= end)\\r\\n { return n + (end - i) }\\r\\n n += nextTab - i;\\r\\n n += tabSize - (n % tabSize);\\r\\n i = nextTab + 1;\\r\\n }\\r\\n}\",\n \"function count_column( string, end, tabSize, startIndex, startValue )\\n{\\n var i, n, nextTab;\\n if ( null == end )\\n {\\n end = string.search( Stream.$NONSPC$ );\\n if ( -1 == end ) end = string.length;\\n }\\n for (i=startIndex||0,n=startValue||0 ;;)\\n {\\n nextTab = string.indexOf( \\\"\\\\t\\\", i );\\n if ( nextTab < 0 || nextTab >= end ) return n + (end - i);\\n n += nextTab - i;\\n n += tabSize - (n % tabSize);\\n i = nextTab + 1;\\n }\\n}\",\n \"function count_column( string, end, tabSize, startIndex, startValue )\\n{\\n var i, n, nextTab;\\n if ( null == end )\\n {\\n end = string.search( Stream.$NONSPC$ );\\n if ( -1 == end ) end = string.length;\\n }\\n for (i=startIndex||0,n=startValue||0 ;;)\\n {\\n nextTab = string.indexOf( \\\"\\\\t\\\", i );\\n if ( nextTab < 0 || nextTab >= end ) return n + (end - i);\\n n += nextTab - i;\\n n += tabSize - (n % tabSize);\\n i = nextTab + 1;\\n }\\n}\",\n \"function countColumn(string, tabSize, to = string.length) {\\n let n = 0;\\n for (let i = 0; i < to;) {\\n if (string.charCodeAt(i) == 9) {\\n n += tabSize - (n % tabSize);\\n i++;\\n }\\n else {\\n n++;\\n i = findClusterBreak(string, i);\\n }\\n }\\n return n;\\n}\",\n \"function findIndentation(input)\\n{\\n\\tvar count = 0;\\n\\n\\tif (input.length === 0)\\n\\t{\\n\\t\\treturn 0;\\n\\t}\\n\\n\\treturn input.split(/[^ \\\\t\\\\r\\\\n]/)[0].length; //**returns the number of tabs as well as the number of spaces!!!\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n\\t\\t for (var pos = 0, col = 0;;) {\\n\\t\\t var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n\\t\\t if (nextTab == -1) { nextTab = string.length; }\\n\\t\\t var skipped = nextTab - pos;\\n\\t\\t if (nextTab == string.length || col + skipped >= goal)\\n\\t\\t { return pos + Math.min(skipped, goal - col) }\\n\\t\\t col += nextTab - pos;\\n\\t\\t col += tabSize - (col % tabSize);\\n\\t\\t pos = nextTab + 1;\\n\\t\\t if (col >= goal) { return pos }\\n\\t\\t }\\n\\t\\t }\",\n \"function findColumn(string, goal, tabSize) {\\r\\n for (var pos = 0, col = 0;;) {\\r\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\r\\n if (nextTab == -1) nextTab = string.length;\\r\\n var skipped = nextTab - pos;\\r\\n if (nextTab == string.length || col + skipped >= goal)\\r\\n return pos + Math.min(skipped, goal - col);\\r\\n col += nextTab - pos;\\r\\n col += tabSize - (col % tabSize);\\r\\n pos = nextTab + 1;\\r\\n if (col >= goal) return pos;\\r\\n }\\r\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\r\\n for (var pos = 0, col = 0;;) {\\r\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\r\\n if (nextTab == -1) { nextTab = string.length; }\\r\\n var skipped = nextTab - pos;\\r\\n if (nextTab == string.length || col + skipped >= goal)\\r\\n { return pos + Math.min(skipped, goal - col) }\\r\\n col += nextTab - pos;\\r\\n col += tabSize - (col % tabSize);\\r\\n pos = nextTab + 1;\\r\\n if (col >= goal) { return pos }\\r\\n }\\r\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n\\n if (nextTab == -1) {\\n nextTab = string.length;\\n }\\n\\n var skipped = nextTab - pos;\\n\\n if (nextTab == string.length || col + skipped >= goal) {\\n return pos + Math.min(skipped, goal - col);\\n }\\n\\n col += nextTab - pos;\\n col += tabSize - col % tabSize;\\n pos = nextTab + 1;\\n\\n if (col >= goal) {\\n return pos;\\n }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos)\\n if (nextTab == -1) { nextTab = string.length }\\n var skipped = nextTab - pos\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos\\n col += tabSize - (col % tabSize)\\n pos = nextTab + 1\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos)\\n if (nextTab == -1) { nextTab = string.length }\\n var skipped = nextTab - pos\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos\\n col += tabSize - (col % tabSize)\\n pos = nextTab + 1\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, col, tabSize, strict) {\\n for (let i = 0, n = 0;;) {\\n if (n >= col)\\n return i;\\n if (i == string.length)\\n break;\\n n += string.charCodeAt(i) == 9 ? tabSize - (n % tabSize) : 1;\\n i = findClusterBreak(string, i);\\n }\\n return strict === true ? -1 : string.length;\\n}\",\n \"indentation() {\\n var _a;\\n return (_a = this.overrideIndent) !== null && _a !== void 0 ? _a : countCol(this.string, null, this.tabSize);\\n }\",\n \"function num_indent (line, indent_string) {\\n\\tvar amt = 0;\\n\\tvar index = 0;\\n\\twhile (line.substring(index, index + indent_string.length) == indent_string) {\\n\\t\\tamt += 1;\\n\\t\\tindex += indent_string.length;\\n\\t}\\n\\treturn amt;\\n}\",\n \"function getIndentation(s) {\\n let indentation = s.match(/[ \\\\t]*/)[0];\\n indentation = indentation.replace(/\\\\t/g, INDENT); // replace tabs by INDENT\\n return Math.floor(indentation.length / INDENT.length);\\n }\",\n \"function lineNumberOfCharacterIndex(code, idx) {\\n var everythingUpUntilTheIndex = code.substring(0, idx);\\n // computer science!\\n return everythingUpUntilTheIndex.split('\\\\n').length;\\n}\",\n \"function updatePosition(str) {\\n const lines = str.match(/\\\\n/g);\\n\\n if (lines) {\\n lineno += lines.length;\\n }\\n\\n const i = str.lastIndexOf('\\\\n'); // eslint-disable-next-line no-bitwise\\n\\n column = ~i ? str.length - i : column + str.length;\\n }\",\n \"function updatePosition(str) {\\n var lines = str.match(/\\\\n/g);\\n if (lines) lineno += lines.length;\\n var i = str.lastIndexOf('\\\\n');\\n column = ~i ? str.length - i : column + str.length;\\n }\",\n \"function updatePosition(str) {\\n var lines = str.match(/\\\\n/g);\\n if (lines) lineno += lines.length;\\n var i = str.lastIndexOf('\\\\n');\\n column = ~i ? str.length - i : column + str.length;\\n }\",\n \"function updatePosition(str) {\\n var lines = str.match(/\\\\n/g);\\n if (lines) lineno += lines.length;\\n var i = str.lastIndexOf('\\\\n');\\n column = ~i ? str.length - i : column + str.length;\\n }\",\n \"function updatePosition(str) {\\n var lines = str.match(/\\\\n/g);\\n if (lines) lineno += lines.length;\\n var i = str.lastIndexOf('\\\\n');\\n column = ~i ? str.length - i : column + str.length;\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.78494596","0.78494596","0.78494596","0.78494596","0.78494596","0.78494596","0.78313595","0.78313595","0.78313595","0.77288246","0.77288246","0.77288246","0.77288246","0.7564648","0.7547028","0.7547028","0.75413024","0.7519291","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7494119","0.7473958","0.7344049","0.7344049","0.7302284","0.6942895","0.69376457","0.68984467","0.6892121","0.6892121","0.6892121","0.6892121","0.6892121","0.6892121","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6874578","0.6865091","0.68480057","0.6820489","0.6820489","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.6814616","0.68042594","0.6769882","0.6569674","0.6354063","0.6331614","0.62961936","0.6218746","0.6218746","0.6218746","0.6218746"],"string":"[\n \"0.78494596\",\n \"0.78494596\",\n \"0.78494596\",\n \"0.78494596\",\n \"0.78494596\",\n \"0.78494596\",\n \"0.78313595\",\n \"0.78313595\",\n \"0.78313595\",\n \"0.77288246\",\n \"0.77288246\",\n \"0.77288246\",\n \"0.77288246\",\n \"0.7564648\",\n \"0.7547028\",\n \"0.7547028\",\n \"0.75413024\",\n \"0.7519291\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7494119\",\n \"0.7473958\",\n \"0.7344049\",\n \"0.7344049\",\n \"0.7302284\",\n \"0.6942895\",\n \"0.69376457\",\n \"0.68984467\",\n \"0.6892121\",\n \"0.6892121\",\n \"0.6892121\",\n \"0.6892121\",\n \"0.6892121\",\n \"0.6892121\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6874578\",\n \"0.6865091\",\n \"0.68480057\",\n \"0.6820489\",\n \"0.6820489\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.6814616\",\n \"0.68042594\",\n \"0.6769882\",\n \"0.6569674\",\n \"0.6354063\",\n \"0.6331614\",\n \"0.62961936\",\n \"0.6218746\",\n \"0.6218746\",\n \"0.6218746\",\n \"0.6218746\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7577807"},"document_rank":{"kind":"string","value":"26"}}},{"rowIdx":4186,"cells":{"query":{"kind":"string","value":"The inverse of countColumn find the offset that corresponds to a particular column."},"document":{"kind":"string","value":"function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function firstInColumnLocation(col) {\r\n\t\tvar sets = $['mapsettings'];\r\n\t\tvar point = new Point(sets.columns[col],0);\r\n\t\tvar offset = getRelativePoint(point);\r\n\t\treturn offset.x;\r\n\t}","function getRelativeColStart(col) {\r\n\t\tvar loc = new Point(sets.columns[col],0);\r\n\t\tvar offset = getRelativePoint(loc);\r\n\t\treturn offset.x;\r\n\t}","function columnIndex(column) {\n return _.indexOf(columns, column);\n }","column() {\n if (this.lastColumnPos < this.start) {\n this.lastColumnValue = countCol(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);\n this.lastColumnPos = this.start;\n }\n return this.lastColumnValue;\n }","function findColumn(string, col, tabSize, strict) {\n for (let i = 0, n = 0;;) {\n if (n >= col)\n return i;\n if (i == string.length)\n break;\n n += string.charCodeAt(i) == 9 ? tabSize - (n % tabSize) : 1;\n i = findClusterBreak(string, i);\n }\n return strict === true ? -1 : string.length;\n}","function getColumn(x) {\r\n\t\tvar col = 0;\r\n\t\tx = getAbsolutePoint(new Point(x,0));\r\n\t\tx = x.x+5; // Adds five probably not necessary, but insures x is squarely in the col\r\n\t\t$.each($['mapsettings'].columns, function(i, item) {\r\n\t\t\tif(x>=item) col = i;\r\n\t\t});\r\n\t\treturn col+1; // add one because column count starts from one\r\n\t}","findSpotForCol(column){\n for(let row = this.height - 1; row >= 0; row--){\n if(!this.board[row][column]){\n return row;\n }\n }\n return null;\n }","column(pos, bias = 1) {\n let { text, from } = this.lineAt(pos, bias);\n let result = this.countColumn(text, pos - from);\n let override = this.options.overrideIndentation ? this.options.overrideIndentation(from) : -1;\n if (override > -1)\n result += override - this.countColumn(text, text.search(/\\S|$/));\n return result;\n }","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n for (let i = board.length-1; i >= 0; i--) {\n if (board[i][x] === null) {\n return i\n }\n }\n //it returns null when the top row is full\n return null;\n}","private_getActiveColumnFromPosition()\n\t{\n\t\tif (g_mouse.x < this.coords.x || g_mouse.x > this.coords.x + this.size.x)\n\t\t{\n\t\t\treturn -1;\n\t\t}\n\t\tif (g_mouse.y < this.coords.y || g_mouse.y > this.coords.y + this.size.y)\n\t\t{\n\t\t\treturn -1;\n\t\t}\n\t\t// Mouse is over the board, so return the column it's in\n\t\tlet columnSize = this.size.x / this.columns;\n\t\tlet distance = g_mouse.x - this.coords.x;\n\t\treturn Math.floor(distance / columnSize);\n\t}","function findSpotForCol(x) {\n\t// TODO: write the real version of this, rather than always returning 0\n\tfor (let i = HEIGHT - 1; i >= 0; i--) {\n\t\tif (board[i][x] === null) {\n\t\t\treturn i;\n\t\t}\n\t}\n\treturn null;\n}","function getIndexFromColumn(column) {\n return column.split('').reduce(function (acc, currentVal) {\n return lettersInAlphabet * acc + lettersArr.indexOf(currentVal);\n }, 0);\n}","function getColumnIndexByColumnName(columns, columnName) {\n for (var i in columns) {\n if (columns[i] == columnName) {\n return i;\n }\n }\n\n return null;\n }","function findColumn(string, goal, tabSize) {\n\t\t for (var pos = 0, col = 0;;) {\n\t\t var nextTab = string.indexOf(\"\\t\", pos);\n\t\t if (nextTab == -1) { nextTab = string.length; }\n\t\t var skipped = nextTab - pos;\n\t\t if (nextTab == string.length || col + skipped >= goal)\n\t\t { return pos + Math.min(skipped, goal - col) }\n\t\t col += nextTab - pos;\n\t\t col += tabSize - (col % tabSize);\n\t\t pos = nextTab + 1;\n\t\t if (col >= goal) { return pos }\n\t\t }\n\t\t }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) nextTab = string.length;\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n return pos + Math.min(skipped, goal - col);\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) return pos;\n }\n }","function col () {\n return index - token.length + 1;\n }","function findColumn(string, goal, tabSize) {\r\n for (var pos = 0, col = 0;;) {\r\n var nextTab = string.indexOf(\"\\t\", pos);\r\n if (nextTab == -1) nextTab = string.length;\r\n var skipped = nextTab - pos;\r\n if (nextTab == string.length || col + skipped >= goal)\r\n return pos + Math.min(skipped, goal - col);\r\n col += nextTab - pos;\r\n col += tabSize - (col % tabSize);\r\n pos = nextTab + 1;\r\n if (col >= goal) return pos;\r\n }\r\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n\n if (nextTab == -1) {\n nextTab = string.length;\n }\n\n var skipped = nextTab - pos;\n\n if (nextTab == string.length || col + skipped >= goal) {\n return pos + Math.min(skipped, goal - col);\n }\n\n col += nextTab - pos;\n col += tabSize - col % tabSize;\n pos = nextTab + 1;\n\n if (col >= goal) {\n return pos;\n }\n }\n }","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos)\n if (nextTab == -1) { nextTab = string.length }\n var skipped = nextTab - pos\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos\n col += tabSize - (col % tabSize)\n pos = nextTab + 1\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos)\n if (nextTab == -1) { nextTab = string.length }\n var skipped = nextTab - pos\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos\n col += tabSize - (col % tabSize)\n pos = nextTab + 1\n if (col >= goal) { return pos }\n }\n}","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n // first click of every column errors but still playable\n for (let i = board.length-1 ;i >= 0; i--){\n if(board[i][x] === null){\n return i;\n }\n }\n return null;\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function findColumn(string, goal, tabSize) {\n for (var pos = 0, col = 0;;) {\n var nextTab = string.indexOf(\"\\t\", pos);\n if (nextTab == -1) { nextTab = string.length; }\n var skipped = nextTab - pos;\n if (nextTab == string.length || col + skipped >= goal)\n { return pos + Math.min(skipped, goal - col) }\n col += nextTab - pos;\n col += tabSize - (col % tabSize);\n pos = nextTab + 1;\n if (col >= goal) { return pos }\n }\n}","function pageOffset () {\n // const offset = indexOfSelected() - (vs.row * vs.cols + vs.col)\n let i = indexOfSelected()\n const pageSize = vs.rows * vs.cols\n const pageNum = Math.floor(indexOfSelected() / pageSize)\n const offset = pageNum * pageSize\n return offset\n }","function findColumn(string, goal, tabSize) {\r\n for (var pos = 0, col = 0;;) {\r\n var nextTab = string.indexOf(\"\\t\", pos);\r\n if (nextTab == -1) { nextTab = string.length; }\r\n var skipped = nextTab - pos;\r\n if (nextTab == string.length || col + skipped >= goal)\r\n { return pos + Math.min(skipped, goal - col) }\r\n col += nextTab - pos;\r\n col += tabSize - (col % tabSize);\r\n pos = nextTab + 1;\r\n if (col >= goal) { return pos }\r\n }\r\n}","function lineColumnToIndex(lineColumn, text) {\n let index = 0;\n for (let i = 0; i < lineColumn.line - 1; ++i) {\n index = text.indexOf(\"\\n\", index) + 1;\n if (index === -1) {\n return -1;\n }\n }\n return index + lineColumn.column;\n}","function findSpotForCol(col) {\n // find the correct row index\n for (let possibleRow = HEIGHT - 1; possibleRow >= 0; possibleRow--) {\n if (board[possibleRow][col] === null) {\n return possibleRow;\n }\n }\n return null;\n}","function pointToOffset(point) {\n var line = point && point.line\n var column = point && point.column\n\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\n return (indices[line - 2] || 0) + column - 1 || 0\n }\n\n return -1\n }","static calculateIndex(row, col) {\n\t\treturn (row - 1) * 9 + (col - 1)\n\t}","function getCol(position) {\n return (position + 2) % 3;\n}","function getOffset() {\n\t\t\tif (!vm.current) {\n\t\t\t\treturn 0;\n\t\t\t}\n\t\t\t//console.log(vm.getRank(vm.current));\n\t\t\treturn (vm.getRank(vm.current) - 2) * 17;\n\t\t}","get col() {\n return this.pos - this.lineStartPos + Number(this.lastGapPos !== this.pos);\n }","findSpotForCol(x) {\n for (let y = this.height - 1; y >= 0; y--) {\n if (!this.board[y][x]) {\n return y;\n }\n }\n return null;\n }","function findSpotForCol(x) {\n\t// TODO: write the real version of this, rather than always returning 0\n\tfor (let y = HEIGHT - 1; y >= 0; y--) {\n\t\tif (!board[y][x]) {\n\t\t\treturn y;\n\t\t}\n\t}\n\treturn null;\n}","rowColToIndex(row, col) {\n return col + row * this.col;\n }","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n for(let y = HEIGHT - 1; y >= 0; y--){\n if(board[x][y] === undefined){\n //due to the way the board array was created, I need to use [x][y] instead of [y][x]\n return y;\n }\n }\n return null;\n}","function findSpotForCol(x) {\n let yLocation = HEIGHT-1;\n\n // iterate through the column starting from the bottom to find the position of y that contains an empty cell\n for (let i=HEIGHT-1; i >= 0; i--){\n yLocation = (board[i][x] === 1 || board[i][x] === 2) ? yLocation-1 : yLocation;\n // console.log(\"i:\",i,\"yLocation\", yLocation);\n }\n // console.log(\"yLocation\", yLocation, \"board\", board[yLocation][x]);\n yLocation = yLocation < 0 ? null : yLocation;\n return yLocation;\n}","findSpotForCol(x) {\n for (let y = this.height - 1; y >= 0; y--) {\n if (!this.board[y][x]) {\n return y;\n }\n }\n return null;\n }","findSpotForCol(x) {\n for (let y = this.HEIGHT - 1; y >= 0; y--) {\n if (!this.board[y][x]) {\n return y;\n }\n }\n return null;\n }","function _fnVisibleToColumnIndex(oSettings, iMatch) {\n\t\t\tvar iColumn = -1;\n\n\t\t\tfor (var i = 0; i < oSettings.aoColumns.length; i++) {\n\t\t\t\tif (oSettings.aoColumns[i].bVisible === true) {\n\t\t\t\t\tiColumn++;\n\t\t\t\t}\n\n\t\t\t\tif (iColumn == iMatch) {\n\t\t\t\t\treturn i;\n\t\t\t\t}\n\t\t\t}\n\n\t\t\treturn null;\n\t\t}","function findSpotForCol(x) {\n for (let y = HEIGHT - 1; y >= 0; y--) {\n if (board[y][x] === undefined) {\n return y;\n }\n }\n return null;\n}","function _get_column(i) { return i % 9; }","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n for(let y = HEIGHT - 1; y >= 0; y--){\n if(board[y][x] == null){\n return y;\n }\n }\n return null;\n}","getColumn (colIdx) {\n\t\treturn this.board.filter((e, idx) => {\n\t\t\treturn position.toCol(idx) === colIdx;\n\t\t});\n\t}","function pointToOffset(point) {\n var line = point && point.line\n var column = point && point.column\n var offset\n\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\n offset = (indices[line - 2] || 0) + column - 1 || 0\n }\n\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\n }","function pointToOffset(point) {\n var line = point && point.line\n var column = point && point.column\n var offset\n\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\n offset = (indices[line - 2] || 0) + column - 1 || 0\n }\n\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\n }","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n // return null if none available;\n // starts at x, height is 6\n // access BOARD [height][x], if the coordinate is equal to null, return current height\n for (let y = HEIGHT-1; y >= 0; y--) {\n if (!BOARD[y][x]) {\n return y;\n }\n }\n return null;\n}","function index(column, row){\n return column + (row * maxColume);\n}","function pointToOffset(point) {\n var line = point && point.line;\n var column = point && point.column;\n var offset;\n\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\n offset = (indices[line - 2] || 0) + column - 1 || 0;\n }\n\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\n }","function redips_column(std){\n\tvar nrows = std.hall.nrows;\n\treturn nrows - 1 - (std.hall_position.charCodeAt(0) - 65); // 'A' is 65, 'B' is 66, .. Vertical offset -1\n}","function getColumnLocation(plot, gridpos, numberOfBars) \n { \n var insideheight = plot.grid._height; \n var colheight = insideheight / numberOfBars; \n var column = parseInt(gridpos.y / colheight); \n return (numberOfBars - 1) - column;\n }","function index(row, col) {\n return row * 8 + col;\n }","getPageOffset() {\n return this.coord.getPageOffset();\n }","function findSpotForCol(x) {\n\tfor (let y = HEIGHT - 1; y >= 0; y--) {\n\t\tif (!board[y][x]) return y;\n\t}\n\treturn null;\n}","get goalColumn() {\n let value = this.flags >> 5 /* RangeFlag.GoalColumnOffset */;\n return value == 33554431 /* RangeFlag.NoGoalColumn */ ? undefined : value;\n }","function findSpotForCol(x) {\n for (let y = HEIGHT - 1; y >= 0; y--) {\n if (board[y][x] === null) {\n return y;\n }\n }\n return null;\n}","function findSpotForCol(x) {\n for (let y = HEIGHT - 1; y >= 0; y--) {\n if (board[y][x] === null) {\n return y;\n }\n }\n return null;\n}","function _fnVisibleToColumnIndex( oSettings, iMatch )\n\t\t{\n\t\t\tvar iColumn = -1;\n\t\t\t\n\t\t\tfor ( var i=0 ; i<oSettings.aoColumns.length ; i++ )\n\t\t\t{\n\t\t\t\tif ( oSettings.aoColumns[i].bVisible === true )\n\t\t\t\t{\n\t\t\t\t\tiColumn++;\n\t\t\t\t}\n\t\t\t\t\n\t\t\t\tif ( iColumn == iMatch )\n\t\t\t\t{\n\t\t\t\t\treturn i;\n\t\t\t\t}\n\t\t\t}\n\t\t\t\n\t\t\treturn null;\n\t\t}","function _fnVisibleToColumnIndex( oSettings, iMatch )\n\t\t{\n\t\t\tvar iColumn = -1;\n\t\t\t\n\t\t\tfor ( var i=0 ; i<oSettings.aoColumns.length ; i++ )\n\t\t\t{\n\t\t\t\tif ( oSettings.aoColumns[i].bVisible === true )\n\t\t\t\t{\n\t\t\t\t\tiColumn++;\n\t\t\t\t}\n\t\t\t\t\n\t\t\t\tif ( iColumn == iMatch )\n\t\t\t\t{\n\t\t\t\t\treturn i;\n\t\t\t\t}\n\t\t\t}\n\t\t\t\n\t\t\treturn null;\n\t\t}","col_row_from_offset(offset) {\n return this.col_row_offset_from_offset(offset).map(([index, _]) => index);\n }","function getColNumber(colObj) {\r\n // checks to see if a cellObj has been parsed as argument.\r\n // if yes, then get the colObj for that cell.\r\n colObj = colObj.hasClass(\"slot\") ? $(colObj[0].parentElement) : colObj;\r\n return parseInt(columns.index(colObj));\r\n }","function colLookup(sheet, value, row) {\n var rowValues = sheet.getRange(row,1,row,sheet.getLastColumn()).getValues();\n for (var i=0; i<columnValues.length; i++) {\n if (rowValues[i] == value) {\n var colNum = i+1;\n return colNum;\n }\n }\n return rowValues;\n}","function findInColumn(sheet, col, data) {\n var column = sheet.getRange(col + \":\" + col); // like A:A\n var values = column.getValues(); \n var row = 0;\n while ( values[row] && values[row][0] !== data ) { row++ }\n if (values[row][0] === data) { return row+1 } else { return -1 } \n}","function getColumnVisiblePostion($firstRow, $cell){\n var tdsFirstRow = $firstRow.children();\n for(var i = 0; i < tdsFirstRow.length; i++){\n if($(tdsFirstRow[i]).data('posx') == $cell.data('posx')){\n return i;\n }\n }\n }","function findSpotForCol(x) {\n for(let y = HEIGHT-1; y >= 0; y--){\n if(board[y][x] === null){\n return y;\n }\n }\n return null;\n}","function findSpotForCol(x,gameboard) {\n for (let y = 0; y<HEIGHT;y ++){\n if (gameboard[x][y] === 'E'){\n return y;\n }\n }\n //debugger;\n //console.log(\"No spot found to place a piece in the given column\");\n return null;\n}","countColumn(line, pos = line.length) {\n return state.countColumn(line, this.state.tabSize, pos);\n }","function findSpotForCol(x) {\n // TODO: write the real version of this, rather than always returning 0\n // iterating over each row to check if the cell is empty === null, if null then use that y location for new chip \n for (let y = HEIGHT - 1; y >= 0; y--) {\n if(board[y][x] === null) {\n return y;\n }\n }\n return null;\n}","function findSpotForCol(x) {\n\tlet h = HEIGHT - 1;\n\tfor (let y = h; y >= 0; y--) {\n\t\tif (!board[y][x]) {\n\t\t\treturn y;\n\t\t}\n\t}\n\treturn null;\n}","function offset_from_location(row, col){\n\t\tvar offset = $('.tile-board').offset();\n\t\toffset.left += (col-1)*tileWidth;\n\t\toffset.top += (row-1)*tileHeight;\n\t\treturn offset;\n\t}"],"string":"[\n \"function firstInColumnLocation(col) {\\r\\n\\t\\tvar sets = $['mapsettings'];\\r\\n\\t\\tvar point = new Point(sets.columns[col],0);\\r\\n\\t\\tvar offset = getRelativePoint(point);\\r\\n\\t\\treturn offset.x;\\r\\n\\t}\",\n \"function getRelativeColStart(col) {\\r\\n\\t\\tvar loc = new Point(sets.columns[col],0);\\r\\n\\t\\tvar offset = getRelativePoint(loc);\\r\\n\\t\\treturn offset.x;\\r\\n\\t}\",\n \"function columnIndex(column) {\\n return _.indexOf(columns, column);\\n }\",\n \"column() {\\n if (this.lastColumnPos < this.start) {\\n this.lastColumnValue = countCol(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);\\n this.lastColumnPos = this.start;\\n }\\n return this.lastColumnValue;\\n }\",\n \"function findColumn(string, col, tabSize, strict) {\\n for (let i = 0, n = 0;;) {\\n if (n >= col)\\n return i;\\n if (i == string.length)\\n break;\\n n += string.charCodeAt(i) == 9 ? tabSize - (n % tabSize) : 1;\\n i = findClusterBreak(string, i);\\n }\\n return strict === true ? -1 : string.length;\\n}\",\n \"function getColumn(x) {\\r\\n\\t\\tvar col = 0;\\r\\n\\t\\tx = getAbsolutePoint(new Point(x,0));\\r\\n\\t\\tx = x.x+5; // Adds five probably not necessary, but insures x is squarely in the col\\r\\n\\t\\t$.each($['mapsettings'].columns, function(i, item) {\\r\\n\\t\\t\\tif(x>=item) col = i;\\r\\n\\t\\t});\\r\\n\\t\\treturn col+1; // add one because column count starts from one\\r\\n\\t}\",\n \"findSpotForCol(column){\\n for(let row = this.height - 1; row >= 0; row--){\\n if(!this.board[row][column]){\\n return row;\\n }\\n }\\n return null;\\n }\",\n \"column(pos, bias = 1) {\\n let { text, from } = this.lineAt(pos, bias);\\n let result = this.countColumn(text, pos - from);\\n let override = this.options.overrideIndentation ? this.options.overrideIndentation(from) : -1;\\n if (override > -1)\\n result += override - this.countColumn(text, text.search(/\\\\S|$/));\\n return result;\\n }\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n for (let i = board.length-1; i >= 0; i--) {\\n if (board[i][x] === null) {\\n return i\\n }\\n }\\n //it returns null when the top row is full\\n return null;\\n}\",\n \"private_getActiveColumnFromPosition()\\n\\t{\\n\\t\\tif (g_mouse.x < this.coords.x || g_mouse.x > this.coords.x + this.size.x)\\n\\t\\t{\\n\\t\\t\\treturn -1;\\n\\t\\t}\\n\\t\\tif (g_mouse.y < this.coords.y || g_mouse.y > this.coords.y + this.size.y)\\n\\t\\t{\\n\\t\\t\\treturn -1;\\n\\t\\t}\\n\\t\\t// Mouse is over the board, so return the column it's in\\n\\t\\tlet columnSize = this.size.x / this.columns;\\n\\t\\tlet distance = g_mouse.x - this.coords.x;\\n\\t\\treturn Math.floor(distance / columnSize);\\n\\t}\",\n \"function findSpotForCol(x) {\\n\\t// TODO: write the real version of this, rather than always returning 0\\n\\tfor (let i = HEIGHT - 1; i >= 0; i--) {\\n\\t\\tif (board[i][x] === null) {\\n\\t\\t\\treturn i;\\n\\t\\t}\\n\\t}\\n\\treturn null;\\n}\",\n \"function getIndexFromColumn(column) {\\n return column.split('').reduce(function (acc, currentVal) {\\n return lettersInAlphabet * acc + lettersArr.indexOf(currentVal);\\n }, 0);\\n}\",\n \"function getColumnIndexByColumnName(columns, columnName) {\\n for (var i in columns) {\\n if (columns[i] == columnName) {\\n return i;\\n }\\n }\\n\\n return null;\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n\\t\\t for (var pos = 0, col = 0;;) {\\n\\t\\t var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n\\t\\t if (nextTab == -1) { nextTab = string.length; }\\n\\t\\t var skipped = nextTab - pos;\\n\\t\\t if (nextTab == string.length || col + skipped >= goal)\\n\\t\\t { return pos + Math.min(skipped, goal - col) }\\n\\t\\t col += nextTab - pos;\\n\\t\\t col += tabSize - (col % tabSize);\\n\\t\\t pos = nextTab + 1;\\n\\t\\t if (col >= goal) { return pos }\\n\\t\\t }\\n\\t\\t }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) nextTab = string.length;\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n return pos + Math.min(skipped, goal - col);\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) return pos;\\n }\\n }\",\n \"function col () {\\n return index - token.length + 1;\\n }\",\n \"function findColumn(string, goal, tabSize) {\\r\\n for (var pos = 0, col = 0;;) {\\r\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\r\\n if (nextTab == -1) nextTab = string.length;\\r\\n var skipped = nextTab - pos;\\r\\n if (nextTab == string.length || col + skipped >= goal)\\r\\n return pos + Math.min(skipped, goal - col);\\r\\n col += nextTab - pos;\\r\\n col += tabSize - (col % tabSize);\\r\\n pos = nextTab + 1;\\r\\n if (col >= goal) return pos;\\r\\n }\\r\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n\\n if (nextTab == -1) {\\n nextTab = string.length;\\n }\\n\\n var skipped = nextTab - pos;\\n\\n if (nextTab == string.length || col + skipped >= goal) {\\n return pos + Math.min(skipped, goal - col);\\n }\\n\\n col += nextTab - pos;\\n col += tabSize - col % tabSize;\\n pos = nextTab + 1;\\n\\n if (col >= goal) {\\n return pos;\\n }\\n }\\n }\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos)\\n if (nextTab == -1) { nextTab = string.length }\\n var skipped = nextTab - pos\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos\\n col += tabSize - (col % tabSize)\\n pos = nextTab + 1\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos)\\n if (nextTab == -1) { nextTab = string.length }\\n var skipped = nextTab - pos\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos\\n col += tabSize - (col % tabSize)\\n pos = nextTab + 1\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n // first click of every column errors but still playable\\n for (let i = board.length-1 ;i >= 0; i--){\\n if(board[i][x] === null){\\n return i;\\n }\\n }\\n return null;\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function findColumn(string, goal, tabSize) {\\n for (var pos = 0, col = 0;;) {\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\n if (nextTab == -1) { nextTab = string.length; }\\n var skipped = nextTab - pos;\\n if (nextTab == string.length || col + skipped >= goal)\\n { return pos + Math.min(skipped, goal - col) }\\n col += nextTab - pos;\\n col += tabSize - (col % tabSize);\\n pos = nextTab + 1;\\n if (col >= goal) { return pos }\\n }\\n}\",\n \"function pageOffset () {\\n // const offset = indexOfSelected() - (vs.row * vs.cols + vs.col)\\n let i = indexOfSelected()\\n const pageSize = vs.rows * vs.cols\\n const pageNum = Math.floor(indexOfSelected() / pageSize)\\n const offset = pageNum * pageSize\\n return offset\\n }\",\n \"function findColumn(string, goal, tabSize) {\\r\\n for (var pos = 0, col = 0;;) {\\r\\n var nextTab = string.indexOf(\\\"\\\\t\\\", pos);\\r\\n if (nextTab == -1) { nextTab = string.length; }\\r\\n var skipped = nextTab - pos;\\r\\n if (nextTab == string.length || col + skipped >= goal)\\r\\n { return pos + Math.min(skipped, goal - col) }\\r\\n col += nextTab - pos;\\r\\n col += tabSize - (col % tabSize);\\r\\n pos = nextTab + 1;\\r\\n if (col >= goal) { return pos }\\r\\n }\\r\\n}\",\n \"function lineColumnToIndex(lineColumn, text) {\\n let index = 0;\\n for (let i = 0; i < lineColumn.line - 1; ++i) {\\n index = text.indexOf(\\\"\\\\n\\\", index) + 1;\\n if (index === -1) {\\n return -1;\\n }\\n }\\n return index + lineColumn.column;\\n}\",\n \"function findSpotForCol(col) {\\n // find the correct row index\\n for (let possibleRow = HEIGHT - 1; possibleRow >= 0; possibleRow--) {\\n if (board[possibleRow][col] === null) {\\n return possibleRow;\\n }\\n }\\n return null;\\n}\",\n \"function pointToOffset(point) {\\n var line = point && point.line\\n var column = point && point.column\\n\\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\\n return (indices[line - 2] || 0) + column - 1 || 0\\n }\\n\\n return -1\\n }\",\n \"static calculateIndex(row, col) {\\n\\t\\treturn (row - 1) * 9 + (col - 1)\\n\\t}\",\n \"function getCol(position) {\\n return (position + 2) % 3;\\n}\",\n \"function getOffset() {\\n\\t\\t\\tif (!vm.current) {\\n\\t\\t\\t\\treturn 0;\\n\\t\\t\\t}\\n\\t\\t\\t//console.log(vm.getRank(vm.current));\\n\\t\\t\\treturn (vm.getRank(vm.current) - 2) * 17;\\n\\t\\t}\",\n \"get col() {\\n return this.pos - this.lineStartPos + Number(this.lastGapPos !