diff --git "a/train_mol_edit_add.json" "b/train_mol_edit_add.json" new file mode 100644--- /dev/null +++ "b/train_mol_edit_add.json" @@ -0,0 +1,13475 @@ +[ + { + "id": "bb402b09-18b2-46bb-9492-8e8e406a688a", + "task": "add", + "question": "Modify the molecule CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)ccc1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)ccc1Cl", + "ref_smiles": "CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)cc(C(=O)O)c1Cl", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3fbc9069-ab7f-40ad-bb64-179f281541ce", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(C(=O)OCC)C(CC(=O)c1ccc(N(C)C)cc1)Cc1ccc([N+](=O)[O-])cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(C(=O)OCC)C(CC(=O)c1ccc(N(C)C)cc1)Cc1ccc([N+](=O)[O-])cc1", + "ref_smiles": "CCOC(=O)C(C(=O)OCC)C(CC(=O)c1ccc(N(C)CCC=O)cc1)Cc1ccc([N+](=O)[O-])cc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "315ba449-d2a8-4dbc-96fd-66d557ffbacb", + "task": "add", + "question": "Modify the molecule CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccccc3)c2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccccc3)c2c1", + "ref_smiles": "CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccc(O)cc3)c2c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3ddbe57c-68ee-4236-98d0-367caf02a6fd", + "task": "add", + "question": "Modify the molecule CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(C)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(C)C(=O)[O-]", + "ref_smiles": "CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(Cc1ccccc1)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fb938603-35ee-48f8-a23a-f2378e3124bc", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCC(CCCCCCCC)C(=O)OCCCCCCCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCC(CCCCCCCC)C(=O)OCCCCCCCC.", + "ref_smiles": "CCCCCCCCCCC(CCC(CCCCC)c1ccccc1)C(=O)OCCCCCCCC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8d2c0411-314e-4cbe-8a41-056b8ba80d49", + "task": "add", + "question": "Modify the molecule CCNc1ccc(C(=O)NCCc2noc(C)n2)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNc1ccc(C(=O)NCCc2noc(C)n2)cc1C", + "ref_smiles": "Cc1nc(CCNC(=O)c2ccc(NCCO)c(C)c2)no1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3c1ed9e8-178f-4732-8b8f-37f114ac9840", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(C)OC(=O)OC(C#N)c1ccccc1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(C)OC(=O)OC(C#N)c1ccccc1", + "ref_smiles": "CCOC(=O)C(C)OC(=O)OC(S)(C#N)c1ccccc1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "5e588180-b55e-4970-a623-7e63a4157ada", + "task": "add", + "question": "Modify the molecule O=C1OCCC2(CC2)N1c1cccc(Br)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1OCCC2(CC2)N1c1cccc(Br)c1", + "ref_smiles": "O=C1OCC(c2ccccc2)C2(CC2)N1c1cccc(Br)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "553e2454-f260-4fd0-9896-748d2a0b4b0d", + "task": "add", + "question": "Modify the molecule Cc1c(CC(=O)[O-])nn2c1CCC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(CC(=O)[O-])nn2c1CCC2", + "ref_smiles": "Cc1c(CC(=O)[O-])nn2c1CCC2O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5ec00389-517e-4d2a-804a-0ff654e59335", + "task": "add", + "question": "Please add a amine to the molecule CCCc1ccn2c(n1)nc1c3ccccc3[nH]c12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1ccn2c(n1)nc1c3ccccc3[nH]c12.", + "ref_smiles": "CC(N)Cc1ccn2c(n1)nc1c3ccccc3[nH]c12", + "add_group": "amine", + "remove_group": null + }, + { + "id": "48b98187-57e4-4e4d-ac11-0676456d8910", + "task": "add", + "question": "Modify the molecule CCOC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O", + "ref_smiles": "CC(OC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4698e715-af2d-4f56-9358-c3a832b3f3bb", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC(C(=O)N1CCC(c2nnsc2-c2cc(C)no2)CC1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C(=O)N1CCC(c2nnsc2-c2cc(C)no2)CC1)c1ccccc1.", + "ref_smiles": "Cc1cc(-c2snnc2C2CCN(C(=O)C(CCc3ccccc3)c3ccccc3)CC2)on1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dae6c4fa-4e13-44c2-8156-af2b788d1f33", + "task": "add", + "question": "Modify the molecule CC(C)(C)C1=CC[NH+](CCN2CCC([NH3+])CC2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C1=CC[NH+](CCN2CCC([NH3+])CC2)CC1", + "ref_smiles": "CC(C)(C)C1=C(c2ccccc2)C[NH+](CCN2CCC([NH3+])CC2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3469d005-785c-40d1-9a45-c53055d2b2b3", + "task": "add", + "question": "Modify the molecule CCCCC(=CS(=O)(=O)c1ccc(C)cc1)[NH+]1CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(=CS(=O)(=O)c1ccc(C)cc1)[NH+]1CCCC1", + "ref_smiles": "CCCCC(=CS(=O)(=O)c1ccc(C)c(-c2ccccc2)c1)[NH+]1CCCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c1f15841-4b47-42a1-9bd4-d60e2d7010c5", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1", + "ref_smiles": "CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2c09bde0-6be9-4825-8a41-3f10262d8cfa", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)CCOCCC(C)C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)CCOCCC(C)C)cc1", + "ref_smiles": "Cc1ccc(C(=O)CCOCCC(C)CO)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "60dd36b4-2f9d-4711-b65f-25045ba6f62b", + "task": "add", + "question": "Please add a amine to the molecule CCC1(CC)NC(=O)CCN(c2ccc(Br)cc2Br)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(CC)NC(=O)CCN(c2ccc(Br)cc2Br)C1=O.", + "ref_smiles": "CCC1(CC)NC(=O)CC(N)N(c2ccc(Br)cc2Br)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "144257b3-f819-4cfd-a072-9f6a9ee337a9", + "task": "add", + "question": "Please add a amine to the molecule C[N+](C)(C)CC(=O)N=NC=C1C=C(N([O-])[O-])C=CC1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[N+](C)(C)CC(=O)N=NC=C1C=C(N([O-])[O-])C=CC1=O.", + "ref_smiles": "C[N+](C)(C)CC(=O)N=NC=C1C=C(N([O-])[O-])C(N)=CC1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "36ff2a43-867f-4d47-8c0e-ca1f0f45a48c", + "task": "add", + "question": "Modify the molecule CC(C)(C)C(=O)C(=O)NCC(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C(=O)C(=O)NCC(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1", + "ref_smiles": "CC(C)(C)C(=O)C(=O)NC(O)C(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "bc07ede9-17ba-4bbf-92d9-5c47dcea4efc", + "task": "add", + "question": "Modify the molecule CC(C)(O)CCSc1cc2ccccc2[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(O)CCSc1cc2ccccc2[nH]1", + "ref_smiles": "CC(C)(O)CCSc1cc2c(O)cccc2[nH]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "636598f8-90bd-4384-9aa1-11e86665610d", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(CNC(=O)N(C)C)CC(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(CNC(=O)N(C)C)CC(=O)[O-].", + "ref_smiles": "COC(OH)(CNC(=O)N(C)C)CC(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7ad9efca-939e-417c-937b-9475b173ff3a", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1.", + "ref_smiles": "C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "61eedbfd-70e3-4c3b-b9c0-2fc063cdde10", + "task": "add", + "question": "Modify the molecule C=CCc1cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OCC)c1OCc1ccc(C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCc1cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OCC)c1OCc1ccc(C(=O)[O-])cc1", + "ref_smiles": "C=CCc1c(OCc2ccc(C(=O)[O-])cc2)c(OCC)cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8b99358d-b565-4ba2-b70e-f32aa9307cf7", + "task": "add", + "question": "Modify the molecule O=C(C1CCCC[NH2+]1)N1CCCC2(CC[NH2+]C2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C1CCCC[NH2+]1)N1CCCC2(CC[NH2+]C2)C1", + "ref_smiles": "O=CCC1CCN(C(=O)C2CCCC[NH2+]2)CC12CC[NH2+]C2", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "5135f3f7-3c5d-48e1-acf0-2098eeb75d13", + "task": "add", + "question": "Please add a benzene ring to the molecule N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCCC1.", + "ref_smiles": "N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCC(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "791af4ab-b1b2-4687-9115-2e736f488f5d", + "task": "add", + "question": "Modify the molecule COC(=O)c1ccc(CCC2CCOCC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1ccc(CCC2CCOCC2)cc1", + "ref_smiles": "O=C(OCc1ccccc1)c1ccc(CCC2CCOCC2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ad235cc1-8dc8-42b0-9034-9228b9922d82", + "task": "add", + "question": "Modify the molecule Cc1cc(C)c(S(=O)(=O)NCC(=O)NCCC2=CCCCC2)c(C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(S(=O)(=O)NCC(=O)NCCC2=CCCCC2)c(C)c1", + "ref_smiles": "Cc1cc(C)c(S(=O)(=O)NCC(=O)NCCC2=CCCCC2)c(CO)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "bdd99ba9-4919-41ed-bc4c-fb5c67c36d20", + "task": "add", + "question": "Please add a benzene ring to the molecule C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)cc1OC.", + "ref_smiles": "C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)c(-c2ccccc2)c1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ae631305-1820-4391-b35a-9266dbdbd399", + "task": "add", + "question": "Modify the molecule C[NH+]1CCN(C(=[NH2+])C(C)(C)c2ccc(F)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(C(=[NH2+])C(C)(C)c2ccc(F)cc2)CC1", + "ref_smiles": "CC(C)(C(=[NH2+])N1CC[NH+](CO)CC1)c1ccc(F)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "32d54dd0-6600-405e-a79a-334e5a6f34d7", + "task": "add", + "question": "Please add a aldehyde to the molecule O=C([O-])c1cc(Cl)cc(NS(=O)(=O)N2CCCC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1cc(Cl)cc(NS(=O)(=O)N2CCCC2)c1.", + "ref_smiles": "O=CCc1c(Cl)cc(NS(=O)(=O)N2CCCC2)cc1C(=O)[O-]", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "28497fef-2839-4fb6-94d7-59168440a603", + "task": "add", + "question": "Modify the molecule CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)C)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)C)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1", + "ref_smiles": "CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)Cc3ccccc3)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4064e13d-0c26-4ac9-ac54-6cb976cd5f1b", + "task": "add", + "question": "Please add a amine to the molecule CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(Cc2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(Cc2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O.", + "ref_smiles": "CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(C(N)c2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "839f041b-c539-4bbb-9106-257ae87ca758", + "task": "add", + "question": "Please add a aldehyde to the molecule C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C=CC3C1C5.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C=CC3C1C5.", + "ref_smiles": "C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C(CC=O)=CC3C1C5", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "732fd2ca-e03d-4c52-9e77-fa505736989b", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCOC(=O)c1ccc(NC(C)=O)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOC(=O)c1ccc(NC(C)=O)cc1.", + "ref_smiles": "CCCCOHC(=O)c1ccc(NC(C)=O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "babeb1cb-b2b3-488a-bd5c-886ad4bbcb56", + "task": "add", + "question": "Modify the molecule CCc1ccc(C2CCCN2S(=O)(=O)N2CCC(COC)C2)o1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(C2CCCN2S(=O)(=O)N2CCC(COC)C2)o1", + "ref_smiles": "COCC1CCN(S(=O)(=O)N2CCCC2c2ccc(C(C)C(=O)O)o2)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "101c2251-aa0b-42c8-8397-7d71574b6c67", + "task": "add", + "question": "Please add a amine to the molecule CS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].", + "ref_smiles": "NCS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ee8299dc-5f07-458c-8e3c-cf371a517adf", + "task": "add", + "question": "Please add a nitrile to the molecule Cc1c(C(F)(F)F)[nH]c2c(C)ccc(Br)c2c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(F)(F)F)[nH]c2c(C)ccc(Br)c2c1=O.", + "ref_smiles": "Cc1c(C(F)(F)F)[nH]c2c(C)c(C#N)cc(Br)c2c1=O", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "3e7a2c2b-efdb-4d8d-8e40-c6caba7e5d34", + "task": "add", + "question": "Modify the molecule CCCOc1cccc(N)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCOc1cccc(N)n1", + "ref_smiles": "Nc1cccc(OCCCc2ccccc2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "acc31a73-b194-4878-9ffd-d42d402456b9", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1", + "ref_smiles": "Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1(O)CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "506f7bd5-3fe5-4611-b273-dce449c9481d", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(NC(=O)c1cc(F)c(N)c(F)c1)C1CCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(NC(=O)c1cc(F)c(N)c(F)c1)C1CCCCC1.", + "ref_smiles": "CCC(NC(=O)c1cc(F)c(N)c(F)c1O)C1CCCCC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "30b68808-0e38-4102-b7d7-bde86a11c7f8", + "task": "add", + "question": "Modify the molecule CC1CCCC(C)[NH+]1CCCC(N)=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC(C)[NH+]1CCCC(N)=O", + "ref_smiles": "CC1CCC(N)C(C)[NH+]1CCCC(N)=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b89580a0-afbb-4a56-aefc-632de7d8d714", + "task": "add", + "question": "Modify the molecule C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2C)C1)C(=O)OCC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2C)C1)C(=O)OCC", + "ref_smiles": "C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2Cc2ccccc2)C1)C(=O)OCC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "df4286e6-6f50-4600-8318-5b903b000bd4", + "task": "add", + "question": "Modify the molecule CC(C)c1ccc(C(=O)N(C)C2CCC[NH2+]CC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)c1ccc(C(=O)N(C)C2CCC[NH2+]CC2)cc1", + "ref_smiles": "CN(C(=O)c1ccc(C(C)(C)C#N)cc1)C1CCC[NH2+]CC1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "e7476004-b04f-429a-ab78-936a235c9f76", + "task": "add", + "question": "Modify the molecule [NH3+]CCCCC(O)C([NH3+])CCO by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCCCC(O)C([NH3+])CCO", + "ref_smiles": "[NH3+]C(CCCC(O)C([NH3+])CCO)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f2750598-6baa-40e6-93b9-29ec533f5635", + "task": "add", + "question": "Modify the molecule CCOC(=O)N(CC[NH3+])C(=S)NCCCc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)N(CC[NH3+])C(=S)NCCCc1ccccc1", + "ref_smiles": "CCOC(=O)N(CC[NH3+])C(=S)NCCC(c1ccccc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b6c6267c-a3bb-489f-9dd0-0706eae446ef", + "task": "add", + "question": "Modify the molecule COC([Si])(CCCC1CC2C=CC1C2)OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC([Si])(CCCC1CC2C=CC1C2)OC", + "ref_smiles": "COC([Si])(CCCC1CC2C=CC1(c1ccccc1)C2)OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "280e395d-6a9b-4890-89cb-c6f21abdb09b", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1.", + "ref_smiles": "CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])C(O)c1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0aa7286c-1305-4dc8-9d76-3e6a314b84d8", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(=NCC(C)(C)[NH+]1CCCCC1)NC1CCN(c2cccs2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=NCC(C)(C)[NH+]1CCCCC1)NC1CCN(c2cccs2)CC1.", + "ref_smiles": "CCNC(=NCC(C)(C)[NH+]1CCCCC1c1ccccc1)NC1CCN(c2cccs2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "91f57e8d-1602-44b2-8276-bf78f2dd94c8", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCn1c(=O)c2[nH]c(-c3ccc(N(CC4CC4)C(=O)c4ccc(I)nc4)nc3)cc2n(CCC)c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCn1c(=O)c2[nH]c(-c3ccc(N(CC4CC4)C(=O)c4ccc(I)nc4)nc3)cc2n(CCC)c1=O.", + "ref_smiles": "CCCn1c(=O)c2[nH]c(-c3ccc(N(C(=O)c4ccc(I)nc4)C(c4ccccc4)C4CC4)nc3)cc2n(CCC)c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ec7666d0-f129-420d-b762-f76616dd0cfa", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1.", + "ref_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3a4f4788-c293-4bfc-aa81-02544b6cc74b", + "task": "add", + "question": "Modify the molecule Cc1cc(C)c(-c2csc(NC(=O)Cc3ccc(F)cc3)n2)c(C)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(-c2csc(NC(=O)Cc3ccc(F)cc3)n2)c(C)c1", + "ref_smiles": "Cc1cc(CN)cc(C)c1-c1csc(NC(=O)Cc2ccc(F)cc2)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "97fa82a9-4d05-4e02-a493-16e8a7e423c8", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2ccccc2c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2ccccc2c1=O.", + "ref_smiles": "CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2cccc(O)c2c1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "436f2d95-2a94-451a-b8d8-ffa294206501", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C1CC(Nc2cc(F)ccc2[N+](=O)[O-])CN1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CC(Nc2cc(F)ccc2[N+](=O)[O-])CN1.", + "ref_smiles": "O=C1CC(O)(Nc2cc(F)ccc2[N+](=O)[O-])CN1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "310728f2-b304-4476-8337-cc5070ae2022", + "task": "add", + "question": "Modify the molecule C1C[NH+](Cc2nnnn2C2CC2)CC2(CC2)CO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C1C[NH+](Cc2nnnn2C2CC2)CC2(CC2)CO1", + "ref_smiles": "OC1CC12COCC[NH+](Cc1nnnn1C1CC1)C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4b2cc8b6-50fb-4ae2-a004-ce407977904d", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)C(C)n1cncc1C[NH3+].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(C)n1cncc1C[NH3+].", + "ref_smiles": "CC(CO)C(C)n1cncc1C[NH3+]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e6e29340-a834-4d26-9017-50b70bb5e677", + "task": "add", + "question": "Modify the molecule CCCOc1cccc(C([NH3+])C(=O)NCCCO)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCOc1cccc(C([NH3+])C(=O)NCCCO)c1", + "ref_smiles": "CCCOc1cc(-c2ccccc2)cc(C([NH3+])C(=O)NCCCO)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "10acc4b2-d5f3-4584-bcb3-f55686a36f83", + "task": "add", + "question": "Modify the molecule CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)cc1C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)cc1C(C)(C)C", + "ref_smiles": "CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)c(-c2ccccc2)c1C(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a80ef6cb-f223-41c1-b785-5f7e3b4273db", + "task": "add", + "question": "Modify the molecule Cc1ccc(Cl)c(OCn2ccc(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(Cl)c(OCn2ccc(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1", + "ref_smiles": "Cc1ccc(Cl)c(OCn2cc(C(=O)O)c(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "be8f5383-a521-4984-9771-e48bdd48c062", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1.", + "ref_smiles": "CCCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2-c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3c84f922-9754-4858-a6ee-31954e4407d5", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NC1CC1)c1ccc(C#CCO)c(F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CC1)c1ccc(C#CCO)c(F)c1.", + "ref_smiles": "O=C(NC1CC1)c1cc(F)c(C#CCO)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1df50a76-c4a9-40d8-8463-969e4c332b24", + "task": "add", + "question": "Modify the molecule CCOc1cc(C=NNc2nc(C)cc(C)n2)ccc1OCC(=O)Nc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(C=NNc2nc(C)cc(C)n2)ccc1OCC(=O)Nc1ccccc1", + "ref_smiles": "Cc1cc(C)nc(NN=Cc2ccc(OCC(=O)Nc3ccccc3)c(OC(C)C(=O)O)c2)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "8acd0bf3-694a-4330-9292-c8eac2dc852b", + "task": "add", + "question": "Modify the molecule COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2)cc1", + "ref_smiles": "COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2-c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "87dbc507-09a8-45a4-8bca-fa65cc7a5638", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)c1ccnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1ccnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1.", + "ref_smiles": "COC(=O)c1c(-c2ccccc2)cnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f546aff5-be06-49a6-80d2-c060b8d01482", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2ccc3ccccc3c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2ccc3ccccc3c2)CC1.", + "ref_smiles": "O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2cc(-c3ccccc3)c3ccccc3c2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e1081218-46ca-4c27-8401-85f211be2192", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)Nc1cc[nH+]c(C(=O)Nc2c(Cl)cccc2Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Nc1cc[nH+]c(C(=O)Nc2c(Cl)cccc2Cl)c1.", + "ref_smiles": "CC(CO)Nc1cc[nH+]c(C(=O)Nc2c(Cl)cccc2Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "86223763-69b3-4136-a69a-bf59c1d6ff5f", + "task": "add", + "question": "Modify the molecule C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2)SC1=[NH+]c1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2)SC1=[NH+]c1ccc(F)cc1", + "ref_smiles": "C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2-c2ccccc2)SC1=[NH+]c1ccc(F)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f1ef4db3-1169-440e-b29b-af06aea6fb1e", + "task": "add", + "question": "Modify the molecule Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2)c1", + "ref_smiles": "Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "aaf5a357-5eeb-41bf-bfd1-00a6ca63affa", + "task": "add", + "question": "Modify the molecule O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccccc2)cc1", + "ref_smiles": "O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccc(O)cc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "78969a2f-d943-43d3-a75c-29150fd5a719", + "task": "add", + "question": "Modify the molecule Cc1cc(F)cc(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(F)cc(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1", + "ref_smiles": "Cc1cc(F)c(N)c(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b34312ef-e7ab-4d53-91b7-8bbd120060ae", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH2+]C(Cc1ccc(F)c(Br)c1)C1CCc2ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(Cc1ccc(F)c(Br)c1)C1CCc2ccccc21.", + "ref_smiles": "C[NH2+]C(Cc1cc(Br)c(F)cc1O)C1CCc2ccccc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "04459a49-140b-4dc3-9e8f-47aee0596eb1", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCCC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCCC2)C1.", + "ref_smiles": "O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCC(O)C2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "84bef176-d317-44e1-b451-06fcaf4bd369", + "task": "add", + "question": "Modify the molecule O=C1C(=Cc2c(N3CCC4(CC3)OCCO4)nc3ccccn3c2=O)SC(=S)N1Cc1ccc(F)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1C(=Cc2c(N3CCC4(CC3)OCCO4)nc3ccccn3c2=O)SC(=S)N1Cc1ccc(F)cc1", + "ref_smiles": "NC1COC2(CCN(c3nc4ccccn4c(=O)c3C=C3SC(=S)N(Cc4ccc(F)cc4)C3=O)CC2)O1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "45ea7140-528e-4416-b0db-62c22cb36da5", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O.", + "ref_smiles": "CC(Cc1ccccc1)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5fc1da76-13b9-41c9-b464-62862bafac58", + "task": "add", + "question": "Please add a hydroxyl to the molecule C=CCC1CCCC(CC(CCC)OCc2ccccc2)N1C(=O)OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCC1CCCC(CC(CCC)OCc2ccccc2)N1C(=O)OC.", + "ref_smiles": "C=CCC1CCCC(CC(CCCO)OCc2ccccc2)N1C(=O)OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d2b03128-3ad7-49f3-8b63-e78f8a68aefb", + "task": "add", + "question": "Modify the molecule Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOCC1", + "ref_smiles": "Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOC(N)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "5c7b0ab6-343f-4473-beb0-c87310a3e307", + "task": "add", + "question": "Please add a thiol to the molecule CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)ccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)ccc21.", + "ref_smiles": "CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)c(S)cc21", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "9af76d1e-e760-4e94-8e24-9b469d78c131", + "task": "add", + "question": "Modify the molecule Cc1c(SCCCSc2n[nH]c(N)n2)ccnc1CSc1nc2ccccc2[nH]1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(SCCCSc2n[nH]c(N)n2)ccnc1CSc1nc2ccccc2[nH]1", + "ref_smiles": "Cc1c(SCC(CSc2n[nH]c(N)n2)C(=O)O)ccnc1CSc1nc2ccccc2[nH]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "17b17de4-e105-4b97-9062-a8698ede2690", + "task": "add", + "question": "Modify the molecule CCN(CC)C(=O)CCNC(=O)NC(CCOC)C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)C(=O)CCNC(=O)NC(CCOC)C(=O)[O-]", + "ref_smiles": "CCN(CC)C(=O)CCNC(=O)NC(O)(CCOC)C(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "13459839-dc9c-408a-b6a5-fbacca8fa9e6", + "task": "add", + "question": "Modify the molecule Cc1cnc(Nc2nc(C(F)(F)F)ccc2C(N)=O)s1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cnc(Nc2nc(C(F)(F)F)ccc2C(N)=O)s1", + "ref_smiles": "NC(=O)c1ccc(C(F)(F)F)nc1Nc1ncc(CO)s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1c228b59-7203-4bfa-a3d4-6e95e1e93a1b", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Cc1ccc2ccccc2c1)Nc1nc2c(nc1-c1cccs1)-c1ccc(O)cc1CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1ccc2ccccc2c1)Nc1nc2c(nc1-c1cccs1)-c1ccc(O)cc1CC2.", + "ref_smiles": "O=C(Cc1ccc2cc(-c3ccccc3)ccc2c1)Nc1nc2c(nc1-c1cccs1)-c1ccc(O)cc1CC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "66d8cbb8-7fcd-49fc-a0d3-e198e44ed355", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1.", + "ref_smiles": "CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCC(c3ccccc3)C2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "174e5875-87c8-4fbe-8b12-43c6ca350b2e", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+]=C(NCCCCOCCc1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCCCCOCCc1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1.", + "ref_smiles": "C[NH+]=C(NCCC(COCCc1ccccc1)c1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a6d54606-fc0c-434e-97fb-c04d3e3a0f89", + "task": "add", + "question": "Please add a aldehyde to the molecule CCCCC(O)Cn1cc2c(n1)CCc1c-2sc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(O)Cn1cc2c(n1)CCc1c-2sc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12.", + "ref_smiles": "CCCCC(O)Cn1nc2c(c1CC=O)-c1sc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c1CC2", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "44c9e9be-3851-4f70-a321-dfa041d48d57", + "task": "add", + "question": "Modify the molecule CC(C)NC(=O)c1csc(-c2ccccn2)n1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)NC(=O)c1csc(-c2ccccn2)n1", + "ref_smiles": "CC(CN)NC(=O)c1csc(-c2ccccn2)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8af1a686-55ff-48b6-9ed3-8e925c885e22", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1nn(C)c(NCc2cccc(OC3CCCCC3)c2)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c(NCc2cccc(OC3CCCCC3)c2)c1[N+](=O)[O-].", + "ref_smiles": "Cc1nn(C)c(NCc2cccc(OC3CCCC(c4ccccc4)C3)c2)c1[N+](=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3cad382c-df19-4d34-9a63-73e94277069b", + "task": "add", + "question": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)cc2)c(C)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)cc2)c(C)c1", + "ref_smiles": "Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)c(-c3ccccc3)c2)c(C)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4e915716-db32-41a6-a81d-b43aee960545", + "task": "add", + "question": "Modify the molecule COCCCC(NC(=O)NCC(C)COC)C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCC(NC(=O)NCC(C)COC)C(=O)[O-]", + "ref_smiles": "COCC(C)CNC(=O)NC(CCC(O)OC)C(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2e2af484-e22b-4485-b892-a553ec7c36f5", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)c(Cl)c2)c2cccc(Cl)c2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)c(Cl)c2)c2cccc(Cl)c2)cc1.", + "ref_smiles": "Cc1ccc(S(=O)(=O)N(c2cccc(Cl)c2)C(O)C(=O)Nc2ccc(C)c(Cl)c2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1afa3378-22b8-4cd6-9261-4b92e87482fd", + "task": "add", + "question": "Please add a benzene ring to the molecule O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1ccccc1.", + "ref_smiles": "O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "116e6d72-2469-4c18-9388-69e07e7fd7fa", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)(C)C=CC1(OCC(=O)[O-])C(C2COC(C)(C)O2)OC2OC(C)(C)OC21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C=CC1(OCC(=O)[O-])C(C2COC(C)(C)O2)OC2OC(C)(C)OC21.", + "ref_smiles": "CC(C)(C)C=CC1(OCC(=O)[O-])C2OC(C)(C)OC2OC1C1OC(C)(C)OC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d8fa23b7-ce3c-4dc9-8cdb-3dac36ccd75b", + "task": "add", + "question": "Modify the molecule CCCCCN(c1ncc(N)cn1)C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCN(c1ncc(N)cn1)C(C)C", + "ref_smiles": "CCCCCN(c1ncc(N)cn1)C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "223945db-ce29-4d2c-bf11-56cc3d6e1d39", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCCSSN(C)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCCCCCCCCCSSN(C)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C.", + "ref_smiles": "CCCCCCCCCCCCCCCCCCSSN(Cc1ccccc1)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "309b1a3d-8d5e-4979-a731-1a46272a6cca", + "task": "add", + "question": "Modify the molecule CCCC1CC([NH2+]CC)CN(C(C)C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1CC([NH2+]CC)CN(C(C)C)C1", + "ref_smiles": "CC[NH2+]C1CC(C(CC)c2ccccc2)CN(C(C)C)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "945ee77f-8b15-427c-93a3-04829d4ef9bb", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CCC2)CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CCC2)CCC1.", + "ref_smiles": "CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CC(c3ccccc3)C2)CCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2e36010a-cbd1-4986-ad0e-34840c467473", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(OC(=O)c1cccc(OC)c1OC)c1ccc(Br)cc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(OC(=O)c1cccc(OC)c1OC)c1ccc(Br)cc1F", + "ref_smiles": "COc1cccc(C(=O)OC(C(=O)OC(C)c2ccccc2)c2ccc(Br)cc2F)c1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5751ef04-7746-416e-95cc-e58550b8036f", + "task": "add", + "question": "Modify the molecule COc1ccccc1C=Cc1ccc2cccc(C(=O)[O-])c2n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C=Cc1ccc2cccc(C(=O)[O-])c2n1", + "ref_smiles": "COc1ccc(O)cc1C=Cc1ccc2cccc(C(=O)[O-])c2n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "87184ada-2f20-4da0-bd42-aaf549a66a78", + "task": "add", + "question": "Modify the molecule NC(=O)CCSc1nnc(-c2ccc[nH]2)o1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)CCSc1nnc(-c2ccc[nH]2)o1", + "ref_smiles": "NC(=O)C(CSc1nnc(-c2ccc[nH]2)o1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "46a1f668-bdc2-49c7-aa85-a10fc7f92586", + "task": "add", + "question": "Please add a carboxyl to the molecule CCC[NH2+]C(C)c1csc(C(CC)(CC)OCC)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]C(C)c1csc(C(CC)(CC)OCC)n1.", + "ref_smiles": "CCC[NH2+]C(C)c1csc(C(CC)(OCC)C(C)C(=O)O)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "61718d89-863a-493a-a1ff-521a7ecc02b5", + "task": "add", + "question": "Modify the molecule CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)C", + "ref_smiles": "CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "941233fa-b003-48af-8ab9-9ae1132dca97", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F.", + "ref_smiles": "COc1cc(O)c(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5b20495a-3b29-44df-8a66-cfe69be48917", + "task": "add", + "question": "Modify the molecule C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1", + "ref_smiles": "C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3C(=O)O)cc2)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "85185204-5c64-4ab2-8a6b-5955cef763c7", + "task": "add", + "question": "Please add a amine to the molecule CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1ccccc1.", + "ref_smiles": "CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1cccc(N)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "081679df-8f05-4eb8-882c-42f1932ab281", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1.", + "ref_smiles": "CC(Cc1ccccc1)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ccbdff17-a64f-4038-b0b6-b146b9be5089", + "task": "add", + "question": "Please add a aldehyde to the molecule CC(C)(C)C1c2cncc(n2)C1C(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C1c2cncc(n2)C1C(C)(C)C.", + "ref_smiles": "CC(C)(C)C1c2cncc(n2)C1C(C)(C)CCC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "29ed2aca-595d-4322-98de-0ebf44f6cf77", + "task": "add", + "question": "Modify the molecule Cc1cc(Oc2cc(C[NH2+]CC(C)C)ccn2)ccc1Br by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Oc2cc(C[NH2+]CC(C)C)ccn2)ccc1Br", + "ref_smiles": "Cc1cc(Oc2cc(C(O)[NH2+]CC(C)C)ccn2)ccc1Br", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "661d6b2a-1726-4dab-81b0-5ee7e1e4656d", + "task": "add", + "question": "Please add a benzene ring to the molecule [NH3+]C1(CNC(=O)CSc2ccccc2)CCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1(CNC(=O)CSc2ccccc2)CCCCC1.", + "ref_smiles": "[NH3+]C1(CNC(=O)CSc2ccccc2)CCC(c3ccccc3)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3a8fe8d3-fc0c-47ac-a53f-5a9d66b00c7a", + "task": "add", + "question": "Modify the molecule COc1ccccc1OCC(=O)N1CCC(C)C1CO by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1OCC(=O)N1CCC(C)C1CO", + "ref_smiles": "COc1cc(C(=O)O)ccc1OCC(=O)N1CCC(C)C1CO", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "483823dc-7bb2-4983-b0f1-94ecc4d6a637", + "task": "add", + "question": "Modify the molecule COc1ccc(CC([NH3+])CCCC(C)C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CC([NH3+])CCCC(C)C)cn1", + "ref_smiles": "COc1c(O)cc(CC([NH3+])CCCC(C)C)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a4eee0c0-59b3-4314-a6c0-e11917f964e8", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C([O-])CC(c1cn[nH]c1)C1CCCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])CC(c1cn[nH]c1)C1CCCCCC1.", + "ref_smiles": "O=C([O-])CC(c1cn[nH]c1)C1CCCCC(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "75f84072-a929-41a6-88e3-42b605502012", + "task": "add", + "question": "Please add a amine to the molecule CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)ccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)ccc21.", + "ref_smiles": "CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)cc(N)c21", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3ec56b8f-0b72-45a3-856b-b30a8018e210", + "task": "add", + "question": "Modify the molecule COCC#CCSc1cnccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC#CCSc1cnccn1", + "ref_smiles": "COCC#CCSc1nccnc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d8ef612e-1762-4134-a503-67d1871183dc", + "task": "add", + "question": "Modify the molecule C=C1CCCOC1=CC(=CC)C(CC(=O)OC)[NH2+]CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C1CCCOC1=CC(=CC)C(CC(=O)OC)[NH2+]CC", + "ref_smiles": "C=C1CCCOC1=CC(=CC)C(CC(=O)OCO)[NH2+]CC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "200a7518-5a48-4bff-95e2-7e25bd75b316", + "task": "add", + "question": "Please add a carboxyl to the molecule C[NH2+]C1CCC(C(C)C)CC1CCOCCCOC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C1CCC(C(C)C)CC1CCOCCCOC.", + "ref_smiles": "C[NH2+]C1CCC(C(C)(C)C(=O)O)CC1CCOCCCOC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "aa55238e-7ed4-4a4c-b70b-85d046ebdb51", + "task": "add", + "question": "Modify the molecule CCC[NH+]=C(N)NC1Cc2ccccc2C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH+]=C(N)NC1Cc2ccccc2C1", + "ref_smiles": "CCC[NH+]=C(N)NC1Cc2ccccc2C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "25abbcc3-10e0-484f-afa1-e0c0532c411e", + "task": "add", + "question": "Please add a hydroxyl to the molecule S=C(S)NCC[NH2+]C(S)S.\nPlease wrap the final SMILES in ....", + "src_smiles": "S=C(S)NCC[NH2+]C(S)S.", + "ref_smiles": "OC(S)(S)[NH2+]CCNC(=S)S", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "521bd605-d8ee-4de6-a34e-7e8cc93f9b92", + "task": "add", + "question": "Modify the molecule CSCCC(CO)NC(c1ccccc1)C(F)(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCC(CO)NC(c1ccccc1)C(F)(F)F", + "ref_smiles": "CSCCC(CO)NC(c1ccc(C(=O)O)cc1)C(F)(F)F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "57b8b5e5-0572-4dda-9c95-d4dc209d3d26", + "task": "add", + "question": "Please add a benzene ring to the molecule NOCCc1cc2c(cc1O)OCO2.\nPlease wrap the final SMILES in ....", + "src_smiles": "NOCCc1cc2c(cc1O)OCO2.", + "ref_smiles": "NOCCc1cc2c(cc1O)OC(c1ccccc1)O2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "35420f96-4de3-42ae-9ef8-1e7d8e7ee51e", + "task": "add", + "question": "Modify the molecule O=C(Nc1nncs1)c1ccc(N(CCO)C2CCC2)nc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1nncs1)c1ccc(N(CCO)C2CCC2)nc1", + "ref_smiles": "O=C(Nc1nncs1)c1ccc(N(CCO)C2(O)CCC2)nc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0ede56d4-ecd4-4de8-ba93-ec9668dfa0f4", + "task": "add", + "question": "Please add a carboxyl to the molecule CCOc1ccc(NS(=O)(=O)c2cc(C[NH3+])sc2C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(NS(=O)(=O)c2cc(C[NH3+])sc2C)cc1.", + "ref_smiles": "Cc1sc(C[NH3+])cc1S(=O)(=O)Nc1ccc(OC(C)C(=O)O)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a014af65-0731-4b05-adb8-0db909f55b64", + "task": "add", + "question": "Modify the molecule CCC(C)CSCC(=O)c1c(C)cc(C)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)CSCC(=O)c1c(C)cc(C)cc1C", + "ref_smiles": "CCC(C)C(O)SCC(=O)c1c(C)cc(C)cc1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e6f0cecf-bff6-4dd3-9675-43d77ff27126", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1nn(C)cc1S(=O)(=O)NCC1CCCC[NH+]1C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)cc1S(=O)(=O)NCC1CCCC[NH+]1C1CC1.", + "ref_smiles": "Cc1nn(C)cc1S(=O)(=O)NCC1C(O)CCC[NH+]1C1CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "02e4d6b8-d898-41ba-a51a-65a38fdbb1ca", + "task": "add", + "question": "Modify the molecule O=C(NCC(CO)Cc1cc(F)ccc1F)c1ccccc1OCc1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC(CO)Cc1cc(F)ccc1F)c1ccccc1OCc1ccc(F)cc1", + "ref_smiles": "O=C(NCC(CO)(Cc1cc(F)ccc1F)c1ccccc1)c1ccccc1OCc1ccc(F)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "18f9d5ae-0d21-4e1a-97b5-1a224a1bf3de", + "task": "add", + "question": "Modify the molecule C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(C)C5CCC43C)C12 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(C)C5CCC43C)C12", + "ref_smiles": "C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(CC(=O)O)C5CCC43C)C12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "cf823295-cf05-4bbf-9125-f0fc5da85955", + "task": "add", + "question": "Modify the molecule CCN(CCCC[NH2+]C(C)C)c1ccccc1C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CCCC[NH2+]C(C)C)c1ccccc1C", + "ref_smiles": "CCN(c1ccccc1C)C(N)CCC[NH2+]C(C)C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "22b9e4af-7c03-4637-a161-837fe9b635ba", + "task": "add", + "question": "Modify the molecule NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1", + "ref_smiles": "NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "30bac567-8d34-43a7-848f-dbe429ecfe17", + "task": "add", + "question": "Modify the molecule C=CC(C)([NH3+])c1ccc(F)cc1Cl by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC(C)([NH3+])c1ccc(F)cc1Cl", + "ref_smiles": "C=C(N)C(C)([NH3+])c1ccc(F)cc1Cl", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d2bc786b-40f5-4901-8d91-5caf03aa2479", + "task": "add", + "question": "Modify the molecule CCOC1CC(Nc2ccc3cn[nH]c3c2)C12CCCC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC1CC(Nc2ccc3cn[nH]c3c2)C12CCCC2", + "ref_smiles": "CCOC1CC(Nc2ccc3c(-c4ccccc4)n[nH]c3c2)C12CCCC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ce3189b2-054f-40b6-9567-4d96ee442c49", + "task": "add", + "question": "Modify the molecule COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1", + "ref_smiles": "COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "5342a98e-e737-456c-b94a-ec0b673af05e", + "task": "add", + "question": "Modify the molecule CCCCCC(C)(C[NH3+])N(CCCOC)CCOC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC(C)(C[NH3+])N(CCCOC)CCOC", + "ref_smiles": "CCCCCC(C)(C[NH3+])N(CCOC)CCC(OC)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8fea7fc9-c1dd-4de0-9f9e-91043d34caf1", + "task": "add", + "question": "Modify the molecule C=CCCCCCCCc1nnc(-c2ccccc2)c(-c2ccccc2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCCCCCCCc1nnc(-c2ccccc2)c(-c2ccccc2)n1", + "ref_smiles": "C=CCCCCCC(Cc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "92e28a76-859b-4a89-802b-8c890990d744", + "task": "add", + "question": "Modify the molecule CNc1cc[nH+]c(C(=O)N(C)CC[NH+]2CCCC2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1cc[nH+]c(C(=O)N(C)CC[NH+]2CCCC2)c1", + "ref_smiles": "CNc1cc[nH+]c(C(=O)N(C)CC(c2ccccc2)[NH+]2CCCC2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f45afaf6-34c9-4d82-9325-5c9a0cc096b8", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOc1ccc(C(CC)[NH+]2CCCC(C(=O)[O-])C2)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C(CC)[NH+]2CCCC(C(=O)[O-])C2)cc1OC.", + "ref_smiles": "CCOc1ccc(C(CC)(c2ccccc2)[NH+]2CCCC(C(=O)[O-])C2)cc1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "57145fcd-b54d-415c-84c3-87b0cb8bf45c", + "task": "add", + "question": "Modify the molecule CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2)n1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2)n1", + "ref_smiles": "CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2C(=O)O)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "95552d78-6093-4f82-83cd-98181823c463", + "task": "add", + "question": "Modify the molecule Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)CC3)c(=O)c2c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)CC3)c(=O)c2c1", + "ref_smiles": "Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)C(N)C3)c(=O)c2c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "062a63b2-95ef-4f97-836c-02a1c50bb905", + "task": "add", + "question": "Modify the molecule C[NH2+]C(C)c1sc(C(OC)C(C)(C)C)nc1C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(C)c1sc(C(OC)C(C)(C)C)nc1C", + "ref_smiles": "C[NH2+]C(CC(=O)O)c1sc(C(OC)C(C)(C)C)nc1C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a8b775d8-0a8d-406f-b82e-419b1651b6ab", + "task": "add", + "question": "Modify the molecule CCc1ccc(-c2cn3c4ccccc4nc3n2CCOC(C)=O)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(-c2cn3c4ccccc4nc3n2CCOC(C)=O)cc1", + "ref_smiles": "CCc1ccc(-c2cn3c4cc(C#N)ccc4nc3n2CCOC(C)=O)cc1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "5ba9bc83-2802-49ec-b83f-23b83a62174d", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCNc1cccc(NS(N)(=O)=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCNc1cccc(NS(N)(=O)=O)c1.", + "ref_smiles": "CCC(CCCCCNc1cccc(NS(N)(=O)=O)c1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dd01b352-b76c-4c02-8fc1-c4d74b5a00e5", + "task": "add", + "question": "Modify the molecule CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])C1=O by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])C1=O", + "ref_smiles": "CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2cccc(C#N)c2)C(=O)[O-])C1=O", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "42e9fee0-7ecd-4d12-a9b7-b1e0e2f20695", + "task": "add", + "question": "Please add a amine to the molecule COc1cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1.", + "ref_smiles": "COc1c(NH2)cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "83acfd4b-c8d9-4575-bed7-0d0457e8c2da", + "task": "add", + "question": "Modify the molecule CC(CC#N)c1ccc(F)cc1F by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CC#N)c1ccc(F)cc1F", + "ref_smiles": "CC(c1ccc(F)cc1F)C(C#N)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0fcb9b56-c5ed-47b2-beb8-2755ea787362", + "task": "add", + "question": "Modify the molecule CCC(C(C)O)C1CC(C)(C)OC1(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C(C)O)C1CC(C)(C)OC1(C)C", + "ref_smiles": "CCC(C(C)O)C1CC(C)(CO)OC1(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "90771557-60c5-405e-ac5d-751494735a3e", + "task": "add", + "question": "Please add a carboxyl to the molecule CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3ccccc3)o2)c1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3ccccc3)o2)c1)S(C)(=O)=O.", + "ref_smiles": "CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3cccc(C(=O)O)c3)o2)c1)S(C)(=O)=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "52e23dad-30fe-4ca3-adeb-ee2830d2a48d", + "task": "add", + "question": "Modify the molecule CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccccc7)c7ccc(-c8ccccc8)cc7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccccc7)c7ccc(-c8ccccc8)cc7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21", + "ref_smiles": "CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccc(-c8ccccc8)cc7)c7cccc(O)c7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "da7c2d88-a6e0-4a87-a4ba-0c9015c71074", + "task": "add", + "question": "Modify the molecule CCC(CN1CCCCC1=O)[NH2+]CCc1ccc(OS(=O)(=O)C(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CN1CCCCC1=O)[NH2+]CCc1ccc(OS(=O)(=O)C(C)C)cc1", + "ref_smiles": "CCC(CN1CCCCC1=O)[NH2+]CC(c1ccccc1)c1ccc(OS(=O)(=O)C(C)C)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3e1e8238-ea73-437e-b090-40f33421bcbf", + "task": "add", + "question": "Please add a amine to the molecule CSC(=O)C=C1SSC(=CC(=O)SC)S1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSC(=O)C=C1SSC(=CC(=O)SC)S1.", + "ref_smiles": "CSC(=O)C=C1SSC(=C(N)C(=O)SC)S1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e6a01836-7c74-4641-87aa-0023fd37629b", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)n1cc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)n1cc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)cn1.", + "ref_smiles": "CC(C)n1ncc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4e27f462-bf6d-40d1-aefa-c1a4cad2e716", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(NC(=O)CN(C)c2nc3c(OC)cccc3s2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(NC(=O)CN(C)c2nc3c(OC)cccc3s2)cc1.", + "ref_smiles": "COc1cccc2sc(N(C)CC(=O)Nc3ccc(OCO)cc3)nc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fc75478c-a731-4930-aee9-047ead766448", + "task": "add", + "question": "Please add a aldehyde to the molecule COc1ccc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)cc1OC.", + "ref_smiles": "COc1cc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)ccc1OCCC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "ad683987-e686-46e2-8123-5989e90ae337", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1)c1ccccc1.", + "ref_smiles": "O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1O)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9855b37d-a0e6-4aff-8cad-ce8d0e40d709", + "task": "add", + "question": "Please add a amine to the molecule C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cccc2F)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cccc2F)C1.", + "ref_smiles": "C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cc(N)cc2F)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "770d90c0-1e7b-4a4a-8305-e913f1924b2a", + "task": "add", + "question": "Modify the molecule O=S(=O)([O-])OC12CCC(CC1)CC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)([O-])OC12CCC(CC1)CC2", + "ref_smiles": "O=S(=O)([O-])OC12CCC(CC1)CC2O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "208b7bdc-6882-4108-beb9-e3d5a858b16b", + "task": "add", + "question": "Modify the molecule CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(C)c1", + "ref_smiles": "CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(CO)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "80d3628e-9441-4fd6-a911-8fe725491cde", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(=O)c1cc(COc2cnc(OC)cc2C=O)c2[nH+]c(Br)cn2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1cc(COc2cnc(OC)cc2C=O)c2[nH+]c(Br)cn2c1.", + "ref_smiles": "COC(=O)c1cc(COc2cnc(OC)cc2C(=O)O)c2[nH+]c(Br)cn2c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8a348c42-7a24-4d9b-b887-bd657637916d", + "task": "add", + "question": "Modify the molecule NC(=O)c1cccn2c(=O)c3ccccc3nc12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)c1cccn2c(=O)c3ccccc3nc12", + "ref_smiles": "NC(=O)c1cccn2c(=O)c3ccc(O)cc3nc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f4ea222a-14aa-478e-803b-1b8732a3de9e", + "task": "add", + "question": "Modify the molecule CC(NC(=O)N1CCc2ccc(F)cc2C1)c1ccccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)N1CCc2ccc(F)cc2C1)c1ccccn1", + "ref_smiles": "CC(NC(=O)N1CCc2ccc(F)cc2C1)c1cccc(O)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "67f7c229-008e-4415-8073-b37675448d3d", + "task": "add", + "question": "Please add a aldehyde to the molecule C1=CC23CCCCC(CC2)([NH2+]3)c2ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "C1=CC23CCCCC(CC2)([NH2+]3)c2ccccc21.", + "ref_smiles": "O=CCc1cccc2c1C13CCCCC(C=C2)(CC1)[NH2+]3", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "dd66a283-8120-43ee-bd7c-fb6aa631b356", + "task": "add", + "question": "Modify the molecule CCCCCCCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1", + "ref_smiles": "CCCCC(O)CCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2bdd7c67-7c79-4d95-9359-cb74bf26bb2b", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)cc1.", + "ref_smiles": "COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b0ab53cf-09f1-4156-8a2a-f1f99b682356", + "task": "add", + "question": "Modify the molecule CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1", + "ref_smiles": "CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7f45a3c3-2de5-43ca-8815-48be87b145f1", + "task": "add", + "question": "Please add a aldehyde to the molecule CC(C)Oc1cccc(C([O-])=C2C(=O)C(=O)N(c3ccc(N(C)C)cc3)C2c2cccc(Oc3ccccc3)c2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1cccc(C([O-])=C2C(=O)C(=O)N(c3ccc(N(C)C)cc3)C2c2cccc(Oc3ccccc3)c2)c1.", + "ref_smiles": "CC(C)Oc1cccc(C([O-])=C2C(=O)C(=O)N(c3ccc(N(C)C)cc3)C2c2cccc(Oc3ccc(C=O)cc3)c2)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "67959a53-02c3-4598-9ba6-3f2647359a83", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)cc2)ccc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)cc2)ccc1F.", + "ref_smiles": "Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)c(O)cc2)ccc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "028144ac-f019-45a1-bb86-7cbb681d66d9", + "task": "add", + "question": "Modify the molecule CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4)cc3)c2[N+](=O)[O-])C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4)cc3)c2[N+](=O)[O-])C1", + "ref_smiles": "CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4C(=O)O)cc3)c2[N+](=O)[O-])C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "35495a0b-bb7e-43cd-9685-4a22736a247a", + "task": "add", + "question": "Modify the molecule CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1", + "ref_smiles": "CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d088bae9-bd14-45f1-b4b4-7a54a3ed491c", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(CC=C[NH+](C)C)=C(C)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CC=C[NH+](C)C)=C(C)c1ccccc1.", + "ref_smiles": "CC(CC=C[NH+](C)C)=C(CO)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a98b08e7-1841-4c67-9a02-310dd19d1a9d", + "task": "add", + "question": "Modify the molecule CCc1cnc(CCNC(NCCNS(C)(=O)=O)=[NH+]C)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1cnc(CCNC(NCCNS(C)(=O)=O)=[NH+]C)s1", + "ref_smiles": "CCc1cnc(CCNC(NCC(NS(C)(=O)=O)c2ccccc2)=[NH+]C)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "93651be8-0382-43cb-b092-1171ef9f8672", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+]1CCC(Oc2ccc(C(N)=S)cc2Br)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCC(Oc2ccc(C(N)=S)cc2Br)CC1.", + "ref_smiles": "C[NH+]1CCC(Oc2ccc(C(N)=S)c(-c3ccccc3)c2Br)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d495f16c-a05e-480e-9d6f-20d4c42890be", + "task": "add", + "question": "Modify the molecule N#CC1(NC(=O)Cc2ccccc2)CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC1(NC(=O)Cc2ccccc2)CCCC1", + "ref_smiles": "N#CC1(NC(=O)Cc2cccc(O)c2)CCCC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c779c6bf-0115-42b9-ae3d-19cee7fd2788", + "task": "add", + "question": "Please add a amine to the molecule c1ccc(Cn2nnnc2SCCCc2nc(-c3cccs3)no2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(Cn2nnnc2SCCCc2nc(-c3cccs3)no2)cc1.", + "ref_smiles": "NC(CCc1nc(-c2cccs2)no1)Sc1nnnn1Cc1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "0a208e0a-f342-42ae-9fda-e02c197d54b8", + "task": "add", + "question": "Modify the molecule O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1", + "ref_smiles": "O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "86013dc0-53f8-4a3d-9718-9c4123bf5fcf", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1noc(C=Cc2cn(CCOc3ccccc3)c3ccccc23)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1noc(C=Cc2cn(CCOc3ccccc3)c3ccccc23)c1[N+](=O)[O-].", + "ref_smiles": "Cc1noc(C=Cc2cn(CCOc3ccc(-c4ccccc4)cc3)c3ccccc23)c1[N+](=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e7d5f344-28f7-4cb2-b97f-371087ad4e77", + "task": "add", + "question": "Please add a benzene ring to the molecule COCCCNc1ncnc(Oc2cc(C)cc(C)c2)c1N.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCNc1ncnc(Oc2cc(C)cc(C)c2)c1N.", + "ref_smiles": "COC(CCNc1ncnc(Oc2cc(C)cc(C)c2)c1N)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "88aefe84-2b66-47eb-b722-b447e5c5a393", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ccccc1C(=O)Nc1cnn(Cc2ccccc2F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccccc1C(=O)Nc1cnn(Cc2ccccc2F)c1.", + "ref_smiles": "CCOc1ccccc1C(=O)Nc1cnn(Cc2cccc(O)c2F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0e9c96b7-a474-4fe4-ad51-244ddc772306", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cccc(CC2CC(C(C)(C)C)CCC2C[NH3+])c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(CC2CC(C(C)(C)C)CCC2C[NH3+])c1.", + "ref_smiles": "Cc1cc(O)cc(CC2CC(C(C)(C)C)CCC2C[NH3+])c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "840a9035-6a04-41c5-9da3-f4dc03ec8132", + "task": "add", + "question": "Modify the molecule CCCCCCCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1", + "ref_smiles": "CCCCC(CC=O)CCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "3395a47f-f6bb-43e0-b9f9-5cd3c2a7e319", + "task": "add", + "question": "Please add a aldehyde to the molecule CN(C)c1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)c1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.", + "ref_smiles": "CN(C)c1ccc(C(=O)NCC(=O)Nc2cc(CC=O)c(F)c(F)c2F)cc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "d389507f-c05c-4251-a42d-174bebbf8c86", + "task": "add", + "question": "Modify the molecule O=C(Nc1ccc(F)cc1OCC1CC1)N1CCn2c(n[nH]c2=O)C1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc(F)cc1OCC1CC1)N1CCn2c(n[nH]c2=O)C1", + "ref_smiles": "N#CC1CN(C(=O)Nc2ccc(F)cc2OCC2CC2)Cc2n[nH]c(=O)n21", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "29911b32-e00c-4d63-aff9-3da88a1624ab", + "task": "add", + "question": "Modify the molecule CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl", + "ref_smiles": "CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(O)(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e59566c1-f77a-4e9e-830a-bbab46159915", + "task": "add", + "question": "Please add a aldehyde to the molecule COCCCN(C1Cc2cc(C#N)ccc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCN(C1Cc2cc(C#N)ccc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1.", + "ref_smiles": "COCCCN(C1Cc2cc(C#N)c(CC=O)cc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a0ca642a-4c8b-46d5-879b-3814bb1b9f51", + "task": "add", + "question": "Modify the molecule CC(=NNC(=O)COc1cccc(C)c1)c1ccc(O)cc1O by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=NNC(=O)COc1cccc(C)c1)c1ccc(O)cc1O", + "ref_smiles": "CC(=NNC(=O)COc1cccc(C)c1)c1cc(CC=O)c(O)cc1O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "e46409af-87d3-4a6b-9859-4630f5ab08ac", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1cccc(F)c1COCC1CCC[NH2+]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(F)c1COCC1CCC[NH2+]1.", + "ref_smiles": "COc1cccc(F)c1COCC1(c2ccccc2)CCC[NH2+]1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "595ddbd4-63c8-4b6a-bb97-f2ea27468f47", + "task": "add", + "question": "Modify the molecule CN(CCc1ccccn1)c1nc(NN)ncc1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CCc1ccccn1)c1nc(NN)ncc1Cl", + "ref_smiles": "CN(CCc1cccc(C(=O)O)n1)c1nc(NN)ncc1Cl", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "59e12609-c68f-4ba3-ad91-a41895e49d2c", + "task": "add", + "question": "Modify the molecule CCN(CCNC(NCc1cccc(C(=O)NC)c1)=[NH+]C)c1cccc(C)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CCNC(NCc1cccc(C(=O)NC)c1)=[NH+]C)c1cccc(C)c1", + "ref_smiles": "CNC(=O)c1cccc(CNC(NCCN(CCN)c2cccc(C)c2)=[NH+]C)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8fee30c4-88c1-42af-ba17-aa435dd44d7a", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1.", + "ref_smiles": "O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6ac8108b-353f-4ade-8a5b-415a8f1c3af5", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH2+]C(C)CCC1=CCC=CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(C)CCC1=CCC=CCC1.", + "ref_smiles": "C[NH2+]C(C)CCC1=CCC=C(c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "103497be-1e99-4daf-888e-f41016bc8852", + "task": "add", + "question": "Modify the molecule CCc1cccc2c1N(C)CCCN2CC(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1cccc2c1N(C)CCCN2CC(=O)[O-]", + "ref_smiles": "CCc1cccc2c1N(C)CC(c1ccccc1)CN2CC(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2abd3a4c-9260-4e72-86fb-19f57d515feb", + "task": "add", + "question": "Modify the molecule CC1C[NH2+]CCN1C(=O)c1cc(Br)c2c(c1)OCCO2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1C[NH2+]CCN1C(=O)c1cc(Br)c2c(c1)OCCO2", + "ref_smiles": "CC1C[NH2+]CC(c2ccccc2)N1C(=O)c1cc(Br)c2c(c1)OCCO2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6030570e-7b7c-4891-9ba7-3410047e279a", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1ccc(N(C)C(=O)c2ccn3ncc(-c4ccc(CF)cc4)c3c2)nc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(N(C)C(=O)c2ccn3ncc(-c4ccc(CF)cc4)c3c2)nc1.", + "ref_smiles": "Cc1ccc(N(C)C(=O)c2cc3c(-c4ccc(CF)cc4)cnn3cc2C(=O)O)nc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "7d9d2551-d431-43cf-b7fc-88d05d3638cb", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)(C)[Si](C)(C)OCC1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)[Si](C)(C)OCC1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1.", + "ref_smiles": "CC(C)(C)[Si](C)(C)OC(C(=O)O)C1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c0f74d3d-d9ec-4a22-b005-82de64a0fa6e", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4ccccc4)=C3)c3cccs3)s2)C=C(C)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4ccccc4)=C3)c3cccs3)s2)C=C(C)C1=O.", + "ref_smiles": "CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4cccc(-c5ccccc5)c4)=C3)c3cccs3)s2)C=C(C)C1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "09692ffb-98b7-4df2-b31b-20b936921a26", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cc(C[NH2+]C(C)C)cc(N(CC(C)C)C2CC2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C[NH2+]C(C)C)cc(N(CC(C)C)C2CC2)n1.", + "ref_smiles": "Cc1cc(C[NH2+]C(C)(C)O)cc(N(CC(C)C)C2CC2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "50b3f770-73ba-4638-9a79-c76f4a74f2ba", + "task": "add", + "question": "Please add a aldehyde to the molecule Cn1cncc1C[NH2+]C1CCC2CC21.