File size: 221,531 Bytes
47383d6 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 |
ID,Question_std,Question_cot,Question_chem,A,B,Answer
0,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Oc1ccc(Br)cc1Cl,FC(F)Oc1ccc(Br)cc1Cl,"['O=C(O)C(F)(F)Cl.Oc1ccc(Br)cc1Cl', 'O=C(c1ccccc1)C(F)(F)Cl.Oc1ccc(Br)cc1Cl', 'O=C([O-])C(F)(F)Cl.Oc1ccc(Br)cc1Cl.[Na+]']"
1,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1NC(=O)c2ccccc21.[K]</SMILES> Target product B: <SMILES>O=C1c2ccccc2C(=O)N1CCOc1cc(Cl)cc(Cl)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1NC(=O)c2ccccc21.[K]</SMILES> Target product B: <SMILES>O=C1c2ccccc2C(=O)N1CCOc1cc(Cl)cc(Cl)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1NC(=O)c2ccccc21.[K]</SMILES> Target product B: <SMILES>O=C1c2ccccc2C(=O)N1CCOc1cc(Cl)cc(Cl)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1NC(=O)c2ccccc21.[K],O=C1c2ccccc2C(=O)N1CCOc1cc(Cl)cc(Cl)c1,"['Clc1cc(Cl)cc(OCCBr)c1.O=C1NC(=O)c2ccccc21.[K]', 'Clc1cc(Cl)c(CCBr)c(Oc2cc(Cl)cc(Cl)c2CCBr)c1.O=C1NC(=O)c2ccccc21.[K]']"
2,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccc(Br)cc1Cl</SMILES> Target product B: <SMILES>FC(F)Oc1ccc(Br)cc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Oc1ccc(Br)cc1Cl,FC(F)Oc1ccc(Br)cc1Cl,"['O=C(O)C(F)(F)Cl.Oc1ccc(Br)cc1Cl', 'O=C([O-])C(F)(F)Cl.Oc1ccc(Br)cc1Cl.[Na+]', 'O=C(c1ccccc1)C(F)(F)Cl.Oc1ccc(Br)cc1Cl']"
3,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1cccc([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1cccc([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1cccc([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",C1COCCN1,O=C(c1cccc([N+](=O)[O-])c1)N1CCOCC1,"['C1COCCN1.O=[N+]([O-])c1cccc(I)c1.[C-]#[O+]', 'C1COCCN1.O=[N+]([O-])c1cccc(CO)c1', 'C1COCCN1.O=Cc1cccc([N+](=O)[O-])c1', 'C1COCCN1.O=C(O)c1cccc([N+](=O)[O-])c1', 'C1COCCN1.O=C(Cl)c1cccc([N+](=O)[O-])c1']"
4,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1</SMILES> Target product B: <SMILES>Oc1ccccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1</SMILES> Target product B: <SMILES>Oc1ccccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1</SMILES> Target product B: <SMILES>Oc1ccccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Oc1ccccc1,Oc1ccccc1O,"['CC(=O)O.Oc1ccccc1', 'O=[N+]([O-])c1ccc(Cl)[n+]([O-])c1.Oc1ccccc1', 'C=O.Oc1ccccc1', 'O=[N+]([O-])c1cnc(Cl)nc1.Oc1ccccc1', 'CC(C)(C)[SiH](Cl)C(C)(C)C.Oc1ccccc1', 'O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1Cl.Oc1ccccc1', 'Brc1ccccn1.Oc1ccccc1', 'Oc1ccc(O)cc1.Oc1ccccc1', 'CC(=O)CC(C)=O.CC(=O)OO.Oc1ccccc1', 'CCC(C)(OO)OOC(C)(CC)OO.Oc1ccccc1']"
5,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OCC1CCCNC1</SMILES> Target product B: <SMILES>CCN1CCCC(CO)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OCC1CCCNC1</SMILES> Target product B: <SMILES>CCN1CCCC(CO)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OCC1CCCNC1</SMILES> Target product B: <SMILES>CCN1CCCC(CO)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",OCC1CCCNC1,CCN1CCCC(CO)C1,"['CCBr.OCC1CCCNC1', 'CCI.OCC1CCCNC1']"
6,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ccccc1</SMILES> Target product B: <SMILES>C1=CCN(Cc2ccccc2)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ccccc1</SMILES> Target product B: <SMILES>C1=CCN(Cc2ccccc2)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ccccc1</SMILES> Target product B: <SMILES>C1=CCN(Cc2ccccc2)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NCc1ccccc1,C1=CCN(Cc2ccccc2)C1,"['ClCC=CCCl.NCc1ccccc1', 'CS(=O)(=O)OC/C=C\\COS(C)(=O)=O.NCc1ccccc1', 'C=CCO.NCc1ccccc1', 'NCc1ccccc1.O=C1C=CC(=O)O1', 'NCc1ccccc1.OC/C=C\\CO', 'C=CCBr.NCc1ccccc1', 'ClC/C=C\\CCl.NCc1ccccc1']"
7,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1</SMILES> Target product B: <SMILES>O=c1c(Cl)c(Cl)cnn1Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1</SMILES> Target product B: <SMILES>O=c1c(Cl)c(Cl)cnn1Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1</SMILES> Target product B: <SMILES>O=c1c(Cl)c(Cl)cnn1Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",BrCc1ccccc1,O=c1c(Cl)c(Cl)cnn1Cc1ccccc1,"['BrCc1ccccc1.Oc1nncc(Cl)c1Cl', 'BrCc1ccccc1.O=c1[nH]ncc(Cl)c1Cl']"
8,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC(=O)N1Br</SMILES> Target product B: <SMILES>CC(Br)c1ccc(C#N)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC(=O)N1Br</SMILES> Target product B: <SMILES>CC(Br)c1ccc(C#N)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC(=O)N1Br</SMILES> Target product B: <SMILES>CC(Br)c1ccc(C#N)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1CCC(=O)N1Br,CC(Br)c1ccc(C#N)cn1,"['CCc1ccc(C#N)cn1.O=C1CCC(=O)N1Br', 'CC(C)(C#N)N=NC(C)(C)C#N.CCc1ccc(Br)cn1.O=C1CCC(=O)N1Br']"
9,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC1CSC(O)CS1</SMILES> Target product B: <SMILES>CC(C)CC(C)C1SCC(O)C1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC1CSC(O)CS1</SMILES> Target product B: <SMILES>CC(C)CC(C)C1SCC(O)C1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC1CSC(O)CS1</SMILES> Target product B: <SMILES>CC(C)CC(C)C1SCC(O)C1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",OC1CSC(O)CS1,CC(C)CC(C)C1SCC(O)C1[N+](=O)[O-],"['CC(C)CC(C)C(Cl)C[N+](=O)[O-].OC1CSC(O)CS1', 'CC(C)CC(C)C=C[N+](=O)[O-].OC1CSC(O)CS1', 'CC(=O)OC(C[N+](=O)[O-])C(C)CC(C)C.OC1CSC(O)CS1']"
10,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)nc1N</SMILES> Target product B: <SMILES>O=C(c1ccccc1)c1ccc(-c2nc3ccc(Cl)nc3[nH]2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)nc1N</SMILES> Target product B: <SMILES>O=C(c1ccccc1)c1ccc(-c2nc3ccc(Cl)nc3[nH]2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)nc1N</SMILES> Target product B: <SMILES>O=C(c1ccccc1)c1ccc(-c2nc3ccc(Cl)nc3[nH]2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1ccc(Cl)nc1N,O=C(c1ccccc1)c1ccc(-c2nc3ccc(Cl)nc3[nH]2)cc1,"['CC(=O)OI(OC(C)=O)c1ccccc1.Nc1ccc(Cl)nc1N.O=Cc1ccc(OCc2ccccc2)cc1', 'Nc1ccc(Cl)nc1N.O=C(O)c1ccc(C(=O)c2ccccc2)cc1']"
11,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCN(C(=O)OCc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1CCN(C(=O)OCc2ccccc2)CC1,COC(=O)C=C1CCN(C(=O)OCc2ccccc2)CC1,"['COC(=O)CP(=O)(OC)OC.O=C1CCN(C(=O)OCc2ccccc2)CC1', 'COC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C1CCN(C(=O)OCc2ccccc2)CC1', 'COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=C1CCN(C(=O)OCc2ccccc2)CC1', 'COP(=O)(O)C(C)(C)C(=O)[O-].O=C1CCN(C(=O)OCc2ccccc2)CC1']"
12,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CNOC.Cl</SMILES> Target product B: <SMILES>CON(C)C(=O)C1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CNOC.Cl</SMILES> Target product B: <SMILES>CON(C)C(=O)C1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CNOC.Cl</SMILES> Target product B: <SMILES>CON(C)C(=O)C1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CNOC.Cl,CON(C)C(=O)C1CCOCC1,"['CNOC.COC(=O)C1CCOCC1.Cl', 'CNOC.Cl.O=C(O)C1CCOCC1', 'CNOC.Cl.O=C(Cl)C1CCOCC1']"
13,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NC1(C(=O)NCc2ncc(Nc3c(F)cccc3C(F)(F)F)cc2F)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NC1(C(=O)NCc2ncc(Nc3c(F)cccc3C(F)(F)F)cc2F)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NC1(C(=O)NCc2ncc(Nc3c(F)cccc3C(F)(F)F)cc2F)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F,CC(C)(C)OC(=O)NC1(C(=O)NCc2ncc(Nc3c(F)cccc3C(F)(F)F)cc2F)CC1,"['CC(C)(C)OC(=O)NC1(C(N)=O)CC1.NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F', 'CC(C)(C)OC(=O)NC1(C(=O)O)CC1.NCc1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F']"
