diff --git "a/train_mol_edit_train.json" "b/train_mol_edit_train.json"
new file mode 100644--- /dev/null
+++ "b/train_mol_edit_train.json"
@@ -0,0 +1,36173 @@
+[
+ {
+ "id": "ba33e0f1-0261-4237-b603-9667a436379c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2cc(Br)c(O)c(OC)c2)c2ccc(F)cc2)cc1OC with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2cc(Br)c(O)c(OC)c2)c2ccc(F)cc2)cc1OC",
+ "ref_smiles": "CC(=O)c1c(Br)cc(C=NNC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1OC",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0113ab93-9d33-417b-b3c8-5a380c410002",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C(C)Nc2c(F)cc(F)cc2Cl)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(C)Nc2c(F)cc(F)cc2Cl)cc1",
+ "ref_smiles": "COc1ccc(C(C)Nc2c(O)cc(F)cc2Cl)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e2a398bc-4eee-4f72-a6b2-778d2a2acfc7",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=S(Oc1ccccc1)SCCC(Br)(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(Oc1ccccc1)SCCC(Br)(c1ccccc1)c1ccccc1.",
+ "ref_smiles": "O=S(Oc1ccccc1)SCCC(Br)c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4e5001b7-a2fd-4cae-98ea-cf5ffac79d38",
+ "task": "add",
+ "question": "Please add a amine to the molecule CNc1cc(N2CCCC2CBr)nc(N)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc(N2CCCC2CBr)nc(N)n1.",
+ "ref_smiles": "CNc1cc(N2CCC(N)C2CBr)nc(N)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0724a51e-baf8-4a62-a2c5-1e8852fad84c",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)Cc1ccc(-c2ccc(-c3csc(C(=O)NCc4ccc(CC(=O)[O-])cc4)c3)cc2)cc1O by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Cc1ccc(-c2ccc(-c3csc(C(=O)NCc4ccc(CC(=O)[O-])cc4)c3)cc2)cc1O",
+ "ref_smiles": "CC(=O)Cc1ccc(-c2ccc(-c3csc(C(=O)NCc4ccc(CC(=O)[O-])cc4)c3)cc2)cc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5afbfa20-be6b-4c0c-a61f-12d5fbeb55ae",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(C=NNC(=O)c2ccccc2F)c1OC(F)F by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C=NNC(=O)c2ccccc2F)c1OC(F)F",
+ "ref_smiles": "COc1cccc(C=Nc2(F)cccc-2)c1OC(F)F",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5785f7ad-b298-4f6f-84dc-db175da94552",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc2nc(OCC(C)C)c(C=C(C#N)C(=O)[O-])n2c1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2nc(OCC(C)C)c(C=C(C#N)C(=O)[O-])n2c1",
+ "ref_smiles": "Cc1ccc2nc(OCC(C)C)c(C=CC(=O)[O-])n2c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "335acde3-d36d-45e4-a93d-7f3c8aae5a72",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N1CCC2(CC1)CC[NH+](Cc1ccoc1)C2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCC2(CC1)CC[NH+](Cc1ccoc1)C2",
+ "ref_smiles": "c1cc(C[NH+]2CCC3(CCCC3)C2)co1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e103aa02-56c9-4a62-9dc9-7c4832f4bb15",
+ "task": "sub",
+ "question": "Modify the molecule CC(NC(=O)Cn1nc2ccccn2c1=O)c1ccc(Br)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)Cn1nc2ccccn2c1=O)c1ccc(Br)cc1",
+ "ref_smiles": "CC(NC(=O)Cn1nc2ccccn2c1=O)c1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "59e586b2-e95c-4fcb-ab74-cdd639e9dfc0",
+ "task": "delete",
+ "question": "Modify the molecule CCC1(OC(C)=O)C(O)CC(F)C2(C)C(=O)C(OC(C)=O)C3=C(C)C(O)CC(O)(C(OC(=O)c4ccccc4)C12)C3(C)C by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(OC(C)=O)C(O)CC(F)C2(C)C(=O)C(OC(C)=O)C3=C(C)C(O)CC(O)(C(OC(=O)c4ccccc4)C12)C3(C)C",
+ "ref_smiles": "CCC1(OC(C)=O)C(O)CC(F)C2(C)C(=O)C(OC(C)=O)C3=C(C)CCC(O)(C(OC(=O)c4ccccc4)C12)C3(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "70b77689-8ceb-49b8-a266-e45539e15b7b",
+ "task": "sub",
+ "question": "Modify the molecule CC1C=C2CC3CC(C(=O)N4CCc5cc(F)ccc54)(C1)CC23 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C=C2CC3CC(C(=O)N4CCc5cc(F)ccc54)(C1)CC23",
+ "ref_smiles": "CC1C=C2CC3CC(C(=O)N4CCc5cc(S)ccc54)(C1)CC23",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "696b14aa-c872-4ca4-91dc-62ce2d70f3eb",
+ "task": "delete",
+ "question": "Modify the molecule COCCn1cc(NC(=O)c2cnn3ccc(N)nc23)c(-c2cc(Cl)ccc2C)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1cc(NC(=O)c2cnn3ccc(N)nc23)c(-c2cc(Cl)ccc2C)n1",
+ "ref_smiles": "COCCn1cc(NC(=O)c2cnn3ccc(N)nc23)c(-c2ccccc2C)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "96259848-3b41-4620-b7cb-e8cc9c5315f3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCC(C)O[P+]([O-])(Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1)OC(C)CCC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)O[P+]([O-])(Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1)OC(C)CCC",
+ "ref_smiles": "CCCC(C)O[P+]([O-])(Oc1ccc2c(=O)c(-c3ccc(C#N)cc3)coc2c1)OC(C)CCC",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "73f989d4-1f0b-4edd-91d7-70c429bfbdad",
+ "task": "add",
+ "question": "Modify the molecule CC[NH+](CC(N)=S)Cc1cncc(Br)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC(N)=S)Cc1cncc(Br)c1",
+ "ref_smiles": "CC[NH+](CC(N)=S)Cc1cncc(Br)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e41de51f-1ba0-4864-8ba0-216fa41b620d",
+ "task": "add",
+ "question": "Modify the molecule CCCNc1ccc(OC)cc1[N+](=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1ccc(OC)cc1[N+](=O)[O-]",
+ "ref_smiles": "CCCNc1ccc(OCO)cc1[N+](=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bf1151e0-2911-46b8-a5cc-898c5693ca1f",
+ "task": "delete",
+ "question": "Modify the molecule CCSc1nnc(NC(=O)CSC(c2ccccc2)c2ccccc2)s1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCSc1nnc(NC(=O)CSC(c2ccccc2)c2ccccc2)s1",
+ "ref_smiles": "CCSc1nnc(NC(=O)CSCc2ccccc2)s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d495f16c-a05e-480e-9d6f-20d4c42890be",
+ "task": "add",
+ "question": "Modify the molecule N#CC1(NC(=O)Cc2ccccc2)CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1(NC(=O)Cc2ccccc2)CCCC1",
+ "ref_smiles": "N#CC1(NC(=O)Cc2cccc(O)c2)CCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "af0cb409-916b-4de7-bba5-10cfa45ee975",
+ "task": "add",
+ "question": "Modify the molecule COc1nc(C[NH2+]C(C)C)cc2ccccc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1nc(C[NH2+]C(C)C)cc2ccccc12",
+ "ref_smiles": "COc1nc(C[NH2+]C(C)C)c(-c2ccccc2)c2ccccc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a221ec69-71dd-4d67-8b43-c59996a30999",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCONC(=O)c1cnc2c(-c3ccccc3)c(C)nn2c1CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCONC(=O)c1cnc2c(-c3ccccc3)c(C)nn2c1CC.",
+ "ref_smiles": "CCONC(=O)c1c(C(=O)O)nc2c(-c3ccccc3)c(C)nn2c1CC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "51d9e762-0cd3-4761-98f2-7f8af6c1eb88",
+ "task": "sub",
+ "question": "Modify the molecule O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1cccc(F)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COC(=O)c1cc(-c2ccco2)nc2ccccc12)Nc1cccc(F)c1",
+ "ref_smiles": "N#Cc1cccc(NC(=O)COC(=O)c2cc(-c3ccco3)nc3ccccc23)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "30493cd5-f3f5-41b9-bb30-92a55f9674a8",
+ "task": "add",
+ "question": "Modify the molecule CC(Br)Cc1ncncc1I by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Br)Cc1ncncc1I",
+ "ref_smiles": "CC(Br)C(CC=O)c1ncncc1I",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "26518ddf-fce0-4be3-9d86-f6c6061a5a1f",
+ "task": "add",
+ "question": "Modify the molecule O=C1[NH+]=C(CCc2cccc(F)c2)NC1=Cc1ccc(Br)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1[NH+]=C(CCc2cccc(F)c2)NC1=Cc1ccc(Br)cc1",
+ "ref_smiles": "O=CCc1cc(Br)ccc1C=C1NC(CCc2cccc(F)c2)=[NH+]C1=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "eeb840ff-f60f-45b8-9c50-9a81186e9fee",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc2oc(-c3ccncc3Br)nc2c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2oc(-c3ccncc3Br)nc2c1",
+ "ref_smiles": "Cc1ccc2oc(-c3ccncc3C#N)nc2c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "53617576-2f0c-47b4-ae58-0e56120ee7ff",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1cccc(N2C(=O)C(=O)C(=C([O-])c3ccc(Br)cc3)C2c2ccc(O)c(Cl)c2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(N2C(=O)C(=O)C(=C([O-])c3ccc(Br)cc3)C2c2ccc(O)c(Cl)c2)c1",
+ "ref_smiles": "COc1cccc(N2C(=O)C(=O)C(=C([O-])c3ccc(Br)cc3)C2c2ccc(NO)c(Cl)c2)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "38bad98b-44dd-4f55-b657-3e1ae79be0fb",
+ "task": "add",
+ "question": "Modify the molecule CC1CCN(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1",
+ "ref_smiles": "CC1CC(CC=O)N(C(=O)NC2CCCN(C3CCCCC3)C2=O)CCS1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "e431a7d7-af73-47c6-9e68-cc871233e037",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOCCN(C)c1ccc(N)c(C#N)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCN(C)c1ccc(N)c(C#N)c1.",
+ "ref_smiles": "CCOCCN(C)c1cccc(C#N)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7aad1edd-d11e-4ba9-a3d9-89ec9f40580f",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])CCCCNC(=O)CN1CCCCCCC1=O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCCCNC(=O)CN1CCCCCCC1=O",
+ "ref_smiles": "O=C([O-])CCCCNC(=O)C1CCCCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8fb34561-ea8e-4f55-8086-3a1901a55a45",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCOc1ccc(-c2ccc(C3CCC(CC)CC3)cc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCOc1ccc(-c2ccc(C3CCC(CC)CC3)cc2)cc1",
+ "ref_smiles": "CCCCCCCOc1ccc(C2CCC(CC)CC2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f5eb4026-a077-40ae-9b5c-d237cea96f93",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCc1nnc(NCCS(=O)(=O)c2ccc(Cl)cc2)nc1CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nnc(NCCS(=O)(=O)c2ccc(Cl)cc2)nc1CC.",
+ "ref_smiles": "CCc1nnc(NCCS(=O)(=O)Cl)nc1CC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "87853ff5-28eb-4e3c-914c-2e8d4c7967d3",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC([NH2+]CCCCCCO)c1cccc(C#N)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]CCCCCCO)c1cccc(C#N)c1",
+ "ref_smiles": "CC([NH2+]CCCCCCO)c1cccc(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "aa2933c9-bdc7-42ea-9d08-2757a1af0ec6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCCC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCCC(C)C.",
+ "ref_smiles": "COc1cc(C(=O)N2CCN(S(=O)(=O)C3CCS(=O)(=O)C3)CC2)ccc1OCC(O)C(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3f2ff26e-412a-4be5-b9cb-98bd7d40652f",
+ "task": "add",
+ "question": "Modify the molecule O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1",
+ "ref_smiles": "O=C(NN=Cc1cccc([N+](=O)[O-])c1)c1ccc(-c2csc(Nc3ccc(Cl)cc3)n2)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e388830e-6b13-4f99-8647-78b4b758e48c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1c(SCC(=O)[O-])nnc1-c1ccccc1C(F)(F)F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(SCC(=O)[O-])nnc1-c1ccccc1C(F)(F)F",
+ "ref_smiles": "Cn1c(SCC(=O)[O-])nnc1-c1ccccc1C(O)(F)F",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e00dd4bd-658e-4457-9632-0b2c1eb08fa1",
+ "task": "delete",
+ "question": "Modify the molecule NNC(=O)C1CCCN(C(=O)C2CC2)C1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NNC(=O)C1CCCN(C(=O)C2CC2)C1",
+ "ref_smiles": "NC(=O)C1CCCN(C(=O)C2CC2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a6d54606-fc0c-434e-97fb-c04d3e3a0f89",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCCCC(O)Cn1cc2c(n1)CCc1c-2sc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(O)Cn1cc2c(n1)CCc1c-2sc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12.",
+ "ref_smiles": "CCCCC(O)Cn1nc2c(c1CC=O)-c1sc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c1CC2",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "7c551c32-ac9a-42e1-9dce-606edebbd114",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(Br)c1ccc2ccc(C(Cl)(Cl)Br)cc2c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(Br)c1ccc2ccc(C(Cl)(Cl)Br)cc2c1",
+ "ref_smiles": "OC(F)(Br)c1ccc2ccc(C(Cl)(Cl)Br)cc2c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d29cea5a-fd26-49fa-8471-044d37095540",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule FC(I)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(I)P(I)(c1ccccc1)(c1ccccc1)c1ccccc1.",
+ "ref_smiles": "FC(I)P(I)(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cbe8e639-124f-49d0-9a9d-ef362dbf79cb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccccc1CNC(=O)c1ccc2c(c1)CC(=O)N2Cc1ccc(F)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1CNC(=O)c1ccc2c(c1)CC(=O)N2Cc1ccc(F)cc1",
+ "ref_smiles": "Cc1ccccc1CNC(=O)c1ccc2c(c1)CC(=O)N2Cc1ccc(C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ffe3c399-64dd-4749-9d0f-ee0d652769c1",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc2c(c1)C(Nc1ccccc1C#N)C(=O)N2 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)C(Nc1ccccc1C#N)C(=O)N2",
+ "ref_smiles": "Cc1ccc2c(c1)C(Nc1ccccc1C(=O)[OH])C(=O)N2",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "b13870e7-ab7e-43c4-b9d5-f7236f77467e",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(CN2CCOc3nc(-c4cc5ccccc5o4)ncc3C2=O)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CN2CCOc3nc(-c4cc5ccccc5o4)ncc3C2=O)cc1",
+ "ref_smiles": "COCN1CCOc2nc(-c3cc4ccccc4o3)ncc2C1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a09b53b0-ffac-4cf6-934f-41f69b028092",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(OCC(=O)Nc2cnn(CC3CCCCO3)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OCC(=O)Nc2cnn(CC3CCCCO3)c2)cc1.",
+ "ref_smiles": "COCC(=O)Nc1cnn(CC2CCCCO2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "48c1c708-74bc-4a48-bebd-15fdf6dfbe75",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)cc1.",
+ "ref_smiles": "CC(C)(C)c1ccc(OCC(=O)N2CCC3(CC2)OCCS3)c(N)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e83b1658-852b-4448-9100-2ea34480ac79",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCN(c4ccccc4F)CC3)CC2)cc1OC by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCN(c4ccccc4F)CC3)CC2)cc1OC",
+ "ref_smiles": "COc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCN(c4ccccc4)CC3)CC2)cc1OC",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0aa397a1-40f5-49dc-b38d-8b5746ba7b35",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2ccnc(N)c2)c(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccnc(N)c2)c(Cl)c1",
+ "ref_smiles": "Cc1ccc(NC(=O)c2ccnc(N)c2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "eefc4211-8c05-47d8-a2d6-13efea944fcb",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(-c2cc(-c3ccccc3)[te][o+]2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2cc(-c3ccccc3)[te][o+]2)cc1.",
+ "ref_smiles": "COc1ccc(-c2cc[te][o+]2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0420dae2-c1a5-44fb-bf02-4834a4296cd2",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CC(NC(=O)CCC1CCCCN1C(=O)[O-])C(=O)NCCCCNS(=O)(=O)c1ccc(F)cc1Cl by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)CCC1CCCCN1C(=O)[O-])C(=O)NCCCCNS(=O)(=O)c1ccc(F)cc1Cl",
+ "ref_smiles": "CC(C)CC(CC1CCCCN1C(=O)[O-])C(=O)NCCCCNS(=O)(=O)c1ccc(F)cc1Cl",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ee859e30-0c1a-44d7-accb-fb8bc35362a8",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1cc(S(=O)(=O)NCCC[NH+](C)Cc2ccccc2)cn1C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cc(S(=O)(=O)NCCC[NH+](C)Cc2ccccc2)cn1C",
+ "ref_smiles": "CCOC(=O)c1cc(S(=O)(=O)CCC[NH+](C)Cc2ccccc2)cn1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5fc1da76-13b9-41c9-b464-62862bafac58",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C=CCC1CCCC(CC(CCC)OCc2ccccc2)N1C(=O)OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCC1CCCC(CC(CCC)OCc2ccccc2)N1C(=O)OC.",
+ "ref_smiles": "C=CCC1CCCC(CC(CCCO)OCc2ccccc2)N1C(=O)OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bc3bbaf8-0e32-4860-b888-357ba40a6414",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2ccccc2)cc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2ccccc2)cc1=O.",
+ "ref_smiles": "Cc1noc(C)c1S(=O)(=O)NCCn1cnc(-c2cccc(-c3ccccc3)c2)cc1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "21bbcb8a-c301-489e-83f2-0f33f22f58c8",
+ "task": "add",
+ "question": "Modify the molecule CCc1n[nH]c(=S)n1C1CCOC1C1CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1n[nH]c(=S)n1C1CCOC1C1CC1",
+ "ref_smiles": "CCc1n[nH]c(=S)n1C1CC(c2ccccc2)OC1C1CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1677a0d6-c0fe-4506-8db5-0e223cc756f4",
+ "task": "sub",
+ "question": "Modify the molecule Oc1cc2ccc(C#CCn3ccnc3)cc2c(O)c1Cc1ccccc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1cc2ccc(C#CCn3ccnc3)cc2c(O)c1Cc1ccccc1",
+ "ref_smiles": "Oc1c(Cc2ccccc2)c(I)cc2ccc(C#CCn3ccnc3)cc12",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2ff49e60-6566-4bca-b6cf-359275729517",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)N(C(C)C)P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(C(C)C)P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1.",
+ "ref_smiles": "CC(C)N(P(OCCC#N)OCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d8d6a10e-4753-4e42-9b8f-d7d25ee62484",
+ "task": "add",
+ "question": "Modify the molecule CCC1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1",
+ "ref_smiles": "CC(O)C1(C)Oc2ccc(NCc3cc(C(N)=O)cs3)cc2O1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "15edef37-cc25-4478-b718-bdfe3b77dd55",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)c1ccc(Oc2ncnc(Nc3cccnc3Cl)c2N)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(Oc2ncnc(Nc3cccnc3Cl)c2N)cc1",
+ "ref_smiles": "CC(C)c1ccc(Oc2ncnc(Nc3cccnc3C(=O)O)c2N)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f85e0d06-0991-403b-8e1d-e18b35d54279",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#Cc1cccc(N2CCC3(CCCCC3)C2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cccc(N2CCC3(CCCCC3)C2=O)c1.",
+ "ref_smiles": "N#Cc1cc(-c2ccccc2)cc(N2CCC3(CCCCC3)C2=O)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ecc98fda-01e7-4b79-99e4-2263f669f43e",
+ "task": "add",
+ "question": "Modify the molecule CC(C)([NH3+])CC(P(=O)([O-])[O-])P(=O)([O-])[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)([NH3+])CC(P(=O)([O-])[O-])P(=O)([O-])[O-]",
+ "ref_smiles": "CC(C)([NH3+])C(c1ccccc1)C(P(=O)([O-])[O-])P(=O)([O-])[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "39be956d-e3fb-4cb6-b9f1-5600d44a9505",
+ "task": "add",
+ "question": "Modify the molecule CN(CC(=O)NCC(O)C(N)=O)C(=O)c1ccco1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC(=O)NCC(O)C(N)=O)C(=O)c1ccco1",
+ "ref_smiles": "CN(C(=O)c1ccco1)C(S)C(=O)NCC(O)C(N)=O",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "6b5a5c34-8bd9-4931-973c-721046b529df",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4)c3nc2-c2ccc(OCCCCCC)cc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4)c3nc2-c2ccc(OCCCCCC)cc2)cc1",
+ "ref_smiles": "CCCCCCOc1ccc(-c2nc3c(-c4ccc(C=C(C#N)C(=O)[O-])cc4)c4nc(-c5ccc(OCCCCCC)cc5)c(-c5ccc(OCCCCCC)cc5)nc4c(-c4ccc(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)cc4O)c3nc2-c2ccc(OCCCCCC)cc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2e1484eb-e4d2-4dfe-98bc-a4890734d834",
+ "task": "delete",
+ "question": "Modify the molecule CCn1nc(C(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c2ccccc2c1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nc(C(=O)OCC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c2ccccc2c1=O",
+ "ref_smiles": "CCn1nc(C(=O)OCC(=O)NCCS(N)(=O)=O)c2ccccc2c1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2e4c2e98-c8d4-4dc2-b63c-57e01acde0cb",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccccc1NC(=O)c1ccc(Cl)c(NC(=O)C(C)[NH+]2CCC(C(=O)Nc3cccc(C(=O)NC(C)C)c3)CC2)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)c1ccc(Cl)c(NC(=O)C(C)[NH+]2CCC(C(=O)Nc3cccc(C(=O)NC(C)C)c3)CC2)c1",
+ "ref_smiles": "CC(=O)c1ccc(C(=O)Nc2ccccc2C)cc1NC(=O)C(C)[NH+]1CCC(C(=O)Nc2cccc(C(=O)NC(C)C)c2)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3ddbe57c-68ee-4236-98d0-367caf02a6fd",
+ "task": "add",
+ "question": "Modify the molecule CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(C)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(C)C(=O)[O-]",
+ "ref_smiles": "CC(C)CC(NC(=O)C(C)NC(=O)C(NC(=O)C1CCCN1C(=O)C([NH3+])CCC(N)=O)C(C)C)C(=O)NC(Cc1ccccc1)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a5c8faf6-61cf-4229-b1d1-76d15d3463de",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3)C2=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3)C2=O)cc1",
+ "ref_smiles": "COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OC(=O)c4cccc(Br)c4)c(OC)c3-c3ccccc3C2=O)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d74d2421-0dfe-4bba-a393-79443ebe9e32",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)NC(=O)c1cccc(CNC(=O)Cc2ccccc2C(=O)[O-])c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1cccc(CNC(=O)Cc2ccccc2C(=O)[O-])c1",
+ "ref_smiles": "CCC(C)NC(=O)c1ccc(O)c(CNC(=O)Cc2ccccc2C(=O)[O-])c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "79117f68-cd71-4cc1-ab39-75e67ee34211",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(C=C(C(=O)Nc2ccccc2)C(=O)Nc2ccccc2)cc(C)c1O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C=C(C(=O)Nc2ccccc2)C(=O)Nc2ccccc2)cc(C)c1O",
+ "ref_smiles": "Cc1cc(C=C(C(=O)Nc2ccccc2)C(=O)Nc2ccccc2)cc(C)c1F",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e3e2c1fa-bcd6-4481-88f8-6e106706ae9a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH+](Cc1ccccc1)Cc1cc(O)c2c(c1F)CC1CC3C([NH+](C)C)C(=O)C(C(N)=O)=C([O-])C3(O)C(=O)C1=C2[O-] with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+](Cc1ccccc1)Cc1cc(O)c2c(c1F)CC1CC3C([NH+](C)C)C(=O)C(C(N)=O)=C([O-])C3(O)C(=O)C1=C2[O-]",
+ "ref_smiles": "CCC[NH+](Cc1ccccc1)Cc1cc(O)c2c(c1NO)CC1CC3C([NH+](C)C)C(=O)C(C(N)=O)=C([O-])C3(O)C(=O)C1=C2[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2e8bd220-4e65-41eb-8f19-849cbebcaf26",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCn1ncc(OC)c1C(NN)c1coc(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1ncc(OC)c1C(NN)c1coc(C)c1.",
+ "ref_smiles": "CCn1ncc(OC)c1C(N)c1coc(C)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "03706cd4-50fe-4f85-8eaa-2b7bb89c1db7",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule N#CC(=Cc1ccc(OCc2ccccc2)c(Br)c1)c1cccc(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=Cc1ccc(OCc2ccccc2)c(Br)c1)c1cccc(F)c1.",
+ "ref_smiles": "N#CC(F)=Cc1ccc(OCc2ccccc2)c(Br)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f6425695-de25-484e-9d9a-1129dcee72ee",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule C=CCOC(=O)N1CCN(c2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOC(=O)N1CCN(c2ccccc2)CC1.",
+ "ref_smiles": "C=CC(CC=O)OC(=O)N1CCN(c2ccccc2)CC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "a49e4b26-f5d4-4158-8ca4-f762911f30d1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCC=CCCCCCCCCCCC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCC=CCCCCCCCCCCC",
+ "ref_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC1OC(CC#N)C(O)C(O)C1O)OC(=O)CCCCC=CCCCCCCCCCCC",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1f90c231-ad77-4282-b6a6-cc700c9d9258",
+ "task": "add",
+ "question": "Please add a thiol to the molecule Cn1cccc1C(=O)N1CC2(CC(OCc3ccccn3)CS2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cccc1C(=O)N1CC2(CC(OCc3ccccn3)CS2)C1.",
+ "ref_smiles": "Cn1cccc1C(=O)N1CC2(CC(OC(S)c3ccccn3)CS2)C1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "58a7a367-09d0-4e0b-b62f-013d5ab7196a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1.",
+ "ref_smiles": "CC1C(O)C2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1C(=O)C[NH+]1CCN(C)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bc6cb0da-7342-4b3d-b15c-c0bd82d2ad7f",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CCN(C)C(=O)CNc1nc(N)nc(C)c1[N+](=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(C)C(=O)CNc1nc(N)nc(C)c1[N+](=O)[O-]",
+ "ref_smiles": "CCN(C)C(=O)CNc1nc(N)nc(C)c1[SH]=O",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "12abd738-f1ba-4be9-a5ad-7c7d2e7321b4",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(CCNC(=O)CCC(=O)c2ccc3c(c2)OCCO3)no1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(CCNC(=O)CCC(=O)c2ccc3c(c2)OCCO3)no1",
+ "ref_smiles": "Cc1cc(CCCC(=O)c2ccc3c(c2)OCCO3)no1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f57075eb-f9f0-4248-8c72-b6e99f4e8c0f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=c1c2c(C)ccc(Cl)c2c(=C)n1CC1=[NH+]CCC=N1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=c1c2c(C)ccc(Cl)c2c(=C)n1CC1=[NH+]CCC=N1",
+ "ref_smiles": "C=c1c2c(C)ccc(S)c2c(=C)n1CC1=[NH+]CCC=N1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "96dfd43e-eab2-449e-aa6a-9ad1c69cc30e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Oc1cccc(Cc2nc3cccc(Cl)n3n2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1cccc(Cc2nc3cccc(Cl)n3n2)c1",
+ "ref_smiles": "N#Cc1cccc2nc(Cc3cccc(O)c3)nn12",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8844ba4-055a-421a-b6c2-9c7d3c80c01f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(-n2c(COc3ccccc3)nn(CC(=O)Nc3ccc(Cl)c(Cl)c3)c2=S)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2c(COc3ccccc3)nn(CC(=O)Nc3ccc(Cl)c(Cl)c3)c2=S)cc1",
+ "ref_smiles": "Cc1ccc(-n2c(COc3ccccc3)nn(CC(=O)Nc3ccc(C#N)c(Cl)c3)c2=S)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7b6b7f6f-4422-47ec-a616-6db611d3e2d3",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCN1CC2(CCCN(C(=O)c3coc(C[NH+]4CCOCC4)c3)C2)CCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1CC2(CCCN(C(=O)c3coc(C[NH+]4CCOCC4)c3)C2)CCC1=O.",
+ "ref_smiles": "CC1CC2(CCCN(Cc3coc(C[NH+]4CCOCC4)c3)C2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c49a46e2-42e1-4cf4-81d7-78a2e93a1c72",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)c1nnsc1C(=O)NCc1cc(N)ccc1O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1nnsc1C(=O)NCc1cc(N)ccc1O",
+ "ref_smiles": "CC(C)c1nnsc1C(=O)NCc1cc(N)ccc1Br",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "95781304-0e50-4bb4-ac1c-6a32a3efd8f5",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(NC(=S)NCc2cccc(OC)c2)cc1OCC by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NC(=S)NCc2cccc(OC)c2)cc1OCC",
+ "ref_smiles": "CCOc1ccc(NC(=S)NCOC)cc1OCC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7f5c2722-c872-42b5-af61-9d27718417c2",
+ "task": "delete",
+ "question": "Modify the molecule CCCC([NH2+]C(C)c1ccccc1Br)C(=O)[O-] by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC([NH2+]C(C)c1ccccc1Br)C(=O)[O-]",
+ "ref_smiles": "CCCC([NH2+]C(C)c1ccccc1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d5087e0-8e23-4b09-80ab-19bf21300561",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cnn(C)c1C(Cc1ccc(Cl)cc1Cl)NN with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cnn(C)c1C(Cc1ccc(Cl)cc1Cl)NN",
+ "ref_smiles": "COc1cnn(C)c1C(Cc1ccc(C(=O)O)cc1Cl)NN",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b7ac932b-ac0f-4ebd-b4a3-e69dfdc2dd44",
+ "task": "add",
+ "question": "Modify the molecule Nc1ccc(Cl)cc1NC(=O)Cn1ccc(=O)[nH]c1=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(Cl)cc1NC(=O)Cn1ccc(=O)[nH]c1=O",
+ "ref_smiles": "Nc1cc(N)c(NC(=O)Cn2ccc(=O)[nH]c2=O)cc1Cl",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "2e7104b0-f2df-427e-b92a-d4ca300809ee",
+ "task": "sub",
+ "question": "Modify the molecule CCc1ccccc1-n1c(C)cc(C=Nc2ccc(I)c(C)c2)c1C by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1-n1c(C)cc(C=Nc2ccc(I)c(C)c2)c1C",
+ "ref_smiles": "CCc1ccccc1-n1c(C)cc(C=Nc2ccc(O)c(C)c2)c1C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "67c9f6a2-cd75-40e8-b70f-ff474f1314c2",
+ "task": "add",
+ "question": "Modify the molecule N#CC(NCc1cnccc1-c1c(F)cccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(NCc1cnccc1-c1c(F)cccc1F)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
+ "ref_smiles": "N#CC(NCc1c(-c2c(F)cccc2F)ccnc1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8f321996-5331-4d5e-b27c-53149c607040",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)cc(OCC(=O)c2coc3ccccc23)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(OCC(=O)c2coc3ccccc23)c1.",
+ "ref_smiles": "CCOCC(=O)c1coc2ccccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "cf27da3a-ddf1-42b0-b1f2-84f3d8dd3507",
+ "task": "add",
+ "question": "Modify the molecule O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "O=C1C(=O)N(Cc2ccncc2)C(c2ccccc2)(c2ccccc2)C1=C([O-])c1ccc(Cl)c(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "351423a3-94bf-49f1-86bd-cb4c5c5f2d27",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(N2CCCCO2)ncc1Br by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(N2CCCCO2)ncc1Br",
+ "ref_smiles": "Cc1ccnc(N2CCCCO2)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2aff2b80-ffe9-4ab9-b6d3-d428cdb484e0",
+ "task": "add",
+ "question": "Modify the molecule CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1",
+ "ref_smiles": "CCOc1cc(C#N)cc(Br)c1OCC(=O)Nc1ccc(F)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1394a187-8b3b-4f19-b1de-544c8a5c2289",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])C(CF)NC(=O)C1CC1c1ccc2ccccc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(CF)NC(=O)C1CC1c1ccc2ccccc2c1.",
+ "ref_smiles": "CC(NC(=O)C1CC1c1ccc2ccccc2c1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "ae4223fe-35fb-4c72-bc46-e8bbb603b7a8",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cnc(C(=O)NNc2ccccc2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(C(=O)NNc2ccccc2)cn1.",
+ "ref_smiles": "Cc1cnc(C(=O)NN)cn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5df12a64-bd9a-4d71-b324-2ec5fb8810fe",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]C1C2=C([NH+]=CN1c1ccc(F)c(Cl)c1)N(c1cccc(C[NH+]3CCOCC3)c1)C([NH3+])S2 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1C2=C([NH+]=CN1c1ccc(F)c(Cl)c1)N(c1cccc(C[NH+]3CCOCC3)c1)C([NH3+])S2",
+ "ref_smiles": "[NH3+]C1C2=C([NH+]=CN1c1ccc(O)c(Cl)c1)N(c1cccc(C[NH+]3CCOCC3)c1)C([NH3+])S2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "939d6c6c-c3d8-486a-8084-d1c6354fbbdf",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Nc1ccccc1Cc1ccccc1)N(Cc1ccncc1)Cc1cccnc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccccc1Cc1ccccc1)N(Cc1ccncc1)Cc1cccnc1",
+ "ref_smiles": "O=C(NCc1ccccc1)N(Cc1ccncc1)Cc1cccnc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "61718d89-863a-493a-a1ff-521a7ecc02b5",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)C",
+ "ref_smiles": "CCOC(=O)COc1ccc(-c2ccc(OCCNC(=O)Cc3ccccc3)c(C(C)C)c2)cc1C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "64750cf1-45f2-4f8d-aa25-97f1ea0fb5c4",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCc1ccc(C[NH+]2CCC(O)CC2)cc1)c1sccc1Br by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc(C[NH+]2CCC(O)CC2)cc1)c1sccc1Br",
+ "ref_smiles": "O=C(NCc1ccc(C[NH+]2CCC(Br)CC2)cc1)c1sccc1Br",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "78a37b40-9386-4c64-b76e-77261ff76e30",
+ "task": "sub",
+ "question": "Modify the molecule O=C1CN(c2ccccc2F)C([NH2+]CCN2CCCCC2)=C1c1nc(=O)c2ccc(Br)cc2[nH]1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CN(c2ccccc2F)C([NH2+]CCN2CCCCC2)=C1c1nc(=O)c2ccc(Br)cc2[nH]1",
+ "ref_smiles": "ONc1ccccc1N1CC(=O)C(c2nc(=O)c3ccc(Br)cc3[nH]2)=C1[NH2+]CCN1CCCCC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d9191714-a68e-4a06-962d-f92104cebb1b",
+ "task": "delete",
+ "question": "Modify the molecule FC(F)(F)c1cccc(C(Br)Cc2cccc(Br)c2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cccc(C(Br)Cc2cccc(Br)c2)c1",
+ "ref_smiles": "FC(F)(F)C(Br)Cc1cccc(Br)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4b216aee-6106-44ca-a699-1a91b753ed4a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule N#CCCNC(=O)COc1ccc(-c2ccccc2)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCNC(=O)COc1ccc(-c2ccccc2)cc1Cl.",
+ "ref_smiles": "N#CCCNC(=O)COc1cc(O)c(-c2ccccc2)cc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5f45b85e-2502-40f6-940c-31437f54bea9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCn1ncc(Cl)c1C(CCC(C)OC)NN with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1ncc(Cl)c1C(CCC(C)OC)NN",
+ "ref_smiles": "COCCn1ncc(C(=O)[OH])c1C(CCC(C)OC)NN",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "66dddec0-981f-4f1e-8e17-855557b2afef",
+ "task": "add",
+ "question": "Modify the molecule CC(N)(C[NH2+]CCc1nccs1)c1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(N)(C[NH2+]CCc1nccs1)c1ccccc1",
+ "ref_smiles": "CC(N)(C[NH2+]CCc1ncc(C(=O)O)s1)c1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b3a5c41b-1f04-4ad9-95e5-78e12fb915a6",
+ "task": "delete",
+ "question": "Modify the molecule CC(CNC(=O)C1CC(=O)N(C)C1)Oc1ccccc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CNC(=O)C1CC(=O)N(C)C1)Oc1ccccc1F",
+ "ref_smiles": "CC(CNC(=O)C1CC(=O)N(C)C1)Oc1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "dc1977a7-845d-4ae0-9326-6f575a2e9bb4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])NCS(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])NCS(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1",
+ "ref_smiles": "O=C([O-])NCS(=O)(=O)c1ccc(C=O)c([N+](=O)[O-])c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4476d4ea-1509-4ca8-8daa-a4f640af1bbb",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccccc1",
+ "ref_smiles": "CCOC(=O)C(Cc1cn(C)c2ccc(OC)cc12)N=Cc1ccc(C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "07de09a2-b9ea-4715-bb5a-3b7d7c78eff6",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C([O-])n1nc(Br)c2ncccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])n1nc(Br)c2ncccc21.",
+ "ref_smiles": "O=C([O-])n1nc(Br)c2nc(-c3ccccc3)ccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ebde61b4-9152-498c-bf9c-bbf04b720de4",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F",
+ "ref_smiles": "CCc1cc(O)c(-c2cc(OC)ccc2F)c(C(C)(C)C)c1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "831d55cd-600b-4b08-b8d1-23eaf695e48c",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CSCCC(NC(=O)C([NH3+])Cc1cnc[nH]1)C(=O)NC(CCSC)C(=O)NC(CO)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)C([NH3+])Cc1cnc[nH]1)C(=O)NC(CCSC)C(=O)NC(CO)C(=O)[O-].",
+ "ref_smiles": "CSCCC(NC(=O)C(CCSC)NC(=O)C([NH3+])(C#N)Cc1cnc[nH]1)C(=O)NC(CO)C(=O)[O-]",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "29892836-ee93-4d63-8d3f-be147c608aca",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C([O-])CCC(NC(=O)c1ccccc1SSc1ccccc1C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCC(NC(=O)c1ccccc1SSc1ccccc1C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(=O)[O-].",
+ "ref_smiles": "O=C([O-])CCC(NC(=O)SSc1ccccc1C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "57c15624-8fbe-4561-91bb-25d992a28913",
+ "task": "sub",
+ "question": "Modify the molecule CC1(c2cc(F)ccc2F)NC(=O)N(CC(=O)C23CC4CC(CC(C4)C2)C3)C1=O by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(c2cc(F)ccc2F)NC(=O)N(CC(=O)C23CC4CC(CC(C4)C2)C3)C1=O",
+ "ref_smiles": "CC(=O)c1ccc(F)c(C2(C)NC(=O)N(CC(=O)C34CC5CC(CC(C5)C3)C4)C2=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f9360b75-70ef-42c1-b14c-a93d96524ca8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1ncc(Cl)c1S(=O)(=O)Nc1cccc(C[NH3+])c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ncc(Cl)c1S(=O)(=O)Nc1cccc(C[NH3+])c1",
+ "ref_smiles": "Cn1ncc(NO)c1S(=O)(=O)Nc1cccc(C[NH3+])c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "31887966-1c10-43b0-b20f-8bd46caae112",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])C1(COc2ccccc2Br)CCCCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1(COc2ccccc2Br)CCCCC1",
+ "ref_smiles": "O=C([O-])C1(COBr)CCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "33a5b3d0-9651-4096-bc52-cc8f0dcda60b",
+ "task": "add",
+ "question": "Modify the molecule O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "O=C(NCC(c1ccccc1)n1nc(-n2cncn2)ccc1=O)c1ccc(Cl)c(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "93f89de8-42db-447c-bb80-4fde29ad0c19",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1cc(C)c(B(C[Si](C)(C)C)c2c(C)cc(OC)cc2C)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C)c(B(C[Si](C)(C)C)c2c(C)cc(OC)cc2C)c(C)c1.",
+ "ref_smiles": "COCCB(C[Si](C)(C)C)c1c(C)cc(OC)cc1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5e1506a7-c309-4148-8bc7-bf4a204a2b35",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)C)c1.",
+ "ref_smiles": "CCOc1cc(N)cc(Sc2n[nH]c(=O)n2C(C)(C)S)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "4c5f7554-7645-49e2-8fac-00100a63143d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)NCC(=O)Nc1nc(C)c(-c2cnc(Cl)c(NS(=O)(=O)c3ccccc3)c2)s1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NCC(=O)Nc1nc(C)c(-c2cnc(Cl)c(NS(=O)(=O)c3ccccc3)c2)s1",
+ "ref_smiles": "CC(=O)NCC(=O)Nc1nc(C)c(-c2cnc(C(=O)[OH])c(NS(=O)(=O)c3ccccc3)c2)s1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1215a558-07bc-43f0-ab98-ba60f9595684",
+ "task": "add",
+ "question": "Modify the molecule CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1",
+ "ref_smiles": "CC([NH3+])c1cccc(NC(=O)c2ccc(Br)cc2O)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ab3c28da-120b-4ef5-b8ff-1116462f8d87",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(C(O)=Cc1ccc(O)cc1)c1c(O)cc(O)cc1O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C(O)=Cc1ccc(O)cc1)c1c(O)cc(O)cc1O",
+ "ref_smiles": "O=C(C(S)=Cc1ccc(O)cc1)c1c(O)cc(O)cc1O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ad683987-e686-46e2-8123-5989e90ae337",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1)c1ccccc1.",
+ "ref_smiles": "O=C(CN=c1sc2ccccc2n1C(=O)c1ccccc1O)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "22dfe170-7fd3-4daa-8a23-3d2698acbf40",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccsc1CNC(=O)CCCNC(=O)C(C)(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccsc1CNC(=O)CCCNC(=O)C(C)(C)C",
+ "ref_smiles": "Cc1ccsc1CCCNC(=O)C(C)(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "def21d5f-b7fd-4e0b-a81a-ad05497d72fd",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC[NH+]=C1NC2C(CC(CO)C(C=O)C2C=O)S1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+]=C1NC2C(CC(CO)C(C=O)C2C=O)S1.",
+ "ref_smiles": "CCC[NH+]=C1NC2C(CC(C)C(C=O)C2C=O)S1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8e20b6e3-88c6-4491-94bb-51b19152ee11",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC1c2ccsc2CCN1c1ncc(C(=O)[O-])cc1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1c2ccsc2CCN1c1ncc(C(=O)[O-])cc1N.",
+ "ref_smiles": "CC1c2ccsc2CCN1c1ccc(C(=O)[O-])cn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a84abb1f-7ca2-45e0-be75-edfa1d2b0ecd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCOC(=O)c1c(NC(=O)c2ccc(COc3ccc(Br)cc3)o2)sc(C(=O)OC)c1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOC(=O)c1c(NC(=O)c2ccc(COc3ccc(Br)cc3)o2)sc(C(=O)OC)c1C",
+ "ref_smiles": "CCCOC(=O)c1c(NC(=O)c2ccc(COc3ccc(C=O)cc3)o2)sc(C(=O)OC)c1C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b2cc8b6-50fb-4ae2-a004-ce407977904d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)C(C)n1cncc1C[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(C)n1cncc1C[NH3+].",
+ "ref_smiles": "CC(CO)C(C)n1cncc1C[NH3+]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a8735887-2285-4cc3-8d60-27682a86aabe",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc(SCCC=C(F)F)oc1C(=O)NS(C)(=O)=O by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(SCCC=C(F)F)oc1C(=O)NS(C)(=O)=O",
+ "ref_smiles": "Cc1nc(SCCC=C(F)S)oc1C(=O)NS(C)(=O)=O",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "48faf308-5491-4540-b38e-59a9bfbe4416",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)(C)c1ccc(C(Cl)c2cccs2)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)c1ccc(C(Cl)c2cccs2)cc1",
+ "ref_smiles": "CCC(C)(C)c1ccc(C(O)c2cccs2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "321430bd-79cc-4cc7-90fa-8bbbda7d9ca4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOCC(C)OCc1ccc(C[NH2+]C2CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCC(C)OCc1ccc(C[NH2+]C2CC2)cc1.",
+ "ref_smiles": "CCOCC(C)OCC[NH2+]C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2be38955-1770-4759-9296-45af05404414",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc2[nH]c(C(=O)NC(C)c3nncn3C3CCCC3)cc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2[nH]c(C(=O)NC(C)c3nncn3C3CCCC3)cc2c1.",
+ "ref_smiles": "COc1cc2cc(C(=O)NC(C)c3nncn3C3CCCC3)[nH]c2cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fa83b2c1-4a89-4189-93e1-6655d1cfb15a",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)C(O)CNC(=O)c1ccoc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(O)CNC(=O)c1ccoc1",
+ "ref_smiles": "O=C(NCC(O)C(=O)OCO)c1ccoc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1d3425eb-0ab7-4d91-8ff7-d4abc69f0183",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1cc(C=C2SC(=S)[N-]C2=O)cc(Br)c1OCCC(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C=C2SC(=S)[N-]C2=O)cc(Br)c1OCCC(C)C",
+ "ref_smiles": "CCOc1cc(C=C2SC(=S)[N-]C2=O)ccc1OCCC(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "242a49b5-d8dd-4cb6-accb-cc46a6f6a301",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCn1nc(C)c(Cl)c1CC(O)C[NH+](C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nc(C)c(Cl)c1CC(O)C[NH+](C)C.",
+ "ref_smiles": "CCn1nc(C)c(Cl)c1C(CC=O)C(O)C[NH+](C)C",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "dad1107e-aa5d-4b7d-93c4-525a165707fe",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C=C(CC(=O)OCC)C(=O)Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(CC(=O)OCC)C(=O)Cl.",
+ "ref_smiles": "C=C(C(=O)Cl)C(C(=O)O)C(=O)OCC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bc06dddc-d832-4edc-80a0-fbfe9083c896",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1ccc(NC(=O)CSc2nc3c(c(=O)n2-c2ccc(OC(F)(F)F)cc2)SCC3)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(NC(=O)CSc2nc3c(c(=O)n2-c2ccc(OC(F)(F)F)cc2)SCC3)cc1",
+ "ref_smiles": "CCc1ccc(NC(=O)CSc2nc3c(c(=O)n2-c2ccc(OC(F)(F)NO)cc2)SCC3)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d11f3ef8-2f15-4dfc-a12f-79e5e43f26c8",
+ "task": "add",
+ "question": "Modify the molecule CCCOc1cc(NCC2(C(C)C)CC2)ncn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cc(NCC2(C(C)C)CC2)ncn1",
+ "ref_smiles": "CCCOc1cc(NC(O)C2(C(C)C)CC2)ncn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f0e3962f-cdbb-415a-93ca-b03124917815",
+ "task": "delete",
+ "question": "Modify the molecule CCN(CC(N)=[NH+]O)C(=O)c1ccc(OC)cc1O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC(N)=[NH+]O)C(=O)c1ccc(OC)cc1O",
+ "ref_smiles": "CCN(CC(N)=[NH+]O)C(=O)OOC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d82832e3-c46c-40b1-839d-cd6ab674932a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC1CC1N1CC(C)(CC)[NH2+]CC1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CC1N1CC(C)(CC)[NH2+]CC1C.",
+ "ref_smiles": "CCC1CC1N1C(C)C[NH2+]C(C)(CC)C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9639e545-0c39-4e3b-8326-2b2e6c3eb0d2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C#CCN(C)C(=O)c1csc(Cl)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCN(C)C(=O)c1csc(Cl)c1",
+ "ref_smiles": "CC(=O)c1cc(C(=O)N(C)CC#C)cs1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "53ee0fb1-7c55-4472-84d2-abfb6e3d10ce",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C(CCO)CSCc1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CCO)CSCc1ccco1",
+ "ref_smiles": "[NH3+]C(CSCc1ccco1)CC(O)O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "536b1b79-3da9-4be0-91e5-9ffce62e9be3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCOCCCCNS(=O)(=O)CCCl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOCCCCNS(=O)(=O)CCCl",
+ "ref_smiles": "COCCOCCCCNS(=O)(=O)CCNO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f5674e64-3d4c-4baf-b143-753e4ffc7e86",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)[NH2+]CCC(C)(O)Cc1cc(Cl)cc2c1OCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH2+]CCC(C)(O)Cc1cc(Cl)cc2c1OCC2.",
+ "ref_smiles": "CC(C)[NH2+]CCC(C)(O)Cc1cccc2c1OCC2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "db84315f-f982-4430-982f-1437e4974e86",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule N#CCC(C(=O)c1ccccc1F)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCC(C(=O)c1ccccc1F)c1ccccc1.",
+ "ref_smiles": "N#CCC(C(=O)c1ccccc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "eae63118-9cfb-41a9-aff8-96474b750322",
+ "task": "sub",
+ "question": "Modify the molecule Cn1cc(C(=O)N2CCCC2COc2ccc(C(F)F)cc2Cl)c(C(F)F)n1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(C(=O)N2CCCC2COc2ccc(C(F)F)cc2Cl)c(C(F)F)n1",
+ "ref_smiles": "Cn1cc(C(=O)N2CCCC2OCHOc2ccc(C(F)F)cc2)c(C(F)F)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0838b192-2d8d-4f55-87df-a7ddde10ab14",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCc1ccc(S(=O)(=O)NCC(=O)NCc2ccco2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(S(=O)(=O)NCC(=O)NCc2ccco2)cc1.",
+ "ref_smiles": "CCc1ccc(S(=O)(=O)NCc2ccco2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8417117b-8bc9-4678-a2ce-c4057508b67b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C)cc(CSc2nnc(C)n2N=Cc2cccc(Cl)c2Cl)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(CSc2nnc(C)n2N=Cc2cccc(Cl)c2Cl)c1",
+ "ref_smiles": "Cc1cc(C)cc(CSc2nnc(C)n2N=Cc2cccc(S)c2Cl)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ca443fc9-a15d-472d-ba40-adf5450c530f",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC[NH+](CC)CCC[NH2+]Cc1ccc(C#N)s1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCC[NH2+]Cc1ccc(C#N)s1",
+ "ref_smiles": "CC[NH+](CC)CCC[NH2+]Cc1ccc([N+](=O)[O-])s1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9fcbe497-51b7-4eef-87b6-3b3c6aad1058",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(OC)c(C(O)CNC(=O)C2CC2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OC)c(C(O)CNC(=O)C2CC2)c1",
+ "ref_smiles": "COc1cc(O)c(OC)c(C(O)CNC(=O)C2CC2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ff058be0-7789-4ab9-ae26-4fcf2e734717",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCC(NN)c1cc(C)c(F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NN)c1cc(C)c(F)cc1F.",
+ "ref_smiles": "CCC(N)c1cc(C)c(F)cc1F",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "94c2292a-a3f0-4c52-abee-c47c022880bc",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC1CN(c2ccc3c(c2)OCO3)CCN1C(=O)C1CCCCC1C(=O)NC1(C#N)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(c2ccc3c(c2)OCO3)CCN1C(=O)C1CCCCC1C(=O)NC1(C#N)CC1",
+ "ref_smiles": "CC(=O)C1(NC(=O)C2CCCCC2C(=O)N2CCN(c3ccc4c(c3)OCO4)CC2C)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "208143de-ade6-4f50-a924-e43f5282fb22",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)COC2(C)C[NH2+]C2)ccc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)COC2(C)C[NH2+]C2)ccc1F",
+ "ref_smiles": "Cc1cc(NC(=O)COC2(C)C[NH2+]C2)ccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e89ff7b-e641-49d2-a515-ac3fa7bc5736",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CN1CC[NH+](CCC(=O)NN)C(C)(C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1CC[NH+](CCC(=O)NN)C(C)(C)C1=O.",
+ "ref_smiles": "CN1C(=O)C(C)(C)[NH+](CCC(=O)NN)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "19ff0518-cb5b-48e8-bd46-3392a0981d4d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(Cl)nc(N(C)C2CC[NH2+]CC2)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)nc(N(C)C2CC[NH2+]CC2)n1",
+ "ref_smiles": "CC(=O)c1cc(C)nc(N(C)C2CC[NH2+]CC2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "53a58e21-8b51-4b39-b6dd-a3b6fe515f1d",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C[NH2+]Cc1ccc(OCCn2cccn2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[NH2+]Cc1ccc(OCCn2cccn2)cc1",
+ "ref_smiles": "CC(C)C[NH2+]COCCn1cccn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0348390a-ef52-492a-a6fc-bb1afd004e0e",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(-c2c(C#N)c(SCC(=O)c3ccc(Br)cc3)nc(C)c2C(=O)Nc2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2c(C#N)c(SCC(=O)c3ccc(Br)cc3)nc(C)c2C(=O)Nc2ccccc2)cc1.",
+ "ref_smiles": "COc1ccc(-c2(-c3ccccc3)c(C#N)c(SCC(=O)c3ccc(Br)cc3)nc-2C)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "98c55731-3fcb-4262-9582-9a9a472aa14d",
+ "task": "add",
+ "question": "Modify the molecule O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1",
+ "ref_smiles": "O=C(C=Cc1cc(Cl)cc(C(=O)O)c1-n1cnnn1)NC(Cc1ccccc1)C(=O)Nc1ccc(N(CCc2nn[n-]n2)C(=O)[O-])cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6f6e83d6-ccf2-41e6-acbc-116747e96e94",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC#N)NC(=O)C1CCOC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC#N)NC(=O)C1CCOC1",
+ "ref_smiles": "CCC(CC#N)NC(=O)C1COC(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "59429b1d-4136-4c78-9d4f-d62a6a9c7c52",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(N2CC(O)CC2C[NH+](C)C)ccc1C[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N2CC(O)CC2C[NH+](C)C)ccc1C[NH3+].",
+ "ref_smiles": "CC([NH3+])N1CC(O)CC1C[NH+](C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c7fc89ad-6027-405b-b4d5-b55ec3e73e6f",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)OC(=O)N1CCC(Nc2ncnc3sccc23)CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)OC(=O)N1CCC(Nc2ncnc3sccc23)CC1",
+ "ref_smiles": "CC(C)OC(=O)N1CCC(c2ncnc3sccc23)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c388d712-3dde-4e83-8e91-d33e4b1c05fe",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCCCNC(=O)CN(C)C(=O)c1cc(C)nc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCNC(=O)CN(C)C(=O)c1cc(C)nc(Cl)c1.",
+ "ref_smiles": "COCCCNC(=O)C(O)N(C)C(=O)c1cc(C)nc(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3e1e8238-ea73-437e-b090-40f33421bcbf",
+ "task": "add",
+ "question": "Please add a amine to the molecule CSC(=O)C=C1SSC(=CC(=O)SC)S1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSC(=O)C=C1SSC(=CC(=O)SC)S1.",
+ "ref_smiles": "CSC(=O)C=C1SSC(=C(N)C(=O)SC)S1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "ed5b3c52-df2c-4156-af72-69c82a46f4e6",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Nc1ccc(S(=O)(=O)N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)cn3)C(CC3CCOCC3)C2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(S(=O)(=O)N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)cn3)C(CC3CCOCC3)C2)s1.",
+ "ref_smiles": "O=S(=O)(c1cccs1)N1CCN(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)cn2)C(CC2CCOCC2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "2d9b9a82-8fd8-4639-9c60-05973ae2e3bc",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1cc(C2C(c3cccs3)=C(O)C(=O)N2c2ccccc2OC)ccc1O by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C2C(c3cccs3)=C(O)C(=O)N2c2ccccc2OC)ccc1O",
+ "ref_smiles": "CCOc1cc(C2C(c3cccs3)=C(C#N)C(=O)N2c2ccccc2OC)ccc1O",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c8279cad-4b37-460e-9e13-85cf01ce2a31",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C(=O)N(C)C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2cccc(C(=O)Nc3ccc(F)cc3)c2C)CC1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)N(C)C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2cccc(C(=O)Nc3ccc(F)cc3)c2C)CC1",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)c2cccc(NC(=O)C(C)NC(=O)C3CC[NH+](CC(=O)Nc4ccc(C(=O)N(C)C)cc4C)CC3)c2C)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ba1e08e3-e913-476c-b501-20ae36037bf9",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1.",
+ "ref_smiles": "CCC(O)CCCCCC=CCCCCCCCC(=O)OC(=O)OCc1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b1b4b93a-3deb-4868-8511-83d009e82024",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)(OC)C(=O)c1ccc(F)cc1F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(OC)C(=O)c1ccc(F)cc1F",
+ "ref_smiles": "CCC(C)(OC)C(=O)c1ccc(S)cc1F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8e3431cc-520e-4bd5-ae73-d785e3886e30",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1csc(CNc2cc(C)[nH+]c(C)c2C#N)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(CNc2cc(C)[nH+]c(C)c2C#N)n1",
+ "ref_smiles": "Cc1csc(CNc2cc(C)[nH+]c(C)c2C(=O)[OH])n1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "77dbb9df-bf4d-47b4-8171-65e89cc9961f",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C[NH+]1CCN(c2ccc(CCl)cc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[NH+]1CCN(c2ccc(CCl)cc2)CC1",
+ "ref_smiles": "CC(C)C[NH+]1CCN(c2ccc(CCl)cc2-c3ccccc3)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "acf889f5-abb6-45b4-8b56-605a5950f513",
+ "task": "sub",
+ "question": "Modify the molecule N#CC(CN1CCCC(CCO)C1)c1ccccc1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(CN1CCCC(CCO)C1)c1ccccc1",
+ "ref_smiles": "N#CC(CN1CCCC(CCS)C1)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0fe0ed1d-5329-41a0-995f-eb7d226889db",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCNC(NCC(O)c1ccc(OC(F)F)cc1)=[NH+]Cc1ccc(-n2cncn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCC(O)c1ccc(OC(F)F)cc1)=[NH+]Cc1ccc(-n2cncn2)cc1.",
+ "ref_smiles": "CCNC(NCC(O)OC(F)F)=[NH+]Cc1ccc(-n2cncn2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0e940184-4b23-4441-9fc3-99a33f39ffb6",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C)c(C(=O)COC(=O)CCc2c(C)[nH]c(=O)c(C#N)c2C)c(C)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(C(=O)COC(=O)CCc2c(C)[nH]c(=O)c(C#N)c2C)c(C)c1",
+ "ref_smiles": "CCCC(=O)COC(=O)CCc1c(C)[nH]c(=O)c(C#N)c1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1d123371-0d30-4e0c-b0f3-ffacce3400dc",
+ "task": "sub",
+ "question": "Modify the molecule CC1=Cc2c(cc3c(c2Br)OCO3)C1CCC1=CC=CC1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=Cc2c(cc3c(c2Br)OCO3)C1CCC1=CC=CC1",
+ "ref_smiles": "CC1=Cc2c(cc3c(c2O)OCO3)C1CCC1=CC=CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "52a668bb-8c6a-4184-bf32-466ae9b5d54d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CSc1ccc(C(Cc2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)C(=O)[O-])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc(C(Cc2cccc(-c3cc(C(C)(C)S(C)(=O)=O)cc4cccnc34)c2)C(=O)[O-])cc1.",
+ "ref_smiles": "CSc1ccc(C(Cc2cc(C(C)(C)S(C)(=O)=O)cc3cccnc23)C(=O)[O-])cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4295ddee-8732-40ca-a3b3-9e006c3b86a1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C)c(C(C)NC(=O)COc2ccc(Cl)cc2Cl)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(C(C)NC(=O)COc2ccc(Cl)cc2Cl)c1",
+ "ref_smiles": "Cc1ccc(C)c(C(C)NC(=O)COc2ccc(C#N)cc2Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cdd25e45-c2dd-4a23-8be5-b8e866b4bdfb",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2)c1.",
+ "ref_smiles": "CCC(=O)N1CCCCC1C(=O)Nc1cccc(CSC2CCOCC2O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "57222391-f415-4496-a4da-18d42b437808",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1ccc(-c2nn(Cc3ccccc3)cc2C=CC(=O)N(C)C(C)CC#N)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nn(Cc3ccccc3)cc2C=CC(=O)N(C)C(C)CC#N)cc1",
+ "ref_smiles": "Cc1ccc(-c2nn(Cc3ccccc3)cc2C=CC(=O)N(C)C(C)CS)cc1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "99e30232-a8e3-41f7-8400-f91870f2cd8b",
+ "task": "delete",
+ "question": "Modify the molecule S=c1c2[nH]cnc2ncn1CCCS by removing a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "S=c1c2[nH]cnc2ncn1CCCS",
+ "ref_smiles": "CCCn1cnc2nc[nH]c2c1=S",
+ "add_group": null,
+ "remove_group": "thiol"
+ },
+ {
+ "id": "0ac5f619-5db1-4de9-b7fb-ef8ce31b33ac",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Clc1nc(Br)nc2c1cnn2C1CCC2(CC1)OCCO2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1nc(Br)nc2c1cnn2C1CCC2(CC1)OCCO2",
+ "ref_smiles": "O=C([OH])c1nc(Br)nc2c1cnn2C1CCC2(CC1)OCCO2",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d4fcb0a-8ba1-4a41-8e0e-da54b7c96c05",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(O)Cn1nc(-c2ccc(C(N)=O)cc2)nc1-c1cc(C)nc(C)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)Cn1nc(-c2ccc(C(N)=O)cc2)nc1-c1cc(C)nc(C)n1",
+ "ref_smiles": "O=CCCCn1nc(-c2ccc(C(N)=O)cc2)nc1-c1cc(C)nc(C)n1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "19657ee0-d687-45e4-b9a9-16a316ff0a92",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+](C)CCNc1cc(F)cc(-c2ccnc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(=O)C7CCC7)c6)cc45)cc23)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCNc1cc(F)cc(-c2ccnc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(=O)C7CCC7)c6)cc45)cc23)c1",
+ "ref_smiles": "C[NH+](C)CCNc1cccc(-c2ccnc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(=O)C7CCC7)c6)cc45)cc23)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c6f61634-be3f-43cf-9c34-c4e818660425",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Oc1ccc(O)n1CCCCCCn1c(O)ccc1O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1ccc(O)n1CCCCCCn1c(O)ccc1O",
+ "ref_smiles": "ONc1ccc(O)n1CCCCCCn1c(O)ccc1O",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3a670723-13e8-4d83-a4c8-522c5c76b941",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#CCCC1(CCC#N)C(=O)c2ccccc2OC1CCc1ccccc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCC1(CCC#N)C(=O)c2ccccc2OC1CCc1ccccc1",
+ "ref_smiles": "N#CCCC1(CCC(=O)[OH])C(=O)c2ccccc2OC1CCc1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9943668a-9906-43b8-8f4f-d3e6ec79d291",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)c1ccc(N(C)CC2CCC2)cc1N by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(N(C)CC2CCC2)cc1N",
+ "ref_smiles": "CC(=O)c1ccc(N(C)C(O)C2CCC2)cc1N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ef151fec-fefc-43d6-b172-77c52c77f99f",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C(=O)NC(c2ccccc2)c2ccc3nc(C(F)(F)F)[nH]c3c2)c(F)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)NC(c2ccccc2)c2ccc3nc(C(F)(F)F)[nH]c3c2)c(F)c1",
+ "ref_smiles": "COc1ccc(C(=O)NC(c2ccccc2)c2ccc3nc(C(F)(F)NO)[nH]c3c2)c(F)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e4e55837-48db-4f90-802e-b0c2c028d7bd",
+ "task": "delete",
+ "question": "Modify the molecule COCCN(c1cccc(O)c1)c1nc(C(C)Nc2ncnc(N)c2C#N)nn2ccc(C)c12 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN(c1cccc(O)c1)c1nc(C(C)Nc2ncnc(N)c2C#N)nn2ccc(C)c12",
+ "ref_smiles": "COCCN(c1cccc(O)c1)c1nc(C(C)c2ncnc(N)c2C#N)nn2ccc(C)c12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4e3238d3-04a9-46f3-a699-b5e598cc1efc",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C=C(C)C[NH2+]CC(O)c1cccc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C[NH2+]CC(O)c1cccc(C(F)(F)F)c1.",
+ "ref_smiles": "C=C(C)C[NH2+]CC(O)c1cccc(C(F)F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "636598f8-90bd-4384-9aa1-11e86665610d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(CNC(=O)N(C)C)CC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(CNC(=O)N(C)C)CC(=O)[O-].",
+ "ref_smiles": "COC(OH)(CNC(=O)N(C)C)CC(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "47adf1c9-f19d-4a5c-bbd4-0e75d96fb49d",
+ "task": "delete",
+ "question": "Modify the molecule CCCN1c2ccccc2NCC12CCCCCC2 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN1c2ccccc2NCC12CCCCCC2",
+ "ref_smiles": "CCCN1c2ccccc2CC12CCCCCC2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4de1944a-91d6-4f4a-a85a-b8f479ad394a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC1CN(c2ncc(C(C)=O)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CN(c2ncc(C(C)=O)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1.",
+ "ref_smiles": "CCC1CN(c2ncc(C(=O)Cc3ccccc3)cc2Cl)CC[NH+]1C1CC[NH+](Cc2ccc(Cl)cc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "66ff9806-1ecf-4236-8a36-274915e5df5d",
+ "task": "add",
+ "question": "Modify the molecule CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1",
+ "ref_smiles": "CCCc1ccc(NC(=O)CS(=O)(=O)Cc2ccc(Br)cc2)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b608055b-997b-417e-9d07-07a7688a74be",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COC(=O)NC1CC[NH+](Cc2cccc(N)c2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NC1CC[NH+](Cc2cccc(N)c2)C1.",
+ "ref_smiles": "COC(=O)NC1CC[NH+](Cc2ccccc2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6cdce640-b4ed-433d-ab91-2237764c281f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(N1CCC(n2cnc3cccnc32)CC1)C1(c2ccc(Cl)cc2)CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(N1CCC(n2cnc3cccnc32)CC1)C1(c2ccc(Cl)cc2)CCC1.",
+ "ref_smiles": "O=C(N1CCC(n2cnc3cccnc32)CC1)C1(c2ccccc2)CCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "dddcd939-cc5d-4f81-8f56-3b30b2516541",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCc1ccccc1NC(=O)Cc1ccc2[nH]c(=O)c(C)cc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1NC(=O)Cc1ccc2[nH]c(=O)c(C)cc2c1.",
+ "ref_smiles": "CCNC(=O)Cc1ccc2[nH]c(=O)c(C)cc2c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6d4da01b-99fd-4ab8-9a3a-27356d913cbf",
+ "task": "sub",
+ "question": "Modify the molecule CC(CO)C(C)NC(=O)c1cc(-c2ccc(F)cc2)n[nH]1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CO)C(C)NC(=O)c1cc(-c2ccc(F)cc2)n[nH]1",
+ "ref_smiles": "CC(CC(=O)O)C(C)NC(=O)c1cc(-c2ccc(F)cc2)n[nH]1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f8e01046-5d87-41a9-8e07-8c85ea14a637",
+ "task": "sub",
+ "question": "Modify the molecule CCN(CC)C(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cc(C(=O)N(CC)CC)ccc3Cl)CC2)c(C)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cc(C(=O)N(CC)CC)ccc3Cl)CC2)c(C)c1",
+ "ref_smiles": "CCN(CC)C(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cc(C(=O)N(CC)CC)ccc3NO)CC2)c(C)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "92f18bc8-8757-42bf-a568-e75fda80ef45",
+ "task": "add",
+ "question": "Modify the molecule O=C(CCCCCn1ccc(=O)cc1)N1CCC[NH2+]CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCCCn1ccc(=O)cc1)N1CCC[NH2+]CC1",
+ "ref_smiles": "O=C(O)C1C[NH2+]CCCN1C(=O)CCCCCn1ccc(=O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fbe2d81a-c20d-4f71-bbd7-ca8c67a44251",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(=O)[nH]c(C)c1C(F)F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(=O)[nH]c(C)c1C(F)F",
+ "ref_smiles": "Cc1cc(=O)[nH]c(C)c1C(F)NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a3fc6ce4-09e3-4152-9d74-d6021f6bf5f8",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule [C-]#[N+]c1ccc(OC23CCC(O)C(C)(C)C2CCC(C)C3(C)CC)c2c[nH]c(O)c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[C-]#[N+]c1ccc(OC23CCC(O)C(C)(C)C2CCC(C)C3(C)CC)c2c[nH]c(O)c12.",
+ "ref_smiles": "[C-]#[N+]c1ccc(OC23CCCC(C)(C)C2CCC(C)C3(C)CC)c2c[nH]c(O)c12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3825467a-3a9c-4fbe-9074-a600bfa3470b",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCNC(NCCc1ccc2c(c1)CCO2)=[NH+]Cc1ccccc1OC(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCCc1ccc2c(c1)CCO2)=[NH+]Cc1ccccc1OC(F)F.",
+ "ref_smiles": "CCNC(NCCc1ccc2c(c1)CCO2)=[NH+]COC(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e8d655c5-3293-4cef-8134-c11e6c9c2a46",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(N)cc(C)c1Oc1ccc(O)c(-c2ccc(C(F)(F)F)cc2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N)cc(C)c1Oc1ccc(O)c(-c2ccc(C(F)(F)F)cc2)c1",
+ "ref_smiles": "Cc1cc(N)cc(C)c1Oc1ccc(O)c(-c2ccc(C(F)(F)NO)cc2)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "03b4c0c9-0588-4285-8f7e-25f2afff7749",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(=O)c(CC(=O)[O-])c(N)[nH]1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(=O)c(CC(=O)[O-])c(N)[nH]1",
+ "ref_smiles": "Cc1nc(=O)c(CC(=O)[O-])c[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3041b444-2268-488b-86c6-177308d82f31",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC[NH+]1CCN(c2ccc(-c3c(CCC4=NCC=C4)cc(OC)cc3OC)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]1CCN(c2ccc(-c3c(CCC4=NCC=C4)cc(OC)cc3OC)cc2)CC1.",
+ "ref_smiles": "CC[NH+]1CCN(c2c(CCC3=NCC=C3)cc(OC)cc2OC)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "24a4e495-391f-42b1-a55a-a7a424c6af38",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C1CC1)N1CCc2cc(Br)c(S(=O)(=O)NCCCN3CC[NH+](Cc4ccccc4)CC3)cc21 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CC1)N1CCc2cc(Br)c(S(=O)(=O)NCCCN3CC[NH+](Cc4ccccc4)CC3)cc21",
+ "ref_smiles": "O=C(C1CC1)N1CCc2cc(O)c(S(=O)(=O)NCCCN3CC[NH+](Cc4ccccc4)CC3)cc21",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "90e217fd-2559-4280-be6f-4bbba0d2b922",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(-c2nc3scc(C)n3c2CC#N)cc1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nc3scc(C)n3c2CC#N)cc1",
+ "ref_smiles": "Cc1ccc(-c2nc3scc(C)n3c2C)cc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8c6f5fcd-865f-42f0-9e0e-9f4b5cae2374",
+ "task": "add",
+ "question": "Modify the molecule CCC1NC(=O)CN(Cc2cscc2C)C1=O by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1NC(=O)CN(Cc2cscc2C)C1=O",
+ "ref_smiles": "CCC1NC(=O)CN(Cc2csc(C(=O)O)c2C)C1=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "be56c88c-e442-4afc-ba37-d7db770a161d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CP(Cc1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CP(Cc1ccccc1)c1ccccc1.",
+ "ref_smiles": "CPCc1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "02f774fa-d2e9-4b06-aa39-156919f924ec",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(C(=O)Nc2ccc(Cl)c(NC(=O)CNC(=O)C3CC[NH+](C(C)C(=O)Nc4ccc(C(=O)Nc5c(F)cccc5F)cc4C)CC3)c2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)Nc2ccc(Cl)c(NC(=O)CNC(=O)C3CC[NH+](C(C)C(=O)Nc4ccc(C(=O)Nc5c(F)cccc5F)cc4C)CC3)c2)c1",
+ "ref_smiles": "Cc1cccc(C(=O)Nc2ccc([N+](=O)[O-])c(NC(=O)CNC(=O)C3CC[NH+](C(C)C(=O)Nc4ccc(C(=O)Nc5c(F)cccc5F)cc4C)CC3)c2)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8a6befbd-e4c8-4d1e-8b78-d0fdde46419c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C(O)c2cccc3c2OCCC3)c(F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(O)c2cccc3c2OCCC3)c(F)cc1F.",
+ "ref_smiles": "Cc1cc(C(O)c2cccc3c2OCCC3)ccc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bb8a1578-7055-4fc7-a715-ebbb1336b482",
+ "task": "sub",
+ "question": "Modify the molecule CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(F)cc3C)C(C)C)CC2)c1C by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(F)cc3C)C(C)C)CC2)c1C",
+ "ref_smiles": "CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(C(=O)[OH])cc3C)C(C)C)CC2)c1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "36c62c03-c5c2-4ce9-83a2-dc9b97792bce",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C(O)CC2CC2)cc1F by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(O)CC2CC2)cc1F",
+ "ref_smiles": "CC(=O)C(CC1CC1)c1ccc(OC)c(F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e970c311-9d60-4a2e-89ae-97867ddb8011",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Clc1cccc(C2CCc3cc(-c4ccccc4)oc3-n3cccc32)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cccc(C2CCc3cc(-c4ccccc4)oc3-n3cccc32)c1",
+ "ref_smiles": "O=C([OH])c1cccc(C2CCc3cc(-c4ccccc4)oc3-n3cccc32)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5560705c-ee86-4148-90e6-205e2a2afc88",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C([O-])CN1CC[NH+](CC(=O)[O-])Cc2ccc(CCC(=O)NCCO)c(n2)C[NH+](CC(=O)[O-])CC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CN1CC[NH+](CC(=O)[O-])Cc2ccc(CCC(=O)NCCO)c(n2)C[NH+](CC(=O)[O-])CC1",
+ "ref_smiles": "O=C([O-])CN1CC[NH+](CC(=O)[O-])Cc2ccc(CCC(=O)NCCI)c(n2)C[NH+](CC(=O)[O-])CC1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "dc761318-9de9-4487-bfa7-b3689b7b8813",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCc1ccc(C#CC2CCC(C3CCC(C)CC3)CC2)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(C#CC2CCC(C3CCC(C)CC3)CC2)cc1F.",
+ "ref_smiles": "CCCc1ccc(C#CC2CCC(C3CCC(C)CC3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "52c495b4-041c-42e1-b518-98aeb44274f0",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1ccc(NCC(F)(F)CO)cc1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(NCC(F)(F)CO)cc1",
+ "ref_smiles": "N#Cc1ccc(NCC(F)(F)C([N+](=O)[O-])cc1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7a21af6b-6524-4800-bd6e-bd8bb634cf7c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CSC(=O)NN=CC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSC(=O)NN=CC(C)(C)C.",
+ "ref_smiles": "CSC(=O)NN=CC(C)(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "010a2477-6c28-4e60-897d-74c725ba46a4",
+ "task": "sub",
+ "question": "Modify the molecule CCC(c1cccc(O)c1)C(C)C(=O)OC by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1cccc(O)c1)C(C)C(=O)OC",
+ "ref_smiles": "CCC(c1cccc(NO)c1)C(C)C(=O)OC",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6cd286a4-5113-4456-a76a-2249c5fa37ed",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1cccc(C(=O)OCC(=O)Nc2cc(Cl)cc(Cl)c2)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cccc(C(=O)OCC(=O)Nc2cc(Cl)cc(Cl)c2)c1",
+ "ref_smiles": "O=C(COC(=O)c1cccc(O)c1)Nc1cc(Cl)cc(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "0bc7f276-dcbf-411c-8687-0f2470180c99",
+ "task": "delete",
+ "question": "Modify the molecule C=CCn1c(COc2ccc3ccccc3c2C)nnc1SCC(=O)Nc1ccc(Br)c(C)c1C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(COc2ccc3ccccc3c2C)nnc1SCC(=O)Nc1ccc(Br)c(C)c1C",
+ "ref_smiles": "C=CCn1c(COc2ccc3ccccc3c2C)nnc1SCC(=O)Nc1cccc(C)c1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "103497be-1e99-4daf-888e-f41016bc8852",
+ "task": "add",
+ "question": "Modify the molecule CCc1cccc2c1N(C)CCCN2CC(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc2c1N(C)CCCN2CC(=O)[O-]",
+ "ref_smiles": "CCc1cccc2c1N(C)CC(c1ccccc1)CN2CC(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "23505240-25dc-47e1-93bc-970bb02b2592",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C1N(c2ccc(CO)cc2)CCN1c1ccc(-c2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1N(c2ccc(CO)cc2)CCN1c1ccc(-c2ccccc2)cc1.",
+ "ref_smiles": "O=C1N(c2ccc(-c3ccccc3)cc2)CCN1c1ccc(CO)c(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "52537aff-afb3-48b5-8d21-852172b279f6",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)NNC(=O)c1sc(-c2ccccc2)nc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)NNC(=O)c1sc(-c2ccccc2)nc1C.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(C)C)cc1C(=O)Nc1(C)nc(-c2ccccc2)s-1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f8fbe9d7-51c2-454e-b0cc-bb75b01ebc87",
+ "task": "add",
+ "question": "Modify the molecule CCC(CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1nc2ccccc2s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CO[Si](C)(C)C(C)(C)C)NS(=O)(=O)c1nc2ccccc2s1",
+ "ref_smiles": "CCC(CO[Si](C)(C)C(C)(C)Cc1ccccc1)NS(=O)(=O)c1nc2ccccc2s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3c4969e3-e407-4ec7-9188-4e83c2f3eb74",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCCCCCCC=CCCCCCCCC(=O)PNC(CO)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCC=CCCCCCCCC(=O)PNC(CO)C(=O)[O-].",
+ "ref_smiles": "CCCCCCCCC=CCCCCCCCC(=O)PNC(C)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "dd89b0be-d9dd-45f5-a832-0f4133359365",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(N(CC(=O)NCCSCc2ccccc2)S(C)(=O)=O)cc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N(CC(=O)NCCSCc2ccccc2)S(C)(=O)=O)cc1Cl",
+ "ref_smiles": "COc1ccc(N(CC(=O)NCCSCc2ccccc2)S(C)(=O)=O)cc1[N+](=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "22f1f901-0a7a-4074-93b0-ae4b223a6ad5",
+ "task": "add",
+ "question": "Modify the molecule CC1(C)CC[NH+](CCC([NH3+])c2ccccc2Br)C1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC[NH+](CCC([NH3+])c2ccccc2Br)C1",
+ "ref_smiles": "CC1(C)CC[NH+](CCC([NH3+])c2ccc(C#N)cc2Br)C1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "87155ea9-ec0b-4c4e-8400-de9742342347",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COCCOCCNc1cc(Cl)ccc1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOCCNc1cc(Cl)ccc1N.",
+ "ref_smiles": "Nc1ccc(Cl)cc1NCCOCCOCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "47e4e347-bb5d-4671-9540-9b216e0a6c6c",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC=C(c1ccccc1)c1cc2c(c3ccccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(c1ccccc1)c1cc2c(c3ccccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1.",
+ "ref_smiles": "CC=C(c1ccccc1)c1cc2c(c3cc(N)ccc13)-c1ccc(C)cc1C2(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "27480759-6a29-4fed-a23f-7a3ca879dead",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)CC(=O)c1cccc2c1OCCN2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)CC(=O)c1cccc2c1OCCN2",
+ "ref_smiles": "CCC(C)CC(=O)c1c(O)ccc2c1OCCN2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4fe11192-e972-49c5-a596-b6b755ef937f",
+ "task": "add",
+ "question": "Modify the molecule COCCNC(=O)Cc1ccc(C(C)(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCNC(=O)Cc1ccc(C(C)(C)C)cc1",
+ "ref_smiles": "COCCNC(=O)Cc1ccc(C(C)(C)Cc2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0328b462-4be3-452f-a61d-5e9c307b3293",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2ccc(C(=O)[O-])cc2C1=O",
+ "ref_smiles": "COc1ccc(-c2nc3cc(Cl)ccc3o2)cc1N1C(=O)c2cc(C(=O)[O-])cc(N)c2C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "df4286e6-6f50-4600-8318-5b903b000bd4",
+ "task": "add",
+ "question": "Modify the molecule CC(C)c1ccc(C(=O)N(C)C2CCC[NH2+]CC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(C(=O)N(C)C2CCC[NH2+]CC2)cc1",
+ "ref_smiles": "CN(C(=O)c1ccc(C(C)(C)C#N)cc1)C1CCC[NH2+]CC1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "031e58f1-e600-4a6b-8368-e9782d250e97",
+ "task": "delete",
+ "question": "Modify the molecule CC(CNC(=O)C1CCC[NH2+]C1)[NH+]1CCN(c2ccccc2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CNC(=O)C1CCC[NH2+]C1)[NH+]1CCN(c2ccccc2)CC1",
+ "ref_smiles": "CC(CC1CCC[NH2+]C1)[NH+]1CCN(c2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "039b3553-6dd4-43f4-8466-7d1e680376e3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)CC([NH3+])C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NC(CO)C(=O)NCC(=O)NC(CCC(=O)[O-])C(=O)NC(CCCC[NH3+])C(=O)NC(CCCC[NH3+])C(=O)NC(CC(=O)[O-])C(=O)NC(CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-] with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC([NH3+])C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NC(CO)C(=O)NCC(=O)NC(CCC(=O)[O-])C(=O)NC(CCCC[NH3+])C(=O)NC(CCCC[NH3+])C(=O)NC(CC(=O)[O-])C(=O)NC(CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-]",
+ "ref_smiles": "CC(C)CC([NH3+])C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1ccc(F)cc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NC(CO)C(=O)NCC(=O)NC(CCC(=O)[O-])C(=O)NC(CCCC[NH3+])C(=O)NC(CCCC[NH3+])C(=O)NC(CC(=O)[O-])C(=O)NC(CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-]",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2e03533e-e965-4c43-b659-b7e779013641",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule C[NH+]1CCC23CCCCC2C1Cc1ccc(-c2nnc(C(C)(C)O)s2)cc13.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC23CCCCC2C1Cc1ccc(-c2nnc(C(C)(C)O)s2)cc13.",
+ "ref_smiles": "CC(C)c1nnc(-c2ccc3c(c2)C24CCCCC2C(C3)[NH+](C)CC4)s1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9d26a063-0d92-4b5b-8aaf-60e1bf8dcd7a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cn1cc(CC(O)COc2cccc(Cl)c2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(CC(O)COc2cccc(Cl)c2)cn1.",
+ "ref_smiles": "Cn1cc(CC(O)(COc2cccc(Cl)c2)c3ccccc3)cn1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f010fd4c-73e5-48c5-a63b-1da270bd62db",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl.",
+ "ref_smiles": "O=C(O)CCC[NH2+]C(c1cccc(Cl)c1)c1ccncc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fb08e8af-1c90-43fb-a1f6-a98d656816ee",
+ "task": "delete",
+ "question": "Modify the molecule C#CCC1(CC=C)C(=O)CCCC1O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCC1(CC=C)C(=O)CCCC1O",
+ "ref_smiles": "C#CCC1(CC=C)CCCCC1=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7be664de-f8d1-4298-a5e9-874cf94a0228",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCNC(NCC(C)[NH+]1CCOCC1)=[NH+]CC(C)C[NH+]1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCC(C)[NH+]1CCOCC1)=[NH+]CC(C)C[NH+]1CCCCC1.",
+ "ref_smiles": "CCNC(CC(C)C[NH+]1CCCCC1)NCC(C)[NH+]1CCOCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "dbc86c32-56f7-45ca-a7a9-dcfa16e7c5f5",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOCC4)nc3)n2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOCC4)nc3)n2)c(Cl)c1",
+ "ref_smiles": "Cc1ccc(NC(=O)c2csc(-c3ccc(N4CCOC(O)C4)nc3)n2)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4334f423-b3bc-45e3-8167-ca0b32e5313c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(=O)Nc1cc(NC(=O)CCNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)Nc4cc(F)ccc4C)c3C)CC2)ccc1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1cc(NC(=O)CCNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)Nc4cc(F)ccc4C)c3C)CC2)ccc1F",
+ "ref_smiles": "CCC(=O)Nc1cc(NC(=O)CCNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)Nc4cc([N+](=O)[O-])ccc4C)c3C)CC2)ccc1F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cb3fd90b-9a7b-4d2a-b4e3-ae2a02c43b7a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(CCCSCCO)N1CCOCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCSCCO)N1CCOCC1",
+ "ref_smiles": "ONCCSCCCC(=O)N1CCOCC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b1059366-8cb3-443f-a04f-861f17b4d930",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Nc1cc(Cl)ccc1OCC1CCCO1)c1ccc(COc2ccc(F)cc2)o1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cc(Cl)ccc1OCC1CCCO1)c1ccc(COc2ccc(F)cc2)o1",
+ "ref_smiles": "O=C([OH])c1ccc(OCC2CCCO2)c(NC(=O)c2ccc(COc3ccc(F)cc3)o2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b2e644e-8722-4a52-a6c4-ca977ad74bec",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCN(C(=O)c1ccc(Cl)c(Cl)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C(=O)c1ccc(Cl)c(Cl)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1.",
+ "ref_smiles": "CCCCN(C(=O)c1cc(Cl)c(Cl)cc1-c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(OCC)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "87ab35a9-37b6-41ee-b98c-8c8bb57c7bae",
+ "task": "delete",
+ "question": "Modify the molecule CSCC(C)(O)CNC(=O)c1cn(CC[NH3+])cn1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCC(C)(O)CNC(=O)c1cn(CC[NH3+])cn1",
+ "ref_smiles": "CSCC(C)CNC(=O)c1cn(CC[NH3+])cn1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "899a98e5-6ab6-4051-9ee0-396f877790dc",
+ "task": "sub",
+ "question": "Modify the molecule N#CCN1CCN(C(=O)C2CC3CCC2C3)CC1 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCN1CCN(C(=O)C2CC3CCC2C3)CC1",
+ "ref_smiles": "ONCN1CCN(C(=O)C2CC3CCC2C3)CC1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "08df7f40-027a-4e39-809f-cd4cae0f5e90",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCCCC(CN([O-])NC(=O)c1cccc(C[NH+]2CCN(C)CC2)c1)S(=O)(=O)c1ccc(OC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC(CN([O-])NC(=O)c1cccc(C[NH+]2CCN(C)CC2)c1)S(=O)(=O)c1ccc(OC)cc1.",
+ "ref_smiles": "CCCCCCC(CN([O-])NC(=O)C[NH+]1CCN(C)CC1)S(=O)(=O)c1ccc(OC)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8afbc52a-76ba-4acc-9a9c-aeacf343916f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN(CC1COc2ccccc2O1)C(=O)CCn1nc(-c2cccs2)oc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC1COc2ccccc2O1)C(=O)CCn1nc(-c2cccs2)oc1=O.",
+ "ref_smiles": "CC(CC1COc2ccccc2O1)n1nc(-c2cccs2)oc1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0c3c944b-82b1-45c3-9f2f-db8df24937da",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=c1ccc2c(Nc3c(Cl)ccc4c3OCO4)ccnc2[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1ccc2c(Nc3c(Cl)ccc4c3OCO4)ccnc2[nH]1.",
+ "ref_smiles": "O=c1ccc2c(-c3c(Cl)ccc4c3OCO4)ccnc2[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3fe97817-e8ac-430c-8a9a-9ddfd90f94a8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1=C(C)CC(Br)(CO)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(C)CC(Br)(CO)CC1",
+ "ref_smiles": "CC1=C(C)CC(C#N)(CO)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "89868b2f-df63-49ea-ba04-cb1a464afc2d",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCCOP(=O)([O-])OC(COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)F)COP(=O)(OCCC#N)OCCCCCCOP(=O)(OCCC#N)OC(CC)COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)F by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCOP(=O)([O-])OC(COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)F)COP(=O)(OCCC#N)OCCCCCCOP(=O)(OCCC#N)OC(CC)COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)F",
+ "ref_smiles": "CCCCCOP(=O)([O-])OC(COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)C(=O)O)COP(=O)(OCCC#N)OCCCCCCOP(=O)(OCCC#N)OC(CC)COCC(CCCC(F)(F)F)(CCCC(F)(F)F)CCCC(F)(F)F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3448c65-e189-408c-a7d3-8f7467ee4fc8",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])c1ccccc1N(Br)c1ccc(-c2ccccc2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccccc1N(Br)c1ccc(-c2ccccc2)c(Cl)c1",
+ "ref_smiles": "O=C([O-])c1ccccc1N(Br)c1cc(O)c(-c2ccccc2)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "af481487-3fc1-4a06-a850-58c5de736aa2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)NCc1ccc(OC(F)F)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)NCc1ccc(OC(F)F)cc1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)NCc1ccc(OC(F)S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "62f54473-5d26-4d45-8f15-60662c3add14",
+ "task": "add",
+ "question": "Modify the molecule COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)CC1OC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)CC1OC",
+ "ref_smiles": "COC1CN(C(=O)c2cn(C3C[NH2+]C3)nn2)C(O)C1OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bf50db64-7f34-4eb1-bd14-d15ef19c7391",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCOc1ccc(Cl)cc1C(=O)N1CC2COCCC2(C(=O)[O-])C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOc1ccc(Cl)cc1C(=O)N1CC2COCCC2(C(=O)[O-])C1",
+ "ref_smiles": "COCCOc1ccc(NO)cc1C(=O)N1CC2COCCC2(C(=O)[O-])C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f55e6877-6b42-4b02-97ef-8e077d884233",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1ccc(O)c(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1ccc(O)c(OC)c1.",
+ "ref_smiles": "CCCCCCCC(C)(C)C=CCC=CCC=CCC=CCCCC(=O)NCc1cc(OC)c(O)cc1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "47c80f33-6893-4710-aa23-977faa0b25c9",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCC(NC(=O)Cc1cc(F)cc(F)c1)C(=O)[O-]",
+ "ref_smiles": "O=C(Cc1cc(F)cc(F)c1)NC(CCS)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "68f8f0f4-b12e-4796-bf73-5e8caa913146",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C2CC2B2OC(C)(C)C(C)(C)O2)cc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2CC2B2OC(C)(C)C(C)(C)O2)cc1F",
+ "ref_smiles": "Cc1ccc(C2CC2B2OC(C)(C)C(C)(C)O2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b36c83fd-a7f8-42b6-a579-4343c6748b8d",
+ "task": "add",
+ "question": "Modify the molecule c1ccc(-c2ccc(-c3ccc4c(ccc5c6cc7c(cc6ccc45)Cc4ccccc4-7)c3)cc2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(-c2ccc(-c3ccc4c(ccc5c6cc7c(cc6ccc45)Cc4ccccc4-7)c3)cc2)cc1",
+ "ref_smiles": "c1ccc(-c2cccc(-c3ccc(-c4ccc5c(ccc6c7cc8c(cc7ccc56)Cc5ccccc5-8)c4)cc3)c2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d7500d0c-bccd-4ead-b9ef-396a2dccc242",
+ "task": "delete",
+ "question": "Modify the molecule C=CC(=O)C1=CCCc2ccc(Br)cc21 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)C1=CCCc2ccc(Br)cc21",
+ "ref_smiles": "C=CC(=O)C1=CCCc2ccccc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4bbb97c6-2486-4224-80cb-1656e7902482",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cccc(C)c1NC(=O)C(c1cccc(O)c1)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C1CCC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1NC(=O)C(c1cccc(O)c1)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C1CCC1",
+ "ref_smiles": "Cc1cccc(C)c1NC(=O)C(c1cccc(Cl)c1)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C1CCC1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b87397f2-11b5-4a84-a8f8-c9d9484e8078",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1cc(CCC(=O)Oc2cccc3ccccc23)cc(OC)c1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CCC(=O)Oc2cccc3ccccc23)cc(OC)c1OC.",
+ "ref_smiles": "COc1cc(CCC(=O)Oc2c(O)ccc3ccccc23)cc(OC)c1OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "daeadb99-b953-47a6-b4bb-6f70d2dd6821",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCC([NH3+])C#Cc1cccc(OCC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC([NH3+])C#Cc1cccc(OCC)c1.",
+ "ref_smiles": "CCCC([NH3+])C#Cc1ccc(O)c(OCC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "94a80b31-1943-400a-b1a5-8447eb01f565",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCNc1nc(CC)nc(NC2CCCCCC2C)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1nc(CC)nc(NC2CCCCCC2C)c1C.",
+ "ref_smiles": "CCNc1nc(CC)nc(C2CCCCCC2C)c1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6e9bcfb6-a9a7-4eac-9ab6-58b60c6f564b",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C2CCC(OC(=O)C(C)(F)F)CC2)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2CCC(OC(=O)C(C)(F)F)CC2)cc1",
+ "ref_smiles": "Cc1ccc(C2CCC(OC(=O)C(C)(F)C(=O)[OH])CC2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8f325382-b387-4355-bfc0-18d823e4c648",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1csc(CCNS(=O)(=O)c2cccc(C#N)c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(CCNS(=O)(=O)c2cccc(C#N)c2)n1.",
+ "ref_smiles": "Cc1csc(CCNS(=O)(=O)c2ccc(O)c(C#N)c2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "30f07be3-0241-4bb3-8b88-4e8d57bb1624",
+ "task": "delete",
+ "question": "Modify the molecule CC1=C(O[Si](C)(C)C(C)(C)C)CCCCC(c2ccccc2)=C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(O[Si](C)(C)C(C)(C)C)CCCCC(c2ccccc2)=C1",
+ "ref_smiles": "CC1=C(O[Si](C)(C)C(C)(C)C)CCCCC=C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b0cd675e-81af-49a1-bc55-46b2ba3fd05a",
+ "task": "add",
+ "question": "Modify the molecule CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1",
+ "ref_smiles": "CS(=O)(=O)c1cccc(C(=O)OCCc2cc3cc(Br)ccc3o2)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e4106a2b-85eb-42d1-acec-9f92984f0cbc",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccc(-c2cc(O)c3c(C)cc(=O)cc-3o2)cc1OC with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2cc(O)c3c(C)cc(=O)cc-3o2)cc1OC",
+ "ref_smiles": "COc1ccc(-c2cc(Br)c3c(C)cc(=O)cc-3o2)cc1OC",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "beca09da-9039-4116-816c-aacf29abcd56",
+ "task": "add",
+ "question": "Modify the molecule CCC(CO)(CO)NC(=O)c1ccccc1C(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CO)(CO)NC(=O)c1ccccc1C(F)(F)F",
+ "ref_smiles": "CCC(CO)(NC(=O)c1ccccc1C(F)(F)F)C(O)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "69e3adf2-343c-44c7-9c8c-be50d75cdb24",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C1NCC=C(NNc2cccnc2)c2c1[nH]c1ccc(F)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NCC=C(NNc2cccnc2)c2c1[nH]c1ccc(F)cc21.",
+ "ref_smiles": "O=C1NCC=C(Nc2cccnc2)c2c1[nH]c1ccc(F)cc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "dae17198-e6ae-4bf7-b838-dae752ae9160",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH2+]C(COC(C)C)c1cccc(C)c1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(COC(C)C)c1cccc(C)c1Cl",
+ "ref_smiles": "CC(=O)c1c(C)cccc1C(COC(C)C)[NH2+]CCC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "91bbc46c-0a72-49fe-84cd-e4adbc5dc44f",
+ "task": "add",
+ "question": "Modify the molecule O=Cc1cc(CCCCl)ccc1CBr by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=Cc1cc(CCCCl)ccc1CBr",
+ "ref_smiles": "O=Cc1cc(CCCCl)ccc1C(Br)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b1979c47-c53d-4deb-8d94-6ab6e4eb6e72",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1c(Cl)cc2ccsc2c1[S-] with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1c(Cl)cc2ccsc2c1[S-]",
+ "ref_smiles": "CC(=O)c1cc2ccsc2c([S-])c1OCC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3ddb86ec-96e4-4220-a138-7269f9c23442",
+ "task": "delete",
+ "question": "Modify the molecule CCn1[nH]c(C=C2C(=O)Nc3ccc(S(C)(=O)=O)cc32)nc1=O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1[nH]c(C=C2C(=O)Nc3ccc(S(C)(=O)=O)cc32)nc1=O",
+ "ref_smiles": "CCn1[nH]c(Cc2cccc(S(C)(=O)=O)c2)nc1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "bd5ff72f-2ae0-450c-9bfd-97da986af368",
+ "task": "sub",
+ "question": "Modify the molecule COc1cccc(CNc2ccc(C#N)cc2Cl)c1OC by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(CNc2ccc(C#N)cc2Cl)c1OC",
+ "ref_smiles": "COc1cccc(C(=O)Nc2ccc(C#N)cc2)c1OC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7fe6e0e6-70c4-484f-9d9d-5005caaceb03",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NC(=O)NCC(=O)Nc2ccccc2)cc1Br by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)NCC(=O)Nc2ccccc2)cc1Br",
+ "ref_smiles": "Cc1ccc(NC(=O)Nc2ccccc2)cc1Br",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "06214f1d-6ae1-481a-8e34-79e8edab7c9a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Nc1ccc2c(c1)N(CCl)C(=O)CS2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc2c(c1)N(CCl)C(=O)CS2.",
+ "ref_smiles": "Nc1cc2c(cc1-c1ccccc1)SCC(=O)N2CCl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2ae49b76-0bd2-4142-997d-f831306230d2",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)CNc1nc2ccc(F)cc2[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CNc1nc2ccc(F)cc2[nH]1.",
+ "ref_smiles": "COC(=O)C(Nc1nc2ccc(F)cc2[nH]1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f45afaf6-34c9-4d82-9325-5c9a0cc096b8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOc1ccc(C(CC)[NH+]2CCCC(C(=O)[O-])C2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(CC)[NH+]2CCCC(C(=O)[O-])C2)cc1OC.",
+ "ref_smiles": "CCOc1ccc(C(CC)(c2ccccc2)[NH+]2CCCC(C(=O)[O-])C2)cc1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "014f6a09-1f13-47ca-b156-fdeed4f8791c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)Nc1ccccc1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)Nc1ccccc1F",
+ "ref_smiles": "N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)Nc1ccc(C=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fe2e0e23-19b3-434c-9eb6-e4063cf6d9b6",
+ "task": "sub",
+ "question": "Please substitute a thiol in the molecule CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C([NH3+])CS)C(=O)NC(CCC(N)=O)C(=O)[O-] with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C([NH3+])CS)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "ref_smiles": "CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C([NH3+])C(=O)H)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "thiol"
+ },
+ {
+ "id": "82590341-e7df-4423-9aae-c1b0324abf00",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OC1(Cn2cncn2)CCCCC1=C1C=CC(Cl)=CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1(Cn2cncn2)CCCCC1=C1C=CC(Cl)=CC1",
+ "ref_smiles": "O=C([OH])C1(Cn2cncn2)CCCCC1=C1C=CC(Cl)=CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "00b5b2c3-e4c1-47d0-a504-4e9aea1f3231",
+ "task": "sub",
+ "question": "Modify the molecule CNC(=O)C1CN(C(=O)CC(C)(C)CC([NH3+])C(O)CC(C)C(=O)[O-])c2ccccc21 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)C1CN(C(=O)CC(C)(C)CC([NH3+])C(O)CC(C)C(=O)[O-])c2ccccc21",
+ "ref_smiles": "CC(=O)C(CC(C)C(=O)[O-])C([NH3+])CC(C)(C)CC(=O)N1CC(C(=O)NC)c2ccccc21",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fd86401f-3f77-4fca-b664-4961cba3ad28",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CC(Br)C(=O)c1ccc(Br)s1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(Br)C(=O)c1ccc(Br)s1",
+ "ref_smiles": "CCOC(=O)CCC(=O)c1ccc(Br)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8d2c0411-314e-4cbe-8a41-056b8ba80d49",
+ "task": "add",
+ "question": "Modify the molecule CCNc1ccc(C(=O)NCCc2noc(C)n2)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1ccc(C(=O)NCCc2noc(C)n2)cc1C",
+ "ref_smiles": "Cc1nc(CCNC(=O)c2ccc(NCCO)c(C)c2)no1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4c967818-f235-410b-8fe6-4861a423b5bb",
+ "task": "add",
+ "question": "Modify the molecule O=CN(O)CC1CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=CN(O)CC1CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O",
+ "ref_smiles": "O=CN(O)CC1(c2ccccc2)CC2CCCC23CCC(C(=O)NC(=O)NCCCCO)N3C1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f5ec0d2b-972c-4515-9fe8-560475016d2e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(C)S(=O)(=O)N1CCN(C(=O)c2ccc(C(N)=[NH2+])cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)S(=O)(=O)N1CCN(C(=O)c2ccc(C(N)=[NH2+])cc2)CC1.",
+ "ref_smiles": "CC(C)S(=O)(=O)N1CCN(C(=O)c2ccc(CN)cc2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "552a659f-33e3-4390-a364-b782b48631fb",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(O)=Cc1cn(C)c2ccccc12 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(O)=Cc1cn(C)c2ccccc12",
+ "ref_smiles": "CCOC(C#N)=Cc1cn(C)c2ccccc12",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c1b95f77-c7bc-47a4-b651-7750f5b31171",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(NC(=O)OCC[Si](C)(C)C)cc(N)c1Br by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)OCC[Si](C)(C)C)cc(N)c1Br",
+ "ref_smiles": "Cc1cc(NC(=O)OCC[Si](C)(C)CO)cc(N)c1Br",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b09f416a-ffda-4a72-8b07-b11142af0d8f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(NCc1ccc2c(n1)CCCC2)c1ccn(C2CCCC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc2c(n1)CCCC2)c1ccn(C2CCCC2)n1.",
+ "ref_smiles": "c1cn(C2CCCC2)n1Cc1ccc2c(n1)CCCC2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f445ff16-c28c-4c60-9325-580a2399bc79",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(O)CNC(=O)c1cc(Br)cn1C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)CNC(=O)c1cc(Br)cn1C1CC1.",
+ "ref_smiles": "CC(O)CNC(=O)c1cccn1C1CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b1441a98-fcd6-464a-9bb9-1a2e2af120c1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCC(C(O)c1ccc2c(Cl)c(OC)ccc2c1)[NH+]1CCN(c2ccccc2OC)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(C(O)c1ccc2c(Cl)c(OC)ccc2c1)[NH+]1CCN(c2ccccc2OC)CC1",
+ "ref_smiles": "CC(=O)C(c1ccc2c(Cl)c(OC)ccc2c1)C(CCCC)[NH+]1CCN(c2ccccc2OC)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "506f7bd5-3fe5-4611-b273-dce449c9481d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(NC(=O)c1cc(F)c(N)c(F)c1)C1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NC(=O)c1cc(F)c(N)c(F)c1)C1CCCCC1.",
+ "ref_smiles": "CCC(NC(=O)c1cc(F)c(N)c(F)c1O)C1CCCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "28e31e6b-4235-422e-8942-a7d937405dd9",
+ "task": "add",
+ "question": "Modify the molecule O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl",
+ "ref_smiles": "O=[N+]([O-])c1cc(C2CCC(c3cc([N+](=O)[O-])c(Cl)cc3-c3ccccc3)N2c2ccc(-c3ccc(N4CCOCC4)nc3)cc2)ccc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "576844af-a61a-4f0c-811a-309737423aa8",
+ "task": "sub",
+ "question": "Modify the molecule N#CC1CCC(CC=O)CC1 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1CCC(CC=O)CC1",
+ "ref_smiles": "ONC1CCC(CC=O)CC1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "2e902ebb-b239-4385-9427-ad271fe92e1a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(C)OC(=O)N1CCCC(COS(C)(=O)=O)c2c1cc(O)c1ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCCC(COS(C)(=O)=O)c2c1cc(O)c1ccccc21.",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CCC(c2ccccc2)C(COS(C)(=O)=O)c2c1cc(O)c1ccccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "276953c7-a621-477e-9161-8cff76f1cb52",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)CC2C)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)CC2C)o1",
+ "ref_smiles": "Cc1ccc(CN(C)C2(C[NH3+])CC(C)(C)C(O)C2C)o1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e3fd88b0-55a2-4c3d-93bc-aa0fc0053d6c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1(C)CCCN1c1cc(F)c(Cl)cc1N with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCCN1c1cc(F)c(Cl)cc1N",
+ "ref_smiles": "CC1(C)CCCN1c1cc(C(=O)[OH])c(Cl)cc1N",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8f664d6-9391-4442-8bd4-d8dca34e67c8",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)n1cc2cc(Br)ccc2n1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1cc2cc(Br)ccc2n1",
+ "ref_smiles": "CC(C)n1cc2cc(S)ccc2n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "66edcca5-12a8-4c8a-a7ab-0637bddcfbae",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCC1CC(=O)N(Cn2cncc2CO)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC(=O)N(Cn2cncc2CO)C1.",
+ "ref_smiles": "CCCCCCn1cncc1CO",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "57a495a9-d203-41b7-a16c-7d8c763390d3",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)C(C)C1CCC2C3CCC4N(C)C(=O)CCC4(C)C3CCC12C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)C1CCC2C3CCC4N(C)C(=O)CCC4(C)C3CCC12C.",
+ "ref_smiles": "COC(=O)C(C)C1CCC2C3CCC4(C)CC4(C)C3CCC12C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "28221f50-37b7-4cd1-a57c-0ae00be20749",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]Cc1ccccc1OCC[NH+](C)Cc1ccncc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1ccccc1OCC[NH+](C)Cc1ccncc1",
+ "ref_smiles": "C[NH2+]Cc1ccccc1OCC[NH+](C)C(N)c1ccncc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "29c4c9dc-3cdf-49f0-9541-bdf868782c88",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CC.",
+ "ref_smiles": "CCC[NH2+]C(c1ncc(Cl)cc1Cl)c1nccn1CCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "129d75d2-7315-4c78-9e29-cbaed774333d",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(F)ccc1C[NH+]1C2CCC1C1C[NH2+]CC12 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(F)ccc1C[NH+]1C2CCC1C1C[NH2+]CC12",
+ "ref_smiles": "COc1cc([N+](=O)[O-])ccc1C[NH+]1C2CCC1C1C[NH2+]CC12",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1292a5b7-f43e-4f3d-a2cf-3d4e19a05d02",
+ "task": "delete",
+ "question": "Modify the molecule CC([NH2+]CCNC(=O)N(C)C)c1ccc(S(N)(=O)=O)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]CCNC(=O)N(C)C)c1ccc(S(N)(=O)=O)cc1",
+ "ref_smiles": "CC([NH2+]CCNC(=O)N(C)C)c1ccc([SH](=O)=O)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "71424b55-642b-4718-b88a-7c474d71029b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)Nc1ccc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2)cc1)Nc1ccc(Cl)cc1Cl.",
+ "ref_smiles": "O=C(Nc1ccc(N2CCN(C(=O)C3c4ccccc4Oc4ccccc43)CC2c2ccccc2)cc1)Nc1ccc(Cl)cc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bb3f2acc-67e1-450f-8114-cbf5ff4a74c3",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule BCc1cccc(-c2cccc(CBr)c2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "BCc1cccc(-c2cccc(CBr)c2)c1.",
+ "ref_smiles": "BCc1cccc(-c2cccc(C)c2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7d5a1fb0-24f9-498f-8197-3c8a0edaa607",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]C(C)C(=O)NC1CCCC1n1ccnc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)C(=O)NC1CCCC1n1ccnc1",
+ "ref_smiles": "C[NH2+]C(C)C(=O)NC1C(O)CCC1n1ccnc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fdc14c2f-36ba-4d8b-bdba-b63818e7047b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=C(COCCOCC(=O)NCCc1ccccc1)NCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COCCOCC(=O)NCCc1ccccc1)NCCc1ccccc1.",
+ "ref_smiles": "O=C(COCCOCC(=O)NCCc1ccccc1C(=O)O)NCCc1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "637fc3a4-e407-437a-9890-02b6ca4b66a6",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ccc(Oc2ccc(C=O)cc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(Oc2ccc(C=O)cc2)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(OC=O)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e3dd14b6-7dda-4a32-85f0-6d8e48fe0e85",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)Oc1ccc(-c2cnn(C)c(=O)c2C(=O)Cl)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1ccc(-c2cnn(C)c(=O)c2C(=O)Cl)cc1",
+ "ref_smiles": "CC(C)Oc1ccc(-c2cnn(C)c(=O)c2C=O)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "9f2be5c4-0446-4a22-bc93-2db8d471ee53",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#CCOc1c(I)cc(C=C(C#N)C(=O)Nc2ccc(OCc3ccccc3)cc2)cc1I with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCOc1c(I)cc(C=C(C#N)C(=O)Nc2ccc(OCc3ccccc3)cc2)cc1I",
+ "ref_smiles": "N#CCOc1c(I)cc(C=C(C#N)C(=O)Nc2ccc(OCc3ccccc3)cc2)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3c9f70d-79b3-4c6f-b1c1-9f988d134f67",
+ "task": "delete",
+ "question": "Modify the molecule Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cn(Cc2cnccn2)c1-c1ccccc1Cl by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)Nc2ccc(S(C)(=O)=O)cc2)cn(Cc2cnccn2)c1-c1ccccc1Cl",
+ "ref_smiles": "Cc1c(C(=O)NS(C)(=O)=O)cn(Cc2cnccn2)c1-c1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "67b47643-692f-4342-88fc-223e3e891e66",
+ "task": "add",
+ "question": "Modify the molecule CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)CN2C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)CN2C1=O",
+ "ref_smiles": "CC(O)C1NC(=O)C(NC(=O)c2ccc(N3CCN(c4ccc(N5CCC6(CCCC6)CC5)cc4)CC3)cc2)CC(O)CNC(=O)C2C(O)C(C)CN2C(=O)C(C(O)CC[NH3+])NC(=O)C(C(O)Cc2ccc(O)c(OCC[NH3+])c2)NC(=O)C2CC(O)(O)CN2C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8fee30c4-88c1-42af-ba17-aa435dd44d7a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1.",
+ "ref_smiles": "O=C(Nc1ccnn1Cc1ccc(Br)cc1)C1CCN(C(=O)C=Cc2ccccc2)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7d719053-2716-4fac-b155-cb379dcb4e1d",
+ "task": "add",
+ "question": "Modify the molecule C=C1CC(=O)N(c2ccccc2Br)C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C1CC(=O)N(c2ccccc2Br)C1=O",
+ "ref_smiles": "C=C1C(=O)N(c2ccccc2Br)C(=O)C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ea2ad84b-38df-4413-b928-b1b23e87e732",
+ "task": "delete",
+ "question": "Modify the molecule COC(C[NH3+])CC(=O)Nc1cc(CC(C)(C)C)[nH]n1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C[NH3+])CC(=O)Nc1cc(CC(C)(C)C)[nH]n1",
+ "ref_smiles": "COC(C[NH3+])c1cc(CC(C)(C)C)[nH]n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0450a9fd-2b2e-4083-8e57-5bc9b4b49e8a",
+ "task": "add",
+ "question": "Modify the molecule CCC(=O)C1CC(c2ccccc2)C[NH+]1CC by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)C1CC(c2ccccc2)C[NH+]1CC",
+ "ref_smiles": "CCC(=O)C1CC(c2cccc(C(=O)O)c2)C[NH+]1CC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5afa15b8-b973-454c-a5e0-44a8a6580587",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(C(=O)N(C)C2CCCC(O)C2O)nnn1-c1ccccc1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)N(C)C2CCCC(O)C2O)nnn1-c1ccccc1",
+ "ref_smiles": "Cc1c(C(=O)N(C)C2CCCC(S)C2O)nnn1-c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "19a09269-2dd4-40f9-9833-d0818915ad0e",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC1SC(=S)N(CC(=O)NC(C)C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1SC(=S)N(CC(=O)NC(C)C)C1=O.",
+ "ref_smiles": "CCSC(=S)CC(=O)NC(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "cbe9e9c5-5d8d-4d20-8a6f-dad2c6c75885",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(-c2noc(C3CC(=O)N(c4cccc(Cl)c4)C3)n2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-c2noc(C3CC(=O)N(c4cccc(Cl)c4)C3)n2)cc1",
+ "ref_smiles": "CCOc1ccc(-c2noc(C3CC(=O)N(c4ccccc4)C3)n2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "13dd2526-4d2f-45ef-85be-f2fe33a6649f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cn1c(SCc2nc3ccccc3c(=O)n2CC#N)nnc1-c1ccc(F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(SCc2nc3ccccc3c(=O)n2CC#N)nnc1-c1ccc(F)cc1.",
+ "ref_smiles": "Cn1c(SCc2nc3ccccc3c(=O)n2CC#N)nnc1-c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b01fc776-db0a-4131-9be0-5a12a7eade75",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nccnc1N1CC[NH+](CC(=O)Nc2cc(Cl)ccc2F)CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nccnc1N1CC[NH+](CC(=O)Nc2cc(Cl)ccc2F)CC1",
+ "ref_smiles": "Cc1nccnc1N1CC[NH+](CC(=O)Nc2cc(C(=O)O)ccc2F)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cf8d8539-7ffd-4559-807e-4cee23d52971",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)Cc1[nH]n(-c2ccc(F)cc2Cl)c(=O)c1C(CCl)=NCc1ccccc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1[nH]n(-c2ccc(F)cc2Cl)c(=O)c1C(CCl)=NCc1ccccc1",
+ "ref_smiles": "COC(=O)Cc1[nH]n(-c2ccc(O)cc2Cl)c(=O)c1C(CCl)=NCc1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7cc4ebc0-bc16-42df-aefb-340a59f07498",
+ "task": "add",
+ "question": "Modify the molecule CCC[NH+](CCC)CCCC(C)(O)C[NH3+] by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+](CCC)CCCC(C)(O)C[NH3+]",
+ "ref_smiles": "CCC[NH+](CCC)CC(N)CC(C)(O)C[NH3+]",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "9b394ce2-7589-466c-9764-7300ef849fd1",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C=CC(=O)OCC(=O)N1CCCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)OCC(=O)N1CCCC1=O.",
+ "ref_smiles": "C=C(C(=O)O)C(=O)OCC(=O)N1CCCC1=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "81ef42e9-0fd5-420e-88b5-6454ad466395",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CC1C[NH2+]CCCc1ccc(N)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC1C[NH2+]CCCc1ccc(N)cc1",
+ "ref_smiles": "CC1(C)CC1C[NH2+]CCCN",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "da49e6c3-759a-4208-8f71-37f47531df80",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)N(CCNC(=O)CCc1ccccc1)c1ccc(F)c(Cl)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(CCNC(=O)CCc1ccccc1)c1ccc(F)c(Cl)c1",
+ "ref_smiles": "CC(=O)N(CCNC(=O)CCc1ccccc1)c1ccc(S)c(Cl)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8779ba9f-9105-4e66-a64b-46bff3520c5c",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)CCCC4)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)CCCC4)cc1",
+ "ref_smiles": "Cc1ccc(Cn2c(=O)c3c4c(sc3n(CC(=O)[O-])c2=O)C(c2ccccc2)CCC4)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3e7a2c2b-efdb-4d8d-8e40-c6caba7e5d34",
+ "task": "add",
+ "question": "Modify the molecule CCCOc1cccc(N)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cccc(N)n1",
+ "ref_smiles": "Nc1cccc(OCCCc2ccccc2)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1c446e4f-300d-45b4-a5cf-7b5eedf3145b",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(c1ccc(Br)cc1)N1CCN(C(=O)c2cscn2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccc(Br)cc1)N1CCN(C(=O)c2cscn2)CC1.",
+ "ref_smiles": "O=C(c1ccccc1)N1CCN(C(=O)c2cscn2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "87f45a1a-8c9c-4df3-92b0-26c2f7bcdeea",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc(Nc2ccc(S(C)(=O)=O)cc2F)c2c(n1)N(C1CCN(C(=O)OC(C)C)CC1)CCO2 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(Nc2ccc(S(C)(=O)=O)cc2F)c2c(n1)N(C1CCN(C(=O)OC(C)C)CC1)CCO2",
+ "ref_smiles": "CC(=O)c1cc(S(C)(=O)=O)ccc1Nc1nc(C)nc2c1OCCN2C1CCN(C(=O)OC(C)C)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3bdef453-9138-4dd7-b603-16e1f830e0a5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)CC1.",
+ "ref_smiles": "COc1ccc(C(N)=O)cc1NC(=O)C(C)NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(C(=O)Nc3cccc(F)c3)cc2C)C(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6cd042b5-3ee7-4e05-81d5-d57a0dbd85c9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCc1noc(N)c1-c1cccc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1noc(N)c1-c1cccc(C(F)(F)F)c1.",
+ "ref_smiles": "CCCc1noc(N)c1-c1cc(C(F)(F)F)ccc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "492cf29f-623d-45ed-9739-c9ad7cd31bb6",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C1CC(=O)N(c2cc(Br)ccc2Br)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC(=O)N(c2cc(Br)ccc2Br)C1.",
+ "ref_smiles": "O=C1CC(=O)N(c2ccccc2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "293b2a09-c7e5-4b89-a769-a575240f19be",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CSCC(c2cc(Cl)sc2Cl)[NH2+]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CSCC(c2cc(Cl)sc2Cl)[NH2+]1.",
+ "ref_smiles": "Clc1cc(C2CSCC(Cc3ccccc3)[NH2+]2)c(Cl)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e84ff32e-b005-4cfe-a152-2618e124e572",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)c1nc(Br)c2c(cc(-c3ccccc3)c(=O)n2C(C)c2ccccc2)c1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1nc(Br)c2c(cc(-c3ccccc3)c(=O)n2C(C)c2ccccc2)c1O.",
+ "ref_smiles": "COC(=O)c1ncc2c(cc(-c3ccccc3)c(=O)n2C(C)c2ccccc2)c1O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e738aea4-5506-43a3-90b9-21d87bc47874",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc2[nH]c(=O)n(C3CCC[NH2+]3)c(=O)c12 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc2[nH]c(=O)n(C3CCC[NH2+]3)c(=O)c12",
+ "ref_smiles": "Cc1cccc2[nH]c(=O)n(C3CCC(C(=O)O)[NH2+]3)c(=O)c12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ae3483a1-9b69-4154-bf8b-7ef1a3da9af8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]CCN(CCc1ccccc1)S(=O)(=O)c1ccc(F)c(F)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCN(CCc1ccccc1)S(=O)(=O)c1ccc(F)c(F)c1",
+ "ref_smiles": "[NH3+]CCN(CCc1ccccc1)S(=O)(=O)c1ccc(S)c(F)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7c4a76d0-3ee3-4f59-96f9-49cca60cc0c1",
+ "task": "add",
+ "question": "Modify the molecule CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2C)cn1",
+ "ref_smiles": "CCOCn1cc(NC(=O)Cn2nc([N+](=O)[O-])c([N+](=O)[O-])c2CO)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b91707f9-0604-45ce-8b9e-f0bf0132f302",
+ "task": "sub",
+ "question": "Modify the molecule CCC1CC(C)CCC1[NH2+]C(C)(C)CO by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CC(C)CCC1[NH2+]C(C)(C)CO",
+ "ref_smiles": "CCC1CC(C)CCC1[NH2+]C(C)(C)CNO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3bdfeb25-a326-43c4-adcc-99a368b7a358",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1=CCC2C[NH2+]C(O)c3cc([nH]c32)-c2cccc3ncc(nc23)NC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CCC2C[NH2+]C(O)c3cc([nH]c32)-c2cccc3ncc(nc23)NC1.",
+ "ref_smiles": "CC1=CCC2C[NH2+]Cc3cc([nH]c32)-c2cccc3ncc(nc23)NC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "767b6528-e6e9-4905-a0f9-6616c7ee3498",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CC12CC3CC(CC(C3)C1)C2)N1CCc2[nH]ccc2C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC12CC3CC(CC(C3)C1)C2)N1CCc2[nH]ccc2C1",
+ "ref_smiles": "c1cc2c([nH]1)CCC2C12CC3CC(CC(C3)C1)C2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "4d53d1a7-7a27-48b0-9bc4-59e66608a22e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+]1CCC(CNc2ccc(Br)c(Cl)c2)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(CNc2ccc(Br)c(Cl)c2)CC1",
+ "ref_smiles": "CC(=O)c1ccc(NCC2CC[NH+](C)CC2)cc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "690dafd7-ebbb-41bd-ac44-6530150d1b65",
+ "task": "delete",
+ "question": "Modify the molecule C=C(C)CS(=O)CC(=O)Nc1ccccc1C(=O)OC by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)CS(=O)CC(=O)Nc1ccccc1C(=O)OC",
+ "ref_smiles": "C=C(C)CS(=O)c1ccccc1C(=O)OC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "aaf06576-07a5-4f56-8fac-bbb5410afb54",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])Cn1cc(NS(=O)(=O)c2cccc(Cl)c2Cl)cn1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])Cn1cc(NS(=O)(=O)c2cccc(Cl)c2Cl)cn1",
+ "ref_smiles": "O=C([O-])Cn1cc(NS(=O)(=O)c2cccc(C(=O)[OH])c2Cl)cn1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "43235002-918b-41cc-84ae-0dc8c6b64ba9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)c1ccc(N2C(=O)C(Cl)=C(Nc3ccccc3Sc3ccccc3)C2=O)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(N2C(=O)C(Cl)=C(Nc3ccccc3Sc3ccccc3)C2=O)cc1",
+ "ref_smiles": "CC(=O)c1ccc(N2C(=O)C(O)=C(Nc3ccccc3Sc3ccccc3)C2=O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "92238714-c87e-4902-988e-e9406e1da29c",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)C1CN(c2ccc(C[NH3+])c(C(F)(F)F)c2)C1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1CN(c2ccc(C[NH3+])c(C(F)(F)F)c2)C1",
+ "ref_smiles": "CC(C)C1CN(c2ccc(C[NH3+])c(C(F)(F)C#N)c2)C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aea95a98-c1a4-46b7-88cd-e5b7784dd94f",
+ "task": "sub",
+ "question": "Modify the molecule FC(F)(F)c1cc(-c2ccc(Br)cc2)n(CC[NH+]2CCOCC2)n1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cc(-c2ccc(Br)cc2)n(CC[NH+]2CCOCC2)n1",
+ "ref_smiles": "FC(F)(S)c1cc(-c2ccc(Br)cc2)n(CC[NH+]2CCOCC2)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1e0ff36a-d016-4753-bc7b-a873143c36d2",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CC(O)(Cc2ccc(Cl)cc2)C(C)(C)O1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC(O)(Cc2ccc(Cl)cc2)C(C)(C)O1",
+ "ref_smiles": "CC1(C)CC(O)(Cc2ccccc2)C(C)(C)O1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4d32e4d0-2421-46db-abae-ef4763f08284",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(OCCCC(=O)N(C)Cc2ccc(C(F)(F)F)cc2)cc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OCCCC(=O)N(C)Cc2ccc(C(F)(F)F)cc2)cc1",
+ "ref_smiles": "COc1ccc(OCCCC(=O)N(C)Cc2ccc(C(F)(F)S)cc2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d87e3577-863b-4a09-beef-39906f360c97",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCOc1ccc(C[NH+]=C(NCC)NCC2CC[NH+](C3CC3)C2)c(OC(F)F)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(C[NH+]=C(NCC)NCC2CC[NH+](C3CC3)C2)c(OC(F)F)c1",
+ "ref_smiles": "CC(=O)C(F)Oc1cc(OCCC)ccc1C[NH+]=C(NCC)NCC1CC[NH+](C2CC2)C1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b78edde7-7c19-411c-9f45-aae0e0a62928",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1nc(Cl)c(I)c(CC(C)C)n1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc(Cl)c(I)c(CC(C)C)n1",
+ "ref_smiles": "CCCc1nc(O)c(I)c(CC(C)C)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "65468923-ef1a-4c1c-b3ad-9a3096c34c8b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNC(=O)Cn1c(=S)[nH]c2ccc(Cl)cc21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)Cn1c(=S)[nH]c2ccc(Cl)cc21",
+ "ref_smiles": "CCNC(=O)Cn1c(=S)[nH]c2ccc(S)cc21",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0a39d042-6f8a-4098-8c04-6d74bc8431d9",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule OC(CCCOc1ccc(Br)cc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(CCCOc1ccc(Br)cc1)c1ccccc1.",
+ "ref_smiles": "Brc1ccc(OCCCCc2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3d9646d4-bfc6-433e-8077-978124ad576a",
+ "task": "add",
+ "question": "Modify the molecule O=C=NC=C(N=C=O)C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C=NC=C(N=C=O)C1CCCCC1",
+ "ref_smiles": "O=C=NC(=C(N=C=O)C1CCCCC1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "be816b55-def0-4471-a4c0-20e0b20d70ee",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCOc1cccnc1NCC1CCC(Cl)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cccnc1NCC1CCC(Cl)CC1",
+ "ref_smiles": "CCCOc1cccnc1NCC1CCC(NO)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b0ab53cf-09f1-4156-8a2a-f1f99b682356",
+ "task": "add",
+ "question": "Modify the molecule CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1",
+ "ref_smiles": "CCCCC([NH3+])c1cc(OCC)c(OCC)c(OCC)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2233491f-4a57-4649-a58d-555f0679a10a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12.",
+ "ref_smiles": "CC(C)(C(=S)OCC[NH+]1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)c(C(=O)O)c32)CC1)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ddbd8b74-d3e4-462b-ac3e-bf55d414fa4d",
+ "task": "add",
+ "question": "Modify the molecule CCCCCC(C)[NH2+]Cc1cc(CC)no1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(C)[NH2+]Cc1cc(CC)no1",
+ "ref_smiles": "CCCCCC(C)[NH2+]Cc1cc(CCO)no1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "abb1e1b0-feca-4d02-8d8f-d864595d8bf6",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCCCCCCCCC=CCCCCC(O)C(O)C(COC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)NC(=O)C(O)CCCCCCCCCCCCCC with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCC=CCCCCC(O)C(O)C(COC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)NC(=O)C(O)CCCCCCCCCCCCCC",
+ "ref_smiles": "CCCCCCCCCCCCC=CCCCCC(NO)C(O)C(COC1OC(CO)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O)NC(=O)C(O)CCCCCCCCCCCCCC",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ef42162c-19b3-41b7-a694-db0696e89a92",
+ "task": "sub",
+ "question": "Modify the molecule OCCCC[NH+](CC#Cc1ccc(Cl)cc1)C1CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCCC[NH+](CC#Cc1ccc(Cl)cc1)C1CC1",
+ "ref_smiles": "N#Cc1ccc(C#CC[NH+](CCCCO)C2CC2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fe31ee7f-a7c5-436d-8fcb-1195f634004f",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=C([O-])c1cccc2c(-c3cnc4ccccc4c3)n[nH]c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1cccc2c(-c3cnc4ccccc4c3)n[nH]c12.",
+ "ref_smiles": "O=C(O)c1ccc2cc(-c3n[nH]c4c(C(=O)[O-])cccc34)cnc2c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f1f8823b-71e3-4606-b6a8-604b905c9b56",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C)n1NC1CCCC1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)n1NC1CCCC1O.",
+ "ref_smiles": "Cc1cc(-c2ccccc2)c(C)n1NC1CCCC1O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e9f6c00a-456f-495a-82be-5f8f4310d78d",
+ "task": "sub",
+ "question": "Modify the molecule CCCCOC(=O)CC1(C(=O)[O-])CC(c2ccc(O)cc2)=NO1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOC(=O)CC1(C(=O)[O-])CC(c2ccc(O)cc2)=NO1",
+ "ref_smiles": "CCCCOC(=O)CC1(C(=O)[O-])CC(c2ccc(Cl)cc2)=NO1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "595ddbd4-63c8-4b6a-bb97-f2ea27468f47",
+ "task": "add",
+ "question": "Modify the molecule CN(CCc1ccccn1)c1nc(NN)ncc1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCc1ccccn1)c1nc(NN)ncc1Cl",
+ "ref_smiles": "CN(CCc1cccc(C(=O)O)n1)c1nc(NN)ncc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "04f5102a-f659-4f0b-bb3e-36b98ee2b8d8",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1c(-c2ccc(Cl)c(Cl)c2)cc(-c2cc3cc(Br)ccc3nc2Cl)nc1N by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(-c2ccc(Cl)c(Cl)c2)cc(-c2cc3cc(Br)ccc3nc2Cl)nc1N",
+ "ref_smiles": "Nc1nc(-c2cc3cc(Br)ccc3nc2Cl)cc(-c2ccc(Cl)c(Cl)c2)c1S",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8d6b27ef-ab87-45f2-a102-d43c95fa9159",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C1c2cc(C3CC3c3ccc4cc(C(N)=[NH2+])ccc4c3)ccc2CC[NH+]1CC1CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1c2cc(C3CC3c3ccc4cc(C(N)=[NH2+])ccc4c3)ccc2CC[NH+]1CC1CC1",
+ "ref_smiles": "CC(C)C1c2cc(C3CC3c3ccc4cc(C=[NH2+])ccc4c3)ccc2CC[NH+]1CC1CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7f872d3a-b9bd-453f-9436-735b95962415",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C1OCC2C(CCc3ccccc3)N12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1OCC2C(CCc3ccccc3)N12.",
+ "ref_smiles": "CCC1C2COC(=O)N12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d920882b-4174-4df4-ad42-caa569f5d169",
+ "task": "sub",
+ "question": "Modify the molecule CS(=O)(=O)CCOc1ccc(Cl)cc1NC(=O)C[NH2+]CC1CC1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CCOc1ccc(Cl)cc1NC(=O)C[NH2+]CC1CC1",
+ "ref_smiles": "CS(=O)(=O)CCOc1ccc(CHO)cc1NC(=O)C[NH2+]CC2CC2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6870321f-f44f-49b1-b291-c112f972ae04",
+ "task": "delete",
+ "question": "Modify the molecule Cc1c(NS(=O)(=O)c2ccc(CCCC3CC[NH+](C)CC3)cc2)c(CC2CC2)nn1C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NS(=O)(=O)c2ccc(CCCC3CC[NH+](C)CC3)cc2)c(CC2CC2)nn1C",
+ "ref_smiles": "Cc1c(S(=O)(=O)c2ccc(CCCC3CC[NH+](C)CC3)cc2)c(CC2CC2)nn1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5418ed9e-9471-4ad1-9f8b-4ae99753953b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cn1[nH]c(=O)c2nc3ccccc3nc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1[nH]c(=O)c2nc3ccccc3nc21.",
+ "ref_smiles": "Cn1[nH]c(=O)c2nc3ccc(-c4ccccc4)cc3nc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "41091302-f4e6-4b9c-84e2-f0694bc8cb8b",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C)cc(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1",
+ "ref_smiles": "Cc1cc(C)c(N)c(C(=O)N2CC(c3nc(-c4cccnc4N(C)C)no3)C2)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "64b56cee-d169-4de7-8146-a85be3a7c56e",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccc(N)cc1B(O)O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(N)cc1B(O)O",
+ "ref_smiles": "Nc1ccc(S)c(B(O)O)c1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "997db714-66f8-4a26-bf83-522ca31c6943",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)C(C(=O)OCC1CC=CCC1C)N1CCCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(C(=O)OCC1CC=CCC1C)N1CCCC1=O.",
+ "ref_smiles": "CCC(C(=O)OCC1CC=CCC1C)C(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c758742c-db49-4a7e-866a-c838d43aa206",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)C1CCCN1c1ccc(I)cc1N with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCCN1c1ccc(I)cc1N",
+ "ref_smiles": "NC(=O)C1CCCN1c1ccc(NO)cc1N",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "513219a8-3f12-4bdf-b9f5-1fc840ac933b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1ccnc(Nc2ccc(C(=O)[O-])c(C)c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccnc(Nc2ccc(C(=O)[O-])c(C)c2)n1.",
+ "ref_smiles": "Cc1ccnc(Nc2cc(C)c(C(=O)[O-])cc2C(=O)O)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0f0bbafe-e38d-4d60-8f9d-a491e29b3d86",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc2c(Cl)c(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)sc2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(Cl)c(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)sc2c1",
+ "ref_smiles": "Cc1cc2sc(C3=NC(=Cc4ccccc4OC(=O)c4sc5cc([N+](=O)[O-])ccc5c4Cl)C(=O)O3)c(Cl)c2cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "035f68a0-a460-40f8-a7cc-b7109973764c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]Cc1ccc(S(=O)(=O)NCc2ccc(Br)s2)cc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1ccc(S(=O)(=O)NCc2ccc(Br)s2)cc1Cl",
+ "ref_smiles": "C[NH2+]Cc1ccc(S(=O)(=O)NCc2ccc(C(=O)O)s2)cc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "76f2a37b-7705-450a-8cdb-2baf8808d51c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1)NCCCCC(=O)OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1)NCCCCC(=O)OC.",
+ "ref_smiles": "CCNC(=NCC(c1ccc(OC)cc1)[NH+]1CCOCC1c1ccccc1)NCCCCC(=O)OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "960d6f62-4007-4ef0-a72f-8f7e2e4692a9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)Nc3c(C)cccc3C(=O)Nc3ccc(C)c(F)c3)CC2)c1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)Nc3c(C)cccc3C(=O)Nc3ccc(C)c(F)c3)CC2)c1C",
+ "ref_smiles": "CCC(C)NC(=O)c1cccc(NC(=O)C(C)[NH+]2CCC(C(=O)Nc3c(C)cccc3C(=O)Nc3ccc(C)c(NO)c3)CC2)c1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e6383ada-4cfa-491d-a138-bd4d522eb41e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)c(S(=O)(=O)NCc2cnoc2C2CC2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(S(=O)(=O)NCc2cnoc2C2CC2)c(C)c1.",
+ "ref_smiles": "CCCS(=O)(=O)NCc1cnoc1C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "395d96d1-1269-4891-a5c1-1ebacd531149",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCOC(=O)CCC(=O)CCCc1ccc2c(c1)CCO2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCC(=O)CCCc1ccc2c(c1)CCO2.",
+ "ref_smiles": "CCOC(=O)CCC(=O)CCCc1ccc2c(c1)C(N)CO2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "178543ae-098c-4f17-988a-afffaf0cd3f4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cccc2c1nc(CCl)n2C1(C)CCOCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc2c1nc(CCl)n2C1(C)CCOCC1",
+ "ref_smiles": "COc1cccc2c1nc(CO)n2C1(C)CCOCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "80968d87-dcdf-4c74-b719-3d8b0445b8ae",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NC(=S)NCc2ccco2)c(Br)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=S)NCc2ccco2)c(Br)c1",
+ "ref_smiles": "Cc1ccc(C(=S)NCc2ccco2)c(Br)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b1d5a76d-ea82-4a36-8126-81d85134136b",
+ "task": "add",
+ "question": "Modify the molecule O=C(CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1)NC1CC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1)NC1CC1",
+ "ref_smiles": "NC1CC1NC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2cc(F)ccc2F)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "87a777de-70e7-4c34-95f3-217a57dd49ca",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(Cn2c(CCc3cc4ccccc4[nH]3)nnc2C(Cc2c[nH]c3ccccc23)NC(=O)C2([NH3+])CC[NH2+]CC2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cn2c(CCc3cc4ccccc4[nH]3)nnc2C(Cc2c[nH]c3ccccc23)NC(=O)C2([NH3+])CC[NH2+]CC2)cc1",
+ "ref_smiles": "COCn1c(CCc2cc3ccccc3[nH]2)nnc1C(Cc1c[nH]c2ccccc12)NC(=O)C1([NH3+])CC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1b1ef2f9-a00e-4cc4-a432-6eab47929b41",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1nn(C)c2c1[nH]c(=S)n2-c1ccc(I)cc1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nn(C)c2c1[nH]c(=S)n2-c1ccc(I)cc1Cl",
+ "ref_smiles": "CCC(=O)c1nn(C)c2c1[nH]c(=S)n2-c1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "174e5875-87c8-4fbe-8b12-43c6ca350b2e",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+]=C(NCCCCOCCc1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCCCOCCc1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1.",
+ "ref_smiles": "C[NH+]=C(NCCC(COCCc1ccccc1)c1ccccc1)NC1CC[NH+](Cc2ccccc2)C(C)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a014af65-0731-4b05-adb8-0db909f55b64",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)CSCC(=O)c1c(C)cc(C)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)CSCC(=O)c1c(C)cc(C)cc1C",
+ "ref_smiles": "CCC(C)C(O)SCC(=O)c1c(C)cc(C)cc1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6e850f83-4251-473e-9375-ee8ee2417bf1",
+ "task": "add",
+ "question": "Please add a amine to the molecule C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(COCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(COCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C.",
+ "ref_smiles": "C=CC1=C(C)C2=NC1=CC1=NC(=CC3=C(C)C4=C(O)CC(=C5NC(=C2)C(C)C5CCC(=O)OCc2ccc(OC=COc5ccc(C(N)OCCC[Si](OC)(OC)OC)cc5)cc2)C4=N3)C(CC)=C1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "dd67c01a-f51f-4311-af70-ba3b9b13537f",
+ "task": "add",
+ "question": "Modify the molecule CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2C)cnc1N by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2C)cnc1N",
+ "ref_smiles": "CON(C)C(=O)c1nc(-c2cc(S(=O)(=O)N3CCOCC3)ccc2CO)cnc1N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "657b55a6-aeb4-4eeb-b326-4e931cbfd82c",
+ "task": "add",
+ "question": "Modify the molecule CC(OC(=O)C=Cc1ccccc1)C(=O)c1ccc(NS(C)(=O)=O)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC(=O)C=Cc1ccccc1)C(=O)c1ccc(NS(C)(=O)=O)cc1",
+ "ref_smiles": "CC(OC(=O)C=Cc1cccc(O)c1)C(=O)c1ccc(NS(C)(=O)=O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ecc9744d-344a-4cb4-a360-236d8905f535",
+ "task": "delete",
+ "question": "Modify the molecule CCN(Cc1ccccc1)C(=O)C[NH+]1CCC(NS(C)(=O)=O)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1)C(=O)C[NH+]1CCC(NS(C)(=O)=O)CC1",
+ "ref_smiles": "CCN(C)C(=O)C[NH+]1CCC(NS(C)(=O)=O)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3d63bfe9-2c94-426b-ada3-d051bfdc5c88",
+ "task": "sub",
+ "question": "Modify the molecule ClC(c1ccccc1)c1nnc(-c2cnns2)o1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "ClC(c1ccccc1)c1nnc(-c2cnns2)o1",
+ "ref_smiles": "CC(=O)C(c1ccccc1)c1nnc(-c2cnns2)o1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "96329397-3a1a-4e1f-b90c-80c7a7b46c3a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(C)C[NH+](C)CCCl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C)C[NH+](C)CCCl",
+ "ref_smiles": "COC(C)C[NH+](C)CCO",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "32e5b8a1-2f41-4aff-ac69-8aacb1ee59ed",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule NS(=O)(=O)c1cccc(Cl)c1CCCCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)c1cccc(Cl)c1CCCCO.",
+ "ref_smiles": "NS(=O)(=O)c1cc(C(=O)O)cc(Cl)c1CCCCO",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "200a7518-5a48-4bff-95e2-7e25bd75b316",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C[NH2+]C1CCC(C(C)C)CC1CCOCCCOC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C1CCC(C(C)C)CC1CCOCCCOC.",
+ "ref_smiles": "C[NH2+]C1CCC(C(C)(C)C(=O)O)CC1CCOCCCOC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "be00909b-2514-4323-82a4-dce32ff44269",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN(C)C(=O)NCCNC(=O)COC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)NCCNC(=O)COC(C)(C)C.",
+ "ref_smiles": "CN(C)C(=O)NCCOC(C)(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "cc1aa8bf-cd23-44a3-a366-0bc408eff292",
+ "task": "sub",
+ "question": "Modify the molecule Fc1ccc(Nc2nnc(-c3c(F)cc(F)cc3F)n2N=Cc2c(F)cccc2F)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(Nc2nnc(-c3c(F)cc(F)cc3F)n2N=Cc2c(F)cccc2F)cc1",
+ "ref_smiles": "Oc1ccc(Nc2nnc(-c3c(F)cc(F)cc3F)n2N=Cc2c(F)cccc2F)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d54d2042-ef51-4373-a7fb-861fbf157b63",
+ "task": "add",
+ "question": "Modify the molecule CC1CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2",
+ "ref_smiles": "CC1(O)CCN(C(=O)C2CCCN2C(N)=O)CC12CCC2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fef5b848-93e3-4d87-91b8-088036d63ab0",
+ "task": "add",
+ "question": "Modify the molecule Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2)nc1C(N)=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2)nc1C(N)=O",
+ "ref_smiles": "Cc1sc(SCSC2=C(C(=O)[O-])N3C(=O)C(NC(=O)Cc4ccccc4)C3SC2N)nc1C(N)=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "9198c683-d3eb-4083-a34a-205d0cbbc205",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)NC(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(F)c(NC(=O)c4cccc(F)c4)c3)CC2)c(C)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(F)c(NC(=O)c4cccc(F)c4)c3)CC2)c(C)c1",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)CNC(=O)C2CC[NH+](CC(=O)Nc3ccc(C(=O)NC(C)CC)cc3C)CC2)cc1NC(=O)c1cccc(F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc77532c-9ccc-4e03-b53c-555ff7137c67",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C=Cc1cccc(OCCC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=Cc1cccc(OCCC)c1.",
+ "ref_smiles": "C=C(O)c1cccc(OCCC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7cfd09a0-c78e-4a15-b363-4c7aa11469d9",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])c1ccccc1-c1cc2ccccc2cc1C(=O)[O-] by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccccc1-c1cc2ccccc2cc1C(=O)[O-]",
+ "ref_smiles": "O=C([O-])c1cc2ccccc2cc1C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3aa50c69-d706-447f-977c-c33555ba28d1",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule COc1ccc(CCNC(=O)CO)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCNC(=O)CO)cc1OC.",
+ "ref_smiles": "COc1ccc(CCNC(=O)C)cc1OC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b60d582a-3ae2-4896-89f4-824de69c1037",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CNC(=O)c1ccc(OC2CC2)cc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1ccc(OC2CC2)cc1C#N.",
+ "ref_smiles": "CNC(=O)c1ccc(OC2(O)CC2)cc1C#N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fc4bfc51-4333-4053-90fa-183036f672d8",
+ "task": "add",
+ "question": "Modify the molecule CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccccc1",
+ "ref_smiles": "CCCC(C(=O)OC)c1c(Cl)nc(N2CCCCC2)nc1-c1ccc(-c2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b6ae8d16-f7a8-4d71-b1b1-4e30d6e6975f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(CNC(=O)c2ccc(NC(=O)C3CC3)cc2N2CCOCC2)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CNC(=O)c2ccc(NC(=O)C3CC3)cc2N2CCOCC2)o1.",
+ "ref_smiles": "Cc1ccc(Cc2ccc(cc2N2CCOCC2)o1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "76cae3b5-f016-4503-bb42-3a289d264c05",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CSCCCNc1ccc(OC(F)F)c(Cl)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCCNc1ccc(OC(F)F)c(Cl)c1",
+ "ref_smiles": "CSCCCNc1ccc(OC(F)C#N)c(Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a1ea1e57-149b-4c19-b1ef-523c81534905",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1cc(C[NH2+]C2(CCl)CC2)nn1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(C[NH2+]C2(CCl)CC2)nn1",
+ "ref_smiles": "Cn1cc(C[NH2+]C2(CNO)CC2)nn1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "69cee75e-0a8c-4cde-8e9f-b29453d06fb8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1nc2c(C(N)=O)cc(N3CCOCC3)cc2n1Cc1ccccc1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc2c(C(N)=O)cc(N3CCOCC3)cc2n1Cc1ccccc1Cl",
+ "ref_smiles": "CC(=O)c1ccccc1Cn1c(CCC)nc2c(C(N)=O)cc(N3CCOCC3)cc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "77923e5a-e68c-4cd0-9ca2-d8fac22aba89",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCOc1[nH+]c(C(=O)NCC2CCN(C(=O)NC(C)C)CC2)cc(N)c1C#N with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1[nH+]c(C(=O)NCC2CCN(C(=O)NC(C)C)CC2)cc(N)c1C#N",
+ "ref_smiles": "CCOc1[nH+]c(C(=O)NCC2CCN(C(=O)NC(C)C)CC2)cc(N)c1S",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "fce2c0a5-00d1-4d39-a770-a2a32caaab24",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule N#Cc1ccncc1OCCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccncc1OCCCc1ccccc1.",
+ "ref_smiles": "CCCOc1cnccc1C#N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c4aaad8d-e1b5-42aa-af68-c0d3c162271a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)cs2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3)cs2)cc1.",
+ "ref_smiles": "Cc1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2nc(C(=O)N3CCC(n4c(=O)[nH]c5ccccc54)CC3O)cs2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "016dcb96-8a74-4039-8fa6-d0b0077d17fa",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1ccc2[nH]cc(CCNN(c3ccccc3)S(=O)[O-])c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2[nH]cc(CCNN(c3ccccc3)S(=O)[O-])c2c1.",
+ "ref_smiles": "COc1ccc2[nH]cc(CCN(c3ccccc3)S(=O)[O-])c2c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "08e8f558-246f-4c4b-8f4e-fdaf14f8df61",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)C(=O)C(Cc1cccc(C(F)(F)F)c1)NC(=O)c1ncn(-c2cc(Cl)c([O-])c(Cl)c2)n1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)C(Cc1cccc(C(F)(F)F)c1)NC(=O)c1ncn(-c2cc(Cl)c([O-])c(Cl)c2)n1",
+ "ref_smiles": "CC(C)(C)C(=O)C(Cc1cccc(C(F)(F)C#N)c1)NC(=O)c1ncn(-c2cc(Cl)c([O-])c(Cl)c2)n1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dfa4b661-4956-4d21-bef4-d8c473c47e38",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1cccc(C(=O)NC2CCN(C(=O)c3ccccc3C(=O)[O-])CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C(=O)NC2CCN(C(=O)c3ccccc3C(=O)[O-])CC2)c1.",
+ "ref_smiles": "COc1cccc(C(=O)NC2CCC(c3(C(=O)[O-])cccc3)C2)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d5586e03-6c57-4dbf-b55c-c08de82cad4c",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cccs2)cc(C(F)(F)F)c1C#N",
+ "ref_smiles": "Cc1cccc(C)c1NC(=O)C(C)Sc1nc(-c2cc(S)cs2)cc(C(F)(F)F)c1C#N",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "12d5e595-f794-464c-a05f-ade12eceacbe",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(NC(=O)CCNc2ccccc2C(C)C)cc1C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)CCNc2ccccc2C(C)C)cc1C",
+ "ref_smiles": "Cc1ccc(NC(=O)CCNc2ccccc2C(C)Cc2ccccc2)cc1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "539e0c30-acdb-4510-ae73-cac2a85b92a6",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)NC(=O)C1CC1C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)C1CC1C1CC1.",
+ "ref_smiles": "CC(C)(NC(=O)C1CC1C1CC1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c4bd1ff2-5afb-48f4-9925-bbe34208ca18",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(C2[NH2+]C(CC)C(=O)N2CC)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C2[NH2+]C(CC)C(=O)N2CC)cc1",
+ "ref_smiles": "CCc1ccc(C2[NH2+]C(CC)C(=O)N2C(C)C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dd4faa3e-7598-4dbe-af5b-f309d985f551",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C1C[NH+](C2CCC(NC(=O)Cc3ccc4c(c3)CCC4)C2O)CCN1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C[NH+](C2CCC(NC(=O)Cc3ccc4c(c3)CCC4)C2O)CCN1.",
+ "ref_smiles": "O=C(Cc1ccc2c(c1)CCC2)NC1CCC([NH+]2CC2)C1O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1d032687-22f7-48be-90a9-a7c9bc8e15af",
+ "task": "delete",
+ "question": "Modify the molecule C=CCOCC(O)C=CCC by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOCC(O)C=CCC",
+ "ref_smiles": "C=CCOCCC=CCC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "36e29e79-383b-402d-85df-ef06eaf7ff17",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1C.",
+ "ref_smiles": "Cc1cccc(N2CCN(c3ncnc(Sc4cccc5cccnc45)c3N)CC2)c1CN",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "94613fbc-6560-4586-9d74-51ad27e36817",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(C)n1ccnc(N2CCOCC2CC(=O)[O-])c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)n1ccnc(N2CCOCC2CC(=O)[O-])c1=O.",
+ "ref_smiles": "CC(C)(C)n1c(-c2ccccc2)cnc(N3CCOCC3CC(=O)[O-])c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9562a282-ddf5-434d-b4b3-c9ec0cdb27d8",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(Cl)c(C(F)(F)F)c1N by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)c(C(F)(F)F)c1N",
+ "ref_smiles": "COc1cccc(C(F)(F)F)c1N",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "65e8337d-4e0c-402d-acd4-4cfdf98cb6b6",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)CC1)c1ccc(OC)c(OC)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)CC1)c1ccc(OC)c(OC)c1",
+ "ref_smiles": "CCCCCCCCC(C#N)(CCC[NH+]1CCC(C(O)c2ccc(F)cc2)C(S)C1)c1ccc(OC)c(OC)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "8c209c57-a5af-4a76-ac7d-74dd4275c630",
+ "task": "add",
+ "question": "Modify the molecule CC1C(c2ccccc2)c2ccccc2C1(C)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C(c2ccccc2)c2ccccc2C1(C)c1ccccc1",
+ "ref_smiles": "CC1C(C)(c2ccccc2)c2ccccc2C1(c1ccccc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9748d0fb-a6cc-455c-bb22-3e1bdf1580f8",
+ "task": "delete",
+ "question": "Modify the molecule CCCCn1ccc(-c2cc(OCC[NH+]3CCOCC3)ccc2OC(C)C)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1ccc(-c2cc(OCC[NH+]3CCOCC3)ccc2OC(C)C)c(NC(=O)Nc2c(C(C)C)cccc2C(C)C)c1=O",
+ "ref_smiles": "CCCCn1ccc(-c2cc(OCC[NH+]3CCOCC3)ccc2OC(C)C)c(NC(=O)NC(C)(C)C(C)C)c1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d734816c-2676-425c-8de9-ccc29aade25c",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CS(=O)(=O)CCn1c(CO)cc2cc([N+](=O)[O-])ccc21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CCn1c(CO)cc2cc([N+](=O)[O-])ccc21",
+ "ref_smiles": "CS(=O)(=O)CCn1c(CO)cc2cc([SH]=O)ccc21",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "415b665d-276d-45bb-adba-f40ccfb4ed28",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nn(Cc2ccc(Cl)cc2)c(C)c1NC(=O)c1cnn2c(C(F)F)cc(-c3ccccc3)nc12 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(Cc2ccc(Cl)cc2)c(C)c1NC(=O)c1cnn2c(C(F)F)cc(-c3ccccc3)nc12",
+ "ref_smiles": "Cc1nn(Cc2ccc(C(=O)[OH])cc2)c(C)c1NC(=O)c1cnn2c(C(F)F)cc(-c3ccccc3)nc12",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "30e0a407-59a9-4774-bdcc-f36b893a3d5f",
+ "task": "delete",
+ "question": "Modify the molecule CCN(C)C(=O)C[NH2+]Cc1ccc(NC(C)=O)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(C)C(=O)C[NH2+]Cc1ccc(NC(C)=O)cc1",
+ "ref_smiles": "CCN(C)C(=O)C[NH2+]CNC(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "16081792-8a10-47a3-b692-9bd5d20883c6",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)([O-])OCC(O)COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)([O-])OCC(O)COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
+ "ref_smiles": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)([O-])OCC(C#N)COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5a4027a4-27bc-4790-96c9-e83024669c0f",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1c(C[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C.",
+ "ref_smiles": "Cc1c(C(N)[NH+]2CCCC2c2cncc(C[NH+]3CCCC3)n2)cnn1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "9c7a0b99-6b82-4322-a9bc-123bc4577f5d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)CCC1(C)CNC(=O)CO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCC1(C)CNC(=O)CO1.",
+ "ref_smiles": "CC(C)CCC1(CO)CNC(=O)CO1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fbe887ff-2909-43bc-8770-86b4eccdf0df",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+]=C(NCc1cccc(OC)c1)NCc1c(F)cccc1OC(F)F by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1cccc(OC)c1)NCc1c(F)cccc1OC(F)F",
+ "ref_smiles": "C[NH+]=C(NCc1cccc(OC)c1)NCc1c(O)cccc1OC(F)F",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1dc7a03e-57a0-4117-a7e4-7436d5556cf2",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCN(CC1CCC[NH2+]1)c1ccc(C(=O)N(C)C)nn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC1CCC[NH2+]1)c1ccc(C(=O)N(C)C)nn1.",
+ "ref_smiles": "CCN(CC1CCC[NH2+]1)c1cc-n(CC)n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0689c643-096b-4713-9bb1-dc420b67e39a",
+ "task": "sub",
+ "question": "Modify the molecule CC(CCCCNC(=O)C=CC=Cc1ccccc1)C(=O)NO by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCCCNC(=O)C=CC=Cc1ccccc1)C(=O)NO",
+ "ref_smiles": "CC(CCCCNC(=O)C=CC=Cc1ccccc1)C(=O)NI",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "33349736-7c9c-41ed-b265-680e254d6296",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN1c2nc(C3=CCC(NC(=O)c4ccon4)CC3)ccc2N(CC2CC2(F)F)S1(O)O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1c2nc(C3=CCC(NC(=O)c4ccon4)CC3)ccc2N(CC2CC2(F)F)S1(O)O",
+ "ref_smiles": "CN1c2nc(C3=CCC(NC(=O)c4ccon4)CC3)ccc2N(CC2CC2(F)NO2)S1(O)O",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7df4d83c-d670-4439-8cbe-ef81b7d33fb5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NCC3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NCC3)cc1.",
+ "ref_smiles": "N#Cc1ccc(-n2nc(Cc3ccccc3)c3c2NC(c2ccccc2)C3)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "37b83778-7921-4d05-8f1d-607677872eb1",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)Cc1nn(C)c(=O)c2c(Br)n(Cc3ccc(-c4ccccc4)cc3)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cc1nn(C)c(=O)c2c(Br)n(Cc3ccc(-c4ccccc4)cc3)cc12.",
+ "ref_smiles": "CC(C)Cc1nn(C)c(=O)c2cn(Cc3ccc(-c4ccccc4)cc3)cc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "820112c8-a77c-4a96-958d-6b4ab082e62f",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3)cc1",
+ "ref_smiles": "COc1ccc(C2NC(=O)N(CC(=O)N3CCOCC3)C3=C2C(=O)OC3N)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "11c43a5c-bf50-48c4-8357-c7da2f4f6d8c",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC)C(Cc1cccc(Cl)c1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C(Cc1cccc(Cl)c1)C(=O)[O-]",
+ "ref_smiles": "CCC(CC)C(Cc1cc(Cl)cc(-c2ccccc2)c1)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "93cde473-644c-4be0-8360-68a1aaf49f6a",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1c(CO)cc(Cl)cc1S(=O)(=O)NC1CCCCC1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(CO)cc(Cl)cc1S(=O)(=O)NC1CCCCC1C.",
+ "ref_smiles": "Cc1cc(Cl)cc(S(=O)(=O)NC2CCCCC2C)c1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7ebf4760-485c-4108-846e-a14d506f94da",
+ "task": "add",
+ "question": "Modify the molecule CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1",
+ "ref_smiles": "CC[NH+](CC)CCNC(=O)c1cc(NC(=O)C2CC2)ccc1N1CCCC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a4245ad2-504b-427f-aef5-016a83f26f25",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CCOC(=O)C(C#N)c1ccc([N+](=O)[O-])cc1CN(C)C(=O)OCc1ccccc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(C#N)c1ccc([N+](=O)[O-])cc1CN(C)C(=O)OCc1ccccc1",
+ "ref_smiles": "CCOC(=O)C(C#N)c1ccc(I=O)cc1CN(C)C(=O)OCc1ccccc1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "ec766670-d71e-423d-ad19-205ded758931",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc2c(c1)c(C1C(c3ccc(OC)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2c(c1)c(C1C(c3ccc(OC)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C",
+ "ref_smiles": "COc1ccc2c(c1)c(C1C(c3ccc(OC)c(O)c(OC)c3)=C(O)C(=O)N1c1cc(F)ccc1F)cn2C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d5620f20-8061-4745-9285-60fee2cc6578",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3)cc2C)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3)cc2C)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCC(C)CC5)c4C)CC3C#N)cc2C)cc1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "5acd9de6-234d-44b8-9ceb-992679d31cce",
+ "task": "delete",
+ "question": "Modify the molecule C#CCCOc1ncc(I)cn1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCCOc1ncc(I)cn1",
+ "ref_smiles": "C#CCCOc1ncccn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b51ce0d-5c62-4e62-bc46-444424f3c5ea",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(c1cccc(F)c1-n1nccn1)N1CCOCC1Cc1cccc(-c2ncon2)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc(F)c1-n1nccn1)N1CCOCC1Cc1cccc(-c2ncon2)c1",
+ "ref_smiles": "O=C(c1cccc(O)c1-n1nccn1)N1CCOCC1Cc1cccc(-c2ncon2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2c44bee7-6bed-4bec-8e28-2afbc48c539f",
+ "task": "sub",
+ "question": "Modify the molecule CCNC(=O)C1=C(C)NC(C)=C(C(=O)NCCC[NH+]2CCC(C(=O)OC)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1 by substituting a nitro with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)C1=C(C)NC(C)=C(C(=O)NCCC[NH+]2CCC(C(=O)OC)(c3ccccc3)CC2)C1c1ccc([N+](=O)[O-])cc1",
+ "ref_smiles": "CCNC(=O)C1=C(C)NC(C)=C(C(=O)NCCC[NH+]2CCC(C(=O)OC)(c3ccccc3)CC2)C1c1ccc(S)cc1",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "71f2cc21-0fc9-4d4d-842b-882f8c1c743f",
+ "task": "delete",
+ "question": "Modify the molecule C=S1CC(CC=O)=C(C)N2C(=O)C(NP)C21 by removing a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=S1CC(CC=O)=C(C)N2C(=O)C(NP)C21",
+ "ref_smiles": "C=S1CC=C(C)N2C(=O)C(NP)C21",
+ "add_group": null,
+ "remove_group": "aldehyde"
+ },
+ {
+ "id": "ad5541dd-ccd2-4ed5-95f0-ec8fb55f11ef",
+ "task": "delete",
+ "question": "Modify the molecule Oc1c(C2CCc3ccccc3C2O)ccc2ccccc12 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1c(C2CCc3ccccc3C2O)ccc2ccccc12",
+ "ref_smiles": "Oc1c(C2CCc3ccccc3C2)ccc2ccccc12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2c09bde0-6be9-4825-8a41-3f10262d8cfa",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(=O)CCOCCC(C)C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)CCOCCC(C)C)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)CCOCCC(C)CO)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "766a7536-17bc-4ef5-97da-7496c3266766",
+ "task": "add",
+ "question": "Modify the molecule CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC",
+ "ref_smiles": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COC1OC(COC2OC(C(O)O)C(O)C(O)C2O)C(O)C(O)C1O)OC(=O)CCCCCC=CCC=CCC=CCC=CCCCCC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fd187cff-821a-4ede-8c3d-6e69fe1d04e6",
+ "task": "add",
+ "question": "Modify the molecule CCCCN(CCCC)C(=S)Nc1ccccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(CCCC)C(=S)Nc1ccccn1",
+ "ref_smiles": "CCCCN(C(=S)Nc1ccccn1)C(O)CCC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "05d09003-fa82-453f-b483-3b2c9db47631",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]Cc1cc(Cl)cc(S(=O)(=O)N(C)C(C)CSC)c1Cl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1cc(Cl)cc(S(=O)(=O)N(C)C(C)CSC)c1Cl",
+ "ref_smiles": "C[NH2+]Cc1cc(C#N)cc(S(=O)(=O)N(C)C(C)CSC)c1Cl",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f6c145ee-ef9c-489d-bb21-8dc23978dbd4",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(CC(=O)N(C)C(CO)C(=O)[O-])c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CC(=O)N(C)C(CO)C(=O)[O-])c1",
+ "ref_smiles": "CCC(=O)N(C)C(CO)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "977c1a9c-c48f-4624-be5e-b6540a708b50",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(F)cc3)oc12 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc2c(=O)cc(C(=O)Nc3ccc(F)cc3)oc12",
+ "ref_smiles": "Cc1cccc2c(=O)c(C(=O)O)c(C(=O)Nc3ccc(F)cc3)oc12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b2afe2b0-1f28-487b-9a96-b4ff9af79b69",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1ccc(F)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1ccc(F)c(Cl)c1.",
+ "ref_smiles": "CNc1nn2c(C)cc(C[NH3+])nc2c1S(=O)c1cc(Cl)c(F)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0802044f-e027-4297-9c23-56f6e506838f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(NC(=O)CCc2ccccc2C)c(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)CCc2ccccc2C)c(Br)c1.",
+ "ref_smiles": "CCCC(=O)Nc1ccc(C)cc1Br",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c03bc919-5537-44ee-a13c-39660415c776",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)CNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCN(c1ccc2c(c1)OCO2)S(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CNC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCCN(c1ccc2c(c1)OCO2)S(C)(=O)=O.",
+ "ref_smiles": "CC(C)CNC(=O)C(C)C(Cc1ccc(Cl)c(Cl)c1)CN(c1ccc2c(c1)OCO2)S(C)(=O)=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8205d554-9319-4928-9261-a050eb05468d",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C(N)=[NH+]O)ccc1C[NH2+]Cc1ccc(Br)s1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(N)=[NH+]O)ccc1C[NH2+]Cc1ccc(Br)s1",
+ "ref_smiles": "CC(=O)[NH+]=C(N)c1ccc(C[NH2+]Cc2ccc(Br)s2)c(C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2437fd28-86d2-4e5a-b345-ef8d4d70867c",
+ "task": "add",
+ "question": "Please add a amine to the molecule C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1CCN(c2ncccc2Cl)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1CCN(c2ncccc2Cl)C1.",
+ "ref_smiles": "C[NH+]=C(NCC(C1CCOC1)[NH+]1CCOCC1)NC1(N)CCN(c2ncccc2Cl)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "63483d33-5dbe-4765-acda-004a2808f7a9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)SI with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)SI",
+ "ref_smiles": "CC(=O)SNO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1e2cc659-0ece-4d98-980a-afc92d0eefc6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1ccc(C(=O)N(NCCCl)c2cc(C(=O)Nc3cc(C(=O)Nc4cc(C(=O)NCCC(N)=[NH2+])n(C)c4)n(C)c3)n(C)c2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(C(=O)N(NCCCl)c2cc(C(=O)Nc3cc(C(=O)Nc4cc(C(=O)NCCC(N)=[NH2+])n(C)c4)n(C)c3)n(C)c2)cc1",
+ "ref_smiles": "CCCc1ccc(C(=O)N(NCCC(=O)O)c2cc(C(=O)Nc3cc(C(=O)Nc4cc(C(=O)NCCC(N)=[NH2+])n(C)c4)n(C)c3)n(C)c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "833c9d23-e3d4-4342-9f9b-915f6a2fce7f",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C(O)CCC(F)(F)F)sc1Cl by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(O)CCC(F)(F)F)sc1Cl",
+ "ref_smiles": "Cc1cc(C(O)CCC(F)(F)S)sc1Cl",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "09c3e3e0-b090-46ff-9f08-b9c5e1069406",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1ccc(NC2=C(c3ccc(F)cc3)C(=O)N(c3ccc(N(C)C)cc3)C2=O)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC2=C(c3ccc(F)cc3)C(=O)N(c3ccc(N(C)C)cc3)C2=O)cc1Cl.",
+ "ref_smiles": "COc1ccc(C2=C(c3ccc(F)cc3)C(=O)N(c3ccc(N(C)C)cc3)C2=O)cc1Cl",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d099e06a-31e7-4ab4-a6bc-e3ba2517cf85",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(c1ccc2c(c1)CCCN2)N1CCCC2CCCCC21 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1ccc2c(c1)CCCN2)N1CCCC2CCCCC21",
+ "ref_smiles": "O=S(=O)(c1ccc2c(c1)CCC2)N1CCCC2CCCCC21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "17a25ca4-ea17-49e4-8c8c-baa271741912",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C(=O)N1CCCCO1)N1C(=O)c2ccc(Br)cc2C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)N1CCCCO1)N1C(=O)c2ccc(Br)cc2C1=O.",
+ "ref_smiles": "O=C(C(Cc1ccccc1)N1C(=O)c2ccc(Br)cc2C1=O)N1CCCCO1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7cbcf7ce-fb18-4b78-9e08-58d14af69979",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCN(CCC)C(=O)CN1CCN(c2ccc(C(C)C)cc2)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCC)C(=O)CN1CCN(c2ccc(C(C)C)cc2)C1=O.",
+ "ref_smiles": "CCCN(CCC)C(=O)CN1CCN(C(C)C)C1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0b38dd49-55cc-4cb3-a0f8-8794109c9bbe",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1c(N)cc(S(=O)(=O)Nc2cc(Cl)nc(Cl)n2)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(N)cc(S(=O)(=O)Nc2cc(Cl)nc(Cl)n2)cc1F.",
+ "ref_smiles": "Cc1c(N)cc(S(=O)(=O)c2cc(Cl)nc(Cl)n2)cc1F",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d0c1d779-a46b-40fe-9e42-eb1c998c8699",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC=C(C=C(CCC(F)(F)F)C(F)(F)F)C[NH+](C1CC(CC)N(c2nc(N3CCC(C(=O)OCC)CC3)ncc2Cl)C1)C1N=CC(N2CCOC2=O)=CN1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(C=C(CCC(F)(F)F)C(F)(F)F)C[NH+](C1CC(CC)N(c2nc(N3CCC(C(=O)OCC)CC3)ncc2Cl)C1)C1N=CC(N2CCOC2=O)=CN1.",
+ "ref_smiles": "CC=C(C=C(CCC(F)F)C(F)(F)F)C[NH+](C1CC(CC)N(c2nc(N3CCC(C(=O)OCC)CC3)ncc2Cl)C1)C1N=CC(N2CCOC2=O)=CN1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2adb5d08-321d-4b7e-a98a-b38e1937e1a1",
+ "task": "add",
+ "question": "Modify the molecule COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCC[NH+]2CCN(C)CC2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2)nc(OCC[NH+]2CCN(C)CC2)n1",
+ "ref_smiles": "COc1nc(Nc2ccc(C#N)c(OCC=C(C)C)c2O)nc(OCC[NH+]2CCN(C)CC2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c3c9766b-dbc1-44a6-a15c-1d8a0aba8255",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOC(CC[NH+](CCOC)CC(C)C)OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(CC[NH+](CCOC)CC(C)C)OCC.",
+ "ref_smiles": "CCOC(CC[NH+](CCOC)CC(C)C)OC(C)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "25d22ba4-5c4e-4819-ae53-c3511a286b35",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(CC2c3ccccc3Sc3ccccc32)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CC2c3ccccc3Sc3ccccc32)cc1",
+ "ref_smiles": "CCC1c2ccccc2Sc2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "23491106-be14-4b57-bca1-03c4772930c9",
+ "task": "add",
+ "question": "Modify the molecule CNc1cc(N(C)C2CCCCC2)nc(C2CC2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc(N(C)C2CCCCC2)nc(C2CC2)n1",
+ "ref_smiles": "CNc1cc(N(C)C2CCC(O)CC2)nc(C2CC2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "62a6adbd-a274-4334-9aa0-ecb7bcd3fe19",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccncc1CNC(=O)CC1C[NH2+]C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccncc1CNC(=O)CC1C[NH2+]C1",
+ "ref_smiles": "Cc1ccncc1CC1C[NH2+]C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "820195ab-768b-40b8-b3ef-9ec928efd870",
+ "task": "sub",
+ "question": "Modify the molecule O=C(C1CC1c1cc(F)ccc1F)N1CC[NH2+]CC1c1ccccc1Cl by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CC1c1cc(F)ccc1F)N1CC[NH2+]CC1c1ccccc1Cl",
+ "ref_smiles": "O=C(C1CC1c1c(C=O)cc(F)cc1)N1CC[NH2+]CC1c1ccccc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5418ad07-3b8c-4337-8214-5be9186ccfc2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1cccc(Sc2c(C)n(CC(=O)OC(C)(C)C)c3c(F)c(Cl)ccc23)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cccc(Sc2c(C)n(CC(=O)OC(C)(C)C)c3c(F)c(Cl)ccc23)c1",
+ "ref_smiles": "CCOC(=O)c1cccc(Sc2c(C)n(CC(=O)OC(C)(C)C)c3c([N+](=O)[O-])c(Cl)ccc23)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7995d114-dde2-4c02-923e-ecf3a081ec5e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(c1nc2ccccc2s1)N(C)CCS(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1nc2ccccc2s1)N(C)CCS(C)(=O)=O.",
+ "ref_smiles": "CN(CCS(C)(=O)=O)C(CO)c1nc2ccccc2s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3f9c2c66-0a0c-449b-91ef-9e7c0141ab2b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#Cc1c(C(F)(F)F)cc(C2CC2)nc1SCCC(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(C(F)(F)F)cc(C2CC2)nc1SCCC(=O)[O-]",
+ "ref_smiles": "N#Cc1c(C(F)(F)S)cc(C2CC2)nc1SCCC(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ead203a3-e08a-4fae-ae70-d3afaa431ad2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=CC(C)c1cc(NC(=O)c2ccc(OC(C)(F)F)cn2)ccc1F)OC(N)=[NH2+] with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=CC(C)c1cc(NC(=O)c2ccc(OC(C)(F)F)cn2)ccc1F)OC(N)=[NH2+]",
+ "ref_smiles": "CC(=CC(C)c1cc(NC(=O)c2ccc(OC(C)(O)F)cn2)ccc1F)OC(N)=[NH2+]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d721f0ac-da81-425f-8eb7-4468dbdee50e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CN(CC1CC(O)C1)c1ccc(C(N)=S)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC1CC(O)C1)c1ccc(C(N)=S)c(Cl)c1.",
+ "ref_smiles": "CN(CC1(O)CC(O)C1)c1ccc(C(N)=S)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b7be7186-161d-4d77-a269-19fb9f8db1a0",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1CCC(C(C)C)C([NH+](Cc2ccc(O)c(C[NH+](C3CC(C)CCC3C(C)C)C3CC(C)CCC3C(C)C)c2C[NH+](C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(C(C)C)C([NH+](Cc2ccc(O)c(C[NH+](C3CC(C)CCC3C(C)C)C3CC(C)CCC3C(C)C)c2C[NH+](C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C1.",
+ "ref_smiles": "CC1CCC(C(C)C)C([NH+](Cc2cccc(C[NH+](C3CC(C)CCC3C(C)C)C3CC(C)CCC3C(C)C)c2C[NH+](C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C2CC(C)CCC2C(C)C)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e7476004-b04f-429a-ab78-936a235c9f76",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CCCCC(O)C([NH3+])CCO by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCCC(O)C([NH3+])CCO",
+ "ref_smiles": "[NH3+]C(CCCC(O)C([NH3+])CCO)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6d18d3ae-0bca-4cee-bc47-3667c989747f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC[NH2+]Cc1cn(-c2cc(Cl)cc(C(F)(F)F)c2)nn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]Cc1cn(-c2cc(Cl)cc(C(F)(F)F)c2)nn1.",
+ "ref_smiles": "CCC[NH2+]Cc1cn(-c2cc(Cl)c(O)c(C(F)(F)F)c2)nn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1bc29e05-5442-4077-9af1-c01b9a7522e8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=Cc1ccc(-c2cccc(CN(C)C(=O)c3ccc(C(F)(F)F)cc3)c2)c(OC)c1)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=Cc1ccc(-c2cccc(CN(C)C(=O)c3ccc(C(F)(F)F)cc3)c2)c(OC)c1)C(=O)[O-]",
+ "ref_smiles": "CCOC(=Cc1ccc(-c2cccc(CN(C)C(=O)c3ccc(C(F)(F)S)cc3)c2)c(OC)c1)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5e8dd84c-4c73-49f0-b7a8-e4fd65cc8c23",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCOc1ccccc1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCOc1ccccc1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1",
+ "ref_smiles": "O=C(CCOc1ccccc1)N1CCN(S(=O)(=O)c2ccc(C(=O)O)s2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d8954cfc-2f53-4f3b-87da-21bf46ce2e84",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCOc1ccnc(NCCOCC(F)(F)F)n1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccnc(NCCOCC(F)(F)F)n1",
+ "ref_smiles": "CCCOc1ccnc(NCCOCC(O)(F)F)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bd680b94-e31e-413d-b27b-b9fa645c3a1c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(F)ccc1NC(C)C(=O)NC(C)(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(F)ccc1NC(C)C(=O)NC(C)(C)C",
+ "ref_smiles": "COc1cc(NO2)ccc1NC(C)C(=O)NC(C)(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b41d8223-1a19-45f4-a122-bd1d91a67769",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1cccc(C)c1NC(=O)c1ccc(Br)o1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(C)c1NC(=O)c1ccc(Br)o1",
+ "ref_smiles": "CCc1cccc(C)c1NC(=O)c1ccc(NO)o1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "be913c6d-44e4-4029-804c-5f4bc3e6e051",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1nn(Cc2ccc(Cl)cc2[N+](=O)[O-])c(C)c1CO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(Cc2ccc(Cl)cc2[N+](=O)[O-])c(C)c1CO.",
+ "ref_smiles": "Cc1nn(C(Cl)[N+](=O)[O-])c(C)c1CO",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3d421302-5dd0-45c1-8446-64a6b0fc08e5",
+ "task": "add",
+ "question": "Modify the molecule C=CC=C(C)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC=C(C)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1",
+ "ref_smiles": "CC(=CC=Cc1ccccc1)C[NH+]1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7775d0f5-9873-4d3c-afb8-187ff2c86274",
+ "task": "sub",
+ "question": "Modify the molecule CCNC(=NCc1ccc(F)c(Cl)c1)N[NH3+] by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=NCc1ccc(F)c(Cl)c1)N[NH3+]",
+ "ref_smiles": "CCNC(=NCc1ccc([N+](=O)[O-])c(Cl)c1)N[NH3+]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "34d8363b-a90c-43a2-908d-8e8376e34909",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=S(=O)(c1cncc(F)c1)N1CCCC(c2nc(C(F)(F)F)cs2)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1cncc(F)c1)N1CCCC(c2nc(C(F)(F)F)cs2)C1",
+ "ref_smiles": "CC(=O)c1cncc(S(=O)(=O)N2CCCC(c3nc(C(F)(F)F)cs3)C2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "388a4448-34b9-4549-bbcf-852937b299b0",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)C.",
+ "ref_smiles": "Cc1c(C(=O)[O-])nnn1CC(=O)NCCC(C)CC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "67486275-06c8-431b-9484-8960b5f25558",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)CCCl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)CCCl.",
+ "ref_smiles": "Cn1cc([N+](=O)[O-])cc1COP(=O)(N(CCCl)CCCl)N(CCCl)C(N)CCl",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "2347e6f1-8e8e-4f51-a812-d8b1dbdc5950",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Nc1ccc(F)c(S(=O)(=O)NCc2ccc(Br)cc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(F)c(S(=O)(=O)NCc2ccc(Br)cc2)c1.",
+ "ref_smiles": "Nc1cccc(S(=O)(=O)NCc2ccc(Br)cc2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "67cbb299-9f5c-4517-bff7-d6ca134187bb",
+ "task": "sub",
+ "question": "Modify the molecule Cn1cnnc1CC[NH2+]CCCOCC(F)(F)F by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cnnc1CC[NH2+]CCCOCC(F)(F)F",
+ "ref_smiles": "Cn1cnnc1CC[NH2+]CCCOCC(F)(F)S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a88c95c2-56a6-4d86-8362-6b22ef9344c5",
+ "task": "sub",
+ "question": "Modify the molecule Fc1ccc(-c2ccc(C[NH2+]Cc3cccs3)o2)cc1Cl by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(-c2ccc(C[NH2+]Cc3cccs3)o2)cc1Cl",
+ "ref_smiles": "O=Cc1ccc(-c2ccc(C[NH2+]Cc3cccs3)o2)cc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "84bef176-d317-44e1-b451-06fcaf4bd369",
+ "task": "add",
+ "question": "Modify the molecule O=C1C(=Cc2c(N3CCC4(CC3)OCCO4)nc3ccccn3c2=O)SC(=S)N1Cc1ccc(F)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(=Cc2c(N3CCC4(CC3)OCCO4)nc3ccccn3c2=O)SC(=S)N1Cc1ccc(F)cc1",
+ "ref_smiles": "NC1COC2(CCN(c3nc4ccccn4c(=O)c3C=C3SC(=S)N(Cc4ccc(F)cc4)C3=O)CC2)O1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "87173907-9bef-4821-aba4-a3c7adb74f38",
+ "task": "delete",
+ "question": "Modify the molecule CCCN1C[NH+](CCC)C=C2NC(c3ccc(OCC#Cc4cccc(F)c4)cc3)[NH+]=C21 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN1C[NH+](CCC)C=C2NC(c3ccc(OCC#Cc4cccc(F)c4)cc3)[NH+]=C21",
+ "ref_smiles": "CCCN1C[NH+](CCC)C=C2NC(c3ccc(OCC#Cc4cccc(F)c4)cc3)C21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "179d4c94-f9f4-4fa7-9853-105158a1fa6d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCc1ccc(N)cc1S(=O)(=O)NCCCC1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(N)cc1S(=O)(=O)NCCCC1CC1.",
+ "ref_smiles": "CC(O)c1ccc(N)cc1S(=O)(=O)NCCCC1CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "436f2d95-2a94-451a-b8d8-ffa294206501",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C1CC(Nc2cc(F)ccc2[N+](=O)[O-])CN1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC(Nc2cc(F)ccc2[N+](=O)[O-])CN1.",
+ "ref_smiles": "O=C1CC(O)(Nc2cc(F)ccc2[N+](=O)[O-])CN1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d17799bb-69c3-430c-86ac-c3643543e4e4",
+ "task": "add",
+ "question": "Modify the molecule CCCc1cc(CCl)cc(N(CC)Cc2ccccn2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(CCl)cc(N(CC)Cc2ccccn2)n1",
+ "ref_smiles": "CCCc1cc(CCl)cc(N(CC)Cc2ncccc2O)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "91f57e8d-1602-44b2-8276-bf78f2dd94c8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCn1c(=O)c2[nH]c(-c3ccc(N(CC4CC4)C(=O)c4ccc(I)nc4)nc3)cc2n(CCC)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1c(=O)c2[nH]c(-c3ccc(N(CC4CC4)C(=O)c4ccc(I)nc4)nc3)cc2n(CCC)c1=O.",
+ "ref_smiles": "CCCn1c(=O)c2[nH]c(-c3ccc(N(C(=O)c4ccc(I)nc4)C(c4ccccc4)C4CC4)nc3)cc2n(CCC)c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "550f6f7f-1062-491a-9413-097847faba72",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1.",
+ "ref_smiles": "CS(=O)(=O)N1CCCC1C(=O)N1CCC(CCC(=O)[O-])C1S",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "a4711f4b-15ca-4324-bd67-d26efd7230ca",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)C1CCN(c2ccc(Br)cc2CO)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCN(c2ccc(Br)cc2CO)C1",
+ "ref_smiles": "CC(=O)c1ccc(N2CCC(C(N)=O)C2)c(CO)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "29bfed9f-c81f-49f8-b2f9-6de07df92595",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC[NH2+]C(Cc1ccc(C)cc1)c1ncc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(Cc1ccc(C)cc1)c1ncc(Cl)cc1Cl.",
+ "ref_smiles": "CCC[NH2+]C(Cc1ccc(C)cc1)c1ccc(Cl)cn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b78c7bf-1fc6-4799-9850-56d1cd1bd268",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccnc(C2CC2)c1NC(=O)NC(=O)c1cc(Cl)c(Cl)nc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccnc(C2CC2)c1NC(=O)NC(=O)c1cc(Cl)c(Cl)nc1Cl",
+ "ref_smiles": "Cc1ccnc(C2CC2)c1NC(=O)NC(=O)c1cc(Cl)cnc1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4550984d-1356-4a65-808f-0e74edb48509",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCCn1nnc(C(F)(F)C(F)(F)F)c1C(Cl)(Cl)C(Cl)(Cl)Cl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCn1nnc(C(F)(F)C(F)(F)F)c1C(Cl)(Cl)C(Cl)(Cl)Cl",
+ "ref_smiles": "CCCCCCn1nnc(C(F)([N+](=O)[O-])C(F)(F)F)c1C(Cl)(Cl)C(Cl)(Cl)Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "86f1ce53-dff5-480d-9082-2d303f0db32a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccccc1CC(=O)c1cc(Br)ccc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CC(=O)c1cc(Br)ccc1Br.",
+ "ref_smiles": "COc1ccc(O)cc1CC(=O)c1cc(Br)ccc1Br",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "342eb66d-3423-4a92-ace3-39371736adb0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC(C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1c(C)cccc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccccc1C)c1c(C)cccc1C.",
+ "ref_smiles": "Cc1ccccc1NC(=O)C(c1c(C)cccc1C)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C)C(C)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5e2b84f6-7d34-4d37-bd62-e9801cb32f32",
