\n", "def sum_cubes(n):\n return sum([item**3 for item in range(1, n + 1, 1)])", "def sum_cubes(n):\n count = 0\n for i in range(n+1):\n count += (i ** 3)\n return count", "def sum_cubes(n):\n cubes, numbers = [], [n]\n\n for i in range(0, n):\n numbers.append(int(i))\n\n for num in numbers:\n cubes.append(int(num*num*num))\n return sum(cubes)", "def sum_cubes(n):\n return sum([a**3 for a in range(n+1)])", "def sum_cubes(n):\n counter=0\n saver=0\n while counter<=n:\n saver=counter**3+saver\n counter+=1\n \n return saver\n", "def sum_cubes(n):\n values = range(1, n + 1)\n s = 0\n for value in values:\n cubed = value ** 3\n s += cubed\n return s", "def sum_cubes(n):\n if n==1:\n return 1\n LV=[]\n for i in range(n+1):\n res=i**3\n LV.append(res)\n return sum(LV)", "def sum_cubes(n):\n # your code here\n y = n + 1\n x = list(range(0,y))\n z = []\n for i in x:\n a = i ** 3\n z.append(a)\n return sum(z)", "def sum_cubes(n):\n res = 0\n if n > 0:\n for x in range(1, n + 1):\n res += x ** 3\n return res", "def sum_cubes(n):\n a=0\n for i in range(n+1):\n a=i*i*i+a\n i+=1\n return a", "def sum_cubes(n):\n result = 0\n for i in range(0, n + 1):\n cube = i ** 3\n result += cube\n return result\n # your code here\n", "def sum_cubes(n):\n return (n*(n+1)*n*(n+1))/4; ", "def sum_cubes(n):\n\n# There must be a shorter way!\n\n step1 = list(range(n))\n step2 = [x + 1 for x in step1]\n \n return sum([x**3 for x in step2])\n \n \n \n", "def sum_cubes(n):\n g = 0\n for i in range(n + 1):\n i **= 3\n g += i\n return g\n", "def sum_cubes(n):\n ans = 0\n for x in range(1,n+1):\n ans += x ** 3\n return ans", "def sum_cubes(n):\n cubes = 0\n for i in range(1, n+1):\n cubes += i*i*i \n return cubes\n", "def sum_cubes(n):\n sum = 0\n for number in range(1,n + 1):\n cube = number ** 3\n sum += cube\n return sum", "def sum_cubes(n):\n return sum(nb ** 3 for nb in range(1, n + 1))", "def sum_cubes(n):\n numlist = []\n while n >= 0: \n numlist.append(n)\n n = n -1\n return sum(numlist)**2\n # your code here\n", "def sum_cubes(n):\n # your code here\n suma=0\n for i in range(n):\n suma=suma+(i+1)**3\n return suma", "def sum_cubes(n):\n exponentiated = 0\n for count in range(1, n):\n exponentiated += count ** 3\n return exponentiated + n ** 3", "def sum_cubes(n):\n x=[num**3 for num in range(n+1)]\n return(sum(x))", "from math import *\ndef sum_cubes(n):\n total = 0\n for i in range(n+1):\n total += int(pow(i,3))\n return total", "def sum_cubes(n):\n cubed = 0\n for i in range(n+1):\n cubed+=i*i*i\n i+=1\n return cubed\n", "def sum_cubes(n):\n sums = 0\n for num in range(0, n+1):\n sums+= (num **3)\n return sums", "def sum_cubes(n):\n sums = []\n for item in range(n):\n item += 1\n cube = pow(item,3)\n sums.append(cube)\n return sum(sums)", "def sum_cubes(n):\n res = 1\n \n while n > 1:\n res += (n*n*n)\n n -= 1\n \n return res", "def sum_cubes(n):\n cubes = map(lambda x: x ** 3, range(1, n + 1)) \n return sum(cubes)", "def sum_cubes(a):\n return sum([k**3 for k in range(1,a+1)])", "def sum_cubes(a):\n summ=0\n for k in range(1,a+1):\n summ+=k**3\n return summ", "def sum_cubes(n):\n return (n**2 + n)**2 // 4", "def sum_cubes(n): \n sum = 0\n for i in range(n +1 ):\n sum += i\n return sum * sum"]
{"fn_name": "sum_cubes", "inputs": [[1], [2], [3], [4], [10], [123]], "outputs": [[1], [9], [36], [100], [3025], [58155876]]}
introductory
https://www.codewars.com/kata/59a8570b570190d313000037
def sum_cubes(n):
[ 7985, 264, 729, 429, 4990, 264, 6785, 7546, 308, 11, 36398, 678, 279, 18728, 291, 2750, 504, 220, 16, 311, 308, 11, 323, 4675, 429, 2629, 382, 5615, 3885, 429, 279, 1946, 308, 686, 2677, 387, 264, 6785, 7546, 382, 40381, 1447, 73594...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
532
To help Lavanya learn all about binary numbers and binary sequences, her father has bought her a collection of square tiles, each of which has either a 0 or a 1 written on it. Her brother Nikhil has played a rather nasty prank. He has glued together pairs of tiles with 0 written on them. Lavanya now has square tiles with 1 on them and rectangular tiles with two 0's on them, made up of two square tiles with 0 stuck together). Thus, she can no longer make all possible binary sequences using these tiles. To amuse herself, Lavanya has decided to pick a number $N$ and try and construct as many binary sequences of length $N$ as possible using her collection of tiles. For example if $N$ = 1, she can only make the sequence 1. For $N$=2, she can make 11 and 00. For $N$=4, there are 5 possibilities: 0011, 0000, 1001, 1100 and 1111. Lavanya would like you to write a program to compute the number of arrangements possible with $N$ tiles so that she can verify that she has generated all of them. Since she cannot count beyond 15746, it is sufficient to report this number modulo 15746. -----Input:----- A single line with a single integer $N$. -----Output:----- A single integer indicating the number of binary sequences of length $N$, modulo 15746, that Lavanya can make using her tiles. -----Constraints:----- You may assume that $N \leq$ 1000000. -----Sample Input:----- 4 -----Sample Output:----- 5 -----Explanation:----- This corresponds to the example discussed above.
["n=int(input())\nmodulo=15746\nnum=[1,1]\nfor i in range(2,n+1):\n num.append((num[i-1]+num[i-2])%modulo)\nprint(num[n])", "def EXEC(n):\r\n if n < 3: return n\r\n else:\r\n x, y = 1, 2\r\n for _ in range(2, n):\r\n z = (x + y) % 15746\r\n x, y = y, z\r\n return y % 15746\r\n\r\n\r\nprint(EXEC(int(input())))", "def fib(n):\r\n s1,s2=1,2\r\n if n==1:\r\n return s1\r\n elif n==2:\r\n return s2\r\n else:\r\n for i in range(2,n):\r\n s3=(s1+s2)%15746\r\n s1=s2\r\n s2=s3\r\n return s2%15746\r\n\r\ntry:\r\n n=int(input())\r\n z=fib(n)\r\n print(z)\r\n \r\nexcept:\r\n pass", "\r\n# // Problem : Zero One Tiles\r\n# // Contest : CodeChef - IARCS OPC Judge Problems\r\n# // URL : https://www.codechef.com/IARCSJUD/problems/TILES01\r\n# // Memory Limit : 256 MB\r\n# // Time Limit : 1000 ms\r\n# // Powered by CP Editor (https://github.com/cpeditor/cpeditor)\r\n\r\ndp = [None]*1000010\r\ndp[0] = 0\r\ndp[1] = 1\t\r\nMOD = 15746\r\nn = int(input())\r\nfor i in range(2,n+2):\r\n\tdp[i] = (dp[i-1]+dp[i-2])%MOD\r\nprint(dp[n+1])", "n=int(input())\r\na,b=1,2\r\nif n==1 :\r\n print(1)\r\nelif n==2 :\r\n print(2)\r\nelse :\r\n for i in range (3 , n+1) :\r\n c=(a+b)%15746\r\n a=b\r\n b=c\r\n print(c%15746)", "n = int(input())\r\n\r\nl1 = 1\r\nl2 = 1\r\n\r\nans = 0\r\n\r\nif(n == 0):\r\n ans = 0\r\nelif(n == 1):\r\n ans = 1\r\nelif(n == 2):\r\n ans = 2\r\nelse:\r\n ans = 2\r\n for i in range(3,n+1):\r\n ans = ans % 15746\r\n k = l2 \r\n l2 = ans\r\n l1 = k\r\n ans = l1 + l2\r\n\r\nans = ans % 15746\r\n \r\nprint(ans)", "\r\n'''def abcd(n):\r\n x=(1+math.sqrt(5))/2\r\n y=(1-math.sqrt(5))/2\r\n \r\n val=((power(x, n, 15746)-power(y, n, 15746))//math.sqrt(5))\r\n return(int(val))'''\r\n \r\ndef main():\r\n n=int(input())\r\n #x=abcd(n+1)\r\n a=1; b=2;\r\n if(n==1):\r\n print(1)\r\n elif(n==2):\r\n print(2)\r\n else:\r\n for i in range(3, n+1):\r\n temp=(a+b)%15746\r\n a=b%15746\r\n b=temp%15746\r\n \r\n print(temp%15746)\r\n #print(power(0.55, 67, 1355))\r\n \r\nmain()"]
{"inputs": [["4"]], "outputs": [["5"]]}
interview
https://www.codechef.com/IARCSJUD/problems/TILES01
[ 1249, 1492, 42850, 24074, 3960, 678, 911, 7868, 5109, 323, 7868, 23700, 11, 1059, 6981, 702, 10788, 1059, 264, 4426, 315, 9334, 20493, 11, 1817, 315, 892, 702, 2987, 264, 220, 15, 476, 264, 220, 16, 5326, 389, 432, 13, 6252, 10641, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
4,140
# Bubblesort Algorithm ## Overview The Bubblesort Algorithm is one of many algorithms used to sort a list of similar items (e.g. all numbers or all letters) into either ascending order or descending order. Given a list (e.g.): ```python [9, 7, 5, 3, 1, 2, 4, 6, 8] ``` To sort this list in ascending order using Bubblesort, you first have to compare the first two terms of the list. If the first term is larger than the second term, you perform a swap. The list then becomes: ```python [7, 9, 5, 3, 1, 2, 4, 6, 8] # The "9" and "7" have been swapped because 9 is larger than 7 and thus 9 should be after 7 ``` You then proceed by comparing the 2nd and 3rd terms, performing a swap *when necessary*, and then the 3rd and 4th term, then the 4th and 5th term, etc. etc. When you reach the end of the list, it is said that you have completed **1 complete pass**. ## Task Given an array of integers, your function `bubblesortOnce`/`bubblesort_once`/`BubblesortOnce` (or equivalent, depending on your language's naming conventions) should return a *new* array equivalent to performing exactly **1 complete pass** on the original array. Your function should be pure, i.e. it should **not** mutate the input array.
["def bubblesort_once(l):\n l = l[:]\n for i in range(len(l)-1):\n if l[i] > l[i+1]:\n l[i], l[i+1] = l[i+1], l[i]\n return l", "def bubblesort_once(L):\n if len(L)<=1 : return L\n if L[0]<=L[1]: return [L[0]] + bubblesort_once(L[1:])\n return [L[1]] + bubblesort_once([L[0]]+L[2:])", "def bubblesort_once(lst):\n result = lst[:]\n for i in range(len(result) - 1):\n if result[i] > result[i+1]:\n result[i], result[i+1] = result[i+1], result[i]\n return result", "import copy\n\ndef bubblesort_once(l):\n res = copy.copy(l)\n for i in range(len(res)-1):\n if res[i] > res[i+1]:\n res[i], res[i+1] = res[i+1], res[i]\n return res", "def bubblesort_once(l):\n values = l[:]\n for i in range(0, len(values) - 1):\n first = values[i]\n second = values[i + 1]\n if(first > second ):\n values[i + 1] = first\n values[i] = second\n return values\n", "def bubblesort_once(arr):\n\n new_arr = arr.copy()\n for i in range(len(new_arr)-1):\n if new_arr[i]>new_arr[i+1]:\n new_arr[i], new_arr[i+1] = new_arr[i+1], new_arr[i]\n return new_arr", "def bubblesort_once(lst):\n arr = lst[:]\n for i in range(len(arr)-1):\n arr[i], arr[i+1] = sorted([arr[i], arr[i+1]])\n return arr", "def bubblesort_once(l):\n if len(l) < 2: return l[:]\n \n lst, mx = [], l[0]\n for v in l[1:]:\n if mx<v: mx,v = v,mx\n lst.append(v)\n lst.append(mx)\n return lst", "def bubblesort_once(l):\n for i in range(len(l)-1):\n if l[i] > l[i+1]:\n l = l[:i] + [ l[i+1] ] + [ l[i] ] + l[i+2::]\n return l", "def bubblesort_once(l):\n output = [i for i in l]\n for i in range(len(output)-1):\n output[i], output[i+1] = min(output[i], output[i+1]), max(output[i], output[i+1])\n return output"]
{"fn_name": "bubblesort_once", "inputs": [[[9, 7, 5, 3, 1, 2, 4, 6, 8]], [[1, 2]], [[2, 1]], [[1, 3]], [[3, 1]], [[24, 57]], [[89, 36]], [[1, 2, 3]], [[2, 4, 1]], [[17, 5, 11]], [[25, 16, 9]], [[103, 87, 113]], [[1032, 3192, 2864]], [[1, 2, 3, 4]], [[2, 3, 4, 1]], [[3, 4, 1, 2]], [[4, 1, 2, 3]], [[7, 5, 3, 1]], [[5, 3, 7, 7]], [[3, 1, 8, 5]], [[1, 9, 5, 5]], [[6, 3, 4, 9, 1, 2, 7, 8, 5]], [[6, 3, 4, 15, 14, 9, 1, 2, 7, 8, 5, 14, 11, 15, 17, 19]], [[42]], [[]]], "outputs": [[[7, 5, 3, 1, 2, 4, 6, 8, 9]], [[1, 2]], [[1, 2]], [[1, 3]], [[1, 3]], [[24, 57]], [[36, 89]], [[1, 2, 3]], [[2, 1, 4]], [[5, 11, 17]], [[16, 9, 25]], [[87, 103, 113]], [[1032, 2864, 3192]], [[1, 2, 3, 4]], [[2, 3, 1, 4]], [[3, 1, 2, 4]], [[1, 2, 3, 4]], [[5, 3, 1, 7]], [[3, 5, 7, 7]], [[1, 3, 5, 8]], [[1, 5, 5, 9]], [[3, 4, 6, 1, 2, 7, 8, 5, 9]], [[3, 4, 6, 14, 9, 1, 2, 7, 8, 5, 14, 11, 15, 15, 17, 19]], [[42]], [[]]]}
introductory
https://www.codewars.com/kata/56b97b776ffcea598a0006f2
def bubblesort_once(l):
[ 2, 425, 34295, 371, 40325, 271, 565, 34807, 271, 785, 425, 34295, 371, 40325, 374, 825, 315, 1657, 25185, 1483, 311, 3378, 264, 1140, 315, 4428, 3589, 320, 68, 1302, 13, 678, 5109, 476, 678, 11931, 8, 1119, 2987, 35388, 1973, 476, 4...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,026
Yaroslav is playing a game called "Time". The game has a timer showing the lifespan he's got left. As soon as the timer shows 0, Yaroslav's character dies and the game ends. Also, the game has n clock stations, station number i is at point (x_{i}, y_{i}) of the plane. As the player visits station number i, he increases the current time on his timer by a_{i}. The stations are for one-time use only, so if the player visits some station another time, the time on his timer won't grow. A player spends d·dist time units to move between stations, where dist is the distance the player has covered and d is some constant. The distance between stations i and j is determined as |x_{i} - x_{j}| + |y_{i} - y_{j}|. Initially, the player is at station number 1, and the player has strictly more than zero and strictly less than one units of time. At station number 1 one unit of money can increase the time on the timer by one time unit (you can buy only integer number of time units). Now Yaroslav is wondering, how much money he needs to get to station n. Help Yaroslav. Consider the time to buy and to increase the timer value negligibly small. -----Input----- The first line contains integers n and d (3 ≤ n ≤ 100, 10^3 ≤ d ≤ 10^5) — the number of stations and the constant from the statement. The second line contains n - 2 integers: a_2, a_3, ..., a_{n} - 1 (1 ≤ a_{i} ≤ 10^3). The next n lines contain the coordinates of the stations. The i-th of them contains two integers x_{i}, y_{i} (-100 ≤ x_{i}, y_{i} ≤ 100). It is guaranteed that no two stations are located at the same point. -----Output----- In a single line print an integer — the answer to the problem. -----Examples----- Input 3 1000 1000 0 0 0 1 0 3 Output 2000 Input 3 1000 1000 1 0 1 1 1 2 Output 1000
["n, d = map(int, input().split())\na = [0] + list(map(int, input().split())) + [0]\nx = []\ny = []\nfor i in range(n):\n xx, yy = map(int, input().split())\n x += [xx]\n y += [yy]\nb = [-1] * n\nb[0] = 0\nc = True\nwhile c:\n c = False\n for i in range(n):\n for j in range(1, n):\n if i != j and b[i] != -1:\n t = b[i] + (abs(x[i] - x[j]) + abs(y[i] - y[j])) * d - a[j]\n if b[j] == -1 or t < b[j]:\n b[j] = t\n c = True\nprint(b[-1])", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = range(n)\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])", "f = lambda: list(map(int, input().split()))\nn, d = f()\nr = range(n)\na = [0] + f() + [0]\np = [f() for i in r]\ns = [1e9] * n\nq, s[0] = 1, 0\nwhile q:\n q = 0\n for i in r:\n for j in r:\n if i != j:\n t = s[i] + (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) * d - a[j]\n if t < s[j]: q, s[j] = 1, t\nprint(s[-1])", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = list(range(n))\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])\n", "f = lambda: list(map(int, input().split()))\n\nn, d = f()\n\na = [0] + f() + [0]\n\np = [f() for i in range(n)]\n\nr = list(range(n))\n\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\n\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\n\nprint(s[-1][0])\n\n\n\n\n# Made By Mostafa_Khaled\n", "\nR = lambda: map(int, input().split())\nn, d = R()\na = [0] + list(R()) + [0]\nx = []\ny = []\nINF = float('inf')\n\ndef distance(x1, y1, x2, y2):\n return (abs(x1 - x2) + abs(y1 - y2)) * d\n\nfor i in range(n):\n xi, yi = R()\n x += [xi]\n y += [yi]\nb = [INF] * n\nb[0] = 0\nc = True\nwhile c:\n c = False\n for i in range(n):\n for j in range(1, n):\n if i != j and b[i] != -1:\n t = b[i] + distance(x[i], y[i], x[j], y[j]) - a[j]\n if t < b[j]:\n b[j] = t\n c = True\nprint(b[-1])", "R = lambda: map(int, input().split())\nn, d = R()\na = [0] + list(R()) + [0]\nx = []\ny = []\nINF = float('inf')\nfor i in range(n):\n xi, yi = R()\n x += [xi]\n y += [yi]\nb = [INF] * n\nb[0] = 0\nc = True\nwhile c:\n c = False\n for i in range(n):\n for j in range(1, n):\n if i != j and b[i] != -1:\n t = b[i] + (abs(x[i] - x[j]) + abs(y[i] - y[j])) * d - a[j]\n if t < b[j]:\n b[j] = t\n c = True\nprint(b[-1])", "f = lambda: list(map(int, input().split()))\nn, d = f()\na = [0] + f() + [0]\np = [f() for i in range(n)]\nr = range(n)\ns = [[d * (abs(p[i][0] - p[j][0]) + abs(p[i][1] - p[j][1])) - a[j] * (i != j) for j in r] for i in r]\nfor k in r: s = [[min(s[i][j], s[i][k] + s[k][j]) for i in r] for j in r]\nprint(s[-1][0])", "import sys\n\ndef minp():\n\treturn sys.stdin.readline().strip()\n\ndef mint():\n\treturn int(minp())\n\ndef mints():\n\treturn list(map(int, minp().split()))\n\ndef solve():\n\tn, dc = mints()\n\ta = list(mints())\n\ta.append(0)\n\tx = [0]*n\n\ty = [0]*n\n\tfor i in range(n):\n\t\tx[i], y[i] = mints()\n\td = [1<<30]*n\n\td[0] = 0\n\twas = [False]*n\n\tfor i in range(n):\n\t\tm = 1<<30\n\t\tmi = 0\n\t\tfor j in range(n):\n\t\t\tif not was[j] and m > d[j]:\n\t\t\t\tm = d[j]\n\t\t\t\tmi = j\n\t\tj = mi\n\t\twas[j] = True\n\t\tfor k in range(n):\n\t\t\tif not was[k]:\n\t\t\t\tdd = d[j] + (abs(x[k]-x[j])+abs(y[k]-y[j]))*dc\n\t\t\t\tdd -= a[k-1]\n\t\t\t\tif d[k] > dd:\n\t\t\t\t\td[k] = dd\n\tprint(d[-1])\n\nsolve()\n", "n, d = list(map(int, input().split()))\n\na = [0] + list(map(int, input().split())) + [0] #aumento de timer seg\u00fan estaci\u00f3n\nX = []\nY = []\n\nfor i in range(n):\n x, y = list(map(int, input().split())) #Coordenadas de la estaci\u00f3n i.\n X.append(x) \n Y.append(y)\n\nmon = [-1] * n #array para el monto necesario para llegar.\nmon[0] = 0\nZ = 0 #valor que permitir\u00e1 entrar al loop\n\nwhile Z == 0:\n Z = 1\n\n for i in range(n): #estamos en estaci\u00f3n i\n\n for j in range(1, n): #queremos ir a estaci\u00f3n j\n\n if i != j and mon[i] != -1: #si no queremos ir a la misma estaci\u00f3n y donde estamos pudimos llegar.\n costo = mon[i] + (abs(X[i] - X[j]) + abs(Y[i] - Y[j]))*d - a[j] #nuevo costo necesario para ir de i a j.\n\n if mon[j] == -1 or costo < mon[j]: #si el nuevo costo es menor que uno anterior, se guarda este o si antes no hab\u00eda ningun costo guardado.\n mon[j] = costo\n Z = 0 #volvemos a entrar al loop, esto asegura que todos los mon[] van a dejar de ser '1 y tendran un costo.\nprint(mon[-1]) #costo de llegar a la \u00faltima estaci\u00f3n.