ID,Question_std,Question_cot,Question_chem,B,Answer 0,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(CNc2ncccn2)c(OC)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(CNc2ncccn2)c(OC)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(CNc2ncccn2)c(OC)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1ccc(CNc2ncccn2)c(OC)c1,"['COc1ccc(C=O)c(OC)c1.Nc1ncccn1', 'COc1ccc(CN)c(OC)c1.Clc1ncccn1']" 1,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(C)c2c1C=CC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(C)c2c1C=CC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(C)c2c1C=CC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1ccc(C)c2c1C=CC2,"['C1=CCC=C1.CC(=O)CCC(C)=O.[Na]', 'Cc1ccc(C)c2c1CCC2=O', 'CC(=O)CCC(C)=O.Cc1ccc(C)c2c1C=CC2', 'Cc1ccc(C)c2c1CCC2O', 'Cc1ccc(S(=O)(=O)O)cc1', 'C1=CCC=C1.CC(=O)CCC(C)=O.O', 'C1=CCC=C1.CC(=O)CCC(C)=O']" 2,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(CO)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(CO)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(CO)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)N1CCC(CO)CC1,"['COC(=O)C1CCN(C(=O)OC(C)(C)C)CC1', 'CC(C)(C)OC(=O)N1CCC(COc2ccc(O)cc2)CC1', 'CCOC(=O)C1CCN(C(=O)OC(C)(C)C)CC1', 'B.C1CCOC1.CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1', 'CC(C)(C)OC(=O)N1CCC(C=O)CC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.OCC1CCNCC1', 'CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.O=C(O)C1CCNCC1']" 3,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(Cl)ccc1C(C)=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(Cl)ccc1C(C)=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(Cl)ccc1C(C)=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1cc(Cl)ccc1C(C)=O,"['CC(=O)c1ccc(Cl)cc1O.CI', 'C=COCCCC.COc1cc(Cl)ccc1I', 'CC(=O)c1ccc(Cl)cc1.CO', 'CC1O[Pd]23OC(C)=O->[Pd]4(OC(C)=O->[Pd](O/C(C)=O->4)(<-O=1)<-O=C(/C)O2)<-O=C(/C)O3.COc1cc(Cl)ccc1I', 'COc1cc(N)ccc1C(C)=O.Cl[Cu]', 'COc1cc(Cl)ccc1C(=O)N(C)OC.C[Mg]Br', 'CC(=O)c1ccc(O)cc1Cl.CI', 'CC(=O)c1ccc(Cl)cc1O.CO', 'CC(=O)c1ccc(Cl)cc1O.CI.[Na]', 'CC(=O)c1ccc(Cl)cc1O.COS(=O)(=O)OC']" 4,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(CBr)Nc1ccc(F)cc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(CBr)Nc1ccc(F)cc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(CBr)Nc1ccc(F)cc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(CBr)Nc1ccc(F)cc1F,"['Nc1ccc(F)cc1F.O=C(O)CBr', 'Nc1ccc(F)cc1F.O=C(Cl)CBr', 'Nc1ccc(F)cc1F.O=C(Br)CBr', 'Nc1ccc(F)cc1F']" 5,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCSc1ccc(Br)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCSc1ccc(Br)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCSc1ccc(Br)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCSc1ccc(Br)cn1,"['CC[S-].Clc1ccc(Br)cn1.[Na+]', 'Brc1ccc(Br)nc1.CC[S-].[Na+]', 'Brc1ccc(Br)nc1.CCS', 'Brc1ccc(Br)nc1.CCS.[Na]', 'CCS.Clc1ccc(Br)cn1.[Na]', 'Brc1ccc(SSc2ccc(Br)cn2)nc1.CCBr']" 6,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C(CC(C)C)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C(CC(C)C)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C(CC(C)C)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOC(=O)C(CC(C)C)C(=O)O,"['CCOC(=O)C(CC(C)C)C(=O)OCC', 'CCOC(=O)C(CC(C)C)C(=O)OC']" 7,"Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1-c1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1-c1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1-c1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",C=Cc1ccccc1-c1ccccc1,"['CC(C)(C)[O-].O=Cc1ccc(-c2ccccc2)cc1.[K+]', 'CC(C)(C)[O-].O=Cc1ccccc1-c1ccccc1.[K+]', 'C=C(CCCCN1C(=O)c2ccccc2C1=O)O[n+]1ccccc1.C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccccc1-c1ccccc1.[Br-]', 'Brc1ccccc1-c1ccccc1.C=CB1OB(C=C)OB(C=C)O1.c1ccncc1', 'Brc1ccccc1-c1ccccc1.C=C[Sn](CCCC)(CCCC)CCCC', 'CC(O)c1ccccc1-c1ccccc1', 'Br[Mg]c1ccccc1.C=Cc1ccccc1Cl', 'C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccccc1Br.OB(O)c1ccccc1.[Br-]', 'C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccccc1-c1ccccc1.[I-]', 'C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccccc1-c1ccccc1.[Br-]', 'C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=Cc1ccccc1-c1ccccc1.[Cl-]']" 8,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1noc(-c2ccc(C(=O)O)cc2)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1noc(-c2ccc(C(=O)O)cc2)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1noc(-c2ccc(C(=O)O)cc2)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1noc(-c2ccc(C(=O)O)cc2)n1,"['CC(=N)NO.COC(=O)c1ccc(C(=O)O)cc1', 'COC(=O)c1ccc(-c2nc(C)no2)cc1']" 9,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1CNc2ccccc2N1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1CNc2ccccc2N1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1CNc2ccccc2N1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C1CNc2ccccc2N1,"['COC(=O)CNc1ccccc1[N+](=O)[O-]', 'CCOC(=O)CBr.Nc1ccccc1N', 'c1ccc2nccnc2c1', 'Nc1ccccc1N.O=C(O)CCl', 'CCOC(=O)CNc1ccccc1[N+](=O)[O-]', 'O=C(O)CNc1ccccc1[N+](=O)[O-]']" 10,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(=O)N1CCC(O)CC1,"['CC(=O)Cl.Oc1ccncc1', 'CC(=O)N1CCC(=O)CC1', 'CC(=O)Cl.OC1CCNCC1', 'CC(=O)OC(C)=O.Cl.OC1CCNCC1', 'CC(=O)N(C(C)=O)n1c(C(C)C)nc2ccccc2c1=O.OC1CCNCC1', 'CC(=O)OC(C)=O.OC1CCNCC1', 'COC(C)=O.OC1CCNCC1', 'CC(N)=O.OC1CCNCC1']" 11,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCc1nnc(Cc2cc(N)ccc2S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)o1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCc1nnc(Cc2cc(N)ccc2S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)o1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCc1nnc(Cc2cc(N)ccc2S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)o1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCCc1nnc(Cc2cc(N)ccc2S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)o1,"['CCCc1nnc(Cc2cc(NC(=O)C(F)(F)F)ccc2S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)o1', 'CCCc1nnc(Cc2cc(NC(=O)C(F)(F)F)ccc2S(=O)(=O)Cl)o1.Nc1ccc2c(c1)B(O)OC2']" 12,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)c1cccc(Br)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)c1cccc(Br)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)c1cccc(Br)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(O)c1cccc(Br)n1,"['CC(=O)c1cccc(Br)n1.C[Mg]Br', 'CCOCC.COC(=O)c1cccc(Br)n1.C[Mg]I', 'Brc1cccc(Br)n1.CC(C)=O', 'COC(=O)c1cccc(Br)n1.C[Mg]I', 'COC(=O)c1cccc(Br)n1.C[Mg]Br', 'CC(=O)c1cccc(Br)n1.C[Mg]Cl', 'CC(=O)c1cccc(Br)n1.CI']" 13,"Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1ncccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1ncccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1ncccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",OCc1ncccc1OCc1ccccc1,"['BrCc1ccccc1.OCc1ncccc1O', 'BrCc1ccccc1.Cl.OCc1ncccc1O', 'CC(=O)OCc1ncccc1OCc1ccccc1', 'BrCc1ccccc1.Cc1ncccc1OCc1ccccc1', 'Cl.ClCc1ccccc1.OCc1ncccc1O', 'BrCc1ccccc1.Cl.Cl.O.OCc1ncccc1O', 'ClCc1ccccc1.OCc1ncccc1O']" 14,"Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1.C=Cc1ccccn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1.C=Cc1ccccn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize C=Cc1ccccc1.C=Cc1ccccn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",C=Cc1ccccc1.C=Cc1ccccn1,"['C=Cc1ccccc1.C=Cc1ccccn1', 'C=Cc1ccccc1.CC(C)(C#N)N=NC(C)(C)C#N.O=C(OOC(=O)c1ccccc1)c1ccccc1']" 15,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1ccc(Br)c(C)c1,"['COc1cccc(C)c1.O=C1CCC(=O)N1Br', 'CI.Cc1cc(O)ccc1Br', 'COc1cccc(C)c1', 'CI', 'COc1ccc(CO)c(C)c1', 'COB(OC)OC.Cc1c(Br)cccc1C(=O)[O-].