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cncc1C[NH2+]C1CCC2CC21.", + "ref_smiles": "Cn1cncc1C[NH2+]C1CC(CC=O)C2CC12", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "106bf72e-991f-4867-a538-73494ddbcd7d", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)C)cc3)n2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)C)cc3)n2)cc1.", + "ref_smiles": "COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)CO)cc3)n2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b0cd675e-81af-49a1-bc55-46b2ba3fd05a", + "task": "add", + "question": "Modify the molecule CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1", + "ref_smiles": "CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7309fea3-ebb8-4c44-abf7-95dc16c0b645", + "task": "add", + "question": "Please add a carboxyl to the molecule CCN(CCC(=O)OC)c1nccc(C)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CCC(=O)OC)c1nccc(C)c1[N+](=O)[O-].", + "ref_smiles": "CCN(CCC(=O)OCC(=O)O)c1nccc(C)c1[N+](=O)[O-]", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "58a7a367-09d0-4e0b-b62f-013d5ab7196a", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1.", + "ref_smiles": "CC1C(O)C2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d0c2abd0-2969-4140-8bf2-7a2bd72a6e09", + "task": "add", + "question": "Modify the molecule CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(C)=O)CC4)cc3)n2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(C)=O)CC4)cc3)n2)cc1", + "ref_smiles": "CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(=O)CC(=O)O)CC4)cc3)n2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "8c209c57-a5af-4a76-ac7d-74dd4275c630", + "task": "add", + "question": "Modify the molecule CC1C(c2ccccc2)c2ccccc2C1(C)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1C(c2ccccc2)c2ccccc2C1(C)c1ccccc1", + "ref_smiles": "CC1C(C)(c2ccccc2)c2ccccc2C1(c1ccccc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c0589078-7c54-4dc3-80ba-15a073377aba", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1(CCNS(=O)(=O)CCc2ccccc2)OCCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(CCNS(=O)(=O)CCc2ccccc2)OCCO1.", + "ref_smiles": "CC1(CCNS(=O)(=O)CCc2ccccc2O)OCCO1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cc77532c-9ccc-4e03-b53c-555ff7137c67", + "task": "add", + "question": "Please add a hydroxyl to the molecule C=Cc1cccc(OCCC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=Cc1cccc(OCCC)c1.", + "ref_smiles": "C=C(O)c1cccc(OCCC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "10db4873-f27e-4905-80f3-65304a7f039c", + "task": "add", + "question": "Modify the molecule CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1C", + "ref_smiles": "CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c135df84-11ea-443f-8b09-432412e6a42e", + "task": "add", + "question": "Modify the molecule O=C(NC1CCOC1C1CC1)N1C2CCC1COC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCOC1C1CC1)N1C2CCC1COC2", + "ref_smiles": "O=C(NC1CCOC1C1(c2ccccc2)CC1)N1C2CCC1COC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "be8d35c9-b582-4b48-a749-dc1720695d5d", + "task": "add", + "question": "Modify the molecule Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OCc5ccccc5)CC4)CC3)ncc2F)n1C(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OCc5ccccc5)CC4)CC3)ncc2F)n1C(C)C", + "ref_smiles": "Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OC(O)c5ccccc5)CC4)CC3)ncc2F)n1C(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fd187cff-821a-4ede-8c3d-6e69fe1d04e6", + "task": "add", + "question": "Modify the molecule CCCCN(CCCC)C(=S)Nc1ccccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCN(CCCC)C(=S)Nc1ccccn1", + "ref_smiles": "CCCCN(C(=S)Nc1ccccn1)C(O)CCC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7f1ad3c1-d64b-43d7-860b-308eeb765e62", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C[NH2+]CC(=O)NCC#N)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C[NH2+]CC(=O)NCC#N)cn1.", + "ref_smiles": "Cc1cc(O)c(C[NH2+]CC(=O)NCC#N)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "43850857-7b74-4f2b-85f2-14a99d6bbf02", + "task": "add", + "question": "Modify the molecule Cc1ccccc1C(C(=O)[O-])[NH+](C)Cc1cc(-c2ccncc2)no1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccccc1C(C(=O)[O-])[NH+](C)Cc1cc(-c2ccncc2)no1", + "ref_smiles": "Cc1ccccc1C(C(=O)[O-])[NH+](CO)Cc1cc(-c2ccncc2)no1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ab975622-b0ca-498c-962a-99d45519aab1", + "task": "add", + "question": "Modify the molecule CN(C)[Si](C)(C)CC[SiH2]c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)[Si](C)(C)CC[SiH2]c1ccccc1", + "ref_smiles": "CN(C)[Si](C)(CO)CC[SiH2]c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e5d5ae2f-b628-4174-bf38-c2eb5fbed2c6", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(OC(=O)CCNC(=O)c2cccs2)c(C(C)C)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(OC(=O)CCNC(=O)c2cccs2)c(C(C)C)cc1Cl.", + "ref_smiles": "CC(C)c1cc(Cl)c(Cc2ccccc2)cc1OC(=O)CCNC(=O)c1cccs1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "86c9a4f5-52a4-4885-b3ca-b6bc9e9f2e71", + "task": "add", + "question": "Modify the molecule [NH3+]Cc1ccccc1OCCCS(=O)c1ccccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]Cc1ccccc1OCCCS(=O)c1ccccc1F", + "ref_smiles": "[NH3+]Cc1c(OCCCS(=O)c2ccccc2F)cccc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "024baa5e-3769-4c9f-a354-db09688c8eb0", + "task": "add", + "question": "Modify the molecule O=c1c(=Cc2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1c(=Cc2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12", + "ref_smiles": "O=c1c(=C(O)c2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c3864c2d-417d-45b3-8e47-74ce345e477f", + "task": "add", + "question": "Modify the molecule CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCC", + "ref_smiles": "CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4ea2df38-b3a7-4ad9-963d-13b3c9cdf780", + "task": "add", + "question": "Modify the molecule CSC1CCCC1Nc1c(C)cccc1[N+](=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSC1CCCC1Nc1c(C)cccc1[N+](=O)[O-]", + "ref_smiles": "CSC1CC(c2ccccc2)CC1Nc1c(C)cccc1[N+](=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "76c9ecde-1c40-43ba-a9bc-a56a99157d0e", + "task": "add", + "question": "Modify the molecule C=CC1CCCC=CCC(C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC1CCCC=CCC(C)C1", + "ref_smiles": "C=CC1CCCC=C(C(=O)O)CC(C)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "dc08ef2f-a5be-43f8-b39c-96d5aea2146c", + "task": "add", + "question": "Modify the molecule CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2)CCS(=O)(=O)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2)CCS(=O)(=O)C1", + "ref_smiles": "CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2-c2ccccc2)CCS(=O)(=O)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e514de3c-6c3f-484b-a8bb-41f87e7ac4bc", + "task": "add", + "question": "Please add a hydroxyl to the molecule CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1.", + "ref_smiles": "CS(=O)(=O)Cc1nc2c(O)cccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a34b17c7-8e5d-4701-a1d2-ef993df85ea1", + "task": "add", + "question": "Modify the molecule CSc1ncc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1ncc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1", + "ref_smiles": "CSc1ncc(-c2cc(O)c3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fbb6afbd-f0ed-41e4-bbde-77985c711db3", + "task": "add", + "question": "Modify the molecule CCOC(=O)C1(C)CCCCC1(C)C by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C1(C)CCCCC1(C)C", + "ref_smiles": "CC(CC=O)OC(=O)C1(C)CCCCC1(C)C", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "05046298-b060-4a56-a0ae-408c8e79433f", + "task": "add", + "question": "Modify the molecule CC1CCCC2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13", + "ref_smiles": "CC1CCC(c2ccccc2)C2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ccb85d45-f283-42c6-9e51-2de7624b6640", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C(=C[NH+](C)C)C(=O)c2ccc(OC)cc2OB(F)F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=C[NH+](C)C)C(=O)c2ccc(OC)cc2OB(F)F)cc1.", + "ref_smiles": "COc1ccc(C(=C[NH+](C)C)C(=O)c2ccc(OC)c(-c3ccccc3)c2OB(F)F)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d6545733-1851-47e7-89d1-b187a5776383", + "task": "add", + "question": "Modify the molecule O=Cc1c2c(nn1-c1ccccc1)CCOC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=Cc1c2c(nn1-c1ccccc1)CCOC2", + "ref_smiles": "O=Cc1c2c(nn1-c1ccccc1)CC(c1ccccc1)OC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "405bed3a-071b-4b22-9c31-8b20b2d28915", + "task": "add", + "question": "Modify the molecule CC(C)(C)OC(=O)C1CCC2CCC(CO)C([NH3+])C(=O)N21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)OC(=O)C1CCC2CCC(CO)C([NH3+])C(=O)N21", + "ref_smiles": "CC(C)(C)OC(=O)C1CCC2CCC(O)(CO)C([NH3+])C(=O)N21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f4ca69ca-d0db-4557-88d3-2cdab0c64d75", + "task": "add", + "question": "Modify the molecule CCCC1(C(=O)[O-])CCN(C(=O)C(C)(C)CC)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1(C(=O)[O-])CCN(C(=O)C(C)(C)CC)CC1", + "ref_smiles": "CCCC1(C(=O)[O-])CCN(C(=O)C(C)(CC)CO)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "977c1a9c-c48f-4624-be5e-b6540a708b50", + "task": "add", + "question": "Modify the molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(F)cc3)oc12 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc2c(=O)cc(C(=O)Nc3ccc(F)cc3)oc12", + "ref_smiles": "Cc1cccc2c(=O)c(C(=O)O)c(C(=O)Nc3ccc(F)cc3)oc12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "9bd8c4a4-2240-4a61-875e-e32052a0c785", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(C)c(NC(=O)C2Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(NC(=O)C2Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1.", + "ref_smiles": "Cc1cc(C)c(NC(=O)C2(c3ccccc3)Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e8fbff3c-9262-458e-9577-dd949e3afd33", + "task": "add", + "question": "Modify the molecule CC(C)[NH2+]CC1CCCN1CC1CCCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)[NH2+]CC1CCCN1CC1CCCCC1", + "ref_smiles": "CC(C)[NH2+]CC1CCCN1CC1CCCC(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "50f9ec8b-38cd-4eb9-94b7-e07f6c13406c", + "task": "add", + "question": "Modify the molecule CC(NS(=O)(=O)Cc1noc2ccccc12)c1cnn(C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NS(=O)(=O)Cc1noc2ccccc12)c1cnn(C)c1", + "ref_smiles": "CC(NS(=O)(=O)C(O)c1noc2ccccc12)c1cnn(C)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "242a49b5-d8dd-4cb6-accb-cc46a6f6a301", + "task": "add", + "question": "Please add a aldehyde to the molecule CCn1nc(C)c(Cl)c1CC(O)C[NH+](C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1nc(C)c(Cl)c1CC(O)C[NH+](C)C.", + "ref_smiles": "CCn1nc(C)c(Cl)c1C(CC=O)C(O)C[NH+](C)C", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "7da26799-6d55-492c-b384-eb4b15eae52b", + "task": "add", + "question": "Modify the molecule O=C(Nc1nc(-c2cc(O)ccc2O)cs1)c1c(F)cccc1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1nc(-c2cc(O)ccc2O)cs1)c1c(F)cccc1F", + "ref_smiles": "O=C(Nc1nc(-c2cc(O)cc(O)c2O)cs1)c1c(F)cccc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2adb5d08-321d-4b7e-a98a-b38e1937e1a1", + "task": "add", + "question": "Modify the molecule COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCC[NH+]2CCN(C)CC2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCC[NH+]2CCN(C)CC2)n1", + "ref_smiles": "COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2O)nc(OCC[NH+]2CCN(C)CC2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a4c12fcc-0678-49d5-80b5-1fa11907eb41", + "task": "add", + "question": "Modify the molecule CCc1nncn1CCNC(NCCCn1c(C)nc2ccccc21)=[NH+]Cc1ccco1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nncn1CCNC(NCCCn1c(C)nc2ccccc21)=[NH+]Cc1ccco1", + "ref_smiles": "Cc1nc2ccccc2n1CCCNC(NCCn1cnnc1CCc1ccccc1)=[NH+]Cc1ccco1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6a1965f3-28e3-43e1-8869-525125201b2c", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc2c(c1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc2c(c1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O.", + "ref_smiles": "COc1ccc2c(c1-c1ccccc1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a9ce1821-c7f3-4252-944b-86544f0051d2", + "task": "add", + "question": "Modify the molecule Cc1nn(C)c(N2CC(C)C(C)C2)c1CC[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c(N2CC(C)C(C)C2)c1CC[NH3+]", + "ref_smiles": "Cc1nn(CO)c(N2CC(C)C(C)C2)c1CC[NH3+]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ca4b60ff-ec6b-45c0-8805-6ecd986e4df8", + "task": "add", + "question": "Please add a amine to the molecule CCCCCCCC(=O)N(CC[NH+]1CCN(C(=O)CCCC)CC1)Cc1ccc(F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCC(=O)N(CC[NH+]1CCN(C(=O)CCCC)CC1)Cc1ccc(F)cc1.", + "ref_smiles": "CCCCCCCC(=O)N(Cc1ccc(F)cc1)C(N)C[NH+]1CCN(C(=O)CCCC)CC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "21bbcb8a-c301-489e-83f2-0f33f22f58c8", + "task": "add", + "question": "Modify the molecule CCc1n[nH]c(=S)n1C1CCOC1C1CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1n[nH]c(=S)n1C1CCOC1C1CC1", + "ref_smiles": "CCc1n[nH]c(=S)n1C1CC(c2ccccc2)OC1C1CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "02985827-a0de-4416-a3ef-88b3c6d24e85", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(=O)C(Br)C[NH+](C)CCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(Br)C[NH+](C)CCc1ccccc1.", + "ref_smiles": "COC(=O)C(Br)C[NH+](C)CCc1ccc(O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fa7945df-7193-4c9e-8129-cdce9bd5f247", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1.", + "ref_smiles": "COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "054f148b-480a-410c-aee6-7cfac013d7ab", + "task": "add", + "question": "Modify the molecule O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1nccs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1nccs1", + "ref_smiles": "O=C(COc1cc2oc(=O)cc(-c3ccc(-c4ccccc4)cc3)c2cc1Cl)Nc1nccs1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d17799bb-69c3-430c-86ac-c3643543e4e4", + "task": "add", + "question": "Modify the molecule CCCc1cc(CCl)cc(N(CC)Cc2ccccn2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1cc(CCl)cc(N(CC)Cc2ccccn2)n1", + "ref_smiles": "CCCc1cc(CCl)cc(N(CC)Cc2ncccc2O)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9fa792e4-c19c-42b0-bc43-7301e1eddd60", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cncc(CNC(=O)CCN2CCCS2(=O)=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cncc(CNC(=O)CCN2CCCS2(=O)=O)c1.", + "ref_smiles": "Cc1cncc(C(O)NC(=O)CCN2CCCS2(=O)=O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cf9cb97c-6d1c-4753-9889-4eb13d300e64", + "task": "add", + "question": "Please add a amine to the molecule [NH3+]C1CN(C(=O)NC2CCC[NH2+]C2)CC1c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1CN(C(=O)NC2CCC[NH2+]C2)CC1c1ccccc1.", + "ref_smiles": "NC1CCC(NC(=O)N2CC([NH3+])C(c3ccccc3)C2)C[NH2+]1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "dcc01e2e-1688-4172-8f14-010f306100b7", + "task": "add", + "question": "Please add a amine to the molecule Nc1ccccc1OCCC(=O)N1CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccccc1OCCC(=O)N1CCCC1.", + "ref_smiles": "Nc1cccc(OCCC(=O)N2CCCC2)c1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3315b7b2-e53b-4615-92ba-a0ab66b861d4", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1.", + "ref_smiles": "O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c352e9f6-bb2f-49b9-a8ff-bde47fccc2ba", + "task": "add", + "question": "Modify the molecule N#CC1CCCCC1N(CCO)Cc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC1CCCCC1N(CCO)Cc1ccccc1", + "ref_smiles": "N#CC1C(c2ccccc2)CCCC1N(CCO)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4aa6e823-1b94-4a50-a247-bb434d76c857", + "task": "add", + "question": "Modify the molecule COc1ccc(NC(=O)OC(C)(C)C)c(N)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(NC(=O)OC(C)(C)C)c(N)c1", + "ref_smiles": "COc1c(O)ccc(NC(=O)OC(C)(C)C)c(N)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "393467b8-70ca-41cb-8a0f-cc89b122ca08", + "task": "add", + "question": "Modify the molecule C=CC=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1", + "ref_smiles": "C=CC(=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1)CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "096118dc-cd31-42ea-9d9c-c6f5d94bca94", + "task": "add", + "question": "Please add a benzene ring to the molecule O=S(=O)(Nc1cccc(F)c1F)c1ccc(Br)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(Nc1cccc(F)c1F)c1ccc(Br)c(Cl)c1.", + "ref_smiles": "O=S(=O)(Nc1cccc(F)c1F)c1cc(Cl)c(Br)c(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7490310d-36c7-45e6-b322-9545d4792ae9", + "task": "add", + "question": "Please add a hydroxyl to the molecule C=C(C)C[NH+]1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C[NH+]1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1.", + "ref_smiles": "C=C(C)C[NH+]1CCN(C(=O)C(CO)N2C(=O)c3ccccc3C2=O)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f358c7dd-afab-4af2-be47-f513670eb931", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NC1CCCc2ccccc21)c1ccc2nc[nH]c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCCc2ccccc21)c1ccc2nc[nH]c2c1.", + "ref_smiles": "O=C(NC1CCCc2ccccc21)c1cc2[nH]cnc2cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "66ff9806-1ecf-4236-8a36-274915e5df5d", + "task": "add", + "question": "Modify the molecule CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1", + "ref_smiles": "CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "5fbfb638-8dff-4a8b-b5e0-1b044593bf1a", + "task": "add", + "question": "Please add a aldehyde to the molecule CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(OC)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(OC)c(C)c1.", + "ref_smiles": "CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1cc(C)c(OC)c(CC=O)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "49e1e4a6-cb93-45ad-9f11-d14eae788db0", + "task": "add", + "question": "Please add a benzene ring to the molecule CS(=O)C(=Cc1ccccc1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)C(=Cc1ccccc1)S(C)(=O)=O.", + "ref_smiles": "CS(=O)C(=Cc1ccccc1-c1ccccc1)S(C)(=O)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a548bcc4-dd9f-49a2-bffd-46213e24731a", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1.", + "ref_smiles": "O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e5c0fa20-d9da-4ee9-951c-be9f4d4ba4f2", + "task": "add", + "question": "Modify the molecule Cc1cc(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)n(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)n(C)n1", + "ref_smiles": "Cc1nn(C)c(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ddbd8b74-d3e4-462b-ac3e-bf55d414fa4d", + "task": "add", + "question": "Modify the molecule CCCCCC(C)[NH2+]Cc1cc(CC)no1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC(C)[NH2+]Cc1cc(CC)no1", + "ref_smiles": "CCCCCC(C)[NH2+]Cc1cc(CCO)no1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f74691dd-b1de-46b9-b7fd-9a100e3d2842", + "task": "add", + "question": "Modify the molecule CCN(CC)C1(C#N)CC[NH+](C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)C1(C#N)CC[NH+](C)CC1", + "ref_smiles": "CCN(CCO)C1(C#N)CC[NH+](C)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b9560f55-ea45-4cb3-b17c-d4bc37512289", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5ccccc5n6C)c4)c3c2=O)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5ccccc5n6C)c4)c3c2=O)cc1.", + "ref_smiles": "Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5c(O)cccc5n6C)c4)c3c2=O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e221da83-5206-4631-8d49-866de0f7aa87", + "task": "add", + "question": "Please add a amine to the molecule CCC(C)C(C)([NH3+])CC1CC2CCC1C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)C(C)([NH3+])CC1CC2CCC1C2.", + "ref_smiles": "CCC(C)C(C)([NH3+])CC1(N)CC2CCC1C2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "0c653e25-7874-401c-85b5-243f7cbc2e6f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3ccccc3)CN(C=O)OCc3ccccc3)o2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3ccccc3)CN(C=O)OCc3ccccc3)o2)c1.", + "ref_smiles": "CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3cccc(O)c3)CN(C=O)OCc3ccccc3)o2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "336ef415-6e21-4daf-927d-bf5f28bb3637", + "task": "add", + "question": "Please add a hydroxyl to the molecule Clc1ccnc2c1ccc1ncncc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "Clc1ccnc2c1ccc1ncncc12.", + "ref_smiles": "Oc1cc2ncncc2c2nccc(Cl)c12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "39632754-b90f-4215-bb2c-10a9477c8b8a", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C1CCC(=O)[N+]1(O)Cc1cccc(C[N+]2(O)C(=O)CCC2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CCC(=O)[N+]1(O)Cc1cccc(C[N+]2(O)C(=O)CCC2=O)c1.", + "ref_smiles": "O=C1CCC(=O)[N+]1(O)Cc1cc(O)cc(C[N+]2(O)C(=O)CCC2=O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1215a558-07bc-43f0-ab98-ba60f9595684", + "task": "add", + "question": "Modify the molecule CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1", + "ref_smiles": "CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "be5290b1-34f8-44a3-8bd0-6551274f6cfa", + "task": "add", + "question": "Modify the molecule CCNC(C#N)c1ccccc1COC by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(C#N)c1ccccc1COC", + "ref_smiles": "CCNC(C#N)c1ccc(S)cc1COC", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "77cb67f8-43b0-4801-92c8-bd53dbbf439b", + "task": "add", + "question": "Please add a benzene ring to the molecule COCCn1ncc(Cl)c1C(=O)C1CCCCC1C[NH3+].\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCn1ncc(Cl)c1C(=O)C1CCCCC1C[NH3+].", + "ref_smiles": "[NH3+]CC1CCCCC1C(=O)c1c(Cl)cnn1CCOCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f818da98-ce8b-4852-901c-dd276d7f62e7", + "task": "add", + "question": "Modify the molecule CCNC(NC(C)c1ccc(F)cc1F)=[NH+]Cc1csc(CC)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(NC(C)c1ccc(F)cc1F)=[NH+]Cc1csc(CC)n1", + "ref_smiles": "CCNC(NC(C)c1ccc(F)cc1F)=[NH+]Cc1nc(CC)sc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cb2245d1-9424-4790-992c-650a534ac323", + "task": "add", + "question": "Please add a nitrile to the molecule CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)C.", + "ref_smiles": "CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)CC#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "53ee0fb1-7c55-4472-84d2-abfb6e3d10ce", + "task": "add", + "question": "Modify the molecule [NH3+]C(CCO)CSCc1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(CCO)CSCc1ccco1", + "ref_smiles": "[NH3+]C(CSCc1ccco1)CC(O)O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a6682d0d-641e-4747-b8a1-b13855b5cf04", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)Oc1ncccc1CNC(=O)C(C)n1cccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1ncccc1CNC(=O)C(C)n1cccn1.", + "ref_smiles": "CC(C)Oc1nccc(O)c1CNC(=O)C(C)n1cccn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c10c7c75-9516-4641-a4e2-c5b77eb4ca9e", + "task": "add", + "question": "Modify the molecule Cc1cc(=O)nc(NCCOC(C)C)[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(=O)nc(NCCOC(C)C)[nH]1", + "ref_smiles": "CC(C)OCCNc1nc(=O)cc(CO)[nH]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "708a2881-fb2f-45e4-9199-48c7dd35defd", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCC=CC=CCC=CCC=CCC=CCCCCC(=O)OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC=CC=CCC=CCC=CCC=CCCCCC(=O)OC.", + "ref_smiles": "CCCC=CC=CCC=CCC=CCC=CCC(O)CCC(=O)OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "47721e39-ba12-40ca-bc5f-296235f95341", + "task": "add", + "question": "Please add a carboxyl to the molecule CSc1ccccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1ccccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1.", + "ref_smiles": "CSc1cc(C(=O)O)ccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "6dd69910-fc6d-498a-946b-93a41c0fa077", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)(C)NC(=O)OC1C=CCC([NH3+])CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)NC(=O)OC1C=CCC([NH3+])CCC1.", + "ref_smiles": "CC(C)(C)NC(=O)OC1C=CC(O)C([NH3+])CCC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "92c5be41-e2d6-4121-bc5c-1bafcfc294dd", + "task": "add", + "question": "Modify the molecule CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)CC2)nc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)CC2)nc1", + "ref_smiles": "CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)C(N)C2)nc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ee4503ca-6230-4b31-a879-1866cb60fee3", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCCC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCCC2)C1.", + "ref_smiles": "O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCC(O)C2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3c486bd4-599e-40b2-8fb2-c82b7f22c82a", + "task": "add", + "question": "Please add a amine to the molecule C[NH+]=C(NCc1ncc(C)s1)NC1CC1c1ccccc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCc1ncc(C)s1)NC1CC1c1ccccc1F.", + "ref_smiles": "C[NH+]=C(NCc1ncc(C)s1)NC1C(N)C1c1ccccc1F", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f4d2128e-4c88-41cb-b88c-3b4c12169689", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1CC(C)CN(C(=O)N2CCCC(NC(=O)c3ccc(F)c(F)c3)C2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC(C)CN(C(=O)N2CCCC(NC(=O)c3ccc(F)c(F)c3)C2)C1.", + "ref_smiles": "CC1CC(C)CN(C(=O)N2CCCC(O)(NC(=O)c3ccc(F)c(F)c3)C2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "45880238-ca09-4362-a4ab-df1a0464c021", + "task": "add", + "question": "Modify the molecule COC(=O)C(CC(C)C)(C(=O)OC)C1CCCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(CC(C)C)(C(=O)OC)C1CCCCC1", + "ref_smiles": "COC(=O)C(CC(C)C)(C(=O)OC)C1CCCC(CC=O)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "5eaf0b25-62fc-41ad-a26f-eaaaaaac9835", + "task": "add", + "question": "Modify the molecule CCOC(=O)Cc1ccc(C#N)cc1C(=O)C(C)Br by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)Cc1ccc(C#N)cc1C(=O)C(C)Br", + "ref_smiles": "CCOC(=O)Cc1ccc(C#N)c(C(=O)O)c1C(=O)C(C)Br", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "98372371-7059-4351-bb00-a70e7f65b160", + "task": "add", + "question": "Please add a carboxyl to the molecule COC(=O)c1cc(OC(F)F)c(F)cc1C#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1cc(OC(F)F)c(F)cc1C#N.", + "ref_smiles": "COC(=O)c1c(C#N)cc(F)c(OC(F)F)c1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "763eba5a-fc65-4ef3-bf65-8679b45febe0", + "task": "add", + "question": "Please add a benzene ring to the molecule CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CCO1.", + "ref_smiles": "CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CC(c2ccccc2)O1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7d66b025-da53-4bf1-9a5c-fe22496cf548", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1.", + "ref_smiles": "C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2-c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d2210cb7-2126-4d5a-b28b-d950da7eea14", + "task": "add", + "question": "Modify the molecule Cc1nccn1Cc1nnc(C2CCCN(C(=O)c3cc[nH]c3)C2)n1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nccn1Cc1nnc(C2CCCN(C(=O)c3cc[nH]c3)C2)n1C", + "ref_smiles": "Cc1nccn1Cc1nnc(C2(O)CCCN(C(=O)c3cc[nH]c3)C2)n1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "49508904-2750-439e-b958-0cf0ba7a3ac2", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(=O)C1(Br)CCCCC1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)C1(Br)CCCCC1=O.", + "ref_smiles": "CC(=O)C1(Br)CC(O)CCC1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "18235887-46a6-4645-9aba-b09d677251c9", + "task": "add", + "question": "Modify the molecule Cc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1", + "ref_smiles": "O=CCCc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "c604e122-4344-4049-bed9-f66eda5480c7", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(=O)cc(C)n1-c1cc(Br)ccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(=O)cc(C)n1-c1cc(Br)ccn1.", + "ref_smiles": "Cc1cc(=O)cc(Cc2ccccc2)n1-c1cc(Br)ccn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "43dffcf5-80a0-4e2b-b195-c4700dc97d2c", + "task": "add", + "question": "Please add a hydroxyl to the molecule C#CCCC([NH3+])C(OC)C1CCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CCCC([NH3+])C(OC)C1CCCCC1.", + "ref_smiles": "C#CCCC([NH3+])C(O)C1CCCCC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "421d5ec0-388e-4a37-9b9c-4ba1e404645f", + "task": "add", + "question": "Modify the molecule CCC1(C)CCN(S(=O)(=O)c2cc(Br)ccc2C)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(C)CCN(S(=O)(=O)c2cc(Br)ccc2C)CC1", + "ref_smiles": "CCC1(C)CCN(S(=O)(=O)c2c(C)ccc(Br)c2CC=O)CC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "b3ad8a26-270c-4a81-a3e3-8bfb60042b1f", + "task": "add", + "question": "Modify the molecule CC(=O)N1CC[NH+](Cc2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)N1CC[NH+](Cc2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1", + "ref_smiles": "CC(=O)N1CC[NH+](C(O)c2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ab2dc671-e303-4870-b668-1038d2daabd6", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)NCC(CCl)OC(=O)OCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NCC(CCl)OC(=O)OCc1ccccc1.", + "ref_smiles": "O=C(Cc1ccccc1)NCC(CCl)OC(=O)OCc2ccccc2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "35a77508-0bb5-4bce-9360-a04fcabde132", + "task": "add", + "question": "Please add a benzene ring to the molecule OC(CC1CCOc2ccccc21)C(O)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC(CC1CCOc2ccccc21)C(O)C1CC1.", + "ref_smiles": "OC(CC1CCOc2cc(-c3ccccc3)ccc21)C(O)C1CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f1f8823b-71e3-4606-b6a8-604b905c9b56", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C)n1NC1CCCC1O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C)n1NC1CCCC1O.", + "ref_smiles": "Cc1cc(-c2ccccc2)c(C)n1NC1CCCC1O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8dd25b2d-5ee6-42df-968a-439dc58ea044", + "task": "add", + "question": "Modify the molecule CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])CC1", + "ref_smiles": "CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])C(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2dd25410-94cb-4205-bab6-ded20a6ade3f", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCC(O)C[NH2+]CCCCC([NH3+])C(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCC(O)C[NH2+]CCCCC([NH3+])C(=O)[O-].", + "ref_smiles": "[NH3+]C(CCCC[NH2+]CC(O)CCCCCCCCCCc1ccccc1)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7fe0c6c2-6eb7-4990-9324-41f667b19c41", + "task": "add", + "question": "Modify the molecule CCCc1cc(C(C)=O)ccc1OCc1ccc(C(=O)[O-])cc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1cc(C(C)=O)ccc1OCc1ccc(C(=O)[O-])cc1OC", + "ref_smiles": "COc1cc(C(=O)[O-])ccc1COc1ccc(C(C)=O)cc1CCCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "355cb3af-19d1-41e3-8570-7a1de1bba2ed", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(CCC(=O)N1CC[NH2+]CC1)NCc1ccco1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCC(=O)N1CC[NH2+]CC1)NCc1ccco1.", + "ref_smiles": "O=C(NCc1ccco1)C(CC(=O)N1CC[NH2+]CC1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "429fd4eb-517e-461f-bc4c-3b0efaffae1e", + "task": "add", + "question": "Please add a carboxyl to the molecule CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)C)cc3)C2c2c[nH]c3ccccc23)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)C)cc3)C2c2c[nH]c3ccccc23)cc1OC.", + "ref_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)(C)C(=O)O)cc3)C2c2c[nH]c3ccccc23)cc1OC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "76f2a37b-7705-450a-8cdb-2baf8808d51c", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1)NCCCCC(=O)OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1)NCCCCC(=O)OC.", + "ref_smiles": "CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1c1ccccc1)NCCCCC(=O)OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c4047406-cfce-454d-95ce-3fa7ce1825b9", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(C)(CC)c1[nH+]c(O)cn1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(C)(CC)c1[nH+]c(O)cn1C.", + "ref_smiles": "CCOC(C)(c1[nH+]c(O)cn1C)C(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1dcdc23b-c574-4493-a40c-480a504094db", + "task": "add", + "question": "Modify the molecule N#CCNC(=O)c1ccc(N)cn1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CCNC(=O)c1ccc(N)cn1", + "ref_smiles": "N#CC(CC=O)NC(=O)c1ccc(N)cn1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "67c9f6a2-cd75-40e8-b70f-ff474f1314c2", + "task": "add", + "question": "Modify the molecule N#CC(NCc1cnccc1-c1c(F)cccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC(NCc1cnccc1-c1c(F)cccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1", + "ref_smiles": "N#CC(NCc1c(-c2c(F)cccc2F)ccnc1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0c6d1bc4-9c55-4776-b4fc-ae068f8eb3b8", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(NCCCNC(=O)c1cccc(O)c1)=[NH+]Cc1ccc(C)cc1OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(NCCCNC(=O)c1cccc(O)c1)=[NH+]Cc1ccc(C)cc1OCC.", + "ref_smiles": "CCOc1cc(C)ccc1C[NH+]=C(NCCCNC(=O)c1cccc(O)c1)NCCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dab7d864-9437-4578-bb34-0a3e1dece6ec", + "task": "add", + "question": "Please add a carboxyl to the molecule Cn1c(=O)nc2n(CCc3ccccc3)c3ccccc3nc-2c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1c(=O)nc2n(CCc3ccccc3)c3ccccc3nc-2c1=O.", + "ref_smiles": "Cn1c(=O)nc2n(CC(C(=O)O)c3ccccc3)c3ccccc3nc-2c1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "d721f0ac-da81-425f-8eb7-4468dbdee50e", + "task": "add", + "question": "Please add a hydroxyl to the molecule CN(CC1CC(O)C1)c1ccc(C(N)=S)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CC1CC(O)C1)c1ccc(C(N)=S)c(Cl)c1.", + "ref_smiles": "CN(CC1(O)CC(O)C1)c1ccc(C(N)=S)c(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3e3e2d1d-5737-4256-ad1a-1f8fde8f5e9b", + "task": "add", + "question": "Please add a amine to the molecule C[Si](C)(C)c1ccc(CC(=O)OCCc2cnccn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[Si](C)(C)c1ccc(CC(=O)OCCc2cnccn2)cc1.", + "ref_smiles": "C[Si](C)(C)c1ccc(CC(=O)OCCc2cnc(N)cn2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "345b970c-30fa-4e72-9956-37ac907ae6df", + "task": "add", + "question": "Modify the molecule CC1CCCC1[NH2+]CCCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC1[NH2+]CCCO", + "ref_smiles": "CC1(O)CCCC1[NH2+]CCCO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "02517dff-9823-4f2f-b25e-9d5a13ad7d2f", + "task": "add", + "question": "Modify the molecule Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)CC3)cc2C)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)CC3)cc2C)c1", + "ref_smiles": "Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)C(CC=O)C3)cc2C)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "5e0c9d7a-2762-411e-a7c8-eb9f6a787dbd", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5)cc4)c3)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5)cc4)c3)c2)CC1.", + "ref_smiles": "C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5-cc4-c4ccccc4)cc4)c3)c2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fca4373c-5ade-4815-aa07-6f946899ba8f", + "task": "add", + "question": "Modify the molecule CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)cc4[nH]3)COC12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)cc4[nH]3)COC12", + "ref_smiles": "CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)c(O)c4[nH]3)COC12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7b1aceba-ee81-493c-ba58-f258d4feaed6", + "task": "add", + "question": "Modify the molecule CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2cccc(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2cccc(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1", + "ref_smiles": "CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2ccc(O)c(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c97a0013-24c1-47e5-af71-6a33feb6cafe", + "task": "add", + "question": "Modify the molecule CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2OC)Cc2ccccc2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2OC)Cc2ccccc2)cc1", + "ref_smiles": "CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2c(OC)cccc2C(=O)O)Cc2ccccc2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "585f3610-7c20-4248-b3d8-edabfc3adff5", + "task": "add", + "question": "Please add a carboxyl to the molecule C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1)NCc1ccsc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1)NCc1ccsc1.", + "ref_smiles": "C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1C(=O)O)NCc1ccsc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "7aa85203-f3ef-4ca2-bb85-7c806e968b83", + "task": "add", + "question": "Modify the molecule COCC[NH+](Cc1ccccc1)CC1(C)CC[NH2+]C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC[NH+](Cc1ccccc1)CC1(C)CC[NH2+]C1", + "ref_smiles": "CC1(C[NH+](CCOCc2ccccc2)Cc2ccccc2)CC[NH2+]C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8c6f5fcd-865f-42f0-9e0e-9f4b5cae2374", + "task": "add", + "question": "Modify the molecule CCC1NC(=O)CN(Cc2cscc2C)C1=O by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1NC(=O)CN(Cc2cscc2C)C1=O", + "ref_smiles": "CCC1NC(=O)CN(Cc2csc(C(=O)O)c2C)C1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "e9b5f601-0ff9-4261-88c6-7a104591d341", + "task": "add", + "question": "Modify the molecule COc1ccc(C(O)C2CCC[NH2+]2)cc1NC(C)=O by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(O)C2CCC[NH2+]2)cc1NC(C)=O", + "ref_smiles": "CC(=O)Nc1cc(C(O)C2CCC[NH2+]2)ccc1OCC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "bd578add-3365-487b-a6ed-71105c40dc2c", + "task": "add", + "question": "Please add a benzene ring to the molecule CC[NH2+]C(C)C(C)(C)CN1CCS(=O)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C(C)C(C)(C)CN1CCS(=O)CC1.", + "ref_smiles": "CC([NH2+]CCc1ccccc1)C(C)C(C)(C)CN1CCS(=O)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6f4c54ac-049e-4090-ab9f-6fb054262178", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)N2CCOCC2c2[nH]ncc2S(C)(=O)=O)s1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)N2CCOCC2c2[nH]ncc2S(C)(=O)=O)s1", + "ref_smiles": "Cc1ccc(C(=O)N2CC(C(=O)O)OCC2c2[nH]ncc2S(C)(=O)=O)s1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "9adcc156-8e01-4fd8-852c-794d70f49042", + "task": "add", + "question": "Modify the molecule CCCCCCSC(C)CCCl by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCSC(C)CCCl", + "ref_smiles": "CCCCCCSC(C)(CCCl)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "57e36710-47c6-4f85-9cf5-6f256408e140", + "task": "add", + "question": "Modify the molecule CC[NH2+]CC(COC)OCC1CCOC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]CC(COC)OCC1CCOC1", + "ref_smiles": "CC[NH2+]CC(OCC1CCOC1)C(OC)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7e76dbeb-8d9a-4c1a-a345-a54560b8dc48", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1CCCCN1C(=O)C[NH+]1CCN(C(=O)c2cccn(C)c2=O)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCCN1C(=O)C[NH+]1CCN(C(=O)c2cccn(C)c2=O)CC1.", + "ref_smiles": "Cn1cccc(C(=O)N2CC[NH+](CC(=O)N3CCCCC3(C)O)CC2)c1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1d8df281-02bf-4805-9012-6e985e50d56b", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NCc1ccc(OCc2cccnc2)cc1)c1cc(Cl)nc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1ccc(OCc2cccnc2)cc1)c1cc(Cl)nc(Cl)c1.", + "ref_smiles": "O=C(NCc1ccc(OCc2cncc(-c3ccccc3)c2)cc1)c1cc(Cl)nc(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "01bd4762-a9c0-4e67-86ff-13fe37021513", + "task": "add", + "question": "Please add a thiol to the molecule CS(=O)(=O)Cc1cccc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)Cc1cccc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1.", + "ref_smiles": "CS(=O)(=O)Cc1cc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)ccc1S", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "39be956d-e3fb-4cb6-b9f1-5600d44a9505", + "task": "add", + "question": "Modify the molecule CN(CC(=O)NCC(O)C(N)=O)C(=O)c1ccco1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CC(=O)NCC(O)C(N)=O)C(=O)c1ccco1", + "ref_smiles": "CN(C(=O)c1ccco1)C(S)C(=O)NCC(O)C(N)=O", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "ffa8755d-5a93-46a7-bd98-d6b173fa6a70", + "task": "add", + "question": "Modify the molecule CC(C)(C)C(CCC(N)=O)(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)[O-] by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C(CCC(N)=O)(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)[O-]", + "ref_smiles": "CC(C)(C)C(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)(C(=O)[O-])C(N)CC(N)=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ed70fb7e-b99a-445d-a9a4-231c69e1fa8c", + "task": "add", + "question": "Modify the molecule COC(=O)C1=CCC(P)CC=C1[N+](=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1=CCC(P)CC=C1[N+](=O)[O-]", + "ref_smiles": "COC(=O)C1=C(O)CC(P)CC=C1[N+](=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "942fb998-84fe-4f48-978a-d0f22022f63d", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)C.", + "ref_smiles": "CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3faad370-277e-40f8-a739-f6925da77fe4", + "task": "add", + "question": "Modify the molecule CCC(C)NC(=O)CCNc1nnnn1C by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)NC(=O)CCNc1nnnn1C", + "ref_smiles": "CC(CC=O)C(C)NC(=O)CCNc1nnnn1C", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "4ac7c1f4-83e8-4502-bd84-aa7d6010f40d", + "task": "add", + "question": "Please add a benzene ring to the molecule COCCC(C)NS(=O)(=O)CCO.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCC(C)NS(=O)(=O)CCO.", + "ref_smiles": "COC(CC(C)NS(=O)(=O)CCO)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0550d210-a4f6-4582-b331-e74228557968", + "task": "add", + "question": "Modify the molecule CN(c1ccccc1-c1ccc2c(c1)Nc1cc(C(=O)NCCCN3CCCC3=O)ccc1NC2=O)S(C)(=O)=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(c1ccccc1-c1ccc2c(c1)Nc1cc(C(=O)NCCCN3CCCC3=O)ccc1NC2=O)S(C)(=O)=O", + "ref_smiles": "CN(c1ccccc1-c1ccc2c(c1)Nc1cc(C(=O)NCCC(c3ccccc3)N3CCCC3=O)ccc1NC2=O)S(C)(=O)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "64705bf4-d504-4f8c-aaa8-9079c86aaa3d", + "task": "add", + "question": "Modify the molecule CCNC(=O)Nc1cccc(NC(=O)CCCOc2ccc3c(c2)CCC(=O)N3)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=O)Nc1cccc(NC(=O)CCCOc2ccc3c(c2)CCC(=O)N3)c1", + "ref_smiles": "CCNC(=O)Nc1cccc(NC(=O)CCC(Oc2ccc3c(c2)CCC(=O)N3)c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "beaeeefc-1be9-476b-959b-9f5d80300cc0", + "task": "add", + "question": "Modify the molecule COCCN1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCN1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3", + "ref_smiles": "COCC(C(=O)O)N1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0a13c722-13dd-4ab4-9825-d7e4c652d890", + "task": "add", + "question": "Modify the molecule COC(=O)C1CCCCN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1CCCCN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1", + "ref_smiles": "COC(=O)C1CCC(c2ccccc2)CN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2440bcd8-838d-4c6b-bb56-7a0311bf4b36", + "task": "add", + "question": "Please add a carboxyl to the molecule c1c[nH]c(-c2ccc3sccc3c2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1c[nH]c(-c2ccc3sccc3c2)n1.", + "ref_smiles": "O=C(O)c1cc(-c2ncc[nH]2)cc2ccsc12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "85020466-803f-4737-9c53-467689db0104", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1cncc(-c2cc(NC3CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cncc(-c2cc(NC3CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1.", + "ref_smiles": "COc1cncc(-c2cc(NC3(c4ccccc4)CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0b50fd4a-5594-4706-9ee2-0f77fa9584e3", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NC1CC2CCC1[NH2+]2)c1cc2ccccc2cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CC2CCC1[NH2+]2)c1cc2ccccc2cn1.", + "ref_smiles": "O=C(NC1CC2CCC1[NH2+]2)c1cc2cccc(O)c2cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "89b45a04-929a-4377-b67c-46210c36874c", + "task": "add", + "question": "Modify the molecule CS(=O)(=O)OCC1CCN(c2cc[nH+]cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)OCC1CCN(c2cc[nH+]cc2)CC1", + "ref_smiles": "CS(=O)(=O)OC(O)C1CCN(c2cc[nH+]cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "40a73c6d-4236-42ff-b2ab-c3caeae1fb3b", + "task": "add", + "question": "Modify the molecule O=C(NC1CC(C(=O)[O-])C1)c1cncc(-c2ccc3c(c2)CCO3)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CC(C(=O)[O-])C1)c1cncc(-c2ccc3c(c2)CCO3)c1", + "ref_smiles": "O=CCC1(NC(=O)c2cncc(-c3ccc4c(c3)CCO4)c2)CC(C(=O)[O-])C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "99aae838-c7ef-40d4-a8a5-290439e06776", + "task": "add", + "question": "Modify the molecule CCOC(=O)CCCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21", + "ref_smiles": "CCOC(=O)CC(N)Cn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9bad734a-d186-49e5-ab5b-3e3cb9de3136", + "task": "add", + "question": "Modify the molecule COc1cc([NH+]=C(N)SC)cc(OC)c1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc([NH+]=C(N)SC)cc(OC)c1OC", + "ref_smiles": "COc1cc([NH+]=C(N)SC)c(-c2ccccc2)c(OC)c1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c2acb450-58d6-4c2d-a6c7-d6957fdc1936", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(C)(=O)=O.", + "ref_smiles": "CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(=O)(=O)CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2be38955-1770-4759-9296-45af05404414", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc2[nH]c(C(=O)NC(C)c3nncn3C3CCCC3)cc2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc2[nH]c(C(=O)NC(C)c3nncn3C3CCCC3)cc2c1.", + "ref_smiles": "COc1cc2cc(C(=O)NC(C)c3nncn3C3CCCC3)[nH]c2cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "61b30fcb-8eb9-4d19-b149-52fd636a0c0e", + "task": "add", + "question": "Please add a amine to the molecule N#Cc1ccc(NCC[NH+]2CCSCC2)c(F)c1Br.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1ccc(NCC[NH+]2CCSCC2)c(F)c1Br.", + "ref_smiles": "N#Cc1cc(N)c(NCC[NH+]2CCSCC2)c(F)c1Br", + "add_group": "amine", + "remove_group": null + }, + { + "id": "28e31e6b-4235-422e-8942-a7d937405dd9", + "task": "add", + "question": "Modify the molecule O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl", + "ref_smiles": "O=[N+]([O-])c1cc(C2CCC(c3cc([N+](=O)[O-])c(Cl)cc3-c3ccccc3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e5f7e618-b131-438f-994f-bca58ce21d3c", + "task": "add", + "question": "Modify the molecule C#Cc1ccc(C(C(=O)NCCCCC)N(CC=C)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#Cc1ccc(C(C(=O)NCCCCC)N(CC=C)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1", + "ref_smiles": "C#Cc1ccc(C(C(=O)NCCCCC)N(C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)C(C=C)c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "24845e36-fd28-459f-9737-6a11cf3cab0f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)(O)C(c1cc(F)cc(F)c1)C1C[NH+](CCCCCc2ccc(Cl)cc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(O)C(c1cc(F)cc(F)c1)C1C[NH+](CCCCCc2ccc(Cl)cc2)C1.", + "ref_smiles": "CC(C)(O)C(c1cc(F)cc(F)c1)C1(O)C[NH+](CCCCCc2ccc(Cl)cc2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "65ca5436-5c13-47e2-ba8b-7741e500f0bf", + "task": "add", + "question": "Modify the molecule O=C1NC(c2ccc(Cl)cc2)Nc2scc(-c3ccccc3)c21 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1NC(c2ccc(Cl)cc2)Nc2scc(-c3ccccc3)c21", + "ref_smiles": "O=C(O)c1sc2c(c1-c1ccccc1)C(=O)NC(c1ccc(Cl)cc1)N2", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "6dd6288a-b51c-48e3-a5b3-46e2f867f7b5", + "task": "add", + "question": "Modify the molecule CCC=CCC(C)c1cc(Cl)c(OC)c(Cl)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC=CCC(C)c1cc(Cl)c(OC)c(Cl)c1", + "ref_smiles": "CCC=CCC(C)(S)c1cc(Cl)c(OC)c(Cl)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "bcf0b0b9-ca76-4d8d-84e8-f3614e716f85", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C(=O)[O-])cc1NC(=O)NCCS(C)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)[O-])cc1NC(=O)NCCS(C)=O.", + "ref_smiles": "Cc1ccc(C(=O)[O-])cc1NC(=O)NCC(O)S(C)=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6b216c74-1773-471d-b94a-13be8255635a", + "task": "add", + "question": "Please add a aldehyde to the molecule CCC1CC[NH+](C2CCCCC2C(C)C)CC(C)C[NH2+]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CC[NH+](C2CCCCC2C(C)C)CC(C)C[NH2+]1.", + "ref_smiles": "CCC1[NH2+]CC(C)C[NH+](C2CCCCC2C(C)C)CC1CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "d460b671-a59c-4731-bca7-7bdab97c8f2a", + "task": "add", + "question": "Modify the molecule Cc1noc(C)c1CC(=O)NCC1CC(O)C[NH+]1Cc1ccccc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1noc(C)c1CC(=O)NCC1CC(O)C[NH+]1Cc1ccccc1", + "ref_smiles": "Cc1noc(C)c1CC(=O)NCC1C(N)C(O)C[NH+]1Cc1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f9aa58a5-4af2-47ca-9842-d9079b6499f2", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3CCc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3CCc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1.", + "ref_smiles": "CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3C(O)Cc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f3a5c126-ca17-458e-aff3-6bfec42a5d89", + "task": "add", + "question": "Modify the molecule CCOc1ccc(NCCCSCC)cc1CO by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(NCCCSCC)cc1CO", + "ref_smiles": "CCOc1cc(O)c(NCCCSCC)cc1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0776eed4-56e7-410f-a77a-c9f52c4d0e21", + "task": "add", + "question": "Modify the molecule CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1", + "ref_smiles": "O=C(O)CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ddd9b0f2-95d8-49b1-9915-03c709ce5535", + "task": "add", + "question": "Modify the molecule C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3)n2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3)n2)CC1", + "ref_smiles": "C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3C(=O)O)n2)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3a61589d-eb07-4c38-8f8d-457639859080", + "task": "add", + "question": "Modify the molecule CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)ccc2C1NS(=O)C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)ccc2C1NS(=O)C(C)(C)C", + "ref_smiles": "CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)cc(-c3ccccc3)c2C1NS(=O)C(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a221ec69-71dd-4d67-8b43-c59996a30999", + "task": "add", + "question": "Please add a carboxyl to the molecule CCONC(=O)c1cnc2c(-c3ccccc3)c(C)nn2c1CC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCONC(=O)c1cnc2c(-c3ccccc3)c(C)nn2c1CC.", + "ref_smiles": "CCONC(=O)c1c(C(=O)O)nc2c(-c3ccccc3)c(C)nn2c1CC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "2098bd87-83ce-422c-8b1e-d45907851e14", + "task": "add", + "question": "Modify the molecule CC[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl", + "ref_smiles": "CC(N)[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl", + "add_group": "amine", + "remove_group": null + }, + { + "id": "c27094fb-a4c3-4868-8d48-d1960e7d3165", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.", + "ref_smiles": "CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)c(-c2ccccc2)c(C(F)(F)F)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1bc8288a-a75d-44a9-89df-357f335c8a01", + "task": "add", + "question": "Modify the molecule Cc1ccc(N(c2ccc(-c3c4ccccc4c(N(c4ccc(C)cc4)C4C=Cc5cc(Br)ccc5C4)c4ccccc34)cc2)c2ccc3cc(C)ccc3c2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(N(c2ccc(-c3c4ccccc4c(N(c4ccc(C)cc4)C4C=Cc5cc(Br)ccc5C4)c4ccccc34)cc2)c2ccc3cc(C)ccc3c2)cc1", + "ref_smiles": "Cc1ccc(N(c2ccc(-c3c4ccccc4c(N(c4ccc(C)cc4)C4C=Cc5cc(Br)ccc5C4)c4ccccc34)cc2)c2cc3ccc(C)cc3cc2-c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7a21af6b-6524-4800-bd6e-bd8bb634cf7c", + "task": "add", + "question": "Please add a benzene ring to the molecule CSC(=O)NN=CC(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSC(=O)NN=CC(C)(C)C.", + "ref_smiles": "CSC(=O)NN=CC(C)(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3bb04045-041c-4730-ac9e-283ac71e5d16", + "task": "add", + "question": "Please add a amine to the molecule CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC(C2)CC1C3)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC(C2)CC1C3)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1.", + "ref_smiles": "CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC1CC(C2)C3N)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ea10a7f9-77a0-4077-8106-bce8e24e2b4b", + "task": "add", + "question": "Modify the molecule CCC(O)C(C)[NH+]1CCCCCC1C by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(O)C(C)[NH+]1CCCCCC1C", + "ref_smiles": "CCC(O)C(C)[NH+]1CCCCCC1(C)C#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "76b0ee8a-cc8e-4df6-9b3b-a97b76e838b6", + "task": "add", + "question": "Please add a hydroxyl to the molecule Oc1ccc2c(COc3ccccc3Br)c[nH]c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Oc1ccc2c(COc3ccccc3Br)c[nH]c2c1.", + "ref_smiles": "Oc1cc(O)c2c(COc3ccccc3Br)c[nH]c2c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a2d63e1f-089c-4d0e-ab0e-3e71cf64d454", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OC)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OC)cc1.", + "ref_smiles": "COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OCO)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "18cf0c53-832d-4880-bcd5-60689c122c56", + "task": "add", + "question": "Modify the molecule CCC(=O)N(c1ccc(C(=O)OC)cn1)C1CCCC1c1ccc(N)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(=O)N(c1ccc(C(=O)OC)cn1)C1CCCC1c1ccc(N)cc1", + "ref_smiles": "CCC(=O)N(c1ccc(C(=O)OC)cn1)C1CCC(N)C1c1ccc(N)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9d26a063-0d92-4b5b-8aaf-60e1bf8dcd7a", + "task": "add", + "question": "Please add a benzene ring to the molecule Cn1cc(CC(O)COc2cccc(Cl)c2)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc(CC(O)COc2cccc(Cl)c2)cn1.", + "ref_smiles": "Cn1cc(CC(O)(COc2cccc(Cl)c2)c3ccccc3)cn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0d4d91c0-9316-4601-83e8-91cd03a20c7a", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(C)C1.", + "ref_smiles": "CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(CO)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dc356a7d-01ff-4665-89f2-986b8cc4ce25", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3ccccc3)SC2=S)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3ccccc3)SC2=S)cc1.", + "ref_smiles": "COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3cccc(-c4ccccc4)c3)SC2=S)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "26095dca-a4df-42ed-b6f0-b8cb3a960ee1", + "task": "add", + "question": "Modify the molecule Clc1nnc(C[NH+]2CCCC2C2CCCC2)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Clc1nnc(C[NH+]2CCCC2C2CCCC2)s1", + "ref_smiles": "Clc1nnc(C[NH+]2CC(c3ccccc3)CC2C2CCCC2)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3330b990-60bd-4814-8086-72bc24433926", + "task": "add", + "question": "Please add a amine to the molecule CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1.", + "ref_smiles": "CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "28950847-641d-45c8-819a-7ea0d9c4d0e7", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1.", + "ref_smiles": "Cc1ccc(-n2nc(C(C)(C)Cc3ccccc3)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0762b297-f847-4d34-a366-ade950ff6440", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2cncc(Nc3ccccc3C#N)c2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)c2cncc(Nc3ccccc3C#N)c2)cc1.", + "ref_smiles": "Cc1ccc(NC(=O)c2cncc(Nc3c(C#N)cccc3-c3ccccc3)c2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4d31b336-3784-4d92-9a45-7a1ab2bec014", + "task": "add", + "question": "Please add a amine to the molecule C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)C)no1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)C)no1.", + "ref_smiles": "C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)CN)no1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e80dfa2a-d50a-44f8-be7c-2a68758053c7", + "task": "add", + "question": "Modify the molecule C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccco1", + "ref_smiles": "C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccc(O)o1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "98c55731-3fcb-4262-9582-9a9a472aa14d", + "task": "add", + "question": "Modify the molecule O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1", + "ref_smiles": "O=C(C=Cc1cc(Cl)cc(C(=O)O)c1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "1d666bb2-9687-4630-b48c-87861060cf33", + "task": "add", + "question": "Modify the molecule Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3)c2)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3)c2)c1", + "ref_smiles": "Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3S)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "f286693b-1a66-4433-8beb-e2663074f7c2", + "task": "add", + "question": "Modify the molecule CC(O)c1cc(F)ccc1OC1CCOC2(CCSC2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)c1cc(F)ccc1OC1CCOC2(CCSC2)C1", + "ref_smiles": "CC(O)c1cc(F)cc(O)c1OC1CCOC2(CCSC2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "43b5fa74-4712-494c-8f3a-a38163520521", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(-c2nc(NCc3ccccn3)nc3nn(C)c(N)c23)c(F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2nc(NCc3ccccn3)nc3nn(C)c(N)c23)c(F)c1.", + "ref_smiles": "COc1ccc(-c2nc(NCc3ccccn3)nc3nn(CO)c(N)c23)c(F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a7aa3c54-d682-4ec8-82c3-0806843c2728", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(CN(C(=[NH+]C(=O)c2ccnc(Cl)c2)SC)c2ccc(F)c(C(F)(F)F)c2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CN(C(=[NH+]C(=O)c2ccnc(Cl)c2)SC)c2ccc(F)c(C(F)(F)F)c2)cc1.", + "ref_smiles": "COc1ccc(CN(C(=[NH+]C(=O)c2ccnc(Cl)c2)SC)c2cc(-c3ccccc3)c(F)c(C(F)(F)F)c2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "92563644-e010-4b6b-8b7c-19bea2b2971e", + "task": "add", + "question": "Modify the molecule Cc1ccc(O)c(SCC(O)c2ccccc2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(O)c(SCC(O)c2ccccc2)n1", + "ref_smiles": "Cc1ccc(O)c(SCC(O)(c2ccccc2)c2ccccc2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a28e9448-d640-4978-ac03-21272e2b168b", + "task": "add", + "question": "Modify the molecule CCOC(=O)c1c(-c2cccc([N+](=O)[O-])c2)csc1NC(=O)C=Cc1cccc(F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1c(-c2cccc([N+](=O)[O-])c2)csc1NC(=O)C=Cc1cccc(F)c1", + "ref_smiles": "CCOC(=O)c1c(-c2cc([N+](=O)[O-])ccc2O)csc1NC(=O)C=Cc1cccc(F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9e84531d-e325-49ef-aff1-f13b85dab988", + "task": "add", + "question": "Modify the molecule Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c1", + "ref_smiles": "Cc1cc(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c(C)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f010fd4c-73e5-48c5-a63b-1da270bd62db", + "task": "add", + "question": "Please add a carboxyl to the molecule CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl.", + "ref_smiles": "O=C(O)CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "09b27c64-7085-4c85-a4ec-6b11fde99dde", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCC1(C2CC(=O)N(c3cc(F)ccc3F)C2=O)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC1(C2CC(=O)N(c3cc(F)ccc3F)C2=O)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.", + "ref_smiles": "CCCCC1(C2C(=O)N(c3cc(F)ccc3F)C(=O)C2c2ccccc2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "97c068ba-c3bf-4bf0-ad02-976d81917549", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](Cc3ccc(OC)cc3)CC2)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](Cc3ccc(OC)cc3)CC2)c1C.", + "ref_smiles": "CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](C(c3ccccc3)c3ccc(OC)cc3)CC2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "54f32cc7-d9d2-4dd1-ba4a-2f293f6d3c15", + "task": "add", + "question": "Modify the molecule Cc1noc(C2COCC[NH+]2CCC2CCCC(C)C2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1noc(C2COCC[NH+]2CCC2CCCC(C)C2)n1", + "ref_smiles": "Cc1noc(C2COCC[NH+]2CCC2CC(C)CC(c3ccccc3)C2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ad045e51-5437-4c70-9b9f-13740535dcc7", + "task": "add", + "question": "Modify the molecule COCC(=O)Cc1nnn(C)n1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC(=O)Cc1nnn(C)n1", + "ref_smiles": "COCC(=O)Cc1nnn(CC(=O)O)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "87d35ec8-693f-49d4-b25f-d4deedeaf3e9", + "task": "add", + "question": "Modify the molecule CN(C(=O)C[NH+]1CCN(Cc2ccccn2)CC1)C1(C#N)CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C(=O)C[NH+]1CCN(Cc2ccccn2)CC1)C1(C#N)CCCCC1", + "ref_smiles": "CN(C(=O)C[NH+]1CCN(Cc2ccccn2)C(c3ccccc3)C1)C1(C#N)CCCCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8c860147-250d-4df1-95d7-ac6136cfe875", + "task": "add", + "question": "Modify the molecule COc1ccc(-c2nc(NCc3ccccc3Cl)n(C(=O)c3ccccc3OC)n2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2nc(NCc3ccccc3Cl)n(C(=O)c3ccccc3OC)n2)cc1", + "ref_smiles": "COc1ccccc1C(=O)n1nc(-c2ccc(OCC(=O)O)cc2)nc1NCc1ccccc1Cl", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "28a7c94d-5bc7-4523-9d4a-e6c34cf464ff", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)C.", + "ref_smiles": "COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "447a6e72-94ab-46b2-ad90-3f56747dd4b8", + "task": "add", + "question": "Modify the molecule Cc1cnc(C[NH2+]CC2CCCOC2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cnc(C[NH2+]CC2CCCOC2)cn1", + "ref_smiles": "OCc1cnc(C[NH2+]CC2CCCOC2)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ecc98fda-01e7-4b79-99e4-2263f669f43e", + "task": "add", + "question": "Modify the molecule CC(C)([NH3+])CC(P(=O)([O-])[O-])P(=O)([O-])[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)([NH3+])CC(P(=O)([O-])[O-])P(=O)([O-])[O-]", + "ref_smiles": "CC(C)([NH3+])C(c1ccccc1)C(P(=O)([O-])[O-])P(=O)([O-])[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "150ba75f-d4e7-49a8-aed3-0fed3435bed4", + "task": "add", + "question": "Modify the molecule CCCc1nc2c(n1-c1cc(C)ccc1OC)CC[NH2+]C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1nc2c(n1-c1cc(C)ccc1OC)CC[NH2+]C2", + "ref_smiles": "CCCc1nc2c(n1-c1cc(C)ccc1OC)C(O)C[NH2+]C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f3cacd95-4f45-458e-9065-6bc57033b300", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2C)c2ccc(C)c(Cl)c2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2C)c2ccc(C)c(Cl)c2)cc1.", + "ref_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2CO)c2ccc(C)c(Cl)c2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8f02c59a-f823-41bd-a969-c08dec9aec83", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOC(=O)CCNc1nc2ccc(Cl)cc2s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCNc1nc2ccc(Cl)cc2s1.", + "ref_smiles": "CCOC(=O)C(O)CNc1nc2ccc(Cl)cc2s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a00e51a4-f8b0-47cb-80ca-89fb77f6c52a", + "task": "add", + "question": "Please add a nitrile to the molecule COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2ccccc2C(F)(F)F)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2ccccc2C(F)(F)F)C1.", + "ref_smiles": "COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2c(C#N)cccc2C(F)(F)F)C1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "f33f0fcb-0b87-410f-b4c9-c9fe6c4068a8", + "task": "add", + "question": "Modify the molecule COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2)cc1", + "ref_smiles": "COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4accf23e-1bff-4a0b-970b-611bc576e949", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C([O-])Cc1cn(Cc2ccno2)c2ccccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])Cc1cn(Cc2ccno2)c2ccccc12.", + "ref_smiles": "O=C([O-])Cc1cn(C(c2ccccc2)c2ccno2)c2ccccc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9924ec76-f12f-4009-a071-8361fceafbf3", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)[NH2+]C)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)[NH2+]C)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C.", + "ref_smiles": "CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)([NH2+]C)c1ccccc1)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8d2dffa4-3ea6-40b9-a34d-a549bf1b7144", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)Oc1cccc(C(Cl)Cc2ccccc2F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1cccc(C(Cl)Cc2ccccc2F)c1.", + "ref_smiles": "CC(C)Oc1ccc(C(=O)O)c(C(Cl)Cc2ccccc2F)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b24383b0-c6e9-4a1e-bd7a-b3de274430a2", + "task": "add", + "question": "Modify the molecule COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)C3CCC6(C)C5CCC4C2(C)C)cc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)C3CCC6(C)C5CCC4C2(C)C)cc1OC", + "ref_smiles": "COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)(c7ccccc7)C3CCC6(C)C5CCC4C2(C)C)cc1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2ca07fcf-5688-47ed-bc31-be8dfac4b58d", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1.", + "ref_smiles": "CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "69c1b856-75dd-48c4-917e-22d879b2706d", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(Cl)ccc1SC(N)=S.