\n", "from sys import stdin\nfrom math import inf\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef main():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n for i in range(n):\n x[i], y[i] = readline()\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n lower_value = inf\n position = 0\n for j in range(n):\n if not visited[j] and lower_value > lower_cost[j]:\n lower_value = lower_cost[j]\n position = j\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n return lower_cost[-1]\n\n\ndef __starting_point():\n print(main())\n\n__starting_point()", "from sys import stdin\nfrom math import inf\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef dijkstra():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n for i in range(n):\n x[i], y[i] = readline()\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n lower_value = inf\n position = 0\n for j in range(n):\n if not visited[j] and lower_value > lower_cost[j]:\n lower_value = lower_cost[j]\n position = j\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n return lower_cost[-1]\n\n\ndef __starting_point():\n print(dijkstra())\n\n__starting_point()", "from sys import stdin\nfrom math import inf\n\n\ndef main():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n # parent = [-1] * n # In case you want to know the path traveled\n for i in range(n):\n x[i], y[i] = readline()\n return dijkstra(n, d, a, x, y) # , parent)\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef dijkstra(n, d, a, x, y): # , parent):\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n position = minimum(n, visited, lower_cost)\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n # parent[k] = position\n return lower_cost[-1]\n\n\ndef minimum(n, visited, lower_cost):\n lower_value = inf\n position = 0\n for j in range(n):\n if visited[j] or lower_value <= lower_cost[j]:\n continue\n lower_value = lower_cost[j]\n position = j\n return position\n\n\ndef __starting_point():\n print(main())\n\n__starting_point()", "from sys import stdin\nfrom math import inf\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef dijkstra(): # , parent):\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n # parent = [-1] * n # In case you want to know the path traveled\n for i in range(n):\n x[i], y[i] = readline()\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n lower_value = inf\n position = 0\n for j in range(n):\n if visited[j] or lower_value <= lower_cost[j]:\n continue\n lower_value = lower_cost[j]\n position = j\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n # parent[k] = position\n return lower_cost[-1]\n\n\ndef __starting_point():\n print(dijkstra())\n\n__starting_point()", "from sys import stdin\nfrom math import inf\n \n \ndef readline():\n return map(int, stdin.readline().strip().split())\n \n \ndef dijkstra():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n for i in range(n):\n x[i], y[i] = readline()\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n lower_value = inf\n position = 0\n for j in range(n):\n if not visited[j] and lower_value > lower_cost[j]:\n lower_value = lower_cost[j]\n position = j\n if position == n - 1:\n break\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n return lower_cost[-1]\n \n \ndef __starting_point():\n print(dijkstra())\n__starting_point()", "from sys import stdin, stdout\nfrom math import inf\n\n\ndef main():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n # parent = [-1] * n # In case you want to know the path traveled\n for i in range(n):\n x[i], y[i] = readline()\n return dijkstra(n, d, a, x, y) # , parent)\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef dijkstra(n, d, a, x, y): # , parent):\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n position = minimum(n, visited, lower_cost)\n if position == n - 1:\n break\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n # parent[k] = position\n return lower_cost[-1]\n\n\ndef minimum(n, visited, lower_cost):\n lower_value = inf\n position = 0\n for j in range(n):\n if not visited[j] and lower_value > lower_cost[j]:\n lower_value = lower_cost[j]\n position = j\n return position\n\n\ndef __starting_point():\n stdout.write(\"\".join(str(main()) + \"\\n\"))\n\n__starting_point()", "from sys import stdin, stdout\nfrom math import inf\n\n\ndef main():\n n, d = readline()\n a = [0] + list(readline()) + [0]\n x = [0] * n\n y = [0] * n\n # parent = [-1] * n # In case you want to know the path traveled\n for i in range(n):\n x[i], y[i] = readline()\n return dijkstra(n, d, a, x, y) # , parent)\n\n\ndef readline():\n return list(map(int, stdin.readline().strip().split()))\n\n\ndef dijkstra(n, d, a, x, y): # , parent):\n lower_cost = [inf] * n\n lower_cost[0] = 0\n visited = [False] * n\n for i in range(n - 1):\n position = minimum(n, visited, lower_cost)\n if position == n - 1:\n break\n visited[position] = True\n for k in range(n):\n if not visited[k]:\n diff = lower_cost[position] + d * (abs(x[k] - x[position]) + abs(y[k] - y[position])) - a[position]\n if lower_cost[k] > diff:\n lower_cost[k] = diff\n # parent[k] = position\n return lower_cost[-1]\n\n\ndef minimum(n, visited, lower_cost):\n lower_value = inf\n position = 0\n for j in range(n):\n if not visited[j] and lower_value > lower_cost[j]:\n lower_value = lower_cost[j]\n position = j\n return position\n\n\ndef __starting_point():\n stdout.write(str(main()) + '\\n')\n\n__starting_point()"]
{ "inputs": [ "3 1000\n1000\n0 0\n0 1\n0 3\n", "3 1000\n1000\n1 0\n1 1\n1 2\n", "5 1421\n896 448 727\n-19 -40\n-87 40\n69 51\n-55 61\n-7 67\n", "6 1000\n142 712 254 869\n7 0\n95 38\n96 -20\n-7 93\n75 -45\n-80 -20\n", "7 1288\n943 265 649 447 806\n-4 -51\n-26 32\n47 -28\n31 32\n61 65\n-45 -37\n82 42\n", "8 1931\n440 627 324 538 539 119\n-85 -41\n-91 61\n-84 11\n92 -19\n8 -5\n16 -25\n97 -98\n91 78\n", "9 1829\n98 513 987 291 162 637 356\n38 -3\n-89 93\n-86 45\n-43 -84\n-3 -87\n53 -59\n18 -19\n81 -74\n-85 32\n", "10 1000\n759 222 589 423 947 507 31 414\n-4 -71\n-31 -53\n24 28\n-13 -65\n-59 -49\n-42 -79\n85 -71\n-60 -17\n28 66\n74 2\n", "11 1199\n282 735 54 1000 419 939 901 789 128\n10 -81\n26 72\n19 -91\n-61 85\n0 -33\n-62 79\n-59 65\n-2 -77\n-63 100\n-15 53\n94 54\n", "12 1609\n196 486 94 344 524 588 315 504 449 201\n86 -22\n-2 25\n-95 -8\n-5 -30\n-78 71\n5 -54\n-69 -92\n-41 0\n10 19\n61 17\n75 -39\n-46 22\n", "3 97325\n40\n43 43\n45 -95\n-93 63\n", "11 1615\n137 681 199 33 388 585 241 518 7\n-60 89\n24 6\n-100 -55\n-26 -90\n-40 -33\n-100 28\n12 34\n-60 -13\n38 -89\n62 81\n-35 54\n", "4 62071\n706 480\n6 96\n51 -12\n99 66\n-69 -61\n", "12 1542\n389 356 290 648 182 94 585 988 762 494\n-46 96\n1 88\n0 95\n-91 -100\n-42 -29\n45 -27\n-52 -34\n-62 27\n-19 46\n-100 95\n5 -55\n-36 -65\n", "3 100000\n1\n-100 -100\n-100 -99\n100 100\n", "12 1211\n1 5 7 1000 1000 1000 1000 1000 1000 1000\n1 1\n5 5\n3 4\n4 3\n0 1\n0 2\n0 5\n0 7\n1 0\n3 0\n8 0\n10 10\n", "6 1000\n1000 1000 1000 1000\n0 0\n0 -1\n1 -1\n2 -1\n2 0\n2 1\n" ], "outputs": [ "2000\n", "1000\n", "169099\n", "107000\n", "229903\n", "569018\n", "288982\n", "151000\n", "262581\n", "282231\n", "15182700\n", "96900\n", "14400472\n", "263034\n", "39999999\n", "20220\n", "1000\n" ] }
competition
https://codeforces.com/problemset/problem/301/B
[ 56, 277, 47458, 402, 374, 5619, 264, 1809, 2598, 330, 1462, 3263, 576, 1809, 702, 264, 9021, 9027, 279, 60861, 566, 594, 2684, 2115, 13, 1634, 5135, 438, 279, 9021, 4933, 220, 15, 11, 809, 277, 47458, 402, 594, 3668, 8725, 323, 279,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,944
Solve a given equation and return the value of x in the form of string "x=#value". The equation contains only '+', '-' operation, the variable x and its coefficient. If there is no solution for the equation, return "No solution". If there are infinite solutions for the equation, return "Infinite solutions". If there is exactly one solution for the equation, we ensure that the value of x is an integer. Example 1: Input: "x+5-3+x=6+x-2" Output: "x=2" Example 2: Input: "x=x" Output: "Infinite solutions" Example 3: Input: "2x=x" Output: "x=0" Example 4: Input: "2x+3x-6x=x+2" Output: "x=-1" Example 5: Input: "x=x+2" Output: "No solution"
["class Solution:\n def calc(self, part):\n part += \"+\" ## added tmp symbol in the end to sum last item within the loop\n start = x = n = 0\n coeff = 1\n for end, char in enumerate(part):\n # print(\"charIdx:\", equation[end], \"char: \", char, char == \"+\" or char == \"-\", \"slice: \", equation[start:end])\n if char == \"+\" or char == \"-\":\n var = part[start:end]\n if var == \"\":\n continue\n if \"x\" in var:\n var = var[:-1]\n if var in [\"\", \"+\"]:\n var = 1\n elif var == \"-\":\n var = -1\n x += int(var) * coeff\n start = end\n else:\n n += int(var) * coeff\n start = end\n return x, n\n \n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n # how big is N\n # time vs. space complexity?\n \n # split by \"=\" to left and right; time complexity: O(N)\n # sums Xs and consts on both sides (left and right)\n # take a difference b/w the sides' sums\n # simplify dividing by X's coeff\n # if x==0 and n==0 on the other - infinite\n # if x==0 and a constant on the other - no solution\n # if x on one side, and a constant on the other - solution\n \n # test: 2-x+2x-x-x+1=x\n # test2: \"x+5-3+x=6+x-2\"\n # test2: \"+5-3+x=6+x-2\"\n # -x=-1\n \n left, right = equation.split(\"=\")\n x1, n1 = self.calc(left) # O(leftN)\n x2, n2 = self.calc(right) # O(rightN)\n x, n = x1 - x2, n1 - n2\n n = n / x if (x != 0) else n\n x = 1 if (x != 0) else x\n if x == 0 and n != 0:\n return \"No solution\"\n if x == 0 and n == 0:\n return \"Infinite solutions\"\n return \"x={}\".format(int(-n))\n \n # time complexity O(N)\n", "class Solution:\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n left_x = right_x = 0\n left_const = right_const = 0\n \n cur_left = True\n cur_num = 0\n cur_sign = 1\n has_num = False\n for c in equation:\n if c == \"=\":\n left_const += cur_num * cur_sign\n cur_num = 0\n cur_sign = 1\n cur_left = False\n has_num = False\n elif c in '+-':\n if cur_left:\n left_const += cur_num * cur_sign\n else:\n right_const += cur_num * cur_sign\n cur_num = 0\n cur_sign = 1 if c == '+' else -1\n has_num = False\n elif c == 'x':\n if cur_left:\n left_x += cur_sign* (cur_num if has_num else 1)\n else:\n right_x += cur_sign* (cur_num if has_num else 1)\n cur_num = 0\n has_num = False\n else:\n cur_num = cur_num * 10 + int(c)\n has_num = True\n \n # print(left_x, right_x, left_const, right_const, cur_num, cur_sign)\n \n right_const += cur_num*cur_sign\n left_x -= right_x\n right_const -= left_const\n \n if left_x == 0 and right_const == 0:\n return \"Infinite solutions\"\n elif left_x == 0 and right_const != 0:\n return \"No solution\"\n else:\n return \"x=\" + str(int(right_const/left_x))", "class Solution:\n def solveEquation(self, equation):\n l, r = equation.split(\"=\")\n ret = self.compute(l)\n lnum, lx = ret[0], ret[1]\n ret = self.compute(r)\n rnum, rx = ret[0], ret[1]\n if lx == rx and lnum - rnum == 0:\n return \"Infinite solutions\"\n elif lx == rx and lnum - rnum != 0:\n return \"No solution\"\n else:\n if rx > lx:\n return \"x=\" + str(int((lnum - rnum)/(rx - lx)))\n else:\n return \"x=\" + str(int((rnum - lnum)/(lx - rx)))\n \n print((lx, lnum))\n \n def compute(self, eq):\n val = ''\n s = '+'\n eq = eq + '+'\n num, x = 0,0\n for c in eq:\n if c == 'x':\n if val == '':\n val = '1'\n if s =='+':\n x += int(val)\n else:\n x -= int(val)\n val = ''\n elif c == '+' or c == '-':\n if val != '' and s == '+':\n num += int(val)\n elif val != '' and s == '-':\n num -= int(val)\n s = c\n val = ''\n \n else:\n val += c\n return num, x\n", "class Solution:\n lx = 0\n lc = 0\n rx = 0\n rc = 0\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n self.lx = 0\n self.lc = 0\n self.rx = 0\n self.rc = 0\n size = len(equation)\n l=0 \n r=0\n left=True\n for i in range(1,size):\n #print(i)\n if equation[i] == \"=\":\n l=r\n r=i+1\n self.lastEq(equation[l:r-1],left)\n left=False\n continue\n if equation[i] in {\"+\",\"-\"}:\n if equation[r:i] in {\"+\",\"-\",\"\"}:\n continue\n l=r\n r=i\n self.lastEq(equation[l:r],left)\n if i == size-1:\n l=r\n r=i\n self.lastEq(equation[l:r+1],left)\n \n #print(str(self.lx)+\"x\"+\" \"+str(self.lc) +\" = \" + str(self.rx) + \"x \" + str(self.rc))\n x = self.lx-self.rx\n c = self.rc - self.lc\n if x == 0 and c == 0:\n return \"Infinite solutions\"\n if x == 0:\n return \"No solution\"\n return \"x=\"+str(int(c/x))\n \n def lastEq(self,s,left):\n print(s)\n if \"x\" in s:\n if s[0]!='-':\n if left:\n if s in {\"x\",\"+x\"}:\n self.lx+=1\n else:\n self.lx += float(s[:-1])\n else:\n if s in {\"x\",\"+x\"}:\n self.rx+=1\n else:\n self.rx += float(s[:-1])\n else:\n if left:\n if s in {\"x\",\"-x\"}:\n self.lx-=1\n else:\n self.lx -= float(s[1:-1])\n else:\n if s in {\"x\",\"-x\"}:\n self.rx-=1\n else:\n self.rx -= float(s[1:-1])\n else:\n if s[0]!='-':\n if left:\n self.lc += float(s)\n else:\n self.rc += float(s)\n else:\n if left:\n self.lc -= float(s[1:])\n else:\n self.rc -= float(s[1:])\n print((str(self.lx)+\"x\"+\" \"+str(self.lc) +\" = \" + str(self.rx) + \"x \" + str(self.rc)))\n", "class Solution:\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n count_x = count_integer = 0\n left, right = equation.replace('-', ' -').replace('+', ' +').split('=')\n left_items = left.lstrip().split(' ')\n right_items = right.lstrip().split(' ')\n for l in left_items:\n if l[-1] == 'x':\n if l[:-1] == '' or l[:-1] == '+':\n count_x += 1\n elif l[:-1] == '-':\n count_x -= 1\n else:\n count_x += int(l[:-1])\n else:\n count_integer -= int(l)\n for r in right_items:\n if r[-1] == 'x':\n if r[:-1] == '' or r[:-1] == '+':\n count_x -= 1\n elif r[:-1] == '-':\n count_x += 1\n else:\n count_x -= int(r[:-1])\n else:\n count_integer += int(r)\n if count_x == 0 and count_integer != 0:\n return 'No solution'\n elif count_x == 0 and count_integer == 0:\n return 'Infinite solutions'\n else:\n return 'x=' + str(int(count_integer / count_x))\n", "import re\n class Solution:\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n # Gets sum of x's in an eq\n def get_x_sum(s):\n \n total = 0\n curr = \"\"\n sign = \"+\"\n for c in s:\n if c == \"x\":\n if curr == \"\":\n total += int(sign+\"1\")\n else:\n total += int(sign+curr)\n elif c == \"+\" or c == \"-\":\n curr = \"\"\n sign = c\n else:\n curr += c\n \n return total\n \n # Gets sum of ints in an eq\n def get_int_sum(s):\n total = 0\n curr = \"\"\n sign = \"+\"\n for c in s:\n if c == \"x\":\n curr = \"\"\n sign = \"+\"\n elif c == \"+\" or c == \"-\":\n if curr != \"\":\n total += int(sign+curr)\n curr = \"\"\n sign = c\n else:\n curr += c\n \n if curr != \"\":\n total += int(sign+curr)\n return total\n \n lhs,rhs = equation.split(\"=\")\n \n lhs_sum_x = get_x_sum(lhs)\n lhs_sum_int = get_int_sum(lhs)\n rhs_sum_x = get_x_sum(rhs)\n rhs_sum_int = get_int_sum(rhs)\n \n if lhs_sum_int == rhs_sum_int:\n if lhs_sum_x == rhs_sum_x:\n return \"Infinite solutions\"\n return \"x=0\"\n else:\n if lhs_sum_x == rhs_sum_x:\n return \"No solution\"\n \n diff_x = lhs_sum_x-rhs_sum_x\n diff_int = rhs_sum_int - lhs_sum_int\n return \"x=\" + str(diff_int // diff_x)\n \n \n \n \n \n", "class Solution:\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n a=0\n b=0\n coeff=''\n right=1\n for i in equation+'+':\n if (i=='+' or i=='-' or i=='=') and coeff!='':\n if 'x' in coeff:\n coeff=coeff.strip('x')\n if coeff=='-':\n a-= right\n elif coeff=='+' or coeff=='':\n a+= right\n else:\n a+= (int(coeff.strip('x'))*right)\n else:\n b-= (int(coeff)*right)\n coeff=i\n if i=='=':\n right=-1\n coeff=''\n else:\n coeff+=i\n # print(i,a,b,coeff)\n if a==0 and b==0:\n return \"Infinite solutions\"\n elif a==0:\n return \"No solution\"\n elif b==0:\n return \"x=0\"\n else:\n return \"x=\"+str(int(b/a))\n", "class Solution:\n def solveEquation(self, equation):\n \"\"\"\n :type equation: str\n :rtype: str\n \"\"\"\n [left,right]=equation.split('=')\n l=[0,0]\n temp=''\n flag=1\n if left[0]=='-':\n flag=-1\n left=left[1:]\n for i in left:\n if i!='+' and i!='-':temp+=i\n else:\n if temp[-1]!='x':\n l[1]+=flag*int(temp)\n else:\n if len(temp)==1:l[0]+=flag\n else:l[0]+=flag*int(temp[:-1])\n if i=='+':flag=1\n if i=='-':flag=-1\n temp=''\n print(l)\n if temp[-1]!='x':\n l[1]+=flag*int(temp)\n else:\n if len(temp)==1:l[0]+=flag\n else:l[0]+=flag*int(temp[:-1])\n temp=''\n r=[0,0]\n flag=1\n if right[0]=='-':\n flag=-1\n right=right[1:]\n for i in right:\n if i!='+' and i!='-':temp+=i\n else:\n if temp[-1]!='x':\n r[1]+=flag*int(temp)\n else:\n if len(temp)==1:r[0]+=flag\n else:r[0]+=flag*int(temp[:-1])\n if i=='+':flag=1\n if i=='-':flag=-1\n temp=''\n if temp[-1]!='x':\n r[1]+=flag*int(temp)\n else:\n if len(temp)==1:r[0]+=flag\n else:r[0]+=flag*int(temp[:-1])\n temp=''\n print(l,r)\n if l[0]==r[0]:\n if l[1]==r[1]:return 'Infinite solutions'\n else:return 'No solution'\n else:\n ans=int((r[1]-l[1])/(l[0]-r[0]))\n return 'x='+str(ans)"]
interview
https://leetcode.com/problems/solve-the-equation/
class Solution: def solveEquation(self, equation: str) -> str:
[ 50, 3948, 264, 2661, 23606, 323, 470, 279, 897, 315, 856, 304, 279, 1352, 315, 914, 330, 87, 45131, 957, 3263, 576, 23606, 5610, 1172, 13902, 516, 20672, 5666, 11, 279, 3890, 856, 323, 1181, 35606, 2012, 2679, 1052, 374, 902, 6291, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,906
At the start of each season, every player in a football team is assigned their own unique squad number. Due to superstition or their history certain numbers are more desirable than others. Write a function generateNumber() that takes two arguments, an array of the current squad numbers (squad) and the new player's desired number (n). If the new player's desired number is not already taken, return n, else if the desired number can be formed by adding two digits between 1 and 9, return the number formed by joining these two digits together. E.g. If 2 is taken, return 11 because 1 + 1 = 2. Otherwise return null. Note: Often there will be several different ways to form a replacement number. In these cases the number with lowest first digit should be given priority. E.g. If n = 15, but squad already contains 15, return 69, not 78.