== this.pos);\\n }\",\n \"findSpotForCol(x) {\\n for (let y = this.height - 1; y >= 0; y--) {\\n if (!this.board[y][x]) {\\n return y;\\n }\\n }\\n return null;\\n }\",\n \"function findSpotForCol(x) {\\n\\t// TODO: write the real version of this, rather than always returning 0\\n\\tfor (let y = HEIGHT - 1; y >= 0; y--) {\\n\\t\\tif (!board[y][x]) {\\n\\t\\t\\treturn y;\\n\\t\\t}\\n\\t}\\n\\treturn null;\\n}\",\n \"rowColToIndex(row, col) {\\n return col + row * this.col;\\n }\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n for(let y = HEIGHT - 1; y >= 0; y--){\\n if(board[x][y] === undefined){\\n //due to the way the board array was created, I need to use [x][y] instead of [y][x]\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function findSpotForCol(x) {\\n let yLocation = HEIGHT-1;\\n\\n // iterate through the column starting from the bottom to find the position of y that contains an empty cell\\n for (let i=HEIGHT-1; i >= 0; i--){\\n yLocation = (board[i][x] === 1 || board[i][x] === 2) ? yLocation-1 : yLocation;\\n // console.log(\\\"i:\\\",i,\\\"yLocation\\\", yLocation);\\n }\\n // console.log(\\\"yLocation\\\", yLocation, \\\"board\\\", board[yLocation][x]);\\n yLocation = yLocation < 0 ? null : yLocation;\\n return yLocation;\\n}\",\n \"findSpotForCol(x) {\\n for (let y = this.height - 1; y >= 0; y--) {\\n if (!this.board[y][x]) {\\n return y;\\n }\\n }\\n return null;\\n }\",\n \"findSpotForCol(x) {\\n for (let y = this.HEIGHT - 1; y >= 0; y--) {\\n if (!this.board[y][x]) {\\n return y;\\n }\\n }\\n return null;\\n }\",\n \"function _fnVisibleToColumnIndex(oSettings, iMatch) {\\n\\t\\t\\tvar iColumn = -1;\\n\\n\\t\\t\\tfor (var i = 0; i < oSettings.aoColumns.length; i++) {\\n\\t\\t\\t\\tif (oSettings.aoColumns[i].bVisible === true) {\\n\\t\\t\\t\\t\\tiColumn++;\\n\\t\\t\\t\\t}\\n\\n\\t\\t\\t\\tif (iColumn == iMatch) {\\n\\t\\t\\t\\t\\treturn i;\\n\\t\\t\\t\\t}\\n\\t\\t\\t}\\n\\n\\t\\t\\treturn null;\\n\\t\\t}\",\n \"function findSpotForCol(x) {\\n for (let y = HEIGHT - 1; y >= 0; y--) {\\n if (board[y][x] === undefined) {\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function _get_column(i) { return i % 9; }\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n for(let y = HEIGHT - 1; y >= 0; y--){\\n if(board[y][x] == null){\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"getColumn (colIdx) {\\n\\t\\treturn this.board.filter((e, idx) => {\\n\\t\\t\\treturn position.toCol(idx) === colIdx;\\n\\t\\t});\\n\\t}\",\n \"function pointToOffset(point) {\\n var line = point && point.line\\n var column = point && point.column\\n var offset\\n\\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\\n offset = (indices[line - 2] || 0) + column - 1 || 0\\n }\\n\\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\\n }\",\n \"function pointToOffset(point) {\\n var line = point && point.line\\n var column = point && point.column\\n var offset\\n\\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\\n offset = (indices[line - 2] || 0) + column - 1 || 0\\n }\\n\\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\\n }\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n // return null if none available;\\n // starts at x, height is 6\\n // access BOARD [height][x], if the coordinate is equal to null, return current height\\n for (let y = HEIGHT-1; y >= 0; y--) {\\n if (!BOARD[y][x]) {\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function index(column, row){\\n return column + (row * maxColume);\\n}\",\n \"function pointToOffset(point) {\\n var line = point && point.line;\\n var column = point && point.column;\\n var offset;\\n\\n if (!isNaN(line) && !isNaN(column) && line - 1 in indices) {\\n offset = (indices[line - 2] || 0) + column - 1 || 0;\\n }\\n\\n return offset > -1 && offset < indices[indices.length - 1] ? offset : -1\\n }\",\n \"function redips_column(std){\\n\\tvar nrows = std.hall.nrows;\\n\\treturn nrows - 1 - (std.hall_position.charCodeAt(0) - 65); // 'A' is 65, 'B' is 66, .. Vertical offset -1\\n}\",\n \"function getColumnLocation(plot, gridpos, numberOfBars) \\n { \\n var insideheight = plot.grid._height; \\n var colheight = insideheight / numberOfBars; \\n var column = parseInt(gridpos.y / colheight); \\n return (numberOfBars - 1) - column;\\n }\",\n \"function index(row, col) {\\n return row * 8 + col;\\n }\",\n \"getPageOffset() {\\n return this.coord.getPageOffset();\\n }\",\n \"function findSpotForCol(x) {\\n\\tfor (let y = HEIGHT - 1; y >= 0; y--) {\\n\\t\\tif (!board[y][x]) return y;\\n\\t}\\n\\treturn null;\\n}\",\n \"get goalColumn() {\\n let value = this.flags >> 5 /* RangeFlag.GoalColumnOffset */;\\n return value == 33554431 /* RangeFlag.NoGoalColumn */ ? undefined : value;\\n }\",\n \"function findSpotForCol(x) {\\n for (let y = HEIGHT - 1; y >= 0; y--) {\\n if (board[y][x] === null) {\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function findSpotForCol(x) {\\n for (let y = HEIGHT - 1; y >= 0; y--) {\\n if (board[y][x] === null) {\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function _fnVisibleToColumnIndex( oSettings, iMatch )\\n\\t\\t{\\n\\t\\t\\tvar iColumn = -1;\\n\\t\\t\\t\\n\\t\\t\\tfor ( var i=0 ; i<oSettings.aoColumns.length ; i++ )\\n\\t\\t\\t{\\n\\t\\t\\t\\tif ( oSettings.aoColumns[i].bVisible === true )\\n\\t\\t\\t\\t{\\n\\t\\t\\t\\t\\tiColumn++;\\n\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tif ( iColumn == iMatch )\\n\\t\\t\\t\\t{\\n\\t\\t\\t\\t\\treturn i;\\n\\t\\t\\t\\t}\\n\\t\\t\\t}\\n\\t\\t\\t\\n\\t\\t\\treturn null;\\n\\t\\t}\",\n \"function _fnVisibleToColumnIndex( oSettings, iMatch )\\n\\t\\t{\\n\\t\\t\\tvar iColumn = -1;\\n\\t\\t\\t\\n\\t\\t\\tfor ( var i=0 ; i<oSettings.aoColumns.length ; i++ )\\n\\t\\t\\t{\\n\\t\\t\\t\\tif ( oSettings.aoColumns[i].bVisible === true )\\n\\t\\t\\t\\t{\\n\\t\\t\\t\\t\\tiColumn++;\\n\\t\\t\\t\\t}\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tif ( iColumn == iMatch )\\n\\t\\t\\t\\t{\\n\\t\\t\\t\\t\\treturn i;\\n\\t\\t\\t\\t}\\n\\t\\t\\t}\\n\\t\\t\\t\\n\\t\\t\\treturn null;\\n\\t\\t}\",\n \"col_row_from_offset(offset) {\\n return this.col_row_offset_from_offset(offset).map(([index, _]) => index);\\n }\",\n \"function getColNumber(colObj) {\\r\\n // checks to see if a cellObj has been parsed as argument.\\r\\n // if yes, then get the colObj for that cell.\\r\\n colObj = colObj.hasClass(\\\"slot\\\") ? $(colObj[0].parentElement) : colObj;\\r\\n return parseInt(columns.index(colObj));\\r\\n }\",\n \"function colLookup(sheet, value, row) {\\n var rowValues = sheet.getRange(row,1,row,sheet.getLastColumn()).getValues();\\n for (var i=0; i<columnValues.length; i++) {\\n if (rowValues[i] == value) {\\n var colNum = i+1;\\n return colNum;\\n }\\n }\\n return rowValues;\\n}\",\n \"function findInColumn(sheet, col, data) {\\n var column = sheet.getRange(col + \\\":\\\" + col); // like A:A\\n var values = column.getValues(); \\n var row = 0;\\n while ( values[row] && values[row][0] !== data ) { row++ }\\n if (values[row][0] === data) { return row+1 } else { return -1 } \\n}\",\n \"function getColumnVisiblePostion($firstRow, $cell){\\n var tdsFirstRow = $firstRow.children();\\n for(var i = 0; i < tdsFirstRow.length; i++){\\n if($(tdsFirstRow[i]).data('posx') == $cell.data('posx')){\\n return i;\\n }\\n }\\n }\",\n \"function findSpotForCol(x) {\\n for(let y = HEIGHT-1; y >= 0; y--){\\n if(board[y][x] === null){\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function findSpotForCol(x,gameboard) {\\n for (let y = 0; y<HEIGHT;y ++){\\n if (gameboard[x][y] === 'E'){\\n return y;\\n }\\n }\\n //debugger;\\n //console.log(\\\"No spot found to place a piece in the given column\\\");\\n return null;\\n}\",\n \"countColumn(line, pos = line.length) {\\n return state.countColumn(line, this.state.tabSize, pos);\\n }\",\n \"function findSpotForCol(x) {\\n // TODO: write the real version of this, rather than always returning 0\\n // iterating over each row to check if the cell is empty === null, if null then use that y location for new chip \\n for (let y = HEIGHT - 1; y >= 0; y--) {\\n if(board[y][x] === null) {\\n return y;\\n }\\n }\\n return null;\\n}\",\n \"function findSpotForCol(x) {\\n\\tlet h = HEIGHT - 1;\\n\\tfor (let y = h; y >= 0; y--) {\\n\\t\\tif (!board[y][x]) {\\n\\t\\t\\treturn y;\\n\\t\\t}\\n\\t}\\n\\treturn null;\\n}\",\n \"function offset_from_location(row, col){\\n\\t\\tvar offset = $('.tile-board').offset();\\n\\t\\toffset.left += (col-1)*tileWidth;\\n\\t\\toffset.top += (row-1)*tileHeight;\\n\\t\\treturn offset;\\n\\t}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.70207864","0.6774466","0.6547042","0.65317714","0.6513608","0.6411472","0.64103985","0.6358958","0.63435084","0.6293746","0.62447125","0.62313","0.62138146","0.62027305","0.6194549","0.6194549","0.6194549","0.6194549","0.6194549","0.6194549","0.615899","0.6146788","0.61464524","0.6128407","0.6128407","0.6122685","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60905886","0.60844547","0.60369617","0.6026345","0.6023489","0.6017217","0.6013644","0.60007524","0.6000296","0.59987205","0.59841657","0.59811825","0.5969928","0.59625995","0.59378856","0.59365094","0.59322864","0.5928569","0.59142834","0.59023464","0.58990693","0.5879603","0.5875572","0.5875572","0.58704334","0.5857993","0.58540547","0.5849232","0.58417046","0.5832389","0.5827229","0.5824106","0.58124924","0.5800795","0.5800795","0.5794131","0.5794131","0.5791439","0.5786987","0.5784329","0.57556057","0.5747672","0.5746299","0.5730945","0.57254124","0.572503","0.5722675","0.5707531"],"string":"[\n \"0.70207864\",\n \"0.6774466\",\n \"0.6547042\",\n \"0.65317714\",\n \"0.6513608\",\n \"0.6411472\",\n \"0.64103985\",\n \"0.6358958\",\n \"0.63435084\",\n \"0.6293746\",\n \"0.62447125\",\n \"0.62313\",\n \"0.62138146\",\n \"0.62027305\",\n \"0.6194549\",\n \"0.6194549\",\n \"0.6194549\",\n \"0.6194549\",\n \"0.6194549\",\n \"0.6194549\",\n \"0.615899\",\n \"0.6146788\",\n \"0.61464524\",\n \"0.6128407\",\n \"0.6128407\",\n \"0.6122685\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60905886\",\n \"0.60844547\",\n \"0.60369617\",\n \"0.6026345\",\n \"0.6023489\",\n \"0.6017217\",\n \"0.6013644\",\n \"0.60007524\",\n \"0.6000296\",\n \"0.59987205\",\n \"0.59841657\",\n \"0.59811825\",\n \"0.5969928\",\n \"0.59625995\",\n \"0.59378856\",\n \"0.59365094\",\n \"0.59322864\",\n \"0.5928569\",\n \"0.59142834\",\n \"0.59023464\",\n \"0.58990693\",\n \"0.5879603\",\n \"0.5875572\",\n \"0.5875572\",\n \"0.58704334\",\n \"0.5857993\",\n \"0.58540547\",\n \"0.5849232\",\n \"0.58417046\",\n \"0.5832389\",\n \"0.5827229\",\n \"0.5824106\",\n \"0.58124924\",\n \"0.5800795\",\n \"0.5800795\",\n \"0.5794131\",\n \"0.5794131\",\n \"0.5791439\",\n \"0.5786987\",\n \"0.5784329\",\n \"0.57556057\",\n \"0.5747672\",\n \"0.5746299\",\n \"0.5730945\",\n \"0.57254124\",\n \"0.572503\",\n \"0.5722675\",\n \"0.5707531\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.6172878"},"document_rank":{"kind":"string","value":"32"}}},{"rowIdx":4187,"cells":{"query":{"kind":"string","value":"Returns a number from the range [`0`; `str.length`] unless `pos` is outside that range."},"document":{"kind":"string","value":"function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function getStart (pos, len) {\n if (pos == null) return 0;\n return pos < 0 ? (len + (pos % len)) : Math.min(len, pos);\n}","function getPosAsInt(str) {\n\treturn parseInt(str.substr(0, str.length - 2));\n}","function collectDigits(input, pos) {\n\t\t'use strict';\n\t\twhile (pos < input.length && input.charCodeAt(pos + 1) >= ZERO && input.charCodeAt(pos + 1) <= NINE) {\n\t\t\tpos += 1;\n\t\t}\n\t\treturn pos;\n\t}","function getDigit(num, position) {\n const stringNum = String(num);\n const digit = parseInt(stringNum[stringNum.length - 1 - position]);\n return isNaN(digit) ? 0 : digit;\n}","function startAtNum(str) {\r\n str = str || ''\r\n var match = str.match(/[0-9]/)\r\n return match ? str.slice(match.index).trim() : ''\r\n}","function getPosLetter(inpt,position)\r\n{\r\n\tvar len=inpt.length;\r\n\tif(position<=len)\r\n\t{\r\n\t\tfinalOutput=inpt.charAt(position-1);\r\n\t\treturn finalOutput;\r\n\t\t \r\n\t}\r\n\telse\r\n\t{\r\n\t\tdocument.write(\"Invalid Position!\");\r\n\t\treturn; \r\n\t}\r\n\t\r\n}","function findCoord(str, lower, lowerLetter, upper, upperLetter) {\n let result = 0;\n\n // Check range before final value\n for (let i = 0; i < str.length - 1; i++) {\n let midway = Math.floor((upper - lower) / 2);\n if (str[i] === lowerLetter) {\n upper = midway + lower;\n } else {\n lower = upper - midway;\n }\n }\n\n // Check final value\n if (str[str.length - 1] === lowerLetter) {\n result = lower;\n } else {\n result = upper;\n }\n\n return result;\n}","function validPos(inpt,position)\r\n{\r\n\tif(pos>inpt.length)\r\n\t{\r\n\t\tdocument.write(\"Invalid Position!\");\r\n\t\treturn;\r\n\t}\r\n\telse\r\n\t\treturn 1;\r\n\r\n}","function position(posNumber) {\n let position = \"\";\n position = (posNumber - 1) * 18 + \"px\";\n // console.log(\"position \" + position);\n return position;\n}","function getNthPos(endtag,pos)\n{\n if(pos == 0)\n return 0;\n if(pos > getNumUnderscores(endtag))\n return -1; //error. this is not possible.\n\n for(var i=0; i<pos; i++) { //remove 'pos' number of underscores\n endtag = endtag.substring(endtag.indexOf(\"_\")+1, endtag.length);\n }\n\n if(endtag.indexOf(\"_\") == -1) //has no more underscores so just return everything that's left\n return parseInt(endtag);\n else //otherwise, return up to the next underscore\n return parseInt(endtag.substring(0,endtag.indexOf(\"_\")));\n }","function posToIndex(pos) {\n var row = pos[0];\n var col = pos[1];\n return (row * 4) + col;\n}","function substringHandleNegativeLengths(base_s, index_s) {\n\n\t\t//Index s is negative to adding will get us to the right start\n\t\tconst newIndex = ctx.mkAdd(base_s.getLength(), index_s);\n\n\t\t//Bound the minimum index by 0\n\t\tconst aboveMin = ctx.mkGe(newIndex, ctx.mkIntVal(0));\n\t\tconst indexOrZero = ctx.mkIte(aboveMin, newIndex, ctx.mkIntVal(0));\n\n\t\treturn ctx.mkIte(ctx.mkGe(index_s, ctx.mkIntVal(0)), index_s, indexOrZero);\n\t}","function palindromeX(len, pos) {\n let left = (10 ** Math.floor((len - 1) / 2) + pos - 1).toString();\n let right = [...left].reverse().join('').slice(len % 2);\n return Number(left + right);\n}","function normalizePosition(val) {\n val = parseInt(val);\n if (isNaN(val))\n return undefined;\n else\n return val;\n}","function normalizePosition(val) {\n val = parseInt(val);\n if (isNaN(val))\n return undefined;\n else\n return val;\n}","function truncateString(str, num) {\n // I want to return the string parts\n // from indexOf(0) to indexOf(num), only when the length of string > num\n // otherwise, return the string\n if (str.length > num) {\n return str.slice(0, num) + \"...\";\n } else {\n return str;\n }\n}","function codePointAt(str, pos) {\n let code0 = str.charCodeAt(pos);\n if (!surrogateHigh(code0) || pos + 1 == str.length)\n return code0;\n let code1 = str.charCodeAt(pos + 1);\n if (!surrogateLow(code1))\n return code0;\n return ((code0 - 0xd800) << 10) + (code1 - 0xdc00) + 0x10000;\n}","function textToIndex(pos){\n\n\tvar firstRowLength=114; //Header row length not including new line.\n\n\tvar rowLabelLength=4;\t//Lenght of row labels including new line.\n\n\tvar numberOfCharactersPerGroup=11;\t//Total number of characters in a group including space.\n\n\tvar totalNumberOfCharactersPerLine=114;\t//Total number of characters in a line including row label, spaces, and new Line.\n\n\tvar offset=0;\t//Total offset needed to convert text selection index to a valid index.\n\n\t\n\n\t//Amount for length of Header Row (Row 0) and first row label\n\n\toffset+=firstRowLength+rowLabelLength;\n\n\t\n\n\t//Position selected is in the header or first row labels\n\n\tif(pos<offset){\n\n\t\treturn 0;\n\n\t}\n\n\t\n\n\t//Past the first Line (Rows beyond 1)\n\n\tif(pos>=(firstRowLength+rowLabelLength+totalNumberOfCharactersPerLine)){\n\n\t\t//Calculate number of Row Labels needed (including new line)\n\n\t\toffset+=(Math.floor((pos/(totalNumberOfCharactersPerLine)))-1)*rowLabelLength\n\n\t}\n\n\t\n\n\t//Past First Group in Row 1\n\n\tif(pos>=(numberOfCharactersPerGroup+firstRowLength+rowLabelLength)){\n\n\t\t//Calculate number of spaces needed\n\n\t\toffset+=Math.floor((pos-offset)/numberOfCharactersPerGroup);\n\n\t}\n\n\t//Return Index (Position - Offset)\n\n\treturn pos-offset;\n\n\n\n}","function palindrome(len, pos) {\n let left = Math.pow(10, Math.ceil(len / 2) - 1) + (pos - 1) + '';\n let right = left.slice(0, Math.floor(len / 2)).split('').reverse().join('');\n return +(left + right);\n}","function inc(s, pos) {\n\tif (pos===undefined) pos = s.length-1\n\tvar c = s.charCodeAt(pos) + 1\n\tif (c===123) {\n\t\tc = 97\n\t\ts = inc(s,pos-1)\n\t}\n\tvar a = s.split('')\n\ta[pos] = String.fromCharCode(c)\n\treturn a.join('')\n}","function NumerosLargo(string,largo){\n var out = '';\n var filtro = '1234567890';\n \n for (var i=0; i<string.length; i++){\n if (filtro.indexOf(string.charAt(i)) != -1) {\n if(out.length<(largo)){\n out += string.charAt(i);\n }\n }\n }\n\n return out;\n}","function leftDigit(str) {\n // write your code here\n // let reg = new RegExp([0-9])\n const reg=/[0-9]/\n let left =str.search(reg);\n // return left;\nreturn str[left];\n \n }","function getLength(string, index = 0) {\n if(string[index] === undefined) {\n return index;\n }\n return getLength(string, index + 1)\n}","function positionToChar(position) {\n var counter = 0;\n\n loop:\n for (var i = 1; i <= keyboardDimension[0]; i++) {\n for (var j = 1; j <= keyboardDimension[1]; j++) {\n if (!(i in invalidPositions) || !invalidPositions[i].some(xPosition => xPosition == j)) {\n counter++;\n }\n\n if (position[0] == i && position[1] == j) {\n //We are at the position that is given as the parameter, stop the N(2) loop\n // with the label\n break loop;\n }\n }\n }\n\n if (counter >= 10) {\n return String.fromCharCode(65 + (counter - 10));\n }\n\n return counter;\n}","function strend(str) {\n\t\t\tlet i;\n\t\t\tfor (let i = 0; i < str.length; i++)\n\t\t\t{\n\t\t\t\tif (ord(str[i]) <= 31) break;\n\t\t\t}\n\t\t\treturn i;\n\t\t}","function h$jsstringIndexR(i, str) {\n ;\n if(i < 0 || i > str.length) return -1;\n var ch = str.charCodeAt(i);\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\n}","function location(pos){\n return dimension * + Math.floor(-pos[2]) + Math.floor(pos[0]);\n}","function h$jsstringIndexR(i, str) {\n ;\n if(i < 0 || i > str.length) return -1;\n var ch = str.charCodeAt(i);\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\n}","function h$jsstringIndexR(i, str) {\n ;\n if(i < 0 || i > str.length) return -1;\n var ch = str.charCodeAt(i);\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\n}","function h$jsstringIndexR(i, str) {\n ;\n if(i < 0 || i > str.length) return -1;\n var ch = str.charCodeAt(i);\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\n}","function getCharFromPosition(pos) {\n\t\tvar index = pos.row * 5;\n\t\tindex = index + pos.col;\n\t\treturn keyPhrase.charAt(index);\n\t}","function cigar2pos(cigar, pos)\n{\n\tvar x = 0, y = 0;\n\tfor (var i = 0; i < cigar.length; ++i) {\n\t\tvar op = cigar[i][0], len = cigar[i][1];\n\t\tif (op == 'M') {\n\t\t\tif (y <= pos && pos < y + len)\n\t\t\t\treturn x + (pos - y);\n\t\t\tx += len, y += len;\n\t\t} else if (op == 'D') {\n\t\t\tx += len;\n\t\t} else if (op == 'I') {\n\t\t\tif (y <= pos && pos < y + len)\n\t\t\t\treturn x;\n\t\t\ty += len;\n\t\t} else if (op == 'S' || op == 'H') {\n\t\t\tif (y <= pos && pos < y + len)\n\t\t\t\treturn -1;\n\t\t\ty += len;\n\t\t}\n\t}\n\treturn -1;\n}","function ml_z_of_substring_base(base, s, pos, len) {\n s = caml_jsbytes_of_string(s);\n if(pos != 0 || len != s.length) {\n if (s.length - pos < len) {\n caml_invalid_argument(\"Z.of_substring_base: invalid offset or length\");\n }\n s = s.slice(pos,pos+len);\n }\n return jsoo_z_of_js_string_base(base, s);\n}","function position(letter){\n let alphabet ='abcdefghijklmnopqrstuvwxyz';\nreturn `Position of alphabet: ${alphabet.indexOf(letter)+1}`;\n}","function GiveACharacter(str, num) {\n if (num >=0) {\n return str[num];\n }\n}","function re(e){return e.inclusiveLeft?-1:0}","function _getInt(str, l, minlength, maxlength) {\n for (var m = maxlength; m >= minlength; m--) {\n var _token = str.substring(l, l + m);\n if (_token.length < minlength) {\n return null;\n }\n if (_isInteger(_token)) {\n return _token;\n }\n }\n return null;\n }","function getPosition(num, str) {\n const result = [];\n num.map((a) => {\n str.map((b) => {\n result.push(`${a}${b}`);\n });\n });\n return result.join(' ');\n}","function beyond(s) {\n if (s.length === 0) {\n return exports.MAX_WORD;\n }\n var code = s.charCodeAt(s.length - 1);\n return s.slice(0, -1) + String.fromCharCode(code + 1);\n}","function countOfBalStr(string, position, count = null, total = 0) {\n if (position >= string.length) {\n return total\n }\n \n const letter = string[position]\n const value = letter === 'L' ? 1 : -1 // We can hard code this cause this is a contraint on the question\n count += value\n \n if (count === 0) {\n total++\n }\n \n return countOfBalStr(string, position + 1, count, total)\n}","function at(position) {\n return value.charAt(position)\n }","function at(position) {\n return value.charAt(position)\n }","function at(position) {\n return value.charAt(position)\n }","function at(position) {\n return value.charAt(position)\n }","function n(str) {\n if (str == \"\") { return -1; }\n return Number(str);\n }","function charAt (str='', position) {\n // var strArray = str.split('')\n return str[position]\n}","function get_int(str, index) {\n var orig = index;\n while (str[index] >= '0' && str[index] <= '9') {\n index++;\n }\n return { value: parseInt(str.slice(orig)), len: index - orig };\n}","function skipExtendingChars(str, pos, dir) {\r\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\r\n return pos\r\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\n return pos\n}","function pos2coord(pos) {\n var coord;\n coord = Math.floor(pos / 64);\n return coord;\n}","function substring(p0, pos) {\n return filterFunction('substring', 'string', p0, pos);\n}","function Int_substr(str, a, b) {\n\ta = Int_convertToInt(a);\n\tb = Int_convertToInt(b);\n\n\tvar start = 0;\n\twhile(Int_lt(start, a)) start++;\n\tvar end = 0;\n\twhile(Int_lt(end, b)) end++;\n\treturn str.substring(start,end);\n}","function deleteNthChar(inputString, position) {\n \"use strict\";\n /*\n * deletes the n-th character of the input string and\n * returns the (now one character shorter) string.\n *\n * n is counted from 0\n */\n if (position > inputString.length) {\n throw new BoundaryException(position, \"deleting char at position\");\n }\n\n var outputString = \"\";\n outputString = inputString.slice(0, position);\n outputString = outputString + inputString.slice(position + 1);\n return outputString;\n}","function toPosInt(number) {\n return Math.floor(Math.abs(number));\n }","function at(position) {\n return value.charAt(position);\n }","convertPointToCharacterPosition(text, point) {\n var position = 0;\n var w = 0;\n for (var i = 0, n = text.length; i < n; i++) {\n\n var charWidth = this.calculateCharacterSize(text.charAt(i))[0];\n var halfWidth = charWidth / 2;\n\n if (i > 0) {\n w = this.calculateSize(text.substr(0, i))[0];\n }\n\n // basic rounding calculation bast on character\n // width\n if (w + halfWidth > point) {\n break;\n }\n\n position++;\n }\n\n return position;\n }","function displacement(num){\r\n\twhere=1;\r\n\tfor (var i=0; i<incount; ++i){\r\n\t\tif (startin[i] < num){\r\n\t\t\twhere+=lengthin[i]-1;\r\n\t\t}\r\n\t}\r\n\treturn where;\r\n}","function skipExtendingChars(str, pos, dir) {\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir }\n return pos\n}","function getSubstr(strSource,intStartPosition,intOverPosition,cPosition)\r\n{\r\n\tvar strTarget = \"\";\r\n\tvar cTemp = \"\";\r\n\tvar intLoop = 0;\r\n\tvar intCount = 0;\r\n\ttry\r\n\t{\r\n\t strSource = trim(strSource);\r\n\t\tintCount = strSource.length;\r\n\t\tif (intStartPosition>intCount) intStartPosition = intCount;\r\n\t\tif (intOverPosition>intCount) intOverPosition = intCount;\r\n\t\tif (cPosition==null)\r\n\t\t{\r\n\t\t\tstrTarget = strSource.substring(intStartPosition,intOverPosition);\r\n\t\t}\r\n\t\telse\r\n\t\t{\r\n\t\t if (intStartPosition<=intOverPosition)\r\n\t\t\t{\r\n\t\t\t\tfor (intLoop=intStartPosition;intLoop<intOverPosition;intLoop++)\r\n\t\t\t\t{\r\n\t\t\t\t\tcTemp = strSource.substr(intLoop,1);\r\n\t\t\t\t\tif (cTemp==cPosition) break;\r\n\t\t\t\t\telse strTarget = strTarget + cTemp;\r\n\t\t\t\t}\r\n\t\t }\r\n\t\t\telse\r\n\t\t\t{\r\n\t\t\t\tfor (intLoop=intStartPosition-1;intLoop>intOverPosition;intLoop--)\r\n\t\t\t\t{\r\n\t\t\t\t\tcTemp = strSource.substr(intLoop,1);\r\n\t\t\t\t\tif (cTemp==cPosition) break;\r\n\t\t\t\t\telse strTarget = cTemp+strTarget;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t}\r\n\tcatch(e)\r\n\t{\r\n\t}\r\n\treturn strTarget;\r\n}","findIndex(pos, side, end, startAt = 0) {\n let arr = end ? this.to : this.from;\n for (let lo = startAt, hi = arr.length;;) {\n if (lo == hi)\n return lo;\n let mid = (lo + hi) >> 1;\n let diff = arr[mid] - pos || (end ? this.value[mid].endSide : this.value[mid].startSide) - side;\n if (mid == lo)\n return diff >= 0 ? lo : hi;\n if (diff >= 0)\n hi = mid;\n else\n lo = mid + 1;\n }\n }","function getCharFromPosition(pos) {\n var index = pos.row * 5;\n index = index + pos.col;\n return cipher.key.charAt(index);\n}","function isPosInt(val)\n{\n return (\n isInt(val) &&\n val > 0\n );\n}","function lastPositionOcc (s){\n var position;\n for (i = s.length; i<=0; i--){\n if (s[i] === 'a'){\n position = i;\n }else{\n position = -1\n }\n }\n return position;\n}","function checkIsInt(pos) {\n if (isNaN(pos) || pos > board.length) {\n return false;\n }\n return true;\n}","function len(str)\r\n{\r\n if (str) {\r\n return len(str.substring(1))+1;\r\n }\r\n else\r\n return 0;\r\n}","function range(nbr,min,max){if(nbr<min){return min;}else if(nbr>max){return max;}else{return nbr;}}","function getSpotNumber(s) // paramwret is a string\r\n{\r\n var number = new String('');\r\n \r\n for(var i = 0; i < s.length; i++)\r\n {\r\n if( (s.charAt(i) >= '0') && (s.charAt(i) <= '9') )\r\n number += s.charAt(i);\r\n }\r\n return number; // return a string\r\n}","function inBounds(number, bound) {\n\tif (number > (bound-1)) {\n\t\tnumber = bound - 1;\n\t}\n\treturn parseInt(number, 10);\n}","function clampStartIndexFromRight(startIndex, len) {\n return min(len, max(-1, startIndex));\n }","function xIndexOf(Val, Str, x) {\n 'use strict';\n\n var Ot,\n i;\n\n if (x <= (Str.split(Val).length - 1)) {\n Ot = Str.indexOf(Val);\n if (x > 1) {\n for (i = 1; i < x; i += 1) {\n Ot = Str.indexOf(Val, Ot + 1);\n }\n }\n return Ot;\n } else {\n alert(Val + \" Occurs less than \" + x + \" times\");\n return 0;\n }\n}","function StrToIntWithDefault( s, n ) {\r\n var onlyNumbers = /[^0-9]/g;\r\n var t = s.replace( onlyNumbers, \"\" );\r\n\tt = parseInt( t );\r\n\tif ( ! isNaN( t ) ) {\r\n n = t;\r\n }\r\n return n;\r\n}","function randomIndex(str){\n return Math.floor(Math.random() * str.length);\n }","function h$jsstringIndexR(i, str) {\n ;\n if(i < 0 || i > str.length) return -1;\n var ch = str.charCodeAt(i);\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-0xDC00+0x10000) : ch;\n}","function clampStartIndexFromRight(startIndex, len) {\n return min(len, max(-1, startIndex));\n }"],"string":"[\n \"function getStart (pos, len) {\\n if (pos == null) return 0;\\n return pos < 0 ? (len + (pos % len)) : Math.min(len, pos);\\n}\",\n \"function getPosAsInt(str) {\\n\\treturn parseInt(str.substr(0, str.length - 2));\\n}\",\n \"function collectDigits(input, pos) {\\n\\t\\t'use strict';\\n\\t\\twhile (pos < input.length && input.charCodeAt(pos + 1) >= ZERO && input.charCodeAt(pos + 1) <= NINE) {\\n\\t\\t\\tpos += 1;\\n\\t\\t}\\n\\t\\treturn pos;\\n\\t}\",\n \"function getDigit(num, position) {\\n const stringNum = String(num);\\n const digit = parseInt(stringNum[stringNum.length - 1 - position]);\\n return isNaN(digit) ? 0 : digit;\\n}\",\n \"function startAtNum(str) {\\r\\n str = str || ''\\r\\n var match = str.match(/[0-9]/)\\r\\n return match ? str.slice(match.index).trim() : ''\\r\\n}\",\n \"function getPosLetter(inpt,position)\\r\\n{\\r\\n\\tvar len=inpt.length;\\r\\n\\tif(position<=len)\\r\\n\\t{\\r\\n\\t\\tfinalOutput=inpt.charAt(position-1);\\r\\n\\t\\treturn finalOutput;\\r\\n\\t\\t \\r\\n\\t}\\r\\n\\telse\\r\\n\\t{\\r\\n\\t\\tdocument.write(\\\"Invalid Position!\\\");\\r\\n\\t\\treturn; \\r\\n\\t}\\r\\n\\t\\r\\n}\",\n \"function findCoord(str, lower, lowerLetter, upper, upperLetter) {\\n let result = 0;\\n\\n // Check range before final value\\n for (let i = 0; i < str.length - 1; i++) {\\n let midway = Math.floor((upper - lower) / 2);\\n if (str[i] === lowerLetter) {\\n upper = midway + lower;\\n } else {\\n lower = upper - midway;\\n }\\n }\\n\\n // Check final value\\n if (str[str.length - 1] === lowerLetter) {\\n result = lower;\\n } else {\\n result = upper;\\n }\\n\\n return result;\\n}\",\n \"function validPos(inpt,position)\\r\\n{\\r\\n\\tif(pos>inpt.length)\\r\\n\\t{\\r\\n\\t\\tdocument.write(\\\"Invalid Position!\\\");\\r\\n\\t\\treturn;\\r\\n\\t}\\r\\n\\telse\\r\\n\\t\\treturn 1;\\r\\n\\r\\n}\",\n \"function position(posNumber) {\\n let position = \\\"\\\";\\n position = (posNumber - 1) * 18 + \\\"px\\\";\\n // console.log(\\\"position \\\" + position);\\n return position;\\n}\",\n \"function getNthPos(endtag,pos)\\n{\\n if(pos == 0)\\n return 0;\\n if(pos > getNumUnderscores(endtag))\\n return -1; //error. this is not possible.\\n\\n for(var i=0; i<pos; i++) { //remove 'pos' number of underscores\\n endtag = endtag.substring(endtag.indexOf(\\\"_\\\")+1, endtag.length);\\n }\\n\\n if(endtag.indexOf(\\\"_\\\") == -1) //has no more underscores so just return everything that's left\\n return parseInt(endtag);\\n else //otherwise, return up to the next underscore\\n return parseInt(endtag.substring(0,endtag.indexOf(\\\"_\\\")));\\n }\",\n \"function posToIndex(pos) {\\n var row = pos[0];\\n var col = pos[1];\\n return (row * 4) + col;\\n}\",\n \"function substringHandleNegativeLengths(base_s, index_s) {\\n\\n\\t\\t//Index s is negative to adding will get us to the right start\\n\\t\\tconst newIndex = ctx.mkAdd(base_s.getLength(), index_s);\\n\\n\\t\\t//Bound the minimum index by 0\\n\\t\\tconst aboveMin = ctx.mkGe(newIndex, ctx.mkIntVal(0));\\n\\t\\tconst indexOrZero = ctx.mkIte(aboveMin, newIndex, ctx.mkIntVal(0));\\n\\n\\t\\treturn ctx.mkIte(ctx.mkGe(index_s, ctx.mkIntVal(0)), index_s, indexOrZero);\\n\\t}\",\n \"function palindromeX(len, pos) {\\n let left = (10 ** Math.floor((len - 1) / 2) + pos - 1).toString();\\n let right = [...left].reverse().join('').slice(len % 2);\\n return Number(left + right);\\n}\",\n \"function normalizePosition(val) {\\n val = parseInt(val);\\n if (isNaN(val))\\n return undefined;\\n else\\n return val;\\n}\",\n \"function normalizePosition(val) {\\n val = parseInt(val);\\n if (isNaN(val))\\n return undefined;\\n else\\n return val;\\n}\",\n \"function truncateString(str, num) {\\n // I want to return the string parts\\n // from indexOf(0) to indexOf(num), only when the length of string > num\\n // otherwise, return the string\\n if (str.length > num) {\\n return str.slice(0, num) + \\\"...\\\";\\n } else {\\n return str;\\n }\\n}\",\n \"function codePointAt(str, pos) {\\n let code0 = str.charCodeAt(pos);\\n if (!surrogateHigh(code0) || pos + 1 == str.length)\\n return code0;\\n let code1 = str.charCodeAt(pos + 1);\\n if (!surrogateLow(code1))\\n return code0;\\n return ((code0 - 0xd800) << 10) + (code1 - 0xdc00) + 0x10000;\\n}\",\n \"function textToIndex(pos){\\n\\n\\tvar firstRowLength=114; //Header row length not including new line.\\n\\n\\tvar rowLabelLength=4;\\t//Lenght of row labels including new line.\\n\\n\\tvar numberOfCharactersPerGroup=11;\\t//Total number of characters in a group including space.\\n\\n\\tvar totalNumberOfCharactersPerLine=114;\\t//Total number of characters in a line including row label, spaces, and new Line.\\n\\n\\tvar offset=0;\\t//Total offset needed to convert text selection index to a valid index.\\n\\n\\t\\n\\n\\t//Amount for length of Header Row (Row 0) and first row label\\n\\n\\toffset+=firstRowLength+rowLabelLength;\\n\\n\\t\\n\\n\\t//Position selected is in the header or first row labels\\n\\n\\tif(pos<offset){\\n\\n\\t\\treturn 0;\\n\\n\\t}\\n\\n\\t\\n\\n\\t//Past the first Line (Rows beyond 1)\\n\\n\\tif(pos>=(firstRowLength+rowLabelLength+totalNumberOfCharactersPerLine)){\\n\\n\\t\\t//Calculate number of Row Labels needed (including new line)\\n\\n\\t\\toffset+=(Math.floor((pos/(totalNumberOfCharactersPerLine)))-1)*rowLabelLength\\n\\n\\t}\\n\\n\\t\\n\\n\\t//Past First Group in Row 1\\n\\n\\tif(pos>=(numberOfCharactersPerGroup+firstRowLength+rowLabelLength)){\\n\\n\\t\\t//Calculate number of spaces needed\\n\\n\\t\\toffset+=Math.floor((pos-offset)/numberOfCharactersPerGroup);\\n\\n\\t}\\n\\n\\t//Return Index (Position - Offset)\\n\\n\\treturn pos-offset;\\n\\n\\n\\n}\",\n \"function palindrome(len, pos) {\\n let left = Math.pow(10, Math.ceil(len / 2) - 1) + (pos - 1) + '';\\n let right = left.slice(0, Math.floor(len / 2)).split('').reverse().join('');\\n return +(left + right);\\n}\",\n \"function inc(s, pos) {\\n\\tif (pos===undefined) pos = s.length-1\\n\\tvar c = s.charCodeAt(pos) + 1\\n\\tif (c===123) {\\n\\t\\tc = 97\\n\\t\\ts = inc(s,pos-1)\\n\\t}\\n\\tvar a = s.split('')\\n\\ta[pos] = String.fromCharCode(c)\\n\\treturn a.join('')\\n}\",\n \"function NumerosLargo(string,largo){\\n var out = '';\\n var filtro = '1234567890';\\n \\n for (var i=0; i<string.length; i++){\\n if (filtro.indexOf(string.charAt(i)) != -1) {\\n if(out.length<(largo)){\\n out += string.charAt(i);\\n }\\n }\\n }\\n\\n return out;\\n}\",\n \"function leftDigit(str) {\\n // write your code here\\n // let reg = new RegExp([0-9])\\n const reg=/[0-9]/\\n let left =str.search(reg);\\n // return left;\\nreturn str[left];\\n \\n }\",\n \"function getLength(string, index = 0) {\\n if(string[index] === undefined) {\\n return index;\\n }\\n return getLength(string, index + 1)\\n}\",\n \"function positionToChar(position) {\\n var counter = 0;\\n\\n loop:\\n for (var i = 1; i <= keyboardDimension[0]; i++) {\\n for (var j = 1; j <= keyboardDimension[1]; j++) {\\n if (!(i in invalidPositions) || !invalidPositions[i].some(xPosition => xPosition == j)) {\\n counter++;\\n }\\n\\n if (position[0] == i && position[1] == j) {\\n //We are at the position that is given as the parameter, stop the N(2) loop\\n // with the label\\n break loop;\\n }\\n }\\n }\\n\\n if (counter >= 10) {\\n return String.fromCharCode(65 + (counter - 10));\\n }\\n\\n return counter;\\n}\",\n \"function strend(str) {\\n\\t\\t\\tlet i;\\n\\t\\t\\tfor (let i = 0; i < str.length; i++)\\n\\t\\t\\t{\\n\\t\\t\\t\\tif (ord(str[i]) <= 31) break;\\n\\t\\t\\t}\\n\\t\\t\\treturn i;\\n\\t\\t}\",\n \"function h$jsstringIndexR(i, str) {\\n ;\\n if(i < 0 || i > str.length) return -1;\\n var ch = str.charCodeAt(i);\\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\\n}\",\n \"function location(pos){\\n return dimension * + Math.floor(-pos[2]) + Math.floor(pos[0]);\\n}\",\n \"function h$jsstringIndexR(i, str) {\\n ;\\n if(i < 0 || i > str.length) return -1;\\n var ch = str.charCodeAt(i);\\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\\n}\",\n \"function h$jsstringIndexR(i, str) {\\n ;\\n if(i < 0 || i > str.length) return -1;\\n var ch = str.charCodeAt(i);\\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\\n}\",\n \"function h$jsstringIndexR(i, str) {\\n ;\\n if(i < 0 || i > str.length) return -1;\\n var ch = str.charCodeAt(i);\\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-9216) : ch;\\n}\",\n \"function getCharFromPosition(pos) {\\n\\t\\tvar index = pos.row * 5;\\n\\t\\tindex = index + pos.col;\\n\\t\\treturn keyPhrase.charAt(index);\\n\\t}\",\n \"function cigar2pos(cigar, pos)\\n{\\n\\tvar x = 0, y = 0;\\n\\tfor (var i = 0; i < cigar.length; ++i) {\\n\\t\\tvar op = cigar[i][0], len = cigar[i][1];\\n\\t\\tif (op == 'M') {\\n\\t\\t\\tif (y <= pos && pos < y + len)\\n\\t\\t\\t\\treturn x + (pos - y);\\n\\t\\t\\tx += len, y += len;\\n\\t\\t} else if (op == 'D') {\\n\\t\\t\\tx += len;\\n\\t\\t} else if (op == 'I') {\\n\\t\\t\\tif (y <= pos && pos < y + len)\\n\\t\\t\\t\\treturn x;\\n\\t\\t\\ty += len;\\n\\t\\t} else if (op == 'S' || op == 'H') {\\n\\t\\t\\tif (y <= pos && pos < y + len)\\n\\t\\t\\t\\treturn -1;\\n\\t\\t\\ty += len;\\n\\t\\t}\\n\\t}\\n\\treturn -1;\\n}\",\n \"function ml_z_of_substring_base(base, s, pos, len) {\\n s = caml_jsbytes_of_string(s);\\n if(pos != 0 || len != s.length) {\\n if (s.length - pos < len) {\\n caml_invalid_argument(\\\"Z.of_substring_base: invalid offset or length\\\");\\n }\\n s = s.slice(pos,pos+len);\\n }\\n return jsoo_z_of_js_string_base(base, s);\\n}\",\n \"function position(letter){\\n let alphabet ='abcdefghijklmnopqrstuvwxyz';\\nreturn `Position of alphabet: ${alphabet.indexOf(letter)+1}`;\\n}\",\n \"function GiveACharacter(str, num) {\\n if (num >=0) {\\n return str[num];\\n }\\n}\",\n \"function re(e){return e.inclusiveLeft?