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Cl)ccc1SC(N)=S.", + "ref_smiles": "NC(=S)Sc1ccc(Cl)cc1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "14c76ca2-9343-4c06-ad9c-3b1e7d3316f1", + "task": "add", + "question": "Please add a carboxyl to the molecule C[NH2+]CC(C)(O)c1c(OC)cnn1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CC(C)(O)c1c(OC)cnn1C.", + "ref_smiles": "C[NH2+]C(C(=O)O)C(C)(O)c1c(OC)cnn1C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "07cab2f4-cc4b-49a4-9000-86470273ce9c", + "task": "add", + "question": "Please add a hydroxyl to the molecule CNc1cc(COc2c(Br)cccc2OC)ccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1cc(COc2c(Br)cccc2OC)ccn1.", + "ref_smiles": "CNc1cc(COc2c(Br)cccc2OC)c(O)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "df67f22a-8978-4a74-9b1d-bb69193a7a06", + "task": "add", + "question": "Please add a amine to the molecule COc1ccc(CCNC(=O)C2CC(c3ccccc3)CN(C(=O)COc3ccccc3)C2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CCNC(=O)C2CC(c3ccccc3)CN(C(=O)COc3ccccc3)C2)cc1.", + "ref_smiles": "COc1ccc(CCNC(=O)C2CC(c3ccc(N)cc3)CN(C(=O)COc3ccccc3)C2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3c5e2073-3f4c-48d3-be51-108d1b2a610e", + "task": "add", + "question": "Modify the molecule Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)ccc2F)c(F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)ccc2F)c(F)c1", + "ref_smiles": "Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)cc(O)c2F)c(F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "48a0bf0d-154b-48df-8841-2d562061be74", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC1C[NH+](Cc2ccc(N)c(Br)c2)CCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1C[NH+](Cc2ccc(N)c(Br)c2)CCO1.", + "ref_smiles": "CCC1C[NH+](Cc2ccc(N)c(Br)c2)C(c3ccccc3)CO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "bc1c488c-ad77-4ff4-bb40-746a8855feaf", + "task": "add", + "question": "Modify the molecule CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(C)OC12 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(C)OC12", + "ref_smiles": "CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(CCC=O)OC12", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "87364a49-ab2d-4295-b3ac-465fc6859968", + "task": "add", + "question": "Modify the molecule Cc1c(C(=O)Nc2ccnn2Cc2ccccc2)cnn1C(C)(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(=O)Nc2ccnn2Cc2ccccc2)cnn1C(C)(C)C", + "ref_smiles": "CC(C)(C)n1ncc(C(=O)Nc2ccnn2Cc2ccccc2)c1CC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "fc2a35cb-1dec-4b4d-bc9d-22a6353b1115", + "task": "add", + "question": "Please add a benzene ring to the molecule CC[NH2+]C(Cc1cc(C)nn1C)CC(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C(Cc1cc(C)nn1C)CC(C)(C)C.", + "ref_smiles": "CC[NH2+]C(Cc1cc(C)nn1C)C(c1ccccc1)C(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d16063b5-e1eb-4785-ba6a-f61e1cb30323", + "task": "add", + "question": "Modify the molecule Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2)c1", + "ref_smiles": "Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2S)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "17822b12-ad6b-45c8-922c-96c18d8fcf4c", + "task": "add", + "question": "Modify the molecule COc1ccc(C=CC(=O)N(C=O)CCC[NH3+])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C=CC(=O)N(C=O)CCC[NH3+])cc1", + "ref_smiles": "COc1ccc(C=C(C(=O)N(C=O)CCC[NH3+])c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "555cb38e-b1fc-4ba2-a934-341308885bd0", + "task": "add", + "question": "Modify the molecule Cc1ccc(NC(=O)CN(c2ccccc2Cl)S(C)(=O)=O)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)CN(c2ccccc2Cl)S(C)(=O)=O)cc1C", + "ref_smiles": "Cc1ccc(NC(=O)CN(c2ccccc2Cl)S(C)(=O)=O)cc1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "91715e96-b2ed-4753-95c2-67472dd35420", + "task": "add", + "question": "Please add a carboxyl to the molecule CCC(=O)CC(=O)OCCCCOc1ccc(CCOC2CCCCO2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(=O)CC(=O)OCCCCOc1ccc(CCOC2CCCCO2)cc1.", + "ref_smiles": "CCC(=O)CC(=O)OCCCC(Oc1ccc(CCOC2CCCCO2)cc1)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "1f1b4828-7611-4a29-bfeb-b666242dc4d9", + "task": "add", + "question": "Modify the molecule COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4)n3)n[nH]2)c(OC)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4)n3)n[nH]2)c(OC)c1", + "ref_smiles": "COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4O)n3)n[nH]2)c(OC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e4ac61e8-62ca-4879-a81d-61df97d8951a", + "task": "add", + "question": "Modify the molecule Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1", + "ref_smiles": "Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3f8c82b9-6713-418c-bdda-cfcab0688fd3", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NCc1csc2ncnn12)C1CN(c2cc(-n3cccn3)ncn2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1csc2ncnn12)C1CN(c2cc(-n3cccn3)ncn2)C1.", + "ref_smiles": "O=C(NCc1csc2ncnn12)C1CN(c2cc(-n3cc(-c4ccccc4)cn3)ncn2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5e1506a7-c309-4148-8bc7-bf4a204a2b35", + "task": "add", + "question": "Please add a thiol to the molecule CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)C)c1.", + "ref_smiles": "CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)(C)S)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "e79963ae-98b3-487f-bd72-00d2786a2cac", + "task": "add", + "question": "Please add a nitrile to the molecule C=CC([NH3+])c1c(-c2ccccc2)[nH]c2ccccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC([NH3+])c1c(-c2ccccc2)[nH]c2ccccc12.", + "ref_smiles": "C=CC([NH3+])c1c(-c2ccc(C#N)cc2)[nH]c2ccccc12", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "db3bf90d-3926-49cc-b0b8-7ce7e9e525c5", + "task": "add", + "question": "Modify the molecule Cc1nn(C)c(C)c1C(=O)C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c(C)c1C(=O)C(C)C", + "ref_smiles": "Cc1nn(C)c(C)c1C(=O)C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2884f7d5-c203-45c0-afb8-d34439ad187e", + "task": "add", + "question": "Modify the molecule CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)[nH]1", + "ref_smiles": "CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)cc(-c4ccccc4)c2C)[nH]1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7b3d0fb1-9afd-47ec-82a4-27fe6da68b4a", + "task": "add", + "question": "Please add a nitrile to the molecule CCC1CCC[NH+](CCCC[NH2+]CC(C)C)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CCC[NH+](CCCC[NH2+]CC(C)C)CC1.", + "ref_smiles": "CCC1CCC[NH+](CCCC(C#N)[NH2+]CC(C)C)CC1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "7b688059-b8eb-446d-9f3b-51dc27af62c7", + "task": "add", + "question": "Please add a amine to the molecule COc1ccc(C(=O)N(Cc2cccnc2)C2CC2)cc1Br.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)N(Cc2cccnc2)C2CC2)cc1Br.", + "ref_smiles": "COc1ccc(C(=O)N(Cc2cnccc2N)C2CC2)cc1Br", + "add_group": "amine", + "remove_group": null + }, + { + "id": "22667bce-0ec9-4665-84a4-9ac17def6371", + "task": "add", + "question": "Please add a nitrile to the molecule Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)C)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)C)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21.", + "ref_smiles": "Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)CC#N)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "7a5ba7be-4717-40fe-aafe-8497da9bbc5e", + "task": "add", + "question": "Modify the molecule [NH3+]CC(C[NH3+])Nc1cn[nH]c(=O)c1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CC(C[NH3+])Nc1cn[nH]c(=O)c1Cl", + "ref_smiles": "[NH3+]CC(C[NH3+])(Nc1cn[nH]c(=O)c1Cl)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c005580f-b9a3-4b13-a9ec-eeb7a9607f1f", + "task": "add", + "question": "Modify the molecule O=S(=O)(Cl)CCc1cc2c(s1)CCOC2 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(Cl)CCc1cc2c(s1)CCOC2", + "ref_smiles": "Nc1c(CCS(=O)(=O)Cl)sc2c1COCC2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b9a9866f-950e-45ce-83b6-45f1ef389d68", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C2=COCC=C2)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C2=COCC=C2)c(Cl)c1.", + "ref_smiles": "Cc1cc(Cl)c(C2=COCC=C2)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6d8a4ea6-6d63-43be-a8f3-96e12662b159", + "task": "add", + "question": "Modify the molecule OC(C[NH2+]C1CC1)Cc1sccc1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC(C[NH2+]C1CC1)Cc1sccc1Br", + "ref_smiles": "OC(C[NH2+]C1CC1)C(c1ccccc1)c1sccc1Br", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fa9b119d-cb8f-444e-99b3-aca3a825df3f", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCc1ccn(C2CCCC2)n1)NCC1SCCc2ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1ccn(C2CCCC2)n1)NCC1SCCc2ccccc21.", + "ref_smiles": "O=C(NCC1SCCc2ccccc21)NC(O)c1ccn(C2CCCC2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5d857359-1299-4951-b2b4-361929d71e71", + "task": "add", + "question": "Modify the molecule CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1", + "ref_smiles": "CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a7c72f0a-57e9-4a8a-91d1-d4d7206f65a6", + "task": "add", + "question": "Modify the molecule [NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1", + "ref_smiles": "[NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "09b4db6a-a45e-4949-a2ab-1ab5b6a32a0c", + "task": "add", + "question": "Modify the molecule [NH3+]C(CO)c1nc(C2CSCCS2)no1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(CO)c1nc(C2CSCCS2)no1", + "ref_smiles": "[NH3+]C(CO)c1nc(C2CSCC(C(=O)O)S2)no1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ee5ad004-2a8d-4d58-9432-136a74c82001", + "task": "add", + "question": "Modify the molecule CC(C(=O)N1CCC(CBr)CC1)C1CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(=O)N1CCC(CBr)CC1)C1CC1", + "ref_smiles": "CC(C(=O)N1CCC(CBr)CC1)C1(C(=O)O)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f85e0d06-0991-403b-8e1d-e18b35d54279", + "task": "add", + "question": "Please add a benzene ring to the molecule N#Cc1cccc(N2CCC3(CCCCC3)C2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1cccc(N2CCC3(CCCCC3)C2=O)c1.", + "ref_smiles": "N#Cc1cc(-c2ccccc2)cc(N2CCC3(CCCCC3)C2=O)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ba825141-3b5f-4d55-9f3d-9e17c3dfb6af", + "task": "add", + "question": "Please add a amine to the molecule Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)C)ccc2n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)C)ccc2n1.", + "ref_smiles": "Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)(C)N)ccc2n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3c669b1d-db3c-462b-9a3f-5bd308b9592e", + "task": "add", + "question": "Modify the molecule CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCCCOc6ccc(C=O)cc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCCCOc6ccc(C=O)cc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2", + "ref_smiles": "CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCC(COc6ccc(C=O)cc6)c6ccccc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "bbb6990a-1b47-4720-94cb-82404d8f454a", + "task": "add", + "question": "Please add a carboxyl to the molecule Cn1ccnc1CN1CCCc2cc(C(=O)[O-])ccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1ccnc1CN1CCCc2cc(C(=O)[O-])ccc21.", + "ref_smiles": "Cn1ccnc1CN1CCCc2c1ccc(C(=O)[O-])c2C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "26518ddf-fce0-4be3-9d86-f6c6061a5a1f", + "task": "add", + "question": "Modify the molecule O=C1[NH+]=C(CCc2cccc(F)c2)NC1=Cc1ccc(Br)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1[NH+]=C(CCc2cccc(F)c2)NC1=Cc1ccc(Br)cc1", + "ref_smiles": "O=CCc1cc(Br)ccc1C=C1NC(CCc2cccc(F)c2)=[NH+]C1=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a5c008fa-bcab-4aa9-8c55-7857294208af", + "task": "add", + "question": "Modify the molecule O=C(c1cccc2ccccc12)N1CC[NH+](Cc2ccccc2Br)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1cccc2ccccc12)N1CC[NH+](Cc2ccccc2Br)CC1", + "ref_smiles": "O=C(c1cccc2ccc(-c3ccccc3)cc12)N1CC[NH+](Cc2ccccc2Br)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "86f1ce53-dff5-480d-9082-2d303f0db32a", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccccc1CC(=O)c1cc(Br)ccc1Br.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1CC(=O)c1cc(Br)ccc1Br.", + "ref_smiles": "COc1ccc(O)cc1CC(=O)c1cc(Br)ccc1Br", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f59949a4-9d47-4664-bfb6-c267c1b766e4", + "task": "add", + "question": "Modify the molecule CC(C)c1cnc(N(C)C)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)c1cnc(N(C)C)c(Cl)c1", + "ref_smiles": "CN(C)c1ncc(C(C)(C)c2ccccc2)cc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4e07c706-5f63-4b81-babc-8ffc9fb3cf02", + "task": "add", + "question": "Modify the molecule O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCCO2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCCO2)cc1", + "ref_smiles": "O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCC(c3ccccc3)O2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3ba532f2-d991-4a22-ae72-8a5504319c6b", + "task": "add", + "question": "Modify the molecule CC1CCC(C(C)(C)Cc2ccc(F)c(Cl)c2)C(=O)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCC(C(C)(C)Cc2ccc(F)c(Cl)c2)C(=O)C1", + "ref_smiles": "CC1CCC(C(C)(C)Cc2cc(O)c(F)c(Cl)c2)C(=O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4b2e644e-8722-4a52-a6c4-ca977ad74bec", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCN(C(=O)c1ccc(Cl)c(Cl)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCN(C(=O)c1ccc(Cl)c(Cl)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1.", + "ref_smiles": "CCCCN(C(=O)c1cc(Cl)c(Cl)cc1-c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8a12ce5f-4ee6-4883-ae6e-5650f862f7aa", + "task": "add", + "question": "Modify the molecule CC(CCC(=O)[O-])[NH2+]Cc1cscn1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CCC(=O)[O-])[NH2+]Cc1cscn1", + "ref_smiles": "CC([NH2+]Cc1cscn1)C(CC(=O)[O-])c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4cda2005-0e42-4fbc-a202-db06c0feeacc", + "task": "add", + "question": "Modify the molecule Nc1ccc(CNC(=O)C(Cc2cccc3ccccc23)NC(=O)C2CCCC[NH2+]2)cn1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc(CNC(=O)C(Cc2cccc3ccccc23)NC(=O)C2CCCC[NH2+]2)cn1", + "ref_smiles": "Nc1ccc(CNC(=O)C(Cc2cccc3ccccc23)NC(=O)C2CCCC[NH2+]2)c(-c2ccccc2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "160eb2a4-b2a1-4033-9a27-fbbd0f6530ad", + "task": "add", + "question": "Modify the molecule O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)CC1", + "ref_smiles": "O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)c(O)c2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d9a4688a-f06b-4c9d-bdaf-adcec9c46239", + "task": "add", + "question": "Please add a benzene ring to the molecule Nc1cnn(CC(=O)NCCC2CCCCO2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cnn(CC(=O)NCCC2CCCCO2)c1.", + "ref_smiles": "Nc1cnn(CC(=O)NCCC2(c3ccccc3)CCCCO2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3973bedf-f6af-4cb2-9a9c-9feb4ffedb2f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(C)(C)C(=O)OCCC1C2CC3C(=O)OC1C3O2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)(C)C(=O)OCCC1C2CC3C(=O)OC1C3O2.", + "ref_smiles": "CCC(C)(C)C(=O)OCCC1C2CC3(O)C(=O)OC1C3O2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3c979fd3-4d4f-4ef1-90ad-e7455793b739", + "task": "add", + "question": "Modify the molecule O=c1nc(C[NH+]2CCOC3(CCCC3)C2)[nH]c2c1oc1ccccc12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1nc(C[NH+]2CCOC3(CCCC3)C2)[nH]c2c1oc1ccccc12", + "ref_smiles": "O=c1nc(C[NH+]2CC3(CCCC3)OCC2O)[nH]c2c1oc1ccccc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d4b8267c-efda-4164-9fa6-33ad9b5b6e09", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+]1CCCC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCCC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12.", + "ref_smiles": "C[NH+]1CC(c2ccccc2)CC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "32e5b8a1-2f41-4aff-ac69-8aacb1ee59ed", + "task": "add", + "question": "Please add a carboxyl to the molecule NS(=O)(=O)c1cccc(Cl)c1CCCCO.\nPlease wrap the final SMILES in ....", + "src_smiles": "NS(=O)(=O)c1cccc(Cl)c1CCCCO.", + "ref_smiles": "NS(=O)(=O)c1cc(C(=O)O)cc(Cl)c1CCCCO", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "273bc69e-7b8c-4d28-8d82-b70c831475c8", + "task": "add", + "question": "Please add a benzene ring to the molecule Nc1cccc(CC2(F)CCS(=O)(=O)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cccc(CC2(F)CCS(=O)(=O)CC2)c1.", + "ref_smiles": "Nc1cccc(C(c2ccccc2)C2(F)CCS(=O)(=O)CC2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "797ea6ed-3d00-4be3-b1f8-61a2efdcbd8d", + "task": "add", + "question": "Modify the molecule CNC(=O)Cn1c(=O)nc(-c2ccccc2)c2cc(Cl)sc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNC(=O)Cn1c(=O)nc(-c2ccccc2)c2cc(Cl)sc21", + "ref_smiles": "CNC(=O)Cn1c(=O)nc(-c2cccc(O)c2)c2cc(Cl)sc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b0a336d1-ee40-4f3c-a6d8-68575e35bc5e", + "task": "add", + "question": "Modify the molecule CCCC1CC(O)(c2ccc3nc(C)ccc3c2)CCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1CC(O)(c2ccc3nc(C)ccc3c2)CCO1", + "ref_smiles": "CCCC1CC(O)(c2ccc3nc(C)ccc3c2)C(O)CO1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b1e7e752-2fd3-4ae0-a5c6-90ff934bb4a0", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)COS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)COS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12.", + "ref_smiles": "CC(C)C(OS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7c98f2f7-bfd7-482d-8a64-d82b0134ffe7", + "task": "add", + "question": "Modify the molecule CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCCC)C5=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCCC)C5=O", + "ref_smiles": "CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCC(C)c1ccccc1)C5=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "62b258f6-0d6a-4bec-b6cc-23f63ec230a9", + "task": "add", + "question": "Please add a aldehyde to the molecule N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1.", + "ref_smiles": "N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "f1f8411d-4247-44ab-ba30-eb01740500b8", + "task": "add", + "question": "Modify the molecule O=Cc1ccc(O)c(C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=Cc1ccc(O)c(C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1", + "ref_smiles": "NC(=Cc1cc(C=O)ccc1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "87155ea9-ec0b-4c4e-8400-de9742342347", + "task": "add", + "question": "Please add a benzene ring to the molecule COCCOCCNc1cc(Cl)ccc1N.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCOCCNc1cc(Cl)ccc1N.", + "ref_smiles": "Nc1ccc(Cl)cc1NCCOCCOCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0e693464-5be0-45d1-8275-0fdf67ab1b6e", + "task": "add", + "question": "Modify the molecule CNc1nc(C)cc(OCCOc2ccccc2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1nc(C)cc(OCCOc2ccccc2)n1", + "ref_smiles": "CNc1nc(C)cc(OCC(O)Oc2ccccc2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6f6e83d6-ccf2-41e6-acbc-116747e96e94", + "task": "add", + "question": "Modify the molecule CCC(CC#N)NC(=O)C1CCOC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC#N)NC(=O)C1CCOC1", + "ref_smiles": "CCC(CC#N)NC(=O)C1COC(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "01ce4336-f2ff-4f73-8720-74fb2ed97c2e", + "task": "add", + "question": "Modify the molecule CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)CC2)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)CC2)[nH]1", + "ref_smiles": "CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)C(c4ccccc4)C2)[nH]1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7099942c-65b3-4df6-b9d7-36394e09b854", + "task": "add", + "question": "Modify the molecule C[NH+]=C(NCCc1ccc(OC)cc1O)NCC(c1ccco1)[NH+]1CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCCc1ccc(OC)cc1O)NCC(c1ccco1)[NH+]1CCCC1", + "ref_smiles": "C[NH+]=C(NCC(c1ccco1)[NH+]1CCCC1)NC(O)Cc1ccc(OC)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4180589a-c1c6-4590-bb1c-1cb66e9856b3", + "task": "add", + "question": "Modify the molecule [NH3+]C1CCCN(CCC2CCOC2)C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1CCCN(CCC2CCOC2)C1=O", + "ref_smiles": "[NH3+]C1CC(O)CN(CCC2CCOC2)C1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d79528de-fb9d-4e53-a23d-3d0e629cc348", + "task": "add", + "question": "Modify the molecule OCC1([NH2+]C2CNC2)CCOCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "OCC1([NH2+]C2CNC2)CCOCC1", + "ref_smiles": "NC1COCCC1(CO)[NH2+]C1CNC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d3f27e82-e3b6-40a8-b9da-b8afd4f46d46", + "task": "add", + "question": "Modify the molecule Cc1csc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)n1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1csc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)n1", + "ref_smiles": "Cc1nc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)sc1CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "f04dc3ee-98b6-49d2-8927-356f8ec67aa2", + "task": "add", + "question": "Please add a amine to the molecule CC(C)(C)[NH2+]Cc1ccsc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)[NH2+]Cc1ccsc1Cl.", + "ref_smiles": "CC(C)(CN)[NH2+]Cc1ccsc1Cl", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b27daea9-f451-43e9-bbe8-f15bff5b684f", + "task": "add", + "question": "Modify the molecule CCCC[NH+](CCCC)Cc1cccnc1NN by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC[NH+](CCCC)Cc1cccnc1NN", + "ref_smiles": "CCCC[NH+](Cc1cccnc1NN)CC(N)CC", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3baabbdf-73d6-407f-89e6-0947e23632df", + "task": "add", + "question": "Modify the molecule Cc1nc(=O)c(S(C)(=O)=O)c(C)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(=O)c(S(C)(=O)=O)c(C)[nH]1", + "ref_smiles": "Cc1[nH]c(Cc2ccccc2)nc(=O)c1S(C)(=O)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b4e363b5-f0fa-49b7-b684-2243c1128836", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1nn(C)c2cc(-c3noc(C4CCN(C(=O)CC5C[NH+](C(O)OC(C)(C)C)C5)CC4)n3)ccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c2cc(-c3noc(C4CCN(C(=O)CC5C[NH+](C(O)OC(C)(C)C)C5)CC4)n3)ccc12.", + "ref_smiles": "Cc1nn(C)c2cc(-c3noc(C4CCN(C(=O)CC5(O)C[NH+](C(O)OC(C)(C)C)C5)CC4)n3)ccc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0573fa22-ad1a-4f49-8161-35eb719edb81", + "task": "add", + "question": "Modify the molecule CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)CC1", + "ref_smiles": "CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)C(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "590c144e-519f-4ffa-b487-189576e6b6c6", + "task": "add", + "question": "Modify the molecule CC(O)C(C)[NH+]1CCC(C)(C)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)C(C)[NH+]1CCC(C)(C)C1", + "ref_smiles": "CC(O)C(CO)[NH+]1CCC(C)(C)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "791a8a78-2f66-4ebf-b32d-37a408dace32", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)N2CCC(C)C2CO)cc1O.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)N2CCC(C)C2CO)cc1O.", + "ref_smiles": "COc1ccc(C(=O)N2CC(c3ccccc3)C(C)C2CO)cc1O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9943668a-9906-43b8-8f4f-d3e6ec79d291", + "task": "add", + "question": "Modify the molecule CC(=O)c1ccc(N(C)CC2CCC2)cc1N by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1ccc(N(C)CC2CCC2)cc1N", + "ref_smiles": "CC(=O)c1ccc(N(C)C(O)C2CCC2)cc1N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e78c0820-6611-4ff3-bb8f-76551e135b09", + "task": "add", + "question": "Modify the molecule COC(=O)C(Nc1cccnc1C(N)=S)c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(Nc1cccnc1C(N)=S)c1ccccc1", + "ref_smiles": "COC(=O)C(Nc1cccnc1C(N)=S)c1cccc(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "04176db3-1b4c-4026-bc4f-d71932fa92c3", + "task": "add", + "question": "Modify the molecule CCC1CC1Nc1nc2c(cc1C#N)CCCC2 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CC1Nc1nc2c(cc1C#N)CCCC2", + "ref_smiles": "CCC1CC1Nc1nc2c(cc1C#N)CC(C#N)CC2", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "fcd571d3-9c02-4694-b373-8337f458e66d", + "task": "add", + "question": "Modify the molecule NC(=O)c1ccccc1NCC(=O)N1CCCCC1CCC(=O)[O-] by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)c1ccccc1NCC(=O)N1CCCCC1CCC(=O)[O-]", + "ref_smiles": "NC(=O)c1ccccc1NCC(=O)N1C(CCC(=O)[O-])CCCC1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "76fca29c-5dd2-497b-b1c0-f0d95868c434", + "task": "add", + "question": "Modify the molecule CC(C)c1nc(CCNC(=O)COc2ccccc2)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)c1nc(CCNC(=O)COc2ccccc2)cs1", + "ref_smiles": "CC(C)c1nc(CC(NC(=O)COc2ccccc2)c2ccccc2)cs1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "281c822e-e34d-4104-b5cd-22127290a52c", + "task": "add", + "question": "Modify the molecule C[N+](C(=O)Cc1ccccc1)(C1CCN(c2cc[nH+]cc2)CC1)C1CCc2ccc(OC(=O)[O-])cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[N+](C(=O)Cc1ccccc1)(C1CCN(c2cc[nH+]cc2)CC1)C1CCc2ccc(OC(=O)[O-])cc21", + "ref_smiles": "C[N+](C(=O)Cc1ccccc1)(C1CCc2ccc(OC(=O)[O-])cc21)C1CCN(c2cc[nH+]cc2)CC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d82832e3-c46c-40b1-839d-cd6ab674932a", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC1CC1N1CC(C)(CC)[NH2+]CC1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CC1N1CC(C)(CC)[NH2+]CC1C.", + "ref_smiles": "CCC1CC1N1C(C)C[NH2+]C(C)(CC)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3ecfa6fd-52c7-44a6-8595-8ad031885900", + "task": "add", + "question": "Modify the molecule COc1ccc(CC(=O)N2CCN(c3ncnc4c3nnn4-c3ccc(F)cc3)CC2)cc1OC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CC(=O)N2CCN(c3ncnc4c3nnn4-c3ccc(F)cc3)CC2)cc1OC", + "ref_smiles": "COc1ccc(CC(=O)N2CCN(c3ncnc4c3nnn4-c3ccc(F)cc3)CC2)c(O)c1OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d1f296c1-9be6-475a-b9ae-936472dde6dc", + "task": "add", + "question": "Modify the molecule COC(=O)C1([NH2+]C(C)C)CCC(Sc2cc(C)nn2C)C1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1([NH2+]C(C)C)CCC(Sc2cc(C)nn2C)C1", + "ref_smiles": "COC(=O)C1([NH2+]C(C)CC#N)CCC(Sc2cc(C)nn2C)C1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "5305e1b6-f3ee-4792-9386-3ae23f548878", + "task": "add", + "question": "Please add a amine to the molecule CC(C)c1cc(NC(=O)C2CC3CCC2C3)n[nH]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)c1cc(NC(=O)C2CC3CCC2C3)n[nH]1.", + "ref_smiles": "CC(C)c1cc(NC(=O)C2C3CCC(C3)C2N)n[nH]1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ef02bc88-6c0b-41bb-b309-3e49acd8fab3", + "task": "add", + "question": "Modify the molecule CC(C)Oc1ccccc1C1C[NH2+]CCC1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1ccccc1C1C[NH2+]CCC1C", + "ref_smiles": "CC(C)Oc1ccccc1C1(c2ccccc2)C[NH2+]CCC1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7ee0c6b6-4606-4bfc-a646-ffa34c3592aa", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OC(C)=O)c([N+](=O)[O-])c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OC(C)=O)c([N+](=O)[O-])c1.", + "ref_smiles": "CCOc1cc(C=Nn2c(CC(C)c3ccccc3)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OC(C)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "539e0c30-acdb-4510-ae73-cac2a85b92a6", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)NC(=O)C1CC1C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)NC(=O)C1CC1C1CC1.", + "ref_smiles": "CC(C)(NC(=O)C1CC1C1CC1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "801b33c9-7789-4ac0-85ff-d7999f8d9847", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1.", + "ref_smiles": "CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3O)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4a360207-fb23-46c6-8988-6c9bc18e0cc9", + "task": "add", + "question": "Modify the molecule Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)cc1", + "ref_smiles": "Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5e2b84f6-7d34-4d37-bd62-e9801cb32f32", + "task": "add", + "question": "Modify the molecule CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)CCCC)nc1-c1c(OC)cccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)CCCC)nc1-c1c(OC)cccc1OC", + "ref_smiles": "CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)C(CCC)c2ccccc2)nc1-c1c(OC)cccc1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5236ff1c-8413-444e-907b-017911abacdd", + "task": "add", + "question": "Modify the molecule C=CCOC(=O)Nc1ccc(CCC(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCOC(=O)Nc1ccc(CCC(=O)[O-])cc1", + "ref_smiles": "C=C(COC(=O)Nc1ccc(CCC(=O)[O-])cc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b059d143-1bd2-47ec-b08e-56e0b7bf30a0", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1cccc(C(O)C(=O)NC(C)c2ccccc2C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(C(O)C(=O)NC(C)c2ccccc2C)c1.", + "ref_smiles": "COc1cccc(C(O)C(=O)NC(CC(=O)O)c2ccccc2C)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "fa742a94-49ae-4030-b559-1b9102264080", + "task": "add", + "question": "Modify the molecule COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OC", + "ref_smiles": "COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OCO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d81526cf-041e-4c74-bdb3-8dc7604c102c", + "task": "add", + "question": "Modify the molecule CC(CNc1ccc(Cl)cc1I)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CNc1ccc(Cl)cc1I)C(=O)[O-]", + "ref_smiles": "O=C([O-])C(CNc1ccc(Cl)cc1I)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f5091357-2b30-40b3-bee2-b387cb17f599", + "task": "add", + "question": "Modify the molecule C[NH2+]C1CC[NH+](C2CCc3ccccc3C2)C(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C1CC[NH+](C2CCc3ccccc3C2)C(C)C1", + "ref_smiles": "CC1CC([NH2+]Cc2ccccc2)CC[NH+]1C1CCc2ccccc2C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c9b449f5-1fde-49b2-973e-fa6818dc2d32", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)cc2)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)cc2)cn1.", + "ref_smiles": "Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)c(-c3ccccc3)c2)cn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dd1a5a13-6c5f-4078-910e-f70df91b1cc8", + "task": "add", + "question": "Modify the molecule Brc1ccc(C2N3CCCN23)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Brc1ccc(C2N3CCCN23)cc1", + "ref_smiles": "Nc1cc(Br)ccc1C1N2CCCN12", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3656f61d-5499-4bd8-ab97-7e9a9717cc56", + "task": "add", + "question": "Please add a carboxyl to the molecule CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCC.", + "ref_smiles": "CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCCC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c2bdde61-7744-4bf0-8651-f9644bbe3b25", + "task": "add", + "question": "Modify the molecule CC(C)(C)OC(=O)N1CCC(Nc2cccc(C(N)=O)c2)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)OC(=O)N1CCC(Nc2cccc(C(N)=O)c2)C1", + "ref_smiles": "CC(C)(C)OC(=O)N1CCC(Nc2cccc(C(N)=O)c2)(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "bce18688-12a5-4241-830a-1ee3b53ee6bd", + "task": "add", + "question": "Modify the molecule CSCCCC[NH2+]Cc1cccc(OCC#N)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCCC[NH2+]Cc1cccc(OCC#N)c1", + "ref_smiles": "CSCCC(CC=O)C[NH2+]Cc1cccc(OCC#N)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a38541c8-a33f-4554-8309-98682b452a6f", + "task": "add", + "question": "Modify the molecule CC(=O)OC(CCNC(=O)OC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)OC(CCNC(=O)OC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F", + "ref_smiles": "CC(=O)OC(CCNC(=O)OC(C)(C)CO)C(=O)Oc1c(F)c(F)c(F)c(F)c1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4a52d345-5722-41ce-8d32-10c96cc03b62", + "task": "add", + "question": "Modify the molecule OC(C[NH2+]Cc1ccccc1)COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC(C[NH2+]Cc1ccccc1)COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1", + "ref_smiles": "OC(COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C([NH2+]Cc1ccccc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "eb22fb94-dfc0-4032-af53-0646810d2aa1", + "task": "add", + "question": "Please add a carboxyl to the molecule CCCCNC(=O)CCCC(C)(C)c1ccc2cc3ccccc3cc2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCNC(=O)CCCC(C)(C)c1ccc2cc3ccccc3cc2c1.", + "ref_smiles": "CCCCNC(=O)CCC(C(=O)O)C(C)(C)c1ccc2cc3ccccc3cc2c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "75f6b01a-d469-44a3-8b1d-f59138ece235", + "task": "add", + "question": "Modify the molecule CC(=O)c1ccc(Cc2ccc3ccccc3n2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1ccc(Cc2ccc3ccccc3n2)cc1", + "ref_smiles": "CC(=O)c1ccc(Cc2ccc3c(-c4ccccc4)cccc3n2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0b004d00-3ca1-4949-8f02-6316b43a1355", + "task": "add", + "question": "Modify the molecule O=C([O-])c1cn(CC(=O)N2CCCC2CO)nn1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1cn(CC(=O)N2CCCC2CO)nn1", + "ref_smiles": "O=C([O-])c1cn(CC(=O)N2C(CO)CCC2C(=O)O)nn1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "00f675e5-fea7-445a-8670-ebc6b78c5700", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2)c1.", + "ref_smiles": "CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3e0b709e-fccf-403f-b01a-cd9f7f9a0ab8", + "task": "add", + "question": "Modify the molecule CCCC1CC(C[NH3+])(N(CC)Cc2ccncc2)CCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1CC(C[NH3+])(N(CC)Cc2ccncc2)CCO1", + "ref_smiles": "CCCC1CC(C[NH3+])(N(CC)Cc2ccnc(O)c2)CCO1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "569506eb-7069-4dbb-8738-c064507d494b", + "task": "add", + "question": "Modify the molecule C#CC(Br)CBr by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CC(Br)CBr", + "ref_smiles": "C#CC(Br)C(O)Br", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "04a49acc-5a19-4591-9932-090ea8b1315d", + "task": "add", + "question": "Please add a benzene ring to the molecule Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)ccc1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)ccc1=O.", + "ref_smiles": "Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)c(-c2ccccc2)cc1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "daeadb99-b953-47a6-b4bb-6f70d2dd6821", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCC([NH3+])C#Cc1cccc(OCC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC([NH3+])C#Cc1cccc(OCC)c1.", + "ref_smiles": "CCCC([NH3+])C#Cc1ccc(O)c(OCC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "67c0ac42-cc72-4585-a9b7-3ee2a8291d0a", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCOc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCOc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1.", + "ref_smiles": "CC(O)COc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e789b289-79c7-4f20-bb8d-0c97c73b5f78", + "task": "add", + "question": "Modify the molecule CC1CCCC(CNC(=O)NC(C(=O)[O-])C(C)O)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC(CNC(=O)NC(C(=O)[O-])C(C)O)C1", + "ref_smiles": "CC1CCCC(CNC(=O)NC(C(=O)[O-])C(O)CCC=O)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "61c51098-1ebf-4ecc-9469-c1fdb594c1cf", + "task": "add", + "question": "Please add a benzene ring to the molecule CN(Cc1ccccc1C#CC[NH3+])C(=O)C1CCC(=O)N1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(Cc1ccccc1C#CC[NH3+])C(=O)C1CCC(=O)N1.", + "ref_smiles": "CN(Cc1ccccc1C#CC[NH3+])C(=O)C1(c2ccccc2)CCC(=O)N1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "877cf500-bf0e-4576-868b-95ee0b9cd553", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCOC3=O)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCOC3=O)cc2)cc1.", + "ref_smiles": "COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CC(O)OC3=O)cc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a2495e0b-8b74-4ca7-b798-9c0f85cf7be7", + "task": "add", + "question": "Please add a amine to the molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)C12CC3CC(CC(C3)C1)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)C12CC3CC(CC(C3)C1)C2.", + "ref_smiles": "NC1C2CC3CC1CC(C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1)(C3)C2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "af435425-ee2a-47a1-9dff-b0e25c7e9636", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CSCC1NC(=O)CC[NH3+].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CSCC1NC(=O)CC[NH3+].", + "ref_smiles": "CC1CSC(c2ccccc2)C1NC(=O)CC[NH3+]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d6ed646f-2c5d-4338-884e-ad1301b27695", + "task": "add", + "question": "Modify the molecule Cc1ncc(-c2cccc(-c3ncc(C(C=NCC(=O)N4CCCC4)=C[NH3+])cn3)c2)s1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ncc(-c2cccc(-c3ncc(C(C=NCC(=O)N4CCCC4)=C[NH3+])cn3)c2)s1", + "ref_smiles": "Cc1ncc(-c2cccc(-c3ncc(C(=C[NH3+])C(CC=O)=NCC(=O)N4CCCC4)cn3)c2)s1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "b18dab7f-66e6-43cc-95c7-94fc04644efa", + "task": "add", + "question": "Please add a carboxyl to the molecule Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4ccco4)CC3c3cccs3)nnc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4ccco4)CC3c3cccs3)nnc12.", + "ref_smiles": "Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4cc(C(=O)O)co4)CC3c3cccs3)nnc12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "12152113-62e9-486c-81e7-822561463278", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cn1ncc(CNc2ccc(F)cc2C#N)c1N.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1ncc(CNc2ccc(F)cc2C#N)c1N.", + "ref_smiles": "Cn1ncc(CNc2c(O)cc(F)cc2C#N)c1N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "144b2096-4c8c-4b9e-b305-8d4815b97329", + "task": "add", + "question": "Modify the molecule CC(C)C(CC[NH3+])c1ccc2c(c1)COCC2 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(CC[NH3+])c1ccc2c(c1)COCC2", + "ref_smiles": "CC(C)C(CC[NH3+])c1cc2c(cc1C#N)CCOC2", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "6187e7d9-d977-4467-9e55-bd22fd5b474b", + "task": "add", + "question": "Modify the molecule COCC(C)(O)C1CC1(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC(C)(O)C1CC1(C)C", + "ref_smiles": "COCC(C)(O)C1CC1(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2d599e30-7fac-4ad5-a5ad-505c9b793ef0", + "task": "add", + "question": "Modify the molecule O=C(Nc1ccc(N2CCCC2=O)c(F)c1)C1CCc2cccnc21 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc(N2CCCC2=O)c(F)c1)C1CCc2cccnc21", + "ref_smiles": "O=C(Nc1ccc(N2C(=O)CCC2C(=O)O)c(F)c1)C1CCc2cccnc21", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "80d5469a-cf6c-44d7-8979-c50090a58fad", + "task": "add", + "question": "Modify the molecule CCSCC([NH3+])C(=O)NC(CO)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(C(C)=O)C(C)CC)C(C)SC)C(C)SC)C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCSCC([NH3+])C(=O)NC(CO)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(C(C)=O)C(C)CC)C(C)SC)C(C)SC)C(C)C", + "ref_smiles": "CCSCC([NH3+])C(=O)NC(CO)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(=O)NC(C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(C(C)=O)C(C)C(C)c1ccccc1)C(C)SC)C(C)SC)C(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a2cbb1b1-5c92-4862-bc94-36735df3de41", + "task": "add", + "question": "Please add a benzene ring to the molecule [NH3+]C(c1ccccc1)C(NS(=O)(=O)c1c(-c2ccccc2)cccc1-c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(c1ccccc1)C(NS(=O)(=O)c1c(-c2ccccc2)cccc1-c1ccccc1)c1ccccc1.", + "ref_smiles": "[NH3+]C(c1ccccc1)C(NS(=O)(=O)c1c(-c2ccccc2)cccc1-c1ccccc1-c1ccccc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4f527830-51d1-4faf-936a-5f21c576ed84", + "task": "add", + "question": "Please add a hydroxyl to the molecule [O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "[O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12.", + "ref_smiles": "[O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3O)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d7850cbe-68a1-433b-aa4c-adbe7855395e", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1.", + "ref_smiles": "COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c(O)[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "85c28c2b-75db-4c7c-b620-82cf7d5a417e", + "task": "add", + "question": "Modify the molecule COc1ccccc1C[NH+](C)CC1(C[NH3+])CCCC(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C[NH+](C)CC1(C[NH3+])CCCC(C)C1", + "ref_smiles": "COc1ccccc1C(c1ccccc1)[NH+](C)CC1(C[NH3+])CCCC(C)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1822de63-ee30-435c-9a3f-c19463733f96", + "task": "add", + "question": "Modify the molecule C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1", + "ref_smiles": "C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b5352d34-7926-4bfb-a991-9e6a254c186f", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C1C=C(c2ccccc2)OC1C(=O)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1C=C(c2ccccc2)OC1C(=O)c1ccccc1.", + "ref_smiles": "O=C1C=C(c2ccccc2)OC1C(=O)c1cccc(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7c055d25-db98-49d3-9e79-d204e27f9960", + "task": "add", + "question": "Modify the molecule CC(C)C(C)C(O)C(O)C(C)C1CCC2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(C)C(O)C(O)C(C)C1CCC2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C", + "ref_smiles": "CC(C)C(C)C(O)C(O)C(C)C1CC(O)C2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f4867874-3ae3-4820-8f1a-32f59ce4fc04", + "task": "add", + "question": "Modify the molecule CCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)[O-])n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)[O-])n1", + "ref_smiles": "CCCc1ncc(C(=O)c2ccc(C)c(C)c2O)c(C(=O)[O-])n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6c15f6a9-98e0-4f85-9457-f569c812b155", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1nccs1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1nccs1.", + "ref_smiles": "O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1ncc(O)s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dc53a7ad-1c44-4200-90b4-ee465518470c", + "task": "add", + "question": "Modify the molecule CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1ccccc1", + "ref_smiles": "CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "06d8952b-092d-4f4e-a8c5-16feb04f2b91", + "task": "add", + "question": "Modify the molecule Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)cs1", + "ref_smiles": "Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)c(-c4ccccc4)c3)CC2)cs1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a6826bc9-0784-4244-b8bb-7ed06f736b46", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1=NCC2(C[NH+]3CCC2C3)O1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1=NCC2(C[NH+]3CCC2C3)O1.", + "ref_smiles": "CC1=NCC2(C[NH+]3CC(c4ccccc4)C2C3)O1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6cd042b5-3ee7-4e05-81d5-d57a0dbd85c9", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCc1noc(N)c1-c1cccc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1noc(N)c1-c1cccc(C(F)(F)F)c1.", + "ref_smiles": "CCCc1noc(N)c1-c1cc(C(F)(F)F)ccc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "80c0c992-066c-4506-bd78-c7bf63a8a8a1", + "task": "add", + "question": "Please add a carboxyl to the molecule [NH3+]C(c1cc(F)cc(F)c1)c1nnc(CC(=O)[O-])o1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(c1cc(F)cc(F)c1)c1nnc(CC(=O)[O-])o1.", + "ref_smiles": "[NH3+]C(c1nnc(CC(=O)[O-])o1)c1cc(F)cc(F)c1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "edeb6325-765e-454e-88ce-79c61e0c5ec9", + "task": "add", + "question": "Modify the molecule CCOC(=O)C1(C(=O)OCC)C=C(C(=O)OC)C[NH2+]1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C1(C(=O)OCC)C=C(C(=O)OC)C[NH2+]1", + "ref_smiles": "CCOC(=O)C1(C(=O)OCC)[NH2+]CC(C(=O)OC)=C1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ed9b754b-3b8e-4260-865a-cbd06b17fc3e", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(O)C1CC[NH+](Cc2c[nH+]c3ccc(Br)cn23)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)C1CC[NH+](Cc2c[nH+]c3ccc(Br)cn23)C1.", + "ref_smiles": "CC(O)C1C[NH+](Cc2c[nH+]c3ccc(Br)cn23)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "bfe8ed37-27d8-4dad-b77b-291f16bdf63c", + "task": "add", + "question": "Modify the molecule O=C(NC1CCCCCC1)N1CCC(c2ccncn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCCCCC1)N1CCC(c2ccncn2)CC1", + "ref_smiles": "O=C(NC1CCCCCC1O)N1CCC(c2ccncn2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d42d733c-c389-41b1-bc6f-1e0e90996f6d", + "task": "add", + "question": "Modify the molecule CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2)cc1", + "ref_smiles": "CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dcd57c87-c8ac-4ba4-bbb1-5aee7fc81eb3", + "task": "add", + "question": "Modify the molecule CC(CO)(CO)Nc1c(N)c[nH+]c2ccc(Br)cc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CO)(CO)Nc1c(N)c[nH+]c2ccc(Br)cc12", + "ref_smiles": "CC(CO)(CO)Nc1c(N)c[nH+]c2cc(-c3ccccc3)c(Br)cc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0d7a209d-c4d3-4153-af7c-c7c6703a660e", + "task": "add", + "question": "Modify the molecule CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1ccccc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1ccccc1", + "ref_smiles": "CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1cccc(N)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "1686eb7e-286f-41f8-9fe9-76fc64c89d8c", + "task": "add", + "question": "Please add a aldehyde to the molecule C1CCC(C2NC(C34CC5CC(CC(C5)C3)C4)=[NH+]C2C2CCCCC2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C1CCC(C2NC(C34CC5CC(CC(C5)C3)C4)=[NH+]C2C2CCCCC2)CC1.", + "ref_smiles": "O=CCC1CCCCC1C1NC(C23CC4CC(CC(C4)C2)C3)=[NH+]C1C1CCCCC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "3fc302af-a6ac-4924-98e0-d661c39afb96", + "task": "add", + "question": "Please add a amine to the molecule CCCCC(OC1CC2CCC(C1)[NH+]2CCCC)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(OC1CC2CCC(C1)[NH+]2CCCC)c1ccccc1.", + "ref_smiles": "CCCCC(OC1CC2CCC(C1)[NH+]2CCC(C)N)c1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "453faa41-02ce-46b4-bd19-628e30349d28", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1.", + "ref_smiles": "Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "342eb66d-3423-4a92-ace3-39371736adb0", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC(C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1c(C)cccc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1c(C)cccc1C.", + "ref_smiles": "Cc1ccccc1NC(=O)C(c1c(C)cccc1C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C)C(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "af25c516-d308-43ee-8ffc-d56e3ee2c029", + "task": "add", + "question": "Please add a thiol to the molecule C=NC=CC(C(=O)[O-])=C(C)Nc1nn(CCC2CCCC2)c2ccc(F)cc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=NC=CC(C(=O)[O-])=C(C)Nc1nn(CCC2CCCC2)c2ccc(F)cc12.", + "ref_smiles": "CC(Nc1nn(CCC2CCCC2)c2ccc(F)cc12)=C(C=CN=CS)C(=O)[O-]", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "222dcf70-a8aa-432c-8da2-0eea96db9e90", + "task": "add", + "question": "Please add a thiol to the molecule C[NH+]=C(NCCCOc1ccccc1C)N1CCN(c2ccccn2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCCCOc1ccccc1C)N1CCN(c2ccccn2)CC1.", + "ref_smiles": "C[NH+]=C(NCCC(S)Oc1ccccc1C)N1CCN(c2ccccn2)CC1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "2419aaaf-9c8b-4fd6-858e-33df3ca40d58", + "task": "add", + "question": "Modify the molecule C[Si](C)(C)C#CC#CI by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[Si](C)(C)C#CC#CI", + "ref_smiles": "C[Si](C)(C#CC#CI)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "65f6ab35-7985-47b5-97dd-7a18f353ebaa", + "task": "add", + "question": "Please add a carboxyl to the molecule NC(=[NH+]O)c1nccn1-c1nncs1.