[K+]', 'COS(=O)(=O)OC.COc1ccc(C(=O)O)c(C)c1', 'COc1ccc(C(=O)O)c(C)c1', 'COc1ccc(B(O)O)c(C)c1']" 16,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C(C)(C)Cc1cc2cc(O)ccc2n1Cc1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C(C)(C)Cc1cc2cc(O)ccc2n1Cc1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C(C)(C)Cc1cc2cc(O)ccc2n1Cc1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)C(C)(C)Cc1cc2cc(O)ccc2n1Cc1ccc(Cl)cc1,"['C=[N+]=[N-].CC(C)(Cc1cc2cc(O)ccc2n1Cc1ccc(Cl)cc1)C(=O)O', 'COc1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)C(=O)O)n2Cc1ccc(Cl)cc1', 'COC(=O)C(C)(C)Cc1c(SC(C)(C)C)c2cc(OC)ccc2n1Cc1ccc(Cl)cc1']" 17,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)cc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)cc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)cc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1ccc(Br)cc1OC1CCCC1,"['BrC1CCCC1.COc1ccc(Br)cc1O', 'COc1ccc(Br)cc1O.OC1CCCC1', 'BrC1CCCC1.CCOCC.Oc1ccccc1', 'CCOC(=O)N=NC(=O)OCC.COc1ccc(Br)cc1O.OC1CCCC1', 'BrC1CCCC1.COc1ccc(Br)cc1OC(C)=O']" 18,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)c1cccc(Br)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)c1cccc(Br)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)c1cccc(Br)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)c1cccc(Br)c1F,"['CO.O=C(O)c1cccc(Br)c1F', 'CCOC(OCC)OCC.O=C(O)c1cccc(Br)c1F', 'CI.O=C(O)c1cccc(Br)c1F', 'CI.O=C(O)c1ccc(F)c(Br)c1', 'COS(=O)(=O)OC.O=C(O)c1cccc(Br)c1F', 'COC(OC)OC.O=C(O)c1cccc(Br)c1F']" 19,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2cc([N+](=O)[O-])ccc2s1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2cc([N+](=O)[O-])ccc2s1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2cc([N+](=O)[O-])ccc2s1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Nc1nc2cc([N+](=O)[O-])ccc2s1,"['NC(N)=S.O=[N+]([O-])c1ccc(Cl)c([N+](=O)[O-])c1', 'N#C[S-].O=[N+]([O-])c1ccc(Cl)c([N+](=O)[O-])c1.[NH4+]', 'O=C(NC(=S)Nc1cc([N+](=O)[O-])ccc1F)c1ccccc1', 'N#C[S-].Nc1cccc([N+](=O)[O-])c1.[K+]', 'N#C[Se-].O=[N+]([O-])c1ccc2scnc2c1.[K+]', 'NC(=S)Nc1cccc([N+](=O)[O-])c1', 'CC(=O)Nc1nc2cc([N+](=O)[O-])ccc2s1', 'CC(=O)NC(=S)Nc1cc([N+](=O)[O-])ccc1F', 'N#CS.Nc1cccc([N+](=O)[O-])c1.[K]', 'N#CSc1ccc([N+](=O)[O-])cc1N', 'CN(C)C(=S)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]']" 20,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)c1cn(CCO)c2nc(N3CCN(C)CC3)ncc2c1=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)c1cn(CCO)c2nc(N3CCN(C)CC3)ncc2c1=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)c1cn(CCO)c2nc(N3CCN(C)CC3)ncc2c1=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOC(=O)c1cn(CCO)c2nc(N3CCN(C)CC3)ncc2c1=O,"['CCOC(=O)c1cnc2nc(N3CCN(C)CC3)ncc2c1OCC.OCCBr', 'CCOC(=O)c1c[nH]c2nc(N3CCN(C)CC3)ncc2c1=O.OCCCl', 'CCOC(=O)c1cnc2nc(N3CCN(C)CC3)ncc2c1OCC', 'CCOC(=O)c1cnc2[nH]c(N3CCN(C)CC3)ncc-2c1=O.OCCCl']" 21,"Please provide two sets of reactants for a single-step chemical reaction to synthesize OCCc1cccnc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCCc1cccnc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCCc1cccnc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",OCCc1cccnc1,"['N#Cc1ccc(CCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cn1', 'Cl.O=C(O)Cc1cccnc1', 'CCOC(=O)Cc1cccnc1', 'COC(=O)Cc1cccnc1', 'N#CC(C#N)=Cc1cccnc1', 'C=O.Cc1cccnc1', 'OC(c1cccnc1)C(Cl)(Cl)Cl', 'O=C(O)Cc1cccnc1']" 22,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)C[C@H](CO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)C[C@H](CO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)C[C@H](CO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)C[C@H](CO)NC(=O)OC(C)(C)C,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)C[C@@H](N)C(=O)O', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)C[C@@H](N)CO', 'C=CCOCC(CC(C)C)NC(=O)OC(C)(C)C', 'CC(C)CC(NC(=O)OC(C)(C)C)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)CC(N)CO', 'CC(C)CC(NC(=O)OC(C)(C)C)C(=O)O', 'COC(=O)C(CC(C)C)NC(=O)OC(C)(C)C', 'CC(C)=CC1COC(C)(C)N1C(=O)OC(C)(C)C', 'CC(C)CC1C(=O)OCN1C(=O)OC(C)(C)C', 'CC(C)CC(CO)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C']" 23,"Please provide two sets of reactants for a single-step chemical reaction to synthesize NNC(=O)c1ccc(Br)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize NNC(=O)c1ccc(Br)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize NNC(=O)c1ccc(Br)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",NNC(=O)c1ccc(Br)cc1,"['NN.O.O=C(O)c1ccc(Br)cc1', 'NN.O=C([O-])c1ccc(Br)cc1', 'CCOC(=O)c1ccc(Br)cc1.NN.O', 'COC(=O)c1ccc(Br)cc1.NN.O', 'CCOC(=O)c1ccc(Br)cc1', 'COC(=O)c1ccc(Br)cc1', 'O=C(Cl)c1ccc(Br)cc1', 'O=C(c1ccc(Br)cc1)n1ccnc1', 'O=C(Oc1ccccc1)c1ccc(Br)cc1', 'O=C(OC(=O)c1ccc(Br)cc1)c1ccc(Br)cc1', 'O=C1CCCN1C(=O)c1ccc(Br)cc1', 'O=C(O)c1ccc(Br)cc1']" 24,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1ccccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1ccccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1ccccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(O)c1ccccc1F,"['NS(=O)(=O)O.O=Cc1ccccc1F', 'O=C(Oc1cccc(F)c1)c1ccccc1F.[Na+].