14,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1</SMILES> Target product B: <SMILES>C=Cc1cnc2c(c1)c1ncnn1c(=O)n2Cc1ccc(OC)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1</SMILES> Target product B: <SMILES>C=Cc1cnc2c(c1)c1ncnn1c(=O)n2Cc1ccc(OC)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1</SMILES> Target product B: <SMILES>C=Cc1cnc2c(c1)c1ncnn1c(=O)n2Cc1ccc(OC)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1,C=Cc1cnc2c(c1)c1ncnn1c(=O)n2Cc1ccc(OC)cc1,"['C=C[Sn](CCCC)(CCCC)CCCC.COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1', 'C=C[B-](F)(F)F.COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1.[K+]', 'COc1ccc(B(O)O)cc1OC.COc1ccc(Cn2c(=O)n3ncnc3c3cc(Br)cnc32)cc1']"
15,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCCC(=O)O</SMILES> Target product B: <SMILES>O=C(O)CCCN1C(=O)c2ccccc2C1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCCC(=O)O</SMILES> Target product B: <SMILES>O=C(O)CCCN1C(=O)c2ccccc2C1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCCC(=O)O</SMILES> Target product B: <SMILES>O=C(O)CCCN1C(=O)c2ccccc2C1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NCCCC(=O)O,O=C(O)CCCN1C(=O)c2ccccc2C1=O,"['NCCCC(=O)O.O=C(O)c1ccccc1C(=O)O', 'NCCCC(=O)O.O=C1NC(=O)c2ccccc21', 'COP(=O)(OC)C1(Cl)OC(=O)c2ccccc21.NCCCC(=O)O', 'NCCCC(=O)O.O=C1OC(=O)c2ccccc21', 'CCOC(=O)N1C(=O)c2ccccc2C1=O.NCCCC(=O)O']"
16,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C=[N+]=[N-]</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C=[N+]=[N-]</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C=[N+]=[N-]</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCOC(=O)C=[N+]=[N-],CCOC(=O)C1CCN(C(=O)OCc2ccccc2)CCC1=O,"['CCOC(=O)C=[N+]=[N-].O=C1CCN(C(=O)OCc2ccccc2)CC1', 'CCOC(=O)C=[N+]=[N-].CCOCC.FB(F)F.O=C(OCc1ccccc1)N1CC[N+](=O)CC1.O=C([O-])[O-].[K+].[K+]']"
17,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(=O)N1CCN(c2ccc(N)cc2)CC1</SMILES> Target product B: <SMILES>CC(=O)N1CCN(c2ccc(Nc3nc(Nc4ccc5cn[nH]c5c4)c4c(C)cn(S(=O)(=O)c5ccc(C)cc5)c4n3)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(=O)N1CCN(c2ccc(N)cc2)CC1</SMILES> Target product B: <SMILES>CC(=O)N1CCN(c2ccc(Nc3nc(Nc4ccc5cn[nH]c5c4)c4c(C)cn(S(=O)(=O)c5ccc(C)cc5)c4n3)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(=O)N1CCN(c2ccc(N)cc2)CC1</SMILES> Target product B: <SMILES>CC(=O)N1CCN(c2ccc(Nc3nc(Nc4ccc5cn[nH]c5c4)c4c(C)cn(S(=O)(=O)c5ccc(C)cc5)c4n3)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(=O)N1CCN(c2ccc(N)cc2)CC1,CC(=O)N1CCN(c2ccc(Nc3nc(Nc4ccc5cn[nH]c5c4)c4c(C)cn(S(=O)(=O)c5ccc(C)cc5)c4n3)cc2)CC1,"['CC(=O)N1CCN(c2ccc(N)cc2)CC1.Cc1ccc(S(=O)(=O)n2cc(C)c3c(Nc4ccc5cn[nH]c5c4)nc(Cl)nc32)cc1', 'CC(=O)N1CCN(c2ccc(N)cc2)CC1.CCc1cn(S(=O)(=O)c2ccc(C)cc2)c2nc(Cl)nc(Nc3ccc4cn[nH]c4c3)c12']"
18,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(F)cncc2NC(=O)c2c(N)nn3cc(F)cnc23)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(F)cncc2NC(=O)c2c(N)nn3cc(F)cnc23)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)C1CCN(c2c(F)cncc2NC(=O)c2c(N)nn3cc(F)cnc23)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1,CC(C)(C)OC(=O)C1CCN(c2c(F)cncc2NC(=O)c2c(N)nn3cc(F)cnc23)CC1,"['CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1.Nc1nn2cc(F)cnc2c1C(=O)Cl', 'CC(C)(C)OC(=O)C1CCN(c2c(N)cncc2F)CC1.Nc1nn2cc(F)cnc2c1C(=O)On1nnc2ccc(Cl)cc21']"
19,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1ccc(P(c2ccccc2)c2ccccc2)cc1</SMILES> Target product B: <SMILES>ClP(c1ccccc1)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1ccc(P(c2ccccc2)c2ccccc2)cc1</SMILES> Target product B: <SMILES>ClP(c1ccccc1)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1ccc(P(c2ccccc2)c2ccccc2)cc1</SMILES> Target product B: <SMILES>ClP(c1ccccc1)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",c1ccc(P(c2ccccc2)c2ccccc2)cc1,ClP(c1ccccc1)c1ccccc1,"['ClP(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1', 'ClP(Cl)c1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1', 'Clc1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1']"
20,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F,CC(C)(C)OC(=O)N1CCc2cccc(OS(=O)(=O)C(F)(F)F)c2CC1,"['CC(C)(C)OC(=O)N1CCc2cccc(O)c2CC1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C(N1CCc2cccc(O)c2CC1)C(F)(F)F.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F']"
21,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C(=O)CBr</SMILES> Target product B: <SMILES>CCOC(=O)c1csc(C(F)(F)F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C(=O)CBr</SMILES> Target product B: <SMILES>CCOC(=O)c1csc(C(F)(F)F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C(=O)CBr</SMILES> Target product B: <SMILES>CCOC(=O)c1csc(C(F)(F)F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCOC(=O)C(=O)CBr,CCOC(=O)c1csc(C(F)(F)F)n1,"['CCOC(=O)C(=O)CBr.NC(=O)C(F)(F)F', 'CCOC(=O)C(=O)CBr.NC(=S)C(F)(F)F', 'CCNC(=S)C(F)(F)F.CCOC(=O)C(=O)CBr', 'CCOC(=O)C(=O)CBr.COc1ccc(P2(=S)SP(=S)(c3ccc(OC)cc3)S2)cc1.NC(=O)C(F)(F)F']"
22,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(CN)C(=O)O.Cl</SMILES> Target product B: <SMILES>CC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(CN)C(=O)O.Cl</SMILES> Target product B: <SMILES>CC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(CN)C(=O)O.Cl</SMILES> Target product B: <SMILES>CC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(CN)C(=O)O.Cl,CC(C)(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O,"['CC(C)(CN)C(=O)O.Cl.O=C(Cl)OCC1c2ccccc2-c2ccccc21', 'CC(C)(CN)C(=O)O.Cl.O=C(OCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O']"
23,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCN</SMILES> Target product B: <SMILES>CCOC(=O)c1ccc(C2=NCCN2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCN</SMILES> Target product B: <SMILES>CCOC(=O)c1ccc(C2=NCCN2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NCCN</SMILES> Target product B: <SMILES>CCOC(=O)c1ccc(C2=NCCN2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NCCN,CCOC(=O)c1ccc(C2=NCCN2)cc1,"['CCOC(=N)c1ccc(C(=O)OCC)cc1.Cl.NCCN', 'CCON=Cc1ccc(C(=O)OCC)cc1.Cl.NCCN']"
24,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1c(F)cc(F)c(F)c1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1c(F)cc(F)c(F)c1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1c(F)cc(F)c(F)c1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1c(F)cc(F)c(F)c1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1c(F)cc(F)c(F)c1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1c(F)cc(F)c(F)c1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)c1c(F)cc(F)c(F)c1F,CC(C)(C)OC(=O)c1c(F)cc(F)c(F)c1F,"['CC(C)(C)OC(=O)OC(C)(C)C.O=C(O)c1c(F)cc(F)c(F)c1F', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C(O)c1c(F)cc(F)c(F)c1F']"
25,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccc1</SMILES> Target product B: <SMILES>Cc1ccc(NC(=O)Nc2ccccc2)cc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccc1</SMILES> Target product B: <SMILES>Cc1ccc(NC(=O)Nc2ccccc2)cc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccc1</SMILES> Target product B: <SMILES>Cc1ccc(NC(=O)Nc2ccccc2)cc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1ccccc1,Cc1ccc(NC(=O)Nc2ccccc2)cc1[N+](=O)[O-],"['Cc1ccc(N=C=O)cc1[N+](=O)[O-].Nc1ccccc1', 'Cc1ccc(N)cc1[N+](=O)[O-].Nc1ccccc1.O=C(OC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl']"
26,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1cccc(F)c1</SMILES> Target product B: <SMILES>CCOC(=O)COc1cccc(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1cccc(F)c1</SMILES> Target product B: <SMILES>CCOC(=O)COc1cccc(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1cccc(F)c1</SMILES> Target product B: <SMILES>CCOC(=O)COc1cccc(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Oc1cccc(F)c1,CCOC(=O)COc1cccc(F)c1,"['CCOC(=O)CBr.Oc1cccc(F)c1', 'CCOC(=O)CCl.Oc1cccc(F)c1']"