["def generate_number(squad, n):\n if n not in squad: return n\n for i in range(1, 10):\n for j in range(1, 10):\n if i + j == n and i * 10 + j not in squad:\n return i * 10 + j", "def generate_number(lst, n):\n lst = set(lst)\n return (n if n not in lst else\n next( (9*d+n for d in range(1,10) if 0<n-d<10 and 9*d+n not in lst), None))", "def generate_number(squad, n):\n candidates = [n] + [(n - d) * 10 + d for d in range(9, 0, -1)]\n \n for x in candidates:\n if x < 100 and x not in squad:\n return x", "def generate_number(squad, n):\n l, d = (n - 1, 9 + n) if n < 11 else (19 - n, n * 10 - 81)\n return next((d+i*9 for i in range(l) if d+i*9 not in squad), None) if n in squad else n", "def generate_number(squad, n):\n if n not in squad:\n return n\n for i in range(1, 10):\n for j in range(1, 10):\n if i + j == n:\n x = int(f'{i}{j}')\n if x not in squad:\n return x", "def generate_number(squad, n):\n x, squad = n, set(squad)\n for d in range(1, 10):\n if x not in squad: return x\n if 0 < n - d < 10: x = 9 * d + n\n if x not in squad: return x", "def generate_number(squad, n):\n return n if n not in squad else None if n < 10 else next((x for x in range(10, 100) if sum(int(c) for c in str(x)) == n and x not in squad), None)\n", "import itertools\n\ndef twodigcombs(n):\n ls = []\n digits = [1,2,3,4,5,6,7,8,9]\n for x, y in itertools.combinations_with_replacement(digits, 2):\n if x + y == n:\n ls.append([x,y])\n return sorted(ls)\n\ndef generate_number(squad, n):\n print((squad, n))\n if n not in squad:\n return n\n \n for [a,b] in twodigcombs(n):\n x = a*10 + b\n if x not in squad:\n return x\n \n", "def generate_number(squad, n):\n if n not in squad:\n return n\n print((squad, n))\n for i in range(0,10):\n b = i*10 + n-i if n-i < 10 and n-i>0 else n\n if b not in squad:\n return b\n return None\n # TODO: complete\n", "def generate_number(squad,n):\n if n not in squad:return n\n for i in range(n-9,10):\n d=int(f\"{i}{n-i}\")\n if d not in squad and (n-i)>0:\n return d\n \n"]
{"fn_name": "generate_number", "inputs": [[[1, 2, 3, 4, 6, 9, 10, 15, 69], 11], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 69], 11], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 29, 69], 11], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 29, 38, 47, 56, 65, 69, 74, 83, 92], 11], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 18, 23, 69], 18], [[1, 2, 3, 4, 6, 9, 10, 15, 69], 34], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 29, 34, 38, 47, 56, 65, 69, 74, 83, 92], 34], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 18, 27, 29, 34, 36, 38, 45, 47, 54, 56, 63, 65, 69, 72, 74, 81, 83, 92], 9], [[1, 2, 3, 4, 6, 9, 10, 11, 15, 18, 27, 29, 34, 36, 38, 45, 47, 54, 56, 63, 65, 69, 72, 74, 81, 83, 90, 92], 9]], "outputs": [[11], [29], [38], [null], [99], [34], [null], [null], [null]]}
introductory
https://www.codewars.com/kata/5d62961d18198b000e2f22b3
def generate_number(squad, n):
[ 1655, 279, 1191, 315, 1817, 3200, 11, 1449, 2781, 304, 264, 8964, 2083, 374, 12607, 862, 1828, 4911, 18529, 1372, 13, 23662, 311, 93605, 680, 476, 862, 3840, 3654, 5109, 525, 803, 34846, 1091, 3800, 382, 7985, 264, 729, 6923, 2833, 36...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,287
The wide mouth frog is particularly interested in the eating habits of other creatures. He just can't stop asking the creatures he encounters what they like to eat. But then he meet the alligator who just LOVES to eat wide-mouthed frogs! When he meets the alligator, it then makes a tiny mouth. Your goal in this kata is to create complete the `mouth_size` method this method take one argument `animal` which corresponds to the animal encountered by frog. If this one is an `alligator` (case insensitive) return `small` otherwise return `wide`.
["def mouth_size(animal): \n return 'small' if animal.lower() == 'alligator' else 'wide'", "def mouth_size(animal): \n return 'wide' if animal.lower() != 'alligator' else 'small'", "def mouth_size(animal): \n mouth = {'alligator':'small'}\n return mouth.get(animal.lower(), 'wide')", "import re\n\ndef mouth_size(animal):\n return 'small' if re.search('alligator', animal, re.IGNORECASE) else 'wide'", "mouth_size = lambda s:\"small\" if (s.lower()==\"alligator\") else \"wide\"", "mouth_size = lambda a: 'small' if a.lower() == 'alligator' else 'wide'", "def mouth_size(s): return \"small\" if s.lower() == \"alligator\" else \"wide\"", "def mouth_size(animal): \n animal1 = animal.lower()\n if animal1 == 'alligator':\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n return \"small\" if \"alligator\" in animal.lower() else \"wide\"\n # code here\n", "def mouth_size(animal): \n if animal.lower() == 'alligator': return 'small'\n return 'wide'", "def mouth_size(animal): \n return 'small' if animal.upper() == 'ALLIGATOR' else 'wide'", "def mouth_size(animal): \n if animal.lower() == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "mouth_size=lambda animal: [\"wide\",\"small\"][animal.lower()==\"alligator\"]", "def mouth_size(animal: str) -> str:\n \"\"\" The wide mouth frog or the small one? \"\"\"\n return \"small\" if animal.lower() == \"alligator\" else \"wide\"", "mouth_size = lambda animal: 'small' if animal.lower() == 'alligator' else 'wide'", "def mouth_size(animal): \n animal = animal.lower()\n return 'sm' + animal[:3] if animal[3:] == 'igator' else 'wide'", "def mouth_size(animal): \n if animal.casefold() == \"alligator\":\n return \"small\"\n else:\n return \"wide\"\nprint((mouth_size(\"alligator\")))\n\n\n\n # code here\n", "def mouth_size(animal): \n return animal.lower() == 'alligator' and 'small' or 'wide'", "def mouth_size(animal): \n return ('wide', 'small')[animal.lower() == 'alligator']", "def mouth_size(animal): \n if animal.find('l')==1 or animal.find('L')==1:\n return 'small'\n else:\n return 'wide'\n \n", "def mouth_size(animal): \n new_animal = animal.lower()\n return \"small\" if new_animal == \"alligator\" else \"wide\"", "def mouth_size(animal): \n if animal.lower() == \"alligator\" or animal.lower() is \"alligator!\":\n return \"small\"\n return \"wide\"", "small = [\"alligator\"]\n\ndef mouth_size(animal): \n return \"small\" if animal.lower() in small else \"wide\"", "def mouth_size(animal): \n # code \n if(animal.lower() == \"alligator\"):\n return \"small\"\n return \"wide\"", "mouth_size = lambda x: ('wide', 'small')[x.lower() == 'alligator']", "def mouth_size(animal): \n return 'small' if (animal.lower()=='alligator' or animal.lower()=='alligator!') else 'wide'", "def mouth_size(animal):\n animal_lower = animal.lower()\n if animal_lower == 'alligator':\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n if animal.lower() != \"alligator\":\n return \"wide\"\n elif animal.lower() == \"alligator\":\n return \"small\"\n", "def mouth_size(animal):\n return \"small\" if animal.title() == \"Alligator\" else \"wide\"", "def mouth_size(animal):\n animal = animal.title()\n if animal == 'Alligator':\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n state = \"wide\"\n if animal.lower() == \"alligator\":\n state = \"small\"\n return state", "def mouth_size(animal): \n x = 'alligator'\n if animal.casefold() == x.casefold():\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n # code here\n new_animal = animal.lower()\n if new_animal == \"alligator\":\n return \"small\"\n return \"wide\"", "def mouth_size(animal): \n if animal.upper() != 'ALLIGATOR' :\n return 'wide'\n else :\n return 'small'\n # code here\n", "def mouth_size(animal): \n return \"wide\" if animal.upper()!=\"ALLIGATOR\" else \"small\"\n # code here\n", "def mouth_size(animal): \n result = \"\"\n if animal.lower() == \"alligator\":\n result = \"small\"\n else:\n result = \"wide\"\n return result", "def mouth_size(animal): \n return \"small\" if animal.lower() == \"alligator\".lower() else \"wide\"", "def mouth_size(animal):\n \" \u0420\u0432\u0435\u043c \u0430\u043b\u0438\u0433\u0430\u0442\u043e\u0440\u0443 \u043f\u0430\u0441\u0442\u044c\"\n n = animal.lower()\n if n == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal): \n if \"alligator\" == animal.lower():\n return \"small\"\n return \"wide\"", "def mouth_size(animal): \n animal=animal.lower()\n if animal == 'alligator' or animal == 'alligator!':\n return 'small'\n return 'wide'", "def mouth_size(animal): \n animal=animal.casefold()\n return \"small\" if \"alligator\"in animal else \"wide\"", "def mouth_size(ani):\n animal = ani.lower()\n if animal == \"alligator\":\n return \"small\"\n elif animal == \"toucan\":\n return \"wide\"\n elif animal == \"ant bear\":\n return \"wide\"\n else :\n return \"wide\"", "def mouth_size(animal): \n #casefold makes case insensitive string matching\n if animal.casefold() == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal:str) -> str:\n if animal.lower() == \"alligator\":\n return \"small\"\n else:\n return \"wide\"\n", "def mouth_size(animal): \n return f'small' if animal.lower()=='alligator' else f'wide'", "def mouth_size(animal): \n if str(animal).lower() == \"alligator\":\n return \"small\"\n return \"wide\"", "def mouth_size(animal): \n new_animal = \"\"\n for letters in animal:\n if 65 <= ord(letters) <= 90:\n new_animal += chr(ord(letters)+32)\n else:\n new_animal += letters\n if new_animal == \"alligator\":\n return \"small\"\n return \"wide\"\n", "import re\n\ndef mouth_size(animal):\n\n pattern = re.match(r'alligator', animal, re.I)\n if pattern:\n return \"small\"\n return \"wide\"\n", "import re\ndef mouth_size(animal): \n if re.search(\"alligator\",animal,re.IGNORECASE):\n return \"small\"\n else:\n return \"wide\"\n # code here\n", "def mouth_size(animal):\n x = animal.casefold()\n if x == 'alligator':\n return 'small'\n print(x)\n return 'wide'", "def mouth_size(animal): \n if animal.rstrip('!').lower() == 'alligator':\n return 'small'\n else:\n return 'wide' ", "def mouth_size(animal):\n animal=animal.lower()\n print (animal)\n if animal==(\"alligator\"):\n return (\"small\")\n else:\n return (\"wide\")\n\n", "def mouth_size(animal): \n return 'wide' if animal.lower().find('alligator') else 'small'\n", "def mouth_size(animal): \n \n animal=animal.lower()\n \n ergebnis=\"wide\"\n \n if animal==\"alligator\":\n ergebnis=\"small\"\n \n return ergebnis ", "def mouth_size(x):\n x = x.lower()\n x = x.replace(\"!\",\"\")\n return \"small\" if x == \"alligator\" else \"wide\"", "def mouth_size(animal):\n animal = str(animal).lower()\n if animal==\"alligator\":\n return \"small\"\n else:\n return \"wide\"\ns = mouth_size(\"alligator\")\nprint(s)", "def mouth_size(animal): \n return \"small\" if (animal.lower()).capitalize() == \"Alligator\" else \"wide\"", "mouth_size = lambda a: ['wide', 'small']['tor' in a.casefold()]", "def mouth_size(animal): \n a = animal.lower()\n print(a)\n if a == \"alligator\": return \"small\"\n else: return \"wide\"", "import re\ndef mouth_size(animal): \n animalnew=animal.lower()\n if animalnew=='alligator':\n return \"small\"\n else:\n return \"wide\"\n # code here\n", "def mouth_size(animal): \n return [\"small\", \"wide\"][animal.lower()!=\"alligator\"]", "def mouth_size(animal): \n anim = animal.lower()\n if anim == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal):\n if animal.lower() == 'alligator':\n a='small'\n else:\n a='wide'\n return a", "def mouth_size(animal):\n if str(animal).lower() != \"alligator\":\n return (\"wide\")\n else:\n return(\"small\")\n # code here\n", "def mouth_size(animal):\n animaL = animal.lower()\n if animaL == 'alligator':\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n if animal.lower() == \"alligator\" or animal.lower() == \"alligator!\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal):\n ani=\"alligator\".strip(\"!\")\n return \"small\" if animal.lower() == ani else \"wide\"", "def mouth_size(animal): \n if animal.title() == 'Alligator':\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal): \n # code here\n a=len('alligator')\n b=len(animal)\n return 'wide' if b!=a else 'small'", "def mouth_size(animal): \n animal = animal.lower()\n if animal != \"alligator\":\n return \"wide\"\n return \"small\"", "def mouth_size(animal):\n low=animal.lower()\n if low == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal): \n return \"wide\" if \"alligator\" != animal.lower() else \"small\"", "def mouth_size(animal): \n alligator = \"alligator\"\n if animal.lower() == alligator.lower(): \n return \"small\"\n else: \n return \"wide\"", "def mouth_size(animal): \n return \"wide\" if not animal.lower() in \"alligator\" else \"small\" ", "def mouth_size(animal): \n print(animal.capitalize())\n if animal.capitalize() == 'Alligator':\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n if animal.upper() == \"alligator\".upper():\n return \"small\"\n \n return \"wide\"", "def mouth_size(animal):\n s = animal.lower()\n print(s)\n if s != 'alligator':\n return \"wide\"\n else:\n return \"small\"", "def mouth_size(animal): \n if animal.lower() == \"alligator\":\n mouth = \"small\"\n else:\n mouth = \"wide\"\n return mouth\n", "def mouth_size(animal): \n if animal.lower() != \"alligator\":\n# print (animal.lower())\n return \"wide\"\n else: return \"small\"", "def mouth_size(animal): \n newAnimal = animal.lower()\n if newAnimal == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal):\n aniLow = animal.lower()\n return \"small\" if aniLow == \"alligator\" else \"wide\"", "'''\ud83d\udc0a\ud83d\udc0a\ud83d\udc0a'''\ndef mouth_size(animal): \n return \"small\" if animal.lower() == \"alligator\" else \"wide\"", "def mouth_size(animal): \n \n ret = 'wide'\n if animal.lower() == 'alligator':\n ret = 'small'\n\n return ret\n", "def mouth_size(animal: str) -> str: \n # code here\n if animal.lower() == 'alligator':\n return 'small'\n return 'wide'", "def mouth_size(animal): \n return \"small\" if ''.join([x.lower() for x in animal]) == \"alligator\" else \"wide\"", "def mouth_size(animal): \n if \"alligator\" in animal.casefold():\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal):\n lower_letters = animal.lower()\n if lower_letters == \"alligator\":\n return \"small\"\n else:\n return \"wide\"", "def mouth_size(animal): \n # code here\n if animal.lower()==\"alligator\" or animal==\"wide\":\n return \"small\"\n return \"wide\"", "mouth_size = lambda n: \"small\" if n.casefold()==\"alligator\" else \"wide\"", "def mouth_size(animal): \n x = 'alligator'\n if animal.lower() == x:\n return 'small'\n else:\n return 'wide'\n\n", "def mouth_size(animal):\n if len(animal) < 9: \n return 'wide'\n elif len(animal) > 9: \n return 'wide' \n else: \n return 'small' \n # code here\n", "def mouth_size(animal): \n if animal.upper() == 'alligator'.upper():\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n mouth = \"\"\n if animal.casefold() != \"alligator\":\n mouth = \"wide\"\n else:\n mouth = \"small\"\n return mouth", "def mouth_size(animal):\n a=animal.upper()\n if a=='ALLIGATOR':\n return 'small'\n else:\n return'wide'\n # code here\n", "def mouth_size(animal):\n s = 'alligator'\n return 'small' if animal.lower() == s else 'wide'", "def mouth_size(animal): \n if animal.lower() == 'alligator':\n return 'small'\n else:\n return 'wide'\nmouth_size(\"alligator\")", "def mouth_size(animal):\n new = animal.lower()\n if 'alligator'in new:\n return 'small'\n elif 'alligator!' in new:\n return 'small'\n else:\n return 'wide'", "def mouth_size(animal): \n result = \"\"\n animal_recase = animal.lower() #to make all forms of alligator 'readable'\n if animal_recase == \"alligator\":\n result = \"small\"\n else:\n result = \"wide\"\n return result ", "def mouth_size(animal): \n c = animal.lower()\n a = \"small\"\n b = \"wide\"\n if c == \"alligator\":\n return a\n else:\n return b\n # code here\n", "def mouth_size(x):\n if x.lower() == 'alligator': return 'small'\n else: return 'wide'"]
{"fn_name": "mouth_size", "inputs": [["toucan"], ["ant bear"], ["alligator"]], "outputs": [["wide"], ["wide"], ["small"]]}
introductory
https://www.codewars.com/kata/57ec8bd8f670e9a47a000f89
def mouth_size(animal):
[ 785, 6884, 10780, 59881, 374, 7945, 8014, 304, 279, 12182, 25785, 315, 1008, 19970, 382, 1519, 1101, 646, 944, 2936, 10161, 279, 19970, 566, 33906, 1128, 807, 1075, 311, 8180, 13, 1988, 1221, 566, 3367, 279, 678, 57082, 879, 1101, 5017,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
565
"If you didn't copy assignments during your engineering course, did you even do engineering?" There are $Q$ students in Chef's class. Chef's teacher has given the students a simple assignment: Write a function that takes as arguments an array $A$ containing only unique elements and a number $X$ guaranteed to be present in the array and returns the ($1$-based) index of the element that is equal to $X$. The teacher was expecting a linear search algorithm, but since Chef is such an amazing programmer, he decided to write the following binary search function: integer binary_search(array a, integer n, integer x): integer low, high, mid low := 1 high := n while low ≤ high: mid := (low + high) / 2 if a[mid] == x: break else if a[mid] is less than x: low := mid+1 else: high := mid-1 return mid All of Chef's classmates have copied his code and submitted it to the teacher. Chef later realised that since he forgot to sort the array, the binary search algorithm may not work. Luckily, the teacher is tired today, so she asked Chef to assist her with grading the codes. Each student's code is graded by providing an array $A$ and an integer $X$ to it and checking if the returned index is correct. However, the teacher is lazy and provides the exact same array to all codes. The only thing that varies is the value of $X$. Chef was asked to type in the inputs. He decides that when typing in the input array for each code, he's not going to use the input array he's given, but an array created by swapping some pairs of elements of this original input array. However, he cannot change the position of the element that's equal to $X$ itself, since that would be suspicious. For each of the $Q$ students, Chef would like to know the minimum number of swaps required to make the algorithm find the correct answer. -----Input----- - The first line of the input contains a single integer $T$ denoting the number of test cases. The description of $T$ test cases follows. - The first line of each test case contains two space-separated integers $N$ and $Q$ denoting the number of elements in the array and the number of students. - The second line contains $N$ space-separated integers $A_1, A_2, \dots, A_N$. - The following $Q$ lines describe queries. Each of these lines contains a single integer $X$. -----Output----- For each query, print a single line containing one integer — the minimum required number of swaps, or $-1$ if it is impossible to make the algorithm find the correct answer. (Do you really think Chef can fail?) -----Constraints----- - $1 \le T \le 10$ - $1 \le N, Q \le 10^5$ - $1 \le A_i \le 10^9$ for each valid $i$ - $1 \le X \le 10^9$ - all elements of $A$ are pairwise distinct - for each query, $X$ is present in $A$ - sum of $N$ over all test cases $\le 5\cdot10^5$ - sum of $Q$ over all test cases $\le 5\cdot10^5$ -----Subtasks----- Subtask #1 (20 points): $1 \le N \le 10$ Subtask #2 (30 points): - $1 \le A_i \le 10^6$ for each valid $i$ - $1 \le X \le 10^6$ Subtask #3 (50 points): original constraints -----Example Input----- 1 7 7 3 1 6 7 2 5 4 1 2 3 4 5 6 7 -----Example Output----- 0 1 1 2 1 0 0 -----Explanation----- Example case 1: - Query 1: The algorithm works without any swaps. - Query 2: One solution is to swap $A_2$ and $A_4$. - Query 3: One solution is to swap $A_2$ and $A_6$. - Query 4: One solution is to swap $A_2$ with $A_4$ and $A_5$ with $A_6$. - Query 5: One solution is to swap $A_2$ and $A_4$. - Query 6: The algorithm works without any swaps. - Query 7: The algorithm works without any swaps.