[OH-]', 'O=Cc1ccccc1F', 'OCc1ccccc1F', 'Fc1ccccc1C(Br)Br', 'C=CCOC(=O)c1ccccc1F', 'Fc1ccccc1I.O=C=O', 'Cc1ccccc1F', 'Nc1ccccc1C(=O)O', 'O=C(O)c1ccccc1F']" 25,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cccc(-c2ccccn2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cccc(-c2ccccn2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cccc(-c2ccccn2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(O)c1cccc(-c2ccccn2)c1,"['Brc1ccccn1.O=C(O)c1cccc(B(O)O)c1', 'COC(=O)c1cccc(-c2ccccn2)c1', 'Brc1ccccn1.CC1(C)OB(c2cccc(C(=O)O)c2)OC1(C)C', 'Cc1cccc(-c2ccccn2)c1', 'O=C(O)c1cccc(Br)c1.c1ccc(N2CCOB(c3ccccn3)OCC2)cc1']" 26,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)Nc1ccccc1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1ccc(Cl)c(Cl)c1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Nc1ccccc1', 'CC(C)(C)O.O=C=Nc1ccccc1', 'CC(C)(C)OC(N)=O.Ic1ccccc1', 'CC(C)(C)OC(=O)Nc1ccc(C(=O)O)cc1', 'CC(C)(C)OC(=O)Nc1ccc(F)cc1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C', 'CC(C)(C)OC(=O)Nc1ccc(O)cc1.CC(C)(C)OC(=O)Nc1ccc(OC(=O)OC(C)(C)C)cc1', 'CC(C)(C)OC(=O)Nc1ccc(OC(=O)OC(C)(C)C)cc1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C', 'CC(C)(C)OC(=O)Nc1ccccc1', 'CC(C)(C)OC(=O)Cl.Nc1ccccc1']" 27,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCc3cccn3-c3ccccc32)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCc3cccn3-c3ccccc32)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCc3cccn3-c3ccccc32)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCc3cccn3-c3ccccc32)cc1,"['Cc1ccccc1C(=O)Nc1ccc(C(=O)Cl)cc1.c1ccc2c(c1)NCCc1cccn1-2', 'Cc1ccccc1C(=O)Cl.Nc1ccc(C(=O)N2CCc3cccn3-c3ccccc32)cc1', 'COC(=O)c1ccc(N)cc1.Cc1ccccc1C(=O)Cl.c1ccc2c(c1)NCCc1cccn1-2']" 28,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCCBr. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCCBr. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCCBr. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)NCCCBr,"['Br.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCCBr', 'Br.C1CCOC1.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCCBr.O', 'BrC(Br)(Br)Br.CC(C)(C)OC(=O)NCCCO', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.[Br-].[NH3+]CCCBr', 'BrCCCNBr.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C', 'CC(C)(C)OC(=O)NCCCOS(C)(=O)=O', 'CCOC(=O)C(=O)N(CCCBr)C(=O)OC(C)(C)C', 'CC(C)(C)OC(=O)OC(C)(C)C.NCCCBr', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCCBr', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.NCCCBr', 'CC(C)(C)OC(=O)NCCCO']" 29,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(NC(=O)Nc2ccccc2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(NC(=O)Nc2ccccc2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(NC(=O)Nc2ccccc2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1ccc(NC(=O)Nc2ccccc2)cc1,"['Cc1ccc(Cl)cc1.NC(=O)Nc1ccccc1', 'CC(=O)[O-].Cc1ccc(N)cc1.O=[N+]([O-])c1ccccc1.[K+].[Se]', 'Cc1ccc(C(=O)n2nnc3ccccc32)cc1.Nc1ccccc1', 'Cc1ccc(N)cc1.O=C=Nc1ccccc1', 'Cc1ccc(N)cc1.NC(=O)Nc1ccccc1', 'Cc1ccc(N)cc1.O=C(NO)c1ccccc1', 'Cc1ccc(N=C=Nc2ccccc2)cc1', 'Cc1ccc(N=C=O)cc1.Nc1ccccc1']" 30,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(O)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)N1CCC(O)CC1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.OC1CCNCC1', 'CC(C)(C)OC(=O)N1CCC(Oc2ccc(OCc3ccccc3)cc2)CC1', 'CC(C)(C)OC(=O)OC(C)(C)C.OC1CCNCC1', 'CC(C)(C)OC(=O)N1CCC(=O)CC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.OC1CCNCC1', 'OC1CCNCC1']" 31,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C(N)=O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C(N)=O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc(Br)c(C(N)=O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1ccc(Br)c(C(N)=O)c1,"['COc1ccc(Br)c(C(=O)Cl)c1.[NH4+].[OH-]', 'COc1ccc(Br)c(C(=O)O)c1.O=C([O-])[O-].[NH4+].[NH4+]', 'COc1ccc(Br)c(C(=O)Cl)c1', 'COc1cccc(C(N)=O)c1', 'COc1ccc(Br)c(C(=O)O)c1']" 32,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1c(N2CCNCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1c(N2CCNCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1c(N2CCNCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1c(N2CCNCC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12,"['CCOC(=O)c1cn(C2CC2)c2c(C)c(N3CCN(C(=O)OCC)CC3)c(F)cc2c1=O', 'Cc1c(N2CCN(Cc3ccccc3)CC2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12', 'C1CNCCN1.Cc1c(F)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12', 'O=C([O-])O.O=C([O-])O.[Na+].[Na+]', 'C1CNCCN1.CC(=O)OB(OC(C)=O)OC(=O)c1cn(C2CC2)c2c(C)c(F)c(F)cc2c1=O', 'CC(=O)OB(OC(C)=O)OC(=O)c1cn(C2CC2)c2c(C)c(F)c(F)cc2c1=O.c1ccc(CN2CCNCC2)cc1']" 33,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)Cn1cnc2c(N)nc3c(c21)CCCC3. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)Cn1cnc2c(N)nc3c(c21)CCCC3. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(O)Cn1cnc2c(N)nc3c(c21)CCCC3. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(O)Cn1cnc2c(N)nc3c(c21)CCCC3,"['CC(C)(O)Cn1cnc2c1c1ccccc1n1nnnc21', 'CC(C)(O)Cn1cnc2c(N)nc3ccccc3c21', 'CC(C)(O)Cn1cnc2c(N)nc3ccccc3c21.O=C([O-])O.[Na+]']" 34,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ncccc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ncccc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ncccc1OC1CCCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Brc1ncccc1OC1CCCC1,"['OC1CCCC1.Oc1cccnc1Br', 'BrC1CCCC1.Oc1cccnc1Br']" 35,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Clc1ncnc2c1CCN(Cc1ccccc1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Clc1ncnc2c1CCN(Cc1ccccc1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Clc1ncnc2c1CCN(Cc1ccccc1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Clc1ncnc2c1CCN(Cc1ccccc1)C2,"['O=P(Cl)(Cl)Cl.O=c1[nH]cnc2c1CCN(Cc1ccccc1)C2', 'O=P(Cl)(Cl)Cl.Oc1ncnc2c1CCN(Cc1ccccc1)C2', 'CCOC(=O)C1CCN(Cc2ccccc2)CC1=O.Cl.Cl.N=CN', 'O=c1[nH]cnc2c1CCN(Cc1ccccc1)C2', 'Cl.O=c1[nH]cnc2c1CCN(Cc1ccccc1)C2', 'O=C1N=CN=C2CN(Cc3ccccc3)CCC12', 'CCOC(=O)C1CCN(Cc2ccccc2)CC1=O.Cl', 'O=c1nc[nH]c2c1CCN(Cc1ccccc1)C2', 'Cl.O=c1nc[nH]c2c1CCN(Cc1ccccc1)C2']" 36,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(O)cc12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(O)cc12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(O)cc12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)NCCc1c[nH]c2ccc(O)cc12,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.NCCc1c[nH]c2ccc(O)cc12', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CN1CC(=O)N=C1N.NCCc1c[nH]c2ccc(O)cc12.O.O=S(=O)(O)O', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CN1CC(=O)NC1=N.NCCc1c[nH]c2ccc(O)cc12.O=S(=O)(O)O', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCc1c[nH]c2ccc(O)cc12', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CN1CC(=O)N=C1N.NCCc1c[nH]c2ccc(O)cc12.O=S(=O)(O)O', 'CC(C)(C)OC(=O)ONC(C#N)c1ccccc1.NCCc1c[nH]c2ccc(O)cc12', 'CC(C)(C)OC(=O)Cl.Cl.NCCc1c[nH]c2ccc(O)cc12', 'CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccc(O)cc12)C(=O)O']" 37,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C1C(C=C(Cl)Cl)C1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C1C(C=C(Cl)Cl)C1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)C1C(C=C(Cl)Cl)C1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOC(=O)C1C(C=C(Cl)Cl)C1(C)C,"['CCOC(=O)CC(C=C(Cl)Cl)C(C)(C)Cl', 'CC(C)=CC=C(Cl)Cl.CCOC(=O)C=[N+]=[N-]', 'CCOC(=O)C1C(C=O)C1(C)C.CCOP(=O)(OCC)C(Cl)(Cl)Cl.