27,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Sc1ccccc1</SMILES> Target product B: <SMILES>O=C(O)C(Sc1ccccc1)c1cccs1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Sc1ccccc1</SMILES> Target product B: <SMILES>O=C(O)C(Sc1ccccc1)c1cccs1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Sc1ccccc1</SMILES> Target product B: <SMILES>O=C(O)C(Sc1ccccc1)c1cccs1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Sc1ccccc1,O=C(O)C(Sc1ccccc1)c1cccs1,"['ClC(Cl)Cl.O=Cc1cccs1.Sc1ccccc1.[K+].[OH-]', 'OC(c1cccs1)C(Cl)(Cl)Cl.Sc1ccccc1.[K+].[OH-]']"
28,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrC1CCCC1</SMILES> Target product B: <SMILES>CCOC(=O)Nc1cc(OC2CCCC2)c(Cl)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrC1CCCC1</SMILES> Target product B: <SMILES>CCOC(=O)Nc1cc(OC2CCCC2)c(Cl)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrC1CCCC1</SMILES> Target product B: <SMILES>CCOC(=O)Nc1cc(OC2CCCC2)c(Cl)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",BrC1CCCC1,CCOC(=O)Nc1cc(OC2CCCC2)c(Cl)cc1F,"['BrC1CCCC1.CCOC(=O)Nc1cc(OC(=O)OCC)c(Cl)cc1F', 'BrC1CCCC1.CCOC(=O)Nc1cc(OC(=O)OC)c(Cl)cc1F', 'BrC1CCCC1.CCOC(=O)Nc1cc(O)c(Cl)cc1F']"
29,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(F)c2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(F)c2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(F)c2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=[N+]([O-])c1ccc(O)cc1F,CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])c(F)c2)CC1,"['CC(C)(C)OC(=O)N1CCC(O)CC1.O=[N+]([O-])c1ccc(O)cc1F', 'Cc1ccc(S(=O)(=O)OC2CCN(C(=O)OC(C)(C)C)CC2)cc1.O=[N+]([O-])c1ccc(O)cc1F']"
30,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC(C)=O</SMILES> Target product B: <SMILES>CCOC(=O)C(Cc1ccc(OC)cc1)C(C)=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC(C)=O</SMILES> Target product B: <SMILES>CCOC(=O)C(Cc1ccc(OC)cc1)C(C)=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC(C)=O</SMILES> Target product B: <SMILES>CCOC(=O)C(Cc1ccc(OC)cc1)C(C)=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCOC(=O)CC(C)=O,CCOC(=O)C(Cc1ccc(OC)cc1)C(C)=O,"['CCOC(=O)CC(C)=O.COc1ccc(COC(C)=O)cc1', 'CCOC(=O)CC(C)=O.COc1ccc(CBr)cc1', 'CCOC(=O)CC(C)=O.COc1ccc(CCl)cc1', 'CCOC(=O)CC(C)=O.COc1ccc(C=O)cc1']"
31,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(Br)ccc1O</SMILES> Target product B: <SMILES>Brc1ccc2ocnc2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(Br)ccc1O</SMILES> Target product B: <SMILES>Brc1ccc2ocnc2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(Br)ccc1O</SMILES> Target product B: <SMILES>Brc1ccc2ocnc2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1cc(Br)ccc1O,Brc1ccc2ocnc2c1,"['Nc1cc(Br)ccc1O.O=C=O', 'Nc1cc(Br)ccc1O.[C-]#[N+]C(C)(C)C', 'FC(F)Cl.Nc1cc(Br)ccc1O', 'Nc1cc(Br)ccc1O.O=CO', 'CCOC(OCC)OCC.Nc1cc(Br)ccc1O', 'COC(OC)OC.Nc1cc(Br)ccc1O']"
32,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(N)=S</SMILES> Target product B: <SMILES>CCOC(=O)c1nc(N)sc1C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(N)=S</SMILES> Target product B: <SMILES>CCOC(=O)c1nc(N)sc1C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(N)=S</SMILES> Target product B: <SMILES>CCOC(=O)c1nc(N)sc1C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NC(N)=S,CCOC(=O)c1nc(N)sc1C,"['CCOC(=O)C(=O)C(C)Cl.NC(N)=S', 'CCOC(=O)CC(C)=O.NC(N)=S', 'CC=O.CCOC(=O)C(Cl)Cl.NC(N)=S', 'CCOC(=O)C(O)CC.NC(N)=S', 'CCOC(=O)C(=O)C(C)Br.NC(N)=S', 'CCOC(=O)C(Cl)C(C)=O.NC(N)=S']"
33,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1cc(OC)nc(N)n1</SMILES> Target product B: <SMILES>COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1cc(OC)nc(N)n1</SMILES> Target product B: <SMILES>COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1cc(OC)nc(N)n1</SMILES> Target product B: <SMILES>COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COc1cc(OC)nc(N)n1,COc1cc(OC)nc(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)n1,"['CN(S(C)(=O)=O)S(=O)(=O)NC(=O)SCc1ccccc1.COc1cc(OC)nc(N)n1', 'CN(S(C)(=O)=O)S(=O)(=O)NC(=O)N1CCOCC1.COc1cc(OC)nc(N)n1', 'COc1cc(OC)nc(N)n1.CSC(=O)NS(=O)(=O)N(C)S(C)(=O)=O', 'CNS(C)(=O)=O.COc1cc(OC)nc(N)n1.N#CO.[Na]', 'CCOC(=O)NS(=O)(=O)N(C)S(C)(=O)=O.COc1cc(OC)nc(N)n1', 'CNS(C)(=O)=O.COc1cc(OC)nc(N)n1.N#C[O-].O=S(=O)(Cl)Cl.[Na+]', 'CN(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)S(C)(=O)=O.COc1cc(OC)nc(N)n1']"
34,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)[C@@H]1C[C@@H](O)CN1.Cl</SMILES> Target product B: <SMILES>C=CCCC(C)C[C@@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)[C@@H]1C[C@@H](O)CN1.Cl</SMILES> Target product B: <SMILES>C=CCCC(C)C[C@@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)[C@@H]1C[C@@H](O)CN1.Cl</SMILES> Target product B: <SMILES>C=CCCC(C)C[C@@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COC(=O)[C@@H]1C[C@@H](O)CN1.Cl,C=CCCC(C)C[C@@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)OC,"['C=CCCC(C)C[C@@H](C)C(NC(=O)OC(C)(C)C)C(=O)O.COC(=O)[C@@H]1C[C@@H](O)CN1.Cl', 'C=CCCC(C)C[C@@H](COC)C(NC(=O)OC(C)(C)C)C(=O)O.CCN(C(C)C)C(C)C.CN(C)C(On1nnc2cccnc21)=[N+](C)C.COC(=O)[C@@H]1C[C@@H](O)CN1.Cl.F[P-](F)(F)(F)(F)F']"
35,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1</SMILES> Target product B: <SMILES>CC(C)(O)c1ncc(-c2cc(C3CCCO3)c(N)c([N+](=O)[O-])c2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1</SMILES> Target product B: <SMILES>CC(C)(O)c1ncc(-c2cc(C3CCCO3)c(N)c([N+](=O)[O-])c2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1</SMILES> Target product B: <SMILES>CC(C)(O)c1ncc(-c2cc(C3CCCO3)c(N)c([N+](=O)[O-])c2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1,CC(C)(O)c1ncc(-c2cc(C3CCCO3)c(N)c([N+](=O)[O-])c2)cn1,"['CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1.O=C(Nc1c(C2CCCO2)cc(Br)cc1[N+](=O)[O-])C(F)(F)F', 'CC(C)(O)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1.Nc1c(C2CCCO2)cc(Br)cc1[N+](=O)[O-]']"
36,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CN1CCOCC1</SMILES> Target product B: <SMILES>COc1nc(OC)nc([N+]2(C)CCOCC2)n1.[Cl-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CN1CCOCC1</SMILES> Target product B: <SMILES>COc1nc(OC)nc([N+]2(C)CCOCC2)n1.[Cl-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CN1CCOCC1</SMILES> Target product B: <SMILES>COc1nc(OC)nc([N+]2(C)CCOCC2)n1.[Cl-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CN1CCOCC1,COc1nc(OC)nc([N+]2(C)CCOCC2)n1.[Cl-],"['CN1CCOCC1.CO.Clc1nc(Cl)nc(Cl)n1', 'CN1CCOCC1.CO.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1nc(Cl)nc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1', 'CN1CCOCC1.COc1nc(Cl)nc(OC)n1', 'CN1CCOCC1.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1nc(Cl)nc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1']"
37,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)c1cc2ccccn2n1</SMILES> Target product B: <SMILES>CC(=O)c1c(C(C)C)nn2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)c1cc2ccccn2n1</SMILES> Target product B: <SMILES>CC(=O)c1c(C(C)C)nn2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)c1cc2ccccn2n1</SMILES> Target product B: <SMILES>CC(=O)c1c(C(C)C)nn2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)c1cc2ccccn2n1,CC(=O)c1c(C(C)C)nn2ccccc12,"['CC(C)c1cc2ccccn2n1.CN(C)C=O', 'CC(=O)Cl.CC(C)c1cc2ccccn2n1', 'CC(=O)OC(C)=O.CC(C)c1cc2ccccn2n1']"
38,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>ClP(Cl)Cl</SMILES> Target product B: <SMILES>ClP(Cl)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>ClP(Cl)Cl</SMILES> Target product B: <SMILES>ClP(Cl)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>ClP(Cl)Cl</SMILES> Target product B: <SMILES>ClP(Cl)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",ClP(Cl)Cl,ClP(Cl)c1ccccc1,"['ClP(Cl)Cl.c1ccccc1', 'ClP(Cl)Cl.ClP(c1ccccc1)c1ccccc1', 'ClP(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1']"