-1:0}\",\n \"function _getInt(str, l, minlength, maxlength) {\\n for (var m = maxlength; m >= minlength; m--) {\\n var _token = str.substring(l, l + m);\\n if (_token.length < minlength) {\\n return null;\\n }\\n if (_isInteger(_token)) {\\n return _token;\\n }\\n }\\n return null;\\n }\",\n \"function getPosition(num, str) {\\n const result = [];\\n num.map((a) => {\\n str.map((b) => {\\n result.push(`${a}${b}`);\\n });\\n });\\n return result.join(' ');\\n}\",\n \"function beyond(s) {\\n if (s.length === 0) {\\n return exports.MAX_WORD;\\n }\\n var code = s.charCodeAt(s.length - 1);\\n return s.slice(0, -1) + String.fromCharCode(code + 1);\\n}\",\n \"function countOfBalStr(string, position, count = null, total = 0) {\\n if (position >= string.length) {\\n return total\\n }\\n \\n const letter = string[position]\\n const value = letter === 'L' ? 1 : -1 // We can hard code this cause this is a contraint on the question\\n count += value\\n \\n if (count === 0) {\\n total++\\n }\\n \\n return countOfBalStr(string, position + 1, count, total)\\n}\",\n \"function at(position) {\\n return value.charAt(position)\\n }\",\n \"function at(position) {\\n return value.charAt(position)\\n }\",\n \"function at(position) {\\n return value.charAt(position)\\n }\",\n \"function at(position) {\\n return value.charAt(position)\\n }\",\n \"function n(str) {\\n if (str == \\\"\\\") { return -1; }\\n return Number(str);\\n }\",\n \"function charAt (str='', position) {\\n // var strArray = str.split('')\\n return str[position]\\n}\",\n \"function get_int(str, index) {\\n var orig = index;\\n while (str[index] >= '0' && str[index] <= '9') {\\n index++;\\n }\\n return { value: parseInt(str.slice(orig)), len: index - orig };\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\r\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\r\\n return pos\\r\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }\\n return pos\\n}\",\n \"function pos2coord(pos) {\\n var coord;\\n coord = Math.floor(pos / 64);\\n return coord;\\n}\",\n \"function substring(p0, pos) {\\n return filterFunction('substring', 'string', p0, pos);\\n}\",\n \"function Int_substr(str, a, b) {\\n\\ta = Int_convertToInt(a);\\n\\tb = Int_convertToInt(b);\\n\\n\\tvar start = 0;\\n\\twhile(Int_lt(start, a)) start++;\\n\\tvar end = 0;\\n\\twhile(Int_lt(end, b)) end++;\\n\\treturn str.substring(start,end);\\n}\",\n \"function deleteNthChar(inputString, position) {\\n \\\"use strict\\\";\\n /*\\n * deletes the n-th character of the input string and\\n * returns the (now one character shorter) string.\\n *\\n * n is counted from 0\\n */\\n if (position > inputString.length) {\\n throw new BoundaryException(position, \\\"deleting char at position\\\");\\n }\\n\\n var outputString = \\\"\\\";\\n outputString = inputString.slice(0, position);\\n outputString = outputString + inputString.slice(position + 1);\\n return outputString;\\n}\",\n \"function toPosInt(number) {\\n return Math.floor(Math.abs(number));\\n }\",\n \"function at(position) {\\n return value.charAt(position);\\n }\",\n \"convertPointToCharacterPosition(text, point) {\\n var position = 0;\\n var w = 0;\\n for (var i = 0, n = text.length; i < n; i++) {\\n\\n var charWidth = this.calculateCharacterSize(text.charAt(i))[0];\\n var halfWidth = charWidth / 2;\\n\\n if (i > 0) {\\n w = this.calculateSize(text.substr(0, i))[0];\\n }\\n\\n // basic rounding calculation bast on character\\n // width\\n if (w + halfWidth > point) {\\n break;\\n }\\n\\n position++;\\n }\\n\\n return position;\\n }\",\n \"function displacement(num){\\r\\n\\twhere=1;\\r\\n\\tfor (var i=0; i<incount; ++i){\\r\\n\\t\\tif (startin[i] < num){\\r\\n\\t\\t\\twhere+=lengthin[i]-1;\\r\\n\\t\\t}\\r\\n\\t}\\r\\n\\treturn where;\\r\\n}\",\n \"function skipExtendingChars(str, pos, dir) {\\n while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir }\\n return pos\\n}\",\n \"function getSubstr(strSource,intStartPosition,intOverPosition,cPosition)\\r\\n{\\r\\n\\tvar strTarget = \\\"\\\";\\r\\n\\tvar cTemp = \\\"\\\";\\r\\n\\tvar intLoop = 0;\\r\\n\\tvar intCount = 0;\\r\\n\\ttry\\r\\n\\t{\\r\\n\\t strSource = trim(strSource);\\r\\n\\t\\tintCount = strSource.length;\\r\\n\\t\\tif (intStartPosition>intCount) intStartPosition = intCount;\\r\\n\\t\\tif (intOverPosition>intCount) intOverPosition = intCount;\\r\\n\\t\\tif (cPosition==null)\\r\\n\\t\\t{\\r\\n\\t\\t\\tstrTarget = strSource.substring(intStartPosition,intOverPosition);\\r\\n\\t\\t}\\r\\n\\t\\telse\\r\\n\\t\\t{\\r\\n\\t\\t if (intStartPosition<=intOverPosition)\\r\\n\\t\\t\\t{\\r\\n\\t\\t\\t\\tfor (intLoop=intStartPosition;intLoop<intOverPosition;intLoop++)\\r\\n\\t\\t\\t\\t{\\r\\n\\t\\t\\t\\t\\tcTemp = strSource.substr(intLoop,1);\\r\\n\\t\\t\\t\\t\\tif (cTemp==cPosition) break;\\r\\n\\t\\t\\t\\t\\telse strTarget = strTarget + cTemp;\\r\\n\\t\\t\\t\\t}\\r\\n\\t\\t }\\r\\n\\t\\t\\telse\\r\\n\\t\\t\\t{\\r\\n\\t\\t\\t\\tfor (intLoop=intStartPosition-1;intLoop>intOverPosition;intLoop--)\\r\\n\\t\\t\\t\\t{\\r\\n\\t\\t\\t\\t\\tcTemp = strSource.substr(intLoop,1);\\r\\n\\t\\t\\t\\t\\tif (cTemp==cPosition) break;\\r\\n\\t\\t\\t\\t\\telse strTarget = cTemp+strTarget;\\r\\n\\t\\t\\t\\t}\\r\\n\\t\\t\\t}\\r\\n\\t\\t}\\r\\n\\t}\\r\\n\\tcatch(e)\\r\\n\\t{\\r\\n\\t}\\r\\n\\treturn strTarget;\\r\\n}\",\n \"findIndex(pos, side, end, startAt = 0) {\\n let arr = end ? this.to : this.from;\\n for (let lo = startAt, hi = arr.length;;) {\\n if (lo == hi)\\n return lo;\\n let mid = (lo + hi) >> 1;\\n let diff = arr[mid] - pos || (end ? this.value[mid].endSide : this.value[mid].startSide) - side;\\n if (mid == lo)\\n return diff >= 0 ? lo : hi;\\n if (diff >= 0)\\n hi = mid;\\n else\\n lo = mid + 1;\\n }\\n }\",\n \"function getCharFromPosition(pos) {\\n var index = pos.row * 5;\\n index = index + pos.col;\\n return cipher.key.charAt(index);\\n}\",\n \"function isPosInt(val)\\n{\\n return (\\n isInt(val) &&\\n val > 0\\n );\\n}\",\n \"function lastPositionOcc (s){\\n var position;\\n for (i = s.length; i<=0; i--){\\n if (s[i] === 'a'){\\n position = i;\\n }else{\\n position = -1\\n }\\n }\\n return position;\\n}\",\n \"function checkIsInt(pos) {\\n if (isNaN(pos) || pos > board.length) {\\n return false;\\n }\\n return true;\\n}\",\n \"function len(str)\\r\\n{\\r\\n if (str) {\\r\\n return len(str.substring(1))+1;\\r\\n }\\r\\n else\\r\\n return 0;\\r\\n}\",\n \"function range(nbr,min,max){if(nbr<min){return min;}else if(nbr>max){return max;}else{return nbr;}}\",\n \"function getSpotNumber(s) // paramwret is a string\\r\\n{\\r\\n var number = new String('');\\r\\n \\r\\n for(var i = 0; i < s.length; i++)\\r\\n {\\r\\n if( (s.charAt(i) >= '0') && (s.charAt(i) <= '9') )\\r\\n number += s.charAt(i);\\r\\n }\\r\\n return number; // return a string\\r\\n}\",\n \"function inBounds(number, bound) {\\n\\tif (number > (bound-1)) {\\n\\t\\tnumber = bound - 1;\\n\\t}\\n\\treturn parseInt(number, 10);\\n}\",\n \"function clampStartIndexFromRight(startIndex, len) {\\n return min(len, max(-1, startIndex));\\n }\",\n \"function xIndexOf(Val, Str, x) {\\n 'use strict';\\n\\n var Ot,\\n i;\\n\\n if (x <= (Str.split(Val).length - 1)) {\\n Ot = Str.indexOf(Val);\\n if (x > 1) {\\n for (i = 1; i < x; i += 1) {\\n Ot = Str.indexOf(Val, Ot + 1);\\n }\\n }\\n return Ot;\\n } else {\\n alert(Val + \\\" Occurs less than \\\" + x + \\\" times\\\");\\n return 0;\\n }\\n}\",\n \"function StrToIntWithDefault( s, n ) {\\r\\n var onlyNumbers = /[^0-9]/g;\\r\\n var t = s.replace( onlyNumbers, \\\"\\\" );\\r\\n\\tt = parseInt( t );\\r\\n\\tif ( ! isNaN( t ) ) {\\r\\n n = t;\\r\\n }\\r\\n return n;\\r\\n}\",\n \"function randomIndex(str){\\n return Math.floor(Math.random() * str.length);\\n }\",\n \"function h$jsstringIndexR(i, str) {\\n ;\\n if(i < 0 || i > str.length) return -1;\\n var ch = str.charCodeAt(i);\\n return (((ch|1023)===0xDFFF)) ? ((((str.charCodeAt(i-1))-0xD800)<<10)+(ch)-0xDC00+0x10000) : ch;\\n}\",\n \"function clampStartIndexFromRight(startIndex, len) {\\n return min(len, max(-1, startIndex));\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6600404","0.65358627","0.61570245","0.5993589","0.57630634","0.57247585","0.5646826","0.56274575","0.5462163","0.543008","0.54007566","0.53785247","0.5377223","0.5372194","0.5372194","0.5349353","0.5318074","0.5312245","0.5266459","0.526095","0.5196307","0.51918375","0.5151161","0.51388264","0.512884","0.51150227","0.5110294","0.5103575","0.5103575","0.5103575","0.5101442","0.50708544","0.5062798","0.5051292","0.504851","0.50481045","0.50469244","0.50450945","0.50409865","0.5019482","0.50137097","0.50137097","0.50137097","0.50137097","0.5011056","0.50087655","0.5000256","0.4982229","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49712825","0.49680632","0.49677184","0.49675673","0.49614263","0.4960497","0.49550718","0.49435112","0.4933135","0.4920978","0.49197862","0.49134153","0.4909797","0.49064666","0.4895173","0.4890763","0.4886947","0.488428","0.48784858","0.48758745","0.48709148","0.48523375","0.48506457","0.4850113","0.48448363","0.48422647"],"string":"[\n \"0.6600404\",\n \"0.65358627\",\n \"0.61570245\",\n \"0.5993589\",\n \"0.57630634\",\n \"0.57247585\",\n \"0.5646826\",\n \"0.56274575\",\n \"0.5462163\",\n \"0.543008\",\n \"0.54007566\",\n \"0.53785247\",\n \"0.5377223\",\n \"0.5372194\",\n \"0.5372194\",\n \"0.5349353\",\n \"0.5318074\",\n \"0.5312245\",\n \"0.5266459\",\n \"0.526095\",\n \"0.5196307\",\n \"0.51918375\",\n \"0.5151161\",\n \"0.51388264\",\n \"0.512884\",\n \"0.51150227\",\n \"0.5110294\",\n \"0.5103575\",\n \"0.5103575\",\n \"0.5103575\",\n \"0.5101442\",\n \"0.50708544\",\n \"0.5062798\",\n \"0.5051292\",\n \"0.504851\",\n \"0.50481045\",\n \"0.50469244\",\n \"0.50450945\",\n \"0.50409865\",\n \"0.5019482\",\n \"0.50137097\",\n \"0.50137097\",\n \"0.50137097\",\n \"0.50137097\",\n \"0.5011056\",\n \"0.50087655\",\n \"0.5000256\",\n \"0.4982229\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49712825\",\n \"0.49680632\",\n \"0.49677184\",\n \"0.49675673\",\n \"0.49614263\",\n \"0.4960497\",\n \"0.49550718\",\n \"0.49435112\",\n \"0.4933135\",\n \"0.4920978\",\n \"0.49197862\",\n \"0.49134153\",\n \"0.4909797\",\n \"0.49064666\",\n \"0.4895173\",\n \"0.4890763\",\n \"0.4886947\",\n \"0.488428\",\n \"0.48784858\",\n \"0.48758745\",\n \"0.48709148\",\n \"0.48523375\",\n \"0.48506457\",\n \"0.4850113\",\n \"0.48448363\",\n \"0.48422647\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.49225366"},"document_rank":{"kind":"string","value":"78"}}},{"rowIdx":4188,"cells":{"query":{"kind":"string","value":"Returns the value from the range [`from`; `to`] that satisfies `pred` and is closest to `from`. Assumes that at least `to` satisfies `pred`. Supports `from` being greater than `to`."},"document":{"kind":"string","value":"function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid == from) { return pred(mid) ? from : to }\n if (pred(mid)) { to = mid; }\n else { from = mid + dir; }\n }\n}","function findFirst(pred, from, to) {\n for (;;) {\n if (Math.abs(from - to) <= 1) { return pred(from) ? from : to }\n var mid = Math.floor((from + to) / 2)\n if (pred(mid)) { to = mid }\n else { from = mid }\n }\n}","function findFirst(pred, from, to) {\n for (;;) {\n if (Math.abs(from - to) <= 1) { return pred(from) ? from : to }\n var mid = Math.floor((from + to) / 2);\n if (pred(mid)) { to = mid; }\n else { from = mid; }\n }\n}","function findFirst(pred, from, to) {\r\n // At any point we are certain `to` satisfies `pred`, don't know\r\n // whether `from` does.\r\n var dir = from > to ? -1 : 1;\r\n for (;;) {\r\n if (from == to) { return from }\r\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\r\n if (mid == from) { return pred(mid) ? from : to }\r\n if (pred(mid)) { to = mid; }\r\n else { from = mid + dir; }\r\n }\r\n}","function findFirst(pred, from, to) {\n\t\t // At any point we are certain `to` satisfies `pred`, don't know\n\t\t // whether `from` does.\n\t\t var dir = from > to ? -1 : 1;\n\t\t for (;;) {\n\t\t if (from == to) { return from }\n\t\t var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n\t\t if (mid == from) { return pred(mid) ? from : to }\n\t\t if (pred(mid)) { to = mid; }\n\t\t else { from = mid + dir; }\n\t\t }\n\t\t }","function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n\n for (;;) {\n if (from == to) {\n return from;\n }\n\n var midF = (from + to) / 2,\n mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n\n if (mid == from) {\n return pred(mid) ? from : to;\n }\n\n if (pred(mid)) {\n to = mid;\n } else {\n from = mid + dir;\n }\n }\n } // BIDI HELPERS","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest ( value, to ) {\r\n\t\treturn Math.round(value / to) * to;\r\n\t}","function closest ( value, to ) {\r\n\t\treturn Math.round(value / to) * to;\r\n\t}","function closest(value, to) {\n return Math.round(value / to) * to;\n }","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\n\t\treturn Math.round(value / to) * to;\n\t}","function closest ( value, to ) {\r\n\t\t\treturn Math.round(value / to) * to;\r\n\t\t}","function closest ( value, to ) {\n\t\t\treturn Math.round(value / to) * to;\n\t\t}","function C(e,t,a){for(\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var n=t>a?-1:1;;){if(t==a)return t;var r=(t+a)/2,f=n<0?Math.ceil(r):Math.floor(r);if(f==t)return e(f)?t:a;e(f)?a=f:t=f+n}}","function nearest(value, min, max)\n {\n if((value-min)>(max-value))\n {\n return max;\n }\n else\n {\n return min;\n }\n }","function mapValueInRange(value, fromLow, fromHigh, toLow, toHigh) {\n var fromRangeSize = fromHigh - fromLow;\n var toRangeSize = toHigh - toLow;\n var valueScale = (value - fromLow) / fromRangeSize;\n return toLow + valueScale * toRangeSize;\n}","function computeCost(x,min,max,from){\n if(x < min){\n return min-x+from-x;\n }else if(x > max){\n return x-max+x-from;\n }else{\n return Math.abs(x-from);\n }\n}","rangeMapping(value, from, to) {\n return Math.floor(to[0] + (value - from[0]) * (to[1] - to[0]) / (from[1] - from[0]));\n }","map(value, startRangeLower, startRangeHigher, targetRangeLower, targetRangeHigher)\n {\n let startSpan = startRangeHigher - startRangeLower;\n let targetSpan = targetRangeHigher - targetRangeLower;\n return (((value - startRangeLower) / startSpan) * targetSpan) + targetRangeLower;\n }","function lowerbound(arr, value, compare, start, to) {\r\n if (start === void 0) { start = 0; }\r\n if (to === void 0) { to = arr.length; }\r\n var count = to - start;\r\n while (0 < count) {\r\n var count2 = (count >> 1);\r\n var mid = start + count2;\r\n if (compare(arr[mid], value)) {\r\n start = mid + 1;\r\n count -= count2 + 1;\r\n }\r\n else {\r\n count = count2;\r\n }\r\n }\r\n return start;\r\n}","isCloseTo(value, to) {\n return value >= to - VectorMath.TOLERANCE && value <= to + VectorMath.TOLERANCE;\n }","function nearest(from) {\n\tvar to = indexOfMin(distances[from]);\n\tif (distances[from][to] < infinDist) {\n\t\tdistances[from][to] = distances[to][from]= infinDist;\n\t\treturn to;\n\t}\n\treturn -1;\n}","function map_range(value, low1, high1, low2, high2) {\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\n}","function map_range(value, low1, high1, low2, high2) {\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\n}","function map_range(value, low1, high1, low2, high2) {\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\n}","function map_range(value, low1, high1, low2, high2) {\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\n}","function map_range(value, low1, high1, low2, high2) {\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\n}","function closest (num, arr) {\n // mid, low and high are the index values of the arr\n let mid;\n let low = 0;\n let high = arr.length - 1;\n while (high - low > 1) {\n mid = Math.floor((low + high) / 2);\n if (arr[mid] < num) {\n low = mid;\n } else {\n high = mid;\n }\n }\n // This condition checks for the smallest difference and prints the result when the low and high are closest to\n // our num. \n // Ex: If our array is [1, 2, 4] and our num = 2, low = 0, high = 1, it will check for \n // (num - arr[low] which is 2 - 1 = 1 <= arr[high] - num which is 4 - 2 = 2)\n // basically 1 <= 2 and the answer is 1\n if (num - arr[low] <= arr[high] - num) {\n return arr[low];\n }\n return arr[high];\n}","function getBetween(from, to) {\n\tvar resultX = (from[0] + to[0]) / 2;\n\tvar resultY = (from[1] + to[1]) / 2;\n\treturn [resultX, resultY];\n}","function map(value, fromRangeMin, fromRangeMax, toRangeMin, toRangeMax) {\n return (value - fromRangeMin) * (toRangeMax - toRangeMin) / (fromRangeMax - fromRangeMin) + toRangeMin;\n }","function guard(low, high, value) {\n return Math.min(Math.max(low, value), high);\n}","function valueInRange (start, value, finish) {\n return (start <= value) && (value <= finish);\n}","function valueInRange (start, value, finish) {\n return (start <= value) && (value <= finish);\n}","function valueMapRange(value, inValueX, inValueY, outValueX, outValueY) {\n return (value - inValueX) * (outValueY - outValueX) / (inValueY - inValueX) + outValueX;\n}","function approach(value, valueDest, rate) {\n\tif (value < valueDest) {\n\t\tvalue += Math.abs(value - valueDest) / rate;\n\t}\n\telse if (value > valueDest) {\n\t\tvalue -= Math.abs(value - valueDest) / rate;\n\t}\n\n\treturn value;\n}","mapDataPoint (value, in_min, in_max, out_min, out_max) {\n // Shift negative values up into positive range\n if (in_min < 0 || in_max < 0) {\n in_max = in_max + -in_min\n value = value + -in_min\n in_min = in_min + -in_min\n }\n return out_min + (out_max - out_min) * ((value - in_min) / (in_max - in_min))\n }","_getAbsoluteValue(val, min = windowDimensions.width * -2, max = 0)\n {\n if (val < min)\n return min\n else if (val > max)\n return max\n else \n return val\n }","function rangeChecker(op, target, range){\r\n return op < target + range && op > target - range;\r\n}","function map_range(value, low1, high1, low2, high2) {\r\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\r\n }","function between(value, min, max) {\n return Math.max(min, Math.min(value, max));\n }","function getRandomInRange(from, to, fixed) {\n return (Math.random() * (to - from) + from).toFixed(fixed) * 1;\n // .toFixed() returns string, so ' * 1' is a trick to convert to number\n}","function clampBetween(value, lowerBound, upperBound) {\n let result;\n if ( value >= lowerBound && value <= upperBound) {\n result = value;\n } else if (value < lowerBound) {\n result = lowerBound;\n } else if ( value > upperBound) {\n result = upperBound;\n }\n return result;\n}","static randomLHS(from, to, affinity) {\n\t\tif (typeof to === 'undefined') {\n\t\t\tto = from;\n\t\t\tfrom = 0;\n\t\t}\n\t\tvar random = Math.random() * (to - from),\n\t\t\tresult = (Math.pow(random, 2) / to) + from;\n\t\tif (to < 2) return result;\n\t\treturn Math.floor(result);\n\t}","function binarySearch(array, pred) {\r\n let lo = -1,\r\n hi = array.length;\r\n while (1 + lo < hi) {\r\n const mi = lo + ((hi - lo) >> 1);\r\n if (pred(array[mi])) {\r\n hi = mi;\r\n } else {\r\n lo = mi;\r\n }\r\n }\r\n return hi;\r\n}","function between(val, min, max) {\n\t\treturn Math.min(Math.max(min, val), max);\n\t}","function avance(val, dist) {\n if (val * 100 < dist) return dist - val * 100\n return 0\n}","function constrain(x,lower,upper) {\n if (x > upper) {\n return upper;\n } else if (x < lower) {\n return lower;\n } else {\n return x;\n }\n }","between( between, dependentVal){\n if( dependentVal > between[0] && dependentVal < between[1]){\n return true;\n }else{\n return false;\n }\n\n}","function binarySearch(array, pred) {\n var lo = -1,\n hi = array.length;\n while (1 + lo < hi) {\n var mi = lo + ((hi - lo) >> 1);\n if (pred(array[mi], array, mi)) {\n hi = mi;\n } else {\n lo = mi;\n }\n }\n return hi;\n}","function lookup(value, ay, low, high) {\r\n if(high <= low) {\r\n return (value > dst[low]) ? (low + 1) : low\r\n }\r\n // Compute mid\r\n let mid = Math.floor((low + high)/2)\r\n // Compare value with ay[mid]\r\n if(value === dst[mid]) {\r\n return mid\r\n }\r\n if(value < dst[mid]){\r\n //check lower half for match\r\n return lookup(value, ay, low, mid-1)\r\n } else {\r\n //check upper half for match\r\n return lookup(value, ay, mid+1, high)\r\n }\r\n // adjust low or high to either mid+1 or mid-1 respectively\r\n // call lookup again and return the value, like this:\r\n\r\n return lookup(value, ay, low, high)\r\n}","function closestTo (arr, key, isPrev) {\n const offsetIndex = isPrev ? -1 : 1\n const current = arr.indexOf(key)\n return arr[current + offsetIndex]\n}","findTarget(value) {\n if (value < this.value && this.left) {\n return this.left.findTarget(value);\n } else if (value >= this.value && this.right) {\n return this.right.findTarget(value);\n }\n\n return this;\n }","function point(min, max){\n return chance.integer({ min: min || -50, max: max || 150 });\n }","function array_closest(arr,val) {\n\t\t/*\n\t\tvar min_val=-1; var max_val; var min_key; var max_key;\n\t\tfor(var k in arr) {\n\t\t\tif(val==arr[k]) {\n\t\t\t\treturn [k];\n\t\t\t} else if(arr[k]<val) {\n\t\t\t\tif(arr[k]>min_val) {\n\t\t\t\t\tmin_val = arr[k];\n\t\t\t\t\tmin_key = k;\n\t\t\t\t}\n\t\t\t} else if(arr[k]>val) {\n\t\t\t\tif(!max_val||arr[k]<max_val) {\n\t\t\t\t\tmax_val = arr[k];\n\t\t\t\t\tmax_key = k;\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\t\treturn [min_key, max_key];\n*/\n\t\tvar lo = null;\n\t\tvar hi = null;\n\t for(var i in arr) {\n\t \tif(arr[i]==val) {\n\t \t\treturn Array(i);\n\t \t}\n\t if (arr[i] <= val && (lo === null || lo < arr[i])) {\n\t \tlo = arr[i];\n\t \tlo_k = i;\n\t }\n \tif (arr[i] >= val && (hi === null || hi > arr[i])) {\n \t\thi = arr[i];\n \t\thi_k = i;\n \t}\n \t};\n \tif(hi_k!=lo_k+1) {\n \t\tlo_k = hi_k-1;\n \t\t//echo \"hmm... \";\n \t}\n\t return new Array(lo_k, hi_k);\n\t}","getClosest(arr, val) {\n return arr.reduce(function (prev, curr) {\n return (Math.abs(curr - val) < Math.abs(prev - val) ? curr : prev);\n });\n }","function map(value, in_min, in_max, out_min, out_max){\n return (value - in_min) * (out_max - out_min) / (in_max - in_min) + out_min\n}","function point(min, max) {\n return chance.integer({min: min || -100, max: max || 1100})\n }"],"string":"[\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n for (;;) {\\n if (from == to) { return from }\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n if (mid == from) { return pred(mid) ? from : to }\\n if (pred(mid)) { to = mid; }\\n else { from = mid + dir; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n for (;;) {\\n if (Math.abs(from - to) <= 1) { return pred(from) ? from : to }\\n var mid = Math.floor((from + to) / 2)\\n if (pred(mid)) { to = mid }\\n else { from = mid }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\n for (;;) {\\n if (Math.abs(from - to) <= 1) { return pred(from) ? from : to }\\n var mid = Math.floor((from + to) / 2);\\n if (pred(mid)) { to = mid; }\\n else { from = mid; }\\n }\\n}\",\n \"function findFirst(pred, from, to) {\\r\\n // At any point we are certain `to` satisfies `pred`, don't know\\r\\n // whether `from` does.\\r\\n var dir = from > to ? -1 : 1;\\r\\n for (;;) {\\r\\n if (from == to) { return from }\\r\\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\r\\n if (mid == from) { return pred(mid) ? from : to }\\r\\n if (pred(mid)) { to = mid; }\\r\\n else { from = mid + dir; }\\r\\n }\\r\\n}\",\n \"function findFirst(pred, from, to) {\\n\\t\\t // At any point we are certain `to` satisfies `pred`, don't know\\n\\t\\t // whether `from` does.\\n\\t\\t var dir = from > to ? -1 : 1;\\n\\t\\t for (;;) {\\n\\t\\t if (from == to) { return from }\\n\\t\\t var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n\\t\\t if (mid == from) { return pred(mid) ? from : to }\\n\\t\\t if (pred(mid)) { to = mid; }\\n\\t\\t else { from = mid + dir; }\\n\\t\\t }\\n\\t\\t }\",\n \"function findFirst(pred, from, to) {\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var dir = from > to ? -1 : 1;\\n\\n for (;;) {\\n if (from == to) {\\n return from;\\n }\\n\\n var midF = (from + to) / 2,\\n mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\\n\\n if (mid == from) {\\n return pred(mid) ? from : to;\\n }\\n\\n if (pred(mid)) {\\n to = mid;\\n } else {\\n from = mid + dir;\\n }\\n }\\n } // BIDI HELPERS\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest ( value, to ) {\\r\\n\\t\\treturn Math.round(value / to) * to;\\r\\n\\t}\",\n \"function closest ( value, to ) {\\r\\n\\t\\treturn Math.round(value / to) * to;\\r\\n\\t}\",\n \"function closest(value, to) {\\n return Math.round(value / to) * to;\\n }\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\n\\t\\treturn Math.round(value / to) * to;\\n\\t}\",\n \"function closest ( value, to ) {\\r\\n\\t\\t\\treturn Math.round(value / to) * to;\\r\\n\\t\\t}\",\n \"function closest ( value, to ) {\\n\\t\\t\\treturn Math.round(value / to) * to;\\n\\t\\t}\",\n \"function C(e,t,a){for(\\n // At any point we are certain `to` satisfies `pred`, don't know\\n // whether `from` does.\\n var n=t>a?-1:1;;){if(t==a)return t;var r=(t+a)/2,f=n<0?Math.ceil(r):Math.floor(r);if(f==t)return e(f)?t:a;e(f)?a=f:t=f+n}}\",\n \"function nearest(value, min, max)\\n {\\n if((value-min)>(max-value))\\n {\\n return max;\\n }\\n else\\n {\\n return min;\\n }\\n }\",\n \"function mapValueInRange(value, fromLow, fromHigh, toLow, toHigh) {\\n var fromRangeSize = fromHigh - fromLow;\\n var toRangeSize = toHigh - toLow;\\n var valueScale = (value - fromLow) / fromRangeSize;\\n return toLow + valueScale * toRangeSize;\\n}\",\n \"function computeCost(x,min,max,from){\\n if(x < min){\\n return min-x+from-x;\\n }else if(x > max){\\n return x-max+x-from;\\n }else{\\n return Math.abs(x-from);\\n }\\n}\",\n \"rangeMapping(value, from, to) {\\n return Math.floor(to[0] + (value - from[0]) * (to[1] - to[0]) / (from[1] - from[0]));\\n }\",\n \"map(value, startRangeLower, startRangeHigher, targetRangeLower, targetRangeHigher)\\n {\\n let startSpan = startRangeHigher - startRangeLower;\\n let targetSpan = targetRangeHigher - targetRangeLower;\\n return (((value - startRangeLower) / startSpan) * targetSpan) + targetRangeLower;\\n }\",\n \"function lowerbound(arr, value, compare, start, to) {\\r\\n if (start === void 0) { start = 0; }\\r\\n if (to === void 0) { to = arr.length; }\\r\\n var count = to - start;\\r\\n while (0 < count) {\\r\\n var count2 = (count >> 1);\\r\\n var mid = start + count2;\\r\\n if (compare(arr[mid], value)) {\\r\\n start = mid + 1;\\r\\n count -= count2 + 1;\\r\\n }\\r\\n else {\\r\\n count = count2;\\r\\n }\\r\\n }\\r\\n return start;\\r\\n}\",\n \"isCloseTo(value, to) {\\n return value >= to - VectorMath.TOLERANCE && value <= to + VectorMath.TOLERANCE;\\n }\",\n \"function nearest(from) {\\n\\tvar to = indexOfMin(distances[from]);\\n\\tif (distances[from][to] < infinDist) {\\n\\t\\tdistances[from][to] = distances[to][from]= infinDist;\\n\\t\\treturn to;\\n\\t}\\n\\treturn -1;\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\n}\",\n \"function closest (num, arr) {\\n // mid, low and high are the index values of the arr\\n let mid;\\n let low = 0;\\n let high = arr.length - 1;\\n while (high - low > 1) {\\n mid = Math.floor((low + high) / 2);\\n if (arr[mid] < num) {\\n low = mid;\\n } else {\\n high = mid;\\n }\\n }\\n // This condition checks for the smallest difference and prints the result when the low and high are closest to\\n // our num. \\n // Ex: If our array is [1, 2, 4] and our num = 2, low = 0, high = 1, it will check for \\n // (num - arr[low] which is 2 - 1 = 1 <= arr[high] - num which is 4 - 2 = 2)\\n // basically 1 <= 2 and the answer is 1\\n if (num - arr[low] <= arr[high] - num) {\\n return arr[low];\\n }\\n return arr[high];\\n}\",\n \"function getBetween(from, to) {\\n\\tvar resultX = (from[0] + to[0]) / 2;\\n\\tvar resultY = (from[1] + to[1]) / 2;\\n\\treturn [resultX, resultY];\\n}\",\n \"function map(value, fromRangeMin, fromRangeMax, toRangeMin, toRangeMax) {\\n return (value - fromRangeMin) * (toRangeMax - toRangeMin) / (fromRangeMax - fromRangeMin) + toRangeMin;\\n }\",\n \"function guard(low, high, value) {\\n return Math.min(Math.max(low, value), high);\\n}\",\n \"function valueInRange (start, value, finish) {\\n return (start <= value) && (value <= finish);\\n}\",\n \"function valueInRange (start, value, finish) {\\n return (start <= value) && (value <= finish);\\n}\",\n \"function valueMapRange(value, inValueX, inValueY, outValueX, outValueY) {\\n return (value - inValueX) * (outValueY - outValueX) / (inValueY - inValueX) + outValueX;\\n}\",\n \"function approach(value, valueDest, rate) {\\n\\tif (value < valueDest) {\\n\\t\\tvalue += Math.abs(value - valueDest) / rate;\\n\\t}\\n\\telse if (value > valueDest) {\\n\\t\\tvalue -= Math.abs(value - valueDest) / rate;\\n\\t}\\n\\n\\treturn value;\\n}\",\n \"mapDataPoint (value, in_min, in_max, out_min, out_max) {\\n // Shift negative values up into positive range\\n if (in_min < 0 || in_max < 0) {\\n in_max = in_max + -in_min\\n value = value + -in_min\\n in_min = in_min + -in_min\\n }\\n return out_min + (out_max - out_min) * ((value - in_min) / (in_max - in_min))\\n }\",\n \"_getAbsoluteValue(val, min = windowDimensions.width * -2, max = 0)\\n {\\n if (val < min)\\n return min\\n else if (val > max)\\n return max\\n else \\n return val\\n }\",\n \"function rangeChecker(op, target, range){\\r\\n return op < target + range && op > target - range;\\r\\n}\",\n \"function map_range(value, low1, high1, low2, high2) {\\r\\n return low2 + (high2 - low2) * (value - low1) / (high1 - low1);\\r\\n }\",\n \"function between(value, min, max) {\\n return Math.max(min, Math.min(value, max));\\n }\",\n \"function getRandomInRange(from, to, fixed) {\\n return (Math.random() * (to - from) + from).toFixed(fixed) * 1;\\n // .toFixed() returns string, so ' * 1' is a trick to convert to number\\n}\",\n \"function clampBetween(value, lowerBound, upperBound) {\\n let result;\\n if ( value >= lowerBound && value <= upperBound) {\\n result = value;\\n } else if (value < lowerBound) {\\n result = lowerBound;\\n } else if ( value > upperBound) {\\n result = upperBound;\\n }\\n return result;\\n}\",\n \"static randomLHS(from, to, affinity) {\\n\\t\\tif (typeof to === 'undefined') {\\n\\t\\t\\tto = from;\\n\\t\\t\\tfrom = 0;\\n\\t\\t}\\n\\t\\tvar random = Math.random() * (to - from),\\n\\t\\t\\tresult = (Math.pow(random, 2) / to) + from;\\n\\t\\tif (to < 2) return result;\\n\\t\\treturn Math.floor(result);\\n\\t}\",\n \"function binarySearch(array, pred) {\\r\\n let lo = -1,\\r\\n hi = array.length;\\r\\n while (1 + lo < hi) {\\r\\n const mi = lo + ((hi - lo) >> 1);\\r\\n if (pred(array[mi])) {\\r\\n hi = mi;\\r\\n } else {\\r\\n lo = mi;\\r\\n }\\r\\n }\\r\\n return hi;\\r\\n}\",\n \"function between(val, min, max) {\\n\\t\\treturn Math.min(Math.max(min, val), max);\\n\\t}\",\n \"function avance(val, dist) {\\n if (val * 100 < dist) return dist - val * 100\\n return 0\\n}\",\n \"function constrain(x,lower,upper) {\\n if (x > upper) {\\n return upper;\\n } else if (x < lower) {\\n return lower;\\n } else {\\n return x;\\n }\\n }\",\n \"between( between, dependentVal){\\n if( dependentVal > between[0] && dependentVal < between[1]){\\n return true;\\n }else{\\n return false;\\n }\\n\\n}\",\n \"function binarySearch(array, pred) {\\n var lo = -1,\\n hi = array.length;\\n while (1 + lo < hi) {\\n var mi = lo + ((hi - lo) >> 1);\\n if (pred(array[mi], array, mi)) {\\n hi = mi;\\n } else {\\n lo = mi;\\n }\\n }\\n return hi;\\n}\",\n \"function lookup(value, ay, low, high) {\\r\\n if(high <= low) {\\r\\n return (value > dst[low]) ? (low + 1) : low\\r\\n }\\r\\n // Compute mid\\r\\n let mid = Math.floor((low + high)/2)\\r\\n // Compare value with ay[mid]\\r\\n if(value === dst[mid]) {\\r\\n return mid\\r\\n }\\r\\n if(value < dst[mid]){\\r\\n //check lower half for match\\r\\n return lookup(value, ay, low, mid-1)\\r\\n } else {\\r\\n //check upper half for match\\r\\n return lookup(value, ay, mid+1, high)\\r\\n }\\r\\n // adjust low or high to either mid+1 or mid-1 respectively\\r\\n // call lookup again and return the value, like this:\\r\\n\\r\\n return lookup(value, ay, low, high)\\r\\n}\",\n \"function closestTo (arr, key, isPrev) {\\n const offsetIndex = isPrev ? -1 : 1\\n const current = arr.indexOf(key)\\n return arr[current + offsetIndex]\\n}\",\n \"findTarget(value) {\\n if (value < this.value && this.left) {\\n return this.left.findTarget(value);\\n } else if (value >= this.value && this.right) {\\n return this.right.findTarget(value);\\n }\\n\\n return this;\\n }\",\n \"function point(min, max){\\n return chance.integer({ min: min || -50, max: max || 150 });\\n }\",\n \"function array_closest(arr,val) {\\n\\t\\t/*\\n\\t\\tvar min_val=-1; var max_val; var min_key; var max_key;\\n\\t\\tfor(var k in arr) {\\n\\t\\t\\tif(val==arr[k]) {\\n\\t\\t\\t\\treturn [k];\\n\\t\\t\\t} else if(arr[k]<val) {\\n\\t\\t\\t\\tif(arr[k]>min_val) {\\n\\t\\t\\t\\t\\tmin_val = arr[k];\\n\\t\\t\\t\\t\\tmin_key = k;\\n\\t\\t\\t\\t}\\n\\t\\t\\t} else if(arr[k]>val) {\\n\\t\\t\\t\\tif(!max_val||arr[k]<max_val) {\\n\\t\\t\\t\\t\\tmax_val = arr[k];\\n\\t\\t\\t\\t\\tmax_key = k;\\n\\t\\t\\t\\t}\\n\\t\\t\\t}\\n\\t\\t}\\n\\t\\treturn [min_key, max_key];\\n*/\\n\\t\\tvar lo = null;\\n\\t\\tvar hi = null;\\n\\t for(var i in arr) {\\n\\t \\tif(arr[i]==val) {\\n\\t \\t\\treturn Array(i);\\n\\t \\t}\\n\\t if (arr[i] <= val && (lo === null || lo < arr[i])) {\\n\\t \\tlo = arr[i];\\n\\t \\tlo_k = i;\\n\\t }\\n \\tif (arr[i] >= val && (hi === null || hi > arr[i])) {\\n \\t\\thi = arr[i];\\n \\t\\thi_k = i;\\n \\t}\\n \\t};\\n \\tif(hi_k!