[Mg]', 'CCOC(=O)CC(C)(C)C(Cl)C=C(Cl)Cl.[Na]', 'CCOC(=O)C1C(CC(Cl)(Cl)Cl)C1(C)C', 'CCOC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)Cl', 'CC1(C)C(C#N)C1C=C(Cl)Cl', 'CCOC(=O)CC(C)(C)C(Cl)C=C(Cl)Cl', 'CC1(C)CC(=O)OC1C=C(Cl)Cl']" 38,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.OC[C@H]1CNC[C@@H](O)[C@@H]1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.OC[C@H]1CNC[C@@H](O)[C@@H]1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.OC[C@H]1CNC[C@@H](O)[C@@H]1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cl.OC[C@H]1CNC[C@@H](O)[C@@H]1O,"['Cl.OC[C@H]1CNC[C@@H](O)[C@@H]1O', 'Cl.OC[C@H]1CNC[C@@H](OCc2ccccc2)[C@@H]1O', 'O=C[C@H]1CNC[C@@H](O)[C@@H]1O', 'OC[C@H]1CNC[C@@H](OCc2ccccc2)[C@@H]1O', 'N#C[C@@H]1CO[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1', 'CO[C@@]1(C)O[C@@H]2[C@@H](CO)CN(C(=O)OC(C)(C)C)C[C@H]2O[C@]1(C)OC', 'NC[C@@H]1CO[C@H](OCc2ccccc2)[C@@H](O)[C@@H]1O', 'CC(C)(C)OC(=O)N1CC(COCc2ccccc2)C(O)C(O[Si](C)(C)C(C)(C)C)C1']" 39,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOC(=O)COc1ccccc1,"['CCOC(=O)CCl.COC(=O)Oc1ccccc1', 'CCOC(=O)CBr.Oc1ccccc1', 'CCOC(=O)CCl.Oc1ccccc1', 'CCO.O=C(O)COc1ccccc1', 'CCOC(=O)C=[N+]=[N-].Oc1ccccc1', 'CCP(CC)CC.O=C(O)COc1ccccc1', 'CCOC(=O)CCl.Oc1ccccc1.[Na]']" 40,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Zn+2]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Zn+2]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Zn+2]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)[O-].[Zn+2],"['CCCCCCCCCCCCCCCCCC(=O)O.O=[Zn]', 'CCCCCCCCCCCCCCCCCC(=O)O.[O-2].[Zn+2]', 'CCCCCCCCCCCCCCCCCC(=O)O.[OH-].[Zn]']" 41,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(OC)c(Br)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(OC)c(Br)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(OC)c(Br)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)Cc1ccc(OC)c(Br)c1,"['COc1ccc(CC(=O)O)cc1Br.C[Si](C)(C)C=[N+]=[N-]', 'CI.COC(=O)Cc1ccc(O)c(Br)c1', 'CO.COc1ccc(CC(=O)O)cc1Br', 'COS(=O)(=O)OC.COc1ccc(CC(=O)O)cc1Br', 'COC(=O)Cc1ccc(OC)cc1', 'COc1ccc(CC(=O)O)cc1Br']" 42,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS[C@H]12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS[C@H]12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS[C@H]12. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS[C@H]12,"['CC(O)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C2N=C(COc3ccccc3)SC21.O=P(Cl)(Oc1ccccc1)c1ccccc1', 'O=C(COc1ccccc1)NC1C(=O)N(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=C(O)CBr)C1S', 'C=C1CS(=O)[C@@H]2[C@H](NC(=O)COc3ccccc3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1', 'O=C(COc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(O)CS(=O)[C@H]12', 'C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)COc2ccccc2)C1S']" 43,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OC[C@H]2CCC(=O)N21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OC[C@H]2CCC(=O)N21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OC[C@H]2CCC(=O)N21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC1(C)OC[C@H]2CCC(=O)N21,"['COC(C)(C)OC.O=C1CCC(CO)N1', 'CC(C)=O.O=C1CCC(CO)N1', 'COC(C)(C)OC.O=C1CC[C@H](CO)N1', 'COC(C)(C)OC.O=C1CC[C@@H](CO)N1', 'C=C(C)OC.O=C1CC[C@@H](CO)N1']" 44,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NC1CCCC(O)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NC1CCCC(O)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NC1CCCC(O)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)NC1CCCC(O)C1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NC1CCCC(O)C1', 'CC(C)(C)OC(=O)NC1CCCC(=O)C1', 'CC(C)(C)OC(=O)NC1CCCC(OC(=O)c2ccc([N+](=O)[O-])cc2)C1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.NC1CCCC(O)C1']" 45,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=S1(=O)N=C(Cl)c2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=S1(=O)N=C(Cl)c2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=S1(=O)N=C(Cl)c2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=S1(=O)N=C(Cl)c2ccccc21,"['ClP(Cl)(Cl)(Cl)Cl.O=C1NS(=O)(=O)c2ccccc21', 'O=S(Cl)Cl.O=S1(=O)N=Cc2ccccc21', 'O=C1NS(=O)(=O)c2ccccc21.O=S(Cl)Cl', 'O=C1NS(=O)(=O)c2ccccc21', 'O=S1(=O)N=Cc2ccccc21', 'O=S1(=O)N=C([n+]2cccc(O)c2)c2ccccc21.[Cl-]']" 46,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCC(=O)Nc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCC(=O)Nc1ccccc1,"['CCC(=O)Cl.c1ccc(CN2CCCOC(CNc3ccccc3)C2)cc1', 'CCC(=O)Cl.Nc1ccccc1', 'C=CC(=O)Nc1ccccc1', 'CCC(=NO)c1ccccc1', 'CCC(=O)c1ccccc1', 'CCC(=O)OC(=O)CC.Nc1ccccc1', 'CCC(=O)O.O=[N+]([O-])c1ccccc1', 'CCC(=O)OB(OB(OC(=O)CC)OC(=O)CC)OC(=O)CC.Nc1ccccc1']" 47,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2C12CCNCC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2C12CCNCC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2C12CCNCC2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C1Nc2ccccc2C12CCNCC2,"['O=C1N(Cc2ccccc2)c2ccccc2C12CCNCC2', 'O=C1Nc2ccccc2C12CCN(Cc1ccccc1)CC2', 'CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)Nc1ccccc12']" 48,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(B(O)O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(B(O)O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1ccc(B(O)O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1ccc(B(O)O)cc1,"['CCCCOB(OCCCC)OCCCC.Cc1ccc(I)cc1', 'COB(OC)OC.Cc1ccc(Br)cc1.[Mg]', 'COB(OC)OC.Cc1ccc(Cl)cc1.[Li]', 'CC(C)OB(OC(C)C)OC(C)C.Cc1ccc(Br)cc1', 'Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1', 'Cc1ccc(I)cc1', 'COB(OC)c1ccc(C)cc1', 'CC(C)OB(OC(C)C)OC(C)C.Cc1ccc([Zn]OC(=O)C(C)(C)C)cc1', 'Cc1ccc([N+](C)(C)C)cc1.[I-]', 'Cc1ccc(Br)cc1']" 49,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1cccnc1Nc1cccc(/C=C/c2cccnc2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1cccnc1Nc1cccc(/C=C/c2cccnc2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1cccnc1Nc1cccc(/C=C/c2cccnc2)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=[N+]([O-])c1cccnc1Nc1cccc(/C=C/c2cccnc2)c1,"['Brc1cccnc1.C=Cc1cccc(Nc2ncccc2[N+](=O)[O-])c1', 'Nc1cccc(/C=C/c2cccnc2)c1.O=[N+]([O-])c1cccnc1Cl', 'Brc1cccnc1.C=Cc1cccc(N)c1.Cc1ccccc1P(c1ccccc1C)c1ccccc1C.O=[N+]([O-])c1cccnc1Cl']" 50,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=Cc1ccccc1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=Cc1ccccc1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=Cc1ccccc1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=Cc1ccccc1[N+](=O)[O-],"['C=Cc1ccccc1[N+](=O)[O-].O=O', 'O=O.O=[N+]([O-])c1ccccc1C=CN1CCOCC1', 'CN(C)C=Cc1ccccc1[N+](=O)[O-].O=O', 'COCc1ccccc1[N+](=O)[O-]', 'CC(=O)OC(OC(C)=O)c1ccccc1[N+](=O)[O-]', 'O=[N+]([O-])c1ccccc1C1SCCCS1', 'NCc1ccccc1[N+](=O)[O-]', 'COC(OC)N(C)C.Cc1ccccc1[N+](=O)[O-]', 'NNc1ccccc1', 'NNc1ccccc1.O=[N+]([O-])c1ccccc1CCl']" 51,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O)c1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(O)c1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F,"['N#Cc1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F.O=S(=O)(O)O.