["def f(a,y,index,sorted_pos):\n #print(a,y,index,sorted_pos)\n n=len(a)\n low=0\n high=n-1\n L,R=0,0\n l,r=0,0\n while(low<=high):\n mid=(low+high)//2\n #print(low,high,mid)\n if(a[mid]== y):\n break\n elif(mid > index[y]):\n high=mid-1\n L+=1\n #print(\"L\")\n if(a[mid] <y):\n l+=1\n #print(\" l \")\n else:\n low=mid+1\n R+=1\n #print(\"R\")\n if(a[mid]>y):\n r+=1\n #print(\"r\")\n x=sorted_pos[y]\n #print(L,R,l,r,x,n-x-1)\n if(R>x or L> n-x-1):\n print(\"-1\")\n else:\n print(max(l,r))\n\n\ndef fun():\n test=int(input())\n for t in range(test):\n n,q=list(map(int,input().split()))\n arr=list(map(int,input().split()))\n index= dict()\n for i in range(n):\n index[arr[i]]=i\n sorted_pos=dict()\n a=sorted(arr)\n for i in range(n):\n sorted_pos[a[i]]=i\n for x in range(q):\n y=int(input())\n f(arr,y,index,sorted_pos)\n\nfun()\n\n", "from sys import stdin,stdout\nt=int(stdin.readline())\nwhile(t):\n n,q=list(map(int,stdin.readline().rstrip().split()))\n arr=list(map(int,stdin.readline().rstrip().split()))\n d={}\n d1={}\n a=arr.copy()\n a.sort()\n for i in range(n):\n d1[a[i]]=i\n d[arr[i]]=i\n while(q):\n v=int(stdin.readline().rstrip())\n index=d[v]\n smaller=d1[v]\n bigger=n-smaller-1\n low,high=0,n-1\n c1,c2=0,0\n while(high>=low):\n mid=(high+low)//2\n if mid==index:\n break\n elif index>mid:\n if arr[mid]>v:\n c1+=1\n else:\n smaller-=1\n low=mid+1\n else:\n if v>arr[mid]:\n c2+=1\n else:\n bigger-=1\n high=mid-1\n if c2>c1:\n if bigger>=(c2-c1):\n print(c2)\n else:\n print(-1)\n elif c1>c2:\n if smaller>=(c1-c2):\n print(c1)\n else:\n print(-1)\n else:\n print(c1)\n q-=1\n t-=1\n\n", "def binarySearch(start, end, xindex,opList):\n if start <= end:\n midindex = int((start+end)/2)\n opList.append(midindex)\n if xindex < midindex:\n return binarySearch(start, midindex-1, xindex, opList)\n\n elif xindex > midindex:\n return binarySearch(midindex+1, end, xindex, opList)\n\n else:\n return opList\n\n\ndef counter(opList,a, x):\n small = 0\n big = 0\n rightSmall = 0\n rightBig = 0\n\n for i in range(len(opList)-1):\n # print(\"for oplist[\",i,\"]=\",opList[i])\n if opList[i] < opList[i+1]:\n # print(\"traverse to right\")\n if x < a[opList[i]]:\n # print(\"x is small\")\n small += 1\n else:\n rightSmall += 1\n else:\n # print(\"traverse to left\")\n if x> a[opList[i]]:\n # print(\"x is big\")\n big += 1\n else:\n rightBig += 1\n flag = isBigSmallAvailable(small,big,x,a,rightBig,rightSmall)\n if flag:\n total = small + big\n total = total - min(small,big)\n return total\n else:\n return -1\n\n\ndef isBigSmallAvailable(small,big,x,a,rightBig,rightSmall):\n s = 0\n b = 0\n s = s - rightSmall\n b = b - rightBig\n length = len(a)\n for i in range(length):\n if a[i] < x:\n s += 1\n if a[i] > x:\n b += 1\n\n if s >= small and b >= big:\n return True\n return False\n\n\nt = int(input())\nfor z in range(t):\n l = list(map(int,input().split()))\n n = int(l[0])\n q = int(l[1])\n a = list(map(int,input().split()))\n for i in range(q):\n x = int(input())\n xindex = a.index(x)\n opList = []\n result = binarySearch(0, n-1, xindex, opList)\n count = counter(opList, a, x)\n\n # print(result)\n print(count)\n # else:\n # print(swapCount)\n", "def binarySearch(start, end, xindex,opList):\n if start <= end:\n midindex = int((start+end)/2)\n\n opList.append(midindex)\n if xindex < midindex :\n return binarySearch(start, midindex-1, xindex, opList)\n\n elif xindex > midindex :\n return binarySearch(midindex+1, end, xindex, opList)\n\n else:\n return opList\n\n\ndef counter(opList,a, x):\n small = 0\n big = 0\n rightSmall = 0\n rightBig = 0\n\n for i in range(len(opList)-1):\n # print(\"for oplist[\",i,\"]=\",opList[i])\n if opList[i] < opList[i+1]:\n # print(\"traverse to right\")\n if x < a[opList[i]]:\n # print(\"x is small\")\n small += 1\n else:\n rightSmall += 1\n else:\n # print(\"traverse to left\")\n if x> a[opList[i]]:\n # print(\"x is big\")\n big += 1\n else:\n rightBig += 1\n flag = isBigSmallAvailable(small,big,x,a,rightBig,rightSmall)\n if flag:\n total = small + big\n total = total - min(small,big)\n return total\n else:\n return -1\n\n\ndef isBigSmallAvailable(small,big,x,a,rightBig,rightSmall):\n s = 0\n b = 0\n s = s - rightSmall\n b = b - rightBig\n length = len(a)\n for i in range(length):\n if a[i] < x:\n s += 1\n if a[i] > x:\n b += 1\n\n if s >= small and b >= big:\n return True\n # s = s - rightSmall\n # b = b - rightBig\n # print(\"big \",b)\n\n return False\n\n\nt = int(input())\nswapCount = 0\nswaped = []\nvisited = []\nfor z in range(t):\n l = list(map(int,input().split()))\n n = int(l[0])\n q = int(l[1])\n aa = list(map(int,input().split()))\n for i in range(q):\n swapCount = 0\n swaped.clear()\n visited.clear()\n a = aa[:]\n # print(\"aa is\",aa)\n\n x = int(input())\n # a.sort()\n xindex = a.index(x)\n opList = []\n result = binarySearch(0, n-1, xindex, opList)\n count = counter(opList, a, x)\n\n # print(result)\n print(count)\n # else:\n # print(swapCount)\n", "def binarySearch(start, end, xindex,opList):\n if start <= end:\n midindex = int((start+end)/2)\n\n opList.append(midindex)\n if xindex < midindex :\n return binarySearch(start, midindex-1, xindex, opList)\n\n elif xindex > midindex :\n return binarySearch(midindex+1, end, xindex, opList)\n\n else:\n return opList\n\n\ndef counter(opList,a, x):\n small = 0\n big = 0\n rightSmall = 0\n rightBig = 0\n\n for i in range(len(opList)-1):\n # print(\"for oplist[\",i,\"]=\",opList[i])\n if opList[i] < opList[i+1]:\n # print(\"traverse to right\")\n if x < a[opList[i]]:\n # print(\"x is small\")\n small += 1\n else:\n rightSmall += 1\n else:\n # print(\"traverse to left\")\n if x> a[opList[i]]:\n # print(\"x is big\")\n big += 1\n else:\n rightBig += 1\n flag = isBigSmallAvailable(small,big,x,a,rightBig,rightSmall)\n if flag:\n total = small + big\n total = total - min(small,big)\n return total\n else:\n return -1\n\n\ndef isBigSmallAvailable(small,big,x,a,rightBig,rightSmall):\n s = 0\n b = 0\n length = len(a)\n for i in range(length):\n if a[i] < x:\n s += 1\n if a[i] > x:\n b += 1\n s = s - rightSmall\n b = b - rightBig\n # print(\"big \",b)\n if s>=small and b>=big:\n return True\n return False\n\n\nt = int(input())\nswapCount = 0\nswaped = []\nvisited = []\nfor z in range(t):\n l = list(map(int,input().split()))\n n = int(l[0])\n q = int(l[1])\n aa = list(map(int,input().split()))\n for i in range(q):\n swapCount = 0\n swaped.clear()\n visited.clear()\n a = aa[:]\n # print(\"aa is\",aa)\n\n x = int(input())\n # a.sort()\n xindex = a.index(x)\n opList = []\n result = binarySearch(0, n-1, xindex, opList)\n count = counter(opList, a, x)\n\n # print(result)\n print(count)\n # else:\n # print(swapCount)\n", "def binarySearch(start, end, xindex,opList):\n if start <= end:\n midindex = int((start+end)/2)\n\n opList.append(midindex)\n if xindex < midindex :\n return binarySearch(start, midindex-1, xindex, opList)\n\n elif xindex > midindex :\n return binarySearch(midindex+1, end, xindex, opList)\n\n else:\n return opList\n\n\ndef counter(opList,a, x):\n small = 0\n big = 0\n rightSmall = 0\n rightBig = 0\n\n for i in range(len(opList)-1):\n # print(\"for oplist[\",i,\"]=\",opList[i])\n if opList[i] < opList[i+1]:\n # print(\"traverse to right\")\n if x < a[opList[i]]:\n # print(\"x is small\")\n small += 1\n else:\n rightSmall += 1\n else:\n # print(\"traverse to left\")\n if x> a[opList[i]]:\n # print(\"x is big\")\n big += 1\n else:\n rightBig += 1\n flag = isBigSmallAvailable(small,big,x,a,rightBig,rightSmall)\n if flag:\n total = small + big\n total = total - min(small,big)\n return total\n else:\n return -1\n\n\ndef isBigSmallAvailable(small,big,x,a,rightBig,rightSmall):\n s = 0\n b = 0\n for i in range(len(a)):\n if a[i] < x:\n s += 1\n if a[i] > x:\n b += 1\n s = s - rightSmall\n b = b - rightBig\n # print(\"big \",b)\n if s>=small and b>=big:\n return True\n return False\n\n\nt = int(input())\nswapCount = 0\nswaped = []\nvisited = []\nfor z in range(t):\n l = list(map(int,input().split()))\n n = int(l[0])\n q = int(l[1])\n aa = list(map(int,input().split()))\n for i in range(q):\n swapCount = 0\n swaped.clear()\n visited.clear()\n a = aa[:]\n # print(\"aa is\",aa)\n\n x = int(input())\n # a.sort()\n xindex = a.index(x)\n opList = []\n result = binarySearch(0, n-1, xindex, opList)\n count = counter(opList, a, x)\n\n # print(result)\n print(count)\n # else:\n # print(swapCount)\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n #dup=l[:]\n dup=sorted(l)\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n #d1=d[x].copy()\n d1={}\n d1[0]=d[x][0]\n d1[1]=d[x][1]\n f=1\n low=0\n high=n-1 \n while low<=high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n if d1[1]==-1:\n f=-1 \n break \n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n #dup=l[:]\n dup=sorted(l)\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n #d1=d[x].copy()\n d1={}\n d1[0]=d[x][0]\n d1[1]=d[x][1]\n f=1\n low=0\n high=n-1 \n while low<=high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n #dup=l[:]\n dup=sorted(l)\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n d1=d[x].copy()\n f=1\n low=0\n high=n-1 \n while low<=high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "def f(a,y,index,sorted_pos):\n #print(a,y,index,sorted_pos)\n n=len(a)\n low=0\n high=n-1\n L,R=0,0\n l,r=0,0\n while(low<=high):\n mid=(low+high)//2\n #print(low,high,mid)\n if(a[mid]== y):\n break\n elif(mid > index[y]):\n high=mid-1\n L+=1\n #print(\"L\")\n if(a[mid] <y):\n l+=1\n #print(\" l \")\n else:\n low=mid+1\n R+=1\n #print(\"R\")\n if(a[mid]>y):\n r+=1\n #print(\"r\")\n x=sorted_pos[y]\n #print(L,R,l,r,x,n-x-1)\n if(R>x or L> n-x-1):\n print(\"-1\")\n else:\n print(max(l,r))\n\n\ndef fun():\n test=int(input())\n for t in range(test):\n n,q=list(map(int,input().split()))\n arr=list(map(int,input().split()))\n index= dict()\n for i in range(n):\n index[arr[i]]=i\n sorted_pos=dict()\n a=sorted(arr)\n for i in range(n):\n sorted_pos[a[i]]=i\n for x in range(q):\n y=int(input())\n f(arr,y,index,sorted_pos)\n\nfun()\n\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n dup=l[:]\n dup=sorted(dup)\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n d1=d[x].copy()\n f=1\n low=0\n high=n-1 \n while low<=high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n dup=l.copy()\n dup.sort()\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n d1=d[x].copy()\n f=1\n low=0\n high=n-1 \n while low<high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "for _ in range(int(input())):\n n,q=list(map(int,input().split()))\n l=[int(i) for i in input().split()]\n d={}\n ind={}\n for i in range(n):\n ind[l[i]]=i \n dup=l.copy()\n dup.sort()\n for i in range(n):\n chote=i \n bade=n-i-1 \n d[dup[i]]=[chote,bade]\n for _ in range(q):\n chotewale_swap=0 \n badewale_swap=0\n x=int(input())\n d1=d[x].copy()\n f=1\n low=0\n high=n-1 \n while low<=high:\n mid=(low+high)//2 \n if ind[x]==mid:\n break \n elif ind[x]>mid and x>l[mid]:\n d1[0]-=1 \n low=mid+1\n elif ind[x]>mid and x<l[mid]:\n if d1[0]==0:\n f=-1 \n break \n d1[0]-=1 \n chotewale_swap+=1\n low=mid+1\n elif ind[x]<mid and x<l[mid]:\n d1[1]-=1 \n high=mid-1\n elif ind[x]<mid and x>l[mid]:\n if d1[1]==0:\n f=-1 \n break \n d1[1]-=1 \n badewale_swap+=1 \n high=mid-1 \n if f==-1:\n print(-1)\n else:\n print(max(chotewale_swap,badewale_swap))\n", "t = int(input())\nwhile t > 0:\n t -= 1\n n, q = list(map(int, input().split()))\n arr = list(map(int, input().split()))\n tarr = sorted(arr)\n d = {}\n inddir = {}\n for i in range(len(arr)):\n inddir[arr[i]] = i\n tarrlen = len(tarr)\n for i in range(len(tarr)):\n d[tarr[i]] = [i, tarrlen - i - 1]\n for _ in range(q):\n k = int(input())\n find = inddir[k]\n l, r = 1, tarrlen\n gs=0\n ls=0\n sw = 0\n tempc = d[k].copy()\n while l <= r:\n mid = (l + r) // 2\n if mid - 1 == find:\n break\n elif mid - 1 < find:\n if arr[mid - 1] < k:\n if tempc[0] > 0:\n tempc[0] -= 1\n else:\n sw = -1\n break\n else:\n if tempc[0] > 0:\n tempc[0] -= 1\n sw += 1\n ls+=1\n else:\n sw = -1\n break\n l = mid + 1\n else:\n if arr[mid - 1] > k:\n if tempc[1] > 0:\n tempc[1] -= 1\n else:\n sw = -1\n break\n else:\n if tempc[1] > 0:\n tempc[1] -= 1\n sw += 1\n gs+=1\n else:\n sw = -1\n break\n r = mid - 1\n print(max(ls,gs) if sw!=-1 else -1)\n", "T=int(input())\nfor xs in range(T):\n N,Q=[int(o) for o in input().split()]\n a=[int(o) for o in input().split()]\n b=sorted(a)\n Di={} #Dictionary\n for i in range(len(a)):\n Di[a[i]]=[i]\n for i in range(len(b)):\n Di[b[i]].append(i) \n r=[]\n qu=[int(input()) for j in range(Q)]\n for q in qu:\n low=1\n high=N\n ind=Di[q][0]+1\n b=[]\n f=[]\n s=0\n maxs=N-Di[q][1]-1\n mins=N-maxs-1\n while low<=high: #Binary Search algorithm\n mid=(low+high)//2\n if mid==ind:\n break\n elif mid<ind:\n low=mid+1\n if a[mid-1]>q:\n b.append(a[mid-1])\n else:\n mins-=1 \n elif mid>ind:\n high=mid-1\n if a[mid-1]<q:\n f.append(a[mid-1])\n else:\n maxs-=1\n lenf=len(f)\n lenb=len(b)\n sw=min(lenf,lenb)\n rs=max(lenf,lenb)-sw\n mins,maxs=mins-sw,maxs-sw\n ex=min(mins,maxs)\n if ex<rs: \n r.append(-1)\n s=1\n else:\n sw+=rs # When ex>=rs\n if not s:\n r.append(sw) \n for ans in r:\n print(ans) #Final"]
{"inputs": [["1", "7 7", "3 1 6 7 2 5 4", "1", "2", "3", "4", "5", "6", "7"]], "outputs": [["0", "1", "1", "2", "1", "0", "0"]]}
interview
https://www.codechef.com/problems/FAKEBS