=lo_k+1) {\\n \\t\\tlo_k = hi_k-1;\\n \\t\\t//echo \\\"hmm... \\\";\\n \\t}\\n\\t return new Array(lo_k, hi_k);\\n\\t}\",\n \"getClosest(arr, val) {\\n return arr.reduce(function (prev, curr) {\\n return (Math.abs(curr - val) < Math.abs(prev - val) ? curr : prev);\\n });\\n }\",\n \"function map(value, in_min, in_max, out_min, out_max){\\n return (value - in_min) * (out_max - out_min) / (in_max - in_min) + out_min\\n}\",\n \"function point(min, max) {\\n return chance.integer({min: min || -100, max: max || 1100})\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.72160196","0.71898764","0.71822035","0.71509534","0.70096433","0.65164363","0.60557735","0.60172063","0.60172063","0.60172063","0.60172063","0.60172063","0.60172063","0.60005677","0.60005677","0.59971774","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.59880227","0.5937562","0.59096944","0.5850752","0.5602863","0.5385085","0.52530754","0.5238257","0.5109013","0.50292456","0.501029","0.4932974","0.49194124","0.49194124","0.49194124","0.49194124","0.49194124","0.48383772","0.48316124","0.482789","0.47949162","0.47796744","0.47796744","0.4777058","0.47370803","0.47360668","0.47335905","0.4715617","0.46752647","0.4663089","0.46578616","0.46415484","0.4640864","0.46404234","0.46354765","0.46296442","0.45987356","0.45968136","0.45857897","0.45693547","0.45547098","0.455091","0.45486733","0.4546822","0.4545897","0.45435643","0.45246837"],"string":"[\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.72160196\",\n \"0.71898764\",\n \"0.71822035\",\n \"0.71509534\",\n \"0.70096433\",\n \"0.65164363\",\n \"0.60557735\",\n \"0.60172063\",\n \"0.60172063\",\n \"0.60172063\",\n \"0.60172063\",\n \"0.60172063\",\n \"0.60172063\",\n \"0.60005677\",\n \"0.60005677\",\n \"0.59971774\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.59880227\",\n \"0.5937562\",\n \"0.59096944\",\n \"0.5850752\",\n \"0.5602863\",\n \"0.5385085\",\n \"0.52530754\",\n \"0.5238257\",\n \"0.5109013\",\n \"0.50292456\",\n \"0.501029\",\n \"0.4932974\",\n \"0.49194124\",\n \"0.49194124\",\n \"0.49194124\",\n \"0.49194124\",\n \"0.49194124\",\n \"0.48383772\",\n \"0.48316124\",\n \"0.482789\",\n \"0.47949162\",\n \"0.47796744\",\n \"0.47796744\",\n \"0.4777058\",\n \"0.47370803\",\n \"0.47360668\",\n \"0.47335905\",\n \"0.4715617\",\n \"0.46752647\",\n \"0.4663089\",\n \"0.46578616\",\n \"0.46415484\",\n \"0.4640864\",\n \"0.46404234\",\n \"0.46354765\",\n \"0.46296442\",\n \"0.45987356\",\n \"0.45968136\",\n \"0.45857897\",\n \"0.45693547\",\n \"0.45547098\",\n \"0.455091\",\n \"0.45486733\",\n \"0.4546822\",\n \"0.4545897\",\n \"0.45435643\",\n \"0.45246837\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.71492475"},"document_rank":{"kind":"string","value":"27"}}},{"rowIdx":4189,"cells":{"query":{"kind":"string","value":"The display handles the DOM integration, both for input reading and content drawing. It holds references to DOM nodes and displayrelated state."},"document":{"kind":"string","value":"function Display(place, doc, input) {\n var d = this;\n this.input = input;\n\n // Covers bottom-right square when both scrollbars are present.\n d.scrollbarFiller = elt(\"div\", null, \"CodeMirror-scrollbar-filler\");\n d.scrollbarFiller.setAttribute(\"cm-not-content\", \"true\");\n // Covers bottom of gutter when coverGutterNextToScrollbar is on\n // and h scrollbar is present.\n d.gutterFiller = elt(\"div\", null, \"CodeMirror-gutter-filler\");\n d.gutterFiller.setAttribute(\"cm-not-content\", \"true\");\n // Will contain the actual code, positioned to cover the viewport.\n d.lineDiv = eltP(\"div\", null, \"CodeMirror-code\");\n // Elements are added to these to represent selection and cursors.\n d.selectionDiv = elt(\"div\", null, null, \"position: relative; z-index: 1\");\n d.cursorDiv = elt(\"div\", null, \"CodeMirror-cursors\");\n // A visibility: hidden element used to find the size of things.\n d.measure = elt(\"div\", null, \"CodeMirror-measure\");\n // When lines outside of the viewport are measured, they are drawn in this.\n d.lineMeasure = elt(\"div\", null, \"CodeMirror-measure\");\n // Wraps everything that needs to exist inside the vertically-padded coordinate system\n d.lineSpace = eltP(\"div\", [d.measure, d.lineMeasure, d.selectionDiv, d.cursorDiv, d.lineDiv],\n null, \"position: relative; outline: none\");\n var lines = eltP(\"div\", [d.lineSpace], \"CodeMirror-lines\");\n // Moved around its parent to cover visible view.\n d.mover = elt(\"div\", [lines], null, \"position: relative\");\n // Set to the height of the document, allowing scrolling.\n d.sizer = elt(\"div\", [d.mover], \"CodeMirror-sizer\");\n d.sizerWidth = null;\n // Behavior of elts with overflow: auto and padding is\n // inconsistent across browsers. This is used to ensure the\n // scrollable area is big enough.\n d.heightForcer = elt(\"div\", null, null, \"position: absolute; height: \" + scrollerGap + \"px; width: 1px;\");\n // Will contain the gutters, if any.\n d.gutters = elt(\"div\", null, \"CodeMirror-gutters\");\n d.lineGutter = null;\n // Actual scrollable element.\n d.scroller = elt(\"div\", [d.sizer, d.heightForcer, d.gutters], \"CodeMirror-scroll\");\n d.scroller.setAttribute(\"tabIndex\", \"-1\");\n // The element in which the editor lives.\n d.wrapper = elt(\"div\", [d.scrollbarFiller, d.gutterFiller, d.scroller], \"CodeMirror\");\n\n // Work around IE7 z-index bug (not perfect, hence IE7 not really being supported)\n if (ie && ie_version < 8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; }\n if (!webkit && !(gecko && mobile)) { d.scroller.draggable = true; }\n\n if (place) {\n if (place.appendChild) { place.appendChild(d.wrapper); }\n else { place(d.wrapper); }\n }\n\n // Current rendered range (may be bigger than the view window).\n d.viewFrom = d.viewTo = doc.first;\n d.reportedViewFrom = d.reportedViewTo = doc.first;\n // Information about the rendered lines.\n d.view = [];\n d.renderedView = null;\n // Holds info about a single rendered line when it was rendered\n // for measurement, while not in view.\n d.externalMeasured = null;\n // Empty space (in pixels) above the view\n d.viewOffset = 0;\n d.lastWrapHeight = d.lastWrapWidth = 0;\n d.updateLineNumbers = null;\n\n d.nativeBarWidth = d.barHeight = d.barWidth = 0;\n d.scrollbarsClipped = false;\n\n // Used to only resize the line number gutter when necessary (when\n // the amount of lines crosses a boundary that makes its width change)\n d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null;\n // Set to true when a non-horizontal-scrolling line widget is\n // added. As an optimization, line widget aligning is skipped when\n // this is false.\n d.alignWidgets = false;\n\n d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;\n\n // Tracks the maximum line length so that the horizontal scrollbar\n // can be kept static when scrolling.\n d.maxLine = null;\n d.maxLineLength = 0;\n d.maxLineChanged = false;\n\n // Used for measuring wheel scrolling granularity\n d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null;\n\n // True when shift is held down.\n d.shift = false;\n\n // Used to track whether anything happened since the context menu\n // was opened.\n d.selForContextMenu = null;\n\n d.activeTouch = null;\n\n input.init(d);\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function displayDOM(){\r\n\t\tvar str = '';\r\n\t\tcontainer.getChildren().each(function(item){\r\n\t\t\tstr += '<div style=\"' + item.style.cssText + '\">' + item.get('text') + '</div>\\n';\r\n\t\t});\r\n\t\tdocument.id('output').set('text', str);\r\n\t}","displayScene() {\n\n //Process all component nodes\n this.processNode(this.idRoot, null, null, 1, 1);\n }","display(ele) {\n // make sure ele is a DOM element\n if (this.isDOM(ele)) {\n ele.style.display = 'block';\n } else {\n console.error('Error while trying to display a non DOM object');\n }\n }","$render(displayRef) {\n if(this.$alive)\n this.render.apply(this, [this, displayRef]);\n }","displayScene() {\n // entry point for graph rendering\n //TODO: Render loop starting at root of graph\n //console.log(this.nodes)\n this.components[this.idRoot].display();\n }","display() {\n this._flushSomeDiv(this._threadHost)\n this._threadHost.appendChild(this._identifiedThread)\n this._scrollBottom()\n }","createDOM() {\n // outer element hosts the node itself, css background colors,\n // border etc. will be applied here.\n this.domElement = document.createElement('div');\n this.domElement.node = this;\n this.domElement.classList.add('node');\n this.graph.domElement.appendChild(this.domElement);\n\n // content element has the title for the node and maybe some more UI\n // it is centered in the node in css.\n this.content = document.createElement('div');\n this.content.classList.add('node_content');\n this.domElement.appendChild(this.content);\n this.addDragAndDrop();\n }","function Interpreter_CreateDisplayPanel()\n{\n\t//create a div\n\tvar theDisplayPanel = document.body.appendChild(document.createElement(\"DIV\"));\n\t//set its values\n\ttheDisplayPanel.style.cssText = \"position:absolute;width:100%;height:100%;overflow:auto;left:0px;top:0px;-moz-transform-origin:0 0;\" + (__DESIGNER_CONTROLLER ? \"\" : \"-webkit-transform: translate3d(0, 0, 0);\");\n\t//make it unselectable\n\tBrowser_SetSelectable(theDisplayPanel, false);\n\t//finally add the size change listener\n\tBrowser_AddEvent(window, __BROWSER_EVENT_RESIZE, Interpreter_OnResizeEvent);\n\tBrowser_AddEvent(theDisplayPanel, __BROWSER_EVENT_SCROLL, Interpreter_OnDisplayScroll);\n\t//return it\n\treturn theDisplayPanel;\n}","_buildDisplayView() {\n this.element.innerHTML = this.value;\n }","_buildDisplayView() {\n this.element.innerHTML = this.value;\n }","function Interpreter_UpdateDisplay()\n{\n\t//helpers\n\tvar uidObject, theObject;\n\t//loop through all of our iframes\n\tfor (uidObject in this.LoadedIFrames)\n\t{\n\t\t//get the object\n\t\ttheObject = this.LoadedIFrames[uidObject];\n\t\t//valid?\n\t\tif (theObject && theObject.HTML)\n\t\t{\n\t\t\t//purge all css data\n\t\t\tBrowser_RemoveCSSData_Purge(theObject.HTML.contentDocument);\n\t\t}\n\t}\n\t//purge all css data from main doc too\n\tBrowser_RemoveCSSData_Purge(document);\n\t//loop through all toplevel objects\n\tfor (uidObject in this.TopLevelObjects)\n\t{\n\t\t//get the object\n\t\ttheObject = this.TopLevelObjects[uidObject];\n\t\t//valid?\n\t\tif (theObject)\n\t\t{\n\t\t\t//update it with full recursion\n\t\t\ttheObject.UpdateDisplay(true);\n\t\t}\n\t}\n\t//rearrange the forms\n\tForm_RearrangeForms(this.FocusedFormId);\n\t//and reset this\n\tthis.FocusedFormId = [];\n\t//have we got a focused object id? (AND NOT IN DESIGNER)\n\tif (this.State && this.State.FocusedObjectId > 0)\n\t{\n\t\t//memorise it\n\t\tthis.FocusedObjectId = this.State.FocusedObjectId;\n\t}\n\t//we need to handle the tabs here\n\tthis.PreUpdatePostDisplay();\n}","display() {\n this.editorNode.style.visibility = \"visible\";\n this.focusInput();\n }","function DOMRenderer() {}","render_display() {\n this.element.fadeIn();\n this.visible = true;\n }","function parseNodes()\r\n{\r\n\tvar browser = gBrowser.mCurrentBrowser;\t\r\n\tdisplayNodes(browser.contentDocument);\r\n\tcreateWindow();\r\n}","display()\n {\n $(this.element).html(`\n <link rel=\"stylesheet\" href=\"views/tab-view/tab-view.css\">\n <link rel=\"stylesheet\" href=\"views/tab-content/tab-content.css\">\n <link rel=\"stylesheet\" href=\"views/list-tasks/list-tasks.css\">\n <link rel=\"stylesheet\" href=\"views/diagram-view/diagram-view.css\">\n\n <ul id=\"tabs\">\n </ul>\n <div id=\"tab-content\"></div>\n `);\n\n this.ulTabs = document.getElementById('tabs');\n this.divsContent = document.getElementById('tab-content');\n\n //adapt the height of the div to the full width\n $(window).resize(function()\n {\n $('#tab-content').height($('#tab-content').parent().height() - $('#tabs').height());\n });\n\n $(document).ready(function()\n {\n $(window).trigger('resize');\n });\n }","renderIncDom() {\n\t\tif (this.component_.render) {\n\t\t\tthis.component_.render();\n\t\t} else {\n\t\t\tIncrementalDOM.elementVoid('div');\n\t\t}\n\t}","get display() {\n return this._display.innerHTML;\n }","render() {\n console.debug(`Rendering DOM of ${this.constructor.name}`);\n this.shadowRoot.innerHTML = this.html;\n if (this.script != null) {\n console.debug(`Running script of ${this.constructor.name}`);\n this.script();\n console.debug(`Finished running script of ${this.constructor.name}`);\n }\n console.debug(`Finished rendering DOM of ${this.constructor.name}`);\n }","_render() {\n\n this._el.innerHTML = `\n <div class='itk-slider'>\n <button class='show-prev-btn'> left </button>\n <img class='slide-img' src=''>\n <button class='show-next-btn'> right </button>\n </div>`;\n\n this.showPrevBtn = this._el.querySelector('.show-prev-btn');\n this.showNextBtn = this._el.querySelector('.show-next-btn');\n this.slideImage = this._el.querySelector('.slide-img');\n }","_render() {\n this._reactComponent = this._getReactComponent();\n if (!this._root) this._root = createRoot(this._container.getElement()[0]);\n this._root.render(this._reactComponent);\n }","function displayContentUpdate() {\n display.textContent = displayContent.join('');\n}","function update_display(){\n // canvas\n draw();\n // DOM displaying results\n display_questions_list();\n}","_registerDisplayListeners () {\n this.display = caller('display', {postMessage: window.parent.postMessage.bind(window.parent)})\n this.hide = caller('hide', {postMessage: window.parent.postMessage.bind(window.parent)})\n }","render(){\n //createDom (tag, type, name, value, domClass, id, parent)\n this.containerDom = this.htmlHelper.createDom('div', this.parentDom,this.domClass + '_conatiner')\n this.dom = this.htmlHelper.createDom('canvas', this.containerDom);\n this.dom.style.touchAction=\"none\"; // prevent default browser actions\n\n this.setContextData(this.defaultLineWidth, '#000000')\n }","function display(node){\n if(node.visible){\n if (hasBorder() == true)\n p.stroke(getBorderColor());\n else\n p.noStroke();\n\n if(beingDragged != null && node == beingDragged){\n p.fill(getActiveColor());\n } else if(p.mouseX >= node.x-node.width/2 && p.mouseX <= node.x+node.width/2 \n && p.mouseY >= node.y-node.height/2 && p.mouseY <= node.y+node.height/2){\n if (currentClickedNode == node)\n p.fill(getSelectedColor());\n else\n p.fill(getHoverColor());\n\n document.getElementById('show_label').innerHTML = node.label;\n document.getElementById('show_url').innerHTML = node.url;\n document.getElementById('show_url').href = node.url;\n } else if (currentClickedNode == node){\n p.fill(getSelectedColor()); \n } else {\n p.fill(getNodeColor());\n } \n p.rect(node.x, node.y, node.width, node.height);\n\n //Handle node expander graphic\n if (node.children.length != 0) {\n p.noStroke();\n p.fill(getActiveColor());\n p.rect(node.x+node.width/2, node.y, 3, 3);\n } \n\n //Handle text \n p.fill(getFontColor());\n // calculate text size based on the current size of the node\n p.textSize(getTextSize(node));\n p.text(node.label, node.x - node.width/2 + 5, node.y + 5);\n //p.text(node.label, node.x-35, node.y+5);\n\n //Used for drag/drop\n var x_origin = node.x + node.width/2;\n var y_origin = node.y;\n\n //Recurse on children and draw connecting lines\n for(var i=0; i<node.children.length; i++){\n if(node.children[i].visible && node.children[i].x - node.children[i].width/2 > 0 && node.children[i].y > 0){\n display(node.children[i]);\n p.stroke(getLineColor());\n p.line(x_origin, y_origin, node.children[i].x - node.children[i].width/2, node.children[i].y);\n }\n }\n }\n}","function Display_showGameElements() {\n\tvar displayContent = document.getElementById(\"displayContent\");\n\n\tvar inputToCrib = document.createElementNS(this.xhtmlns, \"input\");\n\tinputToCrib.setAttribute(\"id\", \"inputToCrib\");\n\tinputToCrib.setAttribute(\"type\", \"button\");\n\tinputToCrib.setAttribute(\"value\", \"To Crib\");\n\tinputToCrib.setAttribute(\"onclick\", \"toCrib();\");\n\n\tvar inputPlay = document.createElementNS(this.xhtmlns, \"input\");\n\tinputPlay.setAttribute(\"id\", \"inputPlay\");\n\tinputPlay.setAttribute(\"type\", \"button\");\n\tinputPlay.setAttribute(\"value\", \"Play card\");\n\n\tdisplayContent.appendChild(inputToCrib);\n\tdisplayContent.appendChild(inputPlay);\n\n\t// Show deck and stack\n\tthis.createCard(null, 490, 10, 120, false);\n\tthis.createCard(null, 620, 10, 120, false);\n\n\t// Display count\n\tvar spanCountHeader = document.createElementNS(this.xhtmlns, \"span\");\n\tspanCountHeader.setAttribute(\"id\", \"spanCountHeader\");\n\tspanCountHeader.appendChild(document.createTextNode(\"Curent Play Count:\"));\n\n\tvar spanCount = document.createElementNS(this.xhtmlns, \"span\");\n\tspanCount.setAttribute(\"id\", \"spanCount\");\n\tspanCount.appendChild(document.createTextNode(\"0\"));\n\n\tvar whosCrib = document.createElementNS(this.xhtmlns, \"img\");\n\twhosCrib.setAttribute(\"id\", \"whosCrib\");\n\twhosCrib.setAttribute(\"src\", \"img/crib.png\");\n\n\tdisplayContent.appendChild(whosCrib);\n\tdisplayContent.appendChild(spanCountHeader);\n\tdisplayContent.appendChild(spanCount);\n}","render(innerHTML = \"\")\n {\n this.DOMContainer.innerHTML = innerHTML;\n if (this.handleDOMContainer) \n {\n this.DOMContainer.insertAdjacentElement(\"afterbegin\", this.handleDOMContainer);\n } \n }","render() {\n const { rootNode, sizeSet } = this;\n let visualIndex = this.visualIndex;\n\n if (this.isSharedViewSet() && sizeSet.isPlaceOn(WORKING_SPACE_BOTTOM)) {\n visualIndex += sizeSet.sharedSize.nextSize;\n }\n\n let node = rootNode.childNodes[visualIndex];\n\n if (node.tagName !== this.childNodeType) {\n const newNode = this.nodesPool();\n\n rootNode.replaceChild(newNode, node);\n node = newNode;\n }\n\n this.collectedNodes.push(node);\n this.visualIndex += 1;\n }","display() {\n\t\tsuper.display();\n\n\t\t/* Display the boxes on the right panel. */\n\t\tthis.scoreBox.display();\n\t\tthis.levelLinesBox.display();\n\t\tthis.nextPieceBox.display();\n\t\tthis.statBox.display();\n\n\t\t/* Display the falling piece. */\n\t\tif (this.piece != undefined) {\n\t\t\tthis.piece.display(this.grid.initialx, this.grid.initialy, this.grid.squareSize);\n\t\t}\n\n\t\t/* Display the grid. */\n\t\tthis.grid.display();\n\n\t\tif (this.state == STATE_SELECT_LEVEL) {\n\t\t\tthis.blurBackground();\n\t\t\tthis.levelSelectorBox.display();\n\t\t}\n\t\telse if (this.state == STATE_WAIT_ADVERSARY_SELECTION) {\n\t\t\tthis.blurBackground();\n\t\t\tthis.waitAdversarySelectionBox.display();\n\t\t}\n\t\telse if (this.state == STATE_GAME_OVER) {\n\t\t\tthis.blurBackground();\n\t\t\tthis.gameOverSelectorBox.display();\n\t\t}\n\t\telse if (this.state == STATE_SUBMIT) {\n\t\t\tthis.blurBackground();\n\t\t\tthis.submitBox.display();\n\t\t}\n\t}","function renderDom() {\n stackList.innerHTML = \"\";\n myStack.stackControl.forEach(el => {\n stackList.innerHTML += `<li>${el}</li>`;\n })\n }","connectedCallback() {\n this.renderAndUpdateDom();\n }","function show() {\n const toShow = document.querySelector(\".show\");\n const showBlock = document.querySelector(\".currentDisplay\");\n showBlock.innerHTML = (toShow.innerHTML)\n}","function initializeDisplay() {\n // set the data and properties of link lines\n link = svg.append(\"g\")\n .attr(\"class\", \"links\")\n .selectAll(\"line\")\n .data(graph.links)\n .enter().append(\"line\");\n\n // set the data and properties of node circles\n node = svg.append(\"g\")\n .attr(\"class\", \"nodes\")\n .selectAll(\"circle\")\n .data(graph.nodes)\n .enter()\n .append(\"circle\")\n .call(d3.drag()\n .on(\"start\", dragstarted)\n .on(\"drag\", dragged)\n .on(\"end\", dragended));\n\n node.append(\"title\")\n .text(function (d) {\n return d.id;\n });\n\n link.append(\"title\")\n .text(function (d) {\n return d.value;\n });\n \n // visualize the graph\n updateDisplay();\n}","function displayContent(div){\n\tscrollContentPadding()\n\tprebuildSlideMenu()\n\teditPagerLink()\n\tShadowbox.clearCache()//Re-initialize Shadowbox to include any newly loaded images\n\tShadowbox.setup()\n\n\t\tvar imgLoaded = 0\n\t\tvar contentBox = $(activeContainer).find('.'+div)\n\t\tvar imgCount = $('img',contentBox).size()\t\t\n\t\t\n\t\t\n\t\t$('img',contentBox).each(function(index,element){\n\n\t\t\tif(element.complete){\n\n\t\t\t\timgLoaded ++\n\n\t\t\t} else {\n\n\t\t\t\t$(element).bind('load',function(){\n\t\t\t\t\timgLoaded ++\t\t\t\t\t\t\t\t\t\t\n\t\t\t\t})\t\t\t\t\n\n\t\t\t}\n\t\n\t\t})\t\t\n\n\t\tvar scrollBuilder = setInterval(function(){\t\t\t\n\t\t\tif(imgLoaded == imgCount){\n\t\t\t\t\n\t\t\t\t\n\t\t\t\t\t$(activePanel).mCustomScrollbar(\"vertical\",400,\"easeOutCirc\",1.05,\"fixed\",\"yes\",\"yes\",20)\t\n\t\t\t\t\n\t\t\t\t//readOut(\"Building slidemenu\" + smId)\n\t\t\t\t//readOut($(activeContainer).css('width'))\t\t\n\t\t\t\tclearInterval(scrollBuilder)\n\t\t\t}\n\t\t},250)\n\n\n\t\t\n\t$(activeContainer).fadeTo(1000,1)\t \n}","displayScene() {\n if(this.nodeInfo)\n this.displayNode(this.nodeInfo[this.idRoot],this.defaultMaterialID,\"null\",{s:1,t:1},false);\n }","function displayHTML()\n{\n document.getElementById( \"outputDiv\" ).innerHTML = outputHTML;\n} // end function displayDoc","displayScene()\r\n {\r\n this.traverseGraph(this.components[this.idRoot], this.components[this.idRoot].materials, this.components[this.idRoot].texture);\r\n }","display () {\r\n this.timeout = null;\r\n if (this.pending) return;\r\n let content = this.input.textContent;\r\n if (content === this.oldContent) return;\r\n\r\n if (this.running) {\r\n this.pending = true;\r\n MathJax.Hub.Queue([\"display\", this]);\r\n } else {\r\n this.buffer.innerHTML = this.oldContent = (content.length > 0 ) ? '$' + content + '$' : '';\r\n this.running = true;\r\n MathJax.Hub.Queue([\"Typeset\", MathJax.Hub, this.buffer ], [\"finish\", this] );\r\n }\r\n }","function css_defaultDisplay(nodeName) {\n var doc = document,\n display = elemdisplay[nodeName];\n\n if (!display) {\n display = actualDisplay(nodeName, doc);\n\n // If the simple way fails, read from inside an iframe\n if (display === \"none\" || !display) {\n // Use the already-created iframe if possible\n iframe = (iframe || jQuery(\"<iframe frameborder='0' width='0' height='0'/>\")\n .css(\"cssText\", \"display:block !important\")).appendTo(doc.documentElement);\n\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\n doc = (iframe[0].contentWindow || iframe[0].contentDocument).document;\n doc.write(\"<!doctype html><html><body>\");\n doc.close();\n\n display = actualDisplay(nodeName, doc);\n iframe.detach();\n }\n\n // Store the correct default display\n elemdisplay[nodeName] = display;\n }\n\n return display;\n }","function display() {\n\n doSanityCheck();\n initButtons();\n}","function TrackingDisplay($display) {\n\t\t//Store the canvas element for this display\n\t\tthis.$display = $display;\n\n\t\t//Retrieve and store the 2d drawing context for this canvas\n\t\tthis.drawContext = $display[0].getContext('2d');\n\n\t\t//Store the dimensions of the current display element.\n\t\tthis.width = $display.width();\n\t\tthis.height = $display.height();\n\n\t\t//Determine which axis is the constraining axis for this canvas so we can ensure our displays are squares.\n\t\tif (this.width < this.height) {\n\t\t\tthis.height = this.width;\n\t\t} else {\n\t\t\tthis.width = this.height;\n\t\t}\n\n\t\t//Apply the new dimensions\n\t\t$display.height(this.height).width(this.width).attr(\"width\", this.width).attr(\"height\", this.height);\n\n\t\t//Multidimensional array of values from the CELL_STATE variable representing the state of each cell.\n\t\tthis.gridState = [];\n\n\t\t//Multidimensional array of any values. Used just to contain data related to each cell. At the moment, this only used\n\t\t//to specify the type of ship in a \"SHIP\" cell.\n\t\tthis.gridData = [];\n\n\t\t//Declare the hasInit flag, for controlling when the initialization logic fires\n\t\tthis.hasInit = false;\n\t}","function renderContent() {\n var content = document.getElementById('content_' + selected);\n // Initialize the pane.\n if (content.id == 'content_blocks') {\n // If the workspace was changed by the XML tab, Firefox will have performed\n // an incomplete rendering due to Blockly being invisible. Rerender.\n Blockly.mainWorkspace.render();\n } else if (content.id == 'content_xml') {\n var xmlTextarea = document.getElementById('textarea_xml');\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\n xmlTextarea.value = xmlText;\n xmlTextarea.focus();\n } else if (content.id == 'content_javascript') {\n content.innerHTML = Blockly.Generator.workspaceToCode('JavaScript');\n } else if (content.id == 'content_python') {\n content.innerHTML = Blockly.Generator.workspaceToCode('Python');\n }\n}","createDisplay() {\n const { text, fontSize = 36, color = '#000000' } = this.conf;\n this.display = new ProxyObj();\n // this.setAnchor(0.5);\n this.display.text = text;\n this.display.updateStyle({ fontSize, fill: color });\n }","function clearDisplay() {\n // Removing all children from an element\n var element = document.getElementById(\"rightSideBar\");\n document.getElementById(\"docDisplay\").innerHTML = \"\";\n while (element.firstChild) {\n element.removeChild(element.firstChild);\n }\n}","display() {\n this.scene.pushMatrix();\n this.scene.multMatrix(this.transfMatrix); /*Add the new transformation matrix to this node \n and all its descendants*/\n\n /*if this node is keyframe animated and the animation has not started yet, node cannot be displayed*/\n if((this.animation != null && (this.animation.checkVisibility() == true)) || this.animation == null) {\n if(this.animation != null) {\n this.animation.apply(this.scene);\n }\n \n if(this.material != \"null\") { //Adicionar o material se não for \"null\"\n materialStack.push(this.material);\n }\n\n if(this.scene.materials[materialStack[materialStack.length - 1]] != null)\n this.scene.materials[materialStack[materialStack.length - 1]].apply();\n\n if(this.texture == \"clear\") {\n if(this.scene.textures[textureStack[textureStack.length - 1]] != null) \n this.scene.textures[textureStack[textureStack.length - 1]].unbind(); \n textureStack.push(0);\n } else if(this.texture == \"null\") {\n if(this.scene.textures[textureStack[textureStack.length - 1]] != null) {\n if(this.scene.textures[textureStack[textureStack.length - 1]] != 0)\n this.scene.textures[textureStack[textureStack.length - 1]].bind();\n }\n } else {\n if(this.scene.textures[this.texture] != 0 && this.scene.textures[this.texture] != null) {\n textureStack.push(this.texture);\n this.scene.textures[textureStack[textureStack.length - 1]].bind();\n }\n }\n\n //Display leaves if they exist\n for(var i = 0; i < this.leaves.length; i++) {\n if(this.leaves[i] != null)\n this.leaves[i].display();\n }\n\n //Recursively run this code for all the children nodes\n for(var j = 0; j < this.descendants.length; j++) {\n this.descendants[j].display();\n }\n\n if(this.texture != \"null\"){\n textureStack.pop();\n }\n\n if(this.material != \"null\")\n materialStack.pop();\n }\n\n this.scene.popMatrix();\n\n }","async connectedCallback() {\n const ctor = this.constructor;\n this.setAttribute(`_ui5rt${(0, _Runtimes.getCurrentRuntimeIndex)()}`, \"\");\n this.setAttribute(\"_ui5host\", \"\");\n this.setAttribute(ctor.getMetadata().getPureTag(), \"\");\n if (ctor.getMetadata().supportsF6FastNavigation()) {\n this.setAttribute(\"data-sap-ui-fastnavgroup\", \"true\");\n }\n const slotsAreManaged = ctor.getMetadata().slotsAreManaged();\n this._inDOM = true;\n if (slotsAreManaged) {\n // always register the observer before yielding control to the main thread (await)\n this._startObservingDOMChildren();\n await this._processChildren();\n }\n if (!this._inDOM) {\n // Component removed from DOM while _processChildren was running\n return;\n }\n (0, _Render.renderImmediately)(this);\n this._domRefReadyPromise._deferredResolve();\n this._fullyConnected = true;\n this.onEnterDOM();\n }","display() {\n this.object.display();\n }","show ()\n\t{\n\t\t//if the view hasn't been initialised, call setup (of the concrete view e.g. LOView)\n\t\tif(!this.initialised)\n\t\t{\n\t\t\tthis.setup();\n\t\t}\n\t\telse\n\t\t{\n\t\t\t//unhide the elements of the scene\n\t\t\tthis.root.style.display = 'block';\n\t\t}\n\t}","render() {\n\t\tif (!this.component_.element) {\n\t\t\tthis.component_.element = document.createElement('div');\n\t\t}\n\t\tthis.emit('rendered', !this.isRendered_);\n\t}","function __zoot_c3d__process_DOM() {\n let containers = document.body.getElementsByTagName('zoot-c3d-root-container');\n for (let i = 0; i < containers.length; i++) {\n __zoot_c3d__process_Component(undefined, containers[i]);\n __zoot_c3d__g_root_containers.push(containers[i]);\n containers[i].zoot_c3d_sync();\n }\n}","display() {\n this.scene.pushMatrix();\n this.scene.multMatrix(this.transformationMatrix);\n if ((typeof this.cgfTexture != 'undefined') && this.cgfMaterial != null)\n this.cgfMaterial.setTexture(this.cgfTexture);\n if (this.cgfMaterial != null)\n this.cgfMaterial.apply();\n\n if (typeof this.animations[this.atualAnimationId] != 'undefined')\n this.animations[this.atualAnimationId].display();\n\n for (let children of this.childrens) {\n if (children.cgfTextureId == \"inherit\") {\n children.cgfTexture = this.cgfTexture;\n children.length_sTexture = this.length_sTexture;\n children.length_tTexture = this.length_tTexture;\n }\n if (children.cgfMaterialId == \"inherit\") {\n children.cgfMaterial = this.cgfMaterial;\n }\n if (!(children instanceof Component)) {\n if (!(isNaN(this.length_sTexture) || isNaN(this.length_tTexture)))\n children.updateTexCoords(this.length_sTexture, this.length_tTexture);\n }\n children.display();\n }\n\n this.scene.popMatrix();\n }","show() {\n for (let node of this.nodes) {\n node.show();\n node.showLinks();\n }\n }","_renderScreen() {\n\t\tif (this._el && this._component) {\n\t\t\tthis._component.render(this._el);\n\t\t}\n\t}","connectedCallback() {\n this.innerHTML = this.render();\n\n }","function renderContent() {\n var content = document.getElementById('content_' + selected);\n // Initialize the pane.\n if (content.id == 'content_blocks') {\n // If the workspace was changed by the XML tab, Firefox will have performed\n // an incomplete rendering due to Blockly being invisible. Rerender.\n Blockly.mainWorkspace.render();\n } else if (content.id == 'content_xml') {\n var xmlTextarea = document.getElementById('textarea_xml');\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\n xmlTextarea.value = xmlText;\n xmlTextarea.focus();\n } else if (content.id == 'content_javascript') {\n content.innerHTML = Blockly.Generator.workspaceToCode('JavaScript');\n } else if (content.id == 'content_python') {\n content.innerHTML = Blockly.Generator.workspaceToCode('Python');\n } else if (content.id == 'content_whalesong') {\n content.innerHTML = Blockly.Generator.workspaceToCode('Whalesong');\n } else if (content.id == 'content_ray') {\n content.innerHTML = Blockly.Generator.workspaceToCode('Ray');\n }\n}","displayScene() {\n var root = this.components[this.root];\n if (root == null)\n return \"[displayScene]: root node does not exist!\";\n\n // display scene graph starting at the root component\n root.display(root.materials[root.currentMaterialIndex][1], root.texture);\n }","render() {\n this._addChooserHandler();\n this._addLoggerListeners();\n this._addButtonHandler();\n }","onEnterDOM() {}","function showElement () {\n if(this instanceof HTMLCollection || this instanceof NodeList) {\n for(var i = 0; i < this.length; i++) {\n this[i].style.display = null;\n }\n }\n else if(this instanceof HTMLElement) {\n this.style.display = null;\n }\n\n return this;\n }","function displayContents() {\n\tif (contentsRequest.readyState === XMLHttpRequest.DONE) {\n\t\tif (contentsRequest.status === 200) {\n\t\t\tdocument.getElementById('tree').textContent = properties.showtree();\n\t\t\tdocument.getElementById('display').innerHTML = formatDirContents(contentsRequest.responseText);\n\t\t} else {\n\t\t\talert('There was a problem with the request.');\n\t\t}\n\t}\n}","function updateDisplay () {\n const display = document.querySelector('.calculatorDisplay');\n // update value of screen element with content of `displayValue`\n display.value = calcDisplay.displayValue;\n}","render() {\n this.fetch(() => {\n /**\n * Notice that the order here doesn't matter, if we want it to work like React,\n * we have to set up a virtual DOM and then have another object which it's purpose\n * will be to get the virtual DOM and then put that into the DOM (ReactDOM job is actually just that).\n * Virtual DOM is just any representation of the DOM elements, for that we can use JSX to\n * make our job easier and actually doing that is way easier than what you might think!\n */\n new Articles(this.articles).render();\n });\n }","function actualDisplay( name, doc ) {\n\tvar elem = DM( doc.createElement( name ) ).appendTo( doc.body ),\n\t\tdisplay = DM.css( elem[0], \"display\" );\n\telem.remove();\n\treturn display;\n}","show() {\n this.el.appendChild(this.canvas);\n this.update();\n }","attachToDOM_() {\n document.body.appendChild(this);\n }","function changeTheDOM()\n{\n\tconsole.log('DOM change call');\n\tdocument.getElementById('passage').setAttribute('style','display: block');\n\tdocument.getElementById('playagain').setAttribute('style','display: block');\n\tdocument.getElementById('madlibs-entry').setAttribute('style','display: none');\n\n\tdocument.getElementById('classics').innerHTML = selectedPassageTitle;\n}","function defaultDisplay(nodeName){if(!elemdisplay[nodeName]){var body=document.body,elem=jQuery(\"<\"+nodeName+\">\").appendTo(body),display=elem.css(\"display\");elem.remove(); // If the simple way fails,\n\t// get element's real default display by attaching it to a temp iframe\n\tif(display===\"none\"||display===\"\"){ // No iframe to use yet, so create it\n\tif(!iframe){iframe=document.createElement(\"iframe\");iframe.frameBorder=iframe.width=iframe.height=0;}body.appendChild(iframe); // Create a cacheable copy of the iframe document on first call.