39,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCCCC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCCCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCCCC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCCCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCCCC1</SMILES> Target product B: <SMILES>COC(=O)C=C1CCCCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1CCCCC1,COC(=O)C=C1CCCCC1,"['COC(=O)CP(=O)(OC)OC.O=C1CCCCC1', 'CCOP(=O)(CC(=O)OC)OCC.O=C1CCCCC1', 'CCOP(=O)(CC(=O)OC)OCCc1ccccc1.O=C1CCCCC1', 'C=C(F)F.O=C1CCCCC1', 'COC(CCl)OC.O=C1CCCCC1', 'COC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C1CCCCC1.[Cl-]', 'COC(Cl)=C(Br)Br.O=C1CCCCC1', 'O=C1CCCCC1.[Cl-].[Li]C#COC', 'CCOC#C[Mg]Br.O=C1CCCCC1.[Cl-]', 'COC(=O)CBr.COC(=O)CC1=CCCCC1.O=C1CCCCC1', 'COP(=O)(O)C(C)(C)C(=O)[O-].O=C1CCCCC1', 'COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=C1CCCCC1']"
40,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[N-]=[N+]=[N-].[Na+]</SMILES> Target product B: <SMILES>[N-]=[N+]=NCc1ccc(C(=O)O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[N-]=[N+]=[N-].[Na+]</SMILES> Target product B: <SMILES>[N-]=[N+]=NCc1ccc(C(=O)O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[N-]=[N+]=[N-].[Na+]</SMILES> Target product B: <SMILES>[N-]=[N+]=NCc1ccc(C(=O)O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",[N-]=[N+]=[N-].[Na+],[N-]=[N+]=NCc1ccc(C(=O)O)cc1,"['O=C(O)c1ccc(CBr)cc1.[N-]=[N+]=[N-].[Na+]', 'O=C(O)c1ccc(CCl)cc1.[N-]=[N+]=[N-].[Na+]']"
41,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1Cl</SMILES> Target product B: <SMILES>O=C(O)CCCOc1ccccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1Cl</SMILES> Target product B: <SMILES>O=C(O)CCCOc1ccccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Oc1ccccc1Cl</SMILES> Target product B: <SMILES>O=C(O)CCCOc1ccccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Oc1ccccc1Cl,O=C(O)CCCOc1ccccc1Cl,"['O=C1CCCO1.Oc1ccccc1Cl', 'CCOC(=O)CCCBr.Oc1ccccc1Cl', 'O=C1CCCO1.Oc1ccccc1Cl.[Na]']"
42,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccn1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1ccccn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccn1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1ccccn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccccn1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1ccccn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1ccccn1,CC(C)(C)OC(=O)Nc1ccccn1,"['CC(C)(C)OC(=O)Oc1ccccc1.Nc1ccccn1', 'CC(C)(C)C(=O)Cl.Nc1ccccn1', 'CC(C)(C)OC(=O)Cl.Nc1ccccn1', 'Nc1ccccn1.O=CO', 'CC(C)(C)OC(=O)OC(C)(C)C.Nc1ccccn1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1ccccn1']"
43,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Clc1ccc2c(n1)N[C@H]1CCN2C1</SMILES> Target product B: <SMILES>O=C(Nc1ccccn1)N1c2nc(Cl)ccc2N2CC[C@H]1C2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Clc1ccc2c(n1)N[C@H]1CCN2C1</SMILES> Target product B: <SMILES>O=C(Nc1ccccn1)N1c2nc(Cl)ccc2N2CC[C@H]1C2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Clc1ccc2c(n1)N[C@H]1CCN2C1</SMILES> Target product B: <SMILES>O=C(Nc1ccccn1)N1c2nc(Cl)ccc2N2CC[C@H]1C2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Clc1ccc2c(n1)N[C@H]1CCN2C1,O=C(Nc1ccccn1)N1c2nc(Cl)ccc2N2CC[C@H]1C2,"['Clc1ccc2c(n1)N[C@H]1CCN2C1.O=C(Nc1ccccn1)Oc1ccccc1', 'Clc1ccc2c(n1)N[C@H]1CCN2C1.O=c1nc2ccccn2c(=O)n1-c1ccccn1']"
44,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(O)c(C#N)c1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(OC(C)C)c(C#N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(O)c(C#N)c1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(OC(C)C)c(C#N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(O)c(C#N)c1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(OC(C)C)c(C#N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COC(=O)c1ccc(O)c(C#N)c1,COC(=O)c1ccc(OC(C)C)c(C#N)c1,"['CC(C)I.COC(=O)c1ccc(O)c(C#N)c1', 'CC(C)Br.COC(=O)c1ccc(O)c(C#N)c1', 'COC(=O)c1ccc(O)c(C#N)c1.[2H]C([2H])([2H])C([2H])(Br)C([2H])([2H])[2H]', 'COC(=O)c1ccc(O)c(C#N)c1.[2H]C(C)(C)Br', 'C1CCOC1.COC(=O)c1ccc(O)c(C#N)c1', 'CC[Zn]CC.COC(=O)c1ccc(O)c(C#N)c1.ClCI', 'COC(=O)c1ccc(O)c(C#N)c1.O=C1CCC(=O)N1Cl']"
45,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>COC(=O)C=C1CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>COC(=O)C=C1CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>COC(=O)C=C1CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1CCC2(CC1)OCCO2,COC(=O)C=C1CCC2(CC1)OCCO2,"['COC(=O)CP(=O)(OC)OC.O=C1CCC2(CC1)OCCO2', 'COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=C1CCC2(CC1)OCCO2']"
46,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc([N+](=O)[O-])s1</SMILES> Target product B: <SMILES>O=C(O)c1ccc([N+](=O)[O-])s1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc([N+](=O)[O-])s1</SMILES> Target product B: <SMILES>O=C(O)c1ccc([N+](=O)[O-])s1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc([N+](=O)[O-])s1</SMILES> Target product B: <SMILES>O=C(O)c1ccc([N+](=O)[O-])s1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=Cc1ccc([N+](=O)[O-])s1,O=C(O)c1ccc([N+](=O)[O-])s1,"['O=Cc1ccc([N+](=O)[O-])s1.O=P([O-])(O)O.[Na+]', 'CC(C)=O.O=Cc1ccc([N+](=O)[O-])s1.O=S(=O)(O)O.O=[Cr](=O)=O']"
47,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1cnc(I)nc1</SMILES> Target product B: <SMILES>C=Cc1ncc(Br)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1cnc(I)nc1</SMILES> Target product B: <SMILES>C=Cc1ncc(Br)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1cnc(I)nc1</SMILES> Target product B: <SMILES>C=Cc1ncc(Br)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Brc1cnc(I)nc1,C=Cc1ncc(Br)cn1,"['Brc1cnc(I)nc1.C=C[Mg]Br', 'Brc1cnc(I)nc1.C=CB1OC(C)(C)C(C)(C)O1', 'Brc1cnc(I)nc1.C=C[Sn](CCCC)(CCCC)CCCC']"
48,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cc1ccc(O)cn1</SMILES> Target product B: <SMILES>Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cc1ccc(O)cn1</SMILES> Target product B: <SMILES>Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cc1ccc(O)cn1</SMILES> Target product B: <SMILES>Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Cc1ccc(O)cn1,Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1,"['Cc1ccc(O)cn1.O=S(=O)(N(c1ccc(Cl)cn1)S(=O)(=O)C(F)(F)F)C(F)(F)F', 'Cc1ccc(O)cn1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F', 'Cc1ccc(O)cn1.O=S(=O)(N(c1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F']"
49,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cn1cc(-c2ccc(NN)nn2)cn1</SMILES> Target product B: <SMILES>Cn1cc(-c2ccc3nnc(S)n3n2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cn1cc(-c2ccc(NN)nn2)cn1</SMILES> Target product B: <SMILES>Cn1cc(-c2ccc3nnc(S)n3n2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Cn1cc(-c2ccc(NN)nn2)cn1</SMILES> Target product B: <SMILES>Cn1cc(-c2ccc3nnc(S)n3n2)cn1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Cn1cc(-c2ccc(NN)nn2)cn1,Cn1cc(-c2ccc3nnc(S)n3n2)cn1,"['Cn1cc(-c2ccc(NN)nn2)cn1.S=C=S', 'Cn1cc(-c2ccc(NN)nn2)cn1.S=C(n1ccnc1)n1ccnc1']"
50,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NCCc1cccc(N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NCCc1cccc(N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)NCCc1cccc(N)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)OC(=O)OC(C)(C)C,CC(C)(C)OC(=O)NCCc1cccc(N)c1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCc1cccc(N)c1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CNCc1cccc([N+](=O)[O-])c1']"
51,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OB(O)c1ccccc1F</SMILES> Target product B: <SMILES>Fc1ccccc1-c1cccnc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OB(O)c1ccccc1F</SMILES> Target product B: <SMILES>Fc1ccccc1-c1cccnc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OB(O)c1ccccc1F</SMILES> Target product B: <SMILES>Fc1ccccc1-c1cccnc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",OB(O)c1ccccc1F,Fc1ccccc1-c1cccnc1,"['O=C(O)c1cccnc1.OB(O)c1ccccc1F', 'Brc1cccnc1.OB(O)c1ccccc1F', 'Ic1cccnc1.OB(O)c1ccccc1F']"