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=[NH+]O)c1nccn1-c1nncs1.", + "ref_smiles": "NC(=[NH+]O)c1nccn1-c1nnc(C(=O)O)s1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3bc84d43-5cb7-4aaf-9069-294103f2a8ec", + "task": "add", + "question": "Modify the molecule c1nc2c(cc1CN1CC[NH2+]CC1)CCOC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1nc2c(cc1CN1CC[NH2+]CC1)CCOC2", + "ref_smiles": "c1ccc(-c2nc3c(cc2CN2CC[NH2+]CC2)CCOC3)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "430d3338-9cdd-42c5-bc8a-1991a1bb1842", + "task": "add", + "question": "Modify the molecule CN(CC1CCCCC1O)C(=O)c1cccc(Cl)c1Cl by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CC1CCCCC1O)C(=O)c1cccc(Cl)c1Cl", + "ref_smiles": "CN(CC1CCC(C#N)CC1O)C(=O)c1cccc(Cl)c1Cl", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "8af67d3c-c9f6-47aa-901a-b360d8041ca0", + "task": "add", + "question": "Modify the molecule C=C(C)C[NH+](C)CC(C)(CC)C[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C[NH+](C)CC(C)(CC)C[NH3+]", + "ref_smiles": "CCC(C)(C[NH3+])C[NH+](C)CC(C)=CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6f8cce8a-44f8-45d0-b0c5-c0f7cd921141", + "task": "add", + "question": "Please add a aldehyde to the molecule C#CC(CC)NC(=O)C1(C[NH3+])CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CC(CC)NC(=O)C1(C[NH3+])CCCC1.", + "ref_smiles": "C#CC(NC(=O)C1(C[NH3+])CCCC1)C(C)CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "4e89ff7b-e641-49d2-a515-ac3fa7bc5736", + "task": "add", + "question": "Please add a benzene ring to the molecule CN1CC[NH+](CCC(=O)NN)C(C)(C)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN1CC[NH+](CCC(=O)NN)C(C)(C)C1=O.", + "ref_smiles": "CN1C(=O)C(C)(C)[NH+](CCC(=O)NN)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "11ff89b4-b604-49af-a543-62c64001f2e0", + "task": "add", + "question": "Modify the molecule CN(CCC(=O)[O-])C(=O)NCC1CCCc2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CCC(=O)[O-])C(=O)NCC1CCCc2ccccc21", + "ref_smiles": "CN(CCC(=O)[O-])C(=O)NCC1(c2ccccc2)CCCc2ccccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d041e3a2-e076-461a-b949-83f6fcba9f25", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)cc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)cc12.", + "ref_smiles": "Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)c(O)c12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "de4edfcf-d816-46cc-a97f-51eb897b421d", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccccc1C=CCN(CC[NH+]1CCN(C(=O)c2ccc(F)cc2)CC1)C(=O)CC(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C=CCN(CC[NH+]1CCN(C(=O)c2ccc(F)cc2)CC1)C(=O)CC(C)(C)C.", + "ref_smiles": "CC(C)(C)CC(=O)N(CC=Cc1ccccc1O)CC[NH+]1CCN(C(=O)c2ccc(F)cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "513219a8-3f12-4bdf-b9f5-1fc840ac933b", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1ccnc(Nc2ccc(C(=O)[O-])c(C)c2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccnc(Nc2ccc(C(=O)[O-])c(C)c2)n1.", + "ref_smiles": "Cc1ccnc(Nc2cc(C)c(C(=O)[O-])cc2C(=O)O)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c761ecb4-3740-4ed5-9bba-72d7edbb53c4", + "task": "add", + "question": "Modify the molecule CC=C(C)C(=O)Nc1cccc(-n2cccc2)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC=C(C)C(=O)Nc1cccc(-n2cccc2)c1", + "ref_smiles": "CC=C(C)C(=O)Nc1cccc(-n2cccc2C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4414a1ea-979f-43a9-99f0-7387d39af6c8", + "task": "add", + "question": "Modify the molecule COc1ccc2ccccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc2ccccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21", + "ref_smiles": "COc1ccc2c(-c3ccccc3)cccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5d5a4535-84ef-454b-9bab-64a18f92bade", + "task": "add", + "question": "Modify the molecule COCCN(CC(F)(F)F)S(=O)(=O)c1ccc(F)cc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCN(CC(F)(F)F)S(=O)(=O)c1ccc(F)cc1F", + "ref_smiles": "COCCN(CC(F)(F)F)S(=O)(=O)c1c(F)cc(F)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f4b068f7-0c5c-4eb2-8fdb-e0e688f6e586", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(CNC=S)c1ccc(C(C)CNC=S)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CNC=S)c1ccc(C(C)CNC=S)cc1.", + "ref_smiles": "CC(CNC=S)c1ccc(C(C)C(NC=S)c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4252d6b7-11c4-4acb-b0fc-933d7f13047e", + "task": "add", + "question": "Modify the molecule CCOC(=O)C([NH3+])CCSCCCC1CCCO1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C([NH3+])CCSCCCC1CCCO1", + "ref_smiles": "CCOC(=O)C([NH3+])C(CSCCCC1CCCO1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "166dfdbe-3404-4955-9b70-6ca84f4bc706", + "task": "add", + "question": "Modify the molecule c1cc(-c2ccc3c(c2)C[NH2+]CC3)c2cc[nH]c2n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1cc(-c2ccc3c(c2)C[NH2+]CC3)c2cc[nH]c2n1", + "ref_smiles": "Oc1c(-c2ccnc3[nH]ccc23)ccc2c1C[NH2+]CC2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d4a4688b-9413-4ea4-a224-bbc86a837985", + "task": "add", + "question": "Modify the molecule CCCCC([NH3+])(CCCC)C1(c2ccccc2)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC([NH3+])(CCCC)C1(c2ccccc2)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1", + "ref_smiles": "CCCCC([NH3+])(CCCC)C1(c2ccccc2O)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8b686130-ad70-450c-9acb-7be68ffff4a1", + "task": "add", + "question": "Modify the molecule Nc1ccc(-n2nnc(S(=O)(=O)c3ccccc3Br)c2-c2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc(-n2nnc(S(=O)(=O)c3ccccc3Br)c2-c2ccccc2)cc1", + "ref_smiles": "Nc1ccc(-n2nnc(S(=O)(=O)c3ccc(O)cc3Br)c2-c2ccccc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0a98e866-d5e6-4a0c-acbf-5470487163f0", + "task": "add", + "question": "Please add a hydroxyl to the molecule N=C1C=NC2=CN=C[N+]2([NH3+])C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N=C1C=NC2=CN=C[N+]2([NH3+])C1.", + "ref_smiles": "N=C1C=NC2=CN=C(O)[N+]2([NH3+])C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4476d4ea-1509-4ca8-8daa-a4f640af1bbb", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccccc1", + "ref_smiles": "CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccc(C(=O)O)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "853f922d-9b15-4bad-abf6-8201621acbc9", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)N1CCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)N1CCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)CC1.", + "ref_smiles": "COC(=O)N1CCN(C(=O)Nc2ccc([N+](=O)[O-])cc2-c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "22b673a2-1873-4f61-b07c-78706652408b", + "task": "add", + "question": "Please add a aldehyde to the molecule [NH3+]C1(C(=O)N2CCN(C(=O)c3ccc(C4Nc5ccccc5S4)cc3)CC2)CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1(C(=O)N2CCN(C(=O)c3ccc(C4Nc5ccccc5S4)cc3)CC2)CCC1.", + "ref_smiles": "[NH3+]C1(C(=O)N2CCN(C(=O)c3ccc(C4Nc5ccccc5S4)cc3)CC2CC=O)CCC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "93f4dd90-23ee-4893-b7cd-e5e4daf80ef3", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCCCCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1.", + "ref_smiles": "CCCCCCCCCCC(CCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ec766670-d71e-423d-ad19-205ded758931", + "task": "add", + "question": "Modify the molecule COc1ccc2c(c1)c(C1C(c3ccc(OC)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc2c(c1)c(C1C(c3ccc(OC)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C", + "ref_smiles": "COc1ccc2c(c1)c(C1C(c3ccc(OC)c(O)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dbb9ceba-26c3-41b4-b00a-9265e5c379b6", + "task": "add", + "question": "Please add a hydroxyl to the molecule C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)cc1.", + "ref_smiles": "C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a5c8faf6-61cf-4229-b1d1-76d15d3463de", + "task": "add", + "question": "Modify the molecule COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3)C2=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3)C2=O)cc1", + "ref_smiles": "COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3-c3ccccc3C2=O)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d3c3aac1-ae11-4856-8c54-ae27bd5bd9f6", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CN(S(=O)(=O)CCOCC2CCCC2)CCS1(=O)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CN(S(=O)(=O)CCOCC2CCCC2)CCS1(=O)=O.", + "ref_smiles": "O=S1(=O)CCN(S(=O)(=O)CCOCC2CCCC2)CC1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c4bd1ff2-5afb-48f4-9925-bbe34208ca18", + "task": "add", + "question": "Modify the molecule CCc1ccc(C2[NH2+]C(CC)C(=O)N2CC)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(C2[NH2+]C(CC)C(=O)N2CC)cc1", + "ref_smiles": "CCc1ccc(C2[NH2+]C(CC)C(=O)N2C(C)C(=O)O)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "84821d31-8e31-4a35-9240-14729c3d9746", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OC.", + "ref_smiles": "COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "523fa3f4-03fa-40a3-9e7b-f87e58517e83", + "task": "add", + "question": "Please add a carboxyl to the molecule CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2C)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2C)n1.", + "ref_smiles": "CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2(C)C(=O)O)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4fe11192-e972-49c5-a596-b6b755ef937f", + "task": "add", + "question": "Modify the molecule COCCNC(=O)Cc1ccc(C(C)(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCNC(=O)Cc1ccc(C(C)(C)C)cc1", + "ref_smiles": "COCCNC(=O)Cc1ccc(C(C)(C)Cc2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2d6ea402-6564-4cfe-abce-fd87557a5fda", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1)N(C)C(=O)c1ccc(Cl)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1)N(C)C(=O)c1ccc(Cl)c(Cl)c1.", + "ref_smiles": "CN(C(=O)c1ccc(Cl)c(Cl)c1)C(CCO)c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "22c221ca-4547-4414-be0b-abd0411ee878", + "task": "add", + "question": "Modify the molecule C#CC(OC1CCCCO1)C(C)(C)CCOCCOCCC(C)(C)CO[Si](C)(C)C(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CC(OC1CCCCO1)C(C)(C)CCOCCOCCC(C)(C)CO[Si](C)(C)C(C)(C)C", + "ref_smiles": "C#CC(OC1CCCCO1)C(C)(C)CCOCCOCCC(C)(CO)CO[Si](C)(C)C(C)(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "93a0c520-8ccb-45bb-91cd-9cf15bead5bc", + "task": "add", + "question": "Please add a amine to the molecule O=C1C(Cc2ccccc2)CCC2C=CN(c3ccccc3)N1C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1C(Cc2ccccc2)CCC2C=CN(c3ccccc3)N1C2.", + "ref_smiles": "Nc1ccccc1CC1CCC2C=CN(c3ccccc3)N(C2)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d476e3d3-894c-48b3-8c16-bac1cdb62198", + "task": "add", + "question": "Modify the molecule CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)C1)c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)C1)c1ccccc1", + "ref_smiles": "CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2O)C1)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "581873e2-37c3-4456-b51d-e6a36f823bed", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5CCCc6ccccc65)nc34)n2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5CCCc6ccccc65)nc34)n2)cc1.", + "ref_smiles": "Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5c6ccccc6CCC5O)nc34)n2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "92d92657-3963-47ca-a65e-a4084a39f519", + "task": "add", + "question": "Modify the molecule Cn1c(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)nc2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1c(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)nc2ccccc21", + "ref_smiles": "Cn1c(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)nc2cccc(-c3ccccc3)c21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d4ca4eb0-5130-42a0-b0e7-aec7e00432f7", + "task": "add", + "question": "Please add a hydroxyl to the molecule CN(C(=O)OC(C)(C)C)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C(=O)OC(C)(C)C)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1.", + "ref_smiles": "CC(C)(C)OC(=O)N(CO)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "42b73907-b69e-4b66-a82f-5e3fa0c2ca7e", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(CCOC3)C2)cc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(CCOC3)C2)cc1C.", + "ref_smiles": "Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(COC(O)C3)C2)cc1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7ce5c437-1b54-4646-ac79-8795d02c7d39", + "task": "add", + "question": "Modify the molecule C1CC(SCC[NH2+]C(C2CC2)C2CC2)CC[NH2+]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C1CC(SCC[NH2+]C(C2CC2)C2CC2)CC[NH2+]1", + "ref_smiles": "c1ccc(C(CSC2CC[NH2+]CC2)[NH2+]C(C2CC2)C2CC2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "306bb9c4-bf53-4b12-a122-7bb05b81ddfd", + "task": "add", + "question": "Modify the molecule Cn1cc(CNC(=O)COc2ccccc2)ccc1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc(CNC(=O)COc2ccccc2)ccc1=O", + "ref_smiles": "O=C(COc1ccccc1)NCc1ccc(=O)n(CO)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b4f3d788-4357-4e87-969d-bb981b568705", + "task": "add", + "question": "Please add a nitrile to the molecule CCc1nn(CC)c(CC(NN)C2CCC(CC)C2)c1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nn(CC)c(CC(NN)C2CCC(CC)C2)c1Cl.", + "ref_smiles": "CCc1nn(CC)c(CC(C#N)(NN)C2CCC(CC)C2)c1Cl", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "a4c991d8-1b02-49d3-8d27-3a5031d3cc18", + "task": "add", + "question": "Modify the molecule Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)C", + "ref_smiles": "Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fc836b7c-76ce-42ce-ad68-fb63d699d951", + "task": "add", + "question": "Modify the molecule N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1", + "ref_smiles": "N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a8887f20-078b-4429-8561-5512f6390c02", + "task": "add", + "question": "Modify the molecule COC(=O)N1CCCN(C(=O)c2ccccn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)N1CCCN(C(=O)c2ccccn2)CC1", + "ref_smiles": "COC(=O)N1CCCN(C(=O)c2ccccn2)C(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3d9646d4-bfc6-433e-8077-978124ad576a", + "task": "add", + "question": "Modify the molecule O=C=NC=C(N=C=O)C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C=NC=C(N=C=O)C1CCCCC1", + "ref_smiles": "O=C=NC(=C(N=C=O)C1CCCCC1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "846c5051-4620-4895-9112-5aa04b80ef3f", + "task": "add", + "question": "Modify the molecule CCC(C#N)S(=O)(=O)NCC(O)C(F)(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C#N)S(=O)(=O)NCC(O)C(F)(F)F", + "ref_smiles": "CCC(C#N)S(=O)(=O)NC(C(=O)O)C(O)C(F)(F)F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f992f4f7-0666-4d36-8939-f6c205453540", + "task": "add", + "question": "Modify the molecule CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1", + "ref_smiles": "CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "eb8588ee-a2dd-4b01-9227-ef5fa49e4fb2", + "task": "add", + "question": "Modify the molecule COCCCN(CC(=O)N(CCOC)Cc1cccn1C)S(=O)(=O)c1cccc2cccnc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCN(CC(=O)N(CCOC)Cc1cccn1C)S(=O)(=O)c1cccc2cccnc12", + "ref_smiles": "COCCCN(CC(=O)N(CCOC)C(c1ccccc1)c1cccn1C)S(=O)(=O)c1cccc2cccnc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6c0d1b5c-4b3b-4924-bbea-ca774056c8c0", + "task": "add", + "question": "Modify the molecule C[Si](C)(C)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[Si](C)(C)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21", + "ref_smiles": "C[Si](C)(CS)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "1b0b3f45-6bcf-432c-b7ad-84eb9f1b0a96", + "task": "add", + "question": "Please add a benzene ring to the molecule CN1C(=O)N(Cc2ccccc2)S(=O)(=O)c2ccsc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN1C(=O)N(Cc2ccccc2)S(=O)(=O)c2ccsc21.", + "ref_smiles": "CN1C(=O)N(Cc2cccc(-c3ccccc3)c2)S(=O)(=O)c2ccsc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9b8dd984-8c57-40b0-b90b-8f5b55e5d160", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCC1(c2cccc(C3(C[NH3+])CC3)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC1(c2cccc(C3(C[NH3+])CC3)c2)CC1.", + "ref_smiles": "COCC1(c2cc(O)cc(C3(C[NH3+])CC3)c2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0e62632c-6cfd-41ef-a682-2a42e2eefa4a", + "task": "add", + "question": "Modify the molecule CCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1ccc(CC)cc1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1ccc(CC)cc1", + "ref_smiles": "CCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1ccc(CCS)cc1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "b0be3b70-fe89-4b3c-8d84-6cb39ea3e59c", + "task": "add", + "question": "Modify the molecule [NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)cc4)c3c2Cl)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)cc4)c3c2Cl)CC1", + "ref_smiles": "[NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)c(C(=O)O)c4)c3c2Cl)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "5ef78257-9341-458b-b6ba-5340410dcb06", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1.", + "ref_smiles": "COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "79982c89-f6f0-4c22-8c94-c45a27ee200b", + "task": "add", + "question": "Please add a thiol to the molecule CCOO[Si](CCC[P+](CC)(CC)CC)(OOCC)OOCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOO[Si](CCC[P+](CC)(CC)CC)(OOCC)OOCC.", + "ref_smiles": "CCOO[Si](CC(S)C[P+](CC)(CC)CC)(OOCC)OOCC", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "eafa46bd-c2d5-46f9-b82d-f6303e4cc737", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])CC1)C(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])CC1)C(=O)[O-].", + "ref_smiles": "CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])C(c2ccccc2)C1)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a0802ed1-b616-459c-a449-97e7f81fb0bb", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(CO)Nc1ccc2[nH]c(=O)[nH]c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(CO)Nc1ccc2[nH]c(=O)[nH]c2c1.", + "ref_smiles": "CC(C)(CO)Nc1cc2[nH]c(=O)[nH]c2cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7d5a1fb0-24f9-498f-8197-3c8a0edaa607", + "task": "add", + "question": "Modify the molecule C[NH2+]C(C)C(=O)NC1CCCC1n1ccnc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(C)C(=O)NC1CCCC1n1ccnc1", + "ref_smiles": "C[NH2+]C(C)C(=O)NC1C(O)CCC1n1ccnc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "294cfd46-09d5-43a3-94ca-24c2d1bf2d7b", + "task": "add", + "question": "Modify the molecule CCCCCC(=O)OCC(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC(=O)OCC(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1", + "ref_smiles": "CCCCCC(=O)OC(c1ccccc1)C(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6a0cc142-9567-45c3-9449-ba38b334ae22", + "task": "add", + "question": "Modify the molecule CCCNc1nc(-c2ncccc2CC)nc(C)c1CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNc1nc(-c2ncccc2CC)nc(C)c1CC", + "ref_smiles": "CCc1cccnc1-c1nc(C)c(CC)c(NCCCO)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0746d35d-3bea-4922-8325-c92175d20ccf", + "task": "add", + "question": "Please add a carboxyl to the molecule CCc1ccc(OC(F)(F)F)cc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(OC(F)(F)F)cc1C.", + "ref_smiles": "Cc1cc(OC(F)(F)F)ccc1CCC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "cdf256a9-9f22-4124-92a4-896652c22f44", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(COC(=O)C(NC(=O)c1ccco1)c1ccccc1)Nc1cccc(C(=O)NC2CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(COC(=O)C(NC(=O)c1ccco1)c1ccccc1)Nc1cccc(C(=O)NC2CC2)c1.", + "ref_smiles": "O=C(COC(=O)C(NC(=O)c1ccco1)c1cccc(O)c1)Nc1cccc(C(=O)NC2CC2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "be39721a-4481-4d01-b3f7-c5eef4598c4f", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1cc(C)ccc1OCC[NH+]1CCC(C#N)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(C)ccc1OCC[NH+]1CCC(C#N)CC1.", + "ref_smiles": "Cc1ccc(OCC[NH+]2CCC(C#N)CC2)c(OCC(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "84037d87-2c06-4f71-9256-83dc71426962", + "task": "add", + "question": "Modify the molecule CC[NH2+]C1CCC(C(C)C)CC1Sc1cc(C)cc(C)n1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C1CCC(C(C)C)CC1Sc1cc(C)cc(C)n1", + "ref_smiles": "CC[NH2+]C1(C#N)CCC(C(C)C)CC1Sc1cc(C)cc(C)n1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "6b497037-bea0-49da-b8e6-a8f25e700dd6", + "task": "add", + "question": "Please add a nitrile to the molecule Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3CCC3)c(N)c2=O)c(C)nc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3CCC3)c(N)c2=O)c(C)nc1C.", + "ref_smiles": "Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3(C#N)CCC3)c(N)c2=O)c(C)nc1C", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "f2bbbd23-2376-4825-9013-087b39de4b12", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(CCc1ccc(F)cc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCc1ccc(F)cc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1.", + "ref_smiles": "O=C(CCc1ccc(F)cc1-c1ccccc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "602e7e85-24cc-440d-81ca-907f9596c519", + "task": "add", + "question": "Please add a aldehyde to the molecule CC[NH+](CC1(CS)CCCCCC1)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](CC1(CS)CCCCCC1)C1CC1.", + "ref_smiles": "CC[NH+](CC1(CS)CCCCCC1CC=O)C1CC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "cce400af-726e-4f3f-bbd1-cbd8f5af528d", + "task": "add", + "question": "Modify the molecule CC1CN(C(=O)CCc2ccsc2)CC(C(=O)[O-])O1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CN(C(=O)CCc2ccsc2)CC(C(=O)[O-])O1", + "ref_smiles": "NCC1CN(C(=O)CCc2ccsc2)CC(C(=O)[O-])O1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "485a37af-bee3-4492-8fc3-c9ce65be1b32", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1cc(OC)c(S(=O)(=O)N(C)CC(O)CO)cc1-c1ccnn1-c1ccccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(OC)c(S(=O)(=O)N(C)CC(O)CO)cc1-c1ccnn1-c1ccccc1Cl.", + "ref_smiles": "COc1cc(OC)c(S(=O)(=O)N(C)CC(O)CO)cc1-c1cc(O)nn1-c1ccccc1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a58afda5-7171-4335-b2af-5b0f8558b759", + "task": "add", + "question": "Modify the molecule CCOC(=O)c1ccc(Oc2coc3c(C[NH+]4CCN(c5ccc(OC)cc5)CC4)c(=O)ccc-3c2O)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1ccc(Oc2coc3c(C[NH+]4CCN(c5ccc(OC)cc5)CC4)c(=O)ccc-3c2O)cc1", + "ref_smiles": "COc1ccc(N2CC[NH+](Cc3c4occ(Oc5ccc(C(=O)OC(C)N)cc5)c(O)c-4ccc3=O)CC2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "276953c7-a621-477e-9161-8cff76f1cb52", + "task": "add", + "question": "Modify the molecule Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)CC2C)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)CC2C)o1", + "ref_smiles": "Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)C(O)C2C)o1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1b3c3961-1d02-4fa5-b655-bb24d270a7ba", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cccc(CNc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(CNc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1.", + "ref_smiles": "Cc1cccc(C(O)Nc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7c06230d-b9d2-4652-b264-ed26dc89bdc6", + "task": "add", + "question": "Please add a nitrile to the molecule CCC(CC)(C(=O)[O-])[NH+](C)Cc1ccccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)(C(=O)[O-])[NH+](C)Cc1ccccn1.", + "ref_smiles": "CCC(CC)(C(=O)[O-])[NH+](C)Cc1ncccc1C#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "c180fa89-266d-4306-86ba-7c11c469c68a", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)COc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)COc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)c1.", + "ref_smiles": "CC(C)COc1cc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)ccc1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4df7f27c-c344-429d-9aa4-9720afe27de5", + "task": "add", + "question": "Please add a amine to the molecule Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC[NH+](C)C)c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC[NH+](C)C)c2c1.", + "ref_smiles": "Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC(N)[NH+](C)C)c2c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "0657bf57-16a0-42ce-b2c1-f2fbe76254f8", + "task": "add", + "question": "Modify the molecule CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3ccccc3c1C2 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3ccccc3c1C2", + "ref_smiles": "CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3c(CC=O)cccc3c1C2", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "f6c1f44b-2678-448f-a43c-fa4a30340688", + "task": "add", + "question": "Modify the molecule CCC(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1", + "ref_smiles": "CCC(O)(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6ccf9d60-079d-4264-ac68-d0de245422f5", + "task": "add", + "question": "Please add a amine to the molecule CCc1cc([N+](=O)[O-])c(C(C)CO)cc1Sc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1cc([N+](=O)[O-])c(C(C)CO)cc1Sc1ccccc1.", + "ref_smiles": "CCc1cc([N+](=O)[O-])c(C(C)C(N)O)cc1Sc1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "bc3bbaf8-0e32-4860-b888-357ba40a6414", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2ccccc2)cc1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2ccccc2)cc1=O.", + "ref_smiles": "Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2cccc(-c3ccccc3)c2)cc1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9bd3fa74-7e86-4a13-8c49-594c0a47b423", + "task": "add", + "question": "Please add a hydroxyl to the molecule c1[nH]cc2c1C1CCCC2CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1[nH]cc2c1C1CCCC2CC1.", + "ref_smiles": "OC1CCC2CCC1c1c[nH]cc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "36e29e79-383b-402d-85df-ef06eaf7ff17", + "task": "add", + "question": "Please add a amine to the molecule Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1C.", + "ref_smiles": "Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1CN", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d63e55b3-05e3-43ff-aad7-8cca405788c2", + "task": "add", + "question": "Modify the molecule CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2", + "ref_smiles": "CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d8551743-dcd8-4a24-82dc-6ffbc7166494", + "task": "add", + "question": "Please add a hydroxyl to the molecule COP(=O)(OC)C(=C[N+](=O)[O-])C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COP(=O)(OC)C(=C[N+](=O)[O-])C(C)C.", + "ref_smiles": "COP(=O)(OC)C(=C(O)[N+](=O)[O-])C(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "29232926-85fc-4661-ba2f-83cd98faf9c2", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2.", + "ref_smiles": "COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e617313d-ce15-4e50-ab44-4e7be1d68d66", + "task": "add", + "question": "Please add a benzene ring to the molecule C=C(C)c1ccnc(C(=C)C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)c1ccnc(C(=C)C)c1.", + "ref_smiles": "C=C(C)c1ccnc(C(C)=Cc2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b7bc8ed4-dbff-4bf3-8a70-998a4b2f36bb", + "task": "add", + "question": "Please add a benzene ring to the molecule [NH3+]CCN(CCOc1ccccc1F)CCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCN(CCOc1ccccc1F)CCc1ccccc1.", + "ref_smiles": "[NH3+]CCN(CCOc1ccccc1F)CCc1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "92f18bc8-8757-42bf-a568-e75fda80ef45", + "task": "add", + "question": "Modify the molecule O=C(CCCCCn1ccc(=O)cc1)N1CCC[NH2+]CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCCCCn1ccc(=O)cc1)N1CCC[NH2+]CC1", + "ref_smiles": "O=C(O)C1C[NH2+]CCCN1C(=O)CCCCCn1ccc(=O)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "7c291329-efe4-4c1e-a72b-f194b0b44fb0", + "task": "add", + "question": "Modify the molecule COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)cc1", + "ref_smiles": "COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f10d801d-9afb-4eee-ba4d-030a047917fd", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCNC(=O)c1cccc(NC(=O)c2cccn2C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=O)c1cccc(NC(=O)c2cccn2C)c1.", + "ref_smiles": "CCNC(=O)c1cc(O)cc(NC(=O)c2cccn2C)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d3d695da-2428-4e54-9071-e2d9c4f49233", + "task": "add", + "question": "Modify the molecule CC1CCC([NH2+]Cc2cc(Cl)cc(Cl)c2O)C(C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCC([NH2+]Cc2cc(Cl)cc(Cl)c2O)C(C)C1", + "ref_smiles": "CC1CCC([NH2+]Cc2cc(Cl)c(C(=O)O)c(Cl)c2O)C(C)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "01b35f2f-bc25-419a-bdc8-b0f21e15adb0", + "task": "add", + "question": "Modify the molecule CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2)CC1", + "ref_smiles": "CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2-c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "897549b3-3ee7-49f3-94e0-b40a5494905a", + "task": "add", + "question": "Please add a aldehyde to the molecule CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccncc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccncc1.", + "ref_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccnc(CC=O)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "2bafeca8-da8b-40e5-b4db-3f8a4a61d00e", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2)cc1[N+](=O)[O-] by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2)cc1[N+](=O)[O-]", + "ref_smiles": "Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2CC=O)cc1[N+](=O)[O-]", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "6d2142dc-9fb0-427d-b26d-00b20bb27010", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(NC(=O)C(C)(COC=O)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)C(C)(COC=O)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1.", + "ref_smiles": "CC(NC(=O)C(C)(COC(=O)c1ccccc1)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d9540c81-e668-4765-82c8-6469240f9e26", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C([NH3+])c2ccc(C(C)C)cc2)c(Br)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C([NH3+])c2ccc(C(C)C)cc2)c(Br)c1.", + "ref_smiles": "Cc1cc(Br)c(C([NH3+])c2ccc(C(C)C)cc2)c(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "25ea5301-70d9-4dff-b1a8-f6ed2de7c5df", + "task": "add", + "question": "Please add a carboxyl to the molecule CC[NH+]1CCN(c2ccccc2NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+]1CCN(c2ccccc2NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CC1.", + "ref_smiles": "CC[NH+]1CCN(c2ccccc2NC(=O)c2cc([N+](=O)[O-])c(N3CCCCC3)cc2C(=O)O)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "468136d8-bd6c-45e4-a948-f0e87f4e1b79", + "task": "add", + "question": "Modify the molecule Nc1cccc(C#Cc2cncc(NC(=O)[O-])c2)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cccc(C#Cc2cncc(NC(=O)[O-])c2)c1", + "ref_smiles": "Nc1cc(N)cc(C#Cc2cncc(NC(=O)[O-])c2)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f6425695-de25-484e-9d9a-1129dcee72ee", + "task": "add", + "question": "Please add a aldehyde to the molecule C=CCOC(=O)N1CCN(c2ccccc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCOC(=O)N1CCN(c2ccccc2)CC1.", + "ref_smiles": "C=CC(CC=O)OC(=O)N1CCN(c2ccccc2)CC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "98be3ab5-7ee4-44e2-bfb9-aec81ed351a0", + "task": "add", + "question": "Please add a carboxyl to the molecule CCCC1CC1NS(=O)(=O)Cc1ccccc1C#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1CC1NS(=O)(=O)Cc1ccccc1C#N.", + "ref_smiles": "CCCC1CC1(NS(=O)(=O)Cc1ccccc1C#N)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a5b10104-3cb6-4e52-b7f2-cf136ccdb9b3", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C2([NH3+])COC2)cc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C2([NH3+])COC2)cc1C.", + "ref_smiles": "Cc1ccc(C2([NH3+])COC2)cc1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7c19be2c-f64a-4b57-bea0-42c4f23fdd5b", + "task": "add", + "question": "Modify the molecule CC(C)CCC(O[Si]CC[Si]OC(CCC(C)C)C(C)C)C(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CCC(O[Si]CC[Si]OC(CCC(C)C)C(C)C)C(C)C", + "ref_smiles": "CC(C)CCC(O[Si]CC[Si]OC(CC(C(=O)O)C(C)C)C(C)C)C(C)C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "5410f117-be5f-4dc7-a6b1-f015fcaf3ed3", + "task": "add", + "question": "Modify the molecule Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2ccccc2)n1C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2ccccc2)n1C", + "ref_smiles": "Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2cccc(N)c2)n1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "7d6edca7-4c3d-40d1-b67e-65fcb37ae54a", + "task": "add", + "question": "Modify the molecule NNC(=O)c1occc1C[NH+]1CCc2ccccc2C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NNC(=O)c1occc1C[NH+]1CCc2ccccc2C1", + "ref_smiles": "NNC(=O)c1occ(-c2ccccc2)c1C[NH+]1CCc2ccccc2C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "89597c3a-feaf-43cc-ad10-9c63ab211f05", + "task": "add", + "question": "Modify the molecule ClC(Cc1nc2ccccc2o1)C1CCCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "ClC(Cc1nc2ccccc2o1)C1CCCO1", + "ref_smiles": "OC1CCC(C(Cl)Cc2nc3ccccc3o2)O1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "af0e79e2-a565-44e7-b042-a7fa8057901e", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC#CCCC(=O)OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC#CCCC(=O)OCC.", + "ref_smiles": "CCC#CCCC(=O)OC(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b4d8d5c8-fae7-41b7-9ff2-1faa4c35b5f9", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C([O-])CCc1cc(-c2ccccc2)ccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])CCc1cc(-c2ccccc2)ccc1Cl.", + "ref_smiles": "O=C([O-])C(Cc1cc(-c2ccccc2)ccc1Cl)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "05da71dd-25eb-4932-8e85-831d41862dbb", + "task": "add", + "question": "Please add a aldehyde to the molecule CCCCCC(=O)NCC(C)(O)C[NH+]1CCOCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC(=O)NCC(C)(O)C[NH+]1CCOCC1.", + "ref_smiles": "CCCCCC(=O)NCC(C)(O)C[NH+]1CCOC(CC=O)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "b4fbac32-e31d-4def-90dd-ed319a6b423b", + "task": "add", + "question": "Please add a benzene ring to the molecule CC[NH+]=C(NC1C2CCOC2C12CCCC2)N1CCC2(CCC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+]=C(NC1C2CCOC2C12CCCC2)N1CCC2(CCC2)C1.", + "ref_smiles": "CC[NH+]=C(NC1C2CCOC2C12CCC(c1ccccc1)C2)N1CCC2(CCC2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1f65a845-f192-47c0-9497-82daf3e0e1dc", + "task": "add", + "question": "Modify the molecule O=C(N1CC2CCS(=O)(=O)C2C1)C1(Cc2cccc(F)c2)CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(N1CC2CCS(=O)(=O)C2C1)C1(Cc2cccc(F)c2)CCCCC1", + "ref_smiles": "NC12CN(C(=O)C3(Cc4cccc(F)c4)CCCCC3)CC1CCS2(=O)=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9d04faf3-1ae8-4ab0-875b-f339a382a8f1", + "task": "add", + "question": "Please add a thiol to the molecule COc1ccc2cc(C(C)[NH2+]C3COC3)ccc2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc2cc(C(C)[NH2+]C3COC3)ccc2c1.", + "ref_smiles": "COc1ccc2cc(C(C)[NH2+]C3COC3)cc(S)c2c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "6b5a5c34-8bd9-4931-973c-721046b529df", + "task": "add", + "question": "Modify the molecule CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4)c3nc2-c2ccc(OCCCCCC)cc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4)c3nc2-c2ccc(OCCCCCC)cc2)cc1", + "ref_smiles": "CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4O)c3nc2-c2ccc(OCCCCCC)cc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0ef868a9-95cb-40d7-81ef-b57fcad9a2f8", + "task": "add", + "question": "Modify the molecule CC1CC[NH+](CCCCNC(=O)NCCOc2ccccc2-c2ccccc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](CCCCNC(=O)NCCOc2ccccc2-c2ccccc2)CC1", + "ref_smiles": "CC1CC[NH+](CCC(CNC(=O)NCCOc2ccccc2-c2ccccc2)c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3bf9939d-62d1-4472-bd42-de0e97dc18d0", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ncccc1C(=O)OCC(=O)NC(C)c1cccc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ncccc1C(=O)OCC(=O)NC(C)c1cccc(Cl)c1.", + "ref_smiles": "CCOc1ncccc1C(=O)OC(O)C(=O)NC(C)c1cccc(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "507a39bb-ae04-4d66-a294-dfaeb1cd5914", + "task": "add", + "question": "Please add a aldehyde to the molecule COCC(C)CNC(=O)C1CNc2ccccc2O1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC(C)CNC(=O)C1CNc2ccccc2O1.", + "ref_smiles": "CC(CNC(=O)C1CNc2ccccc2O1)COCCC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "6beca1c9-d75e-4e2c-8d0c-d20d2c7abd87", + "task": "add", + "question": "Modify the molecule C[NH+]=C(NCC(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCC(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1", + "ref_smiles": "C[NH+]=C(NC(C(=O)O)C(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "86cc55ff-e164-467e-a481-bea3d8f4c585", + "task": "add", + "question": "Modify the molecule CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1", + "ref_smiles": "CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1C#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "08d54ce1-555b-4bc6-9f32-4392a2babe33", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(=O)N1CCN(C(=O)c2ccnc(C(=O)N3CCCC(C)C3)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)N1CCN(C(=O)c2ccnc(C(=O)N3CCCC(C)C3)c2)CC1.", + "ref_smiles": "CC(=O)N1CCN(C(=O)c2cc(C(=O)N3CCCC(C)C3)ncc2O)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e4643ac5-863f-4144-ba85-813c4bd1f1bb", + "task": "add", + "question": "Please add a amine to the molecule Cc1c(NC(=O)c2noc3c2CCCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(NC(=O)c2noc3c2CCCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C.", + "ref_smiles": "Cc1c(NC(=O)c2noc3c2C(N)CCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "853ba79d-a1f2-4353-bd98-e6c77d305fba", + "task": "add", + "question": "Please add a aldehyde to the molecule [NH3+]Cc1cccc(F)c1N(Cc1ccsc1)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]Cc1cccc(F)c1N(Cc1ccsc1)C1CC1.", + "ref_smiles": "[NH3+]Cc1cccc(F)c1N(C1CC1)C(CC=O)c1ccsc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "7d50cb39-2f59-4650-93d6-25e7d24e7679", + "task": "add", + "question": "Please add a benzene ring to the molecule Clc1cnc(N2CC[NH+](Cc3nnnn3C3CC3)CC2)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Clc1cnc(N2CC[NH+](Cc3nnnn3C3CC3)CC2)c(Cl)c1.", + "ref_smiles": "Clc1cnc(N2CC[NH+](C(c3ccccc3)c3nnnn3C3CC3)CC2)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e738aea4-5506-43a3-90b9-21d87bc47874", + "task": "add", + "question": "Modify the molecule Cc1cccc2[nH]c(=O)n(C3CCC[NH2+]3)c(=O)c12 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc2[nH]c(=O)n(C3CCC[NH2+]3)c(=O)c12", + "ref_smiles": "Cc1cccc2[nH]c(=O)n(C3CCC(C(=O)O)[NH2+]3)c(=O)c12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c159c990-186c-45a5-bceb-3e6af592256d", + "task": "add", + "question": "Modify the molecule O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2ccccc2s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2ccccc2s1", + "ref_smiles": "O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2c(-c3ccccc3)cccc2s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "403dc799-2731-405d-9751-5c6b4db2afcb", + "task": "add", + "question": "Modify the molecule CC(=O)NC1C(CCO)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NC1C(CCO)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1", + "ref_smiles": "CC(=O)NC1C(CCO)OC(COCc2ccccc2)C(OCc2ccccc2N)C1OCc1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d29cea5a-fd26-49fa-8471-044d37095540", + "task": "add", + "question": "Please add a benzene ring to the molecule FC(I)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "FC(I)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1.", + "ref_smiles": "FC(I)P(I)(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "071972d1-8caf-47bd-ba39-cd3cfff72567", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)C2)c(=O)[nH]c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)C2)c(=O)[nH]c1C.", + "ref_smiles": "Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)(O)C2)c(=O)[nH]c1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "39580cc8-e0c6-4f49-99c0-f2194f71777f", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc2nc(NC(=O)CC(C)(CF)CF)n(C(C)(C)C)c2nc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc2nc(NC(=O)CC(C)(CF)CF)n(C(C)(C)C)c2nc1C.", + "ref_smiles": "Cc1nc2c(cc1Cc1ccccc1)nc(NC(=O)CC(C)(CF)CF)n2C(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "780a4ee7-02da-4094-9fce-17b87ba83b93", + "task": "add", + "question": "Modify the molecule CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1", + "ref_smiles": "CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d7af32ca-cd18-413a-a064-00f0bd34dbca", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCC(C#C[Si](C(C)C)(C(C)C)C(C)C)CC(=O)Nc1cccc2cccnc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(C#C[Si](C(C)C)(C(C)C)C(C)C)CC(=O)Nc1cccc2cccnc12.", + "ref_smiles": "CCCC(C#C[Si](C(C)C)(C(C)C)C(C)(C)c1ccccc1)CC(=O)Nc1cccc2cccnc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "84e604b4-a214-4b80-9d55-cdd399bb71ab", + "task": "add", + "question": "Modify the molecule Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccccc5)cc4)[nH]c3=O)CC2)cc1Br by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccccc5)cc4)[nH]c3=O)CC2)cc1Br", + "ref_smiles": "Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)[nH]c3=O)CC2)cc1Br", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "bdc7f286-af1d-4b6b-8b6c-3419d6124a84", + "task": "add", + "question": "Modify the molecule O=PCCCc1cccc(O)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=PCCCc1cccc(O)c1", + "ref_smiles": "O=PCCCc1cc(O)ccc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "da5b1c3e-2142-48cb-b28d-435b5491eb7c", + "task": "add", + "question": "Modify the molecule [NH3+]C1CC2CCC(C1)N2C(=O)CC1C=CCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1CC2CCC(C1)N2C(=O)CC1C=CCC1", + "ref_smiles": "[NH3+]C1CC2CCC(C1O)N2C(=O)CC1C=CCC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d7641c8d-9b71-48b0-af0a-7db85823eca3", + "task": "add", + "question": "Modify the molecule CC1CCc2[nH]c(C(CC(C)(C)C)NC(=O)OC(C)(C)C)nc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCc2[nH]c(C(CC(C)(C)C)NC(=O)OC(C)(C)C)nc21", + "ref_smiles": "CC1c2nc(C(CC(C)(C)C)NC(=O)OC(C)(C)C)[nH]c2CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f55bd57b-110a-44f7-9ed6-98215c3e11a0", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1ccccc1O2.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1ccccc1O2.", + "ref_smiles": "Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1cccc(O)c1O2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1fab7eae-68ff-41ce-8989-49f998d0d661", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2ccccc2)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2ccccc2)c1C.", + "ref_smiles": "Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2cccc(-c3ccccc3)c2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c60c4a05-c17e-49a8-b006-59c37da28b6c", + "task": "add", + "question": "Modify the molecule C[NH2+]C(c1cccc(OC)c1)c1ccc(C)c(C)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(c1cccc(OC)c1)c1ccc(C)c(C)c1", + "ref_smiles": "C[NH2+]C(c1cccc(OC)c1)c1ccc(Cc2ccccc2)c(C)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dd9eba27-722a-4f89-a433-dd1214002dfc", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)cc1.", + "ref_smiles": "Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d4f0f150-96cd-46db-9f97-e9f1194f51bd", + "task": "add", + "question": "Modify the molecule Fc1cc(CCl)cc(CCl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Fc1cc(CCl)cc(CCl)c1", + "ref_smiles": "Oc1c(F)cc(CCl)cc1CCl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fa674328-2884-479e-a4b5-a13bc86b2cf3", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6ccccc65)CCC43C)C1CCC2=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6ccccc65)CCC43C)C1CCC2=O.", + "ref_smiles": "CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6c(O)cccc65)CCC43C)C1CCC2=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "11bdf069-6ca4-4a01-9fc2-f99418ccf6b3", + "task": "add", + "question": "Please add a hydroxyl to the molecule C=CC(=O)OC(C=CC(C)=CCCOCc1ccc(OC)cc1)CC=CC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC(=O)OC(C=CC(C)=CCCOCc1ccc(OC)cc1)CC=CC.", + "ref_smiles": "C=CC(=O)OC(C=C(O)C(C)=CCCOCc1ccc(OC)cc1)CC=CC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b4977391-a627-483b-adeb-0a351f31845f", + "task": "add", + "question": "Modify the molecule COc1ccccc1C1CCc2nc3ccc(Br)nc3n21 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C1CCc2nc3ccc(Br)nc3n21", + "ref_smiles": "NCOc1ccccc1C1CCc2nc3ccc(Br)nc3n21", + "add_group": "amine", + "remove_group": null + }, + { + "id": "735c1e5a-9615-46b3-b4be-b1ab55ec09b0", + "task": "add", + "question": "Modify the molecule O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1cc(C(F)(F)F)ccc1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1cc(C(F)(F)F)ccc1Cl", + "ref_smiles": "O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1c(Cl)ccc(C(F)(F)F)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f59097eb-6e55-4330-a077-a1b2727132e8", + "task": "add", + "question": "Modify the molecule Cn1cc(CC[NH+](C)CC2(O)CCOCC2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc(CC[NH+](C)CC2(O)CCOCC2)cn1", + "ref_smiles": "Cn1cc(CC(O)[NH+](C)CC2(O)CCOCC2)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "711d978a-4d96-4b99-8bcc-0f3047dc2cac", + "task": "add", + "question": "Please add a amine to the molecule COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)CC2)c1.", + "ref_smiles": "COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)C(N)C2)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8086f0b3-f6a5-4352-ac6c-2ed26ec2e941", + "task": "add", + "question": "Modify the molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CC[NH+](CC(=O)N2CCCC2)CC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CC[NH+](CC(=O)N2CCCC2)CC1", + "ref_smiles": "NC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)N1CC[NH+](CC(=O)N2CCCC2)CC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8c7e2784-a62a-4ad4-9132-fb076827cf83", + "task": "add", + "question": "Modify the molecule CC#CC1([NH3+])CCC(C(C)(C)CC)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC#CC1([NH3+])CCC(C(C)(C)CC)CC1", + "ref_smiles": "CC#CC1([NH3+])CCC(C(C)(C)CC)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0f0bbafe-e38d-4d60-8f9d-a491e29b3d86", + "task": "add", + "question": "Modify the molecule Cc1ccc2c(Cl)c(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)sc2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2c(Cl)c(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)sc2c1", + "ref_smiles": "Cc1cc2sc(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)c(Cl)c2cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4a426b86-4e29-4090-b2c9-2413ee43336c", + "task": "add", + "question": "Modify the molecule C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4ccc(OC(=O)C(=C)C)c(C(F)(F)F)c4)c(S(=O)(=O)[O-])c3)cc2)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4ccc(OC(=O)C(=C)C)c(C(F)(F)F)c4)c(S(=O)(=O)[O-])c3)cc2)cc1C", + "ref_smiles": "C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4cc(C(F)(F)F)c(OC(=O)C(=C)C)cc4O)c(S(=O)(=O)[O-])c3)cc2)cc1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "34c632f7-d91c-463a-a9bc-fe0180c2e963", + "task": "add", + "question": "Modify the molecule CC1CCN(S(=O)(=O)NC2CCCCCC2O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCN(S(=O)(=O)NC2CCCCCC2O)CC1", + "ref_smiles": "CC1(c2ccccc2)CCN(S(=O)(=O)NC2CCCCCC2O)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e11ff2f5-4196-4e32-9598-f770b3bd3294", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1ccccc1CNc1cc[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1CNc1cc[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1.", + "ref_smiles": "COc1ccccc1CNc1cc(C(=O)O)[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0f911c8e-84b0-4916-a7d8-664686bb5cb1", + "task": "add", + "question": "Modify the molecule COCCCN1C(=O)SC(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)C1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCN1C(=O)SC(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)C1=O", + "ref_smiles": "COCCCN1C(=O)SC(=Cc2ccc(-c3c(OC)cc([N+](=O)[O-])cc3-c3ccccc3)o2)C1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c6abc9f1-d1be-4a30-b826-5fefa1142017", + "task": "add", + "question": "Modify the molecule CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1", + "ref_smiles": "CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7df4d83c-d670-4439-8cbe-ef81b7d33fb5", + "task": "add", + "question": "Please add a benzene ring to the molecule N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NCC3)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NCC3)cc1.", + "ref_smiles": "N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NC(c2ccccc2)C3)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ebe71287-5d90-45c9-98e5-488282f7ddd7", + "task": "add", + "question": "Please add a benzene ring to the molecule CC[NH+]1CCN(C(=O)C(C)(C)C(=O)N2CCN(c3ncccn3)CC2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+]1CCN(C(=O)C(C)(C)C(=O)N2CCN(c3ncccn3)CC2)CC1.", + "ref_smiles": "CC[NH+]1CCN(C(=O)C(C)(C)C(=O)N2CCN(c3ncccn3)CC2)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7add1008-7005-4ae2-865a-ac9f8826895a", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C([O-])C(Cc1cccc(Cl)c1)Cc1ccc(Br)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])C(Cc1cccc(Cl)c1)Cc1ccc(Br)cc1Cl.", + "ref_smiles": "O=C([O-])C(Cc1cccc(Cl)c1)Cc1cc(-c2ccccc2)c(Br)cc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1853fa3f-223a-4c80-87ba-e51c1b61e897", + "task": "add", + "question": "Modify the molecule Cc1cccc(CSCc2cc(N)ccc2O)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(CSCc2cc(N)ccc2O)c1", + "ref_smiles": "Cc1cccc(CSC(O)c2cc(N)ccc2O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "06214f1d-6ae1-481a-8e34-79e8edab7c9a", + "task": "add", + "question": "Please add a benzene ring to the molecule Nc1ccc2c(c1)N(CCl)C(=O)CS2.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc2c(c1)N(CCl)C(=O)CS2.", + "ref_smiles": "Nc1cc2c(cc1-c1ccccc1)SCC(=O)N2CCl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6153ac8f-4609-4fbc-a726-3bc215e06a4a", + "task": "add", + "question": "Modify the molecule CC(CO)NC(=O)NCC(c1cccnc1)C(C)C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CO)NC(=O)NCC(c1cccnc1)C(C)C", + "ref_smiles": "CC(CO)NC(=O)NCC(c1cncc(N)c1)C(C)C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d965630e-1ee3-49ff-bd8a-cd2111559c36", + "task": "add", + "question": "Please add a benzene ring to the molecule NC(=O)CCC(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)CCC(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1.", + "ref_smiles": "NC(=O)CC(C(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8eb8c188-8e4b-43fb-8309-38f9aba4678e", + "task": "add", + "question": "Modify the molecule Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCC(C)CC3)n2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCC(C)CC3)n2)cc1", + "ref_smiles": "Cc1ccc(CNC(=S)Nc2nc(Sc3nccc(N)n3)cc(N3CCC(C)CC3)n2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d9a3da3d-f36e-4829-8f1b-e5b16d84e5b2", + "task": "add", + "question": "Modify the molecule COc1cc(C(=O)NCC(c2ccc(F)cc2)[NH+](C)C)ccc1OCc1cscn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(C(=O)NCC(c2ccc(F)cc2)[NH+](C)C)ccc1OCc1cscn1", + "ref_smiles": "COc1cc(C(=O)NCC(c2ccc(F)cc2O)[NH+](C)C)ccc1OCc1cscn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6a99d219-e9b8-4ecc-a2f8-996246d39a5c", + "task": "add", + "question": "Please add a benzene ring to the molecule CN(Cc1ccc2c(c1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(Cc1ccc2c(c1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1.", + "ref_smiles": "CN(Cc1cc2c(cc1-c1ccccc1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "88733ab8-f6a2-4094-be43-7ccba39a8534", + "task": "add", + "question": "Please add a amine to the molecule CCCCC(COC)NC(=O)C1CC[NH2+]C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(COC)NC(=O)C1CC[NH2+]C1.", + "ref_smiles": "CCCCC(COC)NC(=O)C1C[NH2+]C(N)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e981899d-ce76-4368-bc35-c3a23fec54b2", + "task": "add", + "question": "Modify the molecule [NH3+]CCCC(=O)Nc1ccc2c(c1)CCC2=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCCC(=O)Nc1ccc2c(c1)CCC2=O", + "ref_smiles": "[NH3+]CCCC(=O)Nc1ccc2c(c1)C(O)CC2=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4cb50abb-bfd2-4dde-a1f5-ff4d29132721", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=[N+]([O-])c1ccccc1N=c1scc(-c2cc3ccccc3o2)n1N=Cc1ccc(-c2ccccc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=[N+]([O-])c1ccccc1N=c1scc(-c2cc3ccccc3o2)n1N=Cc1ccc(-c2ccccc2)cc1.", + "ref_smiles": "O=[N+]([O-])c1c(O)cccc1N=c1scc(-c2cc3ccccc3o2)n1N=Cc1ccc(-c2ccccc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "67e9a857-92c8-460d-b537-3b157618fb3a", + "task": "add", + "question": "Please add a amine to the molecule COc1cc(OC)c(C(=O)O[NH+]=C(N)c2ccc(C)cc2)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(OC)c(C(=O)O[NH+]=C(N)c2ccc(C)cc2)cc1OC.", + "ref_smiles": "COc1cc(C(=O)O[NH+]=C(N)c2ccc(C)cc2)c(OC)cc1OCN", + "add_group": "amine", + "remove_group": null + }, + { + "id": "cac76963-10fa-418d-9940-8afd4645036b", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)(C)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1.", + "ref_smiles": "CC(C)(CC(=O)O)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c1b95f77-c7bc-47a4-b651-7750f5b31171", + "task": "add", + "question": "Modify the molecule Cc1cc(NC(=O)OCC[Si](C)(C)C)cc(N)c1Br by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(NC(=O)OCC[Si](C)(C)C)cc(N)c1Br", + "ref_smiles": "Cc1cc(NC(=O)OCC[Si](C)(C)CO)cc(N)c1Br", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2996c87c-ee4f-4283-9e3a-e0ca34793d90", + "task": "add", + "question": "Please add a carboxyl to the molecule NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1.", + "ref_smiles": "NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "971d3e66-33eb-498f-834a-b82826254da8", + "task": "add", + "question": "Modify the molecule O=C1CCC(c2ccccc2OCCCl)=NN1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CCC(c2ccccc2OCCCl)=NN1", + "ref_smiles": "O=C1CC(C(=O)O)C(c2ccccc2OCCCl)=NN1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b0128f44-6a01-4d75-85ef-dd13768958bc", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1.", + "ref_smiles": "COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1f898ad1-0161-4b2a-a474-5c12ed8627d3", + "task": "add", + "question": "Modify the molecule C[NH2+]CCCNC(=O)CC1CCC(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CCCNC(=O)CC1CCC(C)C1", + "ref_smiles": "C[NH2+]CCCNC(=O)CC1CCC(C)C1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "938b12c9-ab61-4012-bd9c-4f32de141184", + "task": "add", + "question": "Modify the molecule COc1ccccc1CC(=O)N1CCC2(CC[NH2+]C2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1CC(=O)N1CCC2(CC[NH2+]C2)CC1", + "ref_smiles": "COc1ccccc1CC(=O)N1CCC2(CC1)C[NH2+]C(O)C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1e839a98-df74-4a0a-ac9e-dbe956878bf0", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)cc2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)cc2)n1.", + "ref_smiles": "Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)c(O)c2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "22f1f901-0a7a-4074-93b0-ae4b223a6ad5", + "task": "add", + "question": "Modify the molecule CC1(C)CC[NH+](CCC([NH3+])c2ccccc2Br)C1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)CC[NH+](CCC([NH3+])c2ccccc2Br)C1", + "ref_smiles": "CC1(C)CC[NH+](CCC([NH3+])c2ccc(C#N)cc2Br)C1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "179d4c94-f9f4-4fa7-9853-105158a1fa6d", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCc1ccc(N)cc1S(=O)(=O)NCCCC1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(N)cc1S(=O)(=O)NCCCC1CC1.", + "ref_smiles": "CC(O)c1ccc(N)cc1S(=O)(=O)NCCCC1CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2f97f9c2-369b-4bf7-88c9-44e99d2f5e75", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)ccc2Cl)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)ccc2Cl)CC1.", + "ref_smiles": "Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)c(-c3ccccc3)cc2Cl)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "989f2842-4e52-4cb3-ab1a-1bb02093a444", + "task": "add", + "question": "Please add a carboxyl to the molecule S=C(NCc1cccnc1)N1CCc2c([nH]c3ccccc23)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "S=C(NCc1cccnc1)N1CCc2c([nH]c3ccccc23)C1.", + "ref_smiles": "O=C(O)c1cccc2c3c([nH]c12)CN(C(=S)NCc1cccnc1)CC3", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "67486275-06c8-431b-9484-8960b5f25558", + "task": "add", + "question": "Please add a amine to the molecule Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)CCCl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)CCCl.", + "ref_smiles": "Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)C(N)CCl", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3c389297-c0cd-46f1-b2d8-e08cbae2e32c", + "task": "add", + "question": "Modify the molecule Cn1ccnc1SCc1ccccc1C#CCCO by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1ccnc1SCc1ccccc1C#CCCO", + "ref_smiles": "Cn1ccnc1SCc1cc(-c2ccccc2)ccc1C#CCCO", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c654d418-ebec-4d0e-a2c9-57d2afb7cba6", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1CC(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1CC(=O)[O-].", + "ref_smiles": "CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1C(O)C(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b2afe2b0-1f28-487b-9a96-b4ff9af79b69", + "task": "add", + "question": "Please add a benzene ring to the molecule CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1ccc(F)c(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1ccc(F)c(Cl)c1.", + "ref_smiles": "CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1cc(Cl)c(F)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "766a7536-17bc-4ef5-97da-7496c3266766", + "task": "add", + "question": "Modify the molecule CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC", + "ref_smiles": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(C(O)O)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dd67c01a-f51f-4311-af70-ba3b9b13537f", + "task": "add", + "question": "Modify the molecule CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2C)cnc1N by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2C)cnc1N", + "ref_smiles": "CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2CO)cnc1N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d70693c5-3ee6-4fec-9ab9-cc19c5354db6", + "task": "add", + "question": "Modify the molecule O=S(=O)(Cl)CCS(=O)(=O)c1ccc2nnnn2n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(Cl)CCS(=O)(=O)c1ccc2nnnn2n1", + "ref_smiles": "O=S(=O)(CC(c1ccccc1)S(=O)(=O)Cl)c1ccc2nnnn2n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "27480759-6a29-4fed-a23f-7a3ca879dead", + "task": "add", + "question": "Modify the molecule CCC(C)CC(=O)c1cccc2c1OCCN2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)CC(=O)c1cccc2c1OCCN2", + "ref_smiles": "CCC(C)CC(=O)c1c(O)ccc2c1OCCN2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "203fee9b-0810-45df-9320-19b5aa5d9f5d", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1.", + "ref_smiles": "O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fd315e6e-68b5-4757-8cd5-52a268b7571e", + "task": "add", + "question": "Please add a amine to the molecule CCSc1cc(-c2ccccc2)cnc1C(=O)N(C)c1nnc(C(F)(F)F)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCSc1cc(-c2ccccc2)cnc1C(=O)N(C)c1nnc(C(F)(F)F)s1.", + "ref_smiles": "CCSc1c(C(=O)N(C)c2nnc(C(F)(F)F)s2)ncc(-c2ccccc2)c1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f24468d9-57e0-48e2-8cc0-b00d830d1365", + "task": "add", + "question": "Modify the molecule C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCCOc2ccccc2)c1=O by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCCOc2ccccc2)c1=O", + "ref_smiles": "C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC(S)COc2ccccc2)c1=O", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "6de5eb30-d7de-47b1-845d-ef708b5a157c", + "task": "add", + "question": "Modify the molecule CC(C)OCC(O)c1ccc(C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)OCC(O)c1ccc(C(=O)[O-])cc1", + "ref_smiles": "CC(Cc1ccccc1)OCC(O)c1ccc(C(=O)[O-])cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c107e946-4e73-4c7b-969b-f24447b61fcf", + "task": "add", + "question": "Modify the molecule CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)CC2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)CC2)c1", + "ref_smiles": "CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)C(O)C2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d582ef5f-18f7-4304-b4e3-4302436f0c33", + "task": "add", + "question": "Modify the molecule COc1ccc(N2CCN(C(=O)CSc3nccn3-c3cccc(Cl)c3C)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(N2CCN(C(=O)CSc3nccn3-c3cccc(Cl)c3C)CC2)cc1", + "ref_smiles": "COc1ccc(N2CCN(C(=O)C(Sc3nccn3-c3cccc(Cl)c3C)c3ccccc3)CC2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "eebe0e2f-0b81-4f2a-84c2-3a08009175a9", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOCCCNC(=O)c1cc(NC(=O)COC)ccc1N1CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCCCNC(=O)c1cc(NC(=O)COC)ccc1N1CCCC1.", + "ref_smiles": "COCC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCCOCCO)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c3c9766b-dbc1-44a6-a15c-1d8a0aba8255", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(CC[NH+](CCOC)CC(C)C)OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(CC[NH+](CCOC)CC(C)C)OCC.", + "ref_smiles": "CCOC(CC[NH+](CCOC)CC(C)C)OC(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fc4bfc51-4333-4053-90fa-183036f672d8", + "task": "add", + "question": "Modify the molecule CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccccc1", + "ref_smiles": "CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccc(-c2ccccc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a187e052-08f6-41d1-b2b6-07fee94bda25", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1C.", + "ref_smiles": "C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1898778a-382e-407b-9f51-6c6868f5f39b", + "task": "add", + "question": "Please add a benzene ring to the molecule COC1CCC2NC(=O)C3SC=CC3C2C1c1ccc(CC[NH3+])cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CCC2NC(=O)C3SC=CC3C2C1c1ccc(CC[NH3+])cc1.", + "ref_smiles": "COC1CC(c2ccccc2)C2NC(=O)C3SC=CC3C2C1c1ccc(CC[NH3+])cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0aa4fc5a-0176-4b3f-b58a-7d1f01ec0876", + "task": "add", + "question": "Please add a carboxyl to the molecule CC[NH2+]CC1CCCN1c1ncc(F)cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]CC1CCCN1c1ncc(F)cc1F.", + "ref_smiles": "O=C(O)CC[NH2+]CC1CCCN1c1ncc(F)cc1F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "e569acca-7580-4294-aef7-3f9e2b02b8d1", + "task": "add", + "question": "Modify the molecule O=C(Nc1ccc2nc(CCCO)[nH]c2c1)c1ccccc1F by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc2nc(CCCO)[nH]c2c1)c1ccccc1F", + "ref_smiles": "NC(CCO)c1nc2ccc(NC(=O)c3ccccc3F)cc2[nH]1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "a87d0bb6-ec2c-45cd-ab78-9f3d48913229", + "task": "add", + "question": "Please add a benzene ring to the molecule CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)C.", + "ref_smiles": "CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8ff14707-a4e9-4b80-9ed8-0d1462a1b532", + "task": "add", + "question": "Modify the molecule O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)ccc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)ccc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F", + "ref_smiles": "O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)c(O)cc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f496351d-b4b2-41a3-82e2-3553d023c4b0", + "task": "add", + "question": "Modify the molecule COc1ccc(NC(=O)C[NH2+]CCc2ccnn2C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(NC(=O)C[NH2+]CCc2ccnn2C)cc1", + "ref_smiles": "COc1ccc(NC(=O)C[NH2+]CCc2c(O)cnn2C)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "34efb5cd-7b10-42d2-b5e6-b1bc88c779e9", + "task": "add", + "question": "Modify the molecule Cc1c(Cl)cncc1OCc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(Cl)cncc1OCc1ccccc1", + "ref_smiles": "Cc1c(Cl)cncc1OC(c1ccccc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ae988535-280f-40fe-bb52-de8a9595bcb4", + "task": "add", + "question": "Modify the molecule CSc1cccc(N2CC=C(C)CC2)c1C[NH3+] by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1cccc(N2CC=C(C)CC2)c1C[NH3+]", + "ref_smiles": "CSc1c(N)ccc(N2CC=C(C)CC2)c1C[NH3+]", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e1dfb3de-ab6e-44f0-916c-9e5a4102fcd7", + "task": "add", + "question": "Modify the molecule C=C(C=C(C)c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C=C(C)c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C", + "ref_smiles": "C=C(C=C(C)c1ccc(OC)c(O)c1)O[Si](C)(C)C(C)(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cf27da3a-ddf1-42b0-b1f2-84f3d8dd3507", + "task": "add", + "question": "Modify the molecule O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1", + "ref_smiles": "O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fe31ee7f-a7c5-436d-8fcb-1195f634004f", + "task": "add", + "question": "Please add a carboxyl to the molecule O=C([O-])c1cccc2c(-c3cnc4ccccc4c3)n[nH]c12.