[ 26708, 498, 3207, 944, 2975, 31172, 2337, 697, 14667, 3308, 11, 1521, 498, 1496, 653, 14667, 47369, 3862, 525, 400, 48, 3, 4143, 304, 35975, 594, 536, 13, 35975, 594, 11079, 702, 2661, 279, 4143, 264, 4285, 16319, 510, 7985, 264, 729,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
897
Chef had an array A with length N, but some of its elements got lost. Now, each element of this array is either unknown (denoted by -1) or a positive integer not exceeding K. Chef decided to restore the array A by replacing each unknown element by a positive integer not exceeding K. However, Chef has M restrictions that must hold for the restored array. There are two types of restrictions: - I L R, meaning that for each i such that L < i ≤ R, the condition Ai - Ai-1 = 1 should be satisfied. - D L R, meaning that for each i such that L < i ≤ R, the condition Ai - Ai-1 = -1 should be satisfied. Chef would like to know the number of ways to restore the array while satisfying all restrictions, modulo 109+7. -----Input----- - The first line of the input contains a single integer T denoting the number of test cases. The description of T test cases follows. - The first line of each test case contains three space-separated integers N, M and K. - The second line contains N integers A1, A2, ..., AN. - Each of the following M lines contains one restriction in the form I L R or D L R. -----Output----- For each test case, print a single line containing one integer - the number of ways to restore the array modulo 109+7. -----Constraints----- - 1 ≤ T ≤ 10 - 1 ≤ N, M ≤ 100,000 - 1 ≤ K ≤ 1,000,000,000 - 1 ≤ L < R ≤ N - 1 ≤ Ai ≤ K or Ai = -1 for each valid i - 1 ≤ sum of N over all test cases ≤ 500,000 - 1 ≤ sum of M over all test cases ≤ 500,000 -----Example----- Input: 3 4 2 10 2 3 5 4 I 1 2 D 3 4 5 2 10 -1 -1 -1 -1 -1 I 1 3 D 3 5 6 2 2 -1 -1 -1 -1 -1 -1 I 1 4 D 4 6 Output: 1 8 0
["# cook your dish here\n# cook your dish here\nMOD = 10 ** 9 + 7\n \nfor t in range(int(input())):\n N, M, K = map(int, input().split())\n A = list(map(int, input().split()))\n I, D = [0] * (N + 2), [0] * (N + 2)\n for i in range(M):\n x, L, R = input().split()\n L, R = int(L), int(R)\n if x == 'I':\n I[L] += 1\n I[R] -= 1\n else:\n D[L] += 1\n D[R] -= 1\n \n impossibru = mx = mn = 0\n ans = 1\n for i in range(N):\n I[i] += I[i - 1]\n D[i] += D[i - 1]\n if I[i] and D[i]:\n impossibru = 1\n break\n if not I[i] and not D[i]:\n ans = ans * (mx - mn + 1) % MOD\n mn, mx = 1, K\n elif I[i]:\n mx = min(mx + 1, K)\n mn += 1\n elif D[i]:\n mn = max(1, mn - 1)\n mx -= 1\n if mn > mx:\n impossibru = 1\n break\n if A[i] != -1:\n if not mn <= A[i] <= mx:\n impossibru = 1\n break\n mn = mx = A[i]\n ans = ans * (mx - mn + 1) % MOD\n \n print(0 if impossibru else ans) ", "MOD = 10 ** 9 + 7\nfor t in range(int(input())):\n N, M, K = map(int, input().split()); A = list(map(int, input().split())); I, D = [0] * (N + 2), [0] * (N + 2)\n for i in range(M):\n x, L, R = input().split(); L, R = int(L), int(R)\n if x == 'I':I[L] += 1;I[R] -= 1\n else:D[L] += 1;D[R] -= 1 \n impossibru = mx = mn = 0;ans = 1\n for i in range(N):\n I[i] += I[i - 1];D[i] += D[i - 1]\n if I[i] and D[i]:impossibru = 1;break\n if not I[i] and not D[i]:ans = ans * (mx - mn + 1) % MOD;mn, mx = 1, K\n elif I[i]:mx = min(mx + 1, K);mn += 1\n elif D[i]:mn = max(1, mn - 1);mx -= 1\n if mn > mx:impossibru = 1;break\n if A[i] != -1:\n if not mn <= A[i] <= mx:impossibru = 1;break\n mn = mx = A[i]\n ans = ans * (mx - mn + 1) % MOD \n print(0 if impossibru else ans) ", "# cook your dish here\nMOD = 10 ** 9 + 7\n \nfor t in range(int(input())):\n N, M, K = map(int, input().split())\n A = list(map(int, input().split()))\n I, D = [0] * (N + 2), [0] * (N + 2)\n for i in range(M):\n x, L, R = input().split()\n L, R = int(L), int(R)\n if x == 'I':\n I[L] += 1\n I[R] -= 1\n else:\n D[L] += 1\n D[R] -= 1\n \n impossibru = mx = mn = 0\n ans = 1\n for i in range(N):\n I[i] += I[i - 1]\n D[i] += D[i - 1]\n if I[i] and D[i]:\n impossibru = 1\n break\n if not I[i] and not D[i]:\n ans = ans * (mx - mn + 1) % MOD\n mn, mx = 1, K\n elif I[i]:\n mx = min(mx + 1, K)\n mn += 1\n elif D[i]:\n mn = max(1, mn - 1)\n mx -= 1\n if mn > mx:\n impossibru = 1\n break\n if A[i] != -1:\n if not mn <= A[i] <= mx:\n impossibru = 1\n break\n mn = mx = A[i]\n ans = ans * (mx - mn + 1) % MOD\n \n print(0 if impossibru else ans) "]
{"inputs": [["3", "4 2 10", "2 3 5 4", "I 1 2", "D 3 4", "5 2 10", "-1 -1 -1 -1 -1", "I 1 3", "D 3 5", "6 2 2", "-1 -1 -1 -1 -1 -1", "I 1 4", "D 4 6"]], "outputs": [["1", "8", "0"]]}
interview
https://www.codechef.com/problems/CO92REST
[ 93903, 1030, 458, 1334, 362, 448, 3084, 451, 11, 714, 1045, 315, 1181, 5424, 2684, 5558, 13, 4695, 11, 1817, 2392, 315, 419, 1334, 374, 2987, 9788, 320, 5183, 9253, 553, 481, 16, 8, 476, 264, 6785, 7546, 537, 47905, 730, 624, 93903,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,237
You are standing near a very strange machine. If you put C cents in the machine, the remaining money in your purse will transform in an unusual way. If you have A dollars and B cents remaining in your purse after depositing the C cents, then after the transformation you will have B dollars and A cents. You can repeat this procedure as many times as you want unless you don't have enough money for the machine. If at any point C > B and A > 0, then the machine will allow you to break one of the A dollars into 100 cents so you can place C cents in the machine. The machine will not allow you to exchange a dollar for 100 cents if B >= C. Of course, you want to do this to maximize your profit. For example if C=69 and you have 9 dollars and 77 cents then after you put 69 cents in the machine you will have 8 dollars and 9 cents (9.77 --> 9.08 --> 8.09). But I should warn you that you can't cheat. If you try to throw away 9 cents before the transformation (in order to obtain 99 dollars and 8 cents after), the machine will sense you are cheating and take away all of your money. You need to know how many times you should do this transformation in order to make a maximum profit. Since you are very busy man, you want to obtain the maximum possible profit in the minimum amount of time. -----Input----- The first line contains a single integer T <= 40, the number of test cases. T test cases follow. The only line of each test case contains three nonnegative integers A, B and C where A, B, C < 100. It means that you have A dollars and B cents in your purse and you need to put C cents in the machine to make the transformation. -----Output----- For each test case, output a single line containing the minimal number of times you should do this transformation in order to make a maximal profit. It is guaranteed that the answer is less than 10000. -----Example----- Input: 2 9 77 69 98 99 69 Output: 4 0 -----Explanation----- In the first test we have the following sequence: 9.77, 8.09, 40.07, 38.39, 70.37, 68.69, 0.68. After last step we have not enough money for further transformations. The maximal profit will be after 4 transformations.
["# cook your dish here\r\nfor _ in range(int(input())):\r\n a,b,c=list(map(int, input().split()))\r\n p=a*100+b\r\n mx=p \r\n ans, cnt = 0, 0\r\n while True:\r\n cnt+=1 \r\n if p<c or cnt==10000:\r\n break\r\n \r\n else:\r\n p-=c \r\n a=p//100\r\n b=p%100\r\n p=b*100+a\r\n if p>mx:\r\n mx=p\r\n ans=cnt\r\n \r\n print(ans) ", "# cook your dish here\ntest=int(input())\nfor _ in range(test):\n a,b,c=[int(x) for x in input().split()]\n t=s=0\n m=100*a+b\n while a*100+b>c and t<=10000:\n if b<c:\n a-=1\n b+=100\n b-=c\n temp=b\n b=a\n a=temp\n t+=1\n if a*100+b>m:\n m=a*100+b\n s=t\n print(s)", "T = int(input())\r\nfor i in range(T):\r\n a, b, c = [int(x) for x in input().split()]\r\n t = s = 0\r\n m = 100 * a + b\r\n while (a * 100 + b > c and t <= 10000):\r\n if b < c:\r\n a -= 1\r\n b += 100\r\n b -= c\r\n temp = b\r\n b = a\r\n a = temp\r\n t += 1\r\n if (a * 100) + b > m:\r\n m = a * 100 + b\r\n s = t\r\n print(s)", "t=int(input())\nwhile(t>0):\n a,b,c=[int(x) for x in input().split()]\n _count=pos_max=0\n _max=100*a+b\n while (a*100+b>c and _count<=10000):\n if b<c:\n a-=1\n b+=100\n b-=c\n temp=b\n b=a\n a=temp\n _count+=1\n if a*100+b>_max:\n _max=a*100+b\n pos_max=_count\n\n print(pos_max)\n t-=1\n", "for _ in range(int(input())):\r\n dollar, cents, C = map(int, input().split())\r\n mx = 100*dollar + cents\r\n mx_i = 0\r\n for i in range(1,10001):\r\n if cents >= C:\r\n dollar, cents = cents - C, dollar\r\n if 100 * dollar + cents > mx:\r\n mx = 100 * dollar + cents\r\n mx_i = i\r\n else:\r\n dollar -= 1\r\n cents += 100\r\n dollar, cents = cents - C, dollar\r\n if 100 * dollar + cents > mx:\r\n mx = 100 * dollar + cents\r\n mx_i = i\r\n if 100 * dollar + cents < C:\r\n break\r\n print(mx_i)", "for _ in range(int(input())):\r\n a, b, c = map(int, input().split())\r\n ans, cur_max, cur, count = 0, [a, b], 0, 10000\r\n while count > 0 and (b >= c or a > 0):\r\n cur += 1\r\n count -= 1\r\n if b < c:\r\n b += 100\r\n a -= 1\r\n \r\n b -= c\r\n if cur_max < [b, a]:\r\n ans = cur\r\n cur_max = [b, a]\r\n a, b = b, a\r\n print(ans)", "def convert(dollars, cents, required):\r\n a = dollars\r\n b = cents\r\n if b >= required:\r\n return ((b-required, a))\r\n else:\r\n a = a-1\r\n b = b+100\r\n return ((b-required, a))\r\n\r\n# print(convert(2, 55, 30))\r\n\r\nfor _ in range(int(input())):\r\n thearr = []\r\n a, b, c = map(int,input().split())\r\n thearr.append((a,b))\r\n max_so_far = thearr[0][0] + thearr[0][1]/100\r\n transform = 0\r\n index = 1\r\n count = 0\r\n while a+b/100 > c/100 and count < 10000:\r\n z = convert(a, b, c)\r\n sum = z[0] + z[1]/100\r\n if sum > max_so_far:\r\n max_so_far = sum\r\n transform = index\r\n thearr.append(z)\r\n a, b = z\r\n index += 1\r\n count += 1\r\n # print(thearr, a, b)\r\n\r\n print(transform)\r\n # print(thearr[:10])"]
{"inputs": [["2", "9 77 69", "98 99 69", "", ""]], "outputs": [["4", "0"]]}
interview
https://www.codechef.com/problems/MONTRANS
[ 2610, 525, 11259, 3143, 264, 1602, 14888, 5662, 13, 1416, 498, 2182, 356, 30191, 304, 279, 5662, 11, 279, 9664, 3220, 304, 697, 52001, 686, 5165, 304, 458, 18511, 1616, 13, 1416, 498, 614, 362, 11192, 323, 425, 30191, 9664, 304, 697, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,267
For every good kata idea there seem to be quite a few bad ones! In this kata you need to check the provided array (x) for good ideas 'good' and bad ideas 'bad'. If there are one or two good ideas, return 'Publish!', if there are more than 2 return 'I smell a series!'. If there are no good ideas, as is often the case, return 'Fail!'. ~~~if:c For C: do not dynamically allocate memory, instead return a string literal ~~~
["def well(x):\n c = x.count('good')\n return 'I smell a series!' if c > 2 else 'Publish!' if c else 'Fail!'", "def well(x):\n if x.count(\"good\") == 0:\n return \"Fail!\"\n elif x.count(\"good\") <= 2:\n return \"Publish!\"\n else:\n return \"I smell a series!\"", "def well(x):\n if 'good' in x:\n return 'I smell a series!' if x.count('good') > 2 else 'Publish!'\n else:\n return 'Fail!'", "def well(x):\n good = x.count('good')\n print (good)\n if good == 0:\n return 'Fail!'\n elif good > 2:\n return 'I smell a series!'\n else:\n return 'Publish!'", "def well(ideas):\n good_ideas = ideas.count('good')\n if good_ideas == 0:\n return 'Fail!'\n elif good_ideas < 3:\n return 'Publish!'\n return 'I smell a series!'", "well = lambda x: ('Fail!','Publish!','I smell a series!')[('good' in x) + (x.count('good')>2)]", "def well(x):\n good_ideas = x.count('good')\n if good_ideas == 0:\n return 'Fail!'\n elif good_ideas <= 2:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n results = \"\"\n good_count = x.count(\"good\")\n if good_count == 0:\n results = \"Fail!\"\n elif good_count <= 2:\n results = \"Publish!\"\n else :\n results = \"I smell a series!\"\n return results", "def well(a):c=a.count('good');return['Fail!','Publish!','I smell a series!'][(c>0)+(c>2)]", "def well(x): return ['Fail!', 'Publish!', 'Publish!', 'I smell a series!'][min(3, x.count('good'))]\n", "well=lambda a:[\"Fail!\",\"Publish!\",\"I smell a series!\"][min((a.count(\"good\")+1)//2,2)]\n", "def well(x):\n y=0\n \n for c in x:\n if c==\"good\":\n y=y+1\n \n if y==0:\n return 'Fail!'\n\n if y > 2:\n return 'I smell a series!'\n \n \n return 'Publish!'\n \n # 'Publish!', if there are more than 2 return 'I smell a series!'. If there are no good ideas, as is often the case, return 'Fail!'.\n", "def well(x):\n if x.count('good') >= 3:\n return 'I smell a series!'\n elif x.count('good') >= 1:\n return 'Publish!'\n return 'Fail!'\n", "def well(x):\n if x.count('good') > 2:\n return 'I smell a series!'\n if 'good' in x:\n return 'Publish!'\n return 'Fail!'", "def well(x):\n return (\"I smell a series!\" if x.count(\"good\") > 2\n else \"Fail!\" if x.count(\"good\") < 1\n else \"Publish!\")", "def well(ideas):\n good = 0\n \n for idea in ideas:\n if idea == 'good':\n if good > 1:\n return 'I smell a series!'\n good += 1\n \n return 'Publish!' if good else 'Fail!'", "def well(x):\n return 'Publish!' if 1 <= x.count('good') <= 2 else 'I smell a series!' if x.count('good') > 2 else 'Fail!'", "def well(x):\n return \"I smell a series!\" if x.count(\"good\") > 2 else \"Publish!\" if x.count(\"good\") >= 1 else \"Fail!\"", "well=lambda x:'I smell a series!'if x.count('good')>2 else('Publish!'if x.count('good') else 'Fail!')", "well = lambda x: ('Fail!','Publish!','I smell a series!')