\n\t// IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML\n\t// document to it; WebKit & Firefox won't allow reusing the iframe document.\n\tif(!iframeDoc||!iframe.createElement){iframeDoc=(iframe.contentWindow||iframe.contentDocument).document;iframeDoc.write((jQuery.support.boxModel?\"<!doctype html>\":\"\")+\"<html><body>\");iframeDoc.close();}elem=iframeDoc.createElement(nodeName);iframeDoc.body.appendChild(elem);display=jQuery.css(elem,\"display\");body.removeChild(iframe);} // Store the correct default display\n\telemdisplay[nodeName]=display;}return elemdisplay[nodeName];}","function renderContent() {\n var content = document.getElementById('content_' + selected);\n // Initialize the pane.\n if (content.id == 'content_blocks') {\n // If the workspace was changed by the XML tab, Firefox will have performed\n // an incomplete rendering due to Blockly being invisible. Rerender.\n Blockly.mainWorkspace.render();\n //Check if the arduino code peek is showing\n if(document.getElementById('arduino_code_peek').style.display != 'none' ) {\n renderArduinoCode(null);\n }\n } else if (content.id == 'content_xml') {\n // Initialize the pane.\n var xmlTextarea = document.getElementById('textarea_xml');\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\n xmlTextarea.value = xmlText;\n xmlTextarea.focus();\n } else if (content.id == 'content_arduino') {\n var code = Blockly.Generator.workspaceToCode('Arduino');\n var arduinoTextarea = document.getElementById('textarea_arduino');\n arduinoTextarea.value = code\n arduinoTextarea.focus();\n }\n}","setDisplayNodeParent(element) {\n this.display_node.remove();\n element.appendChild(this.display_node);\n }","function _display(){\n\t\t\t$(levelID).html(level);\n\t\t\t$(pointsID).html(points);\n\t\t\t$(linesID).html(lines);\n\t\t}","get display () {\n\t\treturn this._display;\n\t}","get display () {\n\t\treturn this._display;\n\t}","get display () {\n\t\treturn this._display;\n\t}","render() {\n this.innerHTML = this.htmlElementsString;\n this.rootElement.appendChild(this);\n this.createScript();\n }","function updateDisplay(){\n const display = document.querySelector('.calculator-screen');\n // update the value of screen from displayValue in calculator object\n display.value = calculator.displayValue;\n}","function css_defaultDisplay( nodeName ) {\n var doc = document,\n display = elemdisplay[ nodeName ];\n\n if ( !display ) {\n display = actualDisplay( nodeName, doc );\n\n // If the simple way fails, read from inside an iframe\n if ( display === \"none\" || !display ) {\n // Use the already-created iframe if possible\n iframe = ( iframe ||\n jQuery(\"<iframe frameborder='0' width='0' height='0'/>\")\n .css( \"cssText\", \"display:block !important\" )\n ).appendTo( doc.documentElement );\n\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\n doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\n doc.write(\"<!doctype html><html><body>\");\n doc.close();\n\n display = actualDisplay( nodeName, doc );\n iframe.detach();\n }\n\n // Store the correct default display\n elemdisplay[ nodeName ] = display;\n }\n\n return display;\n}","function css_defaultDisplay( nodeName ) {\n var doc = document,\n display = elemdisplay[ nodeName ];\n\n if ( !display ) {\n display = actualDisplay( nodeName, doc );\n\n // If the simple way fails, read from inside an iframe\n if ( display === \"none\" || !display ) {\n // Use the already-created iframe if possible\n iframe = ( iframe ||\n jQuery(\"<iframe frameborder='0' width='0' height='0'/>\")\n .css( \"cssText\", \"display:block !important\" )\n ).appendTo( doc.documentElement );\n\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\n doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\n doc.write(\"<!doctype html><html><body>\");\n doc.close();\n\n display = actualDisplay( nodeName, doc );\n iframe.detach();\n }\n\n // Store the correct default display\n elemdisplay[ nodeName ] = display;\n }\n\n return display;\n}","createDisplay() {\n const { text, fontSize = 36 } = this.conf;\n this.display = Pool.get(this.type, () => new Label());\n this.display.attr({ text, fontSize });\n }","_onUpdateDisplay() {}","function render()\n {\n if (me.triggerEvent('renderBefore', data) === false)\n return;\n\n // remove all child nodes\n container.html('');\n\n // render child nodes\n for (var i=0; i < data.length; i++) {\n data[i].level = 0;\n render_node(data[i], container);\n }\n\n me.triggerEvent('renderAfter', container);\n }","_render(html){this.$.container.innerHTML=html}","_initDisplay(value) {}","render() {\n this.notify('initial-load', {});\n /**\n * Used to load context menu\n */\n this.trigger('load');\n this.notify('initial-end', {});\n this.renderElements();\n this.renderComplete();\n }","render() {\n this.notify('initial-load', {});\n /**\n * Used to load context menu\n */\n this.trigger('load');\n this.notify('initial-end', {});\n this.renderElements();\n this.renderComplete();\n }","render() {\n this.notify('initial-load', {});\n /**\n * Used to load context menu\n */\n this.trigger('load');\n this.notify('initial-end', {});\n this.renderElements();\n this.renderComplete();\n }","function displayContent(tag) {\n\t\n\tvar pagedisplay = document.getElementsByClassName(\"pagedisplay\")[0];\n\t\n\tswitch(tag) {\n\t\tcase \"projects\":\n\t\t\tvar projects = getProjects();\n\t\t\temptyDiv(\"pagedisplay\");\n\t\t\tpagedisplay.appendChild(projects);\n\t\t\tbreak;\n\t\tcase \"aboutus\":\n\t\t\tvar aboutus = getAboutUs();\n\t\t\temptyDiv(\"pagedisplay\");\n\t\t\tpagedisplay.appendChild(aboutus);\n\t\t\tbreak;\n\t\tcase \"becomemember\":\n\t\t\tvar becomemember = getBecomeMember();\n\t\t\temptyDiv(\"pagedisplay\");\n\t\t\tpagedisplay.appendChild(becomemember);\n\t\t\tbreak;\n\t\tcase \"members\":\n\t\t\tvar membersarea = getMembers();\n\t\t\temptyDiv(\"pagedisplay\");\n\t\t\tpagedisplay.appendChild(membersarea);\n\t\t\tbreak;\n\t\tdefault:\n\t\t\tbreak;\n\t}\n}","function DisplayObject()\n{\n this.last = this;\n this.first = this;\n /**\n * The coordinate of the object relative to the local coordinates of the parent.\n *\n * @property position\n * @type Point\n */\n this.position = new Point();\n\n /**\n * The scale factor of the object.\n *\n * @property scale\n * @type Point\n */\n this.scale = new Point(1,1);//{x:1, y:1};\n\n /**\n * The pivot point of the displayObject that it rotates around\n *\n * @property pivot\n * @type Point\n */\n this.pivot = new Point(0,0);\n\n /**\n * The rotation of the object in radians.\n *\n * @property rotation\n * @type Number\n */\n this.rotation = 0;\n\n /**\n * The opacity of the object.\n *\n * @property alpha\n * @type Number\n */\n this.alpha = 1;\n\n /**\n * The visibility of the object.\n *\n * @property visible\n * @type Boolean\n */\n this.visible = true;\n\n /**\n * This is the defined area that will pick up mouse / touch events. It is null by default.\n * Setting it is a neat way of optimising the hitTest function that the interactionManager will use (as it will not need to hit test all the children)\n *\n * @property hitArea\n * @type Rectangle|Circle|Ellipse|Polygon\n */\n this.hitArea = null;\n\n /**\n * This is used to indicate if the displayObject should display a mouse hand cursor on rollover\n *\n * @property buttonMode\n * @type Boolean\n */\n this.buttonMode = false;\n\n /**\n * Can this object be rendered\n *\n * @property renderable\n * @type Boolean\n */\n this.renderable = false;\n\n /**\n * [read-only] The display object container that contains this display object.\n *\n * @property parent\n * @type DisplayObjectContainer\n * @readOnly\n */\n this.parent = null;\n\n /**\n * [read-only] The stage the display object is connected to, or undefined if it is not connected to the stage.\n *\n * @property stage\n * @type Stage\n * @readOnly\n */\n this.stage = null;\n\n /**\n * [read-only] The multiplied alpha of the displayobject\n *\n * @property worldAlpha\n * @type Number\n * @readOnly\n */\n this.worldAlpha = 1;\n\n /**\n * [read-only] Whether or not the object is interactive, do not toggle directly! use the `interactive` property\n *\n * @property _interactive\n * @type Boolean\n * @readOnly\n * @private\n */\n this._interactive = false;\n\n this.defaultCursor = 'pointer';\n\n /**\n * [read-only] Current transform of the object based on world (parent) factors\n *\n * @property worldTransform\n * @type Mat3\n * @readOnly\n * @private\n */\n this.worldTransform = mat3.create();//mat3.identity();\n\n /**\n * [read-only] Current transform of the object locally\n *\n * @property localTransform\n * @type Mat3\n * @readOnly\n * @private\n */\n this.localTransform = mat3.create();//mat3.identity();\n\n /**\n * [NYI] Unkown\n *\n * @property color\n * @type Array<>\n * @private\n */\n this.color = [];\n\n /**\n * [NYI] Holds whether or not this object is dynamic, for rendering optimization\n *\n * @property dynamic\n * @type Boolean\n * @private\n */\n this.dynamic = true;\n\n // chach that puppy!\n this._sr = 0;\n this._cr = 1;\n\n\n this.filterArea = new Rectangle(0,0,1,1);\n\n /*\n * MOUSE Callbacks\n */\n\n /**\n * A callback that is used when the users clicks on the displayObject with their mouse\n * @method click\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user clicks the mouse down over the sprite\n * @method mousedown\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user releases the mouse that was over the displayObject\n * for this callback to be fired the mouse must have been pressed down over the displayObject\n * @method mouseup\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user releases the mouse that was over the displayObject but is no longer over the displayObject\n * for this callback to be fired, The touch must have started over the displayObject\n * @method mouseupoutside\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the users mouse rolls over the displayObject\n * @method mouseover\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the users mouse leaves the displayObject\n * @method mouseout\n * @param interactionData {InteractionData}\n */\n\n\n /*\n * TOUCH Callbacks\n */\n\n /**\n * A callback that is used when the users taps on the sprite with their finger\n * basically a touch version of click\n * @method tap\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user touch's over the displayObject\n * @method touchstart\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user releases a touch over the displayObject\n * @method touchend\n * @param interactionData {InteractionData}\n */\n\n /**\n * A callback that is used when the user releases the touch that was over the displayObject\n * for this callback to be fired, The touch must have started over the sprite\n * @method touchendoutside\n * @param interactionData {InteractionData}\n */\n}","function actualDisplay( name, doc ) {\r\n\tvar elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),\r\n\t\tdisplay = jQuery.css( elem[0], \"display\" );\r\n\telem.remove();\r\n\treturn display;\r\n}","contentDidUpdate() {\n const html = this.getPaneHtml();\n this.props.onPreviewUpdate(html);\n if (this.previewWindow) {\n this.previewWindow.document.write(html);\n }\n }","function displayCanvas() {\n\ttheCanvas.style.display = 'block';\n}","function TreeViewItem_Show()\n{\n\t//need to update?\n\tif (this.Update)\n\t{\n\t\t//call update\n\t\tthis.UpdateLine();\n\t}\n\t//have we got html?\n\tif (this.HTML)\n\t{\n\t\t//show it\n\t\tthis.HTML.style.display = \"block\";\n\t\t//correct top\n\t\tthis.HTML.style.top = this.Top + \"px\";\n\t}\n}","render() {\n this._userEvent('beforeRender');\n const html = this.template.render({data: this.viewData}, (data) => {\n return this.wrapTemplate(data);\n });\n if (!this.wrapper) {\n this.wrapper = this._createWrapper();\n }\n this.updateNode(this.wrapper, html);\n this.resize();\n this._userEvent('afterRender');\n }","get domContent() {\n return this._domContent;\n }","function RenderableDOMElement() {\n }","render() {\n super.render();\n this._outputView = new OutputArea({\n rendermime: renderMime,\n contentFactory: OutputArea.defaultContentFactory,\n model: this.model.outputs\n });\n this.pWidget.insertWidget(0, this._outputView);\n\n this.pWidget.addClass('jupyter-widgets');\n this.pWidget.addClass('widget-output');\n this.update(); // Set defaults.\n }","function displayHTML() {\n \tvar preview_div = document.getElementById(\"preview_div\");\n \tpreview_div.style.display = \"none\";\n \tvar htmlcode_div = document.getElementById(\"htmlcode_div\");\n \thtmlcode_div.style.display = \"block\";\n }","function updateDisplay(elem){\n \n activeContent = elem.innerHTML.replace(/<.+?>/g,\"\");\n if(activeContent == \"profiles\"){\n activeContent = \"SearchSpan\"\n toggle_visibility(\"SearchSpan\", \"SEARCHdiv\");\n } else if (activeContent == \"barplot\"){\n toggle_visibility(\"barplot\", \"VISUALIZEdiv\")\n } \n }","function css_defaultDisplay( nodeName ) {\n\tvar doc = document,\n\t\tdisplay = elemdisplay[ nodeName ];\n\n\tif ( !display ) {\n\t\tdisplay = actualDisplay( nodeName, doc );\n\n\t\t// If the simple way fails, read from inside an iframe\n\t\tif ( display === \"none\" || !display ) {\n\t\t\t// Use the already-created iframe if possible\n\t\t\tiframe = ( iframe ||\n\t\t\t\tDM(\"<iframe frameborder='0' width='0' height='0'/>\")\n\t\t\t\t.css( \"cssText\", \"display:block !important\" )\n\t\t\t).appendTo( doc.documentElement );\n\n\t\t\t// Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\n\t\t\tdoc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\n\t\t\tdoc.write(\"<!doctype html><html><body>\");\n\t\t\tdoc.close();\n\n\t\t\tdisplay = actualDisplay( nodeName, doc );\n\t\t\tiframe.detach();\n\t\t}\n\n\t\t// Store the correct default display\n\t\telemdisplay[ nodeName ] = display;\n\t}\n\n\treturn display;\n}","function render() {\n\tcontainer.innerHTML = htmlStr;\n}","function defaultDisplay(nodeName) {\n\n if (!elemdisplay[nodeName]) {\n\n var body = document.body,\n\t\t\telem = jQuery(\"<\" + nodeName + \">\").appendTo(body),\n\t\t\tdisplay = elem.css(\"display\");\n\n elem.remove();\n\n // If the simple way fails,\n // get element's real default display by attaching it to a temp iframe\n if (display === \"none\" || display === \"\") {\n // No iframe to use yet, so create it\n if (!iframe) {\n iframe = document.createElement(\"iframe\");\n iframe.frameBorder = iframe.width = iframe.height = 0;\n }\n\n body.appendChild(iframe);\n\n // Create a cacheable copy of the iframe document on first call.\n // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML\n // document to it; WebKit & Firefox won't allow reusing the iframe document.\n if (!iframeDoc || !iframe.createElement) {\n iframeDoc = (iframe.contentWindow || iframe.contentDocument).document;\n iframeDoc.write((document.compatMode === \"CSS1Compat\" ? \"<!doctype html>\" : \"\") + \"<html><body>\");\n iframeDoc.close();\n }\n\n elem = iframeDoc.createElement(nodeName);\n\n iframeDoc.body.appendChild(elem);\n\n display = jQuery.css(elem, \"display\");\n\n body.removeChild(iframe);\n }\n\n // Store the correct default display\n elemdisplay[nodeName] = display;\n }\n\n return elemdisplay[nodeName];\n }"],"string":"[\n \"function displayDOM(){\\r\\n\\t\\tvar str = '';\\r\\n\\t\\tcontainer.getChildren().each(function(item){\\r\\n\\t\\t\\tstr += '<div style=\\\"' + item.style.cssText + '\\\">' + item.get('text') + '</div>\\\\n';\\r\\n\\t\\t});\\r\\n\\t\\tdocument.id('output').set('text', str);\\r\\n\\t}\",\n \"displayScene() {\\n\\n //Process all component nodes\\n this.processNode(this.idRoot, null, null, 1, 1);\\n }\",\n \"display(ele) {\\n // make sure ele is a DOM element\\n if (this.isDOM(ele)) {\\n ele.style.display = 'block';\\n } else {\\n console.error('Error while trying to display a non DOM object');\\n }\\n }\",\n \"$render(displayRef) {\\n if(this.$alive)\\n this.render.apply(this, [this, displayRef]);\\n }\",\n \"displayScene() {\\n // entry point for graph rendering\\n //TODO: Render loop starting at root of graph\\n //console.log(this.nodes)\\n this.components[this.idRoot].display();\\n }\",\n \"display() {\\n this._flushSomeDiv(this._threadHost)\\n this._threadHost.appendChild(this._identifiedThread)\\n this._scrollBottom()\\n }\",\n \"createDOM() {\\n // outer element hosts the node itself, css background colors,\\n // border etc. will be applied here.\\n this.domElement = document.createElement('div');\\n this.domElement.node = this;\\n this.domElement.classList.add('node');\\n this.graph.domElement.appendChild(this.domElement);\\n\\n // content element has the title for the node and maybe some more UI\\n // it is centered in the node in css.\\n this.content = document.createElement('div');\\n this.content.classList.add('node_content');\\n this.domElement.appendChild(this.content);\\n this.addDragAndDrop();\\n }\",\n \"function Interpreter_CreateDisplayPanel()\\n{\\n\\t//create a div\\n\\tvar theDisplayPanel = document.body.appendChild(document.createElement(\\\"DIV\\\"));\\n\\t//set its values\\n\\ttheDisplayPanel.style.cssText = \\\"position:absolute;width:100%;height:100%;overflow:auto;left:0px;top:0px;-moz-transform-origin:0 0;\\\" + (__DESIGNER_CONTROLLER ? \\\"\\\" : \\\"-webkit-transform: translate3d(0, 0, 0);\\\");\\n\\t//make it unselectable\\n\\tBrowser_SetSelectable(theDisplayPanel, false);\\n\\t//finally add the size change listener\\n\\tBrowser_AddEvent(window, __BROWSER_EVENT_RESIZE, Interpreter_OnResizeEvent);\\n\\tBrowser_AddEvent(theDisplayPanel, __BROWSER_EVENT_SCROLL, Interpreter_OnDisplayScroll);\\n\\t//return it\\n\\treturn theDisplayPanel;\\n}\",\n \"_buildDisplayView() {\\n this.element.innerHTML = this.value;\\n }\",\n \"_buildDisplayView() {\\n this.element.innerHTML = this.value;\\n }\",\n \"function Interpreter_UpdateDisplay()\\n{\\n\\t//helpers\\n\\tvar uidObject, theObject;\\n\\t//loop through all of our iframes\\n\\tfor (uidObject in this.LoadedIFrames)\\n\\t{\\n\\t\\t//get the object\\n\\t\\ttheObject = this.LoadedIFrames[uidObject];\\n\\t\\t//valid?\\n\\t\\tif (theObject && theObject.HTML)\\n\\t\\t{\\n\\t\\t\\t//purge all css data\\n\\t\\t\\tBrowser_RemoveCSSData_Purge(theObject.HTML.contentDocument);\\n\\t\\t}\\n\\t}\\n\\t//purge all css data from main doc too\\n\\tBrowser_RemoveCSSData_Purge(document);\\n\\t//loop through all toplevel objects\\n\\tfor (uidObject in this.TopLevelObjects)\\n\\t{\\n\\t\\t//get the object\\n\\t\\ttheObject = this.TopLevelObjects[uidObject];\\n\\t\\t//valid?\\n\\t\\tif (theObject)\\n\\t\\t{\\n\\t\\t\\t//update it with full recursion\\n\\t\\t\\ttheObject.UpdateDisplay(true);\\n\\t\\t}\\n\\t}\\n\\t//rearrange the forms\\n\\tForm_RearrangeForms(this.FocusedFormId);\\n\\t//and reset this\\n\\tthis.FocusedFormId = [];\\n\\t//have we got a focused object id? (AND NOT IN DESIGNER)\\n\\tif (this.State && this.State.FocusedObjectId > 0)\\n\\t{\\n\\t\\t//memorise it\\n\\t\\tthis.FocusedObjectId = this.State.FocusedObjectId;\\n\\t}\\n\\t//we need to handle the tabs here\\n\\tthis.PreUpdatePostDisplay();\\n}\",\n \"display() {\\n this.editorNode.style.visibility = \\\"visible\\\";\\n this.focusInput();\\n }\",\n \"function DOMRenderer() {}\",\n \"render_display() {\\n this.element.fadeIn();\\n this.visible = true;\\n }\",\n \"function parseNodes()\\r\\n{\\r\\n\\tvar browser = gBrowser.mCurrentBrowser;\\t\\r\\n\\tdisplayNodes(browser.contentDocument);\\r\\n\\tcreateWindow();\\r\\n}\",\n \"display()\\n {\\n $(this.element).html(`\\n <link rel=\\\"stylesheet\\\" href=\\\"views/tab-view/tab-view.css\\\">\\n <link rel=\\\"stylesheet\\\" href=\\\"views/tab-content/tab-content.css\\\">\\n <link rel=\\\"stylesheet\\\" href=\\\"views/list-tasks/list-tasks.css\\\">\\n <link rel=\\\"stylesheet\\\" href=\\\"views/diagram-view/diagram-view.css\\\">\\n\\n <ul id=\\\"tabs\\\">\\n </ul>\\n <div id=\\\"tab-content\\\"></div>\\n `);\\n\\n this.ulTabs = document.getElementById('tabs');\\n this.divsContent = document.getElementById('tab-content');\\n\\n //adapt the height of the div to the full width\\n $(window).resize(function()\\n {\\n $('#tab-content').height($('#tab-content').parent().height() - $('#tabs').height());\\n });\\n\\n $(document).ready(function()\\n {\\n $(window).trigger('resize');\\n });\\n }\",\n \"renderIncDom() {\\n\\t\\tif (this.component_.render) {\\n\\t\\t\\tthis.component_.render();\\n\\t\\t} else {\\n\\t\\t\\tIncrementalDOM.elementVoid('div');\\n\\t\\t}\\n\\t}\",\n \"get display() {\\n return this._display.innerHTML;\\n }\",\n \"render() {\\n console.debug(`Rendering DOM of ${this.constructor.name}`);\\n this.shadowRoot.innerHTML = this.html;\\n if (this.script != null) {\\n console.debug(`Running script of ${this.constructor.name}`);\\n this.script();\\n console.debug(`Finished running script of ${this.constructor.name}`);\\n }\\n console.debug(`Finished rendering DOM of ${this.constructor.name}`);\\n }\",\n \"_render() {\\n\\n this._el.innerHTML = `\\n <div class='itk-slider'>\\n <button class='show-prev-btn'> left </button>\\n <img class='slide-img' src=''>\\n <button class='show-next-btn'> right </button>\\n </div>`;\\n\\n this.showPrevBtn = this._el.querySelector('.show-prev-btn');\\n this.showNextBtn = this._el.querySelector('.show-next-btn');\\n this.slideImage = this._el.querySelector('.slide-img');\\n }\",\n \"_render() {\\n this._reactComponent = this._getReactComponent();\\n if (!this._root) this._root = createRoot(this._container.getElement()[0]);\\n this._root.render(this._reactComponent);\\n }\",\n \"function displayContentUpdate() {\\n display.textContent = displayContent.join('');\\n}\",\n \"function update_display(){\\n // canvas\\n draw();\\n // DOM displaying results\\n display_questions_list();\\n}\",\n \"_registerDisplayListeners () {\\n this.display = caller('display', {postMessage: window.parent.postMessage.bind(window.parent)})\\n this.hide = caller('hide', {postMessage: window.parent.postMessage.bind(window.parent)})\\n }\",\n \"render(){\\n //createDom (tag, type, name, value, domClass, id, parent)\\n this.containerDom = this.htmlHelper.createDom('div', this.parentDom,this.domClass + '_conatiner')\\n this.dom = this.htmlHelper.createDom('canvas', this.containerDom);\\n this.dom.style.touchAction=\\\"none\\\"; // prevent default browser actions\\n\\n this.setContextData(this.defaultLineWidth, '#000000')\\n }\",\n \"function display(node){\\n if(node.visible){\\n if (hasBorder() == true)\\n p.stroke(getBorderColor());\\n else\\n p.noStroke();\\n\\n if(beingDragged != null && node == beingDragged){\\n p.fill(getActiveColor());\\n } else if(p.mouseX >= node.x-node.width/2 && p.mouseX <= node.x+node.width/2 \\n && p.mouseY >= node.y-node.height/2 && p.mouseY <= node.y+node.height/2){\\n if (currentClickedNode == node)\\n p.fill(getSelectedColor());\\n else\\n p.fill(getHoverColor());\\n\\n document.getElementById('show_label').innerHTML = node.label;\\n document.getElementById('show_url').innerHTML = node.url;\\n document.getElementById('show_url').href = node.url;\\n } else if (currentClickedNode == node){\\n p.fill(getSelectedColor()); \\n } else {\\n p.fill(getNodeColor());\\n } \\n p.rect(node.x, node.y, node.width, node.height);\\n\\n //Handle node expander graphic\\n if (node.children.length != 0) {\\n p.noStroke();\\n p.fill(getActiveColor());\\n p.rect(node.x+node.width/2, node.y, 3, 3);\\n } \\n\\n //Handle text \\n p.fill(getFontColor());\\n // calculate text size based on the current size of the node\\n p.textSize(getTextSize(node));\\n p.text(node.label, node.x - node.width/2 + 5, node.y + 5);\\n //p.text(node.label, node.x-35, node.y+5);\\n\\n //Used for drag/drop\\n var x_origin = node.x + node.width/2;\\n var y_origin = node.y;\\n\\n //Recurse on children and draw connecting lines\\n for(var i=0; i<node.children.length; i++){\\n if(node.children[i].visible && node.children[i].x - node.children[i].width/2 > 0 && node.children[i].y > 0){\\n display(node.children[i]);\\n p.stroke(getLineColor());\\n p.line(x_origin, y_origin, node.children[i].x - node.children[i].width/2, node.children[i].y);\\n }\\n }\\n }\\n}\",\n \"function Display_showGameElements() {\\n\\tvar displayContent = document.getElementById(\\\"displayContent\\\");\\n\\n\\tvar inputToCrib = document.createElementNS(this.xhtmlns, \\\"input\\\");\\n\\tinputToCrib.setAttribute(\\\"id\\\", \\\"inputToCrib\\\");\\n\\tinputToCrib.setAttribute(\\\"type\\\", \\\"button\\\");\\n\\tinputToCrib.setAttribute(\\\"value\\\", \\\"To Crib\\\");\\n\\tinputToCrib.setAttribute(\\\"onclick\\\", \\\"toCrib();\\\");\\n\\n\\tvar inputPlay = document.createElementNS(this.xhtmlns, \\\"input\\\");\\n\\tinputPlay.setAttribute(\\\"id\\\", \\\"inputPlay\\\");\\n\\tinputPlay.setAttribute(\\\"type\\\", \\\"button\\\");\\n\\tinputPlay.setAttribute(\\\"value\\\", \\\"Play card\\\");\\n\\n\\tdisplayContent.appendChild(inputToCrib);\\n\\tdisplayContent.appendChild(inputPlay);\\n\\n\\t// Show deck and stack\\n\\tthis.createCard(null, 490, 10, 120, false);\\n\\tthis.createCard(null, 620, 10, 120, false);\\n\\n\\t// Display count\\n\\tvar spanCountHeader = document.createElementNS(this.xhtmlns, \\\"span\\\");\\n\\tspanCountHeader.setAttribute(\\\"id\\\", \\\"spanCountHeader\\\");\\n\\tspanCountHeader.appendChild(document.createTextNode(\\\"Curent Play Count:\\\"));\\n\\n\\tvar spanCount = document.createElementNS(this.xhtmlns, \\\"span\\\");\\n\\tspanCount.setAttribute(\\\"id\\\", \\\"spanCount\\\");\\n\\tspanCount.appendChild(document.createTextNode(\\\"0\\\"));\\n\\n\\tvar whosCrib = document.createElementNS(this.xhtmlns, \\\"img\\\");\\n\\twhosCrib.setAttribute(\\\"id\\\", \\\"whosCrib\\\");\\n\\twhosCrib.setAttribute(\\\"src\\\", \\\"img/crib.png\\\");\\n\\n\\tdisplayContent.appendChild(whosCrib);\\n\\tdisplayContent.appendChild(spanCountHeader);\\n\\tdisplayContent.appendChild(spanCount);\\n}\",\n \"render(innerHTML = \\\"\\\")\\n {\\n this.DOMContainer.innerHTML = innerHTML;\\n if (this.handleDOMContainer) \\n {\\n this.DOMContainer.insertAdjacentElement(\\\"afterbegin\\\", this.handleDOMContainer);\\n } \\n }\",\n \"render() {\\n const { rootNode, sizeSet } = this;\\n let visualIndex = this.visualIndex;\\n\\n if (this.isSharedViewSet() && sizeSet.isPlaceOn(WORKING_SPACE_BOTTOM)) {\\n visualIndex += sizeSet.sharedSize.nextSize;\\n }\\n\\n let node = rootNode.childNodes[visualIndex];\\n\\n if (node.tagName !== this.childNodeType) {\\n const newNode = this.nodesPool();\\n\\n rootNode.replaceChild(newNode, node);\\n node = newNode;\\n }\\n\\n this.collectedNodes.push(node);\\n this.visualIndex += 1;\\n }\",\n \"display() {\\n\\t\\tsuper.display();\\n\\n\\t\\t/* Display the boxes on the right panel. */\\n\\t\\tthis.scoreBox.display();\\n\\t\\tthis.levelLinesBox.display();\\n\\t\\tthis.nextPieceBox.display();\\n\\t\\tthis.statBox.display();\\n\\n\\t\\t/* Display the falling piece. */\\n\\t\\tif (this.piece != undefined) {\\n\\t\\t\\tthis.piece.display(this.grid.initialx, this.grid.initialy, this.grid.squareSize);\\n\\t\\t}\\n\\n\\t\\t/* Display the grid. */\\n\\t\\tthis.grid.display();\\n\\n\\t\\tif (this.state == STATE_SELECT_LEVEL) {\\n\\t\\t\\tthis.blurBackground();\\n\\t\\t\\tthis.levelSelectorBox.display();\\n\\t\\t}\\n\\t\\telse if (this.state == STATE_WAIT_ADVERSARY_SELECTION) {\\n\\t\\t\\tthis.blurBackground();\\n\\t\\t\\tthis.waitAdversarySelectionBox.display();\\n\\t\\t}\\n\\t\\telse if (this.state == STATE_GAME_OVER) {\\n\\t\\t\\tthis.blurBackground();\\n\\t\\t\\tthis.gameOverSelectorBox.display();\\n\\t\\t}\\n\\t\\telse if (this.state == STATE_SUBMIT) {\\n\\t\\t\\tthis.blurBackground();\\n\\t\\t\\tthis.submitBox.display();\\n\\t\\t}\\n\\t}\",\n \"function renderDom() {\\n stackList.innerHTML = \\\"\\\";\\n myStack.stackControl.forEach(el => {\\n stackList.innerHTML += `<li>${el}</li>`;\\n })\\n }\",\n \"connectedCallback() {\\n this.renderAndUpdateDom();\\n }\",\n \"function show() {\\n const toShow = document.querySelector(\\\".show\\\");\\n const showBlock = document.querySelector(\\\".currentDisplay\\\");\\n showBlock.innerHTML = (toShow.innerHTML)\\n}\",\n \"function initializeDisplay() {\\n // set the data and properties of link lines\\n link = svg.append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"links\\\")\\n .selectAll(\\\"line\\\")\\n .data(graph.links)\\n .enter().append(\\\"line\\\");\\n\\n // set the data and properties of node circles\\n node = svg.append(\\\"g\\\")\\n .attr(\\\"class\\\", \\\"nodes\\\")\\n .selectAll(\\\"circle\\\")\\n .data(graph.nodes)\\n .enter()\\n .append(\\\"circle\\\")\\n .call(d3.drag()\\n .on(\\\"start\\\", dragstarted)\\n .on(\\\"drag\\\", dragged)\\n .on(\\\"end\\\", dragended));\\n\\n node.append(\\\"title\\\")\\n .text(function (d) {\\n return d.id;\\n });\\n\\n link.append(\\\"title\\\")\\n .text(function (d) {\\n return d.value;\\n });\\n \\n // visualize the graph\\n updateDisplay();\\n}\",\n \"function displayContent(div){\\n\\tscrollContentPadding()\\n\\tprebuildSlideMenu()\\n\\teditPagerLink()\\n\\tShadowbox.clearCache()//Re-initialize Shadowbox to include any newly loaded images\\n\\tShadowbox.setup()\\n\\n\\t\\tvar imgLoaded = 0\\n\\t\\tvar contentBox = $(activeContainer).find('.'+div)\\n\\t\\tvar imgCount = $('img',contentBox).size()\\t\\t\\n\\t\\t\\n\\t\\t\\n\\t\\t$('img',contentBox).each(function(index,element){\\n\\n\\t\\t\\tif(element.complete){\\n\\n\\t\\t\\t\\timgLoaded ++\\n\\n\\t\\t\\t} else {\\n\\n\\t\\t\\t\\t$(element).bind('load',function(){\\n\\t\\t\\t\\t\\timgLoaded ++\\t\\t\\t\\t\\t\\t\\t\\t\\t\\t\\n\\t\\t\\t\\t})\\t\\t\\t\\t\\n\\n\\t\\t\\t}\\n\\t\\n\\t\\t})\\t\\t\\n\\n\\t\\tvar scrollBuilder = setInterval(function(){\\t\\t\\t\\n\\t\\t\\tif(imgLoaded == imgCount){\\n\\t\\t\\t\\t\\n\\t\\t\\t\\t\\n\\t\\t\\t\\t\\t$(activePanel).mCustomScrollbar(\\\"vertical\\\",400,\\\"easeOutCirc\\\",1.05,\\\"fixed\\\",\\\"yes\\\",\\\"yes\\\",20)\\t\\n\\t\\t\\t\\t\\n\\t\\t\\t\\t//readOut(\\\"Building slidemenu\\\" + smId)\\n\\t\\t\\t\\t//readOut($(activeContainer).css('width'))\\t\\t\\n\\t\\t\\t\\tclearInterval(scrollBuilder)\\n\\t\\t\\t}\\n\\t\\t},250)\\n\\n\\n\\t\\t\\n\\t$(activeContainer).fadeTo(1000,1)\\t \\n}\",\n \"displayScene() {\\n if(this.nodeInfo)\\n this.displayNode(this.nodeInfo[this.idRoot],this.defaultMaterialID,\\\"null\\\",{s:1,t:1},false);\\n }\",\n \"function displayHTML()\\n{\\n document.getElementById( \\\"outputDiv\\\" ).innerHTML = outputHTML;\\n} // end function displayDoc\",\n \"displayScene()\\r\\n {\\r\\n this.traverseGraph(this.components[this.idRoot], this.components[this.idRoot].materials, this.components[this.idRoot].texture);\\r\\n }\",\n \"display () {\\r\\n this.timeout = null;\\r\\n if (this.pending) return;\\r\\n let content = this.input.textContent;\\r\\n if (content === this.oldContent) return;\\r\\n\\r\\n if (this.running) {\\r\\n this.pending = true;\\r\\n MathJax.Hub.Queue([\\\"display\\\", this]);\\r\\n } else {\\r\\n this.buffer.innerHTML = this.oldContent = (content.length > 0 ) ? '$' + content + '$' : '';\\r\\n this.running = true;\\r\\n MathJax.Hub.Queue([\\\"Typeset\\\", MathJax.Hub, this.buffer ], [\\\"finish\\\", this] );\\r\\n }\\r\\n }\",\n \"function css_defaultDisplay(nodeName) {\\n var doc = document,\\n display = elemdisplay[nodeName];\\n\\n if (!display) {\\n display = actualDisplay(nodeName, doc);\\n\\n // If the simple way fails, read from inside an iframe\\n if (display === \\\"none\\\" || !display) {\\n // Use the already-created iframe if possible\\n iframe = (iframe || jQuery(\\\"<iframe frameborder='0' width='0' height='0'/>\\\")\\n .css(\\\"cssText\\\", \\\"display:block !important\\\")).appendTo(doc.documentElement);\\n\\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\\n doc = (iframe[0].contentWindow || iframe[0].contentDocument).document;\\n doc.write(\\\"<!doctype html><html><body>\\\");\\n doc.close();\\n\\n display = actualDisplay(nodeName, doc);\\n iframe.detach();\\n }\\n\\n // Store the correct default display\\n elemdisplay[nodeName] = display;\\n }\\n\\n return display;\\n }\",\n \"function display() {\\n\\n doSanityCheck();\\n initButtons();\\n}\",\n \"function TrackingDisplay($display) {\\n\\t\\t//Store the canvas element for this display\\n\\t\\tthis.$display = $display;\\n\\n\\t\\t//Retrieve and store the 2d drawing context for this canvas\\n\\t\\tthis.drawContext = $display[0].getContext('2d');\\n\\n\\t\\t//Store the dimensions of the current display element.\\n\\t\\tthis.width = $display.width();\\n\\t\\tthis.height = $display.height();\\n\\n\\t\\t//Determine which axis is the constraining axis for this canvas so we can ensure our displays are squares.\\n\\t\\tif (this.width < this.height) {\\n\\t\\t\\tthis.height = this.width;\\n\\t\\t} else {\\n\\t\\t\\tthis.width = this.height;\\n\\t\\t}\\n\\n\\t\\t//Apply the new dimensions\\n\\t\\t$display.height(this.height).width(this.width).attr(\\\"width\\\", this.width).attr(\\\"height\\\", this.height);\\n\\n\\t\\t//Multidimensional array of values from the CELL_STATE variable representing the state of each cell.\\n\\t\\tthis.gridState = [];\\n\\n\\t\\t//Multidimensional array of any values. Used just to contain data related to each cell. At the moment, this only used\\n\\t\\t//to specify the type of ship in a \\\"SHIP\\\" cell.\\n\\t\\tthis.gridData = [];\\n\\n\\t\\t//Declare the hasInit flag, for controlling when the initialization logic fires\\n\\t\\tthis.hasInit = false;\\n\\t}\",\n \"function renderContent() {\\n var content = document.getElementById('content_' + selected);\\n // Initialize the pane.\\n if (content.id == 'content_blocks') {\\n // If the workspace was changed by the XML tab, Firefox will have performed\\n // an incomplete rendering due to Blockly being invisible. Rerender.