+ "task": "add",
+ "question": "Modify the molecule CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)CCCC)nc1-c1c(OC)cccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)CCCC)nc1-c1c(OC)cccc1OC",
+ "ref_smiles": "CCCCC1=C(C#N)C(=O)N(N(C)C(=O)c2ccccc2)C(=O)C1=Cc1sc(N(CCCC)C(CCC)c2ccccc2)nc1-c1c(OC)cccc1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "080e0356-369c-41fa-a4e4-67dd02bcf359",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule COc1cccc(OC)c1C(=O)Nc1nc(-c2cc([N+](=O)[O-])cs2)cs1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(OC)c1C(=O)Nc1nc(-c2cc([N+](=O)[O-])cs2)cs1",
+ "ref_smiles": "COc1cccc(OC)c1C(=O)Nc1nc(-c2cc(SH)cs2)cs1",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "46b164a0-09d9-42e8-97ed-7d4cc96c0435",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCc1cccc(C)c1NC(=O)CCSc1ccccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(C)c1NC(=O)CCSc1ccccc1Cl.",
+ "ref_smiles": "CCc1cccc(C)c1CSc1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c10c7c75-9516-4641-a4e2-c5b77eb4ca9e",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(=O)nc(NCCOC(C)C)[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(=O)nc(NCCOC(C)C)[nH]1",
+ "ref_smiles": "CC(C)OCCNc1nc(=O)cc(CO)[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bb3af60a-f3ae-404b-a747-9a9114476f7a",
+ "task": "sub",
+ "question": "Modify the molecule CCOC1CC([NH3+])(C(=O)N(C)Cc2cccc(Cl)c2)C1(C)C by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC1CC([NH3+])(C(=O)N(C)Cc2cccc(Cl)c2)C1(C)C",
+ "ref_smiles": "CCOC1CC([NH3+])(C(=O)N(C)Cc2cccc(C=O)c2)C1(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2ae7fc40-f2f7-4c7d-8679-0886cc90c4cf",
+ "task": "add",
+ "question": "Modify the molecule CC1(c2nnc(C3CCC[NH2+]3)o2)CCCCO1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(c2nnc(C3CCC[NH2+]3)o2)CCCCO1",
+ "ref_smiles": "CC1(c2nnc(C3[NH2+]CCC3CC=O)o2)CCCCO1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "dc23d4d2-3a83-4423-983d-77ed2e8f9c58",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3)n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3)n2)cc1.",
+ "ref_smiles": "Nc1ccc(-c2cnc(NC(=O)Cc3ccc(F)cc3)c(CC3CCCCC3c4ccccc4)n2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "dc356a7d-01ff-4665-89f2-986b8cc4ce25",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3ccccc3)SC2=S)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3ccccc3)SC2=S)cc1.",
+ "ref_smiles": "COc1ccc(NC(=O)CCCCCN2C(=O)C(=CC=Cc3cccc(-c4ccccc4)c3)SC2=S)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "25c8f88e-03b7-4eeb-8b10-8f72615c30ec",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CC(O)c1sc(C)nc1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(O)c1sc(C)nc1C",
+ "ref_smiles": "C=CC([N+](=O)[O-])c1sc(C)nc1C",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c53bf407-54fe-4f51-9715-1b13c6986b67",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(N=Cc2c(O)[nH]c3ccc(F)cc23)cc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N=Cc2c(O)[nH]c3ccc(F)cc23)cc1Cl",
+ "ref_smiles": "Cc1ccc(N=Cc2c(O)[nH]c3ccc(F)cc23)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8349bc6d-9b5e-456d-96c8-909378bf6936",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(CN2CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)CC2=O)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CN2CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)CC2=O)cc1",
+ "ref_smiles": "COc1ccc(CN2C(=O)CC(C(=O)Nc3ccc(F)c(C(N)=O)c3)C2N)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "708d707e-fe5a-42d0-ba3e-4516d8440479",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCS(=O)(=O)NC(C)C(=O)NCC1(c2ccc(F)cc2)CCCC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCS(=O)(=O)NC(C)C(=O)NCC1(c2ccc(F)cc2)CCCC1",
+ "ref_smiles": "CC(=O)c1ccc(C2(CNC(=O)C(C)NS(=O)(=O)CCC)CCCC2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3303eecc-3acd-4262-8826-5eaa04c097a0",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]CCc1n[nH]c(Cc2cccc(F)c2)n1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCc1n[nH]c(Cc2cccc(F)c2)n1",
+ "ref_smiles": "[NH3+]CCc1n[nH]c(Cc2cccc(S)c2)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b3bb0ea1-96b0-472d-8b99-d3de2277f490",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCCCCCCCCCCCCCCN(C(=O)CCCCCCCCCCC)C1OC(CO)C(O)C(O)C1NC(=O)CNC(=O)C(CC(C)C)NC(=O)OCc1ccccc1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCCN(C(=O)CCCCCCCCCCC)C1OC(CO)C(O)C(O)C1NC(=O)CNC(=O)C(CC(C)C)NC(=O)OCc1ccccc1",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCCCN(C(=O)CCCCCCCCCCC)C1OC(CC#N)C(O)C(O)C1NC(=O)CNC(=O)C(CC(C)C)NC(=O)OCc1ccccc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4fa1916f-d54c-47bb-9d93-7aba3875227e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)NC(=O)c1ccc(C)c(NC(=O)C(C)[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3c(C)cccc3C(=O)Nc3cc(F)ccc3F)CC2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1ccc(C)c(NC(=O)C(C)[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3c(C)cccc3C(=O)Nc3cc(F)ccc3F)CC2)c1",
+ "ref_smiles": "CCC(C)NC(=O)c1ccc(C)c(NC(=O)C(C)[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3c(C)cccc3C(=O)Nc3cc(NO)ccc3F)CC2)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7ef4f9bd-3b7c-4e63-baa4-37fe995259e1",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule Cc1cc(N(C)C(C)CC#N)ncn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N(C)C(C)CC#N)ncn1.",
+ "ref_smiles": "Cc1cc(N(C)C(C)C)ncn1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ecd1bf31-6282-46a0-8b4e-17984ecbe248",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NN=C(C)c2cccc3ccccc23)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NN=C(C)c2cccc3ccccc23)c1.",
+ "ref_smiles": "COc1ccccc1NS(=O)(=O)C(=O)NN=C(C)c1cccc2ccccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4a909cbf-3d86-4d34-8eb2-cb13c7b4bc65",
+ "task": "sub",
+ "question": "Modify the molecule Cn1nnc(Br)c1S(=O)(=O)Nc1nnc(C2CC2)o1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nnc(Br)c1S(=O)(=O)Nc1nnc(C2CC2)o1",
+ "ref_smiles": "Cn1nnc(S)c1S(=O)(=O)Nc1nnc(C2CC2)o1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "af4dbc0b-6c68-4d62-8dff-9490940a075a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+](C)CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1.",
+ "ref_smiles": "C[NH+](CCNC(=O)C1(C)COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCC#N)n3)[nH]2)OC1)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f46f6ab6-7aa4-4b58-9be6-a965800629bd",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cn3c(C(=O)O)c[n+]4ccccc34)CSC12)c1csc(N)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cn3c(C(=O)O)c[n+]4ccccc34)CSC12)c1csc(N)n1.",
+ "ref_smiles": "CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cn3c(C(=O)O)c[n+]4ccccc34)CSC12)c1cscn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b5846d75-001f-47b0-b08b-3227bbfe887d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)c1c(Cl)ncnc1NCC1(C2CC2)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1c(Cl)ncnc1NCC1(C2CC2)CC1",
+ "ref_smiles": "CC(C)c1c([N+](=O)[O-])ncnc1NCC1(C2CC2)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cb65a46e-c530-4eab-8a2c-ad7799bb65b7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)n1cnc(Cl)c1Br with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)n1cnc(Cl)c1Br",
+ "ref_smiles": "CC(C)(C)n1cnc(C#N)c1Br",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dc08ef2f-a5be-43f8-b39c-96d5aea2146c",
+ "task": "add",
+ "question": "Modify the molecule CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2)CCS(=O)(=O)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2)CCS(=O)(=O)C1",
+ "ref_smiles": "CC1(NC(=O)c2ccc(NC(=O)c3ccco3)cc2-c2ccccc2)CCS(=O)(=O)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6602ac11-1d1c-42d6-a035-a6353f216dd2",
+ "task": "sub",
+ "question": "Modify the molecule CCC1CCC(O)(c2ccc(OC)c(Br)c2OC)CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(O)(c2ccc(OC)c(Br)c2OC)CC1",
+ "ref_smiles": "CCC1CCC(O)(c2ccc(OC)c(C#N)c2OC)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b2fad6f-9aa8-4ce7-ae10-835392ffbe86",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)C(=O)OCCCCCCC(CCC)[NH+](CC)CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OCCCCCCC(CCC)[NH+](CC)CC",
+ "ref_smiles": "C=C(C)C(=O)OC(O)CCCCCC(CCC)[NH+](CC)CC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cd8558a0-bc0e-4ab5-8e1d-15e3a229a596",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CSCCCC[NH2+]Cc1ccc(I)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCCC[NH2+]Cc1ccc(I)cc1",
+ "ref_smiles": "CSCCCC[NH2+]Cc1ccc(C=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ed70fb7e-b99a-445d-a9a4-231c69e1fa8c",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)C1=CCC(P)CC=C1[N+](=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1=CCC(P)CC=C1[N+](=O)[O-]",
+ "ref_smiles": "COC(=O)C1=C(O)CC(P)CC=C1[N+](=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4e39d44b-57a0-4714-8288-24776e4bc547",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1(C)C[NH2+]C(C)C(c2cccc(Cl)c2)O1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C)C[NH2+]C(C)C(c2cccc(Cl)c2)O1",
+ "ref_smiles": "CCC1(C)C[NH2+]C(C)C(c2cccc(S)c2)O1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "472ea3d9-64a8-46be-8135-5848378394d7",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)c1cc(-c2ccc(C=NNC(=O)c3ccc(NC(C)=O)cc3)o2)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc(-c2ccc(C=NNC(=O)c3ccc(NC(C)=O)cc3)o2)ccc1Cl.",
+ "ref_smiles": "COC(=O)c1cccc(-c2ccc(C=NNC(=O)c3ccc(NC(C)=O)cc3)o2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5544466d-582c-4467-a86f-55534bee109b",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]Cc1cc(C(=O)[O-])nc(I)c1OC(F)(F)F by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]Cc1cc(C(=O)[O-])nc(I)c1OC(F)(F)F",
+ "ref_smiles": "[NH3+]Cc1cc(C(=O)[O-])nc([N+](=O)[O-])c1OC(F)(F)F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a4eee0c0-59b3-4314-a6c0-e11917f964e8",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C([O-])CC(c1cn[nH]c1)C1CCCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC(c1cn[nH]c1)C1CCCCCC1.",
+ "ref_smiles": "O=C([O-])CC(c1cn[nH]c1)C1CCCCC(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7a1836e1-c60f-4ae4-bfeb-fec844830245",
+ "task": "delete",
+ "question": "Modify the molecule CCCCn1c([O-])c(C#N)c(C)c(N=Nc2cccc(Cl)c2)c1=O by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1c([O-])c(C#N)c(C)c(N=Nc2cccc(Cl)c2)c1=O",
+ "ref_smiles": "CCCCn1c([O-])cc(C)c(N=Nc2cccc(Cl)c2)c1=O",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "e341b77b-a498-4f86-b823-597acb426b48",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(C)c(-c2nnc(CCO)o2)cc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C)c(-c2nnc(CCO)o2)cc1Cl",
+ "ref_smiles": "COc1cc(C)c(-c2nnc(CCO)o2)cc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fd3e29a6-ee03-4f72-873c-0b59c13555cb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)N(O)C1CCc2cc(OCc3ccccc3C(F)(F)F)ccc21 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)N(O)C1CCc2cc(OCc3ccccc3C(F)(F)F)ccc21",
+ "ref_smiles": "NC(=O)N(O)C1CCc2cc(OCc3ccccc3C(F)(F)NO)ccc21",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "559a1876-60cf-47cf-858a-7f2cb9c3573f",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)CCc1ccc2c(c1)NC(=O)CO2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)CCc1ccc2c(c1)NC(=O)CO2",
+ "ref_smiles": "CC(=O)CCc1ccc2c(c1)O2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "221edfcf-da5f-4245-8c80-95cd27a31cc6",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc2c(C(=O)NCC[NH+]3CCN(C)CC3)nsc2c1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(C(=O)NCC[NH+]3CCN(C)CC3)nsc2c1",
+ "ref_smiles": "Cc1ccc2c(c1)sn-2CC[NH+]1CCN(C)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b2e8cfbe-8eb6-4dea-adfc-92667936fa75",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCN(C)c1ccc(O)c(N)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(C)c1ccc(O)c(N)c1.",
+ "ref_smiles": "CCN(C)c1cccc(N)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e4643ac5-863f-4144-ba85-813c4bd1f1bb",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1c(NC(=O)c2noc3c2CCCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)c2noc3c2CCCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C.",
+ "ref_smiles": "Cc1c(NC(=O)c2noc3c2C(N)CCc2cc(OC(F)(F)F)ccc2-3)c(=O)n(-c2ccccc2)n1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "d79528de-fb9d-4e53-a23d-3d0e629cc348",
+ "task": "add",
+ "question": "Modify the molecule OCC1([NH2+]C2CNC2)CCOCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCC1([NH2+]C2CNC2)CCOCC1",
+ "ref_smiles": "NC1COCCC1(CO)[NH2+]C1CNC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "dd35d2d9-9460-4a2a-97f4-d4de3a0bd088",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(CC(=O)NCC(O)c1ccncc1)Cc1ccc(Cl)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC(=O)NCC(O)c1ccncc1)Cc1ccc(Cl)cc1",
+ "ref_smiles": "CC(=O)C(CNC(=O)CC(C)Cc1ccc(Cl)cc1)c1ccncc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "25aec7b8-0c8f-453e-8890-c614ee283ecf",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CC1CC1C1(O)C2CCCC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC1C1(O)C2CCCC21.",
+ "ref_smiles": "CC1CC1C1(O)C2CCC(CC=O)C21",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "fe01105b-6500-4b76-a1b4-d7f6e28fb895",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1ccc2[nH]c(-c3cccc(O)c3O)nc2n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2[nH]c(-c3cccc(O)c3O)nc2n1.",
+ "ref_smiles": "CCOc1ccc2[nH]c(OO)nc2n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "17d404ae-c69a-4987-af9d-980cf743d0d8",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NCC(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NCC(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1",
+ "ref_smiles": "CCC(C)C(NC(=O)CCC(C)(C)C(=O)[O-])C(=O)NC(C(=O)N1c2ccccc2CC1C(=O)NCc1nn[n-]n1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2b3e1fe5-1697-4d9d-bfc1-09c5c7f0ecb8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCN1CC(CO)COC1=O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN1CC(CO)COC1=O",
+ "ref_smiles": "CCCCN1CC(CS)COC1=O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5ef78257-9341-458b-b6ba-5340410dcb06",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1.",
+ "ref_smiles": "COc1ccc(C(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2C(F)(F)F)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "64a1f6fa-370b-40f5-8a8e-f48bbb1daf82",
+ "task": "delete",
+ "question": "Modify the molecule CC(Sc1ccccc1C(=O)NC1CCC1)C(=O)[O-] by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Sc1ccccc1C(=O)NC1CCC1)C(=O)[O-]",
+ "ref_smiles": "CC(SC(=O)NC1CCC1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ee9d8654-fa28-46ea-a264-e1087f901131",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)CN(CCOC)C(=O)c1cc(Br)c[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CN(CCOC)C(=O)c1cc(Br)c[nH]1",
+ "ref_smiles": "CCOC(=O)CN(CCOC)C(=O)c1[nH]cc(Br)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d9a4688a-f06b-4c9d-bdaf-adcec9c46239",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Nc1cnn(CC(=O)NCCC2CCCCO2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cnn(CC(=O)NCCC2CCCCO2)c1.",
+ "ref_smiles": "Nc1cnn(CC(=O)NCCC2(c3ccccc3)CCCCO2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "39d85c14-6998-4cdd-982a-a21428ae56ad",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(NC(=O)c1cc(N)nc2ccccc12)C1CCOC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1cc(N)nc2ccccc12)C1CCOC1.",
+ "ref_smiles": "CC(NC(=O)c1cc(N)nc2ccccc12)C1COCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "47d5ea2c-15ac-4e4c-b0ba-560a82b9c509",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C=CC23CCC(O)(CC2)C(F)(F)C3(F)F)c(F)c1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C=CC23CCC(O)(CC2)C(F)(F)C3(F)F)c(F)c1F",
+ "ref_smiles": "Cc1ccc(C=CC23CCC(O)(CC2)C(F)(F)C3F)c(F)c1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1c852b91-f532-42b2-b11e-21a0bf364cb2",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCNC(NC1CCCC1)=[NH+]CCc1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NC1CCCC1)=[NH+]CCc1ccco1.",
+ "ref_smiles": "CCNC(CCc1ccco1)NC1CCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5f2917ef-9ee2-4af0-a48d-46c743a3409d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1cc(C[NH2+]CCc2nc3ccccc3[nH]2)cc(Br)c1OCc1ccc(F)cc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C[NH2+]CCc2nc3ccccc3[nH]2)cc(Br)c1OCc1ccc(F)cc1Cl",
+ "ref_smiles": "CCOc1cc(C[NH2+]CCc2nc3ccccc3[nH]2)cc(O)c1OCc1ccc(F)cc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3b6271d9-a4ec-435a-96b9-21a4a935c19a",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(OC)c1C([NH3+])CCc1ccnn1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(OC)c1C([NH3+])CCc1ccnn1C",
+ "ref_smiles": "COC([NH3+])(CCc1ccnn1C)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fbb9109e-f5b4-4fee-9a77-6b23538f87e8",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCOc1ccc2scc(O)c2c1[S-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2scc(O)c2c1[S-].",
+ "ref_smiles": "CCOc1ccc2sccc2c1[S-]",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7cbdcd72-3025-4229-8fab-442399fbe53d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])C1CN(CCCOc2ccc3ccccc3c2)CC1C(F)(F)F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1CN(CCCOc2ccc3ccccc3c2)CC1C(F)(F)F",
+ "ref_smiles": "O=C([O-])C1CN(CCCOc2ccc3ccccc3c2)CC1C(F)(F)S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "58af125e-8c21-4784-89b3-32bcc59c18ce",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Nc1ccc(N2CCC(Cn3ccc4ccccc43)CC2)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(N2CCC(Cn3ccc4ccccc43)CC2)c(Cl)c1.",
+ "ref_smiles": "Nc1ccc(N2CCC(Cn3ccc4ccccc43)CC2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "75dd5efc-0649-48bc-b78f-6a8579e71a6c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(O)(C[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1)COc1ccccc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)(C[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1)COc1ccccc1C#N.",
+ "ref_smiles": "CC(O)(COc1ccccc1C#N)C(O)[NH2+]C1CC[NH+](Cc2ccc(Cl)cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "611efe9b-383b-4877-8a31-0c4abe05bbaa",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cccc(=O)n1Cc1ccccc1B(O)O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(=O)n1Cc1ccccc1B(O)O.",
+ "ref_smiles": "Cc1cccc(=O)n1Cc1ccccc1BO",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "23e63441-b9b5-4610-8815-6e4258424c99",
+ "task": "delete",
+ "question": "Modify the molecule CCC(C)c1ccccc1NC(=O)C(C)[NH+]1CCN(C(=O)C2CCCO2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)c1ccccc1NC(=O)C(C)[NH+]1CCN(C(=O)C2CCCO2)CC1",
+ "ref_smiles": "CCC(C)NC(=O)C(C)[NH+]1CCN(C(=O)C2CCCO2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ec9f2411-9f69-4661-9e25-d622985c10f9",
+ "task": "delete",
+ "question": "Modify the molecule CCC1(OC(=O)N2CC3COCC(C2)C3Oc2ncnc(Nc3ccc(S(C)(=O)=O)cc3F)c2F)CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(OC(=O)N2CC3COCC(C2)C3Oc2ncnc(Nc3ccc(S(C)(=O)=O)cc3F)c2F)CC1",
+ "ref_smiles": "CCC1(OC(=O)N2CC3COCC(C2)C3Oc2ncnc(-c3ccc(S(C)(=O)=O)cc3F)c2F)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3e7d4c1e-0849-4eb6-b3dd-bde2130a0d17",
+ "task": "delete",
+ "question": "Modify the molecule C[NH2+]C1CCCC1(O)c1cccc(Cl)c1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C1CCCC1(O)c1cccc(Cl)c1",
+ "ref_smiles": "C[NH2+]C1CCCC1c1cccc(Cl)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4728e4df-0202-4992-b20e-c0b6452b216c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2)CC1.",
+ "ref_smiles": "CCCNC(=O)N1CCN(C(=O)CCc2ccc(C)cc2O)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7a3018bb-13c6-46ae-a11a-c9ebe95d72bb",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])CCNC(=O)c1ccc(CC(c2ccc(OC(F)(F)F)cc2)c2nc(-c3cc(Cl)cc(Cl)c3)cs2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCNC(=O)c1ccc(CC(c2ccc(OC(F)(F)F)cc2)c2nc(-c3cc(Cl)cc(Cl)c3)cs2)cc1",
+ "ref_smiles": "O=C([O-])CCNC(=O)CC(c1ccc(OC(F)(F)F)cc1)c1nc(-c2cc(Cl)cc(Cl)c2)cs1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6f090935-9929-4f94-ad62-14823321dc93",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2ccccc2F)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2ccccc2F)CC1.",
+ "ref_smiles": "CCOCCOCCn1cc[nH+]c1C1CCN(C(=O)CCOc2cc(O)ccc2F)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d70693c5-3ee6-4fec-9ab9-cc19c5354db6",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(Cl)CCS(=O)(=O)c1ccc2nnnn2n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Cl)CCS(=O)(=O)c1ccc2nnnn2n1",
+ "ref_smiles": "O=S(=O)(CC(c1ccccc1)S(=O)(=O)Cl)c1ccc2nnnn2n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a598aa4b-9891-4923-8ed2-9f73b08783a5",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cccc(C(=O)NCC2(O)CCOC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)NCC2(O)CCOC2)c1.",
+ "ref_smiles": "Cc1cccc(C(=O)NCC2CCOC2)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8067cb4b-11db-4436-8fcf-553e5dda9601",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cccc(Cn2c(C)cc(C)c2C(=O)NCc2cccnc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Cn2c(C)cc(C)c2C(=O)NCc2cccnc2)c1.",
+ "ref_smiles": "CCn1c(C)cc(C)c1C(=O)NCc1cccnc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "393467b8-70ca-41cb-8a0f-cc89b122ca08",
+ "task": "add",
+ "question": "Modify the molecule C=CC=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1",
+ "ref_smiles": "C=CC(=CCCOc1ccc(C(O)(c2ccccc2)c2ccc(OCCC3C=CCc4c3c(O)n(C)c4O)cc2)cc1)CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "e7965dff-ad58-4903-a0a5-bdd03750504c",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCCCC[NH+]1CCCCC1)Nc1ccc(-c2ccccc2F)c(F)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCCC[NH+]1CCCCC1)Nc1ccc(-c2ccccc2F)c(F)c1",
+ "ref_smiles": "N#Cc1ccccc1-c1ccc(NC(=O)NCCCC[NH+]2CCCCC2)cc1F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0a87697d-d9fa-4c2e-8376-7b65d7dcd3a2",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CC(=O)N1CCc2nc(NC(=O)CCl)sc2C1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(=O)N1CCc2nc(NC(=O)CCl)sc2C1",
+ "ref_smiles": "CC(C)CC(=O)N1CCc2nc(NC(=O)C([N+](=O)[O-])sc2C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f9283215-dcf2-4a80-af32-673917edc603",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)[NH+]=c1ccccn1C(=O)c1cccc(NC(=O)c2ccc(Br)o2)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH+]=c1ccccn1C(=O)c1cccc(NC(=O)c2ccc(Br)o2)c1",
+ "ref_smiles": "CC(C)[NH+]=c1ccccn1C(=O)c1cccc(NC(=O)c2ccc(O)o2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5ee09eca-378e-4ee4-9201-f252824377b4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cccc(N2CCN(C(=O)c3ccn[nH]3)CC2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(N2CCN(C(=O)c3ccn[nH]3)CC2)c1C.",
+ "ref_smiles": "CCN1CCN(C(=O)c2ccn[nH]2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "adbcd93f-91b1-42f7-83f4-8dd8c4388db5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(O)C[NH2+]CC=CCCl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)C[NH2+]CC=CCCl",
+ "ref_smiles": "CCC(O)C[NH2+]CC=CCS",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "038878d1-2b05-4725-b98e-4f37682b51b3",
+ "task": "add",
+ "question": "Modify the molecule Clc1ccc(-n2nnnc2CSc2nc3ccccc3[nH]2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc(-n2nnnc2CSc2nc3ccccc3[nH]2)cc1",
+ "ref_smiles": "Nc1cccc2nc(SCc3nnnn3-c3ccc(Cl)cc3)[nH]c12",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "c3716766-447e-4186-8703-beb4f8e8aeaa",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COCCCCNS(=O)(=O)CC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCCNS(=O)(=O)CC(=O)[O-].",
+ "ref_smiles": "COCCCCS(=O)(=O)CC(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5c567b4a-2787-4c96-9062-81c140bb0e5c",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(Nc2nn3c(NCC4CC4)cc(C)nc3c2C(N)=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Nc2nn3c(NCC4CC4)cc(C)nc3c2C(N)=O)cc1",
+ "ref_smiles": "COc1ccc(Nc2nn3c(NC(c4ccccc4)C4CC4)cc(C)nc3c2C(N)=O)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6205f732-5e05-4846-8740-73296d649791",
+ "task": "add",
+ "question": "Modify the molecule CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OCC",
+ "ref_smiles": "CCOC(CNC(=O)c1cc(Cl)nc(C(C)C)c1)OC(C)O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "11ff89b4-b604-49af-a543-62c64001f2e0",
+ "task": "add",
+ "question": "Modify the molecule CN(CCC(=O)[O-])C(=O)NCC1CCCc2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCC(=O)[O-])C(=O)NCC1CCCc2ccccc21",
+ "ref_smiles": "CN(CCC(=O)[O-])C(=O)NCC1(c2ccccc2)CCCc2ccccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d25b2704-cbc7-4572-93f5-14fb1e5c043b",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(=O)N1CCCC(O)(c2nc(C)c(CCOc3ccc(OC)cc3)s2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)N1CCCC(O)(c2nc(C)c(CCOc3ccc(OC)cc3)s2)CC1.",
+ "ref_smiles": "COc1ccc(OCCc2sc(C3(O)CCCC(C)C3)nc2C)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "14e7488e-8fb2-449d-9a19-df129d182167",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OC)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OC)cc1",
+ "ref_smiles": "CCN(CC(=O)Nc1cccc(-c2nc(=O)cc(C)[nH]2)c1)S(=O)(=O)c1ccc(OCO)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7b3d0fb1-9afd-47ec-82a4-27fe6da68b4a",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCC1CCC[NH+](CCCC[NH2+]CC(C)C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC[NH+](CCCC[NH2+]CC(C)C)CC1.",
+ "ref_smiles": "CCC1CCC[NH+](CCCC(C#N)[NH2+]CC(C)C)CC1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "d8d111af-95e9-43dd-9a0a-9d99f2e19015",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(C(CNC(=O)NCC(C)C)c2c[nH]c3ccccc23)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(CNC(=O)NCC(C)C)c2c[nH]c3ccccc23)c1",
+ "ref_smiles": "CC(C)CNC(=O)NCC(C)c1c[nH]c2ccccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "51bd6968-4569-4441-a824-4f47ae22cc7c",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(C2C(c3ccc(C)cc3)=C(O)C(=O)N2c2ccc(OC(C)C)cc2)ccc1OC(C)=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C2C(c3ccc(C)cc3)=C(O)C(=O)N2c2ccc(OC(C)C)cc2)ccc1OC(C)=O",
+ "ref_smiles": "COc1cc(C2C(C)=C(O)C(=O)N2c2ccc(OC(C)C)cc2)ccc1OC(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e5c0fa20-d9da-4ee9-951c-be9f4d4ba4f2",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)n(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)n(C)n1",
+ "ref_smiles": "Cc1nn(C)c(C(=O)N2CCc3nn(Cc4ccccc4)c(=O)n3CC2)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "efa53f41-3d46-4e04-a445-bcf75962bc75",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)c1nn(CC(F)(F)F)c2c1CCc1[nH]nc(Nc3ccccc3)c1-2 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1nn(CC(F)(F)F)c2c1CCc1[nH]nc(Nc3ccccc3)c1-2",
+ "ref_smiles": "CC(=O)C(F)(F)Cn1nc(C(N)=O)c2c1-c1c(Nc3ccccc3)n[nH]c1CC2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b8223680-8bde-4b06-a612-b7d757d22954",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nc(N)nc(C2(c3ccccc3)CC2)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(N)nc(C2(c3ccccc3)CC2)n1",
+ "ref_smiles": "CCc1nc(N)nc(C2CC2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b43f154a-fb43-42a2-8cb1-7cd73a5c5561",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1",
+ "ref_smiles": "CC(C)(C)OOC(C[N+](=O)[O-])C(O[Si](C)(C)C(C)(C)C)c1ccccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "84b51e9e-4026-414b-8c7b-dc7914af70c6",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CC(=O)Nc1cccc(C(=O)c3ccccc3)c1)c1nnc(C)n1-2 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CC(=O)Nc1cccc(C(=O)c3ccccc3)c1)c1nnc(C)n1-2",
+ "ref_smiles": "COc1ccc2c(c1)C(c1ccccc1)=NC(CC(=O)Nc1cccc(C(=O)c3ccccc3)c1)c1nnc(C)n1-2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "525b7e10-4d93-4941-abb2-23f2ddf0502e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCc1c(Br)cccc1NC(=O)COCC[NH3+] with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1c(Br)cccc1NC(=O)COCC[NH3+]",
+ "ref_smiles": "COCc1c(O)cccc1NC(=O)COCC[NH3+]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c110888f-cae1-491f-af67-158d5ec8a6ba",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)c1cccc2cc(Cl)ccc12 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)c1cccc2cc(Cl)ccc12",
+ "ref_smiles": "OC(F)c1cccc2cc(Cl)ccc12",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "62b129ff-49b8-476e-bfa5-78781c715c92",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C([NH3+])c2cccc(C(F)(F)F)c2)cc1C by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C([NH3+])c2cccc(C(F)(F)F)c2)cc1C",
+ "ref_smiles": "Cc1ccc(C([NH3+])c2cccc(C(O)(F)F)c2)cc1C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d091f85c-a924-4579-ad27-19c82af1cb2a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])c1cc(-c2ccc(N3CCCC3)c(Cl)c2)on1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1cc(-c2ccc(N3CCCC3)c(Cl)c2)on1.",
+ "ref_smiles": "O=C([O-])c1cc(-c2ccc(N3CCCC3)cc2)on1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1443b08a-89eb-46df-9564-04b5d0e73fe9",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule OC(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1.",
+ "ref_smiles": "O=C(O)C(O)(c1ccccc1)C1COC(c2cccc(Br)c2)[NH2+]1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a5523dcb-a0b4-47d9-bc03-2bb910b43060",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OCC1C(O)C(O)C(O)C[NH+]1CCCCl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCC1C(O)C(O)C(O)C[NH+]1CCCCl",
+ "ref_smiles": "OC1C[NH+](CCCCl)C(CI)C(O)C1O",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ddaa5668-9d10-493e-b65a-b1f04a149dfa",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=c1c2c(nc3c(Cl)cc(Cl)cn13)C(=Cc1ccc(Cl)cc1)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1c2c(nc3c(Cl)cc(Cl)cn13)C(=Cc1ccc(Cl)cc1)CC2.",
+ "ref_smiles": "O=c1c2c(nc3c(Cl)cc(Cl)c(-c4ccccc4)n13)C(=Cc1ccc(Cl)cc1)CC2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1a6afd8d-acf9-45e9-bfca-e348e2c35785",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)cc1.",
+ "ref_smiles": "CSCC[NH2+]Cc1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)nc2nnnn23)c2cncn2C)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "b0d894a0-ebe3-4405-9986-75cde46ce7b2",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1.",
+ "ref_smiles": "CCOC(=O)c1ccc(CNC(NCc2ccc(C)cc2)=[NH+]C)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d75a6662-349b-47e6-9d66-a5de6ce71b44",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)OCc2cccc([N+](=O)[O-])c2)c1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)OCc2cccc([N+](=O)[O-])c2)c1",
+ "ref_smiles": "CN(C)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)OCc2cccc(I)c2)c1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "8fd077f2-6acc-4408-9b4c-cbcc69cfe997",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(C)C(c1ccccc1)C(Cc1cn(C)nn1)NN.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(c1ccccc1)C(Cc1cn(C)nn1)NN.",
+ "ref_smiles": "CCC(C)CC(Cc1cn(C)nn1)NN",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d5f4bb5f-d34e-48b7-badc-3900f5eaf527",
+ "task": "add",
+ "question": "Modify the molecule NC(N)=[NH+]CCCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(N)=[NH+]CCCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-]",
+ "ref_smiles": "NC(N)=[NH+]C(CCC([NH3+])C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NCC(=O)[O-])c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "80350724-d71e-4ae4-a79e-1ffdb81a3e6d",
+ "task": "sub",
+ "question": "Modify the molecule CC1=C(C(=O)Nc2ccc(F)cc2)C(c2ccco2)c2cn[nH]c2N1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(C(=O)Nc2ccc(F)cc2)C(c2ccco2)c2cn[nH]c2N1",
+ "ref_smiles": "CC1=C(C(=O)Nc2ccc(S)cc2)C(c2ccco2)c2cn[nH]c2N1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "43f9e837-8be6-4494-a79a-58267b2eba13",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C([O-])CC(N=C1c2ccccc2C=CC1O)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC(N=C1c2ccccc2C=CC1O)C(=O)[O-]",
+ "ref_smiles": "O=C([O-])CC(N=C1c2ccccc2C=CC1S)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c3272b76-0f89-432f-9f89-4d2b78bb7e3c",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Nc1nn(Cc2ccc(F)cc2)cc1Cl)c1ccc(COc2ccc3ccccc3c2)o1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1nn(Cc2ccc(F)cc2)cc1Cl)c1ccc(COc2ccc3ccccc3c2)o1",
+ "ref_smiles": "N#Cc1ccc(Cn2cc(Cl)c(NC(=O)c3ccc(COc4ccc5ccccc5c4)o3)n2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9abfeb6d-a12d-4fe1-828d-89b718fceea5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC[NH2+]C1CCC(C(C)(C)C)CC1N(C)C(C)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C1CCC(C(C)(C)C)CC1N(C)C(C)C(C)C.",
+ "ref_smiles": "CC[NH2+]C1CCC(C(C)(C)C)CC1(O)N(C)C(C)C(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ede2f275-3c76-4f81-afea-aa5e38205512",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(Cc2ccccc2)c1NC(=O)CCCCl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Cc2ccccc2)c1NC(=O)CCCCl",
+ "ref_smiles": "Cc1cccc(Cc2ccccc2)c1NC(=O)CCCC#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "01b35f2f-bc25-419a-bdc8-b0f21e15adb0",
+ "task": "add",
+ "question": "Modify the molecule CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2)CC1",
+ "ref_smiles": "CCC1CCCCN1C(=O)C1(C(=O)N(CC)Cc2ccccc2-c2ccccc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7ff00caa-b41c-4470-adc5-5583975c9ccd",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)c1ccc(NC(=O)NCCC(C)c2ccc(Cl)cc2)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(NC(=O)NCCC(C)c2ccc(Cl)cc2)cc1",
+ "ref_smiles": "CC(C)c1ccc(NC(=O)NCCC(C)c2ccc(C(=O)O)cc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a4c12fcc-0678-49d5-80b5-1fa11907eb41",
+ "task": "add",
+ "question": "Modify the molecule CCc1nncn1CCNC(NCCCn1c(C)nc2ccccc21)=[NH+]Cc1ccco1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nncn1CCNC(NCCCn1c(C)nc2ccccc21)=[NH+]Cc1ccco1",
+ "ref_smiles": "Cc1nc2ccccc2n1CCCNC(NCCn1cnnc1CCc1ccccc1)=[NH+]Cc1ccco1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "285eb3e3-4a73-4348-b137-11cae1ccfb8f",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1-n1cnc(CC(=O)[O-])n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1-n1cnc(CC(=O)[O-])n1",
+ "ref_smiles": "COn1cnc(CC(=O)[O-])n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "570d1410-2764-4563-b344-af6b5ba3df11",
+ "task": "add",
+ "question": "Modify the molecule Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)cnn12 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)cnn12",
+ "ref_smiles": "Nc1ncnc2c(C3OC(COCc4ccc(Cl)cc4Cl)C(OCc4ccc(Cl)cc4Cl)C3(C=O)OCc3ccc(Cl)cc3Cl)c(CC=O)nn12",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "d6ed646f-2c5d-4338-884e-ad1301b27695",
+ "task": "add",
+ "question": "Modify the molecule Cc1ncc(-c2cccc(-c3ncc(C(C=NCC(=O)N4CCCC4)=C[NH3+])cn3)c2)s1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ncc(-c2cccc(-c3ncc(C(C=NCC(=O)N4CCCC4)=C[NH3+])cn3)c2)s1",
+ "ref_smiles": "Cc1ncc(-c2cccc(-c3ncc(C(=C[NH3+])C(CC=O)=NCC(=O)N4CCCC4)cn3)c2)s1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "dd9eba27-722a-4f89-a433-dd1214002dfc",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)cc1.",
+ "ref_smiles": "Cc1ccc(-c2nc(CCNC(=O)Nc3ccc4c(c3)OCCO4)cs2)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2df129f4-a641-4ebf-9a1e-77ee15c8b398",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1cc(-c2cn[nH]c2C2CCCN(C(=O)C3CC=CCC3)C2)on1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(-c2cn[nH]c2C2CCCN(C(=O)C3CC=CCC3)C2)on1.",
+ "ref_smiles": "Cc1cc(-c2cn[nH]c2C2CN(C(=O)C3CC=CCC3)CCC2C(=O)O)on1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d4ca4eb0-5130-42a0-b0e7-aec7e00432f7",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CN(C(=O)OC(C)(C)C)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)OC(C)(C)C)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1.",
+ "ref_smiles": "CC(C)(C)OC(=O)N(CO)c1cc(CSc2ncccc2C(=O)Nc2cccc(Cl)c2)ccn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c618259e-709d-44e6-980d-71678de61210",
+ "task": "add",
+ "question": "Modify the molecule O=C(CSc1nnc2sc3ccccc3n12)NCc1ccc(C(=O)N2CCCC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CSc1nnc2sc3ccccc3n12)NCc1ccc(C(=O)N2CCCC2)cc1",
+ "ref_smiles": "N#Cc1cc(CNC(=O)CSc2nnc3sc4ccccc4n23)ccc1C(=O)N1CCCC1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "cbd52a09-f0b9-497d-8605-dfb092012c4d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C(=O)c2cn(C(C)C)c3ncnc(N)c23)cc1NC(=O)Nc1ccc(C)c(F)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)c2cn(C(C)C)c3ncnc(N)c23)cc1NC(=O)Nc1ccc(C)c(F)c1",
+ "ref_smiles": "COc1ccc(C(=O)c2cn(C(C)C)c3ncnc(N)c23)cc1NC(=O)Nc1ccc(C)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "afb010da-4d1f-456f-966b-9af277f09b2a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CN(C)c1ccccc1N(C(=O)OC(C)(C)C)c1cc2c(cc1O)C13CCCCC1C(C2)N(C(=O)OCc1ccccc1)CC3 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccccc1N(C(=O)OC(C)(C)C)c1cc2c(cc1O)C13CCCCC1C(C2)N(C(=O)OCc1ccccc1)CC3",
+ "ref_smiles": "CN(C)c1ccccc1N(C(=O)OC(C)(C)C)c1cc2c(cc1[N+](=O)[O-])C13CCCCC1C(C2)N(C(=O)OCc1ccccc1)CC3",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fa9b119d-cb8f-444e-99b3-aca3a825df3f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCc1ccn(C2CCCC2)n1)NCC1SCCc2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccn(C2CCCC2)n1)NCC1SCCc2ccccc21.",
+ "ref_smiles": "O=C(NCC1SCCc2ccccc21)NC(O)c1ccn(C2CCCC2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "447556db-8c07-4fab-bbe0-44b20a3cd90a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](CCCc1ccc(CNC(=O)OC(C)(C)C)cc1)CCNC(=O)c1cc2cc(F)ccc2[nH]1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](CCCc1ccc(CNC(=O)OC(C)(C)C)cc1)CCNC(=O)c1cc2cc(F)ccc2[nH]1",
+ "ref_smiles": "C[NH+](CCCc1ccc(CNC(=O)OC(C)(C)C)cc1)CCNC(=O)c1cc2cc(C#N)ccc2[nH]1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2424379d-797a-44c6-99ae-ce0aedd2d108",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(Nc1nc2cc3c(cc2[nH]1)OC(F)(F)O3)c1cc(Cl)ccc1O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1nc2cc3c(cc2[nH]1)OC(F)(F)O3)c1cc(Cl)ccc1O",
+ "ref_smiles": "N#Cc1ccc(Cl)cc1C(=O)Nc1nc2cc3c(cc2[nH]1)OC(F)(F)O3",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8b1fdfc7-6af1-424a-9d37-cae19dd7cb36",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Nc1cccc(OCC(=O)NCC(O)CO)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cccc(OCC(=O)NCC(O)CO)c1",
+ "ref_smiles": "Nc1cccc(OCC(=O)NCC(CO)NO)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f6a4625e-4280-498d-9fc8-d107ee5e9052",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NC(CO)C(=O)OCC(=O)c1ccccc1)OCC1c2ccccc2-c2ccccc21 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(CO)C(=O)OCC(=O)c1ccccc1)OCC1c2ccccc2-c2ccccc21",
+ "ref_smiles": "O=C([OH])CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC(=O)c1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fe7cf490-8987-4995-b4d4-8ac01b568211",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1ccc(C(=O)NN=Cc2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)cc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)NN=Cc2cc(Br)c(OCc3ccc(Cl)cc3)c(Br)c2)cc1",
+ "ref_smiles": "CCOc1ccc(C(=O)NN=Cc2ccc(OCc3ccc(C=O)cc3)cc2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ee8299dc-5f07-458c-8e3c-cf371a517adf",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule Cc1c(C(F)(F)F)[nH]c2c(C)ccc(Br)c2c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(F)(F)F)[nH]c2c(C)ccc(Br)c2c1=O.",
+ "ref_smiles": "Cc1c(C(F)(F)F)[nH]c2c(C)c(C#N)cc(Br)c2c1=O",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "757c3957-9ef9-48a7-8fea-09db82338567",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CCO)C1=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CCO)C1=O",
+ "ref_smiles": "Cc1c(Cl)cccc1N1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C([NH+](C)CC(N)O)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "8a348c42-7a24-4d9b-b887-bd657637916d",
+ "task": "add",
+ "question": "Modify the molecule NC(=O)c1cccn2c(=O)c3ccccc3nc12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1cccn2c(=O)c3ccccc3nc12",
+ "ref_smiles": "NC(=O)c1cccn2c(=O)c3ccc(O)cc3nc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "532a7b84-fde2-4a08-b523-b499a7f7af81",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)c1c[nH+]c(Nc2cnccn2)cc1NC1CCc2cccc(F)c21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1c[nH+]c(Nc2cnccn2)cc1NC1CCc2cccc(F)c21",
+ "ref_smiles": "CC(=O)c1cccc2c1C(Nc1cc(Nc3cnccn3)[nH+]cc1C(N)=O)CC2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1d666bb2-9687-4630-b48c-87861060cf33",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3)c2)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3)c2)c1",
+ "ref_smiles": "Cc1cccc(C(=O)Nc2cccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCCC(C)C5)c4C)CC3S)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "db80b0f5-6d6e-449f-a69b-0efca39358b2",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Cc1c[nH]c(Sc2ccccc2)c1)C(=O)c1nn[n-]n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1c[nH]c(Sc2ccccc2)c1)C(=O)c1nn[n-]n1",
+ "ref_smiles": "O=C(Cc1c[nH]c(S)c1)C(=O)c1nn[n-]n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7025ad70-d964-4776-94b1-c2cc7b6cf034",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)N(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)N(C)C",
+ "ref_smiles": "CCC(C)N(C(=O)N(C)C)C(C(=O)O)c1cccc(OS(C)(=O)=O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "087d6d1a-d21b-46f6-a342-d01b49394df5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(Nc1cccc(OCc2cscn2)c1)c1ccnc(Nc2ccncc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cccc(OCc2cscn2)c1)c1ccnc(Nc2ccncc2)n1.",
+ "ref_smiles": "O=C(NOCc1cscn1)c1ccnc(Nc2ccncc2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c60c4a05-c17e-49a8-b006-59c37da28b6c",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]C(c1cccc(OC)c1)c1ccc(C)c(C)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(c1cccc(OC)c1)c1ccc(C)c(C)c1",
+ "ref_smiles": "C[NH2+]C(c1cccc(OC)c1)c1ccc(Cc2ccccc2)c(C)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b6c6267c-a3bb-489f-9dd0-0706eae446ef",
+ "task": "add",
+ "question": "Modify the molecule COC([Si])(CCCC1CC2C=CC1C2)OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC([Si])(CCCC1CC2C=CC1C2)OC",
+ "ref_smiles": "COC([Si])(CCCC1CC2C=CC1(c1ccccc1)C2)OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c7a19751-0bd5-4c54-9732-e44444b8b058",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cnc(Cl)nc1-c1ccccc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cnc(Cl)nc1-c1ccccc1",
+ "ref_smiles": "CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cnc(C(=O)O)nc1-c1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1768d6c7-3b89-4164-92f5-35177de63571",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1=CONC1(C)NS(=O)(=O)c1cccc2c(O)cccc12 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CONC1(C)NS(=O)(=O)c1cccc2c(O)cccc12",
+ "ref_smiles": "CC1=CONC1(C)NS(=O)(=O)c1cccc2c(C#N)cccc12",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "efdeb7e3-0325-46dd-9623-024a2c09a9fa",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C(=O)N2CC[NH+](C(C)C)CC2)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)N2CC[NH+](C(C)C)CC2)c(F)c1.",
+ "ref_smiles": "Cc1ccc(C(=O)N2CC[NH+](C(C)Cc3ccccc3)CC2)c(F)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "87c573a1-b85f-45b6-b567-18fa18a1838b",
+ "task": "delete",
+ "question": "Modify the molecule O=[N+]([O-])c1cc(NC2Cc3ccccc3C2)c(F)cc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1cc(NC2Cc3ccccc3C2)c(F)cc1F",
+ "ref_smiles": "O=[N+]([O-])c1cc(NC2Cc3ccccc3C2)ccc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "35ae4048-7146-4d1c-83f2-69c80fda37dd",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1C([Si](C)(C)F)C(CCO)OC12C(=O)N(C)c1ccc(N3C(=O)c4cccc5cccc3c45)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C([Si](C)(C)F)C(CCO)OC12C(=O)N(C)c1ccc(N3C(=O)c4cccc5cccc3c45)cc12.",
+ "ref_smiles": "CC1C([Si](C)C)C(CCO)OC12C(=O)N(C)c1ccc(N3C(=O)c4cccc5cccc3c45)cc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "72f46cb8-4269-4942-8716-76cc32c7a21c",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCN1Cc2cc(NC(=O)CC(C)CC(=O)Nc3ccc(C#N)c(C)c3)ccc2N(CC)C1=O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1Cc2cc(NC(=O)CC(C)CC(=O)Nc3ccc(C#N)c(C)c3)ccc2N(CC)C1=O",
+ "ref_smiles": "CCN1Cc2cc(NC(=O)CC(C)CC(=O)Nc3ccc([N+](=O)[O-])c(C)c3)ccc2N(CC)C1=O",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "77cb67f8-43b0-4801-92c8-bd53dbbf439b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COCCn1ncc(Cl)c1C(=O)C1CCCCC1C[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1ncc(Cl)c1C(=O)C1CCCCC1C[NH3+].",
+ "ref_smiles": "[NH3+]CC1CCCCC1C(=O)c1c(Cl)cnn1CCOCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7d968dda-b5a1-4752-bb44-bcff0073c062",
+ "task": "add",
+ "question": "Please add a amine to the molecule C=CC1OCCC1NC(=O)N(C)C1CCN(C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC1OCCC1NC(=O)N(C)C1CCN(C)C1=O.",
+ "ref_smiles": "C=CC1(N)OCCC1NC(=O)N(C)C1CCN(C)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e5643d36-e62b-4742-885d-fd22062899b0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CSc1nc2nc(=O)c3ncn(C)c3n2[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1nc2nc(=O)c3ncn(C)c3n2[nH]1.",
+ "ref_smiles": "Cn1cnc2c(=O)nc3nc(SCc4ccccc4)[nH]n3c21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6ee219e7-6797-4677-9277-ac4e8adc9bca",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1.",
+ "ref_smiles": "CC(C)COC[Si]1(C(C)C)O[Si](COCC(C)C)(C(C)C)O[Si](COCC(C)(C)O)(C(C)C)O[Si](COCC(C)C)(C(C)C)O1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a04e3722-a9f2-43ea-ab50-62db239f97b0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc2ccc(Br)cn2c1N=Nc1ccccc1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2ccc(Br)cn2c1N=Nc1ccccc1O",
+ "ref_smiles": "CC(=O)c1ccc2nc(C)c(N=Nc3ccccc3O)n2c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3e500b90-66a6-42b2-b687-409ae9d8eb9b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(OC(CO)C(O)CO)C(C)NC(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(OC(CO)C(O)CO)C(C)NC(C)=O.",
+ "ref_smiles": "COC(OC(CO)C(O)C(O)c1ccccc1)C(C)NC(C)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "735c1e5a-9615-46b3-b4be-b1ab55ec09b0",
+ "task": "add",
+ "question": "Modify the molecule O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1cc(C(F)(F)F)ccc1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1cc(C(F)(F)F)ccc1Cl",
+ "ref_smiles": "O=C(CSc1nnc(CNC(=O)c2ccc(Cl)cc2Cl)n1-c1ccccc1)Nc1c(Cl)ccc(C(F)(F)F)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "308d8ecc-2054-4ca9-8c7b-c9131d2bc119",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cccc(C(=O)NCC(O)c2cncs2)c1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)NCC(O)c2cncs2)c1C",
+ "ref_smiles": "Cc1cccc(C(=O)NCC(NO)c2cncs2)c1C",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "442ae5a7-e1e6-40d3-b143-f3d13211a890",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCc1cc(C(C)(CC)c2ccc(-c3cccs3)s2)sc1-c1cc(CCCCCC)c(C(C)(Br)CC)s1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCc1cc(C(C)(CC)c2ccc(-c3cccs3)s2)sc1-c1cc(CCCCCC)c(C(C)(Br)CC)s1",
+ "ref_smiles": "CCCCCCc1cc(C(C)(CC)c2ccc(-c3cccs3)s2)sc1-c1cc(CCCCCC)c(C(C)(O)CC)s1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9583c5c1-11cf-4d05-ab7f-e2dbb7322b06",
+ "task": "delete",
+ "question": "Modify the molecule [NH2+]=C1C(=Nc2ccc(O)cc2O)C=NN1CCO by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH2+]=C1C(=Nc2ccc(O)cc2O)C=NN1CCO",
+ "ref_smiles": "OCCN1CC(=Nc2ccc(O)cc2O)C=N1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b0b6c6d3-5691-411c-9cd6-151d34b1eb9d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCOC(C)C(=O)NCC(Cc1ccccc1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOC(C)C(=O)NCC(Cc1ccccc1)C(=O)[O-].",
+ "ref_smiles": "CCCCOC(C)C(=O)NCC(C)C(=O)[O-].",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "13459839-dc9c-408a-b6a5-fbacca8fa9e6",
+ "task": "add",
+ "question": "Modify the molecule Cc1cnc(Nc2nc(C(F)(F)F)ccc2C(N)=O)s1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(Nc2nc(C(F)(F)F)ccc2C(N)=O)s1",
+ "ref_smiles": "NC(=O)c1ccc(C(F)(F)F)nc1Nc1ncc(CO)s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1a2e47be-b61f-4014-b6b3-63ea5797b6d3",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)Cc1cccc(OC2CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Cc1cccc(OC2CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1.",
+ "ref_smiles": "CC(=O)Cc1cccc(OC2(c3ccccc3)CCC(C(=O)N(C)c3ccc(CN4CC[NH2+]C(C)C4)c(C)c3)CC2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f4ecc4d6-4faf-4bb0-81e4-f4801bc81144",
+ "task": "delete",
+ "question": "Modify the molecule Nc1onc(Cc2ccccc2NC(=O)Nc2ccc(-c3ccccc3)nn2)c1-c1cccc(C(F)(F)F)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1onc(Cc2ccccc2NC(=O)Nc2ccc(-c3ccccc3)nn2)c1-c1cccc(C(F)(F)F)c1",
+ "ref_smiles": "Nc1onc(Cc2ccccc2NC(=O)Nc2ccc(-c3ccccc3)nn2)c1-c1cccc(C)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a2606d0c-0abf-47c4-944a-583e310309a2",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(NC(=O)Cn2cc(C=C3C(=O)NC(=O)N(Cc4ccco4)C3=O)c3ccccc32)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)Cn2cc(C=C3C(=O)NC(=O)N(Cc4ccco4)C3=O)c3ccccc32)cc1.",
+ "ref_smiles": "Cc1ccc(NC(=O)Cn2cc(C3C(=O)NC(=O)C3c3ccco3)c3ccccc32)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "fc6776de-2db4-46ac-9b1f-498f87f5eb1b",
+ "task": "delete",
+ "question": "Modify the molecule O=CN(O)CCNC(=O)c1ccsc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=CN(O)CCNC(=O)c1ccsc1",
+ "ref_smiles": "O=CNCCNC(=O)c1ccsc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ff394a6c-f3cf-4e42-ab3e-7f0a427e7938",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CNn1ccc2ccc(N)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNn1ccc2ccc(N)cc21.",
+ "ref_smiles": "Cn1ccc2ccc(N)cc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f3dde041-ff28-4174-bf1b-97fc1f0c3a44",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOc1cc(Cl)ccc1S(=O)(=O)N(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(Cl)ccc1S(=O)(=O)N(C)C.",
+ "ref_smiles": "CCOc1c(S(=O)(=O)N(C)C)ccc(Cl)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d4f04fe3-18a2-4d95-82dd-3965db42e181",
+ "task": "add",
+ "question": "Modify the molecule CCC[NH2+]Cc1ccn(-c2cc([N+](=O)[O-])ccc2OC)n1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]Cc1ccn(-c2cc([N+](=O)[O-])ccc2OC)n1",
+ "ref_smiles": "CCC[NH2+]Cc1cc(N)n(-c2cc([N+](=O)[O-])ccc2OC)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "501d0519-d80d-4866-8adf-647a9e878214",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CNC(=O)NC(C(=O)NC(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)OCc1cncs1)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)NC(C(=O)NC(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)OCc1cncs1)C(C)C.",
+ "ref_smiles": "CNC(=O)N(C(C)C)C(Cc1ccccc1)CC(O)C(Cc1ccccc1)NC(=O)OCc1cncs1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "28497fef-2839-4fb6-94d7-59168440a603",
+ "task": "add",
+ "question": "Modify the molecule CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)C)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)C)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "CCOc1cc(C=C2SC(=[NH+]C(C)C)N(C(C)Cc3ccccc3)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b540a3b0-5d2a-4c7d-904b-fde2ead1fcf3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(NC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(F)(F)COc1ccccc1)C(=O)OCc1ccccc1CO[N+](=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(F)(F)COc1ccccc1)C(=O)OCc1ccccc1CO[N+](=O)[O-]",
+ "ref_smiles": "CC(NC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(F)(C(=O)O)COc1ccccc1)C(=O)OCc1ccccc1CO[N+](=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "52f4e6b6-4e78-41c9-8ff2-3a977cf958d6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(CC1C(=O)Nc2c(-c3cccc(Cl)c3)cnn21)Nc1ccc([N+](=O)[O-])cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1C(=O)Nc2c(-c3cccc(Cl)c3)cnn21)Nc1ccc([N+](=O)[O-])cc1",
+ "ref_smiles": "CC(=O)c1cccc(-c2cnn3c2NC(=O)C3CC(=O)Nc2ccc([N+](=O)[O-])cc2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a7930609-2362-485e-9782-66a596510ca5",
+ "task": "sub",
+ "question": "Modify the molecule CC(On1ccc2ncc(-c3cnn(C4CC[NH2+]CC4)c3)cc21)c1c(Cl)ccc(F)c1Cl by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(On1ccc2ncc(-c3cnn(C4CC[NH2+]CC4)c3)cc21)c1c(Cl)ccc(F)c1Cl",
+ "ref_smiles": "CC(On1ccc2ncc(-c3cnn(C4CC[NH2+]CC4)c3)cc21)c1c(C(=O)O)ccc(F)c1Cl",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b0a988e-1751-4e0a-9e03-934644524f22",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(OC(=O)c1cc(F)cc(F)c1)C1CCC2C3CCC4[NH+](C)CCCC4(C)C3CCC12C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC(=O)c1cc(F)cc(F)c1)C1CCC2C3CCC4[NH+](C)CCCC4(C)C3CCC12C.",
+ "ref_smiles": "CC(OC(=O)c1cccc(F)c1)C1CCC2C3CCC4[NH+](C)CCCC4(C)C3CCC12C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e7d5f344-28f7-4cb2-b97f-371087ad4e77",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COCCCNc1ncnc(Oc2cc(C)cc(C)c2)c1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCNc1ncnc(Oc2cc(C)cc(C)c2)c1N.",
+ "ref_smiles": "COC(CCNc1ncnc(Oc2cc(C)cc(C)c2)c1N)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "71338751-9774-456f-9214-f88102af68ec",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)C(Br)CCCCC1CCN(C(=O)OC(C)(C)C)CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(Br)CCCCC1CCN(C(=O)OC(C)(C)C)CC1",
+ "ref_smiles": "CCOC(=O)C(C#N)CCCCC1CCN(C(=O)OC(C)(C)C)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0241c5bb-95c6-49be-94ab-2b909a67c6d2",
+ "task": "add",
+ "question": "Modify the molecule CCCCOc1cccc(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1cccc(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1",
+ "ref_smiles": "CCCCOc1ccc(O)c(C(=O)N=c2sc3cc(OC)c(OC)cc3n2CCOC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5d54d081-d836-4072-b9bb-b2adf4a8b72c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(-n2c(C)c(C(=O)NCc3cccc(F)c3C3CC3)c3cccc(F)c3c2=O)no1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(-n2c(C)c(C(=O)NCc3cccc(F)c3C3CC3)c3cccc(F)c3c2=O)no1.",
+ "ref_smiles": "Cc1cc(-n2c(C)c(C(=O)NCc3ccccc3C3CC3)c3cccc(F)c3c2=O)no1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c67a6b98-7930-4f48-a36d-97fc30a22f85",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)CCOc1ccc(C(=O)NCCCCCCCCNC(=O)c2ccc(OCCC(C)C)c(Br)c2)cc1Br with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCOc1ccc(C(=O)NCCCCCCCCNC(=O)c2ccc(OCCC(C)C)c(Br)c2)cc1Br",
+ "ref_smiles": "CC(C)CCOc1ccc(C(=O)NCCCCCCCCNC(=O)c2ccc(OCCC(C)C)c(NO2)c2)cc1Br",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a71801ca-ac16-4ca8-a527-9f76d8e60917",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(NC(=O)Cn1cc(S(=O)(=O)N(C)C)ccc1=O)c1cccs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)Cn1cc(S(=O)(=O)N(C)C)ccc1=O)c1cccs1.",
+ "ref_smiles": "CC(c1cccs1)n1cc(S(=O)(=O)N(C)C)ccc1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "bb1fa5f7-3491-4cbb-85da-3a54f74f39be",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(CNC(=O)Nc2ccccc2OC(F)(F)F)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CNC(=O)Nc2ccccc2OC(F)(F)F)c1",
+ "ref_smiles": "Cc1cccc(CNC(=O)Nc2ccccc2OC(O)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "11a0762b-8a8a-47ce-86c6-9d15ba735ce3",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH+]1CCN(c2ccc(NC(=O)c3cccnc3)c(C)c2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]1CCN(c2ccc(NC(=O)c3cccnc3)c(C)c2)CC1",
+ "ref_smiles": "CC[NH+]1CCN(CNC(=O)c2cccnc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "59a00e95-bb56-447a-a937-8fdb98bf85fe",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2ccccc21.",
+ "ref_smiles": "CC1=C(c2ccccc2)C2(C(=O)COC2=O)c2c(O)cccc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5f59a562-479e-4e90-9922-7c7f34106eeb",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CS(=O)(=O)N1CCN(C(=O)NCCc2ccc(C(F)(F)F)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N1CCN(C(=O)NCCc2ccc(C(F)(F)F)cc2)CC1.",
+ "ref_smiles": "CS(=O)(=O)N1CCN(C(=O)NCCc2ccc(C(F)F)cc2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "18f9d5ae-0d21-4e1a-97b5-1a224a1bf3de",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(C)C5CCC43C)C12 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(C)C5CCC43C)C12",
+ "ref_smiles": "C=C(C)C1CCC2([NH2+]CCN3CCN(S(C)(=O)=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(C6=CCC(CF)(C(=O)OCc7ccccc7)CC6)C(C)(CC(=O)O)C5CCC43C)C12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f8fb93e0-0dd7-47b9-8f01-e9ec43e7f100",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)C(CCl)[NH2+]Cc1cncc(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(CCl)[NH2+]Cc1cncc(Br)c1.",
+ "ref_smiles": "CC(C)C(CCl)[NH2+]Cc1cccnc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "24eb5843-ac3f-439c-bafb-9c117ed70861",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)C(NP(=O)(OCC1OC(n2ccc(N)nc2=O)C(C)(F)C1O)Pc1ccccc1)C(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C(NP(=O)(OCC1OC(n2ccc(N)nc2=O)C(C)(F)C1O)Pc1ccccc1)C(C)C",
+ "ref_smiles": "CC(=O)C(NP(=O)(OCC1OC(n2ccc(N)nc2=O)C(C)(F)C1C(=O)O)Pc1ccccc1)C(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0644c651-8564-4d5b-948c-c350bcd0d44f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCN1C(=O)NC(=Cc2cc(Br)c(OCC)cc2OCC)C1=O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN1C(=O)NC(=Cc2cc(Br)c(OCC)cc2OCC)C1=O",
+ "ref_smiles": "CCCN1C(=O)NC(=Cc2cc(C=O)c(OCC)cc2OCC)C1=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "de867692-74b9-401e-90b1-ac8bb331c4f9",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(CCCl)NCc1cccc2cccnc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCl)NCc1cccc2cccnc12.",
+ "ref_smiles": "ClCCc1cccc2cccnc12",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d58c0340-b171-4cac-b49a-47331c997679",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule COc1ccc(C[NH+]2C3CC2CN(c2ccc(-c4cc(OF)cn5ncc(C#N)c45)cn2)C3)cn1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH+]2C3CC2CN(c2ccc(-c4cc(OF)cn5ncc(C#N)c45)cn2)C3)cn1",
+ "ref_smiles": "CC(=O)c1cnn2cc(OF)cc(-c3ccc(N4CC5CC(C4)[NH+]5Cc4ccc(OC)nc4)nc3)c12",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ab77f8ac-fea8-4846-8cce-7930e8d6a8a5",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1nc(F)ccc1C(Nc1cc(Cl)c2[nH+]cc(C#N)c(NCC(C)(C)C(F)(F)F)c2c1)c1nnn(C2(C)CC2)c1F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(F)ccc1C(Nc1cc(Cl)c2[nH+]cc(C#N)c(NCC(C)(C)C(F)(F)F)c2c1)c1nnn(C2(C)CC2)c1F",
+ "ref_smiles": "Cc1nc(F)ccc1C(Nc1cc(Cl)c2[nH+]cc(S)c(NCC(C)(C)C(F)(F)F)c2c1)c1nnn(C2(C)CC2)c1F",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1001219b-b814-4fa9-942f-a74acdb1651d",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CN(Cc1cccc(Br)c1)S(=O)(=O)c1cccnc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1cccc(Br)c1)S(=O)(=O)c1cccnc1C#N.",
+ "ref_smiles": "CN(Cc1cccc(Br)c1)S(=O)(=O)c1cccnc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "f36c471b-73db-47d7-a364-20d2a8ff84cd",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule COc1ccc(C[NH+]2CCCCC2)cc1C#N with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH+]2CCCCC2)cc1C#N",
+ "ref_smiles": "COc1ccc(C[NH+]2CCCCC2)cc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "80dd64ca-ce3b-4973-a38f-769d84c6cc39",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(Nc1ccnc(N2CCOCC2)c1)c1cccc2ccc(-c3cccc(C(F)(F)F)c3)nc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccnc(N2CCOCC2)c1)c1cccc2ccc(-c3cccc(C(F)(F)F)c3)nc12.",
+ "ref_smiles": "FC(F)(F)c1cccc(-c2ccc3ccc(-c3ccnc(N4CCOCC4)c3)nc23)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "12c66150-6b1e-4422-88a7-d17a35ff9377",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)=CC(NN)C1CCc2ccccc21 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)=CC(NN)C1CCc2ccccc21",
+ "ref_smiles": "CC(C)=CC(N)C1CCc2ccccc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5852398b-01c0-4818-a0c6-b1a42821be66",
+ "task": "add",
+ "question": "Modify the molecule CCOc1cc(OCC)c(CCC(=O)[O-])c(OCC)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(OCC)c(CCC(=O)[O-])c(OCC)c1",
+ "ref_smiles": "CCOc1cc(OC(C)c2ccccc2)cc(OCC)c1CCC(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a548bcc4-dd9f-49a2-bffd-46213e24731a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1.",
+ "ref_smiles": "O=C(NCc1ccc(Cl)nc1)C1(O)CCCC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "304cfda2-2bf8-4554-9f9f-1d1930fd3ef2",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule Cc1csc(C(C#N)C(=O)COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(C(C#N)C(=O)COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)n1.",
+ "ref_smiles": "Cc1csc(CC(=O)COC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)n1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "e46f4c3c-ba41-4f56-837d-57d388428e6c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(Cc1cscn1)C(=O)c1ccc(Br)cc1[S-] with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1cscn1)C(=O)c1ccc(Br)cc1[S-]",
+ "ref_smiles": "CN(Cc1cscn1)C(=O)c1ccc(O)cc1[S-]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3b966ddb-6aa3-4a33-bf7b-0527266f74c3",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=S1(=O)CCC(SC2NCC[NH2+]2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S1(=O)CCC(SC2NCC[NH2+]2)C1.",
+ "ref_smiles": "O=C(O)C1(SC2CCS(=O)(=O)C2)NCC[NH2+]1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "17a6a1b8-899c-4ec9-a319-b69aa3d81d92",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(C#Cc1cccc(Oc2cccc(Cl)n2)c1)N(O)C(N)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C#Cc1cccc(Oc2cccc(Cl)n2)c1)N(O)C(N)=O.",
+ "ref_smiles": "CC(C#Cc1cccc(Oc2cccc(Cl)n2)c1)NC(N)=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c15a4167-80c0-44be-b37c-12b3d83fe132",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cn1c(C(=O)NCC2(O)CCSCC2)cc2ccccc21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(C(=O)NCC2(O)CCSCC2)cc2ccccc21",
+ "ref_smiles": "Cn1c(C(=O)NCC2(S)CCSCC2)cc2ccccc21",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6dadb22f-22a1-4bcf-b09b-c2d3bc338095",
+ "task": "delete",
+ "question": "Modify the molecule O=C(c1cncc(Br)c1)c1cccc(N2CCC([NH+]3CCCC3)CC2)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cncc(Br)c1)c1cccc(N2CCC([NH+]3CCCC3)CC2)n1",
+ "ref_smiles": "O=C(c1cccnc1)c1cccc(N2CCC([NH+]3CCCC3)CC2)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3e818a81-7f64-42f9-afeb-6f417614380b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC1CC([NH2+]C(C)c2cccc(Cl)c2)C12CCC2 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC1CC([NH2+]C(C)c2cccc(Cl)c2)C12CCC2",
+ "ref_smiles": "CCOC1CC([NH2+]C(C)c2cccc(S)c2)C12CCC2",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "74e872e4-2d5a-4059-830f-d322274451de",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCNc1c(OCC(CC)CCCC)ccc(N)c1CC(CC)CCCC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCNc1c(OCC(CC)CCCC)ccc(N)c1CC(CC)CCCC",
+ "ref_smiles": "CCCCCCNc1c(OCC(CC)CCCC)cccc1CC(CC)CCCC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "fb7238a2-8d19-48ac-823b-1eda3d431cd0",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(C2CCC[NH2+]2)cc(Br)c1OCC1CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C2CCC[NH2+]2)cc(Br)c1OCC1CC1",
+ "ref_smiles": "COc1cc(C2CCC[NH2+]2)ccc1OCC1CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c863d0b-4684-4ea7-a8a7-291f25db6892",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)c1cc(F)c(Br)c(Br)c1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cc(F)c(Br)c(Br)c1F",
+ "ref_smiles": "CC(=O)c1cc(NO)c(Br)c(Br)c1F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3aabe182-a4da-4a14-8dc1-8e1fe5a40248",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCc1ccc(-c2cn[nH]c2C[NH3+])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(-c2cn[nH]c2C[NH3+])cc1.",
+ "ref_smiles": "CCCc1ccc(-c2cn[nH]c2C[NH3+])c(-c3ccccc3)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b7b66f45-1889-42af-9d20-8dc2d88acc1e",
+ "task": "sub",
+ "question": "Modify the molecule CCC1COC(C)CN1c1ccc(CBr)cn1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1COC(C)CN1c1ccc(CBr)cn1",
+ "ref_smiles": "CCC1COC(C)CN1c1ccc(CC(=O)O)cn1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c5971a20-dad4-4473-a9b9-b69b6b230021",
+ "task": "add",
+ "question": "Modify the molecule C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3)c2c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3)c2c1=O",
+ "ref_smiles": "C=CCn1c(SCC(=O)Nc2ccc(C)c(F)c2)nc2scc(-c3ccc(C)cc3-c3ccccc3)c2c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a8ba47af-ee1f-4fbb-aa59-da2e9904de1f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1(C)CCC[NH+](Cc2cc(Oc3c(Cl)cc(-n4ncc(=O)[nH]c4=O)cc3Cl)ccc2O)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC[NH+](Cc2cc(Oc3c(Cl)cc(-n4ncc(=O)[nH]c4=O)cc3Cl)ccc2O)C1.",
+ "ref_smiles": "CC1(C)CCC[NH+](Cc2cc(Oc3ccc(-n4ncc(=O)[nH]c4=O)cc3Cl)ccc2O)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "77cca8d2-4112-43bf-a5c0-524f86ece769",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC1C(n2cnc3c(=O)nc(NC(=O)C(C)C)[nH]c32)OC2([SiH2]C2OC(C)(C)C)C1OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1C(n2cnc3c(=O)nc(NC(=O)C(C)C)[nH]c32)OC2([SiH2]C2OC(C)(C)C)C1OC(C)(C)C.",
+ "ref_smiles": "COC1C(n2cnc3c(=O)nc[nH]c32)OC2([SiH2]C2OC(C)(C)C)C1OC(C)(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f30e3b62-c36c-4cb4-8484-d42daf509ee2",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)C(C)=CC[NH2+]CC1(O)CCOCC1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)=CC[NH2+]CC1(O)CCOCC1",
+ "ref_smiles": "COC(=O)C(C)=CC[NH2+]CC1CCOCC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a91df5a9-58ae-4972-ade8-3aff4b0090a4",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(CC#N)N(C)C1=CC(=O)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC#N)N(C)C1=CC(=O)CC1",
+ "ref_smiles": "CC(CS)N(C)C1=CC(=O)CC1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d1cfe466-0c23-4c22-8979-ecb13b94279c",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1nc(C2CCCOC2)sc1C(=O)N(C)Cc1nccs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C2CCCOC2)sc1C(=O)N(C)Cc1nccs1.",
+ "ref_smiles": "Cc1sc(C2CCCOC2)nc1(C)Cc1nccs1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1a27e916-4406-423f-9d94-e84611612d17",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)(C)OC(=O)N1CCCC1C(O)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCCC1C(O)F.",
+ "ref_smiles": "CC(C)(C)OC(=O)N1C(C(=O)O)CCC1C(O)F",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "78967d4e-a379-4347-bbb0-b4609f840709",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(P(=O)(c2cccc(-c3cccc(P(=O)(c4c(C)cc(C)cc4C)c4c(C)cc(C)c(C(=O)O)c4C)c3)c2)c2c(C)cc(C)cc2C)c(C)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "56df9db5-8619-42e6-9cc6-8d5e5a3161d2",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C)n(-c2cc(N3CCN(C(=O)c4ccccc4F)CC3)ncn2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(-c2cc(N3CCN(C(=O)c4ccccc4F)CC3)ncn2)n1.",
+ "ref_smiles": "Cc1cc(C)n(-c2cc(N3CCN(C(=O)c4ccccc4)CC3)ncn2)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1fcaf9c2-5f58-4851-8510-88de2ea14404",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(CNC(=O)c2cc(N(C)C3CCCCC3)nc3ccccc23)cc1OC by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CNC(=O)c2cc(N(C)C3CCCCC3)nc3ccccc23)cc1OC",
+ "ref_smiles": "COC(NC(=O)c1cc(N(C)C2CCCCC2)nc2ccccc12)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "df1653f3-e9d8-41c7-bd65-d9273fa1af41",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCC(c1ccccc1O)C(CCCC)CCCC with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(c1ccccc1O)C(CCCC)CCCC",
+ "ref_smiles": "CCCCCC(c1ccccc1Br)C(CCCC)CCCC",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "71557bdf-f383-44ec-b8db-53d62095dbcd",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CN(CCCOc1ccc(F)cc1)C(=O)C1CCN(c2ccc(C#N)cn2)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCCOc1ccc(F)cc1)C(=O)C1CCN(c2ccc(C#N)cn2)CC1",
+ "ref_smiles": "CN(CCCOc1ccc(F)cc1)C(=O)C1CCN(c2ccc(CHO)cn2)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ec49f244-9289-44f4-a054-3a27640fc0df",
+ "task": "delete",
+ "question": "Modify the molecule CCCNc1nc(C)cc(NC(C)c2ccc(F)cc2)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1nc(C)cc(NC(C)c2ccc(F)cc2)n1",
+ "ref_smiles": "CCCNc1nc(C)cc(NC(C))n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "58da3bde-4703-44ec-a7f0-0e6afd09acbc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1nnc2ccc(NCC3CCCCC3)nn12 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1nnc2ccc(NCC3CCCCC3)nn12",
+ "ref_smiles": "O=[N+]([O-])c1nnc2ccc(NCC3CCCCC3)nn12",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2ccb1652-122f-48c1-aea0-e7caeed4e000",
+ "task": "add",
+ "question": "Modify the molecule CC(C)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1",
+ "ref_smiles": "CC(CO)CN(C(=O)C[NH+]1CCCC(CO)C1)C1CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "44578edd-d095-454e-8005-466c2aa582f7",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCC1C(=O)N(C)C(COCC)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(C(=O)NCC(N)=O)CSCC(=O)NC(Cc2ccc(O)cc2)C(=O)N(C)C(C)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(Cc2cnc[nH]2)C(=O)NC(CC(C)C)C(=O)N2CCCC2C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CO)C(=O)NC(Cc2csc3ccccc23)C(=O)N1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC1C(=O)N(C)C(COCC)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(C(=O)NCC(N)=O)CSCC(=O)NC(Cc2ccc(O)cc2)C(=O)N(C)C(C)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(Cc2cnc[nH]2)C(=O)NC(CC(C)C)C(=O)N2CCCC2C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CO)C(=O)NC(Cc2csc3ccccc23)C(=O)N1C.",
+ "ref_smiles": "CCCCC1C(=O)N(C)C(COCC)C(=O)NC(CCCNC=[NH2+])C(=O)NC(C(=O)NCC(N)=O)CSCC(=O)NC(Cc2ccc(O)cc2)C(=O)N(C)C(C)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(Cc2cnc[nH]2)C(=O)NC(CC(C)C)C(=O)N2CCCC2C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CO)C(=O)NC(Cc2csc3ccccc23)C(=O)N1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "389fd82c-af26-4211-8999-2371acbc3abe",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C(Cc2ccc(C)cc2)c2csc(N)n2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(Cc2ccc(C)cc2)c2csc(N)n2)cc1",
+ "ref_smiles": "COc1ccc(C(Cc2ccc(C)cc2)c2cscn2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6d8a4ea6-6d63-43be-a8f3-96e12662b159",
+ "task": "add",
+ "question": "Modify the molecule OC(C[NH2+]C1CC1)Cc1sccc1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(C[NH2+]C1CC1)Cc1sccc1Br",
+ "ref_smiles": "OC(C[NH2+]C1CC1)C(c1ccccc1)c1sccc1Br",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "533ebdbe-97d3-4bcd-ac15-d0f1bd6bb382",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CN(C)C(=O)n1nnc(-c2ccc(Oc3ccccc3)cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)n1nnc(-c2ccc(Oc3ccccc3)cc2)n1.",
+ "ref_smiles": "CN(C)C(=O)n1nnc(Oc2ccccc2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "83e29826-8192-4dfe-8c3b-62a58b55602d",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C(N)=[NH+]c1cccc2cccnc12 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(N)=[NH+]c1cccc2cccnc12",
+ "ref_smiles": "CC(C)C=[NH+]c1cccc2cccnc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "ba711711-ac82-4a72-a04e-5b8c53a268d2",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCN1CC(=O)N(C(C)(C)CCNC(=S)NCCCNC(=S)NCCC(C)(C)N2C(=O)CN(CC)C2=S)C1=S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1CC(=O)N(C(C)(C)CCNC(=S)NCCCNC(=S)NCCC(C)(C)N2C(=O)CN(CC)C2=S)C1=S.",
+ "ref_smiles": "CCN1CC(=O)N(C(C)(C)CCNC(=S)NCCCNC(=S)CCC(C)(C)N2C(=O)CN(CC)C2=S)C1=S",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c7c9adbe-b664-4bab-a129-e56595b5f25c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C#CCC[NH+](C)C1CC(C)OC(OC2C(C)C(=O)C(C)C(=O)OC(CC)C(C)(O)C(O)C(C)C(=NOC3CC[NH2+]C3)CCC2(C)OC)C1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCC[NH+](C)C1CC(C)OC(OC2C(C)C(=O)C(C)C(=O)OC(CC)C(C)(O)C(O)C(C)C(=NOC3CC[NH2+]C3)CCC2(C)OC)C1O",
+ "ref_smiles": "C#CCC(=O)[NH+](C)C1CC(C)OC(OC2C(C)C(=O)C(C)C(=O)OC(CC)C(C)C(C)C(=NOC3CC[NH2+]C3)CCC2(C)OC)C1O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e7452066-5e8f-43ce-a98b-d52beb67f52c",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cc(Cl)c(C(O)c2cccc(C)c2C)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)c(C(O)c2cccc(C)c2C)cc1C.",
+ "ref_smiles": "Cc1cc(Cl)c(Cc2cccc(C)c2C)cc1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8acd0bf3-694a-4330-9292-c8eac2dc852b",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2)cc1",
+ "ref_smiles": "COC(=O)CCc1ccc(OCc2ccc(Oc3ccc(Oc4ccccc4)cc3)cc2-c2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "30b68808-0e38-4102-b7d7-bde86a11c7f8",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCC(C)[NH+]1CCCC(N)=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC(C)[NH+]1CCCC(N)=O",
+ "ref_smiles": "CC1CCC(N)C(C)[NH+]1CCCC(N)=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "f4ca69ca-d0db-4557-88d3-2cdab0c64d75",
+ "task": "add",
+ "question": "Modify the molecule CCCC1(C(=O)[O-])CCN(C(=O)C(C)(C)CC)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1(C(=O)[O-])CCN(C(=O)C(C)(C)CC)CC1",
+ "ref_smiles": "CCCC1(C(=O)[O-])CCN(C(=O)C(C)(CC)CO)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "47721e39-ba12-40ca-bc5f-296235f95341",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CSc1ccccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1.",
+ "ref_smiles": "CSc1cc(C(=O)O)ccc1NC(=O)CSc1nnc(-c2ccc(Cl)cc2)n1-c1ccc(C)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c1f15841-4b47-42a1-9bd4-d60e2d7010c5",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1",
+ "ref_smiles": "CCOC(=O)C(C)(C)NP(=O)(NC(C)(C)C(O)(O)OCC)c1ccc(-c2nc(N)sc2CC(C)C)o1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "48bddc96-cdec-44fc-b115-36d813290753",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(OC)c(NC(=O)CSc2cn(Cc3ccc(F)cc3)c3ccccc23)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OC)c(NC(=O)CSc2cn(Cc3ccc(F)cc3)c3ccccc23)c1",
+ "ref_smiles": "COc1ccc(OC)c(NC(=O)C(CC=O)Sc2cn(Cc3ccc(F)cc3)c3ccccc23)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b0be3b70-fe89-4b3c-8d84-6cb39ea3e59c",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)cc4)c3c2Cl)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)cc4)c3c2Cl)CC1",
+ "ref_smiles": "[NH3+]C1CCC(c2c(F)cc3c(=O)c4c(=O)[nH]sc4n(-c4ccc(F)c(C(=O)O)c4)c3c2Cl)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0dcdaba2-58bb-4946-8941-b68f887026f1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(F)cc1S(=O)(=O)Nc1ccc2c(c1)OCC(C)(C)C(=O)N2CC(C)C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(F)cc1S(=O)(=O)Nc1ccc2c(c1)OCC(C)(C)C(=O)N2CC(C)C",
+ "ref_smiles": "CC(=O)c1ccc(OC)c(S(=O)(=O)Nc2ccc3c(c2)OCC(C)(C)C(=O)N3CC(C)C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0063f3ac-ade9-42b6-ad8c-fc8b81fecce3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COOCc1ccc(-n2cc(-c3cccc4c(=O)cc(N5CCOCC5)[nH]c34)nn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COOCc1ccc(-n2cc(-c3cccc4c(=O)cc(N5CCOCC5)[nH]c34)nn2)cc1.",
+ "ref_smiles": "COOCn1cc(-c2cccc3c(=O)cc(N4CCOCC4)[nH]c23)nn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bd2677e6-750d-4e91-bc7e-8be6a11460af",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1cccc(N2C(SC)=[NH+]C(=[NH+]c3ccccc3C)C23CCOC(C)(C)C3)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(N2C(SC)=[NH+]C(=[NH+]c3ccccc3C)C23CCOC(C)(C)C3)c1.",
+ "ref_smiles": "CON1C(SC)=[NH+]C(=[NH+]c2ccccc2C)C12CCOC(C)(C)C2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "29911b32-e00c-4d63-aff9-3da88a1624ab",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl",
+ "ref_smiles": "CCN(CC)C(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)NC(O)(C(=O)Nc3ccc(Cl)cc3C(N)=O)C(C)C)CC2)ccc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c6abc9f1-d1be-4a30-b826-5fefa1142017",
+ "task": "add",
+ "question": "Modify the molecule CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1",
+ "ref_smiles": "CCCNC(=O)C(C)[NH+](CCC[NH3+])C1CCCCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a0bc49c6-f69e-44fe-a335-189e00347a1d",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule NC(c1c(Cl)ccc(Br)c1O)C(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(c1c(Cl)ccc(Br)c1O)C(F)(F)F.",
+ "ref_smiles": "N#Cc1cc(Br)c(O)c(C(N)C(F)(F)F)c1Cl",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "928a9a3d-8423-4d61-9bff-191853b72c66",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCC(C)(C)NC(=O)c1cc(N)ccc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)(C)NC(=O)c1cc(N)ccc1Cl",
+ "ref_smiles": "CCCC(C)(C)NC(=O)c1cc(N)ccc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ee5ad004-2a8d-4d58-9432-136a74c82001",
+ "task": "add",
+ "question": "Modify the molecule CC(C(=O)N1CCC(CBr)CC1)C1CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)N1CCC(CBr)CC1)C1CC1",
+ "ref_smiles": "CC(C(=O)N1CCC(CBr)CC1)C1(C(=O)O)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4ca5f7d4-c998-4cfa-b015-9ebad47e291c",
+ "task": "delete",
+ "question": "Modify the molecule COCCn1cc(CNC(=O)N2CCCC(C(F)(F)F)C2)cn1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1cc(CNC(=O)N2CCCC(C(F)(F)F)C2)cn1",
+ "ref_smiles": "COCCn1cc(CNC(=O)N2CCCC(C(F)F)C2)cn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e865b012-088b-423e-82ad-56fa914aae99",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)(CCCCC(c1ccccc1Cl)[NH+]1CCCc2sccc2C1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(CCCCC(c1ccccc1Cl)[NH+]1CCCc2sccc2C1)C(=O)[O-].",
+ "ref_smiles": "CC(C)(CCCCC(c1ccccc1)[NH+]1CCCc2sccc2C1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d891a1c3-99b4-4b9e-a46c-7bd949535a81",
+ "task": "sub",
+ "question": "Modify the molecule CCCCOCCC[NH2+]CCCOCC(F)(F)F by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOCCC[NH2+]CCCOCC(F)(F)F",
+ "ref_smiles": "CCCCOCCC[NH2+]CCCOCC(F)(F)NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d39307e1-eb57-497b-9b19-247beb1de893",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCc1nc(C(N)=O)c(Nc2ccc3c(c2)OCC(=O)N3CC[NH+]2CCN(C)CC2)nc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(C(N)=O)c(Nc2ccc3c(c2)OCC(=O)N3CC[NH+]2CCN(C)CC2)nc1Cl.",
+ "ref_smiles": "CCc1cnc(Nc2ccc3c(c2)OCC(=O)N3CC[NH+]2CCN(C)CC2)c(C(N)=O)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "abf2daec-8172-4c91-afc2-370b8ceb5552",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1cc(C#N)ccc1C[NH2+]CC(O)c1ccccc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C#N)ccc1C[NH2+]CC(O)c1ccccc1",
+ "ref_smiles": "CC(=O)c1ccc(C[NH2+]CC(O)c2ccccc2)c(C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "dae6c4fa-4e13-44c2-8156-af2b788d1f33",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)C1=CC[NH+](CCN2CCC([NH3+])CC2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1=CC[NH+](CCN2CCC([NH3+])CC2)CC1",
+ "ref_smiles": "CC(C)(C)C1=C(c2ccccc2)C[NH+](CCN2CCC([NH3+])CC2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0d7a209d-c4d3-4153-af7c-c7c6703a660e",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1ccccc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1ccccc1",
+ "ref_smiles": "CC(C)(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1cccc(N)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "ad3a2c46-f18d-4f7b-930b-c21ea262e7d9",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCCCC([NH2+]C)c1c(Cl)cnn1CCOC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC([NH2+]C)c1c(Cl)cnn1CCOC.",
+ "ref_smiles": "CCCCC(O)CC([NH2+]C)c1c(Cl)cnn1CCOC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "84e3fdcc-0a56-44f6-89cc-3e093f1a09d1",
+ "task": "sub",
+ "question": "Modify the molecule CCCCOc1ccc(C[NH2+]CC(C)(O)CC(C)C)cc1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1ccc(C[NH2+]CC(C)(O)CC(C)C)cc1",
+ "ref_smiles": "CCCCOc1ccc(C[NH2+]CC(C)(S)CC(C)C)cc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0d1299b0-e1e0-49f2-8f84-35533f4cfb8a",
+ "task": "sub",
+ "question": "Modify the molecule CCCc1cc(-c2nnc(SCC(=O)Nc3cc(Cl)ccc3C)n2CCC)cs1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(-c2nnc(SCC(=O)Nc3cc(Cl)ccc3C)n2CCC)cs1",
+ "ref_smiles": "CCCc1cc(-c2nnc(SCC(=O)Nc3cc(S)ccc3C)n2CCC)cs1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "877cf500-bf0e-4576-868b-95ee0b9cd553",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCOC3=O)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCOC3=O)cc2)cc1.",
+ "ref_smiles": "COc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CC(O)OC3=O)cc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9e2bf123-7034-44eb-af33-e4311bd0c456",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCNC(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)NC4CCCCC4)c3)CC2)c(C)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)NC4CCCCC4)c3)CC2)c(C)c1",
+ "ref_smiles": "CCCNC(=O)c1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(NO)c(C(=O)NC4CCCCC4)c3)CC2)c(C)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d037399b-2b6c-4ac9-a2ba-bb86c19b5db8",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)CCC[NH+](CCCNC(=S)Nc1cccc(Br)c1)C1CCCc2ccccc21 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCC[NH+](CCCNC(=S)Nc1cccc(Br)c1)C1CCCc2ccccc21",
+ "ref_smiles": "COC(=O)CCC[NH+](CCCC(=S)Nc1cccc(Br)c1)C1CCCc2ccccc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "768ca348-1cbd-495f-8b2e-5adb5c2ed2c0",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CCCC[N+]([O-])=C(c1cccnc1)c1cccc(COC(=O)N2CCc3c(sc4c3C(c3ccccc3Cl)=NCc3nnc(C)n3-4)C2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCCC[N+]([O-])=C(c1cccnc1)c1cccc(COC(=O)N2CCc3c(sc4c3C(c3ccccc3Cl)=NCc3nnc(C)n3-4)C2)c1",
+ "ref_smiles": "CCOC(=O)CCCC[N+]([O-])=C(c1cccnc1)c1cccc(COC(=O)N2CCc3c(sc4c3C(Cl)=NCc3nnc(C)n3-4)C2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "af7a9b8b-efe0-4d11-b153-f41d0466f938",
+ "task": "add",
+ "question": "Modify the molecule Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccccc1-2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccccc1-2",
+ "ref_smiles": "Nc1nc2c3c(ccn3n1)C(c1cccc(F)c1F)Nc1ccc(-c3ccccc3)cc1-2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "647b420b-be2c-4592-a736-ebea756ff97a",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(NC(=O)C[NH+]2CCC(C(=O)Nc3cccc(C(=O)Nc4cccc(F)c4)c3C)CC2)cccc1C(N)=O by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)Nc3cccc(C(=O)Nc4cccc(F)c4)c3C)CC2)cccc1C(N)=O",
+ "ref_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)Nc3cccc(C(=O)Nc4cccc(O)c4)c3C)CC2)cccc1C(N)=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c99e3b66-9b3e-4cc8-89a0-430d90ac0c91",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1cccc(C)c1C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)N(CC#N)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)N(CC#N)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C",
+ "ref_smiles": "CC(=O)CN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC(Cc1ccccc1)C(=O)OC(C)(C)C)c1c(C)cccc1C",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "3bf9939d-62d1-4472-bd42-de0e97dc18d0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ncccc1C(=O)OCC(=O)NC(C)c1cccc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ncccc1C(=O)OCC(=O)NC(C)c1cccc(Cl)c1.",
+ "ref_smiles": "CCOc1ncccc1C(=O)OC(O)C(=O)NC(C)c1cccc(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "72a6dffe-6b66-4f5c-a4f2-628d126c281e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1c(C)cnc(Cn2cc(S(=O)(=O)Cl)[nH+]c2C)c1C with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(C)cnc(Cn2cc(S(=O)(=O)Cl)[nH+]c2C)c1C",
+ "ref_smiles": "COc1c(C)cnc(Cn2cc(S(=O)(=O)O)[nH+]c2C)c1C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fc1e0297-b82a-4de1-97e5-396f304a314e",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(=O)N1CCc2cc(NC(=O)c3cc(-c4cccnc4)nc4c3cnn4Cc3ccco3)ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCc2cc(NC(=O)c3cc(-c4cccnc4)nc4c3cnn4Cc3ccco3)ccc21.",
+ "ref_smiles": "O=C(Nc1ccc2c(c1)CC2)c1cc(-c2cccnc2)nc2c1cnn2Cc1ccco1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2702f80e-122d-4b0b-8a98-e98ead3f147a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CC(Cl)=C(CCCCN(CCC)S(=O)(=O)Cc1ccccc1)C(Cl)=CC with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(Cl)=C(CCCCN(CCC)S(=O)(=O)Cc1ccccc1)C(Cl)=CC",
+ "ref_smiles": "C=CC(O)=C(CCCCN(CCC)S(=O)(=O)Cc1ccccc1)C(Cl)=CC",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2496e458-d0ab-4e04-8c2e-2c35856353b4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Clc1ccc(CBr)c2nc[nH]c12 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc(CBr)c2nc[nH]c12",
+ "ref_smiles": "Oc1ccc(CBr)c2nc[nH]c12",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "61dca8d4-4033-4779-bed3-3b9c3133e773",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(c1ccc(Cl)cc1Cl)N1C(=O)C(O)C(C)(CO)C1=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccc(Cl)cc1Cl)N1C(=O)C(O)C(C)(CO)C1=O",
+ "ref_smiles": "CC(c1ccc(O)cc1Cl)N1C(=O)C(O)C(C)(CO)C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5d812a82-f7bc-44f4-9fb3-5dfeed2fdfdf",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)C1C(C)N(C)C1[NH+]1CCN(c2ccccc2Cl)CC1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1C(C)N(C)C1[NH+]1CCN(c2ccccc2Cl)CC1",
+ "ref_smiles": "CC(C)C1C(C)N(C)C1[NH+]1CCN(c2ccccc2S)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dc53a7ad-1c44-4200-90b4-ee465518470c",
+ "task": "add",
+ "question": "Modify the molecule CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1ccccc1",
+ "ref_smiles": "CS(=O)(=O)C(Cl)(Cl)S(=O)(=O)Oc1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5d00508d-8cfe-40dd-9bfc-e47026cf9538",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC([NH2+]Cc1ccc(F)c(Cl)c1)c1ccc(F)c(Br)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]Cc1ccc(F)c(Cl)c1)c1ccc(F)c(Br)c1",
+ "ref_smiles": "CC([NH2+]Cc1ccc(O)c(Cl)c1)c1ccc(F)c(Br)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f2d5e188-ef4b-427f-881a-9a13af669c7f",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)NC(C(=O)Oc2ccccc2)C(O)c2ccccc2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)NC(C(=O)Oc2ccccc2)C(O)c2ccccc2)cc1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)C(C(=O)Oc2ccccc2)C(O)c2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "60e0d428-61cc-45aa-a510-18fe2f2de64a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+]=C(NCc1cccc(C(F)(F)F)c1)NCc1nccn1Cc1ccccc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1cccc(C(F)(F)F)c1)NCc1nccn1Cc1ccccc1",
+ "ref_smiles": "C[NH+]=C(NCc1cccc(C=O)c1)NCc1nccn1Cc1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bdd99ba9-4919-41ed-bc4c-fb5c67c36d20",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)cc1OC.",
+ "ref_smiles": "C=CCOc1ccc(C2C(=C([O-])c3ccc(C)cc3)C(=O)C(=O)N2CC[NH+](CC)CC)c(-c2ccccc2)c1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "08f1cdc0-edeb-407a-a3da-91873860833c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1sc2c3ccccc3p(-c3ccccc3)c2c1C1=C(P(c2ccccc2)c2ccccc2)C2CCC1(C)C2(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1sc2c3ccccc3p(-c3ccccc3)c2c1C1=C(P(c2ccccc2)c2ccccc2)C2CCC1(C)C2(C)C.",
+ "ref_smiles": "Cc1sc2c3ccccc3p(-c3ccccc3)c2c1C1=C(Pc2ccccc2)C2CCC1(C)C2(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f1a763cb-16ee-46ad-9066-ffed3caeadc1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(-n2c(C)nc3ccccc3c2=O)ccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(-n2c(C)nc3ccccc3c2=O)ccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1",
+ "ref_smiles": "C(=O)c1cc(-n2c(C)nc3ccccc3c2=O)ccc1NS(=O)(=O)c1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c180fa89-266d-4306-86ba-7c11c469c68a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)COc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COc1cccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)c1.",
+ "ref_smiles": "CC(C)COc1cc(C(=O)NC(=S)Nc2ccccc2C(=O)NC(C)c2ccccc2)ccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "663cd489-cac3-4d01-aa8a-c96c15500e21",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(CC(C)(C)C)C(O)ON1C(O)C2C3CCC(C3)C2C1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC(C)(C)C)C(O)ON1C(O)C2C3CCC(C3)C2C1O.",
+ "ref_smiles": "CC(CON1C(O)C2C3CCC(C3)C2C1O)CC(C)(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f610d84a-eb55-490c-b581-b9a638cf16c2",
+ "task": "add",
+ "question": "Modify the molecule CN(Cc1nc(-c2cccc(Cl)c2)no1)C(=O)C(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1nc(-c2cccc(Cl)c2)no1)C(=O)C(C)(C)C",
+ "ref_smiles": "CN(C(=O)C(C)(C)C)C(O)c1nc(-c2cccc(Cl)c2)no1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "00e3d0a9-cadf-425f-b8f4-d46ec478b014",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule [NH3+]CC(=O)c1cc2c(O)cccc2o1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC(=O)c1cc2c(O)cccc2o1",
+ "ref_smiles": "[NH3+]CC(=O)c1cc2c(F)cccc2o1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5b59507a-1382-4519-8fec-301058c898e8",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CC1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1)NCCC1=CCCCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1c2ccccc2CCN1S(=O)(=O)c1ccc(F)cc1)NCCC1=CCCCC1",
+ "ref_smiles": "O=S(=O)(c1ccc(F)cc1)N1CCc2ccccc2C1CCC1=CCCCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b9560f55-ea45-4cb3-b17c-d4bc37512289",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5ccccc5n6C)c4)c3c2=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5ccccc5n6C)c4)c3c2=O)cc1.",
+ "ref_smiles": "Cc1ccc(-n2nc(-c3ccccc3)c3c4ccccc4n(Cc4cccc(-c5nn(-c6ccccc6)c(=O)c6c5c5c(O)cccc5n6C)c4)c3c2=O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "adaec430-a912-40fb-baef-ace11f5c0dec",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(F)cc1C(NN)c1cc(Br)sc1Br by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(F)cc1C(NN)c1cc(Br)sc1Br",
+ "ref_smiles": "Cc1ccc(NO)cc1C(NN)c1cc(Br)sc1Br",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0ef868a9-95cb-40d7-81ef-b57fcad9a2f8",
+ "task": "add",
+ "question": "Modify the molecule CC1CC[NH+](CCCCNC(=O)NCCOc2ccccc2-c2ccccc2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC[NH+](CCCCNC(=O)NCCOc2ccccc2-c2ccccc2)CC1",
+ "ref_smiles": "CC1CC[NH+](CCC(CNC(=O)NCCOc2ccccc2-c2ccccc2)c2ccccc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ec3d6446-3057-455c-b16a-62dba30133d7",
+ "task": "add",
+ "question": "Modify the molecule CCC1CCCCN1C(=O)NC1CCCC1C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCCN1C(=O)NC1CCCC1C(=O)[O-]",
+ "ref_smiles": "CCC1C(c2ccccc2)CCCN1C(=O)NC1CCCC1C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "032999a7-61e0-4378-96ee-73ebfd71527f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc2sc(N3CC[NH+](CCNC(C)=O)CC3)nc2c1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2sc(N3CC[NH+](CCNC(C)=O)CC3)nc2c1OC.",
+ "ref_smiles": "CC[NH+]1CCN(c2nc3c(OC)c(OC)ccc3s2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "23fc9d52-910e-46ed-8332-179d4bc9a90c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccccc1-c1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)o1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1-c1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)o1",
+ "ref_smiles": "COc1ccccc1-c1nnc(NC(=O)c2cc([N+](=O)[O-])ccc2[N+](=O)[O-])o1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "02caf6e3-7843-42bb-a6a2-99e37598bf06",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)C[NH2+]CC(C)(C)c1cc(Br)ccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C[NH2+]CC(C)(C)c1cc(Br)ccc1F.",
+ "ref_smiles": "COC(=O)C[NH2+]CC(C)(C)c1ccccc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "981d1a57-22b3-4571-8bb6-9d4ebaa239a0",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc([N+](=O)[O-])cc1C(=O)NCCCOCCO by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc([N+](=O)[O-])cc1C(=O)NCCCOCCO",
+ "ref_smiles": "CCOCCCNC(=O)c1cc([N+](=O)[O-])ccc1OC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5974944d-9cba-4635-a191-f1984041cf93",
+ "task": "add",
+ "question": "Modify the molecule COCC1CCC[NH+](CC(O)c2ccc(C#N)cc2)C1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1CCC[NH+](CC(O)c2ccc(C#N)cc2)C1",
+ "ref_smiles": "COCC1CCC[NH+](CC(N)(O)c2ccc(C#N)cc2)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "6c93d124-9fc6-4dfe-901f-f113cdb2a129",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)CN(C)C(=O)c1sccc1C#CC[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CN(C)C(=O)c1sccc1C#CC[NH3+].",
+ "ref_smiles": "COC(=O)C1sccc1(C)C#CC[NH3+]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9daf901d-d86a-4dbb-813a-77e52dc7ce62",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cccc(Sc2ccccc2C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Sc2ccccc2C)c1.",
+ "ref_smiles": "Cc1ccccc1Sc1cccc(C)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "73bb75d7-1d04-4fe6-8a61-ef9ac03f6979",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)N(CCO)C(=O)C1CNC(=O)C[NH2+]1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(CCO)C(=O)C1CNC(=O)C[NH2+]1",
+ "ref_smiles": "CC(C)N(CCC#N)C(=O)C1CNC(=O)C[NH2+]1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "dc51c0c0-f7ac-4ed4-bfb8-7f4ba9721406",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)OC(=O)NCCC1(F)CC[NH2+]CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NCCC1(F)CC[NH2+]CC1",
+ "ref_smiles": "CC(=O)C1(CCNC(=O)OC(C)(C)C)CC[NH2+]CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "62435059-d2db-4c59-9d65-ad7472fe9859",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(C=Cc1ccc(O)c(O)c1)OCC1OC(OC2C(OC3C(Oc4c(-c5ccc(O)c(O)c5)oc5cc(=O)cc([O-])c-5c4O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccc(O)c(O)c1)OCC1OC(OC2C(OC3C(Oc4c(-c5ccc(O)c(O)c5)oc5cc(=O)cc([O-])c-5c4O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O",
+ "ref_smiles": "CC(=O)c1ccc(C=CC(=O)OCC2OC(OC3C(OC4C(Oc5c(-c6ccc(O)c(O)c6)oc6cc(=O)cc([O-])c-6c5O)OC(CO)C(O)C4O)OC(CO)C(O)C3O)C(O)C(O)C2O)cc1O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "da7c2d88-a6e0-4a87-a4ba-0c9015c71074",
+ "task": "add",
+ "question": "Modify the molecule CCC(CN1CCCCC1=O)[NH2+]CCc1ccc(OS(=O)(=O)C(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CN1CCCCC1=O)[NH2+]CCc1ccc(OS(=O)(=O)C(C)C)cc1",
+ "ref_smiles": "CCC(CN1CCCCC1=O)[NH2+]CC(c1ccccc1)c1ccc(OS(=O)(=O)C(C)C)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eee2c188-8bca-49fe-b164-9387f36cca40",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(NCc2ccc(-c3ccc(Cl)cc3)o2)cc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NCc2ccc(-c3ccc(Cl)cc3)o2)cc1Cl",
+ "ref_smiles": "Cc1ccc(NCc2ccc(-c3ccc(O)cc3)o2)cc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1afa3378-22b8-4cd6-9261-4b92e87482fd",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1ccccc1.",
+ "ref_smiles": "O=c1c2ccccc2nc(SCc2c(F)cccc2F)n1CCc1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e54c1ae1-1f07-4e6e-8321-1a638857b952",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(-n2c(C(Sc3ccc(Cl)cc3)c3cc(F)ccc3F)nc3ccccc32)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-n2c(C(Sc3ccc(Cl)cc3)c3cc(F)ccc3F)nc3ccccc32)cc1",
+ "ref_smiles": "COc1ccc(-n2c(C(Sc3ccc(O)cc3)c3cc(F)ccc3F)nc3ccccc32)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f1993a7b-62de-4955-8412-ce33285f38ba",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CCn1c(-c2sc(NC(=O)C3(c4ccc(F)cc4)CC3)nc2C)n[nH]c1=S with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(-c2sc(NC(=O)C3(c4ccc(F)cc4)CC3)nc2C)n[nH]c1=S",
+ "ref_smiles": "C=CCn1c(-c2sc(NC(=O)C3(c4ccc(O)cc4)CC3)nc2C)n[nH]c1=S",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aebb1880-2c23-45e9-992f-7a678cbf9cfc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCn1cc(C)c2c(Br)cc(C(=O)NCc3c(C)cc(C)[nH]c3=O)c(C)c21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1cc(C)c2c(Br)cc(C(=O)NCc3c(C)cc(C)[nH]c3=O)c(C)c21",
+ "ref_smiles": "CCn1cc(C)c2c(C#N)cc(C(=O)NCc3c(C)cc(C)[nH]c3=O)c(C)c21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "70f00e7b-7594-48d9-a433-cd0c26f3bdad",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(=O)N3CCCC3)C(C)C)CC2)cccc1C(=O)Nc1cc(F)ccc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(=O)N3CCCC3)C(C)C)CC2)cccc1C(=O)Nc1cc(F)ccc1F",
+ "ref_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(C(=O)[OH])cc3C(=O)N3CCCC3)C(C)C)CC2)cccc1C(=O)Nc1cc(F)ccc1F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cd79d3e4-2bbf-4c56-96ae-93971c93d18c",
+ "task": "sub",
+ "question": "Modify the molecule O=c1ccc(C(F)(F)F)cn1-c1ccc([N+](=O)[O-])cc1Cl by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1ccc(C(F)(F)F)cn1-c1ccc([N+](=O)[O-])cc1Cl",
+ "ref_smiles": "O=c1ccc(C(F)(F)S)cn1-c1ccc([N+](=O)[O-])cc1Cl",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "137b6865-4fda-458f-a18a-984a58a3afd5",
+ "task": "add",
+ "question": "Modify the molecule Cn1c2cc(C#N)ccc2c2cccc(C#N)c21 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c2cc(C#N)ccc2c2cccc(C#N)c21",
+ "ref_smiles": "N#Cc1ccc2c3cccc(C#N)c3n(CC(=O)O)c2c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6a53ae08-299c-402e-b99b-7247c75cdc05",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1cc2c(c(COc3ccccc3Br)c1)OCOC2 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cc2c(c(COc3ccccc3Br)c1)OCOC2",
+ "ref_smiles": "N#Cc1cc2c(c(COc3ccccc3Br)c1)OCOC2",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "46766769-eca2-4f93-852f-0e3d6e227d75",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(C(O)CO)C(O)C2O)C(O)C1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(C(O)CO)C(O)C2O)C(O)C1O.",
+ "ref_smiles": "[N-]=[N+]=NCC=CCOC1OC(C(O)COC2OC(O)(C(O)CO)C(O)C2O)C(O)C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0e73adc2-5930-4c83-a7e3-6ebd9b6bc236",
+ "task": "sub",
+ "question": "Modify the molecule CC(Oc1ccc(C#N)cc1)C(=O)Nc1cccc(I)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Oc1ccc(C#N)cc1)C(=O)Nc1cccc(I)c1",
+ "ref_smiles": "CC(Oc1ccc(C#N)cc1)C(=O)Nc1cccc(NO)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ab26e0b2-601f-4415-acc4-8aa39c2a965f",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule COc1ccc(C2=C(O)C(=O)N(c3ccc(Br)c(C)c3)C2c2ccc(C(C)(C)C)cc2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2=C(O)C(=O)N(c3ccc(Br)c(C)c3)C2c2ccc(C(C)(C)C)cc2)cc1OC.",
+ "ref_smiles": "COc1ccc(C2=CC(=O)N(c3ccc(Br)c(C)c3)C2c2ccc(C(C)(C)C)cc2)cc1OC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2055a877-e5c6-48ed-b43b-cd3e98a257fb",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=S(=O)(c1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1.",
+ "ref_smiles": "O=S(=O)(c1ccc(Cl)c(O)c1)N1CCC(C(F)(F)F)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "143599a2-9f6c-44ce-9e52-641980684869",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH+](C)CC1(CO)CCN(c2ncnc3cc(F)ccc23)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CC1(CO)CCN(c2ncnc3cc(F)ccc23)CC1.",
+ "ref_smiles": "C[NH+](C)CC1(CO)CCN(c2ncnc3ccccc23)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "80acd3fe-805d-4265-8842-9190bba90f73",
+ "task": "delete",
+ "question": "Modify the molecule CSc1nc(C2CC2)cc(C(=O)OC(C)C(=O)NC2CC2)c1C#N by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1nc(C2CC2)cc(C(=O)OC(C)C(=O)NC2CC2)c1C#N",
+ "ref_smiles": "CSc1cc(C(=O)OC(C)C(=O)NC2CC2)cc(C2CC2)n1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1a8de0b8-b9a3-4768-b61d-59fa94abdb3e",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N(CC(=O)NCc1ccccc1Cl)c1ccc(C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(CC(=O)NCc1ccccc1Cl)c1ccc(C)cc1",
+ "ref_smiles": "CC(=O)N(C)CC(=O)NCc1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "dd3764f2-ba7d-4f03-aca0-66fe0bc00bfc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccccc1NC(=O)c1ccc(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cccc(C(=O)N(C)C)c3C)CC2)C(C)C)cc1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)c1ccc(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cccc(C(=O)N(C)C)c3C)CC2)C(C)C)cc1Cl",
+ "ref_smiles": "CC(=O)c1cc(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cccc(C(=O)N(C)C)c3C)CC2)C(C)C)ccc1C(=O)Nc1ccccc1C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "05845825-df7e-42b7-a71d-aa38b653ca90",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NON(O)C(=O)c1ccccc1)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NON(O)C(=O)c1ccccc1)c1ccccc1",
+ "ref_smiles": "O=CNON(O)C(=O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "069e9da0-ee52-4d42-a503-9888efba2fcc",
+ "task": "sub",
+ "question": "Modify the molecule COc1ncc(-c2cncc(Nc3ccc(C#N)cc3)c2)c(OC)n1 by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ncc(-c2cncc(Nc3ccc(C#N)cc3)c2)c(OC)n1",
+ "ref_smiles": "COc1ncc(-c2cncc(Nc3ccc(S)cc3)c2)c(OC)n1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "453faa41-02ce-46b4-bd19-628e30349d28",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1.",
+ "ref_smiles": "Cc1cccc(N2CC[NH+](CCCNC(=O)CCc3c(C)[nH]c(=O)[nH]c3=O)CC2)c1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0694f3e2-2593-4d74-b659-d3e2621f54b2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)OC(=O)NCCCNc1nc(Cl)ncc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NCCCNc1nc(Cl)ncc1Cl",
+ "ref_smiles": "CC(C)(C)OC(=O)NCCCNc1nc(NO2)ncc1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e27f462-bf6d-40d1-aefa-c1a4cad2e716",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(NC(=O)CN(C)c2nc3c(OC)cccc3s2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)CN(C)c2nc3c(OC)cccc3s2)cc1.",
+ "ref_smiles": "COc1cccc2sc(N(C)CC(=O)Nc3ccc(OCO)cc3)nc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8c7e2784-a62a-4ad4-9132-fb076827cf83",
+ "task": "add",
+ "question": "Modify the molecule CC#CC1([NH3+])CCC(C(C)(C)CC)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC#CC1([NH3+])CCC(C(C)(C)CC)CC1",
+ "ref_smiles": "CC#CC1([NH3+])CCC(C(C)(C)CC)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "83b03536-1570-4a10-817c-dd2dfc9c9ec0",
+ "task": "delete",
+ "question": "Modify the molecule COCC(C)n1cc(C)[nH+]c1Nc1ccc(OC)cc1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(C)n1cc(C)[nH+]c1Nc1ccc(OC)cc1C",
+ "ref_smiles": "COCC(C)n1cc(C)[nH+]c1N(C)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5ce36724-797b-4fb9-9279-03b27d589238",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(C)(C)c1cc(C=Nc2sc3c(c2C#N)CCCC3)cc(C(C)(C)C)c1O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1cc(C=Nc2sc3c(c2C#N)CCCC3)cc(C(C)(C)C)c1O",
+ "ref_smiles": "CC(C)(C)c1cc(C=Nc2sc3c(c2NO)CCCC3)cc(C(C)(C)C)c1O",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "b56f150f-820d-4a39-8de0-b8d3e3a25515",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C1c2ccc3c(c2CCC1Br)OCC1CC(Cl)=CC=C31.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1c2ccc3c(c2CCC1Br)OCC1CC(Cl)=CC=C31.",
+ "ref_smiles": "O=C1CCCc2c1ccc1c2OCC2CC(Cl)=CC=C12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "21f5e2e5-9375-428b-bd61-ce8d517ca370",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1c[nH+]cc(Br)c1NCCCCCO with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1c[nH+]cc(Br)c1NCCCCCO",
+ "ref_smiles": "Nc1c[nH+]cc(C(=O)[OH])c1NCCCCCO",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8f02c59a-f823-41bd-a969-c08dec9aec83",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOC(=O)CCNc1nc2ccc(Cl)cc2s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCNc1nc2ccc(Cl)cc2s1.",
+ "ref_smiles": "CCOC(=O)C(O)CNc1nc2ccc(Cl)cc2s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0fcb9b56-c5ed-47b2-beb8-2755ea787362",
+ "task": "add",
+ "question": "Modify the molecule CCC(C(C)O)C1CC(C)(C)OC1(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(C)O)C1CC(C)(C)OC1(C)C",
+ "ref_smiles": "CCC(C(C)O)C1CC(C)(CO)OC1(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5048d62e-5f39-41b4-9811-271efd214ac0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)c1cc(Nc2cccc(Cl)c2)ncc1C(=O)NC1CCCCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1cc(Nc2cccc(Cl)c2)ncc1C(=O)NC1CCCCC1",
+ "ref_smiles": "CC(C)c1cc(Nc2cccc(O)c2)ncc1C(=O)NC1CCCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aa1f9425-2a8d-4ea3-a611-e1aa77355e1d",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)C12CN(C(=O)OC(C)C)CC(=O)C1(c1ccc(Cl)c(Cl)c1)C2 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C12CN(C(=O)OC(C)C)CC(=O)C1(c1ccc(Cl)c(Cl)c1)C2",
+ "ref_smiles": "CCOC(=O)C12CN(C(=O)OC(C)C)CC(=O)C1(c1ccc(C#N)c(Cl)c1)C2",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ffa8755d-5a93-46a7-bd98-d6b173fa6a70",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)C(CCC(N)=O)(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)[O-] by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(CCC(N)=O)(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)C(=O)[O-]",
+ "ref_smiles": "CC(C)(C)C(NC(=O)c1ccc(NC(Cn2ccnc2)c2ccc(F)cc2)cc1-c1ccccc1)(C(=O)[O-])C(N)CC(N)=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "ffe6b512-c78f-4c46-b067-d65f4523d198",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)NC(=O)NS(=O)(=O)c1ccc(CSc2[nH+]cc(C(C)(C)c3ccc(F)c(F)c3)n2-c2ccc(F)cc2)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)NS(=O)(=O)c1ccc(CSc2[nH+]cc(C(C)(C)c3ccc(F)c(F)c3)n2-c2ccc(F)cc2)c(Cl)c1.",
+ "ref_smiles": "CC(C)NC(=O)NS(=O)(=O)c1ccc(CSc2[nH+]cc(C(C)(C)c3ccc(F)c(F)c3)n2F)c(Cl)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "29ed2aca-595d-4322-98de-0ebf44f6cf77",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Oc2cc(C[NH2+]CC(C)C)ccn2)ccc1Br by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Oc2cc(C[NH2+]CC(C)C)ccn2)ccc1Br",
+ "ref_smiles": "Cc1cc(Oc2cc(C(O)[NH2+]CC(C)C)ccn2)ccc1Br",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d57517eb-f3f2-4189-a780-dbb76a1a2601",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]CCc1[nH]c2nc3c(C)cc(C)cc3n2c1Br with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CCc1[nH]c2nc3c(C)cc(C)cc3n2c1Br",
+ "ref_smiles": "C[NH2+]CCc1[nH]c2nc3c(C)cc(C)cc3n2c1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bac22dd6-86ba-4222-a589-f4302eca8258",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(CC=CCO)c1ncc[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC=CCO)c1ncc[nH]1.",
+ "ref_smiles": "CC=CCC(=O)c1ncc[nH]1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7bdbbb47-60cc-4c1e-b041-f59053a1a432",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(Nc2cc(Nc3ccc(NC(=O)Nc4cccc(C)c4)cc3)nc(C)n2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Nc2cc(Nc3ccc(NC(=O)Nc4cccc(C)c4)cc3)nc(C)n2)cc1",
+ "ref_smiles": "Cc1ccc(Nc2cc(-c3ccc(NC(=O)Nc4cccc(C)c4)cc3)nc(C)n2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a00e51a4-f8b0-47cb-80ca-89fb77f6c52a",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2ccccc2C(F)(F)F)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2ccccc2C(F)(F)F)C1.",
+ "ref_smiles": "COCCNC(=O)CS(=O)(=O)C1CN(S(=O)(=O)c2c(C#N)cccc2C(F)(F)F)C1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "72309943-375a-4a58-9353-07b6da5d1de2",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule [NH3+]CCc1ccc(Br)cc1SCC1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCc1ccc(Br)cc1SCC1CCCC1.",
+ "ref_smiles": "[NH3+]CC[SH](Br)CC1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "45ea7140-528e-4416-b0db-62c22cb36da5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O.",
+ "ref_smiles": "CC(Cc1ccccc1)n1c(=O)c2nscc2n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "06947ee1-e2f8-4a22-84fc-d05a94a212a2",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C(=O)Nc2ccc(F)cc2)cc1NC(=O)C1CCCN1C(=O)C1CC[NH+](C(C)C(=O)Nc2cccc(C(=O)Nc3ccccc3)c2C)CC1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2ccc(F)cc2)cc1NC(=O)C1CCCN1C(=O)C1CC[NH+](C(C)C(=O)Nc2cccc(C(=O)Nc3ccccc3)c2C)CC1",
+ "ref_smiles": "Cc1ccc(C(=O)Nc2ccc(S)cc2)cc1NC(=O)C1CCCN1C(=O)C1CC[NH+](C(C)C(=O)Nc2cccc(C(=O)Nc3ccccc3)c2C)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "50f58328-5a4f-4bb1-931b-c0fc6dc36880",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)c1cc(SC(=O)CCC(=O)N(c2ccccc2)c2ccc(Nc3ccc(N(C(=O)CCC(O)Sc4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)c4ccccc4)cc3)cc2)cc(C(C)(C)C)c1O by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1cc(SC(=O)CCC(=O)N(c2ccccc2)c2ccc(Nc3ccc(N(C(=O)CCC(O)Sc4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)c4ccccc4)cc3)cc2)cc(C(C)(C)C)c1O",
+ "ref_smiles": "CC(C)(C)c1cc(SC(=O)CCC(=O)N(c2ccccc2)c2ccc(Nc3ccc(N(C(=O)CCC(NO)Sc4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)c4ccccc4)cc3)cc2)cc(C(C)(C)C)c1O",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cb4adcf3-783f-4944-9a7c-72ce01ba6e5c",
+ "task": "delete",
+ "question": "Modify the molecule CCCCC(=O)OC1OCCC1P(=O)([O-])Cc1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(=O)OC1OCCC1P(=O)([O-])Cc1ccccc1",
+ "ref_smiles": "CCCCC(=O)OC1OCCC1P(C)(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "03e713f2-4eb0-4c6c-a052-23e69364263a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=C([O-])c1ccc2c(c1)CCN2CCOCC(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc2c(c1)CCN2CCOCC(F)(F)F.",
+ "ref_smiles": "O=C([O-])c1cc2c(c(C(=O)O)c1)N(CCOCC(F)(F)F)CC2",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ce398d98-0c42-449a-8731-754a802eb166",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2",
+ "ref_smiles": "Cc1ccc2c(c1)C(NC(=O)c1nccnc1C(N)=O)C(C)C2O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9d75f5c9-10e0-40dd-b187-3866b478907b",
+ "task": "delete",
+ "question": "Modify the molecule Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N1CCOCC1C1CCCC1O by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)N1CCOCC1C1CCCC1O",
+ "ref_smiles": "Cc1cc(=O)[nH]c(C)c1CCC(=O)N1CCOCC1C1CCCC1O",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9a391802-b823-40e1-b176-0891e63da224",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(=Nc1ccccc1)C(=NNc1ccc(C)cc1)C(=O)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=Nc1ccccc1)C(=NNc1ccc(C)cc1)C(=O)c1ccccc1.",
+ "ref_smiles": "CC(=Nc1ccccc1)C(C=O)=NNc1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "865c05c2-952b-4dd0-a9f2-114940d44812",
+ "task": "delete",
+ "question": "Modify the molecule COCc1cccc(NCc2ccc(F)cc2F)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1cccc(NCc2ccc(F)cc2F)c1",
+ "ref_smiles": "COCNCc1ccc(F)cc1F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "553e2454-f260-4fd0-9896-748d2a0b4b0d",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(CC(=O)[O-])nn2c1CCC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(CC(=O)[O-])nn2c1CCC2",
+ "ref_smiles": "Cc1c(CC(=O)[O-])nn2c1CCC2O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "516a4d4f-2bb9-490b-b48e-1edb0c7bc19f",
+ "task": "add",
+ "question": "Modify the molecule CC(=C(F)CNC(=O)C1CC(F)CN1C(=O)[O-])c1cccc(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=C(F)CNC(=O)C1CC(F)CN1C(=O)[O-])c1cccc(Cl)c1",
+ "ref_smiles": "CC(=C(F)C(NC(=O)C1CC(F)CN1C(=O)[O-])c1ccccc1)c1cccc(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1cf95b72-956a-4ea2-a77d-ebc222ab5cfa",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]=C(NCCCSC)N1CCC(C[NH+]2CCOCC2)C1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCCSC)N1CCC(C[NH+]2CCOCC2)C1",
+ "ref_smiles": "C[NH+]=C(CCCSC)N1CCC(C[NH+]2CCOCC2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "1d5f74b2-23a5-4b15-9e88-491e06703d80",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1CN(c2c(F)c(F)c(F)c(F)c2F)CC(=O)O1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CN(c2c(F)c(F)c(F)c(F)c2F)CC(=O)O1",
+ "ref_smiles": "O=C1CN(c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2)CC(=O)O1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ebfb995e-3723-449e-bae8-99bd42407882",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]=C(NCc1ccn[nH]1)NCC(c1ccccc1)c1ccccc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1ccn[nH]1)NCC(c1ccccc1)c1ccccc1",
+ "ref_smiles": "C[NH+]=C(CC(c1ccccc1)c1ccccc1)NCc1ccn[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b5c2de93-99d7-4484-a2ef-74012c9fb9f7",
+ "task": "sub",
+ "question": "Modify the molecule COCCC(CCl)Cc1ccc(F)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC(CCl)Cc1ccc(F)cc1",
+ "ref_smiles": "COCCC(CC(=O)O)Cc1ccc(F)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ed5fae55-7b6f-46f1-8d77-01c607e07539",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C[NH+]2CCN(C(=O)c3cccc(F)c3)CC2)cc1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH+]2CCN(C(=O)c3cccc(F)c3)CC2)cc1C",
+ "ref_smiles": "CC(=O)c1cccc(C(=O)N2CC[NH+](Cc3ccc(OC)c(C)c3)CC2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f3a45890-23b0-4903-8d0f-000ef8805890",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule NC(Nc1ccc2c(c1)CCC2)=[NH+]Cc1ccc2c(c1)COC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(Nc1ccc2c(c1)CCC2)=[NH+]Cc1ccc2c(c1)COC2.",
+ "ref_smiles": "NC(=[NH+]Cc1ccc2c(c1)COC2)c1ccc2c(c1)CCC2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e245b5e9-725b-4d19-9105-b4bbdc635cd2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NCCc1[nH+]ccn1C(F)F)NCCc1[nH+]ccn1C(F)F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCc1[nH+]ccn1C(F)F)NCCc1[nH+]ccn1C(F)F",
+ "ref_smiles": "O=C(NCCc1[nH+]ccn1C(F)F)NCCc1[nH+]ccn1C(F)C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8bbb5570-59a5-418a-a106-6620d20ee0b8",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)cc1",
+ "ref_smiles": "Cc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3CO)CC2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "76a409cc-801f-478c-b5cd-f565200d789b",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCS(=O)(=O)CCOc1ccc(S(=O)(=O)N2CCC(c3nc(C)cs3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCS(=O)(=O)CCOc1ccc(S(=O)(=O)N2CCC(c3nc(C)cs3)CC2)cc1.",
+ "ref_smiles": "CCS(=O)(=O)CCOS(=O)(=O)N1CCC(c2nc(C)cs2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "834ceea8-e651-4fb5-a809-4e1cedafc84d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1CCC(Nc2ccc(O)cc2)c2ccccc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(Nc2ccc(O)cc2)c2ccccc21",
+ "ref_smiles": "CC1CCC(Nc2ccc(C#N)cc2)c2ccccc21",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8d9b4d84-0a99-4875-945a-7968c876982d",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCNC(=O)C1CCC[NH+](Cc2nc(-c3ccc(C)c(F)c3)no2)C1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCNC(=O)C1CCC[NH+](Cc2nc(-c3ccc(C)c(F)c3)no2)C1",
+ "ref_smiles": "CCCCCCNC(=O)C1CCC[NH+](Cc2nc(-c3ccc(C)cc3)no2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0542f7e3-7de4-45ea-af49-8914af00e809",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)Cn1cnc2c1c(=O)n(CC(=O)Nc1cccc(Cl)c1)c(=O)n2CC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cn1cnc2c1c(=O)n(CC(=O)Nc1cccc(Cl)c1)c(=O)n2CC(C)C.",
+ "ref_smiles": "CC(C)Cn1cnc2c1c(=O)n(CC(=O)Nc1ccccc1)c(=O)n2CC(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "dbac7e26-b8c8-472d-bf9f-b637a3322260",
+ "task": "sub",
+ "question": "Modify the molecule COc1cccc(CN2CCCN(Cc3ccc(Cl)cc3)S2(=O)=O)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(CN2CCCN(Cc3ccc(Cl)cc3)S2(=O)=O)c1",
+ "ref_smiles": "COc1cccc(CN2CCCN(Cc3ccc(NO)cc3)S2(=O)=O)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fe39590f-8f81-47dc-887f-a7fd94a8eb8a",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(C=Cc1cc(Cl)cc(Cl)c1)NCCSCCCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1cc(Cl)cc(Cl)c1)NCCSCCCO.",
+ "ref_smiles": "CCCSCCNC(=O)C=Cc1cc(Cl)cc(Cl)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cac93a20-54d1-4233-9829-3deb00154e79",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N(C(=O)c1cccc(Cl)c1)C(C)C with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(C(=O)c1cccc(Cl)c1)C(C)C",
+ "ref_smiles": "CC(C)N(C(=O)c1cccc(S)c1)C(C)C",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "edb1c26e-a4fb-43de-b497-5cc7d7304e15",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cn1nc(CC(O)c2occc2Br)c2ccccc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc(CC(O)c2occc2Br)c2ccccc21",
+ "ref_smiles": "Cn1nc(CC(C#N)c2occc2Br)c2ccccc21",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f0b1bf72-20f2-49ff-ae66-2ee10fe6360f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1cc(C)c(NC(=O)CCc2nc(-c3cccc4ccccc34)no2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(NC(=O)CCc2nc(-c3cccc4ccccc34)no2)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(Cc2nc(-c3cccc4ccccc34)no2)c(C)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2996c87c-ee4f-4283-9e3a-e0ca34793d90",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1.",
+ "ref_smiles": "NC(=[NH+]O)c1ccc(CNC(=O)c2ccc(I)cc2)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3ab71e60-eebf-4674-89d2-d9675aca0b71",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule NC(=[NH+]O)c1ccccc1CSc1ccccc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)c1ccccc1CSc1ccccc1Br.",
+ "ref_smiles": "NC(=[NH+]O)c1ccccc1CSBr",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9ca0de62-1761-4578-9d58-8c115779ed5d",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(C(=O)OCC(=O)Nc2nc3ccccc3s2)c1O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)OCC(=O)Nc2nc3ccccc3s2)c1O",
+ "ref_smiles": "Cc1cccc(C(=O)OCC(=O)Nc2nc3ccccc3s2)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "37696c42-fe7c-4649-a0d3-05d1f635e008",
+ "task": "delete",
+ "question": "Modify the molecule N#CCc1cccc(Br)c1Br by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCc1cccc(Br)c1Br",
+ "ref_smiles": "Cc1cccc(Br)c1Br",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "90cf8010-0e29-4d7f-b000-951f3000eacc",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC(=O)C(OC(C)C)C(c1cc(OCOCCOC)ccc1[N+](=O)[O-])N(C(=O)OCc1ccccc1)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(OC(C)C)C(c1cc(OCOCCOC)ccc1[N+](=O)[O-])N(C(=O)OCc1ccccc1)C(C)C.",
+ "ref_smiles": "CCOC(=O)C(OC(C)C)C(c1cc(OCOCCOC)ccc1[N+](=O)[O-])N(C(=O)OC)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "369ba7bd-d0a6-425b-8f47-1472734bec1b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)cc1.",
+ "ref_smiles": "[NH3+]C(CC(=O)[O-])c1ccc(C2C[NH+]3CCC2CC3)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b61f84f4-bd55-4474-a8ce-3eaa65ee4601",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)cc34)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)cc34)cc2)CC1.",
+ "ref_smiles": "C[NH+]1CCC(Oc2ccc(-c3n[nH]c4ccc(C(=O)NCC5(c6ccccc6)CC5)c(-c5ccccc5)c34)cc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c98e75ef-8a4a-4733-a7fd-92f6d789d7c8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc(C2CCN(C(=O)c3ccccn3)CC2)ncc1C(=O)Nc1ccc(F)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C2CCN(C(=O)c3ccccn3)CC2)ncc1C(=O)Nc1ccc(F)cc1",
+ "ref_smiles": "C(=O)c1nc(C2CCN(C(=O)c3ccccn3)CC2)ncc1C(=O)Nc1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ce7af262-cc60-4219-9052-b9c04ab15982",
+ "task": "add",
+ "question": "Modify the molecule COCc1nnc(NC(=O)COc2ccc(-c3ccccc3)cc2)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1nnc(NC(=O)COc2ccc(-c3ccccc3)cc2)s1",
+ "ref_smiles": "COCc1nnc(NC(=O)C(Oc2ccc(-c3ccccc3)cc2)c2ccccc2)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "774cd6d9-c15a-4ed8-a205-9e4b85d6ab8b",
+ "task": "add",
+ "question": "Modify the molecule COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2)ccc1OC(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2)ccc1OC(F)F",
+ "ref_smiles": "COc1cc(CN(C(=O)Cc2nc(-c3ccccc3)oc2C)C2CC2O)ccc1OC(F)F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "04df4774-94d0-4817-a349-02ba80480a6c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])Cc1cccc(C(F)C2CC2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])Cc1cccc(C(F)C2CC2)c1",
+ "ref_smiles": "ONC(c1cccc(CC(=O)[O-])c1)C1CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c653e25-7874-401c-85b5-243f7cbc2e6f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3ccccc3)CN(C=O)OCc3ccccc3)o2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3ccccc3)CN(C=O)OCc3ccccc3)o2)c1.",
+ "ref_smiles": "CS(=O)(=O)c1cccc(-c2ccc(C(=O)NCNC(=O)C(CCc3cccc(O)c3)CN(C=O)OCc3ccccc3)o2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5df12593-5c98-4222-bd59-e62f2bf8bc8a",
+ "task": "delete",
+ "question": "Modify the molecule S=c1[nH]nc(-c2ccccc2Br)n1-c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "S=c1[nH]nc(-c2ccccc2Br)n1-c1ccccc1",
+ "ref_smiles": "S=c1[nH]nc(Br)n1-c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7f3bfb83-b76f-499c-8ed8-ea279452d272",
+ "task": "sub",
+ "question": "Please substitute a carboxyl in the molecule CCCCCCCCCCCCC1(CCCCCCCCC)C(C)=[N+](CCC(=O)O)c2ccc(OC)cc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCC1(CCCCCCCCC)C(C)=[N+](CCC(=O)O)c2ccc(OC)cc21",
+ "ref_smiles": "CC(=O)CC[N+]1=C(C)C(CCCCCCCCC)(CCCCCCCCCCCC)c2cc(OC)ccc21",
+ "add_group": "aldehyde",
+ "remove_group": "carboxyl"
+ },
+ {
+ "id": "03cab0ec-67da-43a5-bc75-0075c6ae5405",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cc(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c(C)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)OCC(=O)NCCN2C(=O)CSC2=S)c(C)s1.",
+ "ref_smiles": "Cc1cc(C(=O)OCC(=O)NC(O)CN2C(=O)CSC2=S)c(C)s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f1ed4e35-af25-4d80-b2be-bb9c17bbaaa8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C#CCNC(=O)C(C)Oc1c(Br)cc(CC[NH3+])cc1OC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCNC(=O)C(C)Oc1c(Br)cc(CC[NH3+])cc1OC",
+ "ref_smiles": "C#CCNC(=O)C(C)Oc1c(C#N)cc(CC[NH3+])cc1OC",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "35495a0b-bb7e-43cd-9685-4a22736a247a",
+ "task": "add",
+ "question": "Modify the molecule CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1",
+ "ref_smiles": "CCC1(C(=O)[O-])CCN(C(=O)CSCC#N)C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6ae21ccc-afca-4157-a6d4-f4509b644dd0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [S-]c1ccccc1OB(Oc1ccccc1[S-])Oc1ccccc1[S-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[S-]c1ccccc1OB(Oc1ccccc1[S-])Oc1ccccc1[S-].",
+ "ref_smiles": "Oc1cccc(OB(Oc2ccccc2[S-])Oc2ccccc2[S-])c1[S-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "59a89abb-6c65-47af-be35-03c00834fab4",
+ "task": "delete",
+ "question": "Modify the molecule CCCCC(=O)N1CSCC1C(=O)N1CCC(C2OCCC2C(=O)[O-])CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(=O)N1CSCC1C(=O)N1CCC(C2OCCC2C(=O)[O-])CC1",
+ "ref_smiles": "CCC1CSCC1C(=O)N1CCC(C2OCCC2C(=O)[O-])CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8f3b5dc3-9fe5-4db8-a9ad-5b3cf2b44451",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)cc1.",
+ "ref_smiles": "O=C(NCC1(O)C=CCCC1)C(=O)Nc1ccc(OC(F)(F)F)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fd781c5b-cf9a-42b2-9427-7034068db05b",
+ "task": "delete",
+ "question": "Modify the molecule CCCC[Si](C)(C)CNC(=O)CCS by removing a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[Si](C)(C)CNC(=O)CCS",
+ "ref_smiles": "CCCC[Si](C)(C)CNC(=O)CC",
+ "add_group": null,
+ "remove_group": "thiol"
+ },
+ {
+ "id": "e81f5e40-ce6f-48a4-ad35-83e5dac1a301",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC(C)(C)C(=O)OC1C2CC3(O)CC(O)(C2)CC1(O)C3.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)C(=O)OC1C2CC3(O)CC(O)(C2)CC1(O)C3.",
+ "ref_smiles": "CCC(C)(C)C(=O)OC1C2CC3CC(O)(C2)CC1(O)C3",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8138fcb6-9ba6-4f4f-a263-1bf49cc453f8",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cnc(NN)nc1NC(C)(C)CCc1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(NN)nc1NC(C)(C)CCc1ccccc1",
+ "ref_smiles": "CCC(C)(C)Nc1nc(NN)ncc1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bb402b09-18b2-46bb-9492-8e8e406a688a",
+ "task": "add",
+ "question": "Modify the molecule CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)ccc1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)ccc1Cl",
+ "ref_smiles": "CC1[NH2+]CCC1C(=O)Nc1cc(C(N)=O)cc(C(=O)O)c1Cl",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "994b6c5a-5a2f-4c96-86ba-ac78fa858b76",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(CCn1nnnc1-c1ccc(Cl)cc1Br)C(=O)[O-] with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCn1nnnc1-c1ccc(Cl)cc1Br)C(=O)[O-]",
+ "ref_smiles": "CC(CCn1nnnc1-c1ccc(C=O)cc1Br)C(=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e9324f9d-366d-4068-b8f6-0d4d190fd698",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CC(C)N(C)C(=O)Cl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(C)N(C)C(=O)Cl",
+ "ref_smiles": "CC(C)CC(C)N(C)C(=O)NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c1b9fbd2-a5e9-4179-950b-23a873e78d94",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCOC(=O)c1ccc(N2C(=O)C(O)=C(c3ccc(OC)cc3OC)C2c2cccc(OCCC)c2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOC(=O)c1ccc(N2C(=O)C(O)=C(c3ccc(OC)cc3OC)C2c2cccc(OCCC)c2)cc1",
+ "ref_smiles": "CC(=O)C1=C(c2ccc(OC)cc2OC)C(c2cccc(OCCC)c2)N(c2ccc(C(=O)OCCC)cc2)C1=O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "12f8a584-b52c-493b-ae17-5d1be6b2ea3f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CN(C)c1ccc2c(c1)N(C)C(N=Nc1ccc(N3CCCC(O)C3)cc1)N2C with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc2c(c1)N(C)C(N=Nc1ccc(N3CCCC(O)C3)cc1)N2C",
+ "ref_smiles": "CN(C)c1ccc2c(c1)N(C)C(N=Nc1ccc(N3CCCC(S)C3)cc1)N2C",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "884e3496-efd8-4f97-8f2a-07bdb35231db",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=S(=O)(c1ccncc1)C1CCN(S(=O)(=O)Cc2cccc(F)c2)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1ccncc1)C1CCN(S(=O)(=O)Cc2cccc(F)c2)C1",
+ "ref_smiles": "N#Cc1cccc(CS(=O)(=O)N2CCC(S(=O)(=O)c3ccncc3)C2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "60dd36b4-2f9d-4711-b65f-25045ba6f62b",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCC1(CC)NC(=O)CCN(c2ccc(Br)cc2Br)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(CC)NC(=O)CCN(c2ccc(Br)cc2Br)C1=O.",
+ "ref_smiles": "CCC1(CC)NC(=O)CC(N)N(c2ccc(Br)cc2Br)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "b0b40daa-d447-45e5-85f0-beb559622652",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1nc2c(nc1CCC1CCCCC1)-c1ccccc1CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1nc2c(nc1CCC1CCCCC1)-c1ccccc1CC2.",
+ "ref_smiles": "O=C(Cc1cc(F)c(F)c(F)c1F)Nc1nc2c(nc1CCC1CCCCC1)-c1ccccc1CC2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f2d565ac-59db-4330-ad2b-cf8565fea9ac",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1(C)c2cc(OCCCCC(=O)[O-])ccc2C(=O)c2c1[nH]c1cc(Br)ccc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)c2cc(OCCCCC(=O)[O-])ccc2C(=O)c2c1[nH]c1cc(Br)ccc21",
+ "ref_smiles": "CC1(C)c2cc(OCCCCC(=O)[O-])ccc2C(=O)c2c1[nH]c1cc(C=O)ccc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "75926e48-83a6-45cc-bd91-f032ea8c8014",
+ "task": "sub",
+ "question": "Modify the molecule CC([NH2+]C(CCO)C1CC1)c1cncc(F)c1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]C(CCO)C1CC1)c1cncc(F)c1",
+ "ref_smiles": "CC([NH2+]C(CCNO)C1CC1)c1cncc(F)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4ec7c04b-4ff0-4aee-a917-ae85bb3e49d5",
+ "task": "sub",
+ "question": "Modify the molecule OC(Cc1sccc1Br)c1cc2ccc(F)cc2s1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(Cc1sccc1Br)c1cc2ccc(F)cc2s1",
+ "ref_smiles": "N#CC(Cc1sccc1Br)c1cc2ccc(F)cc2s1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "85185204-5c64-4ab2-8a6b-5955cef763c7",
+ "task": "add",
+ "question": "Please add a amine to the molecule CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1ccccc1.",
+ "ref_smiles": "CN(CCNC(=O)c1ccccc1N(C)C(=O)c1ccc(Br)o1)c1cccc(N)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0aa7286c-1305-4dc8-9d76-3e6a314b84d8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCNC(=NCC(C)(C)[NH+]1CCCCC1)NC1CCN(c2cccs2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=NCC(C)(C)[NH+]1CCCCC1)NC1CCN(c2cccs2)CC1.",
+ "ref_smiles": "CCNC(=NCC(C)(C)[NH+]1CCCCC1c1ccccc1)NC1CCN(c2cccs2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ec7666d0-f129-420d-b762-f76616dd0cfa",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2N)c2cccc([N+](=O)[O-])c2)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6d05ea45-fdb3-4bff-9a8a-d8a05b046d3c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4cc(-c6ccc(CCCC)cc6)cc(Sc6ccc(C)cc6)c4C5=O)cc3)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4cc(-c6ccc(CCCC)cc6)cc(Sc6ccc(C)cc6)c4C5=O)cc3)cc2)CC1.",
+ "ref_smiles": "CCCCCC1CCC(c2ccc(-c3ccc(Sc4cccc5c4C(=O)c4cc(CCCC)cc(Sc6ccc(C)cc6)c4C5=O)cc3)cc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bcd357fa-60b7-43fb-ba5c-9f3750ddd3e0",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule FC(F)c1nc(NCc2ccc[nH]2)c2ccccc2n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)c1nc(NCc2ccc[nH]2)c2ccccc2n1.",
+ "ref_smiles": "FC(F)c1nc(Cc2ccc[nH]2)c2ccccc2n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3a61589d-eb07-4c38-8f8d-457639859080",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)ccc2C1NS(=O)C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)ccc2C1NS(=O)C(C)(C)C",
+ "ref_smiles": "CC(C)(C)S(=O)NC1c2ccc(Cl)cc2-c2cc(Cl)cc(-c3ccccc3)c2C1NS(=O)C(C)(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8fd99497-ebe6-4bc7-8045-254447e83f6d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(CNc1cc2ccccc2c(Cl)n1)N1CCCC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CNc1cc2ccccc2c(Cl)n1)N1CCCC1",
+ "ref_smiles": "CC(=O)c1nc(NCC(=O)N2CCCC2)cc2ccccc12",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "41ae76e6-aba5-434b-b0cb-d3dd0cff7c29",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C([O-])c1c(CC2CC2)c2c(n1O)CC[NH2+]C2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1c(CC2CC2)c2c(n1O)CC[NH2+]C2",
+ "ref_smiles": "O=C([O-])c1c(CC2CC2)c2c(n1C(=O)[OH])CC[NH2+]C2",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7819eff9-b84c-4da4-a132-94b63551100e",
+ "task": "add",
+ "question": "Modify the molecule C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3ncccc3C=CC2C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3ncccc3C=CC2C1",
+ "ref_smiles": "C1=CC(c2cccc(N(c3ccc(-c4ccccc4)cc3)c3ccccc3-c3ccccc3)c2)=C2c3nc(-c4ccccc4)ccc3C=CC2C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9d0bb432-1abf-4ade-ab91-896f5497e1e0",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(SC(c2cccc(C(F)(F)F)c2)c2cccc3cn[nH]c23)ccc1OCC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(SC(c2cccc(C(F)(F)F)c2)c2cccc3cn[nH]c23)ccc1OCC(=O)[O-].",
+ "ref_smiles": "Cc1cc(SC(c2cccc(C(F)F)c2)c2cccc3cn[nH]c23)ccc1OCC(=O)[O-]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "9b3cd6d4-04a4-42e4-af89-38a61fd0d0c7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)N1CCc2ccc(Br)cc2C1C(=O)Nc1ccc2c(c1)OCO2 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)N1CCc2ccc(Br)cc2C1C(=O)Nc1ccc2c(c1)OCO2",
+ "ref_smiles": "COC(=O)N1CCc2ccc([N+](=O)[O-])cc2C1C(=O)Nc1ccc2c(c1)OCO2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f39a9b50-ba6e-41ef-b857-08d772c4f5b9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)(C)C(=O)OC1(C(OC(C)=O)(C(F)(F)F)C(F)(F)F)CCCC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)C(=O)OC1(C(OC(C)=O)(C(F)(F)F)C(F)(F)F)CCCC1",
+ "ref_smiles": "CCC(C)(C)C(=O)OC1(C(OC(C)=O)(C=O)CCCC1)",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "07b38ebb-6325-4e86-aa4e-c2487817be68",
+ "task": "delete",
+ "question": "Modify the molecule CCSc1ccccc1C(=O)NCCOc1ccc(C(C)(C)C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCSc1ccccc1C(=O)NCCOc1ccc(C(C)(C)C)cc1",
+ "ref_smiles": "CCSC(=O)NCCOc1ccc(C(C)(C)C)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e9af1afe-747e-42ea-9928-5a9eb784eb86",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(C[NH+](Cc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)C(C)c2ccccc2)c(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH+](Cc2nc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)cs2)C(C)c2ccccc2)c(OC)c1.",
+ "ref_smiles": "CC[NH+](Cc1nc(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cs1)Cc1ccc(OC)cc1OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7a4f9394-3994-4b7f-b6b2-63e49da4d211",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)n1C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)n1C",
+ "ref_smiles": "Cc1ccc(C(=O)OC(C)C(=O)N2CCCC2)c(N)n1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e6cecf7f-1cae-4fd5-9180-12687bf98260",
+ "task": "add",
+ "question": "Modify the molecule COCCNC(=O)C(C)Nc1cc(NN)nc(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCNC(=O)C(C)Nc1cc(NN)nc(C)n1",
+ "ref_smiles": "COCCNC(=O)C(C)(Nc1cc(NN)nc(C)n1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8838dfc5-483b-4d01-8a2f-6d0b623547ca",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule COC(=O)CCCCNC(=O)C1C=C(C#N)C(SC)=NC1=O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCCCNC(=O)C1C=C(C#N)C(SC)=NC1=O",
+ "ref_smiles": "COC(=O)CCCCNC(=O)C1C=C(S)C(SC)=NC1=O",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "bc0a4439-4e3c-4aa5-a838-cec51ade69e0",
+ "task": "delete",
+ "question": "Modify the molecule CCC1Oc2c(Br)cccc2C1[NH2+]C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1Oc2c(Br)cccc2C1[NH2+]C",
+ "ref_smiles": "CCC1Oc2ccccc2C1[NH2+]C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c1884352-7dc9-4f8e-86de-ad74022680b9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNC(=O)C1CC(F)C[NH+]1C1(c2ccccc2OC)C(=O)N(S(=O)(=O)c2ccc(OC)cc2OC(F)(F)F)c2ccc(Cl)cc21 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)C1CC(F)C[NH+]1C1(c2ccccc2OC)C(=O)N(S(=O)(=O)c2ccc(OC)cc2OC(F)(F)F)c2ccc(Cl)cc21",
+ "ref_smiles": "CCNC(=O)C1CC(O)C[NH+]1C1(c2ccccc2OC)C(=O)N(S(=O)(=O)c2ccc(OC)cc2OC(F)(F)F)c2ccc(Cl)cc21",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9115d5c1-f7dd-4ef4-8c63-26090d78cbfa",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule NC(=O)c1ccc(NC(=O)CC[NH+]2CCCC3(CCCCC3)C2)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1ccc(NC(=O)CC[NH+]2CCCC3(CCCCC3)C2)cc1Cl.",
+ "ref_smiles": "NC(=O)c1ccc(C[NH+]2CCCC3(CCCCC3)C2)cc1Cl",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2959f716-4f1e-4bfa-b480-9698effc173d",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)CN(C)c1cc[nH+]cc1Br by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CN(C)c1cc[nH+]cc1Br",
+ "ref_smiles": "CC(=O)c1c[nH+]ccc1N(C)CC(=O)OCC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9abc92f2-0ef9-4f2d-87f9-e05b091c6e10",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(-c2ccccc2)ccc1C(=O)N(C)CC1CCCCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2ccccc2)ccc1C(=O)N(C)CC1CCCCC1",
+ "ref_smiles": "Cc1ncccc1C(=O)N(C)CC1CCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0eff7bca-17d2-40c3-b2ad-bc50a192abef",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+](CC1CCCC1O)C1CCN(c2ccccc2Cl)C1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](CC1CCCC1O)C1CCN(c2ccccc2Cl)C1=O",
+ "ref_smiles": "C[NH+](CC1CCCC1O)C1CCN(Cl)C1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fc2a35cb-1dec-4b4d-bc9d-22a6353b1115",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC[NH2+]C(Cc1cc(C)nn1C)CC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1cc(C)nn1C)CC(C)(C)C.",
+ "ref_smiles": "CC[NH2+]C(Cc1cc(C)nn1C)C(c1ccccc1)C(C)(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "24038a0a-7a5f-4786-a25c-beb0aaa33d05",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NC(=Cc1cccc2ccccc12)C(=O)N1CCCCC1)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(=Cc1cccc2ccccc12)C(=O)N1CCCCC1)c1ccccc1",
+ "ref_smiles": "O=C(NC(=Cc1cccc2ccccc12)C(=O)N1CCCCC1)",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "46c5d66c-a522-40ce-a017-a5fcc0ceeaec",
+ "task": "add",
+ "question": "Modify the molecule CCCCOc1cc(C)cc2c1C(C)CCC2C(C)CCC=C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1cc(C)cc2c1C(C)CCC2C(C)CCC=C(C)C",
+ "ref_smiles": "CCCCOc1cc(C)cc2c1C(Cc1ccccc1)CCC2C(C)CCC=C(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "93d9f435-806c-49ac-8571-3d2393b20213",
+ "task": "add",
+ "question": "Modify the molecule Cc1nc(Nc2cccc(Cl)c2)cc(N(C)c2ccccc2)n1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(Nc2cccc(Cl)c2)cc(N(C)c2ccccc2)n1",
+ "ref_smiles": "Cc1nc(Nc2cccc(Cl)c2N)cc(N(C)c2ccccc2)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "57f57565-a2a8-49b3-80f4-4cc286110a65",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)C1CC[NH+](Cc2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1CC[NH+](Cc2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1.",
+ "ref_smiles": "COC(=O)C1CC[NH+](C(c2ccccc2)c2cn(-c3ccccc3)nc2-c2cccc(OC)c2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3330b990-60bd-4814-8086-72bc24433926",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1.",
+ "ref_smiles": "CC[NH2+]C(C)CC(=O)Cc1ccc(F)c(Cl)c1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "212352db-c196-42d5-869c-53814db019e7",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(S(=O)(=O)OCCc2ccccc2I)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)OCCc2ccccc2I)cc1.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)OCCc2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "10d3fbd9-142f-4fa9-a6ae-e4c7203de12b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCc1cc2c(cc1CC)CC([NH2+]CC(O)c1ccc(O)c3nc(C)ccc13)C2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc2c(cc1CC)CC([NH2+]CC(O)c1ccc(O)c3nc(C)ccc13)C2",
+ "ref_smiles": "CCc1cc2c(cc1CC)CC([NH2+]CC(C(=O)O)c1ccc(O)c3nc(C)ccc13)C2",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "85949268-26cc-4440-a6d9-20754c6858c0",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCc1nc(C(=O)NC(C)C[NH+]2CCOCC2)n[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(C(=O)NC(C)C[NH+]2CCOCC2)n[nH]1.",
+ "ref_smiles": "CCc1n-n(C(C)C[NH+]2CCOCC2)[nH]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "fb97dcbf-6b26-4c11-a1f3-dffd99de015d",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])CCSCC(=O)c1ccc([N+](=O)[O-])cc1 by substituting a nitro with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCSCC(=O)c1ccc([N+](=O)[O-])cc1",
+ "ref_smiles": "O=C([O-])CCSCC(=O)c1ccc(I)cc1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "8ff14707-a4e9-4b80-9ed8-0d1462a1b532",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)ccc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)ccc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F",
+ "ref_smiles": "O=S(=O)(c1ccccn1)c1cc(OC(F)(F)F)c(O)cc1S(=O)(=O)N1CCC2(CC1)CC2NCC(F)(F)F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a035262e-0097-49ad-905b-769345531a3c",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cc1ccccc1)NC1CN(c2ccncn2)CC1CO by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccccc1)NC1CN(c2ccncn2)CC1CO",
+ "ref_smiles": "O=C(Cc1ccccc1)NC1CN(c2ccnc(C(=O)O)n2)CC1CO",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "34efb5cd-7b10-42d2-b5e6-b1bc88c779e9",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(Cl)cncc1OCc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Cl)cncc1OCc1ccccc1",
+ "ref_smiles": "Cc1c(Cl)cncc1OC(c1ccccc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "32c081ac-f1ae-49be-a5e4-6ba5a6914f93",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(NC(=O)c2c(NC(=O)CN3CC[NH2+]CC3)sc3c2CCCC3)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(NC(=O)c2c(NC(=O)CN3CC[NH2+]CC3)sc3c2CCCC3)c1",
+ "ref_smiles": "CNC(=O)c1c(NC(=O)CN2CC[NH2+]CC2)sc2c1CCCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ec8afd19-118f-4ae3-8c8d-c3f2c582bfbf",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule C=CCn1c(=NC(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)sc2cc(C(=O)OCC)ccc21 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(=NC(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)sc2cc(C(=O)OCC)ccc21",
+ "ref_smiles": "C=CCn1c(=NC(=O)c2ccc(S(=O)(=O)N(CCF)CCC#N)cc2)sc2cc(C(=O)OCC)ccc21",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9120d739-9432-496f-a473-98552b0ac272",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])C1Cn2c(cc3c(Br)cc(F)cc32)C1=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1Cn2c(cc3c(Br)cc(F)cc32)C1=O",
+ "ref_smiles": "O=C([O-])C1Cn2c(cc3c(O)cc(F)cc32)C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "315ba449-d2a8-4dbc-96fd-66d557ffbacb",
+ "task": "add",
+ "question": "Modify the molecule CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccccc3)c2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccccc3)c2c1",
+ "ref_smiles": "CC(C)CCNC(=O)COC(=O)c1ccc2noc(-c3ccc(O)cc3)c2c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f992f4f7-0666-4d36-8939-f6c205453540",
+ "task": "add",
+ "question": "Modify the molecule CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1",
+ "ref_smiles": "CC1(O)CCC[NH+](CC(=O)c2ccc(Br)s2)C1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "27be0d57-098d-4587-b967-7021f6c29713",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)C(NC(=O)CNC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCCC[NH3+])NC(=O)C([NH3+])CCC[NH+]=C(N)N)C(=O)NC(CCCC[NH3+])C(=O)[O-] with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(NC(=O)CNC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCCC[NH3+])NC(=O)C([NH3+])CCC[NH+]=C(N)N)C(=O)NC(CCCC[NH3+])C(=O)[O-]",
+ "ref_smiles": "CC(=O)C(NC(=O)CNC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCC[NH+]=C(N)N)NC(=O)C(CCCC[NH3+])NC(=O)C([NH3+])CCC[NH+]=C(N)N)C(=O)NC(CCCC[NH3+])C(=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f83d1a02-ae2a-41ac-b089-94f5b27d3f12",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#CCCNc1ccc(-c2ccc(F)c(F)c2)nn1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCNc1ccc(-c2ccc(F)c(F)c2)nn1",
+ "ref_smiles": "OCCNc1ccc(-c2ccc(F)c(F)c2)nn1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "7f01e2e8-9be7-4870-93e4-eeaa7e01a862",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cccc(CN(Cc2ccc(OC)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(CN(Cc2ccc(OC)cc2)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1",
+ "ref_smiles": "CCc1cccc(CN(COC)c2ccc3c(c2)C(C)(C)c2ccccc2-3)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a9d9f1e7-7e39-4a74-9380-dd7aa8f97325",
+ "task": "add",
+ "question": "Please add a thiol to the molecule C[NH2+]CC(=O)c1nnoc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC(=O)c1nnoc1C.",
+ "ref_smiles": "Cc1onnc1C(=O)C[NH2+]CS",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "d926465a-5299-42af-9cd8-022614cf9ab3",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C[NH3+])c1ccc2c(c1)CC(=O)N2C#N by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C[NH3+])c1ccc2c(c1)CC(=O)N2C#N",
+ "ref_smiles": "CC(C)(C[NH3+])c1ccc2c(c1)CC(=O)N2C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cc76c71a-2574-455f-bafe-1d6218d1aafe",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)OCC2CCN(C(=O)OCC(C)C)CC2)nn1Cc1cc(Br)ccc1OCc1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)OCC2CCN(C(=O)OCC(C)C)CC2)nn1Cc1cc(Br)ccc1OCc1ccccc1",
+ "ref_smiles": "Cc1cc(NC(=O)OCC2CCN(C(=O)OCC(C)C)CC2)nn1Cc1cc(S)ccc1OCc1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8750f7ae-3da0-48cc-a846-ebf3257a295c",
+ "task": "delete",
+ "question": "Modify the molecule CCC1CCCC1[NH2+]CC1CCCC1CO by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCC1[NH2+]CC1CCCC1CO",
+ "ref_smiles": "CCC1CCCC1[NH2+]CC1CCCC1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f6acb7d7-f4ca-4d2c-96aa-15fcaa480b11",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)Oc4nc6ccc7ccccc7c6nc4O5)c3)n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)Oc4nc6ccc7ccccc7c6nc4O5)c3)n2)cc1.",
+ "ref_smiles": "c1ccc(-c2ncnc(-c3cccc(-c4ccc5c(c4)Oc4nc6ccc7ccccc7c6nc4O5)c3)n2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1773d47a-9a67-4d65-838e-4b8c86aa5d36",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCC1(C(=O)[O-])CCN(C(=O)C(C)Oc2cccc(Br)c2)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1(C(=O)[O-])CCN(C(=O)C(C)Oc2cccc(Br)c2)C1",
+ "ref_smiles": "COCC1(C(=O)[O-])CCN(C(=O)C(C)Oc2cccc(C=O)c2)C1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1f1b4828-7611-4a29-bfeb-b666242dc4d9",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4)n3)n[nH]2)c(OC)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4)n3)n[nH]2)c(OC)c1",
+ "ref_smiles": "COc1ccc(-c2nc(SCc3noc(-c4ccc(Cl)cc4O)n3)n[nH]2)c(OC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d4b3e2f7-5893-401e-9288-0d580ad67b08",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)(CO)C[NH2+]Cc1cc(Br)ccc1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(CO)C[NH2+]Cc1cc(Br)ccc1F",
+ "ref_smiles": "CCC(C)(CO)C[NH2+]Cc1cc(CHO)ccc1F",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9453236b-85cf-45bb-91c4-5e2c9c767268",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(=O)c1cccc(S(=O)(=O)NC(C(N)=O)C(C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)c1cccc(S(=O)(=O)NC(C(N)=O)C(C)C)c1.",
+ "ref_smiles": "CCC(=O)S(=O)(=O)NC(C(N)=O)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6d8ec947-a983-4fde-a95b-30c5fb5da45e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1[nH]n(Cc2ccccc2)c2cc(OS(=O)(=O)C(F)(F)F)cc1-2 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH]n(Cc2ccccc2)c2cc(OS(=O)(=O)C(F)(F)F)cc1-2",
+ "ref_smiles": "Cc1[nH]n(Cc2ccccc2)c2cc(OS(=O)(=O)C(O)(F)F)cc1-2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "520727b6-4326-4b18-9c4b-12aceb3a7ea3",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CC(C)(C)C1=CCN(c2nccc(C#N)n2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1=CCN(c2nccc(C#N)n2)CC1.",
+ "ref_smiles": "CC(C)(C)C1=CCN(c2ncccn2)CC1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "c260ddd8-300d-4210-b0fe-3efbddc78175",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc2ccc(Oc3ccc4c(CO)c(C(=O)NCC(=O)[O-])ncc4c3)cc2o1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2ccc(Oc3ccc4c(CO)c(C(=O)NCC(=O)[O-])ncc4c3)cc2o1",
+ "ref_smiles": "Cc1nc2ccc(Oc3ccc4c(CC(=O)[OH])c(C(=O)NCC(=O)[O-])ncc4c3)cc2o1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e12eb5c3-3983-4e27-a958-041b8b02efb1",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(NC(=O)CCCN2C(=S)NC(C)(C)CC2C)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NC(=O)CCCN2C(=S)NC(C)(C)CC2C)cc1",
+ "ref_smiles": "CCOc1ccc(NC(=O)CCCN2C(=S)C(C)(C)CC2C)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5dc6267d-5c4c-4527-ada9-e33f1f0ba399",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCn1nc(C)cc1C[NH+]1CCC(CCBr)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nc(C)cc1C[NH+]1CCC(CCBr)C1.",
+ "ref_smiles": "Cc1cc(C[NH+]2CCC(CCBr)C2)n(CCO)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "87d35ec8-693f-49d4-b25f-d4deedeaf3e9",
+ "task": "add",
+ "question": "Modify the molecule CN(C(=O)C[NH+]1CCN(Cc2ccccn2)CC1)C1(C#N)CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)C[NH+]1CCN(Cc2ccccn2)CC1)C1(C#N)CCCCC1",
+ "ref_smiles": "CN(C(=O)C[NH+]1CCN(Cc2ccccn2)C(c3ccccc3)C1)C1(C#N)CCCCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1ffd12ec-5b25-4ed0-9d28-9b9ff2cd7dba",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccccc1N1C(=O)CSC1c1cccc(Cl)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1N1C(=O)CSC1c1cccc(Cl)c1",
+ "ref_smiles": "CC(=O)c1cccc(C2SCC(=O)N2c2ccccc2OC)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6d2142dc-9fb0-427d-b26d-00b20bb27010",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(NC(=O)C(C)(COC=O)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)C(C)(COC=O)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1.",
+ "ref_smiles": "CC(NC(=O)C(C)(COC(=O)c1ccccc1)c1cc(-c2ccccc2)on1)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5f0cdad4-ee67-4d58-833f-6a325b08f857",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCn1c(SCC(=O)Nc2c(C)nn(-c3ccccc3)c2C)nc2cc(Cl)ccc2c1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1c(SCC(=O)Nc2c(C)nn(-c3ccccc3)c2C)nc2cc(Cl)ccc2c1=O",
+ "ref_smiles": "COCCn1c(SCC(=O)Nc2c(C)nn(-c3ccccc3)c2C)nc2cc(C#N)ccc2c1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cfe1f3e5-bc5e-4d15-95f9-f8a2dfa1b3c0",
+ "task": "add",
+ "question": "Modify the molecule Fc1cccc2c1C1(CC1)C1(c3cnc[nH]3)CC21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cccc2c1C1(CC1)C1(c3cnc[nH]3)CC21",
+ "ref_smiles": "Oc1cc(F)c2c(c1)C1CC1(c1cnc[nH]1)C21CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "feab0f9a-8d5e-4efd-bcba-7868983639b0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)C.",
+ "ref_smiles": "CCN(Cc1ccccc1C)C(=O)Nc1cccnc1OC(C)CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e6a01836-7c74-4641-87aa-0023fd37629b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)n1cc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1cc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)cn1.",
+ "ref_smiles": "CC(C)n1ncc(C[NH+]2CCc3nc(-c4ccco4)ncc3C2)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8bcca5d6-daa8-440e-b3ee-d975298296b7",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CC1CCN(C(=O)NC2CCc3c(-c4cnc(-c5ccc(OC(C)C)c(C#N)c5)s4)cccc32)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(C(=O)NC2CCc3c(-c4cnc(-c5ccc(OC(C)C)c(C#N)c5)s4)cccc32)C1.",
+ "ref_smiles": "CC1CCN(C(=O)NC2CCc3c(-c4cnc(-c5ccc(OC(C)C)cc5)s4)cccc32)C1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "df67f22a-8978-4a74-9b1d-bb69193a7a06",
+ "task": "add",
+ "question": "Please add a amine to the molecule COc1ccc(CCNC(=O)C2CC(c3ccccc3)CN(C(=O)COc3ccccc3)C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCNC(=O)C2CC(c3ccccc3)CN(C(=O)COc3ccccc3)C2)cc1.",
+ "ref_smiles": "COc1ccc(CCNC(=O)C2CC(c3ccc(N)cc3)CN(C(=O)COc3ccccc3)C2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "8086f0b3-f6a5-4352-ac6c-2ed26ec2e941",
+ "task": "add",
+ "question": "Modify the molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CC[NH+](CC(=O)N2CCCC2)CC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CC[NH+](CC(=O)N2CCCC2)CC1",
+ "ref_smiles": "NC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)N1CC[NH+](CC(=O)N2CCCC2)CC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4483cbfc-6b90-43b1-954a-8245a62faa2a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC[NH+](CC)CC=C(Cl)c1ccc(N)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CC=C(Cl)c1ccc(N)cc1Cl.",
+ "ref_smiles": "CC[NH+](CC)CC=C(Cl)",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7fde3eab-3b94-4fd1-88d1-4a8c1b72d424",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si]Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si]Cl.",
+ "ref_smiles": "FC(C(F)(F)C(F)(F)CC[Si]Cl)C(F)(F)C(F)(F)C(F)(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "9555e63b-7a42-41fe-8f73-b3fa7b8cef15",
+ "task": "delete",
+ "question": "Modify the molecule O=C(C=Cc1ccccc1)NC(=Cc1ccc(Cl)cc1)C(=O)N1CCOCC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccccc1)NC(=Cc1ccc(Cl)cc1)C(=O)N1CCOCC1",
+ "ref_smiles": "O=C(C=Cc1ccccc1)NC(=Cc1ccccc1)C(=O)N1CCOCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d8b710c4-269d-4afc-9fa7-7ed045f7c01a",
+ "task": "delete",
+ "question": "Modify the molecule CS(=O)(=O)c1cccc(C(=O)c2cncc(F)c2)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1cccc(C(=O)c2cncc(F)c2)c1",
+ "ref_smiles": "CS(=O)(=O)c1cccc(C(=O)c2cnccc2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "de1ace32-edd5-4912-8364-ca7e8537e12d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCCCCc1cnc(-c2cc(F)c(C#N)c(F)c2)nc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCc1cnc(-c2cc(F)c(C#N)c(F)c2)nc1",
+ "ref_smiles": "CCCCCCCCCc1cnc(-c2cc(F)c(C#N)c(C#N)c2)nc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "322b736f-5a60-482b-8528-0f7f5bbd5b13",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC(O)COCC[NH+](C)CCOCC1COCC[NH+]1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)COCC[NH+](C)CCOCC1COCC[NH+]1C.",
+ "ref_smiles": "CCCCOCC[NH+](C)CCOCC1COCC[NH+]1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8afa94b1-d125-497a-83dc-90992f35b108",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(Cl)cc1NC(=O)C(C)Sc1nc2ccccc2s1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)cc1NC(=O)C(C)Sc1nc2ccccc2s1",
+ "ref_smiles": "COc1ccc(Cl)cc1CSc1nc2ccccc2s1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "6abac77a-5933-4967-aafd-2eed74764744",
+ "task": "sub",
+ "question": "Modify the molecule O=C1NNC(=O)C1=Cc1ccc(-c2ccc(Br)cc2)o1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NNC(=O)C1=Cc1ccc(-c2ccc(Br)cc2)o1",
+ "ref_smiles": "O=C1NNC(=O)C1=Cc1ccc(-c2ccc(C=O)cc2)o1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a8b775d8-0a8d-406f-b82e-419b1651b6ab",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(-c2cn3c4ccccc4nc3n2CCOC(C)=O)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2cn3c4ccccc4nc3n2CCOC(C)=O)cc1",
+ "ref_smiles": "CCc1ccc(-c2cn3c4cc(C#N)ccc4nc3n2CCOC(C)=O)cc1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "33b0c5db-d3fe-4bcb-a008-13e5dd69c9be",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCNc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc2ccccc2)NC(=O)OC2CCOC2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc2ccccc2)NC(=O)OC2CCOC2)cc1",
+ "ref_smiles": "CC(=O)C(CN(CC(C)C)S(=O)(=O)c1ccc(NCC)cc1)C(Cc1ccccc1)NC(=O)OC1CCOC1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "388292a0-e509-4f4a-b859-c08e56c98a91",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[Si](C)(C)CC(Cc1ccccc1Br)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)CC(Cc1ccccc1Br)C(=O)[O-].",
+ "ref_smiles": "C[Si](C)(C)CC(CBr)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e3686aa9-b97f-4323-89a5-712a865b4a75",
+ "task": "sub",
+ "question": "Modify the molecule CC1CS(=O)(=O)N(c2ccc(Cl)c(C(=O)Nc3ccccc3C(F)(F)F)c2)C1=O by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CS(=O)(=O)N(c2ccc(Cl)c(C(=O)Nc3ccccc3C(F)(F)F)c2)C1=O",
+ "ref_smiles": "CC1CS(=O)(=O)N(c2ccc(C=O)c(C(=O)Nc3ccccc3C(F)(F)F)c2)C1=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "82bfdd0d-a850-4b16-816c-0906d0a147a1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(Cc1cccc(F)c1)N1CCC(O)C2(CCCO2)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1cccc(F)c1)N1CCC(O)C2(CCCO2)C1",
+ "ref_smiles": "CC(=O)C1CCN(C(=O)Cc2cccc(F)c2)CC12CCCO2",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d2173ea8-4462-49f2-ae02-939f8b99a0dc",
+ "task": "add",
+ "question": "Modify the molecule [N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])cn5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])cn5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO",
+ "ref_smiles": "[N-]=[N+]=NC1CC(n2cc(C[NH+]3CCN(c4cc5c(cc4F)c(=O)c(C(=O)[O-])c(-c6ccccc6)n5C4CC4)CC3)c(=O)[nH]c2=O)OC1CO",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "43dffcf5-80a0-4e2b-b195-c4700dc97d2c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C#CCCC([NH3+])C(OC)C1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCCC([NH3+])C(OC)C1CCCCC1.",
+ "ref_smiles": "C#CCCC([NH3+])C(O)C1CCCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ffadf577-366e-4b59-8a75-2be3f66b6665",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C)n(C(CNC(=O)COc2ccccc2F)c2ccco2)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(C(CNC(=O)COc2ccccc2F)c2ccco2)n1",
+ "ref_smiles": "Cc1cc(C)n(C(CNC(=O)COc2ccc(C=O)cc2)c2ccco2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "69a98c31-1f17-4577-ba10-fed1dd206939",
+ "task": "add",
+ "question": "Modify the molecule OCCC(CO)[NH2+]C1CSC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCC(CO)[NH2+]C1CSC1",
+ "ref_smiles": "OCCC([NH2+]C1CSC1)C(O)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "99602372-344b-4da2-b802-9f49f4dfa5dd",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH2+]C(Cc1cc(F)ccc1Cl)C1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(Cc1cc(F)ccc1Cl)C1CCCC1.",
+ "ref_smiles": "C[NH2+]C(C(F)Cl)C1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d5348ae3-a847-4bb7-b219-707604427ab2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1nc2nc(N3CCN(C(=O)C4CCCO4)CC3)nc(-c3ccccc3F)c2c1N with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc2nc(N3CCN(C(=O)C4CCCO4)CC3)nc(-c3ccccc3F)c2c1N",
+ "ref_smiles": "CC(=O)c1ccccc1-c1nc(N2CCN(C(=O)C3CCCO3)CC2)nc2nn(C)c(N)c12",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c11440a-0ecb-4f26-b894-fb111af37023",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C[NH2+]C(C)C23CC4CC(CC(C4)C2)C3)cc1Cl by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH2+]C(C)C23CC4CC(CC(C4)C2)C3)cc1Cl",
+ "ref_smiles": "COC(Cl)[NH2+]C(C)C12CC3CC(CC(C3)C1)C2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "28384ec8-e359-4e58-a996-a06c7f1fe637",
+ "task": "delete",
+ "question": "Modify the molecule NS(=O)(=O)c1cccc(-c2cn3c([nH+]2)CCC3)c1-c1ccccc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)c1cccc(-c2cn3c([nH+]2)CCC3)c1-c1ccccc1",
+ "ref_smiles": "O=[SH](=O)c1cccc(-c2cn3c([nH+]2)CCC3)c1-c1ccccc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "42e9fee0-7ecd-4d12-a9b7-b1e0e2f20695",
+ "task": "add",
+ "question": "Please add a amine to the molecule COc1cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1.",
+ "ref_smiles": "COc1c(NH2)cc(NC(=O)Cn2cc(S(=O)(=O)Cc3ccc(C)cc3)c3ccccc32)cc(OC)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "46a1f668-bdc2-49c7-aa85-a10fc7f92586",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCC[NH2+]C(C)c1csc(C(CC)(CC)OCC)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(C)c1csc(C(CC)(CC)OCC)n1.",
+ "ref_smiles": "CCC[NH2+]C(C)c1csc(C(CC)(OCC)C(C)C(=O)O)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "14b83513-1a39-4d46-ba8e-cc2f2e1c36ea",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ccc(-c2cc(=O)n(CCNC(=O)C3CCCO3)cn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-c2cc(=O)n(CCNC(=O)C3CCCO3)cn2)cc1.",
+ "ref_smiles": "CCOc1ccc(-c2cc(=O)n(C(O)CNC(=O)C3CCCO3)cn2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c6250a7a-bb20-4985-a5e9-3a0b9e90065e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)c1cc([N+](=O)[O-])c(SCCCO)s1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)c1cc([N+](=O)[O-])c(SCCCO)s1",
+ "ref_smiles": "CC(I)c1cc([N+](=O)[O-])c(SCCCO)s1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "de16652d-2a75-4374-a5c8-97bbdf98cfd3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1ncc2c(Cl)nc(C[NH+]3CCNC(=O)C3)nc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ncc2c(Cl)nc(C[NH+]3CCNC(=O)C3)nc21",
+ "ref_smiles": "Cn1ncc2c(C#N)nc(C[NH+]3CCNC(=O)C3)nc21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8febe1ce-79bb-451c-8349-28d173f2d881",
+ "task": "delete",
+ "question": "Modify the molecule CCN(C1CC[NH2+]CC1)S(=O)(=O)c1cc(Cl)ccc1C#N by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(C1CC[NH2+]CC1)S(=O)(=O)c1cc(Cl)ccc1C#N",
+ "ref_smiles": "CCN(C1CC[NH2+]CC1)S(=O)(=O)c1cccc(Cl)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "81cc244e-2c78-47f4-a003-701cb88aa409",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCCC(C)(C)C[NH2+]Cc1ccc(C[NH3+])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(C)(C)C[NH2+]Cc1ccc(C[NH3+])cc1.",
+ "ref_smiles": "CCCCCC(C)(C)C[NH2+]CC[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "813311f5-beae-4394-a7bd-6093912ff862",
+ "task": "sub",
+ "question": "Modify the molecule CC(OC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccccc1C#N by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccccc1C#N",
+ "ref_smiles": "CC(OC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)Nc1ccccc1[N+](=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "376736a2-a110-4e7d-ae8d-9e83c4fce482",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CCCn1c(C)cc(C=C(C#N)C(=O)OCC(=O)c2ccc3c(c2)CCCC3)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1c(C)cc(C=C(C#N)C(=O)OCC(=O)c2ccc3c(c2)CCCC3)c1C.",
+ "ref_smiles": "CCCn1c(C)cc(C=CC(=O)OCC(=O)c2ccc3c(c2)CCCC3)c1C",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cffd860e-8d00-40c7-a547-ebc4c59bc99f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C)c2ccc3c(Br)cc(C)c4ccc1c2c43.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c2ccc3c(Br)cc(C)c4ccc1c2c43.",
+ "ref_smiles": "Cc1ccc2ccc3c(C)cc(C)c4ccc1c2c34",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1dcdc23b-c574-4493-a40c-480a504094db",
+ "task": "add",
+ "question": "Modify the molecule N#CCNC(=O)c1ccc(N)cn1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCNC(=O)c1ccc(N)cn1",
+ "ref_smiles": "N#CC(CC=O)NC(=O)c1ccc(N)cn1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "5ea1a4ee-961f-4e31-b17f-afed3f9f0a6f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1sc(Cl)cc1-c1ncn[nH]1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1sc(Cl)cc1-c1ncn[nH]1",
+ "ref_smiles": "CC(=O)c1cc(-c2ncn[nH]2)c(N)s1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f1f36bd1-6e9d-4b95-8112-90739d6bc66d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C=Cc1cccs1)NCC(F)(F)CO with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1cccs1)NCC(F)(F)CO",
+ "ref_smiles": "O=C(C=Cc1cccs1)NCC(F)(S)CO",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0b50fd4a-5594-4706-9ee2-0f77fa9584e3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NC1CC2CCC1[NH2+]2)c1cc2ccccc2cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CC2CCC1[NH2+]2)c1cc2ccccc2cn1.",
+ "ref_smiles": "O=C(NC1CC2CCC1[NH2+]2)c1cc2cccc(O)c2cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ca53ddc7-14ec-4437-93d3-eee1caf14db2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN1CC[NH+](C2=C(c3ccc(Cl)cc3)C(=O)N(C3CCCCC3)C2=O)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1CC[NH+](C2=C(c3ccc(Cl)cc3)C(=O)N(C3CCCCC3)C2=O)CC1",
+ "ref_smiles": "CN1CC[NH+](C2=C(c3ccc(C=O)cc3)C(=O)N(C3CCCCC3)C2=O)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8af67d3c-c9f6-47aa-901a-b360d8041ca0",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)C[NH+](C)CC(C)(CC)C[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C[NH+](C)CC(C)(CC)C[NH3+]",
+ "ref_smiles": "CCC(C)(C[NH3+])C[NH+](C)CC(C)=CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8cf61957-e9c7-4e3c-938b-5f4e11449656",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=P(CCc1ccccn1)(CCc1ccccn1)C(O)C(Cl)(Cl)Cl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=P(CCc1ccccn1)(CCc1ccccn1)C(O)C(Cl)(Cl)Cl",
+ "ref_smiles": "O=P(CCc1ccccn1)(CCc1ccccn1)C(F)C(Cl)(Cl)Cl",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "abbddd96-6007-49ce-a526-1731b1be82a4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)OCCCNC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)OCCCNC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)o1.",
+ "ref_smiles": "CC(C)OCCCNC(=O)c1ccc(C(F)(F)F)o1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "af25c516-d308-43ee-8ffc-d56e3ee2c029",
+ "task": "add",
+ "question": "Please add a thiol to the molecule C=NC=CC(C(=O)[O-])=C(C)Nc1nn(CCC2CCCC2)c2ccc(F)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=NC=CC(C(=O)[O-])=C(C)Nc1nn(CCC2CCCC2)c2ccc(F)cc12.",
+ "ref_smiles": "CC(Nc1nn(CCC2CCCC2)c2ccc(F)cc12)=C(C=CN=CS)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "8e8e4cca-e4c7-4bea-98e3-8e59245a86b0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(OCCCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OCCCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)ccc1Cl.",
+ "ref_smiles": "Cc1cc(OCCCC(=O)N2CCN([N+](=O)[O-])CC2)ccc1Cl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "581873e2-37c3-4456-b51d-e6a36f823bed",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5CCCc6ccccc65)nc34)n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5CCCc6ccccc65)nc34)n2)cc1.",
+ "ref_smiles": "Cc1ccc(-c2noc(-c3cccn4c(=O)n(CC(=O)N5c6ccccc6CCC5O)nc34)n2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3ae59814-7aea-4e76-a9a0-ca61265d57e9",
+ "task": "add",
+ "question": "Modify the molecule CC1CC(C)CC(C(O)c2ccc(F)cc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)CC(C(O)c2ccc(F)cc2)C1",
+ "ref_smiles": "CC1CC(C)CC(C(O)c2ccc(F)cc2O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6b5d420f-433a-423a-956d-df7927392073",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(C#N)ccc(N)c1C(=O)OCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C#N)ccc(N)c1C(=O)OCc1ccccc1",
+ "ref_smiles": "Cc1c(C#N)ccc(N)c1C(=O)OCc1cccc(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "de8dcd10-46a5-4dd6-9c56-8ac6e724f5c5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(C)c1cc(CNC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Br)ccn1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1cc(CNC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Br)ccn1",
+ "ref_smiles": "CN(C)c1cc(CNC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2O)ccn1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e8afefb7-d8a0-4599-a75e-651b56fad60f",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCCC(NC(c2ccccc2)C(F)(F)F)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC(NC(c2ccccc2)C(F)(F)F)CC1",
+ "ref_smiles": "CC1CCCC(NCC(F)(F)F)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b3e1ba9e-bc8a-4b49-b8f6-9487915c4926",
+ "task": "add",
+ "question": "Modify the molecule CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1",
+ "ref_smiles": "CC(C(=O)NN)c1ccc(CN(C)CC(F)(F)F)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "49cccf1a-3d9c-45e7-b4c7-1812bc76d77f",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCCC(C(=O)[O-])C1(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCCC(C(=O)[O-])C1(C)C",