52,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(F)cnc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(F)cnc2Cl)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(F)cnc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(F)cnc2Cl)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(F)cnc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(F)cnc2Cl)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)c1cc(F)cnc1Cl,CC(C)(C)OC(=O)N1CCC(NC(=O)c2cc(F)cnc2Cl)CC1,"['CC(C)(C)OC(=O)N1CCC(N)CC1.O=C(O)c1cc(F)cnc1Cl', 'CC(C)(C)OC(=O)NN1CCC(N)CC1.O=C(O)c1cc(F)cnc1Cl']"
53,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccccc1</SMILES> Target product B: <SMILES>ON=Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccccc1</SMILES> Target product B: <SMILES>ON=Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccccc1</SMILES> Target product B: <SMILES>ON=Cc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=Cc1ccccc1,ON=Cc1ccccc1,"['C[Si](C)(C)NO[Si](C)(C)C.NO.O=Cc1ccccc1', 'Cl.NO.O=Cc1ccccc1', 'NO.O=Cc1ccccc1.O=S(=O)(O)O']"
54,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1</SMILES> Target product B: <SMILES>CCOC(=O)c1c[nH]cc1-c1ccc([N+](=O)[O-])cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1</SMILES> Target product B: <SMILES>CCOC(=O)c1c[nH]cc1-c1ccc([N+](=O)[O-])cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1</SMILES> Target product B: <SMILES>CCOC(=O)c1c[nH]cc1-c1ccc([N+](=O)[O-])cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1,CCOC(=O)c1c[nH]cc1-c1ccc([N+](=O)[O-])cc1,"['CCOC(=O)C=Cc1ccc([N+](=O)[O-])cc1.[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1', 'CCOC(=O)/C=C/c1ccc([N+](=O)[O-])cc1.[C-]#[N+]CS(=O)(=O)c1ccc(C)cc1']"
55,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC1CCCCC1=O</SMILES> Target product B: <SMILES>CCOC(=O)CC1CCCc2c1[nH]c1c(Br)cc(F)cc21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC1CCCCC1=O</SMILES> Target product B: <SMILES>CCOC(=O)CC1CCCc2c1[nH]c1c(Br)cc(F)cc21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)CC1CCCCC1=O</SMILES> Target product B: <SMILES>CCOC(=O)CC1CCCc2c1[nH]c1c(Br)cc(F)cc21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCOC(=O)CC1CCCCC1=O,CCOC(=O)CC1CCCc2c1[nH]c1c(Br)cc(F)cc21,"['CCOC(=O)CC1CCCCC1=O.NNc1ccc(F)cc1Br', 'CCOC(=O)CC1CCCCC1=O.Nc1ccc(F)cc1Br', 'CCOC(=O)CC1CCCCC1=O.[Cl-].[NH3+]Nc1ccc(F)cc1Br', 'CCOC(=O)CC1CCCCC1=O.Cl.NNc1ccc(F)cc1Br']"
56,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1</SMILES> Target product B: <SMILES>Cc1ncoc1-c1ccc(C(=O)N(C2CC2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1</SMILES> Target product B: <SMILES>Cc1ncoc1-c1ccc(C(=O)N(C2CC2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1</SMILES> Target product B: <SMILES>Cc1ncoc1-c1ccc(C(=O)N(C2CC2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1,Cc1ncoc1-c1ccc(C(=O)N(C2CC2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1,"['CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1.Cc1ncoc1-c1ccc(C(=O)O)cc1', 'CC(C)(C)OC(=O)N1CCC(NC2CC2)CC1.Cc1ncoc1-c1ccc(C(=O)Cl)cc1']"
57,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1CSCCN1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCSCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1CSCCN1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCSCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1CSCCN1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCSCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",C1CSCCN1,CC(C)(C)OC(=O)N1CCSCC1,"['C1CSCCN1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C', 'C1CSCCN1.CC(C)(C)OC(=O)OC(=O)OC(=O)[O-]']"
58,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccccn1</SMILES> Target product B: <SMILES>Brc1cccc(-c2ccccn2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccccn1</SMILES> Target product B: <SMILES>Brc1cccc(-c2ccccn2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccccn1</SMILES> Target product B: <SMILES>Brc1cccc(-c2ccccn2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Brc1ccccn1,Brc1cccc(-c2ccccn2)c1,"['Brc1ccccn1.CC1(C)OB(c2cccc(Br)c2)OC1(C)C', 'Brc1cccc(Br)c1.Brc1ccccn1', 'Brc1ccccn1.Oc1cccc(Br)c1', 'Brc1ccccn1.OB(O)c1ccccc1Br', 'Brc1ccccn1.OB(O)c1cccc(Br)c1', 'Brc1ccccn1.OB(O)Oc1cccc(Br)c1']"
59,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(O)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc(I)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(O)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc(I)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)N1CCC(O)CC1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCC(Oc2ccc(I)cc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)N1CCC(O)CC1,CC(C)(C)OC(=O)N1CCC(Oc2ccc(I)cc2)CC1,"['CC(C)(C)OC(=O)N1CCC(O)CC1.Oc1ccc(I)cc1', 'CC(C)(C)OC(=O)N1CCC(O)CC1.Fc1ccc(I)cc1']"
60,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC[C@H]1OC=C[C@@H](O)[C@@H]1O</SMILES> Target product B: <SMILES>CC(=O)OC[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC[C@H]1OC=C[C@@H](O)[C@@H]1O</SMILES> Target product B: <SMILES>CC(=O)OC[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>OC[C@H]1OC=C[C@@H](O)[C@@H]1O</SMILES> Target product B: <SMILES>CC(=O)OC[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",OC[C@H]1OC=C[C@@H](O)[C@@H]1O,CC(=O)OC[C@H]1OC=C[C@@H](OC(C)=O)[C@@H]1O,"['CC(=O)Cl.OC[C@H]1OC=C[C@@H](O)[C@@H]1O', 'CC(=O)OC(C)=O.OC[C@H]1OC=C[C@@H](O)[C@@H]1O', 'C=C(C)OC(C)=O.OC[C@H]1OC=C[C@@H](O)[C@@H]1O', 'C=COC(C)=O.OC[C@H]1OC=C[C@@H](O)[C@@H]1O']"
61,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccccc1B(O)O</SMILES> Target product B: <SMILES>O=c1[nH]c2ncccc2c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccccc1B(O)O</SMILES> Target product B: <SMILES>O=c1[nH]c2ncccc2c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccccc1B(O)O</SMILES> Target product B: <SMILES>O=c1[nH]c2ncccc2c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COC(=O)c1ccccc1B(O)O,O=c1[nH]c2ncccc2c2ccccc12,"['COC(=O)c1ccccc1B(O)O.Nc1ncccc1Br', 'COC(=O)c1ccccc1B(O)O.Nc1ncc(Br)cc1I']"
62,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COS(=O)(=O)OC</SMILES> Target product B: <SMILES>CN1CS(=O)c2cccc(Cl)c21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COS(=O)(=O)OC</SMILES> Target product B: <SMILES>CN1CS(=O)c2cccc(Cl)c21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COS(=O)(=O)OC</SMILES> Target product B: <SMILES>CN1CS(=O)c2cccc(Cl)c21</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COS(=O)(=O)OC,CN1CS(=O)c2cccc(Cl)c21,"['COS(=O)(=O)OC.COc1nc2c(Cl)cccc2s1', 'COS(=O)(=O)OC.O=S1C=Nc2c(Cl)cccc21']"
63,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CI</SMILES> Target product B: <SMILES>COC(=O)c1cc(C)cc(OC)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CI</SMILES> Target product B: <SMILES>COC(=O)c1cc(C)cc(OC)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CI</SMILES> Target product B: <SMILES>COC(=O)c1cc(C)cc(OC)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CI,COC(=O)c1cc(C)cc(OC)c1,"['CI.Cc1cc(O)cc(C(=O)O)c1', 'CI.COC(=O)c1cc(C)cc(O)c1', 'CI.CN(C)c1ccccn1.Cc1cc(O)cc(C(=O)O)c1']"
64,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(N)c(C)c1</SMILES> Target product B: <SMILES>COc1ccc(NC(=O)OC(C)(C)C)c(C)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(N)c(C)c1</SMILES> Target product B: <SMILES>COc1ccc(NC(=O)OC(C)(C)C)c(C)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(N)c(C)c1</SMILES> Target product B: <SMILES>COc1ccc(NC(=O)OC(C)(C)C)c(C)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COc1ccc(N)c(C)c1,COc1ccc(NC(=O)OC(C)(C)C)c(C)c1,"['CC(C)(C)OC(=O)Cl.COc1ccc(N)c(C)c1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.COc1ccc(N)c(C)c1', 'CC(C)(C)OC(=O)OC(=O)[O-].COc1ccc(N)c(C)c1']"