\\n Blockly.mainWorkspace.render();\\n } else if (content.id == 'content_xml') {\\n var xmlTextarea = document.getElementById('textarea_xml');\\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\\n xmlTextarea.value = xmlText;\\n xmlTextarea.focus();\\n } else if (content.id == 'content_javascript') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('JavaScript');\\n } else if (content.id == 'content_python') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('Python');\\n }\\n}\",\n \"createDisplay() {\\n const { text, fontSize = 36, color = '#000000' } = this.conf;\\n this.display = new ProxyObj();\\n // this.setAnchor(0.5);\\n this.display.text = text;\\n this.display.updateStyle({ fontSize, fill: color });\\n }\",\n \"function clearDisplay() {\\n // Removing all children from an element\\n var element = document.getElementById(\\\"rightSideBar\\\");\\n document.getElementById(\\\"docDisplay\\\").innerHTML = \\\"\\\";\\n while (element.firstChild) {\\n element.removeChild(element.firstChild);\\n }\\n}\",\n \"display() {\\n this.scene.pushMatrix();\\n this.scene.multMatrix(this.transfMatrix); /*Add the new transformation matrix to this node \\n and all its descendants*/\\n\\n /*if this node is keyframe animated and the animation has not started yet, node cannot be displayed*/\\n if((this.animation != null && (this.animation.checkVisibility() == true)) || this.animation == null) {\\n if(this.animation != null) {\\n this.animation.apply(this.scene);\\n }\\n \\n if(this.material != \\\"null\\\") { //Adicionar o material se não for \\\"null\\\"\\n materialStack.push(this.material);\\n }\\n\\n if(this.scene.materials[materialStack[materialStack.length - 1]] != null)\\n this.scene.materials[materialStack[materialStack.length - 1]].apply();\\n\\n if(this.texture == \\\"clear\\\") {\\n if(this.scene.textures[textureStack[textureStack.length - 1]] != null) \\n this.scene.textures[textureStack[textureStack.length - 1]].unbind(); \\n textureStack.push(0);\\n } else if(this.texture == \\\"null\\\") {\\n if(this.scene.textures[textureStack[textureStack.length - 1]] != null) {\\n if(this.scene.textures[textureStack[textureStack.length - 1]] != 0)\\n this.scene.textures[textureStack[textureStack.length - 1]].bind();\\n }\\n } else {\\n if(this.scene.textures[this.texture] != 0 && this.scene.textures[this.texture] != null) {\\n textureStack.push(this.texture);\\n this.scene.textures[textureStack[textureStack.length - 1]].bind();\\n }\\n }\\n\\n //Display leaves if they exist\\n for(var i = 0; i < this.leaves.length; i++) {\\n if(this.leaves[i] != null)\\n this.leaves[i].display();\\n }\\n\\n //Recursively run this code for all the children nodes\\n for(var j = 0; j < this.descendants.length; j++) {\\n this.descendants[j].display();\\n }\\n\\n if(this.texture != \\\"null\\\"){\\n textureStack.pop();\\n }\\n\\n if(this.material != \\\"null\\\")\\n materialStack.pop();\\n }\\n\\n this.scene.popMatrix();\\n\\n }\",\n \"async connectedCallback() {\\n const ctor = this.constructor;\\n this.setAttribute(`_ui5rt${(0, _Runtimes.getCurrentRuntimeIndex)()}`, \\\"\\\");\\n this.setAttribute(\\\"_ui5host\\\", \\\"\\\");\\n this.setAttribute(ctor.getMetadata().getPureTag(), \\\"\\\");\\n if (ctor.getMetadata().supportsF6FastNavigation()) {\\n this.setAttribute(\\\"data-sap-ui-fastnavgroup\\\", \\\"true\\\");\\n }\\n const slotsAreManaged = ctor.getMetadata().slotsAreManaged();\\n this._inDOM = true;\\n if (slotsAreManaged) {\\n // always register the observer before yielding control to the main thread (await)\\n this._startObservingDOMChildren();\\n await this._processChildren();\\n }\\n if (!this._inDOM) {\\n // Component removed from DOM while _processChildren was running\\n return;\\n }\\n (0, _Render.renderImmediately)(this);\\n this._domRefReadyPromise._deferredResolve();\\n this._fullyConnected = true;\\n this.onEnterDOM();\\n }\",\n \"display() {\\n this.object.display();\\n }\",\n \"show ()\\n\\t{\\n\\t\\t//if the view hasn't been initialised, call setup (of the concrete view e.g. LOView)\\n\\t\\tif(!this.initialised)\\n\\t\\t{\\n\\t\\t\\tthis.setup();\\n\\t\\t}\\n\\t\\telse\\n\\t\\t{\\n\\t\\t\\t//unhide the elements of the scene\\n\\t\\t\\tthis.root.style.display = 'block';\\n\\t\\t}\\n\\t}\",\n \"render() {\\n\\t\\tif (!this.component_.element) {\\n\\t\\t\\tthis.component_.element = document.createElement('div');\\n\\t\\t}\\n\\t\\tthis.emit('rendered', !this.isRendered_);\\n\\t}\",\n \"function __zoot_c3d__process_DOM() {\\n let containers = document.body.getElementsByTagName('zoot-c3d-root-container');\\n for (let i = 0; i < containers.length; i++) {\\n __zoot_c3d__process_Component(undefined, containers[i]);\\n __zoot_c3d__g_root_containers.push(containers[i]);\\n containers[i].zoot_c3d_sync();\\n }\\n}\",\n \"display() {\\n this.scene.pushMatrix();\\n this.scene.multMatrix(this.transformationMatrix);\\n if ((typeof this.cgfTexture != 'undefined') && this.cgfMaterial != null)\\n this.cgfMaterial.setTexture(this.cgfTexture);\\n if (this.cgfMaterial != null)\\n this.cgfMaterial.apply();\\n\\n if (typeof this.animations[this.atualAnimationId] != 'undefined')\\n this.animations[this.atualAnimationId].display();\\n\\n for (let children of this.childrens) {\\n if (children.cgfTextureId == \\\"inherit\\\") {\\n children.cgfTexture = this.cgfTexture;\\n children.length_sTexture = this.length_sTexture;\\n children.length_tTexture = this.length_tTexture;\\n }\\n if (children.cgfMaterialId == \\\"inherit\\\") {\\n children.cgfMaterial = this.cgfMaterial;\\n }\\n if (!(children instanceof Component)) {\\n if (!(isNaN(this.length_sTexture) || isNaN(this.length_tTexture)))\\n children.updateTexCoords(this.length_sTexture, this.length_tTexture);\\n }\\n children.display();\\n }\\n\\n this.scene.popMatrix();\\n }\",\n \"show() {\\n for (let node of this.nodes) {\\n node.show();\\n node.showLinks();\\n }\\n }\",\n \"_renderScreen() {\\n\\t\\tif (this._el && this._component) {\\n\\t\\t\\tthis._component.render(this._el);\\n\\t\\t}\\n\\t}\",\n \"connectedCallback() {\\n this.innerHTML = this.render();\\n\\n }\",\n \"function renderContent() {\\n var content = document.getElementById('content_' + selected);\\n // Initialize the pane.\\n if (content.id == 'content_blocks') {\\n // If the workspace was changed by the XML tab, Firefox will have performed\\n // an incomplete rendering due to Blockly being invisible. Rerender.\\n Blockly.mainWorkspace.render();\\n } else if (content.id == 'content_xml') {\\n var xmlTextarea = document.getElementById('textarea_xml');\\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\\n xmlTextarea.value = xmlText;\\n xmlTextarea.focus();\\n } else if (content.id == 'content_javascript') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('JavaScript');\\n } else if (content.id == 'content_python') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('Python');\\n } else if (content.id == 'content_whalesong') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('Whalesong');\\n } else if (content.id == 'content_ray') {\\n content.innerHTML = Blockly.Generator.workspaceToCode('Ray');\\n }\\n}\",\n \"displayScene() {\\n var root = this.components[this.root];\\n if (root == null)\\n return \\\"[displayScene]: root node does not exist!\\\";\\n\\n // display scene graph starting at the root component\\n root.display(root.materials[root.currentMaterialIndex][1], root.texture);\\n }\",\n \"render() {\\n this._addChooserHandler();\\n this._addLoggerListeners();\\n this._addButtonHandler();\\n }\",\n \"onEnterDOM() {}\",\n \"function showElement () {\\n if(this instanceof HTMLCollection || this instanceof NodeList) {\\n for(var i = 0; i < this.length; i++) {\\n this[i].style.display = null;\\n }\\n }\\n else if(this instanceof HTMLElement) {\\n this.style.display = null;\\n }\\n\\n return this;\\n }\",\n \"function displayContents() {\\n\\tif (contentsRequest.readyState === XMLHttpRequest.DONE) {\\n\\t\\tif (contentsRequest.status === 200) {\\n\\t\\t\\tdocument.getElementById('tree').textContent = properties.showtree();\\n\\t\\t\\tdocument.getElementById('display').innerHTML = formatDirContents(contentsRequest.responseText);\\n\\t\\t} else {\\n\\t\\t\\talert('There was a problem with the request.');\\n\\t\\t}\\n\\t}\\n}\",\n \"function updateDisplay () {\\n const display = document.querySelector('.calculatorDisplay');\\n // update value of screen element with content of `displayValue`\\n display.value = calcDisplay.displayValue;\\n}\",\n \"render() {\\n this.fetch(() => {\\n /**\\n * Notice that the order here doesn't matter, if we want it to work like React,\\n * we have to set up a virtual DOM and then have another object which it's purpose\\n * will be to get the virtual DOM and then put that into the DOM (ReactDOM job is actually just that).\\n * Virtual DOM is just any representation of the DOM elements, for that we can use JSX to\\n * make our job easier and actually doing that is way easier than what you might think!\\n */\\n new Articles(this.articles).render();\\n });\\n }\",\n \"function actualDisplay( name, doc ) {\\n\\tvar elem = DM( doc.createElement( name ) ).appendTo( doc.body ),\\n\\t\\tdisplay = DM.css( elem[0], \\\"display\\\" );\\n\\telem.remove();\\n\\treturn display;\\n}\",\n \"show() {\\n this.el.appendChild(this.canvas);\\n this.update();\\n }\",\n \"attachToDOM_() {\\n document.body.appendChild(this);\\n }\",\n \"function changeTheDOM()\\n{\\n\\tconsole.log('DOM change call');\\n\\tdocument.getElementById('passage').setAttribute('style','display: block');\\n\\tdocument.getElementById('playagain').setAttribute('style','display: block');\\n\\tdocument.getElementById('madlibs-entry').setAttribute('style','display: none');\\n\\n\\tdocument.getElementById('classics').innerHTML = selectedPassageTitle;\\n}\",\n \"function defaultDisplay(nodeName){if(!elemdisplay[nodeName]){var body=document.body,elem=jQuery(\\\"<\\\"+nodeName+\\\">\\\").appendTo(body),display=elem.css(\\\"display\\\");elem.remove(); // If the simple way fails,\\n\\t// get element's real default display by attaching it to a temp iframe\\n\\tif(display===\\\"none\\\"||display===\\\"\\\"){ // No iframe to use yet, so create it\\n\\tif(!iframe){iframe=document.createElement(\\\"iframe\\\");iframe.frameBorder=iframe.width=iframe.height=0;}body.appendChild(iframe); // Create a cacheable copy of the iframe document on first call.\\n\\t// IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML\\n\\t// document to it; WebKit & Firefox won't allow reusing the iframe document.\\n\\tif(!iframeDoc||!iframe.createElement){iframeDoc=(iframe.contentWindow||iframe.contentDocument).document;iframeDoc.write((jQuery.support.boxModel?\\\"<!doctype html>\\\":\\\"\\\")+\\\"<html><body>\\\");iframeDoc.close();}elem=iframeDoc.createElement(nodeName);iframeDoc.body.appendChild(elem);display=jQuery.css(elem,\\\"display\\\");body.removeChild(iframe);} // Store the correct default display\\n\\telemdisplay[nodeName]=display;}return elemdisplay[nodeName];}\",\n \"function renderContent() {\\n var content = document.getElementById('content_' + selected);\\n // Initialize the pane.\\n if (content.id == 'content_blocks') {\\n // If the workspace was changed by the XML tab, Firefox will have performed\\n // an incomplete rendering due to Blockly being invisible. Rerender.\\n Blockly.mainWorkspace.render();\\n //Check if the arduino code peek is showing\\n if(document.getElementById('arduino_code_peek').style.display != 'none' ) {\\n renderArduinoCode(null);\\n }\\n } else if (content.id == 'content_xml') {\\n // Initialize the pane.\\n var xmlTextarea = document.getElementById('textarea_xml');\\n var xmlDom = Blockly.Xml.workspaceToDom(Blockly.mainWorkspace);\\n var xmlText = Blockly.Xml.domToPrettyText(xmlDom);\\n xmlTextarea.value = xmlText;\\n xmlTextarea.focus();\\n } else if (content.id == 'content_arduino') {\\n var code = Blockly.Generator.workspaceToCode('Arduino');\\n var arduinoTextarea = document.getElementById('textarea_arduino');\\n arduinoTextarea.value = code\\n arduinoTextarea.focus();\\n }\\n}\",\n \"setDisplayNodeParent(element) {\\n this.display_node.remove();\\n element.appendChild(this.display_node);\\n }\",\n \"function _display(){\\n\\t\\t\\t$(levelID).html(level);\\n\\t\\t\\t$(pointsID).html(points);\\n\\t\\t\\t$(linesID).html(lines);\\n\\t\\t}\",\n \"get display () {\\n\\t\\treturn this._display;\\n\\t}\",\n \"get display () {\\n\\t\\treturn this._display;\\n\\t}\",\n \"get display () {\\n\\t\\treturn this._display;\\n\\t}\",\n \"render() {\\n this.innerHTML = this.htmlElementsString;\\n this.rootElement.appendChild(this);\\n this.createScript();\\n }\",\n \"function updateDisplay(){\\n const display = document.querySelector('.calculator-screen');\\n // update the value of screen from displayValue in calculator object\\n display.value = calculator.displayValue;\\n}\",\n \"function css_defaultDisplay( nodeName ) {\\n var doc = document,\\n display = elemdisplay[ nodeName ];\\n\\n if ( !display ) {\\n display = actualDisplay( nodeName, doc );\\n\\n // If the simple way fails, read from inside an iframe\\n if ( display === \\\"none\\\" || !display ) {\\n // Use the already-created iframe if possible\\n iframe = ( iframe ||\\n jQuery(\\\"<iframe frameborder='0' width='0' height='0'/>\\\")\\n .css( \\\"cssText\\\", \\\"display:block !important\\\" )\\n ).appendTo( doc.documentElement );\\n\\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\\n doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\\n doc.write(\\\"<!doctype html><html><body>\\\");\\n doc.close();\\n\\n display = actualDisplay( nodeName, doc );\\n iframe.detach();\\n }\\n\\n // Store the correct default display\\n elemdisplay[ nodeName ] = display;\\n }\\n\\n return display;\\n}\",\n \"function css_defaultDisplay( nodeName ) {\\n var doc = document,\\n display = elemdisplay[ nodeName ];\\n\\n if ( !display ) {\\n display = actualDisplay( nodeName, doc );\\n\\n // If the simple way fails, read from inside an iframe\\n if ( display === \\\"none\\\" || !display ) {\\n // Use the already-created iframe if possible\\n iframe = ( iframe ||\\n jQuery(\\\"<iframe frameborder='0' width='0' height='0'/>\\\")\\n .css( \\\"cssText\\\", \\\"display:block !important\\\" )\\n ).appendTo( doc.documentElement );\\n\\n // Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\\n doc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\\n doc.write(\\\"<!doctype html><html><body>\\\");\\n doc.close();\\n\\n display = actualDisplay( nodeName, doc );\\n iframe.detach();\\n }\\n\\n // Store the correct default display\\n elemdisplay[ nodeName ] = display;\\n }\\n\\n return display;\\n}\",\n \"createDisplay() {\\n const { text, fontSize = 36 } = this.conf;\\n this.display = Pool.get(this.type, () => new Label());\\n this.display.attr({ text, fontSize });\\n }\",\n \"_onUpdateDisplay() {}\",\n \"function render()\\n {\\n if (me.triggerEvent('renderBefore', data) === false)\\n return;\\n\\n // remove all child nodes\\n container.html('');\\n\\n // render child nodes\\n for (var i=0; i < data.length; i++) {\\n data[i].level = 0;\\n render_node(data[i], container);\\n }\\n\\n me.triggerEvent('renderAfter', container);\\n }\",\n \"_render(html){this.$.container.innerHTML=html}\",\n \"_initDisplay(value) {}\",\n \"render() {\\n this.notify('initial-load', {});\\n /**\\n * Used to load context menu\\n */\\n this.trigger('load');\\n this.notify('initial-end', {});\\n this.renderElements();\\n this.renderComplete();\\n }\",\n \"render() {\\n this.notify('initial-load', {});\\n /**\\n * Used to load context menu\\n */\\n this.trigger('load');\\n this.notify('initial-end', {});\\n this.renderElements();\\n this.renderComplete();\\n }\",\n \"render() {\\n this.notify('initial-load', {});\\n /**\\n * Used to load context menu\\n */\\n this.trigger('load');\\n this.notify('initial-end', {});\\n this.renderElements();\\n this.renderComplete();\\n }\",\n \"function displayContent(tag) {\\n\\t\\n\\tvar pagedisplay = document.getElementsByClassName(\\\"pagedisplay\\\")[0];\\n\\t\\n\\tswitch(tag) {\\n\\t\\tcase \\\"projects\\\":\\n\\t\\t\\tvar projects = getProjects();\\n\\t\\t\\temptyDiv(\\\"pagedisplay\\\");\\n\\t\\t\\tpagedisplay.appendChild(projects);\\n\\t\\t\\tbreak;\\n\\t\\tcase \\\"aboutus\\\":\\n\\t\\t\\tvar aboutus = getAboutUs();\\n\\t\\t\\temptyDiv(\\\"pagedisplay\\\");\\n\\t\\t\\tpagedisplay.appendChild(aboutus);\\n\\t\\t\\tbreak;\\n\\t\\tcase \\\"becomemember\\\":\\n\\t\\t\\tvar becomemember = getBecomeMember();\\n\\t\\t\\temptyDiv(\\\"pagedisplay\\\");\\n\\t\\t\\tpagedisplay.appendChild(becomemember);\\n\\t\\t\\tbreak;\\n\\t\\tcase \\\"members\\\":\\n\\t\\t\\tvar membersarea = getMembers();\\n\\t\\t\\temptyDiv(\\\"pagedisplay\\\");\\n\\t\\t\\tpagedisplay.appendChild(membersarea);\\n\\t\\t\\tbreak;\\n\\t\\tdefault:\\n\\t\\t\\tbreak;\\n\\t}\\n}\",\n \"function DisplayObject()\\n{\\n this.last = this;\\n this.first = this;\\n /**\\n * The coordinate of the object relative to the local coordinates of the parent.\\n *\\n * @property position\\n * @type Point\\n */\\n this.position = new Point();\\n\\n /**\\n * The scale factor of the object.\\n *\\n * @property scale\\n * @type Point\\n */\\n this.scale = new Point(1,1);//{x:1, y:1};\\n\\n /**\\n * The pivot point of the displayObject that it rotates around\\n *\\n * @property pivot\\n * @type Point\\n */\\n this.pivot = new Point(0,0);\\n\\n /**\\n * The rotation of the object in radians.\\n *\\n * @property rotation\\n * @type Number\\n */\\n this.rotation = 0;\\n\\n /**\\n * The opacity of the object.\\n *\\n * @property alpha\\n * @type Number\\n */\\n this.alpha = 1;\\n\\n /**\\n * The visibility of the object.\\n *\\n * @property visible\\n * @type Boolean\\n */\\n this.visible = true;\\n\\n /**\\n * This is the defined area that will pick up mouse / touch events. It is null by default.\\n * Setting it is a neat way of optimising the hitTest function that the interactionManager will use (as it will not need to hit test all the children)\\n *\\n * @property hitArea\\n * @type Rectangle|Circle|Ellipse|Polygon\\n */\\n this.hitArea = null;\\n\\n /**\\n * This is used to indicate if the displayObject should display a mouse hand cursor on rollover\\n *\\n * @property buttonMode\\n * @type Boolean\\n */\\n this.buttonMode = false;\\n\\n /**\\n * Can this object be rendered\\n *\\n * @property renderable\\n * @type Boolean\\n */\\n this.renderable = false;\\n\\n /**\\n * [read-only] The display object container that contains this display object.\\n *\\n * @property parent\\n * @type DisplayObjectContainer\\n * @readOnly\\n */\\n this.parent = null;\\n\\n /**\\n * [read-only] The stage the display object is connected to, or undefined if it is not connected to the stage.\\n *\\n * @property stage\\n * @type Stage\\n * @readOnly\\n */\\n this.stage = null;\\n\\n /**\\n * [read-only] The multiplied alpha of the displayobject\\n *\\n * @property worldAlpha\\n * @type Number\\n * @readOnly\\n */\\n this.worldAlpha = 1;\\n\\n /**\\n * [read-only] Whether or not the object is interactive, do not toggle directly! use the `interactive` property\\n *\\n * @property _interactive\\n * @type Boolean\\n * @readOnly\\n * @private\\n */\\n this._interactive = false;\\n\\n this.defaultCursor = 'pointer';\\n\\n /**\\n * [read-only] Current transform of the object based on world (parent) factors\\n *\\n * @property worldTransform\\n * @type Mat3\\n * @readOnly\\n * @private\\n */\\n this.worldTransform = mat3.create();//mat3.identity();\\n\\n /**\\n * [read-only] Current transform of the object locally\\n *\\n * @property localTransform\\n * @type Mat3\\n * @readOnly\\n * @private\\n */\\n this.localTransform = mat3.create();//mat3.identity();\\n\\n /**\\n * [NYI] Unkown\\n *\\n * @property color\\n * @type Array<>\\n * @private\\n */\\n this.color = [];\\n\\n /**\\n * [NYI] Holds whether or not this object is dynamic, for rendering optimization\\n *\\n * @property dynamic\\n * @type Boolean\\n * @private\\n */\\n this.dynamic = true;\\n\\n // chach that puppy!\\n this._sr = 0;\\n this._cr = 1;\\n\\n\\n this.filterArea = new Rectangle(0,0,1,1);\\n\\n /*\\n * MOUSE Callbacks\\n */\\n\\n /**\\n * A callback that is used when the users clicks on the displayObject with their mouse\\n * @method click\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user clicks the mouse down over the sprite\\n * @method mousedown\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user releases the mouse that was over the displayObject\\n * for this callback to be fired the mouse must have been pressed down over the displayObject\\n * @method mouseup\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user releases the mouse that was over the displayObject but is no longer over the displayObject\\n * for this callback to be fired, The touch must have started over the displayObject\\n * @method mouseupoutside\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the users mouse rolls over the displayObject\\n * @method mouseover\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the users mouse leaves the displayObject\\n * @method mouseout\\n * @param interactionData {InteractionData}\\n */\\n\\n\\n /*\\n * TOUCH Callbacks\\n */\\n\\n /**\\n * A callback that is used when the users taps on the sprite with their finger\\n * basically a touch version of click\\n * @method tap\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user touch's over the displayObject\\n * @method touchstart\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user releases a touch over the displayObject\\n * @method touchend\\n * @param interactionData {InteractionData}\\n */\\n\\n /**\\n * A callback that is used when the user releases the touch that was over the displayObject\\n * for this callback to be fired, The touch must have started over the sprite\\n * @method touchendoutside\\n * @param interactionData {InteractionData}\\n */\\n}\",\n \"function actualDisplay( name, doc ) {\\r\\n\\tvar elem = jQuery( doc.createElement( name ) ).appendTo( doc.body ),\\r\\n\\t\\tdisplay = jQuery.css( elem[0], \\\"display\\\" );\\r\\n\\telem.remove();\\r\\n\\treturn display;\\r\\n}\",\n \"contentDidUpdate() {\\n const html = this.getPaneHtml();\\n this.props.onPreviewUpdate(html);\\n if (this.previewWindow) {\\n this.previewWindow.document.write(html);\\n }\\n }\",\n \"function displayCanvas() {\\n\\ttheCanvas.style.display = 'block';\\n}\",\n \"function TreeViewItem_Show()\\n{\\n\\t//need to update?\\n\\tif (this.Update)\\n\\t{\\n\\t\\t//call update\\n\\t\\tthis.UpdateLine();\\n\\t}\\n\\t//have we got html?\\n\\tif (this.HTML)\\n\\t{\\n\\t\\t//show it\\n\\t\\tthis.HTML.style.display = \\\"block\\\";\\n\\t\\t//correct top\\n\\t\\tthis.HTML.style.top = this.Top + \\\"px\\\";\\n\\t}\\n}\",\n \"render() {\\n this._userEvent('beforeRender');\\n const html = this.template.render({data: this.viewData}, (data) => {\\n return this.wrapTemplate(data);\\n });\\n if (!this.wrapper) {\\n this.wrapper = this._createWrapper();\\n }\\n this.updateNode(this.wrapper, html);\\n this.resize();\\n this._userEvent('afterRender');\\n }\",\n \"get domContent() {\\n return this._domContent;\\n }\",\n \"function RenderableDOMElement() {\\n }\",\n \"render() {\\n super.render();\\n this._outputView = new OutputArea({\\n rendermime: renderMime,\\n contentFactory: OutputArea.defaultContentFactory,\\n model: this.model.outputs\\n });\\n this.pWidget.insertWidget(0, this._outputView);\\n\\n this.pWidget.addClass('jupyter-widgets');\\n this.pWidget.addClass('widget-output');\\n this.update(); // Set defaults.\\n }\",\n \"function displayHTML() {\\n \\tvar preview_div = document.getElementById(\\\"preview_div\\\");\\n \\tpreview_div.style.display = \\\"none\\\";\\n \\tvar htmlcode_div = document.getElementById(\\\"htmlcode_div\\\");\\n \\thtmlcode_div.style.display = \\\"block\\\";\\n }\",\n \"function updateDisplay(elem){\\n \\n activeContent = elem.innerHTML.replace(/<.+?>/g,\\\"\\\");\\n if(activeContent == \\\"profiles\\\"){\\n activeContent = \\\"SearchSpan\\\"\\n toggle_visibility(\\\"SearchSpan\\\", \\\"SEARCHdiv\\\");\\n } else if (activeContent == \\\"barplot\\\"){\\n toggle_visibility(\\\"barplot\\\", \\\"VISUALIZEdiv\\\")\\n } \\n }\",\n \"function css_defaultDisplay( nodeName ) {\\n\\tvar doc = document,\\n\\t\\tdisplay = elemdisplay[ nodeName ];\\n\\n\\tif ( !display ) {\\n\\t\\tdisplay = actualDisplay( nodeName, doc );\\n\\n\\t\\t// If the simple way fails, read from inside an iframe\\n\\t\\tif ( display === \\\"none\\\" || !display ) {\\n\\t\\t\\t// Use the already-created iframe if possible\\n\\t\\t\\tiframe = ( iframe ||\\n\\t\\t\\t\\tDM(\\\"<iframe frameborder='0' width='0' height='0'/>\\\")\\n\\t\\t\\t\\t.css( \\\"cssText\\\", \\\"display:block !important\\\" )\\n\\t\\t\\t).appendTo( doc.documentElement );\\n\\n\\t\\t\\t// Always write a new HTML skeleton so Webkit and Firefox don't choke on reuse\\n\\t\\t\\tdoc = ( iframe[0].contentWindow || iframe[0].contentDocument ).document;\\n\\t\\t\\tdoc.write(\\\"<!doctype html><html><body>\\\");\\n\\t\\t\\tdoc.close();\\n\\n\\t\\t\\tdisplay = actualDisplay( nodeName, doc );\\n\\t\\t\\tiframe.detach();\\n\\t\\t}\\n\\n\\t\\t// Store the correct default display\\n\\t\\telemdisplay[ nodeName ] = display;\\n\\t}\\n\\n\\treturn display;\\n}\",\n \"function render() {\\n\\tcontainer.innerHTML = htmlStr;\\n}\",\n \"function defaultDisplay(nodeName) {\\n\\n if (!elemdisplay[nodeName]) {\\n\\n var body = document.body,\\n\\t\\t\\telem = jQuery(\\\"<\\\" + nodeName + \\\">\\\").appendTo(body),\\n\\t\\t\\tdisplay = elem.css(\\\"display\\\");\\n\\n elem.remove();\\n\\n // If the simple way fails,\\n // get element's real default display by attaching it to a temp iframe\\n if (display === \\\"none\\\" || display === \\\"\\\") {\\n // No iframe to use yet, so create it\\n if (!iframe) {\\n iframe = document.createElement(\\\"iframe\\\");\\n iframe.frameBorder = iframe.width = iframe.height = 0;\\n }\\n\\n body.appendChild(iframe);\\n\\n // Create a cacheable copy of the iframe document on first call.\\n // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML\\n // document to it; WebKit & Firefox won't allow reusing the iframe document.\\n if (!iframeDoc || !iframe.createElement) {\\n iframeDoc = (iframe.contentWindow || iframe.contentDocument).document;\\n iframeDoc.write((document.compatMode === \\\"CSS1Compat\\\" ? \\\"<!doctype html>\\\" : \\\"\\\") + \\\"<html><body>\\\");\\n iframeDoc.close();\\n }\\n\\n elem = iframeDoc.createElement(nodeName);\\n\\n iframeDoc.body.appendChild(elem);\\n\\n display = jQuery.css(elem, \\\"display\\\");\\n\\n body.removeChild(iframe);\\n }\\n\\n // Store the correct default display\\n elemdisplay[nodeName] = display;\\n }\\n\\n return elemdisplay[nodeName];\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7111654","0.6606583","0.6553395","0.62436736","0.62331814","0.62235034","0.61459774","0.6129759","0.611871","0.611871","0.610078","0.60716736","0.60686475","0.6026015","0.60221195","0.60136545","0.60071284","0.5978854","0.58669174","0.5864605","0.57973814","0.5770063","0.5746952","0.5745933","0.57237124","0.5713498","0.56977147","0.5693898","0.5677795","0.5668535","0.56663907","0.56626284","0.56613165","0.56555516","0.5640174","0.5637062","0.56370175","0.5632914","0.5621141","0.5620917","0.5604121","0.5600483","0.55879474","0.5576259","0.55649716","0.5537791","0.5536425","0.552756","0.5513903","0.55136186","0.54989004","0.54918116","0.5481863","0.5465949","0.5456527","0.54538447","0.54481786","0.5441136","0.5432829","0.54306066","0.5426365","0.54214543","0.5419759","0.54178363","0.54020834","0.54013306","0.5400585","0.53943694","0.53919715","0.5388352","0.53873956","0.5380519","0.5380519","0.5380519","0.53771466","0.5375754","0.53705096","0.53705096","0.5364279","0.5363214","0.5362086","0.53599274","0.53587157","0.5351135","0.5351135","0.5351135","0.53447384","0.5329329","0.53252614","0.532175","0.53208554","0.53145766","0.5310847","0.5303435","0.5302407","0.53009796","0.5300424","0.529724","0.5296434","0.5295548","0.52946645"],"string":"[\n \"0.7111654\",\n \"0.6606583\",\n \"0.6553395\",\n \"0.62436736\",\n \"0.62331814\",\n \"0.62235034\",\n \"0.61459774\",\n \"0.6129759\",\n \"0.611871\",\n \"0.611871\",\n \"0.610078\",\n \"0.60716736\",\n \"0.60686475\",\n \"0.6026015\",\n \"0.60221195\",\n \"0.60136545\",\n \"0.60071284\",\n \"0.5978854\",\n \"0.58669174\",\n \"0.5864605\",\n \"0.57973814\",\n \"0.5770063\",\n \"0.5746952\",\n \"0.5745933\",\n \"0.57237124\",\n \"0.5713498\",\n \"0.56977147\",\n \"0.5693898\",\n \"0.5677795\",\n \"0.5668535\",\n \"0.56663907\",\n \"0.56626284\",\n \"0.56613165\",\n \"0.56555516\",\n \"0.5640174\",\n \"0.5637062\",\n \"0.56370175\",\n \"0.5632914\",\n \"0.5621141\",\n \"0.5620917\",\n \"0.5604121\",\n \"0.5600483\",\n \"0.55879474\",\n \"0.5576259\",\n \"0.55649716\",\n \"0.5537791\",\n \"0.5536425\",\n \"0.552756\",\n \"0.5513903\",\n \"0.55136186\",\n \"0.54989004\",\n \"0.54918116\",\n \"0.5481863\",\n \"0.5465949\",\n \"0.5456527\",\n \"0.54538447\",\n \"0.54481786\",\n \"0.5441136\",\n \"0.5432829\",\n \"0.54306066\",\n \"0.5426365\",\n \"0.54214543\",\n \"0.5419759\",\n \"0.54178363\",\n \"0.54020834\",\n \"0.54013306\",\n \"0.5400585\",\n \"0.53943694\",\n \"0.53919715\",\n \"0.5388352\",\n \"0.53873956\",\n \"0.5380519\",\n \"0.5380519\",\n \"0.5380519\",\n \"0.53771466\",\n \"0.5375754\",\n \"0.53705096\",\n \"0.53705096\",\n \"0.5364279\",\n \"0.5363214\",\n \"0.5362086\",\n \"0.53599274\",\n \"0.53587157\",\n \"0.5351135\",\n \"0.5351135\",\n \"0.5351135\",\n \"0.53447384\",\n \"0.5329329\",\n \"0.53252614\",\n \"0.532175\",\n \"0.53208554\",\n \"0.53145766\",\n \"0.5310847\",\n \"0.5303435\",\n \"0.5302407\",\n \"0.53009796\",\n \"0.5300424\",\n \"0.529724\",\n \"0.5296434\",\n \"0.5295548\",\n \"0.52946645\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4190,"cells":{"query":{"kind":"string","value":"Find the line object corresponding to the given line number."},"document":{"kind":"string","value":"function getLine(doc, n) {\n n -= doc.first;\n if (n < 0 || n >= doc.size) { throw new Error(\"There is no line \" + (n + doc.first) + \" in the document.\") }\n var chunk = doc;\n while (!chunk.lines) {\n for (var i = 0;; ++i) {\n var child = chunk.children[i], sz = child.chunkSize();\n if (n < sz) { chunk = child; break }\n n -= sz;\n }\n }\n return chunk.lines[n]\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function code_line(code, line) {\n return code.findIndex(l => l.line === line)\n}","function getSourceLine(lineNo) {\n\t\tif ((lineNo >= 1) && (lineNo <= sourceList.length)) {\n\t\t\treturn sourceList[lineNo - 1];\n\t\t}\n\t\telse {\n\t\t\treturn null;\n\t\t}\n\t}","getLine(x, y) {\n var cell = this.getCell(x, y)\n if (cell == null) return null\n if (cell.type !== 'line') return null\n return cell.line\n }","function findDA(source, lineNumber) {\n\tfor (var i=0; i < source.length; i++) {\n\t\tif (source[i].lineNumber === lineNumber) {\n\t\t\treturn source[i];\n\t\t}\n\t}\n\treturn null;\n}","function getLineItem(primaryLineNumber) {\n\t\t\treturn mainLineItemCollection.getLineItem(primaryLineNumber);\n\n\t\t}","line(n) {\n if (n < 1 || n > this.lines)\n throw new RangeError(`Invalid line number ${n} in ${this.lines}-line document`);\n return this.lineInner(n, true, 1, 0);\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","getLine(message, lineText) {\n const messageSplit = message.split('\\n');\n const line = messageSplit[messageSplit.findIndex(e => e.includes(lineText))];\n if (line) return line;\n throw new Error('Unable to find desired text within the message');\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n}","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n return cm.display.view[findViewIndex(cm, lineN)];\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n return ext;\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n { return cm.display.view[findViewIndex(cm, lineN)] }\n var ext = cm.display.externalMeasured;\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n { return ext }\n }","function findViewForLine(cm, lineN) {\r\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\r\n { return cm.display.view[findViewIndex(cm, lineN)] }\r\n var ext = cm.display.externalMeasured;\r\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\r\n { return ext }\r\n}","get lineNumber() {\n return this._lineNum;\n }","function findViewForLine(cm, lineN) {\r\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\r\n return cm.display.view[findViewIndex(cm, lineN)];\r\n var ext = cm.display.externalMeasured;\r\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\r\n return ext;\r\n }","function findViewForLine(cm, lineN) {\r\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\r\n { return cm.display.view[findViewIndex(cm, lineN)]; }\r\n var ext = cm.display.externalMeasured;\r\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\r\n { return ext; }\r\n }","function findViewForLine(cm, lineN) {\n\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n\t return cm.display.view[findViewIndex(cm, lineN)];\n\t var ext = cm.display.externalMeasured;\n\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n\t return ext;\n\t }","function findViewForLine(cm, lineN) {\n\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n\t return cm.display.view[findViewIndex(cm, lineN)];\n\t var ext = cm.display.externalMeasured;\n\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n\t return ext;\n\t }","function findViewForLine(cm, lineN) {\n\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n\t return cm.display.view[findViewIndex(cm, lineN)];\n\t var ext = cm.display.externalMeasured;\n\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n\t return ext;\n\t }","function getLine(doc, n) {\n\t\t n -= doc.first;\n\t\t if (n < 0 || n >= doc.size) { throw new Error(\"There is no line \" + (n + doc.first) + \" in the document.\") }\n\t\t var chunk = doc;\n\t\t while (!chunk.lines) {\n\t\t for (var i = 0;; ++i) {\n\t\t var child = chunk.children[i], sz = child.chunkSize();\n\t\t if (n < sz) { chunk = child; break }\n\t\t n -= sz;\n\t\t }\n\t\t }\n\t\t return chunk.lines[n]\n\t\t }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN),\n vis = visualLine(line);\n\n if (line == vis) {\n return lineN;\n }\n\n return lineNo(vis);\n } // Get the line number of the start of the next visual line after","function findViewForLine(cm, lineN) {\n\t\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n\t\t return cm.display.view[findViewIndex(cm, lineN)];\n\t\t var ext = cm.display.externalMeasured;\n\t\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n\t\t return ext;\n\t\t }","function getLocation(source, position) {\n let lastLineStart = 0;\n let line = 1;\n\n for (const match of source.body.matchAll(LineRegExp)) {\n typeof match.index === 'number' || invariant(false);\n\n if (match.index >= position) {\n break;\n }\n\n lastLineStart = match.index + match[0].length;\n line += 1;\n }\n\n return {\n line,\n column: position + 1 - lastLineStart,\n };\n}","function findViewForLine(cm, lineN) {\n\t\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n\t\t { return cm.display.view[findViewIndex(cm, lineN)] }\n\t\t var ext = cm.display.externalMeasured;\n\t\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n\t\t { return ext }\n\t\t }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) return lineN;\n return lineNo(vis);\n }","function getLine(doc, n) {\n\t\t n -= doc.first;\n\t\t if (n < 0 || n >= doc.size) throw new Error(\"There is no line \" + (n + doc.first) + \" in the document.