[min(int(x.count('good')/2+0.5),2)]", "def well(x):\n count = x.count(\"good\")\n if count <= 2 and count >= 1:\n return \"Publish!\"\n elif count > 2:\n return \"I smell a series!\"\n else:\n return \"Fail!\"\n \n", "def well(x):\n goodIdeas=0\n for k in x:\n if(k==\"good\"):\n goodIdeas+=1\n if goodIdeas>2:\n return \"I smell a series!\"\n elif goodIdeas>=1:\n return \"Publish!\"\n else:\n return 'Fail!'\n", "def well(x):\n n = x.count('good')\n return ('Fail!', 'Publish!', 'I smell a series!')[(n > 0) + (n > 2)]", "def well(x):\n \n return 'Fail!' if x.count('good')==0 else 'Publish!' if x.count('good')<=2 else \"I smell a series!\"", "def well(x):\n g=x.count('good')\n if g>2: return 'I smell a series!'\n if g: return 'Publish!'\n return 'Fail!'", "def well(x):\n return {0: \"Fail!\", 1: \"Publish!\", 2: \"Publish!\"}.get(x.count(\"good\"), \"I smell a series!\")", "def well(x):\n chk = x.count('good')\n return['Fail!','Publish!','I smell a series!'][(chk > 0)+(chk > 2)]", "def well(x):\n '''\n if x.count('good') > 2: \n return 'I smell a series!'\n elif x.count('good') > 0 < 3: \n return 'Publish!'\n else:\n return 'Fail!'\n '''\n chk, l = x.count('good'), ['Fail!','Publish!','I smell a series!']\n return [l[0],l[1],l[1]][chk] if chk < 3 else l[2]", "def well(x):\n if x.count('good') <= 2 and x.count('good') > 0:\n return 'Publish!'\n elif x.count('good') > 0:\n return 'I smell a series!'\n else:\n return 'Fail!'\n", "def well(x):\n goods = x.count('good')\n return ['Fail!', 'Publish!', 'I smell a series!'][(goods > 2) + (goods >= 1)]", "def well(x):\n good_count = 0\n for i in x:\n if i == \"good\":\n good_count+=1\n \n if 0< good_count <=2 :\n return 'Publish!'\n if good_count == 0 :\n return 'Fail!'\n if good_count > 2:\n return 'I smell a series!'\n", "def well(x):\n print(x)\n if 0 < x.count('good') <= 2: return 'Publish!'\n elif x.count('good') > 2: return 'I smell a series!'\n else: return 'Fail!'", "def well(x):\n good_ideas = x.count('good')\n if not good_ideas: return 'Fail!'\n elif good_ideas <= 2: return 'Publish!'\n else: return 'I smell a series!'\n", "def well(x):\n a = sum(1 for i in x if i == \"good\")\n if a == 1 or a == 2:\n return \"Publish!\"\n elif a > 2:\n return \"I smell a series!\"\n else:\n return \"Fail!\"", "def well(x):\n # your code here\n NG=0\n for i in range(len(x)):\n if(x[i]==\"good\"):\n NG+=1 \n if(NG>2):\n return 'I smell a series!'\n elif(NG>=1):\n return 'Publish!'\n else:\n return 'Fail!'", "def well(x):\n if x.count(\"bad\") == len(x):\n return \"Fail!\"\n if x.count('good') == 1 or x.count('good') == 2:\n return \"Publish!\"\n else:\n return 'I smell a series!'", "def well(x):\n count = 0\n for i in x:\n if i == 'good':\n count += 1\n if count > 2:\n return 'I smell a series!'\n elif count != 0:\n return 'Publish!'\n return 'Fail!'\n", "def well(x):\n if not('good' in x):\n return 'Fail!'\n else:\n return 'Publish!' if x.count('good') < 3 else 'I smell a series!' ", "def well(x):\n counter = 0\n for i in x:\n if i.lower() == 'good':\n counter +=1\n if counter == 1 or counter == 2:\n return \"Publish!\"\n elif counter>2:\n return \"I smell a series!\"\n elif counter<1: \n return \"Fail!\"", "def well(x):\n \n c= x.count(\"good\")\n if c < 1:\n return \"Fail!\"\n elif 1 <= c <=2 :\n return \"Publish!\"\n else:\n return \"I smell a series!\"\n \n", "def well(x):\n good_idea_num = x.count('good')\n if good_idea_num < 1:\n return 'Fail!'\n elif good_idea_num < 3:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n v = len([i for i in x if i == 'good'])\n return 'Fail!' if v == 0 else 'I smell a series!' if v > 2 else 'Publish!'", "def well(x):\n num_good = x.count(\"good\")\n if num_good == 0:\n return \"Fail!\"\n elif num_good > 2:\n return \"I smell a series!\"\n return \"Publish!\"", "def well(x):\n temp = x.count(\"good\")\n if 0 < temp < 3:\n return 'Publish!'\n elif temp > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n return \"I smell a series!\" if sum(1 if i == \"good\" else 0 for i in x) > 2 else \"Publish!\" if 3 > sum(1 if i == \"good\" else 0 for i in x) > 0 else \"Fail!\"", "def well(x):\n c = x.count('good')\n return 'Publish!' if c == 1 or c == 2 else 'I smell a series!' if c > 2 else 'Fail!'", "def well(x):\n return 'I smell a series!' if x.count('good') > 2 else 'Publish!' if x.count('good') != 0 else 'Fail!'", "def well(x):\n c=0\n for i in x:\n if i == 'good':\n c+=1\n \n if c==1 or c==2:\n return 'Publish!'\n elif c >2:\n return 'I smell a series!'\n elif c==0:\n return 'Fail!'", "def well(x):\n alfa = ('Fail!', 'Publish!', 'Publish!', 'I smell a series!')\n return alfa[min(3, max(x.count('good'), 0))]", "def well(x):\n goodCount = 0\n for item in x:\n if item == \"good\":\n goodCount += 1\n \n if goodCount > 2:\n return \"I smell a series!\"\n elif goodCount > 0:\n return \"Publish!\"\n else:\n return \"Fail!\"", "def well(x):\n a = 0\n for i in x:\n if i.lower() == 'good':\n a += 1\n if a <= 2 and a != 0:\n return 'Publish!'\n elif a > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n c = x.count('good')\n return ('Publish!' if c <= 2 else 'I smell a series!') if c>0 else 'Fail!'", "def well(x):\n c = len([i for i in x if i == 'good'])\n if c == 0:\n return 'Fail!'\n elif c < 3:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n y = x.count(\"good\") \n if y == 0:\n return \"Fail!\"\n elif y ==1 or y==2:\n return \"Publish!\"\n else:\n return \"I smell a series!\"", "def well(x):\n cnt=x.count('good')\n return \"Fail!\" if cnt==0 else \"Publish!\" if cnt < 3 else \"I smell a series!\"", "def well(x):\n # your code here\n c=0\n for i in x:\n if(i==\"good\"):\n c+=1\n if(0<c<=2):\n return \"Publish!\"\n elif(c>2):\n return \"I smell a series!\"\n else:\n return \"Fail!\"\n", "def well(x):\n counter = 0\n for idea in x:\n if idea == 'good':\n counter += 1\n if counter == 0:\n return 'Fail!'\n elif counter <= 2:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n if \"good\" in x: return \"I smell a series!\" if x.count(\"good\") > 2 else \"Publish!\"\n return \"Fail!\"", "def well(x):\n i = x.count(\"good\")\n if i > 2:\n return \"I smell a series!\"\n elif i == 0:\n return \"Fail!\"\n else:\n return \"Publish!\"", "def well(x):\n\n return 'Publish!' if x.count('good') in [1,2] else 'I smell a series!' if x.count('good') > 2 else 'Fail!'", "def well(x):\n n = x.count('good')\n return 'Fail!' if n < 1 else 'Publish!' if n < 3 else 'I smell a series!'", "def well(x):\n counter = 0 \n for i in x:\n if i == \"good\":\n counter += 1\n if counter < 1:\n return \"Fail!\" \n elif counter <= 2:\n return \"Publish!\"\n elif counter >2:\n return \"I smell a series!\"", "def well(x):\n score = 0\n for count in range(len(x)):\n if x[count] == \"good\":\n score += 1\n else:\n continue\n if score > 0 and score < 3:\n return \"Publish!\"\n elif score > 2: \n return \"I smell a series!\"\n else:\n return \"Fail!\"\n \n", "def well(x):\n # your code here\n return 'Publish!' if x.count('good')==2 or x.count('good')==1 else 'I smell a series!' if x.count('good')>2 else 'Fail!'", "def well(x):\n good_count = x.count('good')\n return 'I smell a series!' if good_count > 2 else ('Publish!' if good_count else 'Fail!')", "def well(x):\n good_ideas = 0\n \n for idea in x:\n if idea == \"good\":\n good_ideas +=1 \n \n if 0 < good_ideas <=2: \n return \"Publish!\"\n elif 2 < good_ideas: \n return \"I smell a series!\"\n else:\n return \"Fail!\"\n", "def well(x):\n d = {i:x.count(i) for i in x}\n if not d.get('good'):\n return 'Fail!'\n elif 1 <= d.get('good') <=2:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n l=x.count('good')\n return 'I smell a series!' if l>2 else 'Publish!' if l>0 else 'Fail!'", "def well(x):\n if x.count('good') == 0: return \"Fail!\"\n return 'Publish!' if x.count('good') == 1 or x.count('good') == 2 else \"I smell a series!\"", "def well(x):\n return [\"Fail!\",\"Publish!\",\"Publish!\",\"I smell a series!\"][x.count(\"good\") if x.count(\"good\") < 3 else 3]", "def well(x):\n y=\"good\"\n count=0\n cw=0\n while len(x) > cw:\n if x[cw] == y:\n count=count+1\n cw=cw+1\n else:\n cw=cw+1\n if count == 1 or count == 2:\n return \"Publish!\"\n elif count > 2:\n return \"I smell a series!\"\n else:\n return \"Fail!\"", "def well(x):\n g = sum([1 for item in x if item == 'good'])\n if g > 2: return 'I smell a series!'\n elif g > 0: return 'Publish!'\n else: return 'Fail!'", "def well(x):\n \n if x.count(\"good\") in [1,2]:\n return \"Publish!\"\n elif x.count(\"good\") == 0:\n return \"Fail!\"\n elif len(x) > 2:\n return \"I smell a series!\"\n else:\n return \"?\"\n", "def well(x):\n cnt = 0\n for idea in x:\n cnt += 1 if idea == 'good' else 0\n return 'Fail!' if cnt == 0 else 'Publish!' if cnt <=2 else 'I smell a series!'", "def well(x):\n c = x.count('good')\n if 2 >= c >= 1:\n return 'Publish!'\n if c > 2:\n return 'I smell a series!'\n return 'Fail!'", "def well(x):\n \"\"\"(^-__-^)\"\"\"\n if x.count('good') > 2: return 'I smell a series!'\n if x.count('good') == 0: return 'Fail!'\n if 3 > x.count('good') >= 1 : return 'Publish!'", "def well(x):\n return 'Publish!' if 1 <= x.count('good') <= 2 else 'I smell a series!' if \\\n x.count('good') > 2 else 'Fail!'", "def well(x):\n if 'good' not in x:\n return 'Fail!'\n good = 0\n for i in x:\n if i == 'good':\n good += 1\n if good > 2:\n return 'I smell a series!'\n return 'Publish!'", "def well(x):\n res = \"\"\n if x.count(\"good\") == 1 or x.count(\"good\") == 2:\n res = \"Publish!\"\n elif x.count(\"good\") > 2:\n res = \"I smell a series!\"\n else:\n res = \"Fail!\"\n return res", "def well(x):\n count_ = x.count('good')\n return 'Fail!' if count_ == 0 else ('Publish!' if count_ <= 2 else ('I smell a series!'))", "\ndef well(x):\n good_count = 0\n for idea in x:\n if idea == 'good':\n good_count += 1\n if good_count == 0:\n return 'Fail!'\n elif good_count < 3:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n c = x.count('good')\n a = ''\n if c == 0:\n a = 'Fail!'\n elif c < 3:\n a = 'Publish!'\n else:\n a = 'I smell a series!'\n return a", "def well(x):\n k = 0\n for i in x:\n if i == \"good\":\n k += 1\n if k == 0:\n return 'Fail!'\n if k == 1 or k == 2:\n return 'Publish!'\n if k > 2:\n return 'I smell a series!'", "def well(x):\n a = x.count('good')\n if 1 <= a <= 2:\n return 'Publish!'\n if 3 <= a:\n return 'I smell a series!'\n else: \n return 'Fail!'", "def well(x):\n count = x.count('good')\n \n return 'Fail!' if count == 0 else 'Publish!' if count <= 2 else 'I smell a series!'", "def well(x):\n count = 0\n \n for idea in x:\n if idea == 'good': count += 1\n \n return 'Fail!' if count == 0 else 'Publish!' if count <= 2 else 'I smell a series!'", "def well(x):\n y = x.count('good')\n if y is 0:\n return \"Fail!\"\n if y == 1 or y ==2:\n return \"Publish!\"\n return 'I smell a series!'", "def well(x):\n good_ideas = sum(1 for word in x if word == \"good\")\n if good_ideas > 2:\n return \"I smell a series!\"\n elif good_ideas > 0:\n return \"Publish!\"\n return \"Fail!\"", "def well(x):\n c = x.count('good')\n if 0 < c <= 2:\n return 'Publish!'\n elif c > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n res = 0\n for i in x:\n if i == 'good': res += 1\n if res <= 2 and res > 0: return 'Publish!'\n elif res > 2: return 'I smell a series!'\n else: return 'Fail!'", "def well(x): \n good = x.count('good')\n if good> 2:\n return 'I smell a series!'\n elif good == 0:\n return 'Fail!'\n else:\n return 'Publish!'", "def well(x):\n good_counter = 0\n for i in x:\n if i == 'good':\n good_counter += 1\n if 1<=good_counter<=2:\n return 'Publish!'\n elif good_counter>2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n count_good = x.count('good')\n if count_good > 0 and count_good <= 2:\n return 'Publish!'\n elif count_good > 2:\n return 'I smell a series!'\n return 'Fail!'", "def well(x):\n count_good = x.count('good')\n if count_good ==1 or count_good ==2 :\n return 'Publish!'\n elif count_good > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n return ['Fail!', 'Publish!', 'Publish!', 'I smell a series!', 'I smell a series!', 'I smell a series!', 'I smell a series!'].__getitem__(x.count('good'))", "def well(x):\n for i in x:\n if x.count('good') >= 3:\n return 'I smell a series!'\n elif 0 < x.count('good') <= 2:\n return 'Publish!'\n elif x.count:\n return 'Fail!'\n", "def well(x):\n goodCounter = 0\n for i in range(len(x)): \n if x[i] == 'good': \n goodCounter += 1 \n if goodCounter == 1 or goodCounter ==2 : return 'Publish!'\n elif goodCounter > 2: return 'I smell a series!'\n \n return 'Fail!'", "def well(x):\n if str(x.count('good')) in '12':\n return 'Publish!'\n elif x.count('good') > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'", "def well(x):\n y = x.count('good')\n if 2 >= y >= 1:\n return 'Publish!'\n elif y >= 3 :\n return 'I smell a series!'\n if y == 0:\n return 'Fail!'", "def well(x):\n if not 'good' in x:\n return 'Fail!'\n else:\n if len([i for i in x if i==\"good\"])>2:\n return 'I smell a series!'\n else:\n return 'Publish!'", "def well(x):\n # your code here\n if 'good' not in x:\n return 'Fail!'\n elif 3>x.count('good')>0:\n return 'Publish!'\n else:\n return 'I smell a series!'", "def well(x):\n pos = x.count('good')\n if pos == 1 or pos == 2:\n return 'Publish!'\n elif pos > 2:\n return 'I smell a series!'\n else:\n return 'Fail!'"]