[Na+].[OH-]', 'N#Cc1cc(C=C2OC(=O)C3=C2CCCC3)ccc1F.NN.O', 'N#Cc1cc(/C=C2\\OC(=O)C3=C2CCCC3)ccc1F', 'N#Cc1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F', 'COC(=O)c1cc(Cc2n[nH]c(=O)c3c2CCCC3)ccc1F', 'N#Cc1cc(C=C2OC(=O)C3=C2CCCC3)ccc1F']" 52,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccc(F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccc(F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOC(=O)COc1ccc(F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOC(=O)COc1ccc(F)cc1,"['CCOC(=O)CBr.Oc1ccc(F)cc1', 'CCO.O=C(O)COc1ccc(F)cc1', 'CCI.O=C(O)COc1ccc(F)cc1', 'CCOC(=O)CBr.CCOC(=O)CCl', 'O=C(O)COc1ccc(F)cc1', 'CCOC(=O)CCl.Oc1ccc(F)cc1']" 53,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1ccc(F)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1ccc(F)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=[N+]([O-])c1ccc(F)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=[N+]([O-])c1ccc(F)c(Cl)c1,"['O=[N+]([O-])c1ccc(Cl)c(Cl)c1.[F-].[K+]', 'Cl[Sb](Cl)(Cl)(Cl)Cl.O=[N+]([O-])c1ccc(F)cc1', 'O=[N+]([O-])c1ccc(Cl)c(Cl)c1', 'CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.O=S1(=O)CCCC1.O=[N+]([O-])c1ccc(Cl)c(Cl)c1.[Cl-]', 'O=[N+]([O-])c1ccc(F)cc1', 'CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC.O=[N+]([O-])c1ccc(Cl)c(Cl)c1.[Cl-]', 'C[N+](C)(C)c1ccc([N+](=O)[O-])cc1Cl.O=S(=O)([O-])C(F)(F)F', 'O=[N+]([O-])c1ccc(Cl)cc1[N+](=O)[O-]']" 54,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)c1ccc(F)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)c1ccc(F)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(=O)c1ccc(F)cn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(=O)c1ccc(F)cn1,"['CC(=O)N(C)C.Fc1ccc(Br)nc1', 'C=C(OCC)[Sn](CCCC)(CCCC)CCCC.Fc1ccc(Br)nc1', 'C[Mg]Br.N#Cc1ccc(F)cn1', 'CON(C)C(C)=O.Fc1ccc(Br)nc1', 'C=C(OCC)[Sn](C)(C)C.Fc1ccc(Br)nc1']" 55,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)c1nc(N)c(Br)c(Cl)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)c1nc(N)c(Br)c(Cl)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)c1nc(N)c(Br)c(Cl)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CS(=O)c1nc(N)c(Br)c(Cl)n1,"['CSc1nc(N)c(Br)c(Cl)n1.O=C(OO)c1cccc(Cl)c1', 'CS(=O)c1nc(N)cc(Cl)n1.O=C1CCC(=O)N1Br', 'CSc1nc(N)c(Br)c(Cl)n1', 'CS(=O)c1nc(N)cc(Cl)n1']" 56,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C(=O)c1ccc(Cl)cc1)n1cncn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C(=O)c1ccc(Cl)cc1)n1cncn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C(=O)c1ccc(Cl)cc1)n1cncn1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C(=O)c1ccc(Cl)cc1)n1cncn1,"['CC(C)(Br)C(=O)c1ccc(Cl)cc1.c1nc[nH]n1', 'CC(C(=O)c1ccc(Cl)cc1)n1cncn1.CI', 'CC(C(=O)c1ccc(Cl)cc1)n1cncn1.CCNCC.CI', 'CC(C)(Br)C(=O)c1ccc(Cl)cc1.c1nnc[nH]1']" 57,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ccc2c(c1)Cc1cc(I)ccc1-2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ccc2c(c1)Cc1cc(I)ccc1-2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Brc1ccc2c(c1)Cc1cc(I)ccc1-2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Brc1ccc2c(c1)Cc1cc(I)ccc1-2,"['Brc1ccc2c(c1)Cc1ccccc1-2.II.O.O.[O-][I+3]([O-])([O-])O', 'Brc1ccc2c(c1)Cc1ccccc1-2.II', 'Brc1ccc2c(c1)Cc1ccccc1-2', 'Brc1ccc2c(c1)Cc1ccccc1-2.O=S(=O)(O)O', 'Brc1ccc2c(c1)Cc1ccccc1-2.[O-][I+](O)(O)(O)(O)O']" 58,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC[C@@H]1CC(=O)N1c1ccc(C(F)(F)F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC[C@@H]1CC(=O)N1c1ccc(C(F)(F)F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC[C@@H]1CC(=O)N1c1ccc(C(F)(F)F)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC[C@@H]1CC(=O)N1c1ccc(C(F)(F)F)cc1,"['CC[C@@H](CC(=O)Nc1ccc(C(F)(F)F)cc1)OS(C)(=O)=O', 'CC[C@@H](CC(=O)Nc1ccc(C(F)(F)F)cc1)OS(=O)(=O)c1ccc(C)cc1', 'CC[C@H](O)CC(=O)Nc1ccc(C(F)(F)F)cc1']" 59,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1,"['N#CC(=O)c1cccc(Cl)c1Cl.N=C(N)NN.O=C(O)O', 'N#CC(=NNC(=N)N)c1cccc(Cl)c1Cl', 'CS(=O)(=O)O.CS(=O)(=O)O.N#CC(=O)c1cccc(Cl)c1Cl.N=C(N)NN', 'Cl.Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1', 'Nc1nnc(Br)c(N)n1.OB(O)c1cccc(Cl)c1Cl', 'N#CC(=NN=C(N)N)c1cccc(Cl)c1Cl', 'N#CC(=NNC(=N)N)c1cccc(Cl)c1Cl.O=S(=O)(O)O', 'N=C(N)N/N=C(/C(=N)N)c1cccc(Cl)c1Cl', 'N=C(N)NN=C(C(=N)N)c1cccc(Cl)c1Cl']" 60,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(CCO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(CCO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(CCO)NC(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(CCO)NC(=O)OC(C)(C)C,"['CC(C)(C)OC(=O)N1C(=O)CC1(C)C', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(CCO)NCc1ccccc1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(N)CCO', 'CC(C)(CC(=O)O)NC(=O)OC(C)(C)C.CCOC(=O)Cl', 'CC(C)(CC(=O)O)NC(=O)OC(C)(C)C', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(CC(=O)O)NCc1ccccc1']" 61,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(C(=O)O)(c2ccccc2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(C(=O)O)(c2ccccc2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(C(=O)O)(c2ccccc2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)N1CCC(C(=O)O)(c2ccccc2)CC1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cc1ccc(S(=O)(=O)O)cc1.O=C(O)C1(c2ccccc2)CCNCC1', 'Cc1ccc(S(=O)(=O)O)cc1.O=C(O)C1(c2ccccc2)CCNCC1.O=C([O-])[O-].[K+].[K+]', 'CC(C)(C)OC(=O)N1CCC(C=O)(c2ccccc2)CC1', 'CC(C)(C)OC(=O)OC(C)(C)C.Cc1ccc(S(=O)(=O)O)cc1.O=C(O)C1(c2ccccc2)CCNCC1', 'CC(C)(C)OC(=O)N1CCC(C#N)(c2ccccc2)CC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cl.O=C(O)C1(c2ccccc2)CCNCC1', 'COC(=O)C1(c2ccccc2)CCN(C(=O)OC(C)(C)C)CC1', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.Cc1ccc(S(=O)(=O)OC(=O)C2(c3ccccc3)CCNCC2)cc1']" 62,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCNC(=O)Nc1nc2cc(-c3cccnc3)ccn2c1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCNC(=O)Nc1nc2cc(-c3cccnc3)ccn2c1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCNC(=O)Nc1nc2cc(-c3cccnc3)ccn2c1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCNC(=O)Nc1nc2cc(-c3cccnc3)ccn2c1Cl,"['CCNC(=O)NC(=O)CCl.CCNC(=O)Nc1cn2ccc(-c3cccnc3)cc2n1', 'CCNC(=O)Nc1cn2ccc(-c3cccnc3)cc2n1.Cc1ccc(S(=O)(=O)Cl)cc1', 'CCN=C=NCCCN(C)C.CCNC(=O)Nc1cn2ccc(-c3cccnc3)cc2n1.Cl', 'CCNC(=O)Nc1cn2ccc(-c3cccnc3)cc2n1']" 63,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1cc(C=O)ccc1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1cc(C=O)ccc1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1cc(C=O)ccc1O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)c1cc(C=O)ccc1O,"['CC(C)(C)c1ccccc1O.ClC(Cl)Cl.