65,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(F)ccc1F</SMILES> Target product B: <SMILES>Nc1cc(F)c(Br)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(F)ccc1F</SMILES> Target product B: <SMILES>Nc1cc(F)c(Br)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cc(F)ccc1F</SMILES> Target product B: <SMILES>Nc1cc(F)c(Br)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1cc(F)ccc1F,Nc1cc(F)c(Br)cc1F,"['BrBr.Nc1cc(F)ccc1F', 'Nc1cc(F)ccc1F.O=C1CCC(=O)N1Br']"
66,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCN</SMILES> Target product B: <SMILES>CCNCc1ccc2nc(C)[nH]c(=O)c2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCN</SMILES> Target product B: <SMILES>CCNCc1ccc2nc(C)[nH]c(=O)c2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCN</SMILES> Target product B: <SMILES>CCNCc1ccc2nc(C)[nH]c(=O)c2c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCN,CCNCc1ccc2nc(C)[nH]c(=O)c2c1,"['CCN.Cc1nc(=O)c2cc(CBr)ccc2[nH]1', 'CCN.Cc1nc2ccccc2c(=O)n1CBr', 'CCN.Cc1nc2ccc(CBr)cc2c(=O)[nH]1']"
67,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCCC(=O)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCCC(=O)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1CCCC(=O)C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)OC(=O)OC(C)(C)C,CC(C)(C)OC(=O)N1CCCC(=O)C1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.OC1(O)CCCN(Cc2ccccc2)C1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.O=C1CCCN(Cc2ccccc2)C1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Oc1cccnc1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.O=C1CCCNC1', 'Br.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.OC1(O)CCCN(Cc2ccccc2)C1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.OC1CCCNC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C1CCCN(Cc2ccccc2)C1']"
68,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C1COCCN1</SMILES> Target product B: <SMILES>O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)N1CCOCC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",C1COCCN1,O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)N1CCOCC1,"['C1COCCN1.O=C(O)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1', 'C1COCCN1.O=C(Cl)c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1']"
69,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)CCc1ccc(O)cc1</SMILES> Target product B: <SMILES>COC(=O)CCc1ccc(O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)CCc1ccc(O)cc1</SMILES> Target product B: <SMILES>COC(=O)CCc1ccc(O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)CCc1ccc(O)cc1</SMILES> Target product B: <SMILES>COC(=O)CCc1ccc(O)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)CCc1ccc(O)cc1,COC(=O)CCc1ccc(O)cc1,"['COC(OC)OC.O=C(O)CCc1ccc(O)cc1', 'COC(=O)OC.O=C(O)CCc1ccc(O)cc1', 'C=[N+]=[N-].O=C(O)CCc1ccc(O)cc1', 'CO.O=C(O)CCc1ccc(O)cc1', 'CI.O=C(O)CCc1ccc(O)cc1', 'C1COCCO1.Cl.O=C(O)CCc1ccc(O)cc1']"
70,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC1CC(=O)CCN1</SMILES> Target product B: <SMILES>CC1CC(=O)CCN1C(=O)OC(C)(C)C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC1CC(=O)CCN1</SMILES> Target product B: <SMILES>CC1CC(=O)CCN1C(=O)OC(C)(C)C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC1CC(=O)CCN1</SMILES> Target product B: <SMILES>CC1CC(=O)CCN1C(=O)OC(C)(C)C</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC1CC(=O)CCN1,CC1CC(=O)CCN1C(=O)OC(C)(C)C,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC1CC(=O)CCN1', 'CC(C)(C)OOC(=O)OC(=O)OOC(C)(C)C.CC1CC(=O)CCN1']"
71,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>OC1(c2ncccn2)CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>OC1(c2ncccn2)CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C1CCC2(CC1)OCCO2</SMILES> Target product B: <SMILES>OC1(c2ncccn2)CCC2(CC1)OCCO2</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C1CCC2(CC1)OCCO2,OC1(c2ncccn2)CCC2(CC1)OCCO2,"['CCCC[Sn](CCCC)(CCCC)c1ncccn1.O=C1CCC2(CC1)OCCO2', 'O=C1CCC2(CC1)OCCO2.[SnH3]c1ncccn1', 'Brc1ncccn1.O=C1CCC2(CC1)OCCO2']"
72,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)c1cc(Cl)ccc1[N+](=O)[O-],COC(=O)c1cc(Cl)ccc1[N+](=O)[O-],"['CI.O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]', 'CO.O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]', 'C=[N+]=[N-].O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]', 'COS(=O)(=O)OC.O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]']"
73,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1cn[nH]c1</SMILES> Target product B: <SMILES>c1cnc(N2CCN(CCCCn3cccn3)CC2)nc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1cn[nH]c1</SMILES> Target product B: <SMILES>c1cnc(N2CCN(CCCCn3cccn3)CC2)nc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>c1cn[nH]c1</SMILES> Target product B: <SMILES>c1cnc(N2CCN(CCCCn3cccn3)CC2)nc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",c1cn[nH]c1,c1cnc(N2CCN(CCCCn3cccn3)CC2)nc1,"['[Br-].c1cn[nH]c1.c1cnc(N2CC[N+]3(CCCC3)CC2)nc1', 'BrCCCCN1CCN(c2ncccn2)CC1.c1cn[nH]c1']"
74,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C1CCNCC1</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(Cc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C1CCNCC1</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(Cc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CCOC(=O)C1CCNCC1</SMILES> Target product B: <SMILES>CCOC(=O)C1CCN(Cc2ccccc2)CC1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CCOC(=O)C1CCNCC1,CCOC(=O)C1CCN(Cc2ccccc2)CC1,"['CCOC(=O)C1CCNCC1.O=Cc1ccccc1', 'CCOC(=O)C1CCNCC1.CCOC(=O)c1ccccc1', 'CCOC(=O)C1CCNCC1.ClCc1ccccc1', 'BrCc1ccccc1.CCOC(=O)C1CCNCC1', 'CCOC(=O)C1CCNCC1.Cc1ccccc1Br', 'CCOC(=O)C1CCNCC1.OCc1ccccc1', 'CCOC(=O)C1CCNCC1.c1ccc(COP2N(c3ccccc3)CCN2c2ccccc2)cc1', 'CCOC(=O)C1CCNCC1.O=C(Cl)c1ccccc1', 'CCOC(=O)C1CCNCC1.O=C(O)c1ccccc1']"
75,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1Cc2ccc([N+](=O)[O-])cc2C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1Cc2ccc([N+](=O)[O-])cc2C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)OC(=O)OC(C)(C)C</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N1Cc2ccc([N+](=O)[O-])cc2C1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)OC(=O)OC(C)(C)C,CC(C)(C)OC(=O)N1Cc2ccc([N+](=O)[O-])cc2C1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])O.O=[N+]([O-])c1ccc2c(c1)CNC2', 'Br.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])c1ccc2c(c1)CNC2', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.c1ccc2c(c1)CNC2', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=[N+]([O-])c1ccc2c(c1)CNC2', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C(N1Cc2ccc([N+](=O)[O-])cc2C1)C(F)(F)F']"
76,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1Br</SMILES> Target product B: <SMILES>CCOP(=O)(Cc1ccccc1Br)OCC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1Br</SMILES> Target product B: <SMILES>CCOP(=O)(Cc1ccccc1Br)OCC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>BrCc1ccccc1Br</SMILES> Target product B: <SMILES>CCOP(=O)(Cc1ccccc1Br)OCC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",BrCc1ccccc1Br,CCOP(=O)(Cc1ccccc1Br)OCC,"['BrCc1ccccc1Br.CCO[PH](=O)OCC', 'BrCc1ccccc1Br.CCOP(OCC)OCC', 'BrCc1ccccc1Br.CCOP([O-])OCC']"
77,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(N)=O</SMILES> Target product B: <SMILES>CC(C)N1C(=O)CC(=O)NC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(N)=O</SMILES> Target product B: <SMILES>CC(C)N1C(=O)CC(=O)NC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(N)=O</SMILES> Target product B: <SMILES>CC(C)N1C(=O)CC(=O)NC1=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)NC(N)=O,CC(C)N1C(=O)CC(=O)NC1=O,"['CC(C)NC(N)=O.CCOC(=O)CC(=O)OCC', 'CC(C)N1C(=O)CC(=O)NC1=O.CC(C)NC(N)=O', 'CC(C)NC(N)=O.O=C(O)CC(=O)O', 'CC(C)NC(N)=O.CCOC(=O)CC(=O)OCC.[Na]', 'CC(C)NC(N)=O.COC(=O)CC(=O)OC']"