{"fn_name": "well", "inputs": [[["bad", "bad", "bad"]], [["good", "bad", "bad", "bad", "bad"]], [["good", "bad", "bad", "bad", "bad", "good", "bad", "bad", "good"]]], "outputs": [["Fail!"], ["Publish!"], ["I smell a series!"]]}
introductory
https://www.codewars.com/kata/57f222ce69e09c3630000212
def well(x):
[ 2461, 1449, 1661, 61688, 4522, 1052, 2803, 311, 387, 5008, 264, 2421, 3873, 6174, 2219, 641, 419, 61688, 498, 1184, 311, 1779, 279, 3897, 1334, 320, 87, 8, 369, 1661, 6708, 364, 18536, 6, 323, 3873, 6708, 364, 13855, 4427, 1416, 1052,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
3,605
In the drawing below we have a part of the Pascal's triangle, lines are numbered from **zero** (top). The left diagonal in pale blue with only numbers equal to 1 is diagonal **zero**, then in dark green (1, 2, 3, 4, 5, 6, 7) is diagonal 1, then in pale green (1, 3, 6, 10, 15, 21) is diagonal 2 and so on. We want to calculate the sum of the binomial coefficients on a given diagonal. The sum on diagonal 0 is 8 (we'll write it S(7, 0), 7 is the number of the line where we start, 0 is the number of the diagonal). In the same way S(7, 1) is 28, S(7, 2) is 56. Can you write a program which calculate S(n, p) where n is the line where we start and p is the number of the diagonal? The function will take n and p (with: `n >= p >= 0`) as parameters and will return the sum. ## Examples: ``` diagonal(20, 3) => 5985 diagonal(20, 4) => 20349 ``` ## Hint: When following a diagonal from top to bottom have a look at the numbers on the diagonal at its right. ## Ref: http://mathworld.wolfram.com/BinomialCoefficient.html ![alternative text](http://i.imgur.com/eUGaNvIm.jpg)
["def diagonal(n, p):\n # your code\n res = 0\n for base in range(p, max(n,p) + 1):\n value = 1\n for i in range(base-p+1,base+1):\n value *= i\n for i in range(1,p+1):\n value //= i\n res += int(value)\n return res\n", "import math\n\ndef diagonal(n, p):\n s=0\n f=math.factorial(p)\n for i in range(n+1-p):\n prod=1\n for j in range(1,p+1):\n prod*=(i+j)\n prod=prod//f\n s+=prod\n return int(s)", "from operator import mul\nfrom functools import reduce\n\ndef choose(n, p):\n if (p > n - p):\n p = n - p\n return reduce(mul, list(range((n-p+1), n+1)), 1) // reduce( mul, list(range(1,p+1)), 1)\n \ndef diagonal(n, p):\n return choose(n+1, p+1)\n", "from math import factorial\ndef diagonal(n, p):\n return factorial(n + 1) // (factorial(p + 1) * factorial(n - p))", "def diagonal(line, diag):\n s, j, p = 1, 1, 1\n for i in range(diag+1, line+1):\n p = p*i//j\n s += p\n j += 1\n return s", "from functools import reduce \ndef comb(n, p):\n a,b = n-p, p\n return reduce(lambda x, y : x*y, range(max(a,b)+1,n+1))//reduce(lambda x, y : x*y, range(1,min(a,b)+1))\n\ndef diagonal(n, p):\n return comb(n+1, p+1)", "from math import factorial\ndef diagonal(n,p):\n s=factorial(n+1)//(factorial(p+1)*factorial(n-p))\n return int(s)", "from functools import reduce\nfrom operator import mul\nfrom fractions import Fraction as frac\n\ndef diagonal(n, p):\n return reduce(mul, [frac(n+1-k, k+1) for k in range(p+1)], 1)"]
{"fn_name": "diagonal", "inputs": [[20, 3], [20, 4], [20, 5], [20, 15], [100, 0], [1291, 5], [1291, 56], [1291, 1234], [12910, 15], [129100, 5]], "outputs": [[5985], [20349], [54264], [20349], [101], [6385476296235036], [15478983586799578981605681450735426444083026237083755223526535252775423299626083333014485638841019200], [15478983586799578981605681450735426444083026237083755223526535252775423299626083333014485638841019200], [28229317689300804466421113746024782373551037613710510], [6429758786797926366807779220]]}
introductory
https://www.codewars.com/kata/559b8e46fa060b2c6a0000bf
def diagonal(n, p):
[ 641, 279, 13330, 3685, 582, 614, 264, 949, 315, 279, 57359, 594, 21495, 11, 5128, 525, 48826, 504, 3070, 14154, 334, 320, 3481, 4292, 785, 2115, 37236, 304, 27539, 6303, 448, 1172, 5109, 6144, 311, 220, 16, 374, 37236, 3070, 14154, 97...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
848
Coach Moony wants the best team to represent their college in ICPC. He has $N$ students standing in a circle with certain rating $X_i$ on a competitive coding platform. It is an established fact that any coder with more rating on the platform is a better coder. Moony wants to send his best $3$ coders based upon their rating. But all coders only want to have their friends in their team and every coder is friends with four other coders, adjacent two on left side in the circle, and adjacent two on right. So Moony comes up with a solution that team with maximum cumulative rating of all three members in a team shall be representing their college. You need to give the cumulative score of the team that will be representing the college. -----Input:----- - First line will contain $T$, number of testcases. - First line of each test case contains a single integer $N$. - Second line of each test case takes $N$ integers, denoting rating of $ith$ coder. -----Output:----- For each testcase, output a single integer denoting cumulative rating of the team. -----Constraints----- - $1 \leq T \leq 10$ - $7 \leq N \leq 10^5$ - $0 \leq X_i \leq 10^9$ -----Sample Input:----- 1 7 10 40 30 30 20 0 0 -----Sample Output:----- 100
["# cook your dish here\r\n#Moony and ICPC team\r\nT = int(input())\r\n\r\nfor i in range(T):\r\n N,data = int(input()),list(map(int,input().split()))\r\n if(N==3):\r\n print(sum(data))\r\n else:\r\n best = data[0]+data[1]+data[2]\r\n overall = best\r\n k=len(data)\r\n for i in range(1,k-2):\r\n overall=overall - data[i-1] + data[i+2]\r\n if(overall>best):\r\n best = overall\r\n j=max(data[1],data[-2])\r\n l= data[-1]+data[0]+j\r\n if(best < l):\r\n best = l\r\n print(best)", "def func(n,l):\r\n if(n<=3):\r\n return sum(l)\r\n else:\r\n s=0\r\n for i in range(n-2):\r\n temp = sum(l[i:i+3:])\r\n if(temp>s):\r\n s = temp\r\n temp = l[n-1]+l[0]+l[1]\r\n if(temp>s):\r\n s = temp\r\n temp = l[n-1]+l[n-2]+l[0]\r\n if(temp>s):\r\n s = temp\r\n \r\n return s\r\nt = int(input())\r\nfor i in range(t):\r\n n = int(input())\r\n l = list(map(int,input().split()))\r\n print(func(n,l))\r\n \r\n", "for i in range(int(input())):\n\tn = int(input())\n\tarr = list(map(int,input().split()))\n\tarr_sum = []\n\tfor i in range(len(arr)):\n\t\tarr_sum.append(arr[i]+arr[(i+1)%n]+arr[(i+2)%n])\n\tprint(max(arr_sum))\n", "t=int(input())\nfor s in range(0,t):\n n=int(input())\n l=list(map(int,input().strip().split()))\n a=len(l)\n i=0\n max=-999999\n while(i<a):\n sum=0\n if(i==(a-1)):\n sum=l[i]+l[0]+l[1]\n elif(i==(a-2)):\n sum=l[i]+l[i+1]+l[0]\n else:\n sum=l[i]+l[i+1]+l[i+2]\n if(sum>max):\n max=sum\n i=i+1\n print(max)", "'''t = int(input())\nfor i in range(t):\n n = int(input())\n l = list(map(int, input().strip().split()))\n if(n==3):\n print(l[0]+l[1]+l[2])\n elif(n==4):\n print(sum(l)-min(l))\n else:\n ans=0\n for i in range(n):\n k = [0 for i in range(5)]\n k[0]=l[i]\n k[1]=l[(i+n+1)%n]\n k[2] = l[(i+n+2)%n]\n k[3] = l[i-1]\n k[4] = l[i-2]\n k.sort()\n p = k[2]+k[3]+k[4]\n if(p>ans):\n ans=p\n print(ans)'''\nt = int(input())\nfor i in range(t):\n n = int(input())\n l = list(map(int, input().strip().split()))\n if(n==3):\n print(sum(l))\n else:\n ans=0\n for j in range(n):\n p = l[j]+l[(j+n+1)%n]+l[(j+n+2)%n]\n if(p>ans):\n ans=p\n p = l[n-2]+l[n-1]+l[0]\n if(p>ans):\n ans=p\n p = l[1]+l[n-1]+l[0]\n if(p>ans):\n ans=p\n print(ans)\n \n \n", "m=int(input())\r\nfor i in range(0,m):\r\n n=int(input())\r\n a=list(map(int,input().strip().split()))\r\n l=len(a)\r\n j=0\r\n max=-999999\r\n while(j<l):\r\n sum=0\r\n if(j==(l-1)):\r\n sum=a[j]+a[0]+a[1]\r\n elif(j==(l-2)):\r\n sum=a[j]+a[j+1]+a[0]\r\n else:\r\n sum=a[j]+a[j+1]+a[j+2]\r\n if(sum>max):\r\n max=sum\r\n j=j+1\r\n print(max)", "try:\n t=int(input())\n for s in range(0,t):\n n=int(input())\n l=list(map(int,input().strip().split()))\n a=len(l)\n i=0\n max=-999999\n while(i<a):\n sum=0\n if(i==(a-1)):\n sum=l[i]+l[0]+l[1]\n elif(i==(a-2)):\n sum=l[i]+l[i+1]+l[0]\n else:\n sum=l[i]+l[i+1]+l[i+2]\n if(sum>max):\n max=sum\n i=i+1\n print(max)\nexcept:\n pass", "t=int(input())\r\nfor s in range(0,t):\r\n n=int(input())\r\n l=list(map(int,input().strip().split()))\r\n a=len(l)\r\n i=0\r\n max=-999999\r\n while(i<a):\r\n sum=0\r\n if(i==(a-1)):\r\n sum=l[i]+l[0]+l[1]\r\n elif(i==(a-2)):\r\n sum=l[i]+l[i+1]+l[0]\r\n else:\r\n sum=l[i]+l[i+1]+l[i+2]\r\n if(sum>max):\r\n max=sum\r\n i=i+1\r\n print(max)", "t=int(input())\r\nfor s in range(0,t):\r\n n=int(input())\r\n l=list(map(int,input().strip().split()))\r\n a=len(l)\r\n i=0\r\n max=-999999\r\n while(i<a):\r\n sum=0\r\n if(i==(a-1)):\r\n sum=l[i]+l[0]+l[1]\r\n elif(i==(a-2)):\r\n sum=l[i]+l[i+1]+l[0]\r\n else:\r\n sum=l[i]+l[i+1]+l[i+2]\r\n if(sum>max):\r\n max=sum\r\n i=i+1\r\n print(max)", "# cook your dish here\nfrom sys import stdin,stdout\n\ns=\"\"\nt=int(stdin.readline())\nfor _ in range(t):\n\tn=int(stdin.readline())\n\ta=list(map(int,stdin.readline().split()))\n\tm=0\n\tfor i in range(-1,n-2):\n\t\tx=a[i]+a[i+1]+a[i+2]\n\t\tif m<x:\n\t\t\tm=x\n\tx=a[n-2]+a[n-1]+a[0]\n\tif m<x:\n\t\tm=x\n\ts+=str(m)+\"\\n\"\n\t\nstdout.write(s)", "t=int(input()) \r\nwhile t>0:\r\n n=int(input())\r\n li=list(map(int,input().strip().split()))[:n]\r\n sum = 0; start = 0; end = 3 - 1; \r\n for i in range(3) : \r\n sum += li[i]; \r\n ans = sum; \r\n for i in range(3, n + 3) : \r\n sum += li[i % n] - li[(i - 3) % n]; \r\n if (sum > ans) : \r\n ans = sum; \r\n start = (i - 3 + 1) % n; \r\n end = i % n;\r\n print(ans)\r\n t=t-1\r\n\r\n\r\n\r\n", "# cook your dish here\nimport sys\n\ntt=int(sys.stdin.readline())\n\nfor _ in range(tt):\n nn=int(sys.stdin.readline())\n arr=list(map(int,sys.stdin.readline().split()))\n maxx=arr[0]+arr[1]+arr[2]\n summ=maxx\n for i in range(nn-3):\n summ=summ-arr[i]+arr[i+3]\n maxx=max(summ,maxx)\n if(arr[-1]+arr[-2]+arr[0]>maxx):\n maxx=arr[-1]+arr[-2]+arr[0]\n print(maxx)", "# cook your dish here\nt=int(input())\nfor s in range(0,t):\n n=int(input())\n l=list(map(int,input().strip().split()))\n a=len(l)\n i=0\n max=-999999\n while(i<a):\n sum=0\n if(i==(a-1)):\n sum=l[i]+l[0]+l[1]\n elif(i==(a-2)):\n sum=l[i]+l[i+1]+l[0]\n else:\n sum=l[i]+l[i+1]+l[i+2]\n if(sum>max):\n max=sum\n i=i+1\n print(max)", "# cook your dish here\r\nfor _ in range(int(input())):\r\n n=int(input())\r\n x=list(map(int, input().split()))\r\n x.append(x[0])\r\n x.append(x[1])\r\n n+=2\r\n s=0\r\n if(n<=3):\r\n print(sum(x))\r\n continue\r\n for i in range(n-3):\r\n if(sum(x[i:i+3])>s):\r\n s=sum(x[i:i+3])\r\n print(s)", "for _ in range(int(input())):\n n=int(input())\n x=list(map(int, input().split()))\n x.append(x[0])\n x.append(x[1])\n n+=2\n s=0\n if(n<=3):\n print(sum(x))\n continue\n for i in range(n-3):\n if(sum(x[i:i+3])>s):\n s=sum(x[i:i+3])\n print(s)", "try:\n t=int(input())\n for s in range(0,t):\n n=int(input())\n l=list(map(int,input().strip().split()))\n a=len(l)\n i=0\n max=-999999\n while(i<a):\n sum=0\n if(i==(a-1)):\n sum=l[i]+l[0]+l[1]\n elif(i==(a-2)):\n sum=l[i]+l[i+1]+l[0]\n else:\n sum=l[i]+l[i+1]+l[i+2]\n if(sum>max):\n max=sum\n i=i+1\n print(max)\nexcept:\n pass\n", "try:\n t=int(input())\n for s in range(0,t):\n n=int(input())\n l=list(map(int,input().strip().split()))\n a=len(l)\n i=0\n max=-999999\n while(i<a):\n sum=0\n if(i==(a-1)):\n sum=l[i]+l[0]+l[1]\n elif(i==(a-2)):\n sum=l[i]+l[i+1]+l[0]\n else:\n sum=l[i]+l[i+1]+l[i+2]\n if(sum>max):\n max=sum\n i=i+1\n print(max)\nexcept:\n pass\n", "# cook your dish here\nT = int(input())\n\nfor i in range(T):\n N,data = int(input()),list(map(int,input().split()))\n if(N==3):\n print(sum(data))\n else:\n best = data[0]+data[1]+data[2]\n overall = best\n for i in range(1,len(data)-2):\n overall=overall - data[i-1] + data[i+2]\n if(overall>best):\n best = overall\n if(best < data[-1]+data[0]+max(data[1],data[-2])):\n best = data[-1] + data[0] + max(data[1],data[-2])\n print(best)", "t=int(input())\r\nfor i in range(t):\r\n\tn=int(input())\r\n\tarr=list(map(int,input().split()))\r\n\tans=[]\r\n\tfor j in range(n):\r\n\t\tm=sum([arr[j%n],arr[(j+1)%n],arr[(j+2)%n]])\r\n\t\tans.append(m)\r\n\tprint(max(ans))\r\n", "# cook your dish here\nimport sys\n\nt=int(sys.stdin.readline())\n\nfor _ in range(t):\n n=int(sys.stdin.readline())\n arr=list(map(int,sys.stdin.readline().split()))\n maxx=arr[0]+arr[1]+arr[2]\n summ=maxx\n for i in range(n-3):\n summ=summ-arr[i]+arr[i+3]\n maxx=max(summ,maxx)\n if(arr[-1]+arr[-2]+arr[0]>maxx):\n maxx=arr[-1]+arr[-2]+arr[0]\n print(maxx)", "# cook your dish here\nt = int(input())\nfor _ in range(t):\n n = int(input())\n max_rating = 0\n arr = list(map(int,input().split()))\n for i in range(1,len(arr)):\n if i < n-1:\n x = arr[i-1]+arr[i]+arr[i+1]\n else:\n x = arr[i-1]+arr[i]+arr[(i+1)%n]\n max_rating = max(x,max_rating)\n print(max_rating)", "T=int(input())\r\nfor t in range(T):\r\n N=int(input())\r\n X=list(map(int,input().split())) \r\n mx=0\r\n for i in range(N):\r\n if mx<X[i%N]+X[(i+1)%N]+X[(i+2)%N]:\r\n mx=X[i%N]+X[(i+1)%N]+X[(i+2)%N]\r\n print(mx) ", "# cook your dish here\nt = int(input())\n\nfor _ in range(t):\n l = []\n n = int(input())\n temp = list(map(int, input().split()))\n l = temp[n - 2: n]\n l.extend(temp)\n l.extend(temp[: 3])\n tx = sum(l[:3])\n mx = tx\n for i in range(3, len(l)):\n \n mx = max(mx, tx - l[i - 3] + l[i])\n tx = tx - l[i - 3] + l[i]\n \n print(mx)", "J = int(input())\n\nfor i in range(J):\n N,data = int(input()),list(map(int,input().split()))\n if(N==3):\n print(sum(data))\n else:\n best = data[0]+data[1]+data[2]\n overall = best\n for i in range(1,len(data)-2):\n overall=overall - data[i-1] + data[i+2]\n if(overall>best):\n best = overall\n if(best < data[-1]+data[0]+max(data[1],data[-2])):\n best = data[-1] + data[0] + max(data[1],data[-2])\n print(best)", "J = int(input())\n\nfor i in range(J):\n N,data = int(input()),list(map(int,input().split()))\n if(N==3):\n print(sum(data))\n else:\n best = data[0]+data[1]+data[2]\n overall = best\n for i in range(1,len(data)-2):\n overall=overall - data[i-1] + data[i+2]\n if(overall>best):\n best = overall\n if(best < data[-1]+data[0]+max(data[1],data[-2])):\n best = data[-1] + data[0] + max(data[1],data[-2])\n print(best)"]
{"inputs": [["1", "7", "10 40 30 30 20 0 0"]], "outputs": [["100"]]}
interview
https://www.codechef.com/COG2020/problems/COG2002
[ 72694, 6050, 3549, 6801, 279, 1850, 2083, 311, 4009, 862, 7770, 304, 19288, 4872, 13, 1260, 702, 400, 45, 3, 4143, 11259, 304, 264, 12671, 448, 3654, 10728, 400, 55, 5318, 3, 389, 264, 14680, 10822, 5339, 13, 1084, 374, 458, 9555, 2...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,484
For two strings s and t, we say "t divides s" if and only if s = t + ... + t  (t concatenated with itself 1 or more times) Given two strings str1 and str2, return the largest string x such that x divides both str1 and str2.   Example 1: Input: str1 = "ABCABC", str2 = "ABC" Output: "ABC" Example 2: Input: str1 = "ABABAB", str2 = "ABAB" Output: "AB" Example 3: Input: str1 = "LEET", str2 = "CODE" Output: "" Example 4: Input: str1 = "ABCDEF", str2 = "ABC" Output: ""   Constraints: 1 <= str1.length <= 1000 1 <= str2.length <= 1000 str1 and str2 consist of English uppercase letters.
["class Solution:\n def gcdOfStrings(self, str1: str, str2: str) -> str:\n contender = ''\n for i in str1:\n contender += i\n if str1.count(contender) * len(contender) == len(str1) and str2.count(contender) * len(contender) == len(str2):\n break\n orig = contender\n ans = None\n while len(contender) <= len(str1) and len(contender) <= len(str2):\n t1 = str1.replace(contender, '')\n t2 = str2.replace(contender, '')\n if len(t1) == len(t2) == 0:\n ans = contender\n contender += orig\n return ans if ans else ''", "class Solution:\n def gcdOfStrings(self, str1: str, str2: str) -> str:\n m, n = len(str1), len(str2)\n candidate, curr = '', ''\n \n for i in range(min(m, n)):\n if str1[i] != str2[i]:\n break\n else:\n curr += str1[i]\n if m % len(curr) == 0 and n % len(curr) == 0:\n if str1 == curr * (m // len(curr)) and str2 == curr * (n // len(curr)):\n candidate = curr\n \n return candidate\n", "class Solution:\n def gcdOfStrings(self, str1: str, str2: str) -> str:\n def diviser(n):\n if n == 4:\n return [1,2]\n Result = [1]\n for i in range(2,n//2):\n if n%i == 0:\n Result.extend([int(i),int(n/i)])\n return Result\n \n def str_diviser(str3):\n Result = ['',str3]\n Result1 = diviser(len(str3))\n if len(Result1) > 0:\n for i in Result1:\n div=str3[:i]\n for j in range(i,len(str3),i):\n if str3[j:(j+i)] != div:\n break\n if j == len(str3)-i:\n Result.append(div)\n return Result\n a=str_diviser(str1)\n b=str_diviser(str2)\n if len(a)>len(b):\n a,b = b,a\n Cur = ''\n for i in a:\n if i in b and len(i)>len(Cur):\n Cur = i\n return Cur\n"]
{"fn_name": "gcdOfStrings", "inputs": [["\"ABCABC\"", "\"ABC\""]], "outputs": [""]}
introductory
https://leetcode.com/problems/greatest-common-divisor-of-strings/
class Solution: def gcdOfStrings(self, str1: str, str2: str) -> str:
[ 2461, 1378, 9069, 274, 323, 259, 11, 582, 1977, 330, 83, 64828, 274, 1, 421, 323, 1172, 421, 274, 284, 259, 488, 2503, 488, 259, 4102, 320, 83, 97534, 448, 5086, 220, 16, 476, 803, 3039, 340, 22043, 1378, 9069, 607, 16, 323, 607, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
2,439
Implement strStr(). Return the index of the first occurrence of needle in haystack, or -1 if needle is not part of haystack. Example 1: Input: haystack = "hello", needle = "ll" Output: 2 Example 2: Input: haystack = "aaaaa", needle = "bba" Output: -1 Clarification: What should we return when needle is an empty string? This is a great question to ask during an interview. For the purpose of this problem, we will return 0 when needle is an empty string. This is consistent to C's strstr() and Java's indexOf().