+ "ref_smiles": "CC1C(C(=O)O)CCCC(C(=O)[O-])C1(C)C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "92b63beb-9a22-4a4b-8260-ecf3376fce74",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(CN(C(=O)CN(c2ccccc2F)S(C)(=O)=O)C(C)C(=O)NCC(C)C)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CN(C(=O)CN(c2ccccc2F)S(C)(=O)=O)C(C)C(=O)NCC(C)C)c1",
+ "ref_smiles": "Cc1cccc(CN(C(=O)CN(c2ccccc2[N+](=O)[O-])S(C)(=O)=O)C(C)C(=O)NCC(C)C)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bf217b3d-820d-4c2d-8532-c998e57341b0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cncc(N(Cc2ccc(F)cc2)C(=O)C2CCN(C(=O)N(C)C)CC2)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cncc(N(Cc2ccc(F)cc2)C(=O)C2CCN(C(=O)N(C)C)CC2)c1",
+ "ref_smiles": "Cc1cncc(N(Cc2ccc(S)cc2)C(=O)C2CCN(C(=O)N(C)C)CC2)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "76481d89-92a9-490a-8663-f4876a594b99",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1c(C(=O)NCC(O)CC(C)C)cnn1-c1ccncc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)NCC(O)CC(C)C)cnn1-c1ccncc1.",
+ "ref_smiles": "Cc1c(C(=O)NC(O)C(O)CC(C)C)cnn1-c1ccncc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a4791509-ae7e-42c1-9895-6404f00f6fc2",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(NC1c2ccccc2CC1O)C(Cc1ccccc1)CC(O)CC1=Cc2ccccc2S1(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1c2ccccc2CC1O)C(Cc1ccccc1)CC(O)CC1=Cc2ccccc2S1(=O)=O.",
+ "ref_smiles": "O=C(NC1c2ccccc2CC1O)C(CCCC1=Cc2ccccc2S1(=O)=O)Cc1ccccc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6ac05e84-8966-47fe-8091-cb04cc7e8578",
+ "task": "delete",
+ "question": "Modify the molecule O=C1CCc2c(Cl)cc(O)c(F)c21 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCc2c(Cl)cc(O)c(F)c21",
+ "ref_smiles": "O=C1CCc2c(Cl)ccc(F)c21",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9212b9f0-0d2d-427d-ad33-8b48fd8792fd",
+ "task": "sub",
+ "question": "Modify the molecule Fc1ccc(C2CCC(CC[NH2+]CCC3CCC(c4ccc(F)cc4)O3)O2)cc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(C2CCC(CC[NH2+]CCC3CCC(c4ccc(F)cc4)O3)O2)cc1",
+ "ref_smiles": "ONc1ccc(C2CCC(CC[NH2+]CCC3CCC(c4ccc(F)cc4)O3)O2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "87e53ee8-4547-4b72-bf00-ea513263ef11",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)cc1OC.",
+ "ref_smiles": "COc1cc(S(=O)(=O)NCCC(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8d336b35-f184-4add-a24d-33f1bd5281ce",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(C)C1CCC(O[Si](C)(C)C(C)(C)C)C2C=CC(C)(CO)CC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1CCC(O[Si](C)(C)C(C)(C)C)C2C=CC(C)(CO)CC21.",
+ "ref_smiles": "CC(C)C1CCC(O[Si](C)(C)C(C)(C)C)C2C=CC(C)(C)CC21",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b0128f44-6a01-4d75-85ef-dd13768958bc",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1.",
+ "ref_smiles": "COc1ccc(CCNc2ncnc3nc(-c4ccc(N5CCOCC5)nc4)[nH]c23)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "988933e2-6711-43fc-9052-d53796fd70cd",
+ "task": "add",
+ "question": "Modify the molecule O=C(NCCC[NH+]1CCOCC1)c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCC[NH+]1CCOCC1)c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1",
+ "ref_smiles": "O=C(NC(CC[NH+]1CCOCC1)c1ccccc1c1cc(Oc2ccc3c(c2)C(C(=O)[O-])CN3)ccn1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9a392557-11a8-480c-ba5c-2604cb688b53",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)C(Cc1ccccc1)N1CCN2c3ccccc3C3=[C+]C=CC=C3C21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(Cc1ccccc1)N1CCN2c3ccccc3C3=[C+]C=CC=C3C21.",
+ "ref_smiles": "COC(=O)C(C)N1CCN2c3ccccc3C3=[C+]C=CC=C3C21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "63af360b-1b95-4fe3-8910-3c8fd10d0953",
+ "task": "delete",
+ "question": "Modify the molecule O=C1CC[NH+](Cc2ccccc2C(F)(F)F)CCN1CC[NH+]1CCCCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC[NH+](Cc2ccccc2C(F)(F)F)CCN1CC[NH+]1CCCCC1",
+ "ref_smiles": "FC(F)(F)c1ccccc1C[NH+]1CC(CC[NH+]2CCCCC2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "db9c21ea-d9c0-4a5d-b266-055e0943d312",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2C)C1=O.",
+ "ref_smiles": "CC1[NH2+]C(c2ccsc2)N(C2CC[NH+](C)CC2CN)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "d6a64547-de19-4e51-9766-c9384f899925",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)Oc1nc[nH]c(=O)c1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)Oc1nc[nH]c(=O)c1Cl",
+ "ref_smiles": "CC(C)(C)Oc1nc[nH]c(=O)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cad85761-52a8-4122-a54e-816f0dfe2590",
+ "task": "sub",
+ "question": "Modify the molecule CCC(O)CC[NH2+]Cc1ccc(OC(C)C#N)cc1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)CC[NH2+]Cc1ccc(OC(C)C#N)cc1",
+ "ref_smiles": "CCC(C#N)CC[NH2+]Cc1ccc(OC(C)C#N)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "238e0326-6e3b-414c-ae52-af0b15cffe99",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1ccc([S-])c(C(F)(F)F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc([S-])c(C(F)(F)F)c1",
+ "ref_smiles": "N#Cc1ccc([S-])c(C(F)(F)F)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "69b20f44-dca4-4b32-bbfb-9caa65149b23",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(CC1CCCC1)N1CCOCC(F)(F)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1CCCC1)N1CCOCC(F)(F)C1.",
+ "ref_smiles": "O=C(CC1CCCC1)N1CCOCC(F)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "fcc89eb7-c744-4ab4-9824-021b8d5f4873",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C=CC1CC(C)(c2ccccc2)C(=O)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC1CC(C)(c2ccccc2)C(=O)O1.",
+ "ref_smiles": "C=CC1CC(C)C(=O)O1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e3c180e9-cddc-40ed-9e42-fe0d8c2bb4dc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1cc2cc(Br)c(F)cc2nc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc2cc(Br)c(F)cc2nc1Cl",
+ "ref_smiles": "CCc1cc2cc(C(=O)[OH])c(F)cc2nc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c9330c50-7f88-42d4-93f7-29060e76d169",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule NC(COc1ccc2c(c1)CCC(=O)N2)=[NH+]O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(COc1ccc2c(c1)CCC(=O)N2)=[NH+]O",
+ "ref_smiles": "NC(COc1ccc2c(c1)CCC(=O)N2)=[NH+]NO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8cd4f21e-885f-4620-af4b-83eacff2f6b0",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1cccc(Br)c1Cl)C1CCCc2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc(Br)c1Cl)C1CCCc2ccccc21",
+ "ref_smiles": "O=C(c1cccc(Br)c1Cl)C1CCC(c2ccccc2)c2ccccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d1a3583b-055c-4701-82d1-4fafbc77783b",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1.",
+ "ref_smiles": "COC(=O)C(C)NC(=O)N(CC(=O)[O-])c1ccc(Cl)cc1CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "82cc779d-8b2d-40cd-977a-bfffe9c31d77",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule C=C(C=CC(=CC)c1cccc(NS(=O)(=O)c2ccccc2C#N)c1)C1CC1[NH2+]C1CCC([NH3+])CC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C=CC(=CC)c1cccc(NS(=O)(=O)c2ccccc2C#N)c1)C1CC1[NH2+]C1CCC([NH3+])CC1",
+ "ref_smiles": "C=C(C=CC(=CC)c1cccc(NS(=O)(=O)c2ccccc2F)c1)C1CC1[NH2+]C1CCC([NH3+])CC1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "42ff741b-f775-4361-8826-e1accf730b67",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule Cc1ccc(C#N)cc1OCC(C)(C)CS.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C#N)cc1OCC(C)(C)CS.",
+ "ref_smiles": "Cc1ccccc1OCC(C)(C)CS",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cdb75668-14a3-4902-9dfa-d76a56d92990",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccc(C2C(c3ccc(Cl)cc3)=C(O)C(=O)N2c2ccc(N3CCC(C)CC3)cc2)cc1OC with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2C(c3ccc(Cl)cc3)=C(O)C(=O)N2c2ccc(N3CCC(C)CC3)cc2)cc1OC",
+ "ref_smiles": "COc1ccc(C2C(c3ccc(Cl)cc3)=C(S)C(=O)N2c2ccc(N3CCC(C)CC3)cc2)cc1OC",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ae988535-280f-40fe-bb52-de8a9595bcb4",
+ "task": "add",
+ "question": "Modify the molecule CSc1cccc(N2CC=C(C)CC2)c1C[NH3+] by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1cccc(N2CC=C(C)CC2)c1C[NH3+]",
+ "ref_smiles": "CSc1c(N)ccc(N2CC=C(C)CC2)c1C[NH3+]",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "1a4b638e-80c5-45f3-8881-806ef07d2b21",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccccc4)ccc3Cl)CC2)ccc1C by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccccc4)ccc3Cl)CC2)ccc1C",
+ "ref_smiles": "CC(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccccc4)ccc3)CC2)ccc1C=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "484564f9-2479-42b1-8616-205bf6994bcb",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(C(=O)CC2(O)C(=O)Nc3c(Cl)ccc(Cl)c32)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)CC2(O)C(=O)Nc3c(Cl)ccc(Cl)c32)cc1.",
+ "ref_smiles": "COc1ccc(C(=O)COc2cc(Cl)ccc(Cl)c2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "4b0f8a48-23ef-4b17-9260-e1259d730064",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1(C)CCC(O)(CNC(=O)C2CCCCS2)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC(O)(CNC(=O)C2CCCCS2)CC1",
+ "ref_smiles": "CC(=O)C1(CNC(=O)C2CCCCS2)CCC(C)(C)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4f22657a-a044-464d-848a-a4208576fb13",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(OC)c1C1(C2(c3c(OC)cccc3OC)SCC(=O)N2Cc2ccc(-n3cccn3)cc2)SCC(=O)N1Cc1ccc(N2CCCC2)cc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(OC)c1C1(C2(c3c(OC)cccc3OC)SCC(=O)N2Cc2ccc(-n3cccn3)cc2)SCC(=O)N1Cc1ccc(N2CCCC2)cc1",
+ "ref_smiles": "COc1cccc(OC)c1C1(C2(c3c(OC)cccc3OC)SCC(=O)N2Cc2ccc(-n3cccn3)cc2)SC1c1ccc(N2CCCC2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1d7ddd8f-c608-4fcb-bc8e-7f139e3378d5",
+ "task": "add",
+ "question": "Modify the molecule O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCC(=O)NCC(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NCC(=O)NCC(F)(F)F",
+ "ref_smiles": "O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1-c1ccccc1)NCC(=O)NCC(F)(F)F",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "447b2ebb-fc1d-4de3-9019-41dbbb35b4a8",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH+](C)C1CCN(C(=O)c2cc3ccc(Cl)cc3[nH]2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)C1CCN(C(=O)c2cc3ccc(Cl)cc3[nH]2)C1.",
+ "ref_smiles": "C[NH+](C)C1CCN(C(=O)c2cc3ccccc3[nH]2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2c5891f8-5823-44de-8edf-0e44781912f1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(COC(=O)c1ccc(Br)cc1)Nc1ccccc1C(=O)NC1CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COC(=O)c1ccc(Br)cc1)Nc1ccccc1C(=O)NC1CC1",
+ "ref_smiles": "O=C(COC(=O)c1ccc(S)cc1)Nc1ccccc1C(=O)NC1CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "01ce4336-f2ff-4f73-8720-74fb2ed97c2e",
+ "task": "add",
+ "question": "Modify the molecule CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)CC2)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)CC2)[nH]1",
+ "ref_smiles": "CN(C)c1nc(=O)cc(C(=O)NC2CC[NH+](C3CCCC3)C(c4ccccc4)C2)[nH]1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "939f971d-e9d0-4c00-99b8-3c4f12f8e8ea",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH+](CC)CCCC(C)=Nc1ccc(OC)c(Cl)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCCC(C)=Nc1ccc(OC)c(Cl)c1",
+ "ref_smiles": "CC[NH+](CC)CCCC(C)=Nc1ccc(OC)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fb8f767d-bc20-4c0a-82bb-4fe37bf108c0",
+ "task": "delete",
+ "question": "Modify the molecule Cc1csc(=O)n1CCC(=O)Nc1ccc(C#N)cc1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(=O)n1CCC(=O)Nc1ccc(C#N)cc1",
+ "ref_smiles": "Cc1csc(=O)n1CCC(=O)Nc1ccccc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "60614dd7-931a-4c1a-bc20-af25cd527be0",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCc1ccccc1C[NH+]1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NCc1ccccc1C[NH+]1CCCC1.",
+ "ref_smiles": "O=C(CN(c1cccc(C)c1)S(=O)(=O)c1ccccc1)NCc1ccccc1C[NH+]1CCCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "797ea6ed-3d00-4be3-b1f8-61a2efdcbd8d",
+ "task": "add",
+ "question": "Modify the molecule CNC(=O)Cn1c(=O)nc(-c2ccccc2)c2cc(Cl)sc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)Cn1c(=O)nc(-c2ccccc2)c2cc(Cl)sc21",
+ "ref_smiles": "CNC(=O)Cn1c(=O)nc(-c2cccc(O)c2)c2cc(Cl)sc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f546aff5-be06-49a6-80d2-c060b8d01482",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2ccc3ccccc3c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2ccc3ccccc3c2)CC1.",
+ "ref_smiles": "O=C(NC(c1ccccc1)c1ccccc1)C1CC[NH+](Cc2cc(-c3ccccc3)c3ccccc3c2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "99052bdc-c4ca-4cb0-9e1f-5deb3284d2c3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(C)NC(N)=[NH+]C(CO)CO with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)NC(N)=[NH+]C(CO)CO",
+ "ref_smiles": "CC(=O)CC(CO)[NH+]=C(N)NC(C)(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5fce7a5d-f16f-4433-82a0-1e53c04b59c4",
+ "task": "sub",
+ "question": "Modify the molecule O=C(C=C1CCCCC1)Cc1c(F)cccc1Cl by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=C1CCCCC1)Cc1c(F)cccc1Cl",
+ "ref_smiles": "CC(=O)c1cccc(Cl)c1CC(=O)C=C1CCCCC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "283f3593-7e0d-4fae-84b2-902c3742ca56",
+ "task": "sub",
+ "question": "Modify the molecule Clc1cc(Cl)c(Nc2c(Br)cccc2Br)nc1Cl by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cc(Cl)c(Nc2c(Br)cccc2Br)nc1Cl",
+ "ref_smiles": "O=C(O)c1cc(Cl)c(Nc2c(Br)cccc2Br)nc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d5e97fc6-a0d6-4018-8cee-6f75e56d5028",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NCCc1cccc(F)c1)c1ccc2nn(CC3COc4ccccc4O3)cc2c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCc1cccc(F)c1)c1ccc2nn(CC3COc4ccccc4O3)cc2c1",
+ "ref_smiles": "O=C([OH])c1cccc(CCNC(=O)c2ccc3nn(CC4COc5ccccc5O4)cc3c2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ff9726cd-4c8f-4611-96da-2303765fe468",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(O)cc(O)c(Cl)c1NC(=O)[NH+]=C(N)N by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(O)cc(O)c(Cl)c1NC(=O)[NH+]=C(N)N",
+ "ref_smiles": "Cc1c(O)cc(O)c(C(=O)O)c1NC(=O)[NH+]=C(N)N",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c43df09-89af-4836-86c1-49b5be3e189a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C([O-])C(O)c1c(F)cc([N+](=O)[O-])cc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(O)c1c(F)cc([N+](=O)[O-])cc1Br.",
+ "ref_smiles": "O=C([O-])C(O)c1c(Br)cc([N+](=O)[O-])c(O)c1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "18726d88-74e0-4b3b-98b5-855f38d42d35",
+ "task": "add",
+ "question": "Modify the molecule CCCC(=O)Nc1ccc(C(=O)NC(CC)CO)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=O)Nc1ccc(C(=O)NC(CC)CO)cc1",
+ "ref_smiles": "CCCC(=O)Nc1ccc(C(=O)NC(O)(CC)CO)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "05693165-bf7e-4303-a88f-0a52f93cf4a8",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(C=C(C(O)C(C)(C)C)n2cncn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C=C(C(O)C(C)(C)C)n2cncn2)cc1.",
+ "ref_smiles": "Cc1ccc(C=C(C(O)C(C)(C)CO)n2cncn2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "07db22d8-73a0-46d1-86c0-a0a1a986c307",
+ "task": "delete",
+ "question": "Modify the molecule Fc1c(Cl)cc(F)c2[nH]ccc12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1c(Cl)cc(F)c2[nH]ccc12",
+ "ref_smiles": "Fc1ccc(F)c2[nH]ccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8dee7cf5-0b8b-4f33-bc38-97d1a358b64e",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(C)c2c(c1)c(C(=O)CC#N)cn2C(C)C(N)=O by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C)c2c(c1)c(C(=O)CC#N)cn2C(C)C(N)=O",
+ "ref_smiles": "COc1cc(C)c2c(c1)c(C(=O)CHO)cn2C(C)C(N)=O",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "69c1b856-75dd-48c4-917e-22d879b2706d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(Cl)ccc1SC(N)=S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)ccc1SC(N)=S.",
+ "ref_smiles": "NC(=S)Sc1ccc(Cl)cc1Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "33613e67-f2c9-49b1-adf1-67512e88d19b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCc1nc2c(C)c(Cl)c(C)cc2o1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCc1nc2c(C)c(Cl)c(C)cc2o1",
+ "ref_smiles": "COCCc1nc2c(C)c(C#N)c(C)cc2o1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "24d1ea68-97d8-44c4-893f-b1c190c02f81",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(c1cccc(Cl)c1F)N1CC2CC1C[NH+]2Cc1cccc(Nc2ccn[nH]2)n1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc(Cl)c1F)N1CC2CC1C[NH+]2Cc1cccc(Nc2ccn[nH]2)n1",
+ "ref_smiles": "O=C(c1cccc(O)c1F)N1CC2CC1C[NH+]2Cc1cccc(Nc2ccn[nH]2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0cd92bf2-a6a9-4957-9f42-489c477c71e0",
+ "task": "sub",
+ "question": "Modify the molecule CC(O)CC(C)CNC(=O)C(C)Oc1ccc(C#N)cc1 by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)CC(C)CNC(=O)C(C)Oc1ccc(C#N)cc1",
+ "ref_smiles": "CC(=O)c1ccc(OC(C)C(=O)NCC(C)CC(C)O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9454396d-60b8-422b-8d9c-efce7cafee7b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OCCn1c(-c2ccccc2O)n[nH]c1=S with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCn1c(-c2ccccc2O)n[nH]c1=S",
+ "ref_smiles": "ONCCn1c(-c2ccccc2O)n[nH]c1=S",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "381ddaa5-b3f4-4086-8714-8c4177be3cce",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOc1ccc2nc(NC(=O)C(Cc3ccccc3)n3cccc3)sc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2nc(NC(=O)C(Cc3ccccc3)n3cccc3)sc2c1.",
+ "ref_smiles": "CCOc1ccc2nc(NC(=O)C(Cc3cccc(-c4ccccc4)c3)n3cccc3)sc2c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "148bc633-1136-40a3-89ff-3dbc21ea50f7",
+ "task": "delete",
+ "question": "Modify the molecule O=C1NC(=O)N(c2cccc(C(F)(F)F)c2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1N1CC[NH2+]CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NC(=O)N(c2cccc(C(F)(F)F)c2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1N1CC[NH2+]CC1",
+ "ref_smiles": "O=C1NC(=O)N(c2cccc(C(F)F)c2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1N1CC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "51a24552-7365-4acf-ac0b-d3c422a04984",
+ "task": "delete",
+ "question": "Modify the molecule O=C(c1csc(I)c1)N(CCO)C1CCCC1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1csc(I)c1)N(CCO)C1CCCC1",
+ "ref_smiles": "CCN(C(=O)c1csc(I)c1)C1CCCC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c61bbe10-5938-48d3-b84b-1ed48f3d441d",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCc1nc(CCNC(=O)C2CCC2)cs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(CCNC(=O)C2CCC2)cs1.",
+ "ref_smiles": "CCc1nc(CCC2CC2)cs1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "cd946f8c-f03a-4ea4-9c88-e4cc4ef6b814",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CN(c2cc(C(=O)N3Cc4cccc(Cl)c4C3)ccn2)CCO1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(c2cc(C(=O)N3Cc4cccc(Cl)c4C3)ccn2)CCO1",
+ "ref_smiles": "CC1CN(c2cc(C(=O)N3Cc4cccc(S)c4C3)ccn2)CCO1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ef01f3d8-d742-4df1-8915-2901732c1e53",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=c1onc(-c2ccccc2)n1Cc1nc2ccccc2o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1onc(-c2ccccc2)n1Cc1nc2ccccc2o1.",
+ "ref_smiles": "O=c1oncn1Cc1nc2ccccc2o1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fea82d98-e656-4336-9c46-2c2ac5e607a7",
+ "task": "sub",
+ "question": "Please substitute a thiol in the molecule CCOC(=O)CC(S)C(CC1CCNC1=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(C)NC(=O)c1cc(C)on1)C(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(S)C(CC1CCNC1=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(C)NC(=O)c1cc(C)on1)C(C)C",
+ "ref_smiles": "CCOC(=O)CC(C(=O)[OH])C(CC1CCNC1=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(C)NC(=O)c1cc(C)on1)C(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "thiol"
+ },
+ {
+ "id": "24845e36-fd28-459f-9737-6a11cf3cab0f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)(O)C(c1cc(F)cc(F)c1)C1C[NH+](CCCCCc2ccc(Cl)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(O)C(c1cc(F)cc(F)c1)C1C[NH+](CCCCCc2ccc(Cl)cc2)C1.",
+ "ref_smiles": "CC(C)(O)C(c1cc(F)cc(F)c1)C1(O)C[NH+](CCCCCc2ccc(Cl)cc2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e8370b88-6ba3-4b13-9431-bb0e1cf2e900",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC#CC#CC#CC#CC=CC(O)CO with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC#CC#CC#CC#CC=CC(O)CO",
+ "ref_smiles": "CC#CC#CC#CC#CC=CC(CO)NO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9cf8203c-d71c-400d-bbb8-276a959a8dbd",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCN(C(=O)C2CC2C(=O)Nc2ccccc2Cl)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(C(=O)C2CC2C(=O)Nc2ccccc2Cl)CC1",
+ "ref_smiles": "CC1CCN(C(=O)C2CC2C(=O)Nc2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e76cabea-9fa1-4733-ba4f-385a497c5cd3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCOc1cccc(C2C(c3ccc(OC)c(OCC)c3)=C(O)C(=O)N2c2ccc(N3CCCCC3)cc2)c1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cccc(C2C(c3ccc(OC)c(OCC)c3)=C(O)C(=O)N2c2ccc(N3CCCCC3)cc2)c1",
+ "ref_smiles": "CCCOc1cccc(C2C(c3ccc(OC)c(OCC)c3)=C(F)C(=O)N2c2ccc(N3CCCCC3)cc2)c1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0e01de2a-afae-42d1-b20c-062d12a77c9d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCN(C(=O)c1ccc(F)cc1C)C(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(C(=O)c1ccc(F)cc1C)C(C)C",
+ "ref_smiles": "CCCN(C(=O)c1ccc([N+](=O)[O-])cc1C)C(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2d5a5aeb-5cc2-4483-8437-136ff705d730",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1c(-c2ccccc2)ccn1S(=O)(=O)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(-c2ccccc2)ccn1S(=O)(=O)c1ccccc1",
+ "ref_smiles": "CCOC(=O)c1c(-c2ccccc2)ccn1[SH](=O)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "71023501-52a6-4ce6-8b45-993561193e6a",
+ "task": "sub",
+ "question": "Modify the molecule Cc1noc(C)c1N(C)C(=O)CC(O)c1ccc(Cl)cc1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1N(C)C(=O)CC(O)c1ccc(Cl)cc1",
+ "ref_smiles": "CC(=O)C(CC(=O)N(C)c1c(C)noc1C)c1ccc(Cl)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0e8932e8-6295-4e6d-8233-ba27084fd3f0",
+ "task": "delete",
+ "question": "Modify the molecule C=NC(NC(Nc1ccc2c(n1)NC(=O)C(C)(C)O2)=[NH+]C)=[NH+]C(CC)CC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=NC(NC(Nc1ccc2c(n1)NC(=O)C(C)(C)O2)=[NH+]C)=[NH+]C(CC)CC",
+ "ref_smiles": "C=NC(NC(=[NH+]C)c1ccc2c(n1)NC(=O)C(C)(C)O2)=[NH+]C(CC)CC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0436c4d1-6d66-4d9f-b636-15881c7bb42b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(S(=O)(=O)[N-]c2ncccn2)cc1)c1ccnn1COc1ccc(Cl)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(S(=O)(=O)[N-]c2ncccn2)cc1)c1ccnn1COc1ccc(Cl)cc1",
+ "ref_smiles": "O=C([OH])c1ccc(OCn2nccc2C(=O)Nc2ccc(S(=O)(=O)[N-]c3ncccn3)cc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "36bf6b45-668a-4ee0-ad94-163a0545254a",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(C)C(=O)NCC(O)c1ccsc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(C)C(=O)NCC(O)c1ccsc1",
+ "ref_smiles": "CCOC(C)C(=O)NCCc1ccsc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8dd25b2d-5ee6-42df-968a-439dc58ea044",
+ "task": "add",
+ "question": "Modify the molecule CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])CC1",
+ "ref_smiles": "CCC1CCC(NC(=O)CCNC(=O)c2ccco2)(C(=O)[O-])C(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8df682ce-23a5-40a1-9844-71b1f66846c4",
+ "task": "add",
+ "question": "Modify the molecule OC(CN(c1ccccc1)C(Oc1ccccc1)c1cccc(OC(F)(F)F)c1)c1ccc(C(F)(F)F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(CN(c1ccccc1)C(Oc1ccccc1)c1cccc(OC(F)(F)F)c1)c1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "O=C(O)c1cccc(N(CC(O)c2ccc(C(F)(F)F)cc2)C(Oc2ccccc2)c2cccc(OC(F)(F)F)c2)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "481a9213-f2b3-492d-a9ab-02a298229858",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1cc[nH+]c2cc(CN3CCN(S(=O)(=O)c4cc5ccc(Cl)cc5s4)CC3=O)ccc12 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc[nH+]c2cc(CN3CCN(S(=O)(=O)c4cc5ccc(Cl)cc5s4)CC3=O)ccc12",
+ "ref_smiles": "Nc1cc[nH+]c2cc(CN3CCN(S(=O)(=O)c4cc5ccc(C(=O)[OH])cc5s4)CC3=O)ccc12",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dcc01e2e-1688-4172-8f14-010f306100b7",
+ "task": "add",
+ "question": "Please add a amine to the molecule Nc1ccccc1OCCC(=O)N1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccccc1OCCC(=O)N1CCCC1.",
+ "ref_smiles": "Nc1cccc(OCCC(=O)N2CCCC2)c1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "b54f10bc-821a-4c9c-b4d9-3269b8eac38b",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule [NH3+]C1C2CC3(F)CC1CC(F)(C2)C3.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1C2CC3(F)CC1CC(F)(C2)C3.",
+ "ref_smiles": "[NH3+]C1C2CC3CC1CC(C2)C3",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5236ff1c-8413-444e-907b-017911abacdd",
+ "task": "add",
+ "question": "Modify the molecule C=CCOC(=O)Nc1ccc(CCC(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOC(=O)Nc1ccc(CCC(=O)[O-])cc1",
+ "ref_smiles": "C=C(COC(=O)Nc1ccc(CCC(=O)[O-])cc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c352e9f6-bb2f-49b9-a8ff-bde47fccc2ba",
+ "task": "add",
+ "question": "Modify the molecule N#CC1CCCCC1N(CCO)Cc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1CCCCC1N(CCO)Cc1ccccc1",
+ "ref_smiles": "N#CC1C(c2ccccc2)CCCC1N(CCO)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bbc2fea3-bf45-4986-8b5d-a22ddff15281",
+ "task": "delete",
+ "question": "Modify the molecule c1ccc(CN(c2cnccn2)[n+]2ccccc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(CN(c2cnccn2)[n+]2ccccc2)cc1",
+ "ref_smiles": "CN(c1cnccn1)[n+]1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "89a3f10d-14eb-4b6a-8810-c1b2e962ea67",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cccc(Cn2ccc(-c3cccc(-c4cccnc4)c3)n2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Cn2ccc(-c3cccc(-c4cccnc4)c3)n2)n1.",
+ "ref_smiles": "Cc1cccc(Cn2ccc(-c3cccnc3)n2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6ad80b6d-dba7-42f2-a723-088f6b5c02d3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)c1ccc(Sc2nnnn2-c2ccc(Cl)cc2)c([N+](=O)[O-])c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(Sc2nnnn2-c2ccc(Cl)cc2)c([N+](=O)[O-])c1",
+ "ref_smiles": "CC(=O)c1ccc(Sc2nnnn2-c2ccc(C(=O)[OH])cc2)c([N+](=O)[O-])c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0746d35d-3bea-4922-8325-c92175d20ccf",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCc1ccc(OC(F)(F)F)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(OC(F)(F)F)cc1C.",
+ "ref_smiles": "Cc1cc(OC(F)(F)F)ccc1CCC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "eabd0486-cbca-41e8-8b25-6a031db9a913",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule [N-]=[N+]=C1C2CC3C(=O)C(CC1C3c1ccccc1)C2c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[N-]=[N+]=C1C2CC3C(=O)C(CC1C3c1ccccc1)C2c1ccccc1.",
+ "ref_smiles": "[N-]=[N+]=C1C2CC3CC1C(c1ccccc1)C(C2)C3=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f5b1f03c-04be-4a6c-a69a-5c0a27f1ffb8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)C(C)(C)Oc1c(C)cc(C[NH2+]CC(=O)N(C)Cc2nc(-c3cccc(Cl)c3)oc2C)cc1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(C)(C)Oc1c(C)cc(C[NH2+]CC(=O)N(C)Cc2nc(-c3cccc(Cl)c3)oc2C)cc1C",
+ "ref_smiles": "CCOC(=O)C(C)(C)Oc1c(C)cc(C[NH2+]CC(=O)N(C)Cc2nc(-c3cccc([N+](=O)[O-])c3)oc2C)cc1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "977068f8-5fe5-4c13-9e15-549632189979",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(-n2c(=O)n(C3CCN(C(=O)C4CC[NH+](Cc5ccnc(N)c5)CC4)CC3)c3ccc(F)cc32)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-n2c(=O)n(C3CCN(C(=O)C4CC[NH+](Cc5ccnc(N)c5)CC4)CC3)c3ccc(F)cc32)n1",
+ "ref_smiles": "CC(=O)c1ccc2c(c1)n(-c1cccc(C)n1)c(=O)n2C1CCN(C(=O)C2CC[NH+](Cc3ccnc(N)c3)CC2)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7cf42a94-bf5a-44df-b409-d281eee3053a",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]1CCC(C(=O)N2CC[NH+](C3CCCCC3)CC2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(C(=O)N2CC[NH+](C3CCCCC3)CC2)CC1",
+ "ref_smiles": "C[NH+]1CCC2C[NH+](C3CCCCC3)CCC2C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d53278d0-916e-4775-aa32-6d2d2eb20fe7",
+ "task": "sub",
+ "question": "Modify the molecule Cc1oc(C=Cc2ccc(Cl)cc2)nc1CCl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1oc(C=Cc2ccc(Cl)cc2)nc1CCl",
+ "ref_smiles": "Cc1oc(C=Cc2ccc([N+](=O)[O-])cc2)nc1CCl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4412ea4f-eec1-4b7b-b5b7-e45a8c0dc607",
+ "task": "add",
+ "question": "Modify the molecule CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCCCC3)cc2)cc1)c1cccc(Cl)c1Cl by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCCCC3)cc2)cc1)c1cccc(Cl)c1Cl",
+ "ref_smiles": "CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccc(N3CCC(C#N)CC3)cc2)cc1)c1cccc(Cl)c1Cl",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "63874f25-6810-456a-a854-d7b585347d6e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)(C)[Si](C)(C)Oc1ccc(C=CC(=O)Sc2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)[Si](C)(C)Oc1ccc(C=CC(=O)Sc2ccccc2)cc1.",
+ "ref_smiles": "CC(C)(C)[Si](C)(C)OC=CC(=O)Sc1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1c7742c7-203c-4b26-b8a8-549a7b911180",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1cc(-c2ccon2)cc(C(F)(F)F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cc(-c2ccon2)cc(C(F)(F)F)c1",
+ "ref_smiles": "N#CC(F)(F)c1cc(-c2ccon2)cc(C(F)(F)F)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d78f91fa-a50d-4c8a-bcc9-11c223340858",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COCCCCNC(=O)C1(F)CC[NH2+]C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCCNC(=O)C1(F)CC[NH2+]C1.",
+ "ref_smiles": "COC(CCCNC(=O)C1(F)CC[NH2+]C1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fe1706df-ce40-496c-a498-2533f283b8bb",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCCC=CCCCCCCCCCCCCCC(O)(C[N+](C)(C)C)P(=O)([O-])[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC=CCCCCCCCCCCCCCC(O)(C[N+](C)(C)C)P(=O)([O-])[O-]",
+ "ref_smiles": "CCCCCCC=CCCCCCCCCCCCCCC(S)(C[N+](C)(C)C)P(=O)([O-])[O-]",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bfe8ed37-27d8-4dad-b77b-291f16bdf63c",
+ "task": "add",
+ "question": "Modify the molecule O=C(NC1CCCCCC1)N1CCC(c2ccncn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCCCCC1)N1CCC(c2ccncn2)CC1",
+ "ref_smiles": "O=C(NC1CCCCCC1O)N1CCC(c2ccncn2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e775d0cb-abd6-447d-9a83-a0b0276abea6",
+ "task": "sub",
+ "question": "Modify the molecule C#CC=CC=CCN(c1c(-c2c(F)c(F)c(F)c(F)c2F)cccc1C(F)(F)F)C1C=CC=C1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC=CC=CCN(c1c(-c2c(F)c(F)c(F)c(F)c2F)cccc1C(F)(F)F)C1C=CC=C1",
+ "ref_smiles": "C#CC=CC=CCN(c1c(-c2c(O)c(F)c(F)c(F)c2F)cccc1C(F)(F)F)C1C=CC=C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8ddbb2d1-71a5-42bb-82d5-d8b5e9d1cfca",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)C(=Cc1ccc(Cl)cc1Oc1ccccc1)N=[N+]=[N-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(=Cc1ccc(Cl)cc1Oc1ccccc1)N=[N+]=[N-]",
+ "ref_smiles": "CCOC(=O)C(=Cc1ccc(C(=O)[OH])cc1Oc1ccccc1)N=[N+]=[N-]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5d01702d-174e-48fa-b483-723382c23caf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OC(CC)C(F)(F)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F",
+ "ref_smiles": "C=C(C)C(=O)OC(CC)C(F)(C#N)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "27ded9ae-1441-4937-8a94-e6b3c33c4449",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COCc1[nH]n(-c2ccc(C#N)cc2)c2nnc(N)c1-2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1[nH]n(-c2ccc(C#N)cc2)c2nnc(N)c1-2.",
+ "ref_smiles": "COCc1[nH]n(C#N)c2nnc(N)c1-2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f496351d-b4b2-41a3-82e2-3553d023c4b0",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(NC(=O)C[NH2+]CCc2ccnn2C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)C[NH2+]CCc2ccnn2C)cc1",
+ "ref_smiles": "COc1ccc(NC(=O)C[NH2+]CCc2c(O)cnn2C)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5abf2cec-c6a4-4fbf-b49a-857295ecbc78",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COCc1ccccc1CCC(Cl)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1ccccc1CCC(Cl)c1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1.",
+ "ref_smiles": "COCc1ccccc1CCCc1cccc(C=Cc2ccc3ccc(Cl)cc3n2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "24a064a2-7b4b-48c1-bd98-acbe0c67f26a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(NC(=O)C(=O)C(CC(F)(F)F)N(C=O)OC(C)(C)C)c1ccccc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NC(=O)C(=O)C(CC(F)(F)F)N(C=O)OC(C)(C)C)c1ccccc1",
+ "ref_smiles": "CCC(NC(=O)C(=O)C(CC(F)(F)NO)N(C=O)OC(C)(C)C)c1ccccc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "024baa5e-3769-4c9f-a354-db09688c8eb0",
+ "task": "add",
+ "question": "Modify the molecule O=c1c(=Cc2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1c(=Cc2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12",
+ "ref_smiles": "O=c1c(=C(O)c2ccccc2OCc2ccccc2)sc2nc(-c3ccccc3Cl)nn12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5342a98e-e737-456c-b94a-ec0b673af05e",
+ "task": "add",
+ "question": "Modify the molecule CCCCCC(C)(C[NH3+])N(CCCOC)CCOC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(C)(C[NH3+])N(CCCOC)CCOC",
+ "ref_smiles": "CCCCCC(C)(C[NH3+])N(CCOC)CCC(OC)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "93f4dd90-23ee-4893-b7cd-e5e4daf80ef3",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1.",
+ "ref_smiles": "CCCCCCCCCCC(CCCCCCCC1COC(COCCCCCCCC[n+]2ccsc2)C1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bfab36b7-26a8-4855-9dd1-4d280fab67b3",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCOC(=O)c1c(NC(=O)CCc2c(C)nc3nc(SC)nn3c2C)sc(C)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(NC(=O)CCc2c(C)nc3nc(SC)nn3c2C)sc(C)c1C.",
+ "ref_smiles": "CCOC(=O)c1c(Cc2c(C)nc3nc(SC)nn3c2C)sc(C)c1C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "4e07c706-5f63-4b81-babc-8ffc9fb3cf02",
+ "task": "add",
+ "question": "Modify the molecule O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCCO2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCCO2)cc1",
+ "ref_smiles": "O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(OCC2CCC(c3ccccc3)O2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5ec00389-517e-4d2a-804a-0ff654e59335",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCCc1ccn2c(n1)nc1c3ccccc3[nH]c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccn2c(n1)nc1c3ccccc3[nH]c12.",
+ "ref_smiles": "CC(N)Cc1ccn2c(n1)nc1c3ccccc3[nH]c12",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "051da98b-ff2c-4901-8bb8-9378ab9921ce",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]CCC2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]CCC2C1.",
+ "ref_smiles": "CC(C)n1cc(Br)cc1C(=O)N1CCC2[NH2+]C(N)CC2C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "acdb712f-16e2-40cc-8f04-42f96dfb7e8c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCNc1cc(C)cc(C)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCNc1cc(C)cc(C)n1.",
+ "ref_smiles": "Cc1cc(C)nc(NCCCCc2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2a981a93-d547-4858-9fa9-09eb0dbc9629",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC1CCCC(C[NH3+])(C2(O)CCOC2)C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCC(C[NH3+])(C2(O)CCOC2)C1",
+ "ref_smiles": "CCC1CCCC(C[NH3+])(C2(Cl)CCOC2)C1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "48a0bf0d-154b-48df-8841-2d562061be74",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC1C[NH+](Cc2ccc(N)c(Br)c2)CCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1C[NH+](Cc2ccc(N)c(Br)c2)CCO1.",
+ "ref_smiles": "CCC1C[NH+](Cc2ccc(N)c(Br)c2)C(c3ccccc3)CO1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3c84f922-9754-4858-a6ee-31954e4407d5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NC1CC1)c1ccc(C#CCO)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CC1)c1ccc(C#CCO)c(F)c1.",
+ "ref_smiles": "O=C(NC1CC1)c1cc(F)c(C#CCO)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7daf83bb-ba64-4a45-8c49-59bf0dd8c486",
+ "task": "sub",
+ "question": "Modify the molecule CC1CCCC1C(=O)N1CCCC1CCCBr by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC1C(=O)N1CCCC1CCCBr",
+ "ref_smiles": "CC1CCCC1C(=O)N1CCCC1CCCO",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aedf6a84-4215-42c3-9d4f-dc281ce7195f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc(N=Nc4cc(S(=O)(=O)[O-])c5cccc(S(=O)(=O)[O-])c5c4)c(CC(CC)C(C)=O)c3)n2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CS(=O)(=O)c1ccc(Nc2nc(Cl)nc(Nc3ccc(N=Nc4cc(S(=O)(=O)[O-])c5cccc(S(=O)(=O)[O-])c5c4)c(CC(CC)C(C)=O)c3)n2)cc1",
+ "ref_smiles": "C=CS(=O)(=O)c1ccc(Nc2nc(C#N)nc(Nc3ccc(N=Nc4cc(S(=O)(=O)[O-])c5cccc(S(=O)(=O)[O-])c5c4)c(CC(CC)C(C)=O)c3)n2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc70a4ea-4eb6-4813-8fa1-74bdf5954935",
+ "task": "sub",
+ "question": "Modify the molecule NC(=O)Cc1ccc(S(=O)(=O)Cl)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)Cc1ccc(S(=O)(=O)Cl)cc1",
+ "ref_smiles": "NC(=O)Cc1ccc(S(=O)(=O)C(=O)[OH])cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a28e9448-d640-4978-ac03-21272e2b168b",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)c1c(-c2cccc([N+](=O)[O-])c2)csc1NC(=O)C=Cc1cccc(F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(-c2cccc([N+](=O)[O-])c2)csc1NC(=O)C=Cc1cccc(F)c1",
+ "ref_smiles": "CCOC(=O)c1c(-c2cc([N+](=O)[O-])ccc2O)csc1NC(=O)C=Cc1cccc(F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8cf93576-4e91-4291-8068-90954f8e8f77",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1CC2CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)CC(O)(C1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC2CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)CC(O)(C1)C2.",
+ "ref_smiles": "CC1CC2CC(O)CC(C(=O)OCC3(COC(=O)C45CC(C)CC(CC(O)C4)C5)COC(C4C=C5CCCC(C5)C4)OC3)(C1)C2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "89e9df53-d90d-4c9d-8fc8-1cabe330f89e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(-c2nc3cc(C)c(C)cc3o2)cc1NC(=O)c1cc([N+](=O)[O-])ccc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc3cc(C)c(C)cc3o2)cc1NC(=O)c1cc([N+](=O)[O-])ccc1Cl",
+ "ref_smiles": "COc1ccc(-c2nc3cc(C)c(C)cc3o2)cc1NC(=O)c1cc([N+](=O)[O-])ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "261cba25-e964-49a8-8562-41c0f41bb292",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(NCCC(=O)N(CCO)C1CC1)c1ccoc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCC(=O)N(CCO)C1CC1)c1ccoc1",
+ "ref_smiles": "CC(=O)CCN(C(=O)CCNC(=O)c1ccoc1)C1CC1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "eb8fbee8-1a4f-4bd9-9f2b-39c64e066b8b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=c1ncn(-c2cccc(Cl)c2)c2ccc(Cl)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1ncn(-c2cccc(Cl)c2)c2ccc(Cl)cc12.",
+ "ref_smiles": "O=c1nc(-c2ccccc2)n(-c2cccc(Cl)c2)c2ccc(Cl)cc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "da18c5e0-9c08-45b8-9c91-8cca425390d8",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)CSc1ccc(Br)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)CSc1ccc(Br)cc1C.",
+ "ref_smiles": "COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)CSc1ccccc1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "347da01a-f75b-44be-906e-d5ddf94d4216",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)C(=O)Nc1nc(=O)c2ncn(C3OC(CO)C(C)C3C)c2[nH]1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(=O)Nc1nc(=O)c2ncn(C3OC(CO)C(C)C3C)c2[nH]1",
+ "ref_smiles": "CC(C)C(=O)Nc1nc(=O)c2ncn(C3OC(CS)C(C)C3C)c2[nH]1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6caccd85-30c1-49f0-a151-9733044391ae",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1ccc(C2CC(c3ccc(C)c(C)c3)Nc3nnnn32)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C2CC(c3ccc(C)c(C)c3)Nc3nnnn32)cc1.",
+ "ref_smiles": "CCOC1CC(c2ccc(C)c(C)c2)Nc2nnnn21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3bb04045-041c-4730-ac9e-283ac71e5d16",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC(C2)CC1C3)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC(C2)CC1C3)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1.",
+ "ref_smiles": "CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1C2CC3CC1CC(C2)C3N)C(=O)N(CCCCCCC(=O)[O-])CCc1ccccc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "23d58754-36d2-414c-92e9-332f028d45ea",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CCOc1ccc(CC(=O)[O-])cc1[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(CC(=O)[O-])cc1[N+](=O)[O-].",
+ "ref_smiles": "O=C([O-])Cc1ccc(OCCS)c([N+](=O)[O-])c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "f6438a35-2d6c-4383-ad57-f406d945de3b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(Cl)c2c(O)csc12 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)c2c(O)csc12",
+ "ref_smiles": "COc1ccc(C(=O)[OH])c2c(O)csc12",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f8c0f2de-fcdf-4361-9893-0a983ef2c823",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule [NH3+]CC#Cc1cccc(CNS(=O)(=O)N2CCCC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC#Cc1cccc(CNS(=O)(=O)N2CCCC2)c1.",
+ "ref_smiles": "[NH3+]CC#CCNS(=O)(=O)N1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a38e1461-1753-410d-a44b-12a0334f8918",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nnsc1C(=O)NCC(Br)C(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nnsc1C(=O)NCC(Br)C(C)C",
+ "ref_smiles": "CCc1nnsc1C(=O)NCCC(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "820fcede-c0cf-4937-a02c-745cf3f30480",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule C[NH+](C)CCNC(=NCC1CCC2C(O1)c1cc(C(F)(F)F)ccc1NC2C1C=CC=CC1)NC#N with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCNC(=NCC1CCC2C(O1)c1cc(C(F)(F)F)ccc1NC2C1C=CC=CC1)NC#N",
+ "ref_smiles": "CC(=O)NC(=NCC1CCC2C(O1)c1cc(C(F)(F)F)ccc1NC2C1C=CC=CC1)NCC[NH+](C)C",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "da496925-4350-4ba2-b5bb-b258e4b73352",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(O)c2ccc(=O)[nH]c12 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(O)c2ccc(=O)[nH]c12",
+ "ref_smiles": "COc1cccc2ccc(=O)[nH]c12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "054f148b-480a-410c-aee6-7cfac013d7ab",
+ "task": "add",
+ "question": "Modify the molecule O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1nccs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1cc2oc(=O)cc(-c3ccccc3)c2cc1Cl)Nc1nccs1",
+ "ref_smiles": "O=C(COc1cc2oc(=O)cc(-c3ccc(-c4ccccc4)cc3)c2cc1Cl)Nc1nccs1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "223945db-ce29-4d2c-bf11-56cc3d6e1d39",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCCSSN(C)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCCSSN(C)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C.",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCCSSN(Cc1ccccc1)C(=O)O[NH+]=C1SC(C)(C)C(=O)N1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "21a0cc5e-f59c-4d9f-bb34-5704d83ae042",
+ "task": "sub",
+ "question": "Modify the molecule C[N+]1([NH2+]CCCCOc2cccc(C[NH+]3CCCCC3)c2)C=NC(CO)=N1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[N+]1([NH2+]CCCCOc2cccc(C[NH+]3CCCCC3)c2)C=NC(CO)=N1",
+ "ref_smiles": "C[N+]1([NH2+]CCCCOc2cccc(C[NH+]3CCCCC3)c2)C=NC(CNO)=N1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a59ac0de-d265-4a39-9615-1552c419d68f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COC(=O)C12Oc3ccc(-c4ccc5c(c4[O-])C(=O)C4(O)C6CC(C)C(O)C4(O5)C(=O)O6)c(O)c3C([O-])=C1C(=O)CC(C)C2O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C12Oc3ccc(-c4ccc5c(c4[O-])C(=O)C4(O)C6CC(C)C(O)C4(O5)C(=O)O6)c(O)c3C([O-])=C1C(=O)CC(C)C2O",
+ "ref_smiles": "COC(=O)C12Oc3ccc(-c4ccc5c(c4[O-])C(=O)C4(C(=O)[OH])C6CC(C)C(O)C4(O5)C(=O)O6)c(O)c3C([O-])=C1C(=O)CC(C)C2O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4abf81c4-bb73-4888-8440-44f99e0b53ff",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CNc1cc(C)ccc1C(=O)N(CCCO)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc(C)ccc1C(=O)N(CCCO)C(C)C.",
+ "ref_smiles": "CNCC(=O)N(CCCO)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "60924061-1737-4919-a35c-343a99188495",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc2nc(NC(=O)CN(C)C(=O)CN(C(=O)OCc3ccccc3)C3(C)CCN(C(=O)OC(C)(C)C)CC3)sc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2nc(NC(=O)CN(C)C(=O)CN(C(=O)OCc3ccccc3)C3(C)CCN(C(=O)OC(C)(C)C)CC3)sc2c1.",
+ "ref_smiles": "COC(=O)N(CC(=O)N(C)CC(=O)Nc1nc2ccc(C)cc2s1)C1(C)CCN(C(=O)OC(C)(C)C)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e4cb2024-9c67-4d2d-b779-f094d859accc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cc(N2CCCCC2)cc[nH+]1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cc(N2CCCCC2)cc[nH+]1",
+ "ref_smiles": "N#Cc1ccc(NC(=O)c2cc(N3CCCCC3)cc[nH+]2)c(C(F)(F)F)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5a89f2c7-2a35-4a24-9624-ff3419c6e340",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)NC1C(OC2C(O)OC(CO)C(O)C2O)OC(COC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C1O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC1C(OC2C(O)OC(CO)C(O)C2O)OC(COC2OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C1O",
+ "ref_smiles": "CC(=O)NC1C(OC2C(O)OC(CO)C(O)C2O)OC(COC2OC(COC3OC(CO)C(O)CC3O)C(O)C(O)C2O)C(O)C1O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "03f92cfb-2cb4-4822-afef-6826f035b812",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(CC(=O)NCC(CCO)c2ccccc2)c(Cl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(=O)NCC(CCO)c2ccccc2)c(Cl)c1",
+ "ref_smiles": "COc1ccc(CC(=O)NCC(CCO)c2ccc(O)cc2)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7d580ef7-9828-4300-9e56-452dd55230cf",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)CCC([NH2+]C(C)(C)C)C(=O)c1ccc(C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCC([NH2+]C(C)(C)C)C(=O)c1ccc(C)cc1",
+ "ref_smiles": "COC(=O)CCC([NH2+]C(C)(C)C)C(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "897af4ed-8e3b-44d5-991e-0af86879a52e",
+ "task": "add",
+ "question": "Modify the molecule C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3)CC21 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3)CC21",
+ "ref_smiles": "C[NH+](Cc1cccnc1)C1CCCC2CN(C(=O)C3CCOC3C(=O)O)CC21",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "57fb2492-d039-4c78-b615-e04b03330c3f",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CN=CC1=C([NH3+])CCN(c2nccc(Nc3cc4c(cn3)nc(C)n4C(C)C)n2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN=CC1=C([NH3+])CCN(c2nccc(Nc3cc4c(cn3)nc(C)n4C(C)C)n2)C1.",
+ "ref_smiles": "CN=CC1=C([NH3+])CCN(c2nccc(-c3cc4c(cn3)nc(C)n4C(C)C)n2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a4017fa6-c2b0-4ade-b8ec-c62e8b743b88",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cc(O)c2c(c1)C(=O)OC2C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(O)c2c(c1)C(=O)OC2C(=O)[O-].",
+ "ref_smiles": "Cc1ccc2c(c1)C(=O)OC2C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1295b694-34ab-43af-8c35-2fb632a15a3f",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(N(CCCC(=O)N(Cc2cccc(Br)c2)C(Cc2ccccc2)C(=O)NC(C)(C)C)S(C)(=O)=O)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(N(CCCC(=O)N(Cc2cccc(Br)c2)C(Cc2ccccc2)C(=O)NC(C)(C)C)S(C)(=O)=O)c1",
+ "ref_smiles": "COc1cccc(N(CCCC(=O)N(Cc2cccc(Br)c2)C(C)C(=O)NC(C)(C)C)S(C)(=O)=O)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7add1008-7005-4ae2-865a-ac9f8826895a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C([O-])C(Cc1cccc(Cl)c1)Cc1ccc(Br)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(Cc1cccc(Cl)c1)Cc1ccc(Br)cc1Cl.",
+ "ref_smiles": "O=C([O-])C(Cc1cccc(Cl)c1)Cc1cc(-c2ccccc2)c(Br)cc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d3d695da-2428-4e54-9071-e2d9c4f49233",
+ "task": "add",
+ "question": "Modify the molecule CC1CCC([NH2+]Cc2cc(Cl)cc(Cl)c2O)C(C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC([NH2+]Cc2cc(Cl)cc(Cl)c2O)C(C)C1",
+ "ref_smiles": "CC1CCC([NH2+]Cc2cc(Cl)c(C(=O)O)c(Cl)c2O)C(C)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f2c665cc-603e-4564-9610-a5fdcea401dc",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc2nc(C)c(CCC(=O)Nc3ccc(C)c(Br)c3)c(C)n2n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc2nc(C)c(CCC(=O)Nc3ccc(C)c(Br)c3)c(C)n2n1",
+ "ref_smiles": "Cc1ccc(NC(=O)CCc2c(C)nc3cc(C)nn3c2C)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2dd25410-94cb-4205-bab6-ded20a6ade3f",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCCCC(O)C[NH2+]CCCCC([NH3+])C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCC(O)C[NH2+]CCCCC([NH3+])C(=O)[O-].",
+ "ref_smiles": "[NH3+]C(CCCC[NH2+]CC(O)CCCCCCCCCCc1ccccc1)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9fa792e4-c19c-42b0-bc43-7301e1eddd60",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cncc(CNC(=O)CCN2CCCS2(=O)=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cncc(CNC(=O)CCN2CCCS2(=O)=O)c1.",
+ "ref_smiles": "Cc1cncc(C(O)NC(=O)CCN2CCCS2(=O)=O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d575b64e-85c5-41c0-93fc-8f90fc92024d",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CCCCC(NC(=O)CCC([NH3+])C(=O)NC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O)C(=O)[O-] by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCCC(NC(=O)CCC([NH3+])C(=O)NC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O)C(=O)[O-]",
+ "ref_smiles": "NC1(O)C(O)C(NC(=O)C([NH3+])CCC(=O)NC(CCCC[NH3+])C(=O)[O-])OC1n1ccc(=O)[nH]c1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "906eb644-59e3-43c2-ad84-1f513cdc5301",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COC(=O)C=CCC(O)C(C)C=Cc1ccc(OC)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C=CCC(O)C(C)C=Cc1ccc(OC)cc1",
+ "ref_smiles": "COC(=O)C=CCC(Cl)C(C)C=Cc1ccc(OC)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "307bb7a0-c5b1-4f30-abc1-1adf072f2f47",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(NC12CC3CC(CC(C3)C1)C2)c1ccc(NC(=S)Nc2ccc(F)c(Cl)c2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NC12CC3CC(CC(C3)C1)C2)c1ccc(NC(=S)Nc2ccc(F)c(Cl)c2)cc1",
+ "ref_smiles": "O=S(=O)(C12CC3CC(CC(C3)C1)C2)c1ccc(NC(=S)Nc2ccc(F)c(Cl)c2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f48f5447-000f-440a-b5a5-daf1056900d1",
+ "task": "delete",
+ "question": "Modify the molecule CCC(NC(=S)Nc1cc(C)cc(C)c1)c1ccc2c(c1)CCCC2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NC(=S)Nc1cc(C)cc(C)c1)c1ccc2c(c1)CCCC2",
+ "ref_smiles": "CCNC(=S)NC(CC)c1ccc2c(c1)CCCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "294d5232-9302-4b23-adc1-21e5844dcef0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNC(=O)Nc1nc2c(F)c(-c3cccc(OCC(=O)[O-])c3)cc(-c3ncccc3F)c2s1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)Nc1nc2c(F)c(-c3cccc(OCC(=O)[O-])c3)cc(-c3ncccc3F)c2s1",
+ "ref_smiles": "CCNC(=O)Nc1nc2c(C(=O)[OH])c(-c3cccc(OCC(=O)[O-])c3)cc(-c3ncccc3F)c2s1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "42cbc00d-8ce6-465d-b693-8918596a7cc8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1cccc(Cl)c1CN1C(=O)CCSC1=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cccc(Cl)c1CN1C(=O)CCSC1=O",
+ "ref_smiles": "Nc1cccc(O)c1CN1C(=O)CCSC1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7177e451-4d27-4ead-aa18-612207bdafd4",
+ "task": "sub",
+ "question": "Modify the molecule CN(C)C(=O)c1ccc(C[NH+](C)CC(C)(CO)CO)cc1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)c1ccc(C[NH+](C)CC(C)(CO)CO)cc1",
+ "ref_smiles": "CN(C)C(=O)c1ccc(C[NH+](C)CC(C)(CO)CC(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9eda6679-8e23-46a7-8aa7-bdabdd8d07e1",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(C(C)(C)CCCc2ccc(F)c(Oc3ccccc3F)c2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(C)(C)CCCc2ccc(F)c(Oc3ccccc3F)c2)cc1",
+ "ref_smiles": "CCOc1ccc(C(C)(C)CCCc2cccc(Oc3ccccc3F)c2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d21499e3-b345-444c-ab6e-8d8bc7ddb4ce",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Clc1ccc2sc(-c3ccc4c(c3)NCC4)nc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc2sc(-c3ccc4c(c3)NCC4)nc2c1.",
+ "ref_smiles": "c1ccc2sc(-c3ccc4c(c3)NCC4)nc2c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3625d575-0873-43ab-8187-0a75cbab3ada",
+ "task": "sub",
+ "question": "Modify the molecule CN1CC(Nc2cccnc2C#N)CCC1=O by substituting a nitrile with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1CC(Nc2cccnc2C#N)CCC1=O",
+ "ref_smiles": "CN1CC(Nc2cccnc2Br)CCC1=O",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cf115c2e-eb51-4018-8203-4e82584bb338",
+ "task": "add",
+ "question": "Modify the molecule CCc1oc(-c2ccc(F)c(C)c2)cc1CBr by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1oc(-c2ccc(F)c(C)c2)cc1CBr",
+ "ref_smiles": "CCc1oc(-c2cc(C)c(F)c(-c3ccccc3)c2)cc1CBr",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cfcfedea-9399-4b73-8260-40b06fe31668",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cccc(N2CCC(F)(C(=O)[O-])C2)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(N2CCC(F)(C(=O)[O-])C2)c1",
+ "ref_smiles": "COc1cccc(N2CCC(O)(C(=O)[O-])C2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c94dcde3-ca95-41be-a677-479936f66bd0",
+ "task": "delete",
+ "question": "Modify the molecule CCCOc1ccc(-c2cc(CC(=O)[O-])c(CC)s2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(-c2cc(CC(=O)[O-])c(CC)s2)cc1",
+ "ref_smiles": "CCCOc1cc(CC(=O)[O-])c(CC)s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "10503a6e-bee7-49b5-8401-4747df8334e4",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCCN1CN(Cc2ccc3ccccc3c2)C(Cl)=C1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN1CN(Cc2ccc3ccccc3c2)C(Cl)=C1Cl.",
+ "ref_smiles": "CCCCN1CN(Cc2ccc3ccccc3c2)C=C1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e91c705d-9af6-47d4-a9a6-63e525a90d65",
+ "task": "delete",
+ "question": "Modify the molecule CC(c1ccc(C#CC(C)(C)C(=O)N(C)C)cc1)N1CCC(CC(C)(C)O)(c2ccccc2)OC1=O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccc(C#CC(C)(C)C(=O)N(C)C)cc1)N1CCC(CC(C)(C)O)(c2ccccc2)OC1=O",
+ "ref_smiles": "CC(c1ccc(C#CC(C)(C)C(=O)N(C)C)cc1)N1CCC(CC(C)(C))(c2ccccc2)OC1=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5997ab6c-8074-42ab-92e1-34a3e611e16c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCCC.",
+ "ref_smiles": "CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC=CC(C)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1bb894d4-128b-47d1-942c-675e442665eb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])CCc1ccccc1OCCC[NH2+]C1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCc1ccccc1OCCC[NH2+]C1CC[NH+](Cc2ccc(Cl)c(Cl)c2)CC1",
+ "ref_smiles": "O=C([O-])CCc1ccccc1OCCC[NH2+]C1CC[NH+](Cc2ccc(O)c(Cl)c2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0208ca33-1c49-4530-93b9-7bb59c891b15",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C=CC#N)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C=CC#N)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1",
+ "ref_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(C=CS)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6ca6b228-817d-40e7-89d7-f7dc1ff6e9fb",
+ "task": "delete",
+ "question": "Modify the molecule C=CCCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(=O)OC1CC(=C)CCC1=O)c1cc(NC(=O)CCCC(=O)NCCC3C#C3)ccc1-2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(=O)OC1CC(=C)CCC1=O)c1cc(NC(=O)CCCC(=O)NCCC3C#C3)ccc1-2",
+ "ref_smiles": "C=CCCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(=O)OC1CC(=C)CCC1=O)c1cc(NC(=O)CCCCC3C#C3)ccc1-2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a52ac139-e7bb-4204-9423-92e8f12919b1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1CCC(C)N1S(=O)(=O)c1cc(N)c(F)cc1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(C)N1S(=O)(=O)c1cc(N)c(F)cc1F",
+ "ref_smiles": "CC(=O)c1cc(F)c(S(=O)(=O)N2C(C)CCC2CC)cc1N",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "93ea80e5-991e-4668-91f0-4ced3a173566",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCc1[nH]c(C(=O)NC2CCN(C(=O)C=Cc3ccc(C(=O)OC)cc3F)CC2OC)nc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1[nH]c(C(=O)NC2CCN(C(=O)C=Cc3ccc(C(=O)OC)cc3F)CC2OC)nc1Cl.",
+ "ref_smiles": "CCc1cnc(C(=O)NC2CCN(C(=O)C=Cc3ccc(C(=O)OC)cc3F)CC2OC)[nH]1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "05046298-b060-4a56-a0ae-408c8e79433f",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCC2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13",
+ "ref_smiles": "CC1CCC(c2ccccc2)C2CC(=O)C3(C)OC12C1C(=O)N(c2ccccc2)C(=O)C13",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9f578867-bef7-4025-be91-1a53ea8a6bcb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOc1ccc(N2C(=O)C3CNNC3[NH+]=C2SCC(=O)Nc2cccc(C)c2C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(N2C(=O)C3CNNC3[NH+]=C2SCC(=O)Nc2cccc(C)c2C)cc1.",
+ "ref_smiles": "Cc1cccc(NC(=O)CSC2=[NH+]C3NNCC3C(=O)N2c2ccc(OC(C)c3ccccc3)cc2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e68452d3-a10d-44ab-9a57-1ba6ec8a64e9",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)C.",
+ "ref_smiles": "CC(C)CC(O)(Cc1ccc(Br)s1)CC(C)(C)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "efba9f80-a98f-48bf-b674-637a5cc2eca5",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule COc1cccnc1C([NH3+])c1cc(C)c(Br)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccnc1C([NH3+])c1cc(C)c(Br)c(C)c1.",
+ "ref_smiles": "COc1cccnc1C([NH3+])c1cc(C)c(Br)c(CCC=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "f2e3048e-dd1f-4a65-8b57-67c689e51255",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CCCC1CNS(=O)(=O)c1ccnc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC1CNS(=O)(=O)c1ccnc(Cl)c1.",
+ "ref_smiles": "CC1C(CNS(=O)(=O)c2ccnc(Cl)c2)CCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0607afe9-d63a-4872-827b-e38bca51564d",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN(CC(=O)NC1(c2ccccc2)CC1)C(=O)OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC(=O)NC1(c2ccccc2)CC1)C(=O)OC(C)(C)C.",
+ "ref_smiles": "CN(C(=O)OC(C)(C)C)C1(c2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e5f7e618-b131-438f-994f-bca58ce21d3c",
+ "task": "add",
+ "question": "Modify the molecule C#Cc1ccc(C(C(=O)NCCCCC)N(CC=C)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#Cc1ccc(C(C(=O)NCCCCC)N(CC=C)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)cc1",
+ "ref_smiles": "C#Cc1ccc(C(C(=O)NCCCCC)N(C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)C(C=C)c2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3c389297-c0cd-46f1-b2d8-e08cbae2e32c",
+ "task": "add",
+ "question": "Modify the molecule Cn1ccnc1SCc1ccccc1C#CCCO by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ccnc1SCc1ccccc1C#CCCO",
+ "ref_smiles": "Cn1ccnc1SCc1cc(-c2ccccc2)ccc1C#CCCO",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e5aa787f-3471-459c-90f1-624b6bbdc600",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(CCC1CC[NH2+]C1)Nc1nc(C[NH+]2CCOCC2)cs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCC1CC[NH2+]C1)Nc1nc(C[NH+]2CCOCC2)cs1.",
+ "ref_smiles": "c1sc(CC2CC[NH2+]C2)nc1C[NH+]1CCOCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1e61a680-a667-44e1-93a8-5c118cce3a09",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(Cl)c(C(F)(F)F)c1N by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)c(C(F)(F)F)c1N",
+ "ref_smiles": "COc1cccc(C(F)(F)F)c1N",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3395a47f-f6bb-43e0-b9f9-5cd3c2a7e319",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CN(C)c1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc(C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1.",
+ "ref_smiles": "CN(C)c1ccc(C(=O)NCC(=O)Nc2cc(CC=O)c(F)c(F)c2F)cc1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "13bc1285-13ee-4664-8da7-e49e87e629d9",
+ "task": "delete",
+ "question": "Modify the molecule CCN(N1CC[NH2+]CC1)S(=O)(=O)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(N1CC[NH2+]CC1)S(=O)(=O)c1ccccc1",
+ "ref_smiles": "CCN(N1CC[NH2+]CC1)[SH](=O)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "31f72b41-2d15-4024-94c6-ca583bc08816",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CS(=O)(=O)N(c1cccc(C(=O)Nc2ncccn2)c1)C1C[NH+](C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N(c1cccc(C(=O)Nc2ncccn2)c1)C1C[NH+](C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1",
+ "ref_smiles": "CS(=O)(=O)N(c1cccc(C(=O)Nc2ncccn2)c1)C1C[NH+](C(c2ccc(Cl)cc2)c2ccc(NO)cc2)C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5c7b0ab6-343f-4473-beb0-c87310a3e307",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)ccc21.",
+ "ref_smiles": "CC(=O)N1CCc2cc(C(=O)NCCCc3nn(-c4ccc(F)cc4)c(N)c3C#N)c(S)cc21",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "4d7d0e48-3983-483d-9666-bfdc864fb2c1",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCCC1.",
+ "ref_smiles": "CC(C)CC1(CNS(=O)(=O)C2CCCNC2)CCC(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "87254ffc-8780-4be4-ae66-e5e321749eb9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(NC1CCN(C(=O)Nc2cccc3ccccc23)CC1)c1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCN(C(=O)Nc2cccc3ccccc23)CC1)c1ccco1.",
+ "ref_smiles": "O=C(NC1CCN(C(=O)Nc2cc(-c3ccccc3)cc3ccccc23)CC1)c1ccco1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "112aaf98-0247-4e31-8443-ad8132b1e295",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(CC)(NC(=O)Nc1ccc(C(C)C)cc1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(NC(=O)Nc1ccc(C(C)C)cc1)C(=O)[O-].",
+ "ref_smiles": "CCC(CC)(NC(=O)NC(C)C)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "79aec366-5b6f-43b3-8066-0c12c271dbcb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CCn1ncc(NC2(C[NH3+])CCCCC2C)c(Br)c1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1ncc(NC2(C[NH3+])CCCCC2C)c(Br)c1=O",
+ "ref_smiles": "C=CCn1ncc(NC2(C[NH3+])CCCCC2C)c(C#N)c1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "79dc8f6f-0a80-4cd4-9526-a55542ba26f4",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CCCC([NH3+])c1c(F)cccc1Cl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCCC([NH3+])c1c(F)cccc1Cl",
+ "ref_smiles": "CC(C)CCCC([NH3+])c1c(Cl)cccc1NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bad72acf-3c4c-4be9-8aee-a3e19ead456a",
+ "task": "delete",
+ "question": "Modify the molecule CCC1(CC)c2cc(C=Cc3ccc(-c4ccc(-c5ccccc5)cc4-c4ccccc4-c4ccccc4)cc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(CC)c2cc(C=Cc3ccc(-c4ccc(-c5ccccc5)cc4-c4ccccc4-c4ccccc4)cc3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21",
+ "ref_smiles": "CCC1(CC)c2cc(C=Cc3ccc(-c4ccc(-c5ccccc5)cc4-c4ccccc4-c4ccccc4)cc3)ccc2-c2ccc(Nc3ccccc3)cc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0752355f-e93a-45d1-a93c-836ccea53b6a",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC)CC[NH2+]C(C)c1cccc(NC(C)=O)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)CC[NH2+]C(C)c1cccc(NC(C)=O)c1",
+ "ref_smiles": "CCN(CC)CC[NH2+]C(C)c1cc(O)cc(NC(C)=O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "99011eb0-caa8-47e4-a53e-3714680d68c0",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Brc1cccc2c1-c1ccccc1C21c2ccccc2C2(c3ccccc3-c3cccc(Br)c32)c2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1cccc2c1-c1ccccc1C21c2ccccc2C2(c3ccccc3-c3cccc(Br)c32)c2ccccc21.",
+ "ref_smiles": "Brc1cccc2c1C1(c3ccccc3-2)c2ccccc2C2(c3ccccc3-c3ccccc32)c2ccccc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5745bfb8-edf0-4e08-849d-87bae75e45c9",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)N(C(=O)COc1cccc(F)c1C(=O)[O-])C(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(C(=O)COc1cccc(F)c1C(=O)[O-])C(C)C",
+ "ref_smiles": "CC(C)N(C(=O)COc1ccccc1C(=O)[O-])C(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "45cb1af0-0fc0-44b3-ab7e-29c6fc0b63bf",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)Cc1ccc(C(C)C(=O)Oc2cc(O)cc(C=Cc3ccc(O)cc3)c2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cc1ccc(C(C)C(=O)Oc2cc(O)cc(C=Cc3ccc(O)cc3)c2)cc1",
+ "ref_smiles": "CC(C)Cc1ccc(C(C)C(=O)Oc2cc(S)cc(C=Cc3ccc(O)cc3)c2)cc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "17d3ae79-0071-40cf-be6d-81c33a7af534",
+ "task": "sub",
+ "question": "Modify the molecule O=C(C[NH+]1CCC(C(=O)Nc2ccccc2O)CC1)Nc1ccc(N2CCCCCC2)cc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[NH+]1CCC(C(=O)Nc2ccccc2O)CC1)Nc1ccc(N2CCCCCC2)cc1",
+ "ref_smiles": "O=C(C[NH+]1CCC(C(=O)Nc2ccccc2I)CC1)Nc1ccc(N2CCCCCC2)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5a2bf8c5-522d-4586-989a-4de7304368d8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCN(Cc1cc(Cl)ccc1F)C1CC[NH2+]C1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(Cc1cc(Cl)ccc1F)C1CC[NH2+]C1",
+ "ref_smiles": "CCCN(Cc1cc(O)ccc1F)C1CC[NH2+]C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d8d1a1f4-3ee3-4a46-abc8-93c1dac7b838",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(CNN1CCCCC1)N1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CNN1CCCCC1)N1CCCCC1.",
+ "ref_smiles": "C1CCN(NC2CCCC2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "6589f92a-099c-4ec5-a6d5-02f3d3303b4a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1c(Cl)c[nH+]c1C1CCC(CI)O1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(Cl)c[nH+]c1C1CCC(CI)O1",
+ "ref_smiles": "Cn1c(C#N)c[nH+]c1C1CCC(CI)O1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "084d8362-f1e9-4a3a-a02f-54e208184aed",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN1C(C[NH3+])Cc2[nH]cnc2C1c1ccc(Br)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1C(C[NH3+])Cc2[nH]cnc2C1c1ccc(Br)cc1",
+ "ref_smiles": "CN1C(C[NH3+])Cc2[nH]cnc2C1c1ccc(C#N)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d24e178-f81e-4be8-a325-bad9d3e64c62",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CN(C(=O)CC(CC)C[NH3+])C1CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CN(C(=O)CC(CC)C[NH3+])C1CC1",
+ "ref_smiles": "CCOC(=O)C(C(CC)C[NH3+])C1CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2d407d50-a5cb-42eb-9652-315805d8b778",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NCC(=O)N1CCCC1)Nc1ccc(N2CCSCC2)c(Cl)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC(=O)N1CCCC1)Nc1ccc(N2CCSCC2)c(Cl)c1",
+ "ref_smiles": "O=C(CNC(=O)N(Cl)N1CCSCC1)N1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "741cb194-50af-4a58-aea2-06364f7f860b",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCNc1nc(NCCN2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c75)C(=O)N(CCNc2nc(NCCCCCCCCCCCC)nc(N(CCCCCCCC)CCCCCCCC)n2)C6=O)nc(N(CCCCCCCC)CCCCCCCC)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCNc1nc(NCCN2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c75)C(=O)N(CCNc2nc(NCCCCCCCCCCCC)nc(N(CCCCCCCC)CCCCCCCC)n2)C6=O)nc(N(CCCCCCCC)CCCCCCCC)n1",
+ "ref_smiles": "CCCCCCCCCCCCNc1nc(NCCN2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c75)C(=O)N(CCNc2nc(CCCCCCCCCCCC)nc(N(CCCCCCCC)CCCCCCCC)n2)C6=O)nc(N(CCCCCCCC)CCCCCCCC)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b0ae951b-c724-4a2b-acbd-e883dcd2dfec",
+ "task": "delete",
+ "question": "Please remove a thiol from the molecule CC(S)C(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(S)C(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.",
+ "ref_smiles": "CCC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1",
+ "add_group": null,
+ "remove_group": "thiol"
+ },
+ {
+ "id": "cb8de474-1f95-412b-84be-e25e64f60d73",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH+]=C(NCc1ccc(OC)cc1OC)NCC1CCN(c2ccccc2OC)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1ccc(OC)cc1OC)NCC1CCN(c2ccccc2OC)C1.",
+ "ref_smiles": "C[NH+]=C(NCC1CCN(c2ccccc2OC)C1)NC(OC)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "11453a71-2e24-4ff6-bcf9-dac6eb27a18b",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])c1ccc(Nc2ccc(Cl)c3cccnc23)cc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(Nc2ccc(Cl)c3cccnc23)cc1",
+ "ref_smiles": "O=C([O-])c1ccc(Nc2ccc(C=O)c3cccnc23)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "09b4db6a-a45e-4949-a2ab-1ab5b6a32a0c",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C(CO)c1nc(C2CSCCS2)no1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CO)c1nc(C2CSCCS2)no1",
+ "ref_smiles": "[NH3+]C(CO)c1nc(C2CSCC(C(=O)O)S2)no1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "be600863-ee5f-4a58-8b14-963c9c4ad941",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC1(C)CCc2c(N3CCOCC3)[nH]c(=O)c(C#N)c2C1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCc2c(N3CCOCC3)[nH]c(=O)c(C#N)c2C1",
+ "ref_smiles": "CC1(C)CCc2c(N3CCOCC3)[nH]c(=O)c(O)c2C1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "e6e29340-a834-4d26-9017-50b70bb5e677",
+ "task": "add",
+ "question": "Modify the molecule CCCOc1cccc(C([NH3+])C(=O)NCCCO)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cccc(C([NH3+])C(=O)NCCCO)c1",
+ "ref_smiles": "CCCOc1cc(-c2ccccc2)cc(C([NH3+])C(=O)NCCCO)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "72773a05-efdc-475e-be0a-fd795a3beda4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1cc(C)c(C2([NH3+])CCCC(C)CC2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C)c(C2([NH3+])CCCC(C)CC2)cc1C.",
+ "ref_smiles": "COCCC1([NH3+])CCCC(C)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e8613386-e627-4364-97b9-d94507415312",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc2c(cc1F)nc(CCCl)n2CCNC(N)=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc2c(cc1F)nc(CCCl)n2CCNC(N)=O",
+ "ref_smiles": "Cc1cc2c(cc1C(=O)[OH])nc(CCCl)n2CCNC(N)=O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fc50ae4f-13d2-4a1d-a58c-1f22528b597d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCc1nsc(NC(C)(CO)c2ccccc2)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nsc(NC(C)(CO)c2ccccc2)n1",
+ "ref_smiles": "CCc1nsc(NC(C)(CC(=O)O)c2ccccc2)n1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ce2a4b5c-e4c0-4597-a5dd-98b9ce9796ce",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1OCC(O)C(O)C1OC1CCCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1OCC(O)C(O)C1OC1CCCCO1.",
+ "ref_smiles": "CC1OCC(O)C(O)C1OC1OCCCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "17822b12-ad6b-45c8-922c-96c18d8fcf4c",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C=CC(=O)N(C=O)CCC[NH3+])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C=CC(=O)N(C=O)CCC[NH3+])cc1",
+ "ref_smiles": "COc1ccc(C=C(C(=O)N(C=O)CCC[NH3+])c2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8c94cb15-efc8-47b9-87b2-4169658d211f",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(-c2nc(Br)cc(Br)n2)sn1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(-c2nc(Br)cc(Br)n2)sn1",
+ "ref_smiles": "COc1cc(-c2nc(Br)cc(NO2)n2)sn1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d3c1620c-44d3-4225-b4d5-6c54f9c68df9",
+ "task": "sub",
+ "question": "Modify the molecule CCC#Cc1ccc(C2=NOC(CC(C)(C(O)O)S(C)(=O)=O)C2)cc1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC#Cc1ccc(C2=NOC(CC(C)(C(O)O)S(C)(=O)=O)C2)cc1",
+ "ref_smiles": "CCC#Cc1ccc(C2=NOC(CC(C)(C(O)C#N)S(C)(=O)=O)C2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a87d0bb6-ec2c-45cd-ab78-9f3d48913229",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)C.",
+ "ref_smiles": "CCc1nc(-c2cc(F)cc(Br)c2)sc1C[NH2+]C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "126cf91e-6c26-4a07-93e6-5c812224a9dd",
+ "task": "delete",
+ "question": "Modify the molecule NC(=[NH+]O)c1nccnc1Sc1nc2ccccc2o1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)c1nccnc1Sc1nc2ccccc2o1",
+ "ref_smiles": "[NH+]=C(N)c1nccnc1Sc1nc2ccccc2o1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0368df37-fddd-4ce5-b09b-3d37167c56a3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1.",
+ "ref_smiles": "O=C(CCCCC(=O)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3c(O)cccc32)CC1)NCCC[NH+]1CCN(C2=[NH+]c3cc(Cl)ccc3Nc3ccccc32)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "078fb56a-8f70-4f06-9a64-a95f5ac607c6",
+ "task": "sub",
+ "question": "Modify the molecule C=C(CC)C[NH+]1CCCC(O)C1C by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(CC)C[NH+]1CCCC(O)C1C",
+ "ref_smiles": "C=C(CC)C[NH+]1CCCC(S)C1C",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "853ba79d-a1f2-4353-bd98-e6c77d305fba",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule [NH3+]Cc1cccc(F)c1N(Cc1ccsc1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]Cc1cccc(F)c1N(Cc1ccsc1)C1CC1.",
+ "ref_smiles": "[NH3+]Cc1cccc(F)c1N(C1CC1)C(CC=O)c1ccsc1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "211714ea-d6e9-44cc-b56b-a41ea6bbea49",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-c2nc(-c3cccc(C(=O)[O-])n3)cs2)c2c3cc(F)ccc3n(C)c12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc(-c3cccc(C(=O)[O-])n3)cs2)c2c3cc(F)ccc3n(C)c12",
+ "ref_smiles": "COc1ccc(-c2nc(-c3cccc(C(=O)[O-])n3)cs2)c2c3ccccc3n(C)c12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a0f195a2-677d-472f-9c6b-8c9e18e07a8e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1cccc(CO)c1)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cccc(CO)c1)C1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1",
+ "ref_smiles": "O=C(Nc1cccc(C=O)c1)C1CCN(c2ncc(C(F)(F)F)cc2)CC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "71e3406f-3259-44b9-b5ea-4acc0f872196",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C(=O)Nc2ccc(F)c(NC(=O)C3CC[NH+](CC(=O)Nc4ccc(C(=O)N5CCCC(C)C5)cc4C)CC3)c2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2ccc(F)c(NC(=O)C3CC[NH+](CC(=O)Nc4ccc(C(=O)N5CCCC(C)C5)cc4C)CC3)c2)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)Nc2ccc(NO)c(NC(=O)C3CC[NH+](CC(=O)Nc4ccc(C(=O)N5CCCC(C)C5)cc4C)CC3)c2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "92fb19cf-cc99-4822-9e2b-8efb5ea6333e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CS(=O)(=O)CCOS(=O)(=O)C(F)(F)F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CCOS(=O)(=O)C(F)(F)F",
+ "ref_smiles": "CS(=O)(=O)CCOS(=O)(=O)C(F)(F)NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "be8764d0-6da6-40cd-a9ee-ee358a00792f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1csc(CCCCNC(=O)C2(O)CCCC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(CCCCNC(=O)C2(O)CCCC2)n1.",
+ "ref_smiles": "Cc1csc(CCCCC2CCCO2)n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "6605e5c8-6258-4d85-a91f-dbac1a8aafc7",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C[NH2+]CC1CC(O)c2c(OC)c(OC)cc(OC)c21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC1CC(O)c2c(OC)c(OC)cc(OC)c21",
+ "ref_smiles": "CC(=O)C1CC(C[NH2+]C)c2c(OC)cc(OC)c(OC)c21",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0d4d91c0-9316-4601-83e8-91cd03a20c7a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(C)C1.",
+ "ref_smiles": "CC(c1ccc(OC(F)(F)F)cc1)[NH+]1CCOC(C)(CO)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4db9a25c-0d65-4fc9-b4a8-8baf06bdd4fc",
+ "task": "sub",
+ "question": "Modify the molecule O=S(=O)(F)C(F)(F)C(F)(F)OC(C(F)(F)F)C(F)(F)OCC(F)(F)F by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(F)C(F)(F)C(F)(F)OC(C(F)(F)F)C(F)(F)OCC(F)(F)F",
+ "ref_smiles": "N#CS(=O)(=O)C(F)(F)C(F)(F)OC(C(F)(F)F)C(F)(F)OCC(F)(F)F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "240cfa50-5212-491d-9bed-bed52052cf4c",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cc(C=C2OCCC2=O)ccc1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C=C2OCCC2=O)ccc1O.",
+ "ref_smiles": "Cc1cccc(C=C2OCCC2=O)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a17f4fa8-dd42-4585-be43-db46fda9bdd4",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]C1(CNC(=O)N2CCOc3cc(O)ccc3C2)C2CC3CC(C2)CC1C3 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1(CNC(=O)N2CCOc3cc(O)ccc3C2)C2CC3CC(C2)CC1C3",
+ "ref_smiles": "N#Cc1ccc2c(c1)OCCN(C(=O)NCC1([NH3+])C3CC4CC(C3)CC1C4)C2",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "65e8bb38-5c49-4f1e-9ae0-1e6c15e47ca5",
+ "task": "delete",
+ "question": "Modify the molecule CC1CC([NH2+]C2CCc3c(O)cccc32)CCO1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC([NH2+]C2CCc3c(O)cccc32)CCO1",
+ "ref_smiles": "CC1CC([NH2+]C2CCc3ccccc32)CCO1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b79a4621-d7f6-48ce-a212-0baf16901c01",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CCCOc1ccccc1C=C(C#N)C(=O)Oc1ccc(C=CC#N)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccccc1C=C(C#N)C(=O)Oc1ccc(C=CC#N)cc1OC.",
+ "ref_smiles": "C=Cc1ccc(OC(=O)C(C#N)=Cc2ccccc2OCCC)c(OC)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "59eda94f-4dce-42ed-bcad-89f1fd0bfcd3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Brc1ccc(-c2nnc(C[NH+]3CCC(C4OCCO4)CC3)o2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1ccc(-c2nnc(C[NH+]3CCC(C4OCCO4)CC3)o2)cc1.",
+ "ref_smiles": "Brc1nnc(C[NH+]2CCC(C3OCCO3)CC2)o1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7d66b025-da53-4bf1-9a5c-fe22496cf548",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1.",
+ "ref_smiles": "C[NH+](C)CCCNC(=O)C1(C(=O)Nc2ccc(C(F)(F)F)cc2-c2ccccc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ef5e4ba5-eb13-41e3-92cd-69b1b4f713ac",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(F)ccc1Nc1ccc(C(=O)c2cc(OCC[NH+]3CCOCC3)ccc2C)c(N)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(F)ccc1Nc1ccc(C(=O)c2cc(OCC[NH+]3CCOCC3)ccc2C)c(N)c1",
+ "ref_smiles": "Cc1cc(NO2)ccc1Nc1ccc(C(=O)c2cc(OCC[NH+]3CCOCC3)ccc2C)c(N)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "be7ed402-e805-4d39-ba4d-056433675bea",
+ "task": "add",
+ "question": "Modify the molecule CC([NH3+])CCC(=O)Nc1cccc(OCCF)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])CCC(=O)Nc1cccc(OCCF)c1",
+ "ref_smiles": "CC([NH3+])CC(CC=O)C(=O)Nc1cccc(OCCF)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "d4f0f150-96cd-46db-9f97-e9f1194f51bd",
+ "task": "add",
+ "question": "Modify the molecule Fc1cc(CCl)cc(CCl)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cc(CCl)cc(CCl)c1",
+ "ref_smiles": "Oc1c(F)cc(CCl)cc1CCl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3f823f9f-f601-4051-9b7d-264ebc6d6ff5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C=CC(=O)N(C)c1cccc(C)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)N(C)c1cccc(C)n1.",
+ "ref_smiles": "Cc1cccc(N(C)C(=O)C=Cc2ccccc2)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fdb1cda4-e4b6-4d1d-a198-417af3c1b0b3",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCCC1CCCO1)Cc1cccc(Cl)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCC1CCCO1)Cc1cccc(Cl)c1",
+ "ref_smiles": "O=C(CCCC1CCCO1)Cc1cccc(S)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d607a9f2-14a7-4410-a25e-a3400ef156b7",
+ "task": "add",
+ "question": "Modify the molecule CCCC1CCC(n2c(=O)[nH]c(Cl)c(C)c2=O)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CCC(n2c(=O)[nH]c(Cl)c(C)c2=O)CC1",
+ "ref_smiles": "Cc1c(Cl)[nH]c(=O)n(C2CCC(CC(C)CC=O)CC2)c1=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "d7641c8d-9b71-48b0-af0a-7db85823eca3",
+ "task": "add",
+ "question": "Modify the molecule CC1CCc2[nH]c(C(CC(C)(C)C)NC(=O)OC(C)(C)C)nc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCc2[nH]c(C(CC(C)(C)C)NC(=O)OC(C)(C)C)nc21",
+ "ref_smiles": "CC1c2nc(C(CC(C)(C)C)NC(=O)OC(C)(C)C)[nH]c2CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bd5491e0-5be0-49c6-8a4e-7c25759de66b",
+ "task": "delete",
+ "question": "Modify the molecule N#CCCCn1c(CN2C(=O)C3(CCN(C(=O)OC4CC4)CC3)c3ccncc32)cc2cc(Cl)ccc21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCCn1c(CN2C(=O)C3(CCN(C(=O)OC4CC4)CC3)c3ccncc32)cc2cc(Cl)ccc21",
+ "ref_smiles": "N#CCCCn1c(CC2CN(C(=O)OC3CC3)CC2c2ccncc2)cc2cc(Cl)ccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "184fa7db-4e87-4133-880a-2243cf8d0d44",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1ccc(C([NH3+])c2cccc(Br)c2F)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C([NH3+])c2cccc(Br)c2F)cc1",
+ "ref_smiles": "CCc1ccc(C([NH3+])c2cccc(C(=O)[OH])c2F)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e4e9be30-b919-41b9-bf0c-64f32e01f9c8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1ccc(-n2c3ccc(-n4c5ccccc5c5ccccc54)cc3c3cc(-n4c5ccccc5c5ccccc54)ccc32)c(F)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(-n2c3ccc(-n4c5ccccc5c5ccccc54)cc3c3cc(-n4c5ccccc5c5ccccc54)ccc32)c(F)c1",
+ "ref_smiles": "O=C([OH])c1ccc(-n2c3ccc(-n4c5ccccc5c5ccccc54)cc3c3cc(-n4c5ccccc5c5ccccc54)ccc32)c(F)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f88fb02b-7651-4f19-8bfa-e28f7151f838",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C(=O)N2CCOC(C)C2C)ccc1F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)N2CCOC(C)C2C)ccc1F",
+ "ref_smiles": "Cc1cc(C(=O)N2CCOC(C)C2C)ccc1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "91b39ac8-9626-4e15-ab44-02c59b7e41c2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nn(Cc2cccc3c2OC(C)(C)C3)c(N)c1Br with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(Cc2cccc3c2OC(C)(C)C3)c(N)c1Br",
+ "ref_smiles": "CC(=O)c1c(C)nn(Cc2cccc3c2OC(C)(C)C3)c1N",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4dae5ecd-826a-4692-b7c3-52e7e4ec1948",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc(-c2cc(-c3cccc(S(C)(=O)=O)c3)ccc2-n2cc(Cl)c(C(F)(F)F)n2)c(-c2ccc(OC(F)(F)F)cc2)o1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2cc(-c3cccc(S(C)(=O)=O)c3)ccc2-n2cc(Cl)c(C(F)(F)F)n2)c(-c2ccc(OC(F)(F)F)cc2)o1",
+ "ref_smiles": "Cc1nc(-c2cc(-c3cccc(S(C)(=O)=O)c3)ccc2-n2cc(C#N)c(C(F)(F)F)n2)c(-c2ccc(OC(F)(F)F)cc2)o1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "14c76ca2-9343-4c06-ad9c-3b1e7d3316f1",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C[NH2+]CC(C)(O)c1c(OC)cnn1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC(C)(O)c1c(OC)cnn1C.",
+ "ref_smiles": "C[NH2+]C(C(=O)O)C(C)(O)c1c(OC)cnn1C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "63fd959a-448e-4da0-8cea-72636fcbbb89",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOc1ccc(C(=O)C(C)OC(=O)c2ccccc2O)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)C(C)OC(=O)c2ccccc2O)cc1",
+ "ref_smiles": "CCOc1ccc(C(=O)C(C)OC(=O)c2ccccc2NO)cc1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0e925295-aada-40d3-ad0a-c99e4876754c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCc1ccc(NC(=O)CSc2[nH+]cc(CO)n2Cc2ccc(F)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(NC(=O)CSc2[nH+]cc(CO)n2Cc2ccc(F)cc2)cc1.",
+ "ref_smiles": "CCc1ccc(NC(=O)CSc2[nH+]cc(CO)n2Cc2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "569506eb-7069-4dbb-8738-c064507d494b",
+ "task": "add",
+ "question": "Modify the molecule C#CC(Br)CBr by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC(Br)CBr",
+ "ref_smiles": "C#CC(Br)C(O)Br",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9d7f0024-1340-4401-9e22-5edcc306372a",
+ "task": "sub",
+ "question": "Modify the molecule COc1c(O)c(C[NH+]2CCN(CCOc3ccccc3)CC2)c2c(c1O)C1OC(CO)C(O)C(O)C1OC2=O by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(O)c(C[NH+]2CCN(CCOc3ccccc3)CC2)c2c(c1O)C1OC(CO)C(O)C(O)C1OC2=O",
+ "ref_smiles": "COc1c(O)c2c(c(C[NH+]3CCN(CCOc4ccccc4)CC3)c1S)C(=O)OC1C2OC(CO)C(O)C1O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f1d6ef3f-fa69-41fd-a11c-fd7e25d10275",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C=CCn1c(C)nnc1SCC(=O)Nc1cc(-c2ccccc2)sc1C(=O)OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(C)nnc1SCC(=O)Nc1cc(-c2ccccc2)sc1C(=O)OCC.",
+ "ref_smiles": "C=CCn1c(C)nnc1SCC(=O)Nc1ccsc1C(=O)OCC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ff8cfec5-e3d4-4435-a634-0319b8dead2b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1nc(Nc2cc(Cl)c(-c3ccc(OCC4CCC[NH2+]4)cc3)c(Cl)c2)n[nH]1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nc(Nc2cc(Cl)c(-c3ccc(OCC4CCC[NH2+]4)cc3)c(Cl)c2)n[nH]1",
+ "ref_smiles": "Nc1nc(Nc2cc(C=O)c(-c3ccc(OCC4CCC[NH2+]4)cc3)ccc2)n[nH]1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e5ac0573-22b5-45f3-987c-bfd205acf976",
+ "task": "sub",
+ "question": "Modify the molecule NC(=[NH+]O)C(CNCC(F)(F)F)c1ccccc1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)C(CNCC(F)(F)F)c1ccccc1",
+ "ref_smiles": "CC(=O)[NH+]=C(N)C(CNCC(F)(F)F)c1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6b497037-bea0-49da-b8e6-a8f25e700dd6",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3CCC3)c(N)c2=O)c(C)nc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3CCC3)c(N)c2=O)c(C)nc1C.",
+ "ref_smiles": "Cc1cc(CNC(=O)Cn2c(C)cc(S(=O)(=O)CC3(C#N)CCC3)c(N)c2=O)c(C)nc1C",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "ebd44598-4673-4f44-bce1-13483598710b",
+ "task": "add",
+ "question": "Modify the molecule CN(Cc1ccc(Cl)cc1)C1(C[NH3+])CCCCC1(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccc(Cl)cc1)C1(C[NH3+])CCCCC1(C)C",
+ "ref_smiles": "CN(Cc1ccc(Cl)cc1-c1ccccc1)C1(C[NH3+])CCCCC1(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "34e4590e-c19b-4d9d-9895-79fb12aeec08",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)c1ccc(N2CC[NH+](CC(=O)N3CCN(c4ccc(C(C)=O)cc4F)CC3)C(C)C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(N2CC[NH+](CC(=O)N3CCN(c4ccc(C(C)=O)cc4F)CC3)C(C)C2)cc1.",
+ "ref_smiles": "COC(=O)c1ccc(N2CC[NH+](CC(=O)N3CCN(c4ccc(C(C)=O)cc4)CC3)C(C)C2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4a22571a-4015-437a-a124-ebc5981ebdec",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1.",
+ "ref_smiles": "CC(O)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C(C)(C1CC(C)(C)[NH2+]C(C)(C)C1)C1CC(C)(C)[NH2+]C(C)(C)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c32d1e21-97fd-4637-b92d-23b1943473e2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(F)cc(NS(=O)(=O)c2ccc(Br)s2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(F)cc(NS(=O)(=O)c2ccc(Br)s2)c1",
+ "ref_smiles": "Cc1cc(C#N)cc(NS(=O)(=O)c2ccc(Br)s2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3476a247-1dfc-4b9a-a016-91b37675e408",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C#CCN(CC(=O)[O-])C(=O)COc1ccc(C)cc1Br with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCN(CC(=O)[O-])C(=O)COc1ccc(C)cc1Br",
+ "ref_smiles": "C#CCN(CC(=O)[O-])C(=O)COc1ccc(C)cc1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc6c7c43-dd6a-4edd-90be-9ccb08e45c4a",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(Nc2nc(CSc3nnc(C4CC4)n3C)cs2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Nc2nc(CSc3nnc(C4CC4)n3C)cs2)cc1",
+ "ref_smiles": "CNc1nc(CSc2nnc(C3CC3)n2C)cs1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "28f65edd-147a-4b9c-8f63-342412ad36bf",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(OCc2c(C)nn(C)c2NN)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OCc2c(C)nn(C)c2NN)cc1",
+ "ref_smiles": "COCc1c(C)nn(C)c1NN",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7e8543b2-df83-4e69-9799-ed9414031169",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1cccc(NC(=O)CSc2nnc(NC(=O)c3cccc(Cl)c3)s2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(NC(=O)CSc2nnc(NC(=O)c3cccc(Cl)c3)s2)c1.",
+ "ref_smiles": "COc1cccc(NC(=O)CSc2nnc(NC(=O)c3ccccc3)s2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f31e0a1f-c1fa-4da8-9e53-a189c82941bd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)C(C)NC(=O)c1cc(N)ncc1Cl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(C)NC(=O)c1cc(N)ncc1Cl",
+ "ref_smiles": "CCC(C)C(C)NC(=O)c1cc(N)ncc1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "430d3338-9cdd-42c5-bc8a-1991a1bb1842",
+ "task": "add",
+ "question": "Modify the molecule CN(CC1CCCCC1O)C(=O)c1cccc(Cl)c1Cl by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC1CCCCC1O)C(=O)c1cccc(Cl)c1Cl",
+ "ref_smiles": "CN(CC1CCC(C#N)CC1O)C(=O)c1cccc(Cl)c1Cl",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "421d5ec0-388e-4a37-9b9c-4ba1e404645f",
+ "task": "add",
+ "question": "Modify the molecule CCC1(C)CCN(S(=O)(=O)c2cc(Br)ccc2C)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C)CCN(S(=O)(=O)c2cc(Br)ccc2C)CC1",
+ "ref_smiles": "CCC1(C)CCN(S(=O)(=O)c2c(C)ccc(Br)c2CC=O)CC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "9eba71e7-b099-4dbc-addc-5d5326000930",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1",
+ "ref_smiles": "COc1ccc(S(=O)(=O)NCCNS(=O)(=O)c2ccc(C(=O)O)c([N+](=O)[O-])c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "43da74b4-d0bf-44a1-8e96-0304bda7ecc4",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])Cc1nn2c(c1-c1ccc(F)cc1)CCC2 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])Cc1nn2c(c1-c1ccc(F)cc1)CCC2",
+ "ref_smiles": "ONc1ccc(-c2c(CC(=O)[O-])nn3c2CCC3)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3014e3cf-a8f7-498d-b5d7-246e7f55f8ce",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1cc(C)ccc1C by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1Cl)c1cc(C)ccc1C",
+ "ref_smiles": "CCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C(=O)O)c1cc(C)ccc1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a76700f1-32d5-44f9-92a7-6ae9cb904090",
+ "task": "delete",
+ "question": "Modify the molecule NC(=O)C1CCN(C(=O)CCc2cc(Cl)cs2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCN(C(=O)CCc2cc(Cl)cs2)CC1",
+ "ref_smiles": "NC(=O)C1CCC(c2cc(Cl)cs2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e3a147fb-da53-47e1-aff3-3a1d44c6661a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC[NH2+]Cc1sc(-c2ccn(C)n2)nc1C(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]Cc1sc(-c2ccn(C)n2)nc1C(F)(F)F.",
+ "ref_smiles": "CCC[NH2+]Cc1sc(-c2ccn(C)n2)nc1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2f3bfab9-9791-4c2a-8452-4ae4a17b1e1e",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH2+]C(C)(CO)CC(C)N(C)CC(F)(F)F by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(C)(CO)CC(C)N(C)CC(F)(F)F",
+ "ref_smiles": "CC[NH2+]C(C)(C)CC(C)N(C)CC(F)(F)F",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5dedce51-484b-43ba-87ee-b309c8b5f142",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOC(=O)C(CCCCC(=O)[O-])=NNc1ncn[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(CCCCC(=O)[O-])=NNc1ncn[nH]1.",
+ "ref_smiles": "CCOC(=O)C(CCCCC(=O)[O-])=Nc1ncn[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a7786757-fbac-49d6-bd75-7e7d3fa6e943",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CNC(=O)CC1CCCCN1c1ccnc(-n2ccnc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)CC1CCCCN1c1ccnc(-n2ccnc2)n1.",
+ "ref_smiles": "CC1CCCCN1c1ccnc(-n2ccnc2)n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "abd4cc43-4129-4fa5-b945-b7199e765795",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(NCCNC(=O)c1ccc(Cl)c(Cl)c1)=[NH+]CC1CCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(NCCNC(=O)c1ccc(Cl)c(Cl)c1)=[NH+]CC1CCC1",
+ "ref_smiles": "NC(NCCNC(=O)c1ccc(O)c(Cl)c1)=[NH+]CC1CCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2ae336de-495e-4dc4-b9ae-5484511a0a1b",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)n(CCC(=O)OCc2ccc(C(N)=O)cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(CCC(=O)OCc2ccc(C(N)=O)cc2)n1.",
+ "ref_smiles": "Cc1cc(C)n(CCC(=O)OCC(N)=O)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6c0d1b5c-4b3b-4924-bbea-ca774056c8c0",
+ "task": "add",
+ "question": "Modify the molecule C[Si](C)(C)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21",
+ "ref_smiles": "C[Si](C)(CS)CCOCn1ccc2c(NC3CCCCC3)c(S(C)(=O)=O)c[nH+]c21",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "83f294b8-5a7f-4122-8c9e-b7285da11b1e",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-c2cc(=O)nc(Nc3cc(OC)c(Cl)cc3OC)[nH]2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2cc(=O)nc(Nc3cc(OC)c(Cl)cc3OC)[nH]2)cc1",
+ "ref_smiles": "COc1cc(=O)nc(Nc2cc(OC)c(Cl)cc2OC)[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9da50a60-af4c-4ba8-b83c-4ae636ecd1bb",
+ "task": "sub",
+ "question": "Modify the molecule CCC(C)C(NC(=O)C1CCCN1C(=O)C([NH3+])CO)C(=O)NC(C(=O)[O-])C(C)C by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(NC(=O)C1CCCN1C(=O)C([NH3+])CO)C(=O)NC(C(=O)[O-])C(C)C",
+ "ref_smiles": "CCC(C)C(NC(=O)C1CCCN1C(=O)C([NH3+])C([N+](=O)[O-])C(=O)NC(C(=O)[O-])C(C)C",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ebadd816-4077-43f5-ac7e-201ade6447bf",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule NC(=S)c1cc(F)c(Nc2ccc(F)c(F)c2)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=S)c1cc(F)c(Nc2ccc(F)c(F)c2)c(F)c1.",
+ "ref_smiles": "NC(=S)c1cc(F)c(Nc2ccc(F)cc2)c(F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "fd1a4e92-0ba3-4e27-ba15-e9762ba18267",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(N(C(C)=O)C2CCCCCC2n2c(=O)c3c(C)onc3c3c(Cl)cccc32)cc(OC)c1OC with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(N(C(C)=O)C2CCCCCC2n2c(=O)c3c(C)onc3c3c(Cl)cccc32)cc(OC)c1OC",
+ "ref_smiles": "COc1cc(N(C(C)=O)C2CCCCCC2n2c(=O)c3c(C)onc3c3c(NO2)cccc32)cc(OC)c1OC",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bdacf60e-a8ff-4d88-9e90-1c21602707a9",
+ "task": "delete",
+ "question": "Modify the molecule Cc1onc(-c2ccccc2)c1C(=O)NC1C(=O)N2C1SC(C)C2(C)C(=O)[O-] by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1onc(-c2ccccc2)c1C(=O)NC1C(=O)N2C1SC(C)C2(C)C(=O)[O-]",
+ "ref_smiles": "Cc1onc(-c2ccccc2)c1C(=O)N1CSC(C)C1(C)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "50b3f770-73ba-4638-9a79-c76f4a74f2ba",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule Cn1cncc1C[NH2+]C1CCC2CC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cncc1C[NH2+]C1CCC2CC21.",
+ "ref_smiles": "Cn1cncc1C[NH2+]C1CC(CC=O)C2CC12",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "cd70e18a-b0d0-47c4-b0f1-99b86099d9c8",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)[NH2+]CC1CC[NH+](Cc2ccc(Cl)s2)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH2+]CC1CC[NH+](Cc2ccc(Cl)s2)CC1",
+ "ref_smiles": "CC(C)[NH2+]CC1CC[NH+](Cc2cccs2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2f97f9c2-369b-4bf7-88c9-44e99d2f5e75",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)ccc2Cl)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)ccc2Cl)CC1.",
+ "ref_smiles": "Cc1cc(C(=O)N2CCCC2)ccc1NC(=O)C[NH+]1CCC(C(=O)N2CCCC2C(=O)Nc2cc(C(=O)NC3CCCCC3)c(-c3ccccc3)cc2Cl)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c9a31b5b-82b5-40a5-8c73-565735461a7b",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ncc(CO)c2c1Oc1nc(-c3ccccc3)nc(SCC(=O)Nc3cccc(O)c3)c1C2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ncc(CO)c2c1Oc1nc(-c3ccccc3)nc(SCC(=O)Nc3cccc(O)c3)c1C2",
+ "ref_smiles": "Cc1ncc(CO)c2c1Oc1nc(N)nc(SCC(=O)Nc3cccc(O)c3)c1C2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "78406a64-62d6-4475-af19-746b27d7767c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1=C(C=CC(O)c2ccc(C(=O)[O-])cc2)C(C)(C)CCC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(C=CC(O)c2ccc(C(=O)[O-])cc2)C(C)(C)CCC1",
+ "ref_smiles": "CC1=C(C=CC(C#N)c2ccc(C(=O)[O-])cc2)C(C)(C)CCC1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "965a421e-b2bf-4fa6-b5a3-676712e9da6e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)N1CCC([NH2+]C2CC(O)C(CO)C2Cc2ccnc(C3CC3)n2)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCC([NH2+]C2CC(O)C(CO)C2Cc2ccnc(C3CC3)n2)CC1",
+ "ref_smiles": "CC(=O)N1CCC([NH2+]C2CC(C#N)C(CO)C2Cc2ccnc(C3CC3)n2)CC1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ee888353-e1a8-4a67-bc22-1f049c230ce5",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NC(=O)CCCCC[NH3+])cc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)CCCCC[NH3+])cc1F",
+ "ref_smiles": "Cc1ccc(NC(=O)CCCCC[NH3+])cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e97c1f0f-b9e6-4fe3-a076-386f3fce9fb5",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(OCCCCCS(=O)(=O)Cl)c(Cl)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OCCCCCS(=O)(=O)Cl)c(Cl)c1",
+ "ref_smiles": "Cc1ccc(OCCCCCS(=O)(=O)C#N)c(Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "39b45fd2-630e-41ad-b333-4f5c9d525fe6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)C)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)C)cc12.",
+ "ref_smiles": "COCC(=O)N=Nc1c(O)[nH]c2ccc(C(C)(C)O)cc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d8ab9af8-db55-421c-a145-16ffd2fc9871",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CSC1CCC(NC(=O)c2cc(Br)cnc2NN)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSC1CCC(NC(=O)c2cc(Br)cnc2NN)C1",
+ "ref_smiles": "CSC1CCC(NC(=O)c2cc(C#N)cnc2NN)C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "96b4c027-dcb9-4f2f-9639-36b64f2806c0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCN(Cc3c(Cl)cncc3Cl)c3ccc(OC)c(OC4CCCC4)c3)C(=O)OC12C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCN(Cc3c(Cl)cncc3Cl)c3ccc(OC)c(OC4CCCC4)c3)C(=O)OC12C",
+ "ref_smiles": "CCC1OC(=O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(SCCN(Cc3c(Cl)cncc3NO)c3ccc(OC)c(OC4CCCC4)c3)C(=O)OC12C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8f1b867f-f7d3-4ab7-a207-07ce7c11fed1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC[NH+]1CCCC1CNC(=O)NCC(C)(O)c1ccc(F)cc1F with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]1CCCC1CNC(=O)NCC(C)(O)c1ccc(F)cc1F",
+ "ref_smiles": "CC[NH+]1CCCC1CNC(=O)NCC(C)(Cl)c1ccc(F)cc1F",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ad045e51-5437-4c70-9b9f-13740535dcc7",
+ "task": "add",
+ "question": "Modify the molecule COCC(=O)Cc1nnn(C)n1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(=O)Cc1nnn(C)n1",
+ "ref_smiles": "COCC(=O)Cc1nnn(CC(=O)O)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "02befb32-3831-4430-9386-9eea27e3f00c",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C(NC(=O)C(CC(N)=O)NC(=O)C1CCCN1C(=O)C(NC(=O)C(COP(=O)([O-])[O-])NC(=O)C(NC(=O)C(CO)NC(=O)C([NH3+])CCC[NH+]=C(N)N)C(C)O)C(C)O)C(=O)NC(C=O)Cc1cnc[nH]1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(NC(=O)C(CC(N)=O)NC(=O)C1CCCN1C(=O)C(NC(=O)C(COP(=O)([O-])[O-])NC(=O)C(NC(=O)C(CO)NC(=O)C([NH3+])CCC[NH+]=C(N)N)C(C)O)C(C)O)C(=O)NC(C=O)Cc1cnc[nH]1",
+ "ref_smiles": "CC(C)C(NC(=O)C(CC(N)=O)NC(=O)C1CCCN1C(=O)C(NC(=O)C(COP(=O)([O-])[O-])NC(=O)C(NC(=O)C(CO)NC(=O)C([NH3+])CCC[NH+]=CN)C(C)O)C(C)O)C(=O)NC(C=O)Cc1cnc[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "ee4503ca-6230-4b31-a879-1866cb60fee3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCCC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCCC2)C1.",
+ "ref_smiles": "O=C(c1ccc(Cl)cc1)C1CCCN(C(=O)C2CCC(O)C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e596153d-5684-4540-8293-316ba0275eac",
+ "task": "delete",
+ "question": "Modify the molecule CNC(=O)OCCNc1ccc2[nH+]cc(-c3ccc(CC#N)cc3)n2n1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)OCCNc1ccc2[nH+]cc(-c3ccc(CC#N)cc3)n2n1",
+ "ref_smiles": "CNC(=O)OCCNc1ccc2[nH+]cc(-c3ccc(C)cc3)n2n1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "20d019e4-755d-4e51-a77f-b78545751348",
+ "task": "delete",
+ "question": "Modify the molecule COc1c(CC(=O)[O-])cnn1Cc1ccc(F)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(CC(=O)[O-])cnn1Cc1ccc(F)cc1",
+ "ref_smiles": "COc1c(CC(=O)[O-])cnn1CF",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bb18d08d-186a-44b8-a85c-aeb654d996b6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1nn(-c2ccccn2)c(-c2ccccc2)c1Br with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1nn(-c2ccccn2)c(-c2ccccc2)c1Br",
+ "ref_smiles": "N#Cc1c(C(=O)[O-])nn(-c2ccccn2)c1-c1ccccc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "eda242b9-7653-43af-9409-61f211969293",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(Cl)CC1=CCCCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Cl)CC1=CCCCO1",
+ "ref_smiles": "O=S(=O)(Cl)CC1=C(O)CCCO1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "151ae50c-3383-4bfa-be61-096588f740fd",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)OC(=O)N1CCC(c2cccc(OCc3cccnc3)c2)=C(C(=O)N(Cc2cccc(Cl)c2Cl)C2CC2)C1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCC(c2cccc(OCc3cccnc3)c2)=C(C(=O)N(Cc2cccc(Cl)c2Cl)C2CC2)C1",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CCC(c2cccc(OCc3cccnc3)c2)=C(C(=O)N(Cc2ccccc2Cl)C2CC2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e57f40f8-a33b-44ff-b820-b5ef9a149020",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(-c2ccc(C3CCCc4ccc(C(C5CC5)C(C)C(=O)[O-])cc4O3)c(F)c2)ccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(-c2ccc(C3CCCc4ccc(C(C5CC5)C(C)C(=O)[O-])cc4O3)c(F)c2)ccn1.",
+ "ref_smiles": "Cc1cc(-c2ccc(C3CCCc4ccc(C(C5CC5)C(C)C(=O)[O-])cc4O3)cc2)ccn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7d9d2551-d431-43cf-b7fc-88d05d3638cb",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)(C)[Si](C)(C)OCC1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)[Si](C)(C)OCC1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1.",
+ "ref_smiles": "CC(C)(C)[Si](C)(C)OC(C(=O)O)C1C[NH+](C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(n2cnc3c(=O)nc(NC(=O)COc4ccccc4)[nH]c32)O1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "35365f93-06b3-4c6e-a0db-2ff5a64f7679",
+ "task": "delete",
+ "question": "Modify the molecule CC(NC(=O)c1cc2c(nc3sccn32)s1)c1cccc(NS(C)(=O)=O)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1cc2c(nc3sccn32)s1)c1cccc(NS(C)(=O)=O)c1",
+ "ref_smiles": "CC(NC(=O)c1cc2c(nc3sccn32)s1)c1cccc(S(C)(=O)=O)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "aa08994d-550e-4a04-b5fa-77a4f41b6ab0",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C2=C(Sc3ccc(Cl)cc3)C(=O)N(c3ccccc3)C2=O)c(C)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2=C(Sc3ccc(Cl)cc3)C(=O)N(c3ccccc3)C2=O)c(C)c1",
+ "ref_smiles": "Cc1ccc(C2=C(SCl)C(=O)N(c3ccccc3)C2=O)c(C)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bfdf8dbc-e340-45ce-8b5d-16ab70fd3c5c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(Oc2ccc(Cl)cc2)cc1)c1cccnc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(Oc2ccc(Cl)cc2)cc1)c1cccnc1",
+ "ref_smiles": "O=C(Nc1ccc(Oc2ccc(C#N)cc2)cc1)c1cccnc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4cfd55ec-c884-4307-b4dc-c83f18471262",
+ "task": "delete",
+ "question": "Modify the molecule CC(Cc1ccco1)[NH2+]C(C(=O)[O-])c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cc1ccco1)[NH2+]C(C(=O)[O-])c1ccccc1",
+ "ref_smiles": "CC(Cc1ccco1)[NH2+]CC(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "51309018-82f4-4928-a7c4-c1f83fc9b30a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)Oc1ccc(-c2nc(C3CCc4nc(-c5cc(Cl)ccc5-n5cnnn5)cc(=O)n43)[nH]c2Cl)cn1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)Oc1ccc(-c2nc(C3CCc4nc(-c5cc(Cl)ccc5-n5cnnn5)cc(=O)n43)[nH]c2Cl)cn1",
+ "ref_smiles": "NC(=O)Oc1ccc(-c2nc(C3CCc4nc(-c5cc(O)ccc5-n5cnnn5)cc(=O)n43)[nH]c2Cl)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b3fa0a0d-9064-4466-b5c3-baa3302fd0d6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C2(NC(=O)Nc3ccccc3F)CCCC2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2(NC(=O)Nc3ccccc3F)CCCC2)cc1",
+ "ref_smiles": "COc1ccc(C2(NC(=O)Nc3ccccc3S)CCCC2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8d0c7e97-5b90-455a-9ae8-b7cdc1f60797",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(-c2cccc(COc3ccc4cnccc4c3)c2)cc1C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2cccc(COc3ccc4cnccc4c3)c2)cc1C(=O)[O-]",
+ "ref_smiles": "Cc1ccc(-c2cccc(COc3cc4ccncc4cc3O)c2)cc1C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "57e36710-47c6-4f85-9cf5-6f256408e140",
+ "task": "add",
+ "question": "Modify the molecule CC[NH2+]CC(COC)OCC1CCOC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]CC(COC)OCC1CCOC1",
+ "ref_smiles": "CC[NH2+]CC(OCC1CCOC1)C(OC)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "74a0d175-4a1b-4bd9-8656-4bf3521c3339",
+ "task": "delete",
+ "question": "Modify the molecule O=C(C=Cc1ccccc1Br)NCCc1ccc(-n2cccn2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccccc1Br)NCCc1ccc(-n2cccn2)cc1",
+ "ref_smiles": "O=C(C=Cc1ccccc1Br)NCCn1cccn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "abda0137-0539-4333-8e74-71f495a8d998",
+ "task": "delete",
+ "question": "Modify the molecule CCC(C)COc1cc2c(cc1OCC(C)CC)-c1cc3c(cc1-c1cc(C=Cc4ccc(C)cc4)ccc1-c1ccc(C=Cc4ccc(C)cc4)cc1-2)OCC(CC)C(C(C)CC)O3 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)COc1cc2c(cc1OCC(C)CC)-c1cc3c(cc1-c1cc(C=Cc4ccc(C)cc4)ccc1-c1ccc(C=Cc4ccc(C)cc4)cc1-2)OCC(CC)C(C(C)CC)O3",
+ "ref_smiles": "CC=Cc1ccc2c(c1)-c1cc(OCC(C)CC)c(OCC(C)CC)cc1-c1cc3c(cc1-c1cc(C=Cc4ccc(C)cc4)ccc1-2)OCC(CC)C(C(C)CC)O3",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8c8e1028-7883-4d4b-b3ef-5d1ab57ea580",
+ "task": "sub",
+ "question": "Modify the molecule CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(Cl)ccc1C)S(=O)(=O)c1ccc(C)cc1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CN(c1cc(Cl)ccc1C)S(=O)(=O)c1ccc(C)cc1",
+ "ref_smiles": "CCCCNC(=O)C(C)N(Cc1cccc(C#N)c1)C(=O)CN(c1cc(Cl)ccc1C)S(=O)(=O)c1ccc(C)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3e0b709e-fccf-403f-b01a-cd9f7f9a0ab8",
+ "task": "add",
+ "question": "Modify the molecule CCCC1CC(C[NH3+])(N(CC)Cc2ccncc2)CCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC(C[NH3+])(N(CC)Cc2ccncc2)CCO1",
+ "ref_smiles": "CCCC1CC(C[NH3+])(N(CC)Cc2ccnc(O)c2)CCO1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "16fa0be9-561d-471d-8351-73ee262a1d1a",
+ "task": "sub",
+ "question": "Modify the molecule CCC(=O)Nc1ccc(N2CCCC(C=O)(CC[NH2+]C34CC5CC(C3)C(O)C(C5)C4)C2)c(F)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1ccc(N2CCCC(C=O)(CC[NH2+]C34CC5CC(C3)C(O)C(C5)C4)C2)c(F)c1",
+ "ref_smiles": "CCC(=O)Nc1ccc(N2CCCC(C=O)(CC[NH2+]C34CC5CC(C3)C(O)C(C5)C4)C2)c(S)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "43a99938-3c22-45a4-902d-7af06fb2b980",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]C(CCC#N)c1ccc(Cl)c(Cl)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(CCC#N)c1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "CC(=O)c1ccc(C(CCC#N)[NH2+]C)cc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d389507f-c05c-4251-a42d-174bebbf8c86",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1ccc(F)cc1OCC1CC1)N1CCn2c(n[nH]c2=O)C1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(F)cc1OCC1CC1)N1CCn2c(n[nH]c2=O)C1",
+ "ref_smiles": "N#CC1CN(C(=O)Nc2ccc(F)cc2OCC2CC2)Cc2n[nH]c(=O)n21",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "e6eff6f8-5243-4f89-bb59-a0a332337b57",
+ "task": "sub",
+ "question": "Modify the molecule C=CC(=O)N1CCC(Nc2cnc3ncc(C(=O)NCC4(O)CCCC4)c-3[nH]2)CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)N1CCC(Nc2cnc3ncc(C(=O)NCC4(O)CCCC4)c-3[nH]2)CC1",
+ "ref_smiles": "C=CC(=O)N1CCC(Nc2cnc3ncc(C(=O)NCC4(C(=O)O)CCCC4)c-3[nH]2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0b262ee4-4ffa-44dd-93ed-e713365e6cf7",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1.",
+ "ref_smiles": "CC(=O)Nc1ccc(S(=O)(=O)N(CN)CC(=O)OC(C)C(=O)c2ccc(OC(F)F)cc2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "09b27c64-7085-4c85-a4ec-6b11fde99dde",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCC1(C2CC(=O)N(c3cc(F)ccc3F)C2=O)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC1(C2CC(=O)N(c3cc(F)ccc3F)C2=O)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.",
+ "ref_smiles": "CCCCC1(C2C(=O)N(c3cc(F)ccc3F)C(=O)C2c2ccccc2)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "04a1512a-3b0f-46ff-9ffc-d4fe53f5295e",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(O)c(C(CC[NH+]2CCCC(C)C2)c2ccc3c(c2)OCO3)c(OC)c1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(O)c(C(CC[NH+]2CCCC(C)C2)c2ccc3c(c2)OCO3)c(OC)c1",
+ "ref_smiles": "COc1cc(NO)c(C(CC[NH+]2CCCC(C)C2)c2ccc3c(c2)OCO3)c(OC)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9fc68d5b-005c-46ea-b465-e65945130769",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(CCS(C)=O)n1c(=S)[nH]c2cc(F)c(Br)cc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCS(C)=O)n1c(=S)[nH]c2cc(F)c(Br)cc21",
+ "ref_smiles": "CC(CCS(C)=O)n1c(=S)[nH]c2cc(C#N)c(Br)cc21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a1b2b969-7a41-49a3-887c-54ca9a4b8af8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule NC(=S)NN=CC(=NNC(N)=S)C(O)C(O)CO with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=S)NN=CC(=NNC(N)=S)C(O)C(O)CO",
+ "ref_smiles": "NC(=S)NN=CC(=NNC(N)=S)C(C(=O)O)C(O)CO",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c654d418-ebec-4d0e-a2c9-57d2afb7cba6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1CC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1CC(=O)[O-].",
+ "ref_smiles": "CCC(c1ccc(Br)cc1)[NH+]1CCNC(=O)C1C(O)C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8211c8ca-bb8f-40ba-8a01-b1681f2a21ce",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCc1nnsc1C(=O)NCC(C)(O)CC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nnsc1C(=O)NCC(C)(O)CC(C)C.",
+ "ref_smiles": "CCCc1nnsc1C(=O)NCC(C)CC(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1b625c6b-fb25-4ef4-98b3-6b10a7586c53",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CN(Cc2cccc(-c3ccccn3)c2)CC[NH2+]1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CN(Cc2cccc(-c3ccccn3)c2)CC[NH2+]1",
+ "ref_smiles": "CC1(C)CN(Cc2ccccn2)CC[NH2+]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9eb30deb-76dd-4422-9997-ca46cd59cd26",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCCN(C(=O)NC2CCCCC2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCCN(C(=O)NC2CCCCC2)CC1.",
+ "ref_smiles": "CCN(CC)C(=O)c1cc(NC(=O)c2ccc(C(F)(F)F)cc2)ccc1N1CCN(C(=O)NC2CCCCC2)CCC1C#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "dfc23a69-7d38-447d-9aad-0d5881385c8d",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1Br by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1Br",
+ "ref_smiles": "CC(=O)c1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)ccc1OCC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "805b322d-57de-4ec5-8daa-89e6a0fe4a16",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1sc2ccc(Cl)cc2c1C(=O)[O-] by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1sc2ccc(Cl)cc2c1C(=O)[O-]",
+ "ref_smiles": "CCOc1sc2ccc(NO)cc2c1C(=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e22e5c3-afae-46a9-a09c-9f82afc85a05",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)(C)CC1[NH2+]C(C(=O)NCCC2CCCCC2)C(c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)CC1[NH2+]C(C(=O)NCCC2CCCCC2)C(c2cccc(Cl)c2F)C12C(=O)Nc1cc(Cl)ccc12.",
+ "ref_smiles": "CC(C)(C)CC1[NH2+]C(C(=O)NCCC2CCCCC2)C(c2cccccc2)C12C(=O)Nc1ccccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7d50cb39-2f59-4650-93d6-25e7d24e7679",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Clc1cnc(N2CC[NH+](Cc3nnnn3C3CC3)CC2)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cnc(N2CC[NH+](Cc3nnnn3C3CC3)CC2)c(Cl)c1.",
+ "ref_smiles": "Clc1cnc(N2CC[NH+](C(c3ccccc3)c3nnnn3C3CC3)CC2)c(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4e3aab98-d9dc-4346-a85c-8dcc44b9b615",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH+](CC(=O)Nc1c(Cl)cccc1Cl)C(C)C(=O)Nc1cc(C)ccc1OC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC(=O)Nc1c(Cl)cccc1Cl)C(C)C(=O)Nc1cc(C)ccc1OC",
+ "ref_smiles": "CC[NH+](CC(=O)Nc1c(Cl)cccc1C#N)C(C)C(=O)Nc1cc(C)ccc1OC",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8bbd1214-3eb4-46c5-b8ec-f06cabc6893a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(N)nc(C)c1CNc1noc2cnc(Cc3ccc4ncc(Cl)cc4c3)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N)nc(C)c1CNc1noc2cnc(Cc3ccc4ncc(Cl)cc4c3)cc12.",
+ "ref_smiles": "Cc1cc(N)nc(C)c1CNc1noc2cnc(Cc3ccc4ncccc4c3)cc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "94f13661-e71e-450e-8e97-4fa0764a3e4d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1ccccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1ccccn1.",
+ "ref_smiles": "O=S(=O)(CCS(=O)(=O)c1nc2ccccc2s1)c1cccc(-c2ccccc2)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c486fd9a-be56-4e1a-8512-086ab7a309f9",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(C(C)NC(=O)CSCc2cccc(F)c2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)NC(=O)CSCc2cccc(F)c2)cc1C.",
+ "ref_smiles": "Cc1cc(C(C)NC(=O)CSCc2cccc(F)c2)ccc1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e11ff2f5-4196-4e32-9598-f770b3bd3294",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COc1ccccc1CNc1cc[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CNc1cc[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1.",
+ "ref_smiles": "COc1ccccc1CNc1cc(C(=O)O)[nH+]c(C(=O)Nc2ccc(C#N)cc2)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "67f7c229-008e-4415-8073-b37675448d3d",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule C1=CC23CCCCC(CC2)([NH2+]3)c2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C1=CC23CCCCC(CC2)([NH2+]3)c2ccccc21.",
+ "ref_smiles": "O=CCc1cccc2c1C13CCCCC(C=C2)(CC1)[NH2+]3",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "ec19ed75-c330-403e-8bf7-98ae763a8857",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule c1ccc(C[NH+]2CCC(Nc3ccccc3)C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(C[NH+]2CCC(Nc3ccccc3)C2)cc1.",
+ "ref_smiles": "NC1CC[NH+](Cc2ccccc2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "07befa0a-8208-4c7a-89e2-3d7f20e47018",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)n1c(CN2CCC(NS(=O)(=O)c3cc4ccc(Cl)cc4s3)C2=O)cc2ncccc21 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)n1c(CN2CCC(NS(=O)(=O)c3cc4ccc(Cl)cc4s3)C2=O)cc2ncccc21",
+ "ref_smiles": "CCOC(=O)n1c(CN2CCC(NS(=O)(=O)c3cc4ccc(C#N)cc4s3)C2=O)cc2ncccc21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7f36df75-8ba1-497c-b8e6-6b90d47f7cd6",
+ "task": "sub",
+ "question": "Modify the molecule CCCC(O)C(O)(CC)C(O)CCC by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(O)C(O)(CC)C(O)CCC",
+ "ref_smiles": "CCCC(O)C(O)(CC)C(CCC)NO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5adf8540-5085-4fa5-91be-331d401527bb",
+ "task": "sub",
+ "question": "Modify the molecule CN(Cc1ccccc1Cl)S(=O)(=O)c1ccc(N2CCCC2=O)cc1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccccc1Cl)S(=O)(=O)c1ccc(N2CCCC2=O)cc1",
+ "ref_smiles": "CN(Cc1ccccc1C#N)S(=O)(=O)c1ccc(N2CCCC2=O)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d606de40-6024-41f1-ad92-124b97d9fe09",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]C(CNc1ncc(-c2ccc3cnc(F)cc3c2)s1)Cn1ccc(C(F)(F)F)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CNc1ncc(-c2ccc3cnc(F)cc3c2)s1)Cn1ccc(C(F)(F)F)n1",
+ "ref_smiles": "[NH3+]C(CNc1ncc(-c2ccc3cnccc3c2)s1)Cn1ccc(C(F)(F)F)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3424195-07a5-4adb-8ba0-15ef0b7ec4b2",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]C1(C(=O)[O-])CCN(c2cc(Br)c(F)cc2[N+](=O)[O-])C1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1(C(=O)[O-])CCN(c2cc(Br)c(F)cc2[N+](=O)[O-])C1",
+ "ref_smiles": "[NH3+]C1(C(=O)[O-])CCN(c2cc(C(=O)[OH])c(F)cc2[N+](=O)[O-])C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "899eabc5-7664-4ac5-b098-6b0ba3a23579",
+ "task": "delete",
+ "question": "Modify the molecule O=C(OC12CCN3C(=O)OCC3C1CCC(O)C2O)c1ccccc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OC12CCN3C(=O)OCC3C1CCC(O)C2O)c1ccccc1",
+ "ref_smiles": "O=C(OC12CCN3C(=O)OCC3C1CCCC2O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3666f104-d61e-4884-a27e-9eb969700c17",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC(C)NC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(F)(F)F)cc3)CC2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(F)(F)F)cc3)CC2)c(C)c1.",
+ "ref_smiles": "CCC(C)NC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(F)F)cc3)CC2)c(C)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7fb465b4-dbd9-4a9f-8ae5-d44cf3907b9f",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C(NC(=O)Cn2cnc3c(C)csc3c2=O)C2CC2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(NC(=O)Cn2cnc3c(C)csc3c2=O)C2CC2)cc1",
+ "ref_smiles": "COC(NC(=O)Cn1cnc2c(C)csc2c1=O)C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "622d2935-ff24-482d-a071-29037a0ce888",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)c1c(NC(=O)CSc2nnc(C(C)Oc3cc(Cl)ccc3Cl)n2C)sc2c1CCCCCC2 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1c(NC(=O)CSc2nnc(C(C)Oc3cc(Cl)ccc3Cl)n2C)sc2c1CCCCCC2",
+ "ref_smiles": "COC(=O)c1c(NC(=O)CSc2nnc(C(C)Oc3cc(S)ccc3Cl)n2C)sc2c1CCCCCC2",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2b80f67c-d7c2-48d8-8960-9584ee1a16ee",
+ "task": "add",
+ "question": "Modify the molecule CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(N2CCCC2)nc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1ccc(N2CCCC2)nc1",
+ "ref_smiles": "CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1-c1ccccc1)C(=O)Nc1ccc(N2CCCC2)nc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5b7a6bbf-8a92-4503-af8f-e3290da930c8",
+ "task": "sub",
+ "question": "Modify the molecule FC(F)(F)CCC(Cl)c1cc(Br)c(Br)s1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)CCC(Cl)c1cc(Br)c(Br)s1",
+ "ref_smiles": "O=C([OH])C(F)(F)CCC(Cl)c1cc(Br)c(Br)s1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9360ee0b-3255-435c-9e23-ced9e4b18072",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NNC(=O)c1ccc(COCC(F)(F)C(F)F)o1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NNC(=O)c1ccc(COCC(F)(F)C(F)F)o1",
+ "ref_smiles": "N#CC(F)(COCc1ccc(C(=O)NN)o1)C(F)F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cdb83bdb-fd14-46ef-b69d-64bc7e841a6b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(COC1CC[NH2+]C1)Nc1ccccc1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COC1CC[NH2+]C1)Nc1ccccc1Cl",
+ "ref_smiles": "O=C(COC1CC[NH2+]C1)Nc1ccc(C=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e80656c7-a4a4-456f-bf5b-278d532b7787",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)CCSCc1cccc(Nc2ncnc3[nH]ncc23)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCSCc1cccc(Nc2ncnc3[nH]ncc23)c1",
+ "ref_smiles": "COC(=O)CCSCc1cccc(-c2ncnc3[nH]ncc23)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "87855cbf-d8f8-4997-addf-53bb240504c1",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N1CCC(n2c(=O)c(-c3ccccc3C)cc3cnc(NC4CCN(S(C)(=O)=O)CC4)nc32)C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCC(n2c(=O)c(-c3ccccc3C)cc3cnc(NC4CCN(S(C)(=O)=O)CC4)nc32)C1",
+ "ref_smiles": "Cc1ccccc1-c1cc2cnc(NC3CCN(S(C)(=O)=O)CC3)nc2n(C2CCC2)c1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "41f70df1-f0fb-4892-9eec-cc296249bdfc",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccccc1NC(=O)Nc1ccccc1-c1cn2c([nH+]1)SCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1NC(=O)Nc1ccccc1-c1cn2c([nH+]1)SCC2.",
+ "ref_smiles": "CONC(=O)Nc1ccccc1-c1cn2c([nH+]1)SCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2bdd7c67-7c79-4d95-9359-cb74bf26bb2b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)cc1.",
+ "ref_smiles": "COc1ccc(CC(NC(=O)[O-])c2nc3ccc(F)cc3[nH]2)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "557fb45c-4cca-4b3d-b6e2-c4ac53712697",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C(=O)c1ccc(F)c(F)c1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)c1ccc(F)c(F)c1F",
+ "ref_smiles": "CC(C)(C)C(=O)c1ccc(F)c(F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4a87725e-2955-4920-aad8-a9231eb34942",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C)cc(OCC(=O)NNS(=O)(=O)c2cc(Cl)ccc2Cl)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(OCC(=O)NNS(=O)(=O)c2cc(Cl)ccc2Cl)c1",
+ "ref_smiles": "Cc1cc(C)cc(OCC(=O)NS(=O)(=O)c2cc(Cl)ccc2Cl)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c5063f94-b3e8-4428-8dd3-c52eb5e13662",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3)CC2)cc1.",
+ "ref_smiles": "CC(C)(C)c1ccc(C(=O)NC2CCN(C(=O)Cc3ccccc3C(=O)O)CC2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e3ff887c-741a-48f5-a3dc-fdb4ad552219",
+ "task": "delete",
+ "question": "Modify the molecule C=CCc1cc(C=C2SC(Nc3ccc(CC)cc3)NC2=O)cc(OCC)c1OCC(=O)OCC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(C=C2SC(Nc3ccc(CC)cc3)NC2=O)cc(OCC)c1OCC(=O)OCC",
+ "ref_smiles": "C=CCc1cc(C=C2SC(c3ccc(CC)cc3)NC2=O)cc(OCC)c1OCC(=O)OCC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c92c53ee-49c5-4f34-9902-562bec9d40e5",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule COCCN(CCC#N)c1cccc(C(=O)OC)c1N with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN(CCC#N)c1cccc(C(=O)OC)c1N",
+ "ref_smiles": "COCCN(CCNO)c1cccc(C(=O)OC)c1N",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "261591d9-9aa0-48cb-8af6-4e8d02f6be2d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(CCC(F)(F)F)c1c(F)cccc1C=CC(=O)[O-] with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCC(F)(F)F)c1c(F)cccc1C=CC(=O)[O-]",
+ "ref_smiles": "CN(CCC(F)(F)F)c1c(C=O)cccc1C=CC(=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "43c5ffe8-80a9-4f6b-9130-b7475e19903f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)(C)[NH+]1CC(C(=O)N2CCCC(C3=CCC(Cl)CC3)N(C(=O)N3CCOCC3)CC2)C(C2=C(F)CC(F)C=C2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)[NH+]1CC(C(=O)N2CCCC(C3=CCC(Cl)CC3)N(C(=O)N3CCOCC3)CC2)C(C2=C(F)CC(F)C=C2)C1.",
+ "ref_smiles": "CC(C)(C)[NH+]1CC(C(=O)N2CCN(C(=O)N3CCOCC3)C(C3=CCC(Cl)CC3)CCC2O)C(C2=C(F)CC(F)C=C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5c6371db-69dd-4ab8-ab45-3dd28c639353",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(Cn1cnc2ccsc2c1=O)Nc1ccc(OC(F)(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1cnc2ccsc2c1=O)Nc1ccc(OC(F)(F)F)cc1.",
+ "ref_smiles": "O=C(Cn1cnc2ccsc2c1=O)Nc1ccc(OC(F)F)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a59be0fe-b3c5-4660-9aaf-ed4994abbc41",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CC.",
+ "ref_smiles": "CCCC(Cc1nn(CC)c2ccccc12)[NH2+]CCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "421ad330-3dbe-40bf-a296-cf0514bdba1c",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1cc2c(cc1OCc1cc(COc3cc4c(cc3OC)C(=O)N3C5=C(CCC=C5)CC3CN4)cc(NC(=O)CNC(=O)CNC(=O)CNC(=O)CCC(C)(C)S)c1)NCC1CC3=C(C=CCC3)N1C2=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2c(cc1OCc1cc(COc3cc4c(cc3OC)C(=O)N3C5=C(CCC=C5)CC3CN4)cc(NC(=O)CNC(=O)CNC(=O)CNC(=O)CCC(C)(C)S)c1)NCC1CC3=C(C=CCC3)N1C2=O.",
+ "ref_smiles": "COc1cc2c(cc1OCc1cc(COc3cc4c(cc3OC)C(=O)N3C5=C(CCC=C5)CC3CN4)cc(NC(=O)CNC(=O)CNC(=O)CCC(C)(C)S)c1)NCC1CC3=C(C=CCC3)N1C2=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a83e2936-ca8e-4304-b49a-92fbd2181ec7",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])C1CCCCCC1Cc1c(F)ccc(Br)c1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1CCCCCC1Cc1c(F)ccc(Br)c1F",
+ "ref_smiles": "O=C([O-])C1CCCCCC1Cc1c(F)cccc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d3c3aac1-ae11-4856-8c54-ae27bd5bd9f6",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CN(S(=O)(=O)CCOCC2CCCC2)CCS1(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(S(=O)(=O)CCOCC2CCCC2)CCS1(=O)=O.",
+ "ref_smiles": "O=S1(=O)CCN(S(=O)(=O)CCOCC2CCCC2)CC1Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f3c6adfb-f1c3-4264-a093-e593504b63de",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(N(C)CCc2ccccc2)[n+](OS(=O)(=O)O)c(N)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N(C)CCc2ccccc2)[n+](OS(=O)(=O)O)c(N)n1",
+ "ref_smiles": "CCN(C)c1cc(C)nc(N)[n+]1OS(=O)(=O)O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5751ef04-7746-416e-95cc-e58550b8036f",
+ "task": "add",
+ "question": "Modify the molecule COc1ccccc1C=Cc1ccc2cccc(C(=O)[O-])c2n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C=Cc1ccc2cccc(C(=O)[O-])c2n1",
+ "ref_smiles": "COc1ccc(O)cc1C=Cc1ccc2cccc(C(=O)[O-])c2n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "df8a62b7-ffd4-49bd-8137-fbc7d2a7e6ae",
+ "task": "sub",
+ "question": "Modify the molecule C=C(c1ccccc1)C(C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1C)[N+](=O)[O-] by substituting a nitro with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(c1ccccc1)C(C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1C)[N+](=O)[O-]",
+ "ref_smiles": "C=C(c1ccccc1)C([SH]=O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1C",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "7dec5ba8-3164-4fe1-aad1-1c252d6b60c0",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(OCc2nc(C)c(C)s2)c(CO)n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OCc2nc(C)c(C)s2)c(CO)n1",
+ "ref_smiles": "Cc1ccc(OCc2nc(C)c(C)s2)c(CNO)n1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "08bcf65e-f790-4023-b50c-6f060bc9f276",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)N(C)c1nc(CSc2nnc(COc3ccccc3Cl)n2C2CC2)cs1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(C)c1nc(CSc2nnc(COc3ccccc3Cl)n2C2CC2)cs1",
+ "ref_smiles": "CC(=O)N(C)c1nc(CSc2nnc(COc3ccccc3S)n2C2CC2)cs1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a17c7e14-2b98-4932-a82c-aa63abe81568",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NC1CCCOc2c(F)cccc21)N1CC2CCC1C[NH2+]2 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCCOc2c(F)cccc21)N1CC2CCC1C[NH2+]2",
+ "ref_smiles": "O=C(NC1CCCOc2c(O)cccc21)N1CC2CCC1C[NH2+]2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "44ac78a3-2275-4a5f-84d4-dc2a3bd62506",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ccc(C(=O)Cn2c(-c3nonc3NCC[NH3+])nc3ccccc32)cn1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(C(=O)Cn2c(-c3nonc3NCC[NH3+])nc3ccccc32)cn1",
+ "ref_smiles": "Nc1ccc(C(=O)Cn2c(-c3nonc3CC[NH3+])nc3ccccc32)cn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d8342922-2f25-49ec-bbba-d01cdc75be19",
+ "task": "delete",
+ "question": "Modify the molecule O=C1C(c2ccc(F)cc2)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccc(F)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(c2ccc(F)cc2)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccc(F)cc1",
+ "ref_smiles": "O=C1C(F)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccc(F)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0a9ec780-1797-4683-95d5-bfd19771f654",
+ "task": "delete",
+ "question": "Modify the molecule CCC(CC(OP(=O)([O-])Cc1ccccc1)C(=O)[O-])c1cccc2ccccc12 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC(OP(=O)([O-])Cc1ccccc1)C(=O)[O-])c1cccc2ccccc12",
+ "ref_smiles": "CCC(CC(OP(C)(=O)[O-])C(=O)[O-])c1cccc2ccccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "86a6fc3b-68a3-4554-9ac4-bcddd9e05419",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)c1csc(C2CN(c3ncnc4ccc(Br)cc34)CCO2)n1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1csc(C2CN(c3ncnc4ccc(Br)cc34)CCO2)n1",
+ "ref_smiles": "CC(C)(C)c1csc(C2CN(c3ncnc4ccc(C#N)cc34)CCO2)n1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f8971cf0-e94f-4b21-935e-ce5f8d1e5d58",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COCOCCC(C)CC(C)C(OCOCc1ccccc1)C(C)CC(C)CCO with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCOCCC(C)CC(C)C(OCOCc1ccccc1)C(C)CC(C)CCO",
+ "ref_smiles": "COCOCCC(C)CC(C)C(OCOCc1ccccc1)C(C)CC(C)CCNO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "17151480-9658-44d3-b8c2-7c7f28422607",
+ "task": "delete",
+ "question": "Modify the molecule CC([NH3+])CCCCOc1cccc(F)c1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])CCCCOc1cccc(F)c1F",
+ "ref_smiles": "CC([NH3+])CCCCOc1cccc(F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "381a4cc2-0967-4029-8081-57ffaaf278e8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1nc(N)cc(Oc2cc(Cl)ccc2C)n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc(N)cc(Oc2cc(Cl)ccc2C)n1",
+ "ref_smiles": "CCCc1nc(N)cc(Oc2cc(S)ccc2C)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "07a27e14-be74-4116-badd-a0ba6748807c",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCCC2C2CCC[NH2+]2)c(Br)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N2CCCC2C2CCC[NH2+]2)c(Br)c1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N2CCCC2C2CCC[NH2+]2)c(C=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e27d9424-4833-4e7e-b504-4c7fc0ce05ba",
+ "task": "add",
+ "question": "Modify the molecule Cn1cc(C([NH3+])c2ccccc2C(C)(C)C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(C([NH3+])c2ccccc2C(C)(C)C)cn1",
+ "ref_smiles": "Cn1cc(C([NH3+])c2cc(O)ccc2C(C)(C)C)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "86013dc0-53f8-4a3d-9718-9c4123bf5fcf",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1noc(C=Cc2cn(CCOc3ccccc3)c3ccccc23)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C=Cc2cn(CCOc3ccccc3)c3ccccc23)c1[N+](=O)[O-].",
+ "ref_smiles": "Cc1noc(C=Cc2cn(CCOc3ccc(-c4ccccc4)cc3)c3ccccc23)c1[N+](=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fd23d902-cb98-4030-97b7-1628fade1c00",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(Br)ccc1NC(=O)CCn1cnc2ccccc21 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Br)ccc1NC(=O)CCn1cnc2ccccc21",
+ "ref_smiles": "Cc1cc(S)ccc1NC(=O)CCn1cnc2ccccc21",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bc07ede9-17ba-4bbf-92d9-5c47dcea4efc",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(O)CCSc1cc2ccccc2[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(O)CCSc1cc2ccccc2[nH]1",
+ "ref_smiles": "CC(C)(O)CCSc1cc2c(O)cccc2[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "14751c10-6bed-4060-934a-42f62c00941e",
+ "task": "delete",
+ "question": "Modify the molecule CCC([NH3+])Cc1cc(C)ccc1OCCC(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC([NH3+])Cc1cc(C)ccc1OCCC(F)(F)F",
+ "ref_smiles": "CCC([NH3+])Cc1cc(C)ccc1OCCC(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "25abbcc3-10e0-484f-afa1-e0c0532c411e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule S=C(S)NCC[NH2+]C(S)S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "S=C(S)NCC[NH2+]C(S)S.",
+ "ref_smiles": "OC(S)(S)[NH2+]CCNC(=S)S",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "260997a1-1575-43c5-aa98-b639f04ade02",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cn1cc(-c2ccc(F)cc2)cn1)N1CCC([NH+]2CCc3ccccc3C2)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1cc(-c2ccc(F)cc2)cn1)N1CCC([NH+]2CCc3ccccc3C2)C1",
+ "ref_smiles": "N#Cc1ccc(-c2cnn(CC(=O)N3CCC([NH+]4CCc5ccccc5C4)C3)c2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d180715b-2a7c-4631-af4f-3989e1a36e29",
+ "task": "sub",
+ "question": "Modify the molecule CCN(CC(=O)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)S(=O)(=O)c1ccc(Br)cc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC(=O)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)S(=O)(=O)c1ccc(Br)cc1",
+ "ref_smiles": "CCN(CC(=O)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d20274c4-5d91-457e-b810-20fcfd2fe13d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)COc1cccc(C([O-])=C2C(=O)C(=O)N(c3ccc(Nc4ccccc4)cc3)C2c2ccc(F)cc2)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COc1cccc(C([O-])=C2C(=O)C(=O)N(c3ccc(Nc4ccccc4)cc3)C2c2ccc(F)cc2)c1",
+ "ref_smiles": "CC(=O)c1ccc(C2C(=C([O-])c3cccc(OCC(C)C)c3)C(=O)C(=O)N2c2ccc(Nc3ccccc3)cc2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "37b9c973-7f73-40dc-b828-4a3dc9588199",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NC1CC(=O)N(I)c2ccccc21)c1ccc2c(c1)CCC1(CCNC1=O)C2 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CC(=O)N(I)c2ccccc21)c1ccc2c(c1)CCC1(CCNC1=O)C2",
+ "ref_smiles": "O=C(NC1CC(=O)NHc2ccc(CHO)cc21)c1ccc2c(c1)CCC1(CCNC1=O)C2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "45343395-025a-45a8-b425-c005e204287d",
+ "task": "sub",
+ "question": "Modify the molecule CCCC(C)(CC)N([O-])C(C)(CC)CC(C)(O)CC by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)(CC)N([O-])C(C)(CC)CC(C)(O)CC",
+ "ref_smiles": "CCCC(C)(CC)N([O-])C(C)(CC)CC(C)(S)CC",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "106bf72e-991f-4867-a538-73494ddbcd7d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)C)cc3)n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)C)cc3)n2)cc1.",
+ "ref_smiles": "COc1ccc(-c2csc(CCC(=O)Nc3ccc(N(C)CO)cc3)n2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6bdb47f2-92a3-4906-8f81-18c1c3640617",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(O)CCC(=O)N1C(=O)c2cccc(N)c2C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)CCC(=O)N1C(=O)c2cccc(N)c2C1=O.",
+ "ref_smiles": "CC(O)CCC(=O)N1C(=O)c2ccccc2C1=O",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3580c932-e5e6-41f4-846a-58bf99fc0935",
+ "task": "sub",
+ "question": "Modify the molecule CCc1cnc(C(C)Nc2ncc(Br)c(OC)n2)s1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cnc(C(C)Nc2ncc(Br)c(OC)n2)s1",
+ "ref_smiles": "CC(=O)c1cnc(NC(C)c2ncc(CC)s2)nc1OC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8ac60bad-18a0-4cb9-81be-2bab294e285d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC1CC1(NC(=O)C1CC2CN1C(=O)C(C1CCCC1)NC(=O)OC1CCCC1CCCCCc1c(cc3ccccc3[n+]1O)O2)C(=O)NS(=O)(=O)C1CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CC1(NC(=O)C1CC2CN1C(=O)C(C1CCCC1)NC(=O)OC1CCCC1CCCCCc1c(cc3ccccc3[n+]1O)O2)C(=O)NS(=O)(=O)C1CC1",
+ "ref_smiles": "CCC1CC1(NC(=O)C1CC2CN1C(=O)C(C1CCCC1)NC(=O)OC1CCCC1CCCCCc1c(cc3ccccc3[n+]1NO)O2)C(=O)NS(=O)(=O)C1CC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "93651be8-0382-43cb-b092-1171ef9f8672",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+]1CCC(Oc2ccc(C(N)=S)cc2Br)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(Oc2ccc(C(N)=S)cc2Br)CC1.",
+ "ref_smiles": "C[NH+]1CCC(Oc2ccc(C(N)=S)c(-c3ccccc3)c2Br)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ab66270e-b533-4827-b1ed-f02b88faab47",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1.",
+ "ref_smiles": "NCC[NH+]1CCN(S(=O)(=O)c2ccc(CC(=O)[O-])s2)CC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "47ad2942-a2af-4d7e-bb65-c338ec118adf",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C1OC(c2ccc(I)c(Br)c2)=NC1=Cc1ccccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1OC(c2ccc(I)c(Br)c2)=NC1=Cc1ccccc1F.",
+ "ref_smiles": "O=C1OC(c2ccc(I)c(Br)c2)=NC1=Cc1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8a043e1f-c9bf-422e-bc54-d0e82c92d943",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nccc(NC(=O)NCC(C)(O)C2CCCCC2)n1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nccc(NC(=O)NCC(C)(O)C2CCCCC2)n1",
+ "ref_smiles": "Cc1nccc(NC(=O)NCC(C)C2CCCCC2)n1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a38541c8-a33f-4554-8309-98682b452a6f",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)OC(CCNC(=O)OC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)OC(CCNC(=O)OC(C)(C)C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F",
+ "ref_smiles": "CC(=O)OC(CCNC(=O)OC(C)(C)CO)C(=O)Oc1c(F)c(F)c(F)c(F)c1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e7258bbf-3880-4d3a-bd30-7b2f10039138",
+ "task": "add",
+ "question": "Modify the molecule CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)C)CC1",
+ "ref_smiles": "CCCC(C)([NH3+])C(=O)NCC1CCN(CC[NH+](C)CO)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6236d98c-9350-4aad-954c-78f6f2b41ff1",
+ "task": "add",
+ "question": "Modify the molecule CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1",
+ "ref_smiles": "CCCCNC(=[NH+]Cc1nnc(C)n1C)N1CCC(c2ccccc2)C1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f2623f9a-b7b8-4bc8-9e4d-45aae4cd2464",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(-c2ccc(Cl)nc2C)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2ccc(Cl)nc2C)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O",
+ "ref_smiles": "CCc1ccc(-c2ccc(Cl)nc2CC#N)cc1C1=C([O-])C(C)(C)OC(C)(C)C1=O",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "5a6968b2-dce3-44bc-a06a-ed3b5729b451",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2ccccc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2ccccc2)c1.",
+ "ref_smiles": "CN(C)S(=O)(=O)n1cnc(C=CC[NH2+]C(c2ccccc2)c2cccc(O)c2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e91ee108-6288-4647-b6ec-83f0e836ab07",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCOc1c(Cl)cc(C(=O)OCC(=O)NC(=O)NC(C)(C)C)cc1OCC with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1c(Cl)cc(C(=O)OCC(=O)NC(=O)NC(C)(C)C)cc1OCC",
+ "ref_smiles": "CCCCOc1c(S)cc(C(=O)OCC(=O)NC(=O)NC(C)(C)C)cc1OCC",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5ff138f9-fab9-4be1-8a04-c2986b1b7c63",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(c1cccc(F)c1)N1CCC(c2noc(-c3ccc(Cl)cc3)n2)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1cccc(F)c1)N1CCC(c2noc(-c3ccc(Cl)cc3)n2)CC1",
+ "ref_smiles": "O=S(=O)(c1cccc(F)c1)N1CCC(c2noc(-c3ccccc3)n2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2419aaaf-9c8b-4fd6-858e-33df3ca40d58",
+ "task": "add",
+ "question": "Modify the molecule C[Si](C)(C)C#CC#CI by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)C#CC#CI",
+ "ref_smiles": "C[Si](C)(C#CC#CI)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7a980cd1-6e09-42ad-8778-881a3115625d",
+ "task": "delete",
+ "question": "Modify the molecule CCC(CC)N(CCCl)C(=O)c1ncccc1C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)N(CCCl)C(=O)c1ncccc1C",
+ "ref_smiles": "CCC(CC)N(CC)C(=O)c1ncccc1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1b7fb44b-af56-4404-8114-39fba010ad98",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COCCC(=O)N1CC(S(=O)(=O)c2ccc(F)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC(=O)N1CC(S(=O)(=O)c2ccc(F)cc2)C1.",
+ "ref_smiles": "COCCC(=O)N1CC(S(=O)(=O)F)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "61951bba-5ffd-4be4-b181-17fa9a793af9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CNc1cnccc1C(=O)N1CCCC(C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cnccc1C(=O)N1CCCC(C)CC1.",
+ "ref_smiles": "CNc1c(C(=O)N2CCCC(C)CC2)ccnc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4d071832-12d6-4575-94ea-731446cf4be7",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCC(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1",
+ "ref_smiles": "CC1CCC(c2ccccc2)C(C)[NH+]1CCc1cn2cc(N)ccc2[nH+]1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f33f0fcb-0b87-410f-b4c9-c9fe6c4068a8",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2)cc1",
+ "ref_smiles": "COc1ccc(N2CCN(C(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)CC2c2ccccc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2c5eaf31-4266-44ee-966e-957bc162f7e9",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC[NH+](CCC[NH+](C)C)CC(=O)NC(C(C)=O)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CCC[NH+](C)C)CC(=O)NC(C(C)=O)C(C)C.",
+ "ref_smiles": "CC[NH+](CCC[NH+](C)C)C(C(C)=O)C(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5e0c9d7a-2762-411e-a7c8-eb9f6a787dbd",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5)cc4)c3)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5)cc4)c3)c2)CC1.",
+ "ref_smiles": "C[NH+]1CCN(C(=O)c2cccc(-c3cccc(CC(NC(=O)C4CCC(CNC(=O)OC(C)(C)C)CC4)C(=O)Nc4ccc(-c5n[nH]c(Cl)n5-cc4-c4ccccc4)cc4)c3)c2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7aac2c23-f268-4593-a070-a972682cc3e6",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C2CCCN2S(=O)(=O)c2cccc(-c3nc(C)cs3)c2)on1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C2CCCN2S(=O)(=O)c2cccc(-c3nc(C)cs3)c2)on1",
+ "ref_smiles": "Cc1cc(C2CCCN2S(=O)(=O)c2nc(C)cs2)on1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c0589078-7c54-4dc3-80ba-15a073377aba",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1(CCNS(=O)(=O)CCc2ccccc2)OCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(CCNS(=O)(=O)CCc2ccccc2)OCCO1.",
+ "ref_smiles": "CC1(CCNS(=O)(=O)CCc2ccccc2O)OCCO1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c1d74f81-1e91-4f61-92c5-d0b40ab29610",
+ "task": "sub",
+ "question": "Modify the molecule NC(=O)c1c(C(F)(F)F)cc(-c2ccccc2)[nH]c1=O by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1c(C(F)(F)F)cc(-c2ccccc2)[nH]c1=O",
+ "ref_smiles": "NC(=O)c1C(=O)cc(-c2ccccc2)[nH]c1=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "28950847-641d-45c8-819a-7ea0d9c4d0e7",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1.",
+ "ref_smiles": "Cc1ccc(-n2nc(C(C)(C)Cc3ccccc3)cc2NC(=O)Nc2ccc(CC3CCN(S(=O)(=O)c4ccc(F)c(Cl)c4)CC3)cc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f7a93606-ce99-4e2b-a8cc-aa185c0b1151",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(Nc2nc(-c3ccc(C(=O)NN=Cc4c(OCc5ccccc5Cl)ccc5ccccc45)cc3)cs2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Nc2nc(-c3ccc(C(=O)NN=Cc4c(OCc5ccccc5Cl)ccc5ccccc45)cc3)cs2)cc1",
+ "ref_smiles": "Cc1ccc(Nc2nc(-c3ccc(C(=O)NN=Cc4c(OCc5ccccc5S)ccc5ccccc45)cc3)cs2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "03a1c6ab-00a6-4919-a1fe-bc079eb8de68",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1c(Br)cccc1C(O)C(C[NH3+])c1ccccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Br)cccc1C(O)C(C[NH3+])c1ccccc1F.",
+ "ref_smiles": "Cc1c(Br)cccc1C(O)C(C[NH3+])c1c(N)cccc1F",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "01ec1ad1-e1f0-48d1-914e-a7f5aa60e57a",
+ "task": "add",
+ "question": "Modify the molecule CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2)cc1",
+ "ref_smiles": "CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(-n3ccc(C)n3)c(Oc3cccc(C)c3)c2O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5cc11f38-810f-4aa6-bec6-bfd020a0854f",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1.",
+ "ref_smiles": "COc1cc(-c2ccccc2)c(C=NNC(=O)c2ccc(Cl)cc2Cl)cc1CSc1nc(C)cc(C(F)F)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "101c2251-aa0b-42c8-8397-7d71574b6c67",
+ "task": "add",
+ "question": "Please add a amine to the molecule CS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].",
+ "ref_smiles": "NCS(=O)(=O)c1ccnc2c1c(Sc1cnsc1)c1n2CCCC1CC(=O)[O-].",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "b097241c-4a74-4ea4-a49a-426eb910107d",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC[NH+]=C(N)NC1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]=C(N)NC1CCCC1.",
+ "ref_smiles": "CCC(N)NC1CCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b747e7ca-3b70-48f5-96d2-7bd92a13d14b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule c1ccc2c(c1)CCCC2[NH2+]CCc1cscn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc2c(c1)CCCC2[NH2+]CCc1cscn1.",
+ "ref_smiles": "O=C(O)c1cccc2c1C([NH2+]CCc1cscn1)CCC2",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "838ec77d-e862-48e0-95c3-944242721f46",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule OCc1c(F)cncc1-c1ccc(C(F)(F)F)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCc1c(F)cncc1-c1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "O=Cc1ccncc(-c2ccc(C(F)(F)F)cc2)c1O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "72d56a0f-f406-4609-972a-e14b839d4155",
+ "task": "delete",
+ "question": "Modify the molecule CCCS(=O)Cc1nc2ccccc2n1-c1ccc(-c2ccccc2C(=O)[O-])c(C)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCS(=O)Cc1nc2ccccc2n1-c1ccc(-c2ccccc2C(=O)[O-])c(C)c1",
+ "ref_smiles": "CCCS(=O)Cc1nc2ccccc2n1Cc1ccccc1C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "babeb1cb-b2b3-488a-bd5c-886ad4bbcb56",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(C2CCCN2S(=O)(=O)N2CCC(COC)C2)o1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C2CCCN2S(=O)(=O)N2CCC(COC)C2)o1",
+ "ref_smiles": "COCC1CCN(S(=O)(=O)N2CCCC2c2ccc(C(C)C(=O)O)o2)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "72931d5a-f01f-4f7e-b090-a031f5b758cb",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]CCCCCS(=O)(=O)c1ccc(Cl)cc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCCCS(=O)(=O)c1ccc(Cl)cc1",
+ "ref_smiles": "[NH3+]CCCCCS(=O)(=O)c1ccc(S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "33859be9-4472-47eb-956a-ed30e610b6d9",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1nc(-c2ccc(Cl)cc2)oc1NCc1ccco1 by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1nc(-c2ccc(Cl)cc2)oc1NCc1ccco1",
+ "ref_smiles": "CC(=O)c1nc(-c2ccc(Cl)cc2)oc1NCc1ccco1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6eacf91e-c84e-47b6-9a2d-06f0bfd5b092",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC([NH3+])CCC(=O)C1CCCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])CCC(=O)C1CCCCCC1.",
+ "ref_smiles": "CC([NH3+])CCC(=O)C1CCCCCC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "872a7f84-c62e-4136-8990-cb86e42e7aa4",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOc1cc(O)ccc1C(=C(Cl)Cl)c1ccc(O)cc1OCC with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(O)ccc1C(=C(Cl)Cl)c1ccc(O)cc1OCC",
+ "ref_smiles": "CCOc1cc(O)ccc1C(=C(Cl)Cl)c1ccc(S)cc1OCC",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "18f8e120-7983-4175-a715-52a586fd0e52",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(-c2nc3ccc(Cl)cn3c2CN2CCC[NH2+]CC2)cc1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nc3ccc(Cl)cn3c2CN2CCC[NH2+]CC2)cc1C",
+ "ref_smiles": "CCc1nc2ccc(Cl)cn2c1CN1CCC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "09f58a71-7fb9-4e03-9061-3cb42313ad33",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NCc2ccc(C(=O)[O-])cc2Br)c(C)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NCc2ccc(C(=O)[O-])cc2Br)c(C)c1",
+ "ref_smiles": "Cc1ccc(Cc2ccc(C(=O)[O-])cc2Br)c(C)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "8ba09c7a-769b-4fa5-92d5-4508bc29a26c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(CC(N)=O)NC(=O)c1c(F)cccc1Br with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC(N)=O)NC(=O)c1c(F)cccc1Br",
+ "ref_smiles": "CC(CC(N)=O)NC(=O)c1c(Br)cccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c91179ad-d9d2-4c3f-8ebf-23c7ede17274",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C(=O)C2CCC(C3CCC(C)CC3)OC2)c(F)c1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)C2CCC(C3CCC(C)CC3)OC2)c(F)c1Cl",
+ "ref_smiles": "Cc1ccc(C(=O)C2CCC(C3CCC(C)CC3)OC2)cc1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5daf7717-e8b0-4771-bf85-948a5c2e974d",
+ "task": "add",
+ "question": "Modify the molecule CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(C2)[NH2+]3)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(C2)[NH2+]3)CC1",
+ "ref_smiles": "CC1CC[NH+](Cc2ccccc2CNC(=O)CC2CC3CCC(O)(C2)[NH2+]3)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2d9080d3-e197-4ae5-b90b-3691e701331b",
+ "task": "add",
+ "question": "Modify the molecule Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)C",
+ "ref_smiles": "Cc1nc(N2CCS(=O)(=O)CC2)ncc1C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7507cf46-3850-4d47-b403-8d0e2245408b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OC(C[NH2+]C1CCCC1C1COCC[NH2+]1)c1cc(Cl)c2c(c1)OCCO2 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(C[NH2+]C1CCCC1C1COCC[NH2+]1)c1cc(Cl)c2c(c1)OCCO2",
+ "ref_smiles": "N#CC(C[NH2+]C1CCCC1C1COCC[NH2+]1)c1cc(Cl)c2c(c1)OCCO2",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6b3dcdb5-aece-4c20-87ac-206335805672",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(N2CCC([NH+]3CCN(C(C)=O)CC3)CC2)ccc1[N+](=O)[O-] by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(N2CCC([NH+]3CCN(C(C)=O)CC3)CC2)ccc1[N+](=O)[O-]",
+ "ref_smiles": "COc1cc(N2CCC([NH+]3CCCC3)CC2)ccc1[N+](=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "904d71cd-7b0d-42a9-bb0b-ed196cba93e0",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH+](C)CCCOc1ncc(I)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCOc1ncc(I)cn1.",
+ "ref_smiles": "C[NH+](C)CCCOc1ncccn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b0e6aa59-e142-44f5-b294-e3a4f1962cc6",
+ "task": "delete",
+ "question": "Modify the molecule NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(C(=O)c3ccccc3)cc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(C(=O)c3ccccc3)cc2)cc1",
+ "ref_smiles": "NS(=O)(=O)CCNC(=O)c1ccc(C(=O)c2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0be397e9-a190-4af2-a6fa-e3afcf3b5d5b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1C(=Cc2cccc(OCc3ccc(Cl)cc3)c2)SC(=S)N1C1CCCCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(=Cc2cccc(OCc3ccc(Cl)cc3)c2)SC(=S)N1C1CCCCC1",
+ "ref_smiles": "O=C1C(=Cc2cccc(OCc3ccc(O)cc3)c2)SC(=S)N1C1CCCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ea8d637a-aef0-48a5-8d3c-e72d0818ac98",
+ "task": "add",
+ "question": "Modify the molecule NCC(CN1CC[NH+](Cc2ccccc2)CC1)C(F)(F)F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NCC(CN1CC[NH+](Cc2ccccc2)CC1)C(F)(F)F",
+ "ref_smiles": "NCC(CN1CC[NH+](Cc2ccccc2)CC1c1ccccc1)C(F)(F)F",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8644b97a-b804-49fa-b173-2cbd91670069",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cnc(CNC(=O)c2cc(-c3ncc(F)cc3F)cc(-n3nnnc3C(C)C)c2)cn1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(CNC(=O)c2cc(-c3ncc(F)cc3F)cc(-n3nnnc3C(C)C)c2)cn1",
+ "ref_smiles": "Cc1cnc(CNC(=O)c2cc(-c3ncc(S)cc3F)cc(-n3nnnc3C(C)C)c2)cn1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0925ed4b-7bea-4f2f-8c95-889165c8e402",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C([O-])C(O)c1cc(O)c(F)cc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(O)c1cc(O)c(F)cc1Br.",
+ "ref_smiles": "O=C([O-])C(O)c1ccc(F)cc1Br",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "17eacb3c-3446-4567-963a-5b3c5e951975",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)(C)C(=O)NCCC(=O)Nc1cc(Cl)ccc1N1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)NCCC(=O)Nc1cc(Cl)ccc1N1CCOCC1.",
+ "ref_smiles": "CCCCCC(=O)Nc1cc(Cl)ccc1N1CCOCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "7aa85203-f3ef-4ca2-bb85-7c806e968b83",
+ "task": "add",
+ "question": "Modify the molecule COCC[NH+](Cc1ccccc1)CC1(C)CC[NH2+]C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC[NH+](Cc1ccccc1)CC1(C)CC[NH2+]C1",
+ "ref_smiles": "CC1(C[NH+](CCOCc2ccccc2)Cc2ccccc2)CC[NH2+]C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4fb210fb-ae16-4ab8-804a-134264f946ff",
+ "task": "sub",
+ "question": "Modify the molecule O=C1CN(C(=O)Nc2ccccc2Br)c2ccccc2N1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CN(C(=O)Nc2ccccc2Br)c2ccccc2N1",
+ "ref_smiles": "O=C1CN(C(=O)Nc2ccc(C=O)cc2)c3ccccc3N1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "83acfd4b-c8d9-4575-bed7-0d0457e8c2da",
+ "task": "add",
+ "question": "Modify the molecule CC(CC#N)c1ccc(F)cc1F by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC#N)c1ccc(F)cc1F",
+ "ref_smiles": "CC(c1ccc(F)cc1F)C(C#N)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cdeb9f2f-204e-4ed9-ac8c-77531490a4b1",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)C(=O)COC(=O)c1ccccc1N1C(=O)C2CC(Br)C(Br)CC2C1=O by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)COC(=O)c1ccccc1N1C(=O)C2CC(Br)C(Br)CC2C1=O",
+ "ref_smiles": "CC(C)(C)C(=O)COC(=O)c1ccccc1N1C(=O)C2CC(Br)C(C(=O)O)CC2C1=O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "800fa180-e192-4f31-8cc2-106f646b8e84",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)C(NC(=O)c1ccc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(NC(=O)c1ccc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C.",
+ "ref_smiles": "CC(C)C(NC(=O)c1c(-c2ccccc2)cc(Cl)cc1-n1cnnn1)c1nc2ccccc2n1C(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9d6bf382-0ed6-4193-82a3-f864cbe9bb48",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc2c(c(OC)c1Cl)COC2=O by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2c(c(OC)c1Cl)COC2=O",
+ "ref_smiles": "COc1cc(OC)c2c(c1)C(=O)OC2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0885fdb9-934c-4e74-8f63-d750263349da",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)CCn1ccn(C2CC2)c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)CCn1ccn(C2CC2)c1=O",
+ "ref_smiles": "CC(C)(CCn1ccn(C2CC2)c1=O)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "26bebca9-efe0-453a-bb33-bfcf2a0d4aa1",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(Cl)c(C)cc1NC(=O)c1cncc(C(=O)NC(C)C)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)c(C)cc1NC(=O)c1cncc(C(=O)NC(C)C)c1",
+ "ref_smiles": "COc1cc(S)c(C)cc1NC(=O)c1cncc(C(=O)NC(C)C)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3ff0a17-3cf5-47cb-b997-cdd2e4ccafb0",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc(Nc2cc(C)nc(N)n2)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Nc2cc(C)nc(N)n2)c(F)c1.",
+ "ref_smiles": "Cc1ccc(c2cc(C)nc(N)n2)c(F)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "9f92bfa3-bf42-4925-a55b-33bf4ca07ee6",
+ "task": "add",
+ "question": "Modify the molecule CC1CSCCN1C(=O)C1CC2CCC1[NH2+]2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CSCCN1C(=O)C1CC2CCC1[NH2+]2",
+ "ref_smiles": "CC1C(c2ccccc2)SCCN1C(=O)C1CC2CCC1[NH2+]2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c899da08-8a59-4242-9cbc-6a4a3bb68472",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCC(NC(=O)C1CCC1)c1cccc(C(F)(F)F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(NC(=O)C1CCC1)c1cccc(C(F)(F)F)c1",
+ "ref_smiles": "COCC(NC(=O)C1CCC1)c1cccc(C(F)(F)C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b34312ef-e7ab-4d53-91b7-8bbd120060ae",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH2+]C(Cc1ccc(F)c(Br)c1)C1CCc2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(Cc1ccc(F)c(Br)c1)C1CCc2ccccc21.",
+ "ref_smiles": "C[NH2+]C(Cc1cc(Br)c(F)cc1O)C1CCc2ccccc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cd44f306-0ba8-4b8d-aac0-6e8c7633074c",
+ "task": "sub",
+ "question": "Modify the molecule Nc1cc2c(=O)nc[nH]c2cc1Nc1cc(Br)ccc1Cl by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc2c(=O)nc[nH]c2cc1Nc1cc(Br)ccc1Cl",
+ "ref_smiles": "Nc1cc2c(=O)nc[nH]c2cc1Nc1cc(O)ccc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "37a5b285-886d-44d5-ac52-1d5aa494ff57",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1=C(C)CC(C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)C(C(=O)[O-])C1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(C)CC(C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)C(C(=O)[O-])C1",
+ "ref_smiles": "CC1=C(C)CC(C(=O)Nc2nc(-c3ccc(C(=O)[OH])cc3)cs2)C(C(=O)[O-])C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "35967a39-71b1-48e5-8e5f-a7fee9861c03",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1cccc(F)c1-c1cccc(Br)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cccc(F)c1-c1cccc(Br)n1",
+ "ref_smiles": "CC(=O)c1cccc(F)c1-c1cccc(Br)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bd107126-9fcb-436a-90b7-9776556085e0",
+ "task": "add",
+ "question": "Modify the molecule CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)CC1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)CC1",
+ "ref_smiles": "CC1CC[NH+](CCCCNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2C#N)CC1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "d37155e2-40ac-4cd1-8654-bc0e3f2e9415",
+ "task": "delete",
+ "question": "Modify the molecule Cc1[nH]nc(N=Nc2c(S(=O)(=O)[O-])cc3cc(SOOO)cc(O)c3c2N)c1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH]nc(N=Nc2c(S(=O)(=O)[O-])cc3cc(SOOO)cc(O)c3c2N)c1Cl",
+ "ref_smiles": "Cc1cc(N=Nc2c(S(=O)(=O)[O-])cc3cc(SOOO)cc(O)c3c2N)n[nH]1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d58d6b87-3ad4-4548-acee-e54cf0bee4b2",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule [NH3+]CCc1c(Cl)cccc1OCOCC1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCc1c(Cl)cccc1OCOCC1CC1.",
+ "ref_smiles": "[NH3+]CCc1ccccc1OCOCC1CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "51286b07-58aa-4ef0-8228-d36922312889",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]C1CCCN(C(=O)c2cc(-n3cccn3)ccn2)C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CCCN(C(=O)c2cc(-n3cccn3)ccn2)C1",
+ "ref_smiles": "[NH3+]C1CCCC1n1ccc(-n2cccn2)c-1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0620f976-3f2a-45c3-a669-fdcc938a848b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)CC1.",
+ "ref_smiles": "CC1CC[NH+](CCNS(=O)(=O)c2cc3c4c(c2)CC(=O)N4CCC3)C(C(=O)O)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "462644e9-d873-4c80-9d0e-ca98991682cc",
+ "task": "delete",
+ "question": "Modify the molecule CC(C(N)=O)c1cn(CCC(F)(F)F)c(=S)[nH]1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(N)=O)c1cn(CCC(F)(F)F)c(=S)[nH]1",
+ "ref_smiles": "Cc1cn(CCC(F)(F)F)c(=S)[nH]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d460b671-a59c-4731-bca7-7bdab97c8f2a",
+ "task": "add",
+ "question": "Modify the molecule Cc1noc(C)c1CC(=O)NCC1CC(O)C[NH+]1Cc1ccccc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1CC(=O)NCC1CC(O)C[NH+]1Cc1ccccc1",
+ "ref_smiles": "Cc1noc(C)c1CC(=O)NCC1C(N)C(O)C[NH+]1Cc1ccccc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "204ef75e-fae2-4f13-b208-f7d5111fec97",
+ "task": "sub",
+ "question": "Modify the molecule O=C(c1ccccc1)C(Br)CC[NH+]1CCC(=Cc2ccc(F)cc2)CC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccccc1)C(Br)CC[NH+]1CCC(=Cc2ccc(F)cc2)CC1",
+ "ref_smiles": "O=C([OH])C(CC[NH+]1CCC(=Cc2ccc(F)cc2)CC1)C(=O)c1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bcf0b0b9-ca76-4d8d-84e8-f3614e716f85",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(C(=O)[O-])cc1NC(=O)NCCS(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)[O-])cc1NC(=O)NCCS(C)=O.",
+ "ref_smiles": "Cc1ccc(C(=O)[O-])cc1NC(=O)NCC(O)S(C)=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fafce5a5-b707-4452-ae8b-1f606e30601b",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccccc1CC(=O)N1CCC(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CC(=O)N1CCC(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)CC1.",
+ "ref_smiles": "COc1ccccc1C1CCC(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "12107900-bcff-4732-af94-b38de00e293a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1Cc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1Cc1ccccc1.",
+ "ref_smiles": "O=C(C[P+](c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1)N1C(=O)OCC1Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "39e2cccf-c8ed-4876-9824-30426837aabd",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3CCCC3)cc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3CCCC3)cc2)cc1",
+ "ref_smiles": "CC(=O)c1ccc([N-]S(=O)(=O)c2ccc(C(=O)NC3(O)CCCC3)cc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d745e41c-fd76-4dac-9fb3-8c6c51ce787d",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CC(=O)c2c([nH]c(-c3ccnc(NC4CCC4)c3)c2Nc2ccccc2)C1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC(=O)c2c([nH]c(-c3ccnc(NC4CCC4)c3)c2Nc2ccccc2)C1",
+ "ref_smiles": "CC1(C)CC(=O)c2c([nH]c(-c3ccnc(C4CCC4)c3)c2Nc2ccccc2)C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7452ade2-96bc-43d1-aebc-72a7642e0334",
+ "task": "sub",
+ "question": "Modify the molecule CCc1noc(NC(C)=O)c1-c1ccc(C)c(S(=O)(=O)Nc2cc(Cl)ccc2C)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1noc(NC(C)=O)c1-c1ccc(C)c(S(=O)(=O)Nc2cc(Cl)ccc2C)c1",
+ "ref_smiles": "CC(=O)c1ccc(C)c(NS(=O)(=O)c2cc(-c3c(CC)noc3NC(C)=O)ccc2C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7bbcff4f-0150-458e-a709-9e56caaaf6d6",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC(C)(C)C([NH2+]C)c1c(Cl)cnn1C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)C([NH2+]C)c1c(Cl)cnn1C(C)C.",
+ "ref_smiles": "CCC(C)(C)C([NH2+]C)c1ccnn1C(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "711d978a-4d96-4b99-8bcc-0f3047dc2cac",
+ "task": "add",
+ "question": "Please add a amine to the molecule COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)CC2)c1.",
+ "ref_smiles": "COC(=O)c1csc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccc(Cl)cc4)s3)C(N)C2)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "c58b1651-5bed-42d7-8fb1-2a96d34f296f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cn1cc(-c2cc3c(cn2)[nH]c2ncc(F)c(-c4ccc(C(=O)NC5CCCCC5CO)cc4)c23)cn1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(-c2cc3c(cn2)[nH]c2ncc(F)c(-c4ccc(C(=O)NC5CCCCC5CO)cc4)c23)cn1",
+ "ref_smiles": "Cn1cc(-c2cc3c(cn2)[nH]c2ncc(F)c(-c4ccc(C(=O)NC5CCCCC5CBr)cc4)c23)cn1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "60ab80b7-9491-4ae6-9b19-02ac045d58d9",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1csc(SCC(=O)Nc2c(C#N)c3c(n2CC2CCCO2)CCCC3)n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(SCC(=O)Nc2c(C#N)c3c(n2CC2CCCO2)CCCC3)n1",
+ "ref_smiles": "Cc1csc(SCC(=O)Nc2c(S)c3c(n2CC2CCCO2)CCCC3)n1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "77145fbc-aac5-465c-9084-17c16a0d7dd8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NCCc1ccccc1)c1ccc(F)cc1O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCc1ccccc1)c1ccc(F)cc1O",
+ "ref_smiles": "O=C([OH])c1ccc(C(=O)NCCc2ccccc2)c(O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b151f08c-2672-4a26-8eed-afffa0b2bda6",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)OCC1OC(Oc2n[nH]c(C(C)C)c2Cc2ccc(CCNC(=O)NC(C(N)=O)C(C)O)cc2C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)OCC1OC(Oc2n[nH]c(C(C)C)c2Cc2ccc(CCNC(=O)NC(C(N)=O)C(C)O)cc2C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O",
+ "ref_smiles": "CC(=O)OCC1OC(Oc2n[nH]c(C(C)C)c2Cc2ccc(CCNC(=O)NC(C(N)=O)C(C)C#N)cc2C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "00f675e5-fea7-445a-8670-ebc6b78c5700",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2)c1.",
+ "ref_smiles": "CCNC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2cccs2)C(C)c2ccccc2-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9529da27-5c17-4875-95de-7a21a633ffa9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(C)C1=NN(c2ccccc2)C(=O)C1(C)Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1=NN(c2ccccc2)C(=O)C1(C)Br.",
+ "ref_smiles": "CC(C)(Cc1ccccc1)C1=NN(c2ccccc2)C(=O)C1(C)Br",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4baeee8b-1ed0-45a6-86bb-e4c1ed0bfd54",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule N#Cc1cc(Br)ccc1NS(=O)(=O)c1ccc(F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cc(Br)ccc1NS(=O)(=O)c1ccc(F)cc1F.",
+ "ref_smiles": "N#Cc1ccccc1NS(=O)(=O)c1ccc(F)cc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a93dc1ec-2bd4-4e6b-9129-8fb5529c9485",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COCC(O)C(COC)OC(=O)N=[N+]=[N-] with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(O)C(COC)OC(=O)N=[N+]=[N-]",
+ "ref_smiles": "COCC(F)C(COC)OC(=O)N=[N+]=[N-]",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1baedf16-9675-4a1d-a95d-cbd0efa0abec",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)c1cccc(C(=O)NC(c2ccccc2)C(O)C(=O)Nc2ccc3c(N)nccc3c2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1cccc(C(=O)NC(c2ccccc2)C(O)C(=O)Nc2ccc3c(N)nccc3c2)c1",
+ "ref_smiles": "CN(C)c1cccc(C(=O)NCC(O)C(=O)Nc2ccc3c(N)nccc3c2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "07cab2f4-cc4b-49a4-9000-86470273ce9c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CNc1cc(COc2c(Br)cccc2OC)ccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc(COc2c(Br)cccc2OC)ccn1.",
+ "ref_smiles": "CNc1cc(COc2c(Br)cccc2OC)c(O)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2e9b546f-5111-447b-961b-f99379b6847b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(F)c(OCC2C[NH2+]CCO2)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(F)c(OCC2C[NH2+]CCO2)c1",
+ "ref_smiles": "Cc1ccc(O)c(OCC2C[NH2+]CCO2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c0f1ae35-8450-4ea9-afa4-00bb0946a975",
+ "task": "delete",
+ "question": "Modify the molecule N#CNC(=NCCCCCCN(CCC[NH+]1CCOCC1)S(=O)(=O)C1CCCCC1)Nc1cc[nH+]cc1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CNC(=NCCCCCCN(CCC[NH+]1CCOCC1)S(=O)(=O)C1CCCCC1)Nc1cc[nH+]cc1",
+ "ref_smiles": "NC(=NCCCCCCN(CCC[NH+]1CCOCC1)S(=O)(=O)C1CCCCC1)Nc1cc[nH+]cc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "11ba2db4-7a1d-49e0-82e8-d93dc5ac938e",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CCC1CCCC([NH2+]Cc2cc(Br)ccc2[N+](=O)[O-])C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCC([NH2+]Cc2cc(Br)ccc2[N+](=O)[O-])C1",
+ "ref_smiles": "CCC1CCCC([NH2+]Cc2cc(Br)ccc2I=O)C1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "f135c071-003e-4b38-8659-b2400557f5ed",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccccc1",
+ "ref_smiles": "CC(C)C([NH3+])C(=O)NCC(=O)N1CCc2ccccc2C1c1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7366b87d-4b2b-4de9-86d0-193dc5158b15",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)C1=C(NC(=O)c2ccccc2C)SC(=Cc2cc3c(cc2Cl)OCO3)C1=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1=C(NC(=O)c2ccccc2C)SC(=Cc2cc3c(cc2Cl)OCO3)C1=O",
+ "ref_smiles": "CCOC(=O)C1=C(NC(=O)c2ccccc2C)SC(=Cc2cc3c(cc2O)OCO3)C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f8b6d6bc-5dd1-4553-ba60-f631bc25604d",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(NC(=O)[O-])cc1Br by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)[O-])cc1Br",
+ "ref_smiles": "COc1ccc(NC(=O)[O-])cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5bb427ca-50aa-48e4-b7ed-1fc84ded0408",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCCC#CC(C)(CO)OC with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC#CC(C)(CO)OC",
+ "ref_smiles": "CCCCCCC#CC(C)(CBr)OC",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b0e52771-c327-451f-94a3-d854ac2f43e0",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C#CC=CCC(Cc1cccc(C=Cc2cccc(-c3ccsc3)c2)c1)C(=O)[O-] by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C#CC=CCC(Cc1cccc(C=Cc2cccc(-c3ccsc3)c2)c1)C(=O)[O-]",
+ "ref_smiles": "CC(C)(C)C#CC=CCC(Cc1cccc(C=Cc2ccsc2)c1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d7c00cf4-0c05-4a94-9516-a31116102473",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCS(=O)(=O)Cc1ccc(Br)cc1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCS(=O)(=O)Cc1ccc(Br)cc1C",
+ "ref_smiles": "CCS(=O)(=O)Cc1ccc(NO)cc1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a25579a8-a0fc-43de-94ea-218d92c2a987",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nn2cc(CNC(=O)CC(C)(C)C)[nH+]c2s1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn2cc(CNC(=O)CC(C)(C)C)[nH+]c2s1",
+ "ref_smiles": "Cc1nn2cc(CC(C)(C)C)[nH+]c2s1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b1e7e752-2fd3-4ae0-a5c6-90ff934bb4a0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)COS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12.",
+ "ref_smiles": "CC(C)C(OS(=O)(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7d003728-30c5-403c-befd-17668b6c881e",
+ "task": "delete",
+ "question": "Modify the molecule CN(Cc1csc(Br)c1)C(C)(C[NH3+])CC1CCC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1csc(Br)c1)C(C)(C[NH3+])CC1CCC1",
+ "ref_smiles": "CN(Cc1ccsc1)C(C)(C[NH3+])CC1CCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "945ee77f-8b15-427c-93a3-04829d4ef9bb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CCC2)CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CCC2)CCC1.",
+ "ref_smiles": "CC(C)(C)[Si](C)(C)OC1CCCC(=C2CCCC(=C3CCCC3)CC(c3ccccc3)C2)CCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "574f02cb-9aa9-465b-b97d-5e0dc4ff3b6f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH2+]C(Cc1cc(F)ccc1F)c1cnn(C)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1cc(F)ccc1F)c1cnn(C)c1",