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1cccc2c(-c3cnc4ccccc4c3)n[nH]c12.", + "ref_smiles": "O=C(O)c1ccc2cc(-c3n[nH]c4c(C(=O)[O-])cccc34)cnc2c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f7d23bd6-6fd4-42e4-b5c2-072ddb304a73", + "task": "add", + "question": "Modify the molecule C[NH2+]CC1CCCN(S(=O)(=O)NC(C)C[NH+](C)C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CC1CCCN(S(=O)(=O)NC(C)C[NH+](C)C)C1", + "ref_smiles": "C[NH2+]CC1CN(S(=O)(=O)NC(C)C[NH+](C)C)CCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e5467d99-474c-4a69-9f35-612833151c89", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(C(=O)OC(C1CC=CC(=O)O1)C(c1ccccc1)c1cc([O-])c2c(c1)OC(c1ccccc1)CC2=O)(c1ccccc1)C(F)(F)F.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(C(=O)OC(C1CC=CC(=O)O1)C(c1ccccc1)c1cc([O-])c2c(c1)OC(c1ccccc1)CC2=O)(c1ccccc1)C(F)(F)F.", + "ref_smiles": "COC(C(=O)OC(c1ccccc1)(C1CC=CC(=O)O1)C(c1ccccc1)c1cc([O-])c2c(c1)OC(c1ccccc1)CC2=O)(c1ccccc1)C(F)(F)F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3e500b90-66a6-42b2-b687-409ae9d8eb9b", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(OC(CO)C(O)CO)C(C)NC(C)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(OC(CO)C(O)CO)C(C)NC(C)=O.", + "ref_smiles": "COC(OC(CO)C(O)C(O)c1ccccc1)C(C)NC(C)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8554c93a-378e-4439-bae3-6c9a3f3d544c", + "task": "add", + "question": "Modify the molecule PCc1cccc(Oc2ccccc2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "PCc1cccc(Oc2ccccc2)c1", + "ref_smiles": "PCc1ccc(-c2ccccc2)c(Oc2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fdc3e797-6e3d-4622-9b11-952e4d1f1a81", + "task": "add", + "question": "Modify the molecule Nc1cccc(Nc2[nH]cnc(=O)c2Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cccc(Nc2[nH]cnc(=O)c2Cl)c1", + "ref_smiles": "Nc1cc(Nc2[nH]cnc(=O)c2Cl)ccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "47e4e347-bb5d-4671-9540-9b216e0a6c6c", + "task": "add", + "question": "Please add a amine to the molecule CC=C(c1ccccc1)c1cc2c(c3ccccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC=C(c1ccccc1)c1cc2c(c3ccccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.", + "ref_smiles": "CC=C(c1ccccc1)c1cc2c(c3cc(N)ccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "4de1944a-91d6-4f4a-a85a-b8f479ad394a", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC1CN(c2ncc(C(C)=O)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CN(c2ncc(C(C)=O)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1.", + "ref_smiles": "CCC1CN(c2ncc(C(=O)Cc3ccccc3)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3fa75f5e-1f32-4827-950c-10b8b9a0f42e", + "task": "add", + "question": "Modify the molecule Cc1cc(C(=O)CCOC(C)C)ccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C(=O)CCOC(C)C)ccc1F", + "ref_smiles": "Cc1c(F)ccc(C(=O)CCOC(C)C)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2ae49b76-0bd2-4142-997d-f831306230d2", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)CNc1nc2ccc(F)cc2[nH]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)CNc1nc2ccc(F)cc2[nH]1.", + "ref_smiles": "COC(=O)C(Nc1nc2ccc(F)cc2[nH]1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1a84d80b-4bbc-404d-8145-d25bc10ac1ec", + "task": "add", + "question": "Modify the molecule CC1(C)OC2OC(C3CCCC(=O)N3Cc3ccccc3)C(OCc3ccccc3)C2O1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)OC2OC(C3CCCC(=O)N3Cc3ccccc3)C(OCc3ccccc3)C2O1", + "ref_smiles": "CC1(C)OC2OC(C3CCCC(=O)N3Cc3ccccc3)C(OCc3ccccc3)C2(O)O1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0127797c-ad90-4d17-a4a8-bb36dad29916", + "task": "add", + "question": "Please add a hydroxyl to the molecule Nc1cccc(OCC(O)C[NH+]2CCC(c3ccccc3)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cccc(OCC(O)C[NH+]2CCC(c3ccccc3)CC2)c1.", + "ref_smiles": "Nc1cccc(OCC(O)C[NH+]2CCC(c3cccc(O)c3)CC2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "456b9c5c-aced-40bc-84ad-3a91de52dff5", + "task": "add", + "question": "Modify the molecule O=C([O-])CC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])CC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1", + "ref_smiles": "O=C([O-])CC1(c2ccccc2)CCN(S(=O)(=O)c3ccc(Cl)s3)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b6ce9040-f439-475f-892f-36f0a166c5fb", + "task": "add", + "question": "Modify the molecule Cc1cnn(CCNC(=O)CC[NH3+])c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cnn(CCNC(=O)CC[NH3+])c1", + "ref_smiles": "[NH3+]CCC(=O)NCCn1cc(CCC=O)cn1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "05b3e0e8-1c57-443a-97d1-1000c0a487a1", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(CC[NH3+])CCC[NH2+]C1CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CC[NH3+])CCC[NH2+]C1CCC1.", + "ref_smiles": "CC(CC[NH3+])CCC[NH2+]C1CCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5768f9ac-7dd7-41d5-9a21-3d6a8ba26c12", + "task": "add", + "question": "Modify the molecule O=C(Cc1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1", + "ref_smiles": "O=C(C(O)c1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b1fca4f4-9460-4512-80e9-cb9694c174ce", + "task": "add", + "question": "Modify the molecule O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1ccccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1ccccc1Cl", + "ref_smiles": "O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1c(Cl)cccc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c3dfc8c9-02f0-4852-ab87-c59975b7242a", + "task": "add", + "question": "Please add a benzene ring to the molecule CCn1ccn(CC(Cl)C#N)c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1ccn(CC(Cl)C#N)c1=O.", + "ref_smiles": "N#CC(Cl)Cn1ccn(CCc2ccccc2)c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "938f531d-1d62-413b-bc73-6fd7015584e0", + "task": "add", + "question": "Modify the molecule Cc1onc(-c2ccccc2)c1-c1cn2cc(-n3cccc3)ccc2[nH+]1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1onc(-c2ccccc2)c1-c1cn2cc(-n3cccc3)ccc2[nH+]1", + "ref_smiles": "Cc1onc(-c2cccc(C(=O)O)c2)c1-c1cn2cc(-n3cccc3)ccc2[nH+]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f3ec5ea4-50bf-4e57-84f3-80e8a566c94d", + "task": "add", + "question": "Modify the molecule C#CC1(C(F)F)COCC(N)=[NH+]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CC1(C(F)F)COCC(N)=[NH+]1", + "ref_smiles": "C#CC1(C(O)(F)F)COCC(N)=[NH+]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6ee219e7-6797-4677-9277-ac4e8adc9bca", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1.", + "ref_smiles": "CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)(C)O)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fa83b2c1-4a89-4189-93e1-6655d1cfb15a", + "task": "add", + "question": "Modify the molecule COC(=O)C(O)CNC(=O)c1ccoc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(O)CNC(=O)c1ccoc1", + "ref_smiles": "O=C(NCC(O)C(=O)OCO)c1ccoc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "853a0db0-c008-492b-8235-d32258b8e6b4", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)Cn2nnc3ccccc32)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)Cn2nnc3ccccc32)o1", + "ref_smiles": "Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)C(O)n2nnc3ccccc32)o1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0c7e3d34-0244-4b47-8194-fcd7f6a152b9", + "task": "add", + "question": "Modify the molecule CCC(C)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C", + "ref_smiles": "CCC(CC(=O)O)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "25c0f522-6340-4e18-a021-d648f9616938", + "task": "add", + "question": "Modify the molecule CC(C)n1cncc1COC1CCC(O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)n1cncc1COC1CCC(O)CC1", + "ref_smiles": "CC(C)n1cncc1COC1CCC(O)C(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0e7a0286-d6e6-4132-8ced-44647be6fcde", + "task": "add", + "question": "Modify the molecule CC(C)C(CC(=O)[O-])NC(=O)NCCOc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(CC(=O)[O-])NC(=O)NCCOc1ccccc1", + "ref_smiles": "CC(C)C(CC(=O)[O-])NC(=O)NCCOc1cccc(C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "78d87d02-6fa3-47b3-b93f-5eb9dcfe5936", + "task": "add", + "question": "Please add a aldehyde to the molecule O=C([O-])Cn1nc(CC2CCS(=O)(=O)C2)c2c1CC[NH2+]C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])Cn1nc(CC2CCS(=O)(=O)C2)c2c1CC[NH2+]C2.", + "ref_smiles": "O=CCC1CS(=O)(=O)CC1Cc1nn(CC(=O)[O-])c2c1C[NH2+]CC2", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "6b1fe711-c21d-4e7d-bf15-e893bdcb668c", + "task": "add", + "question": "Modify the molecule C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1", + "ref_smiles": "C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "af1ec4f9-bb66-4f93-b542-655aaf13f56f", + "task": "add", + "question": "Modify the molecule CCC1(CC)CCN(C(=O)n2cc[n+](C)c2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(CC)CCN(C(=O)n2cc[n+](C)c2)C1", + "ref_smiles": "CCC1(C(C)C(=O)O)CCN(C(=O)n2cc[n+](C)c2)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f52607d7-6d34-4514-be54-18df5bd2a5fb", + "task": "add", + "question": "Modify the molecule Nc1ccc(O)cc1NC(=O)CCc1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc(O)cc1NC(=O)CCc1ccco1", + "ref_smiles": "Nc1cc(O)c(O)cc1NC(=O)CCc1ccco1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b0e49da3-31eb-4b32-9528-4a2820eaa329", + "task": "add", + "question": "Modify the molecule C[NH+]1CCN(c2nc(C3=CCC[NH+](C)C3)c(Cl)s2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(c2nc(C3=CCC[NH+](C)C3)c(Cl)s2)CC1", + "ref_smiles": "C[NH+]1CCC=C(c2nc(N3CC[NH+](C)C(O)C3)sc2Cl)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "62869c59-4828-417a-847e-a67c75d61a57", + "task": "add", + "question": "Please add a amine to the molecule CCOCCC(=O)C(C#N)c1ccccc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCCC(=O)C(C#N)c1ccccc1C.", + "ref_smiles": "CCOCCC(=O)C(N)(C#N)c1ccccc1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9dcb8626-23e1-404e-b8a4-76ea46f896d0", + "task": "add", + "question": "Modify the molecule O=C(Nc1ccc2c(c1)C(=O)CC2)NC1CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc2c(c1)C(=O)CC2)NC1CCCCC1", + "ref_smiles": "Nc1cc(NC(=O)NC2CCCCC2)cc2c1CCC2=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d26dbc06-bca3-42c4-acaf-ee5003645a29", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cccc(C#CC(C)(C)O)c23)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cccc(C#CC(C)(C)O)c23)cc1.", + "ref_smiles": "Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cc(-c4ccccc4)cc(C#CC(C)(C)O)c23)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3810d86c-8c42-4cfa-8390-6ad476b119ee", + "task": "add", + "question": "Modify the molecule C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1C", + "ref_smiles": "C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1CC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "17d404ae-c69a-4987-af9d-980cf743d0d8", + "task": "add", + "question": "Modify the molecule CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NCC(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NCC(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1", + "ref_smiles": "CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NC(C(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d4f04fe3-18a2-4d95-82dd-3965db42e181", + "task": "add", + "question": "Modify the molecule CCC[NH2+]Cc1ccn(-c2cc([N+](=O)[O-])ccc2OC)n1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]Cc1ccn(-c2cc([N+](=O)[O-])ccc2OC)n1", + "ref_smiles": "CCC[NH2+]Cc1cc(N)n(-c2cc([N+](=O)[O-])ccc2OC)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "29c4c9dc-3cdf-49f0-9541-bdf868782c88", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CC.", + "ref_smiles": "CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "273c93a6-9af9-4d84-acd7-c8b325946c8d", + "task": "add", + "question": "Modify the molecule CN(CC(=O)N1CCSCC1c1cnn(C)c1)C1CCS(=O)(=O)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CC(=O)N1CCSCC1c1cnn(C)c1)C1CCS(=O)(=O)C1", + "ref_smiles": "CN(CC(=O)N1CCSCC1c1cnn(C)c1)C1CS(=O)(=O)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2aff2b80-ffe9-4ab9-b6d3-d428cdb484e0", + "task": "add", + "question": "Modify the molecule CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1", + "ref_smiles": "CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b2c921e9-a53a-4712-b9b6-130aea337b63", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(C)(C#N)CCCCn1ncc(Cl)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(C)(C#N)CCCCn1ncc(Cl)c1C.", + "ref_smiles": "CCNC(C)(C#N)CCCCn1ncc(Cl)c1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "59d20ca2-31bc-4de7-8fc0-182b2dec142a", + "task": "add", + "question": "Modify the molecule C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccccc1OC", + "ref_smiles": "C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCC(c1ccccc1)c1ccccc1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6919bba6-1144-4dbb-bc9b-5e9e3e3ce452", + "task": "add", + "question": "Modify the molecule COc1cc2c(cc1S(N)(=O)=O)CCN(S(=O)(=O)c1cccc(OC(F)(F)F)c1)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc2c(cc1S(N)(=O)=O)CCN(S(=O)(=O)c1cccc(OC(F)(F)F)c1)C2", + "ref_smiles": "COc1cc2c(cc1O)S(N)(=O)=O)CCN(S(=O)(=O)c3cccc(OC(F)(F)F)c3)C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e607443a-7d31-4dbd-9ecc-f2e19b34a8ca", + "task": "add", + "question": "Modify the molecule O=C([O-])c1ccc(Br)cc1SCCc1cccs1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1ccc(Br)cc1SCCc1cccs1", + "ref_smiles": "O=CCc1cc(C(=O)[O-])c(SCCc2cccs2)cc1Br", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "94613fbc-6560-4586-9d74-51ad27e36817", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(C)n1ccnc(N2CCOCC2CC(=O)[O-])c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)n1ccnc(N2CCOCC2CC(=O)[O-])c1=O.", + "ref_smiles": "CC(C)(C)n1c(-c2ccccc2)cnc(N3CCOCC3CC(=O)[O-])c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5852398b-01c0-4818-a0c6-b1a42821be66", + "task": "add", + "question": "Modify the molecule CCOc1cc(OCC)c(CCC(=O)[O-])c(OCC)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(OCC)c(CCC(=O)[O-])c(OCC)c1", + "ref_smiles": "CCOc1cc(OC(C)c2ccccc2)cc(OCC)c1CCC(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "33a5b3d0-9651-4096-bc52-cc8f0dcda60b", + "task": "add", + "question": "Modify the molecule O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1", + "ref_smiles": "O=C(NCC(c1ccccc1)n1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "cf115c2e-eb51-4018-8203-4e82584bb338", + "task": "add", + "question": "Modify the molecule CCc1oc(-c2ccc(F)c(C)c2)cc1CBr by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1oc(-c2ccc(F)c(C)c2)cc1CBr", + "ref_smiles": "CCc1oc(-c2cc(C)c(F)c(-c3ccccc3)c2)cc1CBr", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "188c5739-437b-4169-9e1c-91606252bb71", + "task": "add", + "question": "Modify the molecule O=S(=O)(c1c(F)cc(F)cc1F)N1CCCC(CBr)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(c1c(F)cc(F)cc1F)N1CCCC(CBr)C1", + "ref_smiles": "O=S(=O)(c1c(F)cc(F)c(-c2ccccc2)c1F)N1CCCC(CBr)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4412ea4f-eec1-4b7b-b5b7-e45a8c0dc607", + "task": "add", + "question": "Modify the molecule CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCCCC3)cc2)cc1)c1cccc(Cl)c1Cl by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCCCC3)cc2)cc1)c1cccc(Cl)c1Cl", + "ref_smiles": "CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCC(C#N)CC3)cc2)cc1)c1cccc(Cl)c1Cl", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "75283fa8-c9f6-4987-a81c-1a5cd8b9870b", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1.", + "ref_smiles": "CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0328b462-4be3-452f-a61d-5e9c307b3293", + "task": "add", + "question": "Modify the molecule COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O", + "ref_smiles": "COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2cc(C(=O)[O-])cc(N)c2C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d364eac4-764a-4f18-8cb2-6711829e9498", + "task": "add", + "question": "Modify the molecule Cn1cnnc1C[NH2+]Cc1ccccc1-n1cccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cnnc1C[NH2+]Cc1ccccc1-n1cccn1", + "ref_smiles": "Cn1cnnc1C[NH2+]Cc1ccccc1-n1nccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9bbc5e62-1bc5-4ad8-9f68-f5fffd646b87", + "task": "add", + "question": "Modify the molecule O=Cc1ssc(=O)c1-c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=Cc1ssc(=O)c1-c1ccccc1", + "ref_smiles": "O=Cc1ssc(=O)c1-c1cccc(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "da84981a-c19f-4992-bc31-e289939b0952", + "task": "add", + "question": "Modify the molecule CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1", + "ref_smiles": "OCN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "820112c8-a77c-4a96-958d-6b4ab082e62f", + "task": "add", + "question": "Modify the molecule COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3)cc1", + "ref_smiles": "COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3N)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "86df2d99-925f-442d-9221-74e8c7c627e8", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(Nc1ccc(C2CCC2)cn1)NC1CCCNC1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc(C2CCC2)cn1)NC1CCCNC1=O.", + "ref_smiles": "O=C(Nc1ccc(C2(O)CCC2)cn1)NC1CCCNC1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2e902ebb-b239-4385-9427-ad271fe92e1a", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(C)OC(=O)N1CCCC(COS(C)(=O)=O)c2c1cc(O)c1ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)OC(=O)N1CCCC(COS(C)(=O)=O)c2c1cc(O)c1ccccc21.", + "ref_smiles": "CC(C)(C)OC(=O)N1CCC(c2ccccc2)C(COS(C)(=O)=O)c2c1cc(O)c1ccccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a13c976a-4db8-4dbb-a66e-a1eab0803ec1", + "task": "add", + "question": "Modify the molecule CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cccs2)n[nH]c1=S by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cccs2)n[nH]c1=S", + "ref_smiles": "CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cc(-c3ccccc3)cs2)n[nH]c1=S", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "de481e34-4957-41a1-8862-eeb875b9beae", + "task": "add", + "question": "Modify the molecule Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3ccccc32)c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3ccccc32)c1=O", + "ref_smiles": "Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3cc(-c4ccccc4)ccc32)c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "46c5d66c-a522-40ce-a017-a5fcc0ceeaec", + "task": "add", + "question": "Modify the molecule CCCCOc1cc(C)cc2c1C(C)CCC2C(C)CCC=C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOc1cc(C)cc2c1C(C)CCC2C(C)CCC=C(C)C", + "ref_smiles": "CCCCOc1cc(C)cc2c1C(Cc1ccccc1)CCC2C(C)CCC=C(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ffc70f91-0240-44dc-8962-468f9c5b8064", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1.", + "ref_smiles": "CC1(c2ccccc2)CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6ca98c9e-9834-484c-83ff-8fb2c328ea57", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(N)=NC1CC2CCC1[NH+](C)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(N)=NC1CC2CCC1[NH+](C)C2.", + "ref_smiles": "CC(N)=NC1CC2CCC1[NH+](C)C2O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "96eccecc-0f41-40d0-b44c-73916daa0a94", + "task": "add", + "question": "Modify the molecule CCC1(C(=O)Nc2cccc(OCC[NH3+])c2)CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(C(=O)Nc2cccc(OCC[NH3+])c2)CCCC1", + "ref_smiles": "[NH3+]CCOc1cccc(NC(=O)C2(CCc3ccccc3)CCCC2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "efba9f80-a98f-48bf-b674-637a5cc2eca5", + "task": "add", + "question": "Please add a aldehyde to the molecule COc1cccnc1C([NH3+])c1cc(C)c(Br)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccnc1C([NH3+])c1cc(C)c(Br)c(C)c1.", + "ref_smiles": "COc1cccnc1C([NH3+])c1cc(C)c(Br)c(CCC=O)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "fccf9b83-19a9-4555-aab8-5d3c8072509c", + "task": "add", + "question": "Modify the molecule CC(C(=O)[O-])C(=O)N1CCCC1C1CCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(=O)[O-])C(=O)N1CCCC1C1CCCC1", + "ref_smiles": "CC(C(=O)[O-])C(=O)N1CCCC1C1CCC(CC=O)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "127f963c-40e5-42cf-ada5-43a90145f92c", + "task": "add", + "question": "Modify the molecule CC[NH2+]Cc1ccc(CS(=O)(=O)N2CCCC2)cc1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]Cc1ccc(CS(=O)(=O)N2CCCC2)cc1", + "ref_smiles": "CC[NH2+]Cc1ccc(C(S)S(=O)(=O)N2CCCC2)cc1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "2ff49e60-6566-4bca-b6cf-359275729517", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)N(C(C)C)P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)N(C(C)C)P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1.", + "ref_smiles": "CC(C)N(P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "24391da9-e195-44f8-b290-e0ca6f08e0a7", + "task": "add", + "question": "Please add a benzene ring to the molecule CCc1cccc(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1cccc(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1.", + "ref_smiles": "CCc1ccc(-c2ccccc2)c(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "99c34cfc-7ce3-47ae-ba3f-0fd358ebeb8c", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(NC(=O)NC(C)c1ccncc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)NC(C)c1ccncc1)c1ccccc1.", + "ref_smiles": "CC(NC(=O)NC(C)(O)c1ccncc1)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6b5d420f-433a-423a-956d-df7927392073", + "task": "add", + "question": "Modify the molecule Cc1c(C#N)ccc(N)c1C(=O)OCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C#N)ccc(N)c1C(=O)OCc1ccccc1", + "ref_smiles": "Cc1c(C#N)ccc(N)c1C(=O)OCc1cccc(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "916f83f5-372f-46ad-98e6-931e0c989aae", + "task": "add", + "question": "Modify the molecule CCCCN(C)C(=O)c1cnn(-c2ccc(Br)cc2)c1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCN(C)C(=O)c1cnn(-c2ccc(Br)cc2)c1C", + "ref_smiles": "CCCCN(C)C(=O)c1c(-c2ccccc2)nn(-c2ccc(Br)cc2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "59a00e95-bb56-447a-a937-8fdb98bf85fe", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2ccccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2ccccc21.", + "ref_smiles": "CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2c(O)cccc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9291ca6d-d3e5-40fb-89bd-8a55fe5b999e", + "task": "add", + "question": "Modify the molecule C=CCn1c(CC)nc(-c2ccc(C(C)(C)C)cc2)c1N by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCn1c(CC)nc(-c2ccc(C(C)(C)C)cc2)c1N", + "ref_smiles": "C=CCn1c(CC)nc(-c2ccc(C(C)(C)C)cc2-c2ccccc2)c1N", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e5643d36-e62b-4742-885d-fd22062899b0", + "task": "add", + "question": "Please add a benzene ring to the molecule CSc1nc2nc(=O)c3ncn(C)c3n2[nH]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1nc2nc(=O)c3ncn(C)c3n2[nH]1.", + "ref_smiles": "Cn1cnc2c(=O)nc3nc(SCc4ccccc4)[nH]n3c21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8cf93576-4e91-4291-8068-90954f8e8f77", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1CC2CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)CC(O)(C1)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC2CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)CC(O)(C1)C2.", + "ref_smiles": "CC1CC2CC(O)CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)(C1)C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "07e1a6e8-b447-48b9-9a4c-8bf0027e24b7", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH+](Cc1cccc(C#N)c1)Cc1nnc(NN)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](Cc1cccc(C#N)c1)Cc1nnc(NN)s1.", + "ref_smiles": "C[NH+](Cc1nnc(NN)s1)C(O)c1cccc(C#N)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f2623f9a-b7b8-4bc8-9e4d-45aae4cd2464", + "task": "add", + "question": "Modify the molecule CCc1ccc(-c2ccc(Cl)nc2C)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(-c2ccc(Cl)nc2C)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O", + "ref_smiles": "CCc1ccc(-c2ccc(Cl)nc2CC#N)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "c388d712-3dde-4e83-8e91-d33e4b1c05fe", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCCCNC(=O)CN(C)C(=O)c1cc(C)nc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCNC(=O)CN(C)C(=O)c1cc(C)nc(Cl)c1.", + "ref_smiles": "COCCCNC(=O)C(O)N(C)C(=O)c1cc(C)nc(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b64b114d-98b1-4892-9e51-78e8b37af2d7", + "task": "add", + "question": "Modify the molecule [NH3+]CCCC([NH3+])C(c1ccccc1)c1cnc[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCCC([NH3+])C(c1ccccc1)c1cnc[nH]1", + "ref_smiles": "[NH3+]CCC(c1ccccc1)C([NH3+])C(c1ccccc1)c1cnc[nH]1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "14b83513-1a39-4d46-ba8e-cc2f2e1c36ea", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ccc(-c2cc(=O)n(CCNC(=O)C3CCCO3)cn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(-c2cc(=O)n(CCNC(=O)C3CCCO3)cn2)cc1.", + "ref_smiles": "CCOc1ccc(-c2cc(=O)n(C(O)CNC(=O)C3CCCO3)cn2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7baf25d5-2633-4632-bdaa-8251185d199d", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCc1cc(C(C)C)c(CC(C)C)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1cc(C(C)C)c(CC(C)C)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1.", + "ref_smiles": "CCCc1c(-c2ccccc2)c(C(C)C)c(CC(C)C)c(OC(=O)c3ccccc3)c1OC(=O)c4ccccc4", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ab1f2e0d-fbad-4232-ae76-6f68b49714fd", + "task": "add", + "question": "Please add a carboxyl to the molecule CCCCOCCCNC(=S)N1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOCCCNC(=S)N1CC[NH2+]CC1.", + "ref_smiles": "CCCCOC(CCNC(=S)N1CC[NH2+]CC1)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "137c2ffd-72d6-4eee-8821-d8d9cbefeab8", + "task": "add", + "question": "Modify the molecule CN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1-c1cccnc1)c1ccc2c(c1)CCO2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1-c1cccnc1)c1ccc2c(c1)CCO2", + "ref_smiles": "CN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1-c1cncc(O)c1)c1ccc2c(c1)CCO2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "23491106-be14-4b57-bca1-03c4772930c9", + "task": "add", + "question": "Modify the molecule CNc1cc(N(C)C2CCCCC2)nc(C2CC2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1cc(N(C)C2CCCCC2)nc(C2CC2)n1", + "ref_smiles": "CNc1cc(N(C)C2CCC(O)CC2)nc(C2CC2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4bb12e7d-d302-446c-b577-19211714588f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)C(CC(=O)C1(O[Si](C)(C)C)CC2CCC1(C)C2(C)C)NC(=O)OCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(CC(=O)C1(O[Si](C)(C)C)CC2CCC1(C)C2(C)C)NC(=O)OCc1ccccc1.", + "ref_smiles": "CC(C)C(CC(=O)C1(O[Si](C)(C)C)CC2CCC1(C)C2(C)C)NC(=O)OCc1cccc(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4e7e2ee3-1408-4630-9978-e141450ad02b", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(Nc1nc(C(=O)NCCc2ccncc2)cs1)c1cccc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1nc(C(=O)NCCc2ccncc2)cs1)c1cccc(C(F)(F)F)c1.", + "ref_smiles": "O=C(Nc1nc(C(=O)NCCc2ccncc2)c(O)s1)c1cccc(C(F)(F)F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "77dbb9df-bf4d-47b4-8171-65e89cc9961f", + "task": "add", + "question": "Modify the molecule CC(C)C[NH+]1CCN(c2ccc(CCl)cc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C[NH+]1CCN(c2ccc(CCl)cc2)CC1", + "ref_smiles": "CC(C)C[NH+]1CCN(c2ccc(CCl)cc2-c3ccccc3)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "36514e85-c9f9-4b44-ac30-5defc12ed0c9", + "task": "add", + "question": "Modify the molecule CCC([NH3+])C(=O)NCCCCOC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC([NH3+])C(=O)NCCCCOC", + "ref_smiles": "COCCCCNC(=O)C([NH3+])C(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b7ac932b-ac0f-4ebd-b4a3-e69dfdc2dd44", + "task": "add", + "question": "Modify the molecule Nc1ccc(Cl)cc1NC(=O)Cn1ccc(=O)[nH]c1=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc(Cl)cc1NC(=O)Cn1ccc(=O)[nH]c1=O", + "ref_smiles": "Nc1cc(N)c(NC(=O)Cn2ccc(=O)[nH]c2=O)cc1Cl", + "add_group": "amine", + "remove_group": null + }, + { + "id": "0885fdb9-934c-4e74-8f63-d750263349da", + "task": "add", + "question": "Modify the molecule CC(C)(C)CCn1ccn(C2CC2)c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)CCn1ccn(C2CC2)c1=O", + "ref_smiles": "CC(C)(CCn1ccn(C2CC2)c1=O)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e6ae286d-5f7e-41e2-88cb-705783fbce04", + "task": "add", + "question": "Modify the molecule CC[NH2+]C(Cc1cccs1)c1ncccc1CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C(Cc1cccs1)c1ncccc1CC", + "ref_smiles": "CC[NH2+]C(Cc1cccs1)c1ncc(O)cc1CC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "803264a9-b738-4e57-ab8b-ed972bc12a07", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(=O)C1=C(C)N(C(C)c2ccccc2)C(=O)C1=Cc1ccc(OC)c(OC)c1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1=C(C)N(C(C)c2ccccc2)C(=O)C1=Cc1ccc(OC)c(OC)c1OC.", + "ref_smiles": "COc1ccc(C=C2C(=O)N(C(C)c3ccccc3)C(=O)C2=C(O)C(=O)OC)c(OC)c1OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "34d56dc9-1113-4e7e-ad1d-8b4751ea2d70", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)NC(CS)C(=O)NCS.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NC(CS)C(=O)NCS.", + "ref_smiles": "CC(=O)NC(CS)(C(=O)NCS)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "71bed53c-04bb-4537-b5ac-1728fdc7a015", + "task": "add", + "question": "Modify the molecule CN(CC1CCCCC1)c1nc(N)nc2ccccc12 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CC1CCCCC1)c1nc(N)nc2ccccc12", + "ref_smiles": "CN(CC1CCCCC1)c1nc(N)nc2c(C(=O)O)cccc12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ff0bfff1-0786-4e90-8a24-ff222f6c21f7", + "task": "add", + "question": "Modify the molecule IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1", + "ref_smiles": "IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dfab9f3c-4a23-4757-b702-35a3f9cde126", + "task": "add", + "question": "Please add a amine to the molecule O=C(NCc1ncon1)c1cccc2c1CC[NH2+]C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1ncon1)c1cccc2c1CC[NH2+]C2.", + "ref_smiles": "Nc1cc2c(c(C(=O)NCc3ncon3)c1)CC[NH2+]C2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "31fb98da-2382-4ff6-ab53-278495e9b104", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3)c2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3)c2=O)c1.", + "ref_smiles": "Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3O)c2=O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e0c2eb60-fbe7-4606-851c-6b3e6bf3c4d3", + "task": "add", + "question": "Modify the molecule O=C(NC1CCCC2OCCC12)N1CCCC1CCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCCC2OCCC12)N1CCCC1CCO", + "ref_smiles": "O=C(NC1CCCC2OCCC12)N1CCC(O)C1CCO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4d2ea0ba-a960-4fca-a44e-3fef76c82f47", + "task": "add", + "question": "Modify the molecule Nc1cc(N)cc(C(=O)c2cc3c(cc2Br)OCCO3)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cc(N)cc(C(=O)c2cc3c(cc2Br)OCCO3)c1", + "ref_smiles": "Nc1cc(N)c(S)c(C(=O)c2cc3c(cc2Br)OCCO3)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "c618259e-709d-44e6-980d-71678de61210", + "task": "add", + "question": "Modify the molecule O=C(CSc1nnc2sc3ccccc3n12)NCc1ccc(C(=O)N2CCCC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CSc1nnc2sc3ccccc3n12)NCc1ccc(C(=O)N2CCCC2)cc1", + "ref_smiles": "N#Cc1cc(CNC(=O)CSc2nnc3sc4ccccc4n23)ccc1C(=O)N1CCCC1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "c66ad777-4c2c-4d4b-85e2-0b1a8c9f41e6", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1cscc1CCN1CCOCC1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1cscc1CCN1CCOCC1=O.", + "ref_smiles": "O=C1COCCN1CCc1cscc1NS(=O)(=O)c1c(Cl)cc(Cl)cc1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "87254ffc-8780-4be4-ae66-e5e321749eb9", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NC1CCN(C(=O)Nc2cccc3ccccc23)CC1)c1ccco1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCN(C(=O)Nc2cccc3ccccc23)CC1)c1ccco1.", + "ref_smiles": "O=C(NC1CCN(C(=O)Nc2cc(-c3ccccc3)cc3ccccc23)CC1)c1ccco1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "038878d1-2b05-4725-b98e-4f37682b51b3", + "task": "add", + "question": "Modify the molecule Clc1ccc(-n2nnnc2CSc2nc3ccccc3[nH]2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Clc1ccc(-n2nnnc2CSc2nc3ccccc3[nH]2)cc1", + "ref_smiles": "Nc1cccc2nc(SCc3nnnn3-c3ccc(Cl)cc3)[nH]c12", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e441c193-8ec6-4f57-a27d-b79b4f4710b4", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)n2-c2ccccc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)n2-c2ccccc2)cc1.", + "ref_smiles": "COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4O)o3)n2-c2ccccc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c5971a20-dad4-4473-a9b9-b69b6b230021", + "task": "add", + "question": "Modify the molecule C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3)c2c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3)c2c1=O", + "ref_smiles": "C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3-c3ccccc3)c2c1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a5383d3c-537b-43f1-b500-7ecfa5eec06c", + "task": "add", + "question": "Modify the molecule CC(C)=CCCC(C)[NH2+]CC1CCCCC1O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)=CCCC(C)[NH2+]CC1CCCCC1O", + "ref_smiles": "CC(=CCCC(C)[NH2+]CC1CCCCC1O)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "73f989d4-1f0b-4edd-91d7-70c429bfbdad", + "task": "add", + "question": "Modify the molecule CC[NH+](CC(N)=S)Cc1cncc(Br)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](CC(N)=S)Cc1cncc(Br)c1", + "ref_smiles": "CC[NH+](CC(N)=S)Cc1cncc(Br)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ebd44598-4673-4f44-bce1-13483598710b", + "task": "add", + "question": "Modify the molecule CN(Cc1ccc(Cl)cc1)C1(C[NH3+])CCCCC1(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(Cc1ccc(Cl)cc1)C1(C[NH3+])CCCCC1(C)C", + "ref_smiles": "CN(Cc1ccc(Cl)cc1-c1ccccc1)C1(C[NH3+])CCCCC1(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dd578ed8-1748-4719-8504-d1a822c0a312", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)C1=CC(c2ccccc2)C(C#N)(C#N)C(C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C1=CC(c2ccccc2)C(C#N)(C#N)C(C)C1.", + "ref_smiles": "CC(C)C1=C(c2ccccc2)C(c2ccccc2)C(C#N)(C#N)C(C)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1fdcba8b-70eb-4d48-ac7a-e5745f025141", + "task": "add", + "question": "Modify the molecule CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1C", + "ref_smiles": "CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6f326997-0749-4a2c-9d87-d14ab6d89517", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCCC3(C)[NH3+])nc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCCC3(C)[NH3+])nc2)CC1.", + "ref_smiles": "C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCC(c4ccccc4)C3(C)[NH3+])nc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "31a47f15-6c61-4327-a898-38980660e3cc", + "task": "add", + "question": "Modify the molecule CCCc1ccc(-c2ccc(NC(=O)c3ccccc3)c3c2CNC3=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1ccc(-c2ccc(NC(=O)c3ccccc3)c3c2CNC3=O)cc1", + "ref_smiles": "O=C(Nc1ccc(-c2ccc(CCCc3ccccc3)cc2)c2c1C(=O)NC2)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2174f1a1-3da3-434f-9202-c5b0b5a65a49", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])C1.", + "ref_smiles": "COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7dcbbf9b-03a1-4662-b1a9-28f0dad5018e", + "task": "add", + "question": "Modify the molecule Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2cc(C)ccc2C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2cc(C)ccc2C)cc1", + "ref_smiles": "Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2c(C)ccc(C)c2O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dc23d4d2-3a83-4423-983d-77ed2e8f9c58", + "task": "add", + "question": "Please add a benzene ring to the molecule Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3)n2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3)n2)cc1.", + "ref_smiles": "Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3c4ccccc4)n2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d1a3583b-055c-4701-82d1-4fafbc77783b", + "task": "add", + "question": "Please add a aldehyde to the molecule COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1.", + "ref_smiles": "COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "db99b629-b771-42cb-b2f6-b855ab34c557", + "task": "add", + "question": "Modify the molecule COC(=O)C1C(CCN=[N+]=[N-])OC(=O)N1C(=O)OC(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1C(CCN=[N+]=[N-])OC(=O)N1C(=O)OC(C)(C)C", + "ref_smiles": "COC(=O)C1C(CC(N=[N+]=[N-])c2ccccc2)OC(=O)N1C(=O)OC(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7819eff9-b84c-4da4-a132-94b63551100e", + "task": "add", + "question": "Modify the molecule C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3ncccc3C=CC2C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3ncccc3C=CC2C1", + "ref_smiles": "C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3nc(-c4ccccc4)ccc3C=CC2C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "eb8fbee8-1a4f-4bd9-9f2b-39c64e066b8b", + "task": "add", + "question": "Please add a benzene ring to the molecule O=c1ncn(-c2cccc(Cl)c2)c2ccc(Cl)cc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1ncn(-c2cccc(Cl)c2)c2ccc(Cl)cc12.", + "ref_smiles": "O=c1nc(-c2ccccc2)n(-c2cccc(Cl)c2)c2ccc(Cl)cc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0f991d04-dc36-4810-bfe0-8f3f990953a0", + "task": "add", + "question": "Modify the molecule c1ccc(C2NC(c3ccccc3)[NH2+]C(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)N2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(C2NC(c3ccccc3)[NH2+]C(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)N2)cc1", + "ref_smiles": "c1ccc(C2NC(c3ccccc3)(c3ccccc3)NC(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)[NH2+]2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8252acdd-2f05-4792-8a79-15bfbdc369e5", + "task": "add", + "question": "Modify the molecule COC(=O)NCC1(CC(=O)[O-])CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)NCC1(CC(=O)[O-])CCC1", + "ref_smiles": "COC(=O)NCC1(CC(=O)[O-])CCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d75ce0e1-1399-49dd-bda3-c418be3c4958", + "task": "add", + "question": "Please add a benzene ring to the molecule CCn1cc(C2CCN(C(=O)Nc3ccccc3N(C)C3CCCC3)CC2)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1cc(C2CCN(C(=O)Nc3ccccc3N(C)C3CCCC3)CC2)cn1.", + "ref_smiles": "CCn1cc(C2CCN(C(=O)Nc3c(-c4ccccc4)cccc3N(C)C3CCCC3)CC2)cn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7bf8c0c5-d4fe-4d68-9c9e-b8e1f528281b", + "task": "add", + "question": "Please add a nitrile to the molecule OCCCNC(=S)Nc1ccc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "OCCCNC(=S)Nc1ccc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc2c1.", + "ref_smiles": "N#Cc1cc(NC(=S)NCCCO)cc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc12", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "2a21c1c4-3c33-44b9-a346-b48487bb3680", + "task": "add", + "question": "Modify the molecule CCCNc1nc(C2CC2)nc(-c2ccsc2C)c1C by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNc1nc(C2CC2)nc(-c2ccsc2C)c1C", + "ref_smiles": "Cc1sccc1-c1nc(C2CC2)nc(NCC(C)CC=O)c1C", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "acdb712f-16e2-40cc-8f04-42f96dfb7e8c", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCNc1cc(C)cc(C)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCNc1cc(C)cc(C)n1.", + "ref_smiles": "Cc1cc(C)nc(NCCCCc2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "98569ee7-f51a-4500-a291-6b1083b1913b", + "task": "add", + "question": "Modify the molecule CC(C)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1", + "ref_smiles": "CC(CO)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c01c3c98-8ced-42a2-8f62-b0ee5cacaf2d", + "task": "add", + "question": "Modify the molecule Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1", + "ref_smiles": "Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "922b0ed0-fa7f-4ee4-a133-d93c649c4d98", + "task": "add", + "question": "Please add a hydroxyl to the molecule CSCCC(O)C(=O)NCc1noc(CC(C)C)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCC(O)C(=O)NCc1noc(CC(C)C)n1.", + "ref_smiles": "CSC(O)CC(O)C(=O)NCc1noc(CC(C)C)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "25519a57-fd77-400d-b05b-010fb4ae5195", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCC[Si](C)(C)OC(C)C(=O)OC1CCCOC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC[Si](C)(C)OC(C)C(=O)OC1CCCOC1.", + "ref_smiles": "CC(O[Si](C)(C)CCC(C)c1ccccc1)C(=O)OC1CCCOC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "21d81868-8e13-43ab-90b8-960695af4ad8", + "task": "add", + "question": "Modify the molecule C#CN(Nc1cc(OC)ccc1[N+](=O)[O-])C(=O)OC(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CN(Nc1cc(OC)ccc1[N+](=O)[O-])C(=O)OC(C)(C)C", + "ref_smiles": "COc1ccc([N+](=O)[O-])c(NN(C#CO)C(=O)OC(C)(C)C)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0cce25fd-4dfe-4fc3-a381-7c2cfa708bd9", + "task": "add", + "question": "Modify the molecule CC(CCNc1ccc2c(c1)CCC2)c1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CCNc1ccc2c(c1)CCC2)c1ccccc1", + "ref_smiles": "CC(c1ccccc1)C(CNc1ccc2c(c1)CCC2)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "8be2719b-ac06-4575-b75b-f05b4e3c6214", + "task": "add", + "question": "Modify the molecule O=C(Cn1c(=O)ccc2cc([N+](=O)[O-])ccc21)OC1CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cn1c(=O)ccc2cc([N+](=O)[O-])ccc21)OC1CCCC1", + "ref_smiles": "O=C(Cn1c(=O)c(-c2ccccc2)cc2cc([N+](=O)[O-])ccc21)OC1CCCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d2173ea8-4462-49f2-ae02-939f8b99a0dc", + "task": "add", + "question": "Modify the molecule [N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])cn5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])cn5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO", + "ref_smiles": "[N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])c(-c6ccccc6)n5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7c26b3e0-4dc8-419e-9e5f-600e4b935410", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NCc1cccnc1)C1CCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCc1cccnc1)C1CCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)CC1.", + "ref_smiles": "O=C(NC(c1ccccc1)c1cccnc1)C1CCN(c2nccc3nc(NCc4ccccc4Cl)ncc23)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f68c0f8c-0064-4e59-a03a-d2db29386266", + "task": "add", + "question": "Please add a benzene ring to the molecule CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCCC1)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCCC1)C1CC1.", + "ref_smiles": "CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCC(c2ccccc2)C1)C1CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4a22571a-4015-437a-a124-ebc5981ebdec", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1.", + "ref_smiles": "CC(O)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7d968dda-b5a1-4752-bb44-bcff0073c062", + "task": "add", + "question": "Please add a amine to the molecule C=CC1OCCC1NC(=O)N(C)C1CCN(C)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC1OCCC1NC(=O)N(C)C1CCN(C)C1=O.", + "ref_smiles": "C=CC1(N)OCCC1NC(=O)N(C)C1CCN(C)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "c35c29af-72a3-4eb0-95fe-015ba9da8b7e", + "task": "add", + "question": "Modify the molecule COC1CC(C(C)(C)OC)CC(C)=C1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CC(C(C)(C)OC)CC(C)=C1C", + "ref_smiles": "COC1CC(C(C)(C)OC)C(c2ccccc2)C(C)=C1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "550f6f7f-1062-491a-9413-097847faba72", + "task": "add", + "question": "Please add a thiol to the molecule CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1.", + "ref_smiles": "CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1S", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "28221f50-37b7-4cd1-a57c-0ae00be20749", + "task": "add", + "question": "Modify the molecule C[NH2+]Cc1ccccc1OCC[NH+](C)Cc1ccncc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]Cc1ccccc1OCC[NH+](C)Cc1ccncc1", + "ref_smiles": "C[NH2+]Cc1ccccc1OCC[NH+](C)C(N)c1ccncc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f97bfcc2-0ce0-4d24-8153-ff1b2affd7da", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CC[NH+](CCNC(=O)c2cc(C3CC3)n(C(C)(C)C)n2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](CCNC(=O)c2cc(C3CC3)n(C(C)(C)C)n2)CC1.", + "ref_smiles": "CC1CC[NH+](C(CNC(=O)c2cc(C3CC3)n(C(C)(C)C)n2)c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "164ad01e-3d34-4e33-9ca7-c6541920143e", + "task": "add", + "question": "Please add a carboxyl to the molecule Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3)CC2)nc1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3)CC2)nc1=O.", + "ref_smiles": "Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3C(=O)O)CC2)nc1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "e3f08153-8b31-42fb-aa16-d2b0ccfb26f9", + "task": "add", + "question": "Modify the molecule CNS(=O)(=O)c1ccc(C=NO)o1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNS(=O)(=O)c1ccc(C=NO)o1", + "ref_smiles": "CNS(=O)(=O)c1ccc(C(=NO)C(=O)O)o1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "944a94ba-6ec9-4a3f-9f90-7f72a2933e81", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(COC(=O)c1cccc(CSc2ccc(Cl)cc2)c1)NC(=O)NC1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(COC(=O)c1cccc(CSc2ccc(Cl)cc2)c1)NC(=O)NC1CC1.", + "ref_smiles": "O=C(COC(=O)c1cccc(CSc2ccc(Cl)cc2)c1)NC(=O)NC1(c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "db9c21ea-d9c0-4a5d-b266-055e0943d312", + "task": "add", + "question": "Please add a amine to the molecule CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2C)C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2C)C1=O.", + "ref_smiles": "CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2CN)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "7025ad70-d964-4776-94b1-c2cc7b6cf034", + "task": "add", + "question": "Modify the molecule CCC(C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)N(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)N(C)C", + "ref_smiles": "CCC(C)N(C(=O)N(C)C)C(C(=O)O)c1cccc(OS(C)(=O)=O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3f823f9f-f601-4051-9b7d-264ebc6d6ff5", + "task": "add", + "question": "Please add a benzene ring to the molecule C=CC(=O)N(C)c1cccc(C)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC(=O)N(C)c1cccc(C)n1.", + "ref_smiles": "Cc1cccc(N(C)C(=O)C=Cc2ccccc2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "12d5e595-f794-464c-a05f-ade12eceacbe", + "task": "add", + "question": "Modify the molecule Cc1ccc(NC(=O)CCNc2ccccc2C(C)C)cc1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)CCNc2ccccc2C(C)C)cc1C", + "ref_smiles": "Cc1ccc(NC(=O)CCNc2ccccc2C(C)Cc2ccccc2)cc1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7ce89e5c-2969-46bf-aedd-6fcf11b11557", + "task": "add", + "question": "Modify the molecule C=C(C)CC(=O)C1C[NH+](CCC)CCO1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)CC(=O)C1C[NH+](CCC)CCO1", + "ref_smiles": "C=C(C)CC(=O)C1(c2ccccc2)C[NH+](CCC)CCO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4f68ab2b-3e1e-4a58-874e-d6124047b0e9", + "task": "add", + "question": "Modify the molecule CCCCOc1ccc(C(=NNC(=O)c2ccncc2)C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOc1ccc(C(=NNC(=O)c2ccncc2)C(=O)[O-])cc1", + "ref_smiles": "CCCCOc1ccc(C(=NNC(=O)c2ccnc(-c3ccccc3)c2)C(=O)[O-])cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1d847213-7fbd-47c3-9898-ec76d4197b31", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(OCC(F)(F)F)C(=O)NC(CO)CC(C)(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(OCC(F)(F)F)C(=O)NC(CO)CC(C)(C)C.", + "ref_smiles": "CC(OCC(F)(F)F)C(=O)NC(CC(C)(C)C)C(O)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "9b86aed7-cadd-4a5e-8318-4c3718904339", + "task": "add", + "question": "Modify the molecule CN(c1cccc(Br)c1)C1CCCCC1[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(c1cccc(Br)c1)C1CCCCC1[NH3+]", + "ref_smiles": "CN(c1ccc(O)c(Br)c1)C1CCCCC1[NH3+]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "eab2a6a9-a6d7-43fb-a17e-118d274d1af5", + "task": "add", + "question": "Modify the molecule O=C([O-])C1Cn2c(n[nH]c2=O)C[NH+]1CC1CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])C1Cn2c(n[nH]c2=O)C[NH+]1CC1CCC1", + "ref_smiles": "O=C([O-])C1C(c2ccccc2)n2c(n[nH]c2=O)C[NH+]1CC1CCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5a4027a4-27bc-4790-96c9-e83024669c0f", + "task": "add", + "question": "Please add a amine to the molecule Cc1c(C[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C.", + "ref_smiles": "Cc1c(C(N)[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "35665113-49d7-4264-bc78-cbfe0671ccc7", + "task": "add", + "question": "Modify the molecule CC1(C)CSC(=NCC[NH+]2CCCC2)N1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)CSC(=NCC[NH+]2CCCC2)N1", + "ref_smiles": "CC1(CO)CSC(=NCC[NH+]2CCCC2)N1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "eda242b9-7653-43af-9409-61f211969293", + "task": "add", + "question": "Modify the molecule O=S(=O)(Cl)CC1=CCCCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(Cl)CC1=CCCCO1", + "ref_smiles": "O=S(=O)(Cl)CC1=C(O)CCCO1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "66dddec0-981f-4f1e-8e17-855557b2afef", + "task": "add", + "question": "Modify the molecule CC(N)(C[NH2+]CCc1nccs1)c1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(N)(C[NH2+]CCc1nccs1)c1ccccc1", + "ref_smiles": "CC(N)(C[NH2+]CCc1ncc(C(=O)O)s1)c1ccccc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "9c69fb12-48ee-4956-a33e-4a5aeb46d962", + "task": "add", + "question": "Modify the molecule COCC([NH3+])CN(C)C(=O)Cc1ccccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC([NH3+])CN(C)C(=O)Cc1ccccc1F", + "ref_smiles": "COCC([NH3+])CN(C)C(=O)Cc1ccc(-c2ccccc2)cc1F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c1875650-4f7b-4dee-9f77-b630fd41df56", + "task": "add", + "question": "Please add a nitrile to the molecule CC(C)[NH2+]CC(Cc1ccn(C)n1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)[NH2+]CC(Cc1ccn(C)n1)c1ccccc1.", + "ref_smiles": "CC(C)[NH2+]CC(Cc1nn(C)cc1C#N)c1ccccc1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "22e2f00d-5b62-47ca-ad4e-e871f2caf1aa", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)(C)CCCC(C)(C)CO[Si].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)CCCC(C)(C)CO[Si].", + "ref_smiles": "CC(C)(C)CCCC(C)(CO)CO[Si]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6d18d3ae-0bca-4cee-bc47-3667c989747f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC[NH2+]Cc1cn(-c2cc(Cl)cc(C(F)(F)F)c2)nn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]Cc1cn(-c2cc(Cl)cc(C(F)(F)F)c2)nn1.", + "ref_smiles": "CCC[NH2+]Cc1cn(-c2cc(Cl)c(O)c(C(F)(F)F)c2)nn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5e601ae9-8dd1-4ad5-88e3-86e8a5aefb1e", + "task": "add", + "question": "Modify the molecule Cc1ccc(Br)c(C)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(Br)c(C)c1", + "ref_smiles": "Cc1ccc(Br)c(CCC=O)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "af7a9b8b-efe0-4d11-b153-f41d0466f938", + "task": "add", + "question": "Modify the molecule Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccccc1-2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccccc1-2", + "ref_smiles": "Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccc(-c3ccccc3)cc1-2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dede5586-3e50-4106-8708-8cfa07864739", + "task": "add", + "question": "Modify the molecule O=C1CNC(=O)C(NC(=O)Cc2ccccc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CNC(=O)C(NC(=O)Cc2ccccc2)C1", + "ref_smiles": "O=C1CNC(=O)C(NC(=O)Cc2ccccc2O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cea7e033-a5d8-4d2f-a74e-9133f4d7f9ce", + "task": "add", + "question": "Modify the molecule O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)ccc2N1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)ccc2N1", + "ref_smiles": "O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)c(-c3ccccc3)cc2N1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b0a6869a-763c-4b73-be4f-e67d6b95598d", + "task": "add", + "question": "Modify the molecule CC1NC(=O)CCN(CCSc2ccccc2)C1=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1NC(=O)CCN(CCSc2ccccc2)C1=O", + "ref_smiles": "NCC1NC(=O)CCN(CCSc2ccccc2)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "93aee5fe-9240-4572-9a25-0e7264a418e1", + "task": "add", + "question": "Modify the molecule CCOC(=O)CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1", + "ref_smiles": "O=C(CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1)OCCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9eb30deb-76dd-4422-9997-ca46cd59cd26", + "task": "add", + "question": "Please add a nitrile to the molecule CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCCN(C(=O)NC2CCCCC2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCCN(C(=O)NC2CCCCC2)CC1.", + "ref_smiles": "CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCN(C(=O)NC2CCCCC2)CCC1C#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "7de165ab-5f8b-4d82-9d4e-c0aca4b6e65d", + "task": "add", + "question": "Modify the molecule O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1CCC[NH2+]CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1CCC[NH2+]CC1", + "ref_smiles": "O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1(C(=O)O)CCC[NH2+]CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "87ee7676-92b3-4df3-b3fe-0d24d28dde10", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3)c3ccc(C)cc3)C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3)c3ccc(C)cc3)C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1.", + "ref_smiles": "COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3O)c3ccc(C)cc3C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d8d6a10e-4753-4e42-9b8f-d7d25ee62484", + "task": "add", + "question": "Modify the molecule CCC1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1", + "ref_smiles": "CC(O)C1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cb1b57fd-1144-48a7-baf9-e15b44566b5d", + "task": "add", + "question": "Please add a hydroxyl to the molecule N#Cc1cccc(N2CC[NH+](CCCO)CC2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1cccc(N2CC[NH+](CCCO)CC2)n1.", + "ref_smiles": "N#Cc1cccc(N2CC[NH+](CC(O)CO)CC2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "def38247-8f6b-4545-9223-34f4a6cd278d", + "task": "add", + "question": "Modify the molecule CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)cc1", + "ref_smiles": "CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "13eab73a-7b83-43f0-a84d-7d35449b5939", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(C1=C2CCCC2Cc2ccccc21)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C1=C2CCCC2Cc2ccccc21)c1ccccc1.", + "ref_smiles": "O=C(C1=C2C(O)CCC2Cc2ccccc21)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ce7af262-cc60-4219-9052-b9c04ab15982", + "task": "add", + "question": "Modify the molecule COCc1nnc(NC(=O)COc2ccc(-c3ccccc3)cc2)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCc1nnc(NC(=O)COc2ccc(-c3ccccc3)cc2)s1", + "ref_smiles": "COCc1nnc(NC(=O)C(Oc2ccc(-c3ccccc3)cc2)c2ccccc2)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a9d31743-bcd6-4697-8664-8b75dba25d22", + "task": "add", + "question": "Modify the molecule COC(=O)C(Cc1cc(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C(Cc1cc(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1", + "ref_smiles": "COC(=O)C(Cc1c(-c2ccccc2)c(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "346a0952-5ed5-4c24-807d-a4e2325fe502", + "task": "add", + "question": "Please add a benzene ring to the molecule CON=C(Cl)C12CCC[NH+](CC1)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CON=C(Cl)C12CCC[NH+](CC1)C2.", + "ref_smiles": "CON=C(Cl)C12CCC(c3ccccc3)[NH+](CC1)C2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d72ffbe9-d78f-4551-a3b0-92519926181c", + "task": "add", + "question": "Please add a benzene ring to the molecule [NH3+]CCc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1.", + "ref_smiles": "[NH3+]C(Cc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ea8d637a-aef0-48a5-8d3c-e72d0818ac98", + "task": "add", + "question": "Modify the molecule NCC(CN1CC[NH+](Cc2ccccc2)CC1)C(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NCC(CN1CC[NH+](Cc2ccccc2)CC1)C(F)(F)F", + "ref_smiles": "NCC(CN1CC[NH+](Cc2ccccc2)CC1c1ccccc1)C(F)(F)F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b87397f2-11b5-4a84-a8f8-c9d9484e8078", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1cc(CCC(=O)Oc2cccc3ccccc23)cc(OC)c1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(CCC(=O)Oc2cccc3ccccc23)cc(OC)c1OC.", + "ref_smiles": "COc1cc(CCC(=O)Oc2c(O)ccc3ccccc23)cc(OC)c1OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b255c1cc-0f0f-4197-8b1a-89e76445da1c", + "task": "add", + "question": "Modify the molecule CCOC(=O)c1sc(C(=O)OCC)c(OC(=O)N(C)C)c1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1sc(C(=O)OCC)c(OC(=O)N(C)C)c1C", + "ref_smiles": "CCOC(=O)c1sc(C(=O)OC(C)O)c(C)c1OC(=O)N(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1d7ddd8f-c608-4fcb-bc8e-7f139e3378d5", + "task": "add", + "question": "Modify the molecule O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCC(=O)NCC(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCC(=O)NCC(F)(F)F", + "ref_smiles": "O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1-c1ccccc1)NCC(=O)NCC(F)(F)F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a1d11791-018c-43c1-a31b-d54dee731622", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)c1c(C(C)C)nc(-c2ccc(C(F)(F)F)cc2)n1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1c(C(C)C)nc(-c2ccc(C(F)(F)F)cc2)n1C.", + "ref_smiles": "COC(=O)c1c(C(C)Cc2ccccc2)nc(-c2ccc(C(F)(F)F)cc2)n1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "61d7758f-a5f3-4672-8b70-ebd685c3e60b", + "task": "add", + "question": "Please add a thiol to the molecule CN(CCCC(=O)OC12CCCCC1CCCC2)c1ccc(C2=C(O)C(=C3C=CC(=[N+](C)CCCC(=O)OC45CCCCC4CCCC5)C=C3)C2=O)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(CCCC(=O)OC12CCCCC1CCCC2)c1ccc(C2=C(O)C(=C3C=CC(=[N+](C)CCCC(=O)OC45CCCCC4CCCC5)C=C3)C2=O)cc1.", + "ref_smiles": "CN(CCCC(=O)OC12CCCCC1CCCC2)c1ccc(C2=C(O)C(=C3C=CC(=[N+](C)CCCC(=O)OC45CCCCC4CCCC5)C(S)=C3)C2=O)cc1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "d9a7d70d-d497-4025-b7d8-daf19fb9f068", + "task": "add", + "question": "Modify the molecule Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(C)(O)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(C)(O)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1", + "ref_smiles": "Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(O)(CN)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "6236d98c-9350-4aad-954c-78f6f2b41ff1", + "task": "add", + "question": "Modify the molecule CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1", + "ref_smiles": "CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "38bad98b-44dd-4f55-b657-3e1ae79be0fb", + "task": "add", + "question": "Modify the molecule CC1CCN(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCN(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1", + "ref_smiles": "CC1CC(CC=O)N(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "21bee90d-59a4-4ab0-a509-1101a5633c57", + "task": "add", + "question": "Modify the molecule CN(C)c1ccc2c(c1)-c1cccc[n+]1CC2 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)c1ccc2c(c1)-c1cccc[n+]1CC2", + "ref_smiles": "CN(CC(=O)O)c1ccc2c(c1)-c1cccc[n+]1CC2", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ec537fe4-f192-4f3c-9510-297b6000e59c", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(=O)c1cccc(NC(=O)CCOCC2CCCO2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1cccc(NC(=O)CCOCC2CCCO2)c1.", + "ref_smiles": "CC(=O)c1cc(NC(=O)CCOCC2CCCO2)cc(C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b1d4b038-5921-430d-b538-2109c0c4ad44", + "task": "add", + "question": "Modify the molecule CC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(CO)CC21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(CO)CC21", + "ref_smiles": "CC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(CO)C(O)C21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1d408cfc-1678-4eeb-9ce1-f72e846ce489", + "task": "add", + "question": "Modify the molecule C=CCn1c(=O)c(C(=O)OCCCC)c([O-])c2cc(OC)c(OC)cc21 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCn1c(=O)c(C(=O)OCCCC)c([O-])c2cc(OC)c(OC)cc21", + "ref_smiles": "C=CCn1c(=O)c(C(=O)OC(N)CCC)c([O-])c2cc(OC)c(OC)cc21", + "add_group": "amine", + "remove_group": null + }, + { + "id": "28042018-06fd-4180-ac9d-88d80cec8c41", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(Cn1cc(C(=O)N(Cc2ccccc2C(F)(F)F)C2CC2)nn1)OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(Cn1cc(C(=O)N(Cc2ccccc2C(F)(F)F)C2CC2)nn1)OCC.", + "ref_smiles": "CCOC(Cn1cc(C(=O)N(Cc2cc(-c3ccccc3)ccc2C(F)(F)F)C2CC2)nn1)OCC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "dba05cd4-abaf-4515-8a35-3f71d2368771", + "task": "add", + "question": "Please add a thiol to the molecule CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)cc1.", + "ref_smiles": "CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)c(S)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "7f995cb6-186a-4fff-ba63-2c5088830e28", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)N(C)CN=C(N)N[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)N(C)CN=C(N)N[N+](=O)[O-].", + "ref_smiles": "CC(=O)N(CN=C(N)N[N+](=O)[O-])Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8f325382-b387-4355-bfc0-18d823e4c648", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1csc(CCNS(=O)(=O)c2cccc(C#N)c2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1csc(CCNS(=O)(=O)c2cccc(C#N)c2)n1.", + "ref_smiles": "Cc1csc(CCNS(=O)(=O)c2ccc(O)c(C#N)c2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a035262e-0097-49ad-905b-769345531a3c", + "task": "add", + "question": "Modify the molecule O=C(Cc1ccccc1)NC1CN(c2ccncn2)CC1CO by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1ccccc1)NC1CN(c2ccncn2)CC1CO", + "ref_smiles": "O=C(Cc1ccccc1)NC1CN(c2ccnc(C(=O)O)n2)CC1CO", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "795c2439-a458-40a3-814c-418a006eef39", + "task": "add", + "question": "Please add a hydroxyl to the molecule NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1.", + "ref_smiles": "NS(=O)(=O)c1c(C(F)(F)F)cc(O)c(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "831d55cd-600b-4b08-b8d1-23eaf695e48c", + "task": "add", + "question": "Please add a nitrile to the molecule CSCCC(NC(=O)C([NH3+])Cc1cnc[nH]1)C(=O)NC(CCSC)C(=O)NC(CO)C(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCC(NC(=O)C([NH3+])Cc1cnc[nH]1)C(=O)NC(CCSC)C(=O)NC(CO)C(=O)[O-].", + "ref_smiles": "CSCCC(NC(=O)C(CCSC)NC(=O)C([NH3+])(C#N)Cc1cnc[nH]1)C(=O)NC(CO)C(=O)[O-]", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "6288b989-93c5-4305-83f1-90c26b2efeac", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1.", + "ref_smiles": "CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "85982fc5-b750-468b-bd17-e83dc68eda0e", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)OC(CI)C1OC2OC(C)(C)OC2C1OC(C)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)OC(CI)C1OC2OC(C)(C)OC2C1OC(C)=O.", + "ref_smiles": "CC(=O)OC(CI)C1OC2OC(C)(Cc3ccccc3)OC2C1OC(C)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d74d2421-0dfe-4bba-a393-79443ebe9e32", + "task": "add", + "question": "Modify the molecule CCC(C)NC(=O)c1cccc(CNC(=O)Cc2ccccc2C(=O)[O-])c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)NC(=O)c1cccc(CNC(=O)Cc2ccccc2C(=O)[O-])c1", + "ref_smiles": "CCC(C)NC(=O)c1ccc(O)c(CNC(=O)Cc2ccccc2C(=O)[O-])c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8a0aeecd-aadf-4569-b286-4037b4cae339", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(NCC2CC[NH2+]CC2)cc1OCCO.