\");\n\t\t for (var chunk = doc; !chunk.lines;) {\n\t\t for (var i = 0;; ++i) {\n\t\t var child = chunk.children[i], sz = child.chunkSize();\n\t\t if (n < sz) { chunk = child; break; }\n\t\t n -= sz;\n\t\t }\n\t\t }\n\t\t return chunk.lines[n];\n\t\t }","getLine(x, y) {\r\n var cell = this.getCell(x, y)\r\n if (cell == undefined) return undefined\r\n if (cell.type !== 'line') return undefined\r\n return cell.color\r\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line)\n if (line == vis) { return lineN }\n return lineNo(vis)\n}","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line)\n if (line == vis) { return lineN }\n return lineNo(vis)\n}","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }","function visualLineNo(doc, lineN) {\n var line = getLine(doc, lineN), vis = visualLine(line);\n if (line == vis) { return lineN }\n return lineNo(vis)\n }"],"string":"[\n \"function code_line(code, line) {\\n return code.findIndex(l => l.line === line)\\n}\",\n \"function getSourceLine(lineNo) {\\n\\t\\tif ((lineNo >= 1) && (lineNo <= sourceList.length)) {\\n\\t\\t\\treturn sourceList[lineNo - 1];\\n\\t\\t}\\n\\t\\telse {\\n\\t\\t\\treturn null;\\n\\t\\t}\\n\\t}\",\n \"getLine(x, y) {\\n var cell = this.getCell(x, y)\\n if (cell == null) return null\\n if (cell.type !== 'line') return null\\n return cell.line\\n }\",\n \"function findDA(source, lineNumber) {\\n\\tfor (var i=0; i < source.length; i++) {\\n\\t\\tif (source[i].lineNumber === lineNumber) {\\n\\t\\t\\treturn source[i];\\n\\t\\t}\\n\\t}\\n\\treturn null;\\n}\",\n \"function getLineItem(primaryLineNumber) {\\n\\t\\t\\treturn mainLineItemCollection.getLineItem(primaryLineNumber);\\n\\n\\t\\t}\",\n \"line(n) {\\n if (n < 1 || n > this.lines)\\n throw new RangeError(`Invalid line number ${n} in ${this.lines}-line document`);\\n return this.lineInner(n, true, 1, 0);\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"getLine(message, lineText) {\\n const messageSplit = message.split('\\\\n');\\n const line = messageSplit[messageSplit.findIndex(e => e.includes(lineText))];\\n if (line) return line;\\n throw new Error('Unable to find desired text within the message');\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n}\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n return cm.display.view[findViewIndex(cm, lineN)];\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n return ext;\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\n var ext = cm.display.externalMeasured;\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n { return ext }\\n }\",\n \"function findViewForLine(cm, lineN) {\\r\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\r\\n { return cm.display.view[findViewIndex(cm, lineN)] }\\r\\n var ext = cm.display.externalMeasured;\\r\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\r\\n { return ext }\\r\\n}\",\n \"get lineNumber() {\\n return this._lineNum;\\n }\",\n \"function findViewForLine(cm, lineN) {\\r\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\r\\n return cm.display.view[findViewIndex(cm, lineN)];\\r\\n var ext = cm.display.externalMeasured;\\r\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\r\\n return ext;\\r\\n }\",\n \"function findViewForLine(cm, lineN) {\\r\\n if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\r\\n { return cm.display.view[findViewIndex(cm, lineN)]; }\\r\\n var ext = cm.display.externalMeasured;\\r\\n if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\r\\n { return ext; }\\r\\n }\",\n \"function findViewForLine(cm, lineN) {\\n\\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n\\t return cm.display.view[findViewIndex(cm, lineN)];\\n\\t var ext = cm.display.externalMeasured;\\n\\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n\\t return ext;\\n\\t }\",\n \"function findViewForLine(cm, lineN) {\\n\\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n\\t return cm.display.view[findViewIndex(cm, lineN)];\\n\\t var ext = cm.display.externalMeasured;\\n\\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n\\t return ext;\\n\\t }\",\n \"function findViewForLine(cm, lineN) {\\n\\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n\\t return cm.display.view[findViewIndex(cm, lineN)];\\n\\t var ext = cm.display.externalMeasured;\\n\\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n\\t return ext;\\n\\t }\",\n \"function getLine(doc, n) {\\n\\t\\t n -= doc.first;\\n\\t\\t if (n < 0 || n >= doc.size) { throw new Error(\\\"There is no line \\\" + (n + doc.first) + \\\" in the document.\\\") }\\n\\t\\t var chunk = doc;\\n\\t\\t while (!chunk.lines) {\\n\\t\\t for (var i = 0;; ++i) {\\n\\t\\t var child = chunk.children[i], sz = child.chunkSize();\\n\\t\\t if (n < sz) { chunk = child; break }\\n\\t\\t n -= sz;\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return chunk.lines[n]\\n\\t\\t }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN),\\n vis = visualLine(line);\\n\\n if (line == vis) {\\n return lineN;\\n }\\n\\n return lineNo(vis);\\n } // Get the line number of the start of the next visual line after\",\n \"function findViewForLine(cm, lineN) {\\n\\t\\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n\\t\\t return cm.display.view[findViewIndex(cm, lineN)];\\n\\t\\t var ext = cm.display.externalMeasured;\\n\\t\\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n\\t\\t return ext;\\n\\t\\t }\",\n \"function getLocation(source, position) {\\n let lastLineStart = 0;\\n let line = 1;\\n\\n for (const match of source.body.matchAll(LineRegExp)) {\\n typeof match.index === 'number' || invariant(false);\\n\\n if (match.index >= position) {\\n break;\\n }\\n\\n lastLineStart = match.index + match[0].length;\\n line += 1;\\n }\\n\\n return {\\n line,\\n column: position + 1 - lastLineStart,\\n };\\n}\",\n \"function findViewForLine(cm, lineN) {\\n\\t\\t if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\\n\\t\\t { return cm.display.view[findViewIndex(cm, lineN)] }\\n\\t\\t var ext = cm.display.externalMeasured;\\n\\t\\t if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\\n\\t\\t { return ext }\\n\\t\\t }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) return lineN;\\n return lineNo(vis);\\n }\",\n \"function getLine(doc, n) {\\n\\t\\t n -= doc.first;\\n\\t\\t if (n < 0 || n >= doc.size) throw new Error(\\\"There is no line \\\" + (n + doc.first) + \\\" in the document.\\\");\\n\\t\\t for (var chunk = doc; !chunk.lines;) {\\n\\t\\t for (var i = 0;; ++i) {\\n\\t\\t var child = chunk.children[i], sz = child.chunkSize();\\n\\t\\t if (n < sz) { chunk = child; break; }\\n\\t\\t n -= sz;\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return chunk.lines[n];\\n\\t\\t }\",\n \"getLine(x, y) {\\r\\n var cell = this.getCell(x, y)\\r\\n if (cell == undefined) return undefined\\r\\n if (cell.type !== 'line') return undefined\\r\\n return cell.color\\r\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line)\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n}\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line)\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n}\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\",\n \"function visualLineNo(doc, lineN) {\\n var line = getLine(doc, lineN), vis = visualLine(line);\\n if (line == vis) { return lineN }\\n return lineNo(vis)\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.6920249","0.64912915","0.6366571","0.6360952","0.6341226","0.6221371","0.62164265","0.62164265","0.6216259","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.62154245","0.61878407","0.61878407","0.61878407","0.61878407","0.61878407","0.61878407","0.61878407","0.61878407","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6175","0.6150951","0.61247075","0.60987043","0.6090158","0.606346","0.606346","0.606346","0.60539985","0.60215336","0.60063374","0.5990472","0.5989386","0.59815437","0.59815437","0.59815437","0.59815437","0.59815437","0.59815437","0.59815437","0.5979408","0.5965741","0.5963584","0.5963584","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933","0.59496933"],"string":"[\n \"0.6920249\",\n \"0.64912915\",\n \"0.6366571\",\n \"0.6360952\",\n \"0.6341226\",\n \"0.6221371\",\n \"0.62164265\",\n \"0.62164265\",\n \"0.6216259\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.62154245\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.61878407\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6175\",\n \"0.6150951\",\n \"0.61247075\",\n \"0.60987043\",\n \"0.6090158\",\n \"0.606346\",\n \"0.606346\",\n \"0.606346\",\n \"0.60539985\",\n \"0.60215336\",\n \"0.60063374\",\n \"0.5990472\",\n \"0.5989386\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.59815437\",\n \"0.5979408\",\n \"0.5965741\",\n \"0.5963584\",\n \"0.5963584\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\",\n \"0.59496933\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.59749305"},"document_rank":{"kind":"string","value":"78"}}},{"rowIdx":4191,"cells":{"query":{"kind":"string","value":"Get the part of a document between two positions, as an array of strings."},"document":{"kind":"string","value":"function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n var out = [], n = start.line\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text\n if (n == end.line) { text = text.slice(0, end.ch) }\n if (n == start.line) { text = text.slice(start.ch) }\n out.push(text)\n ++n\n })\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text\n if (n == end.line) { text = text.slice(0, end.ch) }\n if (n == start.line) { text = text.slice(start.ch) }\n out.push(text)\n ++n\n })\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n\t\t var out = [], n = start.line;\n\t\t doc.iter(start.line, end.line + 1, function (line) {\n\t\t var text = line.text;\n\t\t if (n == end.line) { text = text.slice(0, end.ch); }\n\t\t if (n == start.line) { text = text.slice(start.ch); }\n\t\t out.push(text);\n\t\t ++n;\n\t\t });\n\t\t return out\n\t\t }","function getBetween(doc, start, end) {\r\n var out = [], n = start.line;\r\n doc.iter(start.line, end.line + 1, function(line) {\r\n var text = line.text;\r\n if (n == end.line) text = text.slice(0, end.ch);\r\n if (n == start.line) text = text.slice(start.ch);\r\n out.push(text);\r\n ++n;\r\n });\r\n return out;\r\n }","function getBetween(doc, start, end) {\r\n var out = [], n = start.line;\r\n doc.iter(start.line, end.line + 1, function (line) {\r\n var text = line.text;\r\n if (n == end.line) { text = text.slice(0, end.ch); }\r\n if (n == start.line) { text = text.slice(start.ch); }\r\n out.push(text);\r\n ++n;\r\n });\r\n return out\r\n}","function getBetween(doc, start, end) {\n\t\t var out = [], n = start.line;\n\t\t doc.iter(start.line, end.line + 1, function(line) {\n\t\t var text = line.text;\n\t\t if (n == end.line) text = text.slice(0, end.ch);\n\t\t if (n == start.line) text = text.slice(start.ch);\n\t\t out.push(text);\n\t\t ++n;\n\t\t });\n\t\t return out;\n\t\t }","function findSameString(startPos, endPos) {\n var oentity = sourceDoc.substring(startPos, endPos);\n var strLen = endPos - startPos;\n\n var ary = new Array();\n var from = 0;\n while (true) {\n var sameStrPos = sourceDoc.indexOf(oentity, from);\n if (sameStrPos == -1) break;\n\n if (!isOutsideDelimiter(sourceDoc, sameStrPos, sameStrPos + strLen)) {\n var obj = new Object();\n obj['begin'] = sameStrPos;\n obj['end'] = sameStrPos + strLen;\n\n var isExist = false;\n for(var sid in spans) {\n if(spans[sid]['begin'] == obj['begin'] && spans[sid]['end'] == obj['end'] && spans[sid].category == obj.category) {\n isExist = true;\n break;\n }\n }\n\n if(!isExist && startPos != sameStrPos) {\n ary.push(obj);\n }\n }\n from = sameStrPos + 1;\n }\n return ary;\n }","function getLine(doc, n) {\n n -= doc.first;\n\n if (n < 0 || n >= doc.size) {\n throw new Error(\"There is no line \" + (n + doc.first) + \" in the document.\");\n }\n\n var chunk = doc;\n\n while (!chunk.lines) {\n for (var i = 0;; ++i) {\n var child = chunk.children[i],\n sz = child.chunkSize();\n\n if (n < sz) {\n chunk = child;\n break;\n }\n\n n -= sz;\n }\n }\n\n return chunk.lines[n];\n } // Get the part of a document between two positions, as an array of","function getLines(doc, from, to) {\n\t\t var out = [];\n\t\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t\t return out;\n\t\t }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\r\n var out = [];\r\n doc.iter(from, to, function(line) { out.push(line.text); });\r\n return out;\r\n }","function getBody(position, body) {\n const { start, end } = position;\n return body.substring(start.offset, end.offset);\n}","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }","function getLines(doc, from, to) {\r\n var out = [];\r\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\r\n return out\r\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n\t\t var out = [];\n\t\t doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n\t\t return out\n\t\t }","function getLines(doc, from, to) {\n var out = []\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = []\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\n return out\n}","function orderedRange(range) {\r\n if ('anchor' in range)\r\n { range = [range.head, range.anchor]; }\r\n if (CodeMirror.cmpPos(range[0], range[1]) > 0)\r\n { return [range[1], range[0]]; }\r\n else\r\n { return [range[0], range[1]]; }\r\n }","function getOffsetsAfterListCheck(docStr,offset1,offset2){\n var newOffset1 = offset1;\n var newOffset2 = offset2;\n var openListItems = new Array(\"<ol>\",\"<OL>\",\"<ul>\",\"<UL>\");\n var i, nItems = openListItems.length, closeListItem1, closeListItem2, currItem;\n var selStr = docStr.substring(offset1,offset2);\n \n for (i=0;i<nItems;i++){\n if (selStr.indexOf(openListItems[i]) == 0){\n currItem = openListItems[i];\n closeListItem1 = \"</\" + currItem.toLowerCase().substring(1);\n closeListItem2 = \"</\" + currItem.toUpperCase().substring(1);\n \n if ( selStr.indexOf(closeListItem1) == -1 && selStr.indexOf(closeListItem2) == -1){\n newOffset1 += currItem.length;\n }\n } \n }\n return new Array(newOffset1,newOffset2);\n}","function getValue(doc, start, end) {\n var s = doc.indexOf(start);\n if (s < 0) return null;\n s = s + start.length;\n if (end !== null) {\n var e = doc.indexOf(end, s);\n if (e < 0) return null;\n return doc.substr(s, e - s);\n }\n return doc.substr(s);\n }","function substringByStartAndEnd(input, start, end) {}","function getToAndFrom(str, ind) {\r\n const m = str.match(/^Step (.) must be finished before step (.) can begin\\.$/);\r\n return [m[1], m[2]];\r\n}","function extractNames(paragraph){\n var start = paragraph.indexOf(\"(mother \") + \"(mother \".length;\n var end = paragraph.indexOf(\")\");\n console.log(start, end);\n return paragraph.slice(start, end);\n \n}","function getSelectionRanges(document, positions, doc) {\n function getSelectionRange(position) {\n var offset = document.offsetAt(position);\n var node = doc.getNodeFromOffset(offset, true);\n var result = [];\n while (node) {\n switch (node.type) {\n case 'string':\n case 'object':\n case 'array':\n // range without \", [ or {\n var cStart = node.offset + 1, cEnd = node.offset + node.length - 1;\n if (cStart < cEnd && offset >= cStart && offset <= cEnd) {\n result.push(newRange(cStart, cEnd));\n }\n result.push(newRange(node.offset, node.offset + node.length));\n break;\n case 'number':\n case 'boolean':\n case 'null':\n case 'property':\n result.push(newRange(node.offset, node.offset + node.length));\n break;\n }\n if (node.type === 'property' || node.parent && node.parent.type === 'array') {\n var afterCommaOffset = getOffsetAfterNextToken(node.offset + node.length, 5 /* CommaToken */);\n if (afterCommaOffset !== -1) {\n result.push(newRange(node.offset, afterCommaOffset));\n }\n }\n node = node.parent;\n }\n var current = undefined;\n for (var index = result.length - 1; index >= 0; index--) {\n current = vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\"SelectionRange\"].create(result[index], current);\n }\n if (!current) {\n current = vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\"SelectionRange\"].create(vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\"Range\"].create(position, position));\n }\n return current;\n }\n function newRange(start, end) {\n return vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\"Range\"].create(document.positionAt(start), document.positionAt(end));\n }\n var scanner = Object(jsonc_parser__WEBPACK_IMPORTED_MODULE_1__[\"createScanner\"])(document.getText(), true);\n function getOffsetAfterNextToken(offset, expectedToken) {\n scanner.setPosition(offset);\n var token = scanner.scan();\n if (token === expectedToken) {\n return scanner.getTokenOffset() + scanner.getTokenLength();\n }\n return -1;\n }\n return positions.map(getSelectionRange);\n}","function between(string, start, end){\n var startAt = string.indexOf(start) + start.length;\n var endAt = string.indexOf(end, startAt);\n \n return string.slice(startAt, endAt);\n}","function getValue(doc, start, end) {\n var s = doc.indexOf(start);\n if (s < 0) return null;\n\n s = s + start.length;\n\n if (end != null) {\n var e = doc.indexOf(end, s);\n if (e < 0) return null;\n\n return doc.substr(s, e - s);\n }\n\n return doc.substr(s);\n }","static atStart(doc2) {\n return findSelectionIn(doc2, doc2, 0, 0, 1) || new AllSelection(doc2);\n }","content() {\n return this.$from.doc.slice(this.from, this.to, true);\n }"],"string":"[\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text\\n if (n == end.line) { text = text.slice(0, end.ch) }\\n if (n == start.line) { text = text.slice(start.ch) }\\n out.push(text)\\n ++n\\n })\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text\\n if (n == end.line) { text = text.slice(0, end.ch) }\\n if (n == start.line) { text = text.slice(start.ch) }\\n out.push(text)\\n ++n\\n })\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n\\t\\t var out = [], n = start.line;\\n\\t\\t doc.iter(start.line, end.line + 1, function (line) {\\n\\t\\t var text = line.text;\\n\\t\\t if (n == end.line) { text = text.slice(0, end.ch); }\\n\\t\\t if (n == start.line) { text = text.slice(start.ch); }\\n\\t\\t out.push(text);\\n\\t\\t ++n;\\n\\t\\t });\\n\\t\\t return out\\n\\t\\t }\",\n \"function getBetween(doc, start, end) {\\r\\n var out = [], n = start.line;\\r\\n doc.iter(start.line, end.line + 1, function(line) {\\r\\n var text = line.text;\\r\\n if (n == end.line) text = text.slice(0, end.ch);\\r\\n if (n == start.line) text = text.slice(start.ch);\\r\\n out.push(text);\\r\\n ++n;\\r\\n });\\r\\n return out;\\r\\n }\",\n \"function getBetween(doc, start, end) {\\r\\n var out = [], n = start.line;\\r\\n doc.iter(start.line, end.line + 1, function (line) {\\r\\n var text = line.text;\\r\\n if (n == end.line) { text = text.slice(0, end.ch); }\\r\\n if (n == start.line) { text = text.slice(start.ch); }\\r\\n out.push(text);\\r\\n ++n;\\r\\n });\\r\\n return out\\r\\n}\",\n \"function getBetween(doc, start, end) {\\n\\t\\t var out = [], n = start.line;\\n\\t\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t\\t var text = line.text;\\n\\t\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t\\t if (n == start.line) text = text.slice(start.ch);\\n\\t\\t out.push(text);\\n\\t\\t ++n;\\n\\t\\t });\\n\\t\\t return out;\\n\\t\\t }\",\n \"function findSameString(startPos, endPos) {\\n var oentity = sourceDoc.substring(startPos, endPos);\\n var strLen = endPos - startPos;\\n\\n var ary = new Array();\\n var from = 0;\\n while (true) {\\n var sameStrPos = sourceDoc.indexOf(oentity, from);\\n if (sameStrPos == -1) break;\\n\\n if (!isOutsideDelimiter(sourceDoc, sameStrPos, sameStrPos + strLen)) {\\n var obj = new Object();\\n obj['begin'] = sameStrPos;\\n obj['end'] = sameStrPos + strLen;\\n\\n var isExist = false;\\n for(var sid in spans) {\\n if(spans[sid]['begin'] == obj['begin'] && spans[sid]['end'] == obj['end'] && spans[sid].category == obj.category) {\\n isExist = true;\\n break;\\n }\\n }\\n\\n if(!isExist && startPos != sameStrPos) {\\n ary.push(obj);\\n }\\n }\\n from = sameStrPos + 1;\\n }\\n return ary;\\n }\",\n \"function getLine(doc, n) {\\n n -= doc.first;\\n\\n if (n < 0 || n >= doc.size) {\\n throw new Error(\\\"There is no line \\\" + (n + doc.first) + \\\" in the document.\\\");\\n }\\n\\n var chunk = doc;\\n\\n while (!chunk.lines) {\\n for (var i = 0;; ++i) {\\n var child = chunk.children[i],\\n sz = child.chunkSize();\\n\\n if (n < sz) {\\n chunk = child;\\n break;\\n }\\n\\n n -= sz;\\n }\\n }\\n\\n return chunk.lines[n];\\n } // Get the part of a document between two positions, as an array of\",\n \"function getLines(doc, from, to) {\\n\\t\\t var out = [];\\n\\t\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t\\t return out;\\n\\t\\t }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\r\\n var out = [];\\r\\n doc.iter(from, to, function(line) { out.push(line.text); });\\r\\n return out;\\r\\n }\",\n \"function getBody(position, body) {\\n const { start, end } = position;\\n return body.substring(start.offset, end.offset);\\n}\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n }\",\n \"function getLines(doc, from, to) {\\r\\n var out = [];\\r\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\r\\n return out\\r\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n\\t\\t var out = [];\\n\\t\\t doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n\\t\\t return out\\n\\t\\t }\",\n \"function getLines(doc, from, to) {\\n var out = []\\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = []\\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function orderedRange(range) {\\r\\n if ('anchor' in range)\\r\\n { range = [range.head, range.anchor]; }\\r\\n if (CodeMirror.cmpPos(range[0], range[1]) > 0)\\r\\n { return [range[1], range[0]]; }\\r\\n else\\r\\n { return [range[0], range[1]]; }\\r\\n }\",\n \"function getOffsetsAfterListCheck(docStr,offset1,offset2){\\n var newOffset1 = offset1;\\n var newOffset2 = offset2;\\n var openListItems = new Array(\\\"<ol>\\\",\\\"<OL>\\\",\\\"<ul>\\\",\\\"<UL>\\\");\\n var i, nItems = openListItems.length, closeListItem1, closeListItem2, currItem;\\n var selStr = docStr.substring(offset1,offset2);\\n \\n for (i=0;i<nItems;i++){\\n if (selStr.indexOf(openListItems[i]) == 0){\\n currItem = openListItems[i];\\n closeListItem1 = \\\"</\\\" + currItem.toLowerCase().substring(1);\\n closeListItem2 = \\\"</\\\" + currItem.toUpperCase().substring(1);\\n \\n if ( selStr.indexOf(closeListItem1) == -1 && selStr.indexOf(closeListItem2) == -1){\\n newOffset1 += currItem.length;\\n }\\n } \\n }\\n return new Array(newOffset1,newOffset2);\\n}\",\n \"function getValue(doc, start, end) {\\n var s = doc.indexOf(start);\\n if (s < 0) return null;\\n s = s + start.length;\\n if (end !== null) {\\n var e = doc.indexOf(end, s);\\n if (e < 0) return null;\\n return doc.substr(s, e - s);\\n }\\n return doc.substr(s);\\n }\",\n \"function substringByStartAndEnd(input, start, end) {}\",\n \"function getToAndFrom(str, ind) {\\r\\n const m = str.match(/^Step (.) must be finished before step (.) can begin\\\\.$/);\\r\\n return [m[1], m[2]];\\r\\n}\",\n \"function extractNames(paragraph){\\n var start = paragraph.indexOf(\\\"(mother \\\") + \\\"(mother \\\".length;\\n var end = paragraph.indexOf(\\\")\\\");\\n console.log(start, end);\\n return paragraph.slice(start, end);\\n \\n}\",\n \"function getSelectionRanges(document, positions, doc) {\\n function getSelectionRange(position) {\\n var offset = document.offsetAt(position);\\n var node = doc.getNodeFromOffset(offset, true);\\n var result = [];\\n while (node) {\\n switch (node.type) {\\n case 'string':\\n case 'object':\\n case 'array':\\n // range without \\\", [ or {\\n var cStart = node.offset + 1, cEnd = node.offset + node.length - 1;\\n if (cStart < cEnd && offset >= cStart && offset <= cEnd) {\\n result.push(newRange(cStart, cEnd));\\n }\\n result.push(newRange(node.offset, node.offset + node.length));\\n break;\\n case 'number':\\n case 'boolean':\\n case 'null':\\n case 'property':\\n result.push(newRange(node.offset, node.offset + node.length));\\n break;\\n }\\n if (node.type === 'property' || node.parent && node.parent.type === 'array') {\\n var afterCommaOffset = getOffsetAfterNextToken(node.offset + node.length, 5 /* CommaToken */);\\n if (afterCommaOffset !== -1) {\\n result.push(newRange(node.offset, afterCommaOffset));\\n }\\n }\\n node = node.parent;\\n }\\n var current = undefined;\\n for (var index = result.length - 1; index >= 0; index--) {\\n current = vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\\\"SelectionRange\\\"].create(result[index], current);\\n }\\n if (!current) {\\n current = vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\\\"SelectionRange\\\"].create(vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\\\"Range\\\"].create(position, position));\\n }\\n return current;\\n }\\n function newRange(start, end) {\\n return vscode_languageserver_types__WEBPACK_IMPORTED_MODULE_0__[\\\"Range\\\"].create(document.positionAt(start), document.positionAt(end));\\n }\\n var scanner = Object(jsonc_parser__WEBPACK_IMPORTED_MODULE_1__[\\\"createScanner\\\"])(document.getText(), true);\\n function getOffsetAfterNextToken(offset, expectedToken) {\\n scanner.setPosition(offset);\\n var token = scanner.scan();\\n if (token === expectedToken) {\\n return scanner.getTokenOffset() + scanner.getTokenLength();\\n }\\n return -1;\\n }\\n return positions.map(getSelectionRange);\\n}\",\n \"function between(string, start, end){\\n var startAt = string.indexOf(start) + start.length;\\n var endAt = string.indexOf(end, startAt);\\n \\n return string.slice(startAt, endAt);\\n}\",\n \"function getValue(doc, start, end) {\\n var s = doc.indexOf(start);\\n if (s < 0) return null;\\n\\n s = s + start.length;\\n\\n if (end != null) {\\n var e = doc.indexOf(end, s);\\n if (e < 0) return null;\\n\\n return doc.substr(s, e - s);\\n }\\n\\n return doc.substr(s);\\n }\",\n \"static atStart(doc2) {\\n return findSelectionIn(doc2, doc2, 0, 0, 1) || new AllSelection(doc2);\\n }\",\n \"content() {\\n return this.$from.doc.slice(this.from, this.to, true);\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7319094","0.7319094","0.7319094","0.7309015","0.7309015","0.7307082","0.7307082","0.7307082","0.7307082","0.7307082","0.7307082","0.7307082","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.7296952","0.72767013","0.7271897","0.72688466","0.72368896","0.59274596","0.59130013","0.57686216","0.57541645","0.57541645","0.57541645","0.57541645","0.57541645","0.57541645","0.57435167","0.57171416","0.5715687","0.5715687","0.5715687","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.56312245","0.5612647","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.5583784","0.55620414","0.5554531","0.5554531","0.55467445","0.5524847","0.5519659","0.55166227","0.5499387","0.5496232","0.54922205","0.5480213","0.5449512","0.5432724","0.54306257"],"string":"[\n \"0.7319094\",\n \"0.7319094\",\n \"0.7319094\",\n \"0.7309015\",\n \"0.7309015\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7307082\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.7296952\",\n \"0.72767013\",\n \"0.7271897\",\n \"0.72688466\",\n \"0.72368896\",\n \"0.59274596\",\n \"0.59130013\",\n \"0.57686216\",\n \"0.57541645\",\n \"0.57541645\",\n \"0.57541645\",\n \"0.57541645\",\n \"0.57541645\",\n \"0.57541645\",\n \"0.57435167\",\n \"0.57171416\",\n \"0.5715687\",\n \"0.5715687\",\n \"0.5715687\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.56312245\",\n \"0.5612647\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.5583784\",\n \"0.55620414\",\n \"0.5554531\",\n \"0.5554531\",\n \"0.55467445\",\n \"0.5524847\",\n \"0.5519659\",\n \"0.55166227\",\n \"0.5499387\",\n \"0.5496232\",\n \"0.54922205\",\n \"0.5480213\",\n \"0.5449512\",\n \"0.5432724\",\n \"0.54306257\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.73343515"},"document_rank":{"kind":"string","value":"13"}}},{"rowIdx":4192,"cells":{"query":{"kind":"string","value":"Get the lines between from and to, as array of strings."},"document":{"kind":"string","value":"function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }","function getLines(doc, from, to) {\r\n var out = [];\r\n doc.iter(from, to, function(line) { out.push(line.text); });\r\n return out;\r\n }","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n\t var out = [];\n\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t return out;\n\t }","function getLines(doc, from, to) {\n\t\t var out = [];\n\t\t doc.iter(from, to, function(line) { out.push(line.text); });\n\t\t return out;\n\t\t }","function getLines(doc, from, to) {\r\n var out = [];\r\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\r\n return out\r\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n\t\t var out = [];\n\t\t doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\n\t\t return out\n\t\t }","function getLines(doc, from, to) {\n var out = []\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to) {\n var out = []\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\n return out\n}","function getLines(doc, from, to, lineFilter) {\n var out = [];\n doc.iter(from, to, function(line) {\n var text = line.text;\n if(lineFilter){\n text = lineFilter(line);\n }\n out.push(text);\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n }","function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ++n;\n\t });\n\t return out;\n\t }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function(line) {\n var text = line.text;\n if (n == end.line) text = text.slice(0, end.ch);\n if (n == start.line) text = text.slice(start.ch);\n out.push(text);\n ++n;\n });\n return out;\n }","function getBetween(doc, start, end) {\n var out = [], n = start.line\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text\n if (n == end.line) { text = text.slice(0, end.ch) }\n if (n == start.line) { text = text.slice(start.ch) }\n out.push(text)\n ++n\n })\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text\n if (n == end.line) { text = text.slice(0, end.ch) }\n if (n == start.line) { text = text.slice(start.ch) }\n out.push(text)\n ++n\n })\n return out\n}","function getBetween(doc, start, end) {\r\n var out = [], n = start.line;\r\n doc.iter(start.line, end.line + 1, function(line) {\r\n var text = line.text;\r\n if (n == end.line) text = text.slice(0, end.ch);\r\n if (n == start.line) text = text.slice(start.ch);\r\n out.push(text);\r\n ++n;\r\n });\r\n return out;\r\n }","function getBetween(doc, start, end) {\n\t\t var out = [], n = start.line;\n\t\t doc.iter(start.line, end.line + 1, function (line) {\n\t\t var text = line.text;\n\t\t if (n == end.line) { text = text.slice(0, end.ch); }\n\t\t if (n == start.line) { text = text.slice(start.ch); }\n\t\t out.push(text);\n\t\t ++n;\n\t\t });\n\t\t return out\n\t\t }","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n var out = [], n = start.line;\n doc.iter(start.line, end.line + 1, function (line) {\n var text = line.text;\n if (n == end.line) { text = text.slice(0, end.ch); }\n if (n == start.line) { text = text.slice(start.ch); }\n out.push(text);\n ++n;\n });\n return out\n}","function getBetween(doc, start, end) {\n\t\t var out = [], n = start.line;\n\t\t doc.iter(start.line, end.line + 1, function(line) {\n\t\t var text = line.text;\n\t\t if (n == end.line) text = text.slice(0, end.ch);\n\t\t if (n == start.line) text = text.slice(start.ch);\n\t\t out.push(text);\n\t\t ++n;\n\t\t });\n\t\t return out;\n\t\t }","function getBetween(doc, start, end) {\r\n var out = [], n = start.line;\r\n doc.iter(start.line, end.line + 1, function (line) {\r\n var text = line.text;\r\n if (n == end.line) { text = text.slice(0, end.ch); }\r\n if (n == start.line) { text = text.slice(start.ch); }\r\n out.push(text);\r\n ++n;\r\n });\r\n return out\r\n}","iterLines(from, to) {\n let inner;\n if (from == null) {\n inner = this.iter();\n }\n else {\n if (to == null)\n to = this.lines + 1;\n let start = this.line(from).from;\n inner = this.iterRange(start, Math.max(start, to == this.lines + 1 ? this.length : to <= 1 ? 