+ "ref_smiles": "CC[NH2+]C(Cc1cc(C(=O)[OH])ccc1F)c1cnn(C)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "897549b3-3ee7-49f3-94e0-b40a5494905a",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccncc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccncc1.",
+ "ref_smiles": "CC(C)CC(NC(=O)OCc1ccccc1)C(=O)N(CC(=O)CNS(=O)(=O)c1ccc2oc3ccccc3c2c1)Cc1ccnc(CC=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "2ddc07ff-1dab-4f93-8aef-dd811c882d89",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](CCCNC(=O)C(F)(F)F)CC1CCCCC1O by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](CCCNC(=O)C(F)(F)F)CC1CCCCC1O",
+ "ref_smiles": "C[NH+](CCCNC(=O)C(F)(F)C#N)CC1CCCCC1O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bb389890-030a-47b8-b523-3d1a7c55f6e4",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCSCC(NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCSCC(NS(=O)(=O)c1ccc(C)cc1)C(F)(F)F",
+ "ref_smiles": "CCCCCCCCCCCCSCC(C(F)(F)F)S(=O)(=O)c1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "de1352d4-dd29-4257-a4fc-ca94de39e44c",
+ "task": "delete",
+ "question": "Modify the molecule C=CCn1c(NN=Cc2ccc(Br)cc2)nc2c1c(=O)n(C)c(=O)n2C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(NN=Cc2ccc(Br)cc2)nc2c1c(=O)n(C)c(=O)n2C",
+ "ref_smiles": "C=CCn1c(NN=Cc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bd8376f3-15be-43c9-9967-a60101a5a563",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Cc1c(F)cccc1F)Nc1ccc(Br)c(Cl)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1c(F)cccc1F)Nc1ccc(Br)c(Cl)c1",
+ "ref_smiles": "N#Cc1cccc(F)c1CC(=O)Nc1ccc(Br)c(Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1ecc9fe9-6fd3-4a83-a7e3-6684164cc614",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4ccccc34)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4ccccc34)cc21.",
+ "ref_smiles": "CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cccc5ccccc45)cc3)c3ccc(-c4ccc(-c5ccc(C67CC8CC(CC(C8)C6)C7)cc5)cc4)cc3-c3cccc4c(-c5ccccc5)cccc34)cc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "be8d35c9-b582-4b48-a749-dc1720695d5d",
+ "task": "add",
+ "question": "Modify the molecule Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OCc5ccccc5)CC4)CC3)ncc2F)n1C(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OCc5ccccc5)CC4)CC3)ncc2F)n1C(C)C",
+ "ref_smiles": "Cc1[nH+]cc(-c2nc(NC3CCN(S(=O)(=O)C4CCN(C(=O)OC(O)c5ccccc5)CC4)CC3)ncc2F)n1C(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0e162b06-abd7-4cf8-a5cd-3dc3cb628a6a",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nnc(-n2ccc(C(C)C)n2)c(C(N)=S)c1C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nnc(-n2ccc(C(C)C)n2)c(C(N)=S)c1C",
+ "ref_smiles": "Cc1nnc(-n2ccc(C(C)C)n2)c(C=S)c1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3c6b8763-1050-438b-89e3-779989b5fa26",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CCC[NH+]=C(N)N)C(=O)NC(CCC(N)=O)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CCC[NH+]=C(N)N)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "ref_smiles": "CCC(C)C(NC(=O)C([NH3+])CCC(N)=O)C(=O)NC(CC(C[NH+]=C(N)N)c1ccccc1)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "186ee8a2-0640-47c9-8844-715fbbe4bdec",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC)(CC(=O)Nc1ncccc1Cl)C(=O)[O-] by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(CC(=O)Nc1ncccc1Cl)C(=O)[O-]",
+ "ref_smiles": "CCC(CCS)(CC(=O)Nc1ncccc1Cl)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "88a96acb-8498-4b4a-a88b-751b0be4c800",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCNC(=[NH+]CC1(c2cccc(Cl)c2)CCCC1)N1CCC(CC(=O)NC)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=[NH+]CC1(c2cccc(Cl)c2)CCCC1)N1CCC(CC(=O)NC)CC1.",
+ "ref_smiles": "CCNC(=[NH+]CC1(Cl)CCCC1)N1CCC(CC(=O)NC)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "eba8ee3a-d610-42cc-bf6a-5742990cc0d8",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1noc(C)c1CC(=O)NCC1CCN(c2ncc(F)cn2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1CC(=O)NCC1CCN(c2ncc(F)cn2)CC1.",
+ "ref_smiles": "Cc1noc(C)c1CC1CCN(c2ncc(F)cn2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ebf821f1-3be0-4900-a794-65a1cb3338ff",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)C1CCCCN1C(=O)c1cccc(Br)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCCCN1C(=O)c1cccc(Br)n1",
+ "ref_smiles": "NC(=O)C1CCCCN1C(=O)c1cccc(C(=O)[OH])n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fd315e6e-68b5-4757-8cd5-52a268b7571e",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCSc1cc(-c2ccccc2)cnc1C(=O)N(C)c1nnc(C(F)(F)F)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCSc1cc(-c2ccccc2)cnc1C(=O)N(C)c1nnc(C(F)(F)F)s1.",
+ "ref_smiles": "CCSc1c(C(=O)N(C)c2nnc(C(F)(F)F)s2)ncc(-c2ccccc2)c1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "1e66f114-f6a0-481d-8391-bfe6a18fc964",
+ "task": "sub",
+ "question": "Modify the molecule CCCC(=NOCc1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl)c1ccc(Cl)cc1Cl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=NOCc1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl)c1ccc(Cl)cc1Cl",
+ "ref_smiles": "CCCC(=NOCc1ccc(NC(=O)NC(=O)c2c(F)cccc2NO)cc1Cl)c1ccc(Cl)cc1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "37df84a7-ca2c-4ad4-aaee-a4af81569cc6",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(=O)Nc1ccc(C(=O)COC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1ccc(C(=O)COC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1.",
+ "ref_smiles": "CC(=O)Nc1ccc(C(=O)COC(=O)CC23CC4CC(CC(C4)C2)C3)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7d759913-5709-4223-bad3-5aa707b1307a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCN(C(=O)c1ccccc1Cl)c1nnc(-c2cc(C)c(C[NH+]3CCC(C(=O)[O-])(C(=O)[O-])CC3)c(C)c2)s1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C(=O)c1ccccc1Cl)c1nnc(-c2cc(C)c(C[NH+]3CCC(C(=O)[O-])(C(=O)[O-])CC3)c(C)c2)s1",
+ "ref_smiles": "CCCCN(C(=O)c1ccccc1C(=O)O)c1nnc(-c2cc(C)c(C[NH+]3CCC(C(=O)[O-])(C(=O)[O-])CC3)c(C)c2)s1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0e7a0286-d6e6-4132-8ced-44647be6fcde",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C(CC(=O)[O-])NC(=O)NCCOc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(CC(=O)[O-])NC(=O)NCCOc1ccccc1",
+ "ref_smiles": "CC(C)C(CC(=O)[O-])NC(=O)NCCOc1cccc(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fd74ca37-ea71-4574-84be-6e8716dbb35d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccccc1C[NH+](CC1CCCO1)C1CCN(C(=O)C2CC2)C(C(=O)NC2CCC([NH3+])CC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1C[NH+](CC1CCCO1)C1CCN(C(=O)C2CC2)C(C(=O)NC2CCC([NH3+])CC2)C1.",
+ "ref_smiles": "CC[NH+](CC1CCCO1)C1CCN(C(=O)C2CC2)C(C(=O)NC2CCC([NH3+])CC2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "df3ba268-2a06-49b9-b9e2-18666f5ffdb5",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)NC(C)C(=O)NC(C)C(=O)NCCS by substituting a thiol with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(C)C(=O)NC(C)C(=O)NCCS",
+ "ref_smiles": "CC(=O)CCNC(=O)C(C)NC(=O)C(C)NC(C)=O",
+ "add_group": "aldehyde",
+ "remove_group": "thiol"
+ },
+ {
+ "id": "dce42036-2628-41df-9fe8-85f10f3730ec",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)CN(C)C(=O)c2ccc(Cl)nn2)no1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)CN(C)C(=O)c2ccc(Cl)nn2)no1",
+ "ref_smiles": "Cc1cc(NC(=O)CN(C)C(=O)c2ccc(C#N)nn2)no1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8a2bebe-e1dd-4d10-b17c-8f28caedd5bb",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccc(C#N)cc1)C32.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccc(C#N)cc1)C32.",
+ "ref_smiles": "C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccccc1)C32",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "c2498f29-8fda-4268-9c41-b93005af2ad3",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2cccc(NC(=O)C[NH+]3CCC(C(=O)NC(C(=O)Nc4ccc(F)cc4)C(C)C)CC3)c2C)cc1F by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2cccc(NC(=O)C[NH+]3CCC(C(=O)NC(C(=O)Nc4ccc(F)cc4)C(C)C)CC3)c2C)cc1F",
+ "ref_smiles": "Cc1ccc(NC(=O)c2cccc(NC(=O)C[NH+]3CCC(C(=O)NC(C(=O)Nc4ccc(C(=O)[OH])cc4)C(C)C)CC3)c2C)cc1F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2884f7d5-c203-45c0-afb8-d34439ad187e",
+ "task": "add",
+ "question": "Modify the molecule CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)ccc2C)[nH]1",
+ "ref_smiles": "CSc1nc(=O)c(C(N)=O)c(Nc2cc(S(=O)(=O)N3CCCCC3)cc(-c4ccccc4)c2C)[nH]1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0a960e1a-9673-4678-a923-850e9189ef73",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCN(CC)S(=O)(=O)c1ccc(SCc2cccc(OCC(F)(F)F)c2)nc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)S(=O)(=O)c1ccc(SCc2cccc(OCC(F)(F)F)c2)nc1",
+ "ref_smiles": "CCN(CC)S(=O)(=O)c1ccc(SCc2cccc(OCC(F)(F)S)c2)nc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "219bcfe8-c044-46ac-ace2-322e47bf5a1f",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CCCCCCCOP(O)OCCCCCCCC(C)C by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCCCCCCOP(O)OCCCCCCCC(C)C",
+ "ref_smiles": "CC(C)CCCCCCCOPOCCCCCCCC(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a6dc0358-c09d-4bc8-86b1-3505b7db5b72",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C(CCNC(=O)C1CNC(=O)C[NH2+]1)CCC(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(CCNC(=O)C1CNC(=O)C[NH2+]1)CCC(=O)[O-]",
+ "ref_smiles": "CC(C)C(CCNC(=O)C1CNC(=O)C(O)[NH2+]1)CCC(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "14e5762c-d8f6-4088-b0c1-10c284c73f14",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC(=O)OC(Cc1ccccc1)(c1ccccc1O)C(C)C[NH+](C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)OC(Cc1ccccc1)(c1ccccc1O)C(C)C[NH+](C)C.",
+ "ref_smiles": "CCC(=O)OC(Cc1ccccc1)(c1ccccc1)C(C)C[NH+](C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5ed20b46-1bc8-47db-bd92-2876e60c698c",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccc(F)cc3F)sc2c1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccc(F)cc3F)sc2c1",
+ "ref_smiles": "CCOc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccc(O)cc3F)sc2c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3c011c94-71e3-43f6-a6ac-96239d64da96",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NCc1nn[n-]n1)c1ccc(F)cc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1nn[n-]n1)c1ccc(F)cc1Cl",
+ "ref_smiles": "O=C(NCc1nn[n-]n1)c1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a3e47f8d-870c-43e7-8321-8a89faae5874",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C[NH+](C)CCOCCn1nnnc1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCOCCn1nnnc1N.",
+ "ref_smiles": "C[NH+](C)CCOCCn1cnnn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "12939832-d336-453a-8655-49fcb3b887e0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH2+]CC1CCCN1CC(C#N)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC1CCCN1CC(C#N)c1ccccc1.",
+ "ref_smiles": "C[NH2+]CC1CCCN1CCC#N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e060d37d-3d84-40da-a497-f818945a2406",
+ "task": "delete",
+ "question": "Modify the molecule COCCC(C)Nc1cc(C)[nH+]cc1C(=O)[O-] by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC(C)Nc1cc(C)[nH+]cc1C(=O)[O-]",
+ "ref_smiles": "COCCC(C)c1cc(C)[nH+]cc1C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0ab75c73-72b4-446b-ae65-cfe21070ed74",
+ "task": "delete",
+ "question": "Modify the molecule COC1CCC(OC2OC(C(=O)[O-])C(OC3OC(C(=O)[O-])C(OC4OC(C(=O)[O-])C(OC5OC(C(=O)[O-])C(OC6OC(O)C(OC)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O)C(O)C2O)C(O)C1O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CCC(OC2OC(C(=O)[O-])C(OC3OC(C(=O)[O-])C(OC4OC(C(=O)[O-])C(OC5OC(C(=O)[O-])C(OC6OC(O)C(OC)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O)C(O)C2O)C(O)C1O",
+ "ref_smiles": "COC1CCC(OC2OC(C(=O)[O-])C(OC3CC(O)C(OC4OC(C(=O)[O-])C(OC5OC(C(=O)[O-])C(OC6OC(O)C(OC)C(O)C6O)C(O)C5O)C(O)C4O)C(C(=O)[O-])O3)C(O)C2O)C(O)C1O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7cd2f4d8-f9a3-4e0c-80a8-4aacdc106b26",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1sc2c(c1F)CCN(Cc1ccccc1)c1ccccc1-2 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1sc2c(c1F)CCN(Cc1ccccc1)c1ccccc1-2",
+ "ref_smiles": "ONc1c(C(=O)[O-])sc2c1CCN(Cc1ccccc1)c1ccccc1-2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3504e33-86b9-4596-8f09-21d74dfbff26",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C[NH+]2CCc3c(cc(Cl)c(C(=O)NC(CNC(=O)c4cccs4)C(=O)[O-])c3Cl)C2)s1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C[NH+]2CCc3c(cc(Cl)c(C(=O)NC(CNC(=O)c4cccs4)C(=O)[O-])c3Cl)C2)s1",
+ "ref_smiles": "Cc1ccc(C[NH+]2CCc3cc(C(=O)NC(CNC(=O)c4cccs4)C(=O)[O-])c(Cl)cc3C2)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5104cb9a-82b7-4375-a17a-dd01598a9c91",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1ccc(C(N)=O)cc1NC1CCOC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(N)=O)cc1NC1CCOC1.",
+ "ref_smiles": "COc1ccc(C(N)=O)cc1C1CCOC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7f43498a-1a41-47e7-98bd-37f2102bdb95",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(CNc2cccc(Cl)c2Cl)ccc1C#N by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CNc2cccc(Cl)c2Cl)ccc1C#N",
+ "ref_smiles": "COc1cc(CNc2cccc(Cl)c2Cl)ccc1S",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "5d857359-1299-4951-b2b4-361929d71e71",
+ "task": "add",
+ "question": "Modify the molecule CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1",
+ "ref_smiles": "CCN1CCN(C2C[NH+](Cc3ncno3)C2)CC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c25f38b2-f282-472e-b79c-f1eb0403e937",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCCCNC(=O)c1ccc(C[NH+]2CC(O)C(O)C(O)C2CO)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCNC(=O)c1ccc(C[NH+]2CC(O)C(O)C(O)C2CO)cc1.",
+ "ref_smiles": "CCCCCCNC(=O)C[NH+]1CC(O)C(O)C(O)C1CO",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b1505796-1ae8-433e-b79b-f12de309fad0",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1ccc(CC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1ccc(CC)cc1.",
+ "ref_smiles": "CCCCCN1C(=O)C=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1ccc(CC)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bf002d27-00f5-455d-ab36-9320def7fc0c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)c1nc2c(Cl)ccc(C(=O)[O-])c2o1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1nc2c(Cl)ccc(C(=O)[O-])c2o1",
+ "ref_smiles": "CC(C)(C)c1nc2c(C#N)ccc(C(=O)[O-])c2o1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8248501e-698e-4f41-96c0-1e2b07e781a3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccccc1CNc1nc(Cl)nc2c1ncn2C1CCCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CNc1nc(Cl)nc2c1ncn2C1CCCC1",
+ "ref_smiles": "COc1ccccc1CNc1nc(NO)nc2c1ncn2C1CCCC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5d2991f5-962e-4a3e-ba29-fccaf0c4a765",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1ccc(NS(=O)(=O)c2c(N)cccc2F)cn1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NS(=O)(=O)c2c(N)cccc2F)cn1",
+ "ref_smiles": "CC(=O)c1cccc(N)c1S(=O)(=O)Nc1ccc(OCC)nc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8b798245-fd00-4681-85f3-5d9cf433dd4f",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C[NH2+]Cc2ccccc2Cl)ccc1Br by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C[NH2+]Cc2ccccc2Cl)ccc1Br",
+ "ref_smiles": "Cc1cc(C[NH2+]Cc2ccccc2C(=O)[OH])ccc1Br",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c19dcd5d-c731-452b-9891-7349188635fe",
+ "task": "sub",
+ "question": "Modify the molecule COc1c(F)cccc1CCC(C)[NH3+] by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(F)cccc1CCC(C)[NH3+]",
+ "ref_smiles": "COc1c(C(=O)O)cccc1CCC(C)[NH3+]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dff0c0c1-5e49-4a26-ab47-779570528aeb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=c1cccnn1CCNc1ccccc1Br with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1cccnn1CCNc1ccccc1Br",
+ "ref_smiles": "O=C1C=CC=NN1CCNc1ccc(C=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "70c10874-a093-4ca9-8025-f2eebbfce75b",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCOc1ccc(-c2nc(CC(=O)NCCc3ccc(OC)c(OC(F)F)c3)cs2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-c2nc(CC(=O)NCCc3ccc(OC)c(OC(F)F)c3)cs2)cc1.",
+ "ref_smiles": "CCOc1ccc(-c2nc(CCc3ccc(OC)c(OC(F)F)c3)cs2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a8231a8b-fb71-4381-a83e-fe911ba2ae84",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)=CC[NH+]1CCC(NC(=O)C2=NN(c3ccc(F)cc3)C(C(N)=O)C2)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)=CC[NH+]1CCC(NC(=O)C2=NN(c3ccc(F)cc3)C(C(N)=O)C2)CC1",
+ "ref_smiles": "CC(C)=CC[NH+]1CCC(NC(=O)C2=NN(c3ccc(S)cc3)C(C(N)=O)C2)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1b4104f2-58b4-47d6-b32d-0f4348a60211",
+ "task": "sub",
+ "question": "Modify the molecule Fc1ccc(F)c(-c2nnc(CCl)o2)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(F)c(-c2nnc(CCl)o2)c1",
+ "ref_smiles": "N#Cc1ccc(F)c(-c2nnc(CCl)o2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "685e4fce-4d5b-4a58-919e-b63a026334c8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCC(=O)OC1CC(=O)C=C2CCC3C(C(=O)CC4(C)C3CCC4(O)C(=O)CO)C21C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=O)OC1CC(=O)C=C2CCC3C(C(=O)CC4(C)C3CCC4(O)C(=O)CO)C21C",
+ "ref_smiles": "CC(=O)C1(C(=O)CO)CCC2C3CCC4=CC(=O)CC(OC(=O)CCC)C4(C)C3C(=O)CC21C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "131391f0-48e1-4e5e-8689-10a08b5c9015",
+ "task": "delete",
+ "question": "Modify the molecule CC(NC(=O)c1ccc(C(=O)[O-])cn1)c1ccccc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1ccc(C(=O)[O-])cn1)c1ccccc1",
+ "ref_smiles": "CC(c1ccccc1)n1cc(C(=O)[O-])ccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "12c07e23-972e-4aa3-b5da-5c1a94f9e4ae",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1noc(-c2cccnc2N2CCC(Cc3cccc(F)c3)CC2)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(-c2cccnc2N2CCC(Cc3cccc(F)c3)CC2)n1",
+ "ref_smiles": "Cc1noc(-c2cccnc2N2CCC(Cc3cccc(C(=O)[OH])c3)CC2)n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3bc84d43-5cb7-4aaf-9069-294103f2a8ec",
+ "task": "add",
+ "question": "Modify the molecule c1nc2c(cc1CN1CC[NH2+]CC1)CCOC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1nc2c(cc1CN1CC[NH2+]CC1)CCOC2",
+ "ref_smiles": "c1ccc(-c2nc3c(cc2CN2CC[NH2+]CC2)CCOC3)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "673beea1-676d-4817-9da0-47dc8bdef7bf",
+ "task": "sub",
+ "question": "Modify the molecule CCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)Cc1ccccc1Cl by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)Cc1ccccc1Cl",
+ "ref_smiles": "CCCNC(=O)C(C)N(Cc1ccc(C(=O)O)cc1)C(=O)Cc1ccccc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f3cacd95-4f45-458e-9065-6bc57033b300",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2C)c2ccc(C)c(Cl)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2C)c2ccc(C)c(Cl)c2)cc1.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)cc2CO)c2ccc(C)c(Cl)c2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c6840d25-7912-41f4-ad68-8d678c3a5e26",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC[NH2+]C1COc2cc(OCCCCCCO)ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C1COc2cc(OCCCCCCO)ccc21.",
+ "ref_smiles": "CCCCCCOc1ccc2c(c1)OCC2[NH2+]CCC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "266ea467-a7af-4e44-8edb-ef01d2f09e1e",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Br)ccc1N1CCN(C2CC[NH2+]C2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Br)ccc1N1CCN(C2CC[NH2+]C2)CC1",
+ "ref_smiles": "Cc1cc(Br)cc(C(=O)O)c1N1CCN(C2CC[NH2+]C2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1637f74a-1c7a-4d0d-9dbe-863bc3f35c7e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]C(C1=CCCO1)c1coc(Br)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C1=CCCO1)c1coc(Br)c1",
+ "ref_smiles": "C[NH2+]C(C1=CCCO1)c1coc(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "418fb7cf-d6a4-4f49-b5c9-70e4646cd0dc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCn1c(=O)sc2cc(NC(=O)C(C)N(c3cc(Cl)ccc3Cl)S(C)(=O)=O)ccc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(=O)sc2cc(NC(=O)C(C)N(c3cc(Cl)ccc3Cl)S(C)(=O)=O)ccc21",
+ "ref_smiles": "CCn1c(=O)sc2cc(NC(=O)C(C)N(c3cc(C=O)ccc3)S(C)(=O)=O)ccc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4807877d-41a0-4bc7-bb73-3718ed6e6591",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCC(C(=O)N(CC(=O)[O-])c2ccc(O)cc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(C(=O)N(CC(=O)[O-])c2ccc(O)cc2)CC1",
+ "ref_smiles": "CC1CCC(C(=O)N(O)CC(=O)[O-])CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "764512d5-7a46-46c8-a613-397765f5d651",
+ "task": "sub",
+ "question": "Modify the molecule CC[NH+](CC)CCN1Cc2c(ccc(Cl)c2Cl)C1C[NH3+] by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCN1Cc2c(ccc(Cl)c2Cl)C1C[NH3+]",
+ "ref_smiles": "CC[NH+](CC)CCN1Cc2c(ccc(C=O)c2C1C[NH3+]",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "82316a99-333c-4701-9cea-5d34db525c38",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(c1cc2c(s1)CCCC2)c1cc(F)c(Br)cc1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cc2c(s1)CCCC2)c1cc(F)c(Br)cc1F",
+ "ref_smiles": "O=C(c1cc(C=O)c2c(s1)CCCC2)c1cc(F)ccc1F",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e5e2f33a-5e4c-4d60-8c9b-263a387fd39a",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CC1(O)CCCC1)NC1CCCN(c2ccccc2F)C1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1(O)CCCC1)NC1CCCN(c2ccccc2F)C1",
+ "ref_smiles": "O=C(CC1(O)CCCC1)NC1CCCN(c2ccc([N+](=O)[O-])cc2)C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5f8ecbdf-5e35-4725-b675-bf9b7c92e9e6",
+ "task": "sub",
+ "question": "Modify the molecule CSc1cc(O)cc2c(CBr)csc12 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1cc(O)cc2c(CBr)csc12",
+ "ref_smiles": "CSc1cc(S)cc2c(CBr)csc12",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4e126e7d-9aad-4b93-8236-7d054d7d47c2",
+ "task": "sub",
+ "question": "Modify the molecule N#CC(C#N)=C(C#N)c1ccc(-c2cc(-c3cc(-c4ccc(C(C#N)=C(C#N)C#N)s4)sc3-c3ccc(C(C#N)=C(C#N)C#N)s3)c(-c3ccc(C(C#N)=C(C#N)C#N)s3)s2)s1 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(C#N)=C(C#N)c1ccc(-c2cc(-c3cc(-c4ccc(C(C#N)=C(C#N)C#N)s4)sc3-c3ccc(C(C#N)=C(C#N)C#N)s3)c(-c3ccc(C(C#N)=C(C#N)C#N)s3)s2)s1",
+ "ref_smiles": "N#CC(C#N)=C(C#N)c1ccc(-c2cc(-c3cc(-c4ccc(C(C#N)=C(C#N)NO)s4)sc3-c3ccc(C(C#N)=C(C#N)C#N)s3)c(-c3ccc(C(C#N)=C(C#N)C#N)s3)s2)s1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "579e58b5-4533-4512-8c36-b154a5ba0610",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)C(C)(O)n1cnc2c(N)ncnc21 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)(O)n1cnc2c(N)ncnc21",
+ "ref_smiles": "COC(=O)C(C)(O)n1cnc2cncnc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "36aab346-4c5f-43eb-899b-ffb28f244922",
+ "task": "sub",
+ "question": "Modify the molecule COc1cccc(N2CCC(=CC3=C(C(=O)[O-])N4C(=O)C(NC(=O)C(=NO)c5csc(N)n5)C4SC3)C2=O)c1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(N2CCC(=CC3=C(C(=O)[O-])N4C(=O)C(NC(=O)C(=NO)c5csc(N)n5)C4SC3)C2=O)c1",
+ "ref_smiles": "COc1cccc(N2CCC(=CC3=C(C(=O)[O-])N4C(=O)C(NC(=O)C(=NNO)c5csc(N)n5)C4SC3)C2=O)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3ef10911-3723-4ef1-b179-2944c8c37e57",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCC(O)c2ccccc2)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCC(O)c2ccccc2)cc1",
+ "ref_smiles": "CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCC(I)c2ccccc2)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "97bf91a7-9ba6-4d64-93ec-0789f76c547c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1=NN(c2ccc(N)cc2Cl)C(=O)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=NN(c2ccc(N)cc2Cl)C(=O)C1",
+ "ref_smiles": "CC(=O)c1cc(N)ccc1N1N=C(C)CC1=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "80e9acf3-0386-483e-8bd7-de9a69933722",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(C)cc(Oc2cccc(CO)n2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(Oc2cccc(CO)n2)c1",
+ "ref_smiles": "Cc1cc(C)cc(Oc2cccc(CC#N)n2)c1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4d2ea0ba-a960-4fca-a44e-3fef76c82f47",
+ "task": "add",
+ "question": "Modify the molecule Nc1cc(N)cc(C(=O)c2cc3c(cc2Br)OCCO3)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(N)cc(C(=O)c2cc3c(cc2Br)OCCO3)c1",
+ "ref_smiles": "Nc1cc(N)c(S)c(C(=O)c2cc3c(cc2Br)OCCO3)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "e6ae286d-5f7e-41e2-88cb-705783fbce04",
+ "task": "add",
+ "question": "Modify the molecule CC[NH2+]C(Cc1cccs1)c1ncccc1CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1cccs1)c1ncccc1CC",
+ "ref_smiles": "CC[NH2+]C(Cc1cccs1)c1ncc(O)cc1CC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dbe016aa-1593-4a97-ba92-a740d8dd5b31",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(CC(=O)Nc2nc3scc(C)n3n2)cc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(=O)Nc2nc3scc(C)n3n2)cc1",
+ "ref_smiles": "COc1ccc(-c2nc3scc(C)n3n2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5496acf1-fcd8-44fa-a5c8-97a2f858a40c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](C)CCCNc1nncc(NCCc2cccc(Cl)c2)n1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCNc1nncc(NCCc2cccc(Cl)c2)n1",
+ "ref_smiles": "C[NH+](C)CCCNc1nncc(NCCc2cccc(C#N)c2)n1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f5a7926a-dcfc-4f23-b053-3d9a24856de9",
+ "task": "sub",
+ "question": "Modify the molecule CC(OC(=O)c1ccccc1Nc1ccccc1)C(=O)Nc1cc(Cl)cc(Cl)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC(=O)c1ccccc1Nc1ccccc1)C(=O)Nc1cc(Cl)cc(Cl)c1",
+ "ref_smiles": "O=CC(OC(=O)c1ccccc1Nc2ccccc2)C(=O)Nc3cccccc3",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "375eaa5e-fb0f-4d70-bc3e-0cf51b386d37",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(CC(C)NC(=O)N2CC3C(=O)NC(=O)C3C2)s1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CC(C)NC(=O)N2CC3C(=O)NC(=O)C3C2)s1",
+ "ref_smiles": "Cc1ccc(CC(C)NC(=O)N2CC(C=O)C2)s1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b0746f78-b745-49a4-8375-1101b455f9b3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(=O)c1ccc(COC(C[NH3+])c2ccccc2I)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(COC(C[NH3+])c2ccccc2I)cc1.",
+ "ref_smiles": "COC(=O)c1ccc(COC(C[NH3+])c2cccc(O)c2I)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4d1dc251-8f67-4c50-8482-b05f79cfcf61",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CNC(=O)C(C)(C)NS(=O)(=O)c1ccc(C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)C(C)(C)NS(=O)(=O)c1ccc(C)cc1.",
+ "ref_smiles": "CNC(=O)C(C)(C)S(=O)(=O)c1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7099942c-65b3-4df6-b9d7-36394e09b854",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]=C(NCCc1ccc(OC)cc1O)NCC(c1ccco1)[NH+]1CCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCc1ccc(OC)cc1O)NCC(c1ccco1)[NH+]1CCCC1",
+ "ref_smiles": "C[NH+]=C(NCC(c1ccco1)[NH+]1CCCC1)NC(O)Cc1ccc(OC)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c9b449f5-1fde-49b2-973e-fa6818dc2d32",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)cc2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)cc2)cn1.",
+ "ref_smiles": "Cc1c(Cl)cccc1Nc1ccc(C(=O)Nc2ccc(F)c(-c3ccccc3)c2)cn1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6745d9c7-0771-4b70-8509-28b44a990ce5",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCc1ccc(O)c(C[NH+](CC)CC)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCc1ccc(O)c(C[NH+](CC)CC)c1",
+ "ref_smiles": "CCCCCCCCCCCCC(O)[NH+](CC)CC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2c9ce9dc-00a5-4e47-8261-3805c0b63e80",
+ "task": "add",
+ "question": "Modify the molecule CCCC(CCC)C(=O)NCCn1ncc2c(N3CCOCC3)nc(SCC)nc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(CCC)C(=O)NCCn1ncc2c(N3CCOCC3)nc(SCC)nc21",
+ "ref_smiles": "CCCC(CCC)C(=O)NCC(O)n1ncc2c(N3CCOCC3)nc(SCC)nc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "66df39fa-6a7c-4b08-a0d1-71113e2e2569",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)c1ccc(CN(CC(O)COc2ccc(F)cc2)c2ccccn2)cc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc(CN(CC(O)COc2ccc(F)cc2)c2ccccn2)cc1",
+ "ref_smiles": "CN(C)c1ccc(CN(CCCOc2ccc(F)cc2)c2ccccn2)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "92563644-e010-4b6b-8b7c-19bea2b2971e",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(O)c(SCC(O)c2ccccc2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(O)c(SCC(O)c2ccccc2)n1",
+ "ref_smiles": "Cc1ccc(O)c(SCC(O)(c2ccccc2)c2ccccc2)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b1fca4f4-9460-4512-80e9-cb9694c174ce",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1ccccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1ccccc1Cl",
+ "ref_smiles": "O=S(=O)(NCCc1csc(N2CCCCC2)n1)c1c(Cl)cccc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f2bbbd23-2376-4825-9013-087b39de4b12",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(CCc1ccc(F)cc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCc1ccc(F)cc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1.",
+ "ref_smiles": "O=C(CCc1ccc(F)cc1-c1ccccc1)N1CCC(Cn2ncc3cc(-c4cn[nH]c4)ccc32)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fca4373c-5ade-4815-aa07-6f946899ba8f",
+ "task": "add",
+ "question": "Modify the molecule CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)cc4[nH]3)COC12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)cc4[nH]3)COC12",
+ "ref_smiles": "CC1COC2C(Oc3nc4c(F)c(-c5ccc(-c6ccccc6)cc5)c(F)c(O)c4[nH]3)COC12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ab1f2e0d-fbad-4232-ae76-6f68b49714fd",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCCCOCCCNC(=S)N1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOCCCNC(=S)N1CC[NH2+]CC1.",
+ "ref_smiles": "CCCCOC(CCNC(=S)N1CC[NH2+]CC1)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e0c2eb60-fbe7-4606-851c-6b3e6bf3c4d3",
+ "task": "add",
+ "question": "Modify the molecule O=C(NC1CCCC2OCCC12)N1CCCC1CCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCCC2OCCC12)N1CCCC1CCO",
+ "ref_smiles": "O=C(NC1CCCC2OCCC12)N1CCC(O)C1CCO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f5bcd190-5335-47cf-800e-db694c39ce45",
+ "task": "add",
+ "question": "Modify the molecule CC(NC(=O)N1CCC[NH2+]CC1)C(C)(F)F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)N1CCC[NH2+]CC1)C(C)(F)F",
+ "ref_smiles": "CC(NC(=O)N1CCC[NH2+]CC1)C(F)(F)CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "18e3f8b1-82ff-4b22-88ae-ad21f2398091",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(OC)c(S(=O)(=O)Nc2nc3ccc(Br)cc3s2)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OC)c(S(=O)(=O)Nc2nc3ccc(Br)cc3s2)c1",
+ "ref_smiles": "COc1ccc(OC)c(S(=O)(=O)Nc2nc3ccc(S)cc3s2)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0752d1d4-2a8b-4d91-9fce-b221467e9393",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)cnn21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)cnn21.",
+ "ref_smiles": "CCOc1ccccc1NC(=O)CC1C(=O)Nc2c(-c3ccc(C)cc3)c(O)nn21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cabf3842-a815-43a3-a431-5bd817ef69b1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C[NH+]1CCCCC1)n1c(CCl)nc2cc(Cl)cnc21 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C[NH+]1CCCCC1)n1c(CCl)nc2cc(Cl)cnc21",
+ "ref_smiles": "CC(C[NH+]1CCCCC1)n1c(CC(=O)[OH])nc2cc(Cl)cnc21",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "74d70588-3370-4bb2-bc05-65f8834e7112",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1c(F)cc(F)cc1CNc1nc(Nc2cnn(CC(=O)NC3CC3)c2)ncc1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(F)cc(F)cc1CNc1nc(Nc2cnn(CC(=O)NC3CC3)c2)ncc1C",
+ "ref_smiles": "CC(=O)c1cc(F)cc(CNc2nc(Nc3cnn(CC(=O)NC4CC4)c3)ncc2C)c1OC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "43c5ebb0-ed79-439a-81f6-d0384bc30ded",
+ "task": "add",
+ "question": "Modify the molecule NNC(CCC1CCCO1)CC1CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NNC(CCC1CCCO1)CC1CC1",
+ "ref_smiles": "NNC(CCC1CCCO1)(CC1CC1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "314cfa79-4b4a-433f-8659-75f8da976711",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1.",
+ "ref_smiles": "CCC(Sc1cccc(NC(=O)C(=Cc2c[nH]c3c(O)cccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2ccc(C)cc2)c(C)s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "758f1699-0d13-4e87-9c24-29b485acc84c",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nc(-c2cc(Cl)c3[nH]ncc3c2)c(-c2ccccc2)nc1N by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(-c2cc(Cl)c3[nH]ncc3c2)c(-c2ccccc2)nc1N",
+ "ref_smiles": "CCc1nc(-c2cc(Cl)c3[nH]ncc3c2)cnc1N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "87184ada-2f20-4da0-bd42-aaf549a66a78",
+ "task": "add",
+ "question": "Modify the molecule NC(=O)CCSc1nnc(-c2ccc[nH]2)o1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CCSc1nnc(-c2ccc[nH]2)o1",
+ "ref_smiles": "NC(=O)C(CSc1nnc(-c2ccc[nH]2)o1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "16581b29-2efa-449d-88e1-72b806a08818",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C[NH+]1CCC(CCNc2nc3ccccc3o2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(CCNc2nc3ccccc3o2)CC1.",
+ "ref_smiles": "C[NH+]1CCC(CCc2nc3ccccc3o2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d535d0d1-55f6-4b2a-a8ff-b34670c1d741",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(Nc1ccccc1OC(F)F)c1nc(Cl)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccccc1OC(F)F)c1nc(Cl)ccc1Cl.",
+ "ref_smiles": "O=C(Nc1c(OC(F)F)cccc1-c1ccccc1)c1nc(Cl)ccc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0f991d04-dc36-4810-bfe0-8f3f990953a0",
+ "task": "add",
+ "question": "Modify the molecule c1ccc(C2NC(c3ccccc3)[NH2+]C(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)N2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(C2NC(c3ccccc3)[NH2+]C(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)N2)cc1",
+ "ref_smiles": "c1ccc(C2NC(c3ccccc3)(c3ccccc3)NC(c3ccc(-n4c5ccccc5c5c4ccc4c6c7oc8ccccc8c7ccc6n(-c6ccccc6)c45)cc3)[NH2+]2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3eb3fe7c-8f8b-4b58-9d55-32da5b0d3084",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N(Cc1ccccc1)c1cccc(Br)c1C[NH3+] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(Cc1ccccc1)c1cccc(Br)c1C[NH3+]",
+ "ref_smiles": "CC(C)N(Cc1ccccc1)c1cccc(C(=O)[OH])c1C[NH3+]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e5168ca2-1520-4610-985e-9f2143578462",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1c2c(nn1C1CCCC1)CCCC2 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c2c(nn1C1CCCC1)CCCC2",
+ "ref_smiles": "ONc1c2c(nn1C1CCCC1)CCCC2",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6f880d3c-c7ad-4f50-8d01-f75c9e0f0249",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)CN(CCCO)C(=O)c1cc(C(C)(C)C)[nH]n1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)CN(CCCO)C(=O)c1cc(C(C)(C)C)[nH]n1",
+ "ref_smiles": "CC(C)(C)CN(CCCNO)C(=O)c1cc(C(C)(C)C)[nH]n1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b34addf5-1bd3-49e2-9a5a-79bc6dc3844d",
+ "task": "delete",
+ "question": "Modify the molecule O=C1C[NH+](Cc2ccc(-c3cnc4[nH]cc(-c5ccc6[nH]ccc6c5)c4c3)cc2)CCN1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C[NH+](Cc2ccc(-c3cnc4[nH]cc(-c5ccc6[nH]ccc6c5)c4c3)cc2)CCN1",
+ "ref_smiles": "c1cc2cc(-c3c[nH]c4ncc(-c5ccc(C[NH+]6CC6)cc5)cc34)ccc2[nH]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "278d7b8f-41c6-473a-add8-4cdcfc5bb31e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1cn(C2CC(O)C(COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3C([NH3+])C(n4cc(C)c(=O)[nH]c4=O)OC3(COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3CO)C(N)=O)O2)c(=O)[nH]c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cn(C2CC(O)C(COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3C([NH3+])C(n4cc(C)c(=O)[nH]c4=O)OC3(COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3CO)C(N)=O)O2)c(=O)[nH]c1=O.",
+ "ref_smiles": "Cc1cn(C2CC(O)C(COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]cnc54)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3C([NH3+])C(n4cc(C)c(=O)[nH]c4=O)OC3(COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)([O-])OC3CC(n4ccc(N)nc4=O)OC3COP(=O)([O-])OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3CO)C(N)=O)O2)c(=O)[nH]c1=O",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a9da7f12-234f-4608-9a43-87c42c0ddad6",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCCCC1)S(C)(=O)=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCCCC1)S(C)(=O)=O",
+ "ref_smiles": "CCc1ccccc1N(CC(=O)N(Cc1ccccc1)C(CC)C(=O)NC1CCC(c2ccccc2)CC1)S(C)(=O)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f8b1b55e-7b13-4d30-9678-d56b6745d66d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccccc1N1C(=O)NC(=O)C(=Cc2cc(Br)ccc2O)C1=O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1N1C(=O)NC(=O)C(=Cc2cc(Br)ccc2O)C1=O",
+ "ref_smiles": "Cc1ccccc1N1C(=O)NC(=O)C(=Cc2cc(Br)ccc2Br)C1=O",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "091a8f6f-3450-4958-9e0e-6b792b0b8618",
+ "task": "delete",
+ "question": "Modify the molecule CCC1(C)CN(c2cc(OC)ccc2Cl)C(C(C)C)C[NH2+]1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C)CN(c2cc(OC)ccc2Cl)C(C(C)C)C[NH2+]1",
+ "ref_smiles": "CCC1(C)CN(c2cccc(OC)c2)C(C(C)C)C[NH2+]1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "27a7cf80-498d-49cd-87cd-c9cadf78eb07",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCCC(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(Cc1ccccc1C)NC(=O)C(COCc1ccccc1)NC(=O)C(CO)NC(=O)CCCNC(=O)OCc1ccccc1)C(C)(C)C)C(=O)C(N)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(Cc1ccccc1C)NC(=O)C(COCc1ccccc1)NC(=O)C(CO)NC(=O)CCCNC(=O)OCc1ccccc1)C(C)(C)C)C(=O)C(N)=O.",
+ "ref_smiles": "CCCCC(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(Cc1ccccc1C)NC(=O)C(COCc1ccccc1)NC(=O)C(C)NC(=O)CCCNC(=O)OCc1ccccc1)C(C)(C)C)C(=O)C(N)=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c4528d0d-a0c3-4176-8e22-df6ac3af251f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(C2=CN3C(=O)c4cc(OC)c(OCCCOc5cc6c(cc5OC)C(=O)N5C=C(c7ccc(N)cc7)CC5C(CC(C)=O)N6)cc4NC(CC(C)=O)C3C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2=CN3C(=O)c4cc(OC)c(OCCCOc5cc6c(cc5OC)C(=O)N5C=C(c7ccc(N)cc7)CC5C(CC(C)=O)N6)cc4NC(CC(C)=O)C3C2)cc1.",
+ "ref_smiles": "COC1=CN2C(=O)c3cc(OC)c(OCCCOc4cc5c(cc4OC)C(=O)N4C=C(c6ccc(N)cc6)CC4C(CC(C)=O)N5)cc3NC(CC(C)=O)C2C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0544ebf7-68a9-4c7a-8348-a9426a482503",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(OCC(=O)N(Cc2c(Cl)cccc2Cl)C(Cc2ccccc2)C(=O)NCC(C)C)cc(C)c1Br with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OCC(=O)N(Cc2c(Cl)cccc2Cl)C(Cc2ccccc2)C(=O)NCC(C)C)cc(C)c1Br",
+ "ref_smiles": "Cc1cc(OCC(=O)N(Cc2c(Cl)cccc2C(=O)O)C(Cc2ccccc2)C(=O)NCC(C)C)cc(C)c1Br",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8526d79b-c4e0-4335-aacc-15b8c7287de3",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCc1nc(C(C)Nc2nnc(CC)c(CC)n2)cs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(C(C)Nc2nnc(CC)c(CC)n2)cs1.",
+ "ref_smiles": "CCc1nc(C(C)Nc2nnc(C(C)N)c(CC)n2)cs1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0cabda2c-ad7b-43ca-bf2b-7c60cbf8a7b4",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(Oc2ccc(NC(=O)CNC(=O)C([NH3+])C(C)C)cn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Oc2ccc(NC(=O)CNC(=O)C([NH3+])C(C)C)cn2)cc1.",
+ "ref_smiles": "COc1ccc(Oc2ccc(NC(=O)CC(C)(C)[NH3+])cn2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "429fd4eb-517e-461f-bc4c-3b0efaffae1e",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)C)cc3)C2c2c[nH]c3ccccc23)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)C)cc3)C2c2c[nH]c3ccccc23)cc1OC.",
+ "ref_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(C)(C)C(=O)O)cc3)C2c2c[nH]c3ccccc23)cc1OC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b8fcee31-dd31-4d1d-b2a3-7d3e2319c847",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(O)C(CO)[P+](=O)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(O)C(CO)[P+](=O)c1ccccc1.",
+ "ref_smiles": "CC(C(=O)O)[P+](=O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7c0882f9-3d94-4c9d-9268-76aba1529fdc",
+ "task": "sub",
+ "question": "Modify the molecule CCC1C(O)C2C3CCC(C(C)CCNC(=O)NS(=O)(=O)C(C)(C)C)C3(C)CCC2C2(C)CCC(O)CC12 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1C(O)C2C3CCC(C(C)CCNC(=O)NS(=O)(=O)C(C)(C)C)C3(C)CCC2C2(C)CCC(O)CC12",
+ "ref_smiles": "CCC1C(C#N)C2C3CCC(C(C)CCNC(=O)NS(=O)(=O)C(C)(C)C)C3(C)CCC2C2(C)CCC(O)CC12",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "86bca3e6-4188-4d96-9fc4-5629d83bfde7",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N1C(C(=O)NCC(=O)NS(C)(=O)=O)CC(=O)c2ccccc2N(Cc2ccccc2)C(=O)C1CC12CC3CC(CC(C3)C1)C2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1C(C(=O)NCC(=O)NS(C)(=O)=O)CC(=O)c2ccccc2N(Cc2ccccc2)C(=O)C1CC12CC3CC(CC(C3)C1)C2",
+ "ref_smiles": "CC(=O)N1C(C(=O)NS(C)(=O)=O)CC(=O)c2ccccc2N(Cc2ccccc2)C(=O)C1CC12CC3CC(CC(C3)C1)C2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "801f3c15-cec2-4f9f-972f-37f40588970a",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C2C(c3ccc([N+](=O)[O-])cc3)N3C=Cc4ccccc4C3C2(C#N)C(N)=O)cc1 by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2C(c3ccc([N+](=O)[O-])cc3)N3C=Cc4ccccc4C3C2(C#N)C(N)=O)cc1",
+ "ref_smiles": "CC(=O)C1(C(N)=O)C(c2ccc(OC)cc2)C(c2ccc([N+](=O)[O-])cc2)N2C=Cc3ccccc3C21",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "344d857b-0f14-4682-b7fc-8ed78ae878e3",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COCC(=O)N1CCC(CNC(=O)C(F)(F)F)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(=O)N1CCC(CNC(=O)C(F)(F)F)CC1.",
+ "ref_smiles": "COCC(=O)N1CCC(CNC(=O)C(F)F)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8b948e92-3dfc-4534-8ab1-365034d9c88b",
+ "task": "sub",
+ "question": "Modify the molecule OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=Cc2ccccc2O1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=Cc2ccccc2O1",
+ "ref_smiles": "CC(=O)C1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C=Cc2ccccc2O1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3b4a76a1-ded7-474d-b493-e0087f5767b9",
+ "task": "delete",
+ "question": "Modify the molecule NC(=O)CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-] by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-]",
+ "ref_smiles": "NC(=O)CC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "56acc92d-43e0-45a8-8287-c2b2de242f40",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)Cn1ncnc1CC(NN)c1ccncc1F by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cn1ncnc1CC(NN)c1ccncc1F",
+ "ref_smiles": "CC(C)Cn1ncnc1CC(NN)c1ccncc1C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6477f3e2-e7be-4dd4-8a2f-a4e599fe7f2b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1nc2cc(OCC(O)C[NH+]3CCN(Cc4nc(-c5cccs5)no4)CC3C)ccc2s1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2cc(OCC(O)C[NH+]3CCN(Cc4nc(-c5cccs5)no4)CC3C)ccc2s1",
+ "ref_smiles": "CC(=O)C(COc1ccc2sc(C)nc2c1)C[NH+]1CCN(Cc2nc(-c3cccs3)no2)CC1C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b852dd6b-1f48-4492-b8fd-cc22390a1fca",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cn1nc(C2CC2)c2c(C(F)(F)Cl)cc(-c3ccc(F)cc3)nc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc(C2CC2)c2c(C(F)(F)Cl)cc(-c3ccc(F)cc3)nc21.",
+ "ref_smiles": "Cn1nc(C2CC2)c2c(C(F)F)cc(-c3ccc(F)cc3)nc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a7e82806-14fc-402e-b138-23fa9294af1d",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)c1ccc(O)c(CSc2ccccc2C)c1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(O)c(CSc2ccccc2C)c1",
+ "ref_smiles": "CC(=O)c1ccc([N+](=O)[O-])c(CSc2ccccc2C)c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f48e621b-be67-432a-a9bd-db6b507dfb8a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(CC(C)=CC=CC(OC)C2(ON)CC(C(C)OC(C)(C)C(CC=O)OC(=O)C(C)N(C)C(=O)CONC(=O)OCC3c4ccccc4-c4ccccc43)OC(=O)N2)ccc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CC(C)=CC=CC(OC)C2(ON)CC(C(C)OC(C)(C)C(CC=O)OC(=O)C(C)N(C)C(=O)CONC(=O)OCC3c4ccccc4-c4ccccc43)OC(=O)N2)ccc1Cl",
+ "ref_smiles": "COc1cc(CC(C)=CC=CC(OC)C2(ON)CC(C(C)OC(C)(C)C(CC=O)OC(=O)C(C)N(C)C(=O)CONC(=O)OCC3c4ccccc4-c4ccccc43)OC(=O)N2)ccc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "626e5b54-57e2-48d9-8747-ebad6096a694",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCOC(=O)CC(CCC(C)C)C1CCOC(C)(C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(CCC(C)C)C1CCOC(C)(C)C1.",
+ "ref_smiles": "CCOC(=O)CC(CCC(C)(C)C(=O)O)C1CCOC(C)(C)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "356f4bc4-3764-4872-a6da-0ed53d775d0b",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1c(NC2C[NH2+]C2)nn(C2CCCCC2O)c1N by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(NC2C[NH2+]C2)nn(C2CCCCC2O)c1N",
+ "ref_smiles": "N#Cc1c(NC2C[NH2+]C2)nn(C2CCCCC2F)c1N",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5d0bdd5d-7c55-4ebf-941f-7c0b86617527",
+ "task": "delete",
+ "question": "Modify the molecule CN(CC[NH3+])Cc1nccn1Cc1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC[NH3+])Cc1nccn1Cc1ccccc1",
+ "ref_smiles": "CN(CC[NH3+])Cc1nccn1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "636c777f-f343-4370-853d-96adb23148ce",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(-c2cc(C(F)(F)F)n3ncc(C(=O)N4CCOCC4)c3n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2cc(C(F)(F)F)n3ncc(C(=O)N4CCOCC4)c3n2)cc1.",
+ "ref_smiles": "COc1cc(C(F)(F)F)n2ncc(C(=O)N3CCOCC3)c2n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a0b0bdfc-f95e-408f-a4b8-1653be27c2ce",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(-n2ncc3cc(C#N)cnc32)c1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-n2ncc3cc(C#N)cnc32)c1",
+ "ref_smiles": "Cc1cccc(-n2ncc3cccnc32)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "160eb2a4-b2a1-4033-9a27-fbbd0f6530ad",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)CC1",
+ "ref_smiles": "O=C(c1cccs1)N1CC[NH+](CC(O)COC(c2ccc(F)cc2)c2ccc(F)c(O)c2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ab5c9a4a-9e9b-4a95-b219-2de09ceb6de1",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCCCC4C)cc3C)CC2)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCCCC4C)cc3C)CC2)cc1F.",
+ "ref_smiles": "Cc1ccc(NC(=O)c2ccccc2NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)NC4CCC(N)CC4C)cc3C)CC2)cc1F",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "8372b5c5-fc8e-4676-8a91-9bf3c07d62e9",
+ "task": "sub",
+ "question": "Modify the molecule O=c1[nH]cc(Cl)nc1Sc1ccccc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1[nH]cc(Cl)nc1Sc1ccccc1",
+ "ref_smiles": "O=c1[nH]cc(S)nc1Sc1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4bd14360-b633-432c-a1d7-8e1681ea4fe9",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(Cc1ccc(OCCN(CCCOCc2cc(Cl)cc(Cl)c2)C(=O)Nc2cc(C)ccc2OC)cc1)C(=O)[O-] by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(Cc1ccc(OCCN(CCCOCc2cc(Cl)cc(Cl)c2)C(=O)Nc2cc(C)ccc2OC)cc1)C(=O)[O-]",
+ "ref_smiles": "CCOC(Cc1ccc(OCCN(CCCOCc2cc(O)cc(Cl)c2)C(=O)Nc2cc(C)ccc2OC)cc1)C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f5cae44e-22b0-4452-bdf6-4d026b0e3603",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1c(C)c(C)c(Cl)c(C)c1C1C[NH2+]CCO1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(C)c(C)c(Cl)c(C)c1C1C[NH2+]CCO1",
+ "ref_smiles": "COc1c(C)c(C)c([N+](=O)[O-])c(C)c1C1C[NH2+]CCO1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d8fa23b7-ce3c-4dc9-8cdb-3dac36ccd75b",
+ "task": "add",
+ "question": "Modify the molecule CCCCCN(c1ncc(N)cn1)C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN(c1ncc(N)cn1)C(C)C",
+ "ref_smiles": "CCCCCN(c1ncc(N)cn1)C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c8b035ae-4c99-4da7-9fd4-499484a8ac9c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH+](C)CCn1ncc(Br)c1C(=O)c1csc(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCn1ncc(Br)c1C(=O)c1csc(Br)c1.",
+ "ref_smiles": "C[NH+](C)CCn1ncc(Br)c1C(=O)c1ccsc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e8599b78-01a2-4f02-9cfd-175d52b1f7d9",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCC#CC#CCCCCCCCCCSC(NC)=[NH+]C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCC#CC#CCCCCCCCCCSC(NC)=[NH+]C",
+ "ref_smiles": "CCCCCCCCCCCCC#CC#CCCCCCCCCCSC(C)=[NH+]C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "941233fa-b003-48af-8ab9-9ae1132dca97",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F.",
+ "ref_smiles": "COc1cc(O)c(CCC(=O)N(CCc2ccccc2)CC(=O)[O-])cc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1470cb30-fe4e-4b5f-b23c-99350f1dc42e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(O)(CNc1nc(-c2ccccc2)c2ccccc2n1)c1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)(CNc1nc(-c2ccccc2)c2ccccc2n1)c1ccco1.",
+ "ref_smiles": "CC(O)(Cc1nc(-c2ccccc2)c2ccccc2n1)c1ccco1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "2bb0bd4b-ba55-45bd-8cac-c4c536ebcc0b",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(C)OC(C)(C)C(F)CCO by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(C)OC(C)(C)C(F)CCO",
+ "ref_smiles": "CCOC(C)OC(C)(C)C(F)CCC(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "26e589b8-979a-4b5d-b96f-51e76da9b20a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC(CC1([NH3+])CC1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC1([NH3+])CC1)c1ccccc1.",
+ "ref_smiles": "CC(c1ccccc1)C(CC1([NH3+])CC1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7865c5f0-ca6b-4ae0-88b3-f3d764aa3bf7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule OCc1ccc(C#Cc2ccc(C(F)C(O)C(F)n3cnnn3)nc2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCc1ccc(C#Cc2ccc(C(F)C(O)C(F)n3cnnn3)nc2)cc1",
+ "ref_smiles": "N#CC(c1ccc(C#Cc2ccc(CO)cc2)cn1)C(O)C(F)n1cnnn1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a79be756-0639-4e3e-962a-c72c23194903",
+ "task": "sub",
+ "question": "Modify the molecule Nc1ncnc2c1ncn2C1OC(CO[P+](=O)[O-])C(OP(=O)([O-])OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)C1O by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ncnc2c1ncn2C1OC(CO[P+](=O)[O-])C(OP(=O)([O-])OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)C1O",
+ "ref_smiles": "Nc1ncnc2c1ncn2C1OC(CO[P+](=O)[O-])C(OP(=O)([O-])OCC2OC(n3ccc(=O)[nH]c3=O)C(Cl)C2O)C1O",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ece05111-aeb6-4156-aa24-ccc53de6942d",
+ "task": "add",
+ "question": "Modify the molecule FC(F)(F)COc1ccccc1NCc1ccc(Br)cn1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)COc1ccccc1NCc1ccc(Br)cn1",
+ "ref_smiles": "O=C(O)C(Nc1ccccc1OCC(F)(F)F)c1ccc(Br)cn1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e5d5ae2f-b628-4174-bf38-c2eb5fbed2c6",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(OC(=O)CCNC(=O)c2cccs2)c(C(C)C)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OC(=O)CCNC(=O)c2cccs2)c(C(C)C)cc1Cl.",
+ "ref_smiles": "CC(C)c1cc(Cl)c(Cc2ccccc2)cc1OC(=O)CCNC(=O)c1cccs1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "dd01b352-b76c-4c02-8fc1-c4d74b5a00e5",
+ "task": "add",
+ "question": "Modify the molecule CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])C1=O by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)[O-])C1=O",
+ "ref_smiles": "CC1OC(C(Cc2ccccc2)N=[N+]=[N-])CN(C(CC(=O)NC(c2ccccc2)(c2ccccc2)c2cccc(C#N)c2)C(=O)[O-])C1=O",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "7a5ba7be-4717-40fe-aafe-8497da9bbc5e",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CC(C[NH3+])Nc1cn[nH]c(=O)c1Cl by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC(C[NH3+])Nc1cn[nH]c(=O)c1Cl",
+ "ref_smiles": "[NH3+]CC(C[NH3+])(Nc1cn[nH]c(=O)c1Cl)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f5091357-2b30-40b3-bee2-b387cb17f599",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]C1CC[NH+](C2CCc3ccccc3C2)C(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C1CC[NH+](C2CCc3ccccc3C2)C(C)C1",
+ "ref_smiles": "CC1CC([NH2+]Cc2ccccc2)CC[NH+]1C1CCc2ccccc2C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "839f041b-c539-4bbb-9106-257ae87ca758",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C=CC3C1C5.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C=CC3C1C5.",
+ "ref_smiles": "C[NH+]1CCC23C4=C5CCC(OC6OC(C(=O)[O-])C(O)C(O)C6O)=C4OC2C(O)C(CC=O)=CC3C1C5",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "2dc0417c-5c28-4413-997c-3509c06f8456",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule ClCc1cccc(-c2cc(Cl)cc(Cl)c2Cl)c1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "ClCc1cccc(-c2cc(Cl)cc(Cl)c2Cl)c1Cl",
+ "ref_smiles": "ONCc1cccc(-c2cc(Cl)cc(Cl)c2Cl)c1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "91496f14-36b4-4476-b1e0-3f36773b0783",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccc(Cl)cn1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccc(Cl)cn1",
+ "ref_smiles": "O=C(C=Cc1ccc2c(c1)OCO2)Nc1ccc(S)cn1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e441c193-8ec6-4f57-a27d-b79b4f4710b4",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)n2-c2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)n2-c2ccccc2)cc1.",
+ "ref_smiles": "COc1ccc(-c2nnc(SCc3nnc(-c4ccc([N+](=O)[O-])cc4O)o3)n2-c2ccccc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "05fef804-38be-4cae-87bd-9013b8a813b3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(CCc2ccc(OC)cc2Cl)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCc2ccc(OC)cc2Cl)cc1",
+ "ref_smiles": "COc1ccc(CCc2ccc(OC)cc2C#N)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2571df45-d759-4154-b200-ac3ffe411bce",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN1CC(NC(=O)NCC2CCC(C)(C)c3ccccc32)CCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1CC(NC(=O)NCC2CCC(C)(C)c3ccccc32)CCC1=O.",
+ "ref_smiles": "CC1CC1NC(=O)NCC1CCC(C)(C)c2ccccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "86223763-69b3-4136-a69a-bf59c1d6ff5f",
+ "task": "add",
+ "question": "Modify the molecule C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2)SC1=[NH+]c1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2)SC1=[NH+]c1ccc(F)cc1",
+ "ref_smiles": "C=CCN1C(=O)C(CC(=O)c2ccc(Br)cc2-c2ccccc2)SC1=[NH+]c1ccc(F)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ca4b60ff-ec6b-45c0-8805-6ecd986e4df8",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCCCCCCC(=O)N(CC[NH+]1CCN(C(=O)CCCC)CC1)Cc1ccc(F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCC(=O)N(CC[NH+]1CCN(C(=O)CCCC)CC1)Cc1ccc(F)cc1.",
+ "ref_smiles": "CCCCCCCC(=O)N(Cc1ccc(F)cc1)C(N)C[NH+]1CCN(C(=O)CCCC)CC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "19e98e98-bdd9-4261-845e-3a64295aea10",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCC(C(N)=S)[NH+]1CCN(c2cc[nH+]c(C(N)=O)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(N)=S)[NH+]1CCN(c2cc[nH+]c(C(N)=O)c2)CC1.",
+ "ref_smiles": "CCC(C=S)[NH+]1CCN(c2cc[nH+]c(C(N)=O)c2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b4771fe0-c518-4e62-8fab-2bfa3a073e67",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCCN(C(=O)Cc1ccc(C(N)=O)cc1)c1c(N)[nH]c(=O)n(Cc2ccccc2F)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C(=O)Cc1ccc(C(N)=O)cc1)c1c(N)[nH]c(=O)n(Cc2ccccc2F)c1=O.",
+ "ref_smiles": "CCCCN(C(=O)Cc1ccc(C(N)=O)cc1)c1c(N)[nH]c(=O)n(Cc2ccccc2)c1=O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "28a7c94d-5bc7-4523-9d4a-e6c34cf464ff",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)C.",
+ "ref_smiles": "COc1c(C2=CCc3cc(NS(C)(=O)=O)ccc3O2)cc(-c2cccnc2OCc2ccccc2)cc1C(C)(C)CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d4a4688b-9413-4ea4-a224-bbc86a837985",
+ "task": "add",
+ "question": "Modify the molecule CCCCC([NH3+])(CCCC)C1(c2ccccc2)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC([NH3+])(CCCC)C1(c2ccccc2)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1",
+ "ref_smiles": "CCCCC([NH3+])(CCCC)C1(c2ccccc2O)CC[NH+](CCC(c2ccccc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "711125e0-6cac-4899-8947-3e9fb9ff33f7",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)c1ccc(NC(=O)CSc2nnc(C(NC(=O)c3ccccc3Cl)C(C)C)n2C)cc1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(NC(=O)CSc2nnc(C(NC(=O)c3ccccc3Cl)C(C)C)n2C)cc1",
+ "ref_smiles": "CC(C)c1ccc(NC(=O)CSc2nnc(C(NC(=O)c3ccccc3C#N)C(C)C)n2C)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d9a3da3d-f36e-4829-8f1b-e5b16d84e5b2",
+ "task": "add",
+ "question": "Modify the molecule COc1cc(C(=O)NCC(c2ccc(F)cc2)[NH+](C)C)ccc1OCc1cscn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C(=O)NCC(c2ccc(F)cc2)[NH+](C)C)ccc1OCc1cscn1",
+ "ref_smiles": "COc1cc(C(=O)NCC(c2ccc(F)cc2O)[NH+](C)C)ccc1OCc1cscn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ec537fe4-f192-4f3c-9510-297b6000e59c",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(=O)c1cccc(NC(=O)CCOCC2CCCO2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cccc(NC(=O)CCOCC2CCCO2)c1.",
+ "ref_smiles": "CC(=O)c1cc(NC(=O)CCOCC2CCCO2)cc(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4ac92ee5-f41a-4b13-b9b8-9d56d4dcfc00",
+ "task": "delete",
+ "question": "Modify the molecule CCCC(C(=O)NC(C)c1cc(OC)ccc1OC)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C(=O)NC(C)c1cc(OC)ccc1OC)c1ccccc1",
+ "ref_smiles": "CCCCC(=O)NC(C)c1cc(OC)ccc1OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fc675a75-7638-4ceb-ad98-dd2d4509ff72",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1ccc(Br)cc1C(=O)c1c(C)cccc1N with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(Br)cc1C(=O)c1c(C)cccc1N",
+ "ref_smiles": "CC(=O)c1ccc(OCC)c(C(=O)c2c(C)cccc2N)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "57bd9d0e-4fcc-4128-b165-8e5b781b6688",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCC(=Cc1cc(Br)ccc1O)CCC1OCC2C1=C(CCC)CC1C(=O)N(C)C(=O)C12 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=Cc1cc(Br)ccc1O)CCC1OCC2C1=C(CCC)CC1C(=O)N(C)C(=O)C12",
+ "ref_smiles": "CC(=O)c1ccc(O)c(C=C(CCC)CCC2OCC3C2=C(CCC)CC2C(=O)N(C)C(=O)C23)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "853a0db0-c008-492b-8235-d32258b8e6b4",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)Cn2nnc3ccccc32)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)Cn2nnc3ccccc32)o1",
+ "ref_smiles": "Cc1ccc(C(C(=O)NC2CCCCC2)N(CCc2ccccc2)C(=O)C(O)n2nnc3ccccc32)o1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "24e8eb4e-1f9e-4b95-bfef-9e069b221dfb",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)cc3)nc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)cc3)nc12.",
+ "ref_smiles": "COc1ccc(Cl)c2sc(NC(=O)c3ccc(C#N)c(O)cc3)nc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a9af393c-8157-43a3-a275-1281c729cc5c",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc(=O)c(C(C)Nc2cc(Br)ccc2F)c(C)[nH]1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(=O)c(C(C)Nc2cc(Br)ccc2F)c(C)[nH]1",
+ "ref_smiles": "Cc1nc(=O)c(C(C)Nc2cc(NO2)ccc2F)c(C)[nH]1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "41440b36-b0eb-44ac-9d8a-9fb6bb6daa5b",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)Oc1cc(-c2ccn3ncc(CO)c3n2)ccn1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1cc(-c2ccn3ncc(CO)c3n2)ccn1",
+ "ref_smiles": "CC(C)Oc1cc(-c2ccn3ncc(CNO)c3n2)ccn1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3c55176d-6d1b-45ea-b38d-2d7dfc8cd501",
+ "task": "add",
+ "question": "Modify the molecule C[SiH](C)c1cc(C(C)(C)C)ccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[SiH](C)c1cc(C(C)(C)C)ccn1",
+ "ref_smiles": "C[Si](O)(C)c1cc(C(C)(C)C)ccn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1c6ec9eb-0fcd-4fb7-9663-809bb877ed3d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(=O)OC1C(CO[P+](=S)Oc2ccccc2)OC(n2ccc(=O)[nH]c2=O)C1(C)O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)OC1C(CO[P+](=S)Oc2ccccc2)OC(n2ccc(=O)[nH]c2=O)C1(C)O",
+ "ref_smiles": "CCC(=O)OC1C(CO[P+](=S)Oc2ccccc2)OC(n2ccc(=O)[nH]c2=O)C1(C)C#N",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ee6c2467-e29f-4014-96e6-7ab3ef41aaac",
+ "task": "sub",
+ "question": "Modify the molecule CCC(C)C(Cn1cc(C(F)(F)F)ccc1=O)[NH2+]C by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(Cn1cc(C(F)(F)F)ccc1=O)[NH2+]C",
+ "ref_smiles": "CCC(C)C(Cn1cc(C(O)(F)F)ccc1=O)[NH2+]C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ff8b8f36-6cb5-42ac-b782-5defa0486cd3",
+ "task": "delete",
+ "question": "Modify the molecule C[SiH2]C(CCN=C=O)(OCC(F)(F)F)OCC(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[SiH2]C(CCN=C=O)(OCC(F)(F)F)OCC(F)(F)F",
+ "ref_smiles": "C[SiH2]C(CCN=C=O)(OCC(F)F)OCC(F)(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "280e395d-6a9b-4890-89cb-c6f21abdb09b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1.",
+ "ref_smiles": "CCC(C)COC(=O)OC(C)C(C)OC(=O)C([NH3+])C(O)c1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a19ed508-25f4-4e93-89ce-5bdb5eee42c6",
+ "task": "delete",
+ "question": "Modify the molecule C=CCN(CCOC)C(=O)CC1COCC[NH2+]1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN(CCOC)C(=O)CC1COCC[NH2+]1",
+ "ref_smiles": "C=CCC1(CCOC)COCC[NH2+]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5e588180-b55e-4970-a623-7e63a4157ada",
+ "task": "add",
+ "question": "Modify the molecule O=C1OCCC2(CC2)N1c1cccc(Br)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1OCCC2(CC2)N1c1cccc(Br)c1",
+ "ref_smiles": "O=C1OCC(c2ccccc2)C2(CC2)N1c1cccc(Br)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f1f8411d-4247-44ab-ba30-eb01740500b8",
+ "task": "add",
+ "question": "Modify the molecule O=Cc1ccc(O)c(C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=Cc1ccc(O)c(C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1",
+ "ref_smiles": "NC(=Cc1cc(C=O)ccc1O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "29b25230-8a3f-4ca6-9a3d-890086a65a64",
+ "task": "delete",
+ "question": "Modify the molecule CCCC(C)Nc1nccc(C(C#N)c2nc(C)cs2)n1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)Nc1nccc(C(C#N)c2nc(C)cs2)n1",
+ "ref_smiles": "CCCC(C)Nc1nccc(Cc2nc(C)cs2)n1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "aa5f2cbd-8ae0-48c4-bb19-cd49d316843a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1cccc(OCc2[nH+]c(Br)cn2C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(OCc2[nH+]c(Br)cn2C)c1.",
+ "ref_smiles": "COOCc1[nH+]c(Br)cn1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b7ad73b3-0e94-4ee5-b7e0-d5370701d0a4",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc2c(c1)-c1c(cnn1CC(=O)Nc1nc3ccccc3s1)CO2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)-c1c(cnn1CC(=O)Nc1nc3ccccc3s1)CO2",
+ "ref_smiles": "Cc1ccc2c(c1)-c1c(cnn1-c1nc3ccccc3s1)CO2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "67f9b389-036f-4c1d-bece-463eeb86c391",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(CC([NH3+])c2ccccc2OC)c(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC([NH3+])c2ccccc2OC)c(OC)c1.",
+ "ref_smiles": "COc1ccc(CC([NH3+])OC)c(OC)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3666dccc-7636-418e-ae78-8200818b966f",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]1CCN(c2ccc(-c3cc(NCCc4cccc5c4OCC54CC4)ncn3)cn2)CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(c2ccc(-c3cc(NCCc4cccc5c4OCC54CC4)ncn3)cn2)CC1",
+ "ref_smiles": "C[NH+]1CCN(c2ccc(-c3cc(CCc4cccc5c4OCC54CC4)ncn3)cn2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "26095dca-a4df-42ed-b6f0-b8cb3a960ee1",
+ "task": "add",
+ "question": "Modify the molecule Clc1nnc(C[NH+]2CCCC2C2CCCC2)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1nnc(C[NH+]2CCCC2C2CCCC2)s1",
+ "ref_smiles": "Clc1nnc(C[NH+]2CC(c3ccccc3)CC2C2CCCC2)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b43ac132-fc5c-445b-a5bf-c79f89b614d3",
+ "task": "delete",
+ "question": "Modify the molecule Nc1c(C(=O)[O-])sc2nc(N3CCC([NH2+]CC(O)c4ccc5nc(Cc6ccccc6)[nH]c5c4)CC3)cc(C(F)(F)F)c12 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1c(C(=O)[O-])sc2nc(N3CCC([NH2+]CC(O)c4ccc5nc(Cc6ccccc6)[nH]c5c4)CC3)cc(C(F)(F)F)c12",
+ "ref_smiles": "Cc1nc2ccc(C(O)C[NH2+]C3CCN(c4cc(C(F)(F)F)c5c(N)c(C(=O)[O-])sc5n4)CC3)cc2[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c0fed816-b82d-4c5f-bb76-934e4bfe2a32",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(-c2c(N)c(C#N)nc3sc4c(c23)CCCC4)cc1 by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2c(N)c(C#N)nc3sc4c(c23)CCCC4)cc1",
+ "ref_smiles": "Cc1ccc(-c2c(N)c(S)nc3sc4c(c23)CCCC4)cc1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "e7891e80-dfa7-4d79-88b3-fbcf1594f267",
+ "task": "delete",
+ "question": "Modify the molecule CC1OCCC1NC(=O)N1CC(O)CC1c1ccccc1C(F)(F)F by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1OCCC1NC(=O)N1CC(O)CC1c1ccccc1C(F)(F)F",
+ "ref_smiles": "CC1OCCC1NC(=O)N1CCCC1c1ccccc1C(F)(F)F",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3c486bd4-599e-40b2-8fb2-c82b7f22c82a",
+ "task": "add",
+ "question": "Please add a amine to the molecule C[NH+]=C(NCc1ncc(C)s1)NC1CC1c1ccccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1ncc(C)s1)NC1CC1c1ccccc1F.",
+ "ref_smiles": "C[NH+]=C(NCc1ncc(C)s1)NC1C(N)C1c1ccccc1F",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4693d254-ec11-4ade-b1bc-6efbc5a96c13",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CO[SiH](CN[Si](C)(C)c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CO[SiH](CN[Si](C)(C)c1ccccc1)c1ccccc1.",
+ "ref_smiles": "CO[SiH](CN[Si](C)(C)c1cccc(-c2ccccc2)c1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8c8b8983-2d66-442e-9142-e94bf537e3d9",
+ "task": "sub",
+ "question": "Modify the molecule CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccco1)C(=O)Nc1ccc(Cl)cc1Cl by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccco1)C(=O)Nc1ccc(Cl)cc1Cl",
+ "ref_smiles": "CCC(c1nc2ccccc2c(=O)n1C)N(Cc1ccco1)C(=O)Nc1ccc(C#N)cc1Cl",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2d99b53f-da11-4e9e-8c84-a766597c0836",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)ccc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)ccc1Cl",
+ "ref_smiles": "CCN(CC)S(=O)(=O)c1cc(NC(=S)NCCCSC)c(-c2ccccc2)cc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4d5eb7a5-dc06-4d41-982a-8a496e65e821",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(NCCC(C)S(C)=O)nc(C(C)C)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NCCC(C)S(C)=O)nc(C(C)C)n1",
+ "ref_smiles": "Cc1cc(CCC(C)S(C)=O)nc(C(C)C)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5768f9ac-7dd7-41d5-9a21-3d6a8ba26c12",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cc1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1",
+ "ref_smiles": "O=C(C(O)c1nc(CCl)cs1)N1CCC(C(F)(F)F)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f3ec5ea4-50bf-4e57-84f3-80e8a566c94d",
+ "task": "add",
+ "question": "Modify the molecule C#CC1(C(F)F)COCC(N)=[NH+]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC1(C(F)F)COCC(N)=[NH+]1",
+ "ref_smiles": "C#CC1(C(O)(F)F)COCC(N)=[NH+]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "17375582-1dff-49fe-8661-ad9d3d9b4447",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)n1ccc(-c2cccc(Cl)c2)c1C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1ccc(-c2cccc(Cl)c2)c1C(=O)[O-]",
+ "ref_smiles": "CC(C)n1ccc(-c2cccc(S)c2)c1C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f52607d7-6d34-4514-be54-18df5bd2a5fb",
+ "task": "add",
+ "question": "Modify the molecule Nc1ccc(O)cc1NC(=O)CCc1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(O)cc1NC(=O)CCc1ccco1",
+ "ref_smiles": "Nc1cc(O)c(O)cc1NC(=O)CCc1ccco1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "456b9c5c-aced-40bc-84ad-3a91de52dff5",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])CC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1",
+ "ref_smiles": "O=C([O-])CC1(c2ccccc2)CCN(S(=O)(=O)c3ccc(Cl)s3)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "884e1864-17aa-4cbf-b149-4785097b5135",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(F)ccc1NC(=O)N1CC2(CCCC2)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(F)ccc1NC(=O)N1CC2(CCCC2)C1",
+ "ref_smiles": "Cc1cc(C#N)ccc1NC(=O)N1CC2(CCCC2)C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aa5c2f3b-8aa8-4114-b01c-c996979d2536",
+ "task": "delete",
+ "question": "Modify the molecule N#Cc1nc(C#N)c(Br)nc1N by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1nc(C#N)c(Br)nc1N",
+ "ref_smiles": "N#Cc1cnc(N)c(C#N)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "346e34e1-1caa-46c4-b027-f8ae51d1c502",
+ "task": "add",
+ "question": "Modify the molecule CS(=O)(=O)CCNC(c1ccccc1)c1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CCNC(c1ccccc1)c1ccc(F)cc1",
+ "ref_smiles": "CS(=O)(=O)C(CNC(c1ccccc1)c1ccc(F)cc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1f313e2e-0921-4918-94a4-ed27c371b74f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCN(C)C(=O)c1cc(-c2nnc(C)n2-c2ccccc2F)c(O)cc1O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(C)C(=O)c1cc(-c2nnc(C)n2-c2ccccc2F)c(O)cc1O",
+ "ref_smiles": "CCCN(C)C(=O)c1cc(-c2nnc(C)n2-c2ccccc2F)c([N+](=O)[O-])cc1O",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f83fcfc2-ca20-4921-8fdb-21985188a78a",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ccc2ncnc(N(CCCO)C3CCC3)c2c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc2ncnc(N(CCCO)C3CCC3)c2c1",
+ "ref_smiles": "OCCCN(c1ncnc2ccccc12)C1CCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "06dbb0a8-44c1-485e-b1e5-4cd6de23326e",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N(c1cc(C(=O)[O-])cc(N2CCCC2=O)c1)C(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(c1cc(C(=O)[O-])cc(N2CCCC2=O)c1)C(C)C",
+ "ref_smiles": "CC(C)c1cc(C(=O)[O-])cc(N2CCCC2=O)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f8291d9e-6e30-464c-90e5-5144bcb3b2d9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CCc1cc(C=C2C(=O)NC(=O)N(c3cc(Cl)ccc3C)C2=O)cc(OC)c1OC with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(C=C2C(=O)NC(=O)N(c3cc(Cl)ccc3C)C2=O)cc(OC)c1OC",
+ "ref_smiles": "C=CCc1cc(C=C2C(=O)NC(=O)N(c3cc([N+](=O)[O-])ccc3C)C2=O)cc(OC)c1OC",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "90a260b3-447e-4f8c-9cd6-6b5def7ec03b",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOC(CC[NH+](C)C)C[NH+]=C(N)NC(C)COC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(CC[NH+](C)C)C[NH+]=C(N)NC(C)COC.",
+ "ref_smiles": "CCOC(CC[NH+](C)C)C[NH+]=C(N)C(C)COC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bd80fc8c-f28c-4975-ba65-faace22d1e9e",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(NCC2CCC(NSC(C)C)CC2)cc2ccc(=O)oc12 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NCC2CCC(NSC(C)C)CC2)cc2ccc(=O)oc12",
+ "ref_smiles": "Cc1cc(NCC2CCC(SC(C)C)CC2)cc2ccc(=O)oc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7ce5c437-1b54-4646-ac79-8795d02c7d39",
+ "task": "add",
+ "question": "Modify the molecule C1CC(SCC[NH2+]C(C2CC2)C2CC2)CC[NH2+]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C1CC(SCC[NH2+]C(C2CC2)C2CC2)CC[NH2+]1",
+ "ref_smiles": "c1ccc(C(CSC2CC[NH2+]CC2)[NH2+]C(C2CC2)C2CC2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "502ce2b6-e3dd-4b28-bc25-959b5dddad28",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCOc1ccccc1C=CC(=O)NC1CCCN(C(=O)NCC2CCCO2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccccc1C=CC(=O)NC1CCCN(C(=O)NCC2CCCO2)C1.",
+ "ref_smiles": "CCCOC=CC(=O)NC1CCCN(C(=O)NCC2CCCO2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "12da2d01-4255-4186-87aa-515e7dd4daca",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule NC(COc1cccc(NS(=O)(=O)c2cccs2)c1)=[NH+]O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(COc1cccc(NS(=O)(=O)c2cccs2)c1)=[NH+]O.",
+ "ref_smiles": "NC(CONS(=O)(=O)c1cccs1)=[NH+]O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "90771557-60c5-405e-ac5d-751494735a3e",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3ccccc3)o2)c1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3ccccc3)o2)c1)S(C)(=O)=O.",
+ "ref_smiles": "CCN(c1cc(C(=O)NC(C)c2cccc(Cl)c2)cc(-c2nnc(C(C)([NH3+])Cc3cccc(C(=O)O)c3)o2)c1)S(C)(=O)=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cf823295-cf05-4bbf-9125-f0fc5da85955",
+ "task": "add",
+ "question": "Modify the molecule CCN(CCCC[NH2+]C(C)C)c1ccccc1C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CCCC[NH2+]C(C)C)c1ccccc1C",
+ "ref_smiles": "CCN(c1ccccc1C)C(N)CCC[NH2+]C(C)C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "ef32cdaa-1af9-42a3-b1fd-116815099f00",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule c1ccc(N2CC[NH+](CCC3CCc4c3cnn4-c3ccccc3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(N2CC[NH+](CCC3CCc4c3cnn4-c3ccccc3)CC2)cc1.",
+ "ref_smiles": "OC1CC(CC[NH+]2CCN(c3ccccc3)CC2)c2cnn(-c4ccccc4)c21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "92e28a76-859b-4a89-802b-8c890990d744",
+ "task": "add",
+ "question": "Modify the molecule CNc1cc[nH+]c(C(=O)N(C)CC[NH+]2CCCC2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc[nH+]c(C(=O)N(C)CC[NH+]2CCCC2)c1",
+ "ref_smiles": "CNc1cc[nH+]c(C(=O)N(C)CC(c2ccccc2)[NH+]2CCCC2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "25f5dc2c-cdaa-411d-baf7-11fb51ab0dcc",
+ "task": "delete",
+ "question": "Modify the molecule CCC1CC(Nc2cccc(N3CCCC3=O)c2)CCO1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CC(Nc2cccc(N3CCCC3=O)c2)CCO1",
+ "ref_smiles": "CCC1CC(c2cccc(N3CCCC3=O)c2)CCO1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6153ac8f-4609-4fbc-a726-3bc215e06a4a",
+ "task": "add",
+ "question": "Modify the molecule CC(CO)NC(=O)NCC(c1cccnc1)C(C)C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CO)NC(=O)NCC(c1cccnc1)C(C)C",
+ "ref_smiles": "CC(CO)NC(=O)NCC(c1cncc(N)c1)C(C)C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "2174f1a1-3da3-434f-9202-c5b0b5a65a49",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])C1.",
+ "ref_smiles": "COCCN(CC(=O)N(C)C)C(=O)C1CCC([NH3+])(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "309b1a3d-8d5e-4979-a731-1a46272a6cca",
+ "task": "add",
+ "question": "Modify the molecule CCCC1CC([NH2+]CC)CN(C(C)C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC([NH2+]CC)CN(C(C)C)C1",
+ "ref_smiles": "CC[NH2+]C1CC(C(CC)c2ccccc2)CN(C(C)C)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eab02f68-b0a6-402a-9e7e-dbee612e2ec7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3cccc(Cl)c3)CC2)cccc1C(=O)N1CCC(C)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3cccc(Cl)c3)CC2)cccc1C(=O)N1CCC(C)CC1",
+ "ref_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3cccc(S)c3)CC2)cccc1C(=O)N1CCC(C)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a2067936-2cf5-42e5-8480-e9a9a064ee93",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C1CSC(C(=O)NC2CCCCC2)C(c2cnn(C3CC3)c2)N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CSC(C(=O)NC2CCCCC2)C(c2cnn(C3CC3)c2)N1.",
+ "ref_smiles": "O=C1NC(c2cnn(C3CC3)c2)C(C(=O)NC2CCCCC2)SC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3dd09dbb-a63c-4bab-93ad-09a3a044c9f8",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)n1cc(N)cc1C(=O)NCC1CC(O)C1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1cc(N)cc1C(=O)NCC1CC(O)C1",
+ "ref_smiles": "CC(C)n1cc(N)cc1C(=O)NCC1CC(S)C1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0a220a1e-299a-4898-a46c-0fad0db282cb",
+ "task": "delete",
+ "question": "Modify the molecule CCC1CCC(C#N)C(N(C)C(C)CC)C1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(C#N)C(N(C)C(C)CC)C1",
+ "ref_smiles": "CCC1CCCC(N(C)C(C)CC)C1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8cfc779a-456c-4c2c-b23c-5cced1945631",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1NC(=O)c2c(-c3ccc(Cl)cc3)cc(O)c3cccc1c23 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NC(=O)c2c(-c3ccc(Cl)cc3)cc(O)c3cccc1c23",
+ "ref_smiles": "O=C1NC(=O)c2c(-c3ccc([N+](=O)[O-])cc3)cc(O)c3cccc1c23",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "29af02e8-3640-4afd-a30b-cbc4267a57fb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(CCn2c(C)c(C)c3c2ncn2nc(-c4ccc(Cl)cc4)nc32)cc1OC with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCn2c(C)c(C)c3c2ncn2nc(-c4ccc(Cl)cc4)nc32)cc1OC",
+ "ref_smiles": "COc1ccc(CCn2c(C)c(C)c3c2ncn2nc(-c4ccc(O)cc4)nc32)cc1OC",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "473a1a1b-d176-4643-9180-bfe666f5c2e7",
+ "task": "sub",
+ "question": "Modify the molecule C=CCOc1ccc(Cl)cc1C=C1C(=O)NC(=S)NC1=O by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOc1ccc(Cl)cc1C=C1C(=O)NC(=S)NC1=O",
+ "ref_smiles": "C=CCOc1ccc(O)cc1C=C1C(=O)NC(=S)NC1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b260a26a-7e01-456c-9c36-87af9033cd45",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN1CC(=O)N2CC(NC(=O)CCC(=O)[O-])CC2COc2ccc(F)cc2C(=O)N(C)C(C(=O)N(C)CC[NH+](C)C)CCC1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1CC(=O)N2CC(NC(=O)CCC(=O)[O-])CC2COc2ccc(F)cc2C(=O)N(C)C(C(=O)N(C)CC[NH+](C)C)CCC1=O",
+ "ref_smiles": "CN1CC(=O)N2CC(NC(=O)CCC(=O)[O-])CC2COc2ccc(C#N)cc2C(=O)N(C)C(C(=O)N(C)CC[NH+](C)C)CCC1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f2750598-6baa-40e6-93b9-29ec533f5635",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)N(CC[NH3+])C(=S)NCCCc1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)N(CC[NH3+])C(=S)NCCCc1ccccc1",
+ "ref_smiles": "CCOC(=O)N(CC[NH3+])C(=S)NCCC(c1ccccc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b4948d3e-00a4-4c42-ac1c-d275dae757c7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCN(CCC[NH2+]Cc1ccc(Cl)c(F)c1)C(=O)OC(C)(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CCC[NH2+]Cc1ccc(Cl)c(F)c1)C(=O)OC(C)(C)C",
+ "ref_smiles": "CCN(CCC[NH2+]Cc1ccc(NO)c(F)c1)C(=O)OC(C)(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "226aa929-bfc4-4171-8898-95ea57d03fb4",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH+](C)CC1CCCN1c1ncccc1CBr.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CC1CCCN1c1ncccc1CBr.",
+ "ref_smiles": "Cc1cccnc1N1CCCC1C[NH+](C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6e829f07-f716-45be-a167-a9ee06e5d1f0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C(=NNc1nc(NCc2ccccc2)nc(N2CCOCC2)n1)c1ccc(N2CCOCC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C(=NNc1nc(NCc2ccccc2)nc(N2CCOCC2)n1)c1ccc(N2CCOCC2)cc1.",
+ "ref_smiles": "C(=NNc1nc(NCc2ccccc2)nc(N2CCOCC2)n1)N1CCOCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "df9f849a-ff39-450d-90fe-10e429587399",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)OC(=O)NCCC(=O)NCCNC(=O)c1cccc(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NCCC(=O)NCCNC(=O)c1cccc(Cl)c1",
+ "ref_smiles": "CC(C)(C)OC(=O)NCCC(=O)NCCNC(=O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "28042018-06fd-4180-ac9d-88d80cec8c41",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOC(Cn1cc(C(=O)N(Cc2ccccc2C(F)(F)F)C2CC2)nn1)OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(Cn1cc(C(=O)N(Cc2ccccc2C(F)(F)F)C2CC2)nn1)OCC.",
+ "ref_smiles": "CCOC(Cn1cc(C(=O)N(Cc2cc(-c3ccccc3)ccc2C(F)(F)F)C2CC2)nn1)OCC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "19cd9eb7-00f8-41ae-beac-abc642ccb0f6",
+ "task": "add",
+ "question": "Modify the molecule c1csc(CNc2ncnc3ccc(-c4ccc5c(c4)OCCO5)cc23)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1csc(CNc2ncnc3ccc(-c4ccc5c(c4)OCCO5)cc23)c1",
+ "ref_smiles": "Oc1cc2c(cc1-c1ccc3ncnc(NCc4cccs4)c3c1)OCCO2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d7a52a53-69c5-45e3-ab28-550f4f6fa837",
+ "task": "delete",
+ "question": "Modify the molecule COc1nn(C)c(F)c1C(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1nn(C)c(F)c1C(F)(F)F",
+ "ref_smiles": "COc1nn(C)c(F)c1C(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d236a167-be8b-4bf7-baea-d11fba2b5e35",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N1Cc2cccc(CC[N+](=O)c3nnc(CCCCc4ccc(NC(=O)Cc5ccccc5)nn4)s3)c2C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1Cc2cccc(CC[N+](=O)c3nnc(CCCCc4ccc(NC(=O)Cc5ccccc5)nn4)s3)c2C1",
+ "ref_smiles": "CC(=O)Nc1ccc(CCCCc2nnc([N+](=O)CCc3cccc4c3CN(C(C)=O)C4)s2)nn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4496f585-f7f2-47c8-b21c-080230ce307b",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(C=NNC(=O)Cc2ccccc2[N+](=O)[O-])c1OCc1cccc(C(=O)[O-])c1 by removing a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C=NNC(=O)Cc2ccccc2[N+](=O)[O-])c1OCc1cccc(C(=O)[O-])c1",
+ "ref_smiles": "COc1cccc(C=NNC(=O)Cc2ccccc2)c1OCc1cccc(C(=O)[O-])c1",
+ "add_group": null,
+ "remove_group": "nitro"
+ },
+ {
+ "id": "dfab9f3c-4a23-4757-b702-35a3f9cde126",
+ "task": "add",
+ "question": "Please add a amine to the molecule O=C(NCc1ncon1)c1cccc2c1CC[NH2+]C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ncon1)c1cccc2c1CC[NH2+]C2.",
+ "ref_smiles": "Nc1cc2c(c(C(=O)NCc3ncon3)c1)CC[NH2+]C2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0f591bd3-4c4b-4f1b-8811-610126759f23",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)CCC[NH+](C)CCCn1nc(I)c2c(N)ncnc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCC[NH+](C)CCCn1nc(I)c2c(N)ncnc21",
+ "ref_smiles": "CCOC(=O)CCC[NH+](C)CCCn1nc(C=O)c2c(N)ncnc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "92c5be41-e2d6-4121-bc5c-1bafcfc294dd",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)CC2)nc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)CC2)nc1",
+ "ref_smiles": "CCOC(=O)c1cnc(N2CCC(c3noc4c(N5CCc6cc(S(C)(=O)=O)ccc65)ncnc34)C(N)C2)nc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "13eab73a-7b83-43f0-a84d-7d35449b5939",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(C1=C2CCCC2Cc2ccccc21)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1=C2CCCC2Cc2ccccc21)c1ccccc1.",
+ "ref_smiles": "O=C(C1=C2C(O)CCC2Cc2ccccc21)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "aa55238e-7ed4-4a4c-b70b-85d046ebdb51",
+ "task": "add",
+ "question": "Modify the molecule CCC[NH+]=C(N)NC1Cc2ccccc2C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+]=C(N)NC1Cc2ccccc2C1",
+ "ref_smiles": "CCC[NH+]=C(N)NC1Cc2ccccc2C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "57e4c552-dbb4-4258-8e32-41273abd5297",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(F)c(CC(=O)N2CCOC(c3ccccc3)C2)c1F by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(F)c(CC(=O)N2CCOC(c3ccccc3)C2)c1F",
+ "ref_smiles": "Cc1ccc(CHO)c(CC(=O)N2CCOC(c3ccccc3)C2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2c2040d8-0745-4927-abc5-133e46b347e0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1ccc(NC(=O)CC2C(=O)N(c3ccc(Cl)cc3)C(=S)N2Cc2ccccc2F)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NC(=O)CC2C(=O)N(c3ccc(Cl)cc3)C(=S)N2Cc2ccccc2F)cc1",
+ "ref_smiles": "CC(=O)c1ccc(N2C(=O)C(CC(=O)Nc3ccc(OCC)cc3)N(Cc3ccccc3F)C2=S)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6ea8427a-3ebd-40ae-b9d6-302dfe9f0e27",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCc1ccc(C(O)C(C)[NH+]2CCCC(C)C2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C(O)C(C)[NH+]2CCCC(C)C2)cc1",
+ "ref_smiles": "CCc1ccc(C(C#N)C(C)[NH+]2CCCC(C)C2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "51d8598e-20f9-4568-ba55-a14f5c91f210",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(=O)N(Cc1nnc(C2CC2)n1C)C1CC[NH+](CC(N)=O)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(Cc1nnc(C2CC2)n1C)C1CC[NH+](CC(N)=O)C1.",
+ "ref_smiles": "CC(=O)N(Cc1nnc(C2CC2)n1C)C1CC[NH+]C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e8c95e46-e24d-4444-a454-d303fca0185f",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CSCCC(NC(=O)C(NC(=O)C([NH3+])CC(=O)[O-])C(C)O)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)C(NC(=O)C([NH3+])CC(=O)[O-])C(C)O)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-].",
+ "ref_smiles": "CSCCC(NC(=O)C(NC(=O)C([NH3+])CC(=O)[O-])C(C))C(=O)NC(Cc1cnc[nH]1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c33ed086-2013-4e29-bb70-a21c15e0d5b6",
+ "task": "add",
+ "question": "Modify the molecule CCc1cc(C(C)(C)c2cc(CC)c(OCC3OC3C)c(CC)c2)cc(CC)c1OCC1OC1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(C(C)(C)c2cc(CC)c(OCC3OC3C)c(CC)c2)cc(CC)c1OCC1OC1C",
+ "ref_smiles": "CCc1cc(C(C)(C)c2cc(CC)c(OCC3(O)OC3C)c(CC)c2)cc(CC)c1OCC1OC1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "94ce10e4-2347-4f41-a6bd-a6ac7b2502ae",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]CC(c1cccc(Br)c1)C1CCSCC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC(c1cccc(Br)c1)C1CCSCC1",
+ "ref_smiles": "N#Cc1cccc(C(C[NH3+])C2CCSCC2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1a63924c-6b85-43a0-bacf-7b20583314f5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccccc1CC(=O)NC(=S)NNC(=O)COc1ccc(Br)cc1C with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1CC(=O)NC(=S)NNC(=O)COc1ccc(Br)cc1C",
+ "ref_smiles": "Cc1ccccc1CC(=O)NC(=S)NNC(=O)COc1ccc(C#N)cc1C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b56faec3-e07a-4a17-8104-3e5c7613bca3",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)N2CCC(NC(=O)C(C)C3C[NH2+]C3)CC2)cc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N2CCC(NC(=O)C(C)C3C[NH2+]C3)CC2)cc1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N2CCC(C3(C)C[NH2+]C3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "cf9cb97c-6d1c-4753-9889-4eb13d300e64",
+ "task": "add",
+ "question": "Please add a amine to the molecule [NH3+]C1CN(C(=O)NC2CCC[NH2+]C2)CC1c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CN(C(=O)NC2CCC[NH2+]C2)CC1c1ccccc1.",
+ "ref_smiles": "NC1CCC(NC(=O)N2CC([NH3+])C(c3ccccc3)C2)C[NH2+]1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4f68ab2b-3e1e-4a58-874e-d6124047b0e9",
+ "task": "add",
+ "question": "Modify the molecule CCCCOc1ccc(C(=NNC(=O)c2ccncc2)C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1ccc(C(=NNC(=O)c2ccncc2)C(=O)[O-])cc1",
+ "ref_smiles": "CCCCOc1ccc(C(=NNC(=O)c2ccnc(-c3ccccc3)c2)C(=O)[O-])cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7e49fdc8-3e41-477a-9f2e-6ab5e9ddbfbf",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCC(CCOBC1C=C2CCC3CC1CC23)CC(O)N1CC[NH2+]CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(CCOBC1C=C2CCC3CC1CC23)CC(O)N1CC[NH2+]CC1",
+ "ref_smiles": "CCCC(CCOBC1C=C2CCC3CC1CC23)CC(C(=O)[OH])N1CC[NH2+]CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f3d81d57-2a6e-4730-85a7-74f02caf1c8e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1CC(N(C)c2nc(Br)cs2)C(C)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(N(C)c2nc(Br)cs2)C(C)O1.",
+ "ref_smiles": "CC1CC(N(C)c2nccs2)C(C)O1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e2f748f9-6754-4265-b377-8f827ae7a1f7",
+ "task": "delete",
+ "question": "Modify the molecule CS(=O)(=O)Cc1ccccc1CNc1nc(-c2cccc(Cl)c2)nc2c1CCCC2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)Cc1ccccc1CNc1nc(-c2cccc(Cl)c2)nc2c1CCCC2",
+ "ref_smiles": "CS(=O)(=O)CCNc1nc(-c2cccc(Cl)c2)nc2c1CCCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c2acb450-58d6-4c2d-a6c7-d6957fdc1936",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(C)(=O)=O.",
+ "ref_smiles": "CCOc1ccccc1N(CCCC(=O)N(Cc1cccc(OC)c1)C(CC)C(=O)NC1CCCC1)S(=O)(=O)CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "05fd012c-cebc-4923-9b61-ea5fd07fa315",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCOc1ccc(C(=O)NCC(=O)NN=Cc2ccc(O)c(OCC)c2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(C(=O)NCC(=O)NN=Cc2ccc(O)c(OCC)c2)cc1",
+ "ref_smiles": "CCCOc1ccc(C(=O)NCC(=O)NN=Cc2ccc(CHO)c(OCC)c2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6b9d380a-cc14-4de1-af31-4e07936ebdd4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)COc1ccc([N+](=O)[O-])c(F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)COc1ccc([N+](=O)[O-])c(F)c1",
+ "ref_smiles": "Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)COc1ccc([N+](=O)[O-])c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c728a2d-5707-41c6-9db3-b7d1fd038df3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1c2cccccc-2c(I)c1NC(C)=O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c2cccccc-2c(I)c1NC(C)=O",
+ "ref_smiles": "CCOC(=O)c1c2cccccc-2c(S)c1NC(C)=O",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "72666393-6c8d-450b-8f29-c9a0cbcebb94",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1cc(CCl)cc(-c2ccccc2C(F)(F)F)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cc(CCl)cc(-c2ccccc2C(F)(F)F)c1",
+ "ref_smiles": "FC(F)(F)c1cc(C=O)cc(-c2ccccc2C(F)(F)F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8292dbfe-94eb-45d6-8aa5-883d1b4c0d15",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Cl)c(C=O)cc1Cl by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)c(C=O)cc1Cl",
+ "ref_smiles": "Cc1cc(Cl)c(C(=O)c2ccccc2)cc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9b2e23a0-6995-4d66-99b9-9a5f29ed1d1f",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccccc1C(O)CNC(=O)C(C)([NH3+])c1ccc(Br)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C(O)CNC(=O)C(C)([NH3+])c1ccc(Br)cc1.",
+ "ref_smiles": "CC([NH3+])(C(=O)NCC(O)c1ccccc1OCc1ccccc1)c1ccc(Br)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6310ed0a-b82a-4d08-ab3e-9eb58bb1d659",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NNC(=O)c1ccco1)c1ccc(Br)c([N+](=O)[O-])c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NNC(=O)c1ccco1)c1ccc(Br)c([N+](=O)[O-])c1",
+ "ref_smiles": "O=C(NNC(=O)c1ccco1)c1ccc(C=O)c([N+](=O)[O-])c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d2bc786b-40f5-4901-8d91-5caf03aa2479",
+ "task": "add",
+ "question": "Modify the molecule CCOC1CC(Nc2ccc3cn[nH]c3c2)C12CCCC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC1CC(Nc2ccc3cn[nH]c3c2)C12CCCC2",
+ "ref_smiles": "CCOC1CC(Nc2ccc3c(-c4ccccc4)n[nH]c3c2)C12CCCC2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eedcd62d-481b-434c-99a1-f7144a1183e9",
+ "task": "sub",
+ "question": "Modify the molecule N#CC=CCCC(CO)NC(=O)[O-] by substituting a nitrile with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC=CCCC(CO)NC(=O)[O-]",
+ "ref_smiles": "O=C([O-])NC(CO)CCC=CBr",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "63ac4ca8-68de-4d65-b521-57e1f248a1ef",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1.",
+ "ref_smiles": "O=C(Cc1ccc(-c2ccccc2)cc1)Nc1cc(-c2ccccc2)c(Cl)c(C(F)(F)F)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fc1902f2-d70d-4a77-8ace-b72309029b42",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)c1ccccc1-c1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccccc1-c1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2",
+ "ref_smiles": "COC(=O)c1c2nc(cc3ccc(cc4ccc(cc5nc1C=C5)[nH]4)[nH]3)C=C2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "19f79016-c7af-41c7-bf45-527f6a598227",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)N(C(=O)[O-])C1CC(N2Cc3cn[nH]c3C2)C[NH+](CCc2ccccn2)C1c1cc(F)ccc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)N(C(=O)[O-])C1CC(N2Cc3cn[nH]c3C2)C[NH+](CCc2ccccn2)C1c1cc(F)ccc1F",
+ "ref_smiles": "CC(C)(C)N(C(=O)[O-])C1CC(N2Cc3cn[nH]c3C2)C[NH+](CCc2ccccn2)C1c1ccccc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2b8dacf4-4159-425f-8285-0726c6938096",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1(C)CCC(CNc2cc(F)cc(Cl)c2)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC(CNc2cc(F)cc(Cl)c2)O1.",
+ "ref_smiles": "CC1(C)CCC(CNc2cccc(F)c2)O1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1e278b95-f31b-48e8-996a-a492ab9a66f1",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=[N+]([O-])C1=c2ccc([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])C1=c2ccc([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2.",
+ "ref_smiles": "O=[N+]([O-])C1=c2cc(-c3ccccc3)c([nH]2)=C([N+](=O)[O-])c2ccc([nH]2)C([N+](=O)[O-])=c2[nH]c(cc2[N+](=O)[O-])=C(c2ccccc2)c2ccc1[nH]2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ee3dae4b-d664-4e48-92b3-79ca1c8764b0",
+ "task": "delete",
+ "question": "Modify the molecule CCCCC(=O)N(CC1CC1)CC1CC1C1CC=CCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(=O)N(CC1CC1)CC1CC1C1CC=CCC1",
+ "ref_smiles": "CCCC(CC1CC1)C1CC1C1CC=CCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "52302925-a17d-40d6-917c-71a363011a05",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule c1c(N2CC(C[NH2+]C3CN4CCC3CC4)C2)nnc2c1CCCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1c(N2CC(C[NH2+]C3CN4CCC3CC4)C2)nnc2c1CCCC2.",
+ "ref_smiles": "OC1([NH2+]CC2CN(c3cc4c(nn3)CCCC4)C2)CN2CCC1CC2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c779c6bf-0115-42b9-ae3d-19cee7fd2788",
+ "task": "add",
+ "question": "Please add a amine to the molecule c1ccc(Cn2nnnc2SCCCc2nc(-c3cccs3)no2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(Cn2nnnc2SCCCc2nc(-c3cccs3)no2)cc1.",
+ "ref_smiles": "NC(CCc1nc(-c2cccs2)no1)Sc1nnnn1Cc1ccccc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "a581f1da-b1d6-4eaa-9613-d96734fbb5ed",
+ "task": "delete",
+ "question": "Modify the molecule CCC1CS(=O)CC(c2ccc(F)cc2)N1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CS(=O)CC(c2ccc(F)cc2)N1",
+ "ref_smiles": "CCC1CS(=O)CC(F)N1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ba673698-7ca6-4509-9ab2-f5f334050d79",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=[N+]([O-])CCc1ccc(O)c(O)c1O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])CCc1ccc(O)c(O)c1O",
+ "ref_smiles": "N#Cc1ccc(CC[N+](=O)[O-])c(O)c1O",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e52b0ae8-7abb-4d41-bf78-1dada4686217",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)cc(N)c1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)cc(N)c1Cl.",
+ "ref_smiles": "Cc1cc(S(=O)(=O)NCC2(CO)CCCC2)c(CC=O)c(N)c1Cl",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "9053d8fc-b310-4b52-b170-3ccfa8d9abd6",
+ "task": "sub",
+ "question": "Modify the molecule CC([NH3+])Cc1ccc(OCc2c(F)cccc2Cl)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])Cc1ccc(OCc2c(F)cccc2Cl)cc1",
+ "ref_smiles": "CC([NH3+])Cc1ccc(OCc2c(O)cccc2Cl)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a9d7d830-3b3e-49ce-a423-2e0dd124f44b",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(O)CN1C(=O)NC(C)(C)C1=O by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(O)CN1C(=O)NC(C)(C)C1=O",
+ "ref_smiles": "CC(C)(NO2)CN1C(=O)NC(C)(C)C1=O",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "14c328d5-7c68-4cc7-92ab-7e20065a7433",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccn2c(NC(=O)Nc3ccc(Cl)cc3)c(-c3cccc(F)c3)nc2c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccn2c(NC(=O)Nc3ccc(Cl)cc3)c(-c3cccc(F)c3)nc2c1",
+ "ref_smiles": "Cc1ccn2c(NC(=O)Nc3ccc(NO)cc3)c(-c3cccc(F)c3)nc2c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "736a1779-a8d5-46e8-9f9d-6075736aee4c",
+ "task": "delete",
+ "question": "Modify the molecule CN1C(=O)COC2CCN(C(=O)CCCn3cncn3)CCC21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1C(=O)COC2CCN(C(=O)CCCn3cncn3)CCC21",
+ "ref_smiles": "CN1C(=O)COC2CCC(CCn3cncn3)CC21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3c979fd3-4d4f-4ef1-90ad-e7455793b739",
+ "task": "add",
+ "question": "Modify the molecule O=c1nc(C[NH+]2CCOC3(CCCC3)C2)[nH]c2c1oc1ccccc12 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1nc(C[NH+]2CCOC3(CCCC3)C2)[nH]c2c1oc1ccccc12",
+ "ref_smiles": "O=c1nc(C[NH+]2CC3(CCCC3)OCC2O)[nH]c2c1oc1ccccc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d142cab3-dc05-496c-b564-f958fade06ca",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Clc1ccc(SSc2c(Cl)c(Br)c(Cl)c(Br)c2Cl)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc(SSc2c(Cl)c(Br)c(Cl)c(Br)c2Cl)c(Cl)c1.",
+ "ref_smiles": "Clc1ccc(SSc2cc(Br)c(Cl)c(Br)c2Cl)c(Cl)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "20497517-edaf-4dda-9a8a-3ceb2211684c",
+ "task": "add",
+ "question": "Modify the molecule CCCN(CCC)C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCC)C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1",
+ "ref_smiles": "CCCN(C(=O)c1cc(B2OC(C)(C)C(C)(C)O2)cc(C(=O)OC)c1)C(CC)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1cf6d71a-1b38-4fd7-8597-01034275b34b",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(NC(=O)C(C)(C)CO)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)C(C)(C)CO)cc1.",
+ "ref_smiles": "CCC(O)c1ccc(OC)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "efddb34e-2dd1-4591-8508-032f235de368",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(CCBr)c1cc(Cl)cc(CCl)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCBr)c1cc(Cl)cc(CCl)c1",
+ "ref_smiles": "O=C([OH])CCC(=O)c1cc(Cl)cc(CCl)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3bab040f-0a9a-4f77-beff-bcf391d0e0a3",
+ "task": "delete",
+ "question": "Modify the molecule C=CCn1c2ccccc2c2nnc(SC(CC)C(=O)c3ccc([N+](=O)[O-])cc3)nc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c2ccccc2c2nnc(SC(CC)C(=O)c3ccc([N+](=O)[O-])cc3)nc21",
+ "ref_smiles": "C=CCn1c2ccccc2c2nnc(SC(CC)C(=O)[N+](=O)[O-])nc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0d4bd36d-279d-4e30-834c-15cbc06384aa",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [NH3+]CC1CCCN1C(=O)NCC1CCOC2(CCC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC1CCCN1C(=O)NCC1CCOC2(CCC2)C1.",
+ "ref_smiles": "[NH3+]CC1C(O)CCN1C(=O)NCC1CCOC2(CCC2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4db1aff5-b5c6-4a29-aa74-8f693d105cba",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCCCCCCCC(CC)CCCCBr.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCC(CC)CCCCBr.",
+ "ref_smiles": "CCCCCCCCCC(CC)CCCC",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "240d9815-4276-423c-aad5-2e3f410f4749",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCC(CC(=O)c1ccc(F)cn1)NC(=O)OC(C)(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC(CC(=O)c1ccc(F)cn1)NC(=O)OC(C)(C)C",
+ "ref_smiles": "COCCC(CC(=O)c1ccc(C(=O)O)cn1)NC(=O)OC(C)(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "153a0098-774f-4b7c-b0ce-c8e545414aba",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CS(=O)(=O)c1ccc(C(=O)c2c(C(=O)[O-])noc2C2CC2)c(F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1ccc(C(=O)c2c(C(=O)[O-])noc2C2CC2)c(F)c1",
+ "ref_smiles": "CS(=O)(=O)c1ccc(C(=O)c2c(C(=O)[O-])noc2C2CC2)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e2789c20-586c-4da1-a85c-84cf513db007",
+ "task": "delete",
+ "question": "Modify the molecule Cc1csc2c([N+](=O)[O-])cc(N)cc12 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc2c([N+](=O)[O-])cc(N)cc12",
+ "ref_smiles": "Cc1csc2c([N+](=O)[O-])cccc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e55a223a-1339-4610-b5fa-8fce020b0f2e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=S(=O)(c1ccnc(Cl)c1)N1CCc2ccc(F)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1ccnc(Cl)c1)N1CCc2ccc(F)cc21.",
+ "ref_smiles": "O=S(=O)(c1ccncc1)N1CCc2ccc(F)cc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a3e2fe09-7e7e-4398-baa2-800e61b25182",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C)c2c1CC[NH2+]C2C(C)(C)O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c2c1CC[NH2+]C2C(C)(C)O",
+ "ref_smiles": "Cc1ccc(C)c2c1CC[NH2+]C2C(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "36642765-3050-494f-8a63-83e3907ed007",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccc(OCC(=O)NNC(=O)c2ccc(SC(F)(F)F)cc2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(OCC(=O)NNC(=O)c2ccc(SC(F)(F)F)cc2)cc1",
+ "ref_smiles": "CC(=O)c1ccc(OCC(=O)NNC(=O)c2ccc(SC(F)(F)F)cc2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "98a1ccce-8fa9-4093-b01e-bc3e2c987fb1",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1cn(C2CC2)c2c(N3CC[NH+](CCc4ccccc4)CC3)ncnc12 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cn(C2CC2)c2c(N3CC[NH+](CCc4ccccc4)CC3)ncnc12",
+ "ref_smiles": "Brc1cn(C2CC2)c2c(N3CC[NH+](CCc4ccccc4)CC3)ncnc12",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "2954fa31-40ea-437a-aee2-ab579ed42ebd",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CN1CSCC1=O)Nc1ccccc1N1CCCCCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN1CSCC1=O)Nc1ccccc1N1CCCCCC1",
+ "ref_smiles": "O=C1CSCN1c1ccccc1N1CCCCCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f4d2128e-4c88-41cb-b88c-3b4c12169689",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1CC(C)CN(C(=O)N2CCCC(NC(=O)c3ccc(F)c(F)c3)C2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)CN(C(=O)N2CCCC(NC(=O)c3ccc(F)c(F)c3)C2)C1.",
+ "ref_smiles": "CC1CC(C)CN(C(=O)N2CCCC(O)(NC(=O)c3ccc(F)c(F)c3)C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5b902452-862d-4cc5-854e-43aa9d2c591f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CNC(=O)COC(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)COC(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2.",
+ "ref_smiles": "COC(=O)c1ccccc1SCC(=O)NC12CC3CC(CC(C3)C1)C2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b0a336d1-ee40-4f3c-a6d8-68575e35bc5e",
+ "task": "add",
+ "question": "Modify the molecule CCCC1CC(O)(c2ccc3nc(C)ccc3c2)CCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC(O)(c2ccc3nc(C)ccc3c2)CCO1",
+ "ref_smiles": "CCCC1CC(O)(c2ccc3nc(C)ccc3c2)C(O)CO1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "97ae945a-974a-4937-b6da-ac93094d2564",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1",
+ "ref_smiles": "Cc1cc(Br)cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e1dfb3de-ab6e-44f0-916c-9e5a4102fcd7",
+ "task": "add",
+ "question": "Modify the molecule C=C(C=C(C)c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C=C(C)c1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C",
+ "ref_smiles": "C=C(C=C(C)c1ccc(OC)c(O)c1)O[Si](C)(C)C(C)(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "eb2f4467-da09-42d2-8010-1383566fe1ac",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1ccc(NC(=O)CSc2nnc(CNC(=O)c3ccc(OC)cc3)n2-c2cccc(C(F)(F)F)c2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(NC(=O)CSc2nnc(CNC(=O)c3ccc(OC)cc3)n2-c2cccc(C(F)(F)F)c2)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(NC(=O)CSc2nnc(CNC(=O)c3ccc(OC)cc3)n2-c2cccc(C(F)(F)C(=O)[OH])c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "620f889d-6c90-44f9-81cf-819699eb5e71",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])C1c2ccccc2CCN1C(=O)C1CC(=O)N(CC(F)(F)F)C1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1c2ccccc2CCN1C(=O)C1CC(=O)N(CC(F)(F)F)C1",
+ "ref_smiles": "O=C([O-])C1c2ccccc2CCN1C(=O)C1CC(=O)N(CC(F)F)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3315b7b2-e53b-4615-92ba-a0ab66b861d4",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1.",
+ "ref_smiles": "O=C1N(Cc2nccs2)CCN1C1CC[NH2+]CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a648c3ed-d85c-48e3-b460-192f5daba194",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=NCCO)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=NCCO)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C",
+ "ref_smiles": "CC(=NCCBr)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7c291329-efe4-4c1e-a72b-f194b0b44fb0",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)cc1",
+ "ref_smiles": "COc1ccc(C(=O)N(CC(=O)Nc2nc(CC(=O)NCCc3ccccn3)cs2)C(C)C)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a1f5b354-7cc6-4752-a1a0-b703bc099f16",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(C)(C)Nc1nnc(SCC(=O)c2ccc3c(c2)NC(=O)CO3)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)Nc1nnc(SCC(=O)c2ccc3c(c2)NC(=O)CO3)s1.",
+ "ref_smiles": "CC(C)(C)c1nnc(SCC(=O)c2ccc3c(c2)NC(=O)CO3)s1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "fb16c6b8-cac7-4e40-89e9-74460b8401c0",
+ "task": "sub",
+ "question": "Modify the molecule OC1COc2c(Cl)cc(F)cc2C1[NH+]1CCCCCC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1COc2c(Cl)cc(F)cc2C1[NH+]1CCCCCC1",
+ "ref_smiles": "O=C([OH])C1COc2c(Cl)cc(F)cc2C1[NH+]1CCCCCC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3ce3ecd9-ae11-4bae-ae47-c187719b14ed",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)Cc1c(C)c2ccc(O)c(CNc3ccc(OC)c(Cl)c3)c2oc1=O by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1c(C)c2ccc(O)c(CNc3ccc(OC)c(Cl)c3)c2oc1=O",
+ "ref_smiles": "CC(=O)c1ccc2c(C)c(CC(=O)OC)c(=O)oc2c1CNc1ccc(OC)c(Cl)c1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ad871170-b7ac-4149-8b5f-5dc8cdc80532",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)c1nnc(NC(=O)NC(Cc2ccc(O)cc2)C(=O)NC2CCC[N+](C)(Cc3cccc(O)c3)C2)n1C by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1nnc(NC(=O)NC(Cc2ccc(O)cc2)C(=O)NC2CCC[N+](C)(Cc3cccc(O)c3)C2)n1C",
+ "ref_smiles": "COC(=O)c1nnc(NC(=O)NC(Cc2ccc(F)cc2)C(=O)NC2CCC[N+](C)(Cc3cccc(O)c3)C2)n1C",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0b1f43f6-0c3b-4d8d-aeab-29f64911f0be",
+ "task": "add",
+ "question": "Modify the molecule c1ccc(OCCN2CC[NH+](Cc3cccnc3)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(OCCN2CC[NH+](Cc3cccnc3)CC2)cc1",
+ "ref_smiles": "c1ccc(OCC(c2ccccc2)N2CC[NH+](Cc3cccnc3)CC2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ac826efd-af33-41e0-b398-f28d2d55bd31",
+ "task": "delete",
+ "question": "Modify the molecule O=C1Nc2ccccc2C1(O)C1=C[NH2+]C2C=CC=CC12 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1Nc2ccccc2C1(O)C1=C[NH2+]C2C=CC=CC12",
+ "ref_smiles": "O=C1Nc2ccccc2C1C1=C[NH2+]C2C=CC=CC12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "860de1bc-ac0f-498f-a238-b95a7eeea021",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Nc1ccc(Nc2cccc(F)c2)nc1)c1ccc2c(c1)OCO2 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(Nc2cccc(F)c2)nc1)c1ccc2c(c1)OCO2",
+ "ref_smiles": "O=C(Nc1ccc(Nc2cccc(C=O)c2)nc1)c1ccc2c(c1)OCO2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "83bae36f-95a6-4ff2-b545-e67a8ad30ee5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)NCCc4ccccc4)cc3C2=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)NCCc4ccccc4)cc3C2=O)cc1.",
+ "ref_smiles": "CCNC(=O)C(C)OC(=O)c1ccc2c(c1)C(=O)N(c1ccc(NC(C)=O)cc1)C2=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6288b989-93c5-4305-83f1-90c26b2efeac",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1.",
+ "ref_smiles": "CC1(c2nc(-c3cc(=O)[nH]c4ccccc34)no2)CCCCCC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4aa6e823-1b94-4a50-a247-bb434d76c857",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(NC(=O)OC(C)(C)C)c(N)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)OC(C)(C)C)c(N)c1",
+ "ref_smiles": "COc1c(O)ccc(NC(=O)OC(C)(C)C)c(N)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "96d86702-38cb-4b21-9abf-2b2a1a9fbf36",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)cc1.",
+ "ref_smiles": "COC(=O)c1ccc(OCCCS(=O)C(C)C(=O)Nc2cc(C)ccc2C)c(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "aa16d224-5c6e-4ab8-8b2f-fd865259f0fc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC([NH3+])Cc1cc(OCc2cncc(F)c2)ccc1Br with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])Cc1cc(OCc2cncc(F)c2)ccc1Br",
+ "ref_smiles": "CC([NH3+])Cc1cc(OCc2cncc(NO)c2)ccc1Br",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7ee0c6b6-4606-4bfc-a646-ffa34c3592aa",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OC(C)=O)c([N+](=O)[O-])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OC(C)=O)c([N+](=O)[O-])c1.",
+ "ref_smiles": "CCOc1cc(C=Nn2c(CC(C)c3ccccc3)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OC(C)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "187d7a53-99c8-4af3-a9cf-f95be38ab7c1",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)S(=O)(=O)Nc1ccc2c(c1)CN(C(=O)c1cccs1)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)S(=O)(=O)Nc1ccc2c(c1)CN(C(=O)c1cccs1)CC2.",
+ "ref_smiles": "CC(C)S(=O)(=O)Nc1ccc2c(c1O)CN(C(=O)c1cccs1)CC2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f24468d9-57e0-48e2-8cc0-b00d830d1365",
+ "task": "add",
+ "question": "Modify the molecule C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCCOc2ccccc2)c1=O by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCCOc2ccccc2)c1=O",
+ "ref_smiles": "C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC(S)COc2ccccc2)c1=O",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "44fb59d0-1035-4864-8937-ef60951468ee",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2cscc2C)cc1Br by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2cscc2C)cc1Br",
+ "ref_smiles": "Cc1ccc(NC(=O)c2cscc2C)cc1NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d27c2bdd-c4e5-4711-b4c3-4552857dd8da",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)Cc1cc(C(F)F)nc(F)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1cc(C(F)F)nc(F)c1[N+](=O)[O-].",
+ "ref_smiles": "COC(=O)Cc1cc(C(F)F)ncc1[N+](=O)[O-]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8b99358d-b565-4ba2-b70e-f32aa9307cf7",
+ "task": "add",
+ "question": "Modify the molecule O=C(C1CCCC[NH2+]1)N1CCCC2(CC[NH2+]C2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CCCC[NH2+]1)N1CCCC2(CC[NH2+]C2)C1",
+ "ref_smiles": "O=CCC1CCN(C(=O)C2CCCC[NH2+]2)CC12CC[NH2+]C2",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b7ef1403-db80-482b-9b7a-fd1f3bf438dc",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CSCCC(NC(=O)CNC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)CNC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-].",
+ "ref_smiles": "CSCCC(NC(=O)C(CC=O)NC(=O)C1CCCN1C(=O)C1CCC[NH2+]1)C(=O)NC(CCC[NH+]=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "9af5527d-9cf0-458e-8ea8-347d874cbcc7",
+ "task": "sub",
+ "question": "Modify the molecule CCn1c(Cl)nc2cc3c(cc2c1=O)OCCCO3 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(Cl)nc2cc3c(cc2c1=O)OCCCO3",
+ "ref_smiles": "CC(=O)c1nc2cc3c(cc2c(=O)n1CC)OCCCO3",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a99a9987-e4e7-474d-b139-ace484755fbc",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CNC(=O)CCNc1cc(Br)nc(C2CC2)n1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CNC(=O)CCNc1cc(Br)nc(C2CC2)n1",
+ "ref_smiles": "CC(=O)c1cc(NCCC(=O)NCC(C)C)nc(C2CC2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5511fde6-371b-4f07-9a0b-a10a24138629",
+ "task": "delete",
+ "question": "Modify the molecule Clc1cc(NCc2ccccn2)nc(C2CCCCC2)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cc(NCc2ccccn2)nc(C2CCCCC2)n1",
+ "ref_smiles": "c1ccc(CNc2ccnc(C3CCCCC3)n2)nc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "780a4ee7-02da-4094-9fce-17b87ba83b93",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1",
+ "ref_smiles": "CCOC(=O)CCNC(=O)Oc1ccc(OC)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4fd52766-d39f-4f19-9e1c-70968af5f69f",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ncnc2c1ccn2C1OC(C[NH3+])C(O)C1O by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ncnc2c1ccn2C1OC(C[NH3+])C(O)C1O",
+ "ref_smiles": "[NH3+]CC1OC(n2ccc3cncnc32)C(O)C1O",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "303fcc25-48f7-447f-b2da-7cae25d27efa",
+ "task": "delete",
+ "question": "Modify the molecule Clc1ccc(-c2csc(C[NH+]3CCN(c4ccccc4)CC3)n2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc(-c2csc(C[NH+]3CCN(c4ccccc4)CC3)n2)cc1",
+ "ref_smiles": "c1ccc(-c2csc(C[NH+]3CCN(c4ccccc4)CC3)n2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "22e2f00d-5b62-47ca-ad4e-e871f2caf1aa",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)(C)CCCC(C)(C)CO[Si].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)CCCC(C)(C)CO[Si].",
+ "ref_smiles": "CC(C)(C)CCCC(C)(CO)CO[Si]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "efe08b26-40f8-4f8e-9572-edc3eaa57ba7",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C1=CC(C2=CCC(c3ccc(O)cc3)CC2)=CC(C)(C(C)(C)C)C1O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1=CC(C2=CCC(c3ccc(O)cc3)CC2)=CC(C)(C(C)(C)C)C1O",
+ "ref_smiles": "CC(C)(C)C1=CC(C2=CCC(O)CC2)=CC(C)(C(C)(C)C)C1O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "72d8fa54-d59c-4d7f-a230-5b1f253d331f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccnn1Cc1nnc(Nc2ccn(Cc3c(Cl)cccc3Cl)n2)s1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccnn1Cc1nnc(Nc2ccn(Cc3c(Cl)cccc3Cl)n2)s1",
+ "ref_smiles": "Cc1ccnn1Cc1nnc(Nc2ccn(Cc3c(S)cccc3Cl)n2)s1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "80c0c992-066c-4506-bd78-c7bf63a8a8a1",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule [NH3+]C(c1cc(F)cc(F)c1)c1nnc(CC(=O)[O-])o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(c1cc(F)cc(F)c1)c1nnc(CC(=O)[O-])o1.",
+ "ref_smiles": "[NH3+]C(c1nnc(CC(=O)[O-])o1)c1cc(F)cc(F)c1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3469d005-785c-40d1-9a45-c53055d2b2b3",
+ "task": "add",
+ "question": "Modify the molecule CCCCC(=CS(=O)(=O)c1ccc(C)cc1)[NH+]1CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(=CS(=O)(=O)c1ccc(C)cc1)[NH+]1CCCC1",
+ "ref_smiles": "CCCCC(=CS(=O)(=O)c1ccc(C)c(-c2ccccc2)c1)[NH+]1CCCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d9c0e758-781b-4caa-822b-820e0cef62df",
+ "task": "delete",
+ "question": "Modify the molecule Cc1c(CCO)sc[n+]1Cc1cccc([N+](=O)[O-])c1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(CCO)sc[n+]1Cc1cccc([N+](=O)[O-])c1",
+ "ref_smiles": "CCc1sc[n+](Cc2cccc([N+](=O)[O-])c2)c1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "507a39bb-ae04-4d66-a294-dfaeb1cd5914",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule COCC(C)CNC(=O)C1CNc2ccccc2O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(C)CNC(=O)C1CNc2ccccc2O1.",
+ "ref_smiles": "CC(CNC(=O)C1CNc2ccccc2O1)COCCC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "84853711-3cc5-4622-b8bb-bb11f865c12d",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CCC(C#N)N(CCC(=O)OC)CC1CCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C#N)N(CCC(=O)OC)CC1CCCO1.",
+ "ref_smiles": "CCCN(CCC(=O)OC)CC1CCCO1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "35a77508-0bb5-4bce-9360-a04fcabde132",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule OC(CC1CCOc2ccccc21)C(O)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(CC1CCOc2ccccc21)C(O)C1CC1.",
+ "ref_smiles": "OC(CC1CCOc2cc(-c3ccccc3)ccc21)C(O)C1CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9e84531d-e325-49ef-aff1-f13b85dab988",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c1",
+ "ref_smiles": "Cc1cc(S(=O)(=O)N2CCN(C(=O)NC3CCC[NH2+]C3)CC2)c(C)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "853fbd18-f4fa-4c6a-acb4-0e29ccf166b9",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1ccc(C)c([B-](F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C)c([B-](F)(F)F)c1.",
+ "ref_smiles": "COc1ccc(C)c([B-](F)F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4be3bdb9-a078-4388-9884-ea9fd1fb5c49",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)nc2cc(Br)ccc21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)nc2cc(Br)ccc21",
+ "ref_smiles": "CC(C)n1c(-c2cccc(Cl)c2)nc2cc(Br)ccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "127f963c-40e5-42cf-ada5-43a90145f92c",
+ "task": "add",
+ "question": "Modify the molecule CC[NH2+]Cc1ccc(CS(=O)(=O)N2CCCC2)cc1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]Cc1ccc(CS(=O)(=O)N2CCCC2)cc1",
+ "ref_smiles": "CC[NH2+]Cc1ccc(C(S)S(=O)(=O)N2CCCC2)cc1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "6615648c-cccf-47e9-87e5-29e6aec8ae0d",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Nc1cc(N)nc(SCC(=O)[O-])n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(N)nc(SCC(=O)[O-])n1.",
+ "ref_smiles": "Nc1ccnc(SCC(=O)[O-])n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "52cee343-7cda-45f8-96ff-689f1449eceb",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(C)cc(C(O)c2cccc3ncccc23)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(C(O)c2cccc3ncccc23)c1",
+ "ref_smiles": "Cc1cc(C)cc(C(C(=O)O)c2cccc3ncccc23)c1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e9f2ab96-9e76-424c-a35e-7fa603fa866c",
+ "task": "add",
+ "question": "Modify the molecule O=C(OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OC1c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1",
+ "ref_smiles": "O=C(OC1(O)c2ccccc2C(=O)N1c1ccc2ccc(Cl)nc2n1)N1CCN(c2ccccc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a5ba903d-0a78-492f-ac5d-717ff68e9ef1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)c1cnc2nnn(Cc3cc4cccnc4cc3F)c2n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cnc2nnn(Cc3cc4cccnc4cc3F)c2n1",
+ "ref_smiles": "CC(=O)c1cnc2nnn(C(=O)c3cc4cccnc4cc3)c2n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d919e3b-d833-46f1-86b3-a97f1ce1a494",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(COC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(COC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1",
+ "ref_smiles": "COCOC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "07e1a6e8-b447-48b9-9a4c-8bf0027e24b7",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH+](Cc1cccc(C#N)c1)Cc1nnc(NN)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](Cc1cccc(C#N)c1)Cc1nnc(NN)s1.",
+ "ref_smiles": "C[NH+](Cc1nnc(NN)s1)C(O)c1cccc(C#N)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f42bd00d-5446-414d-9e7e-744d6f18f21a",
+ "task": "delete",
+ "question": "Modify the molecule CSc1ccc(Cn2ncc(Cl)c2N)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc(Cn2ncc(Cl)c2N)cc1",
+ "ref_smiles": "CSc1ccc(Cn2nccc2N)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7289f7a7-f088-4894-9e6e-8fd412409ac7",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)CC1",
+ "ref_smiles": "O=C(Cc1cccnc1)N1CC[NH+](Cc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)C(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f97b8d99-8d0f-416c-95cf-baf36668b009",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CN(Cc1ccco1)c1cc(C(=O)[O-])ccc1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccco1)c1cc(C(=O)[O-])ccc1N.",
+ "ref_smiles": "CN(Cc1ccco1)c1cccc(C(=O)[O-])c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "041f3e78-8130-4a61-aee9-b5e0d513abe2",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule c1ccc(-c2ccc(-c3cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)ccc3-c3ccc(-c4ccccc4)cc3)cc2)cc#1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(-c2ccc(-c3cc(N(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)ccc3-c3ccc(-c4ccccc4)cc3)cc2)cc#1.",
+ "ref_smiles": "Oc1c(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)ccc(-c2ccc(-c3cc#ccc3)cc2)c1-c1ccc(-c2ccccc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1efa4101-f9e4-4e75-a977-e91d73f3cfea",
+ "task": "sub",
+ "question": "Modify the molecule CC[NH+](CC)CC(C)NS(=O)(=O)CCCCl by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CC(C)NS(=O)(=O)CCCCl",
+ "ref_smiles": "CC(=O)CCCS(=O)(=O)NC(C)C[NH+](CC)CC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "445c6a61-ef40-4979-8400-b386aa47d506",
+ "task": "sub",
+ "question": "Modify the molecule Cc1oc2ccc(O)cc2c1-c1ccc(O)cc1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1oc2ccc(O)cc2c1-c1ccc(O)cc1",
+ "ref_smiles": "Cc1oc2ccc(C(=O)O)cc2c1-c1ccc(O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b6c063a2-22ca-40b1-a69b-3ba317d2eb53",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1(CNC(=O)C(C)(C)Cc2cccc(Cl)c2)CC[NH2+]CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(CNC(=O)C(C)(C)Cc2cccc(Cl)c2)CC[NH2+]CC1.",
+ "ref_smiles": "CC1(CNC(=O)C(C)(C)Cc2ccccc2)CC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "793cfb2a-58ce-4b2c-9f7a-0408730c2df1",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCc1cc(C2CC3NC(N)=[NH+]C3C2C)ccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(C2CC3NC(N)=[NH+]C3C2C)ccc1F.",
+ "ref_smiles": "CCCc1cc(C2CC3NC(N)=[NH+]C3C2(C)O)ccc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "820b06c7-3aa7-4fe7-9136-fb89bca6f05b",
+ "task": "sub",
+ "question": "Modify the molecule Brc1cnc(-n2cnc3c2CCCC3)c(C[NH2+]C2CC2)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1cnc(-n2cnc3c2CCCC3)c(C[NH2+]C2CC2)c1",
+ "ref_smiles": "Sc1cnc(-n2cnc3c2CCCC3)c(C[NH2+]C2CC2)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "97f49765-66c9-41f9-b61e-44a1cfbaa164",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N(CC1CCC[NH2+]1)C(=O)c1ccc(F)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(CC1CCC[NH2+]1)C(=O)c1ccc(F)cc1",
+ "ref_smiles": "CC(C)N(CC1CCC[NH2+]1)C(=O)c1ccc(C=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8b5beeed-662b-4803-a3e4-47b3b6baa557",
+ "task": "delete",
+ "question": "Modify the molecule COCCc1onc(N)c1-c1cccc(C(F)(F)F)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCc1onc(N)c1-c1cccc(C(F)(F)F)c1",
+ "ref_smiles": "COCCc1onc(N)c1-c1cccc(C(F)F)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3a246229-fd94-4ce7-ba2d-03797419ad9b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH2+]C(Cc1cccc(OC)c1F)c1ncc[nH]1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1cccc(OC)c1F)c1ncc[nH]1",
+ "ref_smiles": "CC[NH2+]C(Cc1cccc(OC)c1O)c1ncc[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b8dffa91-5f9e-41a6-a4ac-c981d8f1b3e2",
+ "task": "sub",
+ "question": "Modify the molecule CCCCN(C(=O)NCO)C(=O)OC(C)(C)C by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C(=O)NCO)C(=O)OC(C)(C)C",
+ "ref_smiles": "CCCCN(C(=O)NCNO)C(=O)OC(C)(C)C",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ae631305-1820-4391-b35a-9266dbdbd399",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]1CCN(C(=[NH2+])C(C)(C)c2ccc(F)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(C(=[NH2+])C(C)(C)c2ccc(F)cc2)CC1",
+ "ref_smiles": "CC(C)(C(=[NH2+])N1CC[NH+](CO)CC1)c1ccc(F)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5beae31b-44c5-4498-b377-0ce854723ff1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(OS(=O)(=O)c1cc(Br)cc(Br)c1[O-])C1(O)CCC[NH2+]1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OS(=O)(=O)c1cc(Br)cc(Br)c1[O-])C1(O)CCC[NH2+]1",
+ "ref_smiles": "N#CC1(C(=O)OS(=O)(=O)c2cc(Br)cc(Br)c2[O-])CCC[NH2+]1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a5538f96-c628-48ec-828c-4416d4b2f145",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[Si](C)(C)CCOCn1cc(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)CCOCn1cc(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O.",
+ "ref_smiles": "C[Si](C)(C)CCOCn1c(O)c(F)c(=O)n(CCC[NH+]2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)c1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b5352d34-7926-4bfb-a991-9e6a254c186f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C1C=C(c2ccccc2)OC1C(=O)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C=C(c2ccccc2)OC1C(=O)c1ccccc1.",
+ "ref_smiles": "O=C1C=C(c2ccccc2)OC1C(=O)c1cccc(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f3736136-83e7-458a-ac32-9e44f807feec",
+ "task": "add",
+ "question": "Modify the molecule CC(C)CC(C)C1OC(C)(C)OCC1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(C)C1OC(C)(C)OCC1C",
+ "ref_smiles": "CC(C)CC(C)C1OC(C)(C)OC(O)C1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d9a7d70d-d497-4025-b7d8-daf19fb9f068",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(C)(O)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(C)(O)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1",
+ "ref_smiles": "Cc1ccc2nc(COCC(=O)N3CCC4(CC3)CC(O)(CN)C(n3cnc5c(N)nc(N)nc53)CO4)[nH]c2c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "133ae758-5ba4-4a65-a7e3-c8a3e0baa8fd",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(N2C(=O)[N+](=Cc3ccccc3)N=C2O)cc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N2C(=O)[N+](=Cc3ccccc3)N=C2O)cc1",
+ "ref_smiles": "COc1ccc(N2C(=O)[N+](=Cc3ccccc3)N=C2I)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a6b04ed4-05ea-42ae-9bbd-f36861e8e4d1",
+ "task": "sub",
+ "question": "Modify the molecule CCC(=O)NCC1CN(c2ccc(O)c(F)c2)C(=O)O1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)NCC1CN(c2ccc(O)c(F)c2)C(=O)O1",
+ "ref_smiles": "CCC(=O)NCC1CN(c2ccc([N+](=O)[O-])c(F)c2)C(=O)O1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "84e604b4-a214-4b80-9d55-cdd399bb71ab",
+ "task": "add",
+ "question": "Modify the molecule Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccccc5)cc4)[nH]c3=O)CC2)cc1Br by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccccc5)cc4)[nH]c3=O)CC2)cc1Br",
+ "ref_smiles": "Nc1c(Br)cc(C(=O)CCC(=O)N2CCC(n3cc(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)[nH]c3=O)CC2)cc1Br",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "03bfaf1d-2778-4610-8f2f-ed7ab1eaee31",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=S(=O)(CCc1ccncc1)N(CCO)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(CCc1ccncc1)N(CCO)C1CC1.",
+ "ref_smiles": "CCN(C1CC1)S(=O)(=O)CCc1ccncc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2e6b2458-8fc1-4a6b-ac92-ea63bfd5551c",
+ "task": "sub",
+ "question": "Modify the molecule CC(CS(C)(=O)=O)Nc1nc2ccc(Br)cc2s1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CS(C)(=O)=O)Nc1nc2ccc(Br)cc2s1",
+ "ref_smiles": "CC(CS(C)(=O)=O)Nc1nc2ccc([N+](=O)[O-])cc2s1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4accf23e-1bff-4a0b-970b-611bc576e949",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C([O-])Cc1cn(Cc2ccno2)c2ccccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])Cc1cn(Cc2ccno2)c2ccccc12.",
+ "ref_smiles": "O=C([O-])Cc1cn(C(c2ccccc2)c2ccno2)c2ccccc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c761ecb4-3740-4ed5-9bba-72d7edbb53c4",
+ "task": "add",
+ "question": "Modify the molecule CC=C(C)C(=O)Nc1cccc(-n2cccc2)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(C)C(=O)Nc1cccc(-n2cccc2)c1",
+ "ref_smiles": "CC=C(C)C(=O)Nc1cccc(-n2cccc2C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ac101d50-ddd1-42e6-823f-f1e2fd888237",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1CCC2C(CNC(=O)C[NH+](C)CC(=O)NCC3=C(C(F)(F)F)OC4OC5(C)CCC6C(C)CCC3C46OO5)=C(C(F)(F)F)OC3OC4(C)CCC1C32OO4.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC2C(CNC(=O)C[NH+](C)CC(=O)NCC3=C(C(F)(F)F)OC4OC5(C)CCC6C(C)CCC3C46OO5)=C(C(F)(F)F)OC3OC4(C)CCC1C32OO4.",
+ "ref_smiles": "CC1CCC2C(CNC(=O)C[NH+](C)CC(=O)NCC3=C(C(F)(F)F)OC4OC5(C)CCC6C(C)CCC3C46OO5)=C(C(F)F)OC3OC4(C)CCC1C32OO4",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7833aa9c-647b-48eb-b4f0-63f7682a15f1",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(=O)NC(CCC[NH+]=C(N)N)C(=O)NC1CC(=O)NCCCCC(C(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CCCNC(N)=O)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2cnc[nH]2)NC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(CCC[NH+]=C(N)N)C(=O)NC1CC(=O)NCCCCC(C(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CCCNC(N)=O)NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2cnc[nH]2)NC1=O.",
+ "ref_smiles": "CC(=O)NC(CCC[NH+]=C(N)N)C(=O)NC1CC(=O)NCCCCC(C(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CCCNC(N)=O)NC(=O)C(C)NC(=O)C(Cc2cnc[nH]2)NC1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "102df03d-0ac9-42b7-a610-eab13142ba0d",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cccc(N)c1S(=O)(=O)N(C)Cc1ccc(Cl)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(N)c1S(=O)(=O)N(C)Cc1ccc(Cl)cc1",
+ "ref_smiles": "Cc1cccc(N)c1S(=O)(=O)N(C)Cc1ccc(C(=O)[OH])cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0dd33c4f-c35e-4e05-bfe8-95d4dab468fe",
+ "task": "sub",
+ "question": "Modify the molecule COCc1nc2n(n1)CC(NC(=O)Cn1ccc(C(F)F)n1)CC2 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCc1nc2n(n1)CC(NC(=O)Cn1ccc(C(F)F)n1)CC2",
+ "ref_smiles": "COCc1nc2n(n1)CC(NC(=O)Cn1ccc(C(F)NO)n1)CC2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "26921118-9d94-4b4b-be65-a35d69c0fc5e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C1CCOc2c(NC(=O)N3CCC(O)(C4CCC4)CC3)cccc21 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCOc2c(NC(=O)N3CCC(O)(C4CCC4)CC3)cccc21",
+ "ref_smiles": "O=C1CCOc2c(NC(=O)N3CCC(C4CCC4)CC3)cc([N+](=O)[O-])cc21",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0c4c179c-1436-4c22-b9c3-a051612e5bfa",
+ "task": "add",
+ "question": "Modify the molecule CC(C)=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2",
+ "ref_smiles": "CC(=CCN1C(=O)C2CCC1CN(C(=O)CSc1nnc(C)s1)C2)CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "94605f7c-6cf2-4451-bb88-ce111cc91aef",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH2+]C(Cc1cccc(F)c1)c1ccccc1OC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1cccc(F)c1)c1ccccc1OC",
+ "ref_smiles": "CC[NH2+]C(Cc1cccc(C#N)c1)c1ccccc1OC",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dd4e6703-b6ac-4da9-b82c-4dff839aaf27",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)CC(=O)N=Cn2c(=O)[nH]c3ccccc32)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)CC(=O)N=Cn2c(=O)[nH]c3ccccc32)cc1",
+ "ref_smiles": "CS(=O)(=O)CC(=O)N=Cn1c(=O)[nH]c2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "39e9d6bf-f09b-427d-ac01-4a4f3f3c0dcc",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule O=Cc1ccc(F)c(N2CCNC2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=Cc1ccc(F)c(N2CCNC2=O)c1.",
+ "ref_smiles": "O=CCC1CN(c2cc(C=O)ccc2F)C(=O)N1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "a9d31743-bcd6-4697-8664-8b75dba25d22",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)C(Cc1cc(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(Cc1cc(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1",
+ "ref_smiles": "COC(=O)C(Cc1c(-c2ccccc2)c(=O)oc2cc(OC)ccc12)NC(=O)C1CCCCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f6701ae0-c126-47e3-8e13-8b1413573f47",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CCCN1C(=O)Nc1cc(Cl)cc(C(=O)[O-])c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCN1C(=O)Nc1cc(Cl)cc(C(=O)[O-])c1",
+ "ref_smiles": "CC1CCCN1C(=O)Nc1cc(S)cc(C(=O)[O-])c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fa674328-2884-479e-a4b5-a13bc86b2cf3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6ccccc65)CCC43C)C1CCC2=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6ccccc65)CCC43C)C1CCC2=O.",
+ "ref_smiles": "CC12CCC3C(CC(=O)C4CC(OC(=O)CNC(=O)OCC5c6ccccc6-c6c(O)cccc65)CCC43C)C1CCC2=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1bebf9fe-f657-4b87-87ae-90fce36ea6ce",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(C#N)cccc1-c1cc(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(-c2cccc(C#N)c2C)cc1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C#N)cccc1-c1cc(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(-c2cccc(C#N)c2C)cc1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21",
+ "ref_smiles": "Cc1c([N+](=O)[O-])cccc1-c1cc(-n2c3ccc(C(F)(F)F)cc3c3cc(C(F)(F)F)ccc32)c(-c2cccc([N+](=O)[O-])c2C)cc1-n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "73df1ffb-1cc2-4487-a2b3-12e2d40f2e90",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)c1cc(Cl)ccc1OCc1c(F)cccc1Cl by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cc(Cl)ccc1OCc1c(F)cccc1Cl",
+ "ref_smiles": "CC(=O)c1cc(O)ccc1OCc1c(F)cccc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b6d990d-804d-4547-8eca-1214a9e29193",
+ "task": "delete",
+ "question": "Modify the molecule COCC(C)n1c(C)cc(C=C(C#N)C(=O)N2CC[NH+](Cc3ccc(C(F)(F)F)cc3)CC2)c1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(C)n1c(C)cc(C=C(C#N)C(=O)N2CC[NH+](Cc3ccc(C(F)(F)F)cc3)CC2)c1C",
+ "ref_smiles": "COCC(C)n1c(C)cc(C=C(C#N)C(=O)N2CC[NH+](CC(F)(F)F)CC2)c1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "06878e6e-1ea2-4b78-9306-986da8d3c23f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(=O)N(Cc1cccc(C)c1)C(CC)C(=O)NC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)N(Cc1cccc(C)c1)C(CC)C(=O)NC(C)(C)C.",
+ "ref_smiles": "CCC(=O)N(CC)C(CC)C(=O)NC(C)(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b9c69ee1-b21f-4d63-82bd-a68ae0be993d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(Cn1cnc2ccsc2c1=O)N1CCC(O)(c2ccc(Cl)cc2)CC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1cnc2ccsc2c1=O)N1CCC(O)(c2ccc(Cl)cc2)CC1",
+ "ref_smiles": "O=C(Cn1cnc2ccsc2c1=O)N1CCC(Br)(c2ccc(Cl)cc2)CC1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "36ff2a43-867f-4d47-8c0e-ca1f0f45a48c",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)C(=O)C(=O)NCC(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)C(=O)NCC(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1",
+ "ref_smiles": "CC(C)(C)C(=O)C(=O)NC(O)C(O)(O)C(Cc1ccccc1)N(N)C(=O)OCCCCc1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4acdea9d-cf6c-46cd-aa15-a55db0738014",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ncccc1Oc1ccc(CC(C)[NH3+])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ncccc1Oc1ccc(CC(C)[NH3+])cc1.",
+ "ref_smiles": "Cc1ncccc1OCC(C)[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "be9cbd27-93ac-41a4-8ab6-1e8c47f66907",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCCOCC(O)C[NH2+]CCn1cc(C)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOCC(O)C[NH2+]CCn1cc(C)cn1.",
+ "ref_smiles": "CCCCOCCC[NH2+]CCn1cc(C)cn1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9273cf4d-3c7b-4df0-bb77-a3735e30ef80",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(CC)C(=O)Nc1ccc(F)c(C#CCCO)c1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C(=O)Nc1ccc(F)c(C#CCCO)c1",
+ "ref_smiles": "CCC(CC)C(=O)Nc1ccc(F)c(C#CCCBr)c1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a1c0fad6-ae46-440b-9786-5b84edef3741",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule [NH3+]C(Cc1cccc(Cl)c1)C1CCN(S(=O)(=O)Cc2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(Cc1cccc(Cl)c1)C1CCN(S(=O)(=O)Cc2ccccc2)CC1.",
+ "ref_smiles": "CS(=O)(=O)N1CCC(C([NH3+])Cc2cccc(Cl)c2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "cd51cd95-fa7d-488a-a01d-901e21fe8eed",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCOc1ccccc1NC(=O)COC(=O)C=Cc1ccc(Cl)c([N+](=O)[O-])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1NC(=O)COC(=O)C=Cc1ccc(Cl)c([N+](=O)[O-])c1.",
+ "ref_smiles": "CCOc1ccccc1NC(=O)COC(=O)C=Cc1cccc([N+](=O)[O-])c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e4e557cc-f4b5-451c-aeaa-90b92d500d77",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(NC(=O)c2ccc3c(c2)S(=O)(=O)N(C2CC2)C3=O)n(-c2ccc([N+](=O)[O-])cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)c2ccc3c(c2)S(=O)(=O)N(C2CC2)C3=O)n(-c2ccc([N+](=O)[O-])cc2)n1.",
+ "ref_smiles": "Cc1cc(NC(=O)c2ccc3c(c2)S(=O)(=O)N(C2CC2)C3=O)n([N+](=O)[O-])n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "64ce5b71-a27b-4c7e-8103-36835757cffe",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH2+]C(C)c1ccccc1N1C(=O)CC(C)(C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)c1ccccc1N1C(=O)CC(C)(C)C1=O.",
+ "ref_smiles": "C[NH2+]C(C)N1C(=O)CC(C)(C)C1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1dea7c42-135a-452e-b04f-e55de0ad188c",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C([O-])C1(CS(=O)(=O)NCC2CC2)CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1(CS(=O)(=O)NCC2CC2)CCCCC1.",
+ "ref_smiles": "O=C([O-])C1(CS(=O)(=O)CC2CC2)CCCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "ae01b4a7-8b9e-4216-9d66-bc83c2ea8582",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(NC(=O)C(CO)NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)O)C(C)O)C(=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(NC(=O)C(CO)NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)O)C(C)O)C(=O)[O-]",
+ "ref_smiles": "CC(NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(NC(=O)C(CC(=O)O)NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)O)C(C)O)C(=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "498fcbcc-12e9-4f76-be7e-c1edfa818d7f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Ic1ccc(-n2cncc2C2C[NH2+]CCO2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Ic1ccc(-n2cncc2C2C[NH2+]CCO2)cc1",
+ "ref_smiles": "Sc1ccc(-n2cncc2C2C[NH2+]CCO2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "de481e34-4957-41a1-8862-eeb875b9beae",
+ "task": "add",
+ "question": "Modify the molecule Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3ccccc32)c1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3ccccc32)c1=O",
+ "ref_smiles": "Nc1ccccc1-c1n[nH]c(=O)n(N=C2C(=O)Nc3cc(-c4ccccc4)ccc32)c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b498d9c9-d941-4bba-858f-92db5dcb2973",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)OCc1ccccc1CNC(=O)Nc1ccc(Cn2cccn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)OCc1ccccc1CNC(=O)Nc1ccc(Cn2cccn2)cc1.",
+ "ref_smiles": "CC(C)OCCNC(=O)Nc1ccc(Cn2cccn2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1f5a1f59-eb57-4ce5-b66b-17b2a3f92734",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1NC(=O)COc1ccc(C=NNC(=O)c2cc(Br)cc(Br)c2O)cc1OC by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1NC(=O)COc1ccc(C=NNC(=O)c2cc(Br)cc(Br)c2O)cc1OC",
+ "ref_smiles": "CONC(=O)COc1ccc(C=NNC(=O)c2cc(Br)cc(Br)c2O)cc1OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1749030d-89c0-4f31-8ea3-2ed4692ba2b2",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ccc([N+](=O)[O-])c(NC(=O)COCCc2ccc(OCc3ccccc3)cc2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc([N+](=O)[O-])c(NC(=O)COCCc2ccc(OCc3ccccc3)cc2)c1",
+ "ref_smiles": "CCOC(=O)c1ccc([N+](=O)[O-])c(NC(=O)COCCOCc2ccccc2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1cd12908-0b04-48b4-acb0-bfca4df91442",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(NC(=O)C1C[NH2+]CC1c1ccccc1Cl)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)C1C[NH2+]CC1c1ccccc1Cl)c1ccccc1.",
+ "ref_smiles": "CC(NC(=O)C1C[NH2+]CC1c1ccccc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1dada884-4f04-43c0-9975-42ac565d29a9",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc2c(Nc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)ccnc2cc1OCC1([NH3+])CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2c(Nc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)ccnc2cc1OCC1([NH3+])CC1",
+ "ref_smiles": "COc1cc2c(Nc3ccc(NC(=O)Nc4cc(C)on4)cc3)ccnc2cc1OCC1([NH3+])CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bd9b4ceb-bfd5-4243-ab40-026be24034ad",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCN(CC)C(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(=O)NCC(C)C)c(Cl)c3)CC2)c(C)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(=O)NCC(C)C)c(Cl)c3)CC2)c(C)c1",
+ "ref_smiles": "CCN(CC)C(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NCC(=O)Nc3ccc(C(=O)NCC(C)C)c(S)c3)CC2)c(C)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b0873e75-5087-4296-b48e-a0b11214a895",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccccc1C(=O)Nc1ccc(F)c(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1C(=O)Nc1ccc(F)c(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)c1",
+ "ref_smiles": "Cc1ccccc1C(=O)Nc1cccc(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3cccc(C(=O)NC(C)C)c3C)CC2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c66ad777-4c2c-4d4b-85e2-0b1a8c9f41e6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1cscc1CCN1CCOCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Nc1cscc1CCN1CCOCC1=O.",
+ "ref_smiles": "O=C1COCCN1CCc1cscc1NS(=O)(=O)c1c(Cl)cc(Cl)cc1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ea10a7f9-77a0-4077-8106-bce8e24e2b4b",
+ "task": "add",
+ "question": "Modify the molecule CCC(O)C(C)[NH+]1CCCCCC1C by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)C(C)[NH+]1CCCCCC1C",
+ "ref_smiles": "CCC(O)C(C)[NH+]1CCCCCC1(C)C#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "088c1c26-4196-4aa0-a9be-48bdd77cc264",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC(C#N)c1cc2c3c(c1)c(Br)c(C)n3CCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C#N)c1cc2c3c(c1)c(Br)c(C)n3CCC2.",
+ "ref_smiles": "CCC(C#N)c1cc2c3c(c1)cc(C)n3CCC2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f3b69d3f-e6c1-46f6-8502-9f971c7245b3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)NCC(C)C)ccc3Cl)CC2)C(C)C)cccc1C(=O)NC1CCCCC1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)NCC(C)C)ccc3Cl)CC2)C(C)C)cccc1C(=O)NC1CCCCC1C",
+ "ref_smiles": "Cc1c(NC(=O)C(NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)NCC(C)C)ccc3NO)CC2)C(C)C)cccc1C(=O)NC1CCCCC1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8dfa09f-a1c3-4775-b052-d6f9012f516e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(C)c1ccc(C(O)CC2CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)c1ccc(C(O)CC2CC2)cc1.",
+ "ref_smiles": "CCC(C)C(O)CC1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ebefcf1d-19c6-4547-bb9e-5cb802c0aa20",
+ "task": "sub",
+ "question": "Modify the molecule [C-]#[N+]c1c(F)ccc(C2C[NH+]3CCN(C(=O)Cc4ccc(-n5cnnn5)nn4)CC3CO2)c1C by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[C-]#[N+]c1c(F)ccc(C2C[NH+]3CCN(C(=O)Cc4ccc(-n5cnnn5)nn4)CC3CO2)c1C",
+ "ref_smiles": "[C-]#[N+]c1c(O)ccc(C2C[NH+]3CCN(C(=O)Cc4ccc(-n5cnnn5)nn4)CC3CO2)c1C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d4574fb4-9425-477d-9f46-f4c67cb55079",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nnc(SCc2ccccc2F)n1N=Cc1ccc(Cl)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nnc(SCc2ccccc2F)n1N=Cc1ccc(Cl)cc1",
+ "ref_smiles": "Cc1nnc(SCc2ccccc2NO)n1N=Cc1ccc(Cl)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "40387a37-5eec-4035-9fa4-403f62465ebf",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CNc1nc(Cl)nc2c1ncn2CC1C(COCOC)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1nc(Cl)nc2c1ncn2CC1C(COCOC)C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.",
+ "ref_smiles": "COCOCC1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1Cn1cnc2c(C)nc(Cl)nc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "19f1a208-eba8-416b-86f7-5f14c561d912",
+ "task": "delete",
+ "question": "Modify the molecule CC([NH2+]C1CCCCN(C(=O)OC(C)(C)C)C1)c1cccc(Cl)c1Cl by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]C1CCCCN(C(=O)OC(C)(C)C)C1)c1cccc(Cl)c1Cl",
+ "ref_smiles": "CC(Cl)(Cl)[NH2+]C1CCCCN(C(=O)OC(C)(C)C)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b7b9b15e-2e8b-475e-978a-6f60373aedc1",
+ "task": "delete",
+ "question": "Modify the molecule Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH]c2ccccc2c1C(=O)C(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1",
+ "ref_smiles": "Cc1[nH]c2ccccc2c1OC1CCN(S(=O)(=O)N(C)C2CCCCC2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "bf1bfc1c-8cd5-4ddf-a570-4fd7e447b006",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)Cn1nc(-c2cc(C)nc(-c3ccc(Oc4ccc(F)cc4)cc3)c2)[nH]1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cn1nc(-c2cc(C)nc(-c3ccc(Oc4ccc(F)cc4)cc3)c2)[nH]1",
+ "ref_smiles": "COC(=O)Cn1nc(-c2cc(C)nc(-c3ccc(Oc4ccc(O)cc4)cc3)c2)[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c3f46ea9-8b71-438d-882c-da55ddb35ea3",
+ "task": "delete",
+ "question": "Modify the molecule CCC(c1nc2occc2c(=O)n1Cc1ccccc1)[NH+](CCN(C)C)Cc1ccc(Cl)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1nc2occc2c(=O)n1Cc1ccccc1)[NH+](CCN(C)C)Cc1ccc(Cl)cc1",
+ "ref_smiles": "CCC(c1nc2occc2c(=O)n1Cc1ccccc1)[NH+](CCl)CCN(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1e3425f3-c503-49c9-8e59-ac1f019649e0",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1",
+ "ref_smiles": "Cc1ccc(N2CCNc3ccc(C#N)cc32)cc1C#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "6ac8108b-353f-4ade-8a5b-415a8f1c3af5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH2+]C(C)CCC1=CCC=CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)CCC1=CCC=CCC1.",
+ "ref_smiles": "C[NH2+]C(C)CCC1=CCC=C(c2ccccc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a9eb0f91-45e1-4688-a7c4-78cd5722bfce",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NC1CCN(C(=O)C2CCC2)CC1)c1ccccc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCN(C(=O)C2CCC2)CC1)c1ccccc1Cl",
+ "ref_smiles": "O=C(NC1CCN(C(=O)C2CCC2)CC1)c1ccccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "794d7281-9a24-4919-af40-5e524e8ce8b3",
+ "task": "sub",
+ "question": "Modify the molecule CN(Cc1ccc(F)cc1)C(=O)C(Cc1ccccc1)NC(=O)c1ccco1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccc(F)cc1)C(=O)C(Cc1ccccc1)NC(=O)c1ccco1",
+ "ref_smiles": "CN(Cc1ccc(C#N)cc1)C(=O)C(Cc1ccccc1)NC(=O)c1ccco1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "02e4d6b8-d898-41ba-a51a-65a38fdbb1ca",
+ "task": "add",
+ "question": "Modify the molecule O=C(NCC(CO)Cc1cc(F)ccc1F)c1ccccc1OCc1ccc(F)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC(CO)Cc1cc(F)ccc1F)c1ccccc1OCc1ccc(F)cc1",
+ "ref_smiles": "O=C(NCC(CO)(Cc1cc(F)ccc1F)c1ccccc1)c1ccccc1OCc1ccc(F)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a23c7ef3-27a5-48f4-a279-a68a47b1ca29",
+ "task": "add",
+ "question": "Modify the molecule CC=C(C)COc1nccc(C)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(C)COc1nccc(C)n1",
+ "ref_smiles": "CC=C(C)C(Oc1nccc(C)n1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b229a6a6-4cc9-43b6-a791-530d8b9ff740",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CNC(=O)c1ccc(C(C)N2C(=O)C3CC2C[NH+]3CC(C)C(=O)N2C(C#N)CC3CC32)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1ccc(C(C)N2C(=O)C3CC2C[NH+]3CC(C)C(=O)N2C(C#N)CC3CC32)cc1.",
+ "ref_smiles": "CNC(=O)C(C)N1C(=O)C2CC1C[NH+]2CC(C)C(=O)N1C(C#N)CC2CC21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1f65a845-f192-47c0-9497-82daf3e0e1dc",
+ "task": "add",
+ "question": "Modify the molecule O=C(N1CC2CCS(=O)(=O)C2C1)C1(Cc2cccc(F)c2)CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(N1CC2CCS(=O)(=O)C2C1)C1(Cc2cccc(F)c2)CCCCC1",
+ "ref_smiles": "NC12CN(C(=O)C3(Cc4cccc(F)c4)CCCCC3)CC1CCS2(=O)=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "1116fe76-7898-45c2-8049-25eb05c3e635",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CSc1ccccc1C(=O)N1CC2CCC(O)C2C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccccc1C(=O)N1CC2CCC(O)C2C1",
+ "ref_smiles": "CSc1ccccc1C(=O)N1CC2CCC(I)C2C1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c00ebec7-ffde-4c8b-81cf-d5f5bd101020",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule NS(=O)(=O)Oc1ccc2oc(C3CCCC3)cc(=O)c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)Oc1ccc2oc(C3CCCC3)cc(=O)c2c1.",
+ "ref_smiles": "O=c1cc(C2CCCC2)oc2ccc(O[SH](=O)=O)cc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "42e0b0c4-1234-401d-ab83-18ca2c32c39c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)COc1ccc(Br)cc1C(=O)Oc1cccc(C(=O)OCCCc2ccccc2)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COc1ccc(Br)cc1C(=O)Oc1cccc(C(=O)OCCCc2ccccc2)c1",
+ "ref_smiles": "CC(C)COc1ccc(S)cc1C(=O)Oc1cccc(C(=O)OCCCc2ccccc2)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1459970d-26ca-40db-a0fd-1ae407a17673",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH2+]C(C)(CO)CCCCN(C)c1cccc(F)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(C)(CO)CCCCN(C)c1cccc(F)c1",
+ "ref_smiles": "CC(=O)c1cccc(N(C)CCCCC(C)(CO)[NH2+]CCC)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc105c41-2313-46b3-981d-ae7ae1690ab8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NCC(N1CC[NH+](CC2CC2)CC1)C(F)(F)F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NCC(N1CC[NH+](CC2CC2)CC1)C(F)(F)F",
+ "ref_smiles": "NCC(N1CC[NH+](CC2CC2)CC1)C(F)(F)S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "864be90f-c4b3-4ab7-8355-43a03b91c836",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(C(=O)N(C)CC(O)C(F)(F)F)c2c(C)noc2n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)N(C)CC(O)C(F)(F)F)c2c(C)noc2n1",
+ "ref_smiles": "CC(=O)C(CN(C)C(=O)c1cc(C)nc2onc(C)c12)C(F)(F)F",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c64954ec-a895-4348-b326-b324b0c64ff5",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C1CC([NH2+]CC(O)COC2CCCC2)CN1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC([NH2+]CC(O)COC2CCCC2)CN1",
+ "ref_smiles": "O=C1CC([NH2+]CC(S)COC2CCCC2)CN1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f6b5add3-b292-4618-bc5e-c80f358fe921",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(O)c2c(c1)N(O)C(=O)CC2 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(O)c2c(c1)N(O)C(=O)CC2",
+ "ref_smiles": "CC(=O)c1cc(C)cc2c1CCC(=O)N2O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "87d230d4-2309-41d8-aad1-21cd0863aa18",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N(CCCO)C(=O)c1cnccc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(CCCO)C(=O)c1cnccc1Cl",
+ "ref_smiles": "CC(C)N(CCCO)C(=O)c1cnccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c78c8bc4-cb98-457a-8fe4-cf44a0e1caa5",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3)ccc2Cl)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3)ccc2Cl)cc1",
+ "ref_smiles": "COc1ccc(C(C)NC(=O)c2cc(NS(=O)(=O)c3ccccc3ccc2Cl)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "03cf258b-c4e2-412b-9a77-75236f705a1d",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]CCCc1nnc(-c2cc(F)cc(F)c2)o1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCc1nnc(-c2cc(F)cc(F)c2)o1",
+ "ref_smiles": "[NH3+]CCCc1nnc(-c2cc(O)cc(F)c2)o1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f1db40aa-9506-4d49-97cb-03c6447ec054",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)c1c2cc(Cl)c(=O)cc-2[nH]c(-c2cccc(C(F)(F)F)c2)c1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1c2cc(Cl)c(=O)cc-2[nH]c(-c2cccc(C(F)(F)F)c2)c1C",
+ "ref_smiles": "COC(=O)c1c2ccc(=O)cc-2[nH]c(-c2cccc(C(F)(F)F)c2)c1C=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "78d9e6c9-7dd9-4c27-8cc6-31cdbd69cddb",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOc1ccccc1NC(=S)NC(=O)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1NC(=S)NC(=O)C(C)C.",
+ "ref_smiles": "CCOc1ccccc1C(=S)NC(=O)C(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f3332591-1603-4c8a-9fc3-ef3a8cf7ecd3",
+ "task": "add",
+ "question": "Modify the molecule CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)cc2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)cc2)n1",
+ "ref_smiles": "CC(CO)Nc1cc(CS(=O)(=O)c2ccncc2)nc(-c2ccc(NC(N)=O)c(O)c2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4d026497-4072-4cc3-9e10-7f3db5b4d90f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C(=O)NCc2ccc(F)cc2)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(Cl)cc2Cl)C(C)C)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)NCc2ccc(F)cc2)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(Cl)cc2Cl)C(C)C)CC1",
+ "ref_smiles": "Cc1ccc(C(=O)NCc2ccc(NO)cc2)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(Cl)cc2Cl)C(C)C)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7b71bba4-6759-4a68-89bd-486530db9d76",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)C(CO)C1Cn1cnc2c(Cl)ncnc21 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)C(CO)C1Cn1cnc2c(Cl)ncnc21",
+ "ref_smiles": "CC1C(Cn2cnc3c(Cl)ncnc32)C1(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bff59894-f0aa-4367-9712-7db13b603f48",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCn1nc2c(N)nc3ccccc3c2c1CC(C)(C)NC(=O)c1ccncc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1nc2c(N)nc3ccccc3c2c1CC(C)(C)NC(=O)c1ccncc1.",
+ "ref_smiles": "CCCn1nc2cnc3ccccc3c2c1CC(C)(C)NC(=O)c1ccncc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "930f4294-39ab-48be-a845-3335d08c8124",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(NC(=O)C(C)O)c(OC)cc1Cl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(NC(=O)C(C)O)c(OC)cc1Cl",
+ "ref_smiles": "COc1cc(NC(=O)C(C)O)c(OC)cc1C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "495be2a0-52bb-4cc1-b9c7-db0ac8f00065",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)c1cn(CC(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c2ccccc12 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cn(CC(=O)N2CCC(C(=O)N3CCCCCC3)CC2)c2ccccc12",
+ "ref_smiles": "COC(=O)c1cn(C2CCC(C(=O)N3CCCCCC3)CC2)c2ccccc12",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3f792d27-ae07-41b3-b4f6-f363c2700bf8",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule NC(=O)c1cccnc1NC1CCCc2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1cccnc1NC1CCCc2ccccc21.",
+ "ref_smiles": "NC(=O)c1cccnc1C1CCCc2ccccc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e22a5f07-1b87-4dda-9f88-2e2ba7cbe525",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNc1nc(-c2csc(C(C)(C)C)n2)nc(C)c1Br with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1nc(-c2csc(C(C)(C)C)n2)nc(C)c1Br",
+ "ref_smiles": "CCNc1nc(-c2csc(C(C)(C)C)n2)nc(C)c1[N+](=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8516e600-801c-4bca-80cc-cd6bfc6d3c41",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)COc1ccc(O)c(C=O)c1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)COc1ccc(O)c(C=O)c1",
+ "ref_smiles": "CC(=O)c1ccc(OCC(=O)OC)cc1C=O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "803264a9-b738-4e57-ab8b-ed972bc12a07",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(=O)C1=C(C)N(C(C)c2ccccc2)C(=O)C1=Cc1ccc(OC)c(OC)c1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1=C(C)N(C(C)c2ccccc2)C(=O)C1=Cc1ccc(OC)c(OC)c1OC.",
+ "ref_smiles": "COc1ccc(C=C2C(=O)N(C(C)c3ccccc3)C(=O)C2=C(O)C(=O)OC)c(OC)c1OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dc08da04-0d9b-46be-90a0-bf8719f92335",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)C([NH3+])COC(C)C(F)(F)F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C([NH3+])COC(C)C(F)(F)F",
+ "ref_smiles": "CCC(C)C([NH3+])COC(C)C(F)(F)S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "944ccdef-1693-45ff-91f6-ca7b921e098d",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CN(Cc1ccc2ccccc2n1)S(=O)(=O)c1cccc(OC)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CN(Cc1ccc2ccccc2n1)S(=O)(=O)c1cccc(OC)c1",
+ "ref_smiles": "CCOC(=O)CN(Cc1ccc2ccccc2n1)S(=O)(=O)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "76fca29c-5dd2-497b-b1c0-f0d95868c434",
+ "task": "add",
+ "question": "Modify the molecule CC(C)c1nc(CCNC(=O)COc2ccccc2)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1nc(CCNC(=O)COc2ccccc2)cs1",
+ "ref_smiles": "CC(C)c1nc(CC(NC(=O)COc2ccccc2)c2ccccc2)cs1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a3614006-b693-4db3-ae23-c60c0004cde3",
+ "task": "add",
+ "question": "Modify the molecule COCCn1cc(CCNC(=O)C2CCCC2)c2cccnc21 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1cc(CCNC(=O)C2CCCC2)c2cccnc21",
+ "ref_smiles": "COCCn1cc(CCNC(=O)C2CCC(CC=O)C2)c2cccnc21",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "4180589a-c1c6-4590-bb1c-1cb66e9856b3",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1CCCN(CCC2CCOC2)C1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CCCN(CCC2CCOC2)C1=O",
+ "ref_smiles": "[NH3+]C1CC(O)CN(CCC2CCOC2)C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0f0f03c5-06a3-4888-b1bb-e88fd88db8ec",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cc(O)cc(C2(C[NH3+])CCCC2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(O)cc(C2(C[NH3+])CCCC2)c1",
+ "ref_smiles": "CC(O)C1(C[NH3+])CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9cf6c715-50f6-4533-abdf-29350ffb05ed",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cnc(C(=O)N(CCC(=O)N2CC[NH+](CC=Cc3ccccc3)CC2)Cc2ccccc2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(C(=O)N(CCC(=O)N2CC[NH+](CC=Cc3ccccc3)CC2)Cc2ccccc2)cn1.",
+ "ref_smiles": "Cc1cnc(C(=O)N(CCC(=O)N2CC[NH+](CC=Cc3ccccc3)CC2)cn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fae9e24d-6fcf-45c1-a483-d11708c05a04",
+ "task": "add",
+ "question": "Modify the molecule CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2)cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2)cc1",
+ "ref_smiles": "CN(C)c1ccc(C(CNC(=O)Nc2ccc(Cl)c(Cl)c2)[NH+]2CCN(c3ccc(F)cc3)CC2C#N)cc1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "ccbdff17-a64f-4038-b0b6-b146b9be5089",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CC(C)(C)C1c2cncc(n2)C1C(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1c2cncc(n2)C1C(C)(C)C.",
+ "ref_smiles": "CC(C)(C)C1c2cncc(n2)C1C(C)(C)CCC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "653a6eb6-36c3-4b38-9549-d35034671372",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1c(Cl)cc(Cl)cc1C([O-])=C1C(=O)C(=O)N(c2ccc(Cl)cc2)C1c1cccc(O)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(Cl)cc(Cl)cc1C([O-])=C1C(=O)C(=O)N(c2ccc(Cl)cc2)C1c1cccc(O)c1",
+ "ref_smiles": "CC(=O)c1cccc(C2C(=C([O-])c3cc(Cl)cc(Cl)c3OC)C(=O)C(=O)N2c2ccc(Cl)cc2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fa742a94-49ae-4030-b559-1b9102264080",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OC",
+ "ref_smiles": "COc1ccc(-c2ccc(OC(C)C)c(C(=O)NC3(CO)CCCc4[nH]c5cc(C(F)(F)F)ccc5c43)c2)cc1OCO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3a2e753f-2011-4f44-8a79-d9a3cf14e056",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1C(=O)N(c2nc3cc(S(=O)(=O)C(F)F)ccc3s2)C2CCN(C(=O)C3CCCN3C(=O)OC(C)(C)C)C12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C(=O)N(c2nc3cc(S(=O)(=O)C(F)F)ccc3s2)C2CCN(C(=O)C3CCCN3C(=O)OC(C)(C)C)C12.",
+ "ref_smiles": "CC1C(=O)N(c2nc3cc(S(=O)(=O)CF)ccc3s2)C2CCN(C(=O)C3CCCN3C(=O)OC(C)(C)C)C12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bf29712b-1da8-41b8-8c8e-a3b230d5b1f3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)CC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CS)NC(=O)C(CS)NC(=O)C(CCCC[NH3+])NC(=O)CNC(=O)C(CO)NC(=O)CNC(=O)C([NH3+])Cc1ccc(I)cc1)C(=O)[O-] with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CS)NC(=O)C(CS)NC(=O)C(CCCC[NH3+])NC(=O)CNC(=O)C(CO)NC(=O)CNC(=O)C([NH3+])Cc1ccc(I)cc1)C(=O)[O-]",
+ "ref_smiles": "CC(C)CC(NC(=O)C(CCl)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CS)NC(=O)C(CS)NC(=O)C(CCCC[NH3+])NC(=O)CNC(=O)C(CO)NC(=O)CNC(=O)C([NH3+])Cc1ccc(I)cc1)C(=O)[O-]",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "857082bb-8bc2-48ff-b108-3b8efa1f309e",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C)cc1NC(=O)C(C)OC(=O)COc1ccc(Cl)cc1Br by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C)cc1NC(=O)C(C)OC(=O)COc1ccc(Cl)cc1Br",
+ "ref_smiles": "COc1ccc(C)cc1COC(=O)COc1ccc(Cl)cc1Br",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9721d28b-9f33-41fa-b885-fbb18976c77d",
+ "task": "sub",
+ "question": "Modify the molecule CCc1ccccc1N(CC(=O)Nc1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(C)cc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1N(CC(=O)Nc1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(C)cc1",
+ "ref_smiles": "CCc1ccccc1N(CC(=O)Nc1cc(OC)c(C=O)cc1OC)S(=O)(=O)c1ccc(C)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9af87e51-c2af-4cc7-b529-b02e75804502",
+ "task": "delete",
+ "question": "Modify the molecule CC1C[NH+](Cc2ccccc2NCC(=O)NCCC2=CCCCC2)CC(C)O1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C[NH+](Cc2ccccc2NCC(=O)NCCC2=CCCCC2)CC(C)O1",
+ "ref_smiles": "CC1C[NH+](Cc2ccccc2CC(=O)NCCC2=CCCCC2)CC(C)O1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "9223c2f7-e38c-4ec7-9d60-6319e579280d",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C[NH3+])ccc1N(CCO)CC(F)(F)F by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C[NH3+])ccc1N(CCO)CC(F)(F)F",
+ "ref_smiles": "Cc1cc(C[NH3+])ccc1N(CCC#N)CC(F)(F)F",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c8910e59-4ffe-4b1d-bb49-9213c4bdd3bb",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OCc1c(C(F)(F)F)sc2ccc(Cl)cc12 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCc1c(C(F)(F)F)sc2ccc(Cl)cc12",
+ "ref_smiles": "CC(=O)Cc1c(C(F)(F)F)sc2ccc(Cl)cc12",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e48a60b3-81c4-470b-b4de-02e737a7cc28",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCN(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1.",
+ "ref_smiles": "CCCC(c1ccccc1)N(C)C(=O)C1CC(=O)N(c2ccc(F)cc2F)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b7786e94-4072-42cc-86ae-a9a8bd9a7fd0",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOc1ccc2c(c1)nc(CCCO)n2CCC(C)=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2c(c1)nc(CCCO)n2CCC(C)=O",
+ "ref_smiles": "CCOc1ccc2c(c1)nc(CCCC(=O)O)n2CCC(C)=O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2662e4d2-6488-4efb-b985-d1abff6ec013",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(Cl)c1N1CC(c2nc(-c3ccc(F)c(Cl)c3)no2)CC1=O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Cl)c1N1CC(c2nc(-c3ccc(F)c(Cl)c3)no2)CC1=O",
+ "ref_smiles": "Cc1cccc(Cl)c1C(C)c1nc(-c2ccc(F)c(Cl)c2)no1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ff3a5d2c-10f8-4c1a-be87-dab5742f4b4b",
+ "task": "sub",
+ "question": "Modify the molecule CCn1cc(CC(O)c2ccc(N)cc2)cn1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1cc(CC(O)c2ccc(N)cc2)cn1",
+ "ref_smiles": "CCn1cc(CC(S)c2ccc(N)cc2)cn1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "463983c9-d8fe-41b1-ba7e-cae276b5d2db",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(CCc1cccnc1)Nc1nc2ccc3ccccc3c2s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCc1cccnc1)Nc1nc2ccc3ccccc3c2s1.",
+ "ref_smiles": "c1cncc(Cc2nc3ccc4ccccc4c3s2)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e4ac61e8-62ca-4879-a81d-61df97d8951a",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1",
+ "ref_smiles": "Cc1ccc(-c2nc3ccccc3c(C(=O)[O-])c2-n2cccn2)c(C)c1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "f59949a4-9d47-4664-bfb6-c267c1b766e4",
+ "task": "add",
+ "question": "Modify the molecule CC(C)c1cnc(N(C)C)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1cnc(N(C)C)c(Cl)c1",
+ "ref_smiles": "CN(C)c1ncc(C(C)(C)c2ccccc2)cc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "95f27cbd-1ddc-412a-8ba5-d392b22b1532",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2)cc1OC by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2)cc1OC",
+ "ref_smiles": "COc1ccc(C(=O)NCCCNC(=O)c2ccc(C[NH3+])cc2C(=O)O)cc1OC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "52545c5d-f01f-4da9-8fe3-132cc5a9cee1",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(CNC(=O)C(=O)Nc2nccs2)c1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(CNC(=O)C(=O)Nc2nccs2)c1",
+ "ref_smiles": "COc1cccc(CNOc2nccs2)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "64231734-3fa0-4bef-84a3-d15e3a51efcc",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)CONC(=O)CC1CCC[NH2+]C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CONC(=O)CC1CCC[NH2+]C1.",
+ "ref_smiles": "CC(C)COC1CCC[NH2+]C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "032b8b9b-6129-4d22-9336-3ac445137841",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C[NH+]=C(NCCC[NH+]1CCCC(C(N)=O)C1)NCC1(CCOC)CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCC[NH+]1CCCC(C(N)=O)C1)NCC1(CCOC)CCC1.",
+ "ref_smiles": "C[NH+]=C(NCCC[NH+]1CCCC1)NCC1(CCOC)CCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1d847213-7fbd-47c3-9898-ec76d4197b31",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(OCC(F)(F)F)C(=O)NC(CO)CC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OCC(F)(F)F)C(=O)NC(CO)CC(C)(C)C.",
+ "ref_smiles": "CC(OCC(F)(F)F)C(=O)NC(CC(C)(C)C)C(O)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d54b2f3b-0526-4854-b917-f4584b76976c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)c1nnc(CNc2ccc(C(=O)NCCCO)cc2)o1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1nnc(CNc2ccc(C(=O)NCCCO)cc2)o1",
+ "ref_smiles": "CC(C)c1nnc(CNc2ccc(C(=O)NCCCS)cc2)o1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f9c9609a-a906-4ed6-abcd-6394d200a47b",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=S(=O)(NC1(C(F)(F)F)CC1)c1ccc(C[NH2+]C2CC2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NC1(C(F)(F)F)CC1)c1ccc(C[NH2+]C2CC2)s1.",
+ "ref_smiles": "O=S(=O)(NC1(C(F)F)CC1)c1ccc(C[NH2+]C2CC2)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "929e8624-9ace-4101-9941-95665646e73c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(CCCl)[NH2+]Cc1ccc(F)cc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CCCl)[NH2+]Cc1ccc(F)cc1Cl",
+ "ref_smiles": "CCC(CC[N+](=O)[O-])[NH2+]Cc1ccc(F)cc1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "763e348b-54ad-4ebe-a044-dc5ff6786499",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1CCC(COCCO)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(COCCO)O1.",
+ "ref_smiles": "CCOCC1CCC(C)O1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e7332fce-c42f-4731-a1ef-d319071b5da4",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCn1c(C2CCCN(C(=O)c3ccc(-n4ncc(C#N)c4N)cc3)C2)n[nH]c1=S with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(C2CCCN(C(=O)c3ccc(-n4ncc(C#N)c4N)cc3)C2)n[nH]c1=S",
+ "ref_smiles": "CCn1c(C2CCCN(C(=O)c3ccc(-n4ncc(S)c4N)cc3)C2)n[nH]c1=S",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "3710ccf4-f143-4091-9902-81bc60e47539",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1CC(C)C(C[NH+](CC2CC2)C(C)C)C(O)C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)C(C[NH+](CC2CC2)C(C)C)C(O)C1",
+ "ref_smiles": "CC1CC(C)C(C[NH+](CC2CC2)C(C)C)C(Br)C1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4e915716-db32-41a6-a81d-b43aee960545",
+ "task": "add",
+ "question": "Modify the molecule COCCCC(NC(=O)NCC(C)COC)C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCC(NC(=O)NCC(C)COC)C(=O)[O-]",
+ "ref_smiles": "COCC(C)CNC(=O)NC(CCC(O)OC)C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0ec1d2e3-65dc-4b73-8d06-e134ca566689",
+ "task": "sub",
+ "question": "Modify the molecule CCC(=O)Nc1ccc(C(C)NC(=O)c2ccccc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 by substituting a nitro with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1ccc(C(C)NC(=O)c2ccccc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1",
+ "ref_smiles": "CCC(=O)Nc1ccc(C(C)NC(=O)c2ccccc2NS(=O)(=O)c2cccc(I)c2)cc1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "dab7d864-9437-4578-bb34-0a3e1dece6ec",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cn1c(=O)nc2n(CCc3ccccc3)c3ccccc3nc-2c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(=O)nc2n(CCc3ccccc3)c3ccccc3nc-2c1=O.",
+ "ref_smiles": "Cn1c(=O)nc2n(CC(C(=O)O)c3ccccc3)c3ccccc3nc-2c1=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8c877060-51ff-4adf-9b99-e81d461ad1d5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Oc1cccc(Cl)c1C[NH+]1CC(N2CC[NH2+]CC2)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1cccc(Cl)c1C[NH+]1CC(N2CC[NH2+]CC2)C1",
+ "ref_smiles": "N#Cc1cccc(O)c1C[NH+]1CC(N2CC[NH2+]CC2)C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "892b841c-f5c3-4acd-aa8b-9e33b7c72b89",
+ "task": "delete",
+ "question": "Modify the molecule C#Cc1cccc(NC(=O)c2ccc(Br)cc2O)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#Cc1cccc(NC(=O)c2ccc(Br)cc2O)c1",
+ "ref_smiles": "C#Cc1cccc(NC(=O)c2ccccc2O)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "cec6452f-f438-4f61-9be2-b49c325a3253",
+ "task": "sub",
+ "question": "Modify the molecule O=S(=O)(NCCCOCCO)c1cccc(Cl)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NCCCOCCO)c1cccc(Cl)c1",
+ "ref_smiles": "O=S(=O)(NCCCOCCO)c1cccc([N+](=O)[O-])c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bcaa0c6a-6ba1-42bf-ab24-9925c2188664",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1nc(-c2cccnc2)nc(NC2CC(C)[NH+](C3CC3)C2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2cccnc2)nc(NC2CC(C)[NH+](C3CC3)C2)c1C.",