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(NCC2CC[NH2+]CC2)cc1OCCO.", + "ref_smiles": "COc1ccc(NC(c2ccccc2)C2CC[NH2+]CC2)cc1OCCO", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1d96c15b-b3f5-4acb-b07f-30a4efaf50e9", + "task": "add", + "question": "Modify the molecule O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(CO)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(CO)cs1", + "ref_smiles": "O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(C(O)c2ccccc2)cs1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "67b23b46-c3c0-4b1a-a4c9-dfacbbb973fc", + "task": "add", + "question": "Please add a amine to the molecule Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)C2)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)C2)c(C)c1.", + "ref_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)(N)C2)c(C)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "1a2e47be-b61f-4014-b6b3-63ea5797b6d3", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)Cc1cccc(OC2CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)Cc1cccc(OC2CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1.", + "ref_smiles": "CC(=O)Cc1cccc(OC2(c3ccccc3)CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7ff4a6b7-6416-410d-bb1d-1f9b919826b3", + "task": "add", + "question": "Modify the molecule CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-]", + "ref_smiles": "CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)c(-c2ccccc2)c1[N+](=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "23b3541d-49c9-4968-9eef-dcc933d24979", + "task": "add", + "question": "Modify the molecule C[NH2+]CCCNC(=O)c1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)[O-])c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CCCNC(=O)c1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)[O-])c1", + "ref_smiles": "C[NH2+]CCCNC(=O)c1ccc2c(oc(=O)n2Cc2cccc(NC(=O)[O-])c2)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5587d2b6-de14-438d-8f1d-876e7ec77cb4", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH2+]Cc1cc(Cl)ccc1OCCC1CCCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]Cc1cc(Cl)ccc1OCCC1CCCO1.", + "ref_smiles": "C[NH2+]Cc1c(OCCC2CCCO2)ccc(Cl)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6f090935-9929-4f94-ad62-14823321dc93", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2ccccc2F)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2ccccc2F)CC1.", + "ref_smiles": "CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2cc(O)ccc2F)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0d4bd36d-279d-4e30-834c-15cbc06384aa", + "task": "add", + "question": "Please add a hydroxyl to the molecule [NH3+]CC1CCCN1C(=O)NCC1CCOC2(CCC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CC1CCCN1C(=O)NCC1CCOC2(CCC2)C1.", + "ref_smiles": "[NH3+]CC1C(O)CCN1C(=O)NCC1CCOC2(CCC2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "72c70b04-91a4-4fba-b115-2f52f4746fa6", + "task": "add", + "question": "Modify the molecule Cc1cccc(Oc2ccc(B(O)O)cc2)c1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(Oc2ccc(B(O)O)cc2)c1", + "ref_smiles": "Cc1cccc(Oc2ccc(B(O)O)c(C#N)c2)c1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "815d365c-e2d9-4618-b847-8008f4424bf3", + "task": "add", + "question": "Please add a carboxyl to the molecule O=[N+]([O-])c1cccnc1NCc1ccnc(N2CCOCC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=[N+]([O-])c1cccnc1NCc1ccnc(N2CCOCC2)c1.", + "ref_smiles": "O=C(O)C1CN(c2cc(CNc3ncccc3[N+](=O)[O-])ccn2)CCO1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "eef17ba3-a02c-462c-b43f-57e9123f148f", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=S1(=O)CC[N+]2(CC1)CC1CCC2C(CO)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S1(=O)CC[N+]2(CC1)CC1CCC2C(CO)C1.", + "ref_smiles": "O=S1(=O)CC[N+]2(CC1)CC1CC(O)C2C(CO)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "62f54473-5d26-4d45-8f15-60662c3add14", + "task": "add", + "question": "Modify the molecule COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)CC1OC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)CC1OC", + "ref_smiles": "COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)C(O)C1OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a482304f-9b7e-4c58-b0f8-14967e486340", + "task": "add", + "question": "Modify the molecule c1cc[n+](N2CCNCC2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1cc[n+](N2CCNCC2)cc1", + "ref_smiles": "Nc1cc[n+](N2CCNCC2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "e6cecf7f-1cae-4fd5-9180-12687bf98260", + "task": "add", + "question": "Modify the molecule COCCNC(=O)C(C)Nc1cc(NN)nc(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCNC(=O)C(C)Nc1cc(NN)nc(C)n1", + "ref_smiles": "COCCNC(=O)C(C)(Nc1cc(NN)nc(C)n1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5c6c7405-01f9-424a-a667-0b042f89904a", + "task": "add", + "question": "Modify the molecule COc1ccc(C(C)=C2SC(=O)N(c3cccc(C)c3C)C2=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(C)=C2SC(=O)N(c3cccc(C)c3C)C2=O)cc1", + "ref_smiles": "COc1ccc(C(C)=C2SC(=O)N(c3ccc(-c4ccccc4)c(C)c3C)C2=O)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7bc4d06f-f679-44db-8c6c-010312456ca1", + "task": "add", + "question": "Please add a amine to the molecule Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccccc3)c2)cc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccccc3)c2)cc1C.", + "ref_smiles": "Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccc(N)cc3)c2)cc1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "7f47a78d-37db-4f84-853e-239de58d4cfa", + "task": "add", + "question": "Modify the molecule CSN1CCC(C)(S(=O)(=O)CC(C)C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSN1CCC(C)(S(=O)(=O)CC(C)C)CC1", + "ref_smiles": "CSN1CCC(C)(S(=O)(=O)CC(C)CO)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "840e83b5-e51d-4e16-af7c-373eef83df01", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(C)c1.", + "ref_smiles": "Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(Cc2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "03f92cfb-2cb4-4822-afef-6826f035b812", + "task": "add", + "question": "Modify the molecule COc1ccc(CC(=O)NCC(CCO)c2ccccc2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CC(=O)NCC(CCO)c2ccccc2)c(Cl)c1", + "ref_smiles": "COc1ccc(CC(=O)NCC(CCO)c2ccc(O)cc2)c(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a9ad83ac-f93b-43f1-9d4e-a9cbf4d5fd72", + "task": "add", + "question": "Modify the molecule Cc1cc(C(F)(F)F)ccc1CF by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C(F)(F)F)ccc1CF", + "ref_smiles": "Cc1c(CF)ccc(C(F)(F)F)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "01b9db10-ab06-4d96-9b9e-6f532fb8fcb9", + "task": "add", + "question": "Please add a benzene ring to the molecule CCn1c(CN2C(=O)c3ccccc3C2=O)nc2ccc(Br)cc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1c(CN2C(=O)c3ccccc3C2=O)nc2ccc(Br)cc21.", + "ref_smiles": "CCn1c(CN2C(=O)c3ccc(-c4ccccc4)cc3C2=O)nc2ccc(Br)cc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5fec007c-f833-435c-8ecf-e97d36b8a901", + "task": "add", + "question": "Modify the molecule C#CCCCC(O)CCCC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CCCCC(O)CCCC", + "ref_smiles": "CCCCC(O)CCCC#Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "030ec969-aca8-4921-8a7d-160435bd35b9", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCC(=O)c1ccncc1CC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCC(=O)c1ccncc1CC.", + "ref_smiles": "CCCCCCCCCC(=O)c1cc(-c2ccccc2)ncc1CC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c54dca32-0ba9-4ad4-beec-31358b30768f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1.", + "ref_smiles": "CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "95f27cbd-1ddc-412a-8ba5-d392b22b1532", + "task": "add", + "question": "Modify the molecule COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2)cc1OC by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2)cc1OC", + "ref_smiles": "COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2C(=O)O)cc1OC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4fddf8f3-0256-4945-bc2b-e28209d41c32", + "task": "add", + "question": "Modify the molecule Cc1ccc2noc(CCC(=O)[O-])c2c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2noc(CCC(=O)[O-])c2c1", + "ref_smiles": "Cc1cc(N)c2noc(CCC(=O)[O-])c2c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "d5f4bb5f-d34e-48b7-badc-3900f5eaf527", + "task": "add", + "question": "Modify the molecule NC(N)=[NH+]CCCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(N)=[NH+]CCCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-]", + "ref_smiles": "NC(N)=[NH+]C(CCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-])c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d99c7914-78f2-4eb6-ba0b-e8af77ff7277", + "task": "add", + "question": "Modify the molecule CCC(C)NC(=O)CCCCCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)NC(=O)CCCCCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O", + "ref_smiles": "CCC(C)NC(=O)CCC(O)CCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e0bbb691-8965-4707-b470-bcf13f27ef15", + "task": "add", + "question": "Modify the molecule [NH3+]C1(CO)CCC(OCCCC(F)(F)F)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1(CO)CCC(OCCCC(F)(F)F)C1", + "ref_smiles": "[NH3+]C1(CO)CCC(OC(O)CCC(F)(F)F)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e9311230-fa57-44a6-8ef9-34924362eb4a", + "task": "add", + "question": "Modify the molecule CC(=O)NC(Cc1ccccc1)C(=O)C(C)(C)C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NC(Cc1ccccc1)C(=O)C(C)(C)C", + "ref_smiles": "CC(=O)NC(Cc1ccccc1N)C(=O)C(C)(C)C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ae1c4384-3ee0-4b4a-9ae1-8237dadde512", + "task": "add", + "question": "Modify the molecule C=CCNC(=S)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCNC(=S)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1", + "ref_smiles": "C=CCNC(=S)NN=Cc1ccc(-c2c(Cl)cc([N+](=O)[O-])cc2-c2ccccc2)o1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "78eda358-c732-484d-94ad-e9bf648948a9", + "task": "add", + "question": "Modify the molecule CCc1ccc(C2SCC(=O)N2Cc2ccccn2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(C2SCC(=O)N2Cc2ccccn2)cc1", + "ref_smiles": "CC(c1ccccc1)c1ccc(C2SCC(=O)N2Cc2ccccn2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5daf7717-e8b0-4771-bf85-948a5c2e974d", + "task": "add", + "question": "Modify the molecule CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(C2)[NH2+]3)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(C2)[NH2+]3)CC1", + "ref_smiles": "CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(O)(C2)[NH2+]3)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7c9a3f75-9325-43e0-85bc-280ef5c65dcd", + "task": "add", + "question": "Modify the molecule Cc1ccc(-c2cc3[nH]c2C=C2N=C(C=c4cc(-c5ccc(I)cc5)c([nH]4)=CC4=NC3(C)CC4(C)C)CC2(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2cc3[nH]c2C=C2N=C(C=c4cc(-c5ccc(I)cc5)c([nH]4)=CC4=NC3(C)CC4(C)C)CC2(C)C)cc1", + "ref_smiles": "CC1(C)CC2=NC1=Cc1[nH]c(cc1-c1ccc(Cc3ccccc3)cc1)C1(C)CC(C)(C)C(=N1)C=c1[nH]c(cc1-c1ccc(I)cc1)=C2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "72339bd9-0769-419f-aebb-3a5028f190cb", + "task": "add", + "question": "Please add a benzene ring to the molecule O=c1cc(CSc2ccc(Cl)cc2)[nH]c(N2CCN(c3ccccn3)CC2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1cc(CSc2ccc(Cl)cc2)[nH]c(N2CCN(c3ccccn3)CC2)n1.", + "ref_smiles": "O=c1cc(CSc2ccc(Cl)c(-c3ccccc3)c2)[nH]c(N2CCN(c3ccccn3)CC2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c303e2e6-887e-4954-8a3a-58ea84a51bb2", + "task": "add", + "question": "Modify the molecule C=CCn1c(CC(=O)Nc2ccc(OC)cc2)nnc1SCC(=O)Nc1nccs1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCn1c(CC(=O)Nc2ccc(OC)cc2)nnc1SCC(=O)Nc1nccs1", + "ref_smiles": "C=CCn1c(CC(=O)Nc2ccc(OC)cc2C(=O)O)nnc1SCC(=O)Nc1nccs1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "fef5b848-93e3-4d87-91b8-088036d63ab0", + "task": "add", + "question": "Modify the molecule Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2)nc1C(N)=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2)nc1C(N)=O", + "ref_smiles": "Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2N)nc1C(N)=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3e353b3b-20dd-4355-bf15-5423996c5429", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NCC(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccco1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccco1.", + "ref_smiles": "O=C(NC(C(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccccc1)c1ccco1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8f3b5dc3-9fe5-4db8-a9ad-5b3cf2b44451", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)cc1.", + "ref_smiles": "O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "90199e30-ecf0-49e3-b562-beea6d664ff4", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOc1cc2c(cc1OCC)CN(C(=O)C(CC)(CC)C[NH3+])CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc2c(cc1OCC)CN(C(=O)C(CC)(CC)C[NH3+])CC2.", + "ref_smiles": "CCOc1cc2c(cc1OC(C)c1ccccc1)CCN(C(=O)C(CC)(CC)C[NH3+])C2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "a120db7e-6670-4138-be08-4ddaa9ed60ba", + "task": "add", + "question": "Please add a benzene ring to the molecule NC(=O)C1CCCN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)C1CCCN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1.", + "ref_smiles": "NC(=O)C1CC(c2ccccc2)CN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1bfff9b7-eaec-4268-9928-fd75c756fcda", + "task": "add", + "question": "Please add a carboxyl to the molecule CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1.", + "ref_smiles": "CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "7b6b3252-900b-41dd-be2b-df6d1b439a43", + "task": "add", + "question": "Modify the molecule Cn1cncc1C(Cc1ccc(I)cc1)NN by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cncc1C(Cc1ccc(I)cc1)NN", + "ref_smiles": "Cn1cnc(O)c1C(Cc1ccc(I)cc1)NN", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8c21a494-6f1f-481f-9c33-c7eeb7e507d4", + "task": "add", + "question": "Modify the molecule CCC[NH+]1CCC(CNc2ncnc(N)c2Cl)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH+]1CCC(CNc2ncnc(N)c2Cl)C1", + "ref_smiles": "CCC[NH+]1CCC(CNc2nc(-c3ccccc3)nc(N)c2Cl)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9a2519c1-0c81-41f1-a421-ebf35d050fb4", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(=O)c1nn(Cc2ccc(OC)cc2)c2c1CN(C(=O)c1ccnn1C)CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1nn(Cc2ccc(OC)cc2)c2c1CN(C(=O)c1ccnn1C)CC2.", + "ref_smiles": "CCOC(=O)c1nn(Cc2ccc(OC)c(-c3ccccc3)c2)c2c1CN(C(=O)c1ccnn1C)CC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8f95f7d7-be3e-4a34-9749-d5341f8d51be", + "task": "add", + "question": "Please add a nitrile to the molecule COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)C)CC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)C)CC2)C1.", + "ref_smiles": "COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)(C)C#N)CC2)C1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "15a9dc37-4d19-4658-b9c3-35cf70360f88", + "task": "add", + "question": "Modify the molecule [NH3+]CC(O)(CN1CCc2ccc(F)cc21)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CC(O)(CN1CCc2ccc(F)cc21)c1ccccc1", + "ref_smiles": "[NH3+]C(c1ccccc1)C(O)(CN1CCc2ccc(F)cc21)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "12107900-bcff-4732-af94-b38de00e293a", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1Cc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1Cc1ccccc1.", + "ref_smiles": "O=C(C[P+](c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1)N1C(=O)OCC1Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b64ae4c3-7c10-4a39-990f-3713bde34f51", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CC(CCCCCC(=O)C2OC2CCCC=O)OC(C)(C)O1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC(CCCCCC(=O)C2OC2CCCC=O)OC(C)(C)O1.", + "ref_smiles": "CC1CC(C(CCCCC(=O)C2OC2CCCC=O)c2ccccc2)OC(C)(C)O1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "11c43a5c-bf50-48c4-8357-c7da2f4f6d8c", + "task": "add", + "question": "Modify the molecule CCC(CC)C(Cc1cccc(Cl)c1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)C(Cc1cccc(Cl)c1)C(=O)[O-]", + "ref_smiles": "CCC(CC)C(Cc1cc(Cl)cc(-c2ccccc2)c1)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0c43df09-89af-4836-86c1-49b5be3e189a", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C([O-])C(O)c1c(F)cc([N+](=O)[O-])cc1Br.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])C(O)c1c(F)cc([N+](=O)[O-])cc1Br.", + "ref_smiles": "O=C([O-])C(O)c1c(Br)cc([N+](=O)[O-])c(O)c1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4b216aee-6106-44ca-a699-1a91b753ed4a", + "task": "add", + "question": "Please add a hydroxyl to the molecule N#CCCNC(=O)COc1ccc(-c2ccccc2)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CCCNC(=O)COc1ccc(-c2ccccc2)cc1Cl.", + "ref_smiles": "N#CCCNC(=O)COc1cc(O)c(-c2ccccc2)cc1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9c6a71f5-cd36-44dd-80a0-17b661b6ee19", + "task": "add", + "question": "Please add a hydroxyl to the molecule Clc1c(CC2CC[NH2+]CC2)ccc2[nH]ccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "Clc1c(CC2CC[NH2+]CC2)ccc2[nH]ccc12.", + "ref_smiles": "OC1CC(Cc2ccc3[nH]ccc3c2Cl)CC[NH2+]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "beca09da-9039-4116-816c-aacf29abcd56", + "task": "add", + "question": "Modify the molecule CCC(CO)(CO)NC(=O)c1ccccc1C(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CO)(CO)NC(=O)c1ccccc1C(F)(F)F", + "ref_smiles": "CCC(CO)(NC(=O)c1ccccc1C(F)(F)F)C(O)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0c4c179c-1436-4c22-b9c3-a051612e5bfa", + "task": "add", + "question": "Modify the molecule CC(C)=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2", + "ref_smiles": "CC(=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2)CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "44da4e41-c39c-4cc7-b1f3-dd284d4a9edd", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C([NH3+])C2CCCc3ccccc32)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C([NH3+])C2CCCc3ccccc32)cc1Cl.", + "ref_smiles": "Cc1ccc(C([NH3+])C2(O)CCCc3ccccc32)cc1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "05693165-bf7e-4303-a88f-0a52f93cf4a8", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C=C(C(O)C(C)(C)C)n2cncn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C=C(C(O)C(C)(C)C)n2cncn2)cc1.", + "ref_smiles": "Cc1ccc(C=C(C(O)C(C)(C)CO)n2cncn2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8356fa0f-116e-487c-b5d9-116f151b1632", + "task": "add", + "question": "Modify the molecule CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1", + "ref_smiles": "CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "70928abf-a580-4ce3-be68-06b741343f0e", + "task": "add", + "question": "Please add a amine to the molecule CC(NC(=O)CC(=O)NC(C)C1(O)CCCC1)C1(O)CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)CC(=O)NC(C)C1(O)CCCC1)C1(O)CCCC1.", + "ref_smiles": "CC(NC(=O)CC(=O)NC(C)(N)C1(O)CCCC1)C1(O)CCCC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9fba7c31-1d2f-4772-ba3a-9959b8a62096", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](Cc2ccccc2)C3)N1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](Cc2ccccc2)C3)N1.", + "ref_smiles": "CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](C(C(=O)O)c2ccccc2)C3)N1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b61f84f4-bd55-4474-a8ce-3eaa65ee4601", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)cc34)cc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)cc34)cc2)CC1.", + "ref_smiles": "C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)c(-c5ccccc5)c34)cc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3c6b8763-1050-438b-89e3-779989b5fa26", + "task": "add", + "question": "Modify the molecule CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CCC[NH+]=C(N)N)C(=O)NC(CCC(N)=O)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CCC[NH+]=C(N)N)C(=O)NC(CCC(N)=O)C(=O)[O-]", + "ref_smiles": "CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CC(C[NH+]=C(N)N)c1ccccc1)C(=O)NC(CCC(N)=O)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "cfe1f3e5-bc5e-4d15-95f9-f8a2dfa1b3c0", + "task": "add", + "question": "Modify the molecule Fc1cccc2c1C1(CC1)C1(c3cnc[nH]3)CC21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Fc1cccc2c1C1(CC1)C1(c3cnc[nH]3)CC21", + "ref_smiles": "Oc1cc(F)c2c(c1)C1CC1(c1cnc[nH]1)C21CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3e8193f7-d18f-4cf7-9a67-5b54243b9836", + "task": "add", + "question": "Modify the molecule CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1", + "ref_smiles": "CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1CC=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "aa2933c9-bdc7-42ea-9d08-2757a1af0ec6", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCCC(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCCC(C)C.", + "ref_smiles": "COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCC(O)C(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "aab939f5-fe92-4e96-b5cf-72977d3b5afe", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(O)Cc1cc(C[NH3+])c(CC(C)O)c(C[NH3+])c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)Cc1cc(C[NH3+])c(CC(C)O)c(C[NH3+])c1.", + "ref_smiles": "CC(O)Cc1c(C[NH3+])cc(CC(O)CO)cc1C[NH3+]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e27d9424-4833-4e7e-b504-4c7fc0ce05ba", + "task": "add", + "question": "Modify the molecule Cn1cc(C([NH3+])c2ccccc2C(C)(C)C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cc(C([NH3+])c2ccccc2C(C)(C)C)cn1", + "ref_smiles": "Cn1cc(C([NH3+])c2cc(O)ccc2C(C)(C)C)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d887bda8-3b5b-4cd1-a571-be31656894e7", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1COc2c(Cl)cccc2C1[NH3+].\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1COc2c(Cl)cccc2C1[NH3+].", + "ref_smiles": "CC1COc2c(Cl)cccc2C1([NH3+])c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "047ff580-98d4-4412-82e0-dc5747ef2bab", + "task": "add", + "question": "Modify the molecule C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(C)C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(C)C(C)(C)C", + "ref_smiles": "C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(Cc1ccccc1)C(C)(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b6e46524-ee10-467e-ba4d-a9f3c9196eb3", + "task": "add", + "question": "Modify the molecule Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1", + "ref_smiles": "Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3d421302-5dd0-45c1-8446-64a6b0fc08e5", + "task": "add", + "question": "Modify the molecule C=CC=C(C)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC=C(C)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1", + "ref_smiles": "CC(=CC=Cc1ccccc1)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5cc11f38-810f-4aa6-bec6-bfd020a0854f", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1.", + "ref_smiles": "COc1cc(-c2ccccc2)c(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b9d0c052-6676-4bf4-9935-558d9439a6f4", + "task": "add", + "question": "Modify the molecule CCCNC(=O)Cn1c(-c2nnc(CC(C)C)o2)cc2ccccc21 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNC(=O)Cn1c(-c2nnc(CC(C)C)o2)cc2ccccc21", + "ref_smiles": "CCCNC(=O)Cn1c(-c2nnc(C(C#N)C(C)C)o2)cc2ccccc21", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "d338a93a-64a2-4c6a-8747-89dc7e49d513", + "task": "add", + "question": "Modify the molecule CCOC1(C(=O)Nc2ccc(OC)c(C(F)(F)F)c2)CCCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC1(C(=O)Nc2ccc(OC)c(C(F)(F)F)c2)CCCCCC1", + "ref_smiles": "CCOC1(C(=O)Nc2ccc(OC)c(C(F)(F)F)c2)CCCCCC1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "626e5b54-57e2-48d9-8747-ebad6096a694", + "task": "add", + "question": "Please add a carboxyl to the molecule CCOC(=O)CC(CCC(C)C)C1CCOC(C)(C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CC(CCC(C)C)C1CCOC(C)(C)C1.", + "ref_smiles": "CCOC(=O)CC(CCC(C)(C)C(=O)O)C1CCOC(C)(C)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b9b6e353-f2be-46d6-adfe-afccec557062", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1.", + "ref_smiles": "Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C(c3ccccc3)[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0bf2dd8a-86a0-46a3-a030-9222ca9ad8a9", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2CO)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2CO)c1.", + "ref_smiles": "C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2C(O)c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1e93c7a2-e1b3-4a12-9b7c-a4185ecd09d8", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(Nc1ccc(OC2CCCCC2O)cc1)C1CCn2cc[nH+]c2C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc(OC2CCCCC2O)cc1)C1CCn2cc[nH+]c2C1.", + "ref_smiles": "O=C(Nc1ccc(OC2CCCCC2(O)O)cc1)C1CCn2cc[nH+]c2C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "8292dbfe-94eb-45d6-8aa5-883d1b4c0d15", + "task": "add", + "question": "Modify the molecule Cc1cc(Cl)c(C=O)cc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Cl)c(C=O)cc1Cl", + "ref_smiles": "Cc1cc(Cl)c(C(=O)c2ccccc2)cc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "57f57565-a2a8-49b3-80f4-4cc286110a65", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)C1CC[NH+](Cc2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1CC[NH+](Cc2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1.", + "ref_smiles": "COC(=O)C1CC[NH+](C(c2ccccc2)c2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "48d17d91-d919-4d5f-90ae-a9f28f96c268", + "task": "add", + "question": "Modify the molecule CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1", + "ref_smiles": "CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "128e3366-b093-4ef3-85bd-82d366952d2b", + "task": "add", + "question": "Please add a benzene ring to the molecule CS(=O)(=O)CC(=O)NCC1(CCl)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)CC(=O)NCC1(CCl)CC1.", + "ref_smiles": "CS(=O)(=O)CC(=O)NCC1(CCl)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1a27e916-4406-423f-9d94-e84611612d17", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)(C)OC(=O)N1CCCC1C(O)F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)OC(=O)N1CCCC1C(O)F.", + "ref_smiles": "CC(C)(C)OC(=O)N1C(C(=O)O)CCC1C(O)F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "5c5175dd-679e-40d4-b04b-fbc98149a9a2", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2.", + "ref_smiles": "CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "17a25ca4-ea17-49e4-8c8c-baa271741912", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C(=O)N1CCCCO1)N1C(=O)c2ccc(Br)cc2C1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(=O)N1CCCCO1)N1C(=O)c2ccc(Br)cc2C1=O.", + "ref_smiles": "O=C(C(Cc1ccccc1)N1C(=O)c2ccc(Br)cc2C1=O)N1CCCCO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "efdeb7e3-0325-46dd-9623-024a2c09a9fa", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C(=O)N2CC[NH+](C(C)C)CC2)c(F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)N2CC[NH+](C(C)C)CC2)c(F)c1.", + "ref_smiles": "Cc1ccc(C(=O)N2CC[NH+](C(C)Cc3ccccc3)CC2)c(F)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "da9d62ea-cf13-4444-90f1-43c2ea4d7177", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1cccc(Nc2cc(-c3nc(N4CC[NH2+]CC4)c4c(C5CC5)cncc4n3)ccn2)c1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(Nc2cc(-c3nc(N4CC[NH2+]CC4)c4c(C5CC5)cncc4n3)ccn2)c1F.", + "ref_smiles": "COc1cccc(Nc2cc(-c3nc(N4CC[NH2+]CC4)c4c(C5CC5)cncc4n3)c(C(=O)O)cn2)c1F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "1c75346f-2d83-46a5-bb65-a33c4db134c9", + "task": "add", + "question": "Modify the molecule CCC(Sc1cccc(NC(=O)c2cccs2)c1)C(=O)Nc1ccccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(Sc1cccc(NC(=O)c2cccs2)c1)C(=O)Nc1ccccc1F", + "ref_smiles": "CCC(Sc1cc(NC(=O)c2cccs2)ccc1-c1ccccc1)C(=O)Nc1ccccc1F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "320ab8fd-1d42-465b-b523-854137afef93", + "task": "add", + "question": "Modify the molecule CCOc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1", + "ref_smiles": "CC(Oc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "195f1ebb-163a-42d9-8dde-86cb08782b67", + "task": "add", + "question": "Modify the molecule COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2cc1OC[N+]1(C)CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2cc1OC[N+]1(C)CCCCC1", + "ref_smiles": "COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2c(N)c1OC[N+]1(C)CCCCC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "feab0f9a-8d5e-4efd-bcba-7868983639b0", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)C.", + "ref_smiles": "CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "253fd49d-0bf7-4bf4-9090-8baac1988b09", + "task": "add", + "question": "Modify the molecule CCC(C)[NH+](C)CCNS(=O)(=O)N(C)CCC[NH2+]C(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)[NH+](C)CCNS(=O)(=O)N(C)CCC[NH2+]C(C)C", + "ref_smiles": "CCC(C)[NH+](C)CC(O)NS(=O)(=O)N(C)CCC[NH2+]C(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dd0501f0-70c0-4021-9267-db50a3d6ea7e", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCCOCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCCOCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1.", + "ref_smiles": "O=C(NC(O)COCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "186ee8a2-0640-47c9-8844-715fbbe4bdec", + "task": "add", + "question": "Modify the molecule CCC(CC)(CC(=O)Nc1ncccc1Cl)C(=O)[O-] by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)(CC(=O)Nc1ncccc1Cl)C(=O)[O-]", + "ref_smiles": "CCC(CCS)(CC(=O)Nc1ncccc1Cl)C(=O)[O-]", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "bdbee59d-a1a9-4f12-9176-1298c94d3903", + "task": "add", + "question": "Modify the molecule Cc1ccc(-c2noc(C3CC[NH2+]CC3)n2)cc1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2noc(C3CC[NH2+]CC3)n2)cc1Br", + "ref_smiles": "Cc1ccc(-c2noc(C3CC[NH2+]C(c4ccccc4)C3)n2)cc1Br", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "353bc2f9-5f6c-4d74-bbab-00b9bb3263c7", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCCC4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCCC4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1.", + "ref_smiles": "COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCC(O)C4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "39d85c14-6998-4cdd-982a-a21428ae56ad", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(NC(=O)c1cc(N)nc2ccccc12)C1CCOC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)c1cc(N)nc2ccccc12)C1CCOC1.", + "ref_smiles": "CC(NC(=O)c1cc(N)nc2ccccc12)C1COCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "76481d89-92a9-490a-8663-f4876a594b99", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1c(C(=O)NCC(O)CC(C)C)cnn1-c1ccncc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(=O)NCC(O)CC(C)C)cnn1-c1ccncc1.", + "ref_smiles": "Cc1c(C(=O)NC(O)C(O)CC(C)C)cnn1-c1ccncc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e9f2ab96-9e76-424c-a35e-7fa603fa866c", + "task": "add", + "question": "Modify the molecule O=C(OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1", + "ref_smiles": "O=C(OC1(O)c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "23d58754-36d2-414c-92e9-332f028d45ea", + "task": "add", + "question": "Please add a thiol to the molecule CCOc1ccc(CC(=O)[O-])cc1[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(CC(=O)[O-])cc1[N+](=O)[O-].", + "ref_smiles": "O=C([O-])Cc1ccc(OCCS)c([N+](=O)[O-])c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "ee9d8654-fa28-46ea-a264-e1087f901131", + "task": "add", + "question": "Modify the molecule CCOC(=O)CN(CCOC)C(=O)c1cc(Br)c[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CN(CCOC)C(=O)c1cc(Br)c[nH]1", + "ref_smiles": "CCOC(=O)CN(CCOC)C(=O)c1[nH]cc(Br)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "aa72b4a4-7e47-4003-a1f3-4e20e2592beb", + "task": "add", + "question": "Modify the molecule CCCCCCCCCCOCC(O)C[NH2+]CCO by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCOCC(O)C[NH2+]CCO", + "ref_smiles": "CCCCCCCCCC(CC=O)OCC(O)C[NH2+]CCO", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "2055a877-e5c6-48ed-b43b-cd3e98a257fb", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(c1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1.", + "ref_smiles": "O=S(=O)(c1ccc(Cl)c(O)c1)N1CCC(C(F)(F)F)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ad3a2c46-f18d-4f7b-930b-c21ea262e7d9", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCCCC([NH2+]C)c1c(Cl)cnn1CCOC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCC([NH2+]C)c1c(Cl)cnn1CCOC.", + "ref_smiles": "CCCCC(O)CC([NH2+]C)c1c(Cl)cnn1CCOC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9dfb2b57-dee5-4225-8f84-b18c506b76f4", + "task": "add", + "question": "Please add a amine to the molecule CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)cc1.", + "ref_smiles": "CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)c(N)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "5997ab6c-8074-42ab-92e1-34a3e611e16c", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCC.", + "ref_smiles": "CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC=CC(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "91bbc46c-0a72-49fe-84cd-e4adbc5dc44f", + "task": "add", + "question": "Modify the molecule O=Cc1cc(CCCCl)ccc1CBr by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=Cc1cc(CCCCl)ccc1CBr", + "ref_smiles": "O=Cc1cc(CCCCl)ccc1C(Br)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "388a4448-34b9-4549-bbcf-852937b299b0", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)C.", + "ref_smiles": "Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)CC(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ee0a671a-81d9-4d67-a165-a9971be82c6d", + "task": "add", + "question": "Modify the molecule OCCC1CCCC[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "OCCC1CCCC[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1", + "ref_smiles": "OCCC1CCCC(O)[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fe72e06a-1161-4e66-ae1a-9b836b3afdc5", + "task": "add", + "question": "Modify the molecule O=C(Nc1ccc2c(c1)CCN2C(=O)Cc1ccccn1)c1cccnc1N1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc2c(c1)CCN2C(=O)Cc1ccccn1)c1cccnc1N1CCCCC1", + "ref_smiles": "O=C(Nc1cc2c(c(-c3ccccc3)c1)N(C(=O)Cc1ccccn1)CC2)c1cccnc1N1CCCCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8526d79b-c4e0-4335-aacc-15b8c7287de3", + "task": "add", + "question": "Please add a amine to the molecule CCc1nc(C(C)Nc2nnc(CC)c(CC)n2)cs1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nc(C(C)Nc2nnc(CC)c(CC)n2)cs1.", + "ref_smiles": "CCc1nc(C(C)Nc2nnc(C(C)N)c(CC)n2)cs1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "1f90c231-ad77-4282-b6a6-cc700c9d9258", + "task": "add", + "question": "Please add a thiol to the molecule Cn1cccc1C(=O)N1CC2(CC(OCc3ccccn3)CS2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cccc1C(=O)N1CC2(CC(OCc3ccccn3)CS2)C1.", + "ref_smiles": "Cn1cccc1C(=O)N1CC2(CC(OC(S)c3ccccn3)CS2)C1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "d5620f20-8061-4745-9285-60fee2cc6578", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3)cc2C)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3)cc2C)cc1", + "ref_smiles": "Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3C#N)cc2C)cc1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "d5586e03-6c57-4dbf-b55c-c08de82cad4c", + "task": "add", + "question": "Modify the molecule Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N", + "ref_smiles": "Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cc(S)cs2)cc(C(F)(F)F)c1C#N", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "01316cd6-e426-43e2-a62f-00d67a3965e0", + "task": "add", + "question": "Please add a amine to the molecule Nc1noc(-c2ccc(I)cc2)c1-c1cc(F)cc(F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1noc(-c2ccc(I)cc2)c1-c1cc(F)cc(F)c1.", + "ref_smiles": "Nc1cc(-c2onc(N)c2-c2cc(F)cc(F)c2)ccc1I", + "add_group": "amine", + "remove_group": null + }, + { + "id": "20a4b1c7-81f5-4700-a860-2543bf3ea88d", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(C=Cc1cccc(Cl)c1Cl)c1ccc(Nc2nc(Nc3ccc(F)cc3)nc(Nc3ccc(F)cc3)n2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C=Cc1cccc(Cl)c1Cl)c1ccc(Nc2nc(Nc3ccc(F)cc3)nc(Nc3ccc(F)cc3)n2)cc1.", + "ref_smiles": "O=C(C=Cc1cc(O)cc(Cl)c1Cl)c1ccc(Nc2nc(Nc3ccc(F)cc3)nc(Nc3ccc(F)cc3)n2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "73d018c0-817e-4d8c-8e51-3ae4d1637081", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH2+]CC1CCCN(c2nc3c(cc2C(N)=O)CCC3)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CC1CCCN(c2nc3c(cc2C(N)=O)CCC3)C1.", + "ref_smiles": "C[NH2+]CC1CCC(O)N(c2nc3c(cc2C(N)=O)CCC3)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0752d1d4-2a8b-4d91-9fce-b221467e9393", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)cnn21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)cnn21.", + "ref_smiles": "CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)c(O)nn21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7cc4ebc0-bc16-42df-aefb-340a59f07498", + "task": "add", + "question": "Modify the molecule CCC[NH+](CCC)CCCC(C)(O)C[NH3+] by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH+](CCC)CCCC(C)(O)C[NH3+]", + "ref_smiles": "CCC[NH+](CCC)CC(N)CC(C)(O)C[NH3+]", + "add_group": "amine", + "remove_group": null + }, + { + "id": "52302925-a17d-40d6-917c-71a363011a05", + "task": "add", + "question": "Please add a hydroxyl to the molecule c1c(N2CC(C[NH2+]C3CN4CCC3CC4)C2)nnc2c1CCCC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1c(N2CC(C[NH2+]C3CN4CCC3CC4)C2)nnc2c1CCCC2.", + "ref_smiles": "OC1([NH2+]CC2CN(c3cc4c(nn3)CCCC4)C2)CN2CCC1CC2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6205f732-5e05-4846-8740-73296d649791", + "task": "add", + "question": "Modify the molecule CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OCC", + "ref_smiles": "CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OC(C)O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "61951bba-5ffd-4be4-b181-17fa9a793af9", + "task": "add", + "question": "Please add a benzene ring to the molecule CNc1cnccc1C(=O)N1CCCC(C)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1cnccc1C(=O)N1CCCC(C)CC1.", + "ref_smiles": "CNc1c(C(=O)N2CCCC(C)CC2)ccnc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "774cd6d9-c15a-4ed8-a205-9e4b85d6ab8b", + "task": "add", + "question": "Modify the molecule COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2)ccc1OC(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2)ccc1OC(F)F", + "ref_smiles": "COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2O)ccc1OC(F)F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d78f91fa-a50d-4c8a-bcc9-11c223340858", + "task": "add", + "question": "Please add a benzene ring to the molecule COCCCCNC(=O)C1(F)CC[NH2+]C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCCNC(=O)C1(F)CC[NH2+]C1.", + "ref_smiles": "COC(CCCNC(=O)C1(F)CC[NH2+]C1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1e278b95-f31b-48e8-996a-a492ab9a66f1", + "task": "add", + "question": "Please add a benzene ring to the molecule O=[N+]([O-])C1=c2ccc([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=[N+]([O-])C1=c2ccc([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2.", + "ref_smiles": "O=[N+]([O-])C1=c2cc(-c3ccccc3)c([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d7d4f875-d71b-46a5-a53e-102cd9dc7384", + "task": "add", + "question": "Modify the molecule Cc1cc(OCCCCn2c(CCCCCNC(=O)C3CCCO3)nc3ccccc32)ccc1Cl by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(OCCCCn2c(CCCCCNC(=O)C3CCCO3)nc3ccccc32)ccc1Cl", + "ref_smiles": "Cc1cc(OCCCCn2c(CCCCC(CC=O)NC(=O)C3CCCO3)nc3ccccc32)ccc1Cl", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "29389218-1691-42c3-ab57-18a615092bc5", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)Nc1ccc(C(=O)NC(CC(C)(C)OC)C(=O)N2CCCC3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)Nc1ccc(C(=O)NC(CC(C)(C)OC)C(=O)N2CCCC3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)cc1.", + "ref_smiles": "COC(=O)Nc1ccc(C(=O)NC(CC(C)(C)OC)C(=O)N2CC(c3ccccc3)CC3(C2)OC(=O)Nc2ccc(Cl)c(F)c23)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "15ec5757-20da-4b8d-b750-0fdc12dab432", + "task": "add", + "question": "Modify the molecule CCC(O)CC(=O)OC(CC)C(C=C(C)C=CC(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)COC1OC(C)CC(OC)C1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(O)CC(=O)OC(CC)C(C=C(C)C=CC(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)COC1OC(C)CC(OC)C1OC", + "ref_smiles": "CCC(O)CC(=O)OC(CC)C(C=C(C)C=C(C(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)c1ccccc1)COC1OC(C)CC(OC)C1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f6311a3e-28c2-46c6-b208-70dac6d7658c", + "task": "add", + "question": "Modify the molecule COCCC1(c2ccc(Nc3nc(-c4c(F)cccc4F)[nH]c4c[nH]c(=O)c3-4)cc2)CCN(C)C1=O by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCC1(c2ccc(Nc3nc(-c4c(F)cccc4F)[nH]c4c[nH]c(=O)c3-4)cc2)CCN(C)C1=O", + "ref_smiles": "COCCC1(c2ccc(Nc3nc(-c4c(F)cccc4F)[nH]c4c(C(=O)O)[nH]c(=O)c3-4)cc2)CCN(C)C1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "aded289d-ecf9-498d-bf3b-b1cba3ccefb7", + "task": "add", + "question": "Please add a carboxyl to the molecule CCN(c1nccc(C(=O)[O-])c1F)C1CCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(c1nccc(C(=O)[O-])c1F)C1CCCCC1.", + "ref_smiles": "CCN(c1ncc(C(=O)O)c(C(=O)[O-])c1F)C1CCCCC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "920f8e2b-7524-4d87-9023-81a694eab1b5", + "task": "add", + "question": "Please add a carboxyl to the molecule O=C(NCC1CCCC1O)c1cnn(-c2cccc(Cl)c2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC1CCCC1O)c1cnn(-c2cccc(Cl)c2)n1.", + "ref_smiles": "O=C(NCC1CCCC1(O)C(=O)O)c1cnn(-c2cccc(Cl)c2)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "12c3c116-4edc-448a-ad53-32bd9ae95886", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)CC(C[NH3+])COc1ccccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC(C[NH3+])COc1ccccc1Cl.", + "ref_smiles": "CC(C)C(O)C(C[NH3+])COc1ccccc1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "24e8eb4e-1f9e-4b95-bfef-9e069b221dfb", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)cc3)nc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)cc3)nc12.", + "ref_smiles": "COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)c(O)cc3)nc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2233491f-4a57-4649-a58d-555f0679a10a", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12.", + "ref_smiles": "CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)c(C(=O)O)c32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "8bbb5570-59a5-418a-a106-6620d20ee0b8", + "task": "add", + "question": "Modify the molecule Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)cc1", + "ref_smiles": "Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3CO)CC2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2473ce43-3a77-4ae6-a46c-3b962f86140f", + "task": "add", + "question": "Modify the molecule COC1CC(NC(=O)Nc2nc(-c3ccsc3)ns2)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CC(NC(=O)Nc2nc(-c3ccsc3)ns2)C1", + "ref_smiles": "COC1CC(NC(=O)Nc2nc(-c3ccsc3-c3ccccc3)ns2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "edf19ad0-38bd-46db-9ab8-d934a4c1a4b6", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NC1CCC(C(=O)[O-])CC1)NC12CC3CC(CC(C3)C1)C2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCC(C(=O)[O-])CC1)NC12CC3CC(CC(C3)C1)C2.", + "ref_smiles": "O=C(NC12CC3CC(CC(C3)C1)C2)NC1(c2ccccc2)CCC(C(=O)[O-])CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "eb91f0ca-1517-4263-a95f-4f0ba11d708e", + "task": "add", + "question": "Please add a benzene ring to the molecule N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1.", + "ref_smiles": "N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2ab964bc-0bc0-412c-a0c9-cbd96ca7d5ea", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O.", + "ref_smiles": "CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(C(OC(C)=O)c2ccccc2)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "266ea467-a7af-4e44-8edb-ef01d2f09e1e", + "task": "add", + "question": "Modify the molecule Cc1cc(Br)ccc1N1CCN(C2CC[NH2+]C2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Br)ccc1N1CCN(C2CC[NH2+]C2)CC1", + "ref_smiles": "Cc1cc(Br)cc(C(=O)O)c1N1CCN(C2CC[NH2+]C2)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b747e7ca-3b70-48f5-96d2-7bd92a13d14b", + "task": "add", + "question": "Please add a carboxyl to the molecule c1ccc2c(c1)CCCC2[NH2+]CCc1cscn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc2c(c1)CCCC2[NH2+]CCc1cscn1.", + "ref_smiles": "O=C(O)c1cccc2c1C([NH2+]CCc1cscn1)CCC2", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b0d894a0-ebe3-4405-9986-75cde46ce7b2", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1.", + "ref_smiles": "CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e480a58a-328f-4d5e-b7f4-1c6a83cbc416", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(Cl)cc1NC(=O)C(C)CC#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(Cl)cc1NC(=O)C(C)CC#N.", + "ref_smiles": "COc1c(O)cc(Cl)cc1NC(=O)C(C)CC#N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "210a7b86-3fe9-4f1a-890b-9dd2b75578df", + "task": "add", + "question": "Please add a carboxyl to the molecule O=C1CCCCC1C1CCCCCN1C(=O)c1ccc(-n2cncn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CCCCC1C1CCCCCN1C(=O)c1ccc(-n2cncn2)cc1.", + "ref_smiles": "O=C1CCCCC1C1CCCCC(C(=O)O)N1C(=O)c1ccc(-n2cncn2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "2c9ce9dc-00a5-4e47-8261-3805c0b63e80", + "task": "add", + "question": "Modify the molecule CCCC(CCC)C(=O)NCCn1ncc2c(N3CCOCC3)nc(SCC)nc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(CCC)C(=O)NCCn1ncc2c(N3CCOCC3)nc(SCC)nc21", + "ref_smiles": "CCCC(CCC)C(=O)NCC(O)n1ncc2c(N3CCOCC3)nc(SCC)nc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "49cccf1a-3d9c-45e7-b4c7-1812bc76d77f", + "task": "add", + "question": "Modify the molecule CC1CCCCC(C(=O)[O-])C1(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCCC(C(=O)[O-])C1(C)C", + "ref_smiles": "CC1C(C(=O)O)CCCC(C(=O)[O-])C1(C)C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "227ef7d3-1731-4bf5-ae67-22931b92eb19", + "task": "add", + "question": "Modify the molecule CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1", + "ref_smiles": "CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2(O)C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4693d254-ec11-4ade-b1bc-6efbc5a96c13", + "task": "add", + "question": "Please add a benzene ring to the molecule CO[SiH](CN[Si](C)(C)c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CO[SiH](CN[Si](C)(C)c1ccccc1)c1ccccc1.", + "ref_smiles": "CO[SiH](CN[Si](C)(C)c1cccc(-c2ccccc2)c1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ab5c9a4a-9e9b-4a95-b219-2de09ceb6de1", + "task": "add", + "question": "Please add a amine to the molecule Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCCCC4C)cc3C)CC2)cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCCCC4C)cc3C)CC2)cc1F.", + "ref_smiles": "Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCC(N)CC4C)cc3C)CC2)cc1F", + "add_group": "amine", + "remove_group": null + }, + { + "id": "1076f61d-d248-4186-9acc-264b6cb89e01", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCN(CCCC)C(=O)NCCc1ccccc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCN(CCCC)C(=O)NCCc1ccccc1F.", + "ref_smiles": "CCCCN(CCC(C)O)C(=O)NCCc1ccccc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2b80f67c-d7c2-48d8-8960-9584ee1a16ee", + "task": "add", + "question": "Modify the molecule CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(N2CCCC2)nc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(N2CCCC2)nc1", + "ref_smiles": "CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1-c1ccccc1)C(=O)Nc1ccc(N2CCCC2)nc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ef32cdaa-1af9-42a3-b1fd-116815099f00", + "task": "add", + "question": "Please add a hydroxyl to the molecule c1ccc(N2CC[NH+](CCC3CCc4c3cnn4-c3ccccc3)CC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(N2CC[NH+](CCC3CCc4c3cnn4-c3ccccc3)CC2)cc1.", + "ref_smiles": "OC1CC(CC[NH+]2CCN(c3ccccc3)CC2)c2cnn(-c4ccccc4)c21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "936cdedb-daa5-449f-b524-5f2c8788f498", + "task": "add", + "question": "Modify the molecule O=C(CN1C(=O)NC2(CCSC2)C1=O)N1CCCCC1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CN1C(=O)NC2(CCSC2)C1=O)N1CCCCC1", + "ref_smiles": "O=C(CN1C(=O)NC2(CSC(S)C2)C1=O)N1CCCCC1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "bd107126-9fcb-436a-90b7-9776556085e0", + "task": "add", + "question": "Modify the molecule CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)CC1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)CC1", + "ref_smiles": "CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2C#N)CC1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "4c967818-f235-410b-8fe6-4861a423b5bb", + "task": "add", + "question": "Modify the molecule O=CN(O)CC1CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=CN(O)CC1CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O", + "ref_smiles": "O=CN(O)CC1(c2ccccc2)CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1d788b86-b4ee-4132-9f2e-5ad8e3c43978", + "task": "add", + "question": "Modify the molecule CCCc1[nH+]cc(-c2ccnc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)n2)n1C by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1[nH+]cc(-c2ccnc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)n2)n1C", + "ref_smiles": "CCCc1[nH+]cc(-c2nc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)ncc2C(=O)O)n1C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4d7d0e48-3983-483d-9666-bfdc864fb2c1", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCCC1.", + "ref_smiles": "CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCC(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1a1fd0f1-e012-40bd-bd43-3cc037ba00eb", + "task": "add", + "question": "Modify the molecule Cc1nc2c(NC(=O)C3CCCO3)cccn2c1C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc2c(NC(=O)C3CCCO3)cccn2c1C", + "ref_smiles": "Cc1nc2c(NC(=O)C3(c4ccccc4)CCCO3)cccn2c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ee644bd9-5698-4b0c-aab5-54a151416707", + "task": "add", + "question": "Please add a benzene ring to the molecule CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)C)c(C)c2)ccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)C)c(C)c2)ccc1Cl.", + "ref_smiles": "CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)(C)c3ccccc3)c(C)c2)ccc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "82b03830-83ac-4a83-991d-eeb733bd9119", + "task": "add", + "question": "Modify the molecule CC(C)Oc1cc(C(F)(F)F)cc2c1OC[NH+](C(C)C)C2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)Oc1cc(C(F)(F)F)cc2c1OC[NH+](C(C)C)C2", + "ref_smiles": "CC(C)Oc1cc(C(F)(F)F)c(-c2ccccc2)c2c1OC[NH+](C(C)C)C2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0a73667d-876b-4b2f-a81f-1ba53da1ce4e", + "task": "add", + "question": "Modify the molecule CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(C)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(C)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1", + "ref_smiles": "CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(CC#N)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "d26e4108-3d57-4be2-8960-b455a6b55474", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCN(CCBr)C(=O)c1cc(F)c(F)cc1[N+](=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCN(CCBr)C(=O)c1cc(F)c(F)cc1[N+](=O)[O-].", + "ref_smiles": "O=C(c1cc(F)c(F)cc1[N+](=O)[O-])N(CCBr)CCCO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4fb96ae2-d87d-4c7a-b605-0840fe14f46c", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cc(C)cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)c1.", + "ref_smiles": "Cc1cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)cc(C)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "516a4d4f-2bb9-490b-b48e-1edb0c7bc19f", + "task": "add", + "question": "Modify the molecule CC(=C(F)CNC(=O)C1CC(F)CN1C(=O)[O-])c1cccc(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=C(F)CNC(=O)C1CC(F)CN1C(=O)[O-])c1cccc(Cl)c1", + "ref_smiles": "CC(=C(F)C(NC(=O)C1CC(F)CN1C(=O)[O-])c1ccccc1)c1cccc(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9b2e23a0-6995-4d66-99b9-9a5f29ed1d1f", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccccc1C(O)CNC(=O)C(C)([NH3+])c1ccc(Br)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C(O)CNC(=O)C(C)([NH3+])c1ccc(Br)cc1.", + "ref_smiles": "CC([NH3+])(C(=O)NCC(O)c1ccccc1OCc1ccccc1)c1ccc(Br)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4728e4df-0202-4992-b20e-c0b6452b216c", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2)CC1.", + "ref_smiles": "CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2O)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5db22663-f53e-4310-afc1-2fd5af66ca88", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(S)CC[NH+]1CCCC(C(C)C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(S)CC[NH+]1CCCC(C(C)C)C1.", + "ref_smiles": "CC(C)C1CCC[NH+](CCC(S)Cc2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f62a43e1-f975-474d-b6bc-dcb65def29cd", + "task": "add", + "question": "Please add a amine to the molecule CCOc1ccc(C(OC)=C2C(=O)N(C(C)=O)c3ccc(C(C)=O)cc32)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C(OC)=C2C(=O)N(C(C)=O)c3ccc(C(C)=O)cc32)cc1OC.", + "ref_smiles": "CCOc1ccc(C(OC)=C2C(=O)N(C(=O)CN)c3ccc(C(C)=O)cc32)cc1OC", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b8ae32a4-424c-441c-8946-7c3ea0be794e", + "task": "add", + "question": "Please add a carboxyl to the molecule CC1(C)CCN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)CCN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)C1.", + "ref_smiles": "CC1(C)CN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)CC1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b446b488-4922-41ed-b901-a7b230dfb874", + "task": "add", + "question": "Please add a nitrile to the molecule CCCC(OC)c1noc(C2C[NH2+]CCO2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(OC)c1noc(C2C[NH2+]CCO2)n1.", + "ref_smiles": "CCCC(OC)c1noc(C2(C#N)C[NH2+]CCO2)n1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "f3332591-1603-4c8a-9fc3-ef3a8cf7ecd3", + "task": "add", + "question": "Modify the molecule CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)cc2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)cc2)n1", + "ref_smiles": "CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)c(O)c2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2df129f4-a641-4ebf-9a1e-77ee15c8b398", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1cc(-c2cn[nH]c2C2CCCN(C(=O)C3CC=CCC3)C2)on1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(-c2cn[nH]c2C2CCCN(C(=O)C3CC=CCC3)C2)on1.", + "ref_smiles": "Cc1cc(-c2cn[nH]c2C2CN(C(=O)C3CC=CCC3)CCC2C(=O)O)on1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "6eacf91e-c84e-47b6-9a2d-06f0bfd5b092", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC([NH3+])CCC(=O)C1CCCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])CCC(=O)C1CCCCCC1.", + "ref_smiles": "CC([NH3+])CCC(=O)C1CCCCCC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f271d7f5-239d-4cc3-a05c-109994d5c6ef", + "task": "add", + "question": "Modify