78,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCCCc1nc(C=O)c(Cl)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCCCc1nc(C=O)c(Cl)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCCCc1nc(C=O)c(Cl)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=P(Cl)(Cl)Cl,CCCCc1nc(C=O)c(Cl)[nH]1,"['CCCCC1=NC(=CN(C)C)C(=O)N1.O=P(Cl)(Cl)Cl', 'CCCCC(=N)OC.COC(=O)CN.COC(OC)N(C)C.Cl.O=P(Cl)(Cl)Cl']"
79,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(=O)CC[C@H](N)C(=O)O</SMILES> Target product B: <SMILES>C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(=O)CC[C@H](N)C(=O)O</SMILES> Target product B: <SMILES>C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>NC(=O)CC[C@H](N)C(=O)O</SMILES> Target product B: <SMILES>C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",NC(=O)CC[C@H](N)C(=O)O,C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O,"['C[C@H](N)C(=O)O.NC(=O)CC[C@H](N)C(=O)O', 'COC(=O)[C@H](C)N.Cl.NC(=O)CC[C@H](N)C(=O)O', 'C[C@@H](Br)C(=O)O.NC(=O)CC[C@H](N)C(=O)O', 'C[C@@H](Cl)C(=O)O.NC(=O)CC[C@H](N)C(=O)O', 'C[C@H](NC(=O)OCc1ccccc1)C(=O)O.NC(=O)CC[C@H](N)C(=O)O', 'C[C@H](NC(=O)OC(C)(C)C)C(=O)O.NC(=O)CC[C@H](N)C(=O)O', 'CC(C)OP(=O)(N[C@@H](C)C(=O)O)OC(C)C.NC(=O)CC[C@H](N)C(=O)O', 'COP(=O)(N[C@@H](C)C(=O)O)OC.NC(=O)CC[C@H](N)C(=O)O', 'CCOP(=O)(N[C@@H](C)C(=O)O)OCC.NC(=O)CC[C@H](N)C(=O)O', 'C[C@H](N)C(=O)[O-].NC(=O)CC[C@H](N)C(=O)O', 'C[C@H](N)C(N)=O.NC(=O)CC[C@H](N)C(=O)O', 'COC(=O)[C@@H](C)N.Cl.NC(=O)CC[C@H](N)C(=O)O', 'COC(=O)[C@H](C)N.NC(=O)CC[C@H](N)C(=O)O', 'C[C@@H](C(=O)Cl)N1C(=O)c2ccccc2C1=O.NC(=O)CC[C@H](N)C(=O)O', 'C[C@@H](Br)C(=O)Cl.NC(=O)CC[C@H](N)C(=O)O', 'C[C@@H](O)C(=O)Cl.NC(=O)CC[C@H](N)C(=O)O', 'Cc1ccc(S(=O)(=O)O[C@H](C)C(=O)Cl)cc1.NC(=O)CC[C@H](N)C(=O)O', 'C[C@H](NC(=O)C(C)(C)C)C(=O)O.NC(=O)CC[C@H](N)C(=O)O']"
80,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Br)ccc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1cc(Br)ccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Br)ccc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1cc(Br)ccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Br)ccc1Cl</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)c1cc(Br)ccc1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)c1cc(Br)ccc1Cl,CC(C)(C)OC(=O)c1cc(Br)ccc1Cl,"['CC(C)(C)O.O=C(O)c1cc(Br)ccc1Cl', 'C=C(C)C.O=C(O)c1cc(Br)ccc1Cl', 'CC(C)(C)[O-].O=C(O)c1cc(Br)ccc1Cl.[K+]']"
81,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ncnc(C(F)(F)F)c1Br</SMILES> Target product B: <SMILES>COc1ncnc(C(F)(F)F)c1C=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ncnc(C(F)(F)F)c1Br</SMILES> Target product B: <SMILES>COc1ncnc(C(F)(F)F)c1C=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ncnc(C(F)(F)F)c1Br</SMILES> Target product B: <SMILES>COc1ncnc(C(F)(F)F)c1C=O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COc1ncnc(C(F)(F)F)c1Br,COc1ncnc(C(F)(F)F)c1C=O,"['CN(C)C=O.COc1ncnc(C(F)(F)F)c1Br', 'CCOC=O.COc1ncnc(C(F)(F)F)c1Br']"
82,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1Br</SMILES> Target product B: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1-c1c(OC)cccc1OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1Br</SMILES> Target product B: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1-c1c(OC)cccc1OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1Br</SMILES> Target product B: <SMILES>COC(=O)c1cc([N+](=O)[O-])ccc1-c1c(OC)cccc1OC</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COC(=O)c1cc([N+](=O)[O-])ccc1Br,COC(=O)c1cc([N+](=O)[O-])ccc1-c1c(OC)cccc1OC,"['COC(=O)c1cc([N+](=O)[O-])ccc1Br.COc1cccc(OC)c1', 'COC(=O)c1cc([N+](=O)[O-])ccc1Br.COc1cccc(OC)c1B(O)O']"
83,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1O</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1O</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=C(O)c1cc(Cl)ccc1O</SMILES> Target product B: <SMILES>COC(=O)c1cc(Cl)ccc1O</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=C(O)c1cc(Cl)ccc1O,COC(=O)c1cc(Cl)ccc1O,"['CI.Cc1cc(O)cc(C(=O)O)c1', 'CO.O=C(O)c1cc(Cl)ccc1O', 'CC(=O)Cl.O=C(O)c1cc(Cl)ccc1O']"
84,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCOC(=O)c1cnc2ccc(F)cc2c1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCOC(=O)c1cnc2ccc(F)cc2c1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=P(Cl)(Cl)Cl</SMILES> Target product B: <SMILES>CCOC(=O)c1cnc2ccc(F)cc2c1Cl</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=P(Cl)(Cl)Cl,CCOC(=O)c1cnc2ccc(F)cc2c1Cl,"['CCOC(=O)c1cc2cc(F)ccc2nc1O.O=P(Cl)(Cl)Cl', 'CCOC(=O)c1cnc2ccc(F)cc2c1O.O=P(Cl)(Cl)Cl']"
85,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl</SMILES> Target product B: <SMILES>CN1C(=O)C(C(=O)Nc2ccc(Cl)cc2Oc2c(Cl)cccc2Cl)C(=O)N(C)C1=S</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl</SMILES> Target product B: <SMILES>CN1C(=O)C(C(=O)Nc2ccc(Cl)cc2Oc2c(Cl)cccc2Cl)C(=O)N(C)C1=S</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl</SMILES> Target product B: <SMILES>CN1C(=O)C(C(=O)Nc2ccc(Cl)cc2Oc2c(Cl)cccc2Cl)C(=O)N(C)C1=S</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl,CN1C(=O)C(C(=O)Nc2ccc(Cl)cc2Oc2c(Cl)cccc2Cl)C(=O)N(C)C1=S,"['CCOC(=O)C1C(=O)N(C)C(=S)N(C)C1=O.Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl', 'CCOC(=O)Cl.CN1C(=O)CC(=O)N(C)C1=S.Nc1ccc(Cl)cc1Oc1c(Cl)cccc1Cl']"
86,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=c1cc[nH]c(=O)[nH]1</SMILES> Target product B: <SMILES>O=c1[nH]cc(C(F)(F)F)c(=O)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=c1cc[nH]c(=O)[nH]1</SMILES> Target product B: <SMILES>O=c1[nH]cc(C(F)(F)F)c(=O)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=c1cc[nH]c(=O)[nH]1</SMILES> Target product B: <SMILES>O=c1[nH]cc(C(F)(F)F)c(=O)[nH]1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=c1cc[nH]c(=O)[nH]1,O=c1[nH]cc(C(F)(F)F)c(=O)[nH]1,"['FC(F)(F)I.O=c1cc[nH]c(=O)[nH]1', 'O=S(O)C(F)(F)F.O=c1cc[nH]c(=O)[nH]1.[Na]', 'O=S(O)C(F)(F)F.O=c1cc[nH]c(=O)[nH]1.[Zn]', 'O=C(O)C(F)(F)F.O=c1cc[nH]c(=O)[nH]1.[Na]', 'CN(C)C(=N)N(C)C.FC(F)(F)I.O=c1cc[nH]c(=O)[nH]1', 'FC(F)(F)Br.O=c1cc[nH]c(=O)[nH]1', 'O=S(=O)([O-])C(F)(F)F.O=[N+]([O-])c1cccc([S+](c2ccc(F)cc2)C(F)(F)F)c1.O=c1cc[nH]c(=O)[nH]1', 'FC(F)(F)[Hg]C(F)(F)F.O=c1cc[nH]c(=O)[nH]1', 'CC(C)(C)OC(=O)NNS(=O)(=O)C(F)(F)F.O=c1cc[nH]c(=O)[nH]1', 'O=S([O-])C(F)(F)F.O=c1cc[nH]c(=O)[nH]1.[Na+]']"
87,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(F)c(Br)n1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(F)c(-c2c(F)cc(C(C)(C)O)cc2F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(F)c(Br)n1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(F)c(-c2c(F)cc(C(C)(C)O)cc2F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COC(=O)c1ccc(F)c(Br)n1</SMILES> Target product B: <SMILES>COC(=O)c1ccc(F)c(-c2c(F)cc(C(C)(C)O)cc2F)n1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COC(=O)c1ccc(F)c(Br)n1,COC(=O)c1ccc(F)c(-c2c(F)cc(C(C)(C)O)cc2F)n1,"['CC(C)[Si](OC(C)(C)c1cc(F)cc(F)c1)(C(C)C)C(C)C.COC(=O)c1ccc(F)c(Br)n1', 'CC(C)[Si](OC(C)(C)c1cc(F)c(B2OC(C)(C)C(C)(C)O2)c(F)c1)(C(C)C)C(C)C.COC(=O)c1ccc(F)c(Br)n1', 'CC(C)(O)c1cc(F)c(B2OC(C)(C)C(C)(C)O2)c(F)c1.COC(=O)c1ccc(F)c(Br)n1']"
88,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(F)c2ccccc12</SMILES> Target product B: <SMILES>O=Cc1ccc(Oc2ccccc2Cl)c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(F)c2ccccc12</SMILES> Target product B: <SMILES>O=Cc1ccc(Oc2ccccc2Cl)c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(F)c2ccccc12</SMILES> Target product B: <SMILES>O=Cc1ccc(Oc2ccccc2Cl)c2ccccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=Cc1ccc(F)c2ccccc12,O=Cc1ccc(Oc2ccccc2Cl)c2ccccc12,"['O=Cc1ccc(F)c2ccccc12.Oc1ccccc1Cl', 'O=Cc1ccc(F)c2ccccc12.Oc1cccc(Cl)c1']"