+ "ref_smiles": "Cc1nc(-c2cccnc2)nc(C2CC(C)[NH+](C3CC3)C2)c1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "ba509a29-be04-4f4d-9bc7-36f809a212fb",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(Br)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Cl)cc1NC(=O)COC(=O)c1ccc(Br)cc1",
+ "ref_smiles": "Cc1ccc(Cl)cc1NC(=O)COC(=O)Br",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "86336aa0-a989-4e97-8854-73cb5933f1df",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(CCc1ccc(OCC(O)C(C)(C)C)c(C)c1)c1cc(C)c(C(=O)N2CCCC2C(=O)[O-])s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CCc1ccc(OCC(O)C(C)(C)C)c(C)c1)c1cc(C)c(C(=O)N2CCCC2C(=O)[O-])s1.",
+ "ref_smiles": "CCC(CCCOCC(O)C(C)(C)C)c1cc(C)c(C(=O)N2CCCC2C(=O)[O-])s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9b633b71-b1ec-43fd-9431-0caa69f14cea",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CCc1cc(CNc2ccc(CC)cc2)cc(OC)c1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(CNc2ccc(CC)cc2)cc(OC)c1O",
+ "ref_smiles": "CC(=O)c1c(CC=C)cc(CNc2ccc(CC)cc2)cc1OC",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2c630701-7d0f-48ab-ae42-166fda1bece1",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(C(=O)OCC(=O)Nc2c(C)nn(C)c2C)cc1OC by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)OCC(=O)Nc2c(C)nn(C)c2C)cc1OC",
+ "ref_smiles": "CCOc1ccc(C(=O)Oc2c(C)nn(C)c2C)cc1OC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e0adcf6c-ff25-4112-b8be-e00b1ece2824",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C=C(C)CNc1sc(C(=O)OCC)c(N)c1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)CNc1sc(C(=O)OCC)c(N)c1OC.",
+ "ref_smiles": "C=C(C)CNc1sc(C(=O)OCC)cc1OC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "93436a17-2caa-4f88-90d0-024cdd31b487",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CS(=O)(=O)C3)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2nc3c(c2NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CS(=O)(=O)C3)cc1",
+ "ref_smiles": "O=Cc1ccc(-n2nc3c(c2NC(=O)c2ccc([H])c([N+](=O)[O-])c2)CS(=O)(=O)C3)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "26018c9d-8422-455e-b259-b885acfcead9",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(C(=O)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc(OC)c1Br by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C(=O)Nc2ccc(Cl)c(C(=O)NC3CCCCC3)c2)cc(OC)c1Br",
+ "ref_smiles": "COc1cc(C(=O)Nc2ccc(C=O)c(C(=O)NC3CCCCC3)c2)cc(OC)c1Br",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "632cf043-4a65-4c3e-b4d5-49bfa07ee690",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1.",
+ "ref_smiles": "CN(C)C(=O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "63cf0cb6-4057-4509-afd6-1d11f65ecbc4",
+ "task": "delete",
+ "question": "Modify the molecule C=CCC(C)NC(N)=[NH+]CC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCC(C)NC(N)=[NH+]CC",
+ "ref_smiles": "C=CCC(C)C(N)=[NH+]CC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b4f3d788-4357-4e87-969d-bb981b568705",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCc1nn(CC)c(CC(NN)C2CCC(CC)C2)c1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nn(CC)c(CC(NN)C2CCC(CC)C2)c1Cl.",
+ "ref_smiles": "CCc1nn(CC)c(CC(C#N)(NN)C2CCC(CC)C2)c1Cl",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "e55381fa-d62e-4350-9270-90e37f3ae63c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CCN=C(CCl)C(CC(C)C)[NH+](Cc1ccccc1)Cc1ccccc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN=C(CCl)C(CC(C)C)[NH+](Cc1ccccc1)Cc1ccccc1",
+ "ref_smiles": "C=CCN=C(CO)C(CC(C)C)[NH+](Cc1ccccc1)Cc1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "908d264c-61e6-4867-9456-0ea6c6a362ce",
+ "task": "sub",
+ "question": "Modify the molecule OCC#Cc1cccc(CSc2ncco2)c1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCC#Cc1cccc(CSc2ncco2)c1",
+ "ref_smiles": "N#CCC#Cc1cccc(CSc2ncco2)c1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "16aeb5e8-1f02-42a4-b19c-564c2bd74a76",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1CCCc2nc(-c3c(F)cccc3Cl)sc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCCc2nc(-c3c(F)cccc3Cl)sc21",
+ "ref_smiles": "O=C1CCCc2nc(-c3c(CHO)cccc3Cl)sc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "adf32f97-9f33-4d94-9517-d943292eed98",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CN(c1ncccc1C(=O)Nc1ccc(C(OCC2CCC[NH2+]2)(C(F)(F)F)C(F)(F)F)cc1)c1cc[nH+]c2[nH]ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(c1ncccc1C(=O)Nc1ccc(C(OCC2CCC[NH2+]2)(C(F)(F)F)C(F)(F)F)cc1)c1cc[nH+]c2[nH]ccc12.",
+ "ref_smiles": "CN(c1ncccc1C(=O)NC(OCC1CCC[NH2+]1)(C(F)(F)F)C(F)(F)F)c1cc[nH+]c2[nH]ccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c5dfc2f3-4bcc-430a-9322-d745556d5a6a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC[NH2+]C(CSc1nc(C)cc(C)n1)c1cccc(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(CSc1nc(C)cc(C)n1)c1cccc(C)c1.",
+ "ref_smiles": "CC[NH2+]C(C)CSc1nc(C)cc(C)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "02f9f41d-b473-4207-a138-ddeee7bf8f79",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(C)c1Cl by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(C)c1Cl",
+ "ref_smiles": "Cc1cc(OCc2ccc(C=CC(=O)c3ccc4ccccc4c3)o2)cc(CO)c1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d5308e89-50a5-4bc1-978a-8b1bf15f3162",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)Nc1cc(Cl)c2ccn(Cc3cnc[nH]3)c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Nc1cc(Cl)c2ccn(Cc3cnc[nH]3)c2c1.",
+ "ref_smiles": "COC(=O)Nc1ccc2ccn(Cc3cnc[nH]3)c2c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "601adcfc-d895-4742-97ab-32cda54369c2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCNC(=O)c1cc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccc(F)cc4F)ccc3C)CC2)ccc1Br with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)c1cc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccc(F)cc4F)ccc3C)CC2)ccc1Br",
+ "ref_smiles": "CCCNC(=O)c1cc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4ccc(C#N)cc4F)ccc3C)CC2)ccc1Br",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7c19be2c-f64a-4b57-bea0-42c4f23fdd5b",
+ "task": "add",
+ "question": "Modify the molecule CC(C)CCC(O[Si]CC[Si]OC(CCC(C)C)C(C)C)C(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCC(O[Si]CC[Si]OC(CCC(C)C)C(C)C)C(C)C",
+ "ref_smiles": "CC(C)CCC(O[Si]CC[Si]OC(CC(C(=O)O)C(C)C)C(C)C)C(C)C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9a2519c1-0c81-41f1-a421-ebf35d050fb4",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOC(=O)c1nn(Cc2ccc(OC)cc2)c2c1CN(C(=O)c1ccnn1C)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1nn(Cc2ccc(OC)cc2)c2c1CN(C(=O)c1ccnn1C)CC2.",
+ "ref_smiles": "CCOC(=O)c1nn(Cc2ccc(OC)c(-c3ccccc3)c2)c2c1CN(C(=O)c1ccnn1C)CC2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "925d3539-9484-41e9-9c80-4f2953e3fde3",
+ "task": "delete",
+ "question": "Modify the molecule C=CC(=CC)CC(=O)NC(=C)SC(=C)CCSCCc1nnc(NC(=O)CC(C)=CC)s1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=CC)CC(=O)NC(=C)SC(=C)CCSCCc1nnc(NC(=O)CC(C)=CC)s1",
+ "ref_smiles": "C=CC(=CC)CC(=O)NC(=C)SC(=C)CCSCCc1nnc(C(C)=CC)s1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "734e367e-8702-4ceb-9233-de6ca908d622",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1CSC(NN=Cc2ccccc2OC(F)(F)F)=[NH+]1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CSC(NN=Cc2ccccc2OC(F)(F)F)=[NH+]1",
+ "ref_smiles": "O=C1CSC(NN=Cc2ccc(C=O)cc(OCH3)c2)=[NH+]1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "10254510-e917-4961-9fcc-6e982f787704",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(CC[Si](C)(C)C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC[Si](C)(C)C)cc1.",
+ "ref_smiles": "COCC[Si](C)(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "22dbaab7-0148-4285-9b26-683b15d0e01b",
+ "task": "sub",
+ "question": "Modify the molecule CC(Cl)=C1C(C)=C(Cl)c2cc3ccc2CCc2ccc(cc21)CC3 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cl)=C1C(C)=C(Cl)c2cc3ccc2CCc2ccc(cc21)CC3",
+ "ref_smiles": "CC(C#N)=C1C(C)=C(Cl)c2cc3ccc2CCc2ccc(cc21)CC3",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fc836b7c-76ce-42ce-ad68-fb63d699d951",
+ "task": "add",
+ "question": "Modify the molecule N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1",
+ "ref_smiles": "N#Cc1ccc(Nc2nccc3n[nH]c(=O)n23)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1266e581-b08a-40ec-9708-f3eeb5982a6b",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCCOc1cc2nn(-c3cccc(O)c3)nc2cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1cc2nn(-c3cccc(O)c3)nc2cc1C.",
+ "ref_smiles": "CCCCOc1cc2nn(-c3ccccc3)nc2cc1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0a259ea5-1f42-4299-aa84-a80b669975d1",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C(N)=[NH+]O)[NH+]1CCCC(CO)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(N)=[NH+]O)[NH+]1CCCC(CO)C1.",
+ "ref_smiles": "CC(C(N)=[NH+]O)[NH+]1CCC(c2ccccc2)C(CO)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "93aee5fe-9240-4572-9a25-0e7264a418e1",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1",
+ "ref_smiles": "O=C(CCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1)OCCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0727cb81-41cb-494c-be3b-f1c19596a351",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CCCC1NC(=O)C1CC(=O)N(C)C1c1cccc(Cl)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC1NC(=O)C1CC(=O)N(C)C1c1cccc(Cl)c1",
+ "ref_smiles": "CC1CCCC1NC(=O)C1CC(=O)N(C)C1c1cccc(S)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "21bff697-ea6c-44f9-a7b8-429217fb1448",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH2+]C(Cc1c(F)ccc(Br)c1F)C1CCOC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(Cc1c(F)ccc(Br)c1F)C1CCOC1",
+ "ref_smiles": "CC[NH2+]C(Cc1c(C(=O)[OH])ccc(Br)c1F)C1CCOC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9c6a71f5-cd36-44dd-80a0-17b661b6ee19",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Clc1c(CC2CC[NH2+]CC2)ccc2[nH]ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1c(CC2CC[NH2+]CC2)ccc2[nH]ccc12.",
+ "ref_smiles": "OC1CC(Cc2ccc3[nH]ccc3c2Cl)CC[NH2+]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d26dbc06-bca3-42c4-acaf-ee5003645a29",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cccc(C#CC(C)(C)O)c23)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cccc(C#CC(C)(C)O)c23)cc1.",
+ "ref_smiles": "Cc1nn(C)c(C)c1-c1ccc(-c2cnn3cc(-c4ccccc4)cc(C#CC(C)(C)O)c23)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fc0f12c4-06f8-4758-af91-b02efd440553",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCOc1ccc(-c2c(C)c(-c3ccc(C)cc3)nc(N)c2C#N)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-c2c(C)c(-c3ccc(C)cc3)nc(N)c2C#N)cc1",
+ "ref_smiles": "CC(=O)c1c(N)nc(-c2ccc(C)cc2)c(C)c1-c1ccc(OCC)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d7d4f875-d71b-46a5-a53e-102cd9dc7384",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(OCCCCn2c(CCCCCNC(=O)C3CCCO3)nc3ccccc32)ccc1Cl by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OCCCCn2c(CCCCCNC(=O)C3CCCO3)nc3ccccc32)ccc1Cl",
+ "ref_smiles": "Cc1cc(OCCCCn2c(CCCCC(CC=O)NC(=O)C3CCCO3)nc3ccccc32)ccc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "e75daa22-ec83-4d17-9f47-0b7950c0c2b4",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12.",
+ "ref_smiles": "CC1(CO)CCCC2(C)C3CC45OC4C(O)C4(CO)OC4C5(O)CC3=CCC12c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a4778e46-b7b6-40a8-b276-cc5b4ffdd6f4",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2cccc(Br)c2)cc1O by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2cccc(Br)c2)cc1O",
+ "ref_smiles": "COc1ccc(C2C(=C([O-])c3cccc4ccccc34)C(=O)C(=O)N2c2ccc(C(=O)O)c(Br)c2)cc1O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "faa2268a-76a8-4f1f-a7c2-29a4e09e2f03",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(NC(=O)C2(O)CCSCC2)c(Cl)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)C2(O)CCSCC2)c(Cl)c1",
+ "ref_smiles": "CC(=O)c1cc(C)ccc1NC(=O)C1(O)CCSCC1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6a99d219-e9b8-4ecc-a2f8-996246d39a5c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CN(Cc1ccc2c(c1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccc2c(c1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1.",
+ "ref_smiles": "CN(Cc1cc2c(cc1-c1ccccc1)OCO2)C(=O)C=Cc1ccc(-c2ccccc2F)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "814212c0-c97f-4c1c-bf28-a4eab06242c0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCCCOC(=O)C=CCl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCOC(=O)C=CCl",
+ "ref_smiles": "CCCCCCCCCOC(=O)C=CC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b3b45038-b655-4e92-a8ec-31bcb0a78ae3",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(Cl)cc1Nc1nncc(N2CCc3ccccc32)n1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)cc1Nc1nncc(N2CCc3ccccc32)n1",
+ "ref_smiles": "COc1ccc(O)cc1Nc1nncc(N2CCc3ccccc32)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b8d9de72-d78b-46b3-9fb7-ec0a048d0324",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(=O)N(CCNC(=O)Cc1c[nH]c2ccccc12)c1cccc(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(CCNC(=O)Cc1c[nH]c2ccccc12)c1cccc(C)c1.",
+ "ref_smiles": "Cc1cccc(CCNC(=O)Cc2c[nH]c3ccccc23)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "dd526974-4945-43f2-8b2f-d3562bf61d3c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule c1cc(C2CC2)ccc1CCC[NH+]1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1cc(C2CC2)ccc1CCC[NH+]1CCCC1.",
+ "ref_smiles": "[NH+]1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ff0bfff1-0786-4e90-8a24-ff222f6c21f7",
+ "task": "add",
+ "question": "Modify the molecule IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1",
+ "ref_smiles": "IC1=C2N=c3c1c(-c1ccccc1)c1ccc(n31)C(c1ccccc1)=C1C=CC(=N1)C(c1ccccc1)=c1ccc([nH]1)=C2c1ccccc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8b686130-ad70-450c-9acb-7be68ffff4a1",
+ "task": "add",
+ "question": "Modify the molecule Nc1ccc(-n2nnc(S(=O)(=O)c3ccccc3Br)c2-c2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(-n2nnc(S(=O)(=O)c3ccccc3Br)c2-c2ccccc2)cc1",
+ "ref_smiles": "Nc1ccc(-n2nnc(S(=O)(=O)c3ccc(O)cc3Br)c2-c2ccccc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f6c5f053-cf51-4dc1-947f-8fc699ce8123",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1c(-c2ccc(C(N)=O)cc2Cl)nnc1C(C)(C)Oc1c(F)cc(F)cc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(-c2ccc(C(N)=O)cc2Cl)nnc1C(C)(C)Oc1c(F)cc(F)cc1F",
+ "ref_smiles": "Cn1c(-c2ccc(C(N)=O)cc2C(=O)O)nnc1C(C)(C)Oc1c(F)cc(F)cc1F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "af765465-25b4-49f8-b670-3725c1b1845e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C[NH2+]C(c1cn(C)c2ccccc12)C1(CO)CCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(c1cn(C)c2ccccc12)C1(CO)CCC1",
+ "ref_smiles": "C[NH2+]C(c1cn(C)c2ccccc12)C1(CNO)CCC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "491b86fe-9ec9-4aab-9959-1ecd0ea0853a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1CN(C(=O)NC2CCCC(F)(F)C2)CCS1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CN(C(=O)NC2CCCC(F)(F)C2)CCS1",
+ "ref_smiles": "CC(=O)C1CN(C(=O)NC2CCCCC2)CCS1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "388d4ed0-39a6-4b53-9327-0d0b264ce398",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CN(C(=O)C[NH+]1CCCCC1)c1ccc(N=C(c2ccccc2)c2c(O)[nH]c3ccc(N(C)S(=O)(=O)c4ccccc4)cc23)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)C[NH+]1CCCCC1)c1ccc(N=C(c2ccccc2)c2c(O)[nH]c3ccc(N(C)S(=O)(=O)c4ccccc4)cc23)cc1.",
+ "ref_smiles": "CN(N=C(c1ccccc1)c1c(O)[nH]c2ccc(N(C)S(=O)(=O)c3ccccc3)cc12)C(=O)C[NH+]1CCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "81685397-c4b7-47ea-a8e7-ac1209a6dae6",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH+](C)Cc1ccc(-c2ccc(CCC(=O)c3ncc(-c4cccc(OC(=O)[O-])n4)o3)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)Cc1ccc(-c2ccc(CCC(=O)c3ncc(-c4cccc(OC(=O)[O-])n4)o3)cc2)cc1.",
+ "ref_smiles": "C[NH+](C)Cc1ccc(CCC(=O)c2ncc(-c3cccc(OC(=O)[O-])n3)o2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7a1fb40a-91b3-45cf-9f80-47e22b6097ed",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CCCCCCN1C(=O)CCC1C=CC(OC(=O)Cc1ccc(C(=O)NCCCC(O)(OP(O)O)O[P+](=O)O)cc1)C(F)(F)c1ccccc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCCCCCN1C(=O)CCC1C=CC(OC(=O)Cc1ccc(C(=O)NCCCC(O)(OP(O)O)O[P+](=O)O)cc1)C(F)(F)c1ccccc1",
+ "ref_smiles": "CCOC(=O)CCCCCCN1C(=O)CCC1C=CC(OC(=O)Cc1ccc(C(=O)NCCCC(O)(OP(O)O)O[P+](=O)O)cc1)C(F)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1b3c3961-1d02-4fa5-b655-bb24d270a7ba",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cccc(CNc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CNc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1.",
+ "ref_smiles": "Cc1cccc(C(O)Nc2cc(C(=O)Nc3cccc(C)c3C)ccn2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8f5fdbe7-6b43-45d8-b32c-790ae1e8d089",
+ "task": "delete",
+ "question": "Modify the molecule NC(=O)CCSC(=S)N1CCOCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CCSC(=S)N1CCOCC1",
+ "ref_smiles": "CSC(=S)N1CCOCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "91ff0d17-c7a2-4d30-a5bd-5c0587404ae0",
+ "task": "sub",
+ "question": "Modify the molecule OC(c1ccccn1)C1(c2ccc(OC(F)(F)F)cc2)CC[NH2+]CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(c1ccccn1)C1(c2ccc(OC(F)(F)F)cc2)CC[NH2+]CC1",
+ "ref_smiles": "O=C([OH])C(c1ccccn1)C1(c2ccc(OC(F)(F)F)cc2)CC[NH2+]CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "65cbeeb4-e6c5-47b7-9dc6-46971b773da7",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]1CCc2c([nH]c3cc(-n4ccc(OCc5ccc(C(F)(F)F)cc5)cc4=O)ccc23)C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCc2c([nH]c3cc(-n4ccc(OCc5ccc(C(F)(F)F)cc5)cc4=O)ccc23)C1",
+ "ref_smiles": "C[NH+]1CCc2c([nH]c3cc(-n4ccc(OCC(F)(F)F)cc4=O)ccc23)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e3922a71-8ed2-43ba-ad1b-373b67b35ec3",
+ "task": "delete",
+ "question": "Modify the molecule CCNc1nc(CCOCC(F)(F)F)ncc1I by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1nc(CCOCC(F)(F)F)ncc1I",
+ "ref_smiles": "CCc1nc(CCOCC(F)(F)F)ncc1I",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6b1fe711-c21d-4e7d-bf15-e893bdcb668c",
+ "task": "add",
+ "question": "Modify the molecule C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1",
+ "ref_smiles": "C=CC1OCCCC1NC(=O)N1CCC(C)(C)S(=O)(=O)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "48fe82b6-b9cb-4a3f-a835-2008e083a2f6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Oc1cccc(Cl)c1)C(=O)Nc1c(C#N)cnn1C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Oc1cccc(Cl)c1)C(=O)Nc1c(C#N)cnn1C",
+ "ref_smiles": "CC(Oc1cccc(C(=O)[OH])c1)C(=O)Nc1c(C#N)cnn1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8fea7fc9-c1dd-4de0-9f9e-91043d34caf1",
+ "task": "add",
+ "question": "Modify the molecule C=CCCCCCCCc1nnc(-c2ccccc2)c(-c2ccccc2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCCCCCCCc1nnc(-c2ccccc2)c(-c2ccccc2)n1",
+ "ref_smiles": "C=CCCCCCC(Cc1nnc(-c2ccccc2)c(-c2ccccc2)n1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c303e2e6-887e-4954-8a3a-58ea84a51bb2",
+ "task": "add",
+ "question": "Modify the molecule C=CCn1c(CC(=O)Nc2ccc(OC)cc2)nnc1SCC(=O)Nc1nccs1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCn1c(CC(=O)Nc2ccc(OC)cc2)nnc1SCC(=O)Nc1nccs1",
+ "ref_smiles": "C=CCn1c(CC(=O)Nc2ccc(OC)cc2C(=O)O)nnc1SCC(=O)Nc1nccs1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a0802ed1-b616-459c-a449-97e7f81fb0bb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(CO)Nc1ccc2[nH]c(=O)[nH]c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(CO)Nc1ccc2[nH]c(=O)[nH]c2c1.",
+ "ref_smiles": "CC(C)(CO)Nc1cc2[nH]c(=O)[nH]c2cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ad1c13c9-9c2d-4413-b3f6-83b08b51aebd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCn1cc(C(=O)Nc2cc(C[NH3+])cc(C(F)(F)F)c2)cn1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1cc(C(=O)Nc2cc(C[NH3+])cc(C(F)(F)F)c2)cn1",
+ "ref_smiles": "CC(=O)C(F)(F)c1cc(C[NH3+])cc(NC(=O)c2cnn(CC)c2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0f911c8e-84b0-4916-a7d8-664686bb5cb1",
+ "task": "add",
+ "question": "Modify the molecule COCCCN1C(=O)SC(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)C1=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCN1C(=O)SC(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)C1=O",
+ "ref_smiles": "COCCCN1C(=O)SC(=Cc2ccc(-c3c(OC)cc([N+](=O)[O-])cc3-c3ccccc3)o2)C1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d2c6c2da-fe02-46fd-8a28-85bb4cdaa57e",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(O)c1ncnc(NCC2CCCC(c3ccc(Cl)cc3)O2)c1C by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(O)c1ncnc(NCC2CCCC(c3ccc(Cl)cc3)O2)c1C",
+ "ref_smiles": "CCOCc1ncnc(NCC2CCCC(c3ccc(Cl)cc3)O2)c1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "36c7f5a3-abc7-4327-83ce-bd876d9f3043",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cccc(-c2nnc(SCC(=O)NC3CCCCCCC3)n2C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-c2nnc(SCC(=O)NC3CCCCCCC3)n2C)c1.",
+ "ref_smiles": "Cc1nnc(SCC(=O)NC2CCCCCCC2)n1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d72ffbe9-d78f-4551-a3b0-92519926181c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule [NH3+]CCc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1.",
+ "ref_smiles": "[NH3+]C(Cc1nnc(-c2cc(O)cc([N+](=O)[O-])c2)o1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "920f8e2b-7524-4d87-9023-81a694eab1b5",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=C(NCC1CCCC1O)c1cnn(-c2cccc(Cl)c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1CCCC1O)c1cnn(-c2cccc(Cl)c2)n1.",
+ "ref_smiles": "O=C(NCC1CCCC1(O)C(=O)O)c1cnn(-c2cccc(Cl)c2)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "caff4ff6-dcf5-4acb-94c1-b674c5c153b4",
+ "task": "delete",
+ "question": "Modify the molecule CC1CN(C2CC(O)C(CO)=C2F)C(=O)NC1=O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(C2CC(O)C(CO)=C2F)C(=O)NC1=O",
+ "ref_smiles": "CC1CN(C2CC(O)C(C)=C2F)C(=O)NC1=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d70a9c92-8ac2-446a-a8c0-8b24f87ebfda",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C(F)C(=O)N1C(=O)OC(C)(C)C1C(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(F)C(=O)N1C(=O)OC(C)(C)C1C(C)C",
+ "ref_smiles": "CC(C)CC(=O)N1C(=O)OC(C)(C)C1C(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "965e2cc9-9712-4090-9244-8a186bffe21f",
+ "task": "add",
+ "question": "Modify the molecule OC1CC[NH+](CCN2CCOCC2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1CC[NH+](CCN2CCOCC2)C1",
+ "ref_smiles": "O=CCC(CN1CCOCC1)[NH+]1CCC(O)C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "501965ac-73c4-41a2-b6a3-18871c3d6313",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CC[NH+](Cc2c(O)ccc3ccccc23)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CC[NH+](Cc2c(O)ccc3ccccc23)CC1.",
+ "ref_smiles": "O=[N+]([O-])c1cc(C(F)F)ccc1N1CC[NH+](Cc2c(O)ccc3ccccc23)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d4b8267c-efda-4164-9fa6-33ad9b5b6e09",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+]1CCCC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCCC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12.",
+ "ref_smiles": "C[NH+]1CC(c2ccccc2)CC2(C(=O)[O-])CCN(c3cc(C(F)(F)F)nc(N4CCCC4)n3)CC12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "23fdb8c8-256e-4441-9626-08846518b797",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCCCCC(F)(F)C=CC1C(OC(C)=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(F)(F)C=CC1C(OC(C)=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21.",
+ "ref_smiles": "CCCCCC(F)(F)C=CC1C(OC(=O)CCC=O)CC2OC(c3nc(C(=O)[O-])cs3)CCC21",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "45cabc5d-f287-4d5d-8fa8-45e844175068",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCC[NH+](CCCC)Cc1nc(-c2ncn3c2C2CCCN2C(=O)c2c(Cl)cccc2-3)no1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[NH+](CCCC)Cc1nc(-c2ncn3c2C2CCCN2C(=O)c2c(Cl)cccc2-3)no1.",
+ "ref_smiles": "CCCC[NH+](CCCC)Cc1nc(-c2ncn3c2C2CCCN2C(=O)c2ccccc2-3)no1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "78969a2f-d943-43d3-a75c-29150fd5a719",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(F)cc(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(F)cc(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1",
+ "ref_smiles": "Cc1cc(F)c(N)c(NS(=O)(=O)c2ccc(Cl)c(C[NH3+])c2)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "66d5848a-acbe-40fe-b8c8-89421ab14c80",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(Nc2cc(Br)ccc2Br)c(F)cc1N by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Nc2cc(Br)ccc2Br)c(F)cc1N",
+ "ref_smiles": "COc1cc(Nc2cc(Br)ccc2Br)ccc1N",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "39585e52-e18c-4336-8b7d-2883156b5da4",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(Nc1nc2n(n1)CCCC2)C1(CCF)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1nc2n(n1)CCCC2)C1(CCF)CC1.",
+ "ref_smiles": "O=C(Nc1nc2n(n1)CCCC2)C1(C(CF)c2ccccc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cefad4f8-213e-4f9e-a569-a90e2f06fa11",
+ "task": "sub",
+ "question": "Modify the molecule O=C(OC1Cc2c(O)cc(O)cc2OC1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(OC(=S)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OC1Cc2c(O)cc(O)cc2OC1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(OC(=S)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c1",
+ "ref_smiles": "O=C(OC1Cc2c(Br)cc(O)cc2OC1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(OC(=S)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c2bf610d-2e31-412b-81f8-5287585c9556",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-c2nn3c(=O)cc(CNC(=O)Nc4cccc(SC)c4)nc3s2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nn3c(=O)cc(CNC(=O)Nc4cccc(SC)c4)nc3s2)cc1",
+ "ref_smiles": "COc1nn2c(=O)cc(CNC(=O)Nc3cccc(SC)c3)nc2s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8b41f5e3-1a0b-4210-831a-bd28698d083b",
+ "task": "sub",
+ "question": "Modify the molecule CC([NH3+])C1=[NH+]N(c2cccc(Cl)c2)C2SC=NN12 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])C1=[NH+]N(c2cccc(Cl)c2)C2SC=NN12",
+ "ref_smiles": "CC([NH3+])C1=[NH+]N(c2cccc(S)c2)C2SC=NN12",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a27f54fa-b7ae-49b2-8648-b5b85badfb17",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C(=O)Cc2cnc(C)c(-n3cc(-c4cncc(N5CC[NH+](C)CC5)c4)nn3)c2)cc1C(F)(F)F by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)Cc2cnc(C)c(-n3cc(-c4cncc(N5CC[NH+](C)CC5)c4)nn3)c2)cc1C(F)(F)F",
+ "ref_smiles": "COc1ccc(C(=O)Cc2cnc(C)c(-n3cc(-c4cncc(N5CC[NH+](C)CC5)c4)nn3)c2)cc1C(F)(F)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "26cc0a1f-f2ac-46a3-a2cd-ddd4bc6f25f0",
+ "task": "sub",
+ "question": "Modify the molecule CCC1(C(=O)[O-])CCN(c2nc(-c3cc(-c4ccon4)n(Cc4ccccc4F)n3)ncc2F)CC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C(=O)[O-])CCN(c2nc(-c3cc(-c4ccon4)n(Cc4ccccc4F)n3)ncc2F)CC1",
+ "ref_smiles": "CCC1(C(=O)[O-])CCN(c2nc(-c3cc(-c4ccon4)n(Cc4ccccc4C(=O)O)n3)ncc2F)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c500f641-3c8e-41fb-84fd-e0d7559a6cb1",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc2cc(-c3ccnc(NC4CC[NH+](Cc5ccccc5)CC4)n3)cc(NC(=O)[O-])c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2cc(-c3ccnc(NC4CC[NH+](Cc5ccccc5)CC4)n3)cc(NC(=O)[O-])c2c1.",
+ "ref_smiles": "COc1ccc2cc(-c3ccnc(NC4CC[NH+](C)CC4)n3)cc(NC(=O)[O-])c2c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "08d54ce1-555b-4bc6-9f32-4392a2babe33",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(=O)N1CCN(C(=O)c2ccnc(C(=O)N3CCCC(C)C3)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCN(C(=O)c2ccnc(C(=O)N3CCCC(C)C3)c2)CC1.",
+ "ref_smiles": "CC(=O)N1CCN(C(=O)c2cc(C(=O)N3CCCC(C)C3)ncc2O)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3c66b67c-691a-4605-979e-d1b149059f9b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C)c(NC(=O)c2cc(F)cnc2N)c(C)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(NC(=O)c2cc(F)cnc2N)c(C)c1",
+ "ref_smiles": "O=Cc1cc(C)c(NC(=O)c2ccc(N)nc2N)c(C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2bab0653-2c4c-43df-a43f-4a704fb67d51",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1cnc2c(C)c(Cl)ccc2c1Nc1ccccc1Cl by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cnc2c(C)c(Cl)ccc2c1Nc1ccccc1Cl",
+ "ref_smiles": "CCOC(=O)c1cnc2c(C)c(Cl)ccc2c1NCl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "023f2fac-4703-4e73-bb67-b5381974bacf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH2+]C(CCC)Cc1c(Br)c(CC)nn1C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(CCC)Cc1c(Br)c(CC)nn1C",
+ "ref_smiles": "CCC[NH2+]C(CCC)Cc1c(C(=O)[OH])c(CC)nn1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0aca2ab2-ff4c-4d49-ba8e-fa5daa0f1cf9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNc1cccc(Br)c1C(=O)[O-] with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1cccc(Br)c1C(=O)[O-]",
+ "ref_smiles": "CCNc1cccc(O)c1C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9bcfe397-4dad-4df0-b086-29b37e04ece3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=CC(=O)[O-])Cn1ccc2cc(Br)ccc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=CC(=O)[O-])Cn1ccc2cc(Br)ccc21",
+ "ref_smiles": "CC(=CC(=O)[O-])Cn1ccc2cc(C#N)ccc21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d6870c11-2e9d-411a-81f1-d7f53923ed4a",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=[N+]([O-])C1CC(C[NH+]2CCC(O)CC2)=CCC1c1ccc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])C1CC(C[NH+]2CCC(O)CC2)=CCC1c1ccc(Cl)cc1Cl.",
+ "ref_smiles": "O=[N+]([O-])C1CC(C[NH+]2CCCCC2)=CCC1c1ccc(Cl)cc1Cl",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "32f4d692-1866-4da2-9167-7fd7b459d2f3",
+ "task": "sub",
+ "question": "Modify the molecule N#CC1=C(S)NC(=O)C([n+]2ccccc2)C1c1ccc(F)c(Br)c1 by substituting a nitrile with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1=C(S)NC(=O)C([n+]2ccccc2)C1c1ccc(F)c(Br)c1",
+ "ref_smiles": "O=C1NC(S)=C(Br)C(c2ccc(F)c(Br)c2)C1[n+]1ccccc1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6b8ece6a-0d4f-4bb9-8078-ab71f64b0ed2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccccc1O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccccc1O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1",
+ "ref_smiles": "O=C(Nc1ccccc1O)C1CCCN1C(=O)c1cc(O)cc(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3c42857f-8365-428c-9418-0ad47b4dfcb1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)COc1ccc(C2C(c3cccs3)=C(O)C(=O)N2c2ccc(F)c(F)c2F)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COc1ccc(C2C(c3cccs3)=C(O)C(=O)N2c2ccc(F)c(F)c2F)cc1",
+ "ref_smiles": "CC(C)COc1ccc(C2C(c3cccs3)=C(O)C(=O)N2c2ccc(C#N)c(F)c2F)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5f384a0a-c790-49c6-9342-10612ad230bf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+]1CCC([NH+]2CCN(C(=O)C(CC(=O)N3CCC(N4CCc5ccccc5NC4=O)CC3)Cc3cc(C(F)(F)F)c4[nH]ncc4c3)CC2)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC([NH+]2CCN(C(=O)C(CC(=O)N3CCC(N4CCc5ccccc5NC4=O)CC3)Cc3cc(C(F)(F)F)c4[nH]ncc4c3)CC2)CC1",
+ "ref_smiles": "C[NH+]1CCC([NH+]2CCN(C(=O)C(CC(=O)N3CCC(N4CCc5ccccc5NC4=O)CC3)Cc3cc(C#N)c4[nH]ncc4c3)CC2)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "17d29e1e-f769-471a-ad91-09a13916ee6e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=Cc1ccc(COC2CCC3C(=O)C(c4ccc(Cl)cc4)=COC3C2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=Cc1ccc(COC2CCC3C(=O)C(c4ccc(Cl)cc4)=COC3C2)cc1",
+ "ref_smiles": "C=Cc1ccc(COC2CCC3C(=O)C(c4ccc(NO)cc4)=COC3C2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e08f052-550f-44fc-86e7-facaef313d81",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCc1nc(-c2cccc(CCS(=O)(=O)c3ccccc3)c2)c(-c2ccnc(Cc3ccc(N4CCOCC4)c(F)c3)n2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(-c2cccc(CCS(=O)(=O)c3ccccc3)c2)c(-c2ccnc(Cc3ccc(N4CCOCC4)c(F)c3)n2)s1.",
+ "ref_smiles": "CCc1nc(-c2cccc(CC[SH](=O)=O)c2)c(-c2ccnc(Cc3ccc(N4CCOCC4)c(F)c3)n2)s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d52fe71f-33a0-45ce-a52b-34b1bc295003",
+ "task": "delete",
+ "question": "Modify the molecule O=CNc1cc(Cl)cc(-c2nc(C(=O)NC3CCCCCCCCCCCCCC3)co2)c1O by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=CNc1cc(Cl)cc(-c2nc(C(=O)NC3CCCCCCCCCCCCCC3)co2)c1O",
+ "ref_smiles": "O=CNc1cccc(-c2nc(C(=O)NC3CCCCCCCCCCCCCC3)co2)c1O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "afd76af1-d5a7-4150-9f02-9b07f636433b",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc2c(=O)nc(C(Cl)=Cc3cccc(Cl)c3)[nH]c12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc2c(=O)nc(C(Cl)=Cc3cccc(Cl)c3)[nH]c12",
+ "ref_smiles": "Cc1cccc2c(=O)nc(C(Cl)=Cc3ccccc3)[nH]c12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7c838abc-e532-40a1-b81c-5d5801474c91",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)c1cccc(N2C(=O)C(O)=C(c3cccc(OCC(C)C)c3)C2c2ccc(OCC(C)C)cc2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cccc(N2C(=O)C(O)=C(c3cccc(OCC(C)C)c3)C2c2ccc(OCC(C)C)cc2)c1",
+ "ref_smiles": "CC(=O)c1cccc(N2C(=O)C(C#N)=C(c3cccc(OCC(C)C)c3)C2c2ccc(OCC(C)C)cc2)c1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bcf5cca0-5d67-4c26-b86d-8c8724f01141",
+ "task": "sub",
+ "question": "Modify the molecule O=NC=C(c1ccccc1)c1c(O)[nH]c2ncccc12 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=NC=C(c1ccccc1)c1c(O)[nH]c2ncccc12",
+ "ref_smiles": "O=NC=C(c1ccccc1)c1c(C(=O)[OH])[nH]c2ncccc12",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "033879d5-1f8a-42fa-b12a-996015454f70",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccc(C#N)cc1)C32.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccc(C#N)cc1)C32.",
+ "ref_smiles": "C=CCOC12Oc3ccc(Oc4cccc([N+](=O)[O-])c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC(C)(C)C)CC1N(C)C(=O)c1ccccc1)C32",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "a34bcff8-f392-46c8-ad93-60d2545a1033",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])CCc1cccc(C(F)(F)F)c1C(F)F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCc1cccc(C(F)(F)F)c1C(F)F",
+ "ref_smiles": "O=C([O-])CCc1cccc(C(F)(F)S)c1C(F)F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0fc07171-f991-48d1-bb6d-9c37fbfbc9df",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])C(O)(CSCc1ccccc1)CS(=O)(=O)c1cc(Cl)ccc1-c1ccccc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(O)(CSCc1ccccc1)CS(=O)(=O)c1cc(Cl)ccc1-c1ccccc1",
+ "ref_smiles": "O=C([O-])C(O)(CSCc1ccccc1)CS(=O)(=O)c1ccccc1-c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0062f874-8fd3-4086-85c1-fefb83bc0158",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2cccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCOCC5)c4C)CC3)c2C)cc1F by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2cccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCOCC5)c4C)CC3)c2C)cc1F",
+ "ref_smiles": "Cc1ccc(NC(=O)c2cccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cccc(C(=O)N5CCOCC5)c4C)CC3)c2C)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8ee0bfcb-e350-4d8b-a814-067dcdb43fea",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCOc1cccc(CNC(=O)C(C)Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cccc(CNC(=O)C(C)Cl)c1.",
+ "ref_smiles": "CCOc1cccc(CNC(=O)CC)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7c055d25-db98-49d3-9e79-d204e27f9960",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C(C)C(O)C(O)C(C)C1CCC2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(C)C(O)C(O)C(C)C1CCC2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C",
+ "ref_smiles": "CC(C)C(C)C(O)C(O)C(C)C1CC(O)C2C3CC(=O)C4CCC(O)CC4(C)C3CCC12C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4a360207-fb23-46c6-8988-6c9bc18e0cc9",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)cc1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)OCC2C(NC(=O)OCc3ccccc3)CCN2C(=O)OCc2ccccc2)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4481437c-5afa-4464-b72e-0d36074d18a3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C(=O)NCc2ccc(F)cc2)ccc1NC(=O)C(NC(=O)C1CC[NH+](CC(=O)Nc2ccc(Cl)c(C(=O)N3CCCCC3)c2)CC1)C(C)C with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)NCc2ccc(F)cc2)ccc1NC(=O)C(NC(=O)C1CC[NH+](CC(=O)Nc2ccc(Cl)c(C(=O)N3CCCCC3)c2)CC1)C(C)C",
+ "ref_smiles": "Cc1cc(C(=O)NCc2ccc(S)cc2)ccc1NC(=O)C(NC(=O)C1CC[NH+](CC(=O)Nc2ccc(Cl)c(C(=O)N3CCCCC3)c2)CC1)C(C)C",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "83a5c03f-18a6-4400-8fbe-9ccd7fbdd8dd",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)c1c(NC(=O)C2CCCN2S(=O)(=O)c2ccc(OC)cc2)sc2c1CCCCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1c(NC(=O)C2CCCN2S(=O)(=O)c2ccc(OC)cc2)sc2c1CCCCC2.",
+ "ref_smiles": "COC(=O)c1c(NC(=O)C2CCCN2S(=O)(=O)OC)sc2c1CCCCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "550a1038-90f2-448e-9fb3-13d1c1a9f6b7",
+ "task": "delete",
+ "question": "Modify the molecule c1ccc(N(c2ccccc2)c2ccc(C(c3ccc(-c4cccc(-c5ccccn5)n4)cc3)(c3ccc(-c4cccc(-c5ccccn5)n4)cc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1ccc(N(c2ccccc2)c2ccc(C(c3ccc(-c4cccc(-c5ccccn5)n4)cc3)(c3ccc(-c4cccc(-c5ccccn5)n4)cc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1",
+ "ref_smiles": "c1ccc(N(c2ccccc2)c2ccc(C(c3ccc(-c4cccc(-c5ccccn5)n4)cc3)(c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3cccc(-c4ccccn4)n3)cc2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d45853f9-8528-46cf-a397-49780e870c15",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)CC(=O)N1CC(NC(=O)OC(C)(C)C)CC(C(C)O)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(=O)N1CC(NC(=O)OC(C)(C)C)CC(C(C)O)C1",
+ "ref_smiles": "CC(=O)C(C)C1CC(NC(=O)OC(C)(C)C)CN(C(=O)CC(C)C)C1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0a6d116a-a89d-441f-8d73-9869f0faca8e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCOC(=O)C(CC)NP(=O)(COCCn1cnc2c(NC3CC3)nc(N)nc21)Oc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOC(=O)C(CC)NP(=O)(COCCn1cnc2c(NC3CC3)nc(N)nc21)Oc1ccccc1.",
+ "ref_smiles": "CCCCOC(=O)C(CC)NP(=O)(COCCn1cnc2c(NC3CC3)ncnc21)Oc1ccccc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "ea088875-6ee1-4b89-b578-eb8c3793a8c5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cn1cnc2ccc(Cl)cc2c1=O)c1ccc(Cl)cc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1cnc2ccc(Cl)cc2c1=O)c1ccc(Cl)cc1Cl",
+ "ref_smiles": "O=C([OH])c1ccc2ncn(CC(=O)c3ccc(Cl)cc3Cl)c(=O)c2c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9da857f4-467c-4f06-aab1-da31e34dfd1d",
+ "task": "add",
+ "question": "Please add a amine to the molecule Fc1ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c2c1.",
+ "ref_smiles": "Nc1c(F)ccc2nc(CCCl)n(-c3c(F)cccc3Cl)c12",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e607443a-7d31-4dbd-9ecc-f2e19b34a8ca",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])c1ccc(Br)cc1SCCc1cccs1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(Br)cc1SCCc1cccs1",
+ "ref_smiles": "O=CCc1cc(C(=O)[O-])c(SCCc2cccs2)cc1Br",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "c3864c2d-417d-45b3-8e47-74ce345e477f",
+ "task": "add",
+ "question": "Modify the molecule CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCC",
+ "ref_smiles": "CCOP(=O)(COCOn1cnc2c(N)ncnc21)OCCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "18f1156a-8d46-49c0-85dd-30a16f55a717",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCN(CCC)C(=O)CN(c1ccc(OC)cc1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCC)C(=O)CN(c1ccc(OC)cc1)S(C)(=O)=O.",
+ "ref_smiles": "CCCN(CCC)C(=O)CN(OC)S(C)(=O)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "afa7bf72-efbf-46bf-b723-95aa82d0e534",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(C(=O)CCOCC(F)F)c1ccc(C[NH3+])cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)CCOCC(F)F)c1ccc(C[NH3+])cc1",
+ "ref_smiles": "CN(C(=O)CCOCC=O)c1ccc(C[NH3+])cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8c30d79-b35a-486c-95b7-433c4cc3efdd",
+ "task": "sub",
+ "question": "Modify the molecule CCC(NC(=O)c1ccc(C(=O)NC(CCc2c[nH]c3ccccc23)C(=O)[O-])c(Cl)c1)c1cccc(O)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NC(=O)c1ccc(C(=O)NC(CCc2c[nH]c3ccccc23)C(=O)[O-])c(Cl)c1)c1cccc(O)c1",
+ "ref_smiles": "CCC(NC(=O)c1ccc(C(=O)NC(CCc2c[nH]c3ccccc23)C(=O)[O-])c(S)c1)c1cccc(O)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "11fe6b3b-aa66-437b-9575-c7c9c71118f6",
+ "task": "delete",
+ "question": "Modify the molecule COC(CC1CCCC1O)C(F)(F)F by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(CC1CCCC1O)C(F)(F)F",
+ "ref_smiles": "COC(CC1CCCC1)C(F)(F)F",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e5bd5959-824b-4bbd-b5ec-492f631a165b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]C(Cc1ccncc1Cl)c1ccc(I)c(Cl)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(Cc1ccncc1Cl)c1ccc(I)c(Cl)c1",
+ "ref_smiles": "[NH3+]C(Cc1ccncc1C(=O)O)c1ccc(I)c(Cl)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "64b28a72-8d05-4bc4-8512-211d55b5b163",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC([NH3+])(CS(=O)(=O)c1ccc(Cl)s1)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])(CS(=O)(=O)c1ccc(Cl)s1)C(=O)[O-]",
+ "ref_smiles": "CC([NH3+])(CS(=O)(=O)c1ccc(S)s1)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "65f6ab35-7985-47b5-97dd-7a18f353ebaa",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule NC(=[NH+]O)c1nccn1-c1nncs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)c1nccn1-c1nncs1.",
+ "ref_smiles": "NC(=[NH+]O)c1nccn1-c1nnc(C(=O)O)s1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "876f9ea7-456b-414c-b058-e7089e90ece5",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCc1cc(=O)nc(SCc2csc(N(C(C)=O)c3ccc(CC)cc3)n2)[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(=O)nc(SCc2csc(N(C(C)=O)c3ccc(CC)cc3)n2)[nH]1.",
+ "ref_smiles": "CCCc1cc(=O)nc(SCc2csc(-c3ccc(CC)cc3)n2)[nH]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3ba532f2-d991-4a22-ae72-8a5504319c6b",
+ "task": "add",
+ "question": "Modify the molecule CC1CCC(C(C)(C)Cc2ccc(F)c(Cl)c2)C(=O)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(C(C)(C)Cc2ccc(F)c(Cl)c2)C(=O)C1",
+ "ref_smiles": "CC1CCC(C(C)(C)Cc2cc(O)c(F)c(Cl)c2)C(=O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "94a94f41-fa51-4237-8190-566c5f354927",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCn1c(SCC(=O)Nc2ccc(F)cc2)nnc1-c1cc2cc(Cl)ccc2o1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(SCC(=O)Nc2ccc(F)cc2)nnc1-c1cc2cc(Cl)ccc2o1",
+ "ref_smiles": "CCn1c(SCC(=O)Nc2ccc(C#N)cc2)nnc1-c1cc2cc(Cl)ccc2o1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c4d2332c-73ad-4ec2-a2f6-5a4d17faf7d3",
+ "task": "sub",
+ "question": "Modify the molecule CCNc1ncc(Cl)c(N(CCC#N)CCOC)n1 by substituting a nitrile with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1ncc(Cl)c(N(CCC#N)CCOC)n1",
+ "ref_smiles": "CCNc1ncc(Cl)c(N(CCI)CCOC)n1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "edc25784-73c0-433f-b9f3-2b4824ee77d1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1c(Cl)ncnc1N(C)Cc1ccsc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1c(Cl)ncnc1N(C)Cc1ccsc1",
+ "ref_smiles": "CCc1c(C#N)ncnc1N(C)Cc1ccsc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e6383770-ba74-4df4-95b7-c8e1c203f95a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC[NH2+]C(c1cccc(OC)c1F)C1CCCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1cccc(OC)c1F)C1CCCCCC1.",
+ "ref_smiles": "CCC[NH2+]C(F)(OC)C1CCCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "062e28ca-0389-445e-916b-930ce1900f26",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cccc(Cl)c3)c12)c1ccc(OCO)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cccc(Cl)c3)c12)c1ccc(OCO)cc1.",
+ "ref_smiles": "CC(NC(=O)c1cc(Cl)cc2ncn(Cc3cc(Cl)ccc3N)c12)c1ccc(OCO)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "7c70b8a7-764b-4305-9248-bb81474d7c5b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1cc(OC2CC(C(=O)NC3(C(=O)[N-]S(=O)(=O)OC4(C)CC4)CC3CC)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2)c2cccc(Cl)c2n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(OC2CC(C(=O)NC3(C(=O)[N-]S(=O)(=O)OC4(C)CC4)CC3CC)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2)c2cccc(Cl)c2n1",
+ "ref_smiles": "CCOc1cc(OC2CC(C(=O)NC3(C(=O)[N-]S(=O)(=O)OC4(C)CC4)CC3CC)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C)C2)c2cccc(NO)c2n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "10db4873-f27e-4905-80f3-65304a7f039c",
+ "task": "add",
+ "question": "Modify the molecule CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1C",
+ "ref_smiles": "CNc1c(C)nc(N2CC3C4C=CC(CC4)C3C2)nc1Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "188977ac-0c8c-42f1-a09b-d8f5ecc19bb7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1nn2c(=O)cc(CSCC(=O)Nc3ccc(Cl)cc3)nc2s1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nn2c(=O)cc(CSCC(=O)Nc3ccc(Cl)cc3)nc2s1",
+ "ref_smiles": "CCc1nn2c(=O)cc(CSCC(=O)Nc3ccc(CHO)cc3)nc2s1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "aa8b4b51-60cc-46b8-9a65-d0ad119f6181",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])NC1CCC(NC(=O)c2cccnc2Oc2ccc(F)cc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])NC1CCC(NC(=O)c2cccnc2Oc2ccc(F)cc2)CC1.",
+ "ref_smiles": "O=C([O-])NC1CCC(NC(=O)c2cccnc2Oc2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2f7ef51e-45a2-46b4-b64b-6650265af963",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(C(F)F)C1CCCCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(C(F)F)C1CCCCC1",
+ "ref_smiles": "NC(C(O)F)C1CCCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2b5334f8-4297-4fe8-99ec-4f1813489889",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CCCN1C(=O)CNC(=O)C[NH3+] by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCCN1C(=O)CNC(=O)C[NH3+]",
+ "ref_smiles": "CC1(C)CCCN1C(=O)C[NH3+]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "4deaeb98-1685-447f-a999-595da0e57a11",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(CC(=O)N2CC[NH+](CCc3ccc4c(=O)occc4c3)CC2)c(F)cc1C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CC(=O)N2CC[NH+](CCc3ccc4c(=O)occc4c3)CC2)c(F)cc1C",
+ "ref_smiles": "COc1cc(CC(=O)N2CC[NH+](CCc3ccc4c(=O)occc4c3)CC2)c(C(=O)[OH])cc1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7600e431-10ed-4b89-a48c-523fb712344f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC(=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cc2ccccc2oc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1cc2ccccc2oc1=O.",
+ "ref_smiles": "CCOC(=C[P+](c1ccccc1)c1ccccc1)c1cc2ccccc2oc1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0762b297-f847-4d34-a366-ade950ff6440",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2cncc(Nc3ccccc3C#N)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2cncc(Nc3ccccc3C#N)c2)cc1.",
+ "ref_smiles": "Cc1ccc(NC(=O)c2cncc(Nc3c(C#N)cccc3-c3ccccc3)c2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f96eca22-61fc-47e1-9b22-2f9f43768cc9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(c1cccs1)n1c(CCl)nc2cccnc21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1cccs1)n1c(CCl)nc2cccnc21",
+ "ref_smiles": "CCC(c1cccs1)n1c(CS)nc2cccnc21",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "db876724-2511-4017-a4d8-04266e24e0f5",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCC1C(=O)NC(C)(CC)C(=O)N1CCC(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1C(=O)NC(C)(CC)C(=O)N1CCC(F)(F)F.",
+ "ref_smiles": "CCCC1C(=O)NC(C)(CC)C(=O)N1CCC(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3101ac85-03ea-4d1e-a761-ef178a8693bd",
+ "task": "delete",
+ "question": "Modify the molecule CCn1nccc1NC(=O)C1CCCN1S(=O)(=O)c1c[nH+]c2n1C(C)(Cc1ccc(-c3cncnc3)cc1)C(=O)N2c1cc(Cl)cc(Cl)c1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nccc1NC(=O)C1CCCN1S(=O)(=O)c1c[nH+]c2n1C(C)(Cc1ccc(-c3cncnc3)cc1)C(=O)N2c1cc(Cl)cc(Cl)c1",
+ "ref_smiles": "CCn1nccc1NC(=O)C1CCCN1S(=O)(=O)c1c[nH+]c(-c2cc(Cl)cc(Cl)c2)n1CCc1ccc(-c2cncnc2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "71b38056-6682-44f7-a914-7236a6dd809f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule OCc1nnn(-c2ccc(Cl)cc2)c1C1CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCc1nnn(-c2ccc(Cl)cc2)c1C1CCC1.",
+ "ref_smiles": "OCc1nnn(Cl)c1C1CCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a7cea8bb-67df-4709-9dd9-114b6be6bc8d",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(N2CCN(c3ncnc4c3cnn4CCNC(=O)C(C)(C)C)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N2CCN(c3ncnc4c3cnn4CCNC(=O)C(C)(C)C)CC2)cc1.",
+ "ref_smiles": "CCCCCn1ncc2c(N3CCN(c4ccc(OC)cc4)CC3)ncnc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "66432e76-2597-4e07-82cb-84899c5d2c42",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(C)N1C(=O)SC(=Cc2cc3c(cc2Cl)N(CC)C(C)(C)C=C3C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)N1C(=O)SC(=Cc2cc3c(cc2Cl)N(CC)C(C)(C)C=C3C)C1=O.",
+ "ref_smiles": "CCN1c2cc(Cl)c(CC(C)(CC)C(=O)S)cc2C(C)=CC1(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c0450804-ed11-4ebb-a8fb-1e17b545de99",
+ "task": "delete",
+ "question": "Modify the molecule CSCCC(NC(=O)C([NH3+])CC(C)C)C(=O)NC(C(=O)NC(CCCC[NH3+])C(=O)[O-])C(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)C([NH3+])CC(C)C)C(=O)NC(C(=O)NC(CCCC[NH3+])C(=O)[O-])C(C)C",
+ "ref_smiles": "CSCC(NC(=O)C([NH3+])CC(C)C)C(C(=O)NC(CCCC[NH3+])C(=O)[O-])C(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "89597c3a-feaf-43cc-ad10-9c63ab211f05",
+ "task": "add",
+ "question": "Modify the molecule ClC(Cc1nc2ccccc2o1)C1CCCO1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "ClC(Cc1nc2ccccc2o1)C1CCCO1",
+ "ref_smiles": "OC1CCC(C(Cl)Cc2nc3ccccc3o2)O1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9bc10273-0a33-4c50-9055-7bb8d5a50b2e",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CN(c1nc(NN)ncc1Br)C1CCCC1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CN(c1nc(NN)ncc1Br)C1CCCC1",
+ "ref_smiles": "CC(C)CN(c1nc(NN)ncc1S)C1CCCC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4fc31af1-f0ee-4fdf-8de2-0c4cc8aeba9a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC1CCC([NH+](CC(N)=O)Cc2ccccc2N)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC([NH+](CC(N)=O)Cc2ccccc2N)CC1.",
+ "ref_smiles": "CCC1CCC([NH+]Cc2ccccc2N)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2442a2a9-d789-49cc-9884-1240d642ac4a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(CN(C)CCl)c(C)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CN(C)CCl)c(C)c1C.",
+ "ref_smiles": "Cc1c(CN(C)CCl)ccc(OCc2ccccc2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b4d8d5c8-fae7-41b7-9ff2-1faa4c35b5f9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C([O-])CCc1cc(-c2ccccc2)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCc1cc(-c2ccccc2)ccc1Cl.",
+ "ref_smiles": "O=C([O-])C(Cc1cc(-c2ccccc2)ccc1Cl)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "59d170ac-3815-4778-8823-6759eae07a31",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CCc1[nH]nc(N)c1-c1cccc(Cl)c1F by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCc1[nH]nc(N)c1-c1cccc(Cl)c1F",
+ "ref_smiles": "CC(C)CCc1[nH]nc(N)c1-c1cccc(O)c1F",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5269099b-7e30-4010-8cd5-f59131d78bad",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Oc1ccc(Br)cc1C=Nn1c(COc2ccccc2)n[nH]c1=S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1ccc(Br)cc1C=Nn1c(COc2ccccc2)n[nH]c1=S.",
+ "ref_smiles": "S=c1[nH]nc(COc2ccccc2)n1N=Cc1cccc(Br)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2d0c8b0d-66df-4315-b724-1534b21e8f20",
+ "task": "delete",
+ "question": "Modify the molecule CS(=O)(=O)N1CCN(C(=O)Nc2ccc(Oc3ccccc3)cc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N1CCN(C(=O)Nc2ccc(Oc3ccccc3)cc2)CC1",
+ "ref_smiles": "CS(=O)(=O)N1CCN(C(=O)NOc2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4dd80fe5-37bc-43bd-a0b3-a6fd40af4afe",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1",
+ "ref_smiles": "O=C([O-])CN(CC[NH+]1CCOCC1)c1ccc(Cl)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3adfaabd-b64d-4bb2-b07b-457ba6334e01",
+ "task": "sub",
+ "question": "Modify the molecule C=C(Nc1c(C=N)nc(Nc2ccc(F)cc2F)n1C1CCC(O)CC1)[NH2+]C(C)(C)C by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(Nc1c(C=N)nc(Nc2ccc(F)cc2F)n1C1CCC(O)CC1)[NH2+]C(C)(C)C",
+ "ref_smiles": "CC(=O)c1ccc(Nc2nc(C=N)c(NC(=C)[NH2+]C(C)(C)C)n2C2CCC(O)CC2)c(F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8d2dffa4-3ea6-40b9-a34d-a549bf1b7144",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)Oc1cccc(C(Cl)Cc2ccccc2F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1cccc(C(Cl)Cc2ccccc2F)c1.",
+ "ref_smiles": "CC(C)Oc1ccc(C(=O)O)c(C(Cl)Cc2ccccc2F)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "523fa3f4-03fa-40a3-9e7b-f87e58517e83",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2C)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2C)n1.",
+ "ref_smiles": "CCC[NH2+]C(C)c1csc(NC(=O)C2OCCC2(C)C(=O)O)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "70928abf-a580-4ce3-be68-06b741343f0e",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(NC(=O)CC(=O)NC(C)C1(O)CCCC1)C1(O)CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)CC(=O)NC(C)C1(O)CCCC1)C1(O)CCCC1.",
+ "ref_smiles": "CC(NC(=O)CC(=O)NC(C)(N)C1(O)CCCC1)C1(O)CCCC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "f4560c39-e400-453b-b98f-195a1fbf366e",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C1CCCCN1c1cc[nH+]c(Cl)c1N by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1CCCCN1c1cc[nH+]c(Cl)c1N",
+ "ref_smiles": "CC(C)(C)C1CCCCN1c1cc[nH+]cc1N",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a0bc05e9-982b-4227-8197-c2138e475840",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(C=NNC(=O)Cc2cccs2)ccc1OCc1ccc(Cl)c(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C=NNC(=O)Cc2cccs2)ccc1OCc1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "COc1cc(C=NNC(=O)Cc2cccs2)ccc1OCc1ccc(Cl)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "75f6b01a-d469-44a3-8b1d-f59138ece235",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)c1ccc(Cc2ccc3ccccc3n2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(Cc2ccc3ccccc3n2)cc1",
+ "ref_smiles": "CC(=O)c1ccc(Cc2ccc3c(-c4ccccc4)cccc3n2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eb7d6485-c9dc-4e80-8399-f38333835c37",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccccc1C=CCC(C)(C(C)=O)C(=O)OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C=CCC(C)(C(C)=O)C(=O)OC(C)(C)C.",
+ "ref_smiles": "COC=CCC(C)(C(C)=O)C(=O)OC(C)(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fd2187d4-9220-40d8-98f3-a96f98ce8fe8",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1cccnc1NC(C)c1cn[nH]c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cccnc1NC(C)c1cn[nH]c1",
+ "ref_smiles": "CCOC(=O)c1cccnc1C(C)c1cn[nH]c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "eefcf130-cda9-427e-bc7c-fef612705340",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(c1n[nH]c(C2CC2)c1Cl)N1CCc2n[nH]c(=O)cc2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1n[nH]c(C2CC2)c1Cl)N1CCc2n[nH]c(=O)cc2C1.",
+ "ref_smiles": "O=c1cc2c(n[nH]1)CC(n1[nH]c(C3CC3)c-1Cl)C2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "bbb6990a-1b47-4720-94cb-82404d8f454a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cn1ccnc1CN1CCCc2cc(C(=O)[O-])ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ccnc1CN1CCCc2cc(C(=O)[O-])ccc21.",
+ "ref_smiles": "Cn1ccnc1CN1CCCc2c1ccc(C(=O)[O-])c2C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "de13e7ba-425c-4e35-a55a-92728d2ad4d4",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CN1C(=O)C2C3CCC(O3)C2C1=O)NCC1CCCCCCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN1C(=O)C2C3CCC(O3)C2C1=O)NCC1CCCCCCC1",
+ "ref_smiles": "O=C(CC1C(=O)C2CCC1O2)NCC1CCCCCCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "533fd0cf-d9fb-424b-9e83-e7b18b23d3e2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C2CC(=O)N(CC(=O)N(C)c3cccc(F)c3)C2)cc1OC1CCCO1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2CC(=O)N(CC(=O)N(C)c3cccc(F)c3)C2)cc1OC1CCCO1",
+ "ref_smiles": "COc1ccc(C2CC(=O)N(CC(=O)N(C)c3cccc(C=O)c3)C2)cc1OC1CCCO1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "edeb6325-765e-454e-88ce-79c61e0c5ec9",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C1(C(=O)OCC)C=C(C(=O)OC)C[NH2+]1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1(C(=O)OCC)C=C(C(=O)OC)C[NH2+]1",
+ "ref_smiles": "CCOC(=O)C1(C(=O)OCC)[NH2+]CC(C(=O)OC)=C1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bd8f38a2-99dc-4165-98bb-81697b768232",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=[N+]([O-])c1ccc(CC(Br)c2cccc(I)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1ccc(CC(Br)c2cccc(I)c2)cc1.",
+ "ref_smiles": "O=[N+]([O-])c1ccc(CCc2cccc(I)c2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "960b5f33-5a9a-4336-aff2-89bb49ce4243",
+ "task": "add",
+ "question": "Modify the molecule COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1",
+ "ref_smiles": "COc1cccc(CC(=O)c2ccc(F)c(F)c2Br)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "aa76ef9c-d5b1-494f-b190-8c2d013b723a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(c1ccccc1Cl)N(Cc1ccc(F)cc1)C(c1ccccc1)c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccccc1Cl)N(Cc1ccc(F)cc1)C(c1ccccc1)c1ccccc1",
+ "ref_smiles": "O=C(c1ccccc1S)N(Cc1ccc(F)cc1)C(c1ccccc1)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d31c5247-bd46-4774-a7df-9b2c56816672",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1nn(C)c(CN(CC2CCCC[NH2+]2)C(C)C)c1Br with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nn(C)c(CN(CC2CCCC[NH2+]2)C(C)C)c1Br",
+ "ref_smiles": "CC(=O)c1c(CC)nn(C)c1CN(CC1CCCC[NH2+]1)C(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e23c216e-9713-45ae-a411-ee85b4a2c2f3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCc1ccc(-c2cc(C3(O)CCC4(CC3)OCCO4)nn2-c2ccc(OC)cc2)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2cc(C3(O)CCC4(CC3)OCCO4)nn2-c2ccc(OC)cc2)cc1",
+ "ref_smiles": "CCc1ccc(-c2cc(C3(Cl)CCC4(CC3)OCCO4)nn2-c2ccc(OC)cc2)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a8d11116-e8b9-4516-8a5f-f180b1c21300",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2)cc1.",
+ "ref_smiles": "COc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)[nH+]3)CC2O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7baf25d5-2633-4632-bdaa-8251185d199d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCc1cc(C(C)C)c(CC(C)C)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(C(C)C)c(CC(C)C)c(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1.",
+ "ref_smiles": "CCCc1c(-c2ccccc2)c(C(C)C)c(CC(C)C)c(OC(=O)c3ccccc3)c1OC(=O)c4ccccc4",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "19c7f7f8-842f-48c1-9630-223945b44c0a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCCCCCc1cnc(-c2ccc(C(C)(C(=O)[O-])C(Cl)CC)cc2)nc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCc1cnc(-c2ccc(C(C)(C(=O)[O-])C(Cl)CC)cc2)nc1",
+ "ref_smiles": "CCCCCCCCCCc1cnc(-c2ccc(C(C)(C(=O)[O-])C(O)CC)cc2)nc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4f2490fe-99f1-41e4-8866-26f947067d8e",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCOc1ccc(C=C(C#N)C(=O)Nc2cccc3ccccc23)cc1Br with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C=C(C#N)C(=O)Nc2cccc3ccccc23)cc1Br",
+ "ref_smiles": "CCOc1ccc(C=C([N+](=O)[O-])C(=O)Nc2cccc3ccccc23)cc1Br",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "f89e4482-85c8-49f0-85c4-84ab174eb443",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule NC(=O)c1[nH]nc(-c2ccccc2)c1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1[nH]nc(-c2ccccc2)c1Br.",
+ "ref_smiles": "NC(=O)c1[nH]ncc1Br",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "cf511a7a-4c5d-4595-915d-bf36c28e3ef6",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule OCCCC[NH2+]CC(O)c1ccc(F)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCCC[NH2+]CC(O)c1ccc(F)c(F)c1.",
+ "ref_smiles": "OCCCC[NH2+]CCc1ccc(F)c(F)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9c5973f6-12c5-4e3e-88a7-1dd35c192af9",
+ "task": "sub",
+ "question": "Modify the molecule Nc1nccc(C(=O)Nc2ccc(Br)cc2Br)c1F by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nccc(C(=O)Nc2ccc(Br)cc2Br)c1F",
+ "ref_smiles": "Nc1nccc(C(=O)Nc2ccc(S)cc2Br)c1F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dd6c15bd-7110-4f5b-b573-5188face7e44",
+ "task": "sub",
+ "question": "Modify the molecule Cn1nccc1C1OCCC1C(=O)N1CCN(CC(F)(F)F)c2ccccc21 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nccc1C1OCCC1C(=O)N1CCN(CC(F)(F)F)c2ccccc21",
+ "ref_smiles": "Cn1nccc1C1OCCC1C(=O)N1CCN(CC(F)(F)S)c2ccccc21",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c4873ebb-e134-47f9-8461-bd5d6c50db89",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1c(S(=O)(=O)Cl)cc(C(F)F)nc1Br with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(S(=O)(=O)Cl)cc(C(F)F)nc1Br",
+ "ref_smiles": "COc1c(S(=O)(=O)C(=O)[OH])cc(C(F)F)nc1Br",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "44feaf94-6fb8-48a2-ad1b-3ce5c4eebebf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)C2CCN(c3ncccn3)CC2)n(-c2cc(C(F)(F)F)ccc2Cl)n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)C2CCN(c3ncccn3)CC2)n(-c2cc(C(F)(F)F)ccc2Cl)n1",
+ "ref_smiles": "Cc1cc(NC(=O)C2CCN(c3ncccn3)CC2)n(-c2cc(C(F)(F)S)ccc2Cl)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "54b29599-99b6-483c-957b-3c0054d415bf",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#CCC(=O)NCc1ccc(Cl)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCC(=O)NCc1ccc(Cl)cc1Cl.",
+ "ref_smiles": "N#CCC(=O)NCc1c(Cl)cc(Cl)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7bd4a07e-d7f2-4e05-b2f1-4024cac8f160",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Clc1ccnc(=CI)c1=CC=[V].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccnc(=CI)c1=CC=[V].",
+ "ref_smiles": "c1ccnc(=CH)c1=CC=[V]",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "15a9dc37-4d19-4658-b9c3-35cf70360f88",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CC(O)(CN1CCc2ccc(F)cc21)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CC(O)(CN1CCc2ccc(F)cc21)c1ccccc1",
+ "ref_smiles": "[NH3+]C(c1ccccc1)C(O)(CN1CCc2ccc(F)cc21)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fb44c0b4-9082-429f-bd8f-c8a451222fef",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCc1ccc(CC)c2cc(Cl)ncc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(CC)c2cc(Cl)ncc12.",
+ "ref_smiles": "CCc1ccc(CC)c2cnccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "31fbb04e-7d24-423f-be2a-258d818203f8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C2CS(=O)CCC(C)N2)cc1F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2CS(=O)CCC(C)N2)cc1F",
+ "ref_smiles": "Cc1ccc(C2CS(=O)CCC(C)N2)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3ca3c03f-fd8e-4ee1-92db-cfae66d86ab5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1nc(C(N)=O)sc1-c1cccc(C(C)(C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C(N)=O)sc1-c1cccc(C(C)(C)C)c1.",
+ "ref_smiles": "Cc1nc(C(N)=O)sc1-c1cc(C(C)(C)C)ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "641288d1-b2a3-4fc5-9cf1-99bc9e26ff7e",
+ "task": "delete",
+ "question": "Modify the molecule CCc1ccccc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)c(F)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1Nc1nc(=O)c(OC)cn1Cc1ccc(F)c(F)c1",
+ "ref_smiles": "CCc1ccccc1Nc1nc(=O)c(OC)cn1Cc1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "22b9e4af-7c03-4637-a161-837fe9b635ba",
+ "task": "add",
+ "question": "Modify the molecule NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1",
+ "ref_smiles": "NP(OCCCCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCSC(c1ccccc1)(c1ccccc1)c1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "86b9744f-2ca0-4233-8a40-b70f244cc25a",
+ "task": "delete",
+ "question": "Modify the molecule CCCC(CC#N)c1ccc(F)c(C)c1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(CC#N)c1ccc(F)c(C)c1",
+ "ref_smiles": "CCCC(C)c1ccc(F)c(C)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "dd578ed8-1748-4719-8504-d1a822c0a312",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)C1=CC(c2ccccc2)C(C#N)(C#N)C(C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1=CC(c2ccccc2)C(C#N)(C#N)C(C)C1.",
+ "ref_smiles": "CC(C)C1=C(c2ccccc2)C(c2ccccc2)C(C#N)(C#N)C(C)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "15ec5757-20da-4b8d-b750-0fdc12dab432",
+ "task": "add",
+ "question": "Modify the molecule CCC(O)CC(=O)OC(CC)C(C=C(C)C=CC(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)COC1OC(C)CC(OC)C1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)CC(=O)OC(CC)C(C=C(C)C=CC(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)COC1OC(C)CC(OC)C1OC",
+ "ref_smiles": "CCC(O)CC(=O)OC(CC)C(C=C(C)C=C(C(=O)C(C)CC(C)COC1OC(C)C(O)C([NH+](C)C)C1O)c1ccccc1)COC1OC(C)CC(OC)C1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "da8618aa-e598-430d-8196-7ff0e832f740",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)[O-])c1I",
+ "ref_smiles": "CCCCCCC(=O)Nc1c(S)c(NC(C)=O)c(I)c(C(=O)[O-])c1I",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2ab82a16-e71b-4f60-9cba-58314a3973c6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(OO)c1cnc2cccc(Br)c2n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OO)c1cnc2cccc(Br)c2n1",
+ "ref_smiles": "ONc1cccc2ncc(C(=O)OO)nc12",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "57b8b5e5-0572-4dda-9c95-d4dc209d3d26",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule NOCCc1cc2c(cc1O)OCO2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NOCCc1cc2c(cc1O)OCO2.",
+ "ref_smiles": "NOCCc1cc2c(cc1O)OC(c1ccccc1)O2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ee0fa5c8-8ed6-431c-93d3-038f751b0828",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)[NH+](CCCO)Cc1cc(=O)n2ccccc2n1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH+](CCCO)Cc1cc(=O)n2ccccc2n1",
+ "ref_smiles": "CCC[NH+](Cc1cc(=O)n2ccccc2n1)C(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a19c06b5-b0bc-4dee-a36f-562f138ea930",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)c1ccc(F)cc1OCC(C)(C)C[NH+]1CCC2(CC1)Cc1cc(Cl)ccc1O2 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(F)cc1OCC(C)(C)C[NH+]1CCC2(CC1)Cc1cc(Cl)ccc1O2",
+ "ref_smiles": "COC(=O)c1ccc(C#N)cc1OCC(C)(C)C[NH+]1CCC2(CC1)Cc1cc(Cl)ccc1O2",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fc527202-8e84-4aab-83c3-97211061ccf3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C)n(CCNC(=O)c2cc3ccc(Cl)cc3n2C)n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(CCNC(=O)c2cc3ccc(Cl)cc3n2C)n1",
+ "ref_smiles": "Cc1cc(C)n(CCNC(=O)c2cc3ccc([N+](=O)[O-])cc3n2C)n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4a3da17d-6436-4bfd-82a2-48c984f4e2b6",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1ccc(NCCOC)cc1Cl by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NCCOC)cc1Cl",
+ "ref_smiles": "CCOc1ccc(NCCOC)cc1C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f59097eb-6e55-4330-a077-a1b2727132e8",
+ "task": "add",
+ "question": "Modify the molecule Cn1cc(CC[NH+](C)CC2(O)CCOCC2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(CC[NH+](C)CC2(O)CCOCC2)cn1",
+ "ref_smiles": "Cn1cc(CC(O)[NH+](C)CC2(O)CCOCC2)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5c698eb7-24ad-4572-8dc6-9adc01b21b9f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCNC(=O)Cn1ncn2nc(-c3cccs3)cc2c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)Cn1ncn2nc(-c3cccs3)cc2c1=O.",
+ "ref_smiles": "CCCn1ncn2nc(-c3cccs3)cc2c1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "cf01ea83-ace4-4653-b394-545d3aedb2b2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(F)cc1NC(=O)NCCC[NH+](C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(F)cc1NC(=O)NCCC[NH+](C)C",
+ "ref_smiles": "Cc1ccc(NO)cc1NC(=O)NCCC[NH+](C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8aad6905-e654-4df1-9e0f-b5c120ff0675",
+ "task": "sub",
+ "question": "Modify the molecule CCC(=O)C(C(=O)CC)C(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)C(C(=O)CC)C(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1",
+ "ref_smiles": "CCC(=O)C(C(=O)CC)C(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)C#N)cc2Cl)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2b1f412e-5903-4fce-9c9e-51f57ef01631",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(C(=O)NC(C)C)cc3)C(C)C)CC2)cccc1C(=O)Nc1ccc(F)cc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(C(=O)NC(C)C)cc3)C(C)C)CC2)cccc1C(=O)Nc1ccc(F)cc1",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(C(=O)NC(C)C)cc3)C(C)C)CC2)cccc1C(=O)Nc1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a2495e0b-8b74-4ca7-b798-9c0f85cf7be7",
+ "task": "add",
+ "question": "Please add a amine to the molecule O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)C12CC3CC(CC(C3)C1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCCn1nc(C(F)(F)F)cc1C1CC1)C12CC3CC(CC(C3)C1)C2.",
+ "ref_smiles": "NC1C2CC3CC1CC(C(=O)NCCCn1nc(C(F)(F)F)cc1C1CC1)(C3)C2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "6ba2db22-6353-414d-97bd-1dabcda55b24",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cn(-c2cc(NC(=O)c3ccc(C)c(Nc4cc(-c5cccnc5)ccn4)c3)cc(C(F)(F)F)c2)cn1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cn(-c2cc(NC(=O)c3ccc(C)c(Nc4cc(-c5cccnc5)ccn4)c3)cc(C(F)(F)F)c2)cn1",
+ "ref_smiles": "Cc1cn(-c2cc(NC(=O)N(C)c3cc(-c4cccnc4)ccn3)cc(C(F)(F)F)c2)cn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "75283fa8-c9f6-4987-a81c-1a5cd8b9870b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1.",
+ "ref_smiles": "CC(C)COC1CC[NH+](Cc2cccc3c2OC(C)(C)C3)CC1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f0f4a500-4f24-4520-a9ff-f585adac89a1",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C=C(OC(=O)C(F)(F)F)c1c(OC(=O)C(F)(F)F)cccc1OC(=O)C(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(OC(=O)C(F)(F)F)c1c(OC(=O)C(F)(F)F)cccc1OC(=O)C(F)(F)F.",
+ "ref_smiles": "C=C(OC(=O)C(F)(F)F)c1c(OC(=O)C(F)F)cccc1OC(=O)C(F)(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "19553580-3011-48df-8b3a-52b81ef65a9b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1cccc(Cl)c1N1CCOCC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCNC(=O)c1ccc(Cl)cc1)Nc1cccc(Cl)c1N1CCOCC1",
+ "ref_smiles": "N#Cc1ccc(C(=O)NCCCC(=O)Nc2cccc(Cl)c2N2CCOCC2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1eff4c90-ac94-4b09-9f38-3269abd5fb67",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Nc1cc(-c2ccc(Br)o2)no1)c1ccoc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cc(-c2ccc(Br)o2)no1)c1ccoc1",
+ "ref_smiles": "ONc1ccc(-c2cc(NC(=O)c3ccoc3)on2)o1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4f9486bf-a2eb-4524-9014-e5295588d32b",
+ "task": "sub",
+ "question": "Modify the molecule CC1C2=CNN(c3ccc(F)cc3)C2=CC2=C1C(C(=O)N1CCC(S(=O)(=O)c3ccccc3)CC1)CC2 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C2=CNN(c3ccc(F)cc3)C2=CC2=C1C(C(=O)N1CCC(S(=O)(=O)c3ccccc3)CC1)CC2",
+ "ref_smiles": "CC1C2=CNN(c3ccc(O)cc3)C2=CC2=C1C(C(=O)N1CCC(S(=O)(=O)c3ccccc3)CC1)CC2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b659d0ac-1c0a-42c8-8085-d96da09a7ef6",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)C(=O)OCCCC1([Si](C)(C)C)CCC[Si]([Si](C)(C)C)([Si](C)(C)C)O1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OCCCC1([Si](C)(C)C)CCC[Si]([Si](C)(C)C)([Si](C)(C)C)O1",
+ "ref_smiles": "C=C(C)C(=O)OCCCC1([Si](C)(C)C)CC(O)C[Si]([Si](C)(C)C)([Si](C)(C)C)O1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7de165ab-5f8b-4d82-9d4e-c0aca4b6e65d",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1CCC[NH2+]CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1CCC[NH2+]CC1",
+ "ref_smiles": "O=C(c1ccc(Cl)cc1Cl)N(Cc1ccccn1)C1(C(=O)O)CCC[NH2+]CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "538e10ed-eb37-45d6-b065-f94abbc24849",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2)cc1.",
+ "ref_smiles": "CSc1ccc(C(C#N)N2CCC(C(=O)[O-])CC2CC=O)cc1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "952182de-d40b-4152-9745-99399979b81e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule NC(=[NH2+])c1ccc(OCCCCCCCCCCCCOc2ccc(C(N)=[NH2+])cc2Br)c(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH2+])c1ccc(OCCCCCCCCCCCCOc2ccc(C(N)=[NH2+])cc2Br)c(Br)c1.",
+ "ref_smiles": "NC(=[NH2+])c1ccc(OCCCCCCCCCCCCOc2ccc(C=[NH2+])cc2Br)c(Br)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "39580cc8-e0c6-4f49-99c0-f2194f71777f",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc2nc(NC(=O)CC(C)(CF)CF)n(C(C)(C)C)c2nc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc2nc(NC(=O)CC(C)(CF)CF)n(C(C)(C)C)c2nc1C.",
+ "ref_smiles": "Cc1nc2c(cc1Cc1ccccc1)nc(NC(=O)CC(C)(CF)CF)n2C(C)(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "711e8c13-7791-40b1-b153-f8238408762c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1CN(C(=O)Cn2cc(C(C)O)nn2)CC(C)O1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(C(=O)Cn2cc(C(C)O)nn2)CC(C)O1",
+ "ref_smiles": "CC1CN(C(=O)Cn2cc(C(C)S)nn2)CC(C)O1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0a0a277a-6f60-4f0c-8055-1b5b330a94ff",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)c1ccc(COc2ccc(C=C3C(=O)Nc4ccccc43)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(COc2ccc(C=C3C(=O)Nc4ccccc43)cc2)cc1.",
+ "ref_smiles": "COC(=O)COc1ccc(C=C2C(=O)Nc3ccccc32)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d11615b7-4f7b-4e48-a9e5-30170a26c124",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Nc1cccc2c1c(N)nc1ccccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cccc2c1c(N)nc1ccccc12.",
+ "ref_smiles": "Nc1nc2ccccc2c2ccccc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "67c0ac42-cc72-4585-a9b7-3ee2a8291d0a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCOc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1.",
+ "ref_smiles": "CC(O)COc1ccc(-c2cc(C(C(=O)OCCCOP(=O)([O-])[O-])n3cnc4c3C=CN(c3cccc(F)c3F)N4)on2)c(C(F)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7522a7cd-4951-49a6-a6e2-95da260ce6cf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1c(NC(=O)c2c(Br)c(C)nn2CC)c(-c2ccc3c(c2)OCO3)cn1C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(NC(=O)c2c(Br)c(C)nn2CC)c(-c2ccc3c(c2)OCO3)cn1C",
+ "ref_smiles": "CCOC(=O)c1c(NC(=O)c2c(C(=O)[OH])c(C)nn2CC)c(-c2ccc3c(c2)OCO3)cn1C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "35bf0bd8-b1f6-48d5-aa49-b305a32f2b6e",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ncccc1C[NH+]1CC2CCC1C2 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ncccc1C[NH+]1CC2CCC1C2",
+ "ref_smiles": "c1cncc(C[NH+]2CC3CCC2C3)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "38038977-5362-4a2f-a870-3d7d4176724f",
+ "task": "delete",
+ "question": "Modify the molecule CN(Cc1ccccc1OC(F)(F)F)C(=O)c1sccc1S(=O)(=O)N1CCSCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccccc1OC(F)(F)F)C(=O)c1sccc1S(=O)(=O)N1CCSCC1",
+ "ref_smiles": "CN(COC(F)(F)F)C(=O)c1sccc1S(=O)(=O)N1CCSCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "16dbb43a-3b7e-46e0-8706-97e2a37eac7d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1cccc(C(=O)Nc2ccccc2Oc2ccccc2Cl)c1)c1cccnc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cccc(C(=O)Nc2ccccc2Oc2ccccc2Cl)c1)c1cccnc1",
+ "ref_smiles": "O=C(Nc1cccc(C(=O)Nc2ccccc2Oc3ccc(C=O)cc3)c1)c1cccnc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0aa4fc5a-0176-4b3f-b58a-7d1f01ec0876",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC[NH2+]CC1CCCN1c1ncc(F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]CC1CCCN1c1ncc(F)cc1F.",
+ "ref_smiles": "O=C(O)CC[NH2+]CC1CCCN1c1ncc(F)cc1F",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1822de63-ee30-435c-9a3f-c19463733f96",
+ "task": "add",
+ "question": "Modify the molecule C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1",
+ "ref_smiles": "C=C(CC)CC(=O)C(C)(C)[NH+]1CCOCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f2f80fb2-51fe-4385-a7e2-9e39006cb6b5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC[NH+](Cc1ccnc(NN)c1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+](Cc1ccnc(NN)c1)C1CC1.",
+ "ref_smiles": "CCC[NH+](Cc1cc(O)nc(NN)c1)C1CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7efef1ee-0cf3-4864-9d8f-06cd1b71154a",
+ "task": "delete",
+ "question": "Modify the molecule CCCCc1noc(CSc2nc3c(cc2C#N)CCCC3)n1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCc1noc(CSc2nc3c(cc2C#N)CCCC3)n1",
+ "ref_smiles": "CCCCc1noc(CSc2ccc3c(n2)CCCC3)n1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "73196e20-d275-43c7-a911-0e47f625d10e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCC1N(Br)C=N[NH+]1C(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC1N(Br)C=N[NH+]1C(C)C",
+ "ref_smiles": "CCCCC1N(NO)C=N[NH+]1C(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6ba7ef8b-2a57-42f3-bdde-fc2984c1a223",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(CCC(F)(F)F)Cc1cc(F)cc(C[NH3+])c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCC(F)(F)F)Cc1cc(F)cc(C[NH3+])c1",
+ "ref_smiles": "CN(CCC(F)(F)S)Cc1cc(F)cc(C[NH3+])c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "74169ba7-8b40-49db-82bf-6bc0ff7b6203",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)C(=O)N1CCC(C(=O)NCC(=O)N2CCN(c3cccc(Cl)c3)CC2)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)N1CCC(C(=O)NCC(=O)N2CCN(c3cccc(Cl)c3)CC2)CC1",
+ "ref_smiles": "CN(C)C(=O)N1CCC(C(=O)NCC(=O)N2CCN(c3ccccc3)CC2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4f463e31-5c7f-4b1e-a5ca-34a4172eda53",
+ "task": "add",
+ "question": "Modify the molecule O=C(CCCN1CC[NH2+]CC1)C1CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCN1CC[NH2+]CC1)C1CCC1",
+ "ref_smiles": "O=C(CCCN1CC[NH2+]CC1)C1(c2ccccc2)CCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "af435425-ee2a-47a1-9dff-b0e25c7e9636",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CSCC1NC(=O)CC[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CSCC1NC(=O)CC[NH3+].",
+ "ref_smiles": "CC1CSC(c2ccccc2)C1NC(=O)CC[NH3+]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1c1e2761-29d0-4e93-886d-55f70ed5ea38",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOc1ccc(C2=C(O)C(=O)N(c3cccc(C)c3)C2c2coc3ccc(F)cc3c2=O)cc1OC with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3cccc(C)c3)C2c2coc3ccc(F)cc3c2=O)cc1OC",
+ "ref_smiles": "CCOc1ccc(C2=C(C(=O)[OH])C(=O)N(c3cccc(C)c3)C2c2coc3ccc(F)cc3c2=O)cc1OC",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d83f2c96-5c23-4076-b7d5-74f9743b2847",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCN(CC(=O)N(C)C)S(=O)(=O)C1CCCC1C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CC(=O)N(C)C)S(=O)(=O)C1CCCC1C(=O)[O-].",
+ "ref_smiles": "CCCN(CC)S(=O)(=O)C1CCCC1C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ccd74b09-cfec-4b55-ba5d-56089286ca70",
+ "task": "sub",
+ "question": "Modify the molecule Oc1cccc(-c2nc(-c3cc(Cl)cc(Cl)c3)no2)c1O by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1cccc(-c2nc(-c3cc(Cl)cc(Cl)c3)no2)c1O",
+ "ref_smiles": "Oc1c([N+](=O)[O-])ccc(-c2nc(-c3ccccc3)no2)c1O",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "27ad03bc-5369-467d-89b9-c2aeb9c0f666",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)NCCC=Cc2ccccc2)s1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)NCCC=Cc2ccccc2)s1",
+ "ref_smiles": "C=CCCNS(=O)(=O)c1ccc(C)s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "59074d16-0ff0-4591-9159-135191249c9a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)Nc2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)ccc1Br with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)Nc2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)ccc1Br",
+ "ref_smiles": "Cc1cc(NC(=O)Nc2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)ccc1C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "586fa602-acfe-4366-b093-f260b4ce9f59",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)OC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1",
+ "ref_smiles": "CC(C)(C)OC(=O)NC(CSC(c1ccccc1)c1ccccc1)C(=O)OCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "296f5420-dea5-4516-92e3-2b3e72f686e7",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCOc1ccc(CSc2nc3c(cc2C#N)CCCCC3)cc1-n1nc2ccccc2n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(CSc2nc3c(cc2C#N)CCCCC3)cc1-n1nc2ccccc2n1",
+ "ref_smiles": "CCOc1ccc(CSc2nc3c(cc2S)CCCCC3)cc1-n1nc2ccccc2n1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8ebc7ea0-0da0-4569-ac8d-2a595129e37f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc2nc(Cl)c(C[NH+]3CCc4[nH]c(N)nc(=O)c4C3)cc2c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2nc(Cl)c(C[NH+]3CCc4[nH]c(N)nc(=O)c4C3)cc2c1",
+ "ref_smiles": "COc1ccc2nc(NO)c(C[NH+]3CCc4[nH]c(N)nc(=O)c4C3)cc2c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2098bd87-83ce-422c-8b1e-d45907851e14",
+ "task": "add",
+ "question": "Modify the molecule CC[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl",
+ "ref_smiles": "CC(N)[NH+](C(C)CC(=O)[O-])C(C)c1ccc(Br)cc1Cl",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "06d8952b-092d-4f4e-a8c5-16feb04f2b91",
+ "task": "add",
+ "question": "Modify the molecule Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)cs1",
+ "ref_smiles": "Cc1nc(C[NH+]2CCN(S(=O)(=O)c3ccc(CC(C)C)c(-c4ccccc4)c3)CC2)cs1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a8f4d85c-ba3c-4f69-947d-cb8f67cbf5a5",
+ "task": "delete",
+ "question": "Modify the molecule CC(=NNC(=O)c1sc2cc(C)ccc2c1Cl)c1ccc([N+](=O)[O-])cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=NNC(=O)c1sc2cc(C)ccc2c1Cl)c1ccc([N+](=O)[O-])cc1",
+ "ref_smiles": "CC(=NNC(=O)c1cc2ccc(C)cc2s1)c1ccc([N+](=O)[O-])cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "ebaafe7e-45c2-4c0c-bdc0-9b92c6a67703",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cc1ccc(F)cc1)N(CCc1cccs1)Cc1ccco1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccc(F)cc1)N(CCc1cccs1)Cc1ccco1",
+ "ref_smiles": "O=C([OH])c1ccc(CC(=O)N(CCc2cccs2)Cc2ccco2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7377ac89-c4b4-43e0-a7a5-090beab91042",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(NC(=O)c2ccc(NC(=O)C[NH+]3CCC(C(=O)NCC(=O)Nc4cc(C(=O)Nc5cccc(F)c5)ccc4C)CC3)c(C)c2)cc1F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccc(NC(=O)C[NH+]3CCC(C(=O)NCC(=O)Nc4cc(C(=O)Nc5cccc(F)c5)ccc4C)CC3)c(C)c2)cc1F",
+ "ref_smiles": "Cc1ccc(NC(=O)c2ccc(NC(=O)C[NH+]3CCC(C(=O)NCC(=O)Nc4cc(C(=O)Nc5cccc(S)c5)ccc4C)CC3)c(C)c2)cc1F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "71ecedbc-33ea-4294-8b98-9ad7e5077f3f",
+ "task": "sub",
+ "question": "Modify the molecule CCCOc1cc(C)c(Cl)c(C)c1C(C)(O)C(F)(F)F by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1cc(C)c(Cl)c(C)c1C(C)(O)C(F)(F)F",
+ "ref_smiles": "CCCOc1cc(C)c(Cl)c(C)c1C(C)(C(=O)O)C(F)(F)F",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7d2f7834-cbbd-456d-8193-c39377e8b231",
+ "task": "sub",
+ "question": "Modify the molecule CCOCCCN1C(=O)C(Nc2ccc(OC(C)C)cc2)=C(c2ccc(F)cc2)C1=O by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCCN1C(=O)C(Nc2ccc(OC(C)C)cc2)=C(c2ccc(F)cc2)C1=O",
+ "ref_smiles": "CCOCCCN1C(=O)C(Nc2ccc(OC(C)C)cc2)=C(c2ccc(O)cc2)C1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4aaf5e82-1012-415c-b672-cf549e064a04",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CCCN(C(=O)CNc2ccc(NC(=O)c3ccccc3)cc2C(F)(F)F)C1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCN(C(=O)CNc2ccc(NC(=O)c3ccccc3)cc2C(F)(F)F)C1",
+ "ref_smiles": "CC1CCCN(C(=O)CNc2ccc(NC(=O)c3ccccc3)cc2C(F)(F)C(=O)OH)C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a482304f-9b7e-4c58-b0f8-14967e486340",
+ "task": "add",
+ "question": "Modify the molecule c1cc[n+](N2CCNCC2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1cc[n+](N2CCNCC2)cc1",
+ "ref_smiles": "Nc1cc[n+](N2CCNCC2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "188dcb0b-bdc6-4b39-ad80-47b7d3238485",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)(C)C1=[NH+]C(=O)CC(Cl)=N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C1=[NH+]C(=O)CC(Cl)=N1.",
+ "ref_smiles": "CC(C)(C)C1=[NH+]C(=O)CC=N1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "99c34cfc-7ce3-47ae-ba3f-0fd358ebeb8c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(NC(=O)NC(C)c1ccncc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)NC(C)c1ccncc1)c1ccccc1.",
+ "ref_smiles": "CC(NC(=O)NC(C)(O)c1ccncc1)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3217842c-206c-4267-bc37-0489a3c27c21",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ncn(-c2cc(Cl)c(C(=O)NCC(c3cccc(F)c3)c3nc4c([nH]c3=O)CC(C)C=C4)c(Cl)c2)n1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ncn(-c2cc(Cl)c(C(=O)NCC(c3cccc(F)c3)c3nc4c([nH]c3=O)CC(C)C=C4)c(Cl)c2)n1",
+ "ref_smiles": "Cc1ncn(-c2cc(O)c(C(=O)NCC(c3cccc(F)c3)c3nc4c([nH]c3=O)CC(C)C=C4)c(Cl)c2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b02a18d-2f8f-430e-887f-486a4b6bc7be",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])CCCCCCOc1ccc(-c2c[nH+]c3ccc(-c4cn[nH]c4-c4ccc(F)cc4)cn23)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCCCCCOc1ccc(-c2c[nH+]c3ccc(-c4cn[nH]c4-c4ccc(F)cc4)cn23)cc1",
+ "ref_smiles": "O=C([O-])CCCCCCOc1ccc(-c2c[nH+]c3ccc(-c4cn[nH]c4-c4ccc(C(=O)O)cc4)cn23)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d8f6f47-085d-4b59-a642-545d90a1fcf9",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)CC1([NH2+]Cc2ccccc2)CCC(C(C)(C)C)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CC1([NH2+]Cc2ccccc2)CCC(C(C)(C)C)CC1",
+ "ref_smiles": "C[NH2+]C1(CC(=O)OC)CCC(C(C)(C)C)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "53df699b-6365-484b-873d-63b6c3aac604",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cc1cccc(Br)c1)NCC1(CCCl)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1cccc(Br)c1)NCC1(CCCl)CC1",
+ "ref_smiles": "O=C(Cc1cc(Br)ccc1C(=O)O)NCC1(CCCl)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "990281e5-993a-402d-b719-fdaf06ae3839",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CCCCCCNC(=O)COc1ccccc1C#N by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCCCCCNC(=O)COc1ccccc1C#N",
+ "ref_smiles": "CC(C)CCCCCCNC(=O)COC#N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e05d7ba9-661f-4ed4-9591-39496c3a9d0f",
+ "task": "sub",
+ "question": "Modify the molecule CSc1ccc(Cl)c(C(=O)NC(C[NH3+])C(C)(C)C)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc(Cl)c(C(=O)NC(C[NH3+])C(C)(C)C)c1",
+ "ref_smiles": "CSc1ccc([N+](=O)[O-])c(C(=O)NC(C[NH3+])C(C)(C)C)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0bedf536-20b5-47b0-be2b-c3716a92d1f8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)C1.",
+ "ref_smiles": "CC1(C)CCC(NC(=O)c2cc3cc(N)ccc3[nH]2)(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b821e03a-e7fa-4e77-a781-a1aadb46f9d8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)CC4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)CC4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1.",
+ "ref_smiles": "Cc1ccc(C2=NC(CC(=O)NCCOc3ccc(CC(=O)NC(C(=O)N4CC(O)C(c5ccccc5)C4C(=O)NCc4ccc(-c5sccc5C)cc4)C(C)(C)C)cc3)c3nnc(C)n3-c3sc(C)c(C)c32)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1ac958c9-163e-4719-908d-a5e9259a57cc",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1(O)CCC2C3C(CCCCCCl)Cc4cc(O)ccc4C3CCC21C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(O)CCC2C3C(CCCCCCl)Cc4cc(O)ccc4C3CCC21C.",
+ "ref_smiles": "CC1(O)CCC2C3C(CCCCCCl)Cc4ccccc4C3CCC21C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "31c6be31-13e7-4daf-a88b-bfda979de9cf",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(C)c(Cc2ccccc2)c(N2CCCN(C(=O)CC(C)(C)C)CC2)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C)c(Cc2ccccc2)c(N2CCCN(C(=O)CC(C)(C)C)CC2)n1",
+ "ref_smiles": "Cc1nc(C)c(C)c(N2CCCN(C(=O)CC(C)(C)C)CC2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a6682d0d-641e-4747-b8a1-b13855b5cf04",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)Oc1ncccc1CNC(=O)C(C)n1cccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1ncccc1CNC(=O)C(C)n1cccn1.",
+ "ref_smiles": "CC(C)Oc1nccc(O)c1CNC(=O)C(C)n1cccn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "270c9978-ed82-4c56-a0f7-c4efb426c53e",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCCS1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCCS1.",
+ "ref_smiles": "CCNC(NCCC(=O)Nc1ccc(Br)cc1C)=[NH+]CC1CCC(CC=O)S1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "ea933c4e-7e65-4016-a504-de51d8644206",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule N=CCCCN(CC[NH3+])CC1OC(n2cnc3c(N)ncnc32)C(O)C1O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N=CCCCN(CC[NH3+])CC1OC(n2cnc3c(N)ncnc32)C(O)C1O",
+ "ref_smiles": "N#CC1C(O)C(CN(CC[NH3+])CCCC=N)OC1n1cnc2c(N)ncnc21",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "76b0ee8a-cc8e-4df6-9b3b-a97b76e838b6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Oc1ccc2c(COc3ccccc3Br)c[nH]c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Oc1ccc2c(COc3ccccc3Br)c[nH]c2c1.",
+ "ref_smiles": "Oc1cc(O)c2c(COc3ccccc3Br)c[nH]c2c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ae0aa973-c6b6-4e0f-810e-c3c6c44a9080",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N1CCc2cc(C(=O)N(CC[NH+](C)C)Cc3ccc(C#N)cc3)ccc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCc2cc(C(=O)N(CC[NH+](C)C)Cc3ccc(C#N)cc3)ccc21",
+ "ref_smiles": "CC(=O)N1CCc2cc(C(=O)N(CC#N)CC[NH+](C)C)ccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8eb8c188-8e4b-43fb-8309-38f9aba4678e",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCC(C)CC3)n2)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCC(C)CC3)n2)cc1",
+ "ref_smiles": "Cc1ccc(CNC(=S)Nc2nc(Sc3nccc(N)n3)cc(N3CCC(C)CC3)n2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "50dfb7e5-147f-4d9c-ad8a-f219f3429a5d",
+ "task": "delete",
+ "question": "Modify the molecule CC1C[NH+](CC(C)(C)O)CCN1C(=O)NC1CCC[NH2+]C1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C[NH+](CC(C)(C)O)CCN1C(=O)NC1CCC[NH2+]C1",
+ "ref_smiles": "CC1C[NH+](CC(C)(C))CCN1C(=O)NC1CCC[NH2+]C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f3714dee-aa01-4e74-9662-5a6b617e7aeb",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule N#Cc1c(CCCNC(=O)C2CC=CCC2)nn(-c2ccc(F)cc2)c1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(CCCNC(=O)C2CC=CCC2)nn(-c2ccc(F)cc2)c1N.",
+ "ref_smiles": "Nc1cc(CCCNC(=O)C2CC=CCC2)nn1-c1ccc(F)cc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "67fd5856-536e-430b-9f32-e07d46565b87",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCCCCCC(=O)NC1C(OC2C(CO)OC(O)C([NH3+])C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2[NH3+])C1O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCC(=O)NC1C(OC2C(CO)OC(O)C([NH3+])C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2[NH3+])C1O",
+ "ref_smiles": "CCCCCCCCCC(=O)NC1C(OC2C(CS)OC(O)C([NH3+])C2O)OC(CO)C(OC2OC(CO)C(O)C(O)C2[NH3+])C1O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0b004d00-3ca1-4949-8f02-6316b43a1355",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])c1cn(CC(=O)N2CCCC2CO)nn1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1cn(CC(=O)N2CCCC2CO)nn1",
+ "ref_smiles": "O=C([O-])c1cn(CC(=O)N2C(CO)CCC2C(=O)O)nn1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7397e34a-ba91-4fd7-9fde-d1d6b9aec312",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C([O-])C(c1ccccc1)[NH+]1CCC(O)(P)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C(c1ccccc1)[NH+]1CCC(O)(P)CC1",
+ "ref_smiles": "ONC1(P)CC[NH+](C(C(=O)[O-])c2ccccc2)CC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b326d563-f010-444a-88c1-54e3ddd8b837",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(N(CC(=O)Nc2ccccc2SC)S(=O)(=O)c2ccc(Br)cc2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(N(CC(=O)Nc2ccccc2SC)S(=O)(=O)c2ccc(Br)cc2)cc1",
+ "ref_smiles": "CCOc1ccc(N(CC(=O)Nc2ccccc2SC)S(=O)(=O)c2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "85b1f41b-edc6-4a90-bd39-99646faa853c",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(CC1CCCCC1(F)F)NCC1(CO)CC2(CCC2)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(CC1CCCCC1(F)F)NCC1(CO)CC2(CCC2)C1",
+ "ref_smiles": "O=CCC(O)C1(CNS(=O)(=O)CC2CCCCC2(F)F)CC2(CCC2)C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "2a21c1c4-3c33-44b9-a346-b48487bb3680",
+ "task": "add",
+ "question": "Modify the molecule CCCNc1nc(C2CC2)nc(-c2ccsc2C)c1C by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1nc(C2CC2)nc(-c2ccsc2C)c1C",
+ "ref_smiles": "Cc1sccc1-c1nc(C2CC2)nc(NCC(C)CC=O)c1C",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "7ed3eba4-f0c2-4505-add6-bfe1bc35dc00",
+ "task": "delete",
+ "question": "Modify the molecule CCC(=O)C1=C(c2cccc(OC)c2)N(C(=O)CC)n2c(nnc2-c2ccc(OC)cc2)S1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)C1=C(c2cccc(OC)c2)N(C(=O)CC)n2c(nnc2-c2ccc(OC)cc2)S1",
+ "ref_smiles": "CCC(=O)C1=C(c2cccc(OC)c2)N(C(=O)CC)n2c(OC)nnc2S1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fe72e06a-1161-4e66-ae1a-9b836b3afdc5",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1ccc2c(c1)CCN2C(=O)Cc1ccccn1)c1cccnc1N1CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc2c(c1)CCN2C(=O)Cc1ccccn1)c1cccnc1N1CCCCC1",
+ "ref_smiles": "O=C(Nc1cc2c(c(-c3ccccc3)c1)N(C(=O)Cc1ccccn1)CC2)c1cccnc1N1CCCCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4ee5444d-15c8-4d65-8a4d-a435a3580498",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#Cc1ccccc1OCC(=O)NCC(O)c1c(F)cccc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccccc1OCC(=O)NCC(O)c1c(F)cccc1F",
+ "ref_smiles": "N#Cc1ccccc1OCC(=O)NCC(O)c1c(F)cccc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e1cd9330-188e-417b-bdea-3b892304dc0d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(CCS(C)(=O)=O)Cc1cc(N)ccc1Br with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCS(C)(=O)=O)Cc1cc(N)ccc1Br",
+ "ref_smiles": "CN(CCS(C)(=O)=O)Cc1cc(N)ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d343c3ed-ec42-485f-88bd-c522eca8ec2c",
+ "task": "delete",
+ "question": "Modify the molecule CC(C=COc1c2occc2cc2ccc(=O)oc12)CO by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C=COc1c2occc2cc2ccc(=O)oc12)CO",
+ "ref_smiles": "CC(C)C=COc1c2occc2cc2ccc(=O)oc12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "09855e25-6bb7-402d-a7b6-c4662734865f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(CCCc1c[nH]c2ccccc12)NCCCc1nnc2ccccn12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCc1c[nH]c2ccccc12)NCCCc1nnc2ccccn12.",
+ "ref_smiles": "c1ccc2c(CCCCCc3nnc4ccccn34)c[nH]c2c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c33d9156-de50-40a9-ae94-765670540669",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(NCC(c1ccc(Cl)cc1)n1ccnc1)C(F)(F)C(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC(c1ccc(Cl)cc1)n1ccnc1)C(F)(F)C(F)F.",
+ "ref_smiles": "O=C(NCC(Cl)n1ccnc1)C(F)(F)C(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d0808540-af3c-4f48-a2a1-1bb8a22ab699",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1c(C=C2SC(=S)N(c3cccc(F)c3)C2=O)cccc1OC with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1c(C=C2SC(=S)N(c3cccc(F)c3)C2=O)cccc1OC",
+ "ref_smiles": "CCOc1c(C=C2SC(=S)N(c3ccccc3)C2=O)cc(CHO)cc1OC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3fa75f5e-1f32-4827-950c-10b8b9a0f42e",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C(=O)CCOC(C)C)ccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)CCOC(C)C)ccc1F",
+ "ref_smiles": "Cc1c(F)ccc(C(=O)CCOC(C)C)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3a8fe8d3-fc0c-47ac-a53f-5a9d66b00c7a",
+ "task": "add",
+ "question": "Modify the molecule COc1ccccc1OCC(=O)N1CCC(C)C1CO by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1OCC(=O)N1CCC(C)C1CO",
+ "ref_smiles": "COc1cc(C(=O)O)ccc1OCC(=O)N1CCC(C)C1CO",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fa413473-ec0f-49f2-a9cd-fe488847372a",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C(=N)c2ccc(Br)cc2)cc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=N)c2ccc(Br)cc2)cc1",
+ "ref_smiles": "COc1ccc(C(=N)c2ccc(S)cc2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "01539081-a09a-4e89-891f-f04720a19741",
+ "task": "sub",
+ "question": "Modify the molecule OB(O)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OB(O)c1nc(-c2ccccc2)cc(-c2ccccc2)n1",
+ "ref_smiles": "OB(F)c1nc(-c2ccccc2)cc(-c2ccccc2)n1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "24d6cb33-bd76-463d-b4c9-4284c6640d67",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CNc1nc(C#N)nc2c1ncn2C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1nc(C#N)nc2c1ncn2C",
+ "ref_smiles": "CNc1nc([N+](=O)[O-])nc2c1ncn2C",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "19ecdde5-c6c3-4af8-9874-c6093daf0f50",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC[NH2+]C1CCc2[nH]c3ccc(OC)cc3c2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C1CCc2[nH]c3ccc(OC)cc3c2C1.",
+ "ref_smiles": "COc1ccc2[nH]c3c(c2c1)CC([NH2+]C(C)N)CC3",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "8e19f0e4-396e-4a2f-974d-843fc77729ae",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1cn2nc(-c3c(-c4ccc(F)cc4)nc4n3CCN(C(=O)C3(CF)CC3)C4)ccc2[nH+]1)c1ccnc(F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cn2nc(-c3c(-c4ccc(F)cc4)nc4n3CCN(C(=O)C3(CF)CC3)C4)ccc2[nH+]1)c1ccnc(F)c1",
+ "ref_smiles": "N#Cc1ccc(-c2nc3n(c2-c2ccc4[nH+]c(NC(=O)c5ccncc5)cn4n2)CCN(C(=O)C2(C)CC2)C3)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8aecaa84-4802-4291-8ea6-076e12b109dc",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)[NH2+]C(CO)(CSc1ncccc1Br)C1CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH2+]C(CO)(CSc1ncccc1Br)C1CC1",
+ "ref_smiles": "CC(C)[NH2+]C(CSc1ncccc1Br)(CC(=O)O)C1CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bde95f45-5c4a-4c9e-8fb2-5bb38d4af156",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCCn1nc(C(=O)NNS(=O)(=O)c2ccc3ccccc3c2)c2ccccc2c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCn1nc(C(=O)NNS(=O)(=O)c2ccc3ccccc3c2)c2ccccc2c1=O.",
+ "ref_smiles": "CCCCCn1nc(C(=O)NS(=O)(=O)c2ccc3ccccc3c2)c2ccccc2c1=O",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6683aef4-9885-43c2-9062-a1bde2a62c4a",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CC1C2CC3CC(C2)CC1C3)N1CCC2(CCCC2)C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1C2CC3CC(C2)CC1C3)N1CCC2(CCCC2)C1",
+ "ref_smiles": "C1CCC2(C1)CCC2C1C2CC3CC(C2)CC1C3",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "accd6692-c483-46cc-aa4b-6d356edd057f",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CC1CCc2ccccc21)N(Cc1ccccc1F)C1CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1CCc2ccccc21)N(Cc1ccccc1F)C1CC1",
+ "ref_smiles": "O=C(CC1CCc2ccccc21)N(CF)C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "34ba8f79-d885-449c-b67b-ae84141a1c4c",
+ "task": "delete",
+ "question": "Modify the molecule CCCOc1ccc(C2=C(O)C(=O)N(c3ccc(N(CC)CC)cc3)C2c2ccncc2)cc1OC by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(C2=C(O)C(=O)N(c3ccc(N(CC)CC)cc3)C2c2ccncc2)cc1OC",
+ "ref_smiles": "CCCOc1ccc(CC(Oc2ccc(N(CC)CC)cc2)c2ccncc2)cc1OC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "faf6843f-a962-4447-a221-3ec9f8361440",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Fc1cc(Br)cnc1OCCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cc(Br)cnc1OCCCc1ccccc1.",
+ "ref_smiles": "CCCOc1ncc(Br)cc1F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9cf4fbed-ae4d-420f-8d39-4397cc0c8ebe",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C[NH+](CCO)C1CCCCC1)Nc1cccc(C(F)(F)F)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[NH+](CCO)C1CCCCC1)Nc1cccc(C(F)(F)F)c1",
+ "ref_smiles": "O=C(C[NH+](CCO)C1CCCCC1)Nc1cccc([N+](=O)[O-])c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "28556dec-6925-43da-8237-3f4bb8d2ba50",
+ "task": "delete",
+ "question": "Modify the molecule OCCC1C=CCC(COCc2ccccc2)C1O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCC1C=CCC(COCc2ccccc2)C1O",
+ "ref_smiles": "OCCC1C=CCC(COCc2ccccc2)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9bd3fa74-7e86-4a13-8c49-594c0a47b423",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule c1[nH]cc2c1C1CCCC2CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1[nH]cc2c1C1CCCC2CC1.",
+ "ref_smiles": "OC1CCC2CCC1c1c[nH]cc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "57145fcd-b54d-415c-84c3-87b0cb8bf45c",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2)n1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2)n1",
+ "ref_smiles": "CCC(CC)n1ccc(CC(C)C(=O)c2ccccc2C(=O)O)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7b4bfa02-bbbb-4924-ad85-97fbf271d5ea",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc2c(c1)C(=O)c1cccc(N)c1C2=S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)C(=O)c1cccc(N)c1C2=S.",
+ "ref_smiles": "Cc1ccc2c(c1)C(=O)c1ccccc1C2=S",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "baafd737-742e-4748-bfe6-e5a2aabe8d73",
+ "task": "sub",
+ "question": "Modify the molecule CSCCC(C)N(C)c1ccc(CCl)cn1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(C)N(C)c1ccc(CCl)cn1",
+ "ref_smiles": "CSCCC(C)N(C)c1ccc(CNO)cn1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7970ad4b-fd16-4681-97ac-da183b2639fc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)C1CCCCN1S(=O)(=O)c1ccc(Br)cc1F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C1CCCCN1S(=O)(=O)c1ccc(Br)cc1F",
+ "ref_smiles": "CC(=O)C1CCCCN1S(=O)(=O)c1ccc(O)cc1F",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0def4790-bdb5-4ea3-89d5-552795a4f425",
+ "task": "delete",
+ "question": "Modify the molecule CC1CN(CC(=O)NC2CCCC2)CC(C)[NH2+]1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(CC(=O)NC2CCCC2)CC(C)[NH2+]1",
+ "ref_smiles": "CC1CN(C2CCCC2)CC(C)[NH2+]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "815d365c-e2d9-4618-b847-8008f4424bf3",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=[N+]([O-])c1cccnc1NCc1ccnc(N2CCOCC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1cccnc1NCc1ccnc(N2CCOCC2)c1.",
+ "ref_smiles": "O=C(O)C1CN(c2cc(CNc3ncccc3[N+](=O)[O-])ccn2)CCO1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5eaf0b25-62fc-41ad-a26f-eaaaaaac9835",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)Cc1ccc(C#N)cc1C(=O)C(C)Br by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)Cc1ccc(C#N)cc1C(=O)C(C)Br",
+ "ref_smiles": "CCOC(=O)Cc1ccc(C#N)c(C(=O)O)c1C(=O)C(C)Br",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ca09e498-4b1a-4210-a51f-6786c9341ef9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1c(CCl)cccc1-c1ccccc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1c(CCl)cccc1-c1ccccc1",
+ "ref_smiles": "O=C([O-])c1c(C)c([N+](=O)[O-])ccc1-c1ccccc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "52e23dad-30fe-4ca3-adeb-ee2830d2a48d",
+ "task": "add",
+ "question": "Modify the molecule CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccccc7)c7ccc(-c8ccccc8)cc7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccccc7)c7ccc(-c8ccccc8)cc7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21",
+ "ref_smiles": "CC1(C)c2ccccc2-c2cc3c4cc(-c5ccc(-c6ccc(N(c7ccc(-c8ccccc8)cc7)c7cccc(O)c7)cc6)cc5)ccc4n(-c4ccccc4)c3cc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6ad18f45-c08b-46b0-92fa-651ebe0dabc7",
+ "task": "sub",
+ "question": "Modify the molecule COc1ncnc(OC)c1-n1c(CC2CCCC2)nnc1NS(=O)(=O)C(C)C(OC)c1ncc(Cl)cn1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ncnc(OC)c1-n1c(CC2CCCC2)nnc1NS(=O)(=O)C(C)C(OC)c1ncc(Cl)cn1",
+ "ref_smiles": "COc1ncnc(OC)c1-n1c(CC2CCCC2)nnc1NS(=O)(=O)C(C)C(OC)c1ncc(C(=O)[OH])cn1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "35a2f567-80ad-434d-9613-1db8b4d766cf",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])c1ccc(O)c(C=Nc2ccc(I)cc2)c1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(O)c(C=Nc2ccc(I)cc2)c1",
+ "ref_smiles": "N#Cc1ccc(C(=O)[O-])cc1C=Nc1ccc(I)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5a797d34-70c5-4f3c-a828-da4a312b6e4e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(Cc1ccccc1F)NCc1[nH+]cc2ccccn12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccccc1F)NCc1[nH+]cc2ccccn12.",
+ "ref_smiles": "O=C(CF)NCc1[nH+]cc2ccccn12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "05da71dd-25eb-4932-8e85-831d41862dbb",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCCCCC(=O)NCC(C)(O)C[NH+]1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(=O)NCC(C)(O)C[NH+]1CCOCC1.",
+ "ref_smiles": "CCCCCC(=O)NCC(C)(O)C[NH+]1CCOC(CC=O)C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "899eab06-0b7d-4455-91cd-93bd9c0c3674",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule N#Cc1cc2cc3c(cc2nc1SCC(=O)Nc1ccc(Cl)cc1)OCO3.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cc2cc3c(cc2nc1SCC(=O)Nc1ccc(Cl)cc1)OCO3.",
+ "ref_smiles": "N#Cc1cc2cc3c(cc2nc1Sc1ccc(Cl)cc1)OCO3",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0bb2df66-4ef3-468b-9a10-d31706d3445a",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)C",
+ "ref_smiles": "CC(C)C(NC(=O)CSc1ccc2c(c1)OCCO2)C(=O)OC(C)(C)CN",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0f4a3e62-788d-45e1-ba63-73901ccf7e3b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(C(=O)OC)C(C)=NCCCO with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(=O)OC)C(C)=NCCCO",
+ "ref_smiles": "CCC(C(=O)OC)C(C)=NCCCC#N",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9ff6f4b2-f917-4aad-960c-a305c8494240",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C=C2C(=O)NC(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cc1OC by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C=C2C(=O)NC(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cc1OC",
+ "ref_smiles": "COc1ccc(C=C2C(=O)NC(=O)N(c3cccc(C(O)(F)F)c3)C2=O)cc1OC",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fa7945df-7193-4c9e-8129-cdce9bd5f247",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1.",
+ "ref_smiles": "COc1ccccc1COC1CCN(C(=O)c2cccc(OCC(=O)[O-])c2)CC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a1830399-032f-4369-ab53-6744579a39f4",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CCOc1ccc(C(=O)OC2CCN(C(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)OC2CCN(C(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-]",
+ "ref_smiles": "CCOc1ccc(C(=O)OC2CCN(C(=O)OC(C)(C)C)CC2)cc1[SH]",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "c6f833a3-ed85-408e-933e-3a0b434ab822",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C(NC(=O)c1nn(Cc2ccc(C#N)cc2F)c2ccccc12)C(=O)NCCNC(=O)C1CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(NC(=O)c1nn(Cc2ccc(C#N)cc2F)c2ccccc12)C(=O)NCCNC(=O)C1CC1",
+ "ref_smiles": "CC(C)(C)C(NC(=O)c1nn(C(F)C#N)c2ccccc12)C(=O)NCCNC(=O)C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6e44514c-6bca-4a08-80fc-66aed27e1d18",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)CCN1C(=O)C(C(C)C)Oc2cc([N+](=O)[O-])ccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCN1C(=O)C(C(C)C)Oc2cc([N+](=O)[O-])ccc21",
+ "ref_smiles": "COC(=O)CCN1C(=O)C(C(C)(C)c2ccccc2)Oc2cc([N+](=O)[O-])ccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "00760ba8-728d-470c-9fe7-dea46c67baa0",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CC(NC(=O)C1CCC[NH2+]1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)[O-] by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)C1CCC[NH2+]1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)[O-]",
+ "ref_smiles": "CC(C)C(NC(=O)C1CCC[NH2+]1)C(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccccc1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "409e85e6-d1c0-46cc-a6ef-9e56c3bdc552",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)C[NH2+]CC(O)c1ccc(O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[NH2+]CC(O)c1ccc(O)cc1.",
+ "ref_smiles": "CC(C)C[NH2+]CC(O)O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "df118696-2639-4ae3-a7b6-4e60221e7d20",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(CC)C1C[NH+]=C(NCc2ccc(C)cc2)S1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C1C[NH+]=C(NCc2ccc(C)cc2)S1.",
+ "ref_smiles": "CCC(C(C)O)C1C[NH+]=C(NCc2ccc(C)cc2)S1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dbe25e5b-3c91-4bd8-b29f-e581bf568396",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])CCS(=O)(=O)N1CCN(CC(F)(F)F)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCS(=O)(=O)N1CCN(CC(F)(F)F)CC1.",
+ "ref_smiles": "O=C([O-])CCS(=O)(=O)N1CCN(CC)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1fab7eae-68ff-41ce-8989-49f998d0d661",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2ccccc2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2ccccc2)c1C.",
+ "ref_smiles": "Cc1cc(S(N)(=O)=O)cc(NC(=O)CNC(=O)C=Cc2cccc(-c3ccccc3)c2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "be4f707f-b099-4174-b62c-52829a2362e6",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)c1ccccc1NC1=C(Cl)C(=O)N(c2ccc(C)cc2)C1=O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccccc1NC1=C(Cl)C(=O)N(c2ccc(C)cc2)C1=O",
+ "ref_smiles": "CC(=O)c1ccccc1N(c1ccc(C)cc1)C(Cl)C=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3591e1a2-9664-4599-8748-e0038f27104f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc(Nc2ccc(C#N)cc2)cc(C(=O)Nc2cccc(F)c2)n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(Nc2ccc(C#N)cc2)cc(C(=O)Nc2cccc(F)c2)n1",
+ "ref_smiles": "Cc1nc(Nc2ccc(C#N)cc2)cc(C(=O)Nc2cccc([N+](=O)[O-])c2)n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "64ff387d-99b6-4fa1-ab4d-210b68fb4a66",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Cl)CCNC(=O)c1cccc2cccnc12 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cl)CCNC(=O)c1cccc2cccnc12",
+ "ref_smiles": "CC(CCNC(=O)c1cccc2cccnc12)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "577a525f-20ad-4801-be3a-5886a5080cc2",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1.",
+ "ref_smiles": "O=C(c1cccc(-n2cnnn2)c1)N1CCC(N2C(=O)CNC2=O)CC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7d05e310-3704-4714-a63b-d64ce39020be",
+ "task": "delete",
+ "question": "Modify the molecule CCN(CC)c1nc(NC)nc(SCC2CCCO2)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)c1nc(NC)nc(SCC2CCCO2)n1",
+ "ref_smiles": "CCN(CC)c1nc(C)nc(SCC2CCCO2)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "beaeeefc-1be9-476b-959b-9f5d80300cc0",
+ "task": "add",
+ "question": "Modify the molecule COCCN1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3",
+ "ref_smiles": "COCC(C(=O)O)N1CCOc2cc3c(c(C)c21)C(C)C[NH2+]CC3",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4900c301-2bf4-4b2e-b127-c99ac9ec9563",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C1c2cccc(-c3ccc4c(c3)C(=O)N(c3nnc(-c5ccccc5)o3)C4=O)c2C(=O)N1c1ccc2[nH]c3ccc(N4C(=O)c5cccc(-c6ccc7c(c6)C(=O)N(c6nnc(-c8ccccc8Cl)o6)C7=O)c5C4=O)cc3c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1c2cccc(-c3ccc4c(c3)C(=O)N(c3nnc(-c5ccccc5)o3)C4=O)c2C(=O)N1c1ccc2[nH]c3ccc(N4C(=O)c5cccc(-c6ccc7c(c6)C(=O)N(c6nnc(-c8ccccc8Cl)o6)C7=O)c5C4=O)cc3c2c1.",
+ "ref_smiles": "O=C1c2cccc(-c3ccc4c(c3)C(=O)N(c3nnco3)C4=O)c2C(=O)N1c1ccc2[nH]c3ccc(N4C(=O)c5cccc(-c6ccc7c(c6)C(=O)N(c6nnc(-c8ccccc8Cl)o6)C7=O)c5C4=O)cc3c2c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c23907fa-95aa-49d1-b052-46f290fa454b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C[NH+]1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)N2CCCC2)CC1)Nc1ccc(Cl)c(C(=O)N2CCOCC2)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[NH+]1CCC(C(=O)Nc2ccc(Cl)cc2C(=O)N2CCCC2)CC1)Nc1ccc(Cl)c(C(=O)N2CCOCC2)c1",
+ "ref_smiles": "O=C(C[NH+]1CCC(C(=O)Nc2ccc(C=O)cc2C(=O)N2CCCC2)CC1)Nc1cccc(C(=O)N2CCOCC2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "06a4926e-132a-40ed-938c-79d2759ba8cf",
+ "task": "add",
+ "question": "Please add a amine to the molecule CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)CC(=O)c2ncccn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)CC(=O)c2ncccn2)cc1.",
+ "ref_smiles": "CN(C)C(=O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)C(N)C(=O)c2ncccn2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "74b48850-a074-45e7-a731-f532f873f2b4",
+ "task": "delete",
+ "question": "Modify the molecule CC=C(NC(=O)C1OC(C)(C)OC1C(N)=O)c1ccc(-c2ccc(-c3c[nH+]c(C4OC(C)(C)OC4C(N)=O)[nH]3)cc2)cc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(NC(=O)C1OC(C)(C)OC1C(N)=O)c1ccc(-c2ccc(-c3c[nH+]c(C4OC(C)(C)OC4C(N)=O)[nH]3)cc2)cc1",
+ "ref_smiles": "CC=C(NC(=O)C1OC(C)(C)OC1C(N)=O)c1ccc(-c2ccc(-c3c[nH+]c(C4OC(C)(C)O4)[nH]3)cc2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d582ef5f-18f7-4304-b4e3-4302436f0c33",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(N2CCN(C(=O)CSc3nccn3-c3cccc(Cl)c3C)CC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N2CCN(C(=O)CSc3nccn3-c3cccc(Cl)c3C)CC2)cc1",
+ "ref_smiles": "COc1ccc(N2CCN(C(=O)C(Sc3nccn3-c3cccc(Cl)c3C)c3ccccc3)CC2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "12ec75b2-f6b6-4065-87fa-927440721791",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(Oc2ncc(Br)cc2Cl)ccc1C(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Oc2ncc(Br)cc2Cl)ccc1C(C)C",
+ "ref_smiles": "Cc1cc(Oc2ncc(NO)cc2Cl)ccc1C(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6054c3e6-691d-41d6-9033-1d0dc2e71f5d",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(OCC(O)COc2ccc(I)cc2)cc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OCC(O)COc2ccc(I)cc2)cc1",
+ "ref_smiles": "CC(=O)c1ccc(OCC(O)COc2ccc(OC)cc2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4768a5e3-5fd4-4e02-a767-8fbfabf3e2c8",
+ "task": "delete",
+ "question": "Modify the molecule CCC1(CC)C(=O)N(C(=O)NCc2ccccc2)C1C(=O)c1ccccc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(CC)C(=O)N(C(=O)NCc2ccccc2)C1C(=O)c1ccccc1",
+ "ref_smiles": "CCC(C(=O)c1ccccc1)C(C)C(=O)NCc1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "61b30fcb-8eb9-4d19-b149-52fd636a0c0e",
+ "task": "add",
+ "question": "Please add a amine to the molecule N#Cc1ccc(NCC[NH+]2CCSCC2)c(F)c1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(NCC[NH+]2CCSCC2)c(F)c1Br.",
+ "ref_smiles": "N#Cc1cc(N)c(NCC[NH+]2CCSCC2)c(F)c1Br",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "2473ce43-3a77-4ae6-a46c-3b962f86140f",
+ "task": "add",
+ "question": "Modify the molecule COC1CC(NC(=O)Nc2nc(-c3ccsc3)ns2)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CC(NC(=O)Nc2nc(-c3ccsc3)ns2)C1",
+ "ref_smiles": "COC1CC(NC(=O)Nc2nc(-c3ccsc3-c3ccccc3)ns2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b09cf93d-8ea7-430b-8020-0ea25b9299e2",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Nc1ccc(N2CCOCC2)c(NC(=O)c2ccccn2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(N2CCOCC2)c(NC(=O)c2ccccn2)c1.",
+ "ref_smiles": "NN(C(=O)c1ccccn1)N1CCOCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "348fcb7b-ead0-4ea8-8e2e-915f0464a74f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(OC)c(C=C2SC(=[NH+]c3cccc(C(=O)[O-])c3C)N(C)C2=O)cc1Br with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(OC)c(C=C2SC(=[NH+]c3cccc(C(=O)[O-])c3C)N(C)C2=O)cc1Br",
+ "ref_smiles": "COc1cc(OC)c(C=C2SC(=[NH+]c3cccc(C(=O)[O-])c3C)N(C)C2=O)cc1C=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dbcc66a9-0d0b-458e-a0ee-af5411ce6054",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(=O)NNC(=O)CSc1nnnn1-c1ccc(C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NNC(=O)CSc1nnnn1-c1ccc(C)cc1.",
+ "ref_smiles": "Cc1ccc(-n2nnnc2SCC(N)=O)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9931c923-0813-4fe3-81c6-248348ece99d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)c1cnc(-c2ccc(F)c(F)c2)nc1N with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cnc(-c2ccc(F)c(F)c2)nc1N",
+ "ref_smiles": "COC(=O)c1cnc(-c2ccc(C(=O)[OH])c(F)c2)nc1N",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0127797c-ad90-4d17-a4a8-bb36dad29916",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Nc1cccc(OCC(O)C[NH+]2CCC(c3ccccc3)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cccc(OCC(O)C[NH+]2CCC(c3ccccc3)CC2)c1.",
+ "ref_smiles": "Nc1cccc(OCC(O)C[NH+]2CCC(c3cccc(O)c3)CC2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5d6fb3ac-d3df-4f09-a9d9-ad8ef440fda7",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CS(=O)(=O)CCSCc1ccccc1B(O)O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CCSCc1ccccc1B(O)O",
+ "ref_smiles": "CC(=O)B(O)c1ccccc1CSCCS(C)(=O)=O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "76012e65-6287-43f5-aab7-139b5f999ba0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCC(=O)OCC(=O)Nc1ccc(I)cc1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(=O)OCC(=O)Nc1ccc(I)cc1C",
+ "ref_smiles": "CCCCC(=O)OCC(=O)Nc1ccc(NO)cc1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc0742b0-7dd1-4aab-8ebb-c9ed1c66ebf9",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCOC1CC(CC(O)Cc2cc(Cl)ccc2Cl)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC1CC(CC(O)Cc2cc(Cl)ccc2Cl)C1.",
+ "ref_smiles": "CCOC1CC(CC(O)Cc2cccc(Cl)c2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "61104df8-0333-4a3b-81e5-6b453390c01d",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc2[nH+]c(C(F)(F)F)cc(N3CCCC[NH2+]CCC3)c2c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2[nH+]c(C(F)(F)F)cc(N3CCCC[NH2+]CCC3)c2c1",
+ "ref_smiles": "Cc1ccc2[nH+]c(C(F)F)cc(N3CCCC[NH2+]CCC3)c2c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "de9cd142-579a-4139-92d2-e05793506190",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C(=O)NC1CCCCC1)[NH+]1CCCN(C(=O)CCc2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)NC1CCCCC1)[NH+]1CCCN(C(=O)CCc2ccccc2)CC1.",
+ "ref_smiles": "CC(C(=O)NC1CCCCC1)[NH+]1CCCN(CCc2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0f2dd5d2-bb31-4886-9f4b-3362cd50c19c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC1CCCC(Oc2c(F)cccc2C(C)[NH3+])C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCC(Oc2c(F)cccc2C(C)[NH3+])C1.",
+ "ref_smiles": "CCC1CCCC(Oc2ccccc2C(C)[NH3+])C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8aa07c6b-c056-4fcb-bcfe-df85402dea27",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule NC(=O)c1cc(-c2ccnc(NCCc3ccc(O)cc3)c2)nc(N2CC[NH2+]CC2)c1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1cc(-c2ccnc(NCCc3ccc(O)cc3)c2)nc(N2CC[NH2+]CC2)c1",
+ "ref_smiles": "NC(=O)c1cc(-c2ccnc(NCCc3ccc(F)cc3)c2)nc(N2CC[NH2+]CC2)c1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9f9f6e5f-b948-45a4-857f-58a7c9f425b3",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCn1c2nc(Br)[nH]c2c(=O)n2c(CCCc3nc(-c4ccc(O)cc4)no3)nnc12 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCn1c2nc(Br)[nH]c2c(=O)n2c(CCCc3nc(-c4ccc(O)cc4)no3)nnc12",
+ "ref_smiles": "CCCCCn1c2nc(C(=O)[OH])[nH]c2c(=O)n2c(CCCc3nc(-c4ccc(O)cc4)no3)nnc12",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c0268eb1-40e9-4862-97a1-0177b9f0032e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)C1C(CO)ON(Cc2cccc(CNC(=O)NCc3ccccc3)c2)C1C(=O)NC1CC2CC(C1C)C2(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C1C(CO)ON(Cc2cccc(CNC(=O)NCc3ccccc3)c2)C1C(=O)NC1CC2CC(C1C)C2(C)C",
+ "ref_smiles": "CC(NO)C1C(CO)ON(Cc2cccc(CNC(=O)NCc3ccccc3)c2)C1C(=O)NC1CC2CC(C1C)C2(C)C",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cf99cd04-7616-480d-90cd-48385ff1e859",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1cc(C)cc(C(=O)NCC(=O)NNC(=O)CN2CCCc3ccccc32)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(C(=O)NCC(=O)NNC(=O)CN2CCCc3ccccc32)c1.",
+ "ref_smiles": "Cc1cc(C)cc(C(=O)NCC(=O)NN2CCCc3ccccc32)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "bc52e67b-d793-4310-b6b0-85915ca6af50",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c[nH]c(=O)n1-c1ccc(C(=O)NCCc2nc3cc(Cl)ccc3s2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c[nH]c(=O)n1-c1ccc(C(=O)NCCc2nc3cc(Cl)ccc3s2)cc1",
+ "ref_smiles": "Cc1c[nH]c(=O)n1-c1ccc(C(=O)NCCc2nc3cc(C(=O)[OH])ccc3s2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "962637fb-dad1-4e2e-80bf-9218219f2787",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2ccccc2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2ccccc2)c1C.",
+ "ref_smiles": "CNC(=O)c1nn(-c2ccccc2)c(NC(=O)Oc2cccc(-c3ccccc3)c2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "73f20506-3b55-43b6-a3c6-a9650115ea59",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(NC(=O)N2CC3CCCC3(C(=O)[O-])C2)c(Br)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)N2CC3CCCC3(C(=O)[O-])C2)c(Br)c1",
+ "ref_smiles": "Cc1ccc(NC(=O)N2CC3CCCC3(C(=O)[O-])C2)c(S)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9855b37d-a0e6-4aff-8cad-ce8d0e40d709",
+ "task": "add",
+ "question": "Please add a amine to the molecule C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cccc2F)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cccc2F)C1.",
+ "ref_smiles": "C[NH+]=C(NCc1cccc(N2CC=CC2)c1)NC1CCN(c2c(F)cc(N)cc2F)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "48d17d91-d919-4d5f-90ae-a9f28f96c268",
+ "task": "add",
+ "question": "Modify the molecule CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1",
+ "ref_smiles": "CC[NH+](CC(=O)[O-])C1CC(NC(=O)c2ccc(N3CCNC3=O)cc2)C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d75fad72-4e4c-432b-bdce-e52325cb185a",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)Oc1ccc(C(O)c2ccc(Br)cn2)cc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1ccc(C(O)c2ccc(Br)cn2)cc1",
+ "ref_smiles": "CC(C)Oc1ccc(C(Br)c2ccc(Br)cn2)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "542f5488-4bed-4d42-b3db-52a4798dc8e1",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(NC(=O)Nc1ccccc1Oc1ccccc1)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(NC(=O)Nc1ccccc1Oc1ccccc1)c1ccccc1",
+ "ref_smiles": "CC(C)(NC(=O)Nc1ccccc1O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b118a6f4-2df5-4ea0-af01-42ec0a6bf344",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cn1cc(-c2[nH]ncc2C(=O)NC2CCC3(CCCCC3)CC2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(-c2[nH]ncc2C(=O)NC2CCC3(CCCCC3)CC2)cn1.",
+ "ref_smiles": "Cn1cc(-c2(C3CCC4(CCCCC4)CC3)[nH]nc-2)cn1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8156d6ca-358c-4d5d-bad3-1817965f741b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CNC(=O)c1cccc(CN(CC(F)(F)F)C2CCC2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1cccc(CN(CC(F)(F)F)C2CCC2)c1",
+ "ref_smiles": "CNC(=O)c1cccc(CN(CC(F)(F)C#N)C2CCC2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "17458fe8-5e2b-4894-9a58-334380cb7415",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1(C)CCC(C)(C)c2c(Br)csc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC(C)(C)c2c(Br)csc21.",
+ "ref_smiles": "CC1(C)CCC(C)(C)c2sccc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "72f1b0aa-b7aa-44df-9f07-4f362fffef78",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(O)CSc1nc(C2CC2)n(-c2ccccc2)n1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(O)CSc1nc(C2CC2)n(-c2ccccc2)n1",
+ "ref_smiles": "CC(C)(C#N)CSc1nc(C2CC2)n(-c2ccccc2)n1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "88aefe84-2b66-47eb-b722-b447e5c5a393",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ccccc1C(=O)Nc1cnn(Cc2ccccc2F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1C(=O)Nc1cnn(Cc2ccccc2F)c1.",
+ "ref_smiles": "CCOc1ccccc1C(=O)Nc1cnn(Cc2cccc(O)c2F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "398619de-3635-4720-93d7-7d7d91313659",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CN(Cc1ccccc1Br)C(=O)CCn1ccc2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccccc1Br)C(=O)CCn1ccc2ccccc21.",
+ "ref_smiles": "CN(CBr)C(=O)CCn1ccc2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e46409af-87d3-4a6b-9859-4630f5ab08ac",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1cccc(F)c1COCC1CCC[NH2+]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(F)c1COCC1CCC[NH2+]1.",
+ "ref_smiles": "COc1cccc(F)c1COCC1(c2ccccc2)CCC[NH2+]1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "916f83f5-372f-46ad-98e6-931e0c989aae",
+ "task": "add",
+ "question": "Modify the molecule CCCCN(C)C(=O)c1cnn(-c2ccc(Br)cc2)c1C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C)C(=O)c1cnn(-c2ccc(Br)cc2)c1C",
+ "ref_smiles": "CCCCN(C)C(=O)c1c(-c2ccccc2)nn(-c2ccc(Br)cc2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1f510617-0dd9-423e-9363-8c6d0d217f7e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])C1CCN(CC(Cl)=CCl)c2ccccc21 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1CCN(CC(Cl)=CCl)c2ccccc21",
+ "ref_smiles": "O=C([O-])C1CCN(CC=C)c2cc([N+](=O)[O-])ccc21",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6076b6aa-b612-437a-ad94-e6acf5961b25",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)OC(=O)N1CCC(NC(=S)N2CCCCC2CCO)CC1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCC(NC(=S)N2CCCCC2CCO)CC1",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CCC(NC(=S)N2CCCCC2CC[N+](=O)[O-])CC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "06f4b7ff-8de4-4093-a237-003ab5d4eef2",
+ "task": "delete",
+ "question": "Modify the molecule O=C(c1ccccc1)c1ccc(OCc2csc(-c3ccc(F)cc3)n2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccccc1)c1ccc(OCc2csc(-c3ccc(F)cc3)n2)cc1",
+ "ref_smiles": "O=C(c1ccccc1)c1ccc(OCc2csc(-c3ccccc3)n2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3808fbad-fa24-4986-bb40-72a55d6b64ac",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)c1cc(NC(=O)N2CCC(C(=O)[O-])C2)c(F)cc1C by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cc(NC(=O)N2CCC(C(=O)[O-])C2)c(F)cc1C",
+ "ref_smiles": "CCOC(=O)c1cc(NC(=O)N2CCC(C(=O)[O-])C2)c(S)cc1C",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c69cc696-c7bd-45a1-b305-e51dfb657125",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CC(=O)OCCC(=O)OCCC(=O)OC(C)(C)CBr with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)OCCC(=O)OCCC(=O)OC(C)(C)CBr",
+ "ref_smiles": "C=CC(=O)OCCC(=O)OCCC(=O)OC(C)(C)CC(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e569acca-7580-4294-aef7-3f9e2b02b8d1",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1ccc2nc(CCCO)[nH]c2c1)c1ccccc1F by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc2nc(CCCO)[nH]c2c1)c1ccccc1F",
+ "ref_smiles": "NC(CCO)c1nc2ccc(NC(=O)c3ccccc3F)cc2[nH]1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "41fa7a14-ab7e-4636-a701-0dcf0d80634c",
+ "task": "sub",
+ "question": "Modify the molecule CCC(C)CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC(O)COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)([O-])OCC(O)COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C",
+ "ref_smiles": "CC(=O)C(COP(=O)([O-])OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)([O-])OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "910316d3-2730-4420-a72d-ae0b8f406dd7",
+ "task": "sub",
+ "question": "Modify the molecule CN1C(=O)CCC2(C)c3ccc(-c4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)cc3CCC12 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1C(=O)CCC2(C)c3ccc(-c4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)cc3CCC12",
+ "ref_smiles": "CN1C(=O)CCC2(C)c3ccc(-c4cc(C(C)(C)C)c([N+](=O)[O-])c(C(C)(C)C)c4)cc3CCC12",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "38d8c901-b3f3-48b0-b13f-d26d8d07f41e",
+ "task": "sub",
+ "question": "Modify the molecule C=CCN(CC=C)C(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(Br)cc2)c1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN(CC=C)C(=O)c1ccc(Cl)c(S(=O)(=O)Nc2ccc(Br)cc2)c1",
+ "ref_smiles": "C=CCN(CC=C)C(=O)c1ccc(C(=O)[OH])c(S(=O)(=O)Nc2ccc(Br)cc2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3edfc168-006b-464b-9acb-a53936875383",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CNC(=O)NNC(=O)c1ccccc1C(=O)c1ccc(Br)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)NNC(=O)c1ccccc1C(=O)c1ccc(Br)cc1",
+ "ref_smiles": "CNC(=O)NNC(=O)c1ccccc1C(=O)c1ccc(C(=O)[OH])cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "65e6e066-cfc9-4449-9287-2efabf0285d0",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)c1ncn(-c2cc(C(=O)OC)c(N)cc2C(F)(F)F)n1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ncn(-c2cc(C(=O)OC)c(N)cc2C(F)(F)F)n1",
+ "ref_smiles": "CCOC(=O)c1ncn(-c2cc(C(=O)OC)c(N)cc2C(F)(F)C#N)n1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "04960d07-1269-47b2-8af7-9b8e1ca745b6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1CCCC2=C1C(c1ccc(Cl)cc1)c1c([nH]c(SCc3ccccc3Cl)nc1=O)N2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCCC2=C1C(c1ccc(Cl)cc1)c1c([nH]c(SCc3ccccc3Cl)nc1=O)N2",
+ "ref_smiles": "O=C1CCCC2=C1C(c1ccc(C(=O)[OH])cc1)c1c([nH]c(SCc3ccccc3Cl)nc1=O)N2",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e9d5172a-5e24-4f0a-9ef3-f9008db8b591",
+ "task": "sub",
+ "question": "Modify the molecule COCCOCC[NH2+]Cc1cc(Br)c(Cl)s1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOCC[NH2+]Cc1cc(Br)c(Cl)s1",
+ "ref_smiles": "COCCOCC[NH2+]Cc1cc(C(=O)[OH])c(Cl)s1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cd6c0ba8-61d3-4410-a02c-1b3ce9ff7fde",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)c1ccc(C(=O)NCC(=O)NCc2cccc(NC(=O)c3ccc(F)cc3)c2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1ccc(C(=O)NCC(=O)NCc2cccc(NC(=O)c3ccc(F)cc3)c2)cc1",
+ "ref_smiles": "CC(C)(C)c1ccc(C(=O)NCC(=O)NCc2cccc(NC(=O)c3ccc(C(=O)[OH])cc3)c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "10766830-92c6-4d58-bfbe-be1abe5d25be",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12)Nc1ncc(Cl)cc1Cl by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(F)cc12)Nc1ncc(Cl)cc1Cl",
+ "ref_smiles": "O=C(CCCc1c(-c2ccccn2)[nH]c2ccc(O)cc12)Nc1ncc(Cl)cc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2528854d-b730-4b50-9a30-1ea3f3db9691",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(NCc1ccc(Cl)cc1)Nc1ccc2c(c1)CCCN2C(=O)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc(Cl)cc1)Nc1ccc2c(c1)CCCN2C(=O)C1CC1.",
+ "ref_smiles": "O=C(NCCl)Nc1ccc2c(c1)CCCN2C(=O)C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f127bbb7-4835-45ec-af0e-b17db25e0ce0",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule COC(=O)C1Cc2cc(OC)c(O)cc2N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1Cc2cc(OC)c(O)cc2N1.",
+ "ref_smiles": "COC(=O)C1Cc2cc(OC)ccc2N1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ae1c4384-3ee0-4b4a-9ae1-8237dadde512",
+ "task": "add",
+ "question": "Modify the molecule C=CCNC(=S)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCNC(=S)NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1",
+ "ref_smiles": "C=CCNC(=S)NN=Cc1ccc(-c2c(Cl)cc([N+](=O)[O-])cc2-c2ccccc2)o1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4daa371d-fb54-43d0-b2a8-0ab8b3a04fac",
+ "task": "add",
+ "question": "Modify the molecule CCCNC(=O)NC(C)(C)C(=O)NCC1Cc2ccccc2O1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)NC(C)(C)C(=O)NCC1Cc2ccccc2O1",
+ "ref_smiles": "CCCNC(=O)NC(C)(C)C(=O)NCC1(c2ccccc2)Cc2ccccc2O1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "98372371-7059-4351-bb00-a70e7f65b160",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COC(=O)c1cc(OC(F)F)c(F)cc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc(OC(F)F)c(F)cc1C#N.",
+ "ref_smiles": "COC(=O)c1c(C#N)cc(F)c(OC(F)F)c1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9cd27f65-5d7b-46c2-976d-0116b2a3ced8",
+ "task": "sub",
+ "question": "Modify the molecule C[NH2+]C(CC1C[NH2+]CCO1)c1cc(Br)ccc1C by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(CC1C[NH2+]CCO1)c1cc(Br)ccc1C",
+ "ref_smiles": "C[NH2+]C(CC1C[NH2+]CCO1)c1cc(C#N)ccc1C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f1ef4db3-1169-440e-b29b-af06aea6fb1e",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2)c1",
+ "ref_smiles": "Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "128e3366-b093-4ef3-85bd-82d366952d2b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CS(=O)(=O)CC(=O)NCC1(CCl)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)CC(=O)NCC1(CCl)CC1.",
+ "ref_smiles": "CS(=O)(=O)CC(=O)NCC1(CCl)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "dc4ef4e6-4131-4e1e-a564-d2c4453adb57",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1ccccc1N(CC(=O)NCC1CC1)S(=O)(=O)c1cc(Cl)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1N(CC(=O)NCC1CC1)S(=O)(=O)c1cc(Cl)ccc1Cl.",
+ "ref_smiles": "COc1ccccc1N(CC(=O)NCC1CC1)S(=O)(=O)c1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "beacff15-b8e6-434c-896b-77109d0399aa",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCCCC(C)Nc1cc([N+](=O)[O-])c(C)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC(C)Nc1cc([N+](=O)[O-])c(C)cc1C.",
+ "ref_smiles": "CCCCCCC(C)c1cc([N+](=O)[O-])c(C)cc1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4fb344e8-b4fe-4df7-8a81-a2ba7bab0018",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)COC(=O)N1CCN(C(=O)COc2ccc(Cl)cc2)CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC(=O)N1CCN(C(=O)COc2ccc(Cl)cc2)CC1",
+ "ref_smiles": "CC(C)COC(=O)N1CCN(C(=O)COc2ccc(C#N)cc2)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cdb31a83-21a0-4aaa-bdc9-703a0b8f4a79",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCn1cc(Br)cc1C(=O)Nc1cnc(Cl)c(Br)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1cc(Br)cc1C(=O)Nc1cnc(Cl)c(Br)c1",
+ "ref_smiles": "CCCn1cc(C#N)cc1C(=O)Nc1cnc(Cl)c(Br)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a75ee632-4f70-4e03-b283-e7e2f061a829",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(C(=O)Nc2cc(C=CC(=O)[O-])ccc2C)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2cc(C=CC(=O)[O-])ccc2C)o1.",
+ "ref_smiles": "CC(=CC(=O)[O-])NC(=O)c1ccc(C)o1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6dafc86f-ffbb-4de0-8cf5-e30e63a8cb5f",
+ "task": "sub",
+ "question": "Modify the molecule C#CCNC(=O)C(C#N)=c1sc(=CNc2cccc(N3CCOCC3)n2)c(=O)n1CC by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCNC(=O)C(C#N)=c1sc(=CNc2cccc(N3CCOCC3)n2)c(=O)n1CC",
+ "ref_smiles": "C#CCNC(=O)C(S)=c1sc(=CNc2cccc(N3CCOCC3)n2)c(=O)n1CC",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cfffd251-1c6c-466d-a899-92b399298ca8",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C)c(C(=O)C(C)(C)C[NH3+])c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(C(=O)C(C)(C)C[NH3+])c(F)c1.",
+ "ref_smiles": "Cc1ccc(C(=O)C(C)(C)C[NH3+])c(C)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "207bea09-7620-43df-88f9-85709daed972",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](C)CCCNC(=O)c1ccccc1N1CCC(NC(=O)c2cccc(Br)c2)CC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCNC(=O)c1ccccc1N1CCC(NC(=O)c2cccc(Br)c2)CC1",
+ "ref_smiles": "C[NH+](C)CCCNC(=O)c1ccccc1N1CCC(NC(=O)c2cccc(O)c2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d9880917-b017-42de-913b-5fcc0184f553",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccc(S(=O)(=O)N2CCC(N3CCc4ccccc43)CC2)cc1F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(S(=O)(=O)N2CCC(N3CCc4ccccc43)CC2)cc1F",
+ "ref_smiles": "O=S(=O)(c1ccc(O)c(F)c1)N1CCC(N2CCc3ccccc32)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "3b61cb0f-160b-4d46-8fb1-4ecd92aad896",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(CCNC(=O)NCC(=O)Nc2ccc(F)c(F)c2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CCNC(=O)NCC(=O)Nc2ccc(F)c(F)c2)c(C)c1.",
+ "ref_smiles": "Cc1ccc(CCNC(=O)Nc2ccc(F)c(F)c2)c(C)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d0388636-3b7e-412d-92c6-c35293b67fc7",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCC=CCCCCCCCC(=O)NCCCCCC(=O)N1CC(OC(=O)CCC(=O)[O-])CC1C(OCc1ccc(OC)cc1)(c1ccccc1)c1ccc(OC)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCC=CCCCCCCCC(=O)NCCCCCC(=O)N1CC(OC(=O)CCC(=O)[O-])CC1C(OCc1ccc(OC)cc1)(c1ccccc1)c1ccc(OC)cc1",
+ "ref_smiles": "CCCCCCCCC=CCCCCCCCC(=O)NCCCCCC(=O)N1CC(OC(=O)CCC(=O)[O-])CC1C(OCc1ccc(OC)cc1)c1ccc(OC)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "763eba5a-fc65-4ef3-bf65-8679b45febe0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CCO1.",
+ "ref_smiles": "CC([NH3+])C1C[NH+](CC2Cc3ccccc32)CC(c2ccccc2)O1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ea792c27-db1b-49b2-9e83-94f8c9bc092d",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCc1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1.",
+ "ref_smiles": "CC(C#N)c1ccc(C(C)NC(=O)CC2(O)CCCC2)cc1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "85688f36-297f-48ae-9040-775c3855d6d8",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCC(C)(C)C(=O)OCCOC(=O)C1C2C=CC(CC2)C1COO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)C(=O)OCCOC(=O)C1C2C=CC(CC2)C1COO.",
+ "ref_smiles": "CCC(C)(C)C(=O)OCCOC(=O)C1C2C=CC(CC2)C1CO",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9f42c436-bec5-42aa-a482-3230410e257f",
+ "task": "sub",
+ "question": "Modify the molecule CC1C(C(=O)[O-])CCN1C(=O)CNC(=O)c1cccc(Br)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C(C(=O)[O-])CCN1C(=O)CNC(=O)c1cccc(Br)c1",
+ "ref_smiles": "CC1C(C(=O)[O-])CCN1C(=O)CNC(=O)c1cccc(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5959627a-194b-4a30-9404-6e95b471d66a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(Br)C(=O)NCc1ccc(Cl)s1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(Br)C(=O)NCc1ccc(Cl)s1",
+ "ref_smiles": "CC(=O)C(CC)C(=O)NCc1ccc(Cl)s1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b9476079-7518-4cbe-8007-900657e102c7",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(NC(=O)c2cnccc2Cl)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2cnccc2Cl)cc1",
+ "ref_smiles": "Cc1ccc(NC(=O)c2cccnc2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "957d6977-6be4-4834-8fdf-523f3897157e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCOC(=O)C1=CC2=CC=CC=C(C=C1Br)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1=CC2=CC=CC=C(C=C1Br)C2.",
+ "ref_smiles": "CCOC(=O)C1=CC2=CC=CC=C(C=C1)C2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e0bbb691-8965-4707-b470-bcf13f27ef15",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1(CO)CCC(OCCCC(F)(F)F)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1(CO)CCC(OCCCC(F)(F)F)C1",
+ "ref_smiles": "[NH3+]C1(CO)CCC(OC(O)CCC(F)(F)F)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "51157782-a733-4a14-a41a-c592501892f4",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)(CC(C)CO)C[NH+](C)C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(CC(C)CO)C[NH+](C)C",
+ "ref_smiles": "CCC(C)(C[NH+](C)C)CC(C)(N)CO",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "eb9a3389-66db-40fd-a06d-09f9c4f9158d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)Cc1ccc(NC(=O)c2nccc3ccc(F)cc23)c(Cl)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1ccc(NC(=O)c2nccc3ccc(F)cc23)c(Cl)c1",
+ "ref_smiles": "COC(=O)Cc1ccc(NC(=O)c2nccc3ccc(F)cc23)c(C=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "29b48c80-697f-4133-9961-bb5b19f6bea5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([S-])N(CC(Br)CBr)CC(Br)CBr with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([S-])N(CC(Br)CBr)CC(Br)CBr",
+ "ref_smiles": "O=C([S-])N(CC(O)CBr)CC(Br)CBr",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "295f4eb3-202d-43c8-9f29-bf6cdcd8599d",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCOC(=O)CC(C)S(=O)(=O)c1ccc(F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(C)S(=O)(=O)c1ccc(F)cc1F.",
+ "ref_smiles": "CCOC(=O)CC(C)(C(=O)O)S(=O)(=O)c1ccc(F)cc1F",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "306bb9c4-bf53-4b12-a122-7bb05b81ddfd",
+ "task": "add",
+ "question": "Modify the molecule Cn1cc(CNC(=O)COc2ccccc2)ccc1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(CNC(=O)COc2ccccc2)ccc1=O",
+ "ref_smiles": "O=C(COc1ccccc1)NCc1ccc(=O)n(CO)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7c9a3f75-9325-43e0-85bc-280ef5c65dcd",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(-c2cc3[nH]c2C=C2N=C(C=c4cc(-c5ccc(I)cc5)c([nH]4)=CC4=NC3(C)CC4(C)C)CC2(C)C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2cc3[nH]c2C=C2N=C(C=c4cc(-c5ccc(I)cc5)c([nH]4)=CC4=NC3(C)CC4(C)C)CC2(C)C)cc1",
+ "ref_smiles": "CC1(C)CC2=NC1=Cc1[nH]c(cc1-c1ccc(Cc3ccccc3)cc1)C1(C)CC(C)(C)C(=N1)C=c1[nH]c(cc1-c1ccc(I)cc1)=C2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b7e8bce6-642e-4111-9d1a-2a9b9c2d4755",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCc1ccccc1NC(=O)C1Nc2cc(F)ccc2S(=O)(=O)N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccccc1NC(=O)C1Nc2cc(F)ccc2S(=O)(=O)N1.",
+ "ref_smiles": "CCc1ccccc1N1Nc2cc(F)ccc2S1(=O)=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1f79ab87-2f9c-446b-8cbf-fbfb58c536ea",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1ccccc1C(=O)C=Cc1ncc[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1C(=O)C=Cc1ncc[nH]1.",
+ "ref_smiles": "CCOC(=O)C=Cc1ncc[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "aaf5a357-5eeb-41bf-bfd1-00a6ca63affa",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccccc2)cc1",
+ "ref_smiles": "O=C([O-])c1ccc(CC(=CCc2ccc(O)cc2)c2ccc(O)cc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2554b518-a806-45ff-87af-05b0efbe88a1",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CNc1snc(C)c1C(=O)NC(C)CC(O)c1ccc(F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1snc(C)c1C(=O)NC(C)CC(O)c1ccc(F)cc1.",
+ "ref_smiles": "CNc1snc(C)c1C(=O)NC(C)CCc1ccc(F)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a41469ff-7844-4bd8-acad-49ccb4275312",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C)c(NC(=O)c2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc2Cl)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(NC(=O)c2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc2Cl)c1",
+ "ref_smiles": "Cc1ccc(C)c(NC(=O)c2cc(NS(=O)(=O)c3ccc(NO)cc3)ccc2Cl)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4f8c4b1a-1325-4c7c-bf94-e61991a7140d",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C([O-])CC(c1ccc(-c2ccccc2)cc1)n1cnc2cc(NS(=O)(=O)c3ccccc3)ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC(c1ccc(-c2ccccc2)cc1)n1cnc2cc(NS(=O)(=O)c3ccccc3)ccc21.",
+ "ref_smiles": "O=C([O-])CC(c1ccc(-c2ccccc2)cc1)n1cnc2cc(S(=O)(=O)c3ccccc3)ccc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e879935b-a135-444e-8184-f440b97fc030",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NC1CCc2cn[nH]c2C1)NC1CCOc2ccc(F)cc21 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCc2cn[nH]c2C1)NC1CCOc2ccc(F)cc21",
+ "ref_smiles": "O=C(NC1CCc2cn[nH]c2C1)NC1CCOc2ccc(C=O)cc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "414c1ec4-cc50-4541-86c5-ec33610455ea",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccnc(NCCOCCCl)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccnc(NCCOCCCl)n1",
+ "ref_smiles": "CC(=O)CCOCCNc1nccc(OC)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "96593edc-5b4e-4516-a498-f9651e585a82",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C([O-])c1ccc(OCC2CCCN(C(=O)C[NH+]3CCN(c4cc[nH]c5cnc6nccc6c45)CC3)C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(OCC2CCCN(C(=O)C[NH+]3CCN(c4cc[nH]c5cnc6nccc6c45)CC3)C2)cc1.",
+ "ref_smiles": "O=C([O-])OCC1CCCN(C(=O)C[NH+]2CCN(c3cc[nH]c4cnc5nccc5c34)CC2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "272eade6-967a-481d-9809-b6e73cb41fbb",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C2OCCCC2[NH3+])cc1Br by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2OCCCC2[NH3+])cc1Br",
+ "ref_smiles": "COC1(Br)OCCCC1[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a9ad83ac-f93b-43f1-9d4e-a9cbf4d5fd72",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C(F)(F)F)ccc1CF by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(F)(F)F)ccc1CF",
+ "ref_smiles": "Cc1c(CF)ccc(C(F)(F)F)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d0c2abd0-2969-4140-8bf2-7a2bd72a6e09",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(C)=O)CC4)cc3)n2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(C)=O)CC4)cc3)n2)cc1",
+ "ref_smiles": "CC(=O)NCCN(C)S(=O)(=O)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(=O)CC(=O)O)CC4)cc3)n2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6b3e2c6a-5430-4f64-8fa1-be1746218748",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccccc1C([O-])=C1C(=O)C(=O)N(c2ccc(F)cc2F)C1c1cccc(OC(C)C)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C([O-])=C1C(=O)C(=O)N(c2ccc(F)cc2F)C1c1cccc(OC(C)C)c1",
+ "ref_smiles": "COc1ccc(CHO)cc1C([O-])=C1C(=O)C(=O)N(c2ccccc2)C1c1cccc(OC(C)C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1f933e9f-f370-4186-bb9f-19a3b57e72b8",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)cc1",
+ "ref_smiles": "Cc1c(C(=O)Cc2cccc(Cl)n2)nnn1-c1ccc(F)c(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7f47a78d-37db-4f84-853e-239de58d4cfa",
+ "task": "add",
+ "question": "Modify the molecule CSN1CCC(C)(S(=O)(=O)CC(C)C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSN1CCC(C)(S(=O)(=O)CC(C)C)CC1",
+ "ref_smiles": "CSN1CCC(C)(S(=O)(=O)CC(C)CO)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9a3743da-e6b0-4e33-b30f-5a94587e4140",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCC(C)CS(=O)(=O)c1ccccc1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)CS(=O)(=O)c1ccccc1F",
+ "ref_smiles": "CCCC(C)CS(=O)(=O)c1ccccc1[N+](=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "62b258f6-0d6a-4bec-b6cc-23f63ec230a9",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1.",
+ "ref_smiles": "N#Cc1ccc(Oc2cccc3c2CCC3Oc2ccc(C(CC(=O)[O-])NS(N)(=O)=O)cc2)cc1CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "ca11c456-8cba-4b18-9c0f-2bd322c6ad24",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]C1CC2CCC(C1)N2S(=O)(=O)c1ccc(Br)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CC2CCC(C1)N2S(=O)(=O)c1ccc(Br)cc1",
+ "ref_smiles": "[NH3+]C1CC2CCC(C1)N2S(=O)(=O)Br",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "46098838-4de5-48fb-8675-09b8bfcb34c3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C([NH3+])CC2CCC2)c(C)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C([NH3+])CC2CCC2)c(C)cc1Cl.",
+ "ref_smiles": "CC([NH3+])(CCl)CC1CCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ac23f844-2f78-4d6b-a6f7-0f241bbe3df9",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C(=O)NN=Cc2ccc(O)c(Cl)c2)nc(=O)[nH]1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)NN=Cc2ccc(O)c(Cl)c2)nc(=O)[nH]1",
+ "ref_smiles": "Cc1cc(C(=O)NN=COCl)nc(=O)[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "84037d87-2c06-4f71-9256-83dc71426962",
+ "task": "add",
+ "question": "Modify the molecule CC[NH2+]C1CCC(C(C)C)CC1Sc1cc(C)cc(C)n1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C1CCC(C(C)C)CC1Sc1cc(C)cc(C)n1",
+ "ref_smiles": "CC[NH2+]C1(C#N)CCC(C(C)C)CC1Sc1cc(C)cc(C)n1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "25519a57-fd77-400d-b05b-010fb4ae5195",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCC[Si](C)(C)OC(C)C(=O)OC1CCCOC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[Si](C)(C)OC(C)C(=O)OC1CCCOC1.",
+ "ref_smiles": "CC(O[Si](C)(C)CCC(C)c1ccccc1)C(=O)OC1CCCOC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "46559320-34d9-4bb4-ae84-b4ddf4aeb4c2",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC([NH3+])Cc1ccc(OCCOc2ccccc2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC([NH3+])Cc1ccc(OCCOc2ccccc2)cn1.",
+ "ref_smiles": "CCC([NH3+])Cc1ccc(OCCO)cn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "17b17de4-e105-4b97-9062-a8698ede2690",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC)C(=O)CCNC(=O)NC(CCOC)C(=O)[O-] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)CCNC(=O)NC(CCOC)C(=O)[O-]",
+ "ref_smiles": "CCN(CC)C(=O)CCNC(=O)NC(O)(CCOC)C(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4ac7c1f4-83e8-4502-bd84-aa7d6010f40d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COCCC(C)NS(=O)(=O)CCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC(C)NS(=O)(=O)CCO.",
+ "ref_smiles": "COC(CC(C)NS(=O)(=O)CCO)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7ad9efca-939e-417c-937b-9475b173ff3a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1.",
+ "ref_smiles": "C[NH+](C)CCNC(=O)c1cccc(NC(=O)COc2ccccc2)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c95a8fce-9df6-4eef-bb52-44147842f9ec",
+ "task": "delete",
+ "question": "Modify the molecule CCN(CC1CC1)CC([NH2+]C)c1cccc(C(F)(F)F)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC1CC1)CC([NH2+]C)c1cccc(C(F)(F)F)c1",
+ "ref_smiles": "CCN(CC1CC1)CC([NH2+]C)C(F)(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b1c2f407-f717-4ae6-9cec-81504cd2850c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1CC(C)(C)CC(Cc2ccc(F)cc2)(OCC[NH+](C)C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)(C)CC(Cc2ccc(F)cc2)(OCC[NH+](C)C)C1.",
+ "ref_smiles": "CC1CC(C)(C)CC(Cc2ccccc2)(OCC[NH+](C)C)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6d61f35e-3cc8-4c9b-b5c4-71da9c1a5c0b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)C(=CNc1ccc(F)cc1F)C(=O)OCC with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(=CNc1ccc(F)cc1F)C(=O)OCC",
+ "ref_smiles": "CCOC(=O)C(=CNc1ccc(O)cc1F)C(=O)OCC",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2685c28e-61e8-4156-99a0-f5f3268a8d57",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(CSc1nncn1CCc1cccs1)Nc1ccccc1C(=O)NCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CSc1nncn1CCc1cccs1)Nc1ccccc1C(=O)NCc1ccccc1.",
+ "ref_smiles": "CNC(=O)c1ccccc1NC(=O)CSc1nncn1CCc1cccs1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5805871f-32ff-4578-8d8a-b6fa77f3be03",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCOCCNC(=O)C(c1ccccc1)(c1ccccc1)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOCCNC(=O)C(c1ccccc1)(c1ccccc1)C(C)C.",
+ "ref_smiles": "CCCOCCNC(=O)C(c1ccccc1)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "dd66a283-8120-43ee-bd7c-fb6aa631b356",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1",
+ "ref_smiles": "CCCCC(O)CCC1CCC(CCCOc2ccc(-c3ncc(CCC)cn3)cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c2c1bca0-ba69-4281-ac0e-071082060833",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(C(=O)CNc2ccc3ccccc3c2)oc2ccc(F)cc12 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)CNc2ccc3ccccc3c2)oc2ccc(F)cc12",
+ "ref_smiles": "Cc1c(C(=O)CNc2ccc3ccccc3c2)oc2ccc(C(=O)[OH])cc12",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1b0b3f45-6bcf-432c-b7ad-84eb9f1b0a96",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CN1C(=O)N(Cc2ccccc2)S(=O)(=O)c2ccsc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1C(=O)N(Cc2ccccc2)S(=O)(=O)c2ccsc21.",
+ "ref_smiles": "CN1C(=O)N(Cc2cccc(-c3ccccc3)c2)S(=O)(=O)c2ccsc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e4f2f674-b484-4da0-832c-31adb1378022",
+ "task": "add",
+ "question": "Modify the molecule COC(CNC(=O)C(=O)Nc1ccccc1F)c1ccsc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(CNC(=O)C(=O)Nc1ccccc1F)c1ccsc1",
+ "ref_smiles": "COC(CNC(=O)C(=O)Nc1ccc(C(=O)O)cc1F)c1ccsc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b38d982b-780d-4f61-9515-8b560fbead00",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule ClCc1cc(I)c2ncc(Cl)cc2c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "ClCc1cc(I)c2ncc(Cl)cc2c1",
+ "ref_smiles": "O=C(O)Cc1cc(I)c2ncc(Cl)cc2c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f85e44f5-0041-4f9b-b2c9-24a3067f10ad",
+ "task": "add",
+ "question": "Modify the molecule CCC[NH2+]C(CCSC)c1ccc(C)s1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(CCSC)c1ccc(C)s1",
+ "ref_smiles": "CCC[NH2+]C(c1ccc(C)s1)C(CC=O)CSC",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "521bd605-d8ee-4de6-a34e-7e8cc93f9b92",
+ "task": "add",
+ "question": "Modify the molecule CSCCC(CO)NC(c1ccccc1)C(F)(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(CO)NC(c1ccccc1)C(F)(F)F",
+ "ref_smiles": "CSCCC(CO)NC(c1ccc(C(=O)O)cc1)C(F)(F)F",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cea7e033-a5d8-4d2f-a74e-9133f4d7f9ce",
+ "task": "add",
+ "question": "Modify the molecule O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)ccc2N1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)ccc2N1",
+ "ref_smiles": "O=C1CC(c2ccc(Cl)cc2)=Nc2cc(Cl)c(-c3ccccc3)cc2N1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3d8bc8d4-5c04-4111-9d4b-55424e660661",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)COC(=O)CN(C(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)NC(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC(=O)CN(C(=O)Nc1cc(Cl)cc(Cl)c1)C(=O)NC(C)C",
+ "ref_smiles": "CC(C)COC(=O)CN(C(=O)Nc1cc(Cl)cc(C(=O)[OH])c1)C(=O)NC(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "05f17b11-f763-4c6d-89ce-00e7e68f9c9f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCN1C(=O)SC(=Cc2ccc3c(c2)C(C)=CC(C)(C)N3C(C)C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN1C(=O)SC(=Cc2ccc3c(c2)C(C)=CC(C)(C)N3C(C)C)C1=O.",
+ "ref_smiles": "CCC(Cc1ccc2c(c1)C(C)=CC(C)(C)N2C(C)C)C(=O)S",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f62e77fb-94e5-42e9-8b00-3e32e0fbf2d0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]C(CCC[NH2+]C1CCCc2cccnc21)Cc1nc2ccc(F)cc2[nH]1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CCC[NH2+]C1CCCc2cccnc21)Cc1nc2ccc(F)cc2[nH]1",
+ "ref_smiles": "[NH3+]C(CCC[NH2+]C1CCCc2cccnc21)Cc1nc2ccc(O)cc2[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "72c70b04-91a4-4fba-b115-2f52f4746fa6",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(Oc2ccc(B(O)O)cc2)c1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Oc2ccc(B(O)O)cc2)c1",
+ "ref_smiles": "Cc1cccc(Oc2ccc(B(O)O)c(C#N)c2)c1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "6716d7b3-7df6-4a71-8867-c42520dfb247",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-n2c(CCc3c[nH]c4ccc(Br)cc34)nc3ccccc3c2=O)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-n2c(CCc3c[nH]c4ccc(Br)cc34)nc3ccccc3c2=O)cc1",
+ "ref_smiles": "COc1ccc(-n2c(CCc3c[nH]c4ccccc34)nc3ccccc3c2=O)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "126b2a64-8a77-4ed3-83b9-1ef52644ee3e",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C(=O)Nc2cc(F)ccc2F)cc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)C(C)C)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2cc(F)ccc2F)cc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)C(C)C)CC1",
+ "ref_smiles": "Cc1ccc(C(=O)Nc2cccc(F)c2)cc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)C(C)C)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3ffe94b0-dc82-4c36-899d-d14bb1d03b8b",
+ "task": "delete",
+ "question": "Modify the molecule CS(=O)(=O)N1C=C(c2ccccc2)C2C(=O)C(=O)C(C(=O)[O-])=CC21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N1C=C(c2ccccc2)C2C(=O)C(=O)C(C(=O)[O-])=CC21",
+ "ref_smiles": "CS(=O)(=O)N1C=CC2C(=O)C(=O)C(C(=O)[O-])=CC21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d6545733-1851-47e7-89d1-b187a5776383",
+ "task": "add",
+ "question": "Modify the molecule O=Cc1c2c(nn1-c1ccccc1)CCOC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=Cc1c2c(nn1-c1ccccc1)CCOC2",
+ "ref_smiles": "O=Cc1c2c(nn1-c1ccccc1)CC(c1ccccc1)OC2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1dd4b3ce-48c5-47c5-a4e2-df4d1c1b5ac2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(Br)cc(NS(=O)(=O)c2cc(CO)ccc2Br)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Br)cc(NS(=O)(=O)c2cc(CO)ccc2Br)c1",
+ "ref_smiles": "Cc1cc(NS(=O)(=O)c2cc(CO)ccc2Br)cc(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "75f84072-a929-41a6-88e3-42b605502012",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)ccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)ccc21.",
+ "ref_smiles": "CC(C)N1CCCc2cc(C(=CC=O)c3ccccc3)cc(N)c21",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "ce09cdbb-3d4f-491e-9136-14795814ee20",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(=NNc1nnc(NCc2ccccc2)nn1)c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=NNc1nnc(NCc2ccccc2)nn1)c1ccc(Cl)cc1.",
+ "ref_smiles": "CC(=NNc1nnc(NCc2ccccc2)nn1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "69a04ce5-4ced-48d0-bae7-b45aeea82d5e",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2ccc(F)c(NC(=O)c3ccccc3F)c2)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2ccc(F)c(NC(=O)c3ccccc3F)c2)CC1",
+ "ref_smiles": "Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2cccc(NC(=O)c3ccccc3F)c2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "35665113-49d7-4264-bc78-cbfe0671ccc7",
+ "task": "add",
+ "question": "Modify the molecule CC1(C)CSC(=NCC[NH+]2CCCC2)N1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CSC(=NCC[NH+]2CCCC2)N1",
+ "ref_smiles": "CC1(CO)CSC(=NCC[NH+]2CCCC2)N1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fb3b1384-5dd6-4d13-9e3b-85b1ffd5930d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule N#Cc1cc(NN=Cc2cccc([N+](=O)[O-])c2)c([N+](=O)[O-])cc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cc(NN=Cc2cccc([N+](=O)[O-])c2)c([N+](=O)[O-])cc1C#N.",
+ "ref_smiles": "N#Cc1cc(NN=C[N+](=O)[O-])c([N+](=O)[O-])cc1C#N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "68bd2735-9a96-4198-9258-e7019256a931",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(F)cc1F)C1CC(=O)N(c2ccc(F)c(F)c2)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(F)cc1F)C1CC(=O)N(c2ccc(F)c(F)c2)C1",
+ "ref_smiles": "O=C(Nc1ccc([N+](=O)[O-])cc1)C1CC(=O)N(c2ccccc2)C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "97d81ea8-94e3-4a88-a117-435b79ac4677",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(N2CCCC2)c(OC)cc1C=C(C#N)c1ccc(C(F)(F)F)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(N2CCCC2)c(OC)cc1C=C(C#N)c1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "COc1cc(N2CCCC2)c(OC)cc1C=C(C#N)c1ccc(C(F)(F)C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "73ff3eea-b49a-4462-b779-928a876763da",
+ "task": "delete",
+ "question": "Modify the molecule CCN(CC)C(=O)C(C)[NH2+]C1CC(OC)C1(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C(=O)C(C)[NH2+]C1CC(OC)C1(C)C",
+ "ref_smiles": "COC1CC([NH2+]C(C)C(C)C)C1(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3a020685-831a-4d2f-b426-0a7afa1f88d9",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)c1ccc(-c2cc(Cl)cnc2-c2ccc(C)nc2)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(-c2cc(Cl)cnc2-c2ccc(C)nc2)cc1",
+ "ref_smiles": "CC(=O)c1ccc(-c2cc(O)cnc2-c2ccc(C)nc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c2238a90-dec0-434e-b176-2df1940baf4c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1cc(C(F)(F)F)ccc1OCCc1ccc(OC(F)(F)F)cc1)c1cc(Cl)ccc1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cc(C(F)(F)F)ccc1OCCc1ccc(OC(F)(F)F)cc1)c1cc(Cl)ccc1O",
+ "ref_smiles": "CC(=O)C(F)(F)c1ccc(OCCc2ccc(OC(F)(F)F)cc2)c(NC(=O)c2cc(Cl)ccc2O)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c1d3b478-d222-472f-822d-321dbdf56591",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCS(=O)(=O)c1ccc(NCC(C)CCCl)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCS(=O)(=O)c1ccc(NCC(C)CCCl)cc1",
+ "ref_smiles": "CCCS(=O)(=O)c1ccc(NCC(C)CCC#N)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1aa362e2-1faf-46ac-aa9c-fcb9fe1a96ee",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nsc(NS(=O)(=O)c2ccc3nc(Cl)ccc3c2)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nsc(NS(=O)(=O)c2ccc3nc(Cl)ccc3c2)n1",
+ "ref_smiles": "CC(=O)c1ccc2cc(S(=O)(=O)Nc3nc(C)ns3)ccc2n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dc062a0d-49f0-4f61-8d8d-4cce6c820ff9",
+ "task": "delete",
+ "question": "Modify the molecule NNC(=O)c1cccc(CSCC(O)CO)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NNC(=O)c1cccc(CSCC(O)CO)n1",
+ "ref_smiles": "NC(=O)c1cccc(CSCC(O)CO)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "8717a0b5-b7cb-4355-8cea-3db5d584ef92",
+ "task": "sub",
+ "question": "Modify the molecule CCCN(C(N)=[NH2+])c1ccc(F)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(C(N)=[NH2+])c1ccc(F)cc1",
+ "ref_smiles": "CCCN(C(N)=[NH2+])c1ccc(C(=O)[OH])cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "85d9de2a-5ba7-43f7-a327-64df78dbfc31",
+ "task": "delete",
+ "question": "Modify the molecule CC1Cc2ccccc2N1c1ccc(C#N)cn1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1Cc2ccccc2N1c1ccc(C#N)cn1",
+ "ref_smiles": "CC1Cc2ccccc2N1c1ccccn1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "652eff7f-0461-425a-a105-0905ca4c37c0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cl)c1cc2ccccc2cc1Oc1nc(Nc2ccc3ccccc3c2)nc(Oc2cc3ccccc3cc2C(=O)Cl)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cl)c1cc2ccccc2cc1Oc1nc(Nc2ccc3ccccc3c2)nc(Oc2cc3ccccc3cc2C(=O)Cl)n1",
+ "ref_smiles": "O=C([OH])C(=O)c1cc2ccccc2cc1Oc1nc(Nc2ccc3ccccc3c2)nc(Oc2cc3ccccc3cc2C(=O)Cl)n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5ea3f7b7-02f7-4f2c-ac23-4ec83fe25787",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCC(C)c1nc(N)cc(-c2ccc(OC)cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)c1nc(N)cc(-c2ccc(OC)cc2)n1.",
+ "ref_smiles": "CCC(C)c1nccc(-c2ccc(OC)cc2)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0e6e65f0-cb90-4cc3-9e76-15e7863857f9",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(C(=O)NNC(=O)CCC(=O)Nc2cc(C)ccc2C)cc1Br by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)NNC(=O)CCC(=O)Nc2cc(C)ccc2C)cc1Br",
+ "ref_smiles": "CCNC(=O)CCC(=O)NNC(=O)c1ccc(OCC)c(Br)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9241d1b9-05d3-4f82-ac1a-a0c2b9e3e249",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccccc1[NH+]=C(Nc1cccnc1)N1CCCC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1[NH+]=C(Nc1cccnc1)N1CCCC1",
+ "ref_smiles": "Cc1ccccc1[NH+]=C(c1cccnc1)N1CCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "1b798d56-6e8c-4fa4-8050-1c9359f2847c",
+ "task": "sub",
+ "question": "Modify the molecule CNS(=O)(=O)c1ccc(CNC(=O)c2ccc(C)c(F)c2)s1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNS(=O)(=O)c1ccc(CNC(=O)c2ccc(C)c(F)c2)s1",
+ "ref_smiles": "CNS(=O)(=O)c1ccc(CNC(=O)c2ccc(C)c(NO)c2)s1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "821b1461-d0d2-4b8b-9dc9-d684904e5a75",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1ccc(S(=O)(=O)Cc2ccc(Br)cc2)c(Cl)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(S(=O)(=O)Cc2ccc(Br)cc2)c(Cl)c1",
+ "ref_smiles": "Nc1ccc(S(=O)(=O)Cc2ccc(O)cc2)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a55ff03f-9cf0-47cf-bcba-17d09e201a61",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CNC(=O)NCC(=O)Nc1ccc(Cl)cc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CNC(=O)NCC(=O)Nc1ccc(Cl)cc1",
+ "ref_smiles": "CC(C)CNC(=O)NCC(=O)Nc1ccc(S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ce9380f2-6ee9-4c2c-99b5-2cdaae480f6d",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOc1ccc(C=C2SC(=[NH+]c3ccccc3)N(Cc3ccc(C(=O)[O-])cc3)C2=O)c(OCC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C=C2SC(=[NH+]c3ccccc3)N(Cc3ccc(C(=O)[O-])cc3)C2=O)c(OCC)c1.",
+ "ref_smiles": "CCOc1ccc(C=C2SC(c3ccccc3)N(Cc3ccc(C(=O)[O-])cc3)C2=O)c(OCC)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "96eccecc-0f41-40d0-b44c-73916daa0a94",
+ "task": "add",
+ "question": "Modify the molecule CCC1(C(=O)Nc2cccc(OCC[NH3+])c2)CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(C(=O)Nc2cccc(OCC[NH3+])c2)CCCC1",
+ "ref_smiles": "[NH3+]CCOc1cccc(NC(=O)C2(CCc3ccccc3)CCCC2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6beca1c9-d75e-4e2c-8d0c-d20d2c7abd87",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]=C(NCC(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCC(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1",
+ "ref_smiles": "C[NH+]=C(NC(C(=O)O)C(=O)N1CCc2ccccc2C1)N1CCC(NC(=O)OC(C)(C)C)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0d13ab74-1f8e-4f18-b253-59536f2c485c",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC1(CNc2nc3ccc(N)cc3s2)CCCS1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(CNc2nc3ccc(N)cc3s2)CCCS1.",
+ "ref_smiles": "CC1(Cc2nc3ccc(N)cc3s2)CCCS1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0e894d55-40b0-4b16-9c4e-d11b4d572bd5",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CN(CC(O)c1ccc(O)c(O)c1)C(=S)Nc1cccc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC(O)c1ccc(O)c(O)c1)C(=S)Nc1cccc(Cl)c1.",
+ "ref_smiles": "CN(CC(O)c1ccc(O)c(O)c1)C(=S)c1cccc(Cl)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "1047e88c-2b60-4d7b-9afb-05713d82d7cf",
+ "task": "sub",
+ "question": "Modify the molecule CCCC(F)(F)c1cccc(C2CCC(=O)CC2)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(F)(F)c1cccc(C2CCC(=O)CC2)c1",
+ "ref_smiles": "O=CCCCc1cccc(C2CCC(=O)CC2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "13e4cc30-59e2-4695-9a55-ab6e985f0c56",
+ "task": "delete",
+ "question": "Modify the molecule N#CC1CCCC1NC(=O)c1cc(F)c(F)c([O-])c1F by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1CCCC1NC(=O)c1cc(F)c(F)c([O-])c1F",
+ "ref_smiles": "O=C(NC1CCCC1)c1cc(F)c(F)c([O-])c1F",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "37baa559-94da-4877-a9c0-5d9b6bd6c509",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC(=O)Nc1ccccc1OC)C(=O)c1csc(-c2cccs2)n1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC(=O)Nc1ccccc1OC)C(=O)c1csc(-c2cccs2)n1",
+ "ref_smiles": "CCN(CC(=O)Nc1cccc(N)c1OC)C(=O)c1csc(-c2cccs2)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "f6168a67-2877-4037-b258-ab9448b397bf",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COCC[NH+]1CC(NC(=O)Nc2ccc(-c3ccc(S(C)(=O)=O)cc3)nc2C)C(c2ccc(F)c(F)c2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC[NH+]1CC(NC(=O)Nc2ccc(-c3ccc(S(C)(=O)=O)cc3)nc2C)C(c2ccc(F)c(F)c2)C1.",
+ "ref_smiles": "COCC[NH+]1CC(NC(=O)Nc2ccc(-c3ccc(S(C)(=O)=O)cc3)nc2C)C(c2cccc(F)c2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "95d85c87-93c8-409b-a445-0799b6f56e8a",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nnc2n1-c1sc3c(c1C(c1ccccc1Cl)=NC2C)CCN(C(=O)Cc1ccc(OCc2ccc4ccccc4n2)cc1)C3 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nnc2n1-c1sc3c(c1C(c1ccccc1Cl)=NC2C)CCN(C(=O)Cc1ccc(OCc2ccc4ccccc4n2)cc1)C3",
+ "ref_smiles": "Cc1nnc2n1-c1sc3c(c1C(c1ccccc1C(=O)[OH])=NC2C)CCN(C(=O)Cc1ccc(OCc2ccc4ccccc4n2)cc1)C3",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1d663ecd-785c-4d76-8be4-75928711453e",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1cc(OC2OC(CO)C(O)C(O)C2O)ccc1C(=O)c1ccc(C#N)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OC2OC(CO)C(O)C(O)C2O)ccc1C(=O)c1ccc(C#N)cc1",
+ "ref_smiles": "Cc1cc(OC2OC(CO)C(O)C(O)C2O)ccc1C(=O)c1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "200e8a4d-bcce-4356-ae2c-2bff33837c24",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1cccc(NC(=O)CCCc2c[nH]c3ccccc23)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(NC(=O)CCCc2c[nH]c3ccccc23)c1.",