the molecule Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(C)n2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(C)n2)n1", + "ref_smiles": "Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(CO)n2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "33ac6725-59e7-46cf-b40d-b8b83f44aee3", + "task": "add", + "question": "Please add a amine to the molecule O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1ccc(C(=O)c2ccccc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1ccc(C(=O)c2ccccc2)cc1.", + "ref_smiles": "Nc1cc(NC2=C(c3ccc(Cl)cc3)C(=O)NC2=O)ccc1C(=O)c1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "284efcef-e0cb-4971-83a7-61ccfea4b599", + "task": "add", + "question": "Please add a benzene ring to the molecule CCNC(=[NH+]Cc1ncnn1C)N1CCN(c2ccccc2OC)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=[NH+]Cc1ncnn1C)N1CCN(c2ccccc2OC)CC1.", + "ref_smiles": "COc1ccccc1N1CCN(C(NCCc2ccccc2)=[NH+]Cc2ncnn2C)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "70c415d4-c484-4954-b011-18f88f40acbb", + "task": "add", + "question": "Please add a nitrile to the molecule O=C([O-])Cn1[nH]cc2c3ccc(Cl)cc3nc-2c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])Cn1[nH]cc2c3ccc(Cl)cc3nc-2c1=O.", + "ref_smiles": "N#CC(C(=O)[O-])n1[nH]cc2c3ccc(Cl)cc3nc-2c1=O", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "7995d114-dde2-4c02-923e-ecf3a081ec5e", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(c1nc2ccccc2s1)N(C)CCS(C)(=O)=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(c1nc2ccccc2s1)N(C)CCS(C)(=O)=O.", + "ref_smiles": "CN(CCS(C)(=O)=O)C(CO)c1nc2ccccc2s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3320868c-ab4f-4929-bfad-b8888cf73561", + "task": "add", + "question": "Modify the molecule Cc1cc(C)c2[nH+]ccc(N3CCC(O)(C(=O)[O-])CC3)c2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c2[nH+]ccc(N3CCC(O)(C(=O)[O-])CC3)c2c1", + "ref_smiles": "Cc1cc(C)c2[nH+]c(O)cc(N3CCC(O)(C(=O)[O-])CC3)c2c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "39b45fd2-630e-41ad-b333-4f5c9d525fe6", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)C)cc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)C)cc12.", + "ref_smiles": "COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)(C)O)cc12", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5418ed9e-9471-4ad1-9f8b-4ae99753953b", + "task": "add", + "question": "Please add a benzene ring to the molecule Cn1[nH]c(=O)c2nc3ccccc3nc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1[nH]c(=O)c2nc3ccccc3nc21.", + "ref_smiles": "Cn1[nH]c(=O)c2nc3ccc(-c4ccccc4)cc3nc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d535d0d1-55f6-4b2a-a8ff-b34670c1d741", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Nc1ccccc1OC(F)F)c1nc(Cl)ccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccccc1OC(F)F)c1nc(Cl)ccc1Cl.", + "ref_smiles": "O=C(Nc1c(OC(F)F)cccc1-c1ccccc1)c1nc(Cl)ccc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "31b8b83a-b81d-49dc-8eb3-1489f05dac67", + "task": "add", + "question": "Please add a aldehyde to the molecule CCC(C(=O)NCc1ccc(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)c(CO)c1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C(=O)NCc1ccc(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)c(CO)c1)c1ccccc1.", + "ref_smiles": "CCC(C(=O)NCc1cc(CO)c(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)cc1CC=O)c1ccccc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a9da7f12-234f-4608-9a43-87c42c0ddad6", + "task": "add", + "question": "Modify the molecule CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCCCC1)S(C)(=O)=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCCCC1)S(C)(=O)=O", + "ref_smiles": "CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCC(c2ccccc2)CC1)S(C)(=O)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f5283bfd-9849-433d-9a03-68c1439e46e5", + "task": "add", + "question": "Please add a benzene ring to the molecule O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccccc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccccc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO.", + "ref_smiles": "O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccc(-c5ccccc5)cc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "25065820-d90c-4291-8dec-eb5f9698ad32", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1ccc(Oc2ccccc2NC(=O)c2ccccc2C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(Oc2ccccc2NC(=O)c2ccccc2C)cc1.", + "ref_smiles": "Cc1ccc(Oc2cc(C(=O)O)ccc2NC(=O)c2ccccc2C)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3a2a0a7b-8672-4d8e-8d54-2b156e861a25", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1ccc(S(=O)(=O)NS(=O)(=O)c2ccc(OC)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(S(=O)(=O)NS(=O)(=O)c2ccc(OC)cc2)cc1.", + "ref_smiles": "COc1ccc(S(=O)(=O)NS(=O)(=O)c2ccc(OC)c(C(=O)O)c2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "19cd9eb7-00f8-41ae-beac-abc642ccb0f6", + "task": "add", + "question": "Modify the molecule c1csc(CNc2ncnc3ccc(-c4ccc5c(c4)OCCO5)cc23)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1csc(CNc2ncnc3ccc(-c4ccc5c(c4)OCCO5)cc23)c1", + "ref_smiles": "Oc1cc2c(cc1-c1ccc3ncnc(NCc4cccs4)c3c1)OCCO2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d762519f-b8f9-4ce9-bb89-cd5bf97d8047", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOC(=O)C([NH3+])CSCCC(=O)OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C([NH3+])CSCCC(=O)OC.", + "ref_smiles": "CCOC(=O)C([NH3+])C(O)SCCC(=O)OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f610d84a-eb55-490c-b581-b9a638cf16c2", + "task": "add", + "question": "Modify the molecule CN(Cc1nc(-c2cccc(Cl)c2)no1)C(=O)C(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(Cc1nc(-c2cccc(Cl)c2)no1)C(=O)C(C)(C)C", + "ref_smiles": "CN(C(=O)C(C)(C)C)C(O)c1nc(-c2cccc(Cl)c2)no1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "02f9f41d-b473-4207-a138-ddeee7bf8f79", + "task": "add", + "question": "Modify the molecule Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(C)c1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(C)c1Cl", + "ref_smiles": "Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(CO)c1Cl", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5b293157-11f3-491a-9503-83f7719fb9bd", + "task": "add", + "question": "Please add a hydroxyl to the molecule CSc1nc(N)cc(N2CCCc3ccccc3C2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1nc(N)cc(N2CCCc3ccccc3C2)n1.", + "ref_smiles": "CSc1nc(N)cc(N2CCC(O)c3ccccc3C2)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "570d1410-2764-4563-b344-af6b5ba3df11", + "task": "add", + "question": "Modify the molecule Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)cnn12 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)cnn12", + "ref_smiles": "Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)c(CC=O)nn12", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "e41de51f-1ba0-4864-8ba0-216fa41b620d", + "task": "add", + "question": "Modify the molecule CCCNc1ccc(OC)cc1[N+](=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNc1ccc(OC)cc1[N+](=O)[O-]", + "ref_smiles": "CCCNc1ccc(OCO)cc1[N+](=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e48a60b3-81c4-470b-b4de-02e737a7cc28", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCN(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCN(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1.", + "ref_smiles": "CCCC(c1ccccc1)N(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "062e28ca-0389-445e-916b-930ce1900f26", + "task": "add", + "question": "Please add a amine to the molecule CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cccc(Cl)c3)c12)c1ccc(OCO)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cccc(Cl)c3)c12)c1ccc(OCO)cc1.", + "ref_smiles": "CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cc(Cl)ccc3N)c12)c1ccc(OCO)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f2e3048e-dd1f-4a65-8b57-67c689e51255", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CCCC1CNS(=O)(=O)c1ccnc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC1CNS(=O)(=O)c1ccnc(Cl)c1.", + "ref_smiles": "CC1C(CNS(=O)(=O)c2ccnc(Cl)c2)CCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "37baa559-94da-4877-a9c0-5d9b6bd6c509", + "task": "add", + "question": "Modify the molecule CCN(CC(=O)Nc1ccccc1OC)C(=O)c1csc(-c2cccs2)n1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC(=O)Nc1ccccc1OC)C(=O)c1csc(-c2cccs2)n1", + "ref_smiles": "CCN(CC(=O)Nc1cccc(N)c1OC)C(=O)c1csc(-c2cccs2)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "63ac4ca8-68de-4d65-b521-57e1f248a1ef", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1.", + "ref_smiles": "O=C(Cc1ccc(-c2ccccc2)cc1)Nc1cc(-c2ccccc2)c(Cl)c(C(F)(F)F)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "af0cb409-916b-4de7-bba5-10cfa45ee975", + "task": "add", + "question": "Modify the molecule COc1nc(C[NH2+]C(C)C)cc2ccccc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1nc(C[NH2+]C(C)C)cc2ccccc12", + "ref_smiles": "COc1nc(C[NH2+]C(C)C)c(-c2ccccc2)c2ccccc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e7258bbf-3880-4d3a-bd30-7b2f10039138", + "task": "add", + "question": "Modify the molecule CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)C)CC1", + "ref_smiles": "CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)CO)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5c7ef52c-c0cb-45f3-a6a0-8df80b8b7351", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCc1ncc(C(=O)Nc2ccc(NC(C)=O)c(OC)c2)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ncc(C(=O)Nc2ccc(NC(C)=O)c(OC)c2)s1.", + "ref_smiles": "COc1cc(NC(=O)c2cnc(CCO)s2)ccc1NC(C)=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c6dd43cd-9e3f-440a-a45b-1d7cdc7a1d46", + "task": "add", + "question": "Please add a hydroxyl to the molecule [NH3+]C(Cc1ccccc1)C(O)C[NH2+]CCCCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(Cc1ccccc1)C(O)C[NH2+]CCCCc1ccccc1.", + "ref_smiles": "[NH3+]C(Cc1ccccc1O)C(O)C[NH2+]CCCCc1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0262cc12-04ba-4912-8a33-f0685aa34113", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)c1cccc(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1cccc(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1.", + "ref_smiles": "CC(=O)c1ccc(-c2ccccc2)c(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7a4f9394-3994-4b7f-b6b2-63e49da4d211", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)n1C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)n1C", + "ref_smiles": "Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)c(N)n1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3e864e23-32b8-4613-a477-7e59c793a693", + "task": "add", + "question": "Please add a carboxyl to the molecule COC1C[NH2+]CC1NC(=O)C(C)Cc1ccccc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1C[NH2+]CC1NC(=O)C(C)Cc1ccccc1Cl.", + "ref_smiles": "COC1C[NH2+]CC1NC(=O)C(C)Cc1ccc(C(=O)O)cc1Cl", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c5f078ef-e204-4ed3-820a-7ad6386111eb", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCCCCCCc1cccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCCc1cccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC.", + "ref_smiles": "CCCCCCCCCc1c(O)ccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1c488bb9-6632-411d-a778-da646fff5e2a", + "task": "add", + "question": "Please add a carboxyl to the molecule COC1CCN(c2ccc(C[NH2+]C(C)C)cc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC1CCN(c2ccc(C[NH2+]C(C)C)cc2)C1.", + "ref_smiles": "COC1CCN(c2ccc(C[NH2+]C(C)C)cc2C(=O)O)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b36c83fd-a7f8-42b6-a579-4343c6748b8d", + "task": "add", + "question": "Modify the molecule c1ccc(-c2ccc(-c3ccc4c(ccc5c6cc7c(cc6ccc45)Cc4ccccc4-7)c3)cc2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(-c2ccc(-c3ccc4c(ccc5c6cc7c(cc6ccc45)Cc4ccccc4-7)c3)cc2)cc1", + "ref_smiles": "c1ccc(-c2cccc(-c3ccc(-c4ccc5c(ccc6c7cc8c(cc7ccc56)Cc5ccccc5-8)c4)cc3)c2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9529da27-5c17-4875-95de-7a21a633ffa9", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(C)C1=NN(c2ccccc2)C(=O)C1(C)Br.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)C1=NN(c2ccccc2)C(=O)C1(C)Br.", + "ref_smiles": "CC(C)(Cc1ccccc1)C1=NN(c2ccccc2)C(=O)C1(C)Br", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "07005add-04db-455e-a7ef-31be192e564b", + "task": "add", + "question": "Modify the molecule CCOc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1", + "ref_smiles": "CC(O)Oc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2ae7fc40-f2f7-4c7d-8679-0886cc90c4cf", + "task": "add", + "question": "Modify the molecule CC1(c2nnc(C3CCC[NH2+]3)o2)CCCCO1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(c2nnc(C3CCC[NH2+]3)o2)CCCCO1", + "ref_smiles": "CC1(c2nnc(C3[NH2+]CCC3CC=O)o2)CCCCO1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "85b1f41b-edc6-4a90-bd39-99646faa853c", + "task": "add", + "question": "Modify the molecule O=S(=O)(CC1CCCCC1(F)F)NCC1(CO)CC2(CCC2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(CC1CCCCC1(F)F)NCC1(CO)CC2(CCC2)C1", + "ref_smiles": "O=CCC(O)C1(CNS(=O)(=O)CC2CCCCC2(F)F)CC2(CCC2)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "2d26ff57-2222-4a16-b120-e981f663b84b", + "task": "add", + "question": "Modify the molecule ClCCc1cnn(-c2ccccc2)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "ClCCc1cnn(-c2ccccc2)c1", + "ref_smiles": "O=CCc1c(CCCl)cnn1-c1ccccc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "962637fb-dad1-4e2e-80bf-9218219f2787", + "task": "add", + "question": "Please add a benzene ring to the molecule CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2ccccc2)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2ccccc2)c1C.", + "ref_smiles": "CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2cccc(-c3ccccc3)c2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f571d9fa-4eea-4669-a3b3-9399f7dacd88", + "task": "add", + "question": "Please add a amine to the molecule CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCCO2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCCO2.", + "ref_smiles": "CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCC(N)O2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b7ef1403-db80-482b-9b7a-fd1f3bf438dc", + "task": "add", + "question": "Please add a aldehyde to the molecule CSCCC(NC(=O)CNC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCCC(NC(=O)CNC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-].", + "ref_smiles": "CSCCC(NC(=O)C(CC=O)NC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-]", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "632cf043-4a65-4c3e-b4d5-49bfa07ee690", + "task": "add", + "question": "Please add a benzene ring to the molecule CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1.", + "ref_smiles": "CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9216d35d-b1e8-4f21-930d-3aa62ee7fcd1", + "task": "add", + "question": "Please add a amine to the molecule C[NH2+]C(C(=O)NC(C(=O)N(C)C(C=C(C)C(=O)OC)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]C(C(=O)NC(C(=O)N(C)C(C=C(C)C(=O)OC)C(C)C)C(C)(C)C)C(C)(C)c1ccccc1.", + "ref_smiles": "C[NH2+]C(C(=O)NC(C(=O)N(C)C(C=C(C)C(=O)OC)C(C)(C)N)C(C)(C)C)C(C)(C)c1ccccc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "7c4a76d0-3ee3-4f59-96f9-49cca60cc0c1", + "task": "add", + "question": "Modify the molecule CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2C)cn1", + "ref_smiles": "CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2CO)cn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "48ba85c2-dc08-4d2d-99b7-1c389f0bf909", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1ccc(C)c(Cn2nc(C3CC3)c3cnn(-c4cccc(Cl)c4)c3c2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C)c(Cn2nc(C3CC3)c3cnn(-c4cccc(Cl)c4)c3c2=O)c1.", + "ref_smiles": "Cc1cc(C(=O)O)c(C)cc1Cn1nc(C2CC2)c2cnn(-c3cccc(Cl)c3)c2c1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "781ec607-4b43-4e7d-9c77-a027ca553846", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)C.", + "ref_smiles": "CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "44fac171-90ae-49d6-9c29-3040c4a9c535", + "task": "add", + "question": "Please add a benzene ring to the molecule Cn1ccnc1C([NH3+])CC1(C)CCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1ccnc1C([NH3+])CC1(C)CCC1.", + "ref_smiles": "Cn1ccnc1C([NH3+])C(c1ccccc1)C1(C)CCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c2c35e46-3ade-4433-a422-b69af1461d65", + "task": "add", + "question": "Modify the molecule CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CCC2(O)CC(F)=C(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CCC2(O)CC(F)=C(F)F", + "ref_smiles": "CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CC(C(=O)O)C2(O)CC(F)=C(F)F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0241c5bb-95c6-49be-94ab-2b909a67c6d2", + "task": "add", + "question": "Modify the molecule CCCCOc1cccc(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOc1cccc(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1", + "ref_smiles": "CCCCOc1ccc(O)c(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "42f8e06d-ee31-4586-af9a-8eaa412199e7", + "task": "add", + "question": "Please add a benzene ring to the molecule CC([NH3+])c1ccc(SC2CCCCC2)cn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])c1ccc(SC2CCCCC2)cn1.", + "ref_smiles": "CC([NH3+])(c1ccccc1)c1ccc(SC2CCCCC2)cn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2437fd28-86d2-4e5a-b345-ef8d4d70867c", + "task": "add", + "question": "Please add a amine to the molecule C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1CCN(c2ncccc2Cl)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1CCN(c2ncccc2Cl)C1.", + "ref_smiles": "C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1(N)CCN(c2ncccc2Cl)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "a2067936-2cf5-42e5-8480-e9a9a064ee93", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C1CSC(C(=O)NC2CCCCC2)C(c2cnn(C3CC3)c2)N1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1CSC(C(=O)NC2CCCCC2)C(c2cnn(C3CC3)c2)N1.", + "ref_smiles": "O=C1NC(c2cnn(C3CC3)c2)C(C(=O)NC2CCCCC2)SC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ff115e5b-dbed-4c16-9810-2e26bf8741ba", + "task": "add", + "question": "Please add a carboxyl to the molecule C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)C)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)C)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC.", + "ref_smiles": "C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)CC(=O)O)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "3ca3c03f-fd8e-4ee1-92db-cfae66d86ab5", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1nc(C(N)=O)sc1-c1cccc(C(C)(C)C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(C(N)=O)sc1-c1cccc(C(C)(C)C)c1.", + "ref_smiles": "Cc1nc(C(N)=O)sc1-c1cc(C(C)(C)C)ccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9abfeb6d-a12d-4fe1-828d-89b718fceea5", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC[NH2+]C1CCC(C(C)(C)C)CC1N(C)C(C)C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C1CCC(C(C)(C)C)CC1N(C)C(C)C(C)C.", + "ref_smiles": "CC[NH2+]C1CCC(C(C)(C)C)CC1(O)N(C)C(C)C(C)C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4dd80fe5-37bc-43bd-a0b3-a6fd40af4afe", + "task": "add", + "question": "Modify the molecule O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1", + "ref_smiles": "O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b821e03a-e7fa-4e77-a781-a1aadb46f9d8", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)CC4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)CC4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1.", + "ref_smiles": "Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)C(c5ccccc5)C4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "71424b55-642b-4718-b88a-7c474d71029b", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)Nc1ccc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)Nc1ccc(Cl)cc1Cl.", + "ref_smiles": "O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2c2ccccc2)cc1)Nc1ccc(Cl)cc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "87e53ee8-4547-4b72-bf00-ea513263ef11", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)cc1OC.", + "ref_smiles": "COc1cc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)ccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b7ffbeb1-1b8f-4287-afb9-79b5176ebaf8", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccnc(NCC2CC(Cl)C2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccnc(NCC2CC(Cl)C2)n1.", + "ref_smiles": "COc1nc(NCC2CC(Cl)C2)ncc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "295f4eb3-202d-43c8-9f29-bf6cdcd8599d", + "task": "add", + "question": "Please add a carboxyl to the molecule CCOC(=O)CC(C)S(=O)(=O)c1ccc(F)cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CC(C)S(=O)(=O)c1ccc(F)cc1F.", + "ref_smiles": "CCOC(=O)CC(C)(C(=O)O)S(=O)(=O)c1ccc(F)cc1F", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c33ed086-2013-4e29-bb70-a21c15e0d5b6", + "task": "add", + "question": "Modify the molecule CCc1cc(C(C)(C)c2cc(CC)c(OCC3OC3C)c(CC)c2)cc(CC)c1OCC1OC1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1cc(C(C)(C)c2cc(CC)c(OCC3OC3C)c(CC)c2)cc(CC)c1OCC1OC1C", + "ref_smiles": "CCc1cc(C(C)(C)c2cc(CC)c(OCC3(O)OC3C)c(CC)c2)cc(CC)c1OCC1OC1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b6b010f2-e1cd-4301-a270-62595256d9b0", + "task": "add", + "question": "Modify the molecule CC(=O)c1cccc(S(=O)(=O)N(C)C(C)CO)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1cccc(S(=O)(=O)N(C)C(C)CO)c1", + "ref_smiles": "CC(=O)c1cccc(S(=O)(=O)N(C)C(C)C(O)O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0eb592b6-d819-4f70-afcb-d9aa2d2b0e86", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1.", + "ref_smiles": "Cc1cccc(Cn2c(C(=O)O)nc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "293b2a09-c7e5-4b89-a769-a575240f19be", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CSCC(c2cc(Cl)sc2Cl)[NH2+]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CSCC(c2cc(Cl)sc2Cl)[NH2+]1.", + "ref_smiles": "Clc1cc(C2CSCC(Cc3ccccc3)[NH2+]2)c(Cl)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9b394ce2-7589-466c-9764-7300ef849fd1", + "task": "add", + "question": "Please add a carboxyl to the molecule C=CC(=O)OCC(=O)N1CCCC1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC(=O)OCC(=O)N1CCCC1=O.", + "ref_smiles": "C=C(C(=O)O)C(=O)OCC(=O)N1CCCC1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0b262ee4-4ffa-44dd-93ed-e713365e6cf7", + "task": "add", + "question": "Please add a amine to the molecule CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1.", + "ref_smiles": "CC(=O)Nc1ccc(S(=O)(=O)N(CN)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "3b966ddb-6aa3-4a33-bf7b-0527266f74c3", + "task": "add", + "question": "Please add a carboxyl to the molecule O=S1(=O)CCC(SC2NCC[NH2+]2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S1(=O)CCC(SC2NCC[NH2+]2)C1.", + "ref_smiles": "O=C(O)C1(SC2CCS(=O)(=O)C2)NCC[NH2+]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "82fe171f-9412-4c5d-91a7-3a2111af2151", + "task": "add", + "question": "Modify the molecule Cc1cccc(C([NH3+])c2c(C)cc(F)cc2C)c1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C([NH3+])c2c(C)cc(F)cc2C)c1Br", + "ref_smiles": "Cc1cc(-c2ccccc2)cc(C([NH3+])c2c(C)cc(F)cc2C)c1Br", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c5063f94-b3e8-4428-8dd3-c52eb5e13662", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3)CC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3)CC2)cc1.", + "ref_smiles": "CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3C(=O)O)CC2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "06a4926e-132a-40ed-938c-79d2759ba8cf", + "task": "add", + "question": "Please add a amine to the molecule CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)CC(=O)c2ncccn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)CC(=O)c2ncccn2)cc1.", + "ref_smiles": "CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)C(N)C(=O)c2ncccn2)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ec3d6446-3057-455c-b16a-62dba30133d7", + "task": "add", + "question": "Modify the molecule CCC1CCCCN1C(=O)NC1CCCC1C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC1CCCCN1C(=O)NC1CCCC1C(=O)[O-]", + "ref_smiles": "CCC1C(c2ccccc2)CCCN1C(=O)NC1CCCC1C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "cc22e646-e6b6-4f04-b35b-d2a5c1c6b17f", + "task": "add", + "question": "Modify the molecule CCN(Cc1ccc(OC)cc1)C(=O)CN1CSCC1=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(Cc1ccc(OC)cc1)C(=O)CN1CSCC1=O", + "ref_smiles": "CCN(Cc1ccc(OC)c(N)c1)C(=O)CN1CSCC1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8349bc6d-9b5e-456d-96c8-909378bf6936", + "task": "add", + "question": "Modify the molecule COc1ccc(CN2CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)CC2=O)cc1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CN2CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)CC2=O)cc1", + "ref_smiles": "COc1ccc(CN2C(=O)CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)C2N)cc1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "cba544fa-317e-4075-b8e6-3e3d58362978", + "task": "add", + "question": "Modify the molecule N#Cc1ccc(=O)[nH]c1C1CCCC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#Cc1ccc(=O)[nH]c1C1CCCC1", + "ref_smiles": "N#Cc1ccc(=O)[nH]c1C1CCCC1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "944dbed2-f075-4cc2-b78f-6cb74b2b3d88", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCCC(C)=CCCC(C)=CCO.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCCC(C)=CCCC(C)=CCO.", + "ref_smiles": "CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCC(C(C)=CCCC(C)=CCO)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c28ebeb8-eda5-43b0-b7d6-8715630bbf12", + "task": "add", + "question": "Modify the molecule CCOc1cc(OC)c(F)cc1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(OC)c(F)cc1F", + "ref_smiles": "COc1cc(OCCO)c(F)cc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "577a525f-20ad-4801-be3a-5886a5080cc2", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1.", + "ref_smiles": "O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d752b95a-4d1e-42f2-84ce-ec50ee164d0b", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cc(Br)ccc1NCCC(=O)[O-].\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Br)ccc1NCCC(=O)[O-].", + "ref_smiles": "Cc1cc(Br)ccc1NC(CC(=O)[O-])c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ce2a4b5c-e4c0-4597-a5dd-98b9ce9796ce", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1OCC(O)C(O)C1OC1CCCCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1OCC(O)C(O)C1OC1CCCCO1.", + "ref_smiles": "CC1OCC(O)C(O)C1OC1OCCCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "690f5bfe-c8b1-4408-a589-8fd9ebe17ae4", + "task": "add", + "question": "Modify the molecule CC(C)(O)CNc1nc(-c2ccccc2CO)cn2c(-c3ccc(C(N)=O)c(C4CC4)c3)c[nH+]c12 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(O)CNc1nc(-c2ccccc2CO)cn2c(-c3ccc(C(N)=O)c(C4CC4)c3)c[nH+]c12", + "ref_smiles": "CC(C)(O)CNc1nc(-c2ccc(-c3ccccc3)cc2CO)cn2c(-c3ccc(C(N)=O)c(C4CC4)c3)c[nH+]c12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "41091302-f4e6-4b9c-84e2-f0694bc8cb8b", + "task": "add", + "question": "Modify the molecule Cc1cc(C)cc(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)cc(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1", + "ref_smiles": "Cc1cc(C)c(N)c(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "18726d88-74e0-4b3b-98b5-855f38d42d35", + "task": "add", + "question": "Modify the molecule CCCC(=O)Nc1ccc(C(=O)NC(CC)CO)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(=O)Nc1ccc(C(=O)NC(CC)CO)cc1", + "ref_smiles": "CCCC(=O)Nc1ccc(C(=O)NC(O)(CC)CO)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ece05111-aeb6-4156-aa24-ccc53de6942d", + "task": "add", + "question": "Modify the molecule FC(F)(F)COc1ccccc1NCc1ccc(Br)cn1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "FC(F)(F)COc1ccccc1NCc1ccc(Br)cn1", + "ref_smiles": "O=C(O)C(Nc1ccccc1OCC(F)(F)F)c1ccc(Br)cn1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "e8f6cc97-926f-49f0-afe3-49677bddeb97", + "task": "add", + "question": "Modify the molecule CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O", + "ref_smiles": "CCNC(=O)C(Cc1ccccc1)N(Cc1c(O)cccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "54b29599-99b6-483c-957b-3c0054d415bf", + "task": "add", + "question": "Please add a benzene ring to the molecule N#CCC(=O)NCc1ccc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CCC(=O)NCc1ccc(Cl)cc1Cl.", + "ref_smiles": "N#CCC(=O)NCc1c(Cl)cc(Cl)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0a259ea5-1f42-4299-aa84-a80b669975d1", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C(N)=[NH+]O)[NH+]1CCCC(CO)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(N)=[NH+]O)[NH+]1CCCC(CO)C1.", + "ref_smiles": "CC(C(N)=[NH+]O)[NH+]1CCC(c2ccccc2)C(CO)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e52b0ae8-7abb-4d41-bf78-1dada4686217", + "task": "add", + "question": "Please add a aldehyde to the molecule Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)cc(N)c1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)cc(N)c1Cl.", + "ref_smiles": "Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)c(CC=O)c(N)c1Cl", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "0d38dae5-5b2f-41d5-ac39-7456dc3ec1e3", + "task": "add", + "question": "Modify the molecule CCOCCCCCc1ccc(C2CCC([NH3+])(COP(=O)([O-])[O-])C2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOCCCCCc1ccc(C2CCC([NH3+])(COP(=O)([O-])[O-])C2)cc1", + "ref_smiles": "CCOCCCCCc1ccc(C2CCC([NH3+])(COP(=O)([O-])[O-])C2)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9871c22c-be65-409a-9cb5-275823091151", + "task": "add", + "question": "Please add a hydroxyl to the molecule [N-]=[N+]=NCC(O)C1CC2CCC1O2.\nPlease wrap the final SMILES in ....", + "src_smiles": "[N-]=[N+]=NCC(O)C1CC2CCC1O2.", + "ref_smiles": "[N-]=[N+]=NCC(O)C1(O)CC2CCC1O2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "66bf676f-e210-4cb4-94f5-e1b008af201c", + "task": "add", + "question": "Modify the molecule O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3)nn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3)nn2)CC1", + "ref_smiles": "O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3O)nn2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "26e589b8-979a-4b5d-b96f-51e76da9b20a", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC(CC1([NH3+])CC1)c1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC1([NH3+])CC1)c1ccccc1.", + "ref_smiles": "CC(c1ccccc1)C(CC1([NH3+])CC1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "99ac2017-5743-4690-9668-b0693c7c27cb", + "task": "add", + "question": "Modify the molecule [NH3+]C1=C2[NH2+]C(O)N(Cc3ccccc3)C2N=C(OCCCCO)N1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C1=C2[NH2+]C(O)N(Cc3ccccc3)C2N=C(OCCCCO)N1", + "ref_smiles": "[NH3+]C1=C2[NH2+]C(O)(CC=O)N(Cc3ccccc3)C2N=C(OCCCCO)N1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "5047654e-4f6e-425a-8ab2-0f6039b3a386", + "task": "add", + "question": "Please add a benzene ring to the molecule C=CNC(=O)CCCCCC.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CNC(=O)CCCCCC.", + "ref_smiles": "CCCCCCC(=O)NC=Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "39585e52-e18c-4336-8b7d-2883156b5da4", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(Nc1nc2n(n1)CCCC2)C1(CCF)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1nc2n(n1)CCCC2)C1(CCF)CC1.", + "ref_smiles": "O=C(Nc1nc2n(n1)CCCC2)C1(C(CF)c2ccccc2)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0bedf536-20b5-47b0-be2b-c3716a92d1f8", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)C1.", + "ref_smiles": "CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9daf901d-d86a-4dbb-813a-77e52dc7ce62", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1cccc(Sc2ccccc2C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(Sc2ccccc2C)c1.", + "ref_smiles": "Cc1ccccc1Sc1cccc(C)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "92d31022-30fd-4a18-a857-e880fc3a6ef3", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCCC(CC)CNC(=O)C(=O)NCc1cccc(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCC(CC)CNC(=O)C(=O)NCc1cccc(C)c1.", + "ref_smiles": "CCC(CNC(=O)C(=O)NCc1cccc(C)c1)CC(CC)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4e5001b7-a2fd-4cae-98ea-cf5ffac79d38", + "task": "add", + "question": "Please add a amine to the molecule CNc1cc(N2CCCC2CBr)nc(N)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNc1cc(N2CCCC2CBr)nc(N)n1.", + "ref_smiles": "CNc1cc(N2CCC(N)C2CBr)nc(N)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f3a8c818-6bdc-453e-9e8b-09ac07def527", + "task": "add", + "question": "Modify the molecule Cc1c(C(=O)NCC(=O)N2CCN(c3ccc(Cl)cc3)CC2)cnn1-c1cccc(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(=O)NCC(=O)N2CCN(c3ccc(Cl)cc3)CC2)cnn1-c1cccc(Cl)c1", + "ref_smiles": "Cc1c(C(=O)NCC(=O)N2CCN(c3ccc(Cl)c(-c4ccccc4)c3)CC2)cnn1-c1cccc(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1f933e9f-f370-4186-bb9f-19a3b57e72b8", + "task": "add", + "question": "Modify the molecule Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)cc1", + "ref_smiles": "Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)c(C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a76c0585-3c12-4ce1-94da-54463b4bc51f", + "task": "add", + "question": "Please add a nitrile to the molecule CCOC(=O)c1c(NC(=O)CCSCCC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1c(NC(=O)CCSCCC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C.", + "ref_smiles": "CCOC(=O)c1c(NC(=O)CCSC(C#N)CC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "42adf584-37d6-4bff-a871-f573d5842c90", + "task": "add", + "question": "Modify the molecule C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)ccc3O4)cc2[N+](=O)[O-])CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)ccc3O4)cc2[N+](=O)[O-])CC1", + "ref_smiles": "C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)cc(-c5ccccc5)c3O4)cc2[N+](=O)[O-])CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7d719053-2716-4fac-b155-cb379dcb4e1d", + "task": "add", + "question": "Modify the molecule C=C1CC(=O)N(c2ccccc2Br)C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C1CC(=O)N(c2ccccc2Br)C1=O", + "ref_smiles": "C=C1C(=O)N(c2ccccc2Br)C(=O)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "83c68a04-dfab-4b84-ba3c-8cb0ff34074d", + "task": "add", + "question": "Modify the molecule COc1cccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1", + "ref_smiles": "COc1cc(O)cc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "da2f157c-df88-49f4-ba76-90b953af536e", + "task": "add", + "question": "Modify the molecule O=C(c1ccc(Cl)cc1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1ccc(Cl)cc1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1", + "ref_smiles": "O=C(c1ccc(Cl)c(-c2ccccc2)c1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "c486fd9a-be56-4e1a-8512-086ab7a309f9", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C(C)NC(=O)CSCc2cccc(F)c2)cc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(C)NC(=O)CSCc2cccc(F)c2)cc1C.", + "ref_smiles": "Cc1cc(C(C)NC(=O)CSCc2cccc(F)c2)ccc1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "324c4493-6c67-4756-9194-9d6adff79196", + "task": "add", + "question": "Modify the molecule Cc1ccccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1", + "ref_smiles": "Cc1cc(O)ccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "46766769-eca2-4f93-852f-0e3d6e227d75", + "task": "add", + "question": "Please add a hydroxyl to the molecule [N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(C(O)CO)C(O)C2O)C(O)C1O.\nPlease wrap the final SMILES in ....", + "src_smiles": "[N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(C(O)CO)C(O)C2O)C(O)C1O.", + "ref_smiles": "[N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(O)(C(O)CO)C(O)C2O)C(O)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0752355f-e93a-45d1-a93c-836ccea53b6a", + "task": "add", + "question": "Modify the molecule CCN(CC)CC[NH2+]C(C)c1cccc(NC(C)=O)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)CC[NH2+]C(C)c1cccc(NC(C)=O)c1", + "ref_smiles": "CCN(CC)CC[NH2+]C(C)c1cc(O)cc(NC(C)=O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2ccb1652-122f-48c1-aea0-e7caeed4e000", + "task": "add", + "question": "Modify the molecule CC(C)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1", + "ref_smiles": "CC(CO)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cb76a82b-29d0-4d57-8fdd-b3a914680a31", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCc1nc(N)c(C)c(Sc2nc3ccccc3[nH]2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nc(N)c(C)c(Sc2nc3ccccc3[nH]2)n1.", + "ref_smiles": "Cc1c(N)nc(C(C)O)nc1Sc1nc2ccccc2[nH]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "187b65ba-c53c-4677-b9c5-5f33344bbae7", + "task": "add", + "question": "Modify the molecule CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OCC", + "ref_smiles": "CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OC(C)O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fa7fd6ca-0d4a-4256-ab1e-2fcfd9ff11ca", + "task": "add", + "question": "Modify the molecule CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=CCCCCCC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=CCCCCCC", + "ref_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=C(CCCCCCC)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f3dde041-ff28-4174-bf1b-97fc1f0c3a44", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOc1cc(Cl)ccc1S(=O)(=O)N(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1cc(Cl)ccc1S(=O)(=O)N(C)C.", + "ref_smiles": "CCOc1c(S(=O)(=O)N(C)C)ccc(Cl)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f55e6877-6b42-4b02-97ef-8e077d884233", + "task": "add", + "question": "Please add a amine to the molecule CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1ccc(O)c(OC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1ccc(O)c(OC)c1.", + "ref_smiles": "CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1cc(OC)c(O)cc1N", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9f578867-bef7-4025-be91-1a53ea8a6bcb", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOc1ccc(N2C(=O)C3CNNC3[NH+]=C2SCC(=O)Nc2cccc(C)c2C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(N2C(=O)C3CNNC3[NH+]=C2SCC(=O)Nc2cccc(C)c2C)cc1.", + "ref_smiles": "Cc1cccc(NC(=O)CSC2=[NH+]C3NNCC3C(=O)N2c2ccc(OC(C)c3ccccc3)cc2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ef39e1c0-d166-47ff-88e4-4fb2e2f19347", + "task": "add", + "question": "Please add a benzene ring to the molecule c1csc(-c2nc3ccccc3nc2N2CC[NH2+]CC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1csc(-c2nc3ccccc3nc2N2CC[NH2+]CC2)c1.", + "ref_smiles": "c1ccc(-c2cccc3nc(-c4cccs4)c(N4CC[NH2+]CC4)nc23)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "041f3e78-8130-4a61-aee9-b5e0d513abe2", + "task": "add", + "question": "Please add a hydroxyl to the molecule c1ccc(-c2ccc(-c3cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)ccc3-c3ccc(-c4ccccc4)cc3)cc2)cc#1.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(-c2ccc(-c3cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)ccc3-c3ccc(-c4ccccc4)cc3)cc2)cc#1.", + "ref_smiles": "Oc1c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)ccc(-c2ccc(-c3cc#ccc3)cc2)c1-c1ccc(-c2ccccc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4e9a997a-dfd4-430d-81fb-b0e4b5f5acba", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(c1ccccc1Cl)N1CCCC(c2[nH+]ccn2CC2CC2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1ccccc1Cl)N1CCCC(c2[nH+]ccn2CC2CC2)C1.", + "ref_smiles": "O=C(c1cccc(-c2ccccc2)c1Cl)N1CCCC(c2[nH+]ccn2CC2CC2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "75dd5efc-0649-48bc-b78f-6a8579e71a6c", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(O)(C[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1)COc1ccccc1C#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)(C[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1)COc1ccccc1C#N.", + "ref_smiles": "CC(O)(COc1ccccc1C#N)C(O)[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "44168957-1d8b-45c0-bb53-db71434eb34c", + "task": "add", + "question": "Modify the molecule CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=CCC2=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=CCC2=O", + "ref_smiles": "CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=C(O)CC2=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "928838ef-f27b-44d6-8ca7-972aeecaff5f", + "task": "add", + "question": "Modify the molecule Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)CC1", + "ref_smiles": "Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)C(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d54d2042-ef51-4373-a7fb-861fbf157b63", + "task": "add", + "question": "Modify the molecule CC1CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2", + "ref_smiles": "CC1(O)CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "94f13661-e71e-450e-8e97-4fa0764a3e4d", + "task": "add", + "question": "Please add a benzene ring to the molecule O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1ccccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1ccccn1.", + "ref_smiles": "O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1cccc(-c2ccccc2)n1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "97ae945a-974a-4937-b6da-ac93094d2564", + "task": "add", + "question": "Modify the molecule Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1", + "ref_smiles": "Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ade76f80-a4e5-488b-9cbd-ddb740742f69", + "task": "add", + "question": "Modify the molecule N#CC(=C[NH2+]CCCCCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC(=C[NH2+]CCCCCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1", + "ref_smiles": "N#CC(=C[NH2+]CCC(O)CCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "965e2cc9-9712-4090-9244-8a186bffe21f", + "task": "add", + "question": "Modify the molecule OC1CC[NH+](CCN2CCOCC2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC1CC[NH+](CCN2CCOCC2)C1", + "ref_smiles": "O=CCC(CN1CCOCC1)[NH+]1CCC(O)C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "3aabe182-a4da-4a14-8dc1-8e1fe5a40248", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCc1ccc(-c2cn[nH]c2C[NH3+])cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1ccc(-c2cn[nH]c2C[NH3+])cc1.", + "ref_smiles": "CCCc1ccc(-c2cn[nH]c2C[NH3+])c(-c3ccccc3)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "2d9080d3-e197-4ae5-b90b-3691e701331b", + "task": "add", + "question": "Modify the molecule Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)C", + "ref_smiles": "Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0301c138-efe9-4fc1-83d9-213970f95eb0", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1.", + "ref_smiles": "COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b43f154a-fb43-42a2-8cb1-7cd73a5c5561", + "task": "add", + "question": "Modify the molecule CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1", + "ref_smiles": "CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "042f4fe9-a702-482a-ada1-c3643d9ced0f", + "task": "add", + "question": "Please add a aldehyde to the molecule Nc1cc(NCC2CCCS2)nc(-c2ccccc2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cc(NCC2CCCS2)nc(-c2ccccc2)n1.", + "ref_smiles": "Nc1cc(NCC2CCCS2)nc(-c2cccc(CC=O)c2)n1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "07addc0f-268f-4947-bfc3-9313daf2d030", + "task": "add", + "question": "Please add a benzene ring to the molecule Cc1nccn1CC1CCCN1C(=O)NCCN1c2ccccc2CC1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nccn1CC1CCCN1C(=O)NCCN1c2ccccc2CC1C.", + "ref_smiles": "Cc1nccn1CC1CCCN1C(=O)NCCN1c2c(cccc2-c2ccccc2)CC1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7602f7a4-6bb7-41ac-a5e3-837e394d0b84", + "task": "add", + "question": "Please add a carboxyl to the molecule O=c1nc(CSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)cc2)[nH]c2ccccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1nc(CSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)cc2)[nH]c2ccccc12.", + "ref_smiles": "O=C(O)c1cc(Cl)ccc1-n1c(Cc2ccccc2)nnc1SCc1nc(=O)c2ccccc2[nH]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "1a809800-bc4c-4cfc-9f2a-46f7f837c7e0", + "task": "add", + "question": "Modify the molecule CC(C)(C)NC(=O)c1ccccc1NC(=O)c1ccc(NS(C)(=O)=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)NC(=O)c1ccccc1NC(=O)c1ccc(NS(C)(=O)=O)cc1", + "ref_smiles": "CC(C)(C)NC(=O)c1cc(-c2ccccc2)ccc1NC(=O)c1ccc(NS(C)(=O)=O)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4d071832-12d6-4575-94ea-731446cf4be7", + "task": "add", + "question": "Modify the molecule CC1CCCC(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCCC(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1", + "ref_smiles": "CC1CCC(c2ccccc2)C(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "4cee046f-240e-4532-8176-3eecebb014ae", + "task": "add", + "question": "Modify the molecule CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)ccc2C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)ccc2C)cc1", + "ref_smiles": "CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)cc(-c3ccccc3)c2C)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "829afab2-a74f-4454-97ef-f8a281c20d47", + "task": "add", + "question": "Modify the molecule Brc1cnc(C2CCC2)nc1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Brc1cnc(C2CCC2)nc1Br", + "ref_smiles": "Brc1nc(C2CCC2)nc(-c3ccccc3)c1Br", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1f67711b-27df-46f4-89fc-07aeb5908969", + "task": "add", + "question": "Please add a carboxyl to the molecule C[NH+]=C(NCCOC)NCCn1ccnc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]=C(NCCOC)NCCn1ccnc1.", + "ref_smiles": "C[NH+]=C(NCCOC)NCCn1cnc(C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "503534a7-26eb-4b9d-9a1b-31a60060eb7e", + "task": "add", + "question": "Modify the molecule Cn1nc(-c2ccc(C[NH+]3CCC(NC(=O)COc4cccc(Cl)c4)CC3)s2)cc1C(F)(F)F by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1nc(-c2ccc(C[NH+]3CCC(NC(=O)COc4cccc(Cl)c4)CC3)s2)cc1C(F)(F)F", + "ref_smiles": "Cn1nc(-c2cc(C#N)c(C[NH+]3CCC(NC(=O)COc4cccc(Cl)c4)CC3)s2)cc1C(F)(F)F", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "716fce1b-cdb8-4452-8f95-7c2262cae948", + "task": "add", + "question": "Please add a benzene ring to the molecule CCN(Cc1ccccn1)c1ccc(CC[NH3+])cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(Cc1ccccn1)c1ccc(CC[NH3+])cc1.", + "ref_smiles": "CCN(Cc1cccc(-c2ccccc2)n1)c1ccc(CC[NH3+])cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1443b08a-89eb-46df-9564-04b5d0e73fe9", + "task": "add", + "question": "Please add a carboxyl to the molecule OC(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1.", + "ref_smiles": "O=C(O)C(O)(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "09e0978c-8074-4f15-a037-cf0404af1b15", + "task": "add", + "question": "Modify the molecule O=C(C1CN(C(=O)C2CCCCC2)C1)N1CCC(c2ccc(O)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C1CN(C(=O)C2CCCCC2)C1)N1CCC(c2ccc(O)cc2)CC1", + "ref_smiles": "O=C(C1CN(C(=O)C2CCCCC2O)C1)N1CCC(c2ccc(O)cc2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9b6d63b4-e8b8-4461-ab2d-a3d4ba867e93", + "task": "add", + "question": "Modify the molecule CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(C)c3cc(OC)ccc23)C1CO by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(C)c3cc(OC)ccc23)C1CO", + "ref_smiles": "CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(CO)c3cc(OC)ccc23)C1CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "657b55a6-aeb4-4eeb-b326-4e931cbfd82c", + "task": "add", + "question": "Modify the molecule CC(OC(=O)C=Cc1ccccc1)C(=O)c1ccc(NS(C)(=O)=O)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(OC(=O)C=Cc1ccccc1)C(=O)c1ccc(NS(C)(=O)=O)cc1", + "ref_smiles": "CC(OC(=O)C=Cc1cccc(O)c1)C(=O)c1ccc(NS(C)(=O)=O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "62f705f1-a62f-4062-8ebb-e1ce264dd91e", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(C)(C)CC(C)Nc1cc(Br)ccc1C#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(C)(C)CC(C)Nc1cc(Br)ccc1C#N.", + "ref_smiles": "COC(C)(CO)CC(C)Nc1cc(Br)ccc1C#N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "430c5c0a-c236-4a27-9916-619311556fe6", + "task": "add", + "question": "Modify the molecule CCCC1(CNS(=O)(=O)c2ccccc2F)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1(CNS(=O)(=O)c2ccccc2F)CC1", + "ref_smiles": "CCCC1(CNS(=O)(=O)c2ccccc2F)CC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "48c1c708-74bc-4a48-bebd-15fdf6dfbe75", + "task": "add", + "question": "Please add a amine to the molecule CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)cc1.", + "ref_smiles": "CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)c(N)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "41e750a2-c306-4645-ae54-266619127dc9", + "task": "add", + "question": "Please add a nitrile to the molecule Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)NCCc1ccccc1Cl)O2.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)NCCc1ccccc1Cl)O2.", + "ref_smiles": "CN1C(=O)C(C)(C(=O)NCCc2ccccc2Cl)Oc2ccc(CC#N)cc21", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "9eba71e7-b099-4dbc-addc-5d5326000930", + "task": "add", + "question": "Modify the molecule COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1", + "ref_smiles": "COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C(=O)O)c([N+](=O)[O-])c2)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "8b73f189-be80-4b6f-82a2-9ceb9e4cc6eb", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCc1nnc2n1Cc1c(C)ncn1-c1ccc(OC)cc1-2.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCc1nnc2n1Cc1c(C)ncn1-c1ccc(OC)cc1-2.", + "ref_smiles": "COc1ccc2c(c1)-c1nnc(COCO)n1Cc1c(C)ncn1-2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3dd0e1b3-b61a-4cd0-94a5-08a092d686ae", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(-c2cn3ccnc3c(Nc3cccc(CC(=O)N(C)C)c3)n2)cc1NC(=O)c1ccc(C(C)(C)C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2cn3ccnc3c(Nc3cccc(CC(=O)N(C)C)c3)n2)cc1NC(=O)c1ccc(C(C)(C)C)cc1.", + "ref_smiles": "Cc1ccc(-c2cn3ccnc3c(Nc3cccc(CC(=O)N(C)C)c3)n2)cc1NC(=O)c1ccc(C(C)(C)CO)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ebde61b4-9152-498c-bf9c-bbf04b720de4", + "task": "add", + "question": "Modify the molecule CCc1ccc(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F", + "ref_smiles": "CCc1cc(O)c(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "19ecdde5-c6c3-4af8-9874-c6093daf0f50", + "task": "add", + "question": "Please add a amine to the molecule CC[NH2+]C1CCc2[nH]c3ccc(OC)cc3c2C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH2+]C1CCc2[nH]c3ccc(OC)cc3c2C1.", + "ref_smiles": "COc1ccc2[nH]c3c(c2c1)CC([NH2+]C(C)N)CC3", + "add_group": "amine", + "remove_group": null + }, + { + "id": "9582ea17-0dd0-422e-b075-9294d368f2e8", + "task": "add", + "question": "Please add a benzene ring to the molecule Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4ncccn4)n3)CCCCC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4ncccn4)n3)CCCCC2)cc1.", + "ref_smiles": "Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4nccc(-c5ccccc5)n4)n3)CCCCC2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "afceadcf-5543-4fff-91c4-c3159632d3c3", + "task": "add", + "question": "Please add a carboxyl to the molecule CCCn1nc(C(=O)Nc2ncc[nH]2)ccc1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCn1nc(C(=O)Nc2ncc[nH]2)ccc1=O.", + "ref_smiles": "CCCn1nc(C(=O)Nc2nc(C(=O)O)c[nH]2)ccc1=O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "5c567b4a-2787-4c96-9062-81c140bb0e5c", + "task": "add", + "question": "Modify the molecule COc1ccc(Nc2nn3c(NCC4CC4)cc(C)nc3c2C(N)=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(Nc2nn3c(NCC4CC4)cc(C)nc3c2C(N)=O)cc1", + "ref_smiles": "COc1ccc(Nc2nn3c(NC(c4ccccc4)C4CC4)cc(C)nc3c2C(N)=O)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "800fa180-e192-4f31-8cc2-106f646b8e84", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)C(NC(=O)c1ccc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(NC(=O)c1ccc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C.", + "ref_smiles": "CC(C)C(NC(=O)c1c(-c2ccccc2)cc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7af67ad2-d8c8-4d37-b70d-8fe418975dd8", + "task": "add", + "question": "Modify the molecule C=[P+](CC)CC([P+](=C)CC)[P+](=C)C(O)C12CC1C(C)C(C)(O)C2C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=[P+](CC)CC([P+](=C)CC)[P+](=C)C(O)C12CC1C(C)C(C)(O)C2C", + "ref_smiles": "C=[P+](CC([P+](=C)CC)[P+](=C)C(O)C12CC1C(C)C(C)(O)C2C)C(C)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7ebf4760-485c-4108-846e-a14d506f94da", + "task": "add", + "question": "Modify the molecule CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1", + "ref_smiles": "CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c551f2f5-09bb-4953-b891-0798edee41c8", + "task": "add", + "question": "Please add a aldehyde to the molecule Nc1cnc2c(C3CCCCC3)nnn2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Nc1cnc2c(C3CCCCC3)nnn2c1.", + "ref_smiles": "Nc1cnc2c(C3CCCC(CC=O)C3)nnn2c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "359cbe52-a39a-4747-9ca3-f86d28296c94", + "task": "add", + "question": "Modify the molecule COc1ccc(N2CCOCC2)c2sc(C(=O)NCc3cccnc3)nc12 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(N2CCOCC2)c2sc(C(=O)NCc3cccnc3)nc12", + "ref_smiles": "COc1ccc(N2CCOC(N)C2)c2sc(C(=O)NCc3cccnc3)nc12", + "add_group": "amine", + "remove_group": null + }, + { + "id": "5974944d-9cba-4635-a191-f1984041cf93", + "task": "add", + "question": "Modify the molecule COCC1CCC[NH+](CC(O)c2ccc(C#N)cc2)C1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC1CCC[NH+](CC(O)c2ccc(C#N)cc2)C1", + "ref_smiles": "COCC1CCC[NH+](CC(N)(O)c2ccc(C#N)cc2)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ce7f32c8-7bd4-44e7-9895-ae54f8d444d0", + "task": "add", + "question": "Modify the molecule CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2)CC=C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2)CC=C1", + "ref_smiles": "CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2CC=O)CC=C1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "4f463e31-5c7f-4b1e-a5ca-34a4172eda53", + "task": "add", + "question": "Modify the molecule O=C(CCCN1CC[NH2+]CC1)C1CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCCN1CC[NH2+]CC1)C1CCC1", + "ref_smiles": "O=C(CCCN1CC[NH2+]CC1)C1(c2ccccc2)CCC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "467aadb5-da8a-41b0-8a97-c78a557a698c", + "task": "add", + "question": "Modify the molecule Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2ccc(-c3csc(Cc4ccccc4)n3)cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2ccc(-c3csc(Cc4ccccc4)n3)cc21", + "ref_smiles": "Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2cc(O)c(-c3csc(Cc4ccccc4)n3)cc21", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "757c3957-9ef9-48a7-8fea-09db82338567", + "task": "add", + "question": "Modify the molecule Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CCO)C1=O by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CCO)C1=O", + "ref_smiles": "Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CC(N)O)C1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "369ba7bd-d0a6-425b-8f47-1472734bec1b", + "task": "add", + "question": "Please add a hydroxyl to the molecule [NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)cc1.", + "ref_smiles": "[NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)c(O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b3e1ba9e-bc8a-4b49-b8f6-9487915c4926", + "task": "add", + "question": "Modify the molecule CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1", + "ref_smiles": "CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ad22fb49-bf50-4220-8701-c2b4dabe10b7", + "task": "add", + "question": "Modify the molecule CCc1nc2ccccc2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1nc2ccccc2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C", + "ref_smiles": "CCc1nc2cccc(O)c2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3b1da969-a5c3-405e-b137-e013b1c7a4ce", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCC1CCCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCC1CCCO1.", + "ref_smiles": "O=C(CCC(c1ccccc1)N1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)NCC1CCCO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f85e44f5-0041-4f9b-b2c9-24a3067f10ad", + "task": "add", + "question": "Modify the molecule CCC[NH2+]C(CCSC)c1ccc(C)s1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH2+]C(CCSC)c1ccc(C)s1", + "ref_smiles": "CCC[NH2+]C(c1ccc(C)s1)C(CC=O)CSC", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a3614006-b693-4db3-ae23-c60c0004cde3", + "task": "add", + "question": "Modify the molecule COCCn1cc(CCNC(=O)C2CCCC2)c2cccnc21 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCn1cc(CCNC(=O)C2CCCC2)c2cccnc21", + "ref_smiles": "COCCn1cc(CCNC(=O)C2CCC(CC=O)C2)c2cccnc21", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "8fbb8944-f220-4102-be49-e5b5ceac0b0c", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccccc1C[NH+](C)C(C)C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C[NH+](C)C(C)C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1C.", + "ref_smiles": "Oc1ccccc1C[NH+](C)C(C)C(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7289f7a7-f088-4894-9e6e-8fd412409ac7", + "task": "add", + "question": "Modify the molecule O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)CC1", + "ref_smiles": "O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)C(O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "88e1962f-4866-42ee-85d8-e94aeba48543", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(CCCn1cccc1)NCCNc1ncccn1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCCn1cccc1)NCCNc1ncccn1.", + "ref_smiles": "O=C(CCCn1cccc1)NCCNc1nccc(O)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "ab2cd0ca-81b3-40f8-8ea6-2baa20e0af59", + "task": "add", + "question": "Modify the molecule N#CC1(c2ccc(-c3cn4c(C(F)(F)F)nnc4cn3)cc2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC1(c2ccc(-c3cn4c(C(F)(F)F)nnc4cn3)cc2)CC1", + "ref_smiles": "N#CC1(c2ccc(-c3cn4c(C(F)(F)F)nnc4cn3)cc2)CC1C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "af4dbc0b-6c68-4d62-8dff-9490940a075a", + "task": "add", + "question": "Please add a benzene ring to the molecule C[NH+](C)CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1.", + "ref_smiles": "C[NH+](CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1)Cc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8cd4f21e-885f-4620-af4b-83eacff2f6b0", + "task": "add", + "question": "Modify the molecule O=C(c1cccc(Br)c1Cl)C1CCCc2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(c1cccc(Br)c1Cl)C1CCCc2ccccc21", + "ref_smiles": "O=C(c1cccc(Br)c1Cl)C1CCC(c2ccccc2)c2ccccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "39e9d6bf-f09b-427d-ac01-4a4f3f3c0dcc", + "task": "add", + "question": "Please add a aldehyde to the molecule O=Cc1ccc(F)c(N2CCNC2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=Cc1ccc(F)c(N2CCNC2=O)c1.", + "ref_smiles": "O=CCC1CN(c2cc(C=O)ccc2F)C(=O)N1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "39e2cccf-c8ed-4876-9824-30426837aabd", + "task": "add", + "question": "Modify the molecule CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3CCCC3)cc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3CCCC3)cc2)cc1", + "ref_smiles": "CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3(O)CCCC3)cc2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b7115d8b-89ed-47ac-a97a-06ffc1353db2", + "task": "add", + "question": "Modify the molecule C#CC(CC)C(O)C(c1ccc(C)cc1)S(C)(=O)=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C#CC(CC)C(O)C(c1ccc(C)cc1)S(C)(=O)=O", + "ref_smiles": "C#CC(CC)C(O)C(c1ccc(C)cc1-c1ccccc1)S(C)(=O)=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "19b8af36-c304-4240-a2c0-94d4350360c0", + "task": "add", + "question": "Please add a carboxyl to the molecule CCS(=O)C1CCCC(NC(NCCCc2cccc(OC)c2)=[NH+]C)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCS(=O)C1CCCC(NC(NCCCc2cccc(OC)c2)=[NH+]C)C1.", + "ref_smiles": "CCS(=O)C1CCCC(NC(NCCCc2cccc(OCC(=O)O)c2)=[NH+]C)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "314cfa79-4b4a-433f-8659-75f8da976711", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1.", + "ref_smiles": "CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3c(O)cccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fb6daf69-5351-4507-a861-fcb43d1738ea", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)cc1OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)cc1OC.", + "ref_smiles": "COc1cc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)ccc1OCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f1ff332f-e1d4-43d3-abc9-c7fb4ee5e113", + "task": "add", + "question": "Modify the molecule CCOC(=O)c1ccccc1NC(=O)COc1cccc2cccnc12 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)c1ccccc1NC(=O)COc1cccc2cccnc12", + "ref_smiles": "CCOC(=O)c1ccc(CC=O)cc1NC(=O)COc1cccc2cccnc12", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a250f6fe-ab39-4d01-a41b-2e92d5f09f88", + "task": "add", + "question": "Modify the molecule CC([NH3+])(c1nc2c([nH]1)CCCC2)C1CCCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])(c1nc2c([nH]1)CCCC2)C1CCCCC1", + "ref_smiles": "CC([NH3+])(c1nc2c([nH]1)CC(CC=O)CC2)C1CCCCC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "538e10ed-eb37-45d6-b065-f94abbc24849", + "task": "add", + "question": "Please add a aldehyde to the molecule CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2)cc1.", + "ref_smiles": "CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2CC=O)cc1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a23c7ef3-27a5-48f4-a279-a68a47b1ca29", + "task": "add", + "question": "Modify the molecule CC=C(C)COc1nccc(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC=C(C)COc1nccc(C)n1", + "ref_smiles": "CC=C(C)C(Oc1nccc(C)n1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7754fdb1-4a19-4a98-ba0e-6a111068ced2", + "task": "add", + "question": "Modify the molecule CN(C(=O)c1ccccc1)c1ccc2c(c1)nc(NC(=O)c1ccc3cc[nH]c3c1)n2CCCN1CCCC1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C(=O)c1ccccc1)c1ccc2c(c1)nc(NC(=O)c1ccc3cc[nH]c3c1)n2CCCN1CCCC1=O", + "ref_smiles": "CN(C(=O)c1ccccc1)c1ccc2c(c1)nc(NC(=O)c1ccc3cc[nH]c3c1)n2C(CCN1CCCC1=O)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e23adfc9-ea05-427b-9482-26a7bc59b429", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1nc(C2CCCN(C(=O)NC3CCOc4ccc(F)cc43)C2)sc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(C2CCCN(C(=O)NC3CCOc4ccc(F)cc43)C2)sc1C.", + "ref_smiles": "Cc1nc(C2CCCN(C(=O)NC3CC(C(=O)O)Oc4ccc(F)cc43)C2)sc1C", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "d607a9f2-14a7-4410-a25e-a3400ef156b7", + "task": "add", + "question": "Modify the molecule CCCC1CCC(n2c(=O)[nH]c(Cl)c(C)c2=O)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC1CCC(n2c(=O)[nH]c(Cl)c(C)c2=O)CC1", + "ref_smiles": "Cc1c(Cl)[nH]c(=O)n(C2CCC(CC(C)CC=O)CC2)c1=O", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "04a078da-7dd7-4fce-9841-f22ae157ae07", + "task": "add", + "question": "Modify the molecule C=CC[NH2+]C1(C(=O)[O-])CCOC(C)(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC[NH2+]C1(C(=O)[O-])CCOC(C)(C)C1", + "ref_smiles": "CC1(C)CC([NH2+]CC=Cc2ccccc2)(C(=O)[O-])CCO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f3736136-83e7-458a-ac32-9e44f807feec", + "task": "add", + "question": "Modify the molecule CC(C)CC(C)C1OC(C)(C)OCC1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC(C)C1OC(C)(C)OCC1C", + "ref_smiles": "CC(C)CC(C)C1OC(C)(C)OC(O)C1C", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "447141f8-c08f-4522-8724-adb228b15211", + "task": "add", + "question": "Modify the molecule CC1CC[NH+](C(CN=C(N)NCCc2ccccn2)c2cccs2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](C(CN=C(N)NCCc2ccccn2)c2cccs2)CC1", + "ref_smiles": "CC1CC[NH+](C(CN=C(N)NCCc2cc(O)ccn2)c2cccs2)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fdc14c2f-36ba-4d8b-bdba-b63818e7047b", + "task": "add", + "question": "Please add a carboxyl to the molecule O=C(COCCOCC(=O)NCCc1ccccc1)NCCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(COCCOCC(=O)NCCc1ccccc1)NCCc1ccccc1.", + "ref_smiles": "O=C(COCCOCC(=O)NCCc1ccccc1C(=O)O)NCCc1ccccc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "65afe786-5818-48a4-bc18-b77a8772b366", + "task": "add", + "question": "Modify the molecule [NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2)cc1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2)cc1)C(=O)[O-]", + "ref_smiles": "[NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2c2ccccc2)cc1)C(=O)[O-]", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d9b30d79-4e6c-49f3-86a9-99133b2d49af", + "task": "add", + "question": "Modify the molecule O=C(NC1CCN(C(=O)NCc2ccccn2)CC1)c1ccccc1C(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NC1CCN(C(=O)NCc2ccccn2)CC1)c1ccccc1C(F)(F)F", + "ref_smiles": "O=C(NC1CCN(C(=O)NCc2ccccn2)CC1)c1ccc(-c2ccccc2)cc1C(F)(F)F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "124ae598-fa23-4c0a-9c38-8ded1153ff0e", + "task": "add", + "question": "Please add a carboxyl to the molecule COc1ccccc1N1CCN(C(=O)C(=O)Nc2cccc(O)c2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1N1CCN(C(=O)C(=O)Nc2cccc(O)c2)CC1.", + "ref_smiles": "COc1ccc(C(=O)O)cc1N1CCN(C(=O)C(=O)Nc2cccc(O)c2)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "d575b64e-85c5-41c0-93fc-8f90fc92024d", + "task": "add", + "question": "Modify the molecule [NH3+]CCCCC(NC(=O)CCC([NH3+])C(=O)NC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O)C(=O)[O-] by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "[NH3+]CCCCC(NC(=O)CCC([NH3+])C(=O)NC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O)C(=O)[O-]", + "ref_smiles": "NC1(O)C(O)C(NC(=O)C([NH3+])CCC(=O)NC(CCCC[NH3+])C(=O)[O-])OC1n1ccc(=O)[nH]c1=O", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8d0c7e97-5b90-455a-9ae8-b7cdc1f60797", + "task": "add", + "question": "Modify the molecule Cc1ccc(-c2cccc(COc3ccc4cnccc4c3)c2)cc1C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(-c2cccc(COc3ccc4cnccc4c3)c2)cc1C(=O)[O-]", + "ref_smiles": "Cc1ccc(-c2cccc(COc3cc4ccncc4cc3O)c2)cc1C(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1e3425f3-c503-49c9-8e59-ac1f019649e0", + "task": "add", + "question": "Modify the molecule Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1", + "ref_smiles": "Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1C#N", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "2756a48e-3e0c-4dc7-9b15-d053e6f5e1b5", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)C(C)NC(=O)C[NH2+]Cc1ccn(C)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(C)NC(=O)C[NH2+]Cc1ccn(C)n1.", + "ref_smiles": "CC(C)C(CC(=O)O)NC(=O)C[NH2+]Cc1ccn(C)n1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "c78c8bc4-cb98-457a-8fe4-cf44a0e1caa5", + "task": "add", + "question": "Modify the molecule COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3)ccc2Cl)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3)ccc2Cl)cc1", + "ref_smiles": "COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3ccc2Cl)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "45baf0b2-c611-4c77-b4d8-78f2cddac74b", + "task": "add", + "question": "Modify the molecule COCCOCCOC(=O)SC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCOCCOC(=O)SC", + "ref_smiles": "COCC(O)OCCOC(=O)SC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "78967d4e-a379-4347-bbb0-b4609f840709", + "task": "add", + "question": "Please add a carboxyl to the molecule Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1.", + "ref_smiles": "Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)c(C(=O)O)c4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "cd6a625e-4824-49e0-8b0f-67bba7250817", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[NH+](C)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](C)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1.", + "ref_smiles": "C[NH+](CO)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "2442a2a9-d789-49cc-9884-1240d642ac4a", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(CN(C)CCl)c(C)c1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(CN(C)CCl)c(C)c1C.", + "ref_smiles": "Cc1c(CN(C)CCl)ccc(OCc2ccccc2)c1C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b60d582a-3ae2-4896-89f4-824de69c1037", + "task": "add", + "question": "Please add a hydroxyl to the molecule CNC(=O)c1ccc(OC2CC2)cc1C#N.