[Na+].[OH-]', 'CC(C)(C)c1ccccc1O.CN(C=O)c1ccccc1', 'CC(C)(C)c1ccccc1O.CO', 'CC(C)(C)c1ccccc1O', 'Cc1ccc(O)c(C(C)(C)C)c1', 'CC(C)(C)c1ccccc1O.ClC(Cl)Cl']" 64,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Fc1cc(Br)ccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Fc1cc(Br)ccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Fc1cc(Br)ccc1OCc1ccccc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Fc1cc(Br)ccc1OCc1ccccc1,"['BrCc1ccccc1.Oc1ccc(Br)cc1F', 'ClCc1ccccc1.Oc1ccc(Br)cc1F', 'BrCc1ccccc1.Oc1ccc(Br)c(F)c1', 'Fc1ccccc1OCc1ccccc1', 'Fc1ccc(Br)cc1F.OCc1ccccc1']" 65,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cn1cc(-c2ccccc2)nc1C=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cn1cc(-c2ccccc2)nc1C=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cn1cc(-c2ccccc2)nc1C=O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cn1cc(-c2ccccc2)nc1C=O,"['Cn1cc(-c2ccccc2)nc1CO', 'CN(C)C=O.Cn1cnc(-c2ccccc2)c1', 'Cn1cnc(-c2ccccc2)c1', 'CI.CN(C)C=O.c1ccc(-c2c[nH]cn2)cc1']" 66,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl,"['CCCCCCCCc1ccc(CCC(CO)(CO)NC(C)=O)cc1.Cl', 'CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl', 'CCCCCCCCc1ccc(C(O)CC(CO)(CO)[N+](=O)[O-])cc1.Cl', 'CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.CCOCC.Cl', 'CC(C)O.CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1.Cl', 'CCCCCCCCc1ccc(CCC(N)(CO)CO)cc1', 'CCCCCCCCc1ccc(CCC(CO)(CO)NC(C)=O)cc1', 'CCCCCCCCc1ccc(CCC(CO)(CO)[N+](=O)[O-])cc1', 'CCCCCCCCc1ccc(CCC2(CO[Si](C)(C)C(C)(C)C)COC3(CC(C)CC(C)C3)N2)cc1']" 67,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2c(ncn2COCCO)c(=O)[nH]1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2c(ncn2COCCO)c(=O)[nH]1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1nc2c(ncn2COCCO)c(=O)[nH]1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Nc1nc2c(ncn2COCCO)c(=O)[nH]1,"['C1COCO1.CC(=O)N(C(C)=O)c1nc2nc[nH]c2c(=O)[nH]1', 'N.O=c1[nH]c(Cl)nc2c1ncn2COCCO', 'CC(=O)Nc1nc2c(ncn2COCCOC(C)=O)c(=O)[nH]1', 'C1COCO1.Nc1nc2nc[nH]c2c(=O)[nH]1', 'NC(=O)c1ncn(COCCO)c1NC(N)=S', 'Nc1nc2c(ncn2COCCOC(=O)c2ccccc2)c(=O)[nH]1', 'CCCN(CCC)P(=O)(O)OCCOCn1cnc2c(=O)[nH]c(N)nc21.N', 'N.Nc1nc2c(ncn2COCCOP(=O)(O)NCCN2CCOCC2)c(=O)[nH]1', 'N.Nc1nc2c(ncn2COCCOP(=O)(O)N2CCOCC2)c(=O)[nH]1', 'N.Nc1nc2c(ncn2COCCOP(=O)(O)N2CCCC2)c(=O)[nH]1']" 68,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc([N+](=O)[O-])cc1OCCN(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc([N+](=O)[O-])cc1OCCN(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1ccc([N+](=O)[O-])cc1OCCN(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1ccc([N+](=O)[O-])cc1OCCN(C)C,"['CN(C)CCCl.COc1ccc([N+](=O)[O-])cc1O.Cl', 'CN(C)CCO.COc1ccc([N+](=O)[O-])cc1O', 'CN(C)CCCl.COc1ccc([N+](=O)[O-])cc1O']" 69,"Please provide two sets of reactants for a single-step chemical reaction to synthesize OC12CC3CC(CC(C3)C1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize OC12CC3CC(CC(C3)C1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize OC12CC3CC(CC(C3)C1)C2. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",OC12CC3CC(CC(C3)C1)C2,"['C1C2CC3CC1CC(C2)C3.O=C1c2ccccc2C(=O)N1O.O=O.c1ccc2c(c1)Cc1ccccc1-2', 'C1C2CC3CC1CC(C2)C3.O=O.O=c1n(O)c(=O)n(O)c(=O)n1O', 'C1C2CC3CC1CC(C2)C3.O=C1c2ccccc2C(=O)N1O.O=O.O=[N+][O-]', 'BrC12CC3CC(CC(C3)C1)C2', 'C[Si](C)(C)OC12CC3CC(CC(C3)C1)C2', 'O=C(OC12CC3CC(CC(C3)C1)C2)C(F)(F)F', 'C1C2CC3CC1CC(C2)C3', 'C=C1CC2CC(=O)CC(C1)C2', 'IC12CC3CC(CC(C3)C1)C2', 'O=[N+]([O-])OC12CC3CC(CC(C3)C1)C2']" 70,"Please provide two sets of reactants for a single-step chemical reaction to synthesize NCCCC(O)(P(=O)(O)O)P(=O)(O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize NCCCC(O)(P(=O)(O)O)P(=O)(O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize NCCCC(O)(P(=O)(O)O)P(=O)(O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",NCCCC(O)(P(=O)(O)O)P(=O)(O)O,"['C1COCCN1.Cl.ClP(Cl)Cl.NCCCC(=O)O.OP(O)O', 'CC(CN1C(=O)c2ccccc2C1=O)C(C)(C)C(C)(OP(=O)(O)O)P(=O)(O)O', 'COP(=O)(OC)C(O)(CCCN1C(=O)c2ccccc2C1=O)P(=O)(OC)OC', 'NCCCC(O)(P(=O)([O-])O)P(=O)(O)O.O.O.O.[Na+]', 'NCCCC(=O)O.O=P(O)(O)O.OP(O)O', 'NCCCC(=O)O', 'O=C1CCCN1', 'O=C1c2ccccc2C(=O)N1CCCC(O)(P(=O)(O)O)P(=O)(O)O', 'CC(C)(C)OC(=O)NCCCC(=O)ON1C(=O)CCC1=O', 'NCCCC(O)(P(=O)([O-])O)P(=O)(O)O.[Na+]']" 71,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(C(=O)CBr)cc(OC)c1OC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(C(=O)CBr)cc(OC)c1OC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1cc(C(=O)CBr)cc(OC)c1OC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1cc(C(=O)CBr)cc(OC)c1OC,"['BrBr.COc1cc(C(=O)c2ccccc2)cc(OC)c1OC', 'BrBr.COc1cc(C(C)=O)cc(OC)c1OC', 'COc1cc(C(C)=O)cc(OC)c1OC', 'COc1cc(C(=O)c2ccccc2)cc(OC)c1OC', 'C=[N+]=[N-].COc1cc(C(=O)O)cc(OC)c1OC']" 72,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)(=O)[O-].Cn1cc[n+](C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)(=O)[O-].Cn1cc[n+](C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CS(=O)(=O)[O-].Cn1cc[n+](C)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CS(=O)(=O)[O-].Cn1cc[n+](C)c1,"['COS(=O)OC.Cn1ccnc1', 'COS(C)(=O)=O.C[n+]1cc[nH]c1', 'COS(C)(=O)=O.Cn1ccnc1', 'CS(=O)(=O)O.Cn1cc[n+](C)c1.[I-]', 'Cn1cc[n+](C)c1.[I-]', 'C=O.CN.CS(=O)(=O)O.O=CC=O', 'COS(C)(=O)=O.Cn1ccnc1.[H+]']" 73,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NN1CCNCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NN1CCNCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)NN1CCNCC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)NN1CCNCC1,"['CC(C)(C)OC(=O)NN1CCN(C(=O)OCc2ccccc2)CC1', 'CC(C)(C)OC(=O)NN1CCN(Cc2ccccc2)CC1', 'CC(C)(C)OC(=O)NN1CCN(C(=O)OC(C)(C)C)CC1']" 74,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1C(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1C(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1C(=O)OC(C)(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1C(=O)OC(C)(C)C,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.COC(=O)C1CN(C(=O)OCc2ccccc2)CCN1', 'CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC1C(=O)O.CI', 'COC(=O)C1CNCCN1C(=O)OC(C)(C)C.O=C(Cl)OCc1ccccc1', 'CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC1C(=O)O.CO']" 75,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCSc1nc(Cl)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCSc1nc(Cl)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCCSc1nc(Cl)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCCSc1nc(Cl)c2nnn([C@@H]3C[C@H](OCCO)[C@@H](O)[C@H]3O)c2n1,"['CCCSc1nc(Cl)c(N)c(N[C@@H]2C[C@H](OCCO)[C@H]3OC(C)(C)O[C@H]32)n1.O=N[O-].