+ "ref_smiles": "Cc1cccc(CCc2c[nH]c3ccccc23)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5f87682b-e546-4945-9985-1cb29854a204",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCC(Oc1ccc(OS(=O)Nc2c(C)cc(C)c(-c3nnc4c(Cl)c(C)[nH]n34)c2C)cc1)C(=O)[O-] by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCC(Oc1ccc(OS(=O)Nc2c(C)cc(C)c(-c3nnc4c(Cl)c(C)[nH]n34)c2C)cc1)C(=O)[O-]",
+ "ref_smiles": "CCCCCCCCCCCCC(Oc1ccc(OS(=O)N(C)CCc2nnc3c(Cl)c(C)[nH]n23)cc1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f365702b-1eed-4cbc-bee2-79fcbd5701df",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule COc1cccnc1NC(C)C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccnc1NC(C)C#N.",
+ "ref_smiles": "CCNc1ncccc1OC",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "7602f7a4-6bb7-41ac-a5e3-837e394d0b84",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule O=c1nc(CSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)cc2)[nH]c2ccccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1nc(CSc2nnc(Cc3ccccc3)n2-c2ccc(Cl)cc2)[nH]c2ccccc12.",
+ "ref_smiles": "O=C(O)c1cc(Cl)ccc1-n1c(Cc2ccccc2)nnc1SCc1nc(=O)c2ccccc2[nH]1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "20974b57-1265-4034-bcf8-84604cc852f8",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(C#N)(CCCC(F)(F)F)NC1CCCCC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C#N)(CCCC(F)(F)F)NC1CCCCC1",
+ "ref_smiles": "CC(I)(CCCC(F)(F)F)NC1CCCCC1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "f0740b7a-5b84-4ce9-ba37-ee038f73d6ff",
+ "task": "sub",
+ "question": "Modify the molecule Brc1ncn(Cc2nccs2)n1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1ncn(Cc2nccs2)n1",
+ "ref_smiles": "Oc1ncn(Cc2nccs2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "67b23b46-c3c0-4b1a-a4c9-dfacbbb973fc",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)C2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)C2)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)N2CCOC(C)(N)C2)c(C)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "7c3a5e09-d67d-4a8c-b975-2930fef20fdd",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC#CCC(Cc1ccc(Cl)cc1)[NH2+]C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC#CCC(Cc1ccc(Cl)cc1)[NH2+]C.",
+ "ref_smiles": "CC#CCC(Cc1ccccc1)[NH2+]C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "07005add-04db-455e-a7ef-31be192e564b",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1",
+ "ref_smiles": "CC(O)Oc1ccccc1-c1noc(COC(=O)Cn2cnc3scc(-c4cccs4)c3c2=O)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "31150bbb-e4ae-43c3-ba86-55f6433cb2c8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C(=O)Nc2ccc(Cl)cc2C)cc1S(=O)(=O)N1CCCCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)Nc2ccc(Cl)cc2C)cc1S(=O)(=O)N1CCCCC1",
+ "ref_smiles": "COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2C)cc1S(=O)(=O)N1CCCCC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "38222995-d145-43e2-8cb0-8e156b307f84",
+ "task": "delete",
+ "question": "Modify the molecule CC(O)C(C)[NH2+]C1CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)C1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(C)[NH2+]C1CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)C1",
+ "ref_smiles": "CCC(C)[NH2+]C1CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7bc4d06f-f679-44db-8c6c-010312456ca1",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccccc3)c2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccccc3)c2)cc1C.",
+ "ref_smiles": "Cc1ccc(N2C(=O)C(O)=C(c3ccc(Cl)cc3)C2c2cccc(OCc3ccc(N)cc3)c2)cc1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "0a7327dc-2799-4250-b8ee-7f1399081b5a",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-]",
+ "ref_smiles": "CC(C)C(=CC(=O)NC(Cc1ccc(O)cc1)C(=O)[O-])c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ca630e70-a47c-4cb6-aed5-c230c2d88db6",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NC1(CCl)CCC1)C1COCCO1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1(CCl)CCC1)C1COCCO1",
+ "ref_smiles": "CC1(NC(=O)C2COCCO2)CCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0295bb35-b4e3-4061-9338-305612d06685",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC([NH+](C)CCCCC(C)(CO)[NH2+]C1CC1)C(C)(C)C with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH+](C)CCCCC(C)(CO)[NH2+]C1CC1)C(C)(C)C",
+ "ref_smiles": "CC([NH+](C)CCCCC(C)(CS)[NH2+]C1CC1)C(C)(C)C",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "70d2ffab-3b46-4efb-b5e7-4cbd6c28ce86",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCNc1nc(C)cc(N2CCC3CCCCC3C2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1nc(C)cc(N2CCC3CCCCC3C2)n1.",
+ "ref_smiles": "CCCc1nc(C)cc(N2CCC3CCCCC3C2)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bdc7f286-af1d-4b6b-8b6c-3419d6124a84",
+ "task": "add",
+ "question": "Modify the molecule O=PCCCc1cccc(O)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=PCCCc1cccc(O)c1",
+ "ref_smiles": "O=PCCCc1cc(O)ccc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eebe0e2f-0b81-4f2a-84c2-3a08009175a9",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOCCCNC(=O)c1cc(NC(=O)COC)ccc1N1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCCNC(=O)c1cc(NC(=O)COC)ccc1N1CCCC1.",
+ "ref_smiles": "COCC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCCCOCCO)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "86cc55ff-e164-467e-a481-bea3d8f4c585",
+ "task": "add",
+ "question": "Modify the molecule CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1",
+ "ref_smiles": "CO[SiH2]CCc1ccc(S(=O)(=O)[O-])cc1C#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "d8551743-dcd8-4a24-82dc-6ffbc7166494",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COP(=O)(OC)C(=C[N+](=O)[O-])C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COP(=O)(OC)C(=C[N+](=O)[O-])C(C)C.",
+ "ref_smiles": "COP(=O)(OC)C(=C(O)[N+](=O)[O-])C(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "21ffae1c-f191-4ce2-a3e4-9645d90faa16",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH+](CCC(N)=S)CC(=O)NC1CCCC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CCC(N)=S)CC(=O)NC1CCCC1",
+ "ref_smiles": "CC[NH+](CCC=S)CC(=O)NC1CCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "202cbbd0-f4ec-4b20-bbde-b9070fdd39b7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(N(F)c1ccccc1F)N(F)C(F)(F)[Si]OCO with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(N(F)c1ccccc1F)N(F)C(F)(F)[Si]OCO",
+ "ref_smiles": "O=C([OH])N(C(=O)N(F)C(F)(F)[Si]OCO)c1ccccc1F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "640351d9-6ca4-4ec7-8915-8a55f4e7688a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(NC(=O)c2ccc(NC(=O)C[NH+]3CCC(C(=O)NCCC(=O)Nc4ccccc4C(N)=O)CC3)c(C)c2)cc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccc(NC(=O)C[NH+]3CCC(C(=O)NCCC(=O)Nc4ccccc4C(N)=O)CC3)c(C)c2)cc1F",
+ "ref_smiles": "Cc1cc(C(=O)Nc2ccc(C)c(C(=O)[OH])c2)ccc1NC(=O)C[NH+]1CCC(C(=O)NCCC(=O)Nc2ccccc2C(N)=O)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "74c66dd6-24cc-4de3-be62-cfd3c5e96114",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)C(C)OC1C(NC(C)=O)C(OCc2ccccc2)OC2COC(c3ccccc3)OC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)OC1C(NC(C)=O)C(OCc2ccccc2)OC2COC(c3ccccc3)OC21.",
+ "ref_smiles": "COC(=O)C(C)OC1C(NC(C)=O)C(OC)OC2COC(c3ccccc3)OC21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "858c44c0-fc14-45aa-b021-ed02cc97c1b5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccccc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1.",
+ "ref_smiles": "COc1ccc(O)cc1C[NH2+]Cc1ccc(NC(=O)Nc2cnc(C#N)cn2)c(OC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f6173857-4a79-42b2-8505-8051bcbdb992",
+ "task": "delete",
+ "question": "Modify the molecule CC(C=C[NH2+]C(C)C)[NH+]=CN by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C=C[NH2+]C(C)C)[NH+]=CN",
+ "ref_smiles": "C=[NH+]C(C)C=C[NH2+]C(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4b0f1f9b-29cb-4f13-b5af-43841a59cf76",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Nc1cc(Oc2ccc(Cl)cc2Br)cc([N+](=O)[O-])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(Oc2ccc(Cl)cc2Br)cc([N+](=O)[O-])c1.",
+ "ref_smiles": "Nc1cc(Oc2ccc(Cl)cc2)cc([N+](=O)[O-])c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7a498fea-e725-4034-acb3-30687712f95e",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)c1ccc(Oc2ccc(Br)cc2F)cc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(Oc2ccc(Br)cc2F)cc1Cl",
+ "ref_smiles": "CC(=O)c1ccc(Oc2ccc(Br)cc2)cc1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f4160bb3-b94f-4eb0-8ea4-90ae7adcd31a",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)c1ccccc1OC(=O)c1ccc(N)cc1O by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccccc1OC(=O)c1ccc(N)cc1O",
+ "ref_smiles": "CC(C)c1ccccc1OC(=O)c1ccc(N)cc1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b9a7cdfb-e7ec-4ff5-8677-c9b46de1dde9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1ccccc1C(=O)N1CCCC(c2cc(CC(F)(F)F)no2)C1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccccc1C(=O)N1CCCC(c2cc(CC(F)(F)F)no2)C1",
+ "ref_smiles": "Nc1ccccc1C(=O)N1CCCC(c2cc(CC(O)(F)F)no2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9f88ce10-b0f2-4739-b1a4-d2c034f196c6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=[NH2+])NCCCC(NC(=O)C1CSSCC(NC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(CCCNC(N)=[NH2+])NC(=O)c2ccc(C(F)(F)F)cc2)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=O)C(=O)NC(CCCC[NH3+])C(=O)NC(CCC(=O)[O-])C(=O)N2CCCC2C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(CCCNC(N)=O)C(=O)N1)C(N)=O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH2+])NCCCC(NC(=O)C1CSSCC(NC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(CCCNC(N)=[NH2+])NC(=O)c2ccc(C(F)(F)F)cc2)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=O)C(=O)NC(CCCC[NH3+])C(=O)NC(CCC(=O)[O-])C(=O)N2CCCC2C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(CCCNC(N)=O)C(=O)N1)C(N)=O",
+ "ref_smiles": "NC(=[NH2+])NCCCC(NC(=O)C1CSSCC(NC(=O)C(Cc2ccc3ccccc3c2)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(CCCNC(N)=[NH2+])NC(=O)c2ccc(C(=O)H)cc2)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=O)C(=O)NC(CCCC[NH3+])C(=O)NC(CCC(=O)[O-])C(=O)N2CCCC2C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(CCCNC(N)=O)C(=O)N1)C(N)=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7e76dbeb-8d9a-4c1a-a345-a54560b8dc48",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1CCCCN1C(=O)C[NH+]1CCN(C(=O)c2cccn(C)c2=O)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCCN1C(=O)C[NH+]1CCN(C(=O)c2cccn(C)c2=O)CC1.",
+ "ref_smiles": "Cn1cccc(C(=O)N2CC[NH+](CC(=O)N3CCCCC3(C)O)CC2)c1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b7bc8ed4-dbff-4bf3-8a70-998a4b2f36bb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule [NH3+]CCN(CCOc1ccccc1F)CCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCN(CCOc1ccccc1F)CCc1ccccc1.",
+ "ref_smiles": "[NH3+]CCN(CCOc1ccccc1F)CCc1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f0ef9b99-87e2-490c-af72-7ef0cd4bde3c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)=CC(=O)N(C)CCC(C)O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)=CC(=O)N(C)CCC(C)O",
+ "ref_smiles": "CC(C)=CC(=O)N(C)CCC(C)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "def38247-8f6b-4545-9223-34f4a6cd278d",
+ "task": "add",
+ "question": "Modify the molecule CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)cc1",
+ "ref_smiles": "CN(Cc1ccc(OC(F)F)cc1)C(=O)CSCc1ccc(C#N)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9dcb8626-23e1-404e-b8a4-76ea46f896d0",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1ccc2c(c1)C(=O)CC2)NC1CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc2c(c1)C(=O)CC2)NC1CCCCC1",
+ "ref_smiles": "Nc1cc(NC(=O)NC2CCCCC2)cc2c1CCC2=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "467e4038-9a63-4ce3-b78d-cfdfe41f9d1a",
+ "task": "delete",
+ "question": "Modify the molecule CC1CN(CC(=O)NC2CCCC2)CC(C)[NH2+]1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(CC(=O)NC2CCCC2)CC(C)[NH2+]1",
+ "ref_smiles": "CC1CN(C2CCCC2)CC(C)[NH2+]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "41262ccc-db86-42e7-ac72-9038338d1f91",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCON=Cc1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCON=Cc1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1.",
+ "ref_smiles": "CCON=C(C(=O)O)c1cccc(CCOc2cc(CC)cc(OS(=O)(=O)c3ccccc3Cl)c2)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7bf8c0c5-d4fe-4d68-9c9e-b8e1f528281b",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule OCCCNC(=S)Nc1ccc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCCNC(=S)Nc1ccc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc2c1.",
+ "ref_smiles": "N#Cc1cc(NC(=S)NCCCO)cc2nc(-c3ccc[nH]3)c(-c3ccc[nH]3)nc12",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "58eba152-fffa-4baf-9062-c8875096858f",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-c2nc(CC(=O)OCC(=O)NC(=O)NC(C)C)cs2)cc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc(CC(=O)OCC(=O)NC(=O)NC(C)C)cs2)cc1",
+ "ref_smiles": "COc1ccc(-c2nc(CC(=O)OC(=O)NC(C)C)cs2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3ba24f06-1fc3-4968-8ece-f2bb154d9fe3",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)OCCCCCCCCOCCO by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)OCCCCCCCCOCCO",
+ "ref_smiles": "CC(C)OCCCCCCCCOCCC(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bf6ce6e4-1ce5-47ba-aeb8-db6277f9b542",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCC1C[NH2+]CC1O)c1cn(Cc2ccccc2)nn1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1C[NH2+]CC1O)c1cn(Cc2ccccc2)nn1",
+ "ref_smiles": "O=C(NCC1C[NH2+]CC1)c1cn(Cc2ccc([N+](=O)[O-])cc2)nn1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d2b03128-3ad7-49f3-8b63-e78f8a68aefb",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOCC1",
+ "ref_smiles": "Cc1cccc(C)c1-n1nnnc1SCC(=O)NCC(C)(C)[NH+]1CCOC(N)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "c6917067-37d6-496b-9a78-c46b2df73235",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(OCC(O)C(C)(C)O)cc(C)c1-c1c(C(F)(F)F)ccc2c1CCC2Oc1ccc2c(c1)OCC2CC(=O)[O-] by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(OCC(O)C(C)(C)O)cc(C)c1-c1c(C(F)(F)F)ccc2c1CCC2Oc1ccc2c(c1)OCC2CC(=O)[O-]",
+ "ref_smiles": "Cc1cc(OCC(O)C(C)(C)O)cc(C)c1-c1c(C(F)(F)C#N)ccc2c1CCC2Oc1ccc2c(c1)OCC2CC(=O)[O-]",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "098557b7-1899-4680-9304-1987ab25f677",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1ccccc1C1C[NH2+]CCN1Cc1cc(Br)c(OC)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C1C[NH2+]CCN1Cc1cc(Br)c(OC)s1.",
+ "ref_smiles": "COc1ccc(CN2CC[NH2+]CC2c2ccccc2OC)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0b1e23cd-a6dc-4f7c-832c-be059c3542f0",
+ "task": "delete",
+ "question": "Modify the molecule [C-]#[N+]C(=Cc1ccc(OC)cc1)C(=O)OCCCCCCCCCC by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[C-]#[N+]C(=Cc1ccc(OC)cc1)C(=O)OCCCCCCCCCC",
+ "ref_smiles": "[C-]#[N+]C(=CH)C(=O)OCCCCCCCCCC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2ba711ac-8cec-46c6-90a6-e43d7983ed2a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCC(C=C(C)C(=O)[O-])C(CC)CO with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C=C(C)C(=O)[O-])C(CC)CO",
+ "ref_smiles": "CCCC(C=C(C)C(=O)[O-])C(CC)CBr",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d0c13306-5c5d-4fc1-8fa7-ea3749ec6b4f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(C)cc1.",
+ "ref_smiles": "CNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d7850cbe-68a1-433b-aa4c-adbe7855395e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1.",
+ "ref_smiles": "COC(=O)N1CC(c2nc(-c3ccc(C)c(NC(=O)c4c(O)[nH+]c5cc(CCC(C)(C)O)ccn45)c3)no2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "946b89b2-2612-4adc-92b8-e58e4f5803e4",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)NC(=O)C(=O)NCC(O)(c1ccsc1)c1cccs1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)C(=O)NCC(O)(c1ccsc1)c1cccs1",
+ "ref_smiles": "CC(C)NC(=O)C(=O)NCC(c1ccsc1)c1cccs1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1d386173-021d-4651-afb4-601203553a99",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(Nc1ccc(Oc2cccc3c2ccn3CC(=O)N2CC[NH+](C(Cc3ccccc3)C3=COCO3)CC2)nc1)c1ccc(C(F)(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(Oc2cccc3c2ccn3CC(=O)N2CC[NH+](C(Cc3ccccc3)C3=COCO3)CC2)nc1)c1ccc(C(F)(F)F)cc1.",
+ "ref_smiles": "O=C(Nc1ccc(Oc2cccc3c2ccn3C2CC[NH+](C(Cc3ccccc3)C3=COCO3)CC2)nc1)c1ccc(C(F)(F)F)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "20adb771-f35f-490c-bb7e-f3fe26dce5cd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(OCC(=O)c1cc(Cl)ccc1Cl)c1ccc(-c2ccccc2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OCC(=O)c1cc(Cl)ccc1Cl)c1ccc(-c2ccccc2)cc1",
+ "ref_smiles": "O=C([OH])c1ccc(C(=O)COC(=O)c2ccc(-c3ccccc3)cc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0dddf7e5-ace0-4dea-9197-90f2a5f81696",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCc1c(C)sc(NC(=O)C(F)(F)C(F)F)c1C#N with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1c(C)sc(NC(=O)C(F)(F)C(F)F)c1C#N",
+ "ref_smiles": "CCc1c(C)sc(NC(=O)C(F)(F)C(F)F)c1Cl",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "56c44d50-c66e-4091-bd75-d785f46fd363",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule [NH3+]C1CCC(NC(=O)c2ccc3[nH+]c(-c4ccccc4)cn3c2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CCC(NC(=O)c2ccc3[nH+]c(-c4ccccc4)cn3c2)C1.",
+ "ref_smiles": "[NH3+]C1CCC(NC(=O)c2ccc3[nH+]ccn3c2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "19aa1bce-902a-4422-bfc9-541fe3eabb87",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(Cl)c(C(=O)c2ccccc2)cc1Br with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)c(C(=O)c2ccccc2)cc1Br",
+ "ref_smiles": "COc1cc(O)c(C(=O)c2ccccc2)cc1Br",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f4867874-3ae3-4820-8f1a-32f59ce4fc04",
+ "task": "add",
+ "question": "Modify the molecule CCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)[O-])n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ncc(C(=O)c2ccc(C)c(C)c2)c(C(=O)[O-])n1",
+ "ref_smiles": "CCCc1ncc(C(=O)c2ccc(C)c(C)c2O)c(C(=O)[O-])n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3e16dbf9-a7ac-4645-889c-83db1c064c47",
+ "task": "delete",
+ "question": "Modify the molecule Cc1sc2ncn(CCC(=O)N(C)C3CC[NH2+]C3)c(=O)c2c1C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1sc2ncn(CCC(=O)N(C)C3CC[NH2+]C3)c(=O)c2c1C",
+ "ref_smiles": "Cc1sc2ncn(CC3(C)CC[NH2+]C3)c(=O)c2c1C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9ff50ded-bc06-4464-b249-273b0201f4ce",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(N=Cc2ccc(OCc3ccccc3)cc2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N=Cc2ccc(OCc3ccccc3)cc2)cc1OC.",
+ "ref_smiles": "COc1ccc(N=COCc2ccccc2)cc1OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "791b04d8-dc01-47ce-b01b-04e349124883",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)CC1.",
+ "ref_smiles": "CC(C)S(=O)(=O)N1CCC(NC(=O)N2CCCc3ccccc3CC2)C(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2d6ea402-6564-4cfe-abce-fd87557a5fda",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1)N(C)C(=O)c1ccc(Cl)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1)N(C)C(=O)c1ccc(Cl)c(Cl)c1.",
+ "ref_smiles": "CN(C(=O)c1ccc(Cl)c(Cl)c1)C(CCO)c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0f66ca9a-0ea1-46f1-9dff-661b67502640",
+ "task": "delete",
+ "question": "Modify the molecule CCOCc1nc2c(N)nc3c(c2n1CC(C)(C)O)CCCC3 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCc1nc2c(N)nc3c(c2n1CC(C)(C)O)CCCC3",
+ "ref_smiles": "CCOCc1nc2cnc3c(c2n1CC(C)(C)O)CCCC3",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "40a73c6d-4236-42ff-b2ab-c3caeae1fb3b",
+ "task": "add",
+ "question": "Modify the molecule O=C(NC1CC(C(=O)[O-])C1)c1cncc(-c2ccc3c(c2)CCO3)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CC(C(=O)[O-])C1)c1cncc(-c2ccc3c(c2)CCO3)c1",
+ "ref_smiles": "O=CCC1(NC(=O)c2cncc(-c3ccc4c(c3)CCO4)c2)CC(C(=O)[O-])C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "7403a0bf-0075-48ab-a557-676c86bd9371",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)NC(CC1CCCCC1)C(O)CS(=O)(=O)C(C)C by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)NC(CC1CCCCC1)C(O)CS(=O)(=O)C(C)C",
+ "ref_smiles": "CC(=O)NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)NC(CC1CCCCC1)C(Br)CS(=O)(=O)C(C)C",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "602e7e85-24cc-440d-81ca-907f9596c519",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CC[NH+](CC1(CS)CCCCCC1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC1(CS)CCCCCC1)C1CC1.",
+ "ref_smiles": "CC[NH+](CC1(CS)CCCCCC1CC=O)C1CC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "1c0655e0-d71c-483c-abdf-6699ae244df8",
+ "task": "delete",
+ "question": "Modify the molecule Cn1nccc1-c1cc(NC(=O)COc2ccc(C#N)cc2)ccc1OCC[NH+]1CCOCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nccc1-c1cc(NC(=O)COc2ccc(C#N)cc2)ccc1OCC[NH+]1CCOCC1",
+ "ref_smiles": "Cn1nccc1-c1cc(NC(=O)COC#N)ccc1OCC[NH+]1CCOCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b9b6e353-f2be-46d6-adfe-afccec557062",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1.",
+ "ref_smiles": "Cc1ccc(NC(=O)c2ccc(C)c(NC(=O)C(c3ccccc3)[NH+]3CCC(C(=O)Nc4ccc(NC(=O)c5ccccc5C)c(C)c4)CC3)c2)c(F)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c5f078ef-e204-4ed3-820a-7ad6386111eb",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCCCCCCc1cccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCc1cccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC.",
+ "ref_smiles": "CCCCCCCCCc1c(O)ccc(SSOP(=O)([O-])[O-])c1CCCCCCCCC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c469023e-f3d5-49ae-865f-a87b96358bc1",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC1CCc2sc(-c3nnc(SCC(=O)NC4CCCCC4C)o3)cc2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCc2sc(-c3nnc(SCC(=O)NC4CCCCC4C)o3)cc2C1.",
+ "ref_smiles": "CC1CCc2sc(-c3nnc(SC4CCCCC4C)o3)cc2C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5f8234f5-8d55-4f8d-93a0-7761dfac696c",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)C(NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)O)C(=O)NC(CCC(N)=O)C(=O)[O-] by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)O)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "ref_smiles": "CC(C)C(NC(=O)C(NC(=O)C1CCC[NH2+]1)C(C)Cl)C(=O)NC(CCC(N)=O)C(=O)[O-]",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "447a6e72-94ab-46b2-ad90-3f56747dd4b8",
+ "task": "add",
+ "question": "Modify the molecule Cc1cnc(C[NH2+]CC2CCCOC2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnc(C[NH2+]CC2CCCOC2)cn1",
+ "ref_smiles": "OCc1cnc(C[NH2+]CC2CCCOC2)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7a03e687-db24-4d64-9546-90915b7ebee4",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O[P+](O)(O)CCc1nc2ccccc2[nH]1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O[P+](O)(O)CCc1nc2ccccc2[nH]1",
+ "ref_smiles": "O[P+](O)(F)CCc1nc2ccccc2[nH]1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e28ed0de-0213-4786-be76-51a33b8e9be6",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)c1ccc(NC(=O)N(Cc2nc(C(=O)N3CCC(C(N)=O)CC3)cs2)C(C)C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(NC(=O)N(Cc2nc(C(=O)N3CCC(C(N)=O)CC3)cs2)C(C)C)cc1.",
+ "ref_smiles": "CC(C)NC(=O)N(Cc1nc(C(=O)N2CCC(C(N)=O)CC2)cs1)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d7cbf120-612f-429e-b75d-05a591e95eb0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1ccccc1.",
+ "ref_smiles": "CCC(C)NC(=O)C(CC)N(Cc1ccc(Cl)cc1)C(=O)CCSc1cccc(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "09a73aa5-4aa8-492d-8c14-91d07f6945e9",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOc1c(OC)cccc1C1=C(O)C(=O)N(c2ccccc2F)C1c1c(C)[nH]c2ccccc12 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1c(OC)cccc1C1=C(O)C(=O)N(c2ccccc2F)C1c1c(C)[nH]c2ccccc12",
+ "ref_smiles": "CCOc1c(OC)cccc1C1=C(Br)C(=O)N(c2ccccc2F)C1c1c(C)[nH]c2ccccc12",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cf6aacc3-56cd-4465-a0b6-f2c9c55ebe7d",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(Cl)c(C)cc1NCc1cn[nH]c1C by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)c(C)cc1NCc1cn[nH]c1C",
+ "ref_smiles": "COc1cc(C#N)c(C)cc1NCc1cn[nH]c1C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "669ced48-b845-4a54-926a-8fde75de7040",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COCC(=O)NCc1cccc(C(=Nc2ccc(C[NH+](C)C)cc2)c2c(O)[nH]c3cc(F)ccc23)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(=O)NCc1cccc(C(=Nc2ccc(C[NH+](C)C)cc2)c2c(O)[nH]c3cc(F)ccc23)c1.",
+ "ref_smiles": "COCC(=O)NCc1cccc(C(=NC[NH+](C)C)c2c(O)[nH]c3cc(F)ccc23)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c0640e36-206f-4875-b371-3e5555680d00",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(c1ccc(F)cc1)C(O)Cc1ccc(Br)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(c1ccc(F)cc1)C(O)Cc1ccc(Br)cn1",
+ "ref_smiles": "CC(C)(c1ccc(F)cc1)C(O)Cc1ncc(Br)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "758da41d-d7ae-4c5d-a223-04ef3a5a3265",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NCC1CCCCC1c1ccccc1)NC1CCC2C[NH2+]CC2C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1CCCCC1c1ccccc1)NC1CCC2C[NH2+]CC2C1",
+ "ref_smiles": "O=C(NCC1CCCCC1)NC1CCC2C[NH2+]CC2C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "23c37382-8595-48ec-bdd2-246e900e3291",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCC(CC(C[NH3+])Cc2ccc(Cl)cc2)O1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(CC(C[NH3+])Cc2ccc(Cl)cc2)O1",
+ "ref_smiles": "CC1CCC(CC(C[NH3+])CCl)O1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ea83075b-358e-4cd4-a6bf-f1b8eec2278b",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4ccc(F)c(C(F)(F)F)c4)nn23)cc1OC by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4ccc(F)c(C(F)(F)F)c4)nn23)cc1OC",
+ "ref_smiles": "COc1ccc(-c2nnc3ccc(OCCNS(=O)(=O)c4ccc(C#N)c(C(F)(F)F)c4)nn23)cc1OC",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "873c1942-b443-4105-ad4f-6ddcecd6cf87",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(O)C(C)(C)[NH2+]Cc1c[nH]c2cc(Cl)ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(C)(C)[NH2+]Cc1c[nH]c2cc(Cl)ccc12.",
+ "ref_smiles": "CCC(C)(C)[NH2+]Cc1c[nH]c2cc(Cl)ccc12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cc0f1532-bb9a-4f09-b480-1d44593b1cc0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCCN(CCOC)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN(CCOC)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1.",
+ "ref_smiles": "COCCN(CCOCO)C(=O)N1CCCC(NC(=O)COc2ccc(C)cc2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5410f117-be5f-4dc7-a6b1-f015fcaf3ed3",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2ccccc2)n1C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2ccccc2)n1C",
+ "ref_smiles": "Cc1c(N=Cc2ccc(-c3ccc(Br)cc3C(=O)[O-])o2)c(=O)n(-c2cccc(N)c2)n1C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "df29885e-2031-4d66-82b0-f4fd16f6d410",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCOc1ccc(N2C(=O)C(O)=C(c3cccc4ccccc34)C2c2cccc(OCC)c2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(N2C(=O)C(O)=C(c3cccc4ccccc34)C2c2cccc(OCC)c2)cc1",
+ "ref_smiles": "CCCOc1ccc(N2C(=O)C(S)=C(c3cccc4ccccc34)C2c2cccc(OCC)c2)cc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0de9a48c-e35b-476d-ab86-3b80bf7c772a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C=CC(C)Oc1ccc(Br)c(CC([NH3+])CC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(C)Oc1ccc(Br)c(CC([NH3+])CC)c1.",
+ "ref_smiles": "C=CC(C)Oc1cccc(CC([NH3+])CC)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "74eb0e32-18c1-4637-95d6-e2644c8c90f2",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccccc1NC1=C(Cl)C(=O)N(c2ccc(F)c(F)c2F)C1=O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccccc1NC1=C(Cl)C(=O)N(c2ccc(F)c(F)c2F)C1=O",
+ "ref_smiles": "O=C1C(Cl)=C(Nc2ccccc2I)C(=O)N1c1ccc(F)c(F)c1F",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "e52e5e08-babf-47c8-b31b-b44bcb954acd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CNC(=O)c1cccc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(F)ccc4C)ccc3C)CC2)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1cccc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(F)ccc4C)ccc3C)CC2)c1",
+ "ref_smiles": "CNC(=O)c1cccc(NC(=O)C2CCCN2C(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(C(=O)O)ccc4C)ccc3C)CC2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d4517f71-ac7f-4a4b-8970-1bbaba999cc1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1cnc(CCn2cncc2CCl)n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cnc(CCn2cncc2CCl)n1",
+ "ref_smiles": "Cn1cnc(CCn2cncc2CS)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8356fa0f-116e-487c-b5d9-116f151b1632",
+ "task": "add",
+ "question": "Modify the molecule CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1",
+ "ref_smiles": "CCc1c(C(=O)N2CCC(C)(C(=O)[O-])C2)cnn1-c1cccc(Cl)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "67959a53-02c3-4598-9ba6-3f2647359a83",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)cc2)ccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)cc2)ccc1F.",
+ "ref_smiles": "Cc1cc(S(=O)(=O)[N-]c2ccc(C(=O)N(C)C)c(O)cc2)ccc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d965630e-1ee3-49ff-bd8a-cd2111559c36",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule NC(=O)CCC(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CCC(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1.",
+ "ref_smiles": "NC(=O)CC(C(=O)N1CCC(C2CC[NH+](Cc3cccc(F)c3F)CC2)C1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ddfe0693-3b12-455b-8f5d-13bf1a63d686",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1CN(C(N)=[NH2+])CCN1c1ccc2[nH+]c(-c3ccc(C(F)(F)F)c(NC(=O)C(C)(C)C)c3)cn2n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(C(N)=[NH2+])CCN1c1ccc2[nH+]c(-c3ccc(C(F)(F)F)c(NC(=O)C(C)(C)C)c3)cn2n1.",
+ "ref_smiles": "CC1CN(C(N)=[NH2+])CCN1c1ccc2[nH+]c(-c3ccc(C)c(NC(=O)C(C)(C)C)c3)cn2n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b216c74-1773-471d-b94a-13be8255635a",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCC1CC[NH+](C2CCCCC2C(C)C)CC(C)C[NH2+]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CC[NH+](C2CCCCC2C(C)C)CC(C)C[NH2+]1.",
+ "ref_smiles": "CCC1[NH2+]CC(C)C[NH+](C2CCCCC2C(C)C)CC1CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "06f3d299-9095-4f29-9698-1148f3947995",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4)nn3c2=O)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4)nn3c2=O)cc1F.",
+ "ref_smiles": "CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C=c2sc3nc(C=Cc4ccc(F)cc4O)nn3c2=O)cc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c005580f-b9a3-4b13-a9ec-eeb7a9607f1f",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(Cl)CCc1cc2c(s1)CCOC2 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Cl)CCc1cc2c(s1)CCOC2",
+ "ref_smiles": "Nc1c(CCS(=O)(=O)Cl)sc2c1COCC2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "699dcbc8-e160-4eac-b587-9f50a2d7c612",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCOc1ccc(C(=O)NCCOCC(F)(F)F)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOc1ccc(C(=O)NCCOCC(F)(F)F)cc1",
+ "ref_smiles": "CCCCOc1ccc(C(=O)NCCOCC(F)(F)NO)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f74691dd-b1de-46b9-b7fd-9a100e3d2842",
+ "task": "add",
+ "question": "Modify the molecule CCN(CC)C1(C#N)CC[NH+](C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)C1(C#N)CC[NH+](C)CC1",
+ "ref_smiles": "CCN(CCO)C1(C#N)CC[NH+](C)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1f6d96bd-a36d-47c0-9365-cd6040ea79fa",
+ "task": "sub",
+ "question": "Modify the molecule CCOc1cc(C[NH2+]CCc2ccccc2F)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C[NH2+]CCc2ccccc2F)c(Br)cc1OCc1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "CCOc1cc(C[NH2+]CCc2ccccc2C#N)c(Br)cc1OCc1ccc(Cl)c(Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f98e0a1d-9359-41e4-89b5-90d4c820607a",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CN(c2cncc(C(=O)[O-])n2)CC1(C)O by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CN(c2cncc(C(=O)[O-])n2)CC1(C)O",
+ "ref_smiles": "CC1CN(c2cncc(C(=O)[O-])n2)CC1(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b90e1526-dba4-4fe9-86de-6a9cdffb4b51",
+ "task": "delete",
+ "question": "Modify the molecule C=CCCOCC[NH2+]C(C)C(=O)NC(CC)CC by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCCOCC[NH2+]C(C)C(=O)NC(CC)CC",
+ "ref_smiles": "C=CCCOCC[NH2+]C(C)(CC)CC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ff44baf4-cbea-4d96-ba62-7e159716a0e1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CSC(N)=[NH+]c1cc(Cl)ccc1Oc1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSC(N)=[NH+]c1cc(Cl)ccc1Oc1ccccc1",
+ "ref_smiles": "CSC(N)=[NH+]c1cc(S)ccc1Oc1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "19b8af36-c304-4240-a2c0-94d4350360c0",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCS(=O)C1CCCC(NC(NCCCc2cccc(OC)c2)=[NH+]C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCS(=O)C1CCCC(NC(NCCCc2cccc(OC)c2)=[NH+]C)C1.",
+ "ref_smiles": "CCS(=O)C1CCCC(NC(NCCCc2cccc(OCC(=O)O)c2)=[NH+]C)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c3dfc8c9-02f0-4852-ab87-c59975b7242a",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCn1ccn(CC(Cl)C#N)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1ccn(CC(Cl)C#N)c1=O.",
+ "ref_smiles": "N#CC(Cl)Cn1ccn(CCc2ccccc2)c1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d2fd254f-e208-4832-9474-c72789ace218",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1nn(C(=O)CNc2cccc(Cl)c2C)c(C)c1Cc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C(=O)CNc2cccc(Cl)c2C)c(C)c1Cc1ccccc1.",
+ "ref_smiles": "Cc1nn(C(=O)CNc2cccc(Cl)c2C)c(C)c1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "dcd8be78-5162-4daf-8dc4-80db039ba1b6",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C(=O)Nc1cc(F)cc(Cl)c1)C(N)=S.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)Nc1cc(F)cc(Cl)c1)C(N)=S.",
+ "ref_smiles": "CC(C(=O)Nc1cccc(F)c1)C(N)=S",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "32416782-f093-41c6-9373-004caf0cc55b",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccc(C(=O)C(C#N)C(=O)C2CC2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(C(=O)C(C#N)C(=O)C2CC2)cc1",
+ "ref_smiles": "O=[N+]([O-])c1ccc(C(=O)C(C#N)C(=O)C2CC2)cc1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1a523bfa-0ab8-4b20-94d1-552f699adafc",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C=CC(=O)N1CCC(Oc2cnc3ncc(-c4n[nH]c(C)n4)c-3[nH]2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)N1CCC(Oc2cnc3ncc(-c4n[nH]c(C)n4)c-3[nH]2)CC1.",
+ "ref_smiles": "Cc1nc(-c2cnc3ncc(OC4CCC(C)C4)[nH]c2-3)n[nH]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1811bc70-e66b-460a-9344-e1c047bafdc8",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(N(C)c2c(N)c[nH+]cc2Br)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(N(C)c2c(N)c[nH+]cc2Br)cc1",
+ "ref_smiles": "COc1ccc(N(C)c2cc[nH+]cc2N)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bea66c6a-48e2-4b05-9f1e-8d476e4c8420",
+ "task": "delete",
+ "question": "Modify the molecule CC(NC(=O)c1ccc(OCc2cscn2)cc1)c1ccccc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1ccc(OCc2cscn2)cc1)c1ccccc1Cl",
+ "ref_smiles": "CC(NC(=O)c1ccc(OCc2cscn2)cc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "857f43c6-cd8c-4c95-961d-9730b818feca",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2C)C(C)C(=O)NC(C)(C)C)c2ccc(F)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2C)C(C)C(=O)NC(C)(C)C)c2ccc(F)cc2)cc1.",
+ "ref_smiles": "COc1ccc(S(=O)(=O)N(F)CC(=O)N(Cc2ccccc2C)C(C)C(=O)NC(C)(C)C)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "57e6da3c-ff62-4b3c-a79d-7f16cd58a0b7",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cccc(OCC(=O)NC2CCN(C(=O)N3CC[NH+](Cc4ccccc4)CC3)CC2)c1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(OCC(=O)NC2CCN(C(=O)N3CC[NH+](Cc4ccccc4)CC3)CC2)c1",
+ "ref_smiles": "CCc1cccc(OC2CCN(C(=O)N3CC[NH+](Cc4ccccc4)CC3)CC2)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "89e988a4-c121-4e91-9000-a0bdc48a4c1b",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ccc(C(F)(F)C(O)OCC)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(C(F)(F)C(O)OCC)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(C(F)C(O)OCC)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "58765a5f-7d5a-4ff4-a103-fe891eb4beb2",
+ "task": "delete",
+ "question": "Modify the molecule COC(C)(CCOOC1(OOCCC(C)(OC)OO)CCCCC1)OO by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C)(CCOOC1(OOCCC(C)(OC)OO)CCCCC1)OO",
+ "ref_smiles": "COC(C)(CCOOC1(OOCCC(C)(OC)OO)CCCCC1)OO",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1593a70e-73c7-40b4-aa4c-e9123a6d4bdd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1cc(=O)n(CC(=O)Nc2cccc(SC)c2)c(-c2cccc(F)c2)n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(=O)n(CC(=O)Nc2cccc(SC)c2)c(-c2cccc(F)c2)n1",
+ "ref_smiles": "CCc1cc(=O)n(CC(=O)Nc2cccc(SC)c2)c(-c2cccc(C(=O)[OH])c2)n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9adcc156-8e01-4fd8-852c-794d70f49042",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCSC(C)CCCl by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCSC(C)CCCl",
+ "ref_smiles": "CCCCCCSC(C)(CCCl)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5f537486-31d8-4b14-b3fc-0646173b8c5a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCCC(O)c1ccc(CN(Cc2ccc(OCC(=O)[O-])cc2)S(=O)(=O)c2ccccn2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(O)c1ccc(CN(Cc2ccc(OCC(=O)[O-])cc2)S(=O)(=O)c2ccccn2)cc1",
+ "ref_smiles": "CCCCCC(C#N)c1ccc(CN(Cc2ccc(OCC(=O)[O-])cc2)S(=O)(=O)c2ccccn2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "343e9497-6493-48d7-b138-c93aee5b2490",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccccc1C[NH+]1CCN2C(=O)C(CO)N(C)C(=O)C2C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C[NH+]1CCN2C(=O)C(CO)N(C)C(=O)C2C1",
+ "ref_smiles": "COc1ccccc1C[NH+]1CCN2C(=O)C(CNO)N(C)C(=O)C2C1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "02985827-a0de-4416-a3ef-88b3c6d24e85",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(=O)C(Br)C[NH+](C)CCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(Br)C[NH+](C)CCc1ccccc1.",
+ "ref_smiles": "COC(=O)C(Br)C[NH+](C)CCc1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f4ea222a-14aa-478e-803b-1b8732a3de9e",
+ "task": "add",
+ "question": "Modify the molecule CC(NC(=O)N1CCc2ccc(F)cc2C1)c1ccccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)N1CCc2ccc(F)cc2C1)c1ccccn1",
+ "ref_smiles": "CC(NC(=O)N1CCc2ccc(F)cc2C1)c1cccc(O)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1d525704-f14b-4f0b-b0e7-2be01a5bf9df",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C1=C(OC(C)C#Cc2ccccc2)CCCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1=C(OC(C)C#Cc2ccccc2)CCCC1",
+ "ref_smiles": "C#CC(C)OC1=C(C(=O)OCC)CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e24d81cf-a341-46a7-867c-e51a0e95d466",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nn(C)c(Cl)c1S(=O)(=O)NCC(C)(O)c1ccccc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(Cl)c1S(=O)(=O)NCC(C)(O)c1ccccc1",
+ "ref_smiles": "Cc1nn(C)c(Cl)c1S(=O)(=O)NCC(C)(F)c1ccccc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1b2758ec-7bd9-46bf-b83c-de2a2a45bc0d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nnc(-c2ccc(-c3ccc(CC(=O)[O-])cc3)cc2)n1NC(=O)OC(C)c1ccccc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nnc(-c2ccc(-c3ccc(CC(=O)[O-])cc3)cc2)n1NC(=O)OC(C)c1ccccc1Cl",
+ "ref_smiles": "Cc1nnc(-c2ccc(-c3ccc(CC(=O)[O-])cc3)cc2)n1NC(=O)OC(C)c1ccccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3bf4407e-46b2-44af-9908-e255d53c771e",
+ "task": "sub",
+ "question": "Modify the molecule CC[NH2+]C(CSc1ccc(F)cc1)C(C)CCOC by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(CSc1ccc(F)cc1)C(C)CCOC",
+ "ref_smiles": "CC[NH2+]C(CSc1ccc(S)cc1)C(C)CCOC",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "833e4697-25c3-4827-90c6-7cda4fa381e3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC1(C)CC1C[NH2+]Cc1ccc(C(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC1C[NH2+]Cc1ccc(C(F)F)cc1.",
+ "ref_smiles": "CC1(C)CC1C[NH2+]CC(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5b46f82b-2fdb-4018-bab5-683c59a828f7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C2(CCC[NH3+])COC2)cc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2(CCC[NH3+])COC2)cc1Cl",
+ "ref_smiles": "COc1ccc(C2(CCC[NH3+])COC2)cc1[N+](=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a9ce1821-c7f3-4252-944b-86544f0051d2",
+ "task": "add",
+ "question": "Modify the molecule Cc1nn(C)c(N2CC(C)C(C)C2)c1CC[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(N2CC(C)C(C)C2)c1CC[NH3+]",
+ "ref_smiles": "Cc1nn(CO)c(N2CC(C)C(C)C2)c1CC[NH3+]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2603e2bb-8700-4d6a-8d62-6f5d77c732e1",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)NC(=O)CCNC(=O)c1c(N)cccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)CCNC(=O)c1c(N)cccc1Cl.",
+ "ref_smiles": "CC(C)NC(=O)CCNC(=O)c1ccccc1N",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b8ae32a4-424c-441c-8946-7c3ea0be794e",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC1(C)CCN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)C1.",
+ "ref_smiles": "CC1(C)CN(C(=O)c2c(F)ccc(S(N)(=O)=O)c2F)CC1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "324c4493-6c67-4756-9194-9d6adff79196",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1",
+ "ref_smiles": "Cc1cc(O)ccc1-c1nnc(C[NH+](C)C2CCC(CO)CC2)o1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dfdd037c-edde-48cc-a249-e604394a8097",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)NC2CCCN(S(C)(=O)=O)C2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCCC2C(=O)NC2CCCN(S(C)(=O)=O)C2)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(S(=O)(=O)N2CCC2C2CCCN(S(C)(=O)=O)C2)c(C)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ea242be6-c5d5-449c-ac07-63f0ade734dc",
+ "task": "sub",
+ "question": "Modify the molecule COc1ccc(C(=O)NCCCNC(=O)C2CCCN2C(=O)c2ccc(Cl)c(Cl)c2)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)NCCCNC(=O)C2CCCN2C(=O)c2ccc(Cl)c(Cl)c2)cc1",
+ "ref_smiles": "COc1ccc(C(=O)NCCCNC(=O)C2CCCN2C(=O)c2ccc(C(=O)O)c(Cl)c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ab8e0b87-e8cf-430b-a5f5-a16a4e149588",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Nc1nc(NCCO)nc(C2CC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nc(NCCO)nc(C2CC2)n1.",
+ "ref_smiles": "Nc1nc(CCO)nc(C2CC2)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d2210cb7-2126-4d5a-b28b-d950da7eea14",
+ "task": "add",
+ "question": "Modify the molecule Cc1nccn1Cc1nnc(C2CCCN(C(=O)c3cc[nH]c3)C2)n1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nccn1Cc1nnc(C2CCCN(C(=O)c3cc[nH]c3)C2)n1C",
+ "ref_smiles": "Cc1nccn1Cc1nnc(C2(O)CCCN(C(=O)c3cc[nH]c3)C2)n1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bc22d1c0-8f7b-40c4-8874-f6d64da52531",
+ "task": "sub",
+ "question": "Modify the molecule Cn1nc(Br)c2c1S(=O)(=O)CCN2 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc(Br)c2c1S(=O)(=O)CCN2",
+ "ref_smiles": "Cn1nc(O)c2c1S(=O)(=O)CCN2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a58afda5-7171-4335-b2af-5b0f8558b759",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)c1ccc(Oc2coc3c(C[NH+]4CCN(c5ccc(OC)cc5)CC4)c(=O)ccc-3c2O)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(Oc2coc3c(C[NH+]4CCN(c5ccc(OC)cc5)CC4)c(=O)ccc-3c2O)cc1",
+ "ref_smiles": "COc1ccc(N2CC[NH+](Cc3c4occ(Oc5ccc(C(=O)OC(C)N)cc5)c(O)c-4ccc3=O)CC2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "c551f2f5-09bb-4953-b891-0798edee41c8",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule Nc1cnc2c(C3CCCCC3)nnn2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cnc2c(C3CCCCC3)nnn2c1.",
+ "ref_smiles": "Nc1cnc2c(C3CCCC(CC=O)C3)nnn2c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "76dc30ae-5fb8-421b-b783-2c7b57781b68",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(Cl)cccc1N(C(=O)C(Cl)(Cl)Cl)C1C=CS(=O)(=O)C1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Cl)cccc1N(C(=O)C(Cl)(Cl)Cl)C1C=CS(=O)(=O)C1",
+ "ref_smiles": "CC(=O)c1cccc(N(C(=O)C(Cl)(Cl)Cl)C2C=CS(=O)(=O)C2)c1C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cf50e011-60f2-4c94-bcc4-e05c810738ee",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(C)(C#N)CCCSc1cc(F)ccc1F with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C#N)CCCSc1cc(F)ccc1F",
+ "ref_smiles": "CC(C)(I)CCCSc1cc(F)ccc1F",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "905cdd57-7b97-4d80-b9b7-757f8f06bc5c",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)c1ccc(S(=O)(=O)NCCc2ccco2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(S(=O)(=O)NCCc2ccco2)cc1",
+ "ref_smiles": "CC(=O)S(=O)(=O)NCCc1ccco1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d03d2051-fb2f-44c6-973c-9c3ad714c9a8",
+ "task": "sub",
+ "question": "Modify the molecule C[NH2+]Cc1ccc(S(=O)(=O)Nc2ncc(Br)cc2C)o1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1ccc(S(=O)(=O)Nc2ncc(Br)cc2C)o1",
+ "ref_smiles": "C[NH2+]Cc1ccc(S(=O)(=O)Nc2ncc(NO)cc2C)o1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "807d9087-afe5-423d-8696-493d75eb2dce",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCCN(c1ncc(C(=O)[O-])cc1N)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN(c1ncc(C(=O)[O-])cc1N)C(C)C.",
+ "ref_smiles": "CCCCCN(c1ccc(C(=O)[O-])cn1)C(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "dc8363b6-f170-4fed-b75b-60d698cf07db",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1cc(C=NNC(N)=S)ccc1OC(=O)c1cccc(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C=NNC(N)=S)ccc1OC(=O)c1cccc(Br)c1.",
+ "ref_smiles": "COc1cc(C=NC(N)=S)ccc1OC(=O)c1cccc(Br)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7b6eed2b-6cb7-45db-b5af-2da5edbe0896",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(NC(=O)c2cccc(OC(F)F)c2)nn1Cc1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)c2cccc(OC(F)F)c2)nn1Cc1ccc(Cl)cc1.",
+ "ref_smiles": "Cc1cc(NC(=O)c2cccc(OC(F)F)c2)nn1CCl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "55f9f139-bd5a-4904-82db-00a6fade0273",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1COC(CO)CN1C(=O)c1ccnc(C[NH3+])c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1COC(CO)CN1C(=O)c1ccnc(C[NH3+])c1",
+ "ref_smiles": "CC1COC(CS)CN1C(=O)c1ccnc(C[NH3+])c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "62ddbb03-48fb-4558-9641-7774e9689e44",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1nnnn1C(N=O)c1ccc(S(C)(=O)=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nnnn1C(N=O)c1ccc(S(C)(=O)=O)cc1.",
+ "ref_smiles": "Cc1nnnn1C(N=O)S(C)(=O)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "882f859e-d78f-4adf-8a31-94be603ea732",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)C(=O)Nc1ccccc1NC(=O)CCl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)Nc1ccccc1NC(=O)CCl",
+ "ref_smiles": "CN(C)C(=O)Nc1ccccc1NC(=O)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b32af9ae-71bb-4227-806a-819ffd4fb250",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(Cn2cc(CSC(=S)N3CCN(C(=O)OC(C)(C)C)CC3)nn2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cn2cc(CSC(=S)N3CCN(C(=O)OC(C)(C)C)CC3)nn2)cc1",
+ "ref_smiles": "COCn1cc(CSC(=S)N2CCN(C(=O)OC(C)(C)C)CC2)nn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4b4b46cf-e259-41cf-b582-bef56afbc1a1",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CSc1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1)Nc1ccc(Cl)cn1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CSc1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1)Nc1ccc(Cl)cn1",
+ "ref_smiles": "O=C(CSc1ccc(NC(=O)c2ccccc2C(=O)[O-])cc1)Nc1ccccn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "989f2842-4e52-4cb3-ab1a-1bb02093a444",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule S=C(NCc1cccnc1)N1CCc2c([nH]c3ccccc23)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "S=C(NCc1cccnc1)N1CCc2c([nH]c3ccccc23)C1.",
+ "ref_smiles": "O=C(O)c1cccc2c3c([nH]c12)CN(C(=S)NCc1cccnc1)CC3",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bb3d5b1d-a7fa-44f0-a753-1d0806002159",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Clc1cccc(COc2nnc(Cl)c3ccccc23)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cccc(COc2nnc(Cl)c3ccccc23)c1",
+ "ref_smiles": "N#Cc1cccc(COc2nnc(Cl)c3ccccc23c2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f8c87cef-8f60-4de7-b4b9-e4b5eaf137f1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)N1C(=O)C(=Cc2ccc(OC(=O)c3ccc(Cl)cc3)cc2)SC1=S with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)N1C(=O)C(=Cc2ccc(OC(=O)c3ccc(Cl)cc3)cc2)SC1=S",
+ "ref_smiles": "CCC(C)N1C(=O)C(=Cc2ccc(OC(=O)c3ccc(C#N)cc3)cc2)SC1=S",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "52cca757-a22e-4118-a529-9854e6893bb3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)Nc1ccccc1NC1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Nc1ccccc1NC1CCCCC1.",
+ "ref_smiles": "CC(C)NNC1CCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "88733ab8-f6a2-4094-be43-7ccba39a8534",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCCCC(COC)NC(=O)C1CC[NH2+]C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(COC)NC(=O)C1CC[NH2+]C1.",
+ "ref_smiles": "CCCCC(COC)NC(=O)C1C[NH2+]C(N)C1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "da84981a-c19f-4992-bc31-e289939b0952",
+ "task": "add",
+ "question": "Modify the molecule CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1",
+ "ref_smiles": "OCN(c1ccc(-c2ccccc2)cc1)c1ccc(-c2nn[n-]n2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "253fd49d-0bf7-4bf4-9090-8baac1988b09",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)[NH+](C)CCNS(=O)(=O)N(C)CCC[NH2+]C(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)[NH+](C)CCNS(=O)(=O)N(C)CCC[NH2+]C(C)C",
+ "ref_smiles": "CCC(C)[NH+](C)CC(O)NS(=O)(=O)N(C)CCC[NH2+]C(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9b8dd984-8c57-40b0-b90b-8f5b55e5d160",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCC1(c2cccc(C3(C[NH3+])CC3)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1(c2cccc(C3(C[NH3+])CC3)c2)CC1.",
+ "ref_smiles": "COCC1(c2cc(O)cc(C3(C[NH3+])CC3)c2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "22667bce-0ec9-4665-84a4-9ac17def6371",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)C)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)C)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21.",
+ "ref_smiles": "Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)N3CC([NH+]4CCN(C(=O)C(C)(C)CC#N)CC4)CC3COC3CCC(C(=O)[O-])CC3)cc2Cl)c2ccccc21",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "c680f356-e150-449e-a5c3-65dce886e4fb",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)Nc1nc(Cl)nc(NC(=O)Nc2ccc(Cl)cc2)n1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)Nc1nc(Cl)nc(NC(=O)Nc2ccc(Cl)cc2)n1",
+ "ref_smiles": "CC(C)(C)Nc1nc(NC(=O)Nc2ccc(Cl)cc2)nc(C(=O)[OH])n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2523ee74-bb3d-4068-99a4-52fc27bb6bdc",
+ "task": "delete",
+ "question": "Modify the molecule CCC1CCC[NH+](CC2(C=O)CCOCC2)CC1 by removing a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC[NH+](CC2(C=O)CCOCC2)CC1",
+ "ref_smiles": "CCC1CCC[NH+](CC2CCOC2)CC1",
+ "add_group": null,
+ "remove_group": "aldehyde"
+ },
+ {
+ "id": "a769be78-e031-4933-b058-0c42b9a8c3ef",
+ "task": "delete",
+ "question": "Modify the molecule CCc1csc2c(I)c(OC)ccc12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1csc2c(I)c(OC)ccc12",
+ "ref_smiles": "CCc1csc2cc(OC)ccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "53bd17d1-80a8-4538-b1c3-dfbee50b2aa3",
+ "task": "add",
+ "question": "Modify the molecule CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])cc1",
+ "ref_smiles": "CC(C)c1ccc(C2Oc3ccccc3CC2N[O-])c(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b80b4bac-2a8a-4cce-a3b2-fdc8d7347ffb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)NCCc1ccc(C(=O)COc2ccc(C)cc2[N+](=O)[O-])cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NCCc1ccc(C(=O)COc2ccc(C)cc2[N+](=O)[O-])cc1F.",
+ "ref_smiles": "CC(=O)NCCc1ccc(C(=O)COc2ccc(Cc3ccccc3)cc2[N+](=O)[O-])cc1F",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "92e57d92-ee63-4a02-9b72-5c5b4dc7877a",
+ "task": "sub",
+ "question": "Modify the molecule OC1C=C(CCSC(F)(F)F)CC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1C=C(CCSC(F)(F)F)CC1",
+ "ref_smiles": "O=C(O)C(F)(F)SCCC1=CC(O)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "90dd9d04-0ec7-4cf6-919d-d9d44117095d",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCNc1ccc(OC2CCCC2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCNc1ccc(OC2CCCC2)cc1",
+ "ref_smiles": "CCCCCCc1ccc(OC2CCCC2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "9d2e625a-f7ce-4542-b1c1-bc3cd711dbbc",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C(=O)Nc2cc(F)ccc2C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(C(=O)N3CCCC3)c(Cl)c2)C(C)C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)Nc2cc(F)ccc2C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(C(=O)N3CCCC3)c(Cl)c2)C(C)C)CC1.",
+ "ref_smiles": "Cc1cc(C(=O)Nc2ccccc2C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C(=O)Nc2ccc(C(=O)N3CCCC3)c(Cl)c2)C(C)C)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7cc3bea9-942c-4c04-83c7-69f6b7a9c7ee",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1ccc(C(C)C)cc1-c1ccnc(C#N)n1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)C)cc1-c1ccnc(C#N)n1",
+ "ref_smiles": "Cc1ccc(C(C)C)cc1-c1ccnc(F)n1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d7e7194c-104a-4f05-a2a7-df68768e71d9",
+ "task": "delete",
+ "question": "Modify the molecule C[Si](C)(C)CCOCn1cnc2cccc(N(C(=O)C3CCC(=O)N3c3cc(C#N)ccn3)C(C(=O)NC3CCC(F)(F)CC3)c3ccccc3Cl)c21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)CCOCn1cnc2cccc(N(C(=O)C3CCC(=O)N3c3cc(C#N)ccn3)C(C(=O)NC3CCC(F)(F)CC3)c3ccccc3Cl)c21",
+ "ref_smiles": "C[Si](C)(C)CCOCn1cnc2cccc(N(C(=O)C3CCC(=O)N3c3cc(C#N)ccn3)C(Cl)C(=O)NC3CCC(F)(F)CC3)c21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7177bdfa-0fac-4426-a863-a43bf537d3a2",
+ "task": "delete",
+ "question": "Modify the molecule Cc1scc(C[NH2+]C2CCNC2)c1C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1scc(C[NH2+]C2CCNC2)c1C",
+ "ref_smiles": "Cc1scc(C[NH2+]C2CCC2)c1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bd578add-3365-487b-a6ed-71105c40dc2c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC[NH2+]C(C)C(C)(C)CN1CCS(=O)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(C)C(C)(C)CN1CCS(=O)CC1.",
+ "ref_smiles": "CC([NH2+]CCc1ccccc1)C(C)C(C)(C)CN1CCS(=O)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b4977391-a627-483b-adeb-0a351f31845f",
+ "task": "add",
+ "question": "Modify the molecule COc1ccccc1C1CCc2nc3ccc(Br)nc3n21 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C1CCc2nc3ccc(Br)nc3n21",
+ "ref_smiles": "NCOc1ccccc1C1CCc2nc3ccc(Br)nc3n21",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4789c396-3681-48db-95d6-89f299cdb929",
+ "task": "add",
+ "question": "Modify the molecule COCCCOc1cc(CC(CC([NH3+])C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCOc1cc(CC(CC([NH3+])C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC",
+ "ref_smiles": "COCCCOc1cc(CC(CC([NH3+])(c2ccccc2)C(O)CC(C(=O)NCC2(C(N)=O)CCCCC2)C(C)C)C(C)C)ccc1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f797fef3-741f-45b0-9278-36aa1667fb27",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccccc1C=CC(=O)Nc1cc(C)c(Cl)cc1OC with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C=CC(=O)Nc1cc(C)c(Cl)cc1OC",
+ "ref_smiles": "COc1ccccc1C=CC(=O)Nc1cc(C)c(NO)cc1OC",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "92575826-eb5e-4a7d-9cd7-0e1721a23590",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1",
+ "ref_smiles": "O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(Oc2ccccc2)cc1S",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "4cee046f-240e-4532-8176-3eecebb014ae",
+ "task": "add",
+ "question": "Modify the molecule CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)ccc2C)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)ccc2C)cc1",
+ "ref_smiles": "CNS(=O)(=O)c1ccc(NC(=S)Nc2cc(C)cc(-c3ccccc3)c2C)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "868b855d-59c3-435a-8d86-6c90973ee3cc",
+ "task": "sub",
+ "question": "Modify the molecule O=c1nc(CSc2nnnn2CCO)[nH]c2ccsc12 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1nc(CSc2nnnn2CCO)[nH]c2ccsc12",
+ "ref_smiles": "N#CCCn1nnnc1SCc1nc(=O)c2sccc2[nH]1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "942fb998-84fe-4f48-978a-d0f22022f63d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)C.",
+ "ref_smiles": "CCC(CC)(C[NH3+])C(=O)NCC(c1ccco1)[NH+](C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f37e57da-3fe7-4e10-9f5d-9fc7ba110f3f",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(C[NH+]1CC2CCCCC2C1)NC(=O)Nc1ccc2c(c1)OCCO2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[NH+]1CC2CCCCC2C1)NC(=O)Nc1ccc2c(c1)OCCO2.",
+ "ref_smiles": "O=C([NH+]1CC2CCCCC2C1)Nc1ccc2c(c1)OCCO2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d37c76af-2881-4754-9560-1b0d606153d0",
+ "task": "sub",
+ "question": "Modify the molecule O=C(Cc1ccc(F)cc1)Nc1cc(-c2cnc3[nH]cccc2-3)ncn1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccc(F)cc1)Nc1cc(-c2cnc3[nH]cccc2-3)ncn1",
+ "ref_smiles": "O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1cc(-c2cnc3[nH]cccc2-3)ncn1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "24963523-7b5f-4683-9c41-86f30011eec1",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(Oc2ncc(Br)cc2C[NH3+])ccc1C(C)C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Oc2ncc(Br)cc2C[NH3+])ccc1C(C)C",
+ "ref_smiles": "CC(C)(C)Oc1ncc(Br)cc1C[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a0b6413e-2332-4e0a-8e08-5ff98a8c81b2",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule C[NH+]1CCCN(c2ccc(N)c(CC#N)c2)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCCN(c2ccc(N)c(CC#N)c2)CC1",
+ "ref_smiles": "C[NH+]1CCCN(c2ccc(N)c([N+](=O)[O-])c2)CC1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "83522e65-8880-45ff-a63f-2b8b69d4e640",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1NC(=O)c2ccccc2N(CCC(F)(F)F)C1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1NC(=O)c2ccccc2N(CCC(F)(F)F)C1=O",
+ "ref_smiles": "CCC1NC(=O)c2ccccc2N(CCC(F)(F)C#N)C1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3c669b1d-db3c-462b-9a3f-5bd308b9592e",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCCCOc6ccc(C=O)cc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCCCOc6ccc(C=O)cc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2",
+ "ref_smiles": "CC(C)C[Si]12C[Si]3(CC(C)C)O[Si]4(CC(C)C)C[Si]5(CC(C)C)O[Si](CC(C)C)(C[Si](CCCOC(=O)CCCC(COc6ccc(C=O)cc6)c6ccccc6)(O1)O4)O[Si](CC(C)C)(C[Si](CC(C)C)(O3)O5)O2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7cfa6d2b-c607-4926-a3c2-3edd9bc58263",
+ "task": "delete",
+ "question": "Modify the molecule CCNC(=[NH+]CCCOCC(C)C)N(C)Cc1cccn1C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=[NH+]CCCOCC(C)C)N(C)Cc1cccn1C",
+ "ref_smiles": "CCNC(CCCOCC(C)C)N(C)Cc1cccn1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "84ec88d3-f193-44d5-8921-86fa08dad9d4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CCOC1C(NN)c1ccncc1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCOC1C(NN)c1ccncc1F",
+ "ref_smiles": "CC1CCOC1C(NN)c1ccncc1NO2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1410f238-8547-4e7f-802b-97b7c1832717",
+ "task": "delete",
+ "question": "Modify the molecule CC1CC(C)C[NH+](CC(C)NC(=O)N2CCC3(O)CCCCC3C2)C1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)C[NH+](CC(C)NC(=O)N2CCC3(O)CCCCC3C2)C1",
+ "ref_smiles": "CC1CC(C)C[NH+](CC(C)NC(=O)N2CCC3CCCCC3C2)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5c5ff874-a70b-4ca5-a017-b977041d2a6e",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)C1CC(=O)N(Cc2ccc3ccccc3c2)C12CC[NH+](Cc1ccnc3ccccc13)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1CC(=O)N(Cc2ccc3ccccc3c2)C12CC[NH+](Cc1ccnc3ccccc13)CC2.",
+ "ref_smiles": "COC(=O)CC1(Cc2ccc3ccccc3c2)CC[NH+](Cc2ccnc3ccccc23)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "50c8c23a-96fe-4998-b77f-8386d6b7a9d4",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(C(O)c2cccc(OC(F)(F)F)c2)c(C)nn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(O)c2cccc(OC(F)(F)F)c2)c(C)nn1.",
+ "ref_smiles": "Cc1cc(C(O)c2cccc(OC(F)F)c2)c(C)nn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1853fa3f-223a-4c80-87ba-e51c1b61e897",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(CSCc2cc(N)ccc2O)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CSCc2cc(N)ccc2O)c1",
+ "ref_smiles": "Cc1cccc(CSC(O)c2cc(N)ccc2O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "65afe786-5818-48a4-bc18-b77a8772b366",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2)cc1)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2)cc1)C(=O)[O-]",
+ "ref_smiles": "[NH3+]C(CCNS(=O)(=O)c1ccc(N2CCOCC2c2ccccc2)cc1)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3cad382c-df19-4d34-9a63-73e94277069b",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)cc2)c(C)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)cc2)c(C)c1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(C)on3)c(-c3ccccc3)c2)c(C)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "411abaa3-3686-403f-96f3-0c1a0ccedfad",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(NC(=O)c2cc(Br)ccc2O)ncc1N by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)c2cc(Br)ccc2O)ncc1N",
+ "ref_smiles": "Cc1cc(NC(=O)c2cccc(Br)c2)ncc1N",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c01a7f14-515a-4dfa-9620-e76c92b5a027",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=C(C(O)=C(c1nc2ccc(C(N)=O)cc2[nH]1)[NH+](C)C)c1ccc(CBr)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C(O)=C(c1nc2ccc(C(N)=O)cc2[nH]1)[NH+](C)C)c1ccc(CBr)cc1",
+ "ref_smiles": "C=C(C(C(=O)O)=C(c1nc2ccc(C(N)=O)cc2[nH]1)[NH+](C)C)c1ccc(CBr)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "70a90e2a-ff07-4f2b-98a2-f23c333f9629",
+ "task": "delete",
+ "question": "Modify the molecule C[NH2+]C(Cc1ccc(OC)nc1)Cc1ccccc1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(Cc1ccc(OC)nc1)Cc1ccccc1F",
+ "ref_smiles": "C[NH2+]C(Cc1ccccc1)Cc1ccc(OC)nc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "fba12395-de85-460f-8bf5-76b350679571",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])C1CC1C(=O)NCCCC(F)(F)F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1CC1C(=O)NCCCC(F)(F)F.",
+ "ref_smiles": "O=C([O-])C1CC1C(=O)NCCCC(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f55dfd66-882a-4025-a25c-8f3589202245",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Nc1nncc(-c2cccnc2)c1C(=O)Nc1nn[n-]n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nncc(-c2cccnc2)c1C(=O)Nc1nn[n-]n1.",
+ "ref_smiles": "Nc1(-c2nn[n-]n2)nncc-1-c1cccnc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "41a9c46d-977d-40b8-94ae-2a36b7732da4",
+ "task": "sub",
+ "question": "Modify the molecule C=C(C)COCCOCCC[Si](Cl)(Cl)Cl by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)COCCOCCC[Si](Cl)(Cl)Cl",
+ "ref_smiles": "C=C(C)COCCOCCC[Si](Cl)(Cl)C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f5de95bd-e288-4955-851b-23cd63b3c177",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1nc(-c2ccc(O)cc2)c2c(n1)C1(c3ccccc3)CC(C#N)C(=O)C(C)C1CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2ccc(O)cc2)c2c(n1)C1(c3ccccc3)CC(C#N)C(=O)C(C)C1CC2.",
+ "ref_smiles": "Cc1nc(O)c2c(n1)C1(c3ccccc3)CC(C#N)C(=O)C(C)C1CC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d4433e1d-d4ec-4ab9-8696-81bf16c263c0",
+ "task": "delete",
+ "question": "Modify the molecule O=c1[nH]c2ccc(S(=O)(=O)Nc3cc(Cl)ccc3Cl)cc2[nH]1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1[nH]c2ccc(S(=O)(=O)Nc3cc(Cl)ccc3Cl)cc2[nH]1",
+ "ref_smiles": "O=c1[nH]c2ccc(S(=O)(=O)Nc3cccc(Cl)c3)cc2[nH]1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "fb575fdf-d6df-4374-9376-67af4889b351",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1ccc(NC(=O)c2ccc(C(=O)N3CCCc4ccccc43)cc2)cc1 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(NC(=O)c2ccc(C(=O)N3CCCc4ccccc43)cc2)cc1",
+ "ref_smiles": "O=C([OH])c1ccc(NC(=O)c2ccc(C(=O)N3CCCc4ccccc43)cc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "41e750a2-c306-4645-ae54-266619127dc9",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)NCCc1ccccc1Cl)O2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)NCCc1ccccc1Cl)O2.",
+ "ref_smiles": "CN1C(=O)C(C)(C(=O)NCCc2ccccc2Cl)Oc2ccc(CC#N)cc21",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "01bd4762-a9c0-4e67-86ff-13fe37021513",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CS(=O)(=O)Cc1cccc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)Cc1cccc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)c1.",
+ "ref_smiles": "CS(=O)(=O)Cc1cc(C(=O)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)ccc1S",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "a6739e9a-55af-4858-8f1b-6d61c0c5c1a6",
+ "task": "sub",
+ "question": "Modify the molecule N#CCCN(CC[NH+]1CCOCC1)C(=O)Cc1ccccc1F by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCCN(CC[NH+]1CCOCC1)C(=O)Cc1ccccc1F",
+ "ref_smiles": "ONCCN(CC[NH+]1CCOCC1)C(=O)Cc1ccccc1F",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8fdb194f-eef1-4282-afa1-816145cfe6ab",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCCCC(O)Cc1ccc(CC)s1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCC(O)Cc1ccc(CC)s1",
+ "ref_smiles": "CCCCCCCC(C#N)Cc1ccc(CC)s1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c1402c30-3ab5-4193-9485-491ba0c0a757",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1ccc2cc(C3([NH3+])CCCCN3C(=O)[O-])ccc2n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc2cc(C3([NH3+])CCCCN3C(=O)[O-])ccc2n1",
+ "ref_smiles": "[NH3+]C1(c2ccc3nc(NO)ccc3c2)CCCCN1C(=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "840a9035-6a04-41c5-9da3-f4dc03ec8132",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1",
+ "ref_smiles": "CCCCC(CC=O)CCCCCCCOc1ccc(Sc2ccc(O)cc2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "808c073d-87ec-4444-ae48-724c9b87c665",
+ "task": "delete",
+ "question": "Modify the molecule CC=C(C)C1OC(=O)C(C)NC(=O)C(C(C)CC)NC(=O)CN(C)C(=O)C(Cc2ccccc2)N(C)C(=O)C(C)NC(=O)C(CC(C)C)OC(=O)C(C)=CCC(OC(=O)NCCCNC(=O)CCCCCN2C(=O)C=CC2=O)C1C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(C)C1OC(=O)C(C)NC(=O)C(C(C)CC)NC(=O)CN(C)C(=O)C(Cc2ccccc2)N(C)C(=O)C(C)NC(=O)C(CC(C)C)OC(=O)C(C)=CCC(OC(=O)NCCCNC(=O)CCCCCN2C(=O)C=CC2=O)C1C",
+ "ref_smiles": "CC=C(C)C1OC(=O)C(C)N(C(C)CC)C(=O)CN(C)C(=O)C(Cc2ccccc2)N(C)C(=O)C(C)NC(=O)C(CC(C)C)OC(=O)C(C)=CCC(OC(=O)NCCCNC(=O)CCCCCN2C(=O)C=CC2=O)C1C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "485f8a6a-b213-4aec-aaf5-39c9ea859c79",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)CC(C[NH3+])C(=O)Nc1cc(Cl)nc(Cl)n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(C[NH3+])C(=O)Nc1cc(Cl)nc(Cl)n1",
+ "ref_smiles": "CC(C)CC(C[NH3+])C(=O)Nc1cc([N+](=O)[O-])nc(Cl)n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "10c002f5-a0c7-4ba1-acf5-4e23f24e99b5",
+ "task": "sub",
+ "question": "Modify the molecule Fc1ccc(CC2C[NH2+]CCO2)c(F)c1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(CC2C[NH2+]CCO2)c(F)c1",
+ "ref_smiles": "CC(=O)c1ccc(CC2C[NH2+]CCO2)c(F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d39bf0d4-90ae-4402-ab56-824e328f9183",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN(C)C(=O)C1=CC(=CO)C(C=O)=C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)C1=CC(=CO)C(C=O)=C1.",
+ "ref_smiles": "C1=CC(=CO)C(C=O)=C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1becf522-613c-44b2-9633-96f0e0741669",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC1CCC(C2CCC(C3CC(F)C(C(F)F)C(F)C3)CC2)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC1CCC(C2CCC(C3CC(F)C(C(F)F)C(F)C3)CC2)CC1",
+ "ref_smiles": "FC(F)C1C(F)CC(C2CCC(C3CCC(S)CC3)CC2)CC1F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e8cb11ef-d792-44fc-9d3b-a7e1b025141c",
+ "task": "sub",
+ "question": "Modify the molecule Cn1ccc(NC(=O)c2ccccc2Nc2ccc(SC(F)F)cc2)n1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ccc(NC(=O)c2ccccc2Nc2ccc(SC(F)F)cc2)n1",
+ "ref_smiles": "Cn1ccc(NC(=O)c2ccccc2Nc2ccc(SC(F)C(=O)O)cc2)n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f268f4b0-5892-4ffb-a479-3737b461cfe8",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule Cc1cc(NCCOCCC(C)C)ccc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NCCOCCC(C)C)ccc1C#N.",
+ "ref_smiles": "Cc1cccc(NCCOCCC(C)C)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "2648466d-0aac-4a9a-9e49-251ae972cd33",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C1NCC(c2cccs2)C12CC[NH+](C1(c3ccccc3)CCCCC1)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NCC(c2cccs2)C12CC[NH+](C1(c3ccccc3)CCCCC1)CC2.",
+ "ref_smiles": "O=C1NCC(c2cccs2)C12CC[NH+](C1CCCCC1)CC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6c15f6a9-98e0-4f85-9457-f569c812b155",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1nccs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1nccs1.",
+ "ref_smiles": "O=S(=O)(c1c[nH+]c2n1CCC2)N1CCSCC1c1ncc(O)s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9d980baa-011d-4a18-b85a-2cbfa5858ad2",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cccc(C(C)C)c1NC(=O)C(C#N)=C[NH2+]CCCCCO by substituting a nitrile with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(C)C)c1NC(=O)C(C#N)=C[NH2+]CCCCCO",
+ "ref_smiles": "Cc1cccc(C(C)C)c1NC(=O)C(O)=C[NH2+]CCCCCO",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d6dcb957-b192-435a-b82d-85122a44c841",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CN(C(=O)c2cccc(F)c2NN)C(C)CO1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(C(=O)c2cccc(F)c2NN)C(C)CO1",
+ "ref_smiles": "CC1CN(C(=O)c2cccc(C(=O)[OH])c2NN)C(C)CO1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e51dc582-5db9-4a82-b42c-d2546ee0a24b",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)C[NH+]1CCC(C(=O)NCCC(=O)Nc2ccccc2C(=O)NCc2ccc(F)cc2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)C[NH+]1CCC(C(=O)NCCC(=O)Nc2ccccc2C(=O)NCc2ccc(F)cc2)CC1",
+ "ref_smiles": "Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)C[NH+]1CCC(C(=O)NCCC(=O)Nc2(Cc3ccc(F)cc3)cccc-2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c031fc27-ac34-4b5c-80a2-87bdf8633caa",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(N=C(O)C(C)N=C(O)COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)C2)C(=O)OCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(N=C(O)C(C)N=C(O)COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCc1ccccc1)C2)C(=O)OCc1ccccc1.",
+ "ref_smiles": "CC(N=C(O)C(C)N=C(O)COc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCC)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCC)Cc1cc(C(C)(C)C)cc(c1OCC(O)=NC(C)C(O)=NC(C)C(=O)OCC)C2)C(=O)OCC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d81526cf-041e-4c74-bdb3-8dc7604c102c",
+ "task": "add",
+ "question": "Modify the molecule CC(CNc1ccc(Cl)cc1I)C(=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CNc1ccc(Cl)cc1I)C(=O)[O-]",
+ "ref_smiles": "O=C([O-])C(CNc1ccc(Cl)cc1I)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7dcf413d-fa19-4fd1-93f4-d59be248159f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(C)C with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(C)C",
+ "ref_smiles": "CCOc1ccc(S(=O)(=O)Nc2ccc(C#N)cc2)cc1C(C)C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ff115e5b-dbed-4c16-9810-2e26bf8741ba",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)C)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)C)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC.",
+ "ref_smiles": "C=C(C)C(=O)OCC(COC(=O)CC[NH+](CCO[P+]([O-])(OCC)OCC)CCC(=O)OCC(COC(=O)C(=C)CC(=O)O)O[P+]([O-])(OCC)OCC)O[P+]([O-])(OCC)OCC",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "195f1ebb-163a-42d9-8dde-86cb08782b67",
+ "task": "add",
+ "question": "Modify the molecule COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2cc1OC[N+]1(C)CCCCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2cc1OC[N+]1(C)CCCCC1",
+ "ref_smiles": "COc1cc2c(=O)n(COC(=O)C(C)(C)C)cnc2c(N)c1OC[N+]1(C)CCCCC1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4252d6b7-11c4-4acb-b0fc-933d7f13047e",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C([NH3+])CCSCCCC1CCCO1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C([NH3+])CCSCCCC1CCCO1",
+ "ref_smiles": "CCOC(=O)C([NH3+])C(CSCCCC1CCCO1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6f326997-0749-4a2c-9d87-d14ab6d89517",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCCC3(C)[NH3+])nc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCCC3(C)[NH3+])nc2)CC1.",
+ "ref_smiles": "C[NH+](C)C1CCN(c2ccc(NC(=O)C3CCCC(c4ccccc4)C3(C)[NH3+])nc2)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a76c0585-3c12-4ce1-94da-54463b4bc51f",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCOC(=O)c1c(NC(=O)CCSCCC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(NC(=O)CCSCCC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C.",
+ "ref_smiles": "CCOC(=O)c1c(NC(=O)CCSC(C#N)CC(=O)Nc2sc(C(=O)N(C)C)c(C)c2C(=O)OCC)sc(C(=O)N(C)C)c1C",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "5bbdae55-4995-460f-a4de-bf2129c21153",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ncnc(Nc2ccc(C)c(F)c2)c1N with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ncnc(Nc2ccc(C)c(F)c2)c1N",
+ "ref_smiles": "COc1ncnc(Nc2ccc(C)c(O)c2)c1N",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4064e13d-0c26-4ac9-ac54-6cb976cd5f1b",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(Cc2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(Cc2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O.",
+ "ref_smiles": "CCOCCOC(=O)NC(Cc1ccccc1)C(O)CC1(C(N)c2ccccc2)[NH2+]C=C(C2c3ccccc3C3NC(=O)OC32)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "50f9ec8b-38cd-4eb9-94b7-e07f6c13406c",
+ "task": "add",
+ "question": "Modify the molecule CC(NS(=O)(=O)Cc1noc2ccccc12)c1cnn(C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NS(=O)(=O)Cc1noc2ccccc12)c1cnn(C)c1",
+ "ref_smiles": "CC(NS(=O)(=O)C(O)c1noc2ccccc12)c1cnn(C)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b9fe4743-c3d0-49a4-9a8f-ff9881046be9",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC1(Nc2cccc(F)c2C(N)=S)CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(Nc2cccc(F)c2C(N)=S)CCOCC1.",
+ "ref_smiles": "CC1(N(F)C(N)=S)CCOCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "45192fbe-5a55-4509-9687-b0a2f1d84632",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1nc(-c2ccc(F)c(C)c2)c(Br)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2ccc(F)c(C)c2)c(Br)s1.",
+ "ref_smiles": "Cc1nc(-c2cccc(C)c2)cs1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "80f586eb-a71c-4cb2-b6fe-cdacbf143bd4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(c1ccc(F)cc1F)[NH+]1CCN(C(NCCNC(=O)C(C)C)=[NH+]C)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(c1ccc(F)cc1F)[NH+]1CCN(C(NCCNC(=O)C(C)C)=[NH+]C)CC1",
+ "ref_smiles": "CC(=O)c1ccc(C(CC)[NH+]2CCN(C(NCCNC(=O)C(C)C)=[NH+]C)CC2)c(F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f7470887-00f1-4280-be37-01548f658623",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3ccccc3Cc3nn[n-]n3)C(=O)C12C by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(=C(C)Nc3ccccc3Cc3nn[n-]n3)C(=O)C12C",
+ "ref_smiles": "CC(=O)c1c2c(c(O)c(C)c1C(=O)[OH])C1(C)C(=O)C(=C(C)Nc3ccccc3Cc3nn[n-]n3)C(=O)C=C1O2",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0301c138-efe9-4fc1-83d9-213970f95eb0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1.",
+ "ref_smiles": "COC(=O)C1CC[NH+](CC(=O)c2c(C)[nH]c3ccccc23)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "47f1dc07-cc3b-4917-bc62-03bd7a83d4db",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C(=O)Nc2cc(NC(=O)C(C)NC(=O)C3CC[NH+](C(C)C(=O)Nc4cc(C(=O)Nc5c(F)cccc5F)ccc4C)CC3)ccc2Cl)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2cc(NC(=O)C(C)NC(=O)C3CC[NH+](C(C)C(=O)Nc4cc(C(=O)Nc5c(F)cccc5F)ccc4C)CC3)ccc2Cl)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)Nc2cc(NC(=O)C(C)NC(=O)C3CC[NH+](C(C)C(=O)Nc4cc(C(=O)Nc5c(F)cccc5C(=O)[OH])ccc4C)CC3)ccc2Cl)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d55ec0b5-18ea-4df3-95b9-8b12a9463de4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CS(=O)(=O)c1ccccc1NC(=O)NC1CC[NH+]2CCCCC12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)c1ccccc1NC(=O)NC1CC[NH+]2CCCCC12.",
+ "ref_smiles": "CS(=O)(=O)NC(=O)NC1CC[NH+]2CCCCC12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8b639403-c20c-4ce8-a8c9-fd95336267b8",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C#CCNC(=O)COC(=O)C=Cc1csc(N(C(C)=O)c2ccccc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCNC(=O)COC(=O)C=Cc1csc(N(C(C)=O)c2ccccc2)n1.",
+ "ref_smiles": "C#CCNC(=O)COC(=O)C=Cc1csc(NC(C)=O)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a6c36e0f-1278-457e-8818-22951c100cd0",
+ "task": "delete",
+ "question": "Modify the molecule C=C[Si](OCc1ccccc1)(c1ccccc1)c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C[Si](OCc1ccccc1)(c1ccccc1)c1ccccc1",
+ "ref_smiles": "C=C[Si](OCc1ccccc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0262cc12-04ba-4912-8a33-f0685aa34113",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)c1cccc(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cccc(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1.",
+ "ref_smiles": "CC(=O)c1ccc(-c2ccccc2)c(OCC(=O)OCC(=O)NC(=O)NCC(F)(F)F)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7c98f2f7-bfd7-482d-8a64-d82b0134ffe7",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCCC)C5=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCCC)C5=O",
+ "ref_smiles": "CCCCCCCCCCCCC(CCCCCCCCCC)CN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CC(CCCCCCCCCC)CCCCCCCCCCC(C)c1ccccc1)C5=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "06835f38-ac61-49b4-a3ba-e212f815858d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N1C(=O)c2ccc(NC(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)cc2C1=O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N1C(=O)c2ccc(NC(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)cc2C1=O",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)Nc2ccc3c(c2)C(=O)N(C(C)C)C3=O)cc1[N+](=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4b0fde73-ff8c-4bdb-8e08-f77ca9eceb35",
+ "task": "sub",
+ "question": "Modify the molecule O=c1[nH]c(=O)n(COC(CO)CO)cc1Br by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1[nH]c(=O)n(COC(CO)CO)cc1Br",
+ "ref_smiles": "O=C([OH])c1cn(COC(CO)CO)c(=O)[nH]c1=O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b27daea9-f451-43e9-bbe8-f15bff5b684f",
+ "task": "add",
+ "question": "Modify the molecule CCCC[NH+](CCCC)Cc1cccnc1NN by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[NH+](CCCC)Cc1cccnc1NN",
+ "ref_smiles": "CCCC[NH+](Cc1cccnc1NN)CC(N)CC",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "01c501fe-2236-4098-a4f6-4cba6d146887",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCN(Cc1ccccc1OC)c1ccc(N)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1OC)c1ccc(N)cc1.",
+ "ref_smiles": "CCN(Cc1ccccc1OC)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "922b0ed0-fa7f-4ee4-a133-d93c649c4d98",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CSCCC(O)C(=O)NCc1noc(CC(C)C)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(O)C(=O)NCc1noc(CC(C)C)n1.",
+ "ref_smiles": "CSC(O)CC(O)C(=O)NCc1noc(CC(C)C)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d26e4108-3d57-4be2-8960-b455a6b55474",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCN(CCBr)C(=O)c1cc(F)c(F)cc1[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCBr)C(=O)c1cc(F)c(F)cc1[N+](=O)[O-].",
+ "ref_smiles": "O=C(c1cc(F)c(F)cc1[N+](=O)[O-])N(CCBr)CCCO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b6b4a25c-b46c-4820-baa6-d5965cd0c725",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1cc(C(C)C)cc(C(=O)NNS(=O)(=O)c2ccccc2)c1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(C)C)cc(C(=O)NNS(=O)(=O)c2ccccc2)c1F.",
+ "ref_smiles": "Cc1cc(C(C)C)c(-c1F)NS(=O)(=O)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "51e2f2f9-4bd9-46b2-a0f8-6becdcc8b525",
+ "task": "sub",
+ "question": "Modify the molecule CC(O)CCC(=O)N1CCC(C)CC1C by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)CCC(=O)N1CCC(C)CC1C",
+ "ref_smiles": "CC(S)CCC(=O)N1CCC(C)CC1C",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7b20d5bb-b338-4969-b5d5-e142bd070658",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)N1CC(=O)Nc2cc(N)cc(F)c21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)N1CC(=O)Nc2cc(N)cc(F)c21",
+ "ref_smiles": "CC(C)(C)N1CC(=O)Nc2cc(N)cc(C#N)c21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2f62738f-aedf-4e34-92b0-f5bd50e13a49",
+ "task": "sub",
+ "question": "Modify the molecule CCCN1C(=O)COc2ccc(NC(=O)CCC(=O)c3ccc(Cl)cc3)cc21 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN1C(=O)COc2ccc(NC(=O)CCC(=O)c3ccc(Cl)cc3)cc21",
+ "ref_smiles": "CCCN1C(=O)COc2ccc(NC(=O)CCC(=O)c3ccc(C=O)cc3)cc21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fb39d0d9-5cf3-427e-ad7b-6d330eb6ba0b",
+ "task": "delete",
+ "question": "Modify the molecule CCNc1nc(NCc2ccccc2)c2ncn(-c3ccccc3)c2n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1nc(NCc2ccccc2)c2ncn(-c3ccccc3)c2n1",
+ "ref_smiles": "CCc1nc(NCc2ccccc2)c2ncn(-c3ccccc3)c2n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4a93eb96-8f87-47a5-9e98-1f791e201910",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(=O)NC(C)c1ccc(OC2CCN(c3cc[nH+]c(N4CCC(F)(F)C4)c3Cl)C2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(C)c1ccc(OC2CCN(c3cc[nH+]c(N4CCC(F)(F)C4)c3Cl)C2)cc1.",
+ "ref_smiles": "CC(=O)NC(C)c1ccc(OC2CCN(c3cc[nH+]c(N4CCC(F)C4)c3Cl)C2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d0532ef0-548c-40ac-9558-19ca9a0f2eb4",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule C=C1CCC2C(C)(CCC=C(C)C)C(OC(=O)C(O)C(C)CC)CCC2(C)C1Cc1c(OC)oc(C)c(C)c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C1CCC2C(C)(CCC=C(C)C)C(OC(=O)C(O)C(C)CC)CCC2(C)C1Cc1c(OC)oc(C)c(C)c1=O.",
+ "ref_smiles": "C=C1CCC2C(C)(CCC=C(C)C)C(OC(=O)CC(C)CC)CCC2(C)C1Cc1c(OC)oc(C)c(C)c1=O",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1a1fd0f1-e012-40bd-bd43-3cc037ba00eb",
+ "task": "add",
+ "question": "Modify the molecule Cc1nc2c(NC(=O)C3CCCO3)cccn2c1C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2c(NC(=O)C3CCCO3)cccn2c1C",
+ "ref_smiles": "Cc1nc2c(NC(=O)C3(c4ccccc4)CCCO3)cccn2c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "99aae838-c7ef-40d4-a8a5-290439e06776",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)CCCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCCn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21",
+ "ref_smiles": "CCOC(=O)CC(N)Cn1c(NC(=O)c2cccs2)nc2cc(C(=O)N(C)C3CCCCC3)ccc21",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "857b024c-523a-4331-89b0-2f0b95f61dc6",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)OC(=O)N1CCC(COCc2ccc(C(F)(F)F)c(F)c2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCC(COCc2ccc(C(F)(F)F)c(F)c2)CC1",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CCC(COC(F)C(F)(F)F)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "393fe073-a91c-4e97-ab51-7c9b58637377",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(=O)c1ccc(OCc2ccc(C(=O)Nc3sc4c(c3C#N)CCCC4)o2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(OCc2ccc(C(=O)Nc3sc4c(c3C#N)CCCC4)o2)cc1",
+ "ref_smiles": "CC(=O)c1c(NC(=O)c2ccc(COc3ccc(C(C)=O)cc3)o2)sc2c1CCCC2",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1ae8ba79-0ba3-4b2c-b4f1-30e353eebe6f",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule N#CCc1sc2ccc(CBr)cc2c1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCc1sc2ccc(CBr)cc2c1O.",
+ "ref_smiles": "Cc1sc2ccc(CBr)cc2c1O",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "833622c1-218e-427c-aae1-d0ec2a5cdcf0",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(C(=O)Nc2cc(NC(=O)C3CC[NH+](C(C)C(=O)Nc4cccc(C(=O)Nc5ccc(C)c(F)c5)c4C)CC3)ccc2C)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)Nc2cc(NC(=O)C3CC[NH+](C(C)C(=O)Nc4cccc(C(=O)Nc5ccc(C)c(F)c5)c4C)CC3)ccc2C)cc1",
+ "ref_smiles": "COc1ccc(C(=O)Nc2cc(NC(=O)C3CC[NH+](C(C)C(=O)Nc4cccc(C(=O)Nc5ccc(C)cc5)c4C)CC3)ccc2C)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f10d801d-9afb-4eee-ba4d-030a047917fd",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCNC(=O)c1cccc(NC(=O)c2cccn2C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)c1cccc(NC(=O)c2cccn2C)c1.",
+ "ref_smiles": "CCNC(=O)c1cc(O)cc(NC(=O)c2cccn2C)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fbb6afbd-f0ed-41e4-bbde-77985c711db3",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C1(C)CCCCC1(C)C by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1(C)CCCCC1(C)C",
+ "ref_smiles": "CC(CC=O)OC(=O)C1(C)CCCCC1(C)C",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "8e9812b2-d9c5-40a9-83cd-b0efaa3f0e85",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1Oc2ccc(NC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)cc2N(Cc2ccc(F)cc2)C1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1Oc2ccc(NC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)cc2N(Cc2ccc(F)cc2)C1=O",
+ "ref_smiles": "CC1Oc2ccc(NC(=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)cc2N(Cc2ccc(C#N)cc2)C1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "85d09030-2d5d-4556-bf03-6faf3ea7dd4d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(CCS(=O)(=O)c1ccc2c(c1)OCCO2)Nc1cccc(-c2nnnn2C2CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCS(=O)(=O)c1ccc2c(c1)OCCO2)Nc1cccc(-c2nnnn2C2CC2)c1.",
+ "ref_smiles": "O=C(CCS(=O)(=O)c1ccc2c(c1)OCCO2)Nc1nnnn1C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "26962596-c882-453e-9cd5-fd6f433b7a48",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCCONC1CCC(CO)[NH2+]C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCONC1CCC(CO)[NH2+]C1.",
+ "ref_smiles": "CCCCOC1CCC(CO)[NH2+]C1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c44f5f0d-0897-4c69-a321-bcfc69a99358",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)C1=C([O-])C2C(=O)C3=C([O-])c4c(O)ccc(C=C5CCC5)c4CC3CC2CC1=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C1=C([O-])C2C(=O)C3=C([O-])c4c(O)ccc(C=C5CCC5)c4CC3CC2CC1=O",
+ "ref_smiles": "CC(=O)C1=C([O-])C2C(=O)C3=C([O-])c4c(C(=O)O)ccc(C=C5CCC5)c4CC3CC2CC1=O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "09e0978c-8074-4f15-a037-cf0404af1b15",
+ "task": "add",
+ "question": "Modify the molecule O=C(C1CN(C(=O)C2CCCCC2)C1)N1CCC(c2ccc(O)cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CN(C(=O)C2CCCCC2)C1)N1CCC(c2ccc(O)cc2)CC1",
+ "ref_smiles": "O=C(C1CN(C(=O)C2CCCCC2O)C1)N1CCC(c2ccc(O)cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4b731439-0db5-4c75-9d21-69512860ede4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(-c2noc(CCNC(=O)Cc3ccccc3)n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2noc(CCNC(=O)Cc3ccccc3)n2)cc1.",
+ "ref_smiles": "Cc1noc(CCNC(=O)Cc2ccccc2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "25ea5301-70d9-4dff-b1a8-f6ed2de7c5df",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC[NH+]1CCN(c2ccccc2NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+]1CCN(c2ccccc2NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CC1.",
+ "ref_smiles": "CC[NH+]1CCN(c2ccccc2NC(=O)c2cc([N+](=O)[O-])c(N3CCCCC3)cc2C(=O)O)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "acb9443d-2e9f-4f9d-895b-1ca63ce2b1de",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOCC1.",
+ "ref_smiles": "CC(C)(C)c1ccccc1C(=O)NCC(O)C[NH+]1CCOC(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "475e034f-90ec-44ef-82c5-d1654f130ba1",
+ "task": "delete",
+ "question": "Modify the molecule C[NH2+]CCNC(=O)C1=CC=C(C2=CNC(=C(C(N)=[NH2+])c3ccccn3)N=C2)CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CCNC(=O)C1=CC=C(C2=CNC(=C(C(N)=[NH2+])c3ccccn3)N=C2)CC1",
+ "ref_smiles": "C[NH2+]CCNC(=O)C1=CC=C(C2=CNC(=C(CN)c3ccccn3)N=C2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "16197c4f-151b-4a30-bfba-160e72cff2b0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)cc(COC(=O)NNC(=O)Cc2ccccc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(COC(=O)NNC(=O)Cc2ccccc2)c1.",
+ "ref_smiles": "CCCOC(=O)NNC(=O)Cc1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b4ba3b0e-77c1-4d09-b306-ee30597f8a62",
+ "task": "delete",
+ "question": "Modify the molecule CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2cc(C)cc(C)c2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2cc(C)cc(C)c2)cc1",
+ "ref_smiles": "CCCN(CCC)S(=O)(=O)C(=O)Nc1cc(C)cc(C)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c01c3c98-8ced-42a2-8f62-b0ee5cacaf2d",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1",
+ "ref_smiles": "Cc1cccc(CC(=O)Nc2ccccc2C(C)Br)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c40b4b4d-f504-47c1-87c1-8f809ff2bc9b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH2+]C(c1ccc(Br)o1)c1cc(Br)c(Br)s1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1ccc(Br)o1)c1cc(Br)c(Br)s1",
+ "ref_smiles": "CCC[NH2+]C(c1ccc(O)o1)c1cc(Br)c(Br)s1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bd284085-a319-48d3-89fa-f7324523ed75",
+ "task": "sub",
+ "question": "Please substitute a thiol in the molecule CC[NH2+]C1CCC(C)CC1S with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C1CCC(C)CC1S",
+ "ref_smiles": "CC[NH2+]C1CCC(C)CC1NO",
+ "add_group": "nitro",
+ "remove_group": "thiol"
+ },
+ {
+ "id": "30bac567-8d34-43a7-848f-dbe429ecfe17",
+ "task": "add",
+ "question": "Modify the molecule C=CC(C)([NH3+])c1ccc(F)cc1Cl by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(C)([NH3+])c1ccc(F)cc1Cl",
+ "ref_smiles": "C=C(N)C(C)([NH3+])c1ccc(F)cc1Cl",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "9527e569-5dda-4cab-af26-c041b0167d9a",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC=CCCNc1c(C)cccc1C#N with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=CCCNc1c(C)cccc1C#N",
+ "ref_smiles": "CC=CCCNc1c(C)cccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "68e7e6dd-0cdb-4c9d-a4c4-1e33882d784c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCN(C(=O)Nc1ccccc1F)C1CCC[NH2+]C1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(C(=O)Nc1ccccc1F)C1CCC[NH2+]C1",
+ "ref_smiles": "CCCN(C(=O)Nc1ccccc1C(=O)O)C1CCC[NH2+]C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "85a1e6b4-3bcf-4d72-a897-2b5dffe39c97",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(c1cc(Cc2n[nH]c(=O)n3c(Cl)c(Cl)nc23)ccc1F)N1CCCN(c2ncccn2)CC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cc(Cc2n[nH]c(=O)n3c(Cl)c(Cl)nc23)ccc1F)N1CCCN(c2ncccn2)CC1",
+ "ref_smiles": "O=C(c1cc(Cc2n[nH]c(=O)n3c(O)c(Cl)nc23)ccc1F)N1CCCN(c2ncccn2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7af85663-62e7-42db-b328-5bba00c8df72",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1noc(C)c1S(=O)On1c(-c2ccc(Cl)cc2)noc1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1S(=O)On1c(-c2ccc(Cl)cc2)noc1=O",
+ "ref_smiles": "Cc1noc(C)c1S(=O)On1c(-c2ccc(C#N)cc2)noc1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b2fd8b29-bf45-49ce-925d-949ead46b052",
+ "task": "delete",
+ "question": "Modify the molecule CSc1ccc2[nH]c(=O)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cn3)c(=O)c2c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc2[nH]c(=O)n(-c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cn3)c(=O)c2c1",
+ "ref_smiles": "CSc1ccc2[nH]c(=O)n(-c3ccc(NC(=O)NS(=O)(=O)c4cccs4)cn3)c(=O)c2c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b2f4cc40-c0db-4c1c-a3d6-44f3d02d4044",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)C=NOCc1ccc(-c2ccccc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C=NOCc1ccc(-c2ccccc2)cc1",
+ "ref_smiles": "CC(C)(C)C=NOCc1ccccc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b53b1fcf-eb0e-42cb-8d42-ffd9961fd676",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C([NH3+])CC2CCCCCC2)c(F)c1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C([NH3+])CC2CCCCCC2)c(F)c1F",
+ "ref_smiles": "CC(=O)c1c(C([NH3+])CC2CCCCCC2)ccc(C)c1F",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e99c2be-e2cd-4d51-9711-c088d882eb8c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CS(=O)(=O)N(CC(=O)Nc1ccccc1)Cc1ccc(Cl)c(Cl)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)N(CC(=O)Nc1ccccc1)Cc1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "CS(=O)(=O)N(CC(=O)Nc1ccccc1)Cc1ccc(NO)c(Cl)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "791af4ab-b1b2-4687-9115-2e736f488f5d",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)c1ccc(CCC2CCOCC2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(CCC2CCOCC2)cc1",
+ "ref_smiles": "O=C(OCc1ccccc1)c1ccc(CCC2CCOCC2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d2f15a62-956b-42d3-bc4b-29d7a67528c0",
+ "task": "add",
+ "question": "Modify the molecule NC(=O)C1CC[NH+](Cc2cccc(C[NH3+])c2F)CC1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CC[NH+](Cc2cccc(C[NH3+])c2F)CC1",
+ "ref_smiles": "N#CC1CC(C(N)=O)CC[NH+]1Cc1cccc(C[NH3+])c1F",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "8887b49c-d225-4e8c-8d92-ed1707a565d6",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)C)C1CCCCC1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)C)C1CCCCC1)C1CC1.",
+ "ref_smiles": "Cn1cccc1CN(C(=O)CN(C(=O)NC(C)(C)CC(=O)O)C1CCCCC1)C1CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0e4861b0-136e-4dac-8d06-bb9b9739b7b9",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)C1CCN(C(=O)c2ccc3[nH]ccc3c2)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C1CCN(C(=O)c2ccc3[nH]ccc3c2)CC1",
+ "ref_smiles": "CC(C#N)C1CCN(C(=O)c2ccc3[nH]ccc3c2)CC1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d2d49191-ff99-4e7b-8618-a828dc813a9b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CN(C(=O)C1=CC2OCOC2C(OC(=O)c2cccc(C=CC(=O)OC3C(=O)OCC3(C)C)c2)C1)C(Cc1ccccc1)C(=O)NC(CO)CCC(=O)OC(C)(C)C with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)C1=CC2OCOC2C(OC(=O)c2cccc(C=CC(=O)OC3C(=O)OCC3(C)C)c2)C1)C(Cc1ccccc1)C(=O)NC(CO)CCC(=O)OC(C)(C)C",
+ "ref_smiles": "CN(C(=O)C1=CC2OCOC2C(OC(=O)c2cccc(C=CC(=O)OC3C(=O)OCC3(C)C)c2)C1)C(Cc1ccccc1)C(=O)NC(CBr)CCC(=O)OC(C)(C)C",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c107e946-4e73-4c7b-969b-f24447b61fcf",
+ "task": "add",
+ "question": "Modify the molecule CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)CC2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)CC2)c1",
+ "ref_smiles": "CNC(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC(C(=O)NCCC(=O)Nc3cc(C)cc(C)c3)C(O)C2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "324a3aa5-4e85-4219-89e8-b76df2ef16aa",
+ "task": "sub",
+ "question": "Modify the molecule CC(=O)c1ccc(NCC#N)cc1 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(NCC#N)cc1",
+ "ref_smiles": "CC(=O)c1ccc(NCNO)cc1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "2ab964bc-0bc0-412c-a0c9-cbd96ca7d5ea",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O.",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC1OC(C(OC(C)=O)c2ccccc2)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5fab3d41-49f0-4e7c-b826-60c0e4eec784",
+ "task": "delete",
+ "question": "Modify the molecule C=CCOc1ccc(NCC(=O)NCc2ccc(OC)cc2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOc1ccc(NCC(=O)NCc2ccc(OC)cc2)cc1",
+ "ref_smiles": "C=CCOc1ccc(CC(=O)NCc2ccc(OC)cc2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "61dc7c0c-084e-4f91-abf3-9edfdda326b5",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Fc1c2ncnc1Nc1cc(ncn1)Nc1ncnc(c1Cl)Nc1cc(ncn1)N2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1c2ncnc1Nc1cc(ncn1)Nc1ncnc(c1Cl)Nc1cc(ncn1)N2.",
+ "ref_smiles": "Fc1c2ncnc1Nc1cc(ncn1)-c1ncnc(c1Cl)Nc1cc(ncn1)N2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "483823dc-7bb2-4983-b0f1-94ecc4d6a637",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(CC([NH3+])CCCC(C)C)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC([NH3+])CCCC(C)C)cn1",
+ "ref_smiles": "COc1c(O)cc(CC([NH3+])CCCC(C)C)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fd4b7a71-6240-4c89-bcd2-578685cd688e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(NC(=O)c2ccc3c(N=Nc4c(C#N)cnn4-c4ncccn4)c(O)c(C(=O)Nc4ccc(C)cc4)cc3c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccc3c(N=Nc4c(C#N)cnn4-c4ncccn4)c(O)c(C(=O)Nc4ccc(C)cc4)cc3c2)cc1.",
+ "ref_smiles": "CNC(=O)c1cc2cc(C(=O)Nc3ccc(C)cc3)ccc2c(N=Nc2c(C#N)cnn2-c2ncccn2)c1O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "217d1fec-9980-411d-a179-f52a42ad4eac",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(=O)NCC(C)C)C(C)C)CC2)cccc1C(=O)N1CCCC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(Cl)cc3C(=O)NCC(C)C)C(C)C)CC2)cccc1C(=O)N1CCCC1",
+ "ref_smiles": "Cc1c(NC(=O)C[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(O)cc3C(=O)NCC(C)C)C(C)C)CC2)cccc1C(=O)N1CCCC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "03fe8b85-f343-444a-83e8-be31fb90e117",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COCC(C)Nc1cccc(C(=O)NCCO)c1C with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(C)Nc1cccc(C(=O)NCCO)c1C",
+ "ref_smiles": "COCC(C)Nc1cccc(C(=O)NCCC#N)c1C",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "62ba06e7-9d21-4b06-8713-e59220db2bba",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCc1ccc(C(NN)c2cc3cc(Cl)ccc3o2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C(NN)c2cc3cc(Cl)ccc3o2)cc1.",
+ "ref_smiles": "CCc1ccc(C(N)c2cc3cc(Cl)ccc3o2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7c417477-a45c-4e28-bf0c-3275ef22a8c7",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]C(Cc1ccc(O)c(O)c1)C(=O)OC1CCCCCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(Cc1ccc(O)c(O)c1)C(=O)OC1CCCCCC1",
+ "ref_smiles": "[NH3+]C(C)C(=O)OC1CCCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "992f41b1-a90a-4f68-bff6-ef2f6b8b3d76",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C1CN(C(=O)Nc2ccc(Cl)c(Br)c2)C(C(=O)[O-])CN1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CN(C(=O)Nc2ccc(Cl)c(Br)c2)C(C(=O)[O-])CN1.",
+ "ref_smiles": "O=C([O-])C1CN1C(=O)Nc1ccc(Cl)c(Br)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "936183a2-3073-478d-8ce7-949700fd485d",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)COC(=O)NCCc1cccc(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC(=O)NCCc1cccc(F)c1.",
+ "ref_smiles": "CC(C)COC(=O)NCCc1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "cb1b57fd-1144-48a7-baf9-e15b44566b5d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule N#Cc1cccc(N2CC[NH+](CCCO)CC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cccc(N2CC[NH+](CCCO)CC2)n1.",
+ "ref_smiles": "N#Cc1cccc(N2CC[NH+](CC(O)CO)CC2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "754bf96d-382e-4d18-8138-d5735a4231ca",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COCCCCN(CCCN(CCCCN(CCCN(CCCCO)C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCCN(CCCN(CCCCN(CCCN(CCCCO)C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F",
+ "ref_smiles": "COCCCCN(CCCN(CCCCN(CCCN(CCCC[N+](=O)[O-])C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F)C(=O)C(F)(F)F",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "f5283bfd-9849-433d-9a03-68c1439e46e5",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccccc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccccc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO.",
+ "ref_smiles": "O=S(CN1C(=CC=C2C=C(C=Cc3sc4ccc(-c5ccccc5)cc4[n+]3CS(=O)(=O)O)COC2)Sc2ccccc21)OO",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a63cb5a1-babc-4aaf-8b4e-a5827d421b90",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(SCC(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)cc1C by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(SCC(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)cc1C",
+ "ref_smiles": "C(=O)c1ccc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7bf136fd-062f-43af-8a76-68fd9167e254",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nnc2nc(N)nc(N)c2n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nnc2nc(N)nc(N)c2n1",
+ "ref_smiles": "CCc1nnc2nc(N)ncc2n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "7c408689-c3b5-4fc8-a069-035e4881888c",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(C(C)[NH3+])n2cc(Br)ccc12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C(C)[NH3+])n2cc(Br)ccc12",
+ "ref_smiles": "Cc1nc(C(C)[NH3+])n2ccccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "76b51ec8-72ff-49ef-bf40-d9770cb9952a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCN(Cc1ccccc1)C(=NCCOC)N[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1)C(=NCCOC)N[NH3+].",
+ "ref_smiles": "CCN(C(=NCCOC)N[NH3+])C(O)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "353e0884-4705-4a1a-a976-4eefe7b4bbb8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)NCCC[NH2+]C(C(=O)[O-])c1ccc(F)c(F)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NCCC[NH2+]C(C(=O)[O-])c1ccc(F)c(F)c1",
+ "ref_smiles": "CC(=O)NCCC[NH2+]C(C(=O)[O-])c1ccc(C(=O)O)c(F)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fd34dc5e-bb2f-41be-b1c3-10c793e9ef3d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(C)OC(=O)N1CCC2=C(CCC(CO)=C2)C1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CCC2=C(CCC(CO)=C2)C1",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CCC2=C(CCC(CS)=C2)C1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5bc92fe2-8438-43a2-96b1-86421ef49167",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCNc1cc(N2CCCCC2CC[NH2+]C)ncn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1cc(N2CCCCC2CC[NH2+]C)ncn1.",
+ "ref_smiles": "CCc1cc(N2CCCCC2CC[NH2+]C)ncn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c33b4aad-4fe1-42f7-badd-0658fdf8e08b",
+ "task": "sub",
+ "question": "Modify the molecule Fc1c(CCl)cc(Br)c2sccc12 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1c(CCl)cc(Br)c2sccc12",
+ "ref_smiles": "Oc1c(CCl)cc(Br)c2sccc12",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e617313d-ce15-4e50-ab44-4e7be1d68d66",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C=C(C)c1ccnc(C(=C)C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)c1ccnc(C(=C)C)c1.",
+ "ref_smiles": "C=C(C)c1ccnc(C(C)=Cc2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "278757ea-be5c-44b4-8ab4-df2fa51fee53",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)NC(CC(=O)N1CC[NH2+]C(C)C1C)c1ccc(Cl)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(CC(=O)N1CC[NH2+]C(C)C1C)c1ccc(Cl)cc1",
+ "ref_smiles": "CC(=O)NC(CC(=O)N1CC[NH2+]C(C)C1C)c1ccc(S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8952fcc-db2e-46e3-b767-030a19fc460e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC(=O)c1c(N(C)CC(=O)c2ccccc2Cc2ccccc2)c2c(Cl)cc(Cl)cc2n1C(=O)OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(N(C)CC(=O)c2ccccc2Cc2ccccc2)c2c(Cl)cc(Cl)cc2n1C(=O)OC(C)(C)C.",
+ "ref_smiles": "CCOC(=O)c1c(N(C)CC(=O)Cc2ccccc2)c2c(Cl)cc(Cl)cc2n1C(=O)OC(C)(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a0013381-7621-4a30-ad23-fb28a1b3ab2a",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cccc(CC)c1N(CCC(=O)NCCc1ccccc1F)C(C)=O by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(CC)c1N(CCC(=O)NCCc1ccccc1F)C(C)=O",
+ "ref_smiles": "CCc1cccc(CC)c1N(CCC(=O)NCCc1ccccc1)C(C)=O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b9a9866f-950e-45ce-83b6-45f1ef389d68",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C2=COCC=C2)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2=COCC=C2)c(Cl)c1.",
+ "ref_smiles": "Cc1cc(Cl)c(C2=COCC=C2)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f98046cd-656c-44f3-b416-848fd273714f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NCC[NH+]1CCOCC1)c1ccc(C[NH+](Cc2ccc(Cl)cc2)Cc2ccc3c(c2)OCO3)o1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC[NH+]1CCOCC1)c1ccc(C[NH+](Cc2ccc(Cl)cc2)Cc2ccc3c(c2)OCO3)o1",
+ "ref_smiles": "O=C([OH])c1ccc(C[NH+](Cc2ccc3c(c2)OCO3)Cc2ccc(C(=O)NCC[NH+]3CCOCC3)o2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "62f705f1-a62f-4062-8ebb-e1ce264dd91e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(C)(C)CC(C)Nc1cc(Br)ccc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C)(C)CC(C)Nc1cc(Br)ccc1C#N.",
+ "ref_smiles": "COC(C)(CO)CC(C)Nc1cc(Br)ccc1C#N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2cc73cc9-76d6-4e09-8392-d81e13ab5b16",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(COC(=O)C2CCCC23NC(=O)NC3=S)c(Br)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(COC(=O)C2CCCC23NC(=O)NC3=S)c(Br)c1",
+ "ref_smiles": "COc1ccc(COC(=O)C2CCCC23NC(=O)NC3=S)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "50da16b2-8dc8-49d7-b03e-ceae6dffbb2f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC1CCC(O)(c2ccc(C)c(C)c2)C1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(O)(c2ccc(C)c(C)c2)C1",
+ "ref_smiles": "CCC1CCC(C(=O)O)(c2ccc(C)c(C)c2)C1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fea38d32-b40b-4771-822c-707937096412",
+ "task": "sub",
+ "question": "Modify the molecule Clc1ccc(-c2nnc(-c3ccccc3)c(N3CCSCC3)n2)c(Cl)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1ccc(-c2nnc(-c3ccccc3)c(N3CCSCC3)n2)c(Cl)c1",
+ "ref_smiles": "O=[N+]([O-])c1ccc(-c2nnc(-c3ccccc3)c(N4CCSCC4)n2)c(Cl)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1d1a1e3d-8bff-4438-bf69-0cb0db08f557",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C=CCNC(=O)CCc1sc(C)nc1-c1cccs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCNC(=O)CCc1sc(C)nc1-c1cccs1.",
+ "ref_smiles": "C=CCCc1sc(C)nc1-c1cccs1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "25af8afb-ed55-4b5a-bad2-01a0da30a005",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C(NC(=O)CNC=O)C(=O)OCC by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(NC(=O)CNC=O)C(=O)OCC",
+ "ref_smiles": "CCOC(=O)C(NC=O)C(=O)OCC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c37162f0-8f5d-40df-aea5-1c89f2dadf1a",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC)C(C[NH2+]Cc1cncn1C(C)C)N(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C(C[NH2+]Cc1cncn1C(C)C)N(C)C",
+ "ref_smiles": "CCC(CC)C(C[NH2+]Cc1cncn1C(C)(C)c1ccccc1)N(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b8fd0ce6-ff79-4d49-bdbd-71787bbb0034",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=c1cc([N+](=O)[O-])c(CBr)c[nH]1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1cc([N+](=O)[O-])c(CBr)c[nH]1",
+ "ref_smiles": "O=c1cc([N+](=O)[O-])c(CO)c[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1f674301-3fb9-4f52-be6e-41c5e58efc1f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=N)C(C#N)C(=O)COC(=O)c1ccc(Cl)cc1F with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=N)C(C#N)C(=O)COC(=O)c1ccc(Cl)cc1F",
+ "ref_smiles": "CC(=N)C(C#N)C(=O)COC(=O)c1ccc(S)cc1F",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6796ccbf-6ce2-412e-9748-2195146fd373",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)Cc1cc(C)nc2ccc(Cl)cc12 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1cc(C)nc2ccc(Cl)cc12",
+ "ref_smiles": "COC(=O)Cc1cc(C)nc2ccc(S)cc12",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8e7687e6-4791-43df-8181-ae6809272f92",
+ "task": "sub",
+ "question": "Modify the molecule C[NH2+]CC(=O)NC1CCN(c2ccccc2Br)C1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC(=O)NC1CCN(c2ccccc2Br)C1",
+ "ref_smiles": "C[NH2+]CC(=O)NC1CCN(c2ccccc2O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6fcf517d-6661-4dd7-8e16-52c7faeef7d1",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(C)C[NH+]=C(N)NCC(C(C)C)[NH+]1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[NH+]=C(N)NCC(C(C)C)[NH+]1CCCC1.",
+ "ref_smiles": "CC(C)C[NH+]=CNCC(C(C)C)[NH+]1CCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6b4967c0-e7df-4949-b586-27e8b3b8c542",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C=CC(C)(C)C1(CC(=O)[O-])C(=O)N(CC=C(C)C)c2ccccc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(C)(C)C1(CC(=O)[O-])C(=O)N(CC=C(C)C)c2ccccc21.",
+ "ref_smiles": "C=CC(C)(C)C(C(=O)[O-])C(C=C(C)C)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "de91647a-33ca-4350-9b45-40176367f1fa",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(=O)N(CC1CCCN1C(=O)Cc1ccon1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(CC1CCCN1C(=O)Cc1ccon1)C1CC1.",
+ "ref_smiles": "O=C(Cc1ccon1)N1CCCC1CC1CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "7490310d-36c7-45e6-b322-9545d4792ae9",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C=C(C)C[NH+]1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C[NH+]1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2=O)CC1.",
+ "ref_smiles": "C=C(C)C[NH+]1CCN(C(=O)C(CO)N2C(=O)c3ccccc3C2=O)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c5071c57-7f84-4ccd-88c9-004767012597",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1ccc(NC(=O)CSc2nnc(COc3ccc(F)cc3Cl)n2C)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(NC(=O)CSc2nnc(COc3ccc(F)cc3Cl)n2C)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(NC(=O)CSc2nnc(COc3ccc(O)cc3Cl)n2C)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ff668576-169f-4e65-9830-8a7c187b589d",
+ "task": "delete",
+ "question": "Modify the molecule COCCn1ncc(Br)c1C(=O)c1ccc(F)c(OC)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCn1ncc(Br)c1C(=O)c1ccc(F)c(OC)c1",
+ "ref_smiles": "COCCn1ncc(Br)c1C(=O)c1cccc(OC)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b993f452-b5d0-4c55-879e-8d138deb399f",
+ "task": "delete",
+ "question": "Modify the molecule C=CC([NH+]=C(C(C(=C)C)=C(C=NC)C1CC1)N1CC[NH2+]CC1)=c1ccnc2c1=CC(c1ccccc1OC)=N2 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC([NH+]=C(C(C(=C)C)=C(C=NC)C1CC1)N1CC[NH2+]CC1)=c1ccnc2c1=CC(c1ccccc1OC)=N2",
+ "ref_smiles": "C=CC(=c1ccnc2c1=CC(c1ccccc1OC)=N2)C(C(C(=C)C)=C(C=NC)C1CC1)N1CC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "9924ec76-f12f-4009-a071-8361fceafbf3",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)[NH2+]C)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)[NH2+]C)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C.",
+ "ref_smiles": "CCCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)([NH2+]C)c1ccccc1)C(=O)NC(CCC(=O)[O-])C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(N)=[NH2+])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCC[NH3+])C(=O)N1CCCC1C(=O)NC(C(N)=O)C(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a930e823-6396-4cad-92c2-091d326e6359",
+ "task": "delete",
+ "question": "Modify the molecule CCC1OC(=O)N=C(c2ccccc2)S1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1OC(=O)N=C(c2ccccc2)S1",
+ "ref_smiles": "CCC1OC(=O)N=CS1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1f28a655-56df-46f8-95e8-523f041a81be",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)C1C2C(=C(C)C[NH+]1C)C(=O)CC(=O)c1cc(Cl)c(Cl)cc12 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1C2C(=C(C)C[NH+]1C)C(=O)CC(=O)c1cc(Cl)c(Cl)cc12",
+ "ref_smiles": "COC(=O)C1C2C(=C(C)C[NH+]1C)C(=O)CC(=O)c1cc(C#N)c(Cl)cc12",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0776eed4-56e7-410f-a77a-c9f52c4d0e21",
+ "task": "add",
+ "question": "Modify the molecule CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1",
+ "ref_smiles": "O=C(O)CC1CCN(c2ccc(NC(=O)C3CCN(C(=O)C=Cc4ccccc4)CC3)cc2)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f3d10385-7595-43e7-b8dd-34eca996f3ad",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc2c(NC(C)C)nc(-c3ccccc3O)nc2c1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(NC(C)C)nc(-c3ccccc3O)nc2c1",
+ "ref_smiles": "Cc1ccc2c(NC(C)C)nc(-c3ccccc3Br)nc2c1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "45880238-ca09-4362-a4ab-df1a0464c021",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)C(CC(C)C)(C(=O)OC)C1CCCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(CC(C)C)(C(=O)OC)C1CCCCC1",
+ "ref_smiles": "COC(=O)C(CC(C)C)(C(=O)OC)C1CCCC(CC=O)C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "bd04626b-3568-4997-b23f-e37b21441cdb",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCC(C)Nc1cc(C)nn1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)Nc1cc(C)nn1C.",
+ "ref_smiles": "CCC(C)c1cc(C)nn1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e614ae11-f012-4520-b6c9-228136ffacd4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1cccc(Cn2cnc(C[NH2+]C3CC3)c2)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cccc(Cn2cnc(C[NH2+]C3CC3)c2)c1",
+ "ref_smiles": "FC(F)(S)c1cccc(Cn2cnc(C[NH2+]C3CC3)c2)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "570260b1-8d45-4c9b-b8d1-ba5735f106bd",
+ "task": "sub",
+ "question": "Modify the molecule CCCCC([NH2+]CCc1ccnn1C)c1ccc(F)cc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC([NH2+]CCc1ccnn1C)c1ccc(F)cc1",
+ "ref_smiles": "CCCCC([NH2+]CCc1ccnn1C)c1ccc(NO2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e076313c-a67c-4114-9e15-dee05b00093c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCC(=O)N(Cc1ccc(Cl)cc1)C(C)C(=O)NCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=O)N(Cc1ccc(Cl)cc1)C(C)C(=O)NCc1ccccc1.",
+ "ref_smiles": "CCCC(=O)N(Cc1ccc(Cl)cc1)C(C)C(=O)NC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "53911e06-e4af-44ba-8c06-e7fb179a0537",
+ "task": "sub",
+ "question": "Modify the molecule Clc1cc(I)cc2c(Br)ccnc12 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cc(I)cc2c(Br)ccnc12",
+ "ref_smiles": "N#Cc1cc(I)cc2c(Br)ccnc12",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "33c95f80-5c0b-450b-9279-b5e6a50cc2c5",
+ "task": "delete",
+ "question": "Modify the molecule CCNC(=[NH+]CC(O)Cc1ccccc1)N1CC[NH+](Cc2ccon2)CC1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=[NH+]CC(O)Cc1ccccc1)N1CC[NH+](Cc2ccon2)CC1",
+ "ref_smiles": "CCNC(CC(O)Cc1ccccc1)N1CC[NH+](Cc2ccon2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "8a75ab92-d150-47d6-83da-ed1da8927c32",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1nc(I)cc2cnccc12 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(I)cc2cnccc12",
+ "ref_smiles": "Cc1nc(C#N)cc2cnccc12",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "da51774e-9d2a-4999-8d57-cc90006d0a39",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(NC(=O)CCc2nc(=O)c3ccccc3[nH]2)cc1OC(F)F by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(=O)CCc2nc(=O)c3ccccc3[nH]2)cc1OC(F)F",
+ "ref_smiles": "COc1ccc(Cc2nc(=O)c3ccccc3[nH]2)cc1OC(F)F",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "430c5c0a-c236-4a27-9916-619311556fe6",
+ "task": "add",
+ "question": "Modify the molecule CCCC1(CNS(=O)(=O)c2ccccc2F)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1(CNS(=O)(=O)c2ccccc2F)CC1",
+ "ref_smiles": "CCCC1(CNS(=O)(=O)c2ccccc2F)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "150ba75f-d4e7-49a8-aed3-0fed3435bed4",
+ "task": "add",
+ "question": "Modify the molecule CCCc1nc2c(n1-c1cc(C)ccc1OC)CC[NH2+]C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc2c(n1-c1cc(C)ccc1OC)CC[NH2+]C2",
+ "ref_smiles": "CCCc1nc2c(n1-c1cc(C)ccc1OC)C(O)C[NH2+]C2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a1e65667-264d-4b37-958a-8cbf69946450",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCCO)C(=O)C2C(C(=O)N(CC=C)c3ccccc3)C3(CC)CCC21O3 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCCO)C(=O)C2C(C(=O)N(CC=C)c3ccccc3)C3(CC)CCC21O3",
+ "ref_smiles": "C=CCN(Cn1nnc2ccccc21)C(=O)C1N(CCCCF)C(=O)C2C(C(=O)N(CC=C)c3ccccc3)C3(CC)CCC21O3",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "69079412-2bb3-4781-a7d5-11472d71bc4f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1c(Cl)cc(C([O-])=C2C(=O)C(=O)N(c3ccccc3C)C2c2ccc(N(C)C)cc2)c(OC)c1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(Cl)cc(C([O-])=C2C(=O)C(=O)N(c3ccccc3C)C2c2ccc(N(C)C)cc2)c(OC)c1Cl.",
+ "ref_smiles": "COc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3C)C2c2ccc(N(C)C)cc2)c(OC)c1Cl",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "9d87eefc-cb4d-48d9-a808-3a15eb4c7ce5",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule ClCC(CCOc1cccc(Br)c1)Cc1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "ClCC(CCOc1cccc(Br)c1)Cc1ccc(Cl)cc1.",
+ "ref_smiles": "CC(CCOc1cccc(Br)c1)Cc1ccc(Cl)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "033ebfaf-6c0b-46c9-b618-5d8475fadddc",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCC[Si](F)(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCC[Si](F)(F)F",
+ "ref_smiles": "CCC(CCCCC[Si](F)(F)F)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8898d86e-487f-4d29-99a5-6c924a07a103",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc(N=Nc2c3n([nH]c2=O)C(c2ccc(Cl)cc2)C2=C(CCCC2=O)N3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N=Nc2c3n([nH]c2=O)C(c2ccc(Cl)cc2)C2=C(CCCC2=O)N3)cc1.",
+ "ref_smiles": "Cc1ccc(N=Nc2c3n([nH]c2=O)C(c2ccc(Cl)cc2)C2=C3CCCC2=O)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b255c1cc-0f0f-4197-8b1a-89e76445da1c",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)c1sc(C(=O)OCC)c(OC(=O)N(C)C)c1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1sc(C(=O)OCC)c(OC(=O)N(C)C)c1C",
+ "ref_smiles": "CCOC(=O)c1sc(C(=O)OC(C)O)c(C)c1OC(=O)N(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "49d8b8fb-7f86-4cbc-8f00-905521a36552",
+ "task": "delete",
+ "question": "Modify the molecule O=C1Nc2cccc3c2C1C(c1ccc([N+](=O)[O-])cc1)[NH+](Cc1ccccc1)CC3 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1Nc2cccc3c2C1C(c1ccc([N+](=O)[O-])cc1)[NH+](Cc1ccccc1)CC3",
+ "ref_smiles": "C[NH+]1CCc2cccc3c2C(C(=O)N3)C1c1ccc([N+](=O)[O-])cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e3c8153c-6672-4b45-92d3-7a3f2e0ff796",
+ "task": "delete",
+ "question": "Modify the molecule CC1(c2cc(CCO)cc(C(c3cc(CCO)cc(C4(C)CCCCC4)c3O)C3CCSC3)c2O)CCCCC1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(c2cc(CCO)cc(C(c3cc(CCO)cc(C4(C)CCCCC4)c3O)C3CCSC3)c2O)CCCCC1",
+ "ref_smiles": "CC1(c2cc(CCO)cc(C(c3cc(CCO)cc(C4(C)CCCCC4)c3)C3CCSC3)c2)CCCCC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "98569ee7-f51a-4500-a291-6b1083b1913b",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1",
+ "ref_smiles": "CC(CO)C1CCCC(NC(=O)C2CCC[NH2+]C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e69d9cc3-c7da-49cb-a52f-d34b0bed15aa",
+ "task": "delete",
+ "question": "Modify the molecule C#CC#CC#CCC(CCOCC(CC)NS(=O)(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC#CC#CCC(CCOCC(CC)NS(=O)(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC",
+ "ref_smiles": "C#CC#CC#CCC(CCOCC(CC)S(=O)(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "630f5c93-dd30-4beb-9ff0-f01af7028a51",
+ "task": "delete",
+ "question": "Modify the molecule CSCCC(NC(=O)C(CC(N)=O)NC(=O)C([NH3+])CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-] by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCC(NC(=O)C(CC(N)=O)NC(=O)C([NH3+])CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-]",
+ "ref_smiles": "CSCCC(NC(=O)CNC(=O)C([NH3+])CCC(=O)[O-])C(=O)NC(CC(C)C)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "00da9e6f-8502-4597-8882-84f06e1c567d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(Br)c2[nH]c(C)c(C[NH3+])c12 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Br)c2[nH]c(C)c(C[NH3+])c12",
+ "ref_smiles": "CC(=O)c1ccc(OC)c2c(C[NH3+])c(C)[nH]c12",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "663b8929-36ab-4d52-ba4b-b777e6c6f947",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(C)NC(C)(C#N)C1CC[NH2+]CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(C)(C#N)C1CC[NH2+]CC1",
+ "ref_smiles": "CC(C)NC(C)([N+](=O)[O-])C1CC[NH2+]CC1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "4fe01c3c-11b1-4ea0-9f28-6d678c30724c",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(-c2cccc(C(=O)N3CC4CCC(C3)C(=O)N4)c2)c(=O)[nH]c1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(-c2cccc(C(=O)N3CC4CCC(C3)C(=O)N4)c2)c(=O)[nH]c1C",
+ "ref_smiles": "Cc1cc(C(=O)N2CC3CCC(C2)C(=O)N3)c(=O)[nH]c1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "31f48881-96a0-4e6b-9399-66b8c505c5ab",
+ "task": "sub",
+ "question": "Modify the molecule O=S(=O)(NCC(F)(F)CO)c1cc(Cl)c(Br)s1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NCC(F)(F)CO)c1cc(Cl)c(Br)s1",
+ "ref_smiles": "O=S(=O)(NCC(F)(F)CS)c1cc(Cl)c(Br)s1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "671e6bc7-7f1d-42c2-98e4-11cdd7975b87",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCC(=O)Nc1ccc(C(=O)OCC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(=O)Nc1ccc(C(=O)OCC)cc1.",
+ "ref_smiles": "CCOC(=O)c1ccc(CC)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a79ea7a3-6f02-46ab-a5a1-bc1ddda70b21",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc2ccc3cc4ccccc4cc3c2cc1N=Cc1ccc(N(C)C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2ccc3cc4ccccc4cc3c2cc1N=Cc1ccc(N(C)C)cc1",
+ "ref_smiles": "Cc1nc2ccc3cc4ccccc4cc3c2cc1N=CN(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b09fd037-80e2-4683-b48b-4ee1900421e4",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(=O)Nc1cccc(C2CC[NH+](CCCC(=O)c3ccc(C)cc3)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1cccc(C2CC[NH+](CCCC(=O)c3ccc(C)cc3)CC2)c1.",
+ "ref_smiles": "Cc1ccc(C(=O)CCC[NH+]2CCC(c3cccc(C)c3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a23e285f-1d99-4a43-9170-99a7126d0f1e",
+ "task": "sub",
+ "question": "Modify the molecule Nc1ccc(OS(=O)(=O)C(F)(F)F)cc1C(F)(F)F by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(OS(=O)(=O)C(F)(F)F)cc1C(F)(F)F",
+ "ref_smiles": "N#CC(F)(F)S(=O)(=O)Oc1ccc(N)c(C(F)(F)F)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cba544fa-317e-4075-b8e6-3e3d58362978",
+ "task": "add",
+ "question": "Modify the molecule N#Cc1ccc(=O)[nH]c1C1CCCC1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccc(=O)[nH]c1C1CCCC1",
+ "ref_smiles": "N#Cc1ccc(=O)[nH]c1C1CCCC1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "50f0bbd9-1461-45b3-885d-172c8dba5534",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ccc(NC(=O)CN2C(=O)c3cccnc3Oc3ccc(Cl)cc32)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(NC(=O)CN2C(=O)c3cccnc3Oc3ccc(Cl)cc32)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(NC(=O)CN2C(=O)c3cccnc3Oc3ccccc32)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "cd24dd84-5fb4-4c0f-9d29-5e08a3c2da20",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC1CC(C)CN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(-c4ccc(F)cc4)o3)cc2Cl)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)CN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(-c4ccc(F)cc4)o3)cc2Cl)C1.",
+ "ref_smiles": "CC1CC(C)CN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(F)o3)cc2Cl)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7e56fe7a-7583-4791-9cd8-1c909f0a2761",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH2+]C(CC(C)CC(C)(C)C)c1ccc(F)c(C)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(CC(C)CC(C)(C)C)c1ccc(F)c(C)c1",
+ "ref_smiles": "CC[NH2+]C(CC(C)CC(C)(C)C)c1ccc(C(=O)[OH])c(C)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8c7848a9-ef47-4be4-9112-3c077a6f3a0e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(CSc1nc2ncccc2o1)Nc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CSc1nc2ncccc2o1)Nc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1",
+ "ref_smiles": "N#Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)CSc3nc4ncccc4o3)cc2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2d7c81f1-15d6-4230-8552-b4af393cb91c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH2+]CC1(C[NH+](CCO)Cc2ccccc2)CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC1(C[NH+](CCO)Cc2ccccc2)CCOCC1.",
+ "ref_smiles": "C[NH2+]CC1(C[NH+](C)CCO)CCOCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "144891e1-ae33-49bc-a675-ca068513b431",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)c1ccc(-c2ccc(C(=O)NCC3(O)CC[NH+](C)CC3)cc2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)c1ccc(-c2ccc(C(=O)NCC3(O)CC[NH+](C)CC3)cc2)cc1",
+ "ref_smiles": "CC(C#N)c1ccc(-c2ccc(C(=O)NCC3(O)CC[NH+](C)CC3)cc2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "eab8370e-6120-4b5c-b404-466da6d4f4bd",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Nc1cc([N+](=O)[O-])ccc1F)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cc([N+](=O)[O-])ccc1F)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1",
+ "ref_smiles": "O=C(Nc1cc([N+](=O)[O-])ccc1F)C1CCCN1C(=O)c1cccc(Cl)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f6dd5515-24b4-4695-b41c-3f56b0b9dc2d",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccccc1N1CC(C(=O)Nc2nnc(C(C)(C)C)s2)CC1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1N1CC(C(=O)Nc2nnc(C(C)(C)C)s2)CC1=O",
+ "ref_smiles": "CN1CC(C(=O)Nc2nnc(C(C)(C)C)s2)CC1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b446b488-4922-41ed-b901-a7b230dfb874",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCCC(OC)c1noc(C2C[NH2+]CCO2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(OC)c1noc(C2C[NH2+]CCO2)n1.",
+ "ref_smiles": "CCCC(OC)c1noc(C2(C#N)C[NH2+]CCO2)n1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "12152113-62e9-486c-81e7-822561463278",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cn1ncc(CNc2ccc(F)cc2C#N)c1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ncc(CNc2ccc(F)cc2C#N)c1N.",
+ "ref_smiles": "Cn1ncc(CNc2c(O)cc(F)cc2C#N)c1N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6dd69910-fc6d-498a-946b-93a41c0fa077",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)(C)NC(=O)OC1C=CCC([NH3+])CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)NC(=O)OC1C=CCC([NH3+])CCC1.",
+ "ref_smiles": "CC(C)(C)NC(=O)OC1C=CC(O)C([NH3+])CCC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "294cfd46-09d5-43a3-94ca-24c2d1bf2d7b",
+ "task": "add",
+ "question": "Modify the molecule CCCCCC(=O)OCC(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(=O)OCC(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1",
+ "ref_smiles": "CCCCCC(=O)OC(c1ccccc1)C(C(=O)OC1CC2C3OC3C(C1)[NH+]2C)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fccd6f57-d565-46f4-8036-dca6734aff09",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cc(CO)c(Cl)c2sccc12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(CO)c(Cl)c2sccc12",
+ "ref_smiles": "CCc1cc(CO)cc2sccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f68fbd5c-d048-4f79-a446-7de21f5fbea8",
+ "task": "sub",
+ "question": "Modify the molecule CCCOCC(Cc1cncc(Br)c1)[NH2+]CC by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOCC(Cc1cncc(Br)c1)[NH2+]CC",
+ "ref_smiles": "CCCOCC(Cc1cncc(NO)c1)[NH2+]CC",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "37a1d88c-3de3-4703-ba8e-84a8e5b25e0f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cn1ccc(CC(O)C(=O)[O-])n1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ccc(CC(O)C(=O)[O-])n1",
+ "ref_smiles": "Cn1ccc(CC(C(=O)[O-])C(=O)[OH])n1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3e3e2d1d-5737-4256-ad1a-1f8fde8f5e9b",
+ "task": "add",
+ "question": "Please add a amine to the molecule C[Si](C)(C)c1ccc(CC(=O)OCCc2cnccn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(C)c1ccc(CC(=O)OCCc2cnccn2)cc1.",
+ "ref_smiles": "C[Si](C)(C)c1ccc(CC(=O)OCCc2cnc(N)cn2)cc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "2ca2c1a8-7262-4f88-a075-493d5dd0a2f3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1c(Cl)noc1-c1cnoc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1c(Cl)noc1-c1cnoc1",
+ "ref_smiles": "CC(=O)c1noc(-c2cnoc2)c1N",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bec67936-7406-4d91-9497-ac8b7ee91658",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ccccc1CC(=O)NCc1cc[nH]c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccccc1CC(=O)NCc1cc[nH]c1",
+ "ref_smiles": "O=C(Cc1ccccc1)NCc1cc[nH]c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4cf836b4-5082-4eb9-9d92-7b5728c79eb7",
+ "task": "sub",
+ "question": "Modify the molecule O=c1nc(-c2ccccc2)c(Br)c(-c2ccccc2)n1-c1ccccc1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1nc(-c2ccccc2)c(Br)c(-c2ccccc2)n1-c1ccccc1",
+ "ref_smiles": "O=C1N=C(-C2=CC=CC=C2)C(=O)C(-C2=CC=CC=C2)N1-C1=CC=CC=C1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "60420f8e-c235-4e2a-b22a-bd20109d7519",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)c1csc(Cn2c(C#N)nc3cc4c(cc32)OC(F)(F)O4)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1csc(Cn2c(C#N)nc3cc4c(cc32)OC(F)(F)O4)c1C.",
+ "ref_smiles": "COC(=O)c1csc(Cn2c(C#N)nc3cc4c(cc32)OC(F)O4)c1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4c62fcf7-99ec-4f36-b322-6002b7205421",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC12CCC3c4ccc(NS(=O)(=O)[O-])cc4CCC3(C=CCCCCCC[NH+]3CCOCC3)C1CCC2O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12CCC3c4ccc(NS(=O)(=O)[O-])cc4CCC3(C=CCCCCCC[NH+]3CCOCC3)C1CCC2O",
+ "ref_smiles": "CC12CCC3c4ccc(NS(=O)(=O)[O-])cc4CCC3(C=CCCCCCC[NH+]3CCOCC3)C1CCC2S",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ca058ff0-7a8e-495d-8dbf-4e6c87cfc47c",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccccc1NC(=O)CN1C(=O)SC(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)C1=O by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)CN1C(=O)SC(=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)C1=O",
+ "ref_smiles": "Cc1ccccc1NC(=O)CN1C(=O)SC(=Cc2ccc(-c3ccccc3)o2)C1=O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b027e7f4-6c6f-4f26-8387-f911e209db9b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule BCC1CCC(OC(=O)c2ccc(-c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)OC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "BCC1CCC(OC(=O)c2ccc(-c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)OC1",
+ "ref_smiles": "BCC1CCC(OC(=O)c2ccc(-c3ccc(-c4ccc(C5CO5)c(C#N)c4F)cc3)c(F)c2F)OC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "49e1e4a6-cb93-45ad-9f11-d14eae788db0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CS(=O)C(=Cc1ccccc1)S(C)(=O)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)C(=Cc1ccccc1)S(C)(=O)=O.",
+ "ref_smiles": "CS(=O)C(=Cc1ccccc1-c1ccccc1)S(C)(=O)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fea4bbc2-7305-4426-a349-255a05de7831",
+ "task": "sub",
+ "question": "Modify the molecule CCC(CC)N(C)c1ncc(F)cc1CCl by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)N(C)c1ncc(F)cc1CCl",
+ "ref_smiles": "CC(=O)c1cnc(N(C)C(CC)CC)c(CCl)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c91b9b7-b92f-4e8d-ad48-80fed64a2ef3",
+ "task": "delete",
+ "question": "Modify the molecule Cn1ncc2cc(-c3cnc(C4=[NH+]C5(CC5)C(=O)N4CC4CCN(C(=O)C5CC5)C4)cn3)ccc21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ncc2cc(-c3cnc(C4=[NH+]C5(CC5)C(=O)N4CC4CCN(C(=O)C5CC5)C4)cn3)ccc21",
+ "ref_smiles": "Cn1ncc2cc(-c3cnc(C=[NH+]CCCC4CCN(C(=O)C5CC5)C4)cn3)ccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f102214e-9302-4a19-9d3d-4de8e878436c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1(CC)CC(=O)N(c2cc(Br)ccc2C)C1=O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(CC)CC(=O)N(c2cc(Br)ccc2C)C1=O",
+ "ref_smiles": "CCC1(CC)CC(=O)N(c2cc(S)ccc2C)C1=O",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7613df75-3aa6-42d5-a652-2963f42b9c47",
+ "task": "sub",
+ "question": "Modify the molecule CC=CCN(C)c1cccc(C#N)c1 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=CCN(C)c1cccc(C#N)c1",
+ "ref_smiles": "CC=CCN(C)c1cccc(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "68043a02-8a08-470f-a856-17e664fd074e",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](C)CCOc1cc(F)cc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(O)CC(C)(C)C)c6)cc45)cc23)c1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCOc1cc(F)cc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(O)CC(C)(C)C)c6)cc45)cc23)c1",
+ "ref_smiles": "C[NH+](C)CCOc1cc(O)cc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(O)CC(C)(C)C)c6)cc45)cc23)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b805448f-1088-4fc3-a114-bffbf895d859",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)N1CCc2c(sc(NC(=O)C=Cc3ccccc3Cl)c2-c2nc3ccccc3s2)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)N1CCc2c(sc(NC(=O)C=Cc3ccccc3Cl)c2-c2nc3ccccc3s2)C1",
+ "ref_smiles": "CCOC(=O)N1CCc2c(sc(NC(=O)C=Cc3ccccc3NO2)c2-c2nc3ccccc3s2)C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e59566c1-f77a-4e9e-830a-bbab46159915",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule COCCCN(C1Cc2cc(C#N)ccc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCN(C1Cc2cc(C#N)ccc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1.",
+ "ref_smiles": "COCCCN(C1Cc2cc(C#N)c(CC=O)cc2N(Cc2cncn2C)C1)S(=O)(=O)c1cn(C)cn1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "a92a91c6-873e-43fb-9f5f-f3fb78385618",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NC(=O)c1ccccc1)Nc1ccc(Br)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(=O)c1ccccc1)Nc1ccc(Br)cc1",
+ "ref_smiles": "O=C(NC(=O)c1ccccc1)Nc1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e794298a-fd11-470a-8c31-64f9abf5ae89",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)C(=O)C[NH+]1CC=CC(OC(=O)[O-])=C1SCCCc1ccc(F)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C(=O)C[NH+]1CC=CC(OC(=O)[O-])=C1SCCCc1ccc(F)cc1",
+ "ref_smiles": "CC(C)(C)C(=O)C[NH+]1CC=CC(OC(=O)[O-])=C1SCCCc1ccc(C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "50f8f478-75cf-407e-a980-184739ed34a2",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)N1CCn2c(C[NH+](Cc3ccccc3)Cc3ccccc3)cc(=O)c([O-])c2C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N1CCn2c(C[NH+](Cc3ccccc3)Cc3ccccc3)cc(=O)c([O-])c2C1=O.",
+ "ref_smiles": "CC(C)c1([O-])c(=O)cc(C[NH+](Cc2ccccc2)Cc2ccccc2)n2CC21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "28f1afca-b91c-4ee8-ada8-3b0e01014293",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NCCCC(=O)N(Cc1ccccc1)CC1CCCO1)c1ccc(F)cc1F by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCCC(=O)N(Cc1ccccc1)CC1CCCO1)c1ccc(F)cc1F",
+ "ref_smiles": "O=C(NCCC(CC1CCCO1)c1ccccc1)c1ccc(F)cc1F",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "3973bedf-f6af-4cb2-9a9c-9feb4ffedb2f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCC(C)(C)C(=O)OCCC1C2CC3C(=O)OC1C3O2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)C(=O)OCCC1C2CC3C(=O)OC1C3O2.",
+ "ref_smiles": "CCC(C)(C)C(=O)OCCC1C2CC3(O)C(=O)OC1C3O2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7874f79e-4ba6-4b47-bf30-a23580aa2667",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccccc1OCC(N)CC#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1OCC(N)CC#N.",
+ "ref_smiles": "Cc1ccccc1OCCCC#N",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3b3ebb8c-c5ae-4fba-bf8a-527d5525a405",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC1C(=O)NCCN1S(=O)(=O)c1ccc(C(=O)[O-])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1C(=O)NCCN1S(=O)(=O)c1ccc(C(=O)[O-])cc1.",
+ "ref_smiles": "CCC1C(=O)NCCN1S(=O)(=O)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ce6e8699-dabf-401d-8382-4159beaec395",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)CCSc1nnc(-c2cc(C)nn2C)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCSc1nnc(-c2cc(C)nn2C)s1",
+ "ref_smiles": "COC(=O)CCSc1nnc(-c2cc(Cc3ccccc3)nn2C)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6d5ddcdc-49c7-4d1b-8ed0-49fd7c70c175",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccccc1NC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)C(C)O3)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)C(C)O3)CC1.",
+ "ref_smiles": "CNC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)C(C)O3)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4064efbe-e07c-4abb-930b-755cdc997a80",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(-n2c(C)cc(C=C(C#N)C(=O)Nc3ccc(Cl)cc3Cl)c2C)cc1 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2c(C)cc(C=C(C#N)C(=O)Nc3ccc(Cl)cc3Cl)c2C)cc1",
+ "ref_smiles": "Cc1ccc(-n2c(C)cc(C=C(C(=O)O)C(=O)Nc3ccc(Cl)cc3Cl)c2C)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "bd07426a-61df-4f43-b61c-b68a0b0cdbff",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(=O)C(C#N)S(C)(=O)=O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C(C#N)S(C)(=O)=O",
+ "ref_smiles": "CC(=O)C(C(C)=O)S(C)(=O)=O",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "31c3df50-145a-4a3c-a653-d7175909df96",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)N1CCN(c2cnc3ccc(-c4cc(C)c(O)c(C)c4)cc3n2)CC1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)N1CCN(c2cnc3ccc(-c4cc(C)c(O)c(C)c4)cc3n2)CC1",
+ "ref_smiles": "COC(=O)N1CCN(c2cnc3ccc(-c4cc(C)c(S)c(C)c4)cc3n2)CC1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2b1e467a-3aa7-403a-9848-432359990f50",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)c1c(NC(=O)C2CC(=O)N(c3cc(Cl)ccc3OC)C2)oc(C)c1C(C)=O by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(NC(=O)C2CC(=O)N(c3cc(Cl)ccc3OC)C2)oc(C)c1C(C)=O",
+ "ref_smiles": "CCOC(=O)c1c(NC(=O)C2CC(=O)N(c3cc(C#N)ccc3OC)C2)oc(C)c1C(C)=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "78c28fbb-8a2d-4dc6-89a2-2d97c8e2f88a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule N#Cc1nc(-c2ccc(F)cc2)[nH]c1C(N)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1nc(-c2ccc(F)cc2)[nH]c1C(N)=O.",
+ "ref_smiles": "N#Cc1nc(-c2ccccc2)[nH]c1C(N)=O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2d599e30-7fac-4ad5-a5ad-505c9b793ef0",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1ccc(N2CCCC2=O)c(F)c1)C1CCc2cccnc21 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(N2CCCC2=O)c(F)c1)C1CCc2cccnc21",
+ "ref_smiles": "O=C(Nc1ccc(N2C(=O)CCC2C(=O)O)c(F)c1)C1CCc2cccnc21",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a34b17c7-8e5d-4701-a1d2-ef993df85ea1",
+ "task": "add",
+ "question": "Modify the molecule CSc1ncc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ncc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1",
+ "ref_smiles": "CSc1ncc(-c2cc(O)c3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "aded289d-ecf9-498d-bf3b-b1cba3ccefb7",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCN(c1nccc(C(=O)[O-])c1F)C1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(c1nccc(C(=O)[O-])c1F)C1CCCCC1.",
+ "ref_smiles": "CCN(c1ncc(C(=O)O)c(C(=O)[O-])c1F)C1CCCCC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "67e9a857-92c8-460d-b537-3b157618fb3a",
+ "task": "add",
+ "question": "Please add a amine to the molecule COc1cc(OC)c(C(=O)O[NH+]=C(N)c2ccc(C)cc2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(OC)c(C(=O)O[NH+]=C(N)c2ccc(C)cc2)cc1OC.",
+ "ref_smiles": "COc1cc(C(=O)O[NH+]=C(N)c2ccc(C)cc2)c(OC)cc1OCN",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4ea05f83-bc38-47c6-ba67-c9a25351cbe5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C#CC(O)C(Br)Oc1ccc(F)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC(O)C(Br)Oc1ccc(F)cc1",
+ "ref_smiles": "C#CC(O)C([N+](=O)[O-])Oc1ccc(F)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "04a078da-7dd7-4fce-9841-f22ae157ae07",
+ "task": "add",
+ "question": "Modify the molecule C=CC[NH2+]C1(C(=O)[O-])CCOC(C)(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC[NH2+]C1(C(=O)[O-])CCOC(C)(C)C1",
+ "ref_smiles": "CC1(C)CC([NH2+]CC=Cc2ccccc2)(C(=O)[O-])CCO1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f440c48c-6859-4e2c-94c7-a8d096668249",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C([O-])CC(O)CC(NC(=O)OCc1ccccc1)C1OCCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC(O)CC(NC(=O)OCc1ccccc1)C1OCCCO1.",
+ "ref_smiles": "COC(=O)NC(CC(O)CC(=O)[O-])C1OCCCO1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "840e83b5-e51d-4e16-af7c-373eef83df01",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(C(=O)NC(C)c2ccccc2N)c(Cc2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fb961e42-5811-4690-b8bb-b890120310ad",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCc1nnc(OC2CC[NH+](C)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCc1nnc(OC2CC[NH+](C)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1.",
+ "ref_smiles": "CCCCc1nnc(OC2CC[NH+](CO)CC2)cc1-c1ccc(Oc2ccc(C)nn2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1df50a76-c4a9-40d8-8463-969e4c332b24",
+ "task": "add",
+ "question": "Modify the molecule CCOc1cc(C=NNc2nc(C)cc(C)n2)ccc1OCC(=O)Nc1ccccc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C=NNc2nc(C)cc(C)n2)ccc1OCC(=O)Nc1ccccc1",
+ "ref_smiles": "Cc1cc(C)nc(NN=Cc2ccc(OCC(=O)Nc3ccccc3)c(OC(C)C(=O)O)c2)n1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dcd57c87-c8ac-4ba4-bbb1-5aee7fc81eb3",
+ "task": "add",
+ "question": "Modify the molecule CC(CO)(CO)Nc1c(N)c[nH+]c2ccc(Br)cc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CO)(CO)Nc1c(N)c[nH+]c2ccc(Br)cc12",
+ "ref_smiles": "CC(CO)(CO)Nc1c(N)c[nH+]c2cc(-c3ccccc3)c(Br)cc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bcb48cbb-3a61-49b1-a0cb-fdffe9c94fb1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OCCNc1nc(NC2CCCCC2)cc(C2CCOC2)n1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCNc1nc(NC2CCCCC2)cc(C2CCOC2)n1",
+ "ref_smiles": "FCCNc1nc(NC2CCCCC2)cc(C2CCOC2)n1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2afb656c-52cd-4b98-b431-9f721da207eb",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(CC2(F)CCC[NH2+]C2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CC2(F)CCC[NH2+]C2)cc1C.",
+ "ref_smiles": "Cc1ccc(CC2CCC[NH2+]C2)cc1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "273bc69e-7b8c-4d28-8d82-b70c831475c8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Nc1cccc(CC2(F)CCS(=O)(=O)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cccc(CC2(F)CCS(=O)(=O)CC2)c1.",
+ "ref_smiles": "Nc1cccc(C(c2ccccc2)C2(F)CCS(=O)(=O)CC2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cac76963-10fa-418d-9940-8afd4645036b",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(C)(C)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1.",
+ "ref_smiles": "CC(C)(CC(=O)O)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)F)c2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "87f3c720-d578-4f21-8a6b-6a89010d4e75",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](CC(=O)NC1CC1)Cc1cc(Br)cc2c1OCC2 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](CC(=O)NC1CC1)Cc1cc(Br)cc2c1OCC2",
+ "ref_smiles": "C[NH+](CC(=O)NC1CC1)Cc1cc(C(=O)[OH])cc2c1OCC2",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5709a76c-b97d-4e0f-82fc-9f53429fbe3b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=CCOc1ccc(-c2nnc(N(CCCC)C(=O)c3ccccc3Cl)s2)cc1C(F)(F)F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOc1ccc(-c2nnc(N(CCCC)C(=O)c3ccccc3Cl)s2)cc1C(F)(F)F",
+ "ref_smiles": "C=CCOc1ccc(-c2nnc(N(CCCC)C(=O)c3ccccc3C(=O)[OH])s2)cc1C(F)(F)F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a6826bc9-0784-4244-b8bb-7ed06f736b46",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1=NCC2(C[NH+]3CCC2C3)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=NCC2(C[NH+]3CCC2C3)O1.",
+ "ref_smiles": "CC1=NCC2(C[NH+]3CC(c4ccccc4)C2C3)O1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "db438ab4-fb3c-46ee-9e8d-10668102ef24",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C1COc2c(C(=O)C(O)O)ccc(OCc3ccccc3)c2N1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1COc2c(C(=O)C(O)O)ccc(OCc3ccccc3)c2N1",
+ "ref_smiles": "O=C1COc2c(C(=O)C(O)C(=O)[OH])ccc(OCc3ccccc3)c2N1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "60790ab1-6596-40cc-b45b-b36e9ac8f70d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(NC(=O)c2ccc(NCC(O)C(C)(C)C)nc2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)c2ccc(NCC(O)C(C)(C)C)nc2)cc1",
+ "ref_smiles": "Cc1ccc(NC(=O)c2ccc(NCC(C(=O)O)C(C)(C)C)nc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4698e715-af2d-4f56-9358-c3a832b3f3bb",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCC(C(=O)N1CCC(c2nnsc2-c2cc(C)no2)CC1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(=O)N1CCC(c2nnsc2-c2cc(C)no2)CC1)c1ccccc1.",
+ "ref_smiles": "Cc1cc(-c2snnc2C2CCN(C(=O)C(CCc3ccccc3)c3ccccc3)CC2)on1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "35bed030-4118-434d-a06f-d5b55f7c5db3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(OCc2cn(Cc3ccccc3)nn2)c(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccc(F)cc2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OCc2cn(Cc3ccccc3)nn2)c(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccc(F)cc2)c1",
+ "ref_smiles": "Cc1ccc(OCc2cn(Cc3ccccc3)nn2)c(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccc([N+](=O)[O-])cc2)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "08c9952b-324e-47a6-95f9-d8973658857a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C[NH+](CCc1cccs1)CC(O)C1CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](CCc1cccs1)CC(O)C1CC1",
+ "ref_smiles": "C[NH+](CCc1cccs1)CC(NO)C1CC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "587dfbe6-4641-4646-b570-98cbdd885106",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]C(c1cncnc1)c1cc(F)c(F)c(F)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(c1cncnc1)c1cc(F)c(F)c(F)c1",
+ "ref_smiles": "C[NH2+]C(c1cncnc1)c1cc(F)c(F)c(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "85982fc5-b750-468b-bd17-e83dc68eda0e",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)OC(CI)C1OC2OC(C)(C)OC2C1OC(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)OC(CI)C1OC2OC(C)(C)OC2C1OC(C)=O.",
+ "ref_smiles": "CC(=O)OC(CI)C1OC2OC(C)(Cc3ccccc3)OC2C1OC(C)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "21d81868-8e13-43ab-90b8-960695af4ad8",
+ "task": "add",
+ "question": "Modify the molecule C#CN(Nc1cc(OC)ccc1[N+](=O)[O-])C(=O)OC(C)(C)C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CN(Nc1cc(OC)ccc1[N+](=O)[O-])C(=O)OC(C)(C)C",
+ "ref_smiles": "COc1ccc([N+](=O)[O-])c(NN(C#CO)C(=O)OC(C)(C)C)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a6809128-0de5-4296-90c5-550f179c80ac",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(CSC)[NH2+]C1CCC(C(F)(F)F)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CSC)[NH2+]C1CCC(C(F)(F)F)CC1",
+ "ref_smiles": "CCC(CSC)[NH2+]C1CCC(C(F)(F)NO)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "04999bc6-082e-4018-927c-1f3e96037eaa",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(Cl)c(C(=O)NOCCOCc2cc(C(F)(F)F)c(C(=O)NOCCO)s2)s1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)c(C(=O)NOCCOCc2cc(C(F)(F)F)c(C(=O)NOCCO)s2)s1",
+ "ref_smiles": "Cc1cc(Cl)c(C(=O)NOCCOCc2cc(C(F)(F)F)c(C(=O)NOCCS)s2)s1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "79f176ef-9c58-429c-a8ee-9634ff0ecae4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1CCCN1S(=O)(=O)c1ccc(Br)s1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCCN1S(=O)(=O)c1ccc(Br)s1",
+ "ref_smiles": "N#Cc1ccc(S(=O)(=O)N2CCCC2=O)s1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ab5ff807-c833-41e3-ae40-277e757acec8",
+ "task": "sub",
+ "question": "Modify the molecule CCN(CC1CCCO1)c1cccc(F)c1CCl by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC1CCCO1)c1cccc(F)c1CCl",
+ "ref_smiles": "CCN(CC1CCCO1)c1cccc(NO)c1CCl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e7e2ee3-1408-4630-9978-e141450ad02b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(Nc1nc(C(=O)NCCc2ccncc2)cs1)c1cccc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1nc(C(=O)NCCc2ccncc2)cs1)c1cccc(C(F)(F)F)c1.",
+ "ref_smiles": "O=C(Nc1nc(C(=O)NCCc2ccncc2)c(O)s1)c1cccc(C(F)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "778cf4f1-8833-4525-a353-133b03c7c05e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(NCC1CCCC1CCl)c1ccccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1CCCC1CCl)c1ccccc1Cl.",
+ "ref_smiles": "O=C(NCC1CCCC1CCl)",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b18dab7f-66e6-43cc-95c7-94fc04644efa",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4ccco4)CC3c3cccs3)nnc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4ccco4)CC3c3cccs3)nnc12.",
+ "ref_smiles": "Cn1c(=O)c2ccccc2n2c(SCC(=O)N3N=C(c4cc(C(=O)O)co4)CC3c3cccs3)nnc12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a120db7e-6670-4138-be08-4ddaa9ed60ba",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule NC(=O)C1CCCN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCCN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1.",
+ "ref_smiles": "NC(=O)C1CC(c2ccccc2)CN(c2ccc(CNC(=O)CC3C=CCC3)cc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "01dc8fe1-8677-4963-b7cb-c763c5f0d82b",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)CC2)C(C)C)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)CC2)C(C)C)c1",
+ "ref_smiles": "Cc1cccc(C(=O)NC(C(=O)N2CCC(C(=O)N3CCCC3)C(S)C2)C(C)C)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "86c9a4f5-52a4-4885-b3ca-b6bc9e9f2e71",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]Cc1ccccc1OCCCS(=O)c1ccccc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]Cc1ccccc1OCCCS(=O)c1ccccc1F",
+ "ref_smiles": "[NH3+]Cc1c(OCCCS(=O)c2ccccc2F)cccc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2e2af484-e22b-4485-b892-a553ec7c36f5",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)c(Cl)c2)c2cccc(Cl)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(C)c(Cl)c2)c2cccc(Cl)c2)cc1.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(c2cccc(Cl)c2)C(O)C(=O)Nc2ccc(C)c(Cl)c2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7dea4746-2441-45b2-8bd4-e7cb267fc56c",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CCOC(=O)C(C#N)C(C(=O)c1ccc(Cl)cc1)c1cccc(I)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(C#N)C(C(=O)c1ccc(Cl)cc1)c1cccc(I)c1.",
+ "ref_smiles": "CCOC(=O)CC(C(=O)c1ccc(Cl)cc1)c1cccc(I)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "a9e8992d-fd81-436d-975a-50d11db4866a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1c(-c2ccccc2)ncc2c(=O)[nH][nH]c(=O)c12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(-c2ccccc2)ncc2c(=O)[nH][nH]c(=O)c12.",
+ "ref_smiles": "Cc1cncc2c(=O)[nH][nH]c(=O)c12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e0bdd662-11e5-42e4-a94c-28c40a677497",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CC(C)(C)N(CCNC(=O)CNc1nc(NCc2ccccc2OC(F)(F)F)ncc1C#N)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)N(CCNC(=O)CNc1nc(NCc2ccccc2OC(F)(F)F)ncc1C#N)C(=O)[O-].",
+ "ref_smiles": "CC(C)(C)N(CCNC(=O)CNc1ccnc(NCc2ccccc2OC(F)(F)F)n1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d03d7cb0-e838-4d9a-bf1b-919c419a8995",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](C)CCCn1cc[nH+]c1C1CCN(C(=O)Cc2ccccc2Cl)CC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCn1cc[nH+]c1C1CCN(C(=O)Cc2ccccc2Cl)CC1",
+ "ref_smiles": "C[NH+](C)CCCn1cc[nH+]c1C1CCN(C(=O)Cc2ccccc2O)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "405c5736-9bc2-4f97-99d2-2939b46eb558",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule N#CCC(N)c1cnc(Cl)c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCC(N)c1cnc(Cl)c(Cl)c1.",
+ "ref_smiles": "N#CCC(N)c1cncc(Cl)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5b25f5b7-7fce-40f8-8acb-77b08c55e140",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1cccc(C)c1OCc1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCC3)o1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1OCc1nnc(SCC(=O)Nc2sc3c(c2C#N)CCCC3)o1",
+ "ref_smiles": "Cc1cccc(C)c1OCc1nnc(SCC(=O)Nc2sc3c(c2C(=O)[OH])CCCC3)o1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ceb625e9-3edb-4b7a-a2b2-65a2e3a69965",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(C[NH+](C)CC(=O)Nc2ccc3c(c2)OCO3)ccc1OC(F)F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C[NH+](C)CC(=O)Nc2ccc3c(c2)OCO3)ccc1OC(F)F",
+ "ref_smiles": "COc1cc(C[NH+](C)CC(=O)Nc2ccc3c(c2)OCO3)ccc1OC",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "eb22fb94-dfc0-4032-af53-0646810d2aa1",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCCCNC(=O)CCCC(C)(C)c1ccc2cc3ccccc3cc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCNC(=O)CCCC(C)(C)c1ccc2cc3ccccc3cc2c1.",
+ "ref_smiles": "CCCCNC(=O)CCC(C(=O)O)C(C)(C)c1ccc2cc3ccccc3cc2c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0c7e3d34-0244-4b47-8194-fcd7f6a152b9",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C",
+ "ref_smiles": "CCC(CC(=O)O)C(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(Cl)c(C(=O)N4CCCCC4)c3)CC2)cc1C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f271d7f5-239d-4cc3-a05c-109994d5c6ef",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(C)n2)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(C)n2)n1",
+ "ref_smiles": "Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cccs4)cc3)nc(CO)n2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e05f0ed9-7ed1-42de-a4d8-db2076ff1c1c",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCn1nccc1C(O)Cc1ccnc(N)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nccc1C(O)Cc1ccnc(N)c1.",
+ "ref_smiles": "CCn1nccc1CCc1ccnc(N)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5fbfb638-8dff-4a8b-b5e0-1b044593bf1a",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(OC)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1ccc(OC)c(C)c1.",
+ "ref_smiles": "CCN(c1cc(OC)c(Cl)cc1OC)S(=O)(=O)c1cc(C)c(OC)c(CC=O)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "c2414d0a-535d-421c-95f4-51ca2ecd4ccf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1ccc(-n2c(C)nnc2SC(C[N+](=O)[O-])c2cc(OC)c(OC)cc2Br)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-n2c(C)nnc2SC(C[N+](=O)[O-])c2cc(OC)c(OC)cc2Br)cc1",
+ "ref_smiles": "CCOc1ccc(-n2c(C)nnc2SC(C[N+](=O)[O-])c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "53ddeac1-650e-40eb-9b49-86e8d40e55b1",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule C=C(C[NH2+]C(C)C)C[NH+]1CCCCCC1CO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C[NH2+]C(C)C)C[NH+]1CCCCCC1CO.",
+ "ref_smiles": "C=C(C[NH2+]C(C)C)C[NH+]1CCCCCC1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7a25ca72-eca8-4e81-9997-fc6792d0a24f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)N1CCC(C(=O)N(CCC[NH+]2CCC(c3cc(-c4ccc(Cl)cc4)n[nH]3)CC2)c2ccccc2)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CCC(C(=O)N(CCC[NH+]2CCC(c3cc(-c4ccc(Cl)cc4)n[nH]3)CC2)c2ccccc2)CC1",
+ "ref_smiles": "CC(=O)N1CCC(C(=O)N(CCC[NH+]2CCC(c3cc(-c4ccc(C#N)cc4)n[nH]3)CC2)c2ccccc2)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4159e951-4bf0-4140-8203-16b0b0ab5f84",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1ccc(CC)cc1CCC(=O)c1c(OCC)ccc(OCC)c1OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(CC)cc1CCC(=O)c1c(OCC)ccc(OCC)c1OCC.",
+ "ref_smiles": "CCOc1ccc(OCC)c(C(=O)CC(CC)OCC)c1OCC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "048f078f-d1d9-4896-9693-1de8a7b98a95",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Oc1ccc(C(C)(C)C)cc1)C1CCOC(c2c(F)cccc2F)=N1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Oc1ccc(C(C)(C)C)cc1)C1CCOC(c2c(F)cccc2F)=N1",
+ "ref_smiles": "CC(Oc1ccc(C(C)(C)C)cc1)C1CCOC(c2c(O)cccc2F)=N1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4391e984-6a47-4fc4-a139-a896ab1c468d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCN1C(N)=[NH+]CC1(C)c1cc(Cl)ccc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN1C(N)=[NH+]CC1(C)c1cc(Cl)ccc1Cl",
+ "ref_smiles": "COCCN1C(N)=[NH+]CC1(C)c1cc(NO)ccc1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8caa4e4d-6675-4492-93c5-94277cef988d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3)NC2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3)NC2=O)c1.",
+ "ref_smiles": "COc1cccc(NC(=O)CC2[NH+]=C([NH+]=C(N)Nc3cccc(C)c3-c3ccccc3)NC2=O)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eef17ba3-a02c-462c-b43f-57e9123f148f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=S1(=O)CC[N+]2(CC1)CC1CCC2C(CO)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S1(=O)CC[N+]2(CC1)CC1CCC2C(CO)C1.",
+ "ref_smiles": "O=S1(=O)CC[N+]2(CC1)CC1CC(O)C2C(CO)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a6f988b1-f469-4d8d-a897-c8f5c77c95e7",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC1CN(c2ccc(N)cc2C(F)F)CCC1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CN(c2ccc(N)cc2C(F)F)CCC1C.",
+ "ref_smiles": "COC1CN(c2ccc(N)cc2CF)CCC1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "829c7c30-3c29-455b-bf01-cd3f60876942",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCN(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(O)cc1.",
+ "ref_smiles": "CCCCCCCC(C(=O)Nc1ccc2ccccc2c1)(c1ccc(O)cc1)C(S)NC(=O)OC(C)(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "f68c0f8c-0064-4e59-a03a-d2db29386266",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCCC1)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCCC1)C1CC1.",
+ "ref_smiles": "CN(C(=O)c1cc(S(=O)(=O)Cl)cn1C1CCC(c2ccccc2)C1)C1CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c63d9322-eb17-4358-a167-0f0d238aef03",
+ "task": "sub",
+ "question": "Modify the molecule CCCCn1c(C(C)[NH+](Cc2ccccc2)Cc2ccc(O)cc2Cl)c[nH+]c1-c1cccc(F)c1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1c(C(C)[NH+](Cc2ccccc2)Cc2ccc(O)cc2Cl)c[nH+]c1-c1cccc(F)c1",
+ "ref_smiles": "CCCCn1c(C(C)[NH+](Cc2ccccc2)Cc2ccc(O)cc2S)c[nH+]c1-c1cccc(F)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "21915f61-ba46-4332-8b6f-400ecf60365a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC1CN(CC(C)(C)O)CC[NH+]1CC(C)O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CN(CC(C)(C)O)CC[NH+]1CC(C)O",
+ "ref_smiles": "CCC1CN(CC(C)(C)C(=O)O)CC[NH+]1CC(C)O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "062a63b2-95ef-4f97-836c-02a1c50bb905",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]C(C)c1sc(C(OC)C(C)(C)C)nc1C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)c1sc(C(OC)C(C)(C)C)nc1C",
+ "ref_smiles": "C[NH2+]C(CC(=O)O)c1sc(C(OC)C(C)(C)C)nc1C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "81a84365-bf5e-4182-a375-b9c40f0be2fc",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(NC(=O)c1cccc(C(=O)Nc2ccc(C#N)cc2)c1)c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1cccc(C(=O)Nc2ccc(C#N)cc2)c1)c1ccccc1",
+ "ref_smiles": "CC(NC(=O)c1cccc(C(=O)Nc2ccc(S)cc2)c1)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "478cbbec-63ec-4dee-a741-a457ec73e342",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(N)n(Cc2ccc(Cl)cc2Br)n1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N)n(Cc2ccc(Cl)cc2Br)n1",
+ "ref_smiles": "Cc1cc(N)n(Cc2ccc(NO)cc2Br)n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d02e9fa7-1dfa-4446-bc79-c05ee3bc4d0e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(CC)N(CCO)c1ccc(C[NH3+])cc1F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)N(CCO)c1ccc(C[NH3+])cc1F",
+ "ref_smiles": "CCC(CC)N(CCO)c1ccc(C[NH3+])cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4e9d9a7d-06d1-4ca6-8b6d-fd2ac5093e09",
+ "task": "delete",
+ "question": "Modify the molecule COCCNc1ccc2[nH+]cc(-c3cncc(OC)c3)n2n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCNc1ccc2[nH+]cc(-c3cncc(OC)c3)n2n1",
+ "ref_smiles": "COCCc1ccc2[nH+]cc(-c3cncc(OC)c3)n2n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bc1c488c-ad77-4ff4-bb40-746a8855feaf",
+ "task": "add",
+ "question": "Modify the molecule CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(C)OC12 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(C)OC12",
+ "ref_smiles": "CCCCOCC1OC(n2ccc(=O)[nH]c2=O)C2OC(C)(CCC=O)OC12",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "cccac5a1-1576-4f93-beca-841b61d060d4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)c(C2CCCCC2C[NH2+]CC(C)C)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(C2CCCCC2C[NH2+]CC(C)C)cc1C.",
+ "ref_smiles": "CCCC1CCCCC1C[NH2+]CC(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bddfd7e6-9d3d-473c-914f-269d410de68a",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C(O)C[NH+]2CCN(C(=O)c3ccccc3F)CC2)c(C)c1 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(O)C[NH+]2CCN(C(=O)c3ccccc3F)CC2)c(C)c1",
+ "ref_smiles": "Cc1ccc(C(C#N)C[NH+]2CCN(C(=O)c3ccccc3F)CC2)c(C)c1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "89a11619-367a-4d22-84f4-ca1fc6bdfb60",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Nc1ccnc(NCCOc2ccc(F)cc2)n1)c1ccccc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Nc1ccnc(NCCOc2ccc(F)cc2)n1)c1ccccc1",
+ "ref_smiles": "CC(Nc1ccnc(NCCOc2ccc(C(=O)O)cc2)n1)c1ccccc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7ee03f3d-a3e7-4ced-af02-57e13a8ec20b",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1cc(NS(=O)(=O)c2ccc(=O)[nH]c2)ccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(NS(=O)(=O)c2ccc(=O)[nH]c2)ccc1F.",
+ "ref_smiles": "COc1cc(S(=O)(=O)c2ccc(=O)[nH]c2)ccc1F",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "08c70e2d-529d-4c51-ad3e-3935223203d5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC1CC(C)C[NH+](Cc2ccccc2CNC(=O)C(N=C2NS(=O)(=O)c3ccccc32)C(C)C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C)C[NH+](Cc2ccccc2CNC(=O)C(N=C2NS(=O)(=O)c3ccccc32)C(C)C)C1.",
+ "ref_smiles": "CC1CC(C)C[NH+](CCNC(=O)C(N=C2NS(=O)(=O)c3ccccc32)C(C)C)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "590d3e9a-21de-45cb-b09a-809881b35155",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(CNC(=O)N1CC(=O)NC2CCCCC21)Oc1ccc(F)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CNC(=O)N1CC(=O)NC2CCCCC21)Oc1ccc(F)cc1",
+ "ref_smiles": "CC(CNC(=O)N1CC(=O)NC2CCCCC21)Oc1ccc(S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "12798594-92d0-478a-b51c-a7df27c517b3",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(C)(C)C(O)c1ncccc1OC by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(C)(C)C(O)c1ncccc1OC",
+ "ref_smiles": "CCOC(C)(C)C(C(=O)O)c1ncccc1OC",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a0b5d19b-106c-4345-8303-35ef42f178d7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=C1CC2COC(=O)C2(Cc2ccc(NC(=O)Cc3cc(C)c(Cl)cc3Cl)cc2)C1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C1CC2COC(=O)C2(Cc2ccc(NC(=O)Cc3cc(C)c(Cl)cc3Cl)cc2)C1",
+ "ref_smiles": "C=C1CC2COC(=O)C2(Cc2ccc(NC(=O)Cc3cc(C)c(O)cc3Cl)cc2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ea727a37-4d92-4bf6-b7db-5aa74111a8af",
+ "task": "sub",
+ "question": "Modify the molecule CC1CCCC1C[NH2+]Cc1cc(Cl)cc(Cl)c1O by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC1C[NH2+]Cc1cc(Cl)cc(Cl)c1O",
+ "ref_smiles": "CC1CCCC1C[NH2+]Cc1cc(Cl)cc(Cl)c1C#N",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "40502daf-7530-4d76-9461-a6d8efa0fe2c",
+ "task": "delete",
+ "question": "Please remove a carboxyl from the molecule O=C(C[n+]1ccc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)CSc4cc(Cl)ccc4Cl)C3SC2)cc1)NC(CO)C(=O)O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[n+]1ccc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)CSc4cc(Cl)ccc4Cl)C3SC2)cc1)NC(CO)C(=O)O.",
+ "ref_smiles": "O=C(C[n+]1ccc(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)CSc4cc(Cl)ccc4Cl)C3SC2)cc1)NCCO",
+ "add_group": null,
+ "remove_group": "carboxyl"
+ },
+ {
+ "id": "8c1d9313-838f-4840-a367-dacecad9c6f4",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CCc1cc(C=NNC(=O)CC(=O)Nc2ccc(Cl)cc2)cc(OC)c1O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(C=NNC(=O)CC(=O)Nc2ccc(Cl)cc2)cc(OC)c1O",
+ "ref_smiles": "C=CCc1cc(C=NNC(=O)CC(=O)Nc2ccc(Cl)cc2)cc(OC)c1I",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8ac17661-a875-4bde-9486-4cdddda126c1",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(-c2nsc(NC(=O)C3CC3C)c2C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(-c2nsc(NC(=O)C3CC3C)c2C)cc1",
+ "ref_smiles": "CCOc1nsc(NC(=O)C2CC2C)c1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1171d03d-6313-4639-806a-01c24f4522d2",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(NC(=O)c1ccc(Cl)s1)C(=O)Nc1ccc2c(c1)CCNC(=O)C2 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(NC(=O)c1ccc(Cl)s1)C(=O)Nc1ccc2c(c1)CCNC(=O)C2",
+ "ref_smiles": "CC(C)(NC(=O)c1ccc(O)s1)C(=O)Nc1ccc2c(c1)CCNC(=O)C2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0f5bf8a4-a79c-4486-a06d-307ed20d1052",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+]1C2CCC1CC(C[NH+]=C(N)[NH+]=C(N)N)C2 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1C2CCC1CC(C[NH+]=C(N)[NH+]=C(N)N)C2",
+ "ref_smiles": "C[NH+]1C2CCC1CC(C[NH+]=C[NH+]=C(N)N)C2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "be19b482-b124-4f32-9191-e916c237baf0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(CC)OC(CC(C)(C)C1CCCCC1)Oc1ccc(CI)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)OC(CC(C)(C)C1CCCCC1)Oc1ccc(CI)cc1",
+ "ref_smiles": "CCC(CC)OC(CC(C)(C)C1CCCCC1)Oc1ccc(C[N+](=O)[O-])cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2ca07fcf-5688-47ed-bc31-be8dfac4b58d",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1.",
+ "ref_smiles": "CCc1ccc(NC(=O)c2ccncc2)c(C(=O)[O-])c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fcd571d3-9c02-4694-b373-8337f458e66d",
+ "task": "add",
+ "question": "Modify the molecule NC(=O)c1ccccc1NCC(=O)N1CCCCC1CCC(=O)[O-] by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1ccccc1NCC(=O)N1CCCCC1CCC(=O)[O-]",
+ "ref_smiles": "NC(=O)c1ccccc1NCC(=O)N1C(CCC(=O)[O-])CCCC1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dc7f693c-cc3f-4e29-8cc4-ccb93d141253",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(CCCCCC(NC(=O)NCCCc1ccccc1)C(=O)Nc1ccccc1)NO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCCCC(NC(=O)NCCCc1ccccc1)C(=O)Nc1ccccc1)NO.",
+ "ref_smiles": "NC(=O)CCCCCC(NC(=O)NCCCc1ccccc1)C(=O)Nc1ccccc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fa7fd6ca-0d4a-4256-ab1e-2fcfd9ff11ca",
+ "task": "add",
+ "question": "Modify the molecule CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=CCCCCCC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=CCCCCCC",
+ "ref_smiles": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[NH3+])OC(=O)CCCCCCCCCC=C(CCCCCCC)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "80d3628e-9441-4fd6-a911-8fe725491cde",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC(=O)c1cc(COc2cnc(OC)cc2C=O)c2[nH+]c(Br)cn2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc(COc2cnc(OC)cc2C=O)c2[nH+]c(Br)cn2c1.",