\nPlease wrap the final SMILES in ....", + "src_smiles": "CNC(=O)c1ccc(OC2CC2)cc1C#N.", + "ref_smiles": "CNC(=O)c1ccc(OC2(O)CC2)cc1C#N", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "1cce48ac-5b6e-4d8b-a65b-cc503444eaeb", + "task": "add", + "question": "Modify the molecule CCNS(=O)(=O)CCNC(=O)c1ncccc1C#CCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNS(=O)(=O)CCNC(=O)c1ncccc1C#CCO", + "ref_smiles": "CCNS(=O)(=O)C(O)CNC(=O)c1ncccc1C#CCO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a0bc49c6-f69e-44fe-a335-189e00347a1d", + "task": "add", + "question": "Please add a nitrile to the molecule NC(c1c(Cl)ccc(Br)c1O)C(F)(F)F.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(c1c(Cl)ccc(Br)c1O)C(F)(F)F.", + "ref_smiles": "N#Cc1cc(Br)c(O)c(C(N)C(F)(F)F)c1Cl", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "e4615841-8797-4557-8f8f-c031339b5ea1", + "task": "add", + "question": "Modify the molecule CCC([NH3+])C(C)OCCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC([NH3+])C(C)OCCc1ccccc1", + "ref_smiles": "CCC([NH3+])C(C)OCCc1ccccc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3ae59814-7aea-4e76-a9a0-ca61265d57e9", + "task": "add", + "question": "Modify the molecule CC1CC(C)CC(C(O)c2ccc(F)cc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC(C)CC(C(O)c2ccc(F)cc2)C1", + "ref_smiles": "CC1CC(C)CC(C(O)c2ccc(F)cc2O)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a59be0fe-b3c5-4660-9aaf-ed4994abbc41", + "task": "add", + "question": "Please add a benzene ring to the molecule CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CC.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CC.", + "ref_smiles": "CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CCc1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7d7c8873-a310-4708-8caf-97f08ff41167", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC([NH2+]CC(C)(C)c1ccccc1)c1cc(F)ccc1O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH2+]CC(C)(C)c1ccccc1)c1cc(F)ccc1O.", + "ref_smiles": "CC(C)(C[NH2+]C(CO)c1cc(F)ccc1O)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "988933e2-6711-43fc-9052-d53796fd70cd", + "task": "add", + "question": "Modify the molecule O=C(NCCC[NH+]1CCOCC1)c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCCC[NH+]1CCOCC1)c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1", + "ref_smiles": "O=C(NC(CC[NH+]1CCOCC1)c1ccccc1c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "98230ee7-1c90-4cb6-a0de-0d0ca694d659", + "task": "add", + "question": "Modify the molecule Cc1cc(NC(=O)NCCCOC(C)C)no1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(NC(=O)NCCCOC(C)C)no1", + "ref_smiles": "Cc1onc(NC(=O)NCCCOC(C)C)c1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1a6afd8d-acf9-45e9-bfca-e348e2c35785", + "task": "add", + "question": "Please add a nitrile to the molecule CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)cc1.", + "ref_smiles": "CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)c(C#N)c1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "3de6116f-49b3-4b2c-a477-877b4aa51aeb", + "task": "add", + "question": "Please add a aldehyde to the molecule C=C(NNC(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccccc1)c1ccc(OC)c(OC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(NNC(=O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccccc1)c1ccc(OC)c(OC)c1.", + "ref_smiles": "C=C(NNC(=O)CN(c1ccc(C)c(CC=O)c1)S(=O)(=O)c1ccccc1)c1ccc(OC)c(OC)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "137b6865-4fda-458f-a18a-984a58a3afd5", + "task": "add", + "question": "Modify the molecule Cn1c2cc(C#N)ccc2c2cccc(C#N)c21 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1c2cc(C#N)ccc2c2cccc(C#N)c21", + "ref_smiles": "N#Cc1ccc2c3cccc(C#N)c3n(CC(=O)O)c2c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b81c7c11-a41a-451b-94d7-1fae65f072f4", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCC[NH+](CCCC)CCCOc1cccc(C[NH3+])c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC[NH+](CCCC)CCCOc1cccc(C[NH3+])c1.", + "ref_smiles": "CCCC[NH+](CCCOc1cccc(C[NH3+])c1)CC(O)CC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "08d55b09-5504-4562-aeda-08cb39fe7dde", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)cc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)cc(Cl)c1.", + "ref_smiles": "O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)c(O)c(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "23fdb8c8-256e-4441-9626-08846518b797", + "task": "add", + "question": "Please add a aldehyde to the molecule CCCCCC(F)(F)C=CC1C(OC(C)=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCC(F)(F)C=CC1C(OC(C)=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21.", + "ref_smiles": "CCCCCC(F)(F)C=CC1C(OC(=O)CCC=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "381ddaa5-b3f4-4086-8714-8c4177be3cce", + "task": "add", + "question": "Please add a benzene ring to the molecule CCOc1ccc2nc(NC(=O)C(Cc3ccccc3)n3cccc3)sc2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc2nc(NC(=O)C(Cc3ccccc3)n3cccc3)sc2c1.", + "ref_smiles": "CCOc1ccc2nc(NC(=O)C(Cc3cccc(-c4ccccc4)c3)n3cccc3)sc2c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "25aec7b8-0c8f-453e-8890-c614ee283ecf", + "task": "add", + "question": "Please add a aldehyde to the molecule CC1CC1C1(O)C2CCCC21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC1C1(O)C2CCCC21.", + "ref_smiles": "CC1CC1C1(O)C2CCC(CC=O)C21", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "55f8c940-b775-420b-92db-e2c00c1a725e", + "task": "add", + "question": "Modify the molecule Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1", + "ref_smiles": "Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "20497517-edaf-4dda-9a8a-3ceb2211684c", + "task": "add", + "question": "Modify the molecule CCCN(CCC)C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCN(CCC)C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1", + "ref_smiles": "CCCN(C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1)C(CC)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "37404a76-48cc-4c0d-a1ba-bd92b57b62d1", + "task": "add", + "question": "Modify the molecule CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1", + "ref_smiles": "CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7dd7625a-854b-4e05-839f-ba1f55259ff1", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1CN(C(C[NH3+])c2cc(F)ccc2Br)CCCO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CN(C(C[NH3+])c2cc(F)ccc2Br)CCCO1.", + "ref_smiles": "CC1(c2ccccc2)CN(C(C[NH3+])c2cc(F)ccc2Br)CCCO1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e68452d3-a10d-44ab-9a57-1ba6ec8a64e9", + "task": "add", + "question": "Please add a carboxyl to the molecule CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)C.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)C.", + "ref_smiles": "CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)(C)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "4789c396-3681-48db-95d6-89f299cdb929", + "task": "add", + "question": "Modify the molecule COCCCOc1cc(CC(CC([NH3+])C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCCOc1cc(CC(CC([NH3+])C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC", + "ref_smiles": "COCCCOc1cc(CC(CC([NH3+])(c2ccccc2)C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "7889c7f6-cdbc-4d9a-a382-50375c571470", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cccnc32)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cccnc32)CC1.", + "ref_smiles": "O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cc(-c4ccccc4)cnc32)CC1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "01dc8fe1-8677-4963-b7cb-c763c5f0d82b", + "task": "add", + "question": "Modify the molecule Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)CC2)C(C)C)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)CC2)C(C)C)c1", + "ref_smiles": "Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)C(S)C2)C(C)C)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "96d86702-38cb-4b21-9abf-2b2a1a9fbf36", + "task": "add", + "question": "Please add a benzene ring to the molecule COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)cc1.", + "ref_smiles": "COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)c(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "9f92bfa3-bf42-4925-a55b-33bf4ca07ee6", + "task": "add", + "question": "Modify the molecule CC1CSCCN1C(=O)C1CC2CCC1[NH2+]2 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CSCCN1C(=O)C1CC2CCC1[NH2+]2", + "ref_smiles": "CC1C(c2ccccc2)SCCN1C(=O)C1CC2CCC1[NH2+]2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "d11f3ef8-2f15-4dfc-a12f-79e5e43f26c8", + "task": "add", + "question": "Modify the molecule CCCOc1cc(NCC2(C(C)C)CC2)ncn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCOc1cc(NCC2(C(C)C)CC2)ncn1", + "ref_smiles": "CCCOc1cc(NC(O)C2(C(C)C)CC2)ncn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "d7cbf120-612f-429e-b75d-05a591e95eb0", + "task": "add", + "question": "Please add a benzene ring to the molecule CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1ccccc1.", + "ref_smiles": "CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1cccc(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "fae9e24d-6fcf-45c1-a483-d11708c05a04", + "task": "add", + "question": "Modify the molecule CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2)cc1", + "ref_smiles": "CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2C#N)cc1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "d7ac1fae-6250-4ca9-a983-f4232f5de5f8", + "task": "add", + "question": "Modify the molecule Cc1cc(NC(=O)CN2CCC([NH+](C)Cc3noc(C)n3)C2)on1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(NC(=O)CN2CCC([NH+](C)Cc3noc(C)n3)C2)on1", + "ref_smiles": "Cc1nc(C[NH+](C)C2CCN(CC(=O)Nc3cc(CCC=O)no3)C2)no1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "e4f2f674-b484-4da0-832c-31adb1378022", + "task": "add", + "question": "Modify the molecule COC(CNC(=O)C(=O)Nc1ccccc1F)c1ccsc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(CNC(=O)C(=O)Nc1ccccc1F)c1ccsc1", + "ref_smiles": "COC(CNC(=O)C(=O)Nc1ccc(C(=O)O)cc1F)c1ccsc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "43c5ebb0-ed79-439a-81f6-d0384bc30ded", + "task": "add", + "question": "Modify the molecule NNC(CCC1CCCO1)CC1CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "NNC(CCC1CCCO1)CC1CC1", + "ref_smiles": "NNC(CCC1CCCO1)(CC1CC1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "32f14020-dc60-4f0f-911f-8d62d87f3fce", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(C)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(C)s1.", + "ref_smiles": "CC[NH+](CC)Cc1ccccc1C(O)NC(=O)c1ccc(C)s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f2c8a0bd-7b6e-4d41-8b44-bbe9544042f2", + "task": "add", + "question": "Please add a carboxyl to the molecule CN(C)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1.", + "ref_smiles": "CN(CC(=O)O)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "591044fb-64cc-40d5-b457-ec4e06b53927", + "task": "add", + "question": "Modify the molecule O=C(CC1(c2ccccc2)CCN(C(=O)[O-])CC1)NCc1ccc(C(F)(F)F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CC1(c2ccccc2)CCN(C(=O)[O-])CC1)NCc1ccc(C(F)(F)F)cc1", + "ref_smiles": "O=C(CC1(c2ccccc2)CCN(C(=O)[O-])C(C(=O)O)C1)NCc1ccc(C(F)(F)F)cc1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "0450a9fd-2b2e-4083-8e57-5bc9b4b49e8a", + "task": "add", + "question": "Modify the molecule CCC(=O)C1CC(c2ccccc2)C[NH+]1CC by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(=O)C1CC(c2ccccc2)C[NH+]1CC", + "ref_smiles": "CCC(=O)C1CC(c2cccc(C(=O)O)c2)C[NH+]1CC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "858c44c0-fc14-45aa-b021-ed02cc97c1b5", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccccc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccccc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1.", + "ref_smiles": "COc1ccc(O)cc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "03a1c6ab-00a6-4919-a1fe-bc079eb8de68", + "task": "add", + "question": "Please add a amine to the molecule Cc1c(Br)cccc1C(O)C(C[NH3+])c1ccccc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1c(Br)cccc1C(O)C(C[NH3+])c1ccccc1F.", + "ref_smiles": "Cc1c(Br)cccc1C(O)C(C[NH3+])c1c(N)cccc1F", + "add_group": "amine", + "remove_group": null + }, + { + "id": "793cfb2a-58ce-4b2c-9f7a-0408730c2df1", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCc1cc(C2CC3NC(N)=[NH+]C3C2C)ccc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCc1cc(C2CC3NC(N)=[NH+]C3C2C)ccc1F.", + "ref_smiles": "CCCc1cc(C2CC3NC(N)=[NH+]C3C2(C)O)ccc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cdaa877f-f1fa-4873-9edc-45a72253732e", + "task": "add", + "question": "Modify the molecule COc1cc(OC)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cc(OC)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1", + "ref_smiles": "COc1cc(OCO)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0368df37-fddd-4ce5-b09b-3d37167c56a3", + "task": "add", + "question": "Please add a hydroxyl to the molecule O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1.", + "ref_smiles": "O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3c(O)cccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dbc86c32-56f7-45ca-a7a9-dcfa16e7c5f5", + "task": "add", + "question": "Modify the molecule Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOCC4)nc3)n2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOCC4)nc3)n2)c(Cl)c1", + "ref_smiles": "Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOC(O)C4)nc3)n2)c(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c0640e36-206f-4875-b371-3e5555680d00", + "task": "add", + "question": "Modify the molecule CC(C)(c1ccc(F)cc1)C(O)Cc1ccc(Br)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(c1ccc(F)cc1)C(O)Cc1ccc(Br)cn1", + "ref_smiles": "CC(C)(c1ccc(F)cc1)C(O)Cc1ncc(Br)cc1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4e823174-b145-45e1-93b1-9e309409e0e0", + "task": "add", + "question": "Please add a benzene ring to the molecule N#CC1(CO)CCCCCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC1(CO)CCCCCC1.", + "ref_smiles": "N#CC1(CO)CCCCC(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b42f5a9a-7fd8-427a-ac0e-83666caec2f3", + "task": "add", + "question": "Please add a amine to the molecule CN1C(=O)C(CCO)c2cccc(F)c21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN1C(=O)C(CCO)c2cccc(F)c21.", + "ref_smiles": "CN1C(=O)C(CCO)c2ccc(N)c(F)c21", + "add_group": "amine", + "remove_group": null + }, + { + "id": "033ebfaf-6c0b-46c9-b618-5d8475fadddc", + "task": "add", + "question": "Modify the molecule CCCCCCCC[Si](F)(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCC[Si](F)(F)F", + "ref_smiles": "CCC(CCCCC[Si](F)(F)F)C(=O)O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "03e713f2-4eb0-4c6c-a052-23e69364263a", + "task": "add", + "question": "Please add a carboxyl to the molecule O=C([O-])c1ccc2c(c1)CCN2CCOCC(F)(F)F.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1ccc2c(c1)CCN2CCOCC(F)(F)F.", + "ref_smiles": "O=C([O-])c1cc2c(c(C(=O)O)c1)N(CCOCC(F)(F)F)CC2", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "92575826-eb5e-4a7d-9cd7-0e1721a23590", + "task": "add", + "question": "Modify the molecule O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1", + "ref_smiles": "O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1S", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "8887b49c-d225-4e8c-8d92-ed1707a565d6", + "task": "add", + "question": "Please add a carboxyl to the molecule Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)C)C1CCCCC1)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)C)C1CCCCC1)C1CC1.", + "ref_smiles": "Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)CC(=O)O)C1CCCCC1)C1CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "f4eaee75-b18b-4ce5-b8df-cdbdc1f4e1fc", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCC(CNc1ccc(C(=O)N(C)C)cn1)OC.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC(CNc1ccc(C(=O)N(C)C)cn1)OC.", + "ref_smiles": "COCC(CNc1ccc(C(=O)N(C)CO)cn1)OC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a8d11116-e8b9-4516-8a5f-f180b1c21300", + "task": "add", + "question": "Please add a hydroxyl to the molecule COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2)cc1.", + "ref_smiles": "COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "be3bee14-4cae-4c7d-8018-4e9e57d039a2", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C2Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C2Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1.", + "ref_smiles": "COc1ccc(C2(c3ccccc3)Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8a56756f-08f7-49a3-8f1e-6b0a76c1dc3e", + "task": "add", + "question": "Modify the molecule CCCNc1ccc(C[NH+](CC)CC(C)CC)cn1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNc1ccc(C[NH+](CC)CC(C)CC)cn1", + "ref_smiles": "CCCNc1ccc(C[NH+](CC)C(N)C(C)CC)cn1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "acb9443d-2e9f-4f9d-895b-1ca63ce2b1de", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOCC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOCC1.", + "ref_smiles": "CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOC(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b3ab4d9a-1461-4183-90cc-bfbf57b6eceb", + "task": "add", + "question": "Modify the molecule CCOC(=O)C(C)(C)CN(c1nc(Cl)ncc1[N+](=O)[O-])C1CCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)C(C)(C)CN(c1nc(Cl)ncc1[N+](=O)[O-])C1CCCC1", + "ref_smiles": "CCOC(=O)C(C)(C)CN(c1nc(Cl)nc(CC=O)c1[N+](=O)[O-])C1CCCC1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "2d99b53f-da11-4e9e-8c84-a766597c0836", + "task": "add", + "question": "Modify the molecule CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)ccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)ccc1Cl", + "ref_smiles": "CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)c(-c2ccccc2)cc1Cl", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "41262ccc-db86-42e7-ac72-9038338d1f91", + "task": "add", + "question": "Please add a carboxyl to the molecule CCON=Cc1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCON=Cc1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1.", + "ref_smiles": "CCON=C(C(=O)O)c1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "ab66270e-b533-4827-b1ed-f02b88faab47", + "task": "add", + "question": "Please add a amine to the molecule CC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1.", + "ref_smiles": "NCC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "36a7bf90-5831-4a95-8f64-db1b69071675", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCC(O)C1(O)C(O)=C(O)C1O.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCC(O)C1(O)C(O)=C(O)C1O.", + "ref_smiles": "CCC(O)C(O)C1(O)C(O)=C(O)C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a4778e46-b7b6-40a8-b276-cc5b4ffdd6f4", + "task": "add", + "question": "Modify the molecule COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2cccc(Br)c2)cc1O by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2cccc(Br)c2)cc1O", + "ref_smiles": "COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2ccc(C(=O)O)c(Br)c2)cc1O", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "67b47643-692f-4342-88fc-223e3e891e66", + "task": "add", + "question": "Modify the molecule CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)CN2C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)CN2C1=O", + "ref_smiles": "CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)(O)CN2C1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "9c7a0b99-6b82-4322-a9bc-123bc4577f5d", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)CCC1(C)CNC(=O)CO1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)CCC1(C)CNC(=O)CO1.", + "ref_smiles": "CC(C)CCC1(CO)CNC(=O)CO1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0b1f43f6-0c3b-4d8d-aeab-29f64911f0be", + "task": "add", + "question": "Modify the molecule c1ccc(OCCN2CC[NH+](Cc3cccnc3)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "c1ccc(OCCN2CC[NH+](Cc3cccnc3)CC2)cc1", + "ref_smiles": "c1ccc(OCC(c2ccccc2)N2CC[NH+](Cc3cccnc3)CC2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "06f3d299-9095-4f29-9698-1148f3947995", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4)nn3c2=O)cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4)nn3c2=O)cc1F.", + "ref_smiles": "CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4O)nn3c2=O)cc1F", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c4aaad8d-e1b5-42aa-af68-c0d3c162271a", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)cs2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)cs2)cc1.", + "ref_smiles": "Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3O)cs2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "60d2cb38-c268-4bf4-94b2-c50f43afeca2", + "task": "add", + "question": "Please add a amine to the molecule Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)cc1.", + "ref_smiles": "Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)c(NH2)c1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8779ba9f-9105-4e66-a64b-46bff3520c5c", + "task": "add", + "question": "Modify the molecule Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)CCCC4)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)CCCC4)cc1", + "ref_smiles": "Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)C(c2ccccc2)CCC4)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "93d9f435-806c-49ac-8571-3d2393b20213", + "task": "add", + "question": "Modify the molecule Cc1nc(Nc2cccc(Cl)c2)cc(N(C)c2ccccc2)n1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1nc(Nc2cccc(Cl)c2)cc(N(C)c2ccccc2)n1", + "ref_smiles": "Cc1nc(Nc2cccc(Cl)c2N)cc(N(C)c2ccccc2)n1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "f2f80fb2-51fe-4385-a7e2-9e39006cb6b5", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC[NH+](Cc1ccnc(NN)c1)C1CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC[NH+](Cc1ccnc(NN)c1)C1CC1.", + "ref_smiles": "CCC[NH+](Cc1cc(O)nc(NN)c1)C1CC1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4daa371d-fb54-43d0-b2a8-0ab8b3a04fac", + "task": "add", + "question": "Modify the molecule CCCNC(=O)NC(C)(C)C(=O)NCC1Cc2ccccc2O1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCNC(=O)NC(C)(C)C(=O)NCC1Cc2ccccc2O1", + "ref_smiles": "CCCNC(=O)NC(C)(C)C(=O)NCC1(c2ccccc2)Cc2ccccc2O1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8c29356c-5974-4f2e-a52f-91e58cff6258", + "task": "add", + "question": "Modify the molecule CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2cccc(F)c2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2cccc(F)c2)cc1", + "ref_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2ccc(O)c(F)c2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "960b5f33-5a9a-4336-aff2-89bb49ce4243", + "task": "add", + "question": "Modify the molecule COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1", + "ref_smiles": "COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "18e29158-8c91-480f-a66a-c3b26945b795", + "task": "add", + "question": "Modify the molecule COC(=O)c1ccc(N)c(OCOCC(F)(F)F)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1ccc(N)c(OCOCC(F)(F)F)c1", + "ref_smiles": "Nc1ccc(C(=O)OCc2ccccc2)cc1OCOCC(F)(F)F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "5dc6267d-5c4c-4527-ada9-e33f1f0ba399", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCn1nc(C)cc1C[NH+]1CCC(CCBr)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCn1nc(C)cc1C[NH+]1CCC(CCBr)C1.", + "ref_smiles": "Cc1cc(C[NH+]2CCC(CCBr)C2)n(CCO)n1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "b659d0ac-1c0a-42c8-8085-d96da09a7ef6", + "task": "add", + "question": "Modify the molecule C=C(C)C(=O)OCCCC1([Si](C)(C)C)CCC[Si]([Si](C)(C)C)([Si](C)(C)C)O1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C(=O)OCCCC1([Si](C)(C)C)CCC[Si]([Si](C)(C)C)([Si](C)(C)C)O1", + "ref_smiles": "C=C(C)C(=O)OCCCC1([Si](C)(C)C)CC(O)C[Si]([Si](C)(C)C)([Si](C)(C)C)O1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "187d7a53-99c8-4af3-a9cf-f95be38ab7c1", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)S(=O)(=O)Nc1ccc2c(c1)CN(C(=O)c1cccs1)CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)S(=O)(=O)Nc1ccc2c(c1)CN(C(=O)c1cccs1)CC2.", + "ref_smiles": "CC(C)S(=O)(=O)Nc1ccc2c(c1O)CN(C(=O)c1cccs1)CC2", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "69a98c31-1f17-4577-ba10-fed1dd206939", + "task": "add", + "question": "Modify the molecule OCCC(CO)[NH2+]C1CSC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "OCCC(CO)[NH2+]C1CSC1", + "ref_smiles": "OCCC([NH2+]C1CSC1)C(O)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "f8fbe9d7-51c2-454e-b0cc-bb75b01ebc87", + "task": "add", + "question": "Modify the molecule CCC(CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1nc2ccccc2s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1nc2ccccc2s1", + "ref_smiles": "CCC(CO[Si](C)(C)C(C)(C)Cc1ccccc1)NS(=O)(=O)c1nc2ccccc2s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "8df682ce-23a5-40a1-9844-71b1f66846c4", + "task": "add", + "question": "Modify the molecule OC(CN(c1ccccc1)C(Oc1ccccc1)c1cccc(OC(F)(F)F)c1)c1ccc(C(F)(F)F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "OC(CN(c1ccccc1)C(Oc1ccccc1)c1cccc(OC(F)(F)F)c1)c1ccc(C(F)(F)F)cc1", + "ref_smiles": "O=C(O)c1cccc(N(CC(O)c2ccc(C(F)(F)F)cc2)C(Oc2ccccc2)c2cccc(OC(F)(F)F)c2)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "d323765b-0d3b-494b-94f8-3115e8a68ce6", + "task": "add", + "question": "Modify the molecule CC1CCC(CNC(=O)c2c(O)cccc2O)C[NH2+]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CCC(CNC(=O)c2c(O)cccc2O)C[NH2+]1", + "ref_smiles": "CC1CCC(CNC(=O)c2c(O)ccc(O)c2O)C[NH2+]1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "270c9978-ed82-4c56-a0f7-c4efb426c53e", + "task": "add", + "question": "Please add a aldehyde to the molecule CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCCS1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCCS1.", + "ref_smiles": "CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCC(CC=O)S1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "a6dc0358-c09d-4bc8-86b1-3505b7db5b72", + "task": "add", + "question": "Modify the molecule CC(C)C(CCNC(=O)C1CNC(=O)C[NH2+]1)CCC(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(CCNC(=O)C1CNC(=O)C[NH2+]1)CCC(=O)[O-]", + "ref_smiles": "CC(C)C(CCNC(=O)C1CNC(=O)C(O)[NH2+]1)CCC(=O)[O-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6fdeb9b9-5bda-4b3d-83ae-743f0e9f48de", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCOc1ccc2nc(SCCCCS)[nH]c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOc1ccc2nc(SCCCCS)[nH]c2c1.", + "ref_smiles": "CCOc1cc(O)c2nc(SCCCCS)[nH]c2c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f5bcd190-5335-47cf-800e-db694c39ce45", + "task": "add", + "question": "Modify the molecule CC(NC(=O)N1CCC[NH2+]CC1)C(C)(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(NC(=O)N1CCC[NH2+]CC1)C(C)(F)F", + "ref_smiles": "CC(NC(=O)N1CCC[NH2+]CC1)C(F)(F)CO", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "395d96d1-1269-4891-a5c1-1ebacd531149", + "task": "add", + "question": "Please add a amine to the molecule CCOC(=O)CCC(=O)CCCc1ccc2c(c1)CCO2.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCOC(=O)CCC(=O)CCCc1ccc2c(c1)CCO2.", + "ref_smiles": "CCOC(=O)CCC(=O)CCCc1ccc2c(c1)C(N)CO2", + "add_group": "amine", + "remove_group": null + }, + { + "id": "65e8337d-4e0c-402d-acd4-4cfdf98cb6b6", + "task": "add", + "question": "Modify the molecule CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)CC1)c1ccc(OC)c(OC)c1 by adding a thiol.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)CC1)c1ccc(OC)c(OC)c1", + "ref_smiles": "CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)C(S)C1)c1ccc(OC)c(OC)c1", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "01ec1ad1-e1f0-48d1-914e-a7f5aa60e57a", + "task": "add", + "question": "Modify the molecule CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2)cc1", + "ref_smiles": "CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "dad1107e-aa5d-4b7d-93c4-525a165707fe", + "task": "add", + "question": "Please add a carboxyl to the molecule C=C(CC(=O)OCC)C(=O)Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(CC(=O)OCC)C(=O)Cl.", + "ref_smiles": "C=C(C(=O)Cl)C(C(=O)O)C(=O)OCC", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "b80b4bac-2a8a-4cce-a3b2-fdc8d7347ffb", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(=O)NCCc1ccc(C(=O)COc2ccc(C)cc2[N+](=O)[O-])cc1F.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(=O)NCCc1ccc(C(=O)COc2ccc(C)cc2[N+](=O)[O-])cc1F.", + "ref_smiles": "CC(=O)NCCc1ccc(C(=O)COc2ccc(Cc3ccccc3)cc2[N+](=O)[O-])cc1F", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "791b04d8-dc01-47ce-b01b-04e349124883", + "task": "add", + "question": "Please add a benzene ring to the molecule CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)CC1.", + "ref_smiles": "CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)C(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "aef7a5c1-fc02-4b74-bffe-4a607e08da55", + "task": "add", + "question": "Modify the molecule COCC1CCCC[NH+]1C1CC([NH3+])C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCC1CCCC[NH+]1C1CC([NH3+])C1", + "ref_smiles": "COCC1CC(c2ccccc2)CC[NH+]1C1CC([NH3+])C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "76b51ec8-72ff-49ef-bf40-d9770cb9952a", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCN(Cc1ccccc1)C(=NCCOC)N[NH3+].\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(Cc1ccccc1)C(=NCCOC)N[NH3+].", + "ref_smiles": "CCN(C(=NCCOC)N[NH3+])C(O)c1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "43c5ffe8-80a9-4f6b-9130-b7475e19903f", + "task": "add", + "question": "Please add a hydroxyl to the molecule CC(C)(C)[NH+]1CC(C(=O)N2CCCC(C3=CCC(Cl)CC3)N(C(=O)N3CCOCC3)CC2)C(C2=C(F)CC(F)C=C2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)(C)[NH+]1CC(C(=O)N2CCCC(C3=CCC(Cl)CC3)N(C(=O)N3CCOCC3)CC2)C(C2=C(F)CC(F)C=C2)C1.", + "ref_smiles": "CC(C)(C)[NH+]1CC(C(=O)N2CCN(C(=O)N3CCOCC3)C(C3=CCC(Cl)CC3)CCC2O)C(C2=C(F)CC(F)C=C2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "be7ed402-e805-4d39-ba4d-056433675bea", + "task": "add", + "question": "Modify the molecule CC([NH3+])CCC(=O)Nc1cccc(OCCF)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC([NH3+])CCC(=O)Nc1cccc(OCCF)c1", + "ref_smiles": "CC([NH3+])CC(CC=O)C(=O)Nc1cccc(OCCF)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "d2f15a62-956b-42d3-bc4b-29d7a67528c0", + "task": "add", + "question": "Modify the molecule NC(=O)C1CC[NH+](Cc2cccc(C[NH3+])c2F)CC1 by adding a nitrile.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)C1CC[NH+](Cc2cccc(C[NH3+])c2F)CC1", + "ref_smiles": "N#CC1CC(C(N)=O)CC[NH+]1Cc1cccc(C[NH3+])c1F", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "53bd17d1-80a8-4538-b1c3-dfbee50b2aa3", + "task": "add", + "question": "Modify the molecule CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])cc1", + "ref_smiles": "CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])c(C(=O)O)c1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "df118696-2639-4ae3-a7b6-4e60221e7d20", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(CC)C1C[NH+]=C(NCc2ccc(C)cc2)S1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)C1C[NH+]=C(NCc2ccc(C)cc2)S1.", + "ref_smiles": "CCC(C(C)O)C1C[NH+]=C(NCc2ccc(C)cc2)S1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e233596e-2991-4395-b70f-7673417a0aa9", + "task": "add", + "question": "Modify the molecule CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1", + "ref_smiles": "CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7239348c-83b3-4ca9-923f-c26b6d2fb8d4", + "task": "add", + "question": "Please add a aldehyde to the molecule C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2CC2)C1Cl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2CC2)C1Cl.", + "ref_smiles": "C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2(CC=O)CC2)C1Cl", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "9fcbe497-51b7-4eef-87b6-3b3c6aad1058", + "task": "add", + "question": "Modify the molecule COc1ccc(OC)c(C(O)CNC(=O)C2CC2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(OC)c(C(O)CNC(=O)C2CC2)c1", + "ref_smiles": "COc1cc(O)c(OC)c(C(O)CNC(=O)C2CC2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fdcac435-65b6-4c27-bbe5-6d682679757c", + "task": "add", + "question": "Please add a amine to the molecule N#CC(C(=O)c1ccccc1)c1nc(-c2ccccc2Cl)cs1.\nPlease wrap the final SMILES in ....", + "src_smiles": "N#CC(C(=O)c1ccccc1)c1nc(-c2ccccc2Cl)cs1.", + "ref_smiles": "N#CC(C(=O)c1ccccc1N)c1nc(-c2ccccc2Cl)cs1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "6e44514c-6bca-4a08-80fc-66aed27e1d18", + "task": "add", + "question": "Modify the molecule COC(=O)CCN1C(=O)C(C(C)C)Oc2cc([N+](=O)[O-])ccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)CCN1C(=O)C(C(C)C)Oc2cc([N+](=O)[O-])ccc21", + "ref_smiles": "COC(=O)CCN1C(=O)C(C(C)(C)c2ccccc2)Oc2cc([N+](=O)[O-])ccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "51157782-a733-4a14-a41a-c592501892f4", + "task": "add", + "question": "Modify the molecule CCC(C)(CC(C)CO)C[NH+](C)C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)(CC(C)CO)C[NH+](C)C", + "ref_smiles": "CCC(C)(C[NH+](C)C)CC(C)(N)CO", + "add_group": "amine", + "remove_group": null + }, + { + "id": "14e7488e-8fb2-449d-9a19-df129d182167", + "task": "add", + "question": "Modify the molecule CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OC)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OC)cc1", + "ref_smiles": "CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OCO)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "4b2fad6f-9aa8-4ce7-ae10-835392ffbe86", + "task": "add", + "question": "Modify the molecule C=C(C)C(=O)OCCCCCCC(CCC)[NH+](CC)CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=C(C)C(=O)OCCCCCCC(CCC)[NH+](CC)CC", + "ref_smiles": "C=C(C)C(=O)OC(O)CCCCCC(CCC)[NH+](CC)CC", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c37162f0-8f5d-40df-aea5-1c89f2dadf1a", + "task": "add", + "question": "Modify the molecule CCC(CC)C(C[NH2+]Cc1cncn1C(C)C)N(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(CC)C(C[NH2+]Cc1cncn1C(C)C)N(C)C", + "ref_smiles": "CCC(CC)C(C[NH2+]Cc1cncn1C(C)(C)c1ccccc1)N(C)C", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "b0746f78-b745-49a4-8375-1101b455f9b3", + "task": "add", + "question": "Please add a hydroxyl to the molecule COC(=O)c1ccc(COC(C[NH3+])c2ccccc2I)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)c1ccc(COC(C[NH3+])c2ccccc2I)cc1.", + "ref_smiles": "COC(=O)c1ccc(COC(C[NH3+])c2cccc(O)c2I)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "7abfe9d0-40ce-430d-b0d4-b2b7e853d51c", + "task": "add", + "question": "Modify the molecule Cc1ccc(C(=O)NN2C(=O)C(=Cc3cn(Cc4ccc(F)cc4Cl)c4ccccc34)SC2=S)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc(C(=O)NN2C(=O)C(=Cc3cn(Cc4ccc(F)cc4Cl)c4ccccc34)SC2=S)c(Cl)c1", + "ref_smiles": "Cc1ccc(C(=O)NN2C(=O)C(=Cc3cn(Cc4ccc(F)c(-c5ccccc5)c4Cl)c4ccccc34)SC2=S)c(Cl)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "e75daa22-ec83-4d17-9f47-0b7950c0c2b4", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12.", + "ref_smiles": "CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "6e850f83-4251-473e-9375-ee8ee2417bf1", + "task": "add", + "question": "Please add a amine to the molecule C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(COCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(COCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C.", + "ref_smiles": "C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(C(N)OCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C", + "add_group": "amine", + "remove_group": null + }, + { + "id": "eb0c5e7c-3e9b-4feb-8588-46fbf11f6729", + "task": "add", + "question": "Modify the molecule CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1", + "ref_smiles": "CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "897af4ed-8e3b-44d5-991e-0af86879a52e", + "task": "add", + "question": "Modify the molecule C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3)CC21 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3)CC21", + "ref_smiles": "C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3C(=O)O)CC21", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "23505240-25dc-47e1-93bc-970bb02b2592", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C1N(c2ccc(CO)cc2)CCN1c1ccc(-c2ccccc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C1N(c2ccc(CO)cc2)CCN1c1ccc(-c2ccccc2)cc1.", + "ref_smiles": "O=C1N(c2ccc(-c3ccccc3)cc2)CCN1c1ccc(CO)c(-c2ccccc2)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "051da98b-ff2c-4901-8bb8-9378ab9921ce", + "task": "add", + "question": "Please add a amine to the molecule CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]CCC2C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]CCC2C1.", + "ref_smiles": "CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]C(N)CC2C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "b1d5a76d-ea82-4a36-8126-81d85134136b", + "task": "add", + "question": "Modify the molecule O=C(CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1)NC1CC1 by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1)NC1CC1", + "ref_smiles": "NC1CC1NC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1", + "add_group": "amine", + "remove_group": null + }, + { + "id": "07de09a2-b9ea-4715-bb5a-3b7d7c78eff6", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C([O-])n1nc(Br)c2ncccc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])n1nc(Br)c2ncccc21.", + "ref_smiles": "O=C([O-])n1nc(Br)c2nc(-c3ccccc3)ccc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ce398d98-0c42-449a-8731-754a802eb166", + "task": "add", + "question": "Modify the molecule Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2", + "ref_smiles": "Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "5a6968b2-dce3-44bc-a06a-ed3b5729b451", + "task": "add", + "question": "Please add a hydroxyl to the molecule CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2ccccc2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2ccccc2)c1.", + "ref_smiles": "CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2cccc(O)c2)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "03cab0ec-67da-43a5-bc75-0075c6ae5405", + "task": "add", + "question": "Please add a hydroxyl to the molecule Cc1cc(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c(C)s1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Cc1cc(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c(C)s1.", + "ref_smiles": "Cc1cc(C(=O)OCC(=O)NC(O)CN2C(=O)CSC2=S)c(C)s1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "fdf003f0-9cd8-4ac4-803c-a2cfcff1a1b6", + "task": "add", + "question": "Please add a benzene ring to the molecule CCN(CC(C)C)S(=O)(=O)c1c(Cl)nc2sccn12.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCN(CC(C)C)S(=O)(=O)c1c(Cl)nc2sccn12.", + "ref_smiles": "CCN(CC(C)C)S(=O)(=O)c1c(Cl)nc2sc(-c3ccccc3)cn12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "534bf69e-7f7d-49f7-8bcd-fd8c3b98ba58", + "task": "add", + "question": "Modify the molecule CCC(C)(C)C1CCc2c(sc(NC(=O)c3ccncc3)c2C#N)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(C)(C)C1CCc2c(sc(NC(=O)c3ccncc3)c2C#N)C1", + "ref_smiles": "CCC(C)(C)C1CCc2c(sc(NC(=O)c3ccnc(O)c3)c2C#N)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "c3448c65-e189-408c-a7d3-8f7467ee4fc8", + "task": "add", + "question": "Modify the molecule O=C([O-])c1ccccc1N(Br)c1ccc(-c2ccccc2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C([O-])c1ccccc1N(Br)c1ccc(-c2ccccc2)c(Cl)c1", + "ref_smiles": "O=C([O-])c1ccccc1N(Br)c1cc(O)c(-c2ccccc2)c(Cl)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "6ae21ccc-afca-4157-a6d4-f4509b644dd0", + "task": "add", + "question": "Please add a hydroxyl to the molecule [S-]c1ccccc1OB(Oc1ccccc1[S-])Oc1ccccc1[S-].\nPlease wrap the final SMILES in ....", + "src_smiles": "[S-]c1ccccc1OB(Oc1ccccc1[S-])Oc1ccccc1[S-].", + "ref_smiles": "Oc1cccc(OB(Oc2ccccc2[S-])Oc2ccccc2[S-])c1[S-]", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "a9d9f1e7-7e39-4a74-9380-dd7aa8f97325", + "task": "add", + "question": "Please add a thiol to the molecule C[NH2+]CC(=O)c1nnoc1C.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH2+]CC(=O)c1nnoc1C.", + "ref_smiles": "Cc1onnc1C(=O)C[NH2+]CS", + "add_group": "thiol", + "remove_group": null + }, + { + "id": "fb961e42-5811-4690-b8bb-b890120310ad", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCc1nnc(OC2CC[NH+](C)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCc1nnc(OC2CC[NH+](C)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1.", + "ref_smiles": "CCCCc1nnc(OC2CC[NH+](CO)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "e92f7750-2067-4a42-a50f-98c4c2716407", + "task": "add", + "question": "Please add a nitrile to the molecule C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1C#Cc1cccc(Cl)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1C#Cc1cccc(Cl)c1.", + "ref_smiles": "C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1(C#N)C#Cc1cccc(Cl)c1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "edc0f2e5-1336-48b7-996e-f6975ef72331", + "task": "add", + "question": "Please add a aldehyde to the molecule CS(=O)(=O)CCOc1cncc([B-](F)(F)F)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)CCOc1cncc([B-](F)(F)F)c1.", + "ref_smiles": "CS(=O)(=O)CCOc1cnc(CC=O)c([B-](F)(F)F)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "22c65b24-23b0-4311-b773-e47ae250568f", + "task": "add", + "question": "Modify the molecule NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-] by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-]", + "ref_smiles": "NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(C(=O)[O-])C(C(=O)O)c1cnc[nH]1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "a5538f96-c628-48ec-828c-4416d4b2f145", + "task": "add", + "question": "Please add a hydroxyl to the molecule C[Si](C)(C)CCOCn1cc(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[Si](C)(C)CCOCn1cc(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O.", + "ref_smiles": "C[Si](C)(C)CCOCn1c(O)c(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3c55176d-6d1b-45ea-b38d-2d7dfc8cd501", + "task": "add", + "question": "Modify the molecule C[SiH](C)c1cc(C(C)(C)C)ccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "C[SiH](C)c1cc(C(C)(C)C)ccn1", + "ref_smiles": "C[Si](O)(C)c1cc(C(C)(C)C)ccn1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "cdd25e45-c2dd-4a23-8be5-b8e866b4bdfb", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2)c1.", + "ref_smiles": "CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2O)c1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "f135c071-003e-4b38-8659-b2400557f5ed", + "task": "add", + "question": "Modify the molecule CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccccc1", + "ref_smiles": "CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccc(O)cc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "0620f976-3f2a-45c3-a669-fdcc938a848b", + "task": "add", + "question": "Please add a carboxyl to the molecule CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)CC1.", + "ref_smiles": "CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)C(C(=O)O)C1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "48bddc96-cdec-44fc-b115-36d813290753", + "task": "add", + "question": "Modify the molecule COc1ccc(OC)c(NC(=O)CSc2cn(Cc3ccc(F)cc3)c3ccccc23)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(OC)c(NC(=O)CSc2cn(Cc3ccc(F)cc3)c3ccccc23)c1", + "ref_smiles": "COc1ccc(OC)c(NC(=O)C(CC=O)Sc2cn(Cc3ccc(F)cc3)c3ccccc23)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "ea792c27-db1b-49b2-9e83-94f8c9bc092d", + "task": "add", + "question": "Please add a nitrile to the molecule CCc1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCc1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1.", + "ref_smiles": "CC(C#N)c1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1", + "add_group": "nitrile", + "remove_group": null + }, + { + "id": "e12d1fea-cb20-4733-986e-48e43e869ca5", + "task": "add", + "question": "Modify the molecule CCC(O)(OC)C(O)CCO by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCC(O)(OC)C(O)CCO", + "ref_smiles": "CCC(O)(OC)C(O)(CCO)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "1ecc9fe9-6fd3-4a83-a7e3-6684164cc614", + "task": "add", + "question": "Please add a benzene ring to the molecule CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4ccccc34)cc21.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4ccccc34)cc21.", + "ref_smiles": "CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4c(-c5ccccc5)cccc34)cc21", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "53df699b-6365-484b-873d-63b6c3aac604", + "task": "add", + "question": "Modify the molecule O=C(Cc1cccc(Br)c1)NCC1(CCCl)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1cccc(Br)c1)NCC1(CCCl)CC1", + "ref_smiles": "O=C(Cc1cc(Br)ccc1C(=O)O)NCC1(CCCl)CC1", + "add_group": "carboxyl", + "remove_group": null + }, + { + "id": "600e09e6-ca83-4f9b-85cd-2282368d1b1b", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)cc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)cc1.", + "ref_smiles": "COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)c(-c5ccccc5)c4)cc3)cc2)cc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ce6e8699-dabf-401d-8382-4159beaec395", + "task": "add", + "question": "Modify the molecule COC(=O)CCSc1nnc(-c2cc(C)nn2C)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "COC(=O)CCSc1nnc(-c2cc(C)nn2C)s1", + "ref_smiles": "COC(=O)CCSc1nnc(-c2cc(Cc3ccccc3)nn2C)s1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "518c1e96-3ceb-433e-90c0-2df5a1ecbde9", + "task": "add", + "question": "Please add a aldehyde to the molecule O=C(Nc1ccccc1C(=O)N1CCOCC1)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Nc1ccccc1C(=O)N1CCOCC1)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1.", + "ref_smiles": "O=CCc1ccc(C(=O)N2CCOCC2)c(NC(=O)c2cc(-c3ccco3)n(-c3cccc(Cl)c3)n2)c1", + "add_group": "aldehyde", + "remove_group": null + }, + { + "id": "9da857f4-467c-4f06-aab1-da31e34dfd1d", + "task": "add", + "question": "Please add a amine to the molecule Fc1ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c2c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "Fc1ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c2c1.", + "ref_smiles": "Nc1c(F)ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c12", + "add_group": "amine", + "remove_group": null + }, + { + "id": "8caa4e4d-6675-4492-93c5-94277cef988d", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3)NC2=O)c1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3)NC2=O)c1.", + "ref_smiles": "COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3-c3ccccc3)NC2=O)c1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "ba1e08e3-e913-476c-b501-20ae36037bf9", + "task": "add", + "question": "Please add a hydroxyl to the molecule CCCCCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1.\nPlease wrap the final SMILES in ....", + "src_smiles": "CCCCCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1.", + "ref_smiles": "CCC(O)CCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "3bdef453-9138-4dd7-b603-16e1f830e0a5", + "task": "add", + "question": "Please add a benzene ring to the molecule COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)CC1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)CC1.", + "ref_smiles": "COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)C(c2ccccc2)C1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0bb2df66-4ef3-468b-9a10-d31706d3445a", + "task": "add", + "question": "Modify the molecule CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)C by adding a amine.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)C", + "ref_smiles": "CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)CN", + "add_group": "amine", + "remove_group": null + }, + { + "id": "ddaa5668-9d10-493e-b65a-b1f04a149dfa", + "task": "add", + "question": "Please add a benzene ring to the molecule O=c1c2c(nc3c(Cl)cc(Cl)cn13)C(=Cc1ccc(Cl)cc1)CC2.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=c1c2c(nc3c(Cl)cc(Cl)cn13)C(=Cc1ccc(Cl)cc1)CC2.", + "ref_smiles": "O=c1c2c(nc3c(Cl)cc(Cl)c(-c4ccccc4)n13)C(=Cc1ccc(Cl)cc1)CC2", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "cc0f1532-bb9a-4f09-b480-1d44593b1cc0", + "task": "add", + "question": "Please add a hydroxyl to the molecule COCCN(CCOC)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1.\nPlease wrap the final SMILES in ....", + "src_smiles": "COCCN(CCOC)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1.", + "ref_smiles": "COCCN(CCOCO)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1", + "add_group": "hydroxyl", + "remove_group": null + }, + { + "id": "75da67d9-7eac-419b-a2a2-971317de021b", + "task": "add", + "question": "Modify the molecule O=C(Cc1nc2ccccc2oc1=O)c1ccc(Cl)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(Cc1nc2ccccc2oc1=O)c1ccc(Cl)cc1", + "ref_smiles": "O=C(c1ccc(Cl)cc1)C(c1ccccc1)c1nc2ccccc2oc1=O", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "0a7327dc-2799-4250-b8ee-7f1399081b5a", + "task": "add", + "question": "Modify the molecule CC(C)C=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(C)C=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-]", + "ref_smiles": "CC(C)C(=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-])c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "346e34e1-1caa-46c4-b027-f8ae51d1c502", + "task": "add", + "question": "Modify the molecule CS(=O)(=O)CCNC(c1ccccc1)c1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "CS(=O)(=O)CCNC(c1ccccc1)c1ccc(F)cc1", + "ref_smiles": "CS(=O)(=O)C(CNC(c1ccccc1)c1ccc(F)cc1)c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "bcc33bf0-756e-463b-b22f-cfa30578d935", + "task": "add", + "question": "Please add a benzene ring to the molecule O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12.", + "ref_smiles": "O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1c1ccccc1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "3f2ff26e-412a-4be5-b9cb-98bd7d40652f", + "task": "add", + "question": "Modify the molecule O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....", + "src_smiles": "O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1", + "ref_smiles": "O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1-c1ccccc1", + "add_group": "benzene", + "remove_group": null + }, + { + "id": "30493cd5-f3f5-41b9-bb30-92a55f9674a8", + "task": "add", + "question": "Modify the molecule CC(Br)Cc1ncncc1I by adding a aldehyde.\nPlease wrap the final SMILES in ....", + "src_smiles": "CC(Br)Cc1ncncc1I", + "ref_smiles": "CC(Br)C(CC=O)c1ncncc1I", + "add_group": "aldehyde", + "remove_group": null + } +] \ No newline at end of file