["class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if haystack == \"\" and needle == \"\":\n return 0\n if needle == \"\":\n return 0\n if haystack == \"\" or needle == \"\" or len(haystack.split(needle)) == 1:\n return -1\n return len(haystack.split(needle)[0])\n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n # if needle in haystack:\n # for i in range(len(haystack)-len(needle)+1):\n # if haystack[i:i+len(needle)]==needle:\n # return i\n # else:\n # return -1\n \n return haystack.find(needle)\n \n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n for i in range(len(haystack) - len(needle) + 1):\n if haystack[i:i + len(needle)] == needle:\n return i\n \n return -1\n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if not needle:\n return 0\n \n for i in range(0, len(haystack)-len(needle)+1):\n match = True\n for j in range(len(needle)):\n if haystack[i+j] != needle[j]:\n match = False\n break\n if match:\n return i\n \n return -1\n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n \n if needle == \"\":\n return 0 \n for i in range(len(haystack) - len(needle) + 1):\n for j in range(len(needle)):\n if haystack[i+j] == needle[j]:\n if j == len(needle) - 1:\n return i \n else:\n break\n \n return -1\n \n \n", "class Solution:\n def makeNext(self,s):\n k = -1; i = 0;\n next = [None for i in range(len(s))]\n next[0] = -1\n while(i < (len(s)-1)):\n while(k>=0 and s[i] != s[k]):\n k = next[k]\n i += 1; k+= 1;\n if(s[i] == s[k]):\n next[i] = next[k]\n else:\n next[i] = k\n return next\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if(needle == \"\"):\n return 0\n Next = self.makeNext(needle)\n length = len(needle)\n \n for i in range(len(haystack)):\n count = 0\n while(haystack[i + count] == needle[count]):\n count += 1 \n if(count + i >= len(haystack)) and (count < length):\n return -1\n break\n if (count >= length):\n return i\n break\n return -1\n \n \n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if not needle:\n return 0\n \n nexts = [0] * len(needle)\n nexts[0] = -1;\n if len(needle) > 1:\n nexts[1] = 0;\n left = 0; right = 2;\n while right < len(needle):\n if needle[left] == needle[right - 1]:\n nexts[right] = left + 1\n left += 1\n right += 1\n else:\n if nexts[left] > 0:\n left = nexts[left]\n else:\n nexts[right] = 0\n left = 0\n right += 1\n \n i = 0; j = 0\n while i <= len(haystack) - len(needle):\n if j == len(needle):\n return i\n \n if haystack[i + j] == needle[j]:\n j += 1\n else:\n # ababdef i=0\n # ababc j=4\n # x0012\n # ababc i=2,j=2\n if nexts[j] > 0:\n i = i + j - nexts[j]\n j = nexts[j]\n else:\n i = i + 1\n j = 0\n \n return -1\n \n", "class Solution:\n def myNext(self, T):\n next = [-1] # a next array with first is -1\n l = len(T) # the kid str length\n i, j = 0, -1 # i is last , j is first\n while i < l:\n if j == -1 or T[i] == T[j]:\n i += 1\n j += 1\n next.append(int(j)) # the same str\n else:\n j = next[j]\n return next\n \n def strStr(self, haystack, needle):\n if needle == \"\":\n return 0\n arr = Solution().myNext(needle)\n l1 = len(haystack)\n l2 = len(needle)\n i, j = 0, 0\n while i < l1 and j < l2:\n if j == -1 or haystack[i] == needle[j]:\n i += 1\n j += 1\n if j == l2:\n return i - l2\n else:\n j = arr[j]\n return -1", "class Solution:\n def makeNext(self,s):\n k = -1; i = 0;\n next = [None for i in range(len(s))]\n next[0] = -1\n while(i < (len(s)-1)):\n while(k>=0 and s[i] != s[k]):\n k = next[k]\n i += 1; k+= 1;\n if(s[i] == s[k]):\n next[i] = next[k]\n else:\n next[i] = k\n return next\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if(needle == \"\"):\n return 0\n Next = self.makeNext(needle)\n length = len(needle)\n \n for i in range(len(haystack)):\n count = 0\n while(haystack[i + count] == needle[count]):\n count += 1 \n if(count + i >= len(haystack)) and (count < length):\n return -1\n break\n if (count >= length):\n return i\n break\n return -1\n \n \n", "class Solution(object):\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if len(haystack) == len(needle):\n if haystack == needle:\n return 0\n else:\n return -1\n \n for i in range(0,len(haystack)):\n k=i\n j=0\n while j<len(needle) and k<len(haystack) and haystack[k] == needle[j]:\n j+=1\n k+=1\n if j==len(needle):\n return i\n return -1 if needle else 0", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n \n if needle == \"\":\n return 0 \n for i in range(len(haystack) - len(needle) + 1):\n for j in range(len(needle)):\n if haystack[i+j] == needle[j]:\n if j == len(needle) - 1:\n return i \n else:\n break\n \n return -1\n \n \n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if len(haystack) < len(needle):\n return -1\n if needle == '':\n return 0\n \n for i in range(len(haystack)):\n if haystack[i] == needle[0]:\n res = True\n j = 1\n try:\n while (j < len(needle)):\n if haystack[i+j] == needle[j]:\n j += 1\n else:\n res = False\n break\n if res:\n return i\n except:\n return -1\n return -1", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n \n # KMP\n i, j, m, n = -1, 0, len(haystack), len(needle)\n # construct jump array\n jump = [-1]*n\n while j < n-1: # j is increased by one\n if i == -1 or needle[i] == needle[j]:\n i, j = i+1, j+1\n jump[j] = jump[i] if needle[i]==needle[j] else i\n else:\n i = jump[i]\n \n # swipe\n i, j = 0, 0 # both start at 0\n while i < m and j < n: # CAUTION j < n\n if j == -1 or haystack[i] == needle[j]:\n i, j = i+1, j+1\n else:\n j = jump[j]\n return i-j if j == n else -1", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n next = self.next(needle)\n i = 0\n j = 0\n while i < len(haystack) and j < len(needle):\n if j == -1 or haystack[i] == needle[j]:\n i += 1\n j += 1\n else:\n j = next[j]\n if j == len(needle):\n return i - j\n else:\n return -1\n \n \n def next(self, p):\n next = []\n next.append(-1)\n i = 0\n k = -1\n while i < len(p) - 1:\n if k == -1 or p[i] == p[k]:\n i += 1\n k += 1\n next.append(k)\n else:\n k = next[k]\n return next", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n \n if not needle:\n return 0\n \n if not haystack:\n return -1\n \n if len(haystack) < len(needle):\n return -1\n \n N = len(haystack)\n for i in range(N):\n if needle == haystack[i:i+len(needle)]:\n return i\n \n return -1\n \n", "class Solution:\n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if needle == '':\n return 0\n substr_len = len(needle)\n for index, char in enumerate(haystack):\n if haystack[index:index+substr_len] == needle:\n return index\n return -1", "class Solution:\n \n def prefixTable(self, s):\n t = [0 for _ in s]\n j = 0\n i = 1\n while i < len(s):\n if j == 0 and s[i] != s[j]:\n t[i] = 0\n i += 1\n elif s[i] == s[j]:\n t[i] = j + 1\n i += 1\n j += 1\n elif j > 0 and s[j] != s[i]:\n j = t[j-1]\n return t\n \n def find(self, text, pattern):\n ans = []\n t = self.prefixTable(pattern)\n i = j = 0\n while i < len(text):\n if text[i] == pattern[j]:\n i += 1\n j += 1\n \n if j == len(pattern):\n ans.append(i - len(pattern))\n j = t[j-1]\n \n elif i < len(text) and text[i] != pattern[j]:\n if j > 0:\n j = t[j-1]\n else:\n i += 1\n return ans\n \n def strStr(self, haystack, needle):\n \"\"\"\n :type haystack: str\n :type needle: str\n :rtype: int\n \"\"\"\n if len(needle) == 0:\n return 0\n ans = self.find(haystack, needle)\n return ans[0] if ans else -1\n # for i in range(len(haystack) - len(needle) + 1):\n # if haystack[i: i + len(needle)] == needle:\n # return i\n # return -1\n \n \n # for i in range(len(haystack) - len(needle) + 1):\n # if haystack[i : i + len(needle)] == needle:\n # return i\n # return -1\n"]
{"fn_name": "strStr", "inputs": [["\"hello\"", "\"ll\""]], "outputs": [-1]}
introductory
https://leetcode.com/problems/implement-strstr/
class Solution: def strStr(self, haystack: str, needle: str) -> int:
[ 62980, 607, 2580, 368, 382, 5598, 279, 1922, 315, 279, 1156, 31559, 315, 30309, 304, 88447, 11, 476, 481, 16, 421, 30309, 374, 537, 949, 315, 88447, 382, 13314, 220, 16, 24391, 2505, 25, 88447, 284, 330, 14990, 497, 30309, 284, 330, ...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
776
You are given an integer $D$. Find an integer sequence $A_1, A_2, \ldots, A_N$ such that the following conditions are satisfied: - $1 \le N \le 10^5$ - $1 \le A_i \le 10^5$ for each valid $i$ - $\sum_{i=1}^N \sum_{j=i}^N \left( \mathrm{min}(A_i, A_{i+1}, \ldots, A_j) - \mathrm{GCD}(A_i, A_{i+1}, \ldots, A_j) \right) = D$ It can be proved that a solution always exists under the given constraints. Note: $\mathrm{GCD}(B_1, B_2, \ldots, B_M)$ is the greatest integer which divides all the integers $B_1, B_2, \ldots, B_M$. -----Input----- - The first line of the input contains a single integer $T$ denoting the number of test cases. The description of $T$ test cases follows. - The first and only line of each test case contains a single integer $D$. -----Output----- For each test case, print two lines. The first of these lines should contain a single integer $N$. The second line should contain $N$ space-separated integers $A_1, A_2, \ldots, A_N$. If there are multiple solutions, you may find any one of them. -----Constraints----- - $1 \le T \le 10$ - $0 \le D \le 10^9$ -----Example Input----- 4 2 5 200 13 -----Example Output----- 3 3 3 2 5 2 8 5 1 10 7 12 10 15 11 19 13 15 4 5 4 4 10
["# cook your dish here\nt=int(input())\nfor i in range(t):\n D=int(input())\n P=10**5-2\n ans=[]\n if(D==0):\n ans.append(1)\n while(D>0):\n P=min(P,D)\n ans.append(P+2);\n ans.append(P+1);\n ans.append(1);\n D=D-P;\n print(len(ans))\n print(*ans,sep=\" \",end=\"\\n\")\n \n \n \n ", "for _ in range(int(input())):\n D = int(input())\n P = 10 ** 5 - 2\n a = []\n if D == 0:\n print(\"1\")\n print(\"1\")\n else:\n while D > 0:\n P = min(P, D)\n a.append(P + 1)\n a.append(P + 2)\n a.append(1)\n D = D - P\n print(len(a))\n print(*a)", "from sys import stdin\nI=stdin.readline\nfor _ in range(int(I())):\n d=int(I())\n seq=[]\n if d==0:\n print(1)\n print(1)\n continue\n n=d//(10**5-2)\n rem=d%(10**5-2)\n seq=[10**5,10**5-1,1]*n\n seq.extend([rem+2,rem+1,1])\n if len(seq)>100000:\n print(runtme)\n print(len(seq))\n for i in range(len(seq)):\n if 1>seq[i]>100000:\n print(runtime)\n print(seq[i],end=\" \")\n\n print(\"\")\n", "# cook your dish here\nt=int(input())\nfor i in range(t):\n D=int(input())\n P=10**5-2\n ans=[]\n if(D==0):\n ans.append(1)\n while(D>0):\n P=min(P,D)\n ans.append(P+2)\n ans.append(P+1)\n ans.append(1)\n D-=P\n print(len(ans))\n print(*ans,sep=\" \")\n", "# cook your dish here\nfor _ in range(int(input())):\n d = int(input())\n # print(2)\n # print(d+1,d+2)\n p2 = 10**5\n p1 = p2 - 1\n p = p2 - 2\n \n div = d//p\n arr = []\n for i in range(div):\n arr.append(p1)\n arr.append(p2)\n arr.append(1)\n \n rem = d%p\n \n arr.append(rem+1)\n arr.append(rem+2)\n arr.append(1)\n print(len(arr))\n print(*arr)", "for _ in range(int(input())):\n n=int(input())\n a=n//99998\n b=n%99998\n print(3*(a+1))\n print(f'1 99999 100000 '*a + f'1 {b+1} {b+2}')\n", "# cook your dish here\ndef solve(d):\n op=[]\n p=(10**5)-2\n if d>0:\n while d>0:\n p=min(d,p)\n op.append(p+1)\n op.append(p+2)\n op.append(1)\n d= d-p\n else:\n op.append(d+1)\n op.append(d+2)\n print(len(op))\n print(*op)\ndef __starting_point():\n for test in range(int (input())):\n d=int(input())\n solve(d)\n__starting_point()", "# cook your dish here\ndef solve(d):\n op=[]\n p=(10**5)-2\n if(d>0):\n while d>0:\n p=min(d,p)\n op.append(p+1)\n op.append(p+2)\n op.append(1)\n d= d-p\n else:\n op.append(1)\n print(len(op))\n print(*op)\nt=int(input())\nfor i in range(t):\n d=int(input())\n solve(d)", "#dt = {} for i in x: dt[i] = dt.get(i,0)+1\nimport sys;input = sys.stdin.readline\ninp,ip = lambda :int(input()),lambda :[int(w) for w in input().split()]\n\nfor _ in range(inp()):\n n = inp()\n ans = []\n t = 10**5 -2\n for i in range(n//t):\n ans.extend([t+2,t+1,1])\n n = n%t\n ans.extend([n+2,n+1,1])\n print(len(ans))\n print(*ans)"]
{"inputs": [["4", "2", "5", "200", "13"]], "outputs": [["3", "3 3 2", "5", "2 8 5 1 10", "7", "12 10 15 11 19 13 15", "4", "5 4 4 10"]]}
interview
https://www.codechef.com/problems/DIANE
[ 2610, 525, 2661, 458, 7546, 400, 35, 12947, 7379, 458, 7546, 8500, 400, 32, 62, 16, 11, 362, 62, 17, 11, 1124, 507, 2412, 11, 362, 1604, 3, 1741, 429, 279, 2701, 4682, 525, 19527, 510, 12, 400, 16, 1124, 273, 451, 1124, 273, 220...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...
1,207
Chef is the new king of the country Chefland. As first and most important responsibility he wants to reconstruct the road system of Chefland. There are N (1 to N) cities in the country and each city i has a population Pi. Chef wants to build some bi-directional roads connecting different cities such that each city is connected to every other city (by a direct road or through some other intermediate city) and starting from any city one can visit every other city in the country through these roads. Cost of building a road between two cities u and v is Pu x Pv. Cost to build the road system is the sum of cost of every individual road that would be built. Help king Chef to find the minimum cost to build the new road system in Chefland such that every city is connected to each other. -----Input----- The first line of the input contains an integer T denoting the number of test cases. The description of T test cases follows. First line contains an integer N denoting the number of cities in the country. Second line contains N space separated integers Pi, the population of i-th city. -----Output----- For each test case, print a single integer, the minimum cost to build the new road system on separate line. -----Constraints----- - 1 ≤ T ≤ 10 - 1 ≤ N ≤ 105 - 1 ≤ Pi ≤ 106 -----Example----- Input: 2 2 5 10 4 15 10 7 13 Output: 50 266
["t=int(input())\nfor _ in range(t):\n n=int(input())\n a=list(map(int,input().split()))\n a.sort()\n s=sum(a)\n if a[0]*(s-a[0])<=a[n-1]*(s-a[n-1]):\n print(a[0]*(s-a[0]))\n else:\n print(a[n-1]*(s-a[n-1]))", "def solve(A,n):\n \n \n \n A.sort()\n res = 0\n for i in range(1,n):\n \n res = res + A[i]*A[0]\n \n return res\n \n \nt = int(input())\n\nfor _ in range(t):\n \n n = int(input())\n \n A=list(map(int,input().split()))\n print(solve(A,n))", "# cook your dish here\nfor _ in range(int(input())):\n n=int(input())\n m=1000001\n s=0\n for x in map(int,input().split()):\n m=min(m,x)\n s+=x\n s-=m\n s*=m\n print(s)", "# cook your dish here\nfor _ in range(int(input())):\n n=int(input())\n m=1000001\n l=[]\n for x in map(int,input().split()):\n l.append(x)\n m=min(m,x)\n s=0\n for i in l:\n s+=m*i\n s-=m*m\n print(s)", "# cook your dish here\nt=0\ntry:\n t=int(input())\nexcept:\n pass\n\nfor _ in range(t):\n \n n= int(input())\n p=list(map(int, input().split()))\n \n middle = min(p)\n p.remove(middle)\n cost =0\n for i in p:\n cost+= i*middle\n print(cost)", "for _ in range(int(input())):\n n=int(input())\n ar=[int(x) for x in input().split()]\n if n==1:\n print(ar[0])\n elif n==2:\n print(ar[0]*ar[1])\n else:\n ar.sort()\n an=0\n for i in range(1,n):\n an+=ar[0]*ar[i]\n print(an)\n", "t=int(input()) \nfor kk in range(t): \n n=int(eval(input ())) \n a=[int(x) for x in input ().split()] \n k=min(a) \n s=0\n for i in range(n): \n if a[i]!=k: \n s+=k*a[i] \n print(s)\n \n \n \n \n \n \n\n \n \n \n \n \n \n \n \n \n \n \n\n \n \n \n \n\n \n", "T = int(input())\nans = []\n\nfor _ in range(T):\n N = int(input())\n P = [int(i) for i in input().split()]\n\n m = min(P)\n ans.append((sum(P)-m)*m)\n\nfor i in ans:\n print(i)\n\n", "# cook your dish here\nt=int(input())\nfor _ in range(t):\n n=int(input())\n arr=[int(i) for i in input().split()]\n min_val=1000000\n for ele in arr:\n if min_val>ele:\n min_val=ele\n tot=0\n for ele in arr:\n if ele!=min_val:\n tot+=ele\n print(min_val*tot)\n \n \n", "for _ in range(int(input())):\n c = int(input())\n p = list(map(int,input().split()))\n p.sort()\n count = 0\n for i in range(1,c):\n count+=p[0]*p[i]\n print(count)\n", "# cook your dish here\nt=int(input())\n\ndef kingship(p,n):\n \n s=0\n m=min(p)\n \n for i in range(0,n):\n s+=p[i]*m\n return s-m*m\nfor _ in range(t):\n n=int(input())\n p=list(map(int,input().split()))\n \n r=kingship(p,n)\n print(r)", "# cook your dish here\nt=int(input())\n\ndef kingship(p,n):\n \n s=0\n p=sorted(p)\n \n for i in range(1,n):\n s+=p[0]*p[i]\n return s\nfor _ in range(t):\n n=int(input())\n p=list(map(int,input().split()))\n \n r=kingship(p,n)\n print(r)", "try:\n t=int(input())\n for i in range(t):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n cost=0\n for j in range(1,len(l)):\n cost=cost+l[0]*l[j]\n print(cost)\nexcept:\n pass", "# cook your dish here\nt = int(input())\nfor _ in range(t):\n n = int(input())\n arr = list(map(int, input().split()))\n arr.sort()\n ans = 0\n for i in range(1,n):\n ans = ans + arr[0]*arr[i]\n print(ans)\n", "t=int(input())\nfor i in range(t):\n n=int(input())\n a=list(map(int, input().split()))\n a.sort()\n s=0\n for j in range(1,n):\n s+=a[j]*a[0]\n print(s)\n", "for _ in range(int(input())):\n n = int(input())\n ls = list(map(int,input().split()))\n ls.sort()\n s =0\n for i in range(1,n):\n s+= ls[i]*ls[0]\n print(s)", "# cook your dish here\nfor _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n x=min(l)\n y=0\n for i in l:\n y+=i*x \n print(y-x*x)\n", "# cook your dish here\nfor _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n x=min(l)\n y=0\n for i in l:\n if i!=x:\n y+=i*x \n print(y)\n", "for _ in range(int(input())):\n N=int(input())\n arr=list(map(int,input().split()))\n arr.sort()\n sum=0\n for i in range(1,len(arr)):\n sum+=arr[i]*arr[0]\n print(sum)", "# cook your dish here\nfor t in range(int(input())):\n n = int(input())\n p = list(map(int, input().split()))\n m = min(p)\n s = 0\n for i in p:\n if i != m:\n s += i*m\n print(s)", "# cook your dish here\nfor i in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n sum=0\n for j in range(1,len(l)):\n sum+=l[j]\n print(sum*l[0])", "for _ in range(int(input())):\n n=int(input())\n l=list(map(int,input().split()))\n l.sort()\n s=sum(l[1:])\n print(l[0]*s)\n"]
{"inputs": [["2", "2", "5 10", "4", "15 10 7 13"]], "outputs": [["50", "266"]]}
interview
https://www.codechef.com/problems/KINGSHIP
[ 93903, 374, 279, 501, 11477, 315, 279, 3146, 8436, 1489, 437, 13, 1634, 1156, 323, 1429, 2989, 11752, 566, 6801, 311, 43828, 279, 5636, 1849, 315, 8436, 1489, 437, 13, 2619, 525, 451, 320, 16, 311, 451, 8, 9720, 304, 279, 3146, 323,...
[ 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1...