+ "ref_smiles": "COC(=O)c1cc(COc2cnc(OC)cc2C(=O)O)c2[nH+]c(Br)cn2c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2abd3a4c-9260-4e72-86fb-19f57d515feb",
+ "task": "add",
+ "question": "Modify the molecule CC1C[NH2+]CCN1C(=O)c1cc(Br)c2c(c1)OCCO2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C[NH2+]CCN1C(=O)c1cc(Br)c2c(c1)OCCO2",
+ "ref_smiles": "CC1C[NH2+]CC(c2ccccc2)N1C(=O)c1cc(Br)c2c(c1)OCCO2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "dbb9ceba-26c3-41b4-b00a-9265e5c379b6",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)cc1.",
+ "ref_smiles": "C=C(c1ccccc1)c1ccc(CC)cc1Nc1ccc(C)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "281c822e-e34d-4104-b5cd-22127290a52c",
+ "task": "add",
+ "question": "Modify the molecule C[N+](C(=O)Cc1ccccc1)(C1CCN(c2cc[nH+]cc2)CC1)C1CCc2ccc(OC(=O)[O-])cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[N+](C(=O)Cc1ccccc1)(C1CCN(c2cc[nH+]cc2)CC1)C1CCc2ccc(OC(=O)[O-])cc21",
+ "ref_smiles": "C[N+](C(=O)Cc1ccccc1)(C1CCc2ccc(OC(=O)[O-])cc21)C1CCN(c2cc[nH+]cc2)CC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "20318f18-29d6-4ed9-9f95-d4d6ec990aeb",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)OC(=O)NCc1cc2cc(BOC(C)(C)C(C)(C)P)cc(C(F)(F)F)c2o1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NCc1cc2cc(BOC(C)(C)C(C)(C)P)cc(C(F)(F)F)c2o1",
+ "ref_smiles": "CC(=O)C(F)(F)c1cc(BOC(C)(C)C(C)(C)P)cc2cc(CNC(=O)OC(C)(C)C)oc12",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "967777ce-b433-4b46-965a-b086b0d6b0fa",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cc[n+](CCC(=O)NCC(C)O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc[n+](CCC(=O)NCC(C)O)cc1.",
+ "ref_smiles": "CCC(=O)NCC(C)Cc1cc[n+]cc1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d40e3f8c-9190-473f-9ad8-59a29c64888e",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C(C)O)ccc1OCC1CC1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(C)O)ccc1OCC1CC1",
+ "ref_smiles": "Cc1cc(C(C)S)ccc1OCC1CC1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "80b00ff4-2959-48e5-820d-bbf2daa998a7",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCCC1CCN(C(=O)C(C(N)=[NH+]O)C(C)C)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CCN(C(=O)C(C(N)=[NH+]O)C(C)C)CC1.",
+ "ref_smiles": "CCCC1CCN(C(=O)C(C(=[NH+])N)C(C)C)CC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a9889789-0aa7-4cf6-aa97-40fece3c5404",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCN(Cc1ccccc1)C(=O)COc1ccc(I)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1)C(=O)COc1ccc(I)cc1.",
+ "ref_smiles": "CCN(C)C(=O)COc1ccc(I)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ed2fd0cc-4feb-48bb-8df1-d4ded8a41c99",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(-c2csc3ncn(Cc4nc(-c5ccc(Cl)cc5)no4)c(=O)c23)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2csc3ncn(Cc4nc(-c5ccc(Cl)cc5)no4)c(=O)c23)s1.",
+ "ref_smiles": "Cc1ccc(-c2csc3ncn(Cc4nc(-c5ccccc5)no4)c(=O)c23)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "39632754-b90f-4215-bb2c-10a9477c8b8a",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C1CCC(=O)[N+]1(O)Cc1cccc(C[N+]2(O)C(=O)CCC2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCC(=O)[N+]1(O)Cc1cccc(C[N+]2(O)C(=O)CCC2=O)c1.",
+ "ref_smiles": "O=C1CCC(=O)[N+]1(O)Cc1cc(O)cc(C[N+]2(O)C(=O)CCC2=O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "bccf4b64-84e0-461f-a9f6-863066d4d4fc",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CNc1cc(C(=O)NC(Cc2ccccc2)C[NH+](C)C)cc(-c2cccc(CN3OCC(C(C)O)C3C(=O)NC3CC4CC(C3C)C4(C)C)c2OC)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1cc(C(=O)NC(Cc2ccccc2)C[NH+](C)C)cc(-c2cccc(CN3OCC(C(C)O)C3C(=O)NC3CC4CC(C3C)C4(C)C)c2OC)c1",
+ "ref_smiles": "CNc1cc(C(=O)NC(Cc2ccccc2)C[NH+](C)C)cc(-c2cccc(CN3OCC(C(C)S)C3C(=O)NC3CC4CC(C3C)C4(C)C)c2OC)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9b86aed7-cadd-4a5e-8318-4c3718904339",
+ "task": "add",
+ "question": "Modify the molecule CN(c1cccc(Br)c1)C1CCCCC1[NH3+] by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(c1cccc(Br)c1)C1CCCCC1[NH3+]",
+ "ref_smiles": "CN(c1ccc(O)c(Br)c1)C1CCCCC1[NH3+]",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9cbee5ac-3f69-48f6-a77b-a6eef76b8d26",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Bc1cc(CC(OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C(C)(O)CCN(CC)S(C)(=O)=O)CC2)cc(C)c1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Bc1cc(CC(OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C(C)(O)CCN(CC)S(C)(=O)=O)CC2)cc(C)c1O.",
+ "ref_smiles": "BCOCC(OC(=O)N1CCC(N2CCc3ccccc3NC2=O)CC1)C(=O)N1CCC(C(C)(O)CCN(CC)S(C)(=O)=O)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1cce48ac-5b6e-4d8b-a65b-cc503444eaeb",
+ "task": "add",
+ "question": "Modify the molecule CCNS(=O)(=O)CCNC(=O)c1ncccc1C#CCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNS(=O)(=O)CCNC(=O)c1ncccc1C#CCO",
+ "ref_smiles": "CCNS(=O)(=O)C(O)CNC(=O)c1ncccc1C#CCO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "19909b49-2880-444d-830c-c40f85635b8a",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1cc(C)c(C[NH3+])c(N2CC[NH+](CC(C)(C)O)CC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(C[NH3+])c(N2CC[NH+](CC(C)(C)O)CC2)n1.",
+ "ref_smiles": "Cc1cc(C)c(C[NH3+])c(N2CC[NH+](CC(C)C)CC2)n1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3d6dccb3-71d7-444a-9b24-49843b85735e",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)c1ccc(N2C3CCC2CC(NC(=O)c2ccc(C(N)=O)c(NCCC[NH2+]C(C)C)c2)C3)nc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(N2C3CCC2CC(NC(=O)c2ccc(C(N)=O)c(NCCC[NH2+]C(C)C)c2)C3)nc1",
+ "ref_smiles": "CC(=O)c1ccc(N2C3CCC2CC(NC(=O)c2ccc(C(N)=O)c(CCC[NH2+]C(C)C)c2)C3)nc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "081679df-8f05-4eb8-882c-42f1932ab281",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1.",
+ "ref_smiles": "CC(Cc1ccccc1)C(C)Sc1nnc(SSc2n[nH]c(=S)s2)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c46c3075-7ee8-41b3-bb08-cdefa5af494c",
+ "task": "delete",
+ "question": "Modify the molecule FC1=C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC1=C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F",
+ "ref_smiles": "FC(F)(F)C1=CC(F)(F)C(F)(F)C(F)(F)C1(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "1d96c15b-b3f5-4acb-b07f-30a4efaf50e9",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(CO)cs1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(CO)cs1",
+ "ref_smiles": "O=S(=O)(Nc1cc(Cl)ccc1Cl)c1cc(C(O)c2ccccc2)cs1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e85bc98b-486f-4a2f-9d9a-54cb84e6fde4",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)C12CCC34OC3(C(O)CC3(C)C(C(=O)[O-])CCCC34C)C1(O)O2 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C12CCC34OC3(C(O)CC3(C)C(C(=O)[O-])CCCC34C)C1(O)O2",
+ "ref_smiles": "CC(C)C12CCC34OC3(C(O)CC3(C)C(C(=O)[O-])CCCC34C)C1O2",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "883e8866-c259-40f2-b72a-92b5e68b7e5d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cccc(NC(=O)c2c(Cl)c(C)nn2C)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(NC(=O)c2c(Cl)c(C)nn2C)c1",
+ "ref_smiles": "CC(=O)c1c(C)nn(C)c1C(=O)Nc1cccc(OC)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ab24ed6e-04d8-46f3-a840-513683bfff14",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)Cn1c(=O)n(C)c(=O)c2c(-c3ccccc3)n(Cc3cccc4ccccc34)nc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cn1c(=O)n(C)c(=O)c2c(-c3ccccc3)n(Cc3cccc4ccccc34)nc21",
+ "ref_smiles": "CC(C)Cn1c(=O)n(C)c(=O)c2cn(Cc3cccc4ccccc34)nc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a78da731-1455-4ecd-9df3-1dd7b354eeea",
+ "task": "delete",
+ "question": "Modify the molecule O=C1C=CC2=CC=C(O)C=CC1C2 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C=CC2=CC=C(O)C=CC1C2",
+ "ref_smiles": "O=C1C=CC2=CC=CC=CC1C2",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2b7777cf-03be-48d2-bd1b-d5d664a7b7ae",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(-c2nnc(SCC(=O)Nc3cccc(C(=O)[O-])c3)n2N)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2nnc(SCC(=O)Nc3cccc(C(=O)[O-])c3)n2N)cc1",
+ "ref_smiles": "Cc1nnc(SCC(=O)Nc2cccc(C(=O)[O-])c2)n1N",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b0132ca1-e1d1-42c0-96ee-155c6dd59a79",
+ "task": "delete",
+ "question": "Modify the molecule C=C(C)C(=O)OCCC(CCOC(=O)C(=C)C)c1ccc(-c2ccc(N(c3ccc(C)c(C)c3)c3ccc(C)c(C)c3)cc2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OCCC(CCOC(=O)C(=C)C)c1ccc(-c2ccc(N(c3ccc(C)c(C)c3)c3ccc(C)c(C)c3)cc2)cc1",
+ "ref_smiles": "C=C(C)C(=O)OCCC(CCOC(=O)C(=C)C)c1ccc(N(c2ccc(C)c(C)c2)c2ccc(C)c(C)c2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "73d018c0-817e-4d8c-8e51-3ae4d1637081",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH2+]CC1CCCN(c2nc3c(cc2C(N)=O)CCC3)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC1CCCN(c2nc3c(cc2C(N)=O)CCC3)C1.",
+ "ref_smiles": "C[NH2+]CC1CCC(O)N(c2nc3c(cc2C(N)=O)CCC3)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ca69c27d-7c57-4b9e-9a5f-bb9c8aafabf7",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NC1CC[NH+](Cc2ccncc2)CC1)N1CCc2ccc(F)cc21 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CC[NH+](Cc2ccncc2)CC1)N1CCc2ccc(F)cc21",
+ "ref_smiles": "O=C(NC1CC[NH+](Cc2ccncc2)CC1)N1CCc2ccc(S)cc21",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e8ec5f51-2a01-4740-ac69-51abdac7b2cd",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CC1CCOCC1)NC1CC(Oc2cccc(F)c2)C(O)C1[NH+]1CCc2ccccc2C1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1CCOCC1)NC1CC(Oc2cccc(F)c2)C(O)C1[NH+]1CCc2ccccc2C1",
+ "ref_smiles": "O=C(CC1CCOCC1)NC1CC(Oc2cccc(S)c2)C(O)C1[NH+]1CCc2ccccc2C1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cac37a3b-e003-4c1e-b266-284596010163",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nn(C)cc1Nc1ccc(C(F)(F)F)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nn(C)cc1Nc1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "CCc1nn(C)cc1NC(F)(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ed5cfb0d-5300-4a4b-b07f-8aca07628c67",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(C(=O)N(CC(C)C)CC2C[NH+](CC(O)COC(C)C)CCO2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)N(CC(C)C)CC2C[NH+](CC(O)COC(C)C)CCO2)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)N(CC(C)C)CC2C[NH+](CC(C#N)COC(C)C)CCO2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "04a49acc-5a19-4591-9932-090ea8b1315d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)ccc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)ccc1=O.",
+ "ref_smiles": "Cn1nc(C[NH+]2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)c(-c2ccccc2)cc1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6b245b2f-e248-4a0a-8adc-a85a9aa14d82",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC12OC(=O)C1(C(O)C1C=CCCC1)[NH2+]C=CC2CCCl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12OC(=O)C1(C(O)C1C=CCCC1)[NH2+]C=CC2CCCl.",
+ "ref_smiles": "CCC1C=C[NH2+]C2(C(O)C3C=CCCC3)C(=O)OC12C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6e4327a1-9584-4600-8a0b-4ad10bc5ebe4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1cc(Br)c2sc(N)cc2c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cc(Br)c2sc(N)cc2c1",
+ "ref_smiles": "CCOC(=O)c1cc(C#N)c2sc(N)cc2c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1bc634b6-7961-4c00-a087-370720808656",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](C)C1CC[NH+](CC(c2cccc(C(F)(F)F)c2)C2(O)CCCCC2)CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)C1CC[NH+](CC(c2cccc(C(F)(F)F)c2)C2(O)CCCCC2)CC1",
+ "ref_smiles": "C[NH+](C)C1CC[NH+](CC(c2cccc(C(F)(F)F)c2)C2(C(=O)[OH])CCCCC2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e677f569-e8d4-4d6d-a5e0-9f4a3e7ad6dd",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Nc1nc(=O)n(C2OC(CO)(CF)C(O)C2F)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1nc(=O)n(C2OC(CO)(CF)C(O)C2F)cc1F.",
+ "ref_smiles": "Nc1ccn(C2OC(CO)(CF)C(O)C2F)c(=O)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "49a57105-6f98-4515-93b7-b53e557b4b8a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC[NH2+]C(Cc1cc(F)cc(F)c1)c1ccc(Br)o1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(Cc1cc(F)cc(F)c1)c1ccc(Br)o1",
+ "ref_smiles": "CCC[NH2+]C(Cc1cc(F)cc(C(=O)[OH])c1)c1ccc(Br)o1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "117123b8-ee6f-4ae5-a8f1-74ee21bddf56",
+ "task": "sub",
+ "question": "Modify the molecule CCS(=O)(=O)CCNC(NCCc1nc(C(F)(F)F)cs1)=[NH+]C by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCS(=O)(=O)CCNC(NCCc1nc(C(F)(F)F)cs1)=[NH+]C",
+ "ref_smiles": "CCS(=O)(=O)CCNC(NCCc1nc(C(F)(F)C#N)cs1)=[NH+]C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b942bec0-43c8-47c7-a4ec-75b8d1ec7af7",
+ "task": "sub",
+ "question": "Modify the molecule NC(=[NH+]OC(=O)c1ccc(Br)cc1)c1ccncc1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]OC(=O)c1ccc(Br)cc1)c1ccncc1",
+ "ref_smiles": "N#Cc1ccc(C(=O)O[NH+]=C(N)c2ccncc2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2eaae0dd-e008-4c78-822f-f846521b4e9f",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc2c(c1)c1c(n2CO)C[NH+]2CCc3cc(OC)c(OCc4ccc(-n5cccn5)cc4)cc3C2C1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2c(c1)c1c(n2CO)C[NH+]2CCc3cc(OC)c(OCc4ccc(-n5cccn5)cc4)cc3C2C1",
+ "ref_smiles": "COc1ccc2c(c1)c1c(n2C)C[NH+]2CCc3cc(OC)c(OCc4ccc(-n5cccn5)cc4)cc3C2C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e92ff7a4-9c56-41eb-a5b3-85c24a10eff2",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCn1cnc2c(=O)nc[nH]c21)NCCOCCO by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCn1cnc2c(=O)nc[nH]c21)NCCOCCO",
+ "ref_smiles": "CC(=O)CCOCCNC(=O)CCn1cnc2c(=O)nc[nH]c21",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d75d00ad-f0e5-47b9-8b5e-9efd35abd458",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCCCCCCCCCCCCCOS(=O)(=O)N(CCCCCCCCCCCCCCCCCC)c1c(C)c([N+](=O)[O-])c(C)c([N+](=O)[O-])c1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCCOS(=O)(=O)N(CCCCCCCCCCCCCCCCCC)c1c(C)c([N+](=O)[O-])c(C)c([N+](=O)[O-])c1Cl",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCCOS(=O)(=O)N(CCCCCCCCCCCCCCCCCC)c1c(C)c([N+](=O)[O-])c(C)c([N+](=O)[O-])c1C(=O)[OH]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "7bef9759-ebcf-4825-b04c-2bf71e700ecc",
+ "task": "delete",
+ "question": "Modify the molecule CN(CC(O)C[NH2+]C(C)(C)CCCc1c(F)cccc1F)S(=O)(=O)c1cc(F)cc(CCC(=O)[O-])c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CC(O)C[NH2+]C(C)(C)CCCc1c(F)cccc1F)S(=O)(=O)c1cc(F)cc(CCC(=O)[O-])c1",
+ "ref_smiles": "CN(CC(O)C[NH2+]C(C)(C)CCCc1ccccc1F)S(=O)(=O)c1cc(F)cc(CCC(=O)[O-])c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "895ff8bb-7a16-43ae-b72e-1bde8246b3e6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1C2C=CC(CC2)C1Cl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C2C=CC(CC2)C1Cl",
+ "ref_smiles": "O=C1C2C=CC(CC2)C1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "84821d31-8e31-4a35-9240-14729c3d9746",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OC.",
+ "ref_smiles": "COc1ccc(Cc2nc3scc(-c4ccc5ccccc5c4)c3c(=O)[nH]2)cc1OCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "585f3610-7c20-4248-b3d8-edabfc3adff5",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1)NCc1ccsc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1)NCc1ccsc1.",
+ "ref_smiles": "C[NH+]=C(NCC[NH+]1CCN(C(=O)C2CCCC2)CC1C(=O)O)NCc1ccsc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d7d7a031-e212-4d8a-a1bc-23d894441205",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(NS(=O)(=O)c2c[nH+]c(C)[nH]2)c(O)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NS(=O)(=O)c2c[nH+]c(C)[nH]2)c(O)c1",
+ "ref_smiles": "CON(O)S(=O)(=O)c1c[nH+]c(C)[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "791a8a78-2f66-4ebf-b32d-37a408dace32",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)N2CCC(C)C2CO)cc1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)N2CCC(C)C2CO)cc1O.",
+ "ref_smiles": "COc1ccc(C(=O)N2CC(c3ccccc3)C(C)C2CO)cc1O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b42f5a9a-7fd8-427a-ac0e-83666caec2f3",
+ "task": "add",
+ "question": "Please add a amine to the molecule CN1C(=O)C(CCO)c2cccc(F)c21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN1C(=O)C(CCO)c2cccc(F)c21.",
+ "ref_smiles": "CN1C(=O)C(CCO)c2ccc(N)c(F)c21",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "829b1602-c46d-4e3d-a546-745f728051c3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cn1c(-c2ccncc2)nc(C(=O)NCc2ccc(Cl)c(Cl)c2)c([O-])c1=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(-c2ccncc2)nc(C(=O)NCc2ccc(Cl)c(Cl)c2)c([O-])c1=O",
+ "ref_smiles": "Cn1c(-c2ccncc2)nc(C(=O)NCc2ccc(O)c(Cl)c2)c([O-])c1=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "daf22062-5ff2-4488-af2a-72bcbadd39e8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(CC)(CC1OC(n2ccc3c(=O)nc(N)[nH]c32)C(O)C1O)OP(=O)([O-])C(C)(O)CC with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(CC1OC(n2ccc3c(=O)nc(N)[nH]c32)C(O)C1O)OP(=O)([O-])C(C)(O)CC",
+ "ref_smiles": "CCC(CC)(CC1OC(n2ccc3c(=O)nc(N)[nH]c32)C(C(=O)O)C1O)OP(=O)([O-])C(C)(O)CC",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7fa27854-c9b5-41b5-b05f-d9ac2d142935",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule C#CCOc1c(CC=C)cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1OCC with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCOc1c(CC=C)cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1OCC",
+ "ref_smiles": "C#CCOc1c(CC=C)cc(C=C(C(=O)O)C(=O)Nc2cccc([N+](=O)[O-])c2)cc1OCC",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "353bc2f9-5f6c-4d74-bbab-00b9bb3263c7",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCCC4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCCC4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1.",
+ "ref_smiles": "COc1ccc(C2=C(O)C(=O)N(c3ccc(N4CCCC(O)C4)cc3)C2c2ccc(O)c(OC)c2)c(OC)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "071972d1-8caf-47bd-ba39-cd3cfff72567",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)C2)c(=O)[nH]c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)C2)c(=O)[nH]c1C.",
+ "ref_smiles": "Cc1nc(C(=O)Nc2ccccc2C[NH+]2CC(C)OC(C)(O)C2)c(=O)[nH]c1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "82b03830-83ac-4a83-991d-eeb733bd9119",
+ "task": "add",
+ "question": "Modify the molecule CC(C)Oc1cc(C(F)(F)F)cc2c1OC[NH+](C(C)C)C2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1cc(C(F)(F)F)cc2c1OC[NH+](C(C)C)C2",
+ "ref_smiles": "CC(C)Oc1cc(C(F)(F)F)c(-c2ccccc2)c2c1OC[NH+](C(C)C)C2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "03d4f041-4b61-4672-9792-cf086ade9bcf",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)CC(NC(=O)c2cc(F)ccc2N)CCO1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC(NC(=O)c2cc(F)ccc2N)CCO1",
+ "ref_smiles": "CC1(C)CC(NC(=O)c2cccc(F)c2)CCO1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e23686df-865c-4da6-8425-a7972c1f5930",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)CC[NH+](C)Cc1cccc(F)c1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC[NH+](C)Cc1cccc(F)c1F",
+ "ref_smiles": "CCOC(=O)CC[NH+](C)Cc1cccc(NO)c1F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a4b073dd-a60c-463d-9707-ff81efd2374a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCN(Cc1ccccc1)C(=O)CN(CCc1ccccc1F)C(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1)C(=O)CN(CCc1ccccc1F)C(C)=O.",
+ "ref_smiles": "CCN(C)C(=O)CN(CCc1ccccc1F)C(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "65421183-a4cf-4390-a0a6-0356ddcf76bd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]C(c1ccccc1C1CCC1)C1CCC(F)(F)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(c1ccccc1C1CCC1)C1CCC(F)(F)CC1",
+ "ref_smiles": "[NH3+]C(c1ccccc1C1CCC1)C1CCC(F)(S)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1686eb7e-286f-41f8-9fe9-76fc64c89d8c",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule C1CCC(C2NC(C34CC5CC(CC(C5)C3)C4)=[NH+]C2C2CCCCC2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C1CCC(C2NC(C34CC5CC(CC(C5)C3)C4)=[NH+]C2C2CCCCC2)CC1.",
+ "ref_smiles": "O=CCC1CCCCC1C1NC(C23CC4CC(CC(C4)C2)C3)=[NH+]C1C1CCCCC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "24391da9-e195-44f8-b290-e0ca6f08e0a7",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCc1cccc(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1.",
+ "ref_smiles": "CCc1ccc(-c2ccccc2)c(C)c1NC(=S)NC(=O)CCC(=O)OCCCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1f898ad1-0161-4b2a-a474-5c12ed8627d3",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]CCCNC(=O)CC1CCC(C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CCCNC(=O)CC1CCC(C)C1",
+ "ref_smiles": "C[NH2+]CCCNC(=O)CC1CCC(C)C1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "60699471-4115-4416-b80c-a49a34cf7a96",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1cccc(C(O)CN(Cc2ccccc2)OC)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C(O)CN(Cc2ccccc2)OC)c1",
+ "ref_smiles": "COc1cccc(C(S)CN(Cc2ccccc2)OC)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1242f046-0444-42e6-945b-38ce1ff71833",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1ccc(F)c(C[NH2+]Cc2cc(F)ccc2Br)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc(F)c(C[NH2+]Cc2cc(F)ccc2Br)c1",
+ "ref_smiles": "O=C([O-])c1ccc(C=O)c(C[NH2+]Cc2cc(F)ccc2)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0a335bda-0d4a-4d98-8b82-21e84e9d33a5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)C1CC(=O)N(Cc2sccc2Br)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1CC(=O)N(Cc2sccc2Br)C1",
+ "ref_smiles": "CC(C)C1CC(=O)N(Cc2sccc2NO)C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "944dbed2-f075-4cc2-b78f-6cb74b2b3d88",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCCC(C)=CCCC(C)=CCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCCC(C)=CCCC(C)=CCO.",
+ "ref_smiles": "CC(C)=CCCC(C)=CCCC(C)=CC(C)CC(C)=CCC(C(C)=CCCC(C)=CCO)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4d31b336-3784-4d92-9a45-7a1ab2bec014",
+ "task": "add",
+ "question": "Please add a amine to the molecule C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)C)no1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)C)no1.",
+ "ref_smiles": "C[NH+]=C(NCc1cccc(OC(F)F)c1)NCc1cc(C(C)CN)no1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "d42d733c-c389-41b1-bc6f-1e0e90996f6d",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2)cc1",
+ "ref_smiles": "CCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "871431d3-2a6e-49dc-a277-d1aac7f7da78",
+ "task": "sub",
+ "question": "Modify the molecule CC(CCc1ccccc1)(Cn1ccnc1)Sc1ccc(Cl)cc1Cl by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCc1ccccc1)(Cn1ccnc1)Sc1ccc(Cl)cc1Cl",
+ "ref_smiles": "CC(CCc1ccccc1)(Cn1ccnc1)Sc1ccc(C#N)cc1Cl",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bcc33bf0-756e-463b-b22f-cfa30578d935",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12.",
+ "ref_smiles": "O=C(NCCC[NH+]1CCC(Oc2ccc(Cl)c(Cl)c2)CC1c1ccccc1)c1c[nH]c(=O)c2cc(S(=O)[O-])ccc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cd662749-36da-4ad2-a49e-476e279f51cb",
+ "task": "delete",
+ "question": "Modify the molecule C=CCSc1ccccc1NC(=O)c1ccc(C)nc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCSc1ccccc1NC(=O)c1ccc(C)nc1",
+ "ref_smiles": "C=CCSNC(=O)c1ccc(C)nc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5ba9bc83-2802-49ec-b83f-23b83a62174d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCNc1cccc(NS(N)(=O)=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCNc1cccc(NS(N)(=O)=O)c1.",
+ "ref_smiles": "CCC(CCCCCNc1cccc(NS(N)(=O)=O)c1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "87c5674b-a623-463e-a8ab-5e7c122f9d53",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(F)c(Br)cc1NC(=O)NC1CCc2nnnn2CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(F)c(Br)cc1NC(=O)NC1CCc2nnnn2CC1",
+ "ref_smiles": "CC(=O)c1cc(C)c(NC(=O)NC2CCc3nnnn3CC2)cc1Br",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "042f4fe9-a702-482a-ada1-c3643d9ced0f",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule Nc1cc(NCC2CCCS2)nc(-c2ccccc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(NCC2CCCS2)nc(-c2ccccc2)n1.",
+ "ref_smiles": "Nc1cc(NCC2CCCS2)nc(-c2cccc(CC=O)c2)n1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "028144ac-f019-45a1-bb86-7cbb681d66d9",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4)cc3)c2[N+](=O)[O-])C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4)cc3)c2[N+](=O)[O-])C1",
+ "ref_smiles": "CCOC(=O)C1CCCN(c2ncnc(Nc3ccc(N=Nc4ccccc4C(=O)O)cc3)c2[N+](=O)[O-])C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a3eb984c-6d5a-4401-b7ac-c7c87ee2cec5",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CN(C)C(=O)C1CCCN1c1cncc(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)C1CCCN1c1cncc(Br)c1.",
+ "ref_smiles": "CN(C)C(=O)C1CCCN1c1cccnc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0c9ce389-5019-4189-9861-088f7d7bbd3b",
+ "task": "delete",
+ "question": "Modify the molecule CC1(O)CCC2(CC1)C(=O)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc12 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(O)CCC2(CC1)C(=O)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc12",
+ "ref_smiles": "CC1CCC2(CC1)C(=O)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b24383b0-c6e9-4a1e-bd7a-b3de274430a2",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)C3CCC6(C)C5CCC4C2(C)C)cc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)C3CCC6(C)C5CCC4C2(C)C)cc1OC",
+ "ref_smiles": "COc1ccc(C=CC(=O)OC2CCC34CC35CCC36C(C)C(CCC=C(C)C)(c7ccccc7)C3CCC6(C)C5CCC4C2(C)C)cc1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d33a95cc-e7fb-4995-9e54-21fdda269b3b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)n1ncc(Br)c1C(NN)c1cc(Cl)cc(Cl)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1ncc(Br)c1C(NN)c1cc(Cl)cc(Cl)c1",
+ "ref_smiles": "CC(C)n1ncc(O)c1C(NN)c1cc(Cl)cc(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5d5a4535-84ef-454b-9bab-64a18f92bade",
+ "task": "add",
+ "question": "Modify the molecule COCCN(CC(F)(F)F)S(=O)(=O)c1ccc(F)cc1F by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCN(CC(F)(F)F)S(=O)(=O)c1ccc(F)cc1F",
+ "ref_smiles": "COCCN(CC(F)(F)F)S(=O)(=O)c1c(F)cc(F)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "28c58588-3230-4984-af52-0d2c5d1022c5",
+ "task": "delete",
+ "question": "Modify the molecule COc1c(F)ccc(C(=O)NO)c1F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1c(F)ccc(C(=O)NO)c1F",
+ "ref_smiles": "COc1cccc(C(=O)NO)c1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "bf397fa2-71a1-4591-8eea-0a0bb75f1212",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC1NC(=O)C(Cc2ccccc2)NC(=O)c2cc([N+](=O)[O-])ccc2OCCCNC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1NC(=O)C(Cc2ccccc2)NC(=O)c2cc([N+](=O)[O-])ccc2OCCCNC1=O.",
+ "ref_smiles": "CN1CCCOc2ccc([N+](=O)[O-])cc2C(=O)NC(Cc2ccccc2)C1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1375a6c5-c9cf-484e-a317-bfbbc8cb0504",
+ "task": "delete",
+ "question": "Modify the molecule COCOc1cc(C=C(CCC(OC)OC)S(=O)c2ccc(C)cc2)c(OCOC)cc1C=C(CCC(OC)OC)S(=O)c1ccc(C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCOc1cc(C=C(CCC(OC)OC)S(=O)c2ccc(C)cc2)c(OCOC)cc1C=C(CCC(OC)OC)S(=O)c1ccc(C)cc1",
+ "ref_smiles": "COCOc1cc(C=C(CCC(OC)OC)S(=O)c2ccc(C)cc2)c(OCOC)cc1C=C(CCC(OC)OC)S(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5e6fc41b-77dc-4dd3-a9b4-6f77e4ced991",
+ "task": "sub",
+ "question": "Modify the molecule COC1OC(COC(=O)c2ccccc2)C(O)(C(=S)SC)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1OC(COC(=O)c2ccccc2)C(O)(C(=S)SC)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1",
+ "ref_smiles": "COC1OC(COC(=O)c2ccccc2)C(Cl)(C(=S)SC)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1556f727-c3a2-4866-83b9-899a49be21e1",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C[NH2+]C(c1ccc2c(c1)CCC(=O)N2C)C(C)N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(c1ccc2c(c1)CCC(=O)N2C)C(C)N.",
+ "ref_smiles": "CCC([NH2+]C)c1ccc2c(c1)CCC(=O)N2C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b6e46524-ee10-467e-ba4d-a9f3c9196eb3",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1",
+ "ref_smiles": "Cc1ccc(OC(C)C(=O)Nc2ccc3c(c2)CC(=O)N3)c(Br)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ab38f7ba-f072-4df1-ba15-eb8ca452413f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule [NH3+]C(Cc1ccc(O)cc1)c1nc(C(=O)NCc2ccccc2)co1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(Cc1ccc(O)cc1)c1nc(C(=O)NCc2ccccc2)co1",
+ "ref_smiles": "[NH3+]C(Cc1ccc([N+](=O)[O-])cc1)c1nc(C(=O)NCc2ccccc2)co1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5998d2b1-e60a-4173-aa34-680e14dfbaeb",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(c1ccc(Cl)cc1)N(C)c1cc(F)ccc1N with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccc(Cl)cc1)N(C)c1cc(F)ccc1N",
+ "ref_smiles": "CC(c1ccc(C#N)cc1)N(C)c1cc(F)ccc1N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9a98b28b-15a0-43a5-acab-3fdcaa68f8bb",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=c1[nH]c(=O)n(C2(C3OC(CO)C(O)C(O)C3O)OC(CO)C(O)C2O)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1[nH]c(=O)n(C2(C3OC(CO)C(O)C(O)C3O)OC(CO)C(O)C2O)cc1F.",
+ "ref_smiles": "O=c1[nH]c(=O)n(C2(C3OC(CO)C(O)C(O)C3O)CC(O)C(CO)O2)cc1F",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "e3f08153-8b31-42fb-aa16-d2b0ccfb26f9",
+ "task": "add",
+ "question": "Modify the molecule CNS(=O)(=O)c1ccc(C=NO)o1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNS(=O)(=O)c1ccc(C=NO)o1",
+ "ref_smiles": "CNS(=O)(=O)c1ccc(C(=NO)C(=O)O)o1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fdcac435-65b6-4c27-bbe5-6d682679757c",
+ "task": "add",
+ "question": "Please add a amine to the molecule N#CC(C(=O)c1ccccc1)c1nc(-c2ccccc2Cl)cs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(C(=O)c1ccccc1)c1nc(-c2ccccc2Cl)cs1.",
+ "ref_smiles": "N#CC(C(=O)c1ccccc1N)c1nc(-c2ccccc2Cl)cs1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "48164593-2bb3-4649-ac41-7bd3c5c80b69",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCNC(NCCc1cccnc1)=[NH+]CC1COc2ccccc2O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCCc1cccnc1)=[NH+]CC1COc2ccccc2O1.",
+ "ref_smiles": "CCNC(CCc1cccnc1)=[NH+]CC1COc2ccccc2O1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "21bee90d-59a4-4ab0-a509-1101a5633c57",
+ "task": "add",
+ "question": "Modify the molecule CN(C)c1ccc2c(c1)-c1cccc[n+]1CC2 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc2c(c1)-c1cccc[n+]1CC2",
+ "ref_smiles": "CN(CC(=O)O)c1ccc2c(c1)-c1cccc[n+]1CC2",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f571d9fa-4eea-4669-a3b3-9399f7dacd88",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCCO2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCCO2.",
+ "ref_smiles": "CC(CCO)SCC([NH3+])c1ccc2c(c1)OCCC(N)O2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "c6ac774d-4d38-4a70-8077-009f7a7fa327",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cn1cncc1CSCCCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cncc1CSCCCO.",
+ "ref_smiles": "CCCSCc1cncn1C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8b2edf28-1b5d-4bc0-b4e0-17f288182e85",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)COc1ccc(Br)cc1C=Nn1c(C2CCCCC2)nc2ccc(Br)cc2c1=O with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)COc1ccc(Br)cc1C=Nn1c(C2CCCCC2)nc2ccc(Br)cc2c1=O",
+ "ref_smiles": "CC(C)(C)COc1ccc(NO)cc1C=Nn1c(C2CCCCC2)nc2ccc(Br)cc2c1=O",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1ad48129-9114-4d41-9254-eb164cb27b4b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N3CCCCCC3)c(Cl)c2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N3CCCCCC3)c(Cl)c2)cc1",
+ "ref_smiles": "COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N3CCCCCC3)c(NO)c2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c135df84-11ea-443f-8b09-432412e6a42e",
+ "task": "add",
+ "question": "Modify the molecule O=C(NC1CCOC1C1CC1)N1C2CCC1COC2 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCOC1C1CC1)N1C2CCC1COC2",
+ "ref_smiles": "O=C(NC1CCOC1C1(c2ccccc2)CC1)N1C2CCC1COC2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "80e1355d-c505-4754-995d-d733e67787c3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCn1cncc1-c1nc(C)c(Br)c(Cl)n1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1cncc1-c1nc(C)c(Br)c(Cl)n1",
+ "ref_smiles": "CCCn1cncc1-c1nc(C)c(O)c(Cl)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "50be3f7e-67ad-4831-8c5c-e0474cc6a24a",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)N2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1OC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)N2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1OC",
+ "ref_smiles": "COc1ccc(S(=O)(=O)C(Cc2ccccc2)C(=O)N2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)cc1OC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "268f82ed-4a03-41dc-9f97-8e6845c795ff",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)Cn1c(=NC(=O)c2ccc(-c3ccccc3)cc2)sc2ccc(Cl)c(C)c21 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cn1c(=NC(=O)c2ccc(-c3ccccc3)cc2)sc2ccc(Cl)c(C)c21",
+ "ref_smiles": "COC(=O)Cn1c(=NC(=O)c2ccc(-c3ccccc3)cc2)sc2cccc(CHO)c21",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "732fd2ca-e03d-4c52-9e77-fa505736989b",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCOC(=O)c1ccc(NC(C)=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCOC(=O)c1ccc(NC(C)=O)cc1.",
+ "ref_smiles": "CCCCOHC(=O)c1ccc(NC(C)=O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6b68f401-4be7-4c4a-be16-23aa0b7ba5d0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(-c2cc(C(=O)OCC(=O)N3N=C(c4ccc(Cl)cc4)CC3c3ccco3)c3ccccc3n2)cc(OC)c1OC with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(-c2cc(C(=O)OCC(=O)N3N=C(c4ccc(Cl)cc4)CC3c3ccco3)c3ccccc3n2)cc(OC)c1OC",
+ "ref_smiles": "CC(=O)c1ccc(C2=NN(C(=O)COC(=O)c3cc(-c4cc(OC)c(OC)c(OC)c4)nc4ccccc34)C(c3ccco3)C2)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bb3cdc33-9983-444b-8920-bc78d1adb902",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc2c(c1)C([NH+]1CCN(CCN3CCCC3=O)CC1)Cc1ccc(C(F)(F)F)cc1S2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2c(c1)C([NH+]1CCN(CCN3CCCC3=O)CC1)Cc1ccc(C(F)(F)F)cc1S2.",
+ "ref_smiles": "Cc1ccc2c(c1)C([NH+]1CCN(CCN3CCCC3=O)CC1)Cc1ccc(C(F)F)cc1S2.",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f8a3e919-bad0-4ec4-8dff-94b3c130e3ad",
+ "task": "delete",
+ "question": "Modify the molecule CCN(C)C=[NH+]c1cc(Br)c(OCc2ccc(F)cc2C)nc1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(C)C=[NH+]c1cc(Br)c(OCc2ccc(F)cc2C)nc1C",
+ "ref_smiles": "CCN(C)C=[NH+]c1cc(Br)c(OC(C)F)nc1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "116e6d72-2469-4c18-9388-69e07e7fd7fa",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)(C)C=CC1(OCC(=O)[O-])C(C2COC(C)(C)O2)OC2OC(C)(C)OC21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)C=CC1(OCC(=O)[O-])C(C2COC(C)(C)O2)OC2OC(C)(C)OC21.",
+ "ref_smiles": "CC(C)(C)C=CC1(OCC(=O)[O-])C2OC(C)(C)OC2OC1C1OC(C)(C)OC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c28ebeb8-eda5-43b0-b7d6-8715630bbf12",
+ "task": "add",
+ "question": "Modify the molecule CCOc1cc(OC)c(F)cc1F by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(OC)c(F)cc1F",
+ "ref_smiles": "COc1cc(OCCO)c(F)cc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "328cce04-6351-4b44-9252-ddb0c1bba466",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)Cc1csc(NC(=O)c2cc(Cl)cc(Cl)c2)n1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1csc(NC(=O)c2cc(Cl)cc(Cl)c2)n1",
+ "ref_smiles": "COC(=O)Cc1csc(NC(=O)c2cc(Cl)cc(NO)c2)n1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "051b8389-c17b-46c0-bbc6-77ed9fbf095a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(NC(=O)C1CC2CCC1O2)C(O)Cc1ccccc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)C1CC2CCC1O2)C(O)Cc1ccccc1",
+ "ref_smiles": "CC(NC(=O)C1CC2CCC1O2)C(C(=O)c1ccccc1)CC",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "fa6df769-2f17-48a4-aa36-3c1e730a019b",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCOC(=O)CCNC(=O)C(c1ccc(C)cc1C)N(CC)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CCNC(=O)C(c1ccc(C)cc1C)N(CC)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C.",
+ "ref_smiles": "CCOC(=O)CCNC(=O)C(CC(C)C)(c1ccc(C)cc1C)C(C)NC(=O)OC(C)(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "22c65b24-23b0-4311-b773-e47ae250568f",
+ "task": "add",
+ "question": "Modify the molecule NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-] by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)[O-]",
+ "ref_smiles": "NC(=O)CCC([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(C(=O)[O-])C(C(=O)O)c1cnc[nH]1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1c8ac71e-38ad-490c-bdbf-2514bfcec7d3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC[NH2+]C(C)c1ccnc(N(CC)CCO)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(C)c1ccnc(N(CC)CCO)c1",
+ "ref_smiles": "CC[NH2+]C(C)c1ccnc(N(CC)CCS)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "bf96a4e3-0ad8-4ff0-a024-9fc943f48f3b",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(CCC(=O)[O-])[NH2+]Cc1ccc(N(C)C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCC(=O)[O-])[NH2+]Cc1ccc(N(C)C)cc1.",
+ "ref_smiles": "CC(CCC(=O)[O-])[NH2+]CN(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5c6c7405-01f9-424a-a667-0b042f89904a",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(C)=C2SC(=O)N(c3cccc(C)c3C)C2=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(C)=C2SC(=O)N(c3cccc(C)c3C)C2=O)cc1",
+ "ref_smiles": "COc1ccc(C(C)=C2SC(=O)N(c3ccc(-c4ccccc4)c(C)c3C)C2=O)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "786acb43-7318-4861-b46a-053935217411",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nn(C)c(NC2CCCC2C[NH3+])c1C#N by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(NC2CCCC2C[NH3+])c1C#N",
+ "ref_smiles": "CC(=O)c1c(C)nn(C)c1NC1CCCC1C[NH3+]",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "c29d05ff-16bb-4b2a-93b5-2158b5dc920f",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH2+]C(c1ccc(OC)cc1)C(C)SC1CCCCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH2+]C(c1ccc(OC)cc1)C(C)SC1CCCCC1",
+ "ref_smiles": "CC[NH2+]C(OC)C(C)SC1CCCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4fa07898-4605-4f24-8b27-9dde689b55e7",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(CO)(Nc1ccccc1Cl)c1cccc(F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CO)(Nc1ccccc1Cl)c1cccc(F)c1",
+ "ref_smiles": "CCC(CC#N)(Nc1ccccc1Cl)c1cccc(F)c1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "776e01e4-0673-450b-a7ef-d7a134571f02",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(C[NH+]2CC(O)C2)ccc1OCC(O)C[NH+]1CCC(O)CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C[NH+]2CC(O)C2)ccc1OCC(O)C[NH+]1CCC(O)CC1",
+ "ref_smiles": "COc1cc(C[NH+]2CC(C(=O)[OH])C2)ccc1OCC(O)C[NH+]1CCC(O)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "83c68a04-dfab-4b84-ba3c-8cb0ff34074d",
+ "task": "add",
+ "question": "Modify the molecule COc1cccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1",
+ "ref_smiles": "COc1cc(O)cc(C(=O)Nc2ccc(NC(=O)CCNC(=O)C3CC[NH+](CC(=O)Nc4ccccc4C(=O)N4CCCC(C)C4)CC3)cc2C)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f9bc605a-11f0-4eed-9c41-1b48ba3c370b",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCC[NH+]1CCC2(CCOC2)C1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCC[NH+]1CCC2(CCOC2)C1",
+ "ref_smiles": "CC(=O)c1ccc(Nc2ncnc3cc(OC)c(OCCC[NH+]4CCC5(CCOC5)C4)cc23)cc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d887bda8-3b5b-4cd1-a571-be31656894e7",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1COc2c(Cl)cccc2C1[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1COc2c(Cl)cccc2C1[NH3+].",
+ "ref_smiles": "CC1COc2c(Cl)cccc2C1([NH3+])c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8889a7a0-2955-4133-b2be-51a55d7c0630",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccccc1C(=O)C1CN(C)CCC[NH+]1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1C(=O)C1CN(C)CCC[NH+]1C",
+ "ref_smiles": "CC(=O)C1CN(C)CCC[NH+]1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4755bfaa-aa38-4186-ab78-1fcd282937ad",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COCC(=O)N(CCC(=O)[O-])c1cccc(C(=O)[O-])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(=O)N(CCC(=O)[O-])c1cccc(C(=O)[O-])c1.",
+ "ref_smiles": "COCC(=O)N(CCC(=O)[O-])C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b825a5c2-2ff8-4637-9f06-088fbd7b504d",
+ "task": "delete",
+ "question": "Modify the molecule CCn1nccc1CN(C)c1nc(N)nc2c1nc(C)n2C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nccc1CN(C)c1nc(N)nc2c1nc(C)n2C",
+ "ref_smiles": "CCn1nccc1CN(C)c1ncnc2c1nc(C)n2C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "99ac2017-5743-4690-9668-b0693c7c27cb",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1=C2[NH2+]C(O)N(Cc3ccccc3)C2N=C(OCCCCO)N1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1=C2[NH2+]C(O)N(Cc3ccccc3)C2N=C(OCCCCO)N1",
+ "ref_smiles": "[NH3+]C1=C2[NH2+]C(O)(CC=O)N(Cc3ccccc3)C2N=C(OCCCCO)N1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "d41eac33-8046-4000-b249-51e4832216c8",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nc(CNC(NC(C)C(C)c2ccccc2)=[NH+]C)cs1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(CNC(NC(C)C(C)c2ccccc2)=[NH+]C)cs1",
+ "ref_smiles": "CCc1nc(CNC(=[NH+]C)C(C)C(C)c2ccccc2)cs1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e8379d48-9861-4ac6-8b26-97bdf20ee051",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)OC(=O)NC1=[NH+]C(C)(c2nc(Br)ccc2F)C2CCN=S2(=O)C1(C)C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)NC1=[NH+]C(C)(c2nc(Br)ccc2F)C2CCN=S2(=O)C1(C)C",
+ "ref_smiles": "CC(C)(C)OC(=O)NC1=[NH+]C(C)(c2nc(NO)ccc2F)C2CCN=S2(=O)C1(C)C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2da5a179-db8d-42ff-9879-0f2812a5e20a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(I)cc1)c1ccc2c3c(cccc13)CC2 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(I)cc1)c1ccc2c3c(cccc13)CC2",
+ "ref_smiles": "O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccc2c3c(cccc13)CC2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "345b970c-30fa-4e72-9956-37ac907ae6df",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCC1[NH2+]CCCO by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC1[NH2+]CCCO",
+ "ref_smiles": "CC1(O)CCCC1[NH2+]CCCO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "98be3ab5-7ee4-44e2-bfb9-aec81ed351a0",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCCC1CC1NS(=O)(=O)Cc1ccccc1C#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC1NS(=O)(=O)Cc1ccccc1C#N.",
+ "ref_smiles": "CCCC1CC1(NS(=O)(=O)Cc1ccccc1C#N)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "480ac5ee-8585-4049-b14a-5e3786544a99",
+ "task": "delete",
+ "question": "Modify the molecule FC(F)(F)C(CBr)c1ccc(Br)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)C(CBr)c1ccc(Br)cc1",
+ "ref_smiles": "FC(F)(F)C(Br)CBr",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "49370792-bc95-471d-b997-f083e6cec93a",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(C1=C(O)C(=O)N(Cc2cccnc2)C1c1ccc(F)cc1)c1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1=C(O)C(=O)N(Cc2cccnc2)C1c1ccc(F)cc1)c1ccco1.",
+ "ref_smiles": "O=C(C1=CC(=O)N(Cc2cccnc2)C1c1ccc(F)cc1)c1ccco1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "781ec607-4b43-4e7d-9c77-a027ca553846",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)C.",
+ "ref_smiles": "CC1C(=O)CCC(C(=O)Nc2cccc(C3CCC(=O)N3)c2)C1(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "167becc6-211f-44a4-b48f-c74e1b5a6fe2",
+ "task": "sub",
+ "question": "Modify the molecule CCC(C)C(NC(C)=O)C(=O)NC1CSSCC(C(=O)NC(C(N)=O)C(C)O)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(Cc2cnc[nH]2)NC(=O)C(C)(CC)NC(=O)CNC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CC(=O)[O-])NC(=O)C(CCC(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(C(C)C)NC1=O by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(NC(C)=O)C(=O)NC1CSSCC(C(=O)NC(C(N)=O)C(C)O)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(Cc2cnc[nH]2)NC(=O)C(C)(CC)NC(=O)CNC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CC(=O)[O-])NC(=O)C(CCC(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(C(C)C)NC1=O",
+ "ref_smiles": "CCC(C)C(NC(C)=O)C(=O)NC1CSSCC(C(=O)NC(C(N)=O)C(C)C#N)NC(=O)C(CCCNC(N)=[NH2+])NC(=O)C(Cc2cnc[nH]2)NC(=O)C(C)(CC)NC(=O)CNC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(CC(=O)[O-])NC(=O)C(CCC(N)=O)NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C(C(C)C)NC1=O",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "acc31a73-b194-4878-9ffd-d42d402456b9",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1",
+ "ref_smiles": "Cc1ccc(C(=O)N2CCCC2)cc1NC(=O)C1(O)CC[NH+](C(C)C(=O)Nc2ccc(Cl)c(C(=O)N3CCCC3)c2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7af988b5-78f7-4e9a-b22b-f6a3a593c77a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cc1c(Cl)cccc1Cl)C1=COCCC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1c(Cl)cccc1Cl)C1=COCCC1",
+ "ref_smiles": "O=C(Cc1c(S)cccc1Cl)C1=COCCC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "320ab8fd-1d42-465b-b523-854137afef93",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1",
+ "ref_smiles": "CC(Oc1ccc(N2C(=O)C(=Cc3ccc(COc4ccc(Cl)c(Cl)c4)o3)NC2=S)cc1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "31d63893-4a00-4ece-8b20-c5874de85b3c",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C(=O)N(C)c2cccnc2)c(NN)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)N(C)c2cccnc2)c(NN)c1",
+ "ref_smiles": "Cc1ccc(C(=O)N(C)c2cccnc2)c(N)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5c5175dd-679e-40d4-b04b-fbc98149a9a2",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2.",
+ "ref_smiles": "CC1CCCC[NH+]1CCCNC(=O)c1cn2c([nH+]1)CCC(O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "74115751-2b86-43a6-b9d4-4609a54d0eb2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cccc(F)c1C[NH2+]C(C(=O)NO)C(C)O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(F)c1C[NH2+]C(C(=O)NO)C(C)O",
+ "ref_smiles": "CC(=O)c1cccc(OC)c1C[NH2+]C(C(=O)NO)C(C)O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "83a7c85b-1e7e-481a-b2c4-f612437ac76f",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)CCC[NH2+]Cc1ccc(Cl)cc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCC[NH2+]Cc1ccc(Cl)cc1Br.",
+ "ref_smiles": "CC(C)CCC[NH2+]Cc1ccccc1Br",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "795c2439-a458-40a3-814c-418a006eef39",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)c1c(C(F)(F)F)ccc(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1.",
+ "ref_smiles": "NS(=O)(=O)c1c(C(F)(F)F)cc(O)c(-c2ccc(C3CCN(CC4CCC[NH2+]4)CC3)cc2)c1-c1nn[n-]n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "42b73907-b69e-4b66-a82f-5e3fa0c2ca7e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(CCOC3)C2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(CCOC3)C2)cc1C.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N(C)CC(=O)N2CC(C)OC3(COC(O)C3)C2)cc1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1823f5e7-dd5e-4103-8e60-1b4e6fb78401",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCc1nc(N(CC)c2ccccc2)sc1C[NH3+].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc(N(CC)c2ccccc2)sc1C[NH3+].",
+ "ref_smiles": "CCCc1nc(NCC)sc1C[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1bc98728-edd6-4096-b6a4-e497139d6545",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(CN2CC[NH+](CC(=O)NCCCN(C)c3ccccc3)CC2)no1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(CN2CC[NH+](CC(=O)NCCCN(C)c3ccccc3)CC2)no1",
+ "ref_smiles": "Cc1cc(CN2CC[NH+](CCCN(C)c3ccccc3)CC2)no1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e9311230-fa57-44a6-8ef9-34924362eb4a",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)NC(Cc1ccccc1)C(=O)C(C)(C)C by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(Cc1ccccc1)C(=O)C(C)(C)C",
+ "ref_smiles": "CC(=O)NC(Cc1ccccc1N)C(=O)C(C)(C)C",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "6783800c-fccb-42c8-96fe-9a1f5a55dfae",
+ "task": "delete",
+ "question": "Modify the molecule CCC[NH2+]C(c1cc(F)ccc1Br)C1CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1cc(F)ccc1Br)C1CC1",
+ "ref_smiles": "CCC[NH2+]C(F)(Br)C1CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d78ff5f0-bcce-44bb-b281-b2e09c8eb3c6",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C#CCOc1ccccc1C[NH2+]C(C)c1ccsc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCOc1ccccc1C[NH2+]C(C)c1ccsc1.",
+ "ref_smiles": "C#CCOC[NH2+]C(C)c1ccsc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7a59bc42-9e69-4e2f-94c0-457bcb04e8aa",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH+](CC)CCN(C(=O)CCSc1ccc(F)cc1)c1nc2c(Cl)cccc2s1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCN(C(=O)CCSc1ccc(F)cc1)c1nc2c(Cl)cccc2s1",
+ "ref_smiles": "CC[NH+](CC)CCN(C(=O)CCSc1ccccc1)c1nc2c(Cl)cccc2s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c008a561-5e6e-497a-a5ec-501d532550c2",
+ "task": "delete",
+ "question": "Modify the molecule CC([NH3+])=C(C#N)C(=O)CSc1[nH+]cc(-c2ccccc2)n1-c1ccccc1Cl by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])=C(C#N)C(=O)CSc1[nH+]cc(-c2ccccc2)n1-c1ccccc1Cl",
+ "ref_smiles": "CC([NH3+])=C(C#N)C(=O)CSc1[nH+]cc(-c2ccccc2)n1Cl",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3faad370-277e-40f8-a739-f6925da77fe4",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)NC(=O)CCNc1nnnn1C by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)CCNc1nnnn1C",
+ "ref_smiles": "CC(CC=O)C(C)NC(=O)CCNc1nnnn1C",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "2e670fb6-8aa3-4487-b3e7-ba2bfda032d2",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(C(=O)Nc2cc(F)ccc2F)c1NC(=O)CNC(=O)C1CC[NH+](C(C)C(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)Nc2cc(F)ccc2F)c1NC(=O)CNC(=O)C1CC[NH+](C(C)C(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1",
+ "ref_smiles": "Cc1cccc(C(=O)Nc2cc(C(=O)O)ccc2F)c1NC(=O)CNC(=O)C1CC[NH+](C(C)C(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "34c632f7-d91c-463a-a9bc-fe0180c2e963",
+ "task": "add",
+ "question": "Modify the molecule CC1CCN(S(=O)(=O)NC2CCCCCC2O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCN(S(=O)(=O)NC2CCCCCC2O)CC1",
+ "ref_smiles": "CC1(c2ccccc2)CCN(S(=O)(=O)NC2CCCCCC2O)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6de5eb30-d7de-47b1-845d-ef708b5a157c",
+ "task": "add",
+ "question": "Modify the molecule CC(C)OCC(O)c1ccc(C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)OCC(O)c1ccc(C(=O)[O-])cc1",
+ "ref_smiles": "CC(Cc1ccccc1)OCC(O)c1ccc(C(=O)[O-])cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1109af01-e439-4a1f-ad2d-dc2f43fce1b8",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC(C)c1ccc(NC(=S)NCCCCO)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(NC(=S)NCCCCO)cc1.",
+ "ref_smiles": "CCCCNC(=S)Nc1ccc(C(C)C)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a4cfe805-a100-4cf1-a87a-242dff8032b3",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(CC1CCCCCN1C(=O)OC(C)(C)C)[NH2+]CC(C)(C)O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC1CCCCCN1C(=O)OC(C)(C)C)[NH2+]CC(C)(C)O",
+ "ref_smiles": "CC(CC1CCCCCN1C(=O)OC(C)(C)C)[NH2+]CC(C)(C)F",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "dd34ad6a-75e3-4746-abd5-47fe877bdd17",
+ "task": "delete",
+ "question": "Modify the molecule O=c1cc(C2CC(Nc3ncnc4nc[nH]c34)C2)[nH]c(N2CCCC2)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=c1cc(C2CC(Nc3ncnc4nc[nH]c34)C2)[nH]c(N2CCCC2)n1",
+ "ref_smiles": "O=c1cc(C2CC(c3ncnc4nc[nH]c34)C2)[nH]c(N2CCCC2)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3682a521-b0a8-4904-b125-8487970793cc",
+ "task": "sub",
+ "question": "Modify the molecule CCC[NH2+]C(c1ccc(CCOC)cc1)c1ccc(Br)o1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(c1ccc(CCOC)cc1)c1ccc(Br)o1",
+ "ref_smiles": "CCC[NH2+]C(c1ccc(CCOC)cc1)c1ccc(C(=O)[OH])o1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8c21a494-6f1f-481f-9c33-c7eeb7e507d4",
+ "task": "add",
+ "question": "Modify the molecule CCC[NH+]1CCC(CNc2ncnc(N)c2Cl)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH+]1CCC(CNc2ncnc(N)c2Cl)C1",
+ "ref_smiles": "CCC[NH+]1CCC(CNc2nc(-c3ccccc3)nc(N)c2Cl)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "eb8588ee-a2dd-4b01-9227-ef5fa49e4fb2",
+ "task": "add",
+ "question": "Modify the molecule COCCCN(CC(=O)N(CCOC)Cc1cccn1C)S(=O)(=O)c1cccc2cccnc12 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCCN(CC(=O)N(CCOC)Cc1cccn1C)S(=O)(=O)c1cccc2cccnc12",
+ "ref_smiles": "COCCCN(CC(=O)N(CCOC)C(c1ccccc1)c1cccn1C)S(=O)(=O)c1cccc2cccnc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5c6ed796-3e31-4202-b3a1-7ad8c84c582e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Fc1ccc(NCc2cc(Br)c(Br)o2)c(I)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(NCc2cc(Br)c(Br)o2)c(I)c1.",
+ "ref_smiles": "Fc1ccc(Cc2cc(Br)c(Br)o2)c(I)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bfe27c3c-f037-4e5f-a8ff-614dbbc3afd3",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(CC(=O)NC2C[NH2+]Cc3ccccc32)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(=O)NC2C[NH2+]Cc3ccccc32)cc1",
+ "ref_smiles": "COCC(=O)NC1C[NH2+]Cc2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e92f7750-2067-4a42-a50f-98c4c2716407",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1C#Cc1cccc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1C#Cc1cccc(Cl)c1.",
+ "ref_smiles": "C[NH+]1CCN(C(=O)N2CCC3C=NOC32)CC1(C#N)C#Cc1cccc(Cl)c1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "82fe171f-9412-4c5d-91a7-3a2111af2151",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C([NH3+])c2c(C)cc(F)cc2C)c1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C([NH3+])c2c(C)cc(F)cc2C)c1Br",
+ "ref_smiles": "Cc1cc(-c2ccccc2)cc(C([NH3+])c2c(C)cc(F)cc2C)c1Br",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6a1965f3-28e3-43e1-8869-525125201b2c",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc2c(c1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2c(c1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O.",
+ "ref_smiles": "COc1ccc2c(c1-c1ccccc1)CCn1c-2cc(OCc2cnc(Oc3ccc(F)cc3)c(F)c2)nc1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "447141f8-c08f-4522-8724-adb228b15211",
+ "task": "add",
+ "question": "Modify the molecule CC1CC[NH+](C(CN=C(N)NCCc2ccccn2)c2cccs2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC[NH+](C(CN=C(N)NCCc2ccccn2)c2cccs2)CC1",
+ "ref_smiles": "CC1CC[NH+](C(CN=C(N)NCCc2cc(O)ccn2)c2cccs2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c0f74d3d-d9ec-4a22-b005-82de64a0fa6e",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4ccccc4)=C3)c3cccs3)s2)C=C(C)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4ccccc4)=C3)c3cccs3)s2)C=C(C)C1=O.",
+ "ref_smiles": "CC1=CC(=C(c2cccs2)c2ccc(C(=C3C=C(c4ccccc4)C(=O)C(c4cccc(-c5ccccc5)c4)=C3)c3cccs3)s2)C=C(C)C1=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "131b4a27-22d5-4aa7-9549-23f9c9c88bb6",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COC(C)CC1(CO)CCC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C)CC1(CO)CCC1",
+ "ref_smiles": "COC(C)CC1(CC#N)CCC1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "5047654e-4f6e-425a-8ab2-0f6039b3a386",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C=CNC(=O)CCCCCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CNC(=O)CCCCCC.",
+ "ref_smiles": "CCCCCCC(=O)NC=Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "87f70b7a-2b68-4a8a-be00-885dd1a1edf4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Clc1cccc(Nc2ncnc3ccc(NN=NCCCCCN=NNc4ccc5ncnc(Nc6cccc(Cl)c6)c5c4)cc23)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Clc1cccc(Nc2ncnc3ccc(NN=NCCCCCN=NNc4ccc5ncnc(Nc6cccc(Cl)c6)c5c4)cc23)c1",
+ "ref_smiles": "Oc1cccc(Nc2ncnc3ccc(NN=NCCCCCN=NNc4ccc5ncnc(Nc6cccc(Cl)c6)c5c4)cc23)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f55bd57b-110a-44f7-9ed6-98215c3e11a0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1ccccc1O2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1ccccc1O2.",
+ "ref_smiles": "Cc1cccc(C)c1C(C)NC(=O)N1CCC2(C1)Oc1cccc(O)c1O2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1bf9a381-d650-4804-ba58-1f19e2cf1f20",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule CN(CCC#N)C(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1C1CCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCC#N)C(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1C1CCCC1.",
+ "ref_smiles": "CCN(C)C(=O)CSc1nnc(-c2ccc(C(C)(C)C)cc2)n1C1CCCC1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "a1d2d792-2135-46f6-9db1-9b2a3a9ba479",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1ccccc1-c1noc(SCc2nnc(-c3ccncc3)o2)n1 by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1ccccc1-c1noc(SCc2nnc(-c3ccncc3)o2)n1",
+ "ref_smiles": "CC(=O)c1ccccc1-c1noc(SCc2nnc(-c3ccncc3)o2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "66dfce64-ed77-4385-9b7f-160762ac089f",
+ "task": "delete",
+ "question": "Modify the molecule CCCCn1nc2n(Cc3ccc(CC)cc3)c(=O)c3sccc3n2c1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1nc2n(Cc3ccc(CC)cc3)c(=O)c3sccc3n2c1=O",
+ "ref_smiles": "CCCCn1nc2n(CCC)c(=O)c3sccc3n2c1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d8c2b182-fe45-406d-880f-23e1124c0ac9",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC1(F)CC[NH+](Cc2cncc(-c3cnc4n[nH]c(-c5nc6c(-c7ccc(F)cc7)cncc6[nH]5)c4c3)c2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(F)CC[NH+](Cc2cncc(-c3cnc4n[nH]c(-c5nc6c(-c7ccc(F)cc7)cncc6[nH]5)c4c3)c2)C1.",
+ "ref_smiles": "CCC1CC[NH+](Cc2cncc(-c3cnc4n[nH]c(-c5nc6c(-c7ccccc7)cncc6[nH]5)c4c3)c2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "125dfb6c-aac6-4998-b94b-0596f12616b0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOCC(=O)NCC[NH+]1CCN(c2ccc(F)cc2)CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCC(=O)NCC[NH+]1CCN(c2ccc(F)cc2)CC1",
+ "ref_smiles": "CCOCC(=O)NCC[NH+]1CCN(c2ccc(C(=O)O)cc2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3c5e2073-3f4c-48d3-be51-108d1b2a610e",
+ "task": "add",
+ "question": "Modify the molecule Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)ccc2F)c(F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)ccc2F)c(F)c1",
+ "ref_smiles": "Cc1noc(C)c1-c1cc(F)c(-c2nc(C(=O)Nc3cnccc3C3CC(C)C(C)(O)C([NH3+])C3)cc(O)c2F)c(F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0ff0bea4-7ac3-4510-b126-5cf6ef8cecc0",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCc1ccc(S(=O)(=O)N2CCCN(C(=O)CC)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(S(=O)(=O)N2CCCN(C(=O)CC)CC2)cc1.",
+ "ref_smiles": "CCCc1ccc(S(=O)(=O)N2CCCC(C)C2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e80dfa2a-d50a-44f8-be7c-2a68758053c7",
+ "task": "add",
+ "question": "Modify the molecule C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccco1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccco1",
+ "ref_smiles": "C[NH+](C)CCN1C(=O)CCC(C(=O)[O-])C1c1ccc(O)o1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d2d5277b-14d4-43e6-a2b5-28263e66c775",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1c2cc(Cl)ccc2-c2ccc(N=Cc3ccc(Cl)cc3Cl)cc21 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1c2cc(Cl)ccc2-c2ccc(N=Cc3ccc(Cl)cc3Cl)cc21",
+ "ref_smiles": "O=C1c2cc(NO2)ccc2-c2ccc(N=Cc3ccccc3)cc21",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f7883e8f-8ccb-4fbd-8ce6-ad3fdf8cbc00",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1ccc(Cl)nn1)c1ccc2cc(Br)ccc2c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(Cl)nn1)c1ccc2cc(Br)ccc2c1",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)c2ccc3cc(Br)ccc3c2)nn1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "48ba85c2-dc08-4d2d-99b7-1c389f0bf909",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1ccc(C)c(Cn2nc(C3CC3)c3cnn(-c4cccc(Cl)c4)c3c2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(Cn2nc(C3CC3)c3cnn(-c4cccc(Cl)c4)c3c2=O)c1.",
+ "ref_smiles": "Cc1cc(C(=O)O)c(C)cc1Cn1nc(C2CC2)c2cnn(-c3cccc(Cl)c3)c2c1=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3a41f162-f266-4060-9402-cb70c4ae602f",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ncc(-c2cccc(-c3cn[nH]c3)c2)nc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ncc(-c2cccc(-c3cn[nH]c3)c2)nc1C(=O)NC1C2CC3CC1CC(O)(C3)C2",
+ "ref_smiles": "Nc1ncc(-c2cccc(-c3cn[nH]c3)c2)nc1C(=O)NC1C2CC3CC(C2)CC1C3",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ff4214cd-aee7-484a-ab71-bb0f3a486c50",
+ "task": "delete",
+ "question": "Modify the molecule CCC[NH2+]C(CC[NH+](CC)C(C)C)c1cccc(C)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]C(CC[NH+](CC)C(C)C)c1cccc(C)c1",
+ "ref_smiles": "CCC[NH2+]C(C)CC[NH+](CC)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "23b3541d-49c9-4968-9eef-dcc933d24979",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]CCCNC(=O)c1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)[O-])c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CCCNC(=O)c1ccc2c(c1)oc(=O)n2Cc1cccc(NC(=O)[O-])c1",
+ "ref_smiles": "C[NH2+]CCCNC(=O)c1ccc2c(oc(=O)n2Cc2cccc(NC(=O)[O-])c2)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "49508904-2750-439e-b958-0cf0ba7a3ac2",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(=O)C1(Br)CCCCC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C1(Br)CCCCC1=O.",
+ "ref_smiles": "CC(=O)C1(Br)CC(O)CCC1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "76601756-e681-4799-a559-b3ccd964af5c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCCn1c[n+](CCC(F)(F)F)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1c[n+](CCC(F)(F)F)cn1.",
+ "ref_smiles": "CCCCn1c[n+](CCC(F)F)cn1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "fc75478c-a731-4930-aee9-047ead766448",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule COc1ccc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)cc1OC.",
+ "ref_smiles": "COc1cc(C(=O)OCC(=O)NC(C)c2ccc(C)c(C)c2)ccc1OCCC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "ceccb98c-368f-4196-8b49-068c2e5a36e5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(NC1CCN(C(=O)CCc2ccc(Cl)cc2)CC1)c1ccc(=O)[nH]n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCN(C(=O)CCc2ccc(Cl)cc2)CC1)c1ccc(=O)[nH]n1.",
+ "ref_smiles": "O=C(NC1CCN(C(=O)CCCl)CC1)c1ccc(=O)[nH]n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6fe2a1a3-fe72-43bb-a4ee-c6f806455a90",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc(C(O)C(C)[NH2+]CCOCCO)cc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(O)C(C)[NH2+]CCOCCO)cc1",
+ "ref_smiles": "CCOc1ccc(CC(C)[NH2+]CCOCCO)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "00860366-618e-4372-a2d0-6c5edc566f0a",
+ "task": "sub",
+ "question": "Modify the molecule O=C(COc1cccc(C=NNC(=O)C(=O)NC2CC2)c1)Nc1ccccc1C(F)(F)F by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1cccc(C=NNC(=O)C(=O)NC2CC2)c1)Nc1ccccc1C(F)(F)F",
+ "ref_smiles": "N#CC(c1ccccc1NC(=O)COc2cccc(C=NNC(=O)C(=O)NC3CC3)c2)F(F)F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9d72f11b-517d-45ce-8368-cc3b691342d7",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COCC1CC[NH+](CCCS(=O)(=O)Cl)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1CC[NH+](CCCS(=O)(=O)Cl)C1.",
+ "ref_smiles": "COCC1CC[NH+](CCC[SH](=O)=O)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f16e8fa7-60b2-41d8-9eae-b8a0b9cd8e0f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC[NH+](CC)CCNS(=O)(=O)c1cc(N)c(C)cc1F with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCNS(=O)(=O)c1cc(N)c(C)cc1F",
+ "ref_smiles": "CC[NH+](CC)CCNS(=O)(=O)c1cc(N)c(C)cc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ce7f32c8-7bd4-44e7-9895-ae54f8d444d0",
+ "task": "add",
+ "question": "Modify the molecule CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2)CC=C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2)CC=C1",
+ "ref_smiles": "CC1=CN(C(=O)Nc2cccc(-c3nn(C4CCCCO4)c4ccc(-c5ncn(C(c6ccccc6)(c6ccccc6)c6ccccc6)n5)cc34)c2CC=O)CC=C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "5f3d7a2e-7504-4f3f-a31d-c23f42ae7185",
+ "task": "delete",
+ "question": "Modify the molecule NS(=O)(=O)CCOCCOc1ccc(C(F)(F)F)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)CCOCCOc1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "NS(=O)(=O)CCOCCOc1ccc(C(F)F)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "9c232473-9325-4dc3-a097-0f513df4ea24",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCC(C)[NH2+]Cc1ccccc1CO with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(C)[NH2+]Cc1ccccc1CO",
+ "ref_smiles": "CCCCC(C)[NH2+]Cc1ccccc1CNO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2cc47c26-72fb-4656-9a55-fb4530390333",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(N(C(C)C(=O)NCc2nc(-c3cccc(C)c3)no2)S(C)(=O)=O)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N(C(C)C(=O)NCc2nc(-c3cccc(C)c3)no2)S(C)(=O)=O)cc1",
+ "ref_smiles": "Cc1cccc(-c2noc(CNC(=O)C(C)N(C)S(C)(=O)=O)n2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "e4615841-8797-4557-8f8f-c031339b5ea1",
+ "task": "add",
+ "question": "Modify the molecule CCC([NH3+])C(C)OCCc1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC([NH3+])C(C)OCCc1ccccc1",
+ "ref_smiles": "CCC([NH3+])C(C)OCCc1ccccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0a13c722-13dd-4ab4-9825-d7e4c652d890",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)C1CCCCN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1CCCCN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1",
+ "ref_smiles": "COC(=O)C1CCC(c2ccccc2)CN1C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NNC(=O)OC(C)(C)C)c4cnc(OC)cc4n3)cc2)c(Cl)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ab0a66ae-a068-457a-b681-785f1c004149",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C(NC(=S)Nc1ccccc1C(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1)C(c1ccccc1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(=S)Nc1ccccc1C(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1)C(c1ccccc1)c1ccccc1.",
+ "ref_smiles": "O=C(NC(=S)c1ccccc1C(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1)C(c1ccccc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "2d81407c-375f-4826-a488-94e5a73247d6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(C)C(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4c(F)cccc4F)cc3C)CC2)ccc1OC with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4c(F)cccc4F)cc3C)CC2)ccc1OC",
+ "ref_smiles": "CCC(C)C(=O)Nc1cc(NC(=O)C(C)NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4c(F)cccc4C#N)cc3C)CC2)ccc1OC",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0bcc7fc1-9e74-4a41-aa18-fd9f2568a2f0",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C=C(C)C(=O)OCCCCC(=O)NCCOC(=O)C(=C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)OCCCCC(=O)NCCOC(=O)C(=C)C.",
+ "ref_smiles": "C=C(C)C(=O)OCCCCCOC(=O)C(=C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "7bcc3b1a-7e0d-4050-8d5e-a64db759d87f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)C(C)(C)C[NH+]1CCCCC1CCO with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(C)(C)C[NH+]1CCCCC1CCO",
+ "ref_smiles": "CC(C#N)C(C)(C)C[NH+]1CCCCC1CCO",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4e823174-b145-45e1-93b1-9e309409e0e0",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#CC1(CO)CCCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1(CO)CCCCCC1.",
+ "ref_smiles": "N#CC1(CO)CCCCC(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a9ce637f-4c4b-451b-8de5-6d58591ccc58",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(C)c(Nc2cc(C3CC3)nc(NCCCO)n2)c(C)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(Nc2cc(C3CC3)nc(NCCCO)n2)c(C)c1",
+ "ref_smiles": "CC(=O)CCCNc1nc(Nc2c(C)cc(C)cc2C)cc(C2CC2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7c5b401e-0b41-437c-9ed3-9020791eebcf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])CCC(O)C1(Cl)C=CC(c2ccccc2)C=C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCC(O)C1(Cl)C=CC(c2ccccc2)C=C1",
+ "ref_smiles": "O=C([O-])CCC(O)C1([N+](=O)[O-])C=CC(c2ccccc2)C=C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b027845-d6de-4108-abc7-92d8e3d555a8",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(=NNC(=O)COc1ccc(C)cc1)c1cccc(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=NNC(=O)COc1ccc(C)cc1)c1cccc(Br)c1.",
+ "ref_smiles": "CC(Br)=NNC(=O)COc1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7b1aceba-ee81-493c-ba58-f258d4feaed6",
+ "task": "add",
+ "question": "Modify the molecule CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2cccc(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2cccc(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1",
+ "ref_smiles": "CCn1c(C(=O)[O-])c[nH+]c1-c1cccc(-c2ccc(O)c(C)c2OCc2ccc3c(c2)CC[NH+](C2CCOCC2)C3)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "29232926-85fc-4661-ba2f-83cd98faf9c2",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2.",
+ "ref_smiles": "COC(=O)NC12CCC(NS(=O)(=O)c3ccc(CNC(=O)c4cc5ccncc5s4)cc3)(CC1)CC2c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e0749dc9-6d00-4998-b9ad-baac435a5489",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule N#CC(=C[NH2+]Cc1ccccc1Br)C(=O)Nc1ccccc1O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=C[NH2+]Cc1ccccc1Br)C(=O)Nc1ccccc1O",
+ "ref_smiles": "N#CC(=C[NH2+]Cc1ccccc1Br)C(=O)Nc1ccccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "06223ff0-98ea-4b86-98bc-eb21e28d24e4",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1cccnc1NC(=S)NCCC[NH+]1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccnc1NC(=S)NCCC[NH+]1CCCCC1.",
+ "ref_smiles": "COc1cccnc1NC(=S)CCC[NH+]1CCCCC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a4c991d8-1b02-49d3-8d27-3a5031d3cc18",
+ "task": "add",
+ "question": "Modify the molecule Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)C",
+ "ref_smiles": "Cc1[nH]c(C(C)(C)[NH3+])nc(=O)c1C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9e322b64-c739-430e-a4f6-0b9d7ccc59fe",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ccc(N2CC[NH+](CC(C=Cc3ccc(F)cc3)N3C(=O)c4ccccc4C3=O)CC2)nc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(N2CC[NH+](CC(C=Cc3ccc(F)cc3)N3C(=O)c4ccccc4C3=O)CC2)nc1",
+ "ref_smiles": "CCOC(=O)c1ccc(N2CC[NH+](CC(C=Cc3ccccc3)N3C(=O)c4ccccc4C3=O)CC2)nc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "87dbc507-09a8-45a4-8bca-fa65cc7a5638",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)c1ccnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1.",
+ "ref_smiles": "COC(=O)c1c(-c2ccccc2)cnc(C(F)(F)F)c1-c1ccc(OC(F)(F)F)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f54ff6b4-a235-4a00-92ed-c7f2a832f455",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1cc(CBr)cnc1N(C)CC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(CBr)cnc1N(C)CC(C)C.",
+ "ref_smiles": "Cc1cnc(N(C)CC(C)C)c(C)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "44349f4b-6d5e-4851-99e0-69c64fde15d5",
+ "task": "delete",
+ "question": "Modify the molecule CCc1ccc(OCC(=O)Nc2cccc(C[NH3+])c2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(OCC(=O)Nc2cccc(C[NH3+])c2)cc1",
+ "ref_smiles": "CCc1ccc(OCC(=O)NC[NH3+])cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d16063b5-e1eb-4785-ba6a-f61e1cb30323",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2)c1",
+ "ref_smiles": "Cc1cc(Cl)cc(C(=O)N2CCC3(CC[NH2+]3)CC2S)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "4e828010-586e-4f27-9e13-6210fdb40b0f",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1COCCCOc1ccc(C2C(O)CN(OC(=O)OC(C)(C)C)CC2O)cc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1COCCCOc1ccc(C2C(O)CN(OC(=O)OC(C)(C)C)CC2O)cc1",
+ "ref_smiles": "COc1ccccc1COCCCOc1ccc(C2CCN(OC(=O)OC(C)(C)C)CC2O)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "62323fd6-5158-475f-9079-0c3708eeb2bd",
+ "task": "sub",
+ "question": "Modify the molecule CCc1cc(C(=O)N(C)c2ccccc2F)cc(NN)n1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(C(=O)N(C)c2ccccc2F)cc(NN)n1",
+ "ref_smiles": "CCc1cc(C(=O)N(C)c2ccccc2C(=O)[OH])cc(NN)n1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "55f8c940-b775-420b-92db-e2c00c1a725e",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1",
+ "ref_smiles": "Cc1cc(O)ccc1NC(=O)C1([NH3+])CCCCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7f7f909b-0281-4be0-b316-15242ac1247d",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOc1cc(F)c(CN=C(C2CC2)C(C)C(=N)c2nc(N)cc(Nc3ccnnc3)n2)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(F)c(CN=C(C2CC2)C(C)C(=N)c2nc(N)cc(Nc3ccnnc3)n2)c(F)c1.",
+ "ref_smiles": "CCOc1cc(F)c(CN=C(C2CC2)C(C)C(=N)c2nccc(Nc3ccnnc3)n2)c(F)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "456f15af-7b72-4cde-b8b4-65e43654c2b6",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)c1nc(C[NH+]2CCc3ccccc3C2CO)no1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1nc(C[NH+]2CCc3ccccc3C2CO)no1",
+ "ref_smiles": "CC(C)c1nc(C[NH+]2CCc3ccccc3C2CC#N)no1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "48ac4799-69e9-4ebc-bb4d-61ce20f74417",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#Cc1c(F)c(F)c(Nc2c(Br)cc(C(F)(F)F)cc2Br)c(C#N)c1F with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(F)c(F)c(Nc2c(Br)cc(C(F)(F)F)cc2Br)c(C#N)c1F",
+ "ref_smiles": "N#Cc1c(F)c(Cl)c(F)c(F)c1Nc1c(Br)cc(C(F)(F)F)cc1Br",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "208b7bdc-6882-4108-beb9-e3d5a858b16b",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(C)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(C)c1",
+ "ref_smiles": "CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCC(=O)N3CC(C)C)c(CO)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "dd0e81f2-ca6c-4233-8291-c0fe864bb46f",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NCCCNc1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NCCCNc1ccccc1",
+ "ref_smiles": "Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)NCCCN",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4df7f27c-c344-429d-9aa4-9720afe27de5",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC[NH+](C)C)c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC[NH+](C)C)c2c1.",
+ "ref_smiles": "Cc1ccc2nc(-c3ccc(Cl)cc3)nc(NCC(N)[NH+](C)C)c2c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "55563f0e-0c3d-4d5e-b627-6d384d3189d9",
+ "task": "delete",
+ "question": "Modify the molecule N#CC1CN(C(=O)CN2CCC[NH2+]CC2)CCO1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1CN(C(=O)CN2CCC[NH2+]CC2)CCO1",
+ "ref_smiles": "O=C(CN1CCC[NH2+]CC1)N1CCOCC1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1243340d-fd80-4a32-9856-dfb6594667d1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCOc1ccc(Oc2ccc(Br)cc2C[NH3+])cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(Oc2ccc(Br)cc2C[NH3+])cc1",
+ "ref_smiles": "CCCOc1ccc(Oc2ccc(S)cc2C[NH3+])cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc2758be-d5f6-4c23-a8eb-b4e86d542198",
+ "task": "delete",
+ "question": "Modify the molecule CCC(C(=O)OCCNC(=O)CCc1ccc(C)cc1)c1ccccc1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(=O)OCCNC(=O)CCc1ccc(C)cc1)c1ccccc1",
+ "ref_smiles": "CCC(C(=O)OCCCc1ccc(C)cc1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "12b8c428-4049-4507-9343-b1b3313d881f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCn1c(=O)[nH]c(=O)c2cc(-c3ccccc3)[nH]c21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCn1c(=O)[nH]c(=O)c2cc(-c3ccccc3)[nH]c21.",
+ "ref_smiles": "CCCn1c(=O)[nH]c(=O)c2cc[nH]c21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b31dfb81-1ad6-4a5e-82c5-10fefc91ee82",
+ "task": "delete",
+ "question": "Modify the molecule CCN(CC)c1ccc(Nc2ccnc(Nc3ccccc3OC)n2)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(CC)c1ccc(Nc2ccnc(Nc3ccccc3OC)n2)cc1",
+ "ref_smiles": "CCN(CC)c1ccc(-c2ccnc(Nc3ccccc3OC)n2)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0c071823-9657-4761-adc2-88eb3c01972c",
+ "task": "delete",
+ "question": "Modify the molecule FC1CCC2SC1CCC2F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC1CCC2SC1CCC2F",
+ "ref_smiles": "FC1CCC2CCCC1S2",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4fe38048-3b09-4c88-a2cb-e0768e3391a4",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)(C)OC(=O)N1CC[NH+]2CCN(c3nn4c(-c5cnc(N)c(C(F)(F)F)c5)c[nH+]c4s3)CC2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1CC[NH+]2CCN(c3nn4c(-c5cnc(N)c(C(F)(F)F)c5)c[nH+]c4s3)CC2C1.",
+ "ref_smiles": "CC(C)(C)OC(=O)N1CC[NH+]2CCN(c3nn4c(-c5cnc(N)c(C(F)F)c5)c[nH+]c4s3)CC2C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "ea87d1ce-54fb-4b3a-9bf8-cfd305910650",
+ "task": "sub",
+ "question": "Modify the molecule CC[NH+](C)CCNc1nn(C)cc1[N+](=O)[O-] by substituting a nitro with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](C)CCNc1nn(C)cc1[N+](=O)[O-]",
+ "ref_smiles": "CC[NH+](C)CCNc1nn(C)cc1[SH]=O",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "ad22fb49-bf50-4220-8701-c2b4dabe10b7",
+ "task": "add",
+ "question": "Modify the molecule CCc1nc2ccccc2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc2ccccc2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C",
+ "ref_smiles": "CCc1nc2cccc(O)c2c(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Br)c1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a0ca642a-4c8b-46d5-879b-3814bb1b9f51",
+ "task": "add",
+ "question": "Modify the molecule CC(=NNC(=O)COc1cccc(C)c1)c1ccc(O)cc1O by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=NNC(=O)COc1cccc(C)c1)c1ccc(O)cc1O",
+ "ref_smiles": "CC(=NNC(=O)COc1cccc(C)c1)c1cc(CC=O)c(O)cc1O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "e7d070c0-75ad-4dcf-b0c2-18652eb571ca",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COCC1(C(=O)N2CCN(S(N)(=O)=O)CC2)CC[NH2+]CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1(C(=O)N2CCN(S(N)(=O)=O)CC2)CC[NH2+]CC1.",
+ "ref_smiles": "COCC1(C(=O)N2CCN([SH](=O)=O)CC2)CC[NH2+]CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "56a988c4-4161-40cb-8073-c8e2d7f48519",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(Sc2ncccc2Cl)c(CC(C)[NH3+])c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Sc2ncccc2Cl)c(CC(C)[NH3+])c1",
+ "ref_smiles": "Cc1ccc(Sc2ncccc2O)c(CC(C)[NH3+])c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d6a21302-b833-4715-865c-cda33e715f6a",
+ "task": "sub",
+ "question": "Modify the molecule CCC1CCCCC1C(C)(O)c1ccc(F)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCCCC1C(C)(O)c1ccc(F)cc1",
+ "ref_smiles": "CCC1CCCCC1C(C)(O)c1ccc(O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "14263184-6aae-4347-992e-091207939223",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1CN(C(C)CO)C(=O)Cc2cc(NC(=O)Nc3ccc4c(c3)OCO4)ccc2OC1C[NH+](C)Cc1ccc(-c2ccccc2)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(C(C)CO)C(=O)Cc2cc(NC(=O)Nc3ccc4c(c3)OCO4)ccc2OC1C[NH+](C)Cc1ccc(-c2ccccc2)cc1",
+ "ref_smiles": "CC(=O)CC(C)N1CC(C)C(C[NH+](C)Cc2ccc(-c3ccccc3)cc2)Oc2ccc(NC(=O)Nc3ccc4c(c3)OCO4)cc2CC1=O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a536dda0-0e36-43f0-99d0-355daa46b14b",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)Nc1c(C(=O)N2CCCCC2)sc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c12 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1c(C(=O)N2CCCCC2)sc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c12",
+ "ref_smiles": "CC(=O)Nc1c(C(=O)N2CCCCC2)sc2nc(Cl)cc(-c3ccc(Cl)cc3)c12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5fec007c-f833-435c-8ecf-e97d36b8a901",
+ "task": "add",
+ "question": "Modify the molecule C#CCCCC(O)CCCC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCCCC(O)CCCC",
+ "ref_smiles": "CCCCC(O)CCCC#Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a809c21f-bfdd-4ac1-8119-48d5bb205966",
+ "task": "sub",
+ "question": "Modify the molecule COCCOCC(=O)Nc1c(F)cccc1F by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOCC(=O)Nc1c(F)cccc1F",
+ "ref_smiles": "COCCOCC(=O)Nc1c(O)cccc1F",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "390c1382-7df5-4580-8094-cb7d22d55866",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4ccc(F)cc4)cc3C)CC2)ccc1NC(=O)c1cccc(F)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4ccc(F)cc4)cc3C)CC2)ccc1NC(=O)c1cccc(F)c1",
+ "ref_smiles": "Cc1cc(NC(=O)CNC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4ccc(NO)cc4)cc3C)CC2)ccc1NC(=O)c1cccc(F)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fb6daf69-5351-4507-a861-fcb43d1738ea",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)cc1OC.",
+ "ref_smiles": "COc1cc(C(=O)NN=C(C)C23CC4CC(CC(C4)C2)C3)ccc1OCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "98bfce04-8a0b-4e9e-8459-909e8f7827b5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cnccc1Cn1c(CCl)nc2cc(Cl)c(Cl)cc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cnccc1Cn1c(CCl)nc2cc(Cl)c(Cl)cc21",
+ "ref_smiles": "Cc1cnccc1Cn1c(CC#N)nc2cc(Cl)c(Cl)cc21",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e409afe3-ce9a-414b-8e45-d2e966681fbf",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1C1CCN(C(=O)NC2CCC3C[NH2+]CC3C2)C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C1CCN(C(=O)NC2CCC3C[NH2+]CC3C2)C1",
+ "ref_smiles": "COC1CCN(C(=O)NC2CCC3C[NH2+]CC3C2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "9d212cbc-3b85-4820-943d-9f7a9959f9b9",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CC(O)C[NH+](CC)C(C)C by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(O)C[NH+](CC)C(C)C",
+ "ref_smiles": "CCOC(=O)CCC[NH+](CC)C(C)C",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "38213924-cd97-4717-910e-327873fcc336",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOCC(O)COc1c(C(C)(C)C)cc(OSC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCC(O)COc1c(C(C)(C)C)cc(OSC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C",
+ "ref_smiles": "CCOCC(S)COc1c(C(C)(C)C)cc(OSC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ecf2ec4a-e1e5-4a5e-afe9-90612ebf31b0",
+ "task": "sub",
+ "question": "Modify the molecule COC1OC(CO)C(O)C(O)C1[NH2+]C1C=C(CO)C(O)C(O)C1O by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1OC(CO)C(O)C(O)C1[NH2+]C1C=C(CO)C(O)C(O)C1O",
+ "ref_smiles": "COC1OC(CS)C(O)C(O)C1[NH2+]C1C=C(CO)C(O)C(O)C1O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "37404a76-48cc-4c0d-a1ba-bd92b57b62d1",
+ "task": "add",
+ "question": "Modify the molecule CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1",
+ "ref_smiles": "CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ncc(-c3ccccc3F)o2)cc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8c29356c-5974-4f2e-a52f-91e58cff6258",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2cccc(F)c2)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2cccc(F)c2)cc1",
+ "ref_smiles": "CCOc1ccc(C2=C(O)C(=O)N(c3ccccc3Cl)C2c2ccc(O)c(F)c2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "32f6c4d5-1974-4181-8585-2fc67b600805",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)OCC(O)C1OC(=O)C(=O)C1=O by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OCC(O)C1OC(=O)C(=O)C1=O",
+ "ref_smiles": "CC(=O)C(COC(C)(C)C)C1OC(=O)C(=O)C1=O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "128d037d-cc78-41ef-af5d-31f96d4fa299",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cccc(NCC(NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)C(=O)N2CCC(C)CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(NCC(NS(=O)(=O)c2cc(Cl)c(N)c(Cl)c2)C(=O)N2CCC(C)CC2)c1.",
+ "ref_smiles": "CNCC(NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)N1CCC(C)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b2c1be2b-edcb-4cba-88f1-81be1ad237d3",
+ "task": "delete",
+ "question": "Modify the molecule CN(C(=O)NC(CCC(N)=O)C(=O)[O-])C1CCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C(=O)NC(CCC(N)=O)C(=O)[O-])C1CCC1",
+ "ref_smiles": "CC(NC(=O)N(C)C1CCC1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "6a0cc142-9567-45c3-9449-ba38b334ae22",
+ "task": "add",
+ "question": "Modify the molecule CCCNc1nc(-c2ncccc2CC)nc(C)c1CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1nc(-c2ncccc2CC)nc(C)c1CC",
+ "ref_smiles": "CCc1cccnc1-c1nc(C)c(CC)c(NCCCO)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5be53709-071c-40a4-9be8-d0a40660e77b",
+ "task": "sub",
+ "question": "Modify the molecule CC1=C(C#N)C(c2ccc(C#N)cc2)n2c(N)nnc2N1c1cccc(CF)c1 by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(C#N)C(c2ccc(C#N)cc2)n2c(N)nnc2N1c1cccc(CF)c1",
+ "ref_smiles": "CC1=C(NO)C(c2ccc(C#N)cc2)n2c(N)nnc2N1c1cccc(CF)c1",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "cfb162e3-0429-4e78-8627-47ac11dd9d46",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC(=O)C1CCCN(C(=S)Nc2ccc(OC)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCCN(C(=S)Nc2ccc(OC)cc2)C1.",
+ "ref_smiles": "CCOC(=O)C1CCCN(C(=S)NOC)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "17ac3881-7286-415f-a4bb-19a82e1f02e1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCC[NH+]1CCC(NC(=O)c2c(C)nn(Cc3ccccc3Cl)c2Cl)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[NH+]1CCC(NC(=O)c2c(C)nn(Cc3ccccc3Cl)c2Cl)CC1",
+ "ref_smiles": "CCCC[NH+]1CCC(NC(=O)c2c(C)nn(Cc3ccccc3S)c2Cl)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "22cdeca4-ea0d-4d3d-a073-49bed29f880c",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule CCN1CC[NH+](C2CCN(c3cc(CO)ccc3[N+](=O)[O-])C2)CC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1CC[NH+](C2CCN(c3cc(CO)ccc3[N+](=O)[O-])C2)CC1",
+ "ref_smiles": "CCN1CC[NH+](C2CCN(c3cc(CO)ccc3I)C2)CC1",
+ "add_group": "halo",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "9871c22c-be65-409a-9cb5-275823091151",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [N-]=[N+]=NCC(O)C1CC2CCC1O2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[N-]=[N+]=NCC(O)C1CC2CCC1O2.",
+ "ref_smiles": "[N-]=[N+]=NCC(O)C1(O)CC2CCC1O2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1b931152-579c-4848-b916-76fbdcc6be69",
+ "task": "sub",
+ "question": "Modify the molecule CCc1cc(SC)cc2scc(F)c12 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc(SC)cc2scc(F)c12",
+ "ref_smiles": "C(=O)Hc1cc(SC)cc2sccc12",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "270ad566-d12c-4f47-b69e-2537825c600b",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCC(CC)(CNc1c(C#N)c(C)nn1C)C(=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(CNc1c(C#N)c(C)nn1C)C(=O)[O-]",
+ "ref_smiles": "CCC(CC)(CNc1c(C(=O)[OH])c(C)nn1C)C(=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "01b5da9a-454b-427d-98cd-a5569aed4113",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3F)cc2)cc1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3F)cc2)cc1",
+ "ref_smiles": "Cc1ccc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3O)cc2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "eb91f0ca-1517-4263-a95f-4f0ba11d708e",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1.",
+ "ref_smiles": "N#CC(=N[N-]c1cccc(Cl)c1)C(=O)C1CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "26b95239-6b70-4e48-a714-653de9c4a0f9",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1c(CN2C(=O)CC(C)C(C(=O)[O-])C2C)cnn1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(CN2C(=O)CC(C)C(C(=O)[O-])C2C)cnn1C.",
+ "ref_smiles": "Cc1c(C2C(C)C(C(=O)[O-])C2C)cnn1C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "01820b19-13ad-44fa-82ba-575ee1c7e872",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1onc(-c2ccc(Cl)o2)c1-c1cccc(Cl)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1onc(-c2ccc(Cl)o2)c1-c1cccc(Cl)c1",
+ "ref_smiles": "Nc1onc(-c2ccc(S)o2)c1-c1cccc(Cl)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f4eaee75-b18b-4ce5-b8df-cdbdc1f4e1fc",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COCC(CNc1ccc(C(=O)N(C)C)cn1)OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(CNc1ccc(C(=O)N(C)C)cn1)OC.",
+ "ref_smiles": "COCC(CNc1ccc(C(=O)N(C)CO)cn1)OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "15c31de6-302b-439c-8bad-9b61ab7c3325",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(CO)Nc1nc2ccc(N)cc2[nH]1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CO)Nc1nc2ccc(N)cc2[nH]1",
+ "ref_smiles": "CC(CF)Nc1nc2ccc(N)cc2[nH]1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "81aee12d-62e0-4220-9fb8-e1950637730b",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+]1C2CCC1CC(OC(=O)C(Cc1ccccc1)Oc1ccc(Cl)cc1)C2 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1C2CCC1CC(OC(=O)C(Cc1ccccc1)Oc1ccc(Cl)cc1)C2",
+ "ref_smiles": "C[NH+]1C2CCC1CC(OC(=O)C(Cc1ccccc1)Oc1ccc(C#N)cc1)C2",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bc60d757-2dd0-440e-94d6-a8fb5e80a7b6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(-c2nnc3ccc(C(=O)[O-])cn23)c1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-c2nnc3ccc(C(=O)[O-])cn23)c1Cl",
+ "ref_smiles": "Cc1cccc(-c2nnc3ccc(C(=O)[O-])cn23)c1NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c7c1bd4c-5217-4abd-92ea-aa963c61a899",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)NC(=O)C(C)n1c(CCl)nc2cc(I)c(F)cc21 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)C(C)n1c(CCl)nc2cc(I)c(F)cc21",
+ "ref_smiles": "CC(C)NC(=O)C(C)n1c(C[N+](=O)[O-])nc2cc(I)c(F)cc21",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b3ad8a26-270c-4a81-a3e3-8bfb60042b1f",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)N1CC[NH+](Cc2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1CC[NH+](Cc2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1",
+ "ref_smiles": "CC(=O)N1CC[NH+](C(O)c2ccc(-c3cc4c(C)cccc4c[n+]3[O-])cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4414a1ea-979f-43a9-99f0-7387d39af6c8",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc2ccccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2ccccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21",
+ "ref_smiles": "COc1ccc2c(-c3ccccc3)cccc2c1C1=C(C)C(C2C(=O)Nc3ccc(Br)c(C)c32)c2ccccc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "00f98d8c-813f-45b1-af47-76caee10f1e0",
+ "task": "sub",
+ "question": "Modify the molecule C[NH2+]Cc1cc(F)c(C)c(S(=O)(=O)N2CCC(C)CC2)c1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1cc(F)c(C)c(S(=O)(=O)N2CCC(C)CC2)c1",
+ "ref_smiles": "C[NH2+]Cc1cc(C(=O)[OH])c(C)c(S(=O)(=O)N2CCC(C)CC2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a4647665-a4ab-4db6-ad22-e9e081d157b2",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCC(C)(C)CC(=CC(CC(=O)[O-])C(=O)N(C[Si](OC)(OC)OC)c1ccccc1)C(CC(=O)N(C[Si](OC)(OC)OC)c1ccccc1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)(C)CC(=CC(CC(=O)[O-])C(=O)N(C[Si](OC)(OC)OC)c1ccccc1)C(CC(=O)N(C[Si](OC)(OC)OC)c1ccccc1)C(=O)[O-].",
+ "ref_smiles": "CCC(C)(C)CC(=CC(CC(=O)[O-])C(=O)NC[Si](OC)(OC)OC)C(CC(=O)N(C[Si](OC)(OC)OC)c1ccccc1)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b35986a1-f21e-41e1-9468-3fff9d2270c8",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccc4c(c3)CC(=O)N4)cc12 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccc4c(c3)CC(=O)N4)cc12",
+ "ref_smiles": "Cc1nn(C2CCCCC2)c2sc(C(=O)Nc3ccccc3)cc12",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "78d87d02-6fa3-47b3-b93f-5eb9dcfe5936",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule O=C([O-])Cn1nc(CC2CCS(=O)(=O)C2)c2c1CC[NH2+]C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])Cn1nc(CC2CCS(=O)(=O)C2)c2c1CC[NH2+]C2.",
+ "ref_smiles": "O=CCC1CS(=O)(=O)CC1Cc1nn(CC(=O)[O-])c2c1C[NH2+]CC2",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b3892200-bab7-47f9-86ec-f2139db01f3e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(CC(C)[NH2+]C2CCCC2SC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(C)[NH2+]C2CCCC2SC)cc1.",
+ "ref_smiles": "COCC(C)[NH2+]C1CCCC1SC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a8887f20-078b-4429-8561-5512f6390c02",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)N1CCCN(C(=O)c2ccccn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)N1CCCN(C(=O)c2ccccn2)CC1",
+ "ref_smiles": "COC(=O)N1CCCN(C(=O)c2ccccn2)C(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ff4fa243-f4f6-4ab9-997b-c991a6b541f8",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCC[Te](I)(CC#N)CCCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[Te](I)(CC#N)CCCC.",
+ "ref_smiles": "CCCC[Te](CC#N)CCCC",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5d3a7cd9-a83a-4fa7-b991-91afe7814dda",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C([O-])c1ccc2cc1OCCCCCCOc1ccc(cc1)C[NH+]=C1NC(=[NH+]C(OCC(F)(F)F)N1)N2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1ccc2cc1OCCCCCCOc1ccc(cc1)C[NH+]=C1NC(=[NH+]C(OCC(F)(F)F)N1)N2.",
+ "ref_smiles": "O=C([O-])c1ccc2cc1OCCCCCCOc1ccc(cc1)C[NH+]=C1NC(N2)C(OCC(F)(F)F)N1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b1eae99a-8317-4dd8-82f6-db027dc9f34a",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cc1nc(-c2ccccc2)sc1CNc1cccc(F)c1C#N with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(-c2ccccc2)sc1CNc1cccc(F)c1C#N",
+ "ref_smiles": "Cc1nc(-c2ccccc2)sc1CNc1cccc(F)c1S",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "9092c0ec-479e-4cdc-b939-2fbcbe4ff476",
+ "task": "delete",
+ "question": "Modify the molecule CCc1ccc(-c2cc(C(F)(F)F)c3c(=O)[nH]c(=S)n(C(C)C)c3n2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2cc(C(F)(F)F)c3c(=O)[nH]c(=S)n(C(C)C)c3n2)cc1",
+ "ref_smiles": "CCc1cc(C(F)(F)F)c2c(=O)[nH]c(=S)n(C(C)C)c2n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5b157a8f-c33b-4d3f-a746-4d65fa2a65ac",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C(=O)Nc2c(F)cccc2F)cc1NC(=O)C[NH+]1CCC(C(=O)Nc2ccccc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2c(F)cccc2F)cc1NC(=O)C[NH+]1CCC(C(=O)Nc2ccccc2)CC1",
+ "ref_smiles": "CN(C(=O)C[NH+]1CCC(C(=O)Nc2ccccc2)CC1)C(=O)Nc1c(F)cccc1F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d6fde0b5-2cd0-438a-bd91-8928fbf06289",
+ "task": "delete",
+ "question": "Please remove a nitrile from the molecule COC(=O)C1(CC#N)CCN(C(=O)[O-])CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1(CC#N)CCN(C(=O)[O-])CC1.",
+ "ref_smiles": "COC(=O)C1(C)CCN(C(=O)[O-])CC1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "4fb96ae2-d87d-4c7a-b605-0840fe14f46c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cc(C)cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)c1.",
+ "ref_smiles": "Cc1cc(CSCC(=O)NC(C)c2ccc(C(C)(C)C)cc2)cc(C)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "363a672a-0f36-4033-ab92-6b1338009fd9",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(CN(C2CC2)S(=O)(=O)CCl)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CN(C2CC2)S(=O)(=O)CCl)o1.",
+ "ref_smiles": "Cc1ccc(CN(C2CC2)S(C)(=O)=O)o1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "58212ebe-fd43-4cf2-8d06-3f84a6473b5a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C1CC(=O)NC(C(=O)[O-])N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CC(=O)NC(C(=O)[O-])N1.",
+ "ref_smiles": "O=C([O-])C1NC1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b6b010f2-e1cd-4301-a270-62595256d9b0",
+ "task": "add",
+ "question": "Modify the molecule CC(=O)c1cccc(S(=O)(=O)N(C)C(C)CO)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cccc(S(=O)(=O)N(C)C(C)CO)c1",
+ "ref_smiles": "CC(=O)c1cccc(S(=O)(=O)N(C)C(C)C(O)O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "44af122a-0f33-474f-9788-366e7e160080",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COCCC[NH+](C)C(C(=O)OC)c1ccccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCC[NH+](C)C(C(=O)OC)c1ccccc1Cl.",
+ "ref_smiles": "COCCC[NH+](C)C(Cl)C(=O)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "107ff357-18fc-459a-a4f9-abe0ae93606b",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)C1CCN(C(=O)OCc2ccccc2)C(C#N)C1 by substituting a nitrile with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCN(C(=O)OCc2ccccc2)C(C#N)C1",
+ "ref_smiles": "CCOC(=O)C1CCN(C(=O)OCc2ccccc2)C(Br)C1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "d63e55b3-05e3-43ff-aad7-8cca405788c2",
+ "task": "add",
+ "question": "Modify the molecule CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2",
+ "ref_smiles": "CCNC(=O)C(=N)C1CN(C(C)c2cc(C)c(OCC3CC3)cn2)C(=O)C12C=C2N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "6ae97fb3-1b1f-4f80-a4f6-c101d14423ce",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(=O)OC1CC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)N(C(=O)CCCCCCC(=O)Oc2c(C)c(C)c3c(c2C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)OC1CC(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)N(C(=O)CCCCCCC(=O)Oc2c(C)c(C)c3c(c2C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)C1.",
+ "ref_smiles": "CCC(=O)OC1CC(CCCCC(=O)Oc2c(C)c(C)c3c(c2C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5305e1b6-f3ee-4792-9386-3ae23f548878",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(C)c1cc(NC(=O)C2CC3CCC2C3)n[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1cc(NC(=O)C2CC3CCC2C3)n[nH]1.",
+ "ref_smiles": "CC(C)c1cc(NC(=O)C2C3CCC(C3)C2N)n[nH]1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "741d525e-7fc8-4cdc-a19d-bfc8a7531062",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(NC(=O)Oc2ccc3c(c2)ncn3C)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(NC(=O)Oc2ccc3c(c2)ncn3C)cc1C.",
+ "ref_smiles": "CCNC(=O)Oc1ccc2c(c1)ncn2C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d3f27e82-e3b6-40a8-b9da-b8afd4f46d46",
+ "task": "add",
+ "question": "Modify the molecule Cc1csc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)n1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1csc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)n1",
+ "ref_smiles": "Cc1nc(C(C#N)C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)sc1CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "cb3c2759-fe66-4a56-aeec-f154e723beb3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1(C)CC(C)(c2cc(Cl)c([O-])c(Cl)c2)c2c1cc(Cl)c([O-])c2Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CC(C)(c2cc(Cl)c([O-])c(Cl)c2)c2c1cc(Cl)c([O-])c2Cl",
+ "ref_smiles": "CC(=O)c1cc(C2(C)CC(C)(C)c3cc(Cl)c([O-])c(Cl)c32)cc(Cl)c1[O-]",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "34c18cb0-21cc-4ce5-9aa0-e4adc6c20bea",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CC(N)[NH2+]CC(O)COc1ccccc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(N)[NH2+]CC(O)COc1ccccc1",
+ "ref_smiles": "CC(=O)C(C[NH2+]C(N)C=C)COc1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c9d3e4e9-1399-42df-8309-82566242df0a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)NC(CC[NH+]1CCC2(CCN(Cc3ccc(S(C)(=O)=O)cc3)C2=O)CC1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NC(CC[NH+]1CCC2(CCN(Cc3ccc(S(C)(=O)=O)cc3)C2=O)CC1)c1ccccc1.",
+ "ref_smiles": "COC(=O)NC(CC[NH+]1CCCCC(c2ccc(S(C)(=O)=O)cc2)CC1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b4750ea0-0d75-4007-95a0-d747c767de18",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1cc(OC)c2c(c1)c(I)cn2C(=O)OC(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(OC)c2c(c1)c(I)cn2C(=O)OC(C)(C)C.",
+ "ref_smiles": "COc1cc(OC)c2c(ccn2C(=O)OC(C)(C)C)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "10acc4b2-d5f3-4584-bcb3-f55686a36f83",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)cc1C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)cc1C(C)(C)C",
+ "ref_smiles": "CCOc1ccc(C([O-])=C2C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(O)cc2)c(-c2ccccc2)c1C(C)(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7c1d34b9-b10b-4d29-81b1-dda3a368a1fd",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule C=CCC(C=C)OC(=O)NC1CCCC2C1=C(C(=O)[O-])N1C(=O)C(C(C)O)C21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCC(C=C)OC(=O)NC1CCCC2C1=C(C(=O)[O-])N1C(=O)C(C(C)O)C21.",
+ "ref_smiles": "C=CCC(C=C)OC(=O)NC1CCCC2C1=C(C(=O)[O-])N1C(=O)C(CC)C21",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1f67711b-27df-46f4-89fc-07aeb5908969",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule C[NH+]=C(NCCOC)NCCn1ccnc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCOC)NCCn1ccnc1.",
+ "ref_smiles": "C[NH+]=C(NCCOC)NCCn1cnc(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a5b10104-3cb6-4e52-b7f2-cf136ccdb9b3",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C2([NH3+])COC2)cc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C2([NH3+])COC2)cc1C.",
+ "ref_smiles": "Cc1ccc(C2([NH3+])COC2)cc1Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7ec7224f-f9a1-423e-9737-78e6af699c4c",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(Sc1nncn1-c1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Sc1nncn1-c1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl.",
+ "ref_smiles": "CC(Sc1nncn1-c1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c54dca32-0ba9-4ad4-beec-31358b30768f",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1.",
+ "ref_smiles": "CCCCCCC(=O)Oc1ccc2c(c1)c(CC(=O)[O-])c(C)n2C(=O)c1ccc(Cl)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "aac1e9af-49e3-4cfd-9764-a0bcd79fdf4d",
+ "task": "sub",
+ "question": "Please substitute a thiol in the molecule CC(C)CC(NC(=O)C([NH3+])Cc1ccccc1)C(=O)NC(CS)C(=O)[O-] with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(NC(=O)C([NH3+])Cc1ccccc1)C(=O)NC(CS)C(=O)[O-]",
+ "ref_smiles": "CC(C)CC(NC(=O)C([NH3+])Cc1ccccc1)C(=O)NC(CF)C(=O)[O-]",
+ "add_group": "halo",
+ "remove_group": "thiol"
+ },
+ {
+ "id": "590b6cca-02d9-4457-bc09-ee7d9cd091d5",
+ "task": "delete",
+ "question": "Modify the molecule CCc1cccc(C)c1NC(=O)N(C)C(C)c1ccccc1Cl by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cccc(C)c1NC(=O)N(C)C(C)c1ccccc1Cl",
+ "ref_smiles": "CCc1cccc(C)c1NC(=O)N(C)C(C)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "90c44b2f-eead-4a90-b723-6d886b7e5d71",
+ "task": "delete",
+ "question": "Modify the molecule CCCSc1nnc(NC(=O)c2nc(SCC)ncc2Cl)s1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCSc1nnc(NC(=O)c2nc(SCC)ncc2Cl)s1",
+ "ref_smiles": "CCCSc1nnc(NC(=O)c2ccnc(SCC)n2)s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d5cdf15f-b140-4c73-b8a2-35b6017bea3d",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule N#CC1=NCC=C(Br)c2ccccc21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC1=NCC=C(Br)c2ccccc21",
+ "ref_smiles": "SC1=NCC=C(Br)c2ccccc21",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "edb6eb4e-5a72-406b-a185-ea29860cb095",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(O)cc(C)c1CC([NH3+])C(=O)NC(=O)C(C)[NH2+]CCCc1ccccc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(O)cc(C)c1CC([NH3+])C(=O)NC(=O)C(C)[NH2+]CCCc1ccccc1",
+ "ref_smiles": "Cc1cc(I)cc(C)c1CC([NH3+])C(=O)NC(=O)C(C)[NH2+]CCCc1ccccc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4d3ae038-6428-4a80-8710-93bbef1366c4",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(CC(=O)C[NH3+])cc1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CC(=O)C[NH3+])cc1C",
+ "ref_smiles": "COCCC(=O)C[NH3+]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7916be32-1e60-4751-9ce5-fb90cdeec3f0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)C1CCC[NH+](CCc2ccccc2[N+](=O)[O-])C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1CCC[NH+](CCc2ccccc2[N+](=O)[O-])C1.",
+ "ref_smiles": "COC(=O)C1CCC[NH+](CC[N+](=O)[O-])C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6e9c3af3-6d42-4992-9e5b-6292067e5a5a",
+ "task": "delete",
+ "question": "Modify the molecule CCC(=O)N1c2ccccc2C=CC1CNS(C)(=O)=O by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)N1c2ccccc2C=CC1CNS(C)(=O)=O",
+ "ref_smiles": "CCC(=O)N1c2ccccc2C=CC1CS(C)(=O)=O",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "44fac171-90ae-49d6-9c29-3040c4a9c535",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cn1ccnc1C([NH3+])CC1(C)CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1ccnc1C([NH3+])CC1(C)CCC1.",
+ "ref_smiles": "Cn1ccnc1C([NH3+])C(c1ccccc1)C1(C)CCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ed9b754b-3b8e-4260-865a-cbd06b17fc3e",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(O)C1CC[NH+](Cc2c[nH+]c3ccc(Br)cn23)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C1CC[NH+](Cc2c[nH+]c3ccc(Br)cn23)C1.",
+ "ref_smiles": "CC(O)C1C[NH+](Cc2c[nH+]c3ccc(Br)cn23)CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b1f84bc4-2fa2-4069-bd85-e1a2afe9afb9",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)Cn1c(=NC(=O)CSCC(=O)N2CCCCC2C)sc2cc(OCC)ccc21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)Cn1c(=NC(=O)CSCC(=O)N2CCCCC2C)sc2cc(OCC)ccc21",
+ "ref_smiles": "CCOC(=O)Cn1c(=NC(=O)C[SH]2CCCCC2C)sc2cc(OCC)ccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "edf19ad0-38bd-46db-9ab8-d934a4c1a4b6",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(NC1CCC(C(=O)[O-])CC1)NC12CC3CC(CC(C3)C1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCC(C(=O)[O-])CC1)NC12CC3CC(CC(C3)C1)C2.",
+ "ref_smiles": "O=C(NC12CC3CC(CC(C3)C1)C2)NC1(c2ccccc2)CCC(C(=O)[O-])CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b64b114d-98b1-4892-9e51-78e8b37af2d7",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CCCC([NH3+])C(c1ccccc1)c1cnc[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCC([NH3+])C(c1ccccc1)c1cnc[nH]1",
+ "ref_smiles": "[NH3+]CCC(c1ccccc1)C([NH3+])C(c1ccccc1)c1cnc[nH]1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "76c9ecde-1c40-43ba-a9bc-a56a99157d0e",
+ "task": "add",
+ "question": "Modify the molecule C=CC1CCCC=CCC(C)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC1CCCC=CCC(C)C1",
+ "ref_smiles": "C=CC1CCCC=C(C(=O)O)CC(C)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c25b79c9-3b26-4b47-ac1d-79fb6b1ec069",
+ "task": "sub",
+ "question": "Modify the molecule COC(C)(C)CCC(CBr)Cc1cccc(F)c1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(C)(C)CCC(CBr)Cc1cccc(F)c1",
+ "ref_smiles": "COC(C)(C)CCC(CC(=O)O)Cc1cccc(F)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8c67f570-e2ee-41af-a6e4-4ea3125bcd1e",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CCS(=O)(=O)Nc1cccc2ccccc12 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCS(=O)(=O)Nc1cccc2ccccc12",
+ "ref_smiles": "CC(C)CCS(=O)(=O)c1cccc2ccccc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6336194e-d096-4b92-9842-ce16789d8a8c",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(N)ccc1NC(=O)c1ccccc1OC(C)C by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(N)ccc1NC(=O)c1ccccc1OC(C)C",
+ "ref_smiles": "COc1ccccc1NC(=O)c1ccccc1OC(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "0fa188e4-883b-4ebd-80a4-3f62fb3f8af4",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(Cl)cc(C(C#N)CN)c1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)cc(C(C#N)CN)c1",
+ "ref_smiles": "COc1cc(Cl)cc(CCN)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "96e82644-a6b6-4ea0-a590-712c65959011",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1(C)CSCC(O)(c2cncnc2)C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CSCC(O)(c2cncnc2)C1",
+ "ref_smiles": "CC1(C)CSCC(I)(c2cncnc2)C1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "70993725-ca0e-436f-a4c7-7b9831e9ab48",
+ "task": "delete",
+ "question": "Modify the molecule CN(Cc1ccccc1)c1c(F)cc(N2CC(N(C)C(=O)[O-])OC2=O)cc1CCO by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(Cc1ccccc1)c1c(F)cc(N2CC(N(C)C(=O)[O-])OC2=O)cc1CCO",
+ "ref_smiles": "CCc1cc(N2CC(N(C)C(=O)[O-])OC2=O)cc(F)c1N(C)Cc1ccccc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "600e09e6-ca83-4f9b-85cd-2282368d1b1b",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)cc1.",
+ "ref_smiles": "COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)c(-c5ccccc5)c4)cc3)cc2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1b3f93e8-14d0-439f-acae-f14867fd81da",
+ "task": "delete",
+ "question": "Modify the molecule CCc1nc(SCC(=O)c2cccc(OC)c2)n(C)c(=O)c1Cc1cccc(C)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1nc(SCC(=O)c2cccc(OC)c2)n(C)c(=O)c1Cc1cccc(C)c1",
+ "ref_smiles": "CCc1nc(SCC(=O)OC)n(C)c(=O)c1Cc1cccc(C)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "05b3e0e8-1c57-443a-97d1-1000c0a487a1",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(CC[NH3+])CCC[NH2+]C1CCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC[NH3+])CCC[NH2+]C1CCC1.",
+ "ref_smiles": "CC(CC[NH3+])CCC[NH2+]C1CCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9bd8c4a4-2240-4a61-875e-e32052a0c785",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(C)c(NC(=O)C2Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(NC(=O)C2Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1.",
+ "ref_smiles": "Cc1cc(C)c(NC(=O)C2(c3ccccc3)Nc3cc(F)ccc3S(=O)(=O)N2)c(C)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d1984758-7e63-4da9-bba2-92753648c7e7",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCN1C(=O)C(F)(F)CN(C2CCCC2)c2nc(Nc3ccc(C(N)=O)cc3OC)ncc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN1C(=O)C(F)(F)CN(C2CCCC2)c2nc(Nc3ccc(C(N)=O)cc3OC)ncc21.",
+ "ref_smiles": "CCN1C(=O)C(F)(F)CN(C2CCCC2)c2nc(-c3ccc(C(N)=O)cc3OC)ncc21",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "8e7f76e6-0d75-46f2-a61a-baed35d093a2",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C1CCC[NH+]1Cc1cccc(NN)n1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCC[NH+]1Cc1cccc(NN)n1",
+ "ref_smiles": "CCOC(=O)C1CCC[NH+]1Cc1cccc(N)n1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e9f910fc-8b98-4a98-9ce4-a3292a0cc1b9",
+ "task": "sub",
+ "question": "Modify the molecule CCCCN(C)C(=O)C1CC(F)(F)CN1C1CN(C(=O)c2ccccc2)C1 by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(C)C(=O)C1CC(F)(F)CN1C1CN(C(=O)c2ccccc2)C1",
+ "ref_smiles": "CC(=O)C1CC(C(=O)N(C)CCCC)N(C2CN(C(=O)c3ccccc3)C2)C1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "03a6899c-acb3-4f7d-ac8e-17e87b73a03e",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc2ncnn2c(C)c1CCC(=O)N1CCC[NH+](Cc2ccccc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2ncnn2c(C)c1CCC(=O)N1CCC[NH+](Cc2ccccc2)CC1",
+ "ref_smiles": "Cc1nc2ncnn2c(C)c1CCC(=O)N1CCC[NH+](C)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "31dbef1f-008f-47d9-bde0-5a47f1cec78b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCC(O)C(O)C=CC(=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(O)C(O)C=CC(=O)[O-]",
+ "ref_smiles": "CCCCC(C(=O)O)C(O)C=CC(=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a57ba3ca-1c19-4a0f-bbee-01f7fe10600a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(Br)c(Cl)c3)C2=O)cc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(Br)c(Cl)c3)C2=O)cc1Br.",
+ "ref_smiles": "COC(=O)COc1ccc(C=C2SC(=O)N(c3ccc(Br)c(Cl)c3)C2=O)cc1Br",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9c84aea2-da34-4c3a-a54c-ad762528dda1",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)CC(=O)OCCOCCOCCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)CC(=O)OCCOCCOCCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1",
+ "ref_smiles": "CCOC(=O)CC(=O)OCCOCCOCCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(C)c5ccc2[nH]5)C=C4)C=C3)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "03846281-b9da-4d1f-a633-6825b43787f7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cccc(-c2nc(C(=O)Nc3ccccc3F)nn2-c2ccc(Cl)cc2)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-c2nc(C(=O)Nc3ccccc3F)nn2-c2ccc(Cl)cc2)c1",
+ "ref_smiles": "Cc1cccc(-c2nc(C(=O)Nc3ccccc3NO)nn2-c2ccc(Cl)cc2)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a9344c76-0867-4b2d-9637-fb9581342f8b",
+ "task": "sub",
+ "question": "Modify the molecule CC=C(OCC)c1noc(C)c1C(=O)c1cccc(Br)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=C(OCC)c1noc(C)c1C(=O)c1cccc(Br)c1",
+ "ref_smiles": "CC=C(OCC)c1noc(C)c1C(=O)c1cccc(NO)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e23adfc9-ea05-427b-9482-26a7bc59b429",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1nc(C2CCCN(C(=O)NC3CCOc4ccc(F)cc43)C2)sc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C2CCCN(C(=O)NC3CCOc4ccc(F)cc43)C2)sc1C.",
+ "ref_smiles": "Cc1nc(C2CCCN(C(=O)NC3CC(C(=O)O)Oc4ccc(F)cc43)C2)sc1C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "67f42e20-e41c-40f3-a0cb-c75fb6a715d5",
+ "task": "sub",
+ "question": "Modify the molecule COCC[NH+]1CC2(CCN(c3ccc(N4CCc5cc(OCC6CCCO6)ccc5C4=O)cc3F)C2)C1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC[NH+]1CC2(CCN(c3ccc(N4CCc5cc(OCC6CCCO6)ccc5C4=O)cc3F)C2)C1",
+ "ref_smiles": "COCC[NH+]1CC2(CCN(c3ccc(N4CCc5cc(OCC6CCCO6)ccc5C4=O)cc3O)C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9582ea17-0dd0-422e-b075-9294d368f2e8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4ncccn4)n3)CCCCC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4ncccn4)n3)CCCCC2)cc1.",
+ "ref_smiles": "Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(Sc4nccc(-c5ccccc5)n4)n3)CCCCC2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a2d63e1f-089c-4d0e-ab0e-3e71cf64d454",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OC)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OC)cc1.",
+ "ref_smiles": "COc1ccc(COc2ccc(C(CC(=O)c3ccc(OCc4ccccc4)c(OC)c3)C[N+](=O)[O-])cc2OCO)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f6950de3-a716-4045-bbd0-ef3b82c3845f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COC1OC(COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2O)C(OCc2ccccc2)C(OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2O)C1OCc1ccccc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1OC(COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2O)C(OCc2ccccc2)C(OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2O)C1OCc1ccccc1",
+ "ref_smiles": "CC(=O)C1C(OCC2OC(OC)C(OCc3ccccc3)C(OC3OC(COCc4ccccc4)C(OCc4ccccc4)C(OCc4ccccc4)C3O)C2OCc2ccccc2)OC(COCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "770d90c0-1e7b-4a4a-8305-e913f1924b2a",
+ "task": "add",
+ "question": "Modify the molecule O=S(=O)([O-])OC12CCC(CC1)CC2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)([O-])OC12CCC(CC1)CC2",
+ "ref_smiles": "O=S(=O)([O-])OC12CCC(CC1)CC2O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "63ba2cab-b1aa-4982-860d-82df2e39886c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=S)c1ccc(S(=O)(=O)Nc2ccc(Br)cc2)s1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=S)c1ccc(S(=O)(=O)Nc2ccc(Br)cc2)s1",
+ "ref_smiles": "NC(=S)c1ccc(S(=O)(=O)Nc2ccc(S)cc2)s1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c1d64c0f-bbf2-4fbb-a129-b505b5558d97",
+ "task": "sub",
+ "question": "Modify the molecule COc1cccc(C=C2OC3C(=C(c4cccc(OC)c4OC)C2=O)OCC3O)c1OC by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C=C2OC3C(=C(c4cccc(OC)c4OC)C2=O)OCC3O)c1OC",
+ "ref_smiles": "COc1cccc(C=C2OC3C(=C(c4cccc(OC)c4OC)C2=O)OCC3C#N)c1OC",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "228a9892-9cad-4964-a4ae-4e4f0cd99dd4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ncccc1NC(=O)c1ccnc(N)c1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ncccc1NC(=O)c1ccnc(N)c1F",
+ "ref_smiles": "CC(=O)c1c(C(=O)Nc2cccnc2C)ccnc1N",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6c17d792-60e3-49b8-a57e-53505a417b9f",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule c1cc(C[NH2+]C2NNNN2)c[nH]1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1cc(C[NH2+]C2NNNN2)c[nH]1.",
+ "ref_smiles": "c1cc(C[NH2+]C2NNN2)c[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "02e11822-1d21-4a92-a873-a337e82f8b2d",
+ "task": "delete",
+ "question": "Modify the molecule CC1C[NH+](CC(O)C[NH+](C)CC(O)C2CC2)CC(C)O1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C[NH+](CC(O)C[NH+](C)CC(O)C2CC2)CC(C)O1",
+ "ref_smiles": "CC1C[NH+](CC(O)C[NH+](C)CCC2CC2)CC(C)O1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9876b7a5-66a7-41cc-81af-475cb322fb0e",
+ "task": "sub",
+ "question": "Modify the molecule O=C1C[NH+](Cc2ccccc2)CCCC1CCO by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C[NH+](Cc2ccccc2)CCCC1CCO",
+ "ref_smiles": "ONCCC1CCC[NH+](Cc2ccccc2)CC1=O",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c6b9c7ab-13e8-4dd7-a6fa-802b5a84ec2a",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(N2CC(C)Cc3ccccc32)ccc1CBr by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(N2CC(C)Cc3ccccc32)ccc1CBr",
+ "ref_smiles": "Cc1ccc(N2CC(C)Cc3ccccc32)cc1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "3e2beff3-1d7c-4528-8699-c01a27fb116a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C)[NH+]1CCC(=NNC(=O)CCC(=O)NCc2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH+]1CCC(=NNC(=O)CCC(=O)NCc2ccccc2)CC1.",
+ "ref_smiles": "CC(C)[NH+]1CCC(=NNC(=O)CCc2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d8de8d0d-9fa5-44ab-9b6b-5d0edbb65fd2",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Cc1cccc2ccccc12)NCC1CCCC1O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1cccc2ccccc12)NCC1CCCC1O",
+ "ref_smiles": "OC1CCCC1Cc1cccc2ccccc12",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "98230ee7-1c90-4cb6-a0de-0d0ca694d659",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(NC(=O)NCCCOC(C)C)no1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)NCCCOC(C)C)no1",
+ "ref_smiles": "Cc1onc(NC(=O)NCCCOC(C)C)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9d04faf3-1ae8-4ab0-875b-f339a382a8f1",
+ "task": "add",
+ "question": "Please add a thiol to the molecule COc1ccc2cc(C(C)[NH2+]C3COC3)ccc2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2cc(C(C)[NH2+]C3COC3)ccc2c1.",
+ "ref_smiles": "COc1ccc2cc(C(C)[NH2+]C3COC3)cc(S)c2c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "a7c72f0a-57e9-4a8a-91d1-d4d7206f65a6",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1",
+ "ref_smiles": "[NH3+]C1(c2cncc3ccccc23)Cc2ccccc2C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "62c2e184-2237-4967-825f-6aa65df789f0",
+ "task": "delete",
+ "question": "Modify the molecule COC1CC(n2c(C(C)Cl)nc3cc(Cl)ccc32)C1(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CC(n2c(C(C)Cl)nc3cc(Cl)ccc32)C1(C)C",
+ "ref_smiles": "COC1CC(n2c(C(C)Cl)nc3ccccc32)C1(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b7115d8b-89ed-47ac-a97a-06ffc1353db2",
+ "task": "add",
+ "question": "Modify the molecule C#CC(CC)C(O)C(c1ccc(C)cc1)S(C)(=O)=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CC(CC)C(O)C(c1ccc(C)cc1)S(C)(=O)=O",
+ "ref_smiles": "C#CC(CC)C(O)C(c1ccc(C)cc1-c1ccccc1)S(C)(=O)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7889c7f6-cdbc-4d9a-a382-50375c571470",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cccnc32)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cccnc32)CC1.",
+ "ref_smiles": "O=C(C1CC[NH2+]CC1)N1CC[NH+](C2c3ccc(Cl)cc3CCc3cc(-c4ccccc4)cnc32)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2a109678-49b4-4f8c-9ab2-9394cd03f650",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)[NH2+]CC(Cc1cc(Br)cs1)C1CCS(=O)(=O)C1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH2+]CC(Cc1cc(Br)cs1)C1CCS(=O)(=O)C1",
+ "ref_smiles": "CC(C)[NH2+]CC(Cc1cc(C(=O)[OH])cs1)C1CCS(=O)(=O)C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6fdeb9b9-5bda-4b3d-83ae-743f0e9f48de",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOc1ccc2nc(SCCCCS)[nH]c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2nc(SCCCCS)[nH]c2c1.",
+ "ref_smiles": "CCOc1cc(O)c2nc(SCCCCS)[nH]c2c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c37bcef9-ba21-41fa-ac57-877ece5aa949",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCOC(=O)C(C)(C)NP(=O)(COC(C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccc(C)cc1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCOC(=O)C(C)(C)NP(=O)(COC(C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccc(C)cc1",
+ "ref_smiles": "CCCCCOC(=O)C(C)(C)P(=O)(COC(C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccc(C)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f286693b-1a66-4433-8beb-e2663074f7c2",
+ "task": "add",
+ "question": "Modify the molecule CC(O)c1cc(F)ccc1OC1CCOC2(CCSC2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)c1cc(F)ccc1OC1CCOC2(CCSC2)C1",
+ "ref_smiles": "CC(O)c1cc(F)cc(O)c1OC1CCOC2(CCSC2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "87ce8f07-b422-4548-9956-00bc75b350e9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(c1ccc(C(F)(F)F)cc1)N(C)C(=O)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1C(O)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccc(C(F)(F)F)cc1)N(C)C(=O)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1C(O)C(=O)[O-]",
+ "ref_smiles": "CC(c1ccc(C(F)(F)S)cc1)N(C)C(=O)c1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1C(O)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2c502c61-276b-4290-8419-b44c5451f90f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(-n2c(O)cc(Sc3ccccc3C(=O)[O-])c2O)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-n2c(O)cc(Sc3ccccc3C(=O)[O-])c2O)cc1",
+ "ref_smiles": "Cc1ccc(-n2c(F)cc(Sc3ccccc3C(=O)[O-])c2O)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9c8a4218-9c32-4456-b65f-f1ff048ac68e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule NC(=[NH+]O)OC12CC3CC(CC(C3)C1=O)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=[NH+]O)OC12CC3CC(CC(C3)C1=O)C2.",
+ "ref_smiles": "O=C1C2CC3CC(C2)CC1(OC=[NH+]O)C3",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "51280355-2ef1-40ca-9cf1-9406f7b7329e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C[NH+](CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)C2CC2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C[NH+](CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)C2CC2)cc1",
+ "ref_smiles": "COc1ccc(C[NH+](CN2C(=O)c3cc(Cl)c(C#N)cc3C2=O)C2CC2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4edcb6cc-7c7b-4d12-aa63-283bf77262c7",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)C1=C(C)NC(CSC)=C(C(=O)OC)C1c1cccc(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1=C(C)NC(CSC)=C(C(=O)OC)C1c1cccc(Cl)c1",
+ "ref_smiles": "COC(=O)C1=C(C)NC(CSC)=C(C(=O)OC)C1c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a187e052-08f6-41d1-b2b6-07fee94bda25",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1C.",
+ "ref_smiles": "C[NH2+]Cc1c(S(=O)(=O)NCc2cn(C)nc2C)n[nH]c1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f3189ef8-bc9a-4d77-b5e1-760dde49577c",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc(Cl)nc(NC2CCCC(C)CC2)c1N by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(Cl)nc(NC2CCCC(C)CC2)c1N",
+ "ref_smiles": "Cc1nc([N+](=O)[O-])nc(NC2CCCC(C)CC2)c1N",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "edee943a-7bc8-4b0c-97e0-86fcc97af192",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC1(O)C(O)c2c(c3c([O-])c4c(=O)ccc(=O)c4c([O-])c3c2=[N+]=[N-])C2OC3(CC)C(O)c4c(c5c([O-])c6c(=O)ccc(=O)c6c([O-])c5c4=[N+]=[N-])C(O)C3C21 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(O)C(O)c2c(c3c([O-])c4c(=O)ccc(=O)c4c([O-])c3c2=[N+]=[N-])C2OC3(CC)C(O)c4c(c5c([O-])c6c(=O)ccc(=O)c6c([O-])c5c4=[N+]=[N-])C(O)C3C21",
+ "ref_smiles": "CCC1(S)C(O)c2c(c3c([O-])c4c(=O)ccc(=O)c4c([O-])c3c2=[N+]=[N-])C2OC3(CC)C(O)c4c(c5c([O-])c6c(=O)ccc(=O)c6c([O-])c5c4=[N+]=[N-])C(O)C3C21",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "78bcf57f-1cac-4f80-99d4-1f30b9284cf7",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCC(NC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(NC(=O)CC23CC4CC(CC(Br)(C4)C2)C3)CC1",
+ "ref_smiles": "CC1CCC(NC(=O)CC23CC4CC(CC(C4)C2)C3)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c98212b2-ef3f-46d1-82d3-02e42427acae",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule NC1=[NH+]c2[nH]ncc2C([NH3+])N1C1Cc2ccccc2N(S(=O)(=O)c2ccc(F)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC1=[NH+]c2[nH]ncc2C([NH3+])N1C1Cc2ccccc2N(S(=O)(=O)c2ccc(F)cc2)C1.",
+ "ref_smiles": "NC1=[NH+]c2[nH]ncc2C([NH3+])N1C1Cc2ccccc2N(S(=O)(=O)c2ccccc2C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "15d2f146-8c22-41f0-9366-a8e2ff16c149",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)c1[nH]n(-c2ccc(Br)cc2)c2nnc(N)c1-2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1[nH]n(-c2ccc(Br)cc2)c2nnc(N)c1-2",
+ "ref_smiles": "CC(C)(C)c1[nH]n(Br)c2nnc(N)c1-2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "971d3e66-33eb-498f-834a-b82826254da8",
+ "task": "add",
+ "question": "Modify the molecule O=C1CCC(c2ccccc2OCCCl)=NN1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCC(c2ccccc2OCCCl)=NN1",
+ "ref_smiles": "O=C1CC(C(=O)O)C(c2ccccc2OCCCl)=NN1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a0f403e0-368a-4a2b-8f71-8ad7fbaa7b1c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCO[P+]([O-])(OCC)C(F)(F)C1CC(n2ccc(=O)[nH]c2=O)OC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCO[P+]([O-])(OCC)C(F)(F)C1CC(n2ccc(=O)[nH]c2=O)OC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C",
+ "ref_smiles": "CCO[P+]([O-])(OCC)C(F)(C(=O)[OH])C1CC(n2ccc(=O)[nH]c2=O)OC1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6c40a09c-21be-4787-8b05-bac49d943067",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)C[NH+]1CCN(Cc2cc(C(C)C)n[nH]2)CC1CCO with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C[NH+]1CCN(Cc2cc(C(C)C)n[nH]2)CC1CCO",
+ "ref_smiles": "CC(C)C[NH+]1CCN(Cc2cc(C(C)C)n[nH]2)CC1CCF",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "28e79be0-8c8c-4883-aeaf-8dd565d85c02",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)Nc1ccc(F)c(Cl)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NS(=O)(=O)c1cc(Cl)ccc1Cl)C(=O)Nc1ccc(F)c(Cl)c1",
+ "ref_smiles": "CC(NS(=O)(=O)c1cc(O)ccc1Cl)C(=O)Nc1ccc(F)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "81d57920-1156-4593-a778-88a4abf8e46f",
+ "task": "delete",
+ "question": "Modify the molecule CCOCCn1c(=NC(=O)c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)sc2cc(C)ccc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCn1c(=NC(=O)c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)sc2cc(C)ccc21",
+ "ref_smiles": "CCOCCn1c(=NC(=O)c2ccc(S(=O)(=O)NC)cc2)sc2cc(C)ccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "227ef7d3-1731-4bf5-ae67-22931b92eb19",
+ "task": "add",
+ "question": "Modify the molecule CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1",
+ "ref_smiles": "CN(C)C(=O)C1CCN(CC[NH2+]C23CCCC2(O)C2CCC4C(C)(CCC5C(C)(C)C(c6ccc(C=O)cc6)=CCC54C)C2CC3)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a6d8d0fb-91c2-46c7-8e90-f82b1e05ddb8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1cc(Nc2cc(NC3CCCC3)ncn2)ccc1Cl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cc(Nc2cc(NC3CCCC3)ncn2)ccc1Cl",
+ "ref_smiles": "CC(=O)C(F)(F)c1cc(Nc2cc(NC3CCCC3)ncn2)ccc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "22b750b6-e4c0-402a-a731-cf9010486889",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cn1cccc1CI.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cccc1CI.",
+ "ref_smiles": "Cc1cccn1C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a6cbdded-7940-4afd-a0d9-536d0a02df43",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Cc1cccc(F)c1)C(=O)Nc1ccc(N2CCC(C(N)=O)CC2)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cc1cccc(F)c1)C(=O)Nc1ccc(N2CCC(C(N)=O)CC2)cc1",
+ "ref_smiles": "CC(Cc1cccc(S)c1)C(=O)Nc1ccc(N2CCC(C(N)=O)CC2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8af1a686-55ff-48b6-9ed3-8e925c885e22",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1nn(C)c(NCc2cccc(OC3CCCCC3)c2)c1[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(NCc2cccc(OC3CCCCC3)c2)c1[N+](=O)[O-].",
+ "ref_smiles": "Cc1nn(C)c(NCc2cccc(OC3CCCC(c4ccccc4)C3)c2)c1[N+](=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "39e3dbbc-8bea-4dc2-8250-cd363420680a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C(CC(=O)Cl)c2cccc(F)c2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(CC(=O)Cl)c2cccc(F)c2)cc1",
+ "ref_smiles": "COc1ccc(C(CC(=O)C(=O)O)c2cccc(F)c2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a1f75648-2e4d-44d4-9be9-bcb42bb09bfe",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CCc2ccc3c(c2)OCO3)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CCc2ccc3c(c2)OCO3)c1.",
+ "ref_smiles": "COc1ccc(OC)c(Sc2nc3c(cnc[n+]3CCc3ccc4c(c3)OCO4)[nH]2)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "8cc17e82-1348-49d1-94fc-24e8a49ba005",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule OCCn1cnc(Nc2ncc3cnn(Cc4ccccc4F)c3n2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCn1cnc(Nc2ncc3cnn(Cc4ccccc4F)c3n2)c1.",
+ "ref_smiles": "CCn1cnc(Nc2ncc3cnn(Cc4ccccc4F)c3n2)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a1d11791-018c-43c1-a31b-d54dee731622",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COC(=O)c1c(C(C)C)nc(-c2ccc(C(F)(F)F)cc2)n1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1c(C(C)C)nc(-c2ccc(C(F)(F)F)cc2)n1C.",
+ "ref_smiles": "COC(=O)c1c(C(C)Cc2ccccc2)nc(-c2ccc(C(F)(F)F)cc2)n1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "43b5fa74-4712-494c-8f3a-a38163520521",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(-c2nc(NCc3ccccn3)nc3nn(C)c(N)c23)c(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc(NCc3ccccn3)nc3nn(C)c(N)c23)c(F)c1.",
+ "ref_smiles": "COc1ccc(-c2nc(NCc3ccccn3)nc3nn(CO)c(N)c23)c(F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b03e15f2-7777-4404-ae16-f02344ad1518",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCOC(=O)C=C(O)Cc1oc2c(C(C)=O)c(O)c(C)c(O)c2c1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C=C(O)Cc1oc2c(C(C)=O)c(O)c(C)c(O)c2c1C",
+ "ref_smiles": "CC(=O)C(=CC(=O)OCC)Cc1oc2c(C(C)=O)c(O)c(C)c(O)c2c1C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "047ff580-98d4-4412-82e0-dc5747ef2bab",
+ "task": "add",
+ "question": "Modify the molecule C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(C)C(C)(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(C)C(C)(C)C",
+ "ref_smiles": "C=CCOC(=O)N1CC(C2=C(C(=O)[O-])N3C(=O)C(C(C)O[Si](C)(C)C(C)(C)C)C3C2)CC1CO[Si](C)(Cc1ccccc1)C(C)(C)C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "1f6b9419-b2cd-48dc-b17e-415c4d86b97f",
+ "task": "delete",
+ "question": "Modify the molecule CCCC(C)NC(=O)COC(=O)c1oc2ccc(OCC)cc2c1C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)NC(=O)COC(=O)c1oc2ccc(OCC)cc2c1C",
+ "ref_smiles": "CCCC(C)OC(=O)c1oc2ccc(OCC)cc2c1C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "99e332e5-4f1d-4f7c-8671-8ef7b51ea3cb",
+ "task": "sub",
+ "question": "Modify the molecule COc1cc(CCl)cc(Cl)c1OCc1c(C)cccc1C by substituting a halo with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(CCl)cc(Cl)c1OCc1c(C)cccc1C",
+ "ref_smiles": "COc1cc(CH2)cc(H)c1OCc1c(C)cccc1C=O",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "357ab758-b8cf-4236-ab2b-acf11511b1a3",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(CCCNC(=O)c2cc3ccc(F)cc3nc2Cl)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(CCCNC(=O)c2cc3ccc(F)cc3nc2Cl)cc1",
+ "ref_smiles": "COc1ccc(CCCNC(=O)c2cc3ccc(O)cc3nc2Cl)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "801b05f6-968a-4228-bc8d-b0b70675e176",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc2cc(CNC(=O)Cn3nc4ccccn4c3=O)ccc2c1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc2cc(CNC(=O)Cn3nc4ccccn4c3=O)ccc2c1",
+ "ref_smiles": "COc1ccc2cc(Cn3nc4ccccn4c3=O)ccc2c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d088bae9-bd14-45f1-b4b4-7a54a3ed491c",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(CC=C[NH+](C)C)=C(C)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC=C[NH+](C)C)=C(C)c1ccccc1.",
+ "ref_smiles": "CC(CC=C[NH+](C)C)=C(CO)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2d845871-e177-45d7-b57a-c9a515001ba4",
+ "task": "delete",
+ "question": "Modify the molecule COc1cccc(CCNNC(=O)C2(Cc3ccc(Br)cc3)N=C(c3ccc(OCCCO)cc3)OC2c2ccccc2Br)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(CCNNC(=O)C2(Cc3ccc(Br)cc3)N=C(c3ccc(OCCCO)cc3)OC2c2ccccc2Br)c1",
+ "ref_smiles": "COc1cccc(CCNNC(=O)C2(Cc3ccc(Br)cc3)N=C(c3ccc(OCCCO)cc3)OC2c2ccccc2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "2440bcd8-838d-4c6b-bb56-7a0311bf4b36",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule c1c[nH]c(-c2ccc3sccc3c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1c[nH]c(-c2ccc3sccc3c2)n1.",
+ "ref_smiles": "O=C(O)c1cc(-c2ncc[nH]2)cc2ccsc12",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "912c889b-9889-4356-a158-4183d27f8425",
+ "task": "delete",
+ "question": "Modify the molecule NC(Cc1ccc(O)cc1)C1NCCC(C(=O)[O-])[NH2+]1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(Cc1ccc(O)cc1)C1NCCC(C(=O)[O-])[NH2+]1",
+ "ref_smiles": "NC(Cc1ccc(O)cc1)C1CCC(C(=O)[O-])[NH2+]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "41d01b81-441c-4373-a647-2cf8927ae756",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccccc1NC(=O)CCSCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)CCSCc1ccccc1.",
+ "ref_smiles": "Cc1ccccc1CSCc1ccccc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c37d7bc6-9eb6-4faa-9ebb-c39f63bc01ca",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCCOc1ccc(Cl)cc1)N1CCN(c2ccc(Br)cn2)CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCOc1ccc(Cl)cc1)N1CCN(c2ccc(Br)cn2)CC1",
+ "ref_smiles": "N#Cc1ccc(OCCCC(=O)N2CCN(c3ccc(Br)cn3)CC2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "661bf646-0431-4333-8858-147879697f05",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(CC)C(=O)N1CCCN(C(=O)Cc2ccc3nc(C)[nH]c3c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C(=O)N1CCCN(C(=O)Cc2ccc3nc(C)[nH]c3c2)CC1.",
+ "ref_smiles": "CCC(CC)C(=O)N1CCC(c2ccc3nc(C)[nH]c3c2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ee644bd9-5698-4b0c-aab5-54a151416707",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)C)c(C)c2)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)C)c(C)c2)ccc1Cl.",
+ "ref_smiles": "CNS(=O)(=O)c1cc(C(=O)OCCOc2ccc(C(C)(C)c3ccccc3)c(C)c2)ccc1Cl",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2ef1e0da-ca7b-4ca0-ac34-9efadc624e5e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCNC(NCC(SC)c1cccc(Cl)c1)=[NH+]CC(=O)NC(C)(C)C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCC(SC)c1cccc(Cl)c1)=[NH+]CC(=O)NC(C)(C)C",
+ "ref_smiles": "CCNC(NCC(SC)c1ccc(C=O)cc1)=[NH+]CC(=O)NC(C)(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e13c7f7c-fd25-4392-80cf-a2f80dcc2180",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCn1c(O)c2c(c1O)CCCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(O)c2c(c1O)CCCC2.",
+ "ref_smiles": "CCn1cc2c(c1O)CCCC2",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "187b65ba-c53c-4677-b9c5-5f33344bbae7",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OCC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OCC",
+ "ref_smiles": "CCOc1ccc(C2C(C(=O)OC)=CN=c3sc(=Cc4cc(Br)c(OCc5ccc([N+](=O)[O-])cc5)c(OCC)c4)c(=O)n32)cc1OC(C)O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3ce9a723-68e5-4e3b-acaf-f0bbe03f532a",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COC(=O)c1ccc(NC(=O)C(=O)NCC2CCN(C(=O)c3ccncc3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1ccc(NC(=O)C(=O)NCC2CCN(C(=O)c3ccncc3)CC2)cc1.",
+ "ref_smiles": "COC(=O)c1ccc(NOCC2CCN(C(=O)c3ccncc3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "835c99f2-a0fc-4b9c-9467-286e8586a157",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Fc1ccc(Oc2nc(N3CCOCC3)nc3c2C[NH+](Cc2ccsc2)CC3)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(Oc2nc(N3CCOCC3)nc3c2C[NH+](Cc2ccsc2)CC3)cc1.",
+ "ref_smiles": "c1ccc(Oc2nc(N3CCOCC3)nc3c2C[NH+](Cc2ccsc2)CC3)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e789b289-79c7-4f20-bb8d-0c97c73b5f78",
+ "task": "add",
+ "question": "Modify the molecule CC1CCCC(CNC(=O)NC(C(=O)[O-])C(C)O)C1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC(CNC(=O)NC(C(=O)[O-])C(C)O)C1",
+ "ref_smiles": "CC1CCCC(CNC(=O)NC(C(=O)[O-])C(O)CCC=O)C1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "4e9cfb7e-70d3-4906-89f9-73105aeeba4a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COc1ccc(Oc2ccc(N3CC(C(=O)OCC(=O)Nc4ccccc4Cl)CC3=O)cc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Oc2ccc(N3CC(C(=O)OCC(=O)Nc4ccccc4Cl)CC3=O)cc2)cc1.",
+ "ref_smiles": "COc1ccc(Oc2ccc(N3CC(C(=O)OCC(=O)Nc4ccccc4)CC3=O)cc2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "42f8e06d-ee31-4586-af9a-8eaa412199e7",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC([NH3+])c1ccc(SC2CCCCC2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])c1ccc(SC2CCCCC2)cn1.",
+ "ref_smiles": "CC([NH3+])(c1ccccc1)c1ccc(SC2CCCCC2)cn1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "412a28fa-aaf2-4759-b8d3-8a01c658a742",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1cccc(-c2nc(-c3ncc(C(F)(F)F)cc3Cl)no2)c1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cccc(-c2nc(-c3ncc(C(F)(F)F)cc3Cl)no2)c1",
+ "ref_smiles": "N#Cc1cccc(-c2nc(-c3ncc(C(O)(F)F)cc3Cl)no2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f3f4032a-bf4c-4ec1-aa63-93194bcc46cd",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)NC2(C)CCC2)c(Br)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)NC2(C)CCC2)c(Br)c1",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)NC2(C)CCC2)c(NO)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c66e21bf-4766-4108-a163-576455f44bb5",
+ "task": "sub",
+ "question": "Modify the molecule O=C(C(C(F)(F)F)C(F)(F)F)N1CCC(Cl)C1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C(C(F)(F)F)C(F)(F)F)N1CCC(Cl)C1",
+ "ref_smiles": "O=C(C(C(O)(F)F)C(F)(F)F)N1CCC(Cl)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f45e6ec1-2f78-424f-a40f-4a4f60ac70bb",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)N(CCC(=O)[O-])c1ccc(C(F)(F)F)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N(CCC(=O)[O-])c1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "CC(C)N(CCC(=O)[O-])C(F)(F)F",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ade76f80-a4e5-488b-9cbd-ddb740742f69",
+ "task": "add",
+ "question": "Modify the molecule N#CC(=C[NH2+]CCCCCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=C[NH2+]CCCCCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1",
+ "ref_smiles": "N#CC(=C[NH2+]CCC(O)CCC(=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7ad5a764-a711-4110-bf1c-528bdb485542",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)NC(=O)Nc1ccc(C[NH+]2CCOCC2)c(Cl)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)Nc1ccc(C[NH+]2CCOCC2)c(Cl)c1",
+ "ref_smiles": "CC(C)NC(=O)Nc1ccc(C[NH+]2CCOCC2)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "da5b1c3e-2142-48cb-b28d-435b5491eb7c",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]C1CC2CCC(C1)N2C(=O)CC1C=CCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CC2CCC(C1)N2C(=O)CC1C=CCC1",
+ "ref_smiles": "[NH3+]C1CC2CCC(C1O)N2C(=O)CC1C=CCC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cc40c520-ad3a-4567-94c8-1eaa85cb359c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccc(Cl)cc1C(=O)NC(=S)Nc1cc(C)c(O)c(C(=O)[O-])c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)cc1C(=O)NC(=S)Nc1cc(C)c(O)c(C(=O)[O-])c1",
+ "ref_smiles": "COc1ccc(Cl)cc1C(=O)NC(=S)Nc1cc(C)c([N+](=O)[O-])c(C(=O)[O-])c1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "355cb3af-19d1-41e3-8570-7a1de1bba2ed",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(CCC(=O)N1CC[NH2+]CC1)NCc1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCC(=O)N1CC[NH2+]CC1)NCc1ccco1.",
+ "ref_smiles": "O=C(NCc1ccco1)C(CC(=O)N1CC[NH2+]CC1)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d476e3d3-894c-48b3-8c16-bac1cdb62198",
+ "task": "add",
+ "question": "Modify the molecule CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)C1)c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2)C1)c1ccccc1",
+ "ref_smiles": "CC([NH3+])(C(=O)N1CCC(NC(=O)Nc2ccc(F)cc2O)C1)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "32785635-e8db-4d29-a3e5-bda398aeeeaa",
+ "task": "sub",
+ "question": "Modify the molecule CCOCC1CCN(C(=O)Cc2ccc(O)c(F)c2)C1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCC1CCN(C(=O)Cc2ccc(O)c(F)c2)C1",
+ "ref_smiles": "CCOCC1CCN(C(=O)Cc2ccc(C(=O)[OH])c(F)c2)C1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "12c3c116-4edc-448a-ad53-32bd9ae95886",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(C)CC(C[NH3+])COc1ccccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC(C[NH3+])COc1ccccc1Cl.",
+ "ref_smiles": "CC(C)C(O)C(C[NH3+])COc1ccccc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cdf256a9-9f22-4124-92a4-896652c22f44",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(COC(=O)C(NC(=O)c1ccco1)c1ccccc1)Nc1cccc(C(=O)NC2CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COC(=O)C(NC(=O)c1ccco1)c1ccccc1)Nc1cccc(C(=O)NC2CC2)c1.",
+ "ref_smiles": "O=C(COC(=O)C(NC(=O)c1ccco1)c1cccc(O)c1)Nc1cccc(C(=O)NC2CC2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b7a980a0-384f-4d43-92ac-aecfe5ee496c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)Cc1ccc(NC(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2cc(C)ccc2OC)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)Cc1ccc(NC(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2cc(C)ccc2OC)cc1",
+ "ref_smiles": "CCOC(=O)Cc1ccc(NC(=O)CN(c2ccc(O)cc2)S(=O)(=O)c2cc(C)ccc2OC)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "77605cef-ba4b-4fbb-aa55-5efc3421c017",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)Oc1ccc(C([O-])=C2C(=O)C(=O)N(Cc3ccc(F)cc3)C2c2ccco2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1ccc(C([O-])=C2C(=O)C(=O)N(Cc3ccc(F)cc3)C2c2ccco2)cc1",
+ "ref_smiles": "CC(C)Oc1ccc(C([O-])=C2C(=O)C(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2c2ccco2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6b4b3a82-e3d8-434a-9bc9-3ea71fcf9b03",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCc1ccc(C)cc1OCC(O)COC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C)cc1OCC(O)COC(C)C.",
+ "ref_smiles": "CCCOCC(O)COC(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "590c144e-519f-4ffa-b487-189576e6b6c6",
+ "task": "add",
+ "question": "Modify the molecule CC(O)C(C)[NH+]1CCC(C)(C)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(C)[NH+]1CCC(C)(C)C1",
+ "ref_smiles": "CC(O)C(CO)[NH+]1CCC(C)(C)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c5cbc7ce-abc2-49c7-a39e-03d61a334b53",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC[NH+](CCOC)CC1(CO)CCOC1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CCOC)CC1(CO)CCOC1",
+ "ref_smiles": "CC[NH+](CCOC)CC1(CCl)CCOC1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "86df2d99-925f-442d-9221-74e8c7c627e8",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(Nc1ccc(C2CCC2)cn1)NC1CCCNC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(C2CCC2)cn1)NC1CCCNC1=O.",
+ "ref_smiles": "O=C(Nc1ccc(C2(O)CCC2)cn1)NC1CCCNC1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "50bc811a-9a46-403b-ad0e-4c31403282b1",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CCCC3)ccc1OCc1ccccc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CCCC3)ccc1OCc1ccccc1Cl",
+ "ref_smiles": "COc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CCCC3)ccc1OCc1ccccc1NO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1fdf81e3-3580-47a3-893b-0b610242c86c",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)Cn1c(=O)n(C)c(=O)c2cc(O)c(O)cc21 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cn1c(=O)n(C)c(=O)c2cc(O)c(O)cc21",
+ "ref_smiles": "CC(C)Cn1c(=O)n(C)c(=O)c2ccc(O)cc21",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "126ec893-64dd-4737-84e0-06eaf3196df3",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1ccc2cc(C(=O)Nc3ccc(Cl)cc3C)c(=O)oc2c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc2cc(C(=O)Nc3ccc(Cl)cc3C)c(=O)oc2c1",
+ "ref_smiles": "CCOc1ccc2cc(C(=O)Nc3ccccc3C)c(=O)oc2c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "338f7141-5bbc-4f7c-9e82-c7a072e68ae5",
+ "task": "delete",
+ "question": "Modify the molecule Cn1nccc1CNC(=O)NCCCC(=O)N1CCc2ccccc21 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nccc1CNC(=O)NCCCC(=O)N1CCc2ccccc21",
+ "ref_smiles": "Cn1nccc1CNC(=O)NCCC1Cc2ccccc21",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "604798ce-8854-4018-9c31-53ba6c8572e2",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COC(=O)CCC1OB(O)c2cc(O)cc(C)c21 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CCC1OB(O)c2cc(O)cc(C)c21",
+ "ref_smiles": "COC(=O)CCC1OB(C(=O)[OH])c2cc(O)cc(C)c21",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7ef66792-71e2-4e7a-bc20-d9477872ec56",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=C[Si](C)(Cl)c1ccccc1C[NH+](C)C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C[Si](C)(Cl)c1ccccc1C[NH+](C)C",
+ "ref_smiles": "CC(=O)[Si](C)(C=C)c1ccccc1C[NH+](C)C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3d6eaadd-e646-4b5c-9116-10317d4a668d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(F)ccc4F)ccc3C)CC2)cc1Cl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(F)ccc4F)ccc3C)CC2)cc1Cl",
+ "ref_smiles": "CCC(=O)Nc1ccc(NC(=O)C(C)NC(=O)C2CC[NH+](CC(=O)Nc3cc(C(=O)Nc4cc(NO)ccc4F)ccc3C)CC2)cc1Cl",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8a0aeecd-aadf-4569-b286-4037b4cae339",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(NCC2CC[NH2+]CC2)cc1OCCO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NCC2CC[NH2+]CC2)cc1OCCO.",
+ "ref_smiles": "COc1ccc(NC(c2ccccc2)C2CC[NH2+]CC2)cc1OCCO",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bec7cfb4-3503-43ef-b7cf-c0a7047ab15a",
+ "task": "delete",
+ "question": "Modify the molecule CC(F)Oc1ccccc1-c1noc(C2CC2)c1COC1CCC(O)(c2nc3c(F)cc(C(=O)[O-])cc3s2)CC1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(F)Oc1ccccc1-c1noc(C2CC2)c1COC1CCC(O)(c2nc3c(F)cc(C(=O)[O-])cc3s2)CC1",
+ "ref_smiles": "CC(F)Oc1ccccc1-c1noc(C2CC2)c1COC1CCC(c2nc3c(F)cc(C(=O)[O-])cc3s2)CC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7fe0c6c2-6eb7-4990-9324-41f667b19c41",
+ "task": "add",
+ "question": "Modify the molecule CCCc1cc(C(C)=O)ccc1OCc1ccc(C(=O)[O-])cc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(C(C)=O)ccc1OCc1ccc(C(=O)[O-])cc1OC",
+ "ref_smiles": "COc1cc(C(=O)[O-])ccc1COc1ccc(C(C)=O)cc1CCCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "424a16e2-4074-478c-be5f-30068a2cee1a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCc1csc2[nH+]cc(C(=O)NCC3C4CC4CN3C(=O)c3c(-c4ccccc4)nc4ccc(Cl)cn34)n12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1csc2[nH+]cc(C(=O)NCC3C4CC4CN3C(=O)c3c(-c4ccccc4)nc4ccc(Cl)cn34)n12.",
+ "ref_smiles": "CCc1csc2[nH+]cc(C(=O)NCC3C4CC4CN3C(=O)c3c(-c4ccccc4)nc4ccccn34)n12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "affbf151-2f97-4fea-a0b0-ea1cdd1a6b57",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(S(=O)(=O)Cl)n(-c2ccc(Cl)cc2)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(S(=O)(=O)Cl)n(-c2ccc(Cl)cc2)n1",
+ "ref_smiles": "Cc1cc(S(=O)(=O)Cl)n(Cl)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "5c7ef52c-c0cb-45f3-a6a0-8df80b8b7351",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCc1ncc(C(=O)Nc2ccc(NC(C)=O)c(OC)c2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ncc(C(=O)Nc2ccc(NC(C)=O)c(OC)c2)s1.",
+ "ref_smiles": "COc1cc(NC(=O)c2cnc(CCO)s2)ccc1NC(C)=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1f56159c-d358-4e5e-8c8a-11e28dfcf575",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOC(=O)c1c(NC(=CC(=O)c2ccccc2)C(=O)N2CCCCC2)sc2c1CCCC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(NC(=CC(=O)c2ccccc2)C(=O)N2CCCCC2)sc2c1CCCC2.",
+ "ref_smiles": "CCOC(=O)c1c(C(=CC(=O)c2ccccc2)C(=O)N2CCCCC2)sc2c1CCCC2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c2c35e46-3ade-4433-a422-b69af1461d65",
+ "task": "add",
+ "question": "Modify the molecule CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CCC2(O)CC(F)=C(F)F by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CCC2(O)CC(F)=C(F)F",
+ "ref_smiles": "CC12CC=C3C(CCC45CC6(CCC34C5)OCCO6)C1CC(C(=O)O)C2(O)CC(F)=C(F)F",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7f995cb6-186a-4fff-ba63-2c5088830e28",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)N(C)CN=C(N)N[N+](=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(C)CN=C(N)N[N+](=O)[O-].",
+ "ref_smiles": "CC(=O)N(CN=C(N)N[N+](=O)[O-])Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "95552d78-6093-4f82-83cd-98181823c463",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)CC3)c(=O)c2c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)CC3)c(=O)c2c1",
+ "ref_smiles": "Cc1ccc2[se]n(C3CCC(n4[se]c5ccc(C)cc5c4=O)C(N)C3)c(=O)c2c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "b7ffbeb1-1b8f-4287-afb9-79b5176ebaf8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccnc(NCC2CC(Cl)C2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccnc(NCC2CC(Cl)C2)n1.",
+ "ref_smiles": "COc1nc(NCC2CC(Cl)C2)ncc1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "59c7f20c-9e41-4361-862e-172367a81920",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CC(C)(C)NS(=O)(=O)c1cc(C(=O)N2CCCCC2)ccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)NS(=O)(=O)c1cc(C(=O)N2CCCCC2)ccc1Cl.",
+ "ref_smiles": "CC(C)(C)S(=O)(=O)c1cc(C(=O)N2CCCCC2)ccc1Cl",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f2c35951-6b70-4f08-83c5-50d4e01470bb",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(=O)Nc1ccc(-c2cnc3n[nH]c(-c4nc5c(-c6ccc(C(N)=O)cc6)cccc5[nH]4)c3c2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)Nc1ccc(-c2cnc3n[nH]c(-c4nc5c(-c6ccc(C(N)=O)cc6)cccc5[nH]4)c3c2)cn1.",
+ "ref_smiles": "Cc1ccc(-c2cnc3n[nH]c(-c4nc5c(-c6ccc(C(N)=O)cc6)cccc5[nH]4)c3c2)cn1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "48070aeb-760b-4b13-b1df-76a25fc9f5de",
+ "task": "delete",
+ "question": "Modify the molecule NC(=O)c1c(NC(=O)COC(=O)CCc2c[nH]c3ccccc23)sc2c1CCC2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1c(NC(=O)COC(=O)CCc2c[nH]c3ccccc23)sc2c1CCC2",
+ "ref_smiles": "NC(=O)c1c(OC(=O)CCc2c[nH]c3ccccc23)sc2c1CCC2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "001401b7-ef4d-4b89-84a8-33b6a2177cc9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1cnc2nc(-c3cc(Cl)ccc3I)[nH]c2c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1cnc2nc(-c3cc(Cl)ccc3I)[nH]c2c1",
+ "ref_smiles": "O=C([O-])c1cnc2nc(-c3cc(O)ccc3I)[nH]c2c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b15ce586-b6a9-4b73-8988-b5628fd6b4ca",
+ "task": "sub",
+ "question": "Modify the molecule Cc1noc(C)c1CSCC(=O)OCC(=O)Nc1cccc(Cl)c1C by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C)c1CSCC(=O)OCC(=O)Nc1cccc(Cl)c1C",
+ "ref_smiles": "Cc1noc(C)c1CSCC(=O)OCC(=O)Nc1cccc(C#N)c1C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "48b98187-57e4-4e4d-ac11-0676456d8910",
+ "task": "add",
+ "question": "Modify the molecule CCOC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O",
+ "ref_smiles": "CC(OC1CCC2(CC1)Cc1ccc(-c3cccc(C#N)c3)cc1C2=O)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2bafeca8-da8b-40e5-b4db-3f8a4a61d00e",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2)cc1[N+](=O)[O-] by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2)cc1[N+](=O)[O-]",
+ "ref_smiles": "Cc1ccc(C(C)[NH2+]CC(=O)NC2CC2CC=O)cc1[N+](=O)[O-]",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "c97a0013-24c1-47e5-af71-6a33feb6cafe",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2OC)Cc2ccccc2)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2OC)Cc2ccccc2)cc1",
+ "ref_smiles": "CCOc1ccc(S(=O)(=O)N(CC(=O)NCc2c(OC)cccc2C(=O)O)Cc2ccccc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b4cc3f84-15df-458a-b4b8-982f87d04ca2",
+ "task": "delete",
+ "question": "Modify the molecule COc1cc(C(=O)N(CC2CCCO2)c2nc3c(OC)ccc(Cl)c3s2)nc(OC)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C(=O)N(CC2CCCO2)c2nc3c(OC)ccc(Cl)c3s2)nc(OC)n1",
+ "ref_smiles": "COc1cc(C(=O)N(CC2CCCO2)c2nc3c(OC)cccc3s2)nc(OC)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e981899d-ce76-4368-bc35-c3a23fec54b2",
+ "task": "add",
+ "question": "Modify the molecule [NH3+]CCCC(=O)Nc1ccc2c(c1)CCC2=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCCC(=O)Nc1ccc2c(c1)CCC2=O",
+ "ref_smiles": "[NH3+]CCCC(=O)Nc1ccc2c(c1)C(O)CC2=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8f24f622-636e-4b55-baa3-9924ae5f7f6d",
+ "task": "sub",
+ "question": "Modify the molecule O=C(CCc1nnc(CCc2ccccc2)o1)N1CCC(c2cccc(Cl)c2)C1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCc1nnc(CCc2ccccc2)o1)N1CCC(c2cccc(Cl)c2)C1",
+ "ref_smiles": "O=C(CCc1nnc(CCc2ccccc2)o1)N1CCC(c2cccc(O)c2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d9540c81-e668-4765-82c8-6469240f9e26",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1ccc(C([NH3+])c2ccc(C(C)C)cc2)c(Br)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C([NH3+])c2ccc(C(C)C)cc2)c(Br)c1.",
+ "ref_smiles": "Cc1cc(Br)c(C([NH3+])c2ccc(C(C)C)cc2)c(-c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "89b45a04-929a-4377-b67c-46210c36874c",
+ "task": "add",
+ "question": "Modify the molecule CS(=O)(=O)OCC1CCN(c2cc[nH+]cc2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)OCC1CCN(c2cc[nH+]cc2)CC1",
+ "ref_smiles": "CS(=O)(=O)OC(O)C1CCN(c2cc[nH+]cc2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1641035a-639a-48c8-818e-58d7a34e7b17",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccnc(NCCC(=O)N2CCCC2)c1C#N by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccnc(NCCC(=O)N2CCCC2)c1C#N",
+ "ref_smiles": "Cc1ccnc(NCCC(=O)N2CCCC2)c1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "fe70b838-f442-49d3-bc59-a51ff7b5b4ce",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=C(COCc1ccccc1)Cc1cccc(O)c1O with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(COCc1ccccc1)Cc1cccc(O)c1O",
+ "ref_smiles": "C=C(COCc1ccccc1)Cc1cccc(Cl)c1O",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1fdcba8b-70eb-4d48-ac7a-e5745f025141",
+ "task": "add",
+ "question": "Modify the molecule CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1C",
+ "ref_smiles": "CC[NH+](Cc1ccc(N)cc1)Cc1ccccc1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "2e9160d4-8429-489a-a490-4ad296688d5c",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1C1(C(=O)NCc2ccc(-c3ccoc3)cc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C1(C(=O)NCc2ccc(-c3ccoc3)cc2)CC1",
+ "ref_smiles": "COc1ccccc1C1(C(=O)NCc2ccoc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "31fb98da-2382-4ff6-ab53-278495e9b104",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3)c2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3)c2=O)c1.",
+ "ref_smiles": "Cc1cccc(-c2c(Cl)[nH]c(=O)n(C3CCC3O)c2=O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c3589494-3168-47f1-ae21-f2dbb286ca2c",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(NCC1(O)CCC1)c1ccc2c(c1)OCO2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1(O)CCC1)c1ccc2c(c1)OCO2",
+ "ref_smiles": "O=C(NCC1(C(=O)[OH])CCC1)c1ccc2c(c1)OCO2",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "87364a49-ab2d-4295-b3ac-465fc6859968",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(C(=O)Nc2ccnn2Cc2ccccc2)cnn1C(C)(C)C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(C(=O)Nc2ccnn2Cc2ccccc2)cnn1C(C)(C)C",
+ "ref_smiles": "CC(C)(C)n1ncc(C(=O)Nc2ccnn2Cc2ccccc2)c1CC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "017bdeef-f7c3-4c72-a469-bbe6ecfb9083",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cccnc1N1C2CCC1CC(Br)C2 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccnc1N1C2CCC1CC(Br)C2",
+ "ref_smiles": "Cc1cccnc1N1C2CCC1CC(S)C2",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "46ab6874-1c49-4179-9f05-7ec085449776",
+ "task": "delete",
+ "question": "Modify the molecule N#Cc1cc(-c2cc(C(=O)[O-])ccn2)cc(Cl)c1N1CCCCC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cc(-c2cc(C(=O)[O-])ccn2)cc(Cl)c1N1CCCCC1",
+ "ref_smiles": "N#Cc1cc(-c2cc(C(=O)[O-])ccn2)ccc1N1CCCCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f358c7dd-afab-4af2-be47-f513670eb931",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NC1CCCc2ccccc21)c1ccc2nc[nH]c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCCc2ccccc21)c1ccc2nc[nH]c2c1.",
+ "ref_smiles": "O=C(NC1CCCc2ccccc21)c1cc2[nH]cnc2cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "43e7f6a5-1f31-46a6-9c84-c6a5b13d22e7",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)NCCCC(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc2nc(C(F)(F)F)nn2c(C)c1CCC(=O)NCCCC(=O)[O-].",
+ "ref_smiles": "Cc1nc2nc(C(F)F)nn2c(C)c1CCC(=O)NCCCC(=O)[O-].",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "62611ba0-ba0e-4c88-a4ef-3d10cc7e9bbd",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc2oc3ccc(N(C)c4cccc(Cl)c4)cc3c2c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2oc3ccc(N(C)c4cccc(Cl)c4)cc3c2c1.",
+ "ref_smiles": "Cc1ccc2oc3ccc(N(C)Cl)cc3c2c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ef39e1c0-d166-47ff-88e4-4fb2e2f19347",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule c1csc(-c2nc3ccccc3nc2N2CC[NH2+]CC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "c1csc(-c2nc3ccccc3nc2N2CC[NH2+]CC2)c1.",
+ "ref_smiles": "c1ccc(-c2cccc3nc(-c4cccs4)c(N4CC[NH2+]CC4)nc23)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bf03f90f-8e1a-435b-b0f3-a766dabab23c",
+ "task": "delete",
+ "question": "Modify the molecule CCc1oc2nc(-c3ccsc3)nn2c1C(=O)NCc1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1oc2nc(-c3ccsc3)nn2c1C(=O)NCc1ccccc1",
+ "ref_smiles": "CCc1oc2nc(-c3ccsc3)nn2c1C(=O)NC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1563e4f6-5423-4e05-b0aa-f8fc5dcd262f",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COC(=O)c1cc2cc(NS(=O)(=O)c3c[nH]c(=O)[nH]c3=O)ccc2s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc2cc(NS(=O)(=O)c3c[nH]c(=O)[nH]c3=O)ccc2s1.",
+ "ref_smiles": "COC(=O)c1cc2cc(S(=O)(=O)c3c[nH]c(=O)[nH]c3=O)ccc2s1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e8f6cc97-926f-49f0-afe3-49677bddeb97",
+ "task": "add",
+ "question": "Modify the molecule CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O",
+ "ref_smiles": "CCNC(=O)C(Cc1ccccc1)N(Cc1c(O)cccc1F)C(=O)CN(c1cccc(C)c1C)S(C)(=O)=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e8ff3414-7a8c-44c6-9323-5171a3fd37d3",
+ "task": "delete",
+ "question": "Modify the molecule C#CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3cccc(N)c3)CSC12)c1csc(N)n1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(C[n+]3cccc(N)c3)CSC12)c1csc(N)n1",
+ "ref_smiles": "C#CCON=C(C(=O)NC1SCC(C[n+]2cccc(N)c2)=C1C(=O)O)c1csc(N)n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "66f37683-c3b3-4406-84ba-fcdfa1fcad37",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CN(C)C(=O)c1ccc(N)cc1NCCCn1cccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)c1ccc(N)cc1NCCCn1cccn1.",
+ "ref_smiles": "Nc1ccc(NCCCn2cccn2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "173b176f-bba0-41c4-9f31-723c1e711ce9",
+ "task": "sub",
+ "question": "Modify the molecule CCn1nnnc1NCc1cc(Cl)c(OC(C)C)c(OC)c1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1nnnc1NCc1cc(Cl)c(OC(C)C)c(OC)c1",
+ "ref_smiles": "CCn1nnnc1NCc1cc(OC)c(OC(C)C)c(C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fa5ac802-d429-44be-bd6b-3b10928310f6",
+ "task": "delete",
+ "question": "Modify the molecule N#CC(=CNc1ccc2ncccc2c1)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CC(=CNc1ccc2ncccc2c1)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1",
+ "ref_smiles": "N#CC(=Cc1ccc2ncccc2c1)c1nc(-c2cc3cc(Br)ccc3oc2=O)cs1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e143b5a2-63f8-4fc0-a982-4831f35403c4",
+ "task": "sub",
+ "question": "Modify the molecule CCCOc1ccc(Br)cc1CNc1ccc2[nH]c(=O)[nH]c2c1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCOc1ccc(Br)cc1CNc1ccc2[nH]c(=O)[nH]c2c1",
+ "ref_smiles": "CCCOc1ccc(C#N)cc1CNc1ccc2[nH]c(=O)[nH]c2c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "87ee7676-92b3-4df3-b3fe-0d24d28dde10",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3)c3ccc(C)cc3)C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3)c3ccc(C)cc3)C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1.",
+ "ref_smiles": "COC1=CC(OC)=C(C2=C(P(c3ccc(C)cc3O)c3ccc(C)cc3C=C(OC)C(C)C2OC)C(P(c2ccc(C)cc2)c2ccc(C)cc2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6cbcf6bb-63da-4688-9b74-9f9a081ba63e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCCc1cccc(C(O)c2ccc(Cl)o2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cccc(C(O)c2ccc(Cl)o2)c1.",
+ "ref_smiles": "CCCc1cccc(C(O)c2ccco2)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "cdea3c50-105f-4fc5-9597-2d16b9adc475",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)CNC(=O)c1ccc(CNC(=O)Cn2ccc3ccc(Cl)cc32)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)CNC(=O)c1ccc(CNC(=O)Cn2ccc3ccc(Cl)cc32)cc1",
+ "ref_smiles": "NC(=O)CNC(=O)c1ccc(CNC(=O)Cn2ccc3ccc(NO)cc32)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "50db607e-f06c-4866-9251-d8414a91b945",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc2onc(CC(=O)Nc3cccc(Cl)c3)c2cc1C with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc2onc(CC(=O)Nc3cccc(Cl)c3)c2cc1C",
+ "ref_smiles": "CC(=O)c1cccc(NC(=O)Cc2noc3cc(C)c(C)cc23)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "83921888-bc2a-4de3-a8ca-d9d06039dd28",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)n1c(=O)ccc2cnc(Nc3ccc(N4CCC(CCCO)CC4)cc3)cc21 by substituting a hydroxyl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1c(=O)ccc2cnc(Nc3ccc(N4CCC(CCCO)CC4)cc3)cc21",
+ "ref_smiles": "CC(C)n1c(=O)ccc2cnc(Nc3ccc(N4CCC(CCCC#N)CC4)cc3)cc21",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "8182da45-4bf2-4540-8a8b-f9d6c629dcc5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C=CCN(c1ccc(F)cc1C(C)[NH2+]CC)C(C)(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCN(c1ccc(F)cc1C(C)[NH2+]CC)C(C)(C)C.",
+ "ref_smiles": "C=CCN(C(C)(C)C)C(C)(F)[NH2+]CC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "61311f69-98d7-4326-a9b9-41a51a3d8e16",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CCC(CC#N)NCCOCCOC with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC#N)NCCOCCOC",
+ "ref_smiles": "CCC(CO)NCCOCCOC",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6e7acb3f-db8d-4544-87ea-69c67d6ef7b4",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccccc1C=CCC1C(=O)N(C)C(N)=[NH+]C1(C)c1cc(-c2cccc(N)c2)cs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1C=CCC1C(=O)N(C)C(N)=[NH+]C1(C)c1cc(-c2cccc(N)c2)cs1.",
+ "ref_smiles": "Cc1ccccc1C=CCC1C(=O)N(C)C(N)=[NH+]C1(C)c1cc(-c2ccccc2)cs1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "801b33c9-7789-4ac0-85ff-d7999f8d9847",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1.",
+ "ref_smiles": "CC(Nc1cc(C[N+]2(S(=O)(=O)c3ccc(F)cc3O)CCCC2C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9fba7c31-1d2f-4772-ba3a-9959b8a62096",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](Cc2ccccc2)C3)N1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](Cc2ccccc2)C3)N1.",
+ "ref_smiles": "CC(=Cc1ccccc1)C1NC(=O)c2c(sc3c2CC[NH+](C(C(=O)O)c2ccccc2)C3)N1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f3a5c126-ca17-458e-aff3-6bfec42a5d89",
+ "task": "add",
+ "question": "Modify the molecule CCOc1ccc(NCCCSCC)cc1CO by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NCCCSCC)cc1CO",
+ "ref_smiles": "CCOc1cc(O)c(NCCCSCC)cc1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b8114ab0-e273-4fae-aad9-5c68b609b1ed",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(OC(C)(C)C)C(NC(=O)CNS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)NCC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)[O-] with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC(C)(C)C)C(NC(=O)CNS(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1)C(=O)NCC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)[O-]",
+ "ref_smiles": "CC(OC(C)(C)C)C(NC(=O)CNS(=O)(=O)c1ccc(-c2ccc(S)cc2)cc1)C(=O)NCC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)[O-]",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d08dc5d1-b36c-498a-a283-2acf4548c9b0",
+ "task": "delete",
+ "question": "Modify the molecule N#CCc1cc2ccc(Br)c([N+](=O)[O-])c2s1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCc1cc2ccc(Br)c([N+](=O)[O-])c2s1",
+ "ref_smiles": "N#CCc1cc2cccc([N+](=O)[O-])c2s1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "76870a3d-c878-4c44-a9f0-6f3f42f6268e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1ccc(OC(CCn2nnc3ccccc32)c2ccccc2)cc1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1ccc(OC(CCn2nnc3ccccc32)c2ccccc2)cc1",
+ "ref_smiles": "N#CC(F)(F)c1ccc(OC(CCn2nnc3ccccc32)c2ccccc2)cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "be39721a-4481-4d01-b3f7-c5eef4598c4f",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COc1cc(C)ccc1OCC[NH+]1CCC(C#N)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C)ccc1OCC[NH+]1CCC(C#N)CC1.",
+ "ref_smiles": "Cc1ccc(OCC[NH+]2CCC(C#N)CC2)c(OCC(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7c06230d-b9d2-4652-b264-ed26dc89bdc6",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCC(CC)(C(=O)[O-])[NH+](C)Cc1ccccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)(C(=O)[O-])[NH+](C)Cc1ccccn1.",
+ "ref_smiles": "CCC(CC)(C(=O)[O-])[NH+](C)Cc1ncccc1C#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "405bed3a-071b-4b22-9c31-8b20b2d28915",
+ "task": "add",
+ "question": "Modify the molecule CC(C)(C)OC(=O)C1CCC2CCC(CO)C([NH3+])C(=O)N21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)C1CCC2CCC(CO)C([NH3+])C(=O)N21",
+ "ref_smiles": "CC(C)(C)OC(=O)C1CCC2CCC(O)(CO)C([NH3+])C(=O)N21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "000f6656-5889-43b2-919f-b73b2c65cfb1",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC(C)CN(C1CC1)S(=O)(=O)c1ccc(C[NH3+])c(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CN(C1CC1)S(=O)(=O)c1ccc(C[NH3+])c(Cl)c1.",
+ "ref_smiles": "CC(C)CN(C1CC1)S(=O)(=O)c1ccc(C[NH3+])cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "de1bb7e2-81df-46e0-951e-6710e36fefbf",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C(C=Cc1cccc2ccccc12)NCC1CCN(c2ccccc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1cccc2ccccc12)NCC1CCN(c2ccccc2)C1.",
+ "ref_smiles": "c1ccc(N2CCC(CCc3cccc4ccccc34)C2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8c92ec1c-a448-44d2-a44e-173a621a89a8",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule COc1ccc(OCCOc2cccc(CCN3CC(C(=O)[O-])CC3=O)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(OCCOc2cccc(CCN3CC(C(=O)[O-])CC3=O)c2)cc1.",
+ "ref_smiles": "COc1ccc(OCCOc2cccc(CCCCC(=O)[O-])c2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "02517dff-9823-4f2f-b25e-9d5a13ad7d2f",
+ "task": "add",