[Na+]', 'CC(C)CCON=O.CCCSc1nc(Cl)c(N)c(N[C@@H]2C[C@H](OCCO)[C@@H](O)[C@H]2O)n1', 'CCCSc1nc(Cl)c(N)c(Cl)n1.N[C@@H]1C[C@H](OCCO)[C@@H](O)[C@H]1O.O=N[O-].[Na+]', 'CCCSc1nc(Cl)c(N)c(N[C@@H]2C[C@H](OCCO)[C@@H](O)[C@H]2O)n1', 'CCCSc1nc(Cl)c(N)c(N[C@@H]2C[C@H](OCCO)[C@H]3OC(C)(C)O[C@H]32)n1', 'CCCBr.OCCO[C@H]1C[C@@H](n2nnc3c(Cl)nc(S)nc32)[C@H](O)[C@@H]1O', 'CCCSc1nc(Cl)c(N)c(NC2CC(OCCO)C(O)C2O)n1', 'CCCSc1nc(Cl)c2nnn(C3CC(OCCO)C4OC(C)(C)OC43)c2n1']" 76,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(=O)C(C)(C)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(=O)C(C)(C)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)OC(=O)N1CCC(=O)C(C)(C)C1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)OC(=O)N1CCC(=O)C(C)(C)C1,"['CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC1(C)CN(Cc2ccccc2)CCC1=O', 'CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC1(C)CNCCC1=O', 'CC(C)(C)OC(=O)OC(C)(C)C.CC1(C)CN(Cc2ccccc2)CCC1=O', 'CC(C)(C)OC(=O)N1CCC(=O)CC1.CC(C)(C)[O-].CI.[Na+]', 'CI', 'CC(C)(C)OC(=O)N1CCC(=O)CC1.CI', 'CC(C)(C)OC(=O)N1CCC(=O)CC1']" 77,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1c(C(C)=O)cc(Cl)c(C)c1Br. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1c(C(C)=O)cc(Cl)c(C)c1Br. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COc1c(C(C)=O)cc(Cl)c(C)c1Br. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COc1c(C(C)=O)cc(Cl)c(C)c1Br,"['COc1cc(C)c(Cl)cc1C(C)=O.O=C1CCC(=O)N1Br', 'CC(=O)c1cc(Cl)c(C)c(Br)c1O.COS(=O)(=O)OC', 'COc1cc(C)c(Cl)cc1C(C)=O']" 78,"Please provide two sets of reactants for a single-step chemical reaction to synthesize N[C@@H](Cc1ccc(O)cc1)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize N[C@@H](Cc1ccc(O)cc1)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize N[C@@H](Cc1ccc(O)cc1)C(=O)O. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",N[C@@H](Cc1ccc(O)cc1)C(=O)O,"['CC(C)(C)Oc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1', 'N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O', 'O=CNC(Cc1ccc(O)cc1)C(=O)O', 'O=C1N[C@H](Cc2ccc(O)cc2)C(=O)N[C@H]1Cc1c[nH]c2c([C@]34C[C@H]5C(=O)N[C@H](Cc6ccccc6)C(=O)N5[C@H]3Nc3ccccc34)cccc12', 'CCCCCCC(C)O.COc1ccc(/C=C/NC(C)=O)cc1', 'NC(Cc1ccc(O)cc1)C(=O)O', 'Cl.NC(=O)C(N)Cc1ccc(O)cc1', 'CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.N[C@H](Cc1ccc(O)cc1)C(=O)O']" 79,"Please provide two sets of reactants for a single-step chemical reaction to synthesize NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1,"['CC(C)(C)OC(=O)NC1CCNCC1.ClCc1ccc(Cl)c(Cl)c1', 'CC(C)(C)OC(=O)NC1CCNCC1.Clc1ccc(CBr)cc1Cl', 'CC(C)(C)OC(=O)NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1', 'ON=C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1', 'NC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1']" 80,"Please provide two sets of reactants for a single-step chemical reaction to synthesize C[C@H](N)c1ncc(F)cn1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize C[C@H](N)c1ncc(F)cn1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize C[C@H](N)c1ncc(F)cn1.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",C[C@H](N)c1ncc(F)cn1.Cl,"['CC[C@@H](C)S(=O)N[C@@H](C)c1ncc(F)cn1.Cl', 'CCCCOC(=O)N[C@@H](C)c1ncc(F)cn1.Cl', 'C[C@H](NC(=O)OC(C)(C)C)c1ncc(F)cn1']" 81,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)C(=O)Nc1cccc(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)C(=O)Nc1cccc(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)C(=O)Nc1cccc(N)n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)C(=O)Nc1cccc(N)n1,"['CC(C)(C)C(=O)OC(=O)C(C)(C)C.Nc1cccc(N)n1', 'CC(C)(C)C(=O)Cl.Nc1cccc(N)n1']" 82,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1cn2ccncc2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1cn2ccncc2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cc1cn2ccncc2n1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cc1cn2ccncc2n1,"['CC(=O)CBr.Nc1cnccn1', 'CC(=O)CCl.Nc1cnccn1']" 83,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOc1ccc(Br)c(O)c1C(=O)NCC1CCCN1CC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOc1ccc(Br)c(O)c1C(=O)NCC1CCCN1CC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CCOc1ccc(Br)c(O)c1C(=O)NCC1CCCN1CC. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CCOc1ccc(Br)c(O)c1C(=O)NCC1CCCN1CC,"['CCOc1ccc(Br)c(OCC)c1C(=O)NCC1CCCN1CC.Cl', 'CCOc1ccc(Br)c(OCC)c1C(=O)NCC1CCCN1CC']" 84,"Please provide two sets of reactants for a single-step chemical reaction to synthesize N#Cc1ccc(C=O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize N#Cc1ccc(C=O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize N#Cc1ccc(C=O)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",N#Cc1ccc(C=O)cc1,"['N#Cc1ccc(CN)cc1.O=[Mn](=O)(=O)[O-].[K+]', 'CC(C)(C)OCl.N#Cc1ccc(CN)cc1', 'C=O.N#Cc1ccc(CN)cc1', 'N#Cc1ccc(CN)cc1.O', 'N#C[Fe](C#N)(C#N)(C#N)(C#N)C#N.O=Cc1ccc(I)cc1.[K+]', 'CC(C)(C)[Si](C)(C)OCc1ccc(C#N)cc1', 'CC(=O)OC(OC(C)=O)c1ccc(C#N)cc1', 'N#Cc1ccc(COS(=O)OCc2ccc(C#N)cc2)cc1']" 85,"Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1cccnc1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1cccnc1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize OCc1cccnc1Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",OCc1cccnc1Cl,"['O=C(O)c1cccnc1Cl', 'O=Cc1cccnc1Cl', 'ClCc1cccnc1Cl.O', 'CCOC(=O)c1cccnc1Cl', 'O=C(Cl)c1cccnc1Cl', 'CCOC(=O)OC(=O)c1cccnc1Cl']" 86,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1)C(O)(c1ccccc1)c1ccccc1.[Cl-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1)C(O)(c1ccccc1)c1ccccc1.[Cl-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C(O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1)C(O)(c1ccccc1)c1ccccc1.[Cl-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C(O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1)C(O)(c1ccccc1)c1ccccc1.[Cl-],"['ClCCCCCl.O=C(O)C(O)(c1ccccc1)c1ccccc1.OC1C[C@H]2CC[C@@H](C1)N2', 'CC(C)C[C@H](N)C(=O)O.CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCCC.ClC(c1ccccc1)(c1ccccc1)c1ccccc1.O', 'O=C(O)C(O)(c1ccccc1)c1ccccc1.O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1.[Cl-]', 'O=C(n1ccnc1)C(O)(c1ccccc1)c1ccccc1.O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1.[Cl-]', 'Cl.ClCCCCCl.O=C(O[C@H]1C[C@H]2CC[C@@H](C1)N2)C(O)(c1ccccc1)c1ccccc1', 'ClCCCCCl.O=C(O)C(O)(c1ccccc1)c1ccccc1.O[C@H]1C[C@H]2CC[C@@H](C1)N2', 'O=C(Cl)C(c1ccccc1)c1ccccc1.O[C@H]1C[C@H]2CC[C@@H](C1)[N+]21CCCC1.