89,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cccc2ncccc12</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1cccc2ncccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cccc2ncccc12</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1cccc2ncccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1cccc2ncccc12</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)Nc1cccc2ncccc12</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1cccc2ncccc12,CC(C)(C)OC(=O)Nc1cccc2ncccc12,"['CC(C)(C)OC(=O)OC(C)(C)C.Nc1cccc2ncccc12', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1cccc2ncccc12']"
90,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1c(O)cccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>Nc1c(OCC2CO2)cccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1c(O)cccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>Nc1c(OCC2CO2)cccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1c(O)cccc1[N+](=O)[O-]</SMILES> Target product B: <SMILES>Nc1c(OCC2CO2)cccc1[N+](=O)[O-]</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1c(O)cccc1[N+](=O)[O-],Nc1c(OCC2CO2)cccc1[N+](=O)[O-],"['Nc1c(O)cccc1[N+](=O)[O-].O=[N+]([O-])c1cccc(S(=O)(=O)OC[C@@H]2CO2)c1', 'Cc1ccc(S(=O)(=O)OC[C@@H]2CO2)cc1.Nc1c(O)cccc1[N+](=O)[O-]', 'Nc1c(O)cccc1[N+](=O)[O-].OC[C@@H]1CO1', 'BrCC1CO1.Nc1c(O)cccc1[N+](=O)[O-]', 'Cc1ccc(S(=O)(=O)OC[C@H]2CO2)cc1.Nc1c(O)cccc1[N+](=O)[O-]', 'Cc1ccc(S(=O)(=O)OCC2CO2)cc1.Nc1c(O)cccc1[N+](=O)[O-]']"
91,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(C)C</SMILES> Target product B: <SMILES>CCS(=O)(=O)Oc1ccc(C)cc1C(CCN(C(C)C)C(C)C)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(C)C</SMILES> Target product B: <SMILES>CCS(=O)(=O)Oc1ccc(C)cc1C(CCN(C(C)C)C(C)C)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)NC(C)C</SMILES> Target product B: <SMILES>CCS(=O)(=O)Oc1ccc(C)cc1C(CCN(C(C)C)C(C)C)c1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)NC(C)C,CCS(=O)(=O)Oc1ccc(C)cc1C(CCN(C(C)C)C(C)C)c1ccccc1,"['CC(C)NC(C)C.CCS(=O)(=O)Oc1ccc(C)cc1C(CCI)c1ccccc1', 'CC(C)NC(C)C.CCS(=O)(=O)Oc1ccc(C)cc1C(CCC(C)S(=O)(=O)[O-])c1ccccc1']"
92,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(CCO)cc1</SMILES> Target product B: <SMILES>COc1ccc(CCCl)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(CCO)cc1</SMILES> Target product B: <SMILES>COc1ccc(CCCl)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>COc1ccc(CCO)cc1</SMILES> Target product B: <SMILES>COc1ccc(CCCl)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",COc1ccc(CCO)cc1,COc1ccc(CCCl)cc1,"['COc1ccc(CCO)cc1.O=C(Cl)Cl', 'COc1ccc(CCO)cc1.O=S(Cl)Cl']"
93,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(O)cc1</SMILES> Target product B: <SMILES>O=Cc1ccc(OC2CCCC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(O)cc1</SMILES> Target product B: <SMILES>O=Cc1ccc(OC2CCCC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=Cc1ccc(O)cc1</SMILES> Target product B: <SMILES>O=Cc1ccc(OC2CCCC2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=Cc1ccc(O)cc1,O=Cc1ccc(OC2CCCC2)cc1,"['BrC1CCCC1.O=Cc1ccc(O)cc1', 'O=Cc1ccc(O)cc1.OC1CCCC1']"
94,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(F)c(F)c1</SMILES> Target product B: <SMILES>CC(=O)Nc1ccc(F)c(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(F)c(F)c1</SMILES> Target product B: <SMILES>CC(=O)Nc1ccc(F)c(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Nc1ccc(F)c(F)c1</SMILES> Target product B: <SMILES>CC(=O)Nc1ccc(F)c(F)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Nc1ccc(F)c(F)c1,CC(=O)Nc1ccc(F)c(F)c1,"['CC(=O)OC(C)=O.Nc1ccc(F)c(F)c1', 'CC(=O)Cl.Nc1ccc(F)c(F)c1']"
95,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)NOCc1ccccc1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N(CCCCC#N)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)NOCc1ccccc1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N(CCCCC#N)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)(C)OC(=O)NOCc1ccccc1</SMILES> Target product B: <SMILES>CC(C)(C)OC(=O)N(CCCCC#N)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)(C)OC(=O)NOCc1ccccc1,CC(C)(C)OC(=O)N(CCCCC#N)OCc1ccccc1,"['CC(C)(C)OC(=O)NOCc1ccccc1.N#CCCCCCl', 'CC(C)(C)OC(=O)NOCc1ccccc1.CC(Cl)CCC#N']"
96,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>O=[N+]([O-])c1ccc(OCCN2CCOCC2)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>O=[N+]([O-])c1ccc(OCCN2CCOCC2)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>O=[N+]([O-])c1ccc(O)cc1F</SMILES> Target product B: <SMILES>O=[N+]([O-])c1ccc(OCCN2CCOCC2)cc1F</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",O=[N+]([O-])c1ccc(O)cc1F,O=[N+]([O-])c1ccc(OCCN2CCOCC2)cc1F,"['Cl.ClCCN1CCOCC1.O=[N+]([O-])c1ccc(O)cc1F', 'ClCCN1CCOCC1.O=[N+]([O-])c1ccc(O)cc1F', 'O=[N+]([O-])c1ccc(O)cc1F.OCCN1CCOCC1']"
97,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C#CCOC</SMILES> Target product B: <SMILES>COCC#Cc1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C#CCOC</SMILES> Target product B: <SMILES>COCC#Cc1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>C#CCOC</SMILES> Target product B: <SMILES>COCC#Cc1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",C#CCOC,COCC#Cc1cnc2c(ccn2S(=O)(=O)c2ccccc2)c1,"['C#CCOC.O=S(=O)(c1ccccc1)n1ccc2cc(I)cnc21', 'C#CCOC.O=S(=O)(c1ccccc1)n1ccc2cc(Br)cnc21']"
98,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccc(I)cc1</SMILES> Target product B: <SMILES>Brc1ccc(-c2cccnc2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccc(I)cc1</SMILES> Target product B: <SMILES>Brc1ccc(-c2cccnc2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>Brc1ccc(I)cc1</SMILES> Target product B: <SMILES>Brc1ccc(-c2cccnc2)cc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",Brc1ccc(I)cc1,Brc1ccc(-c2cccnc2)cc1,"['Brc1ccc(I)cc1.OB(O)c1cccnc1', 'Brc1ccc(I)cc1.CC1(C)OB(c2cccnc2)OC1(C)C', 'Brc1ccc(I)cc1.c1cncc(B2OCCCO2)c1', 'Brc1ccc(I)cc1.Brc1cccnc1']"
99,"Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O</SMILES> Target product B: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. The final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.
No explanations and other information. Only return the answer in the specified format. ","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O</SMILES> Target product B: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A. - The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. You may think step by step, and the final answer should be formatted as follows: Reactant Set 1: <SMILES>[valid_SMILES_1]</SMILES>; Reactant Set 2: <SMILES>[valid_SMILES_2]</SMILES>.","Chemical Reasoning Task: Identify two distinct reactant pathways containing compound A that both synthesize target molecule B. Given: Initial reactant A: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O</SMILES> Target product B: <SMILES>CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OCc1ccccc1</SMILES> Requirements: 1. Provide TWO different reactant sets that EACH: - Contain compound A.- The product B is formed in both cases. - Exclude solvents, catalysts, or other non-reactants. 2. Formatting rules: - Multiple reactants in a set separated by ""."". - Use SMILES. ",CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O,CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OCc1ccccc1,"['CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O.Cc1ccc(S(=O)(=O)O)cc1.NCC(=O)OCc1ccccc1', 'CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O.NCC(=O)OCc1ccccc1', 'CC(C)(C)OC(=O)NCC(=O)OCc1ccccc1.CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O', 'CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)O.Cl.NCC(=O)OCc1ccccc1']"
|