+ "question": "Modify the molecule Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)CC3)cc2C)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)CC3)cc2C)c1",
+ "ref_smiles": "Cc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCN3C(=O)C3CC[NH+](CC(=O)Nc4cc(C(=O)NC5CCCCC5C)ccc4C)C(CC=O)C3)cc2C)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "447a3111-2ac8-413e-94d2-cc03a1ccec16",
+ "task": "delete",
+ "question": "Modify the molecule O=C(OCc1cc(Cl)ccc1F)N1C=Cc2ncsc2C1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OCc1cc(Cl)ccc1F)N1C=Cc2ncsc2C1",
+ "ref_smiles": "O=C(OC(F)Cl)N1C=Cc2ncsc2C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "72c871da-af22-4446-bff1-92631cf224c4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C(=O)NC2CCCCC2C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2cccc(C(F)(F)F)c2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)NC2CCCCC2C)ccc1NC(=O)C[NH+]1CCC(C(=O)NC(C)C(=O)Nc2cccc(C(F)(F)F)c2)CC1.",
+ "ref_smiles": "CC(NC(=O)C1CC[NH+](CC(=O)N(C)C(=O)NC2CCCCC2C)CC1)C(=O)Nc1cccc(C(F)(F)F)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "708a2881-fb2f-45e4-9199-48c7dd35defd",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCC=CC=CCC=CCC=CCC=CCCCCC(=O)OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC=CC=CCC=CCC=CCC=CCCCCC(=O)OC.",
+ "ref_smiles": "CCCC=CC=CCC=CCC=CCC=CCC(O)CCC(=O)OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4ca20077-21a0-4d4a-9020-2ab877d5c50f",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)(C)OC(=O)N1C(CNc2cccc(-c3csc(SCC(=O)NC4CC[NH+](Cc5ccc(Cl)c(Cl)c5)CC4)n3)c2)COC1(C)C by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)N1C(CNc2cccc(-c3csc(SCC(=O)NC4CC[NH+](Cc5ccc(Cl)c(Cl)c5)CC4)n3)c2)COC1(C)C",
+ "ref_smiles": "CC(C)(C)OC(=O)N1C(CNc2cccc(-c3csc(SCC(=O)NC4CC[NH+](Cc5ccc(O)c(Cl)c5)CC4)n3)c2)COC1(C)C",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3baabbdf-73d6-407f-89e6-0947e23632df",
+ "task": "add",
+ "question": "Modify the molecule Cc1nc(=O)c(S(C)(=O)=O)c(C)[nH]1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(=O)c(S(C)(=O)=O)c(C)[nH]1",
+ "ref_smiles": "Cc1[nH]c(Cc2ccccc2)nc(=O)c1S(C)(=O)=O",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "2df30ebd-3242-4f6b-a30b-30ee7aeb8446",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ccc(Cl)c(C(=O)NCCn2ccnc2)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(Cl)c(C(=O)NCCn2ccnc2)c1",
+ "ref_smiles": "O=C(NCCn1ccnc1)c1ccccc1Cl",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "78b3ba9d-7a4d-4e08-a43a-1f6eebd9fa1f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]C(CC1CC2CCC1C2)c1cc(F)ccc1C with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(CC1CC2CCC1C2)c1cc(F)ccc1C",
+ "ref_smiles": "C[NH2+]C(CC1CC2CCC1C2)c1cc(NO)ccc1C",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1e93c7a2-e1b3-4a12-9b7c-a4185ecd09d8",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(Nc1ccc(OC2CCCCC2O)cc1)C1CCn2cc[nH+]c2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc(OC2CCCCC2O)cc1)C1CCn2cc[nH+]c2C1.",
+ "ref_smiles": "O=C(Nc1ccc(OC2CCCCC2(O)O)cc1)C1CCn2cc[nH+]c2C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4ea2df38-b3a7-4ad9-963d-13b3c9cdf780",
+ "task": "add",
+ "question": "Modify the molecule CSC1CCCC1Nc1c(C)cccc1[N+](=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSC1CCCC1Nc1c(C)cccc1[N+](=O)[O-]",
+ "ref_smiles": "CSC1CC(c2ccccc2)CC1Nc1c(C)cccc1[N+](=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f7d23bd6-6fd4-42e4-b5c2-072ddb304a73",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]CC1CCCN(S(=O)(=O)NC(C)C[NH+](C)C)C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC1CCCN(S(=O)(=O)NC(C)C[NH+](C)C)C1",
+ "ref_smiles": "C[NH2+]CC1CN(S(=O)(=O)NC(C)C[NH+](C)C)CCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8a56756f-08f7-49a3-8f1e-6b0a76c1dc3e",
+ "task": "add",
+ "question": "Modify the molecule CCCNc1ccc(C[NH+](CC)CC(C)CC)cn1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1ccc(C[NH+](CC)CC(C)CC)cn1",
+ "ref_smiles": "CCCNc1ccc(C[NH+](CC)C(N)C(C)CC)cn1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e8b25789-3ae6-49bf-83c9-12b856117202",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(C(C)[NH2+]CC2CCCC(O)C2)cc1[N+](=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)[NH2+]CC2CCCC(O)C2)cc1[N+](=O)[O-]",
+ "ref_smiles": "Cc1ccc(C(C)[NH2+]CC2CCCC(C(=O)O)C2)cc1[N+](=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a4dc74d9-240c-47bd-a864-1f540c352444",
+ "task": "delete",
+ "question": "Modify the molecule C[NH+](C)CCOCCn1c(=S)[nH]c2cc(Br)ccc21 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCOCCn1c(=S)[nH]c2cc(Br)ccc21",
+ "ref_smiles": "C[NH+](C)CCOCCn1c(=S)[nH]c2ccccc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "ede39218-2751-425c-9e2d-32f4eba94b46",
+ "task": "delete",
+ "question": "Modify the molecule Cc1sc2ncnc(N)c2c1-c1ccc(NC(=O)Nc2cccc(C(=O)[O-])c2C)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1sc2ncnc(N)c2c1-c1ccc(NC(=O)Nc2cccc(C(=O)[O-])c2C)cc1",
+ "ref_smiles": "Cc1sc2ncnc(N)c2c1-c1ccc(NC(=O)N(C)C(=O)[O-])cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1c488bb9-6632-411d-a778-da646fff5e2a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COC1CCN(c2ccc(C[NH2+]C(C)C)cc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CCN(c2ccc(C[NH2+]C(C)C)cc2)C1.",
+ "ref_smiles": "COC1CCN(c2ccc(C[NH2+]C(C)C)cc2C(=O)O)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6c881a11-cb4e-496e-90cd-e227233af3b8",
+ "task": "delete",
+ "question": "Modify the molecule CC1(O)CCC[NH+](Cc2cnccn2)C1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(O)CCC[NH+](Cc2cnccn2)C1",
+ "ref_smiles": "CC1CCC[NH+](Cc2cnccn2)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3a4f4788-c293-4bfc-aa81-02544b6cc74b",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C)c(-c2csc(NC(=O)Cc3ccc(F)cc3)n2)c(C)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(-c2csc(NC(=O)Cc3ccc(F)cc3)n2)c(C)c1",
+ "ref_smiles": "Cc1cc(CN)cc(C)c1-c1csc(NC(=O)Cc2ccc(F)cc2)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "7b688059-b8eb-446d-9f3b-51dc27af62c7",
+ "task": "add",
+ "question": "Please add a amine to the molecule COc1ccc(C(=O)N(Cc2cccnc2)C2CC2)cc1Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)N(Cc2cccnc2)C2CC2)cc1Br.",
+ "ref_smiles": "COc1ccc(C(=O)N(Cc2cnccc2N)C2CC2)cc1Br",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "b4ec1cd0-4e73-4bf2-bc9f-edc0ca0223e5",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(C(C)NC2=[NH+]C(C)C(C)CS2)cc1F by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)NC2=[NH+]C(C)C(C)CS2)cc1F",
+ "ref_smiles": "Cc1ccc(C(C)NC2=[NH+]C(C)C(C)CS2)cc1S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a6c5a5b3-95b7-468a-9605-15947d80dd74",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)N1C=C2N(C(=O)C(C)([NH3+])CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(Cl)cc2)C1=O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)N1C=C2N(C(=O)C(C)([NH3+])CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(Cl)cc2)C1=O",
+ "ref_smiles": "CC(C)N1C=C2N(C(=O)C(C)([NH3+])CN2S(=O)(=O)c2ccc(C#N)cc2Cl)C(Cc2ccc(Cl)cc2)C1=O",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e1b14f4d-c799-4446-ab96-25b0d27b8ef8",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C(NCCc1ccccc1)c1cccc2c1NCCN2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCc1ccccc1)c1cccc2c1NCCN2.",
+ "ref_smiles": "O=C(NCCc1ccccc1)c1cccc2c1NCC2",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "2aade303-5729-420d-8c7d-d425424bdd08",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH2+]C1CSCC1Cc1ccc(F)c(F)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C1CSCC1Cc1ccc(F)c(F)c1",
+ "ref_smiles": "C[NH2+]C1CSCC1Cc1ccc(NO)c(F)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2260285e-f02f-4649-883f-f0ca68301a2e",
+ "task": "delete",
+ "question": "Modify the molecule Cn1nc(NCC(=O)NC2C[NH+](C3CCC(O)(c4nccs4)CC3)C2)c2cc(C(F)(F)F)ccc21 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1nc(NCC(=O)NC2C[NH+](C3CCC(O)(c4nccs4)CC3)C2)c2cc(C(F)(F)F)ccc21",
+ "ref_smiles": "Cn1nc(NCC(=O)NC2C[NH+](C3CCC(O)(c4nccs4)CC3)C2)c2cc(C(F)F)ccc21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0eb592b6-d819-4f70-afcb-d9aa2d2b0e86",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(Cn2cnc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1.",
+ "ref_smiles": "Cc1cccc(Cn2c(C(=O)O)nc3c(cnn3CCNC(=O)COc3ccccc3C)c2=O)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "50b9dc7d-cea7-4f02-b52f-dcf15b2fcd11",
+ "task": "sub",
+ "question": "Modify the molecule N#Cc1c(OC(F)(F)F)cnc(C(F)(F)F)c1[O-] by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(OC(F)(F)F)cnc(C(F)(F)F)c1[O-]",
+ "ref_smiles": "N#Cc1c(OC(O)(F)F)cnc(C(F)(F)F)c1[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e8fbff3c-9262-458e-9577-dd949e3afd33",
+ "task": "add",
+ "question": "Modify the molecule CC(C)[NH2+]CC1CCCN1CC1CCCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)[NH2+]CC1CCCN1CC1CCCCC1",
+ "ref_smiles": "CC(C)[NH2+]CC1CCCN1CC1CCCC(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "6030570e-7b7c-4891-9ba7-3410047e279a",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1ccc(N(C)C(=O)c2ccn3ncc(-c4ccc(CF)cc4)c3c2)nc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N(C)C(=O)c2ccn3ncc(-c4ccc(CF)cc4)c3c2)nc1.",
+ "ref_smiles": "Cc1ccc(N(C)C(=O)c2cc3c(-c4ccc(CF)cc4)cnn3cc2C(=O)O)nc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5db22663-f53e-4310-afc1-2fd5af66ca88",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(S)CC[NH+]1CCCC(C(C)C)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(S)CC[NH+]1CCCC(C(C)C)C1.",
+ "ref_smiles": "CC(C)C1CCC[NH+](CCC(S)Cc2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6187e7d9-d977-4467-9e55-bd22fd5b474b",
+ "task": "add",
+ "question": "Modify the molecule COCC(C)(O)C1CC1(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC(C)(O)C1CC1(C)C",
+ "ref_smiles": "COCC(C)(O)C1CC1(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d36bd59f-a500-4461-8716-506e91c7fcf4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(Nc1c(Nc2cc(F)cc(F)c2)c(=O)c1=O)c1cccc2ccccc12 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Nc1c(Nc2cc(F)cc(F)c2)c(=O)c1=O)c1cccc2ccccc12",
+ "ref_smiles": "CC(Nc1c(Nc2cc(F)cc(NO)c2)c(=O)c1=O)c1cccc2ccccc12",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "23edb16a-8e17-4b59-9ff0-2d1a31461254",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule NC(=O)C[NH+]1CCC(O)(C[NH3+])CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C[NH+]1CCC(O)(C[NH3+])CC1.",
+ "ref_smiles": "NC(=O)C[NH+]1CCC(C[NH3+])CC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a80ef6cb-f223-41c1-b785-5f7e3b4273db",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(Cl)c(OCn2ccc(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Cl)c(OCn2ccc(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1",
+ "ref_smiles": "Cc1ccc(Cl)c(OCn2cc(C(=O)O)c(C(=O)N3CC[NH+](Cc4cnn(C)c4)CC3)n2)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "da2f157c-df88-49f4-ba76-90b953af536e",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1ccc(Cl)cc1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccc(Cl)cc1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1",
+ "ref_smiles": "O=C(c1ccc(Cl)c(-c2ccccc2)c1)N1CCC([NH2+]C2CN(c3nc(C(F)(F)F)nc4ccccc34)CC2O)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "203fee9b-0810-45df-9320-19b5aa5d9f5d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1.",
+ "ref_smiles": "O=C(OCc1ccccc1)C1CCC[NH+]1C1CC[NH2+]CC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e12d1fea-cb20-4733-986e-48e43e869ca5",
+ "task": "add",
+ "question": "Modify the molecule CCC(O)(OC)C(O)CCO by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(O)(OC)C(O)CCO",
+ "ref_smiles": "CCC(O)(OC)C(O)(CCO)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "346a0952-5ed5-4c24-807d-a4e2325fe502",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CON=C(Cl)C12CCC[NH+](CC1)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CON=C(Cl)C12CCC[NH+](CC1)C2.",
+ "ref_smiles": "CON=C(Cl)C12CCC(c3ccccc3)[NH+](CC1)C2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9d542aed-39c6-4328-a4c7-aefd0034ce92",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1(C(=O)Nc2ccc(Cl)c(Cl)c2)CCN1C(=O)CC1CC1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C(=O)Nc2ccc(Cl)c(Cl)c2)CCN1C(=O)CC1CC1",
+ "ref_smiles": "CC1(C(=O)Nc2ccc(C(=O)[OH])c(Cl)c2)CCN1C(=O)CC1CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "59d20ca2-31bc-4de7-8fc0-182b2dec142a",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccccc1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCCc1ccccc1OC",
+ "ref_smiles": "C[NH+]=C(NCCC[NH+]1CCN(C(=O)OC(C)(C)C)CC1)NCC(c1ccccc1)c1ccccc1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "98df7b64-412a-45f2-9254-e9e5e1850fbe",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(CC(=O)Nc2cccc(Cl)c2F)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CC(=O)Nc2cccc(Cl)c2F)cc1",
+ "ref_smiles": "Cc1ccc(CC(=O)Nc2cccc(O)c2F)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "91715e96-b2ed-4753-95c2-67472dd35420",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCC(=O)CC(=O)OCCCCOc1ccc(CCOC2CCCCO2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)CC(=O)OCCCCOc1ccc(CCOC2CCCCO2)cc1.",
+ "ref_smiles": "CCC(=O)CC(=O)OCCCC(Oc1ccc(CCOC2CCCCO2)cc1)C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c6dd43cd-9e3f-440a-a45b-1d7cdc7a1d46",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [NH3+]C(Cc1ccccc1)C(O)C[NH2+]CCCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C(Cc1ccccc1)C(O)C[NH2+]CCCCc1ccccc1.",
+ "ref_smiles": "[NH3+]C(Cc1ccccc1O)C(O)C[NH2+]CCCCc1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5cf50e30-cc32-486a-873c-729c3b86f779",
+ "task": "sub",
+ "question": "Modify the molecule CCC1Nc2cc(-c3nnc(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4ccccc34)ccc21 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1Nc2cc(-c3nnc(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4ccccc34)ccc21",
+ "ref_smiles": "CCC1Nc2cc(-c3nnc(Nc4cc(C(F)(F)F)cc(C(F)(F)C(=O)O)c4)c4ccccc34)ccc21",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "19f2edb1-710d-457e-ad61-526ee6fed789",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCCCCC(C)NC(=O)C1COc2ccccc2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCC(C)NC(=O)C1COc2ccccc2C1.",
+ "ref_smiles": "CCCCCC(C)C1Cc2ccccc2O1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d4899406-d7f6-47d6-9eaf-6bd0a2dad1c5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N=C(OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OC(=O)c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N=C(OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OC(=O)c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl",
+ "ref_smiles": "N#CC(Cl)(Cl)C(=N)OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OC(=O)c1ccc([N+](=O)[O-])cc1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "13f57b20-b4bd-4193-bf75-d659a78e3c46",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(-c2nc3ccc(S(=O)(=O)[O-])cc3[nH]2)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2nc3ccc(S(=O)(=O)[O-])cc3[nH]2)cc1",
+ "ref_smiles": "COc1nc2ccc(S(=O)(=O)[O-])cc2[nH]1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a6be06ab-0e15-4795-aa08-df2d9f5cc318",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C(CC1(O)CCCCC1)NCC(c1cccs1)[NH+]1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1(O)CCCCC1)NCC(c1cccs1)[NH+]1CCOCC1.",
+ "ref_smiles": "O=C(CC1CCCCC1)NCC(c1cccs1)[NH+]1CCOCC1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "284efcef-e0cb-4971-83a7-61ccfea4b599",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCNC(=[NH+]Cc1ncnn1C)N1CCN(c2ccccc2OC)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=[NH+]Cc1ncnn1C)N1CCN(c2ccccc2OC)CC1.",
+ "ref_smiles": "COc1ccccc1N1CCN(C(NCCc2ccccc2)=[NH+]Cc2ncnn2C)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0a98f34d-53e0-4341-b959-73f394223743",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC(C[NH3+])CCC(=O)Nc1cnoc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C[NH3+])CCC(=O)Nc1cnoc1.",
+ "ref_smiles": "CC(C[NH3+])Cc1cnoc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e5066c30-f312-43cd-b0b8-4be9b6ce358a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](C)CCOc1ccc(NC(=O)CC([NH3+])c2ccccc2)cc1Cl with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCOc1ccc(NC(=O)CC([NH3+])c2ccccc2)cc1Cl",
+ "ref_smiles": "C[NH+](C)CCOc1ccc(NC(=O)CC([NH3+])c2ccccc2)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8be2719b-ac06-4575-b75b-f05b4e3c6214",
+ "task": "add",
+ "question": "Modify the molecule O=C(Cn1c(=O)ccc2cc([N+](=O)[O-])ccc21)OC1CCCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cn1c(=O)ccc2cc([N+](=O)[O-])ccc21)OC1CCCC1",
+ "ref_smiles": "O=C(Cn1c(=O)c(-c2ccccc2)cc2cc([N+](=O)[O-])ccc21)OC1CCCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b0e49da3-31eb-4b32-9528-4a2820eaa329",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]1CCN(c2nc(C3=CCC[NH+](C)C3)c(Cl)s2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(c2nc(C3=CCC[NH+](C)C3)c(Cl)s2)CC1",
+ "ref_smiles": "C[NH+]1CCC=C(c2nc(N3CC[NH+](C)C(O)C3)sc2Cl)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8554c93a-378e-4439-bae3-6c9a3f3d544c",
+ "task": "add",
+ "question": "Modify the molecule PCc1cccc(Oc2ccccc2)c1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "PCc1cccc(Oc2ccccc2)c1",
+ "ref_smiles": "PCc1ccc(-c2ccccc2)c(Oc2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3aa5ba81-b21b-4627-9fad-b3c6f85de6c9",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule NC(=O)OCCc1ccc(NC2CCN(C(=O)NCc3c(F)cccc3F)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)OCCc1ccc(NC2CCN(C(=O)NCc3c(F)cccc3F)CC2)cc1.",
+ "ref_smiles": "NC(=O)OCCc1ccc(NC2CCN(C(=O)NCc3ccccc3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "e177ffa7-d0a3-4056-9495-4dd65483367a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CSCC(C)(O)CNC(=O)CNC(=O)c1ccccc1Cl with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCC(C)(O)CNC(=O)CNC(=O)c1ccccc1Cl",
+ "ref_smiles": "CSCC(C)(C#N)CNC(=O)CNC(=O)c1ccccc1Cl",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a940f77a-9f61-4f65-8def-9737a5ceac17",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)c1cccc(C(C)C)c1OC(=O)N(C)S(=O)(=O)Oc1c(C(C)C)cccc1C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1cccc(C(C)C)c1OC(=O)N(C)S(=O)(=O)Oc1c(C(C)C)cccc1C(C)C.",
+ "ref_smiles": "CC(C)c1cccc(C(C)C)c1OC(=O)N(C)S(=O)(=O)OC(C)(C)C(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3b67b02e-b9f6-456f-b0e6-28c9507fefbb",
+ "task": "sub",
+ "question": "Please substitute a nitro in the molecule COc1ccc(-n2c(SCc3ccc(C(N)=O)cc3[N+](=O)[O-])nc3ccccc32)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-n2c(SCc3ccc(C(N)=O)cc3[N+](=O)[O-])nc3ccccc32)cc1",
+ "ref_smiles": "COc1ccc(-n2c(SCc3ccc(C(N)=O)cc3[SH]=O)nc3ccccc32)cc1",
+ "add_group": "thiol",
+ "remove_group": "nitro"
+ },
+ {
+ "id": "b059d143-1bd2-47ec-b08e-56e0b7bf30a0",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COc1cccc(C(O)C(=O)NC(C)c2ccccc2C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C(O)C(=O)NC(C)c2ccccc2C)c1.",
+ "ref_smiles": "COc1cccc(C(O)C(=O)NC(CC(=O)O)c2ccccc2C)c1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ea5498ae-4b37-47ce-a0d7-6a7389f4d036",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C)c(-n2nc(C)c(S(=O)(=O)Cl)c2Cl)c(C)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c(-n2nc(C)c(S(=O)(=O)Cl)c2Cl)c(C)c1",
+ "ref_smiles": "Cc1cc(C)c(-n2nc(C)c(S(=O)(=O)C(=O)O)c2Cl)c(C)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3810d86c-8c42-4cfa-8390-6ad476b119ee",
+ "task": "add",
+ "question": "Modify the molecule C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1C",
+ "ref_smiles": "C[NH2+]Cc1cn(S(=O)(=O)c2ccc3c(c2)OCCO3)c(-c2ccccc2)c1CC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b40ffaaf-19e6-46ee-b00c-355af22673c4",
+ "task": "delete",
+ "question": "Modify the molecule CCCCN(CCCC)C(=O)C1C(C(=O)[O-])C1(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(CCCC)C(=O)C1C(C(=O)[O-])C1(C)C",
+ "ref_smiles": "CCCCC1(C(=O)[O-])C(CCC)C1(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "dd1a5a13-6c5f-4078-910e-f70df91b1cc8",
+ "task": "add",
+ "question": "Modify the molecule Brc1ccc(C2N3CCCN23)cc1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1ccc(C2N3CCCN23)cc1",
+ "ref_smiles": "Nc1cc(Br)ccc1C1N2CCCN12",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "e4aba6d1-e77d-4976-a5d6-770d63a725cb",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCc1cccc(C(C)(O)Cc2ccc(OC)cc2)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cccc(C(C)(O)Cc2ccc(OC)cc2)c1",
+ "ref_smiles": "CCCc1cccc(C(C)(Cc2ccc(OC)cc2)C(=O)O)c1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b9d0c052-6676-4bf4-9935-558d9439a6f4",
+ "task": "add",
+ "question": "Modify the molecule CCCNC(=O)Cn1c(-c2nnc(CC(C)C)o2)cc2ccccc21 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)Cn1c(-c2nnc(CC(C)C)o2)cc2ccccc21",
+ "ref_smiles": "CCCNC(=O)Cn1c(-c2nnc(C(C#N)C(C)C)o2)cc2ccccc21",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "928838ef-f27b-44d6-8ca7-972aeecaff5f",
+ "task": "add",
+ "question": "Modify the molecule Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)CC1",
+ "ref_smiles": "Cc1c(-c2ccc(C(F)(F)F)cc2)nn(CC(C)C)c(=O)c1N1CC[NH+](C)C(O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "936cdedb-daa5-449f-b524-5f2c8788f498",
+ "task": "add",
+ "question": "Modify the molecule O=C(CN1C(=O)NC2(CCSC2)C1=O)N1CCCCC1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN1C(=O)NC2(CCSC2)C1=O)N1CCCCC1",
+ "ref_smiles": "O=C(CN1C(=O)NC2(CSC(S)C2)C1=O)N1CCCCC1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "07ad8bec-cbee-4f98-8a12-2eff213daeb5",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(Cc1ccccc1)NCc1cccc(COCc2ccccc2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Cc1ccccc1)NCc1cccc(COCc2ccccc2)c1",
+ "ref_smiles": "COCc1cccc(CNS(=O)(=O)Cc2ccccc2)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ebf1a2cb-75c8-469c-86fe-8c5144edc46f",
+ "task": "delete",
+ "question": "Modify the molecule CC(Cc1ccc(Cl)cc1)[NH2+]CC1(C)CCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Cc1ccc(Cl)cc1)[NH2+]CC1(C)CCC1",
+ "ref_smiles": "CC(CCl)[NH2+]CC1(C)CCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7239348c-83b3-4ca9-923f-c26b6d2fb8d4",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2CC2)C1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2CC2)C1Cl.",
+ "ref_smiles": "C=C(CCl)C(C(=O)OCN1C(=O)CCC1=O)N1C(=O)C(NC(=O)C2(CC=O)CC2)C1Cl",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b81c7c11-a41a-451b-94d7-1fae65f072f4",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCC[NH+](CCCC)CCCOc1cccc(C[NH3+])c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC[NH+](CCCC)CCCOc1cccc(C[NH3+])c1.",
+ "ref_smiles": "CCCC[NH+](CCCOc1cccc(C[NH3+])c1)CC(O)CC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "af5108bd-6726-42ed-93d0-daa566bde1d8",
+ "task": "delete",
+ "question": "Modify the molecule O=C1C(SCC(O)c2ccc(F)cc2Cl)C(c2ccc(O)cc2)N1c1ccc(-c2cccnc2)cc1 by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(SCC(O)c2ccc(F)cc2Cl)C(c2ccc(O)cc2)N1c1ccc(-c2cccnc2)cc1",
+ "ref_smiles": "O=C1C(SCC(O)c2ccc(F)cc2Cl)C(c2ccccc2)N1c1ccc(-c2cccnc2)cc1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d102d0ca-6193-4d47-951f-0eb0867d73bd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C=Cc1ccc(Cl)cc1Cl)NCc1ccc(N2CCCC2=O)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccc(Cl)cc1Cl)NCc1ccc(N2CCCC2=O)cc1",
+ "ref_smiles": "O=C(C=Cc1ccc([N+](=O)[O-])cc1)NCc1ccc(N2CCCC2=O)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e562bb4d-e01f-4924-9acf-6924735d2bbb",
+ "task": "delete",
+ "question": "Modify the molecule C[Si](C)(c1ccccc1)N1Cc2ccccc2-c2ccccc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[Si](C)(c1ccccc1)N1Cc2ccccc2-c2ccccc21",
+ "ref_smiles": "C[Si](C)N1Cc2ccccc2-c2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "60d2cb38-c268-4bf4-94b2-c50f43afeca2",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)cc1.",
+ "ref_smiles": "Cc1ccc(C(C)[NH2+]CC(C)C[NH+]2CCCC2)c(NH2)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "253b8f31-61fc-4c58-b25b-b70812f7d46d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(NCc1ccccc1F)c1ccc2c(c1)CN(S(=O)(=O)c1ccc3c(c1)CCCC3)CCO2 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccccc1F)c1ccc2c(c1)CN(S(=O)(=O)c1ccc3c(c1)CCCC3)CCO2",
+ "ref_smiles": "O=C(NCc1ccccc1O)c1ccc2c(c1)CN(S(=O)(=O)c1ccc3c(c1)CCCC3)CCO2",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1cf1691b-b295-408f-8cd5-7316bfab4e56",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC12CCCC1N(c1ccccc1)NC(=O)N2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC12CCCC1N(c1ccccc1)NC(=O)N2.",
+ "ref_smiles": "CCOC12CCCC1NNC(=O)N2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0c5a5f52-0964-4427-99e3-3b526243ffbf",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C=Cc1ccc(F)cc1)N1CCN(c2nn3cnnc3c3ccccc23)CC1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1ccc(F)cc1)N1CCN(c2nn3cnnc3c3ccccc23)CC1",
+ "ref_smiles": "O=C(C=Cc1ccc(O)cc1)N1CCN(c2nn3cnnc3c3ccccc23)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "643269e4-d3f4-4a77-b8ec-94c0b580bbc1",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule C[NH2+]C(C)(C)C(O)C1=CCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)(C)C(O)C1=CCCO1.",
+ "ref_smiles": "C[NH2+]C(C)(C)CC1=CCCO1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "30f78d8b-f7ae-4d85-96ed-1dc310592033",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(=O)Oc1ccccc1C1=NN(C(C)=O)C(c2ccncc2)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Oc1ccccc1C1=NN(C(C)=O)C(c2ccncc2)O1.",
+ "ref_smiles": "CC(=O)OC1=NN(C(C)=O)C(c2ccncc2)O1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "230a48e5-614c-4e39-9512-8f3b4db69103",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CCC(Nc2cc(Cl)cc(C(F)(F)F)c2)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(Nc2cc(Cl)cc(C(F)(F)F)c2)CC1",
+ "ref_smiles": "CC(=O)c1cc(NC2CCC(C)CC2)cc(C(F)(F)F)c1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "44168957-1d8b-45c0-bb53-db71434eb34c",
+ "task": "add",
+ "question": "Modify the molecule CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=CCC2=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=CCC2=O",
+ "ref_smiles": "CC12CC=C3C(CCC4=CC(=O)CCC43C(F)(F)F)C1=C(O)CC2=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "90199e30-ecf0-49e3-b562-beea6d664ff4",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOc1cc2c(cc1OCC)CN(C(=O)C(CC)(CC)C[NH3+])CC2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc2c(cc1OCC)CN(C(=O)C(CC)(CC)C[NH3+])CC2.",
+ "ref_smiles": "CCOc1cc2c(cc1OC(C)c1ccccc1)CCN(C(=O)C(CC)(CC)C[NH3+])C2",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "10a1613b-e76c-423e-9a56-e7b9bf54f7b1",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=C=NC1=CC=CN2SNC=C12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C=NC1=CC=CN2SNC=C12.",
+ "ref_smiles": "O=C=NC1=CC=CN2SC=C12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "6f72f156-851a-40ba-8aa1-d2ca775dac56",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COCC([NH3+])CCNC(=O)c1ccc(O)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC([NH3+])CCNC(=O)c1ccc(O)cc1",
+ "ref_smiles": "COCC([NH3+])CCNC(=O)c1ccc(C(=O)[OH])cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "eab2a6a9-a6d7-43fb-a17e-118d274d1af5",
+ "task": "add",
+ "question": "Modify the molecule O=C([O-])C1Cn2c(n[nH]c2=O)C[NH+]1CC1CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1Cn2c(n[nH]c2=O)C[NH+]1CC1CCC1",
+ "ref_smiles": "O=C([O-])C1C(c2ccccc2)n2c(n[nH]c2=O)C[NH+]1CC1CCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cc22e646-e6b6-4f04-b35b-d2a5c1c6b17f",
+ "task": "add",
+ "question": "Modify the molecule CCN(Cc1ccc(OC)cc1)C(=O)CN1CSCC1=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccc(OC)cc1)C(=O)CN1CSCC1=O",
+ "ref_smiles": "CCN(Cc1ccc(OC)c(N)c1)C(=O)CN1CSCC1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "97c068ba-c3bf-4bf0-ad02-976d81917549",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](Cc3ccc(OC)cc3)CC2)c1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](Cc3ccc(OC)cc3)CC2)c1C.",
+ "ref_smiles": "CCOC(=O)c1c(C)[nH]c(C(=O)N2CC[NH+](C(c3ccccc3)c3ccc(OC)cc3)CC2)c1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "04459a49-140b-4dc3-9e8f-47aee0596eb1",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCCC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCCC2)C1.",
+ "ref_smiles": "O=C(NCC1CC1)C1CCCN(C(=O)C2(O)CCC(O)C2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "724bb8c8-066b-4e23-8f42-8cbce96ca062",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1(C)C2CC=C(CN(CC[NH+]3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)C(=O)Nc3ccc(Cl)c(Cl)c3)C1C2 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)C2CC=C(CN(CC[NH+]3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)C(=O)Nc3ccc(Cl)c(Cl)c3)C1C2",
+ "ref_smiles": "CC(=O)c1ccc(NC(=O)N(CC[NH+]2CCN(C(=O)c3ccc(-c4ccccc4)cc3)CC2)CC2=CCC3CC2C3(C)C)cc1Cl",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "27deec2c-69a1-4e7e-878b-f71eee09232a",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC(C)(C)c1ccc(NC(=O)CCC(=O)NC2CCC(Cc3ccccc3)([NH+]3CCOCC3)CC2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1ccc(NC(=O)CCC(=O)NC2CCC(Cc3ccccc3)([NH+]3CCOCC3)CC2)cc1.",
+ "ref_smiles": "CC(C)(C)c1ccc(NC(=O)CCC(=O)NC2CCC(C)([NH+]3CCOCC3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f64c9eb5-052b-45ce-81b3-328a5ac36994",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Oc1ccc(-c2cc(=S)ss2)cc1)c1ccc(OCCCCO[N+](=O)[O-])cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Oc1ccc(-c2cc(=S)ss2)cc1)c1ccc(OCCCCO[N+](=O)[O-])cc1",
+ "ref_smiles": "O=C(OCCCCO[N+](=O)[O-])Oc1ccc(-c2cc(=S)ss2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "4b7ffc39-665d-4201-ad2b-ef4d434b2a00",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1=CC(C(O)C(C)C)C(=O)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CC(C(O)C(C)C)C(=O)O1.",
+ "ref_smiles": "CC1=CC(CC(C)C)C(=O)O1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b6b8edb7-d0cc-45b0-bb81-d3d12d5ff283",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C=CCNC(NCC[NH+]1CCCCC1)=[NH+]C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCNC(NCC[NH+]1CCCCC1)=[NH+]C.",
+ "ref_smiles": "C=CCC(NCC[NH+]1CCCCC1)=[NH+]C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "13a1fcfb-05cf-4499-8202-c49ebfb695b0",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule COC(=O)NCCc1c[nH]c2cc(F)ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NCCc1c[nH]c2cc(F)ccc12.",
+ "ref_smiles": "COC(=O)NCCc1c[nH]c2ccccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "631b298b-3e2e-4ce6-9635-7e83b24b0554",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCCCCCCCCCCCCCCC(OC(=O)C(OC)(c1ccccc1)C(F)(F)F)C1(C(=O)OC)COC(C(C)(C)C)N1C=O with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCCC(OC(=O)C(OC)(c1ccccc1)C(F)(F)F)C1(C(=O)OC)COC(C(C)(C)C)N1C=O",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCC(OC(=O)C(OC)(c1ccccc1)C(O)(F)F)C1(C(=O)OC)COC(C(C)(C)C)N1C=O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d99c7914-78f2-4eb6-ba0b-e8af77ff7277",
+ "task": "add",
+ "question": "Modify the molecule CCC(C)NC(=O)CCCCCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)NC(=O)CCCCCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O",
+ "ref_smiles": "CCC(C)NC(=O)CCC(O)CCn1c(=S)[nH]c2c([nH]c3ccc(OC)cc32)c1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5af65bc3-dc39-40b1-8261-bb7969479a8f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC=COc1ccc(C2CCCCC2)c(F)c1F with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC=COc1ccc(C2CCCCC2)c(F)c1F",
+ "ref_smiles": "CC=COc1ccc(C2CCCCC2)c([N+](=O)[O-])c1F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5c07b1db-643e-4049-89d7-f4d876dfabeb",
+ "task": "delete",
+ "question": "Modify the molecule Nc1ccccc1OCCS(=O)(=O)N1CCCSCC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccccc1OCCS(=O)(=O)N1CCCSCC1",
+ "ref_smiles": "NOCCS(=O)(=O)N1CCCSCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3fa60320-e70e-4c7c-9b68-2fec39d571d2",
+ "task": "sub",
+ "question": "Modify the molecule CCc1ccc(C(=O)Cn2ccnc2C#N)s1 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C(=O)Cn2ccnc2C#N)s1",
+ "ref_smiles": "CCc1ccc(C(=O)Cn2ccnc2C(=O)[OH])s1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "1dbd2466-8a56-49e7-9b40-0a3a43c5e43d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccc(-c2cc(C[NH+]3CCN(c4ccccc4[N+](=O)[O-])CC3)on2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2cc(C[NH+]3CCN(c4ccccc4[N+](=O)[O-])CC3)on2)cc1.",
+ "ref_smiles": "COc1ccc(-c2cc(C[NH+]3CCN([N+](=O)[O-])CC3)on2)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fa3c411e-c13c-46fd-b3ba-700113f86f9c",
+ "task": "delete",
+ "question": "Modify the molecule CCNC(NCCC(C)C)=[NH+]CCCc1nc(C)no1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCCC(C)C)=[NH+]CCCc1nc(C)no1",
+ "ref_smiles": "CCNC(CCCc1nc(C)no1)NCCC(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "78eda358-c732-484d-94ad-e9bf648948a9",
+ "task": "add",
+ "question": "Modify the molecule CCc1ccc(C2SCC(=O)N2Cc2ccccn2)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(C2SCC(=O)N2Cc2ccccn2)cc1",
+ "ref_smiles": "CC(c1ccccc1)c1ccc(C2SCC(=O)N2Cc2ccccn2)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "ddd9b0f2-95d8-49b1-9915-03c709ce5535",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3)n2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3)n2)CC1",
+ "ref_smiles": "C[NH+]1CCN(c2cccc(C(=O)N3CCCCCC3C(=O)O)n2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "af1ec4f9-bb66-4f93-b542-655aaf13f56f",
+ "task": "add",
+ "question": "Modify the molecule CCC1(CC)CCN(C(=O)n2cc[n+](C)c2)C1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1(CC)CCN(C(=O)n2cc[n+](C)c2)C1",
+ "ref_smiles": "CCC1(C(C)C(=O)O)CCN(C(=O)n2cc[n+](C)c2)C1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "fe932939-3eac-4797-91b8-a566b051c358",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)S(=O)(=O)NCCOc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)=NCC2 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)S(=O)(=O)NCCOc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)=NCC2",
+ "ref_smiles": "CC(C)S(=O)(=O)NCCOc1ccc2c(c1)C(C1(Cl)CCC1)=NCC2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b89580a0-afbb-4a56-aefc-632de7d8d714",
+ "task": "add",
+ "question": "Modify the molecule C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2C)C1)C(=O)OCC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2C)C1)C(=O)OCC",
+ "ref_smiles": "C=C(COC1CCCC(OCc2nc(-c3cccc(C)c3)oc2Cc2ccccc2)C1)C(=O)OCC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c6d1fcb0-41db-47fc-bcde-dd3a0667088c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(c2ccccc2F)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(c2ccccc2F)CC1",
+ "ref_smiles": "COc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "33ac6725-59e7-46cf-b40d-b8b83f44aee3",
+ "task": "add",
+ "question": "Please add a amine to the molecule O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1ccc(C(=O)c2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1ccc(C(=O)c2ccccc2)cc1.",
+ "ref_smiles": "Nc1cc(NC2=C(c3ccc(Cl)cc3)C(=O)NC2=O)ccc1C(=O)c1ccccc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "4599c668-806b-4cdb-9994-2a9a9bdd8e13",
+ "task": "sub",
+ "question": "Modify the molecule [NH3+]CCC(O)c1nc2ccc(Cl)cc2o1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCC(O)c1nc2ccc(Cl)cc2o1",
+ "ref_smiles": "[NH3+]CCC(O)c1nc2ccc(O)cc2o1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "de6ff071-153a-4d1f-a67f-027ea56f7884",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc(CCNS(=O)(=O)c2ccc(F)cc2F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CCNS(=O)(=O)c2ccc(F)cc2F)cc1.",
+ "ref_smiles": "Cc1ccc(CCS(=O)(=O)c2ccc(F)cc2F)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3559c254-7478-4daa-ba05-0f76df7fc0ba",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)NC1=[NH+]CC(c2ccc(C)cc2)CN1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NC1=[NH+]CC(c2ccc(C)cc2)CN1",
+ "ref_smiles": "COC(=O)NC1=[NH+]CC(C)CN1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "63c4950d-ae68-4aa4-a425-0c3c604b01cc",
+ "task": "sub",
+ "question": "Modify the molecule O=C1NC(C(=O)NCc2ccccc2Cl)CO1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1NC(C(=O)NCc2ccccc2Cl)CO1",
+ "ref_smiles": "O=C1NC(C(=O)NCc2ccccc2C(=O)[OH])CO1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d762519f-b8f9-4ce9-bb89-cd5bf97d8047",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOC(=O)C([NH3+])CSCCC(=O)OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C([NH3+])CSCCC(=O)OC.",
+ "ref_smiles": "CCOC(=O)C([NH3+])C(O)SCCC(=O)OC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "be3bee14-4cae-4c7d-8018-4e9e57d039a2",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1ccc(C2Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C2Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1.",
+ "ref_smiles": "COc1ccc(C2(c3ccccc3)Nc3ccccc3C(=O)N2NS(C)(=O)=O)cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "aa72b4a4-7e47-4003-a1f3-4e20e2592beb",
+ "task": "add",
+ "question": "Modify the molecule CCCCCCCCCCOCC(O)C[NH2+]CCO by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCOCC(O)C[NH2+]CCO",
+ "ref_smiles": "CCCCCCCCCC(CC=O)OCC(O)C[NH2+]CCO",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "9ecc2a27-d38b-4e15-bdbb-244a0c887cc8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(Nc1ccc2c(c1)CCCO2)N1CCC(O)CC12CCC2 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccc2c(c1)CCCO2)N1CCC(O)CC12CCC2",
+ "ref_smiles": "N#CC1CCN(C(=O)Nc2ccc3c(c2)CCCO3)C2(CCC2)C1",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "eb0c5e7c-3e9b-4feb-8588-46fbf11f6729",
+ "task": "add",
+ "question": "Modify the molecule CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1",
+ "ref_smiles": "CC(O)C[NH+](Cc1nnc(-c2cccc(Cl)c2)o1)C1CCCCC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7dcbbf9b-03a1-4662-b1a9-28f0dad5018e",
+ "task": "add",
+ "question": "Modify the molecule Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2cc(C)ccc2C)cc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2cc(C)ccc2C)cc1",
+ "ref_smiles": "Cc1ccc(N(C)C(=O)CSc2nnc(C)n2-c2c(C)ccc(C)c2O)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e784e981-047f-4af5-a74e-186ad079f31e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule C[NH2+]CC(=O)c1c(O)ccc2cc(Br)ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]CC(=O)c1c(O)ccc2cc(Br)ccc12.",
+ "ref_smiles": "C[NH2+]CC(=O)c1c(O)ccc2ccccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b532a19a-c85d-485d-b9d4-0be4981d0365",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C[NH2+]Cc1ccc(I)cc1)N1CCCC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C[NH2+]Cc1ccc(I)cc1)N1CCCC1",
+ "ref_smiles": "CC(C[NH2+]Cc1ccc(S)cc1)N1CCCC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d2cd2143-754f-4b4e-ac7a-11d384929665",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C#CCN(CC)C(=O)CCC(C)O with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCN(CC)C(=O)CCC(C)O",
+ "ref_smiles": "C#CCN(CC)C(=O)CCC(C)C#N",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "232909c8-f34b-4b05-aecd-b9834d34fc6b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Nc1ccc(Cl)c(Br)c1CC(=O)[O-] with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1ccc(Cl)c(Br)c1CC(=O)[O-]",
+ "ref_smiles": "Nc1ccc(O)c(Br)c1CC(=O)[O-]",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f9cd6cbc-0bc8-4476-8a5d-a996be188a83",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)c1ccc(NC(=O)N2CCc3[nH]c(Cc4ccccc4F)nc(=O)c3C2)cc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccc(NC(=O)N2CCc3[nH]c(Cc4ccccc4F)nc(=O)c3C2)cc1",
+ "ref_smiles": "CCOC(=O)c1ccc(NC(=O)N2CCc3[nH]c(Cc4ccccc4[N+](=O)[O-])nc(=O)c3C2)cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "35420f96-4de3-42ae-9ef8-1e7d8e7ee51e",
+ "task": "add",
+ "question": "Modify the molecule O=C(Nc1nncs1)c1ccc(N(CCO)C2CCC2)nc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1nncs1)c1ccc(N(CCO)C2CCC2)nc1",
+ "ref_smiles": "O=C(Nc1nncs1)c1ccc(N(CCO)C2(O)CCC2)nc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "591044fb-64cc-40d5-b457-ec4e06b53927",
+ "task": "add",
+ "question": "Modify the molecule O=C(CC1(c2ccccc2)CCN(C(=O)[O-])CC1)NCc1ccc(C(F)(F)F)cc1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CC1(c2ccccc2)CCN(C(=O)[O-])CC1)NCc1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "O=C(CC1(c2ccccc2)CCN(C(=O)[O-])C(C(=O)O)C1)NCc1ccc(C(F)(F)F)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cf5f5daf-2f61-4a1d-ac03-077db94cec64",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)c1sc2c(ccc(=O)n2-c2ccccc2Cl)c1-c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)c1sc2c(ccc(=O)n2-c2ccccc2Cl)c1-c1ccccc1",
+ "ref_smiles": "NC(=O)c1sc2c(ccc(=O)n2-c2ccccc2S)c1-c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6eee3f00-4354-49e0-b041-0fa02b7e3836",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C=C(C=CC=C1N(CCC(C)C)c2cc3ccccc3cc2C1(C)Cc1ccccc1)C(C)(Cc1ccccc1)c1cc(OC)ccc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C=CC=C1N(CCC(C)C)c2cc3ccccc3cc2C1(C)Cc1ccccc1)C(C)(Cc1ccccc1)c1cc(OC)ccc1C.",
+ "ref_smiles": "C=C(C=CC=C1N(CCC(C)C)c2cc3ccccc3cc2C1(C)Cc1ccccc1)C(C)(C)c1cc(OC)ccc1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "54714b45-4ba2-4f16-b4e0-8fa770e27e51",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C1(c2ccc(-c3ccc(-c4onc(C)c4C[NH+](C)CC(C)c4ccccc4)cc3)cc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1(c2ccc(-c3ccc(-c4onc(C)c4C[NH+](C)CC(C)c4ccccc4)cc3)cc2)CC1",
+ "ref_smiles": "CCOC(=O)C1(c2ccc(-c3onc(C)c3C[NH+](C)CC(C)c3ccccc3)cc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c6533fc0-a023-4f35-82c9-9a28dd848c8e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule FC(F)(F)c1cccc(OCC2CC[NH+](CC3COCCOC3)CC2)n1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "FC(F)(F)c1cccc(OCC2CC[NH+](CC3COCCOC3)CC2)n1",
+ "ref_smiles": "O=Cc1cccc(OCC2CC[NH+](CC3COCCOC3)CC2)n1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b4ddef0f-c75d-4da0-b2c0-bebb4c95f03d",
+ "task": "sub",
+ "question": "Modify the molecule OCCc1ccc(C(F)(F)F)c(F)c1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCc1ccc(C(F)(F)F)c(F)c1",
+ "ref_smiles": "ONC(F)(F)c1ccc(CCO)cc1F",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6d0111ab-516c-4655-9852-09d180d4843e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)COC(=O)NC(C)(C)CCO with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)COC(=O)NC(C)(C)CCO",
+ "ref_smiles": "CC(=O)CCC(C)(C)NC(=O)OCC(C)C",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "1bfff9b7-eaec-4268-9928-fd75c756fcda",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1.",
+ "ref_smiles": "CCC(NS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(OC)c(C)c1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "825f6d9f-7d48-4803-a98c-8bcdbd318bd5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CNC(=O)c1ccc(CN(Cc2ccco2)C(=O)C=Cc2cccc(C(F)(F)F)c2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)c1ccc(CN(Cc2ccco2)C(=O)C=Cc2cccc(C(F)(F)F)c2)cc1.",
+ "ref_smiles": "CNC(=O)c1ccc(CN(Cc2ccco2)C(=O)C=CC(F)(F)F)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3e2d4372-0f9f-4633-b242-c879a9632408",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccccc1NC(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3ccc(Cl)c(C(=O)NC4CCCCC4)c3)CC2)ccc1Cl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1NC(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3ccc(Cl)c(C(=O)NC4CCCCC4)c3)CC2)ccc1Cl",
+ "ref_smiles": "Cc1ccccc1NC(=O)c1cc(NC(=O)C[NH+]2CCC(C(=O)N3CCCC3C(=O)Nc3ccc(S)c(C(=O)NC4CCCCC4)c3)CC2)ccc1Cl",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "25065820-d90c-4291-8dec-eb5f9698ad32",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cc1ccc(Oc2ccccc2NC(=O)c2ccccc2C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Oc2ccccc2NC(=O)c2ccccc2C)cc1.",
+ "ref_smiles": "Cc1ccc(Oc2cc(C(=O)O)ccc2NC(=O)c2ccccc2C)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c27094fb-a4c3-4868-8d48-d1960e7d3165",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.",
+ "ref_smiles": "CC(OCC1(c2ccccc2)CCC([NH3+])C(=O)N1)c1cc(C(F)(F)F)c(-c2ccccc2)c(C(F)(F)F)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "5e20fbea-16b9-4367-a898-1f69808224b2",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)C1CCCN(C(=O)C(C#N)=C2C=CC(=O)C=C2)C1 by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCCN(C(=O)C(C#N)=C2C=CC(=O)C=C2)C1",
+ "ref_smiles": "CCOC(=O)C1CCCN(C(=O)C(S)=C2C=CC(=O)C=C2)C1",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "b64ae4c3-7c10-4a39-990f-3713bde34f51",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CC(CCCCCC(=O)C2OC2CCCC=O)OC(C)(C)O1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(CCCCCC(=O)C2OC2CCCC=O)OC(C)(C)O1.",
+ "ref_smiles": "CC1CC(C(CCCCC(=O)C2OC2CCCC=O)c2ccccc2)OC(C)(C)O1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bfe5335e-44a1-44b7-9e12-e6cafc79330a",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule Cn1cc(N2CC3(CCN(C(=O)C4(C#N)CCCC4)C3)CC2=O)cn1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(N2CC3(CCN(C(=O)C4(C#N)CCCC4)C3)CC2=O)cn1",
+ "ref_smiles": "CC(=O)C1(C(=O)N2CCC3(CC(=O)N(c4cnn(C)c4)C3)C2)CCCC1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "a250f6fe-ab39-4d01-a41b-2e92d5f09f88",
+ "task": "add",
+ "question": "Modify the molecule CC([NH3+])(c1nc2c([nH]1)CCCC2)C1CCCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH3+])(c1nc2c([nH]1)CCCC2)C1CCCCC1",
+ "ref_smiles": "CC([NH3+])(c1nc2c([nH]1)CC(CC=O)CC2)C1CCCCC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "e480a58a-328f-4d5e-b7f4-1c6a83cbc416",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule COc1ccc(Cl)cc1NC(=O)C(C)CC#N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)cc1NC(=O)C(C)CC#N.",
+ "ref_smiles": "COc1c(O)cc(Cl)cc1NC(=O)C(C)CC#N",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "74406f8a-82f3-4530-84eb-369541a66cca",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CN1C(=O)SC(=Cc2cccc(OCc3ccccc3)c2)C1=O)Nc1cccc2ccccc12 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CN1C(=O)SC(=Cc2cccc(OCc3ccccc3)c2)C1=O)Nc1cccc2ccccc12",
+ "ref_smiles": "O=C(S)C(Cc1cccc(OCc2ccccc2)c1)C(=O)Nc1cccc2ccccc12",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b29c1214-27ee-4036-b984-b7e018e4b79c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1=C(OCCn2c([O-])cn(C)c2=O)C=CC(C[NH+](CC2CCC(C(=O)[O-])CC2)C(C)c2ccc(Cl)c(Cl)c2)C1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=C(OCCn2c([O-])cn(C)c2=O)C=CC(C[NH+](CC2CCC(C(=O)[O-])CC2)C(C)c2ccc(Cl)c(Cl)c2)C1",
+ "ref_smiles": "CC1=C(OCCn2c([O-])cn(C)c2=O)C=CC(C[NH+](CC2CCC(C(=O)[O-])CC2)C(C)c2ccc(O)c(Cl)c2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0b559f73-7930-4941-baf4-34257a0a89a0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(C)c(NC(=O)C=Cc2c(Cl)nc3ccccn23)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(NC(=O)C=Cc2c(Cl)nc3ccccn23)c1",
+ "ref_smiles": "CC(=O)c1nc2ccccn2c1C=CC(=O)Nc1cc(C)ccc1C",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e979cf3b-311a-4ecc-b4b2-1874cfe7533c",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)C(=O)c1ccc(N)cc1N1CCn2cnnc2C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)C(=O)c1ccc(N)cc1N1CCn2cnnc2C1",
+ "ref_smiles": "CCc1(N2CCn3cnnc3C2)cc(N)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "a4a81806-37b0-4f9b-a441-efd48f1135e7",
+ "task": "sub",
+ "question": "Modify the molecule Cc1ccc(N2C(=O)C(Cc3ccccc3C)SC2=C(C#N)C(=O)Nc2ccccc2)cc1C by substituting a nitrile with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N2C(=O)C(Cc3ccccc3C)SC2=C(C#N)C(=O)Nc2ccccc2)cc1C",
+ "ref_smiles": "Cc1ccc(N2C(=O)C(Cc3ccccc3C)SC2=C(O)C(=O)Nc2ccccc2)cc1C",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ca9d5f3e-2adc-44ca-925c-274532d26cee",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule C[NH2+]C(C)(C)C(=O)N(C)c1cc(C)c(OC)c(C)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(C)(C)C(=O)N(C)c1cc(C)c(OC)c(C)c1.",
+ "ref_smiles": "C[NH2+]CCCc1cc(C)c(OC)c(C)c1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "adaff2c9-410f-4b7e-a607-e473a4c782de",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CN(CCO)C(=O)c1cnn(-c2ccccc2Cl)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(CCO)C(=O)c1cnn(-c2ccccc2Cl)c1",
+ "ref_smiles": "CN(CCO)C(=O)c1cnn(-c2ccccc2C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3766ae31-8bc6-436d-88de-aac2a6549a0b",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](Cn1ccc(Br)n1)C1CCC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](Cn1ccc(Br)n1)C1CCC1",
+ "ref_smiles": "C[NH+](Cn1ccc(C#N)n1)C1CCC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c962db42-fb4a-4301-adb1-c4eccb0742a8",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1cc(NC)nc(-c2ccc(Cl)c(F)c2)n1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1cc(NC)nc(-c2ccc(Cl)c(F)c2)n1",
+ "ref_smiles": "CCCc1cc(NC)nc(-c2ccc(S)c(F)c2)n1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6c0ec257-92f2-4462-aeec-b42f164fb984",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOC(C)(Cc1ccccc1C)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(C)(Cc1ccccc1C)C(=O)[O-].",
+ "ref_smiles": "CCOC(C)(CC)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1076f61d-d248-4186-9acc-264b6cb89e01",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCN(CCCC)C(=O)NCCc1ccccc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(CCCC)C(=O)NCCc1ccccc1F.",
+ "ref_smiles": "CCCCN(CCC(C)O)C(=O)NCCc1ccccc1F",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "70df55d7-d6b0-48aa-9fb8-b900214e124d",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NC1CCCC1)c1cc2cc(Cl)ccc2[nH]1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1CCCC1)c1cc2cc(Cl)ccc2[nH]1",
+ "ref_smiles": "O=C(NC1CCCC1)c1cc2ccccc2[nH]1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c1f66cb1-6c2c-4572-b963-b7ada709927e",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(CN(Cc2ccco2)C(=O)CCC(=O)c2ccc(C)s2)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CN(Cc2ccco2)C(=O)CCC(=O)c2ccc(C)s2)s1.",
+ "ref_smiles": "Cc1ccc(C(=O)CC(Cc2ccco2)c2ccc(C)s2)s1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "9286835d-3133-4ce2-87b2-e9b2f30b9c31",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCN(CC(=O)Nc1cccc(Cl)c1Cl)C(C)=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN(CC(=O)Nc1cccc(Cl)c1Cl)C(C)=O",
+ "ref_smiles": "CCCCN(CC(=O)Nc1cccc(C(=O)O)c1Cl)C(C)=O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1e839a98-df74-4a0a-ac9e-dbe956878bf0",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)cc2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)cc2)n1.",
+ "ref_smiles": "Cc1c(Cl)cccc1NC(=O)c1ccnc(Nc2ccc(Cl)c(O)c2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "3b85bc49-7ccf-4a4e-acb1-c89fe2626ba7",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1ccc(F)cc1Oc1ccc(CC[NH3+])cc1Br with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(F)cc1Oc1ccc(CC[NH3+])cc1Br",
+ "ref_smiles": "Cc1ccc(O)cc1Oc1ccc(CC[NH3+])cc1Br",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6ccf9d60-079d-4264-ac68-d0de245422f5",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCc1cc([N+](=O)[O-])c(C(C)CO)cc1Sc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cc([N+](=O)[O-])c(C(C)CO)cc1Sc1ccccc1.",
+ "ref_smiles": "CCc1cc([N+](=O)[O-])c(C(C)C(N)O)cc1Sc1ccccc1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "a7d4292b-0aec-4629-8efe-92778d66c913",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(NC(=O)N1CC[NH+]2CCOCC2C1)c1nc(-c2cccc(F)c2)no1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)N1CC[NH+]2CCOCC2C1)c1nc(-c2cccc(F)c2)no1",
+ "ref_smiles": "CC(NC(=O)N1CC[NH+]2CCOCC2C1)c1nc(-c2cccc(C#N)c2)no1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f689891d-6073-4035-b171-e8bf44783b97",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(COc1ccc(Cl)c2cccnc12)N1CCCC1C1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1ccc(Cl)c2cccnc12)N1CCCC1C1CCOCC1.",
+ "ref_smiles": "O=C(COc1cccc2cccnc12)N1CCCC1C1CCOCC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4009eac8-3938-46ca-8592-68a595533092",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOC(=O)c1oc2ccc(Br)cc2c1N(C(=O)OCC)C1CCOC(CC)C1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1oc2ccc(Br)cc2c1N(C(=O)OCC)C1CCOC(CC)C1",
+ "ref_smiles": "CCOC(=O)c1oc2ccc(C#N)cc2c1N(C(=O)OCC)C1CCOC(CC)C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6dedc7e8-9671-4460-84f7-45fa1f75042b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(C1CCCN1c1nccc(Nc2ccccc2)n1)N1CCC(O)C1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1CCCN1c1nccc(Nc2ccccc2)n1)N1CCC(O)C1",
+ "ref_smiles": "O=C(C1CCCN1c1nccc(Nc2ccccc2)n1)N1CCC(I)C1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "336ea881-cfc2-4bd5-8087-bf236777905c",
+ "task": "delete",
+ "question": "Modify the molecule CCNc1ccc(Cl)c(C[NH+]2CC(CO)OC(C)(C)C2)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1ccc(Cl)c(C[NH+]2CC(CO)OC(C)(C)C2)n1",
+ "ref_smiles": "CCNc1cccc(C[NH+]2CC(CO)OC(C)(C)C2)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "518c1e96-3ceb-433e-90c0-2df5a1ecbde9",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule O=C(Nc1ccccc1C(=O)N1CCOCC1)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1ccccc1C(=O)N1CCOCC1)c1cc(-c2ccco2)n(-c2cccc(Cl)c2)n1.",
+ "ref_smiles": "O=CCc1ccc(C(=O)N2CCOCC2)c(NC(=O)c2cc(-c3ccco3)n(-c3cccc(Cl)c3)n2)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "3f68cd40-4283-4eec-8cf2-58408508eee7",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]CCNC(=O)C1CCCN(C(=O)CCn2cnc3ccccc3c2=O)C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCNC(=O)C1CCCN(C(=O)CCn2cnc3ccccc3c2=O)C1",
+ "ref_smiles": "[NH3+]CCNC(=O)C1CCCC1Cn1cnc2ccccc2c1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ba825141-3b5f-4d55-9f3d-9e17c3dfb6af",
+ "task": "add",
+ "question": "Please add a amine to the molecule Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)C)ccc2n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)C)ccc2n1.",
+ "ref_smiles": "Cc1ccc2cc(NC(=O)CCCCNS(=O)C(C)(C)N)ccc2n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "3896faca-4159-42f2-a0d2-75a07f724e7e",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)c1ccc2noc(-c3ccc(N4CCCCC4)cc3)c2c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc2noc(-c3ccc(N4CCCCC4)cc3)c2c1",
+ "ref_smiles": "CC(=O)c1ccc2noc(N3CCCCC3)c2c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "d98c5035-59d7-4dc4-8895-343521a30453",
+ "task": "sub",
+ "question": "Modify the molecule COC(=O)C1(c2ccc(O)c(C(C)=N)c2)CC1 by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C1(c2ccc(O)c(C(C)=N)c2)CC1",
+ "ref_smiles": "COC(=O)C1(c2ccc(C(=O)[OH])c(C(C)=N)c2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d0081828-73b3-4599-bc50-a37473615c06",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(OC1OCCC(C2CCC(C[NH3+])O2)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(OC1OCCC(C2CCC(C[NH3+])O2)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1",
+ "ref_smiles": "CC(OC1OCCC(C2CCC(C[NH3+])O2)C1c1ccccc1)c1cc(C(O)(F)F)cc(C(F)(F)F)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c8d29052-1eca-46d2-a469-61aafcd648c9",
+ "task": "sub",
+ "question": "Modify the molecule CCNC(CC1CCCN(S(C)(=O)=O)C1)CC(F)(F)F by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(CC1CCCN(S(C)(=O)=O)C1)CC(F)(F)F",
+ "ref_smiles": "CCNC(CC1CCCN(S(C)(=O)=O)C1)CC(F)(F)S",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "97fa82a9-4d05-4e02-a493-16e8a7e423c8",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2ccccc2c1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2ccccc2c1=O.",
+ "ref_smiles": "CCCCn1nc(C(=O)Nc2ccc(OCC#N)cc2)c2cccc(O)c2c1=O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "b3ab4d9a-1461-4183-90cc-bfbf57b6eceb",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)C(C)(C)CN(c1nc(Cl)ncc1[N+](=O)[O-])C1CCCC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(C)(C)CN(c1nc(Cl)ncc1[N+](=O)[O-])C1CCCC1",
+ "ref_smiles": "CCOC(=O)C(C)(C)CN(c1nc(Cl)nc(CC=O)c1[N+](=O)[O-])C1CCCC1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b69ba555-3be7-4e7e-804e-ace9ab924685",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(S(=O)(=O)N2C=CCC(Br)C23CCCC3=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)N2C=CCC(Br)C23CCCC3=O)cc1.",
+ "ref_smiles": "Cc1ccc(S(=O)(=O)N2C=CCCC23CCCC3=O)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "854e1d69-605a-453b-88dd-84bdde99de7a",
+ "task": "delete",
+ "question": "Modify the molecule O=C(C[NH+]1CCC2(CC1)OCCO2)Nc1nc2c(s1)CCC2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C[NH+]1CCC2(CC1)OCCO2)Nc1nc2c(s1)CCC2",
+ "ref_smiles": "C1Cc2nc([NH+]3CCC4(CC3)OCCO4)sc2C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c604e122-4344-4049-bed9-f66eda5480c7",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule Cc1cc(=O)cc(C)n1-c1cc(Br)ccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(=O)cc(C)n1-c1cc(Br)ccn1.",
+ "ref_smiles": "Cc1cc(=O)cc(Cc2ccccc2)n1-c1cc(Br)ccn1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "88492b51-e902-4432-bb98-a6a6cdab40ff",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule NC(=O)C(CCC(F)(F)F)C(CC1CC1)C(=O)NC1N=C(c2ccccc2)c2cccc3c2N(CC(F)(F)CO3)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C(CCC(F)(F)F)C(CC1CC1)C(=O)NC1N=C(c2ccccc2)c2cccc3c2N(CC(F)(F)CO3)C1=O.",
+ "ref_smiles": "O=C(NC1N=C(c2ccccc2)c2cccc3c2N(CC(F)(F)CO3)C1=O)C(CCC(F)(F)F)CC1CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1dfe2529-d548-4649-9980-38e825955b3c",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(Oc1ccc2c(c1)C1(COC=N1)C1=C(C=CCO1)O2)C(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(Oc1ccc2c(c1)C1(COC=N1)C1=C(C=CCO1)O2)C(F)(F)F",
+ "ref_smiles": "O=S(=O)(Oc1ccc2c(c1)C1(COC=N1)C1=C(C=CCO1)O2)C(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b07c8ce1-003b-4f64-a09b-7b4422cbce39",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCCCc1ccc(C(NC(=O)COc2ccc(OC)cc2)c2cccs2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCc1ccc(C(NC(=O)COc2ccc(OC)cc2)c2cccs2)cc1.",
+ "ref_smiles": "CCCCC(NC(=O)COc1ccc(OC)cc1)c1cccs1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7e03bf84-8e17-46d8-8e5b-a32f6df9a381",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CCC[NH2+]CC(C)(C)CN(CC)c1cccc(F)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC[NH2+]CC(C)(C)CN(CC)c1cccc(F)c1.",
+ "ref_smiles": "CCC[NH2+]CC(C)(C)CN(CC)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "d323765b-0d3b-494b-94f8-3115e8a68ce6",
+ "task": "add",
+ "question": "Modify the molecule CC1CCC(CNC(=O)c2c(O)cccc2O)C[NH2+]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCC(CNC(=O)c2c(O)cccc2O)C[NH2+]1",
+ "ref_smiles": "CC1CCC(CNC(=O)c2c(O)ccc(O)c2O)C[NH2+]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "0a208e0a-f342-42ae-9fda-e02c197d54b8",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1",
+ "ref_smiles": "O=C(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc(-c3ccc(Cl)cc3F)no2)CC1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "ecd34882-7fbc-4eea-a4c3-7ebccc9ec5a6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CSc1ccc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(Cl)cc4)cc23)s1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSc1ccc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(Cl)cc4)cc23)s1",
+ "ref_smiles": "CSc1ccc(-c2ncnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(C#N)cc4)cc23)s1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "524ec31e-5af2-4cd3-ab44-69cf3b654d35",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1ccc(C(=O)Cn2nc(C)ccc2=O)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(=O)Cn2nc(C)ccc2=O)cc1.",
+ "ref_smiles": "CCOC(=O)Cn1nc(C)ccc1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0bfebad4-249f-4887-8c8f-e2691a0c9e12",
+ "task": "sub",
+ "question": "Modify the molecule O=C([O-])CCC1(C(=O)c2ccc(-c3ccc(Cl)cc3)cc2)CCCC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCC1(C(=O)c2ccc(-c3ccc(Cl)cc3)cc2)CCCC1",
+ "ref_smiles": "O=C([O-])CCC1(C(=O)c2ccc(-c3ccc(C(=O)[OH])cc3)cc2)CCCC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3656f61d-5499-4bd8-ab97-7e9a9717cc56",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCC.",
+ "ref_smiles": "CCOC(=O)C(CCCCCOC(C)=O)(C(=O)OCC)C(=O)OCCC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "82fa93c1-a1d2-44b9-8aa9-5b544d94b7d8",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(C)c1cc(C(=O)[O-])cc(NCCOCCO)n1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)c1cc(C(=O)[O-])cc(NCCOCCO)n1",
+ "ref_smiles": "CC(C)(C)c1cc(C(=O)[O-])cc(NCCOCCCl)n1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "a8fe88dd-7615-48f7-9579-5d8f78840fee",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)CCc3cccc(F)c3)CC2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)CCc3cccc(F)c3)CC2)cc1",
+ "ref_smiles": "CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)CCc3ccccc3)CC2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7ce8251b-6a1e-4736-921a-b50400aa2597",
+ "task": "delete",
+ "question": "Modify the molecule CC1(C)Cc2cc(CNc3cccc(NC(N)=O)c3)ccc2O1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)Cc2cc(CNc3cccc(NC(N)=O)c3)ccc2O1",
+ "ref_smiles": "CC1(C)Cc2cc(CNc3cccc(NC(N)=O)c3)ccc2O1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6a6e7e9f-33f7-4033-beb0-0337791a7451",
+ "task": "sub",
+ "question": "Modify the molecule CC(c1ccoc1)N1C(=[NH2+])CCC(=[NH2+])N1O by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(c1ccoc1)N1C(=[NH2+])CCC(=[NH2+])N1O",
+ "ref_smiles": "CC(c1ccoc1)N1C(=[NH2+])CCC(=[NH2+])N1S",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "42adf584-37d6-4bff-a871-f573d5842c90",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)ccc3O4)cc2[N+](=O)[O-])CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)ccc3O4)cc2[N+](=O)[O-])CC1",
+ "ref_smiles": "C[NH+]1CCN(c2ccc(C(=O)N3CCC4(CC3)CC(=O)c3cc(Cl)cc(-c5ccccc5)c3O4)cc2[N+](=O)[O-])CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "05e9933e-f6e8-4842-9be1-9adfd39c851b",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CCC(O)(CC=C)CNC(=O)C1CCC(=O)N(C2CCCC2)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCC(O)(CC=C)CNC(=O)C1CCC(=O)N(C2CCCC2)C1",
+ "ref_smiles": "C=CCC(CC=C)(CNC(=O)C1CCC(=O)N(C2CCCC2)C1)NO",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "63fed2b4-927e-4ab0-9d32-9ebc0e2702e9",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Nc1cc(F)c(Cl)cc1NC1(CO)CCCCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(F)c(Cl)cc1NC1(CO)CCCCC1",
+ "ref_smiles": "Nc1cc(F)c(Cl)cc1NC1(CNO)CCCCC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "db3bf90d-3926-49cc-b0b8-7ce7e9e525c5",
+ "task": "add",
+ "question": "Modify the molecule Cc1nn(C)c(C)c1C(=O)C(C)C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c(C)c1C(=O)C(C)C",
+ "ref_smiles": "Cc1nn(C)c(C)c1C(=O)C(C)Cc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3e353b3b-20dd-4355-bf15-5423996c5429",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule O=C(NCC(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccco1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccco1.",
+ "ref_smiles": "O=C(NC(C(=O)N1CCN(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2F)CC1)c1ccccc1)c1ccco1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "88b5a70b-67b3-475c-b500-9685131eedb6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCNc1ccc(C(=O)Nc2ccc(Br)c(C)c2)cn1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNc1ccc(C(=O)Nc2ccc(Br)c(C)c2)cn1",
+ "ref_smiles": "CCCNc1ccc(C(=O)Nc2ccc(NO)c(C)c2)cn1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "eb4d188c-ab1b-4ef0-9444-c17f980de284",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCCC(O)c1cc(F)ccc1C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCC(O)c1cc(F)ccc1C",
+ "ref_smiles": "CCCCC(C(=O)O)c1cc(F)ccc1C",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "08c0cc56-be89-468f-93ac-cdb3754f8c5d",
+ "task": "delete",
+ "question": "Modify the molecule Nc1cc(C(F)(F)F)cc(N2CCC([NH+]3CCCC3)C2)n1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(C(F)(F)F)cc(N2CCC([NH+]3CCCC3)C2)n1",
+ "ref_smiles": "Nc1cc(C(F)F)cc(N2CCC([NH+]3CCCC3)C2)n1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "076c1fd8-4894-4925-b344-72d305f9a8cf",
+ "task": "delete",
+ "question": "Modify the molecule O=S(=O)(NCc1cccc(I)c1)c1cnc(Cl)c(Br)c1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)(NCc1cccc(I)c1)c1cnc(Cl)c(Br)c1",
+ "ref_smiles": "O=S(=O)(Cc1cccc(I)c1)c1cnc(Cl)c(Br)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "e9b5f601-0ff9-4261-88c6-7a104591d341",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(O)C2CCC[NH2+]2)cc1NC(C)=O by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(O)C2CCC[NH2+]2)cc1NC(C)=O",
+ "ref_smiles": "CC(=O)Nc1cc(C(O)C2CCC[NH2+]2)ccc1OCC(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "a13c976a-4db8-4dbb-a66e-a1eab0803ec1",
+ "task": "add",
+ "question": "Modify the molecule CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cccs2)n[nH]c1=S by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cccs2)n[nH]c1=S",
+ "ref_smiles": "CC(C(=O)NCc1ccc(OCC2CC2)nc1)n1c(-c2cc(-c3ccccc3)cs2)n[nH]c1=S",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "f519bba3-e15b-4ff2-955a-24a4cbd0fc1b",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)n1sc(-c2ccccc2)c(Cl)c1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)n1sc(-c2ccccc2)c(Cl)c1=O",
+ "ref_smiles": "CC(C)(C)n1scc(Cl)c1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "ba59417b-9d7f-4df8-96c2-9a9445ba9c91",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccc(NC(CO)CO)cc1OC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(NC(CO)CO)cc1OC",
+ "ref_smiles": "COc1ccc(C(CO)CO)cc1OC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4f1d1663-4929-496a-9fe9-bcc12d5fa5bf",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NCCc1ccccc1.",
+ "ref_smiles": "CCNC(=O)COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "a9edf89e-b364-41bb-91ce-c63755a140db",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COCCOc1c(Cl)cccc1NC(=O)N(C)Cc1ccc(OC)cc1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCCOc1c(Cl)cccc1NC(=O)N(C)Cc1ccc(OC)cc1",
+ "ref_smiles": "COCCOc1c(C=O)cccc1NC(=O)N(C)Cc1ccc(OC)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4f7f0c2d-0c54-48e2-bb9d-d748906370de",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1cc(Cl)ccc1C(=O)NC1(CO)CCC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)ccc1C(=O)NC1(CO)CCC1",
+ "ref_smiles": "Cc1cc(Cl)ccc1C(=O)NC1(C(NO2))CCC1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "0909572c-f266-4be2-b13c-054a29d77906",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#Cc1nc(CC(c2ccc(Oc3nc4cc(C(F)(F)F)ccc4s3)cc2)C(F)(F)F)[nH]c1C#N with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1nc(CC(c2ccc(Oc3nc4cc(C(F)(F)F)ccc4s3)cc2)C(F)(F)F)[nH]c1C#N",
+ "ref_smiles": "N#Cc1nc(CC(c2ccc(Oc3nc4cc(C(F)(F)C(=O)O)ccc4s3)cc2)C(F)(F)F)[nH]c1C#N",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9b6d63b4-e8b8-4461-ab2d-a3d4ba867e93",
+ "task": "add",
+ "question": "Modify the molecule CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(C)c3cc(OC)ccc23)C1CO by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(C)c3cc(OC)ccc23)C1CO",
+ "ref_smiles": "CCC(=O)N1CC2(C[NH+](Cc3nccs3)C2)c2c(n(CO)c3cc(OC)ccc23)C1CO",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "661d6b2a-1726-4dab-81b0-5ee7e1e4656d",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule [NH3+]C1(CNC(=O)CSc2ccccc2)CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1(CNC(=O)CSc2ccccc2)CCCCC1.",
+ "ref_smiles": "[NH3+]C1(CNC(=O)CSc2ccccc2)CCC(c3ccccc3)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7dfc5856-99f0-41c8-b6cc-aa6eea679265",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C1C(Cl)=C(Nc2ccc(F)c(Cl)c2)C(=O)N1c1cc(Cl)ccc1Cl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1C(Cl)=C(Nc2ccc(F)c(Cl)c2)C(=O)N1c1cc(Cl)ccc1Cl",
+ "ref_smiles": "O=C1C(S)=C(Nc2ccc(F)c(Cl)c2)C(=O)N1c1cc(Cl)ccc1Cl",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8a12ce5f-4ee6-4883-ae6e-5650f862f7aa",
+ "task": "add",
+ "question": "Modify the molecule CC(CCC(=O)[O-])[NH2+]Cc1cscn1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCC(=O)[O-])[NH2+]Cc1cscn1",
+ "ref_smiles": "CC([NH2+]Cc1cscn1)C(CC(=O)[O-])c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "716fce1b-cdb8-4452-8f95-7c2262cae948",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCN(Cc1ccccn1)c1ccc(CC[NH3+])cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccn1)c1ccc(CC[NH3+])cc1.",
+ "ref_smiles": "CCN(Cc1cccc(-c2ccccc2)n1)c1ccc(CC[NH3+])cc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "c159c990-186c-45a5-bceb-3e6af592256d",
+ "task": "add",
+ "question": "Modify the molecule O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2ccccc2s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2ccccc2s1",
+ "ref_smiles": "O=[N+]([O-])c1c(Nc2cccc(C(F)(F)F)c2)ncnc1Nc1nc2c(-c3ccccc3)cccc2s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6f6bf6f4-83dd-41b6-9e0f-330662c4faf5",
+ "task": "sub",
+ "question": "Modify the molecule CC(O)C(NC(=O)C(CS)NC(=O)C(CCC(N)=O)NC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-] by substituting a hydroxyl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)C(NC(=O)C(CS)NC(=O)C(CCC(N)=O)NC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-]",
+ "ref_smiles": "CC(C(=O)O)C(NC(=O)C(CS)NC(=O)C(CCC(N)=O)NC(=O)C([NH3+])CCCC[NH3+])C(=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d04c14a4-5bff-4399-959a-bcb1b75f5cd0",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cccc2sc(N(CC[NH+]3CCOCC3)C(=O)Cc3ccc(F)cc3)nc12 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc2sc(N(CC[NH+]3CCOCC3)C(=O)Cc3ccc(F)cc3)nc12",
+ "ref_smiles": "Cc1cccc2sc(N(CC[NH+]3CCOCC3)C(=O)Cc3ccc(C#N)cc3)nc12",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0573fa22-ad1a-4f49-8161-35eb719edb81",
+ "task": "add",
+ "question": "Modify the molecule CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)CC1",
+ "ref_smiles": "CC(Nc1cncc(Br)c1)c1cc(F)ccc1N1CCC(O)C(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "88a33726-1b4a-4979-9340-44555f3dba5c",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(-c2oc3c(C#N)cc(OC)cc3c2I)cc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(-c2oc3c(C#N)cc(OC)cc3c2I)cc1",
+ "ref_smiles": "COc1ccc(-c2oc3c(C#N)cc(OC)cc3c2S)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "de1956ce-a12c-4bde-82dc-010e95d7b243",
+ "task": "sub",
+ "question": "Modify the molecule Fc1cc(Cl)ccc1NC(c1ccc(Cl)cc1)C1CC1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1cc(Cl)ccc1NC(c1ccc(Cl)cc1)C1CC1",
+ "ref_smiles": "O=C(O)c1cc(Cl)ccc1NC(c1ccc(Cl)cc1)C1CC1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "109a8c14-fc1c-4479-aa03-4e396152f419",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC(C)C([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NCCCCCCCCCCCCNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C([NH3+])C(C)CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C([NH3+])C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NCCCCCCCCCCCCNC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C([NH3+])C(C)CC.",
+ "ref_smiles": "CCC(C)C([NH3+])C(Cc1ccccc1)C(Cc1ccccc1)CCCCCCCCCCCCCC(Cc1ccccc1)C(Cc1ccccc1)C([NH3+])C(C)CC",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "8f45aed2-719d-4b44-8476-a6bdeb516819",
+ "task": "delete",
+ "question": "Modify the molecule O=C1COc2ccc(C3CC(C(=O)[O-])[NH2+]CO3)cc2N1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1COc2ccc(C3CC(C(=O)[O-])[NH2+]CO3)cc2N1",
+ "ref_smiles": "O=C([O-])C1CC(c2ccc3c(c2)O3)OC[NH2+]1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "11bdf069-6ca4-4a01-9fc2-f99418ccf6b3",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C=CC(=O)OC(C=CC(C)=CCCOCc1ccc(OC)cc1)CC=CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CC(=O)OC(C=CC(C)=CCCOCc1ccc(OC)cc1)CC=CC.",
+ "ref_smiles": "C=CC(=O)OC(C=C(O)C(C)=CCCOCc1ccc(OC)cc1)CC=CC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "037efc8e-8a67-4d40-9781-4aebb5fdda1c",
+ "task": "delete",
+ "question": "Modify the molecule CCC(C)CN(C)C(=O)c1n[nH]c(C(C)C)c1S(=O)(=O)Cl by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)CN(C)C(=O)c1n[nH]c(C(C)C)c1S(=O)(=O)Cl",
+ "ref_smiles": "CCC(C)C(C)n1[nH]c(C(C)C)c-1S(=O)(=O)Cl",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ff9cf602-8a1b-4b91-9b61-8a24d432dca5",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])CC1CCC[NH2+]C1c1ccc(C(F)(F)F)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CC1CCC[NH2+]C1c1ccc(C(F)(F)F)cc1",
+ "ref_smiles": "O=C([O-])CC1CCC[NH2+]C1c1ccc(C(O)(F)F)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "dd0501f0-70c0-4021-9267-db50a3d6ea7e",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCCOCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCOCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1.",
+ "ref_smiles": "O=C(NC(O)COCC(F)F)N1CCc2nnc(N3CCCOCC3)cc2C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c1238a9f-dc3f-4493-9b3a-a75d1a4ef95c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC12CCC3c4ccc(OCc5ccccc5)cc4CCC3C1C(C(=O)[O-])CO2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC12CCC3c4ccc(OCc5ccccc5)cc4CCC3C1C(C(=O)[O-])CO2.",
+ "ref_smiles": "COc1ccc2c(c1)CCC1C2CCC2(C)OCC(C(=O)[O-])C12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "af3ca804-a847-478b-9a74-c3e3163de1d4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C[NH+]2C3CCC2CC(=O)C3)ccc1F with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C[NH+]2C3CCC2CC(=O)C3)ccc1F",
+ "ref_smiles": "Cc1cc(C[NH+]2C3CCC2CC(=O)C3)ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "c35c29af-72a3-4eb0-95fe-015ba9da8b7e",
+ "task": "add",
+ "question": "Modify the molecule COC1CC(C(C)(C)OC)CC(C)=C1C by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CC(C(C)(C)OC)CC(C)=C1C",
+ "ref_smiles": "COC1CC(C(C)(C)OC)C(c2ccccc2)C(C)=C1C",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8c6c8c4e-a573-4fac-bbab-7c594e4ea0e1",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule COC(=O)c1sc(NC(C)CCCC(C)C)nc1C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1sc(NC(C)CCCC(C)C)nc1C.",
+ "ref_smiles": "COC(=O)c1sc(C(C)CCCC(C)C)nc1C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "4290e6e0-9e90-43fd-90c0-1ca8a4454816",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule NC(=O)C12CC3CC(C1)C(NC(=O)C1CN(S(=O)(=O)c4ccc(Br)cc4F)CCO1)C(C3)C2 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C12CC3CC(C1)C(NC(=O)C1CN(S(=O)(=O)c4ccc(Br)cc4F)CCO1)C(C3)C2",
+ "ref_smiles": "N#Cc1ccc(S(=O)(=O)N2CCOC(C(=O)NC3C4CC5CC3CC(C(N)=O)(C5)C4)C2)c(F)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "071b1e80-0ce4-4e1e-bb6c-603ca4a74be1",
+ "task": "delete",
+ "question": "Modify the molecule Cc1nc(C[NH+](C)Cc2ccccc2C(N)=[NH2+])cs1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C[NH+](C)Cc2ccccc2C(N)=[NH2+])cs1",
+ "ref_smiles": "Cc1nc(C[NH+](C)Cc2ccccc2CN)cs1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "1a6cd72a-2241-4d33-b084-f5a03b94e716",
+ "task": "sub",
+ "question": "Modify the molecule [C-]#[N+]c1ccc(Cl)cc1CC(=O)NC(C)(C)C by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[C-]#[N+]c1ccc(Cl)cc1CC(=O)NC(C)(C)C",
+ "ref_smiles": "[C-]#[N+]c1ccc(C#N)cc1CC(=O)NC(C)(C)C",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "144b2096-4c8c-4b9e-b305-8d4815b97329",
+ "task": "add",
+ "question": "Modify the molecule CC(C)C(CC[NH3+])c1ccc2c(c1)COCC2 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(CC[NH3+])c1ccc2c(c1)COCC2",
+ "ref_smiles": "CC(C)C(CC[NH3+])c1cc2c(cc1C#N)CCOC2",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "01b9db10-ab06-4d96-9b9e-6f532fb8fcb9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCn1c(CN2C(=O)c3ccccc3C2=O)nc2ccc(Br)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCn1c(CN2C(=O)c3ccccc3C2=O)nc2ccc(Br)cc21.",
+ "ref_smiles": "CCn1c(CN2C(=O)c3ccc(-c4ccccc4)cc3C2=O)nc2ccc(Br)cc21",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "0657bf57-16a0-42ce-b2c1-f2fbe76254f8",
+ "task": "add",
+ "question": "Modify the molecule CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3ccccc3c1C2 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3ccccc3c1C2",
+ "ref_smiles": "CCCCn1c([O-])c2n(c1=O)C(c1ccccc1OC)c1[nH]c3c(CC=O)cccc3c1C2",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "3284ff23-ec22-4252-a968-e8e69b8fcd17",
+ "task": "delete",
+ "question": "Modify the molecule C#CCc1ccc(Br)c(Oc2cccnc2)c1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCc1ccc(Br)c(Oc2cccnc2)c1",
+ "ref_smiles": "C#CC(Br)Oc1cccnc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "44c9e9be-3851-4f70-a321-dfa041d48d57",
+ "task": "add",
+ "question": "Modify the molecule CC(C)NC(=O)c1csc(-c2ccccn2)n1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)NC(=O)c1csc(-c2ccccn2)n1",
+ "ref_smiles": "CC(CN)NC(=O)c1csc(-c2ccccn2)n1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "a4373e95-b5c4-4b32-a8c7-0cb20936d568",
+ "task": "sub",
+ "question": "Modify the molecule Cc1c(-c2csc(NCc3ccccc3)n2)c2cc(Cl)ccc2n1Cc1ccccc1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(-c2csc(NCc3ccccc3)n2)c2cc(Cl)ccc2n1Cc1ccccc1",
+ "ref_smiles": "Cc1c(-c2csc(NCc3ccccc3)n2)c2cc(NO)ccc2n1Cc1ccccc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6ca98c9e-9834-484c-83ff-8fb2c328ea57",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC(N)=NC1CC2CCC1[NH+](C)C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(N)=NC1CC2CCC1[NH+](C)C2.",
+ "ref_smiles": "CC(N)=NC1CC2CCC1[NH+](C)C2O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "396d0ba4-c09a-40e6-a9b2-21801faf9e21",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc(C(=O)N2CC[NH+](C)C(c3nc(C4CC4)no3)C2)ccc1C#N by substituting a nitrile with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C(=O)N2CC[NH+](C)C(c3nc(C4CC4)no3)C2)ccc1C#N",
+ "ref_smiles": "Cc1nc(C(=O)N2CC[NH+](C)C(c3nc(C4CC4)no3)C2)ccc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ce3189b2-054f-40b6-9567-4d96ee442c49",
+ "task": "add",
+ "question": "Modify the molecule COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1 by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1",
+ "ref_smiles": "COc1ccc(C(C[NH3+])N2CCCC2)c(Cl)c1N",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "1fecee8d-c619-48f6-be62-95e807f18cfd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Nc1cccc(Br)c1)c1ccncn1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Nc1cccc(Br)c1)c1ccncn1",
+ "ref_smiles": "O=C([OH])c1cccc(NC(=O)c2ccncn2)c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a98b08e7-1841-4c67-9a02-310dd19d1a9d",
+ "task": "add",
+ "question": "Modify the molecule CCc1cnc(CCNC(NCCNS(C)(=O)=O)=[NH+]C)s1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1cnc(CCNC(NCCNS(C)(=O)=O)=[NH+]C)s1",
+ "ref_smiles": "CCc1cnc(CCNC(NCC(NS(C)(=O)=O)c2ccccc2)=[NH+]C)s1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "24e97fc8-8c46-4fb6-b523-fbc0370906c5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COc1ccccc1CCN1CC(C(=O)Nc2ccc(C)c(Cl)c2)CC1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CCN1CC(C(=O)Nc2ccc(C)c(Cl)c2)CC1=O.",
+ "ref_smiles": "COCCN1CC(C(=O)Nc2ccc(C)c(Cl)c2)CC1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "bfaffd69-6466-483c-96e6-138c0f82148b",
+ "task": "sub",
+ "question": "Modify the molecule C=CCc1cc(CC=Cc2ccccc2)c(O)c(OC)c1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(CC=Cc2ccccc2)c(O)c(OC)c1",
+ "ref_smiles": "C=CCc1cc(CC=Cc2ccccc2)c(S)c(OC)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "18235887-46a6-4645-9aba-b09d677251c9",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1",
+ "ref_smiles": "O=CCCc1cc(CNC(=O)N2CC[NH+]3CCCCC3C2)no1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "c0330412-59ac-4cd3-9498-e1315c0f09a4",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C([O-])CCCOc1c(F)cc(-c2cccc(SCC3CC3)n2)cc1F.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])CCCOc1c(F)cc(-c2cccc(SCC3CC3)n2)cc1F.",
+ "ref_smiles": "O=C([O-])CCCOc1ccc(-c2cccc(SCC3CC3)n2)cc1F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "dede5586-3e50-4106-8708-8cfa07864739",
+ "task": "add",
+ "question": "Modify the molecule O=C1CNC(=O)C(NC(=O)Cc2ccccc2)C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CNC(=O)C(NC(=O)Cc2ccccc2)C1",
+ "ref_smiles": "O=C1CNC(=O)C(NC(=O)Cc2ccccc2O)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "aef7a5c1-fc02-4b74-bffe-4a607e08da55",
+ "task": "add",
+ "question": "Modify the molecule COCC1CCCC[NH+]1C1CC([NH3+])C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC1CCCC[NH+]1C1CC([NH3+])C1",
+ "ref_smiles": "COCC1CC(c2ccccc2)CC[NH+]1C1CC([NH3+])C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e514de3c-6c3f-484b-a8bb-41f87e7ac4bc",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1.",
+ "ref_smiles": "CS(=O)(=O)Cc1nc2c(O)cccc2n1CC(=O)NCc1ccc(-n2cnc3ccccc32)nc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f83f60a6-44b1-4df9-a8b5-6ebca9565815",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCN(CCCCCC)c1ccc(Nc2c3ccccc3nc3ccccc23)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCN(CCCCCC)c1ccc(Nc2c3ccccc3nc3ccccc23)cc1",
+ "ref_smiles": "CCCCCCN(CCCCCC)Nc1c2ccccc2nc2ccccc12",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "193b2904-6865-4573-8f2e-d011eaabc978",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCc1ccc(-c2nc(CC(=O)Nc3cc(N4CCCC4=O)ccc3Cl)cs2)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCc1ccc(-c2nc(CC(=O)Nc3cc(N4CCCC4=O)ccc3Cl)cs2)cc1",
+ "ref_smiles": "CCc1ccc(-c2nc(CC(=O)Nc3cc(N4CCCC4=O)ccc3O)cs2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f1938970-70bd-4670-9580-5726092a2a23",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule [NH3+]C1CCn2c(nc3c(Cl)cccc32)C1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CCn2c(nc3c(Cl)cccc32)C1",
+ "ref_smiles": "[NH3+]C1CCn2c(nc3c(C(=O)[OH])cccc32)C1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "38bfcc8f-cb5a-4011-a035-79e880c80e5a",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule Cc1ccc(Nc2c(F)cccc2Cl)c(CC(=O)NO)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(Nc2c(F)cccc2Cl)c(CC(=O)NO)c1",
+ "ref_smiles": "Cc1ccc(Nc2c(F)cccc2Cl)c(CC(=O)NS)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9bad734a-d186-49e5-ab5b-3e3cb9de3136",
+ "task": "add",
+ "question": "Modify the molecule COc1cc([NH+]=C(N)SC)cc(OC)c1OC by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc([NH+]=C(N)SC)cc(OC)c1OC",
+ "ref_smiles": "COc1cc([NH+]=C(N)SC)c(-c2ccccc2)c(OC)c1OC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6d7511ee-3deb-4ff0-ad93-37cef10a6b0e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCc1nc(COc2ccc(Cl)cc2CO)no1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1nc(COc2ccc(Cl)cc2CO)no1",
+ "ref_smiles": "CCCc1nc(COc2ccc(S)cc2CO)no1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0bf2dd8a-86a0-46a3-a030-9222ca9ad8a9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2CO)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2CO)c1.",
+ "ref_smiles": "C[NH2+]Cc1ccnc(-c2ccc(-c3c(C)cccc3C)cc2C(O)c2ccccc2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6aac9ebb-fc19-4bc9-92a1-f96b75534173",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])c(C=Nc3ccc(Nc4nc(O)nc(Nc5ccc(N=Nc6ccc7c(S(=O)(=O)[O-])cccc7c6S(=O)(=O)[O-])cc5)n4)cc3)ccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])c(C=Nc3ccc(Nc4nc(O)nc(Nc5ccc(N=Nc6ccc7c(S(=O)(=O)[O-])cccc7c6S(=O)(=O)[O-])cc5)n4)cc3)ccc12.",
+ "ref_smiles": "O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])c(C=Nc3ccc(Nc4nc(O)nc(-c5ccc(N=Nc6ccc7c(S(=O)(=O)[O-])cccc7c6S(=O)(=O)[O-])cc5)n4)cc3)ccc12",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "1085195a-1b92-4d5f-8b63-509244e4024a",
+ "task": "sub",
+ "question": "Modify the molecule COc1cccc(C2CC(CO)CC[NH2+]2)c1 by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cccc(C2CC(CO)CC[NH2+]2)c1",
+ "ref_smiles": "COc1cccc(C2CC(CS)CC[NH2+]2)c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7181c738-5d77-411e-8bcd-a943e1395143",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule NS(=O)(=O)Oc1ccc2c(c1)cc(O)c1ccccc12 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NS(=O)(=O)Oc1ccc2c(c1)cc(O)c1ccccc12",
+ "ref_smiles": "N#Cc1cc2cc(OS(N)(=O)=O)ccc2c2ccccc12",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "31b8b83a-b81d-49dc-8eb3-1489f05dac67",
+ "task": "add",
+ "question": "Please add a aldehyde to the molecule CCC(C(=O)NCc1ccc(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)c(CO)c1)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(=O)NCc1ccc(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)c(CO)c1)c1ccccc1.",
+ "ref_smiles": "CCC(C(=O)NCc1cc(CO)c(C([NH3+])C2CCCc3ccc(Cc4cc(-c5ccccc5)ccn4)nc32)cc1CC=O)c1ccccc1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "b08a6934-2491-4e87-a6e1-5b5051ee7514",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C([O-])C1CCCN(C(=O)c2ccncc2O)C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])C1CCCN(C(=O)c2ccncc2O)C1",
+ "ref_smiles": "O=C([O-])C1CCCN(C(=O)c2cc([N+](=O)[O-])nccc2)C1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "68f8f8ea-419a-4dc2-bbc6-c6fafedb4fe3",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nn(CCC(=O)Nc2ccc(C[NH+]3CCCCC3)cc2)c(C)c1Cl by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(CCC(=O)Nc2ccc(C[NH+]3CCCCC3)cc2)c(C)c1Cl",
+ "ref_smiles": "Cc1nn(CCC(=O)Nc2ccc(C[NH+]3CCCCC3)cc2)c(C)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "33b909a0-a65f-473f-a21e-c12c66aad423",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCOc1ccccc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)C(Cc1ccccc1)C(=O)NC1CCCCC1)S(=O)(=O)c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccccc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)C(Cc1ccccc1)C(=O)NC1CCCCC1)S(=O)(=O)c1ccccc1",
+ "ref_smiles": "CCOc1ccccc1N(CC(=O)N(Cc1ccc(S)cc1Cl)C(Cc1ccccc1)C(=O)NC1CCCCC1)S(=O)(=O)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cdaa877f-f1fa-4873-9edc-45a72253732e",
+ "task": "add",
+ "question": "Modify the molecule COc1cc(OC)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(OC)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1",
+ "ref_smiles": "COc1cc(OCO)cc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "54dccd7b-8071-4fad-9d97-81baf030443c",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCc1ccc(C[NH+]2CCOCC2)cc1)c1cc2cc(F)ccc2[nH]1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc(C[NH+]2CCOCC2)cc1)c1cc2cc(F)ccc2[nH]1",
+ "ref_smiles": "O=C(NCc1ccc(C[NH+]2CCOCC2)cc1)c1cc2cc([N+](=O)[O-])ccc2[nH]1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "61bb4f95-5ce9-4d53-9c8a-f6ed4ce34591",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccsc1CN(C)C(=O)Cn1nnc(-c2cccc(F)c2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccsc1CN(C)C(=O)Cn1nnc(-c2cccc(F)c2)n1.",
+ "ref_smiles": "Cc1ccsc1CN(C)C(=O)Cn1nnc(F)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "31a47f15-6c61-4327-a898-38980660e3cc",
+ "task": "add",
+ "question": "Modify the molecule CCCc1ccc(-c2ccc(NC(=O)c3ccccc3)c3c2CNC3=O)cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1ccc(-c2ccc(NC(=O)c3ccccc3)c3c2CNC3=O)cc1",
+ "ref_smiles": "O=C(Nc1ccc(-c2ccc(CCCc3ccccc3)cc2)c2c1C(=O)NC2)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cd6a625e-4824-49e0-8b0f-67bba7250817",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH+](C)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1.",
+ "ref_smiles": "C[NH+](CO)CC=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CC[NH+](C)CC4)cc3)nc3c2SCC3)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7b295bc8-e87f-48f9-a362-5bed2faeb2fe",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C1COC1)N1CC[NH+](CC2=C(c3ccc(Cl)cc3)[NH2+]C3CNC(C4CC4)=CN23)CC1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C1COC1)N1CC[NH+](CC2=C(c3ccc(Cl)cc3)[NH2+]C3CNC(C4CC4)=CN23)CC1",
+ "ref_smiles": "O=C(C1COC1)N1CC[NH+](CC2=C(c3ccc(S)cc3)[NH2+]C3CNC(C4CC4)=CN23)CC1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "ee0a671a-81d9-4d67-a165-a9971be82c6d",
+ "task": "add",
+ "question": "Modify the molecule OCCC1CCCC[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCCC1CCCC[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1",
+ "ref_smiles": "OCCC1CCCC(O)[NH+]1Cc1nc2cc(F)c(F)cc2[nH]1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f03b84e3-f0ef-4b0f-ba3c-22c3cc79df62",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C=C(C)OC(=O)c1cccc(C)c1CCl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)OC(=O)c1cccc(C)c1CCl",
+ "ref_smiles": "C=C(C)OC(=O)c1cccc(C)c1CNO",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d6588982-8c08-4756-b312-0f87664534d9",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1CN(c2ncc(CC(O)CO)cc2Cl)CCN1C(=O)Nc1nc2ccc(Cl)cc2s1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CN(c2ncc(CC(O)CO)cc2Cl)CCN1C(=O)Nc1nc2ccc(Cl)cc2s1",
+ "ref_smiles": "CC1CN(c2ncc(CC(O)CO)cc2C#N)CCN1C(=O)Nc1nc2ccc(Cl)cc2s1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1d7fcdb9-9dfc-4015-8a2b-7862aa372773",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule O=C(CCOCC(F)(F)F)N1CCN(c2ccccc2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCOCC(F)(F)F)N1CCN(c2ccccc2)CC1.",
+ "ref_smiles": "O=C(CCOCC(F)F)N1CCN(c2ccccc2)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "5b5ff361-1f1f-480e-8011-4fa4d3067fc9",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)CCNC(=O)CCNc1ccc(F)cc1F by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CCNC(=O)CCNc1ccc(F)cc1F",
+ "ref_smiles": "CC(C)CCNC(=O)CCNc1ccc(C(=O)O)cc1F",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d041e3a2-e076-461a-b949-83f6fcba9f25",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)cc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)cc12.",
+ "ref_smiles": "Cc1nn(C)c2ncc(NC(=O)C3CCN(C(=O)c4ccco4)CC3)c(O)c12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "05e31d36-f20b-4b60-a3df-8d3288e42afd",
+ "task": "sub",
+ "question": "Modify the molecule CC1OCC(O)(CO)CC1NC(=O)OC(C)(C)C by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1OCC(O)(CO)CC1NC(=O)OC(C)(C)C",
+ "ref_smiles": "CC(=O)C1(CO)COC(C)C(NC(=O)OC(C)(C)C)C1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6638ce20-3a18-4307-ac78-19b3c9fbbe97",
+ "task": "delete",
+ "question": "Modify the molecule Cc1c(CC(C)O)c(=O)oc2cc(OCC(=O)Nc3cccc([N+](=O)[O-])c3)c(Cl)cc12 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(CC(C)O)c(=O)oc2cc(OCC(=O)Nc3cccc([N+](=O)[O-])c3)c(Cl)cc12",
+ "ref_smiles": "Cc1c(CC(C)O)c(=O)oc2cc(OCC(=O)Nc3cccc([N+](=O)[O-])c3)ccc12",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "6dd6288a-b51c-48e3-a5b3-46e2f867f7b5",
+ "task": "add",
+ "question": "Modify the molecule CCC=CCC(C)c1cc(Cl)c(OC)c(Cl)c1 by adding a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC=CCC(C)c1cc(Cl)c(OC)c(Cl)c1",
+ "ref_smiles": "CCC=CCC(C)(S)c1cc(Cl)c(OC)c(Cl)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "d8ef612e-1762-4134-a503-67d1871183dc",
+ "task": "add",
+ "question": "Modify the molecule C=C1CCCOC1=CC(=CC)C(CC(=O)OC)[NH2+]CC by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C1CCCOC1=CC(=CC)C(CC(=O)OC)[NH2+]CC",
+ "ref_smiles": "C=C1CCCOC1=CC(=CC)C(CC(=O)OCO)[NH2+]CC",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "d3fe4839-e351-41f2-ac52-7e5dd0b76da0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule COC(=O)Cc1ccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)Cc1ccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)cc1.",
+ "ref_smiles": "COC(=O)CCCC1(C2CCCC2)CC(=O)CC(=O)O1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "58500637-e947-4eb8-b4d1-c3a376093235",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1c(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(NC(=O)c4ccc(Cl)cc4)cc3)C(C)C)CC2)cccc1C(=O)NC(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3ccc(NC(=O)c4ccc(Cl)cc4)cc3)C(C)C)CC2)cccc1C(=O)NC(C)C.",
+ "ref_smiles": "Cc1c(NC(=O)C(C)[NH+]2CCC(C(C(=O)Nc3ccc(NC(=O)c4ccc(Cl)cc4)cc3)C(C)C)C2)cccc1C(=O)NC(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "1948f0e1-ffba-4e8d-b9c7-1f3f84ce4264",
+ "task": "delete",
+ "question": "Modify the molecule COc1ccccc1C1CCc2ccccc21 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1C1CCc2ccccc21",
+ "ref_smiles": "COC1CCc2ccccc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b8fcc857-786e-4b51-85a5-8241fa631a7c",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc(C)c(S(=O)(=O)NCCC(=O)NCCCOC2CCCCC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C)c(S(=O)(=O)NCCC(=O)NCCCOC2CCCCC2)c1.",
+ "ref_smiles": "Cc1ccc(C)c(S(=O)(=O)CCC(=O)NCCCOC2CCCCC2)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "47c22aa0-2d2a-4d1f-9c25-1da51054b60d",
+ "task": "sub",
+ "question": "Modify the molecule CCOC(=O)c1cn(C)c2ccc(F)cc2c1=[NH+]c1ccc(-c2ccccc2)cc1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cn(C)c2ccc(F)cc2c1=[NH+]c1ccc(-c2ccccc2)cc1",
+ "ref_smiles": "CCOC(=O)c1cn(C)c2ccc(C(=O)[OH])cc2c1=[NH+]c1ccc(-c2ccccc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3ec56b8f-0b72-45a3-856b-b30a8018e210",
+ "task": "add",
+ "question": "Modify the molecule COCC#CCSc1cnccn1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COCC#CCSc1cnccn1",
+ "ref_smiles": "COCC#CCSc1nccnc1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "efe8b6c6-1871-4b3f-9d8c-c53a86d41210",
+ "task": "sub",
+ "question": "Modify the molecule CC(CCNS(=O)(=O)CCO)c1ccccc1 by substituting a hydroxyl with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CCNS(=O)(=O)CCO)c1ccccc1",
+ "ref_smiles": "CC(CCNS(=O)(=O)CCBr)c1ccccc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d1858da9-9a4b-42a6-8593-fd47557f362a",
+ "task": "delete",
+ "question": "Modify the molecule CCCCN1C(=O)CC(C(=O)OC)C1(C)C by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCN1C(=O)CC(C(=O)OC)C1(C)C",
+ "ref_smiles": "CCCC1C(C(=O)OC)C1(C)C",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "4f527830-51d1-4faf-936a-5f21c576ed84",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule [O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12.",
+ "ref_smiles": "[O-][P+]([O-])([O-])c1cc(P(c2ccccc2)c2ccccc2)c(-c2c(P(c3ccccc3)c3ccccc3O)cc([P+]([O-])([O-])[O-])c3ccccc23)c2ccccc12",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "9ca94153-fa06-40a5-8df2-f5852cb5e268",
+ "task": "sub",
+ "question": "Modify the molecule CCNC(=O)NCC1CC1c1c(Cl)ccc2c1CC(CCCCc1ccccc1)O2 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(=O)NCC1CC1c1c(Cl)ccc2c1CC(CCCCc1ccccc1)O2",
+ "ref_smiles": "CCNC(=O)NCC1CC1c1c(C(=O)O)ccc2c1CC(CCCCc1ccccc1)O2",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3edab79e-68cc-4485-8a73-5b44128a8934",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CBr)c1cc(O)c(Cl)cc1Br by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CBr)c1cc(O)c(Cl)cc1Br",
+ "ref_smiles": "O=C(CBr)c1ccc(Cl)cc1Br",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "26ed1174-8852-421f-a302-f5b852ef31ce",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC1CCC(N(C)c2cnc(CCl)cn2)CC1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1CCC(N(C)c2cnc(CCl)cn2)CC1",
+ "ref_smiles": "CC(=O)Cc1cnc(N(C)C2CCC(CC)CC2)cn1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d7af32ca-cd18-413a-a064-00f0bd34dbca",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCC(C#C[Si](C(C)C)(C(C)C)C(C)C)CC(=O)Nc1cccc2cccnc12.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C#C[Si](C(C)C)(C(C)C)C(C)C)CC(=O)Nc1cccc2cccnc12.",
+ "ref_smiles": "CCCC(C#C[Si](C(C)C)(C(C)C)C(C)(C)c1ccccc1)CC(=O)Nc1cccc2cccnc12",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "8478e25d-4fb6-4949-ace0-5eff37f63e84",
+ "task": "delete",
+ "question": "Modify the molecule Cc1c(S(=O)(=O)N2CCCC(c3ccc(C(=O)[O-])cc3)C2)cnn1C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(S(=O)(=O)N2CCCC(c3ccc(C(=O)[O-])cc3)C2)cnn1C",
+ "ref_smiles": "Cc1c(S(=O)(=O)N2CCCC(C(=O)[O-])C2)cnn1C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "badef609-e117-4dff-9d63-f6410f0aa362",
+ "task": "delete",
+ "question": "Modify the molecule CC[NH+](CC)CCOc1ccc(C(N)=S)c(Cl)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)CCOc1ccc(C(N)=S)c(Cl)c1",
+ "ref_smiles": "CC[NH+](CC)CCOc1ccc(C(N)=S)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "753b8632-491c-480f-992d-22f80e493eba",
+ "task": "sub",
+ "question": "Modify the molecule CCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccc(O)cc1 by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccc(O)cc1",
+ "ref_smiles": "CCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccc(NO)cc1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "38a063d7-1b89-4d61-a70e-bc3266872914",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cc(Cl)ccc1NC1=C(Sc2ccccc2)C(=O)N(c2ccc(C(C)C)cc2)C1=O by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)ccc1NC1=C(Sc2ccccc2)C(=O)N(c2ccc(C(C)C)cc2)C1=O",
+ "ref_smiles": "CC(C)c1ccc(N2C(=O)C(Sc3ccccc3)=C(N(C)Cl)C2=O)cc1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "19c8288a-eda8-419d-89b7-3980bd5236d5",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule C[NH2+]C(CCCC(C)C)CCc1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(CCCC(C)C)CCc1ccccc1.",
+ "ref_smiles": "CCC(CCCC(C)C)[NH2+]C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f2c8a0bd-7b6e-4d41-8b44-bbe9544042f2",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CN(C)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1.",
+ "ref_smiles": "CN(CC(=O)O)NC(=O)c1ccc(-c2cc(Cl)ccc2Cl)o1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cae41e4a-3e4b-4846-b88e-ea47c5292c7e",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NCc1c[nH]c2ncc(Cl)cc12)c1cn(Cc2ccc(N3CCCC3)nc2)nc1C(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1c[nH]c2ncc(Cl)cc12)c1cn(Cc2ccc(N3CCCC3)nc2)nc1C(F)(F)F",
+ "ref_smiles": "O=C(NCc1c[nH]c2ncccc12)c1cn(Cc2ccc(N3CCCC3)nc2)nc1C(F)(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "0ede56d4-ecd4-4de8-ba93-ec9668dfa0f4",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule CCOc1ccc(NS(=O)(=O)c2cc(C[NH3+])sc2C)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(NS(=O)(=O)c2cc(C[NH3+])sc2C)cc1.",
+ "ref_smiles": "Cc1sc(C[NH3+])cc1S(=O)(=O)Nc1ccc(OC(C)C(=O)O)cc1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5600f8f9-6ac5-4131-b1e5-5cb9b0b635ef",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCN(Cc1ccccc1)C(=O)CN(CCc1ccccc1F)C(C)=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1ccccc1)C(=O)CN(CCc1ccccc1F)C(C)=O.",
+ "ref_smiles": "CCN(C)C(=O)CN(CCc1ccccc1F)C(C)=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "36a6cdf0-d948-4670-aaf5-202d5b57b232",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C(=O)C=C(O)c1ccc([N+](=O)[O-])cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C(=O)C=C(O)c1ccc([N+](=O)[O-])cc1",
+ "ref_smiles": "CCOC(=O)C(=O)C=C(O)[N+](=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "0a73667d-876b-4b2f-a81f-1ba53da1ce4e",
+ "task": "add",
+ "question": "Modify the molecule CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(C)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1 by adding a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(C)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1",
+ "ref_smiles": "CON(C)Cc1ccc(-c2ccc3c(c2)CN(CCC(CC#N)(C(=O)NO)S(C)(=O)=O)C3=O)c(F)c1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "a7ecb34c-9f56-4ef9-8bdb-5d5fed4010d6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CNC(=O)C1C[NH2+]CCN1Cc1cc(F)ccc1F with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNC(=O)C1C[NH2+]CCN1Cc1cc(F)ccc1F",
+ "ref_smiles": "CNC(=O)C1C[NH2+]CCN1Cc1cc(C#N)ccc1F",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "8296ceff-cccb-4460-a113-d2d60d90074f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CC1=CC(C)(C)N(C)c2cc(C)c(C=C(C#N)C(=O)Nc3cccc(Br)c3)cc21.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CC(C)(C)N(C)c2cc(C)c(C=C(C#N)C(=O)Nc3cccc(Br)c3)cc21.",
+ "ref_smiles": "CC1=CC(C)(C)N(C)c2cc(C)c(C=C(C#N)C(=O)NBr)cc21",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "7ce89e5c-2969-46bf-aedd-6fcf11b11557",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)CC(=O)C1C[NH+](CCC)CCO1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)CC(=O)C1C[NH+](CCC)CCO1",
+ "ref_smiles": "C=C(C)CC(=O)C1(c2ccccc2)C[NH+](CCC)CCO1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "614e9268-456f-46de-ac8f-4d93da6fc079",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C)n(C(C)C(=O)Nc2ccc(NS(=O)(=O)c3cc(F)cc(F)c3)cc2Cl)n1 by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)n(C(C)C(=O)Nc2ccc(NS(=O)(=O)c3cc(F)cc(F)c3)cc2Cl)n1",
+ "ref_smiles": "Cc1cc(C)n(C(C)C(=O)Nc2ccc(NS(=O)(=O)c3cc(O)cc(F)c3)cc2Cl)n1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5f6135a8-41c2-4370-9ae5-9905230de19a",
+ "task": "delete",
+ "question": "Modify the molecule CC1CC(C(=O)[O-])CN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CC(C(=O)[O-])CN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C1",
+ "ref_smiles": "CC1CC(C(=O)[O-])CN(S(=O)(=O)c2ccc(F)c(F)c2)C1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "56a7e28d-d0cb-433d-affe-71acc7b65675",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC1([NH2+]NC(=O)NCc2ccc(-c3ccc(Br)cc3)o2)CCS(=O)(=O)C1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1([NH2+]NC(=O)NCc2ccc(-c3ccc(Br)cc3)o2)CCS(=O)(=O)C1",
+ "ref_smiles": "CC1([NH2+]NC(=O)NCc2ccc(-c3ccc(C=O)cc3)o2)CCS(=O)(=O)C1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "31aa113f-bcd3-4989-9956-79cfc1483a4f",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)c1cc(C)[nH]c2nc(SCC(=O)Nc3cc4c(cc3Cl)OCCCO4)nc(=O)c1-2 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc(C)[nH]c2nc(SCC(=O)Nc3cc4c(cc3Cl)OCCCO4)nc(=O)c1-2",
+ "ref_smiles": "COC(=O)c1cc(C)[nH]c2nc(Sc3cc4c(cc3Cl)OCCCO4)nc(=O)c1-2",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "871b0d0b-4a23-48a7-9828-2e1dcd96684e",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(CO)CC=Cc1cc(O)cc(-c2ccccc2-c2cc(O)cc(C=CCC(C)(C)CO)c2O)c1O with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(CO)CC=Cc1cc(O)cc(-c2ccccc2-c2cc(O)cc(C=CCC(C)(C)CO)c2O)c1O",
+ "ref_smiles": "CC(=O)CC(C)(C)CC=Cc1cc(O)cc(-c2ccccc2-c2cc(O)cc(C=CCC(C)(C)CO)c2O)c1O",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c0df3940-0f80-48ad-ba9b-4d43f596dbda",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCCC1(C)C(O)CCC1CCc1ccc(O)cc1F with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1(C)C(O)CCC1CCc1ccc(O)cc1F",
+ "ref_smiles": "CCCC1(C)C(CCC1CCc1ccc(O)cc1F)CC(=O)",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d2f297d1-bf5b-495b-a6a8-2174274a449f",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1cc(C)cc(NC(=S)N(Cc2cccs2)C2CCS(=O)(=O)C2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)cc(NC(=S)N(Cc2cccs2)C2CCS(=O)(=O)C2)c1.",
+ "ref_smiles": "CCNC(=S)N(Cc1cccs1)C1CCS(=O)(=O)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "c86d349a-738a-40e7-a292-8a63a435d90f",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(=O)c1ccc(C#N)c(NCCNc2ncc(Cl)cc2Cl)c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1ccc(C#N)c(NCCNc2ncc(Cl)cc2Cl)c1",
+ "ref_smiles": "CC(=O)c1ccc(C(=O)[OH])c(NCCNc2ncc(Cl)cc2Cl)c1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "229a197a-cfbd-46fc-88df-3896483b4bdc",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule OC1CNCC(C(F)(F)F)C1O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC1CNCC(C(F)(F)F)C1O",
+ "ref_smiles": "O=C(O)C(F)(F)C1CNCC(O)C1O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "0b1113d6-2a22-4793-a36b-3afa6e0ae44d",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1NC(=O)C2CCCN2C(=O)C(CC(=O)[O-])NC(=O)C(C(C)O)NC(=O)C(CC(=O)[O-])NC(=O)C(Cc2ccccc2)NC1=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1NC(=O)C2CCCN2C(=O)C(CC(=O)[O-])NC(=O)C(C(C)O)NC(=O)C(CC(=O)[O-])NC(=O)C(Cc2ccccc2)NC1=O",
+ "ref_smiles": "CC1NC(=O)C2CCCN2C(=O)C(CC(=O)[O-])NC(=O)C(C(C)C(=O)[OH])NC(=O)C(CC(=O)[O-])NC(=O)C(Cc2ccccc2)NC1=O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "9bd47c73-5e60-4d0e-9e12-0d1727661c9f",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)CC([NH3+])C(=O)NC(C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(C)C with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC([NH3+])C(=O)NC(C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(C)C",
+ "ref_smiles": "CC(C)CC([NH3+])C(=O)NC(C(=O)NC(Cc1ccc(C(=O)[OH])cc1)C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(C)C",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "064ae8c5-0497-4722-ac29-1d804cf50ddf",
+ "task": "delete",
+ "question": "Modify the molecule CCCC1CC1[NH2+]CC(O)(CC)CC by removing a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC1CC1[NH2+]CC(O)(CC)CC",
+ "ref_smiles": "CCCC1CC1[NH2+]CC(CC)CC",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "66cb048b-759b-417b-8cdc-45283566d194",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)C1(c2nnc3ccc(C(F)(F)F)cn23)CC[NH2+]C1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C1(c2nnc3ccc(C(F)(F)F)cn23)CC[NH2+]C1",
+ "ref_smiles": "CC(C)C1(c2nnc3ccc(C(F)(F)NO)cn23)CC[NH2+]C1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "66bf676f-e210-4cb4-94f5-e1b008af201c",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3)nn2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3)nn2)CC1",
+ "ref_smiles": "O=C(c1ccco1)N1CCN(c2ccc(-c3ccccc3O)nn2)CC1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e233596e-2991-4395-b70f-7673417a0aa9",
+ "task": "add",
+ "question": "Modify the molecule CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1",
+ "ref_smiles": "CC(CC(=O)Nc1ccc(OC(C)(C)C)cc1)C1CCC[NH2+]C1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5135f3f7-3c5d-48e1-acf0-2098eeb75d13",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCCC1.",
+ "ref_smiles": "N#Cc1c(Br)ccc(F)c1C(O)(C1CCCCC1)C1CCCC(c2ccccc2)C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "9b8a418f-c9e1-4b2d-bb96-6b7b13dde78a",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC([NH2+]CCN1CCCC1)c1ccc(F)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC([NH2+]CCN1CCCC1)c1ccc(F)cc1.",
+ "ref_smiles": "CC([NH2+]CCN1CCCC1)c1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c454bcd5-21db-4729-b6c3-9cde2d79404b",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+]1CCC(CC[NH2+]CC2Cc3cc(Cl)ccc3O2)CC1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCC(CC[NH2+]CC2Cc3cc(Cl)ccc3O2)CC1",
+ "ref_smiles": "C[NH+]1CCC(CC[NH2+]CC2Cc3cc([N+](=O)[O-])ccc3O2)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b5d26098-0588-46ed-b8d9-a1c2ed26722e",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule CCOc1cccc(NCC(=O)Nc2ccc(C(=O)NC)cc2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cccc(NCC(=O)Nc2ccc(C(=O)NC)cc2)c1.",
+ "ref_smiles": "CCOc1cccc(NCC(=O)NC(=O)NC)c1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f062a5ee-6387-4ebe-a743-e6e9f3040b9f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)NC(=O)N(CCC[NH3+])c1ccc(F)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)NC(=O)N(CCC[NH3+])c1ccc(F)cc1",
+ "ref_smiles": "CC(C)(C)NC(=O)N(CCC[NH3+])c1ccc([N+](=O)[O-])cc1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "88602e1e-8fb6-451d-8fd7-eb957354631f",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(C(=O)C[NH+]2CCCCC2C(N)=O)cc1Br with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(=O)C[NH+]2CCCCC2C(N)=O)cc1Br",
+ "ref_smiles": "COc1ccc(C(=O)C[NH+]2CCCCC2C(N)=O)cc1O",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d843510a-441b-4087-a42d-6b2c25c524c4",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(=O)Nc1cccc(Nc2nccc(Nc3cccc(Cl)c3C)n2)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)Nc1cccc(Nc2nccc(Nc3cccc(Cl)c3C)n2)c1",
+ "ref_smiles": "CC(=O)Nc1cccc(Nc2nccc(Nc3cccc(C#N)c3C)n2)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "66d8cbb8-7fcd-49fc-a0d3-e198e44ed355",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1.",
+ "ref_smiles": "CC(=O)N1C=Cc2ccccc2C1CC(=O)Nc1cccc(S(=O)(=O)N2CCCCC(c3ccccc3)C2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "b68ec252-3707-4adb-a15e-1531a59b9db1",
+ "task": "delete",
+ "question": "Modify the molecule O=C(COc1ccccc1)N1CCCCC1c1csc(-c2ccc(C(F)(F)F)cn2)n1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1ccccc1)N1CCCCC1c1csc(-c2ccc(C(F)(F)F)cn2)n1",
+ "ref_smiles": "O=C(CO)N1CCCCC1c1csc(-c2ccc(C(F)(F)F)cn2)n1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "fc2a0a17-b999-4b1e-b085-fe864f83085b",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cn1c(N2CCCOCC2c2ccccc2)nc(-c2ccncn2)cc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1c(N2CCCOCC2c2ccccc2)nc(-c2ccncn2)cc1=O.",
+ "ref_smiles": "Cn1c(N2CCCOCC2)nc(-c2ccncn2)cc1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "54d0699b-f1d0-46b4-abf9-f2dfe7a11d10",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule C[NH+](C)CCCC(O)(c1ccc(F)cc1)c1ccc(C(=O)[O-])cc1CO with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCCC(O)(c1ccc(F)cc1)c1ccc(C(=O)[O-])cc1CO",
+ "ref_smiles": "CC(=O)c1ccc(C(O)(CCC[NH+](C)C)c2ccc(C(=O)[O-])cc2CO)cc1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "efff4929-f4df-41ab-871a-762b9ca55ecd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C1CCCN1C(=O)C1CC[NH+](CC(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C1CCCN1C(=O)C1CC[NH+](CC(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1",
+ "ref_smiles": "Cc1cc(C(=O)Nc2ccc(C#N)c(F)c2)ccc1NC(=O)C1CCCN1C(=O)C1CC[NH+](CC(=O)Nc2cc(C(=O)NC3CCCC3)ccc2Cl)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "e0a6b835-7c0f-48e7-98ec-fde8bbbf0cf0",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule Cc1ccccc1-c1ccnc(C(O)C[NH3+])n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccccc1-c1ccnc(C(O)C[NH3+])n1.",
+ "ref_smiles": "Cc1ccccc1-c1ccnc(CC[NH3+])n1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "09673200-c9f5-4cc0-9b27-050a4d7fdb39",
+ "task": "sub",
+ "question": "Modify the molecule OC(Cn1cncn1)(Cn1ccc2cc(Br)ccc21)c1ccc(Cl)cc1Cl by substituting a hydroxyl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OC(Cn1cncn1)(Cn1ccc2cc(Br)ccc21)c1ccc(Cl)cc1Cl",
+ "ref_smiles": "SC(Cn1cncn1)(Cn1ccc2cc(Br)ccc21)c1ccc(Cl)cc1Cl",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "2389b709-ba41-4d48-a829-798b742cfc64",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCCCCCl)C1COc2ccccc2C1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCCCCCl)C1COc2ccccc2C1",
+ "ref_smiles": "N#CCCCCNC(=O)C1COc2ccccc2C1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "34d56dc9-1113-4e7e-ad1d-8b4751ea2d70",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(=O)NC(CS)C(=O)NCS.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)NC(CS)C(=O)NCS.",
+ "ref_smiles": "CC(=O)NC(CS)(C(=O)NCS)c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "e221da83-5206-4631-8d49-866de0f7aa87",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCC(C)C(C)([NH3+])CC1CC2CCC1C2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C)C(C)([NH3+])CC1CC2CCC1C2.",
+ "ref_smiles": "CCC(C)C(C)([NH3+])CC1(N)CC2CCC1C2",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "38c6188e-f3e4-4392-b2d1-cd6bdbd09954",
+ "task": "delete",
+ "question": "Modify the molecule CCOc1cc(CO)cc(Br)c1OCCOCC(F)(F)F by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(CO)cc(Br)c1OCCOCC(F)(F)F",
+ "ref_smiles": "CCOc1cc(CO)ccc1OCCOCC(F)(F)F",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "c9479958-50f0-4fc8-8dec-aabd60ce6daa",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule [NH3+]C1CC[NH+](CC(=O)NCCC2CCCO2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]C1CC[NH+](CC(=O)NCCC2CCCO2)CC1.",
+ "ref_smiles": "[NH3+]C1CC[NH+](CCC2CCCO2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "fd0bd898-83bc-4bea-b9ac-83a219ae4ef7",
+ "task": "delete",
+ "question": "Modify the molecule IC1CCCC1c1ccccc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "IC1CCCC1c1ccccc1",
+ "ref_smiles": "IC1CCCC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "08d55b09-5504-4562-aeda-08cb39fe7dde",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)cc(Cl)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)cc(Cl)c1.",
+ "ref_smiles": "O=C(NCC1(F)CC[NH+](CCC2CCC2)CC1)c1cc(Cl)c(O)c(Cl)c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "cb9daa24-73f6-468c-9f07-2e429d410e51",
+ "task": "delete",
+ "question": "Modify the molecule O=C(Cc1ccc(F)cc1)NNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccc(F)cc1)NNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1",
+ "ref_smiles": "O=C(Cc1ccccc1)NNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "b9938c9b-5221-4ef8-934c-1354aaca538e",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CC1(C)CCC[NH+](C2CC(C)(C)Oc3cc(O)ccc32)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(C)CCC[NH+](C2CC(C)(C)Oc3cc(O)ccc32)C1.",
+ "ref_smiles": "CC1(C)CCC[NH+](C2CC(C)(C)Oc3ccccc32)C1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "cb2245d1-9424-4790-992c-650a534ac323",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)C.",
+ "ref_smiles": "CCCC(C)C(=O)N(CC1CCC[NH2+]1)C(C)CC#N",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "94bcb909-26ea-4d73-b3a0-49fbd6de631c",
+ "task": "sub",
+ "question": "Modify the molecule CCC(SCc1cc2c(cc1Br)OCCO2)C(=O)Nc1cc(C)on1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(SCc1cc2c(cc1Br)OCCO2)C(=O)Nc1cc(C)on1",
+ "ref_smiles": "CCC(SCc1cc2c(cc1C(=O)[OH])OCCO2)C(=O)Nc1cc(C)on1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f98f0927-d296-4c6a-b354-7a5c64b6a6a6",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)(C)OC(=O)[N-]C(=O)C1CC(F)(F)CN1C(C)(C)C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)OC(=O)[N-]C(=O)C1CC(F)(F)CN1C(C)(C)C",
+ "ref_smiles": "CC(C)(C)OC(=O)[N-]C(=O)C1CC(F)CN1C(C)(C)C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "f6c1f44b-2678-448f-a43c-fa4a30340688",
+ "task": "add",
+ "question": "Modify the molecule CCC(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1",
+ "ref_smiles": "CCC(O)(CC)NC(=O)COC(=O)c1c[nH+]c(SC)n1-c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "15a1b0e3-8a4b-47a7-9d9a-640cf771dc3c",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(c1cccc2ccccc12)N1CCCC(C(=O)N2CCCC2c2ccccc2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc2ccccc12)N1CCCC(C(=O)N2CCCC2c2ccccc2)C1.",
+ "ref_smiles": "O=C(c1cccc2ccccc12)N1CCCC(C(=O)N2CCCC2)C1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "efb6149a-ef83-417a-ba00-b812f3e10c0e",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule Cc1ccc(-c2cc(C(F)F)n3ncc(C(=O)Nc4ccc(C(=O)N5CCOCC5)cc4)c3n2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2cc(C(F)F)n3ncc(C(=O)Nc4ccc(C(=O)N5CCOCC5)cc4)c3n2)cc1.",
+ "ref_smiles": "Cc1ccc(-c2cc(CF)n3ncc(C(=O)Nc4ccc(C(=O)N5CCOCC5)cc4)c3n2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "dba05cd4-abaf-4515-8a35-3f71d2368771",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)cc1.",
+ "ref_smiles": "CC(C)Oc1ccccc1NC(=O)c1ccc([N-]S(=O)(=O)c2ccccc2)c(S)c1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "7bb79d44-f58a-429f-afc9-26265ef4b3df",
+ "task": "sub",
+ "question": "Modify the molecule N#CCC(=O)NCCNC(=O)c1ccccc1Br by substituting a nitrile with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#CCC(=O)NCCNC(=O)c1ccccc1Br",
+ "ref_smiles": "ONCC(=O)NCCNC(=O)c1ccccc1Br",
+ "add_group": "nitro",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "6f10d401-4b46-45ec-b618-030f95db6c7a",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1ccc(NC(=S)N2CC[NH+](Cc3c(Cl)cccc3Cl)CC2)c(F)c1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc(NC(=S)N2CC[NH+](Cc3c(Cl)cccc3Cl)CC2)c(F)c1",
+ "ref_smiles": "O=[N+]([O-])c1ccc(NC(=S)N2CC[NH+](Cc3c(Cl)cccc3Cl)CC2)c(F)c1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "85020466-803f-4737-9c53-467689db0104",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule COc1cncc(-c2cc(NC3CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cncc(-c2cc(NC3CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1.",
+ "ref_smiles": "COc1cncc(-c2cc(NC3(c4ccccc4)CCN(S(C)(=O)=O)CC3)c3cnccc3c2)c1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fe0bcb9f-2192-439d-bc57-900b0971f0ce",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cn1cc(-c2ccc3nnc(Sc4ccc5ncc(NC6CCN(C(=O)[O-])C6)cc5c4)n3c2)cn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cc(-c2ccc3nnc(Sc4ccc5ncc(NC6CCN(C(=O)[O-])C6)cc5c4)n3c2)cn1.",
+ "ref_smiles": "Cn1cc(-c2ccc3nnc(Sc4ccc5ncc(C6CCN(C(=O)[O-])C6)cc5c4)n3c2)cn1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "c00909bf-3f40-49a8-be2d-25eb989dc018",
+ "task": "sub",
+ "question": "Modify the molecule NC(=O)C1CCCCN1C(=O)c1c(F)cccc1Br by substituting a halo with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NC(=O)C1CCCCN1C(=O)c1c(F)cccc1Br",
+ "ref_smiles": "NC(=O)C1CCCCN1C(=O)c1c(O)cccc1Br",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "88e1962f-4866-42ee-85d8-e94aeba48543",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule O=C(CCCn1cccc1)NCCNc1ncccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCn1cccc1)NCCNc1ncccn1.",
+ "ref_smiles": "O=C(CCCn1cccc1)NCCNc1nccc(O)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "32f14020-dc60-4f0f-911f-8d62d87f3fce",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(C)s1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(C)s1.",
+ "ref_smiles": "CC[NH+](CC)Cc1ccccc1C(O)NC(=O)c1ccc(C)s1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "1d788b86-b4ee-4132-9f2e-5ad8e3c43978",
+ "task": "add",
+ "question": "Modify the molecule CCCc1[nH+]cc(-c2ccnc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)n2)n1C by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCc1[nH+]cc(-c2ccnc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)n2)n1C",
+ "ref_smiles": "CCCc1[nH+]cc(-c2nc(Nc3ccc(S(=O)(=O)NCCOCC)cc3)ncc2C(=O)O)n1C",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "7ff4a6b7-6416-410d-bb1d-1f9b919826b3",
+ "task": "add",
+ "question": "Modify the molecule CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)cc1[N+](=O)[O-]",
+ "ref_smiles": "CCN(Cc1cnn(C)c1)c1ccc(S(N)(=O)=O)c(-c2ccccc2)c1[N+](=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "3bcd5bdf-50f2-4ea1-a9fc-15c9e4639150",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2NS(=O)(=O)NCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2NS(=O)(=O)NCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1",
+ "ref_smiles": "COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2NS(=O)(=O)NCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2NO)(c2ccccc2)c2ccc(OC)cc2)cc1",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "655543dc-ad61-4d2e-8bca-3184b5ed7421",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule O=CN1CCN(c2nc(NCCC3=CCCCC3)cc(-c3ccccc3)n2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=CN1CCN(c2nc(NCCC3=CCCCC3)cc(-c3ccccc3)n2)CC1.",
+ "ref_smiles": "O=CN1CCN(c2nc(CCC3=CCCCC3)cc(-c3ccccc3)n2)CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "b0368257-5015-4492-8378-b25a561f0283",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CCC(C(C)O)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6c[n+](C(C)OC(=O)NC7OC8COC(C)(C)OC8C7OC(=O)CN(C)C(=O)OC(C)(C)C)cn6)(c6ccc(F)cc6F)C5)cc4)CC3)cc2)c1=O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(C(C)O)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6c[n+](C(C)OC(=O)NC7OC8COC(C)(C)OC8C7OC(=O)CN(C)C(=O)OC(C)(C)C)cn6)(c6ccc(F)cc6F)C5)cc4)CC3)cc2)c1=O",
+ "ref_smiles": "CCC(C(C)S)n1ncn(-c2ccc(N3CCN(c4ccc(OCC5COC(Cn6c[n+](C(C)OC(=O)NC7OC8COC(C)(C)OC8C7OC(=O)CN(C)C(=O)OC(C)(C)C)cn6)(c6ccc(F)cc6F)C5)cc4)CC3)cc2)c1=O",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c6ed8ca6-f77a-430c-bb89-5d4a578228a3",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule C[NH+]1C(C)(C)CC(Nc2nc(Nc3ccc(OC4CC[NH+](CCF)CC4)c(OC(F)F)c3)ncc2F)CC1(C)C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1C(C)(C)CC(Nc2nc(Nc3ccc(OC4CC[NH+](CCF)CC4)c(OC(F)F)c3)ncc2F)CC1(C)C.",
+ "ref_smiles": "C[NH+]1C(C)(C)CC(Nc2nc(-c3ccc(OC4CC[NH+](CCF)CC4)c(OC(F)F)c3)ncc2F)CC1(C)C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "f62a43e1-f975-474d-b6bc-dcb65def29cd",
+ "task": "add",
+ "question": "Please add a amine to the molecule CCOc1ccc(C(OC)=C2C(=O)N(C(C)=O)c3ccc(C(C)=O)cc32)cc1OC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1ccc(C(OC)=C2C(=O)N(C(C)=O)c3ccc(C(C)=O)cc32)cc1OC.",
+ "ref_smiles": "CCOc1ccc(C(OC)=C2C(=O)N(C(=O)CN)c3ccc(C(C)=O)cc32)cc1OC",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "030ec969-aca8-4921-8a7d-160435bd35b9",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCCCCCCCCC(=O)c1ccncc1CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCC(=O)c1ccncc1CC.",
+ "ref_smiles": "CCCCCCCCCC(=O)c1cc(-c2ccccc2)ncc1CC",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "6d7706c6-2398-4c46-8a56-1b89f557eecf",
+ "task": "delete",
+ "question": "Modify the molecule CC(C)CC1(CN2CC(=O)NC(C3CC3)C2=O)CCCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC1(CN2CC(=O)NC(C3CC3)C2=O)CCCC1",
+ "ref_smiles": "CC(C)CC1(C2CC(=O)NC23CC3)CCCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "5226c243-03b3-4981-b64f-0cd35a9a2691",
+ "task": "delete",
+ "question": "Modify the molecule CNc1nc2c(cc(-c3cc(F)cc(C#N)c3)n2CC[NH2+]C(C)C)c2c1ncn2C by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CNc1nc2c(cc(-c3cc(F)cc(C#N)c3)n2CC[NH2+]C(C)C)c2c1ncn2C",
+ "ref_smiles": "CNc1nc2c(cc(-c3cccc(C#N)c3)n2CC[NH2+]C(C)C)c2c1ncn2C",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a75b7c4f-c213-444a-8995-c4f982079de4",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(C(=O)Nc2ccccc2F)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2c(C)cccc2C(=O)N2CCOCC2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(=O)Nc2ccccc2F)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2c(C)cccc2C(=O)N2CCOCC2)CC1.",
+ "ref_smiles": "Cc1ccc(C(=O)NF)cc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2c(C)cccc2C(=O)N2CCOCC2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "2c0f053b-fb1a-4c6b-a179-431f07c8249b",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCC(CC)C[NH+](CC)CCOCCCl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC(CC)C[NH+](CC)CCOCCCl",
+ "ref_smiles": "CCC(CC)C[NH+](CC)CCOCC(=O)H",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "482b2853-f19c-4ea7-b792-f50dcaaf2fe4",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule COc1cc(C(=O)[O-])cc(-c2cn[nH]c2N)c1O with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(C(=O)[O-])cc(-c2cn[nH]c2N)c1O",
+ "ref_smiles": "COc1cc(C(=O)[O-])cc(-c2cn[nH]c2N)c1S",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "3320868c-ab4f-4929-bfad-b8888cf73561",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(C)c2[nH+]ccc(N3CCC(O)(C(=O)[O-])CC3)c2c1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C)c2[nH+]ccc(N3CCC(O)(C(=O)[O-])CC3)c2c1",
+ "ref_smiles": "Cc1cc(C)c2[nH+]c(O)cc(N3CCC(O)(C(=O)[O-])CC3)c2c1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e9df474c-0df9-4266-94d9-84da039c4e5a",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCN(C(N)=[NH2+])c1cc2ccccc2[nH]1 by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCN(C(N)=[NH2+])c1cc2ccccc2[nH]1",
+ "ref_smiles": "CCCCCN(C=[NH2+])c1cc2ccccc2[nH]1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "d0d903ba-6468-425b-b172-f9aafe0f9733",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COC(=O)C(C)c1ccc(-c2ccc(-c3nc(C(N)=O)c(C)nc3C)cc2)c(Cl)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)C(C)c1ccc(-c2ccc(-c3nc(C(N)=O)c(C)nc3C)cc2)c(Cl)c1",
+ "ref_smiles": "COC(=O)C(C)c1ccc(-c2ccc(-c3nc(C(N)=O)c(C)nc3C)cc2)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "44da4e41-c39c-4cc7-b1f3-dd284d4a9edd",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1ccc(C([NH3+])C2CCCc3ccccc32)cc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C([NH3+])C2CCCc3ccccc32)cc1Cl.",
+ "ref_smiles": "Cc1ccc(C([NH3+])C2(O)CCCc3ccccc32)cc1Cl",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "e89ceefa-0ad5-4dda-a27b-be4a94290e91",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1ccc(Cl)c(S(=O)(=O)N2CCCCC2C(=O)[O-])c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccc(Cl)c(S(=O)(=O)N2CCCCC2C(=O)[O-])c1",
+ "ref_smiles": "COc1ccc(C(=O)O)c(S(=O)(=O)N2CCCCC2C(=O)[O-])c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "9dfb2b57-dee5-4225-8f84-b18c506b76f4",
+ "task": "add",
+ "question": "Please add a amine to the molecule CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)cc1.",
+ "ref_smiles": "CC(NC(=O)c1cscn1)C(O)c1ccc(Cl)c(N)c1",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "9c78ea63-0d9a-463c-a2ab-8211f9b699c6",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1(c2nc3ccc(C(F)(F)F)cc3[nH]2)CCCS1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1(c2nc3ccc(C(F)(F)F)cc3[nH]2)CCCS1.",
+ "ref_smiles": "CC1(c2nc3ccc(C(F)F)cc3[nH]2)CCCS1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "4682726c-d9f0-4536-9117-4ddea9e4913f",
+ "task": "delete",
+ "question": "Modify the molecule CCN(O)C(=O)c1sccc1Br by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCN(O)C(=O)c1sccc1Br",
+ "ref_smiles": "CCc1sccc1Br",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0e2be694-b08f-4211-b9d0-8657768f454d",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1c(Br)cc2c(c1CON)OCO2 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1c(Br)cc2c(c1CON)OCO2",
+ "ref_smiles": "Cc1c(S)cc2c(c1CON)OCO2",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "4ff76431-ebb6-4129-b690-62754a28e96e",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)n1cc(C2CN(S(=O)(=O)c3ccc4c(c3)COC4)CC2CO)cn1 by substituting a hydroxyl with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)n1cc(C2CN(S(=O)(=O)c3ccc4c(c3)COC4)CC2CO)cn1",
+ "ref_smiles": "CC(C)n1cc(C2CN(S(=O)(=O)c3ccc4c(c3)COC4)CC2C(=O))cn1",
+ "add_group": "aldehyde",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "7d6edca7-4c3d-40d1-b67e-65fcb37ae54a",
+ "task": "add",
+ "question": "Modify the molecule NNC(=O)c1occc1C[NH+]1CCc2ccccc2C1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "NNC(=O)c1occc1C[NH+]1CCc2ccccc2C1",
+ "ref_smiles": "NNC(=O)c1occ(-c2ccccc2)c1C[NH+]1CCc2ccccc2C1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "965929d8-114c-4d89-918f-310e4cd74677",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule O=C(NCC1(O)CCC1)c1ccc(Oc2ccccc2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCC1(O)CCC1)c1ccc(Oc2ccccc2)cc1",
+ "ref_smiles": "O=C(NCC1(C(=O)O)CCC1)c1ccc(Oc2ccccc2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "db3cc6a6-72a1-45e4-bcf3-431908fcccb6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C(=O)Nc1cc(C(=O)N2CCCC2)ccc1Cl)[NH+]1CCC(C(=O)NCCC(=O)Nc2cc(Cl)ccc2Cl)CC1 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)Nc1cc(C(=O)N2CCCC2)ccc1Cl)[NH+]1CCC(C(=O)NCCC(=O)Nc2cc(Cl)ccc2Cl)CC1",
+ "ref_smiles": "CC(C(=O)Nc1cc(C(=O)N2CCCC2)ccc1NO)[NH+]1CCC(C(=O)NCCC(=O)Nc2cc(Cl)ccc2Cl)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "f9209aa4-37e5-43d0-96e6-39227e124e70",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)(O)c1cc(F)c2c(c1)C(=O)N(Cc1ccc(C#N)cn1)C2(OC1CCC(O)C1)c1ccc(Cl)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(O)c1cc(F)c2c(c1)C(=O)N(Cc1ccc(C#N)cn1)C2(OC1CCC(O)C1)c1ccc(Cl)cc1",
+ "ref_smiles": "CC(C)(I)c1cc(F)c2c(c1)C(=O)N(Cc1ccc(C#N)cn1)C2(OC1CCC(O)C1)c1ccc(Cl)cc1",
+ "add_group": "halo",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "d7030e70-7faa-40ad-98bc-9ab845876d7e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(Cc1ccc(F)cc1)Nc1cc(C(F)(F)F)ccc1Oc1ccc(Cl)c(Cl)c1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(Cc1ccc(F)cc1)Nc1cc(C(F)(F)F)ccc1Oc1ccc(Cl)c(Cl)c1",
+ "ref_smiles": "O=C(Cc1ccc(S)cc1)Nc1cc(C(F)(F)F)ccc1Oc1ccc(Cl)c(Cl)c1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "620fc071-1970-443d-80fe-9cb9b48400d1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)CC([NH3+])C(=O)NC(C)C(=O)NC(CO)C(=O)NC(CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)[O-] with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC([NH3+])C(=O)NC(C)C(=O)NC(CO)C(=O)NC(CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)[O-]",
+ "ref_smiles": "CC(C)CC([NH3+])C(=O)NC(C)C(=O)NC(CNO)C(=O)NC(CC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CC(N)=O)C(=O)NC(CO)C(=O)[O-]",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "6cdb7b10-ce1a-4ce0-b419-8155735dd3f9",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOCCCNC(=S)NCCc1nccs1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCCNC(=S)NCCc1nccs1.",
+ "ref_smiles": "CCOCCCNC(=S)CCc1nccs1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "309902a1-d31b-4251-9bd2-04cb9f0d2147",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Nc1c2c([nH+]c3cc(Cl)ccc13)CC1C=C(CCCCn3cc(CNC(=O)CCC(C(=O)NCCP(=O)([O-])[O-])[NH+]4CCC[NH+](CC(=O)NCCP(=O)([O-])[O-])CCN(C(=O)NCCP(=O)([O-])[O-])CCCN(CC(=O)NCCP(=O)([O-])[O-])CC4)nn3)CC2C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1c2c([nH+]c3cc(Cl)ccc13)CC1C=C(CCCCn3cc(CNC(=O)CCC(C(=O)NCCP(=O)([O-])[O-])[NH+]4CCC[NH+](CC(=O)NCCP(=O)([O-])[O-])CCN(C(=O)NCCP(=O)([O-])[O-])CCCN(CC(=O)NCCP(=O)([O-])[O-])CC4)nn3)CC2C1.",
+ "ref_smiles": "Nc1c2c([nH+]c3cc(Cl)ccc13)CC1C=C(CCCCn3cc(CNC(=O)CC(CCP(=O)([O-])[O-])[NH+]4CCC[NH+](CC(=O)NCCP(=O)([O-])[O-])CCN(C(=O)NCCP(=O)([O-])[O-])CCCN(CC(=O)NCCP(=O)([O-])[O-])CC4)nn3)CC2C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d221afe8-58bc-4a06-8ee2-73bb3427e7d5",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule OCc1nnc2ccc(F)cn12 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "OCc1nnc2ccc(F)cn12",
+ "ref_smiles": "Fc1ccc2nnc(CS)n2c1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "27cdfb0a-a3fc-4108-b047-a9803a685b09",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C([O-])c1nc(CN2CC[NH2+]CC2)n2c(Cl)cccc12 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])c1nc(CN2CC[NH2+]CC2)n2c(Cl)cccc12",
+ "ref_smiles": "O=C([O-])c1nc(CN2CC[NH2+]CC2)n2c(O)cccc12",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "1f56bfeb-bc63-4d82-8783-f669c15f89f4",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(=O)C(O)C(O)C(O)(C(C)=O)C(O)(C(C)=O)C(O)(C(C)=O)C(=O)C(=O)c1ccccc1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)C(O)C(O)C(O)(C(C)=O)C(O)(C(C)=O)C(O)(C(C)=O)C(=O)C(=O)c1ccccc1",
+ "ref_smiles": "CC(=O)C(S)C(O)C(O)(C(C)=O)C(O)(C(C)=O)C(O)(C(C)=O)C(=O)C(=O)c1ccccc1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4b995de3-1281-43f9-947c-c7fa345a9639",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CC1Oc2ccccc2N(CCC(=O)NC2(C)CCS(=O)(=O)C2)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1Oc2ccccc2N(CCC(=O)NC2(C)CCS(=O)(=O)C2)C1=O.",
+ "ref_smiles": "CC1Oc2ccccc2N(CC2(C)CCS(=O)(=O)C2)C1=O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "49ddfb5d-6a43-476d-82a5-2115ac6966ba",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule CCC1NC(=O)C(C)N(C(C)Cc2ccco2)C1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCC1NC(=O)C(C)N(C(C)Cc2ccco2)C1=O.",
+ "ref_smiles": "CCC1(C)C(=O)N1C(C)Cc1ccco1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "d51eaf5e-75b2-4387-8ada-57a881b64496",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Cc1cc(NC(=O)C(OC(=O)c2cccc(Cl)c2)c2ccc(Cl)cc2)c2c(C)ccc(C(C)C)cc1-2 with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)C(OC(=O)c2cccc(Cl)c2)c2ccc(Cl)cc2)c2c(C)ccc(C(C)C)cc1-2",
+ "ref_smiles": "Cc1cc(NC(=O)C(OC(=O)c2cccc(NO)c2)c2ccc(Cl)cc2)c2c(C)ccc(C(C)C)cc1-2",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b75b26cc-e177-494b-a1e7-f0b5bb8ca75b",
+ "task": "sub",
+ "question": "Modify the molecule CC(C)Cc1ccc(CCc2cc(C(=O)c3ccccc3Cl)c(NC(=O)C[NH3+])s2)cc1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)Cc1ccc(CCc2cc(C(=O)c3ccccc3Cl)c(NC(=O)C[NH3+])s2)cc1",
+ "ref_smiles": "CC(C)Cc1ccc(CCc2cc(C(=O)c3ccccc3S)c(NC(=O)C[NH3+])s2)cc1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "cc324b80-b3ed-4ef8-9d51-417ccb840294",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCCNC(=O)C1(C)CCCCN1C(=O)c1ccc(C)c(F)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCNC(=O)C1(C)CCCCN1C(=O)c1ccc(C)c(F)c1",
+ "ref_smiles": "CCCCNC(=O)C1(C)CCCCN1C(=O)c1ccc(C)c(C#N)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "467aadb5-da8a-41b0-8a97-c78a557a698c",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2ccc(-c3csc(Cc4ccccc4)n3)cc21 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2ccc(-c3csc(Cc4ccccc4)n3)cc21",
+ "ref_smiles": "Cc1cc(Cl)ccc1NC(=O)CN1C(=O)COc2cc(O)c(-c3csc(Cc4ccccc4)n3)cc21",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "4aa8c6e5-fcdc-44e4-906f-fb81a03a5f4d",
+ "task": "delete",
+ "question": "Modify the molecule C#CCCCC(C=C(C=CC(C)C)c1ccccc1)(C(=O)OC)C(=O)OC by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCCCC(C=C(C=CC(C)C)c1ccccc1)(C(=O)OC)C(=O)OC",
+ "ref_smiles": "C#CCCCC(C=CC=CC(C)C)(C(=O)OC)C(=O)OC",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8baef4ab-8d96-4329-bf0c-71e29d5c9480",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Nc1cc(C(=O)[O-])ccc1S(=O)(=O)N1CCOCC1CO.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Nc1cc(C(=O)[O-])ccc1S(=O)(=O)N1CCOCC1CO.",
+ "ref_smiles": "O=C([O-])c1ccc(S(=O)(=O)N2CCOCC2CO)cc1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "a558c7cb-629b-4e75-b7f4-c522cc7e6cca",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule C=CCC(C(=O)[O-])C1CCC(O)C1 with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCC(C(=O)[O-])C1CCC(O)C1",
+ "ref_smiles": "C=CCC(C(=O)[O-])C1CCC(S)C1",
+ "add_group": "thiol",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "29bcd2cd-da74-4268-9ba5-d6525265c46b",
+ "task": "delete",
+ "question": "Modify the molecule CC(Oc1ccccc1Cl)C(=O)N1CCCNC(=O)C1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(Oc1ccccc1Cl)C(=O)N1CCCNC(=O)C1",
+ "ref_smiles": "CC(Oc1ccccc1Cl)C(=O)N1CCC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "6810fd88-80f8-4135-8839-94700d93c29e",
+ "task": "delete",
+ "question": "Modify the molecule CCNc1nc(NCC)n2c(SCC(=O)N3CCc4ccccc4C3)nnc2n1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNc1nc(NCC)n2c(SCC(=O)N3CCc4ccccc4C3)nnc2n1",
+ "ref_smiles": "CCNc1nc(NCC)n2c(SC3CCc4ccccc43)nnc2n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "b852d192-1492-4606-ad9c-353dbfcb24d6",
+ "task": "sub",
+ "question": "Modify the molecule C[NH2+]C(Cc1cc(C)nn1C)c1ccc(Cl)o1 by substituting a halo with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]C(Cc1cc(C)nn1C)c1ccc(Cl)o1",
+ "ref_smiles": "C[NH2+]C(Cc1cc(C)nn1C)c1ccc(C(=O)[OH])o1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "222dcf70-a8aa-432c-8da2-0eea96db9e90",
+ "task": "add",
+ "question": "Please add a thiol to the molecule C[NH+]=C(NCCCOc1ccccc1C)N1CCN(c2ccccn2)CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]=C(NCCCOc1ccccc1C)N1CCN(c2ccccn2)CC1.",
+ "ref_smiles": "C[NH+]=C(NCCC(S)Oc1ccccc1C)N1CCN(c2ccccn2)CC1",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "00a6bf59-c73b-47f9-8a1f-82ad6d40de89",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOC(=O)c1cc(N2CCOC3CCCC32)ncc1N.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1cc(N2CCOC3CCCC32)ncc1N.",
+ "ref_smiles": "CCOC(=O)c1ccnc(N2CCOC3CCCC32)c1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "bce18688-12a5-4241-830a-1ee3b53ee6bd",
+ "task": "add",
+ "question": "Modify the molecule CSCCCC[NH2+]Cc1cccc(OCC#N)c1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CSCCCC[NH2+]Cc1cccc(OCC#N)c1",
+ "ref_smiles": "CSCCC(CC=O)C[NH2+]Cc1cccc(OCC#N)c1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "941d0785-7724-497d-be3b-23fdd8e86e33",
+ "task": "sub",
+ "question": "Modify the molecule CC(CC(C)(N)C#N)Sc1cnn(C)c1 by substituting a nitrile with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(CC(C)(N)C#N)Sc1cnn(C)c1",
+ "ref_smiles": "CC(=O)C(C)(N)CC(C)Sc1cnn(C)c1",
+ "add_group": "aldehyde",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "dc303807-298e-4fd0-9913-0d5d408e57a3",
+ "task": "sub",
+ "question": "Modify the molecule O=C(NCc1ccc(F)cc1)Nc1cc2cnn(-c3ccc(F)cc3)c2cn1 by substituting a halo with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NCc1ccc(F)cc1)Nc1cc2cnn(-c3ccc(F)cc3)c2cn1",
+ "ref_smiles": "O=C(NCc1ccc(S)cc1)Nc1cc2cnn(-c3ccc(F)cc3)c2cn1",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3e8193f7-d18f-4cf7-9a67-5b54243b9836",
+ "task": "add",
+ "question": "Modify the molecule CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1",
+ "ref_smiles": "CCCNC(=O)Cn1cccc1C(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1CC=O",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "a2567e8e-2651-47ca-87df-53cb0f8380ef",
+ "task": "delete",
+ "question": "Modify the molecule C#CCNC(=O)C(C)[NH2+]C(C)(C)C(C)O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C#CCNC(=O)C(C)[NH2+]C(C)(C)C(C)O",
+ "ref_smiles": "C#CC(C)[NH2+]C(C)(C)C(C)O",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "ab975622-b0ca-498c-962a-99d45519aab1",
+ "task": "add",
+ "question": "Modify the molecule CN(C)[Si](C)(C)CC[SiH2]c1ccccc1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)[Si](C)(C)CC[SiH2]c1ccccc1",
+ "ref_smiles": "CN(C)[Si](C)(CO)CC[SiH2]c1ccccc1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "de9033c3-bfc6-4851-96c1-a56b9d8a88ff",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)c1ncsc1NC(C)C(C)CC by removing a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ncsc1NC(C)C(C)CC",
+ "ref_smiles": "CCOC(=O)c1ncsc1C(C)C(C)CC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "9d426fbe-c55f-47a5-bca3-b95b801f6fad",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(C(C)(C)CNCC(C#N)C(C)C)cc1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(C(C)(C)CNCC(C#N)C(C)C)cc1",
+ "ref_smiles": "Cc1ccc(C(C)(C)CNCCC(C)C)cc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "461b9c43-ce72-490d-9b14-312d610f1f7d",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(COc1ccc(Cl)cc1)Nc1cc(Cl)ccn1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1ccc(Cl)cc1)Nc1cc(Cl)ccn1.",
+ "ref_smiles": "O=C(COCl)Nc1cc(Cl)ccn1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "1d357959-5581-43a5-90e3-6bd69102544a",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule CC(=O)c1cc(C#N)ccc1Sc1ccc(Cl)cc1 with a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)c1cc(C#N)ccc1Sc1ccc(Cl)cc1",
+ "ref_smiles": "CC(=O)c1cc(Br)ccc1Sc1ccc(Cl)cc1",
+ "add_group": "halo",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "ce40fa3d-eaca-455e-b2ac-0586d8944b63",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1Cl with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1cc(S(=O)(=O)Nc2ccc(F)cc2)ccc1Cl",
+ "ref_smiles": "O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1cc(S(=O)(=O)Nc2ccc(S)cc2)ccc1Cl",
+ "add_group": "thiol",
+ "remove_group": "halo"
+ },
+ {
+ "id": "938b12c9-ab61-4012-bd9c-4f32de141184",
+ "task": "add",
+ "question": "Modify the molecule COc1ccccc1CC(=O)N1CCC2(CC[NH2+]C2)CC1 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1ccccc1CC(=O)N1CCC2(CC[NH2+]C2)CC1",
+ "ref_smiles": "COc1ccccc1CC(=O)N1CCC2(CC1)C[NH2+]C(O)C2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "164ad01e-3d34-4e33-9ca7-c6541920143e",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3)CC2)nc1=O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3)CC2)nc1=O.",
+ "ref_smiles": "Cn1[nH]c(C[NH+]2CCC(C(=O)c3ccc(Cl)cc3C(=O)O)CC2)nc1=O",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "09627d09-0eae-400f-9984-2e31719401a6",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule Fc1ccc2c(c1)C(Br)CCO2 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Fc1ccc2c(c1)C(Br)CCO2",
+ "ref_smiles": "O=C([OH])c1ccc2c(c1)C(Br)CCO2",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "bb863d0a-2a60-4394-9d1b-c6f41557623d",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(C(=O)Nc2ccc(F)cc2F)ccc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2cccc(C(=O)NCC(C)C)c2C)CC1 by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C(=O)Nc2ccc(F)cc2F)ccc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2cccc(C(=O)NCC(C)C)c2C)CC1",
+ "ref_smiles": "Cc1cc(C(=O)Nc2ccc(C#N)cc2F)ccc1NC(=O)C(C)[NH+]1CCC(C(=O)NCCC(=O)Nc2cccc(C(=O)NCC(C)C)c2C)CC1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "a5c008fa-bcab-4aa9-8c55-7857294208af",
+ "task": "add",
+ "question": "Modify the molecule O=C(c1cccc2ccccc12)N1CC[NH+](Cc2ccccc2Br)CC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(c1cccc2ccccc12)N1CC[NH+](Cc2ccccc2Br)CC1",
+ "ref_smiles": "O=C(c1cccc2ccc(-c3ccccc3)cc12)N1CC[NH+](Cc2ccccc2Br)CC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "cea074a3-6b45-4e64-8de1-1601dec163ec",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)(C)CC1[NH2+]C(C(=O)CC2CC(C)(C)C2)C(c2cccc(F)c2F)C12C(=O)Nc1cc(Cl)ccc12 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)(C)CC1[NH2+]C(C(=O)CC2CC(C)(C)C2)C(c2cccc(F)c2F)C12C(=O)Nc1cc(Cl)ccc12",
+ "ref_smiles": "CC(C)(C)CC1[NH2+]C(C(=O)CC2CC(C)(C)C2)C(c2cccc(O)c2F)C12C(=O)Nc1cc(Cl)ccc12",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "2d34901c-a651-4376-a8bc-a8155eac5813",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(O)c1ccc(F)cc1OCCCCC(C)(C)C#N with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(O)c1ccc(F)cc1OCCCCC(C)(C)C#N",
+ "ref_smiles": "CC(C#N)c1ccc(F)cc1OCCCCC(C)(C)C#N",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "18c1bbba-38e6-40ec-9059-ae1d684ec704",
+ "task": "sub",
+ "question": "Modify the molecule Cc1nc(C(=O)N2CCCCC2Cc2[nH]c(-c3cccc(C#N)c3)c[nH+]2)c(-c2ccc(F)cc2)s1 by substituting a nitrile with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1nc(C(=O)N2CCCCC2Cc2[nH]c(-c3cccc(C#N)c3)c[nH+]2)c(-c2ccc(F)cc2)s1",
+ "ref_smiles": "Cc1nc(C(=O)N2CCCCC2Cc2[nH]c(-c3cccc(C(=O)O)c3)c[nH+]2)c(-c2ccc(F)cc2)s1",
+ "add_group": "carboxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "8cf84d2a-f428-4ae4-8e45-13ebbf153cd2",
+ "task": "sub",
+ "question": "Please substitute a nitrile in the molecule COC(=O)c1cc([O-])c(C(F)(F)F)c(C#N)c1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)c1cc([O-])c(C(F)(F)F)c(C#N)c1",
+ "ref_smiles": "COC(=O)c1cc([O-])c(C(F)(F)F)c(O)c1",
+ "add_group": "hydroxyl",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "72565e1f-b416-46a6-bf6a-303485209471",
+ "task": "sub",
+ "question": "Modify the molecule C[N+]1(C)C2CCC1(C#N)CC2 by substituting a nitrile with a thiol.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[N+]1(C)C2CCC1(C#N)CC2",
+ "ref_smiles": "C[N+]1(C)C2CCC1(S)CC2",
+ "add_group": "thiol",
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "61eedbfd-70e3-4c3b-b9c0-2fc063cdde10",
+ "task": "add",
+ "question": "Modify the molecule C=CCc1cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OCC)c1OCc1ccc(C(=O)[O-])cc1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=CCc1cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(OCC)c1OCc1ccc(C(=O)[O-])cc1",
+ "ref_smiles": "C=CCc1c(OCc2ccc(C(=O)[O-])cc2)c(OCC)cc(C=C(C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)c1-c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "a2f555b3-75ef-424a-89f6-6df15844b873",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CCC(=O)c1ccc(Cl)cc1)NCc1ccc(C[NH+]2CCCC2)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCC(=O)c1ccc(Cl)cc1)NCc1ccc(C[NH+]2CCCC2)cc1",
+ "ref_smiles": "O=C(CCC(=O)c1ccccc1)NCc1ccc(C[NH+]2CCCC2)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "a6c06d96-c7db-4792-b8a8-a554ff29d71e",
+ "task": "delete",
+ "question": "Modify the molecule COC(=O)CNC(=O)Nc1cc(Cl)c[nH]c1=O by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)CNC(=O)Nc1cc(Cl)c[nH]c1=O",
+ "ref_smiles": "COC(=O)CNC(=O)Nc1ccc[nH]c1=O",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "eafa46bd-c2d5-46f9-b82d-f6303e4cc737",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])CC1)C(=O)[O-].\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])CC1)C(=O)[O-].",
+ "ref_smiles": "CC(C)CC([NH2+]C=C(C#N)C(=O)N1CCN(CC[NH3+])C(c2ccccc2)C1)C(=O)[O-]",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "7b6b3252-900b-41dd-be2b-df6d1b439a43",
+ "task": "add",
+ "question": "Modify the molecule Cn1cncc1C(Cc1ccc(I)cc1)NN by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cn1cncc1C(Cc1ccc(I)cc1)NN",
+ "ref_smiles": "Cn1cnc(O)c1C(Cc1ccc(I)cc1)NN",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "8f2d1647-7b53-4059-8788-641e1ee12d43",
+ "task": "delete",
+ "question": "Modify the molecule CCCCCCCCCCCCCCCCOc1ccc(-c2ccccc2C2CC(C(=O)[O-])C(CCCCCCCCCC)(CCCCCCCCCC)OC2=O)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCCCCCCCCCCCCCCOc1ccc(-c2ccccc2C2CC(C(=O)[O-])C(CCCCCCCCCC)(CCCCCCCCCC)OC2=O)cc1",
+ "ref_smiles": "CCCCCCCCCCCCCCCCCOc1ccccc1C1CC(C(=O)[O-])C(CCCCCCCCCC)(CCCCCCCCCC)OC1=O",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "031ad4a0-e0f5-446a-ba6f-91cf1a28b44b",
+ "task": "delete",
+ "question": "Please remove a halo from the molecule CC1=CCC2=C(O1)SCC1c3cc(Cl)cc(Cl)c3OCC21Br.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CCC2=C(O1)SCC1c3cc(Cl)cc(Cl)c3OCC21Br.",
+ "ref_smiles": "CC1=CCC2=C(O1)SCC1c3ccccc3OCC21",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "742b7d2a-4788-4afa-aa2f-86957dcf82f0",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCCNC(NCC[NH+]1CCN(CC)CC1)=[NH+]C.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(NCC[NH+]1CCN(CC)CC1)=[NH+]C.",
+ "ref_smiles": "CCCNC(CC[NH+]1CCN(CC)CC1)=[NH+]C",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "063a40d6-cb26-47c3-8450-cb8045654b48",
+ "task": "delete",
+ "question": "Modify the molecule CN(C)c1ccc(NC2=C(SCc3ccco3)C(=O)N(c3ccc(F)c(F)c3F)C2=O)cc1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CN(C)c1ccc(NC2=C(SCc3ccco3)C(=O)N(c3ccc(F)c(F)c3F)C2=O)cc1",
+ "ref_smiles": "CN(C)c1ccc(NC2=C(SCc3ccco3)C(=O)N(c3ccc(F)cc3F)C2=O)cc1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "089e91d7-13e9-4693-a571-d45ac8fcd6f9",
+ "task": "delete",
+ "question": "Modify the molecule CC1CCCC[NH+]1Cc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC[NH+]1Cc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1",
+ "ref_smiles": "CC1CCCC[NH+]1CNC(=O)CCc1ccc2c(c1)OCCO2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6919bba6-1144-4dbb-bc9b-5e9e3e3ce452",
+ "task": "add",
+ "question": "Modify the molecule COc1cc2c(cc1S(N)(=O)=O)CCN(S(=O)(=O)c1cccc(OC(F)(F)F)c1)C2 by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc2c(cc1S(N)(=O)=O)CCN(S(=O)(=O)c1cccc(OC(F)(F)F)c1)C2",
+ "ref_smiles": "COc1cc2c(cc1O)S(N)(=O)=O)CCN(S(=O)(=O)c3cccc(OC(F)(F)F)c3)C2",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "936f7e51-7c72-4c82-8f91-ad190b869cd0",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule Cc1ccc(N=c2ccc3cccc4c([O-])c(-c5ccccc5)c(=O)n2c34)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(N=c2ccc3cccc4c([O-])c(-c5ccccc5)c(=O)n2c34)cc1.",
+ "ref_smiles": "CN=c1ccc2cccc3c([O-])c(-c4ccccc4)c(=O)n1c23",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "684010bb-d211-4111-a851-2c5f086b63c6",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule Cc1ccc(-c2ncccn2)c(C(=O)N2CCCC(C)C2C[NH3+])n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(-c2ncccn2)c(C(=O)N2CCCC(C)C2C[NH3+])n1.",
+ "ref_smiles": "Cc1ccc2(-c3ncccn3)CCCC(C)C2(C[NH3+])n1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "e56b216a-c184-4d52-b933-35dd78499dee",
+ "task": "sub",
+ "question": "Modify the molecule Cc1cc(Br)c(F)cc1NCC1CCC(C)CC1 by substituting a halo with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(Br)c(F)cc1NCC1CCC(C)CC1",
+ "ref_smiles": "Cc1cc([N+](=O)[O-])c(F)cc1NCC1CCC(C)CC1",
+ "add_group": "nitro",
+ "remove_group": "halo"
+ },
+ {
+ "id": "d3b5ffba-5cdf-4eb9-8822-121772279dbb",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(C)c1-c1ccc(OC(C)C(=O)[O-])cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1-c1ccc(OC(C)C(=O)[O-])cc1",
+ "ref_smiles": "Cc1cccc(C)c1OC(C)C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "66a544ca-5746-437e-a3d5-7644bc4de651",
+ "task": "delete",
+ "question": "Modify the molecule Cc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)C(=Cc3cccc(Cl)c3Cl)NC(=O)c3ccccc3)cc2)C1=O by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)C(=Cc3cccc(Cl)c3Cl)NC(=O)c3ccccc3)cc2)C1=O",
+ "ref_smiles": "Cc1cccc(C)c1[SH](CC=O)c1ccc(NC(=O)C(=Cc2cccc(Cl)c2Cl)NC(=O)c2ccccc2)cc1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "0c6d1bc4-9c55-4776-b4fc-ae068f8eb3b8",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CCNC(NCCCNC(=O)c1cccc(O)c1)=[NH+]Cc1ccc(C)cc1OCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCNC(NCCCNC(=O)c1cccc(O)c1)=[NH+]Cc1ccc(C)cc1OCC.",
+ "ref_smiles": "CCOc1cc(C)ccc1C[NH+]=C(NCCCNC(=O)c1cccc(O)c1)NCCc1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "4fa01dcd-1f4f-40ed-a981-77b66ab06c69",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCNC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3cc(C(=O)NCc4ccc(F)cc4)ccc3C)C(C)C)CC2)c(C)c1 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCNC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3cc(C(=O)NCc4ccc(F)cc4)ccc3C)C(C)C)CC2)c(C)c1",
+ "ref_smiles": "CCCNC(=O)c1ccc(NC(=O)C(C)[NH+]2CCC(C(=O)NC(C(=O)Nc3cc(C(=O)NCc4ccc(C#N)cc4)ccc3C)C(C)C)CC2)c(C)c1",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "412a9c3d-f873-4819-8c12-3a5732420feb",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1=CC(=C2C=C(C=Cc3ccc(N=Nc4ccc(N(c5ccc(CCO)cc5)c5ccc(CCO)cc5)cc4)c(CCO)c3)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1=CC(=C2C=C(C=Cc3ccc(N=Nc4ccc(N(c5ccc(CCO)cc5)c5ccc(CCO)cc5)cc4)c(CCO)c3)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O",
+ "ref_smiles": "CC1=CC(=C2C=C(C=Cc3ccc(N=Nc4ccc(N(c5ccc(CCO)cc5)c5ccc(CCC(=O)[OH])cc5)cc4)c(CCO)c3)C(=O)C(C(C)(C)C)=C2)C=C(C(C)(C)C)C1=O",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "ce4ef33f-1a22-4c4b-a43c-dac302789964",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C1SCC(c2ccccc2O)N1c1ccc(-c2nc3ccccc3s2)cc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1SCC(c2ccccc2O)N1c1ccc(-c2nc3ccccc3s2)cc1.",
+ "ref_smiles": "O=C1SCC(c2ccccc2O)N1c1nc2ccccc2s1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "6d3f99f5-3b49-4b3c-8d4b-bfa4f4813f47",
+ "task": "delete",
+ "question": "Modify the molecule O=C(NC1(C(=O)[O-])CCOCC1)c1cccc(OC(F)F)c1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC1(C(=O)[O-])CCOCC1)c1cccc(OC(F)F)c1",
+ "ref_smiles": "O=C(NC1(C(=O)[O-])CCOCC1)c1cccc(OCF)c1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "8f95f7d7-be3e-4a34-9749-d5341f8d51be",
+ "task": "add",
+ "question": "Please add a nitrile to the molecule COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)C)CC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)C)CC2)C1.",
+ "ref_smiles": "COC1CC(c2ncn[nH]2)N(C(=O)NC2CCC(C(C)(C)C#N)CC2)C1",
+ "add_group": "nitrile",
+ "remove_group": null
+ },
+ {
+ "id": "09692ffb-98b7-4df2-b31b-20b936921a26",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule Cc1cc(C[NH2+]C(C)C)cc(N(CC(C)C)C2CC2)n1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(C[NH2+]C(C)C)cc(N(CC(C)C)C2CC2)n1.",
+ "ref_smiles": "Cc1cc(C[NH2+]C(C)(C)O)cc(N(CC(C)C)C2CC2)n1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "5b20495a-3b29-44df-8a66-cfe69be48917",
+ "task": "add",
+ "question": "Modify the molecule C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1 by adding a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1",
+ "ref_smiles": "C[NH+]1CCN(c2ccc(CCCC(=O)N3CCC(c4ccc(Cl)cc4)CC3C(=O)O)cc2)CC1",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "79982c89-f6f0-4c22-8c94-c45a27ee200b",
+ "task": "add",
+ "question": "Please add a thiol to the molecule CCOO[Si](CCC[P+](CC)(CC)CC)(OOCC)OOCC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOO[Si](CCC[P+](CC)(CC)CC)(OOCC)OOCC.",
+ "ref_smiles": "CCOO[Si](CC(S)C[P+](CC)(CC)CC)(OOCC)OOCC",
+ "add_group": "thiol",
+ "remove_group": null
+ },
+ {
+ "id": "ffc70f91-0240-44dc-8962-468f9c5b8064",
+ "task": "add",
+ "question": "Please add a benzene ring to the molecule CC1CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1.",
+ "ref_smiles": "CC1(c2ccccc2)CCCC[NH+]1CCOc1ccccc1C(=O)N1CCOCC1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "fa3763e3-535b-446f-8f6f-ab5589b6a88c",
+ "task": "sub",
+ "question": "Modify the molecule CC(C(=O)OC(C)CC(=C(C)C(=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)=C(CC(C)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F by substituting a hydroxyl with a nitro.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C(=O)OC(C)CC(=C(C)C(=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)=C(CC(C)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F",
+ "ref_smiles": "CC(C(=O)OC(C)CC(=C(C)C(=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)=C(CC(C)[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F",
+ "add_group": "nitro",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "b0a6869a-763c-4b73-be4f-e67d6b95598d",
+ "task": "add",
+ "question": "Modify the molecule CC1NC(=O)CCN(CCSc2ccccc2)C1=O by adding a amine.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1NC(=O)CCN(CCSc2ccccc2)C1=O",
+ "ref_smiles": "NCC1NC(=O)CCN(CCSc2ccccc2)C1=O",
+ "add_group": "amine",
+ "remove_group": null
+ },
+ {
+ "id": "829afab2-a74f-4454-97ef-f8a281c20d47",
+ "task": "add",
+ "question": "Modify the molecule Brc1cnc(C2CCC2)nc1Br by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Brc1cnc(C2CCC2)nc1Br",
+ "ref_smiles": "Brc1nc(C2CCC2)nc(-c3ccccc3)c1Br",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d11e6da2-3c1e-41bc-ba4c-0d513e22b9b4",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule CCOCCCNc1sc(C#N)c(N)c1S(=O)(=O)CC.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOCCCNc1sc(C#N)c(N)c1S(=O)(=O)CC.",
+ "ref_smiles": "CCOCCCNc1sc(C#N)cc1S(=O)(=O)CC",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "5587d2b6-de14-438d-8f1d-876e7ec77cb4",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule C[NH2+]Cc1cc(Cl)ccc1OCCC1CCCO1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH2+]Cc1cc(Cl)ccc1OCCC1CCCO1.",
+ "ref_smiles": "C[NH2+]Cc1c(OCCC2CCCO2)ccc(Cl)c1O",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "36708de8-96f0-4542-95d0-241a328383d7",
+ "task": "sub",
+ "question": "Modify the molecule C[NH+](C)CCN(CC(=O)[O-])C(=O)c1sccc1Cl by substituting a halo with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C[NH+](C)CCN(CC(=O)[O-])C(=O)c1sccc1Cl",
+ "ref_smiles": "C[NH+](C)CCN(CC(=O)[O-])C(=O)c1sccc1C#N",
+ "add_group": "nitrile",
+ "remove_group": "halo"
+ },
+ {
+ "id": "3b5f5e39-4855-4aca-bad6-6fef45810445",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(Cl)c(-c2ccc3c(c2)N2CC[NH2+]CCC2C3)c(Cl)c1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)c(-c2ccc3c(c2)N2CC[NH2+]CCC2C3)c(Cl)c1",
+ "ref_smiles": "CC(=O)c1cc(OC)cc(Cl)c1-c1ccc2c(c1)N1CC[NH2+]CCC1C2",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5c78cf46-827b-436b-9d2d-4881b3942bad",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC(C)c1ccc(-n2cc(CCCO)nn2)cc1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)c1ccc(-n2cc(CCCO)nn2)cc1",
+ "ref_smiles": "CC(C)c1ccc(-n2cc(CCCC(=O)OH)nn2)cc1",
+ "add_group": "carboxyl",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "54f32cc7-d9d2-4dd1-ba4a-2f293f6d3c15",
+ "task": "add",
+ "question": "Modify the molecule Cc1noc(C2COCC[NH+]2CCC2CCCC(C)C2)n1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1noc(C2COCC[NH+]2CCC2CCCC(C)C2)n1",
+ "ref_smiles": "Cc1noc(C2COCC[NH+]2CCC2CC(C)CC(c3ccccc3)C2)n1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "d7ac1fae-6250-4ca9-a983-f4232f5de5f8",
+ "task": "add",
+ "question": "Modify the molecule Cc1cc(NC(=O)CN2CCC([NH+](C)Cc3noc(C)n3)C2)on1 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1cc(NC(=O)CN2CCC([NH+](C)Cc3noc(C)n3)C2)on1",
+ "ref_smiles": "Cc1nc(C[NH+](C)C2CCN(CC(=O)Nc3cc(CCC=O)no3)C2)no1",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "93438a92-b5a4-42cf-bcbe-37c4b53ec92e",
+ "task": "delete",
+ "question": "Please remove a amine from the molecule Cc1ccc(CO)cc1S(=O)(=O)NCCOCC1CC1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(CO)cc1S(=O)(=O)NCCOCC1CC1.",
+ "ref_smiles": "Cc1ccc(CO)cc1S(=O)(=O)CCOCC1CC1",
+ "add_group": null,
+ "remove_group": "amine"
+ },
+ {
+ "id": "3b17de3a-5506-4058-8b20-a75c620a79d3",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(COc1ccccc1)Nc1nc2n(n1)C(c1ccc(F)cc1)C=C(c1ccc(Cl)cc1)N2.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1ccccc1)Nc1nc2n(n1)C(c1ccc(F)cc1)C=C(c1ccc(Cl)cc1)N2.",
+ "ref_smiles": "O=C(CO)Nc1nc2n(n1)C(c1ccc(F)cc1)C=C(c1ccc(Cl)cc1)N2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "baa12b1a-e368-42ee-a574-32ef63633119",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(COc2ccc(C=C(C#N)c3cccc([N+](=O)[O-])c3)cc2I)cc1 by removing a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(COc2ccc(C=C(C#N)c3cccc([N+](=O)[O-])c3)cc2I)cc1",
+ "ref_smiles": "Cc1ccc(COc2ccc(C=Cc3cccc([N+](=O)[O-])c3)cc2I)cc1",
+ "add_group": null,
+ "remove_group": "nitrile"
+ },
+ {
+ "id": "43c0e17d-39eb-45ca-add2-d604a8787982",
+ "task": "delete",
+ "question": "Modify the molecule Cc1ccc(S(=O)(=O)NC(CC(=O)[O-])C(=O)[O-])cc1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "Cc1ccc(S(=O)(=O)NC(CC(=O)[O-])C(=O)[O-])cc1",
+ "ref_smiles": "CS(=O)(=O)NC(CC(=O)[O-])C(=O)[O-]",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "3e864e23-32b8-4613-a477-7e59c793a693",
+ "task": "add",
+ "question": "Please add a carboxyl to the molecule COC1C[NH2+]CC1NC(=O)C(C)Cc1ccccc1Cl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC1C[NH2+]CC1NC(=O)C(C)Cc1ccccc1Cl.",
+ "ref_smiles": "COC1C[NH2+]CC1NC(=O)C(C)Cc1ccc(C(=O)O)cc1Cl",
+ "add_group": "carboxyl",
+ "remove_group": null
+ },
+ {
+ "id": "f9aa58a5-4af2-47ca-9842-d9079b6499f2",
+ "task": "add",
+ "question": "Please add a hydroxyl to the molecule CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3CCc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3CCc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1.",
+ "ref_smiles": "CCOC(=O)C1CCC(OCC[NH+]2CCN(c3nc(N)nc4c3C(O)Cc3cc(OCc5ccc(Cl)cc5)ccc3-4)CC2)C1",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "17f55bb1-6c04-4b19-96c6-08cab5c5e8d0",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule O=C1CCCC2CCCC12O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCCC2CCCC12O.",
+ "ref_smiles": "O=C1CCCC2CCCC12",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "4a426b86-4e29-4090-b2c9-2413ee43336c",
+ "task": "add",
+ "question": "Modify the molecule C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4ccc(OC(=O)C(=C)C)c(C(F)(F)F)c4)c(S(=O)(=O)[O-])c3)cc2)cc1C by adding a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4ccc(OC(=O)C(=C)C)c(C(F)(F)F)c4)c(S(=O)(=O)[O-])c3)cc2)cc1C",
+ "ref_smiles": "C=C(C)C(=O)Oc1ccc(N=Nc2ccc(-c3ccc(N=Nc4cc(C(F)(F)F)c(OC(=O)C(=C)C)cc4O)c(S(=O)(=O)[O-])c3)cc2)cc1C",
+ "add_group": "hydroxyl",
+ "remove_group": null
+ },
+ {
+ "id": "c19de274-0c0e-46b7-af8a-43ae06674f36",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CC(C)C(NC(=O)NCc1ccc(Br)cc1)C(=O)[O-] with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(C)C(NC(=O)NCc1ccc(Br)cc1)C(=O)[O-]",
+ "ref_smiles": "CC(C)C(NC(=O)NCc1ccc(C(=O)[OH])cc1)C(=O)[O-]",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "fddb12ee-c7d4-4d3c-bb71-e615d79660cd",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule O=C(C=Cc1cccc(Br)c1)Nc1ccc(C(C(=O)[O-])c2ccc3ocnc3c2)cc1 with a hydroxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(C=Cc1cccc(Br)c1)Nc1ccc(C(C(=O)[O-])c2ccc3ocnc3c2)cc1",
+ "ref_smiles": "O=C(C=Cc1cccc(O)c1)Nc1ccc(C(C(=O)[O-])c2ccc3ocnc3c2)cc1",
+ "add_group": "hydroxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "b97f4246-2419-45bf-ad22-5f080c1d896e",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule COc1cc(Cl)ccc1C(=O)Nc1ccc(C(=O)Cl)cn1 with a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COc1cc(Cl)ccc1C(=O)Nc1ccc(C(=O)Cl)cn1",
+ "ref_smiles": "COc1cc(C=O)ccc1C(=O)Nc1ccc(C(=O)Cl)cn1",
+ "add_group": "aldehyde",
+ "remove_group": "halo"
+ },
+ {
+ "id": "5a4c58ca-b2d3-43ad-94e3-cd539f5303d1",
+ "task": "sub",
+ "question": "Please substitute a hydroxyl in the molecule CC1C(=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)c2cc3oc(=O)[nH]c3cc21 with a nitrile.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC1C(=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)c2cc3oc(=O)[nH]c3cc21",
+ "ref_smiles": "CC1C(=Cc2cc(C(C)(C)C)c(C#N)c(C(C)(C)C)c2)C(=O)c2cc3oc(=O)[nH]c3cc21",
+ "add_group": "nitrile",
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "c08b5a0c-7d5f-48f9-bf0d-1f7589a1b7e0",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule N#Cc1cccc(CC(NC(=O)c2cccc(F)c2)C(=O)[O-])c1 with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "N#Cc1cccc(CC(NC(=O)c2cccc(F)c2)C(=O)[O-])c1",
+ "ref_smiles": "N#Cc1cccc(CC(NC(=O)c2cccc(C(=O)[OH])c2)C(=O)[O-])c1",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ },
+ {
+ "id": "6ce43bf2-9b34-4f5e-893c-7f876984d264",
+ "task": "delete",
+ "question": "Modify the molecule CC(=O)N(C(C)C)C(C)c1cc(Cl)c(C)cc1C1CCN(C(=O)C2C[NH+](C(C)(C)C)CC2c2ccc(F)cc2F)CC1 by removing a halo.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CC(=O)N(C(C)C)C(C)c1cc(Cl)c(C)cc1C1CCN(C(=O)C2C[NH+](C(C)(C)C)CC2c2ccc(F)cc2F)CC1",
+ "ref_smiles": "CC(=O)N(C(C)C)C(C)c1cc(Cl)c(C)cc1C1CCN(C(=O)C2C[NH+](C(C)(C)C)CC2c2ccccc2F)CC1",
+ "add_group": null,
+ "remove_group": "halo"
+ },
+ {
+ "id": "7eb6f092-0bf6-4fe1-b0a8-700c6c1edfc8",
+ "task": "delete",
+ "question": "Modify the molecule O=C(COc1ccc(C2CCCCC2)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(COc1ccc(C2CCCCC2)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1",
+ "ref_smiles": "O=C(COC1CCCCC1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "8252acdd-2f05-4792-8a79-15bfbdc369e5",
+ "task": "add",
+ "question": "Modify the molecule COC(=O)NCC1(CC(=O)[O-])CCC1 by adding a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "COC(=O)NCC1(CC(=O)[O-])CCC1",
+ "ref_smiles": "COC(=O)NCC1(CC(=O)[O-])CCC1c1ccccc1",
+ "add_group": "benzene",
+ "remove_group": null
+ },
+ {
+ "id": "bb31a01d-9e3b-419a-9194-6d0e5145a1ad",
+ "task": "delete",
+ "question": "Modify the molecule [NH3+]CCN1CCC(C(=O)NCCC2CCCC2)CC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "[NH3+]CCN1CCC(C(=O)NCCC2CCCC2)CC1",
+ "ref_smiles": "[NH3+]CCN1CCC(CC2CCCC2)CC1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "fb212b5c-7d36-4ac6-a168-b10b744d29f1",
+ "task": "delete",
+ "question": "Modify the molecule O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCC1(c2ccc(Cl)cc2)CCOCC1 by removing a amide.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCC1(c2ccc(Cl)cc2)CCOCC1",
+ "ref_smiles": "O=C1CCc2cc(OCCCC3(c4ccc(Cl)cc4)CCOCC3)ccc2N1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "c4e14328-6239-4802-8186-e80e39bfc5a8",
+ "task": "delete",
+ "question": "Modify the molecule CCOC(=O)C1=C(C)N=c2sc(=Cc3cc(I)c(O)c(OCC)c3)c(=O)n2C1c1ccccc1OC(C)C by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)C1=C(C)N=c2sc(=Cc3cc(I)c(O)c(OCC)c3)c(=O)n2C1c1ccccc1OC(C)C",
+ "ref_smiles": "CCOC(=O)C1=C(C)N=c2sc(=C(OI)OCC)c(=O)n2C1c1ccccc1OC(C)C",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "80ffc8dc-397f-41e4-bd7d-d890c6291982",
+ "task": "delete",
+ "question": "Modify the molecule O=C([O-])N1CCC2(C=C(c3ccccc3)NO2)CC1 by removing a benzene ring.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C([O-])N1CCC2(C=C(c3ccccc3)NO2)CC1",
+ "ref_smiles": "O=C([O-])N1CCC2(C=CNO2)CC1",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "f1ff332f-e1d4-43d3-abc9-c7fb4ee5e113",
+ "task": "add",
+ "question": "Modify the molecule CCOC(=O)c1ccccc1NC(=O)COc1cccc2cccnc12 by adding a aldehyde.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOC(=O)c1ccccc1NC(=O)COc1cccc2cccnc12",
+ "ref_smiles": "CCOC(=O)c1ccc(CC=O)cc1NC(=O)COc1cccc2cccnc12",
+ "add_group": "aldehyde",
+ "remove_group": null
+ },
+ {
+ "id": "2fb0a7b3-af7c-46bf-9160-afb1d89589df",
+ "task": "delete",
+ "question": "Please remove a benzene ring from the molecule O=C(NC(=Cc1ccc2c(c1)OCO2)C(=O)N1CC2CC(C1)c1cccc(=O)n1C2)c1ccccc1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C(NC(=Cc1ccc2c(c1)OCO2)C(=O)N1CC2CC(C1)c1cccc(=O)n1C2)c1ccccc1.",
+ "ref_smiles": "O=CNC(=Cc1ccc2c(c1)OCO2)C(=O)N1CC2CC(C1)c1cccc(=O)n1C2",
+ "add_group": null,
+ "remove_group": "benzene"
+ },
+ {
+ "id": "b62c5806-5fad-44d1-aed9-b8acf6c8bdb2",
+ "task": "delete",
+ "question": "Please remove a hydroxyl from the molecule CCOc1cc(C2C(c3cccc4ccccc34)=C(O)C(=O)N2c2ccc(CC)cc2)ccc1O.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCOc1cc(C2C(c3cccc4ccccc34)=C(O)C(=O)N2c2ccc(CC)cc2)ccc1O.",
+ "ref_smiles": "CCOc1cccc(C2C(c3cccc4ccccc34)=C(O)C(=O)N2c2ccc(CC)cc2)c1",
+ "add_group": null,
+ "remove_group": "hydroxyl"
+ },
+ {
+ "id": "804809e7-70aa-4613-8db4-b8021977ac47",
+ "task": "delete",
+ "question": "Please remove a amide from the molecule O=C1CCCN(C(=O)CCCc2ccc[nH]2)C1.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "O=C1CCCN(C(=O)CCCc2ccc[nH]2)C1.",
+ "ref_smiles": "O=C1CCCC(Cc2ccc[nH]2)C1",
+ "add_group": null,
+ "remove_group": "amide"
+ },
+ {
+ "id": "2c17c745-d78f-4f8e-a6e3-b55c39499a10",
+ "task": "sub",
+ "question": "Please substitute a halo in the molecule CCCN(CCO)C(=O)c1cc(O)ccc1Cl with a carboxyl.\nPlease wrap the final SMILES in ....",
+ "src_smiles": "CCCN(CCO)C(=O)c1cc(O)ccc1Cl",
+ "ref_smiles": "CCCN(CCO)C(=O)c1cc(O)ccc1C(=O)O",
+ "add_group": "carboxyl",
+ "remove_group": "halo"
+ }
+]
\ No newline at end of file