[Cl-]']" 87,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(O)c(O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(O)c(O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)Cc1ccc(O)c(O)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)Cc1ccc(O)c(O)c1,"['CO.O=C(O)Cc1ccc(O)c(O)c1', 'CO.O=C(O)C(O)c1ccc(O)c(O)c1', 'COC(=O)Cc1ccc(O)c(C=O)c1', 'COC(=O)C(O)c1ccc(O)c(O)c1']" 88,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21,"['COC(=O)C[C@@H]1COc2cc(O)ccc21.O[C@H]1CCc2c(Br)ccc(F)c21', 'C1COCCN1.O=C(O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21', 'C1COCCN1.CO.O=C(O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(Br)ccc(F)c43)ccc21']" 89,"Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2Sc2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2Sc2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize O=C1Nc2ccccc2Sc2ccccc21. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",O=C1Nc2ccccc2Sc2ccccc21,"['Nc1ccccc1Sc1ccccc1C(=O)O', 'O=C=Nc1ccccc1Sc1ccccc1', 'Nc1ccccc1S(=O)(=O)c1ccccc1C(=O)O', 'COC(=O)c1ccccc1Sc1ccccc1[N+](=O)[O-]', 'COC(=O)c1ccccc1Sc1ccccc1N', 'O=C(OCc1ccccc1)c1ccccc1Sc1ccccc1[N+](=O)[O-]', 'CCOC(=O)c1ccccc1Sc1ccccc1N']" 90,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1cc(Cl)cc(C(=O)O)c1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1cc(Cl)cc(C(=O)O)c1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Nc1cc(Cl)cc(C(=O)O)c1[N+](=O)[O-]. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Nc1cc(Cl)cc(C(=O)O)c1[N+](=O)[O-],"['C[N+](C)(C)N.O=C(O)c1cc(Cl)ccc1[N+](=O)[O-].[I-]', 'CON.Cl.O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]', 'O=C(O)c1cc(Cl)ccc1[N+](=O)[O-]']" 91,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OB(c2cnn(C3CC3)c2)OC1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OB(c2cnn(C3CC3)c2)OC1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC1(C)OB(c2cnn(C3CC3)c2)OC1(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC1(C)OB(c2cnn(C3CC3)c2)OC1(C)C,"['Brc1cnn(C2CC2)c1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C', 'Brc1cnn(C2CC2)c1.CCn1cc(B2OC(C)(C)C(C)(C)O2)cn1', 'CC(C)OB1OC(C)(C)C(C)(C)O1.Ic1cnn(C2CC2)c1', 'CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Ic1cnn(C2CC2)c1', 'Brc1cnn(C2CC2)c1.CC(C)OB1OC(C)(C)C(C)(C)O1']" 92,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CN1CCN(C(=O)C2(N)CCCC2)CC1.Cl.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CN1CCN(C(=O)C2(N)CCCC2)CC1.Cl.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CN1CCN(C(=O)C2(N)CCCC2)CC1.Cl.Cl. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CN1CCN(C(=O)C2(N)CCCC2)CC1.Cl.Cl,"['CC(C)(C)OC(=O)NC1(C(=O)O)CCCC1.CCN=C=NCCCN(C)C.CN1CCNCC1.Cl', 'CN1CCN(C(=O)C2(NC(=O)OC(C)(C)C)CCCC2)CC1.Cl', 'CN1CCN(C(=O)C2(NC(=O)OC(C)(C)C)CCCC2)CC1']" 93,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1(C)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1(C)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COC(=O)C1(C)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COC(=O)C1(C)CN(C(=O)Nc2ccc(C(F)(F)F)cc2)N=C1c1ccc(Cl)cc1,"['COC(=O)C1(C)CNN=C1c1ccc(Cl)cc1.Cl.O=C=Nc1ccc(C(F)(F)F)cc1', 'COC(=O)C1(C)CNN=C1c1ccc(Cl)cc1.O=C=Nc1ccc(C(F)(F)F)cc1']" 94,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.Cl.O=C(NCC1CCN(CCOc2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.Cl.O=C(NCC1CCN(CCOc2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Cl.Cl.O=C(NCC1CCN(CCOc2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Cl.Cl.O=C(NCC1CCN(CCOc2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1,"['CO.Cl.O=C(NCC1CCN(CCOc2ccccc2)CC1)C1=Cc2cnc3cccc(n23)S1', 'CS(=O)(=O)OCCOc1ccccc1.Cl.Cl.O=C(NCC1CCNCC1)C1=Cc2cnc3cccc(n23)S1']" 95,"Please provide two sets of reactants for a single-step chemical reaction to synthesize Oc1ccc(-c2nc3c(Cl)cc(O)cc3o2)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize Oc1ccc(-c2nc3c(Cl)cc(O)cc3o2)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize Oc1ccc(-c2nc3c(Cl)cc(O)cc3o2)c(Cl)c1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",Oc1ccc(-c2nc3c(Cl)cc(O)cc3o2)c(Cl)c1,"['COc1ccc(-c2nc3c(Cl)cc(OC)cc3o2)c(Cl)c1', 'COc1ccc(C(=O)Nc2c(O)cc(OC)cc2Cl)c(Cl)c1']" 96,"Please provide two sets of reactants for a single-step chemical reaction to synthesize COCCOc1ccc(OCC(O)CNCCNC(=O)N2CCOCC2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize COCCOc1ccc(OCC(O)CNCCNC(=O)N2CCOCC2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize COCCOc1ccc(OCC(O)CNCCNC(=O)N2CCOCC2)cc1. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",COCCOc1ccc(OCC(O)CNCCNC(=O)N2CCOCC2)cc1,"['COCCOS(C)(=O)=O.O=C(NCCNCC(O)COc1ccc(O)cc1)N1CCOCC1', 'COCCOc1ccc(OCC2CO2)cc1.NCCNC(=O)N1CCOCC1', 'O=C(Cl)N1CCOCC1', 'COCCOS(C)(=O)=O.O=C(NCCNCC(O)COc1ccc(O)cc1)N1CCOCC1.O=C([O-])[O-].[K+]']" 97,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)N(CCC(c1ccccc1)c1cc(CO)ccc1O)C(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)N(CCC(c1ccccc1)c1cc(CO)ccc1O)C(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)N(CCC(c1ccccc1)c1cc(CO)ccc1O)C(C)C. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)N(CCC(c1ccccc1)c1cc(CO)ccc1O)C(C)C,"['C1CCOC1.COC1=CC(=C=O)C(OC)C(C(CC(=O)N(C(C)C)C(C)C)c2ccccc2)=C1.[Al+3].[H-].[H-].[H-].[H-].[Li+]', 'CC(C)NC(C)C.OCc1ccc2c(c1)C(c1ccccc1)CC(O)O2', 'CC(C)N(CCC(c1ccccc1)c1cc(C=O)ccc1O)C(C)C', 'COC(=O)c1ccc(O)c(C(CCN(C(C)C)C(C)C)c2ccccc2)c1', 'CC(C)N(CCC(c1ccccc1)c1cc(CO)ccc1OCc1ccccc1)C(C)C']" 98,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC#CCOc1ncnc(N2CC(C)CC(C)C2)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC#CCOc1ncnc(N2CC(C)CC(C)C2)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC#CCOc1ncnc(N2CC(C)CC(C)C2)c1F. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC#CCOc1ncnc(N2CC(C)CC(C)C2)c1F,"['CC#CCOc1ncnc(F)c1F.CC1CNCC(C)C1', 'CC#CCOc1ncnc(Cl)c1F.CC1CNCC(C)C1', 'CC#CCO.CC1CC(C)CN(c2ncnc(F)c2F)C1', 'CC#CCO.CC1CNCC(C)C1.Fc1ncnc(F)c1F']" 99,"Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1ccccc1CO. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. The final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set"" No explanations and other information. Only return the answer in the specified format.","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1ccccc1CO. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation. You may think step by step, and the final answer should be formatted as follows: ""Reactant Set 1: SMILES notation of the first reactant set; Reactant Set 2: SMILES notation of the second reactant set""","Please provide two sets of reactants for a single-step chemical reaction to synthesize CC(C)(C)c1ccccc1CO. In each reaction scheme, if multiple reactants are involved, they should be separated by a ""."". All molecules should be represented using SMILES notation.",CC(C)(C)c1ccccc1CO,"['C=O.CC(C)(C)c1ccccc1Br', 'B.C1CCOC1.CC(C)(C)c1ccccc1C(=O)O', 'CC(C)(C)c1ccccc1C(=O)Cl', 'CC(C)(C)c1ccccc1CCl', 'COC(=O)c1ccccc1C(C)(C)C', 'CC(C)(C)c1ccccc1C=O']"