0 : this.line(to - 1).to));\n }\n return new LineCursor(inner);\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array;\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array\n }","function buildViewArray(cm, from, to) {\n var array = [], nextPos;\n for (var pos = from; pos < to; pos = nextPos) {\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n nextPos = pos + view.size;\n array.push(view);\n }\n return array\n }"],"string":"[\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function(line) { out.push(line.text); });\\n return out;\\n }\",\n \"function getLines(doc, from, to) {\\r\\n var out = [];\\r\\n doc.iter(from, to, function(line) { out.push(line.text); });\\r\\n return out;\\r\\n }\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n\\t var out = [];\\n\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t return out;\\n\\t }\",\n \"function getLines(doc, from, to) {\\n\\t\\t var out = [];\\n\\t\\t doc.iter(from, to, function(line) { out.push(line.text); });\\n\\t\\t return out;\\n\\t\\t }\",\n \"function getLines(doc, from, to) {\\r\\n var out = [];\\r\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\r\\n return out\\r\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = [];\\n doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n\\t\\t var out = [];\\n\\t\\t doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value\\n\\t\\t return out\\n\\t\\t }\",\n \"function getLines(doc, from, to) {\\n var out = []\\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to) {\\n var out = []\\n doc.iter(from, to, function (line) { out.push(line.text) }) // iter aborts when callback returns truthy value\\n return out\\n}\",\n \"function getLines(doc, from, to, lineFilter) {\\n var out = [];\\n doc.iter(from, to, function(line) {\\n var text = line.text;\\n if(lineFilter){\\n text = lineFilter(line);\\n }\\n out.push(text);\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n }\",\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n\\t var out = [], n = start.line;\\n\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t var text = line.text;\\n\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t if (n == start.line) text = text.slice(start.ch);\\n\\t out.push(text);\\n\\t ++n;\\n\\t });\\n\\t return out;\\n\\t }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function(line) {\\n var text = line.text;\\n if (n == end.line) text = text.slice(0, end.ch);\\n if (n == start.line) text = text.slice(start.ch);\\n out.push(text);\\n ++n;\\n });\\n return out;\\n }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text\\n if (n == end.line) { text = text.slice(0, end.ch) }\\n if (n == start.line) { text = text.slice(start.ch) }\\n out.push(text)\\n ++n\\n })\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text\\n if (n == end.line) { text = text.slice(0, end.ch) }\\n if (n == start.line) { text = text.slice(start.ch) }\\n out.push(text)\\n ++n\\n })\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\r\\n var out = [], n = start.line;\\r\\n doc.iter(start.line, end.line + 1, function(line) {\\r\\n var text = line.text;\\r\\n if (n == end.line) text = text.slice(0, end.ch);\\r\\n if (n == start.line) text = text.slice(start.ch);\\r\\n out.push(text);\\r\\n ++n;\\r\\n });\\r\\n return out;\\r\\n }\",\n \"function getBetween(doc, start, end) {\\n\\t\\t var out = [], n = start.line;\\n\\t\\t doc.iter(start.line, end.line + 1, function (line) {\\n\\t\\t var text = line.text;\\n\\t\\t if (n == end.line) { text = text.slice(0, end.ch); }\\n\\t\\t if (n == start.line) { text = text.slice(start.ch); }\\n\\t\\t out.push(text);\\n\\t\\t ++n;\\n\\t\\t });\\n\\t\\t return out\\n\\t\\t }\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n var out = [], n = start.line;\\n doc.iter(start.line, end.line + 1, function (line) {\\n var text = line.text;\\n if (n == end.line) { text = text.slice(0, end.ch); }\\n if (n == start.line) { text = text.slice(start.ch); }\\n out.push(text);\\n ++n;\\n });\\n return out\\n}\",\n \"function getBetween(doc, start, end) {\\n\\t\\t var out = [], n = start.line;\\n\\t\\t doc.iter(start.line, end.line + 1, function(line) {\\n\\t\\t var text = line.text;\\n\\t\\t if (n == end.line) text = text.slice(0, end.ch);\\n\\t\\t if (n == start.line) text = text.slice(start.ch);\\n\\t\\t out.push(text);\\n\\t\\t ++n;\\n\\t\\t });\\n\\t\\t return out;\\n\\t\\t }\",\n \"function getBetween(doc, start, end) {\\r\\n var out = [], n = start.line;\\r\\n doc.iter(start.line, end.line + 1, function (line) {\\r\\n var text = line.text;\\r\\n if (n == end.line) { text = text.slice(0, end.ch); }\\r\\n if (n == start.line) { text = text.slice(start.ch); }\\r\\n out.push(text);\\r\\n ++n;\\r\\n });\\r\\n return out\\r\\n}\",\n \"iterLines(from, to) {\\n let inner;\\n if (from == null) {\\n inner = this.iter();\\n }\\n else {\\n if (to == null)\\n to = this.lines + 1;\\n let start = this.line(from).from;\\n inner = this.iterRange(start, Math.max(start, to == this.lines + 1 ? this.length : to <= 1 ? 0 : this.line(to - 1).to));\\n }\\n return new LineCursor(inner);\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array;\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array\\n }\",\n \"function buildViewArray(cm, from, to) {\\n var array = [], nextPos;\\n for (var pos = from; pos < to; pos = nextPos) {\\n var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\\n nextPos = pos + view.size;\\n array.push(view);\\n }\\n return array\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.78904086","0.78904086","0.78904086","0.78904086","0.78904086","0.78904086","0.78513694","0.7843995","0.7843995","0.7843995","0.7803603","0.77783775","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.7767557","0.77651346","0.77185714","0.77185714","0.7507505","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.66725796","0.6653445","0.6653445","0.6653445","0.6648661","0.6648661","0.6648661","0.6648661","0.6648661","0.6648661","0.6648661","0.661851","0.661851","0.6595245","0.65938985","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.65801287","0.6559701","0.6552818","0.6457985","0.6061667","0.6061667","0.6061667","0.6061667","0.6061667","0.6061667","0.6061667","0.6061667","0.6059143","0.6059143","0.6059143","0.6059143"],"string":"[\n \"0.78904086\",\n \"0.78904086\",\n \"0.78904086\",\n \"0.78904086\",\n \"0.78904086\",\n \"0.78904086\",\n \"0.78513694\",\n \"0.7843995\",\n \"0.7843995\",\n \"0.7843995\",\n \"0.7803603\",\n \"0.77783775\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.7767557\",\n \"0.77651346\",\n \"0.77185714\",\n \"0.77185714\",\n \"0.7507505\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.66725796\",\n \"0.6653445\",\n \"0.6653445\",\n \"0.6653445\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.6648661\",\n \"0.661851\",\n \"0.661851\",\n \"0.6595245\",\n \"0.65938985\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.65801287\",\n \"0.6559701\",\n \"0.6552818\",\n \"0.6457985\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6061667\",\n \"0.6059143\",\n \"0.6059143\",\n \"0.6059143\",\n \"0.6059143\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7850108"},"document_rank":{"kind":"string","value":"22"}}},{"rowIdx":4193,"cells":{"query":{"kind":"string","value":"Update the height of a line, propagating the height change upwards to parent nodes."},"document":{"kind":"string","value":"function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function updateLineHeight(line, height) {\n\t\t var diff = height - line.height;\n\t\t if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n\t\t }","function updateLineHeight(line, height) {\n\t\t var diff = height - line.height;\n\t\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t\t }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n }","function updateLineHeight(line, height) {\n\t var diff = height - line.height;\n\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t }","function updateLineHeight(line, height) {\n\t var diff = height - line.height;\n\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t }","function updateLineHeight(line, height) {\n\t var diff = height - line.height;\n\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t }","function updateLineHeight(line, height) {\r\n var diff = height - line.height;\r\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\r\n }","function updateLineHeight(line, height) {\n var diff = height - line.height;\n\n if (diff) {\n for (var n = line; n; n = n.parent) {\n n.height += diff;\n }\n }\n } // Given a line object, find its line number by walking up through","function updateLineHeight(line, height) {\r\n var diff = height - line.height;\r\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\r\n}","function updateLineHeight(line, height) {\n var diff = height - line.height\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n var w = line.widgets[i], parent = w.node.parentNode;\n if (parent) { w.height = parent.offsetHeight; }\n } }\n}","function updateWidgetHeight(line) {\r\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\r\n var w = line.widgets[i], parent = w.node.parentNode;\r\n if (parent) { w.height = parent.offsetHeight; }\r\n } }\r\n}","function updateWidgetHeight(line) {\n\t\t if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\n\t\t var w = line.widgets[i], parent = w.node.parentNode;\n\t\t if (parent) { w.height = parent.offsetHeight; }\n\t\t } }\n\t\t }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\n }","function updateWidgetHeight(line) {\n\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\n\t }","function updateWidgetHeight(line) {\n\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\n\t }","function updateWidgetHeight(line) {\n\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\n\t }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\n }","function updateWidgetHeight(line) {\r\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\r\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\r\n }","function updateWidgetHeight(line) {\n\t\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n\t\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\n\t\t }","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\n}","function updateWidgetHeight(line) {\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\n}","function lineHeight(){\n\t\thistoryLine.each(function(index, element){\n\t\t\tif(index == $('.line').length - 1){\n\t\t\t\treturn false;\n\t\t\t} else{\n\t\t\t\tvar thisBlock = $(this).closest('.history-item').height()/2;\n\t\t\t\tvar nextBlock = $(this).closest('.history-item').next().height()/2;\n\t\t\t\tvar h = thisBlock+nextBlock;\n\t\t\t\t$(this).height(h);\n\t\t\t}\n\t\t\t\n\t\t})\n\t}","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\t\t\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) break;\n\t\t else h += line.height;\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i = 0; i < p.children.length; ++i) {\n\t\t var cur = p.children[i];\n\t\t if (cur == chunk) break;\n\t\t else h += cur.height;\n\t\t }\n\t\t }\n\t\t return h;\n\t\t }","function heightAtLine(lineObj) {\r\n lineObj = visualLine(lineObj);\r\n\r\n var h = 0, chunk = lineObj.parent;\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i];\r\n if (line == lineObj) break;\r\n else h += line.height;\r\n }\r\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\r\n for (var i = 0; i < p.children.length; ++i) {\r\n var cur = p.children[i];\r\n if (cur == chunk) break;\r\n else h += cur.height;\r\n }\r\n }\r\n return h;\r\n }","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) { break }\n\t\t else { h += line.height; }\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n\t\t var cur = p.children[i$1];\n\t\t if (cur == chunk) { break }\n\t\t else { h += cur.height; }\n\t\t }\n\t\t }\n\t\t return h\n\t\t }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }"],"string":"[\n \"function updateLineHeight(line, height) {\\n\\t\\t var diff = height - line.height;\\n\\t\\t if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n\\t\\t }\",\n \"function updateLineHeight(line, height) {\\n\\t\\t var diff = height - line.height;\\n\\t\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t\\t }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n }\",\n \"function updateLineHeight(line, height) {\\n\\t var diff = height - line.height;\\n\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t }\",\n \"function updateLineHeight(line, height) {\\n\\t var diff = height - line.height;\\n\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t }\",\n \"function updateLineHeight(line, height) {\\n\\t var diff = height - line.height;\\n\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t }\",\n \"function updateLineHeight(line, height) {\\r\\n var diff = height - line.height;\\r\\n if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\r\\n }\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n\\n if (diff) {\\n for (var n = line; n; n = n.parent) {\\n n.height += diff;\\n }\\n }\\n } // Given a line object, find its line number by walking up through\",\n \"function updateLineHeight(line, height) {\\r\\n var diff = height - line.height;\\r\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\r\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n var w = line.widgets[i], parent = w.node.parentNode;\\n if (parent) { w.height = parent.offsetHeight; }\\n } }\\n}\",\n \"function updateWidgetHeight(line) {\\r\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\r\\n var w = line.widgets[i], parent = w.node.parentNode;\\r\\n if (parent) { w.height = parent.offsetHeight; }\\r\\n } }\\r\\n}\",\n \"function updateWidgetHeight(line) {\\n\\t\\t if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {\\n\\t\\t var w = line.widgets[i], parent = w.node.parentNode;\\n\\t\\t if (parent) { w.height = parent.offsetHeight; }\\n\\t\\t } }\\n\\t\\t }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n\\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n\\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\\n\\t }\",\n \"function updateWidgetHeight(line) {\\n\\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n\\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\\n\\t }\",\n \"function updateWidgetHeight(line) {\\n\\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n\\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\\n\\t }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\n }\",\n \"function updateWidgetHeight(line) {\\r\\n if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\r\\n line.widgets[i].height = line.widgets[i].node.offsetHeight;\\r\\n }\",\n \"function updateWidgetHeight(line) {\\n\\t\\t if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\\n\\t\\t line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight;\\n\\t\\t }\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\\n}\",\n \"function updateWidgetHeight(line) {\\n if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i)\\n { line.widgets[i].height = line.widgets[i].node.parentNode.offsetHeight; } }\\n}\",\n \"function lineHeight(){\\n\\t\\thistoryLine.each(function(index, element){\\n\\t\\t\\tif(index == $('.line').length - 1){\\n\\t\\t\\t\\treturn false;\\n\\t\\t\\t} else{\\n\\t\\t\\t\\tvar thisBlock = $(this).closest('.history-item').height()/2;\\n\\t\\t\\t\\tvar nextBlock = $(this).closest('.history-item').next().height()/2;\\n\\t\\t\\t\\tvar h = thisBlock+nextBlock;\\n\\t\\t\\t\\t$(this).height(h);\\n\\t\\t\\t}\\n\\t\\t\\t\\n\\t\\t})\\n\\t}\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\t\\t\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) break;\\n\\t\\t else h += line.height;\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t\\t var cur = p.children[i];\\n\\t\\t if (cur == chunk) break;\\n\\t\\t else h += cur.height;\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h;\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\r\\n lineObj = visualLine(lineObj);\\r\\n\\r\\n var h = 0, chunk = lineObj.parent;\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i];\\r\\n if (line == lineObj) break;\\r\\n else h += line.height;\\r\\n }\\r\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\r\\n for (var i = 0; i < p.children.length; ++i) {\\r\\n var cur = p.children[i];\\r\\n if (cur == chunk) break;\\r\\n else h += cur.height;\\r\\n }\\r\\n }\\r\\n return h;\\r\\n }\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) { break }\\n\\t\\t else { h += line.height; }\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n\\t\\t var cur = p.children[i$1];\\n\\t\\t if (cur == chunk) { break }\\n\\t\\t else { h += cur.height; }\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.8322016","0.830631","0.8282418","0.8282418","0.8282418","0.8282418","0.8282418","0.8282418","0.8282418","0.82768357","0.82768357","0.82768357","0.8260964","0.8210703","0.8163414","0.81575036","0.81575036","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.81119776","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.74375516","0.7423423","0.7423423","0.7423423","0.7423423","0.7423423","0.7423423","0.7423423","0.7423423","0.73969525","0.7390022","0.7373789","0.73639584","0.73639584","0.73639584","0.73587394","0.73587394","0.7351786","0.7351786","0.7351786","0.7351786","0.7351786","0.7351786","0.7351786","0.7344579","0.7342016","0.7337207","0.7337207","0.7337207","0.6993215","0.69376314","0.68629587","0.686121","0.6850907","0.6850907","0.6850907","0.6850907","0.6850907","0.6850907","0.6850907"],"string":"[\n \"0.8322016\",\n \"0.830631\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.8282418\",\n \"0.82768357\",\n \"0.82768357\",\n \"0.82768357\",\n \"0.8260964\",\n \"0.8210703\",\n \"0.8163414\",\n \"0.81575036\",\n \"0.81575036\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.81119776\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.74375516\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.7423423\",\n \"0.73969525\",\n \"0.7390022\",\n \"0.7373789\",\n \"0.73639584\",\n \"0.73639584\",\n \"0.73639584\",\n \"0.73587394\",\n \"0.73587394\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7351786\",\n \"0.7344579\",\n \"0.7342016\",\n \"0.7337207\",\n \"0.7337207\",\n \"0.7337207\",\n \"0.6993215\",\n \"0.69376314\",\n \"0.68629587\",\n \"0.686121\",\n \"0.6850907\",\n \"0.6850907\",\n \"0.6850907\",\n \"0.6850907\",\n \"0.6850907\",\n \"0.6850907\",\n \"0.6850907\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.82786244"},"document_rank":{"kind":"string","value":"25"}}},{"rowIdx":4194,"cells":{"query":{"kind":"string","value":"Given a line object, find its line number by walking up through its parent links."},"document":{"kind":"string","value":"function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function lineNo(line) {\n\t\t if (line.parent == null) { return null }\n\t\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t\t for (var i = 0;; ++i) {\n\t\t if (chunk.children[i] == cur) { break }\n\t\t no += chunk.children[i].chunkSize();\n\t\t }\n\t\t }\n\t\t return no + cur.first\n\t\t }","function lineNo(line) {\n\t\t if (line.parent == null) return null;\n\t\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t\t for (var i = 0;; ++i) {\n\t\t if (chunk.children[i] == cur) break;\n\t\t no += chunk.children[i].chunkSize();\n\t\t }\n\t\t }\n\t\t return no + cur.first;\n\t\t }","function lineNo(line) {\r\n if (line.parent == null) return null;\r\n var cur = line.parent, no = indexOf(cur.lines, line);\r\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\r\n for (var i = 0;; ++i) {\r\n if (chunk.children[i] == cur) break;\r\n no += chunk.children[i].chunkSize();\r\n }\r\n }\r\n return no + cur.first;\r\n }","function lineNo(line) {\n\t if (line.parent == null) return null;\n\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t for (var i = 0;; ++i) {\n\t if (chunk.children[i] == cur) break;\n\t no += chunk.children[i].chunkSize();\n\t }\n\t }\n\t return no + cur.first;\n\t }","function lineNo(line) {\n\t if (line.parent == null) return null;\n\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t for (var i = 0;; ++i) {\n\t if (chunk.children[i] == cur) break;\n\t no += chunk.children[i].chunkSize();\n\t }\n\t }\n\t return no + cur.first;\n\t }","function lineNo(line) {\n\t if (line.parent == null) return null;\n\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t for (var i = 0;; ++i) {\n\t if (chunk.children[i] == cur) break;\n\t no += chunk.children[i].chunkSize();\n\t }\n\t }\n\t return no + cur.first;\n\t }","function lineNo(line) {\r\n if (line.parent == null) { return null }\r\n var cur = line.parent, no = indexOf(cur.lines, line);\r\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\r\n for (var i = 0;; ++i) {\r\n if (chunk.children[i] == cur) { break }\r\n no += chunk.children[i].chunkSize();\r\n }\r\n }\r\n return no + cur.first\r\n}","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) return null;\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) break;\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first;\n }","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line);\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize();\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line)\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize()\n }\n }\n return no + cur.first\n}","function lineNo(line) {\n if (line.parent == null) { return null }\n var cur = line.parent, no = indexOf(cur.lines, line)\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n for (var i = 0;; ++i) {\n if (chunk.children[i] == cur) { break }\n no += chunk.children[i].chunkSize()\n }\n }\n return no + cur.first\n}","_getStartRefLineNumber(referenceNumber) {\n var refRef = PassageMarkdown.START_REF_PREFIX + referenceNumber;\n var ref = this.refs[refRef];\n\n if (!ref) {\n return null;\n }\n\n var $ref = $$1(ReactDOM$c.findDOMNode(ref)); // We really care about the first text after the ref, not the\n // ref element itself:\n\n var $refText = $ref.next();\n\n if ($refText.length === 0) {\n // But if there are no elements after the ref, just\n // use the ref itself.\n $refText = $ref;\n }\n\n var vPos = $refText.offset().top;\n return this.state.startLineNumbersAfter + 1 + this._convertPosToLineNumber(vPos);\n }","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\t\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","function heightAtLine(lineObj) {\r\n lineObj = visualLine(lineObj);\r\n\r\n var h = 0, chunk = lineObj.parent;\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i];\r\n if (line == lineObj) break;\r\n else h += line.height;\r\n }\r\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\r\n for (var i = 0; i < p.children.length; ++i) {\r\n var cur = p.children[i];\r\n if (cur == chunk) break;\r\n else h += cur.height;\r\n }\r\n }\r\n return h;\r\n }","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\t\t\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) break;\n\t\t else h += line.height;\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i = 0; i < p.children.length; ++i) {\n\t\t var cur = p.children[i];\n\t\t if (cur == chunk) break;\n\t\t else h += cur.height;\n\t\t }\n\t\t }\n\t\t return h;\n\t\t }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj)\n\n var h = 0, chunk = lineObj.parent\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i]\n if (line == lineObj) { break }\n else { h += line.height }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1]\n if (cur == chunk) { break }\n else { h += cur.height }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj)\n\n var h = 0, chunk = lineObj.parent\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i]\n if (line == lineObj) { break }\n else { h += line.height }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1]\n if (cur == chunk) { break }\n else { h += cur.height }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) { break }\n\t\t else { h += line.height; }\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n\t\t var cur = p.children[i$1];\n\t\t if (cur == chunk) { break }\n\t\t else { h += cur.height; }\n\t\t }\n\t\t }\n\t\t return h\n\t\t }","function heightAtLine(lineObj) {\r\n lineObj = visualLine(lineObj);\r\n\r\n var h = 0, chunk = lineObj.parent;\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i];\r\n if (line == lineObj) { break }\r\n else { h += line.height; }\r\n }\r\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\r\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\r\n var cur = p.children[i$1];\r\n if (cur == chunk) { break }\r\n else { h += cur.height; }\r\n }\r\n }\r\n return h\r\n}","getPrecedingValidLine(model, lineNumber, indentRulesSupport) {\r\n let languageID = model.getLanguageIdAtPosition(lineNumber, 0);\r\n if (lineNumber > 1) {\r\n let lastLineNumber;\r\n let resultLineNumber = -1;\r\n for (lastLineNumber = lineNumber - 1; lastLineNumber >= 1; lastLineNumber--) {\r\n if (model.getLanguageIdAtPosition(lastLineNumber, 0) !== languageID) {\r\n return resultLineNumber;\r\n }\r\n let text = model.getLineContent(lastLineNumber);\r\n if (indentRulesSupport.shouldIgnore(text) || /^\\s+$/.test(text) || text === '') {\r\n resultLineNumber = lastLineNumber;\r\n continue;\r\n }\r\n return lastLineNumber;\r\n }\r\n }\r\n return -1;\r\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function updateLineHeight(line, height) {\n var diff = height - line.height;\n\n if (diff) {\n for (var n = line; n; n = n.parent) {\n n.height += diff;\n }\n }\n } // Given a line object, find its line number by walking up through","function lineAtHeight(chunk, h) {\n\t\t var n = chunk.first;\n\t\t outer: do {\n\t\t for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n\t\t var child = chunk.children[i$1], ch = child.height;\n\t\t if (h < ch) { chunk = child; continue outer }\n\t\t h -= ch;\n\t\t n += child.chunkSize();\n\t\t }\n\t\t return n\n\t\t } while (!chunk.lines)\n\t\t var i = 0;\n\t\t for (; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i], lh = line.height;\n\t\t if (h < lh) { break }\n\t\t h -= lh;\n\t\t }\n\t\t return n + i\n\t\t }","get lineNumber() {\n return this._lineNum;\n }","function lineAtHeight(chunk, h) {\n\t\t var n = chunk.first;\n\t\t outer: do {\n\t\t for (var i = 0; i < chunk.children.length; ++i) {\n\t\t var child = chunk.children[i], ch = child.height;\n\t\t if (h < ch) { chunk = child; continue outer; }\n\t\t h -= ch;\n\t\t n += child.chunkSize();\n\t\t }\n\t\t return n;\n\t\t } while (!chunk.lines);\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i], lh = line.height;\n\t\t if (h < lh) break;\n\t\t h -= lh;\n\t\t }\n\t\t return n + i;\n\t\t }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function _lineAtHeight(chunk, h) {\n var n = chunk.first;\n\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1],\n ch = child.height;\n\n if (h < ch) {\n chunk = child;\n continue outer;\n }\n\n h -= ch;\n n += child.chunkSize();\n }\n\n return n;\n } while (!chunk.lines);\n\n var i = 0;\n\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i],\n lh = line.height;\n\n if (h < lh) {\n break;\n }\n\n h -= lh;\n }\n\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n }"],"string":"[\n \"function lineNo(line) {\\n\\t\\t if (line.parent == null) { return null }\\n\\t\\t var cur = line.parent, no = indexOf(cur.lines, line);\\n\\t\\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n\\t\\t for (var i = 0;; ++i) {\\n\\t\\t if (chunk.children[i] == cur) { break }\\n\\t\\t no += chunk.children[i].chunkSize();\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return no + cur.first\\n\\t\\t }\",\n \"function lineNo(line) {\\n\\t\\t if (line.parent == null) return null;\\n\\t\\t var cur = line.parent, no = indexOf(cur.lines, line);\\n\\t\\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n\\t\\t for (var i = 0;; ++i) {\\n\\t\\t if (chunk.children[i] == cur) break;\\n\\t\\t no += chunk.children[i].chunkSize();\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return no + cur.first;\\n\\t\\t }\",\n \"function lineNo(line) {\\r\\n if (line.parent == null) return null;\\r\\n var cur = line.parent, no = indexOf(cur.lines, line);\\r\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\r\\n for (var i = 0;; ++i) {\\r\\n if (chunk.children[i] == cur) break;\\r\\n no += chunk.children[i].chunkSize();\\r\\n }\\r\\n }\\r\\n return no + cur.first;\\r\\n }\",\n \"function lineNo(line) {\\n\\t if (line.parent == null) return null;\\n\\t var cur = line.parent, no = indexOf(cur.lines, line);\\n\\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n\\t for (var i = 0;; ++i) {\\n\\t if (chunk.children[i] == cur) break;\\n\\t no += chunk.children[i].chunkSize();\\n\\t }\\n\\t }\\n\\t return no + cur.first;\\n\\t }\",\n \"function lineNo(line) {\\n\\t if (line.parent == null) return null;\\n\\t var cur = line.parent, no = indexOf(cur.lines, line);\\n\\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n\\t for (var i = 0;; ++i) {\\n\\t if (chunk.children[i] == cur) break;\\n\\t no += chunk.children[i].chunkSize();\\n\\t }\\n\\t }\\n\\t return no + cur.first;\\n\\t }\",\n \"function lineNo(line) {\\n\\t if (line.parent == null) return null;\\n\\t var cur = line.parent, no = indexOf(cur.lines, line);\\n\\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n\\t for (var i = 0;; ++i) {\\n\\t if (chunk.children[i] == cur) break;\\n\\t no += chunk.children[i].chunkSize();\\n\\t }\\n\\t }\\n\\t return no + cur.first;\\n\\t }\",\n \"function lineNo(line) {\\r\\n if (line.parent == null) { return null }\\r\\n var cur = line.parent, no = indexOf(cur.lines, line);\\r\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\r\\n for (var i = 0;; ++i) {\\r\\n if (chunk.children[i] == cur) { break }\\r\\n no += chunk.children[i].chunkSize();\\r\\n }\\r\\n }\\r\\n return no + cur.first\\r\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) return null;\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) break;\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first;\\n }\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line);\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize();\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line)\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize()\\n }\\n }\\n return no + cur.first\\n}\",\n \"function lineNo(line) {\\n if (line.parent == null) { return null }\\n var cur = line.parent, no = indexOf(cur.lines, line)\\n for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\\n for (var i = 0;; ++i) {\\n if (chunk.children[i] == cur) { break }\\n no += chunk.children[i].chunkSize()\\n }\\n }\\n return no + cur.first\\n}\",\n \"_getStartRefLineNumber(referenceNumber) {\\n var refRef = PassageMarkdown.START_REF_PREFIX + referenceNumber;\\n var ref = this.refs[refRef];\\n\\n if (!ref) {\\n return null;\\n }\\n\\n var $ref = $$1(ReactDOM$c.findDOMNode(ref)); // We really care about the first text after the ref, not the\\n // ref element itself:\\n\\n var $refText = $ref.next();\\n\\n if ($refText.length === 0) {\\n // But if there are no elements after the ref, just\\n // use the ref itself.\\n $refText = $ref;\\n }\\n\\n var vPos = $refText.offset().top;\\n return this.state.startLineNumbersAfter + 1 + this._convertPosToLineNumber(vPos);\\n }\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\t\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"function heightAtLine(lineObj) {\\r\\n lineObj = visualLine(lineObj);\\r\\n\\r\\n var h = 0, chunk = lineObj.parent;\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i];\\r\\n if (line == lineObj) break;\\r\\n else h += line.height;\\r\\n }\\r\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\r\\n for (var i = 0; i < p.children.length; ++i) {\\r\\n var cur = p.children[i];\\r\\n if (cur == chunk) break;\\r\\n else h += cur.height;\\r\\n }\\r\\n }\\r\\n return h;\\r\\n }\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\t\\t\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) break;\\n\\t\\t else h += line.height;\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t\\t var cur = p.children[i];\\n\\t\\t if (cur == chunk) break;\\n\\t\\t else h += cur.height;\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h;\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj)\\n\\n var h = 0, chunk = lineObj.parent\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i]\\n if (line == lineObj) { break }\\n else { h += line.height }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1]\\n if (cur == chunk) { break }\\n else { h += cur.height }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj)\\n\\n var h = 0, chunk = lineObj.parent\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i]\\n if (line == lineObj) { break }\\n else { h += line.height }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1]\\n if (cur == chunk) { break }\\n else { h += cur.height }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) { break }\\n\\t\\t else { h += line.height; }\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n\\t\\t var cur = p.children[i$1];\\n\\t\\t if (cur == chunk) { break }\\n\\t\\t else { h += cur.height; }\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\r\\n lineObj = visualLine(lineObj);\\r\\n\\r\\n var h = 0, chunk = lineObj.parent;\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i];\\r\\n if (line == lineObj) { break }\\r\\n else { h += line.height; }\\r\\n }\\r\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\r\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\r\\n var cur = p.children[i$1];\\r\\n if (cur == chunk) { break }\\r\\n else { h += cur.height; }\\r\\n }\\r\\n }\\r\\n return h\\r\\n}\",\n \"getPrecedingValidLine(model, lineNumber, indentRulesSupport) {\\r\\n let languageID = model.getLanguageIdAtPosition(lineNumber, 0);\\r\\n if (lineNumber > 1) {\\r\\n let lastLineNumber;\\r\\n let resultLineNumber = -1;\\r\\n for (lastLineNumber = lineNumber - 1; lastLineNumber >= 1; lastLineNumber--) {\\r\\n if (model.getLanguageIdAtPosition(lastLineNumber, 0) !== languageID) {\\r\\n return resultLineNumber;\\r\\n }\\r\\n let text = model.getLineContent(lastLineNumber);\\r\\n if (indentRulesSupport.shouldIgnore(text) || /^\\\\s+$/.test(text) || text === '') {\\r\\n resultLineNumber = lastLineNumber;\\r\\n continue;\\r\\n }\\r\\n return lastLineNumber;\\r\\n }\\r\\n }\\r\\n return -1;\\r\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n\\n if (diff) {\\n for (var n = line; n; n = n.parent) {\\n n.height += diff;\\n }\\n }\\n } // Given a line object, find its line number by walking up through\",\n \"function lineAtHeight(chunk, h) {\\n\\t\\t var n = chunk.first;\\n\\t\\t outer: do {\\n\\t\\t for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n\\t\\t var child = chunk.children[i$1], ch = child.height;\\n\\t\\t if (h < ch) { chunk = child; continue outer }\\n\\t\\t h -= ch;\\n\\t\\t n += child.chunkSize();\\n\\t\\t }\\n\\t\\t return n\\n\\t\\t } while (!chunk.lines)\\n\\t\\t var i = 0;\\n\\t\\t for (; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i], lh = line.height;\\n\\t\\t if (h < lh) { break }\\n\\t\\t h -= lh;\\n\\t\\t }\\n\\t\\t return n + i\\n\\t\\t }\",\n \"get lineNumber() {\\n return this._lineNum;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n\\t\\t var n = chunk.first;\\n\\t\\t outer: do {\\n\\t\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t\\t var child = chunk.children[i], ch = child.height;\\n\\t\\t if (h < ch) { chunk = child; continue outer; }\\n\\t\\t h -= ch;\\n\\t\\t n += child.chunkSize();\\n\\t\\t }\\n\\t\\t return n;\\n\\t\\t } while (!chunk.lines);\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i], lh = line.height;\\n\\t\\t if (h < lh) break;\\n\\t\\t h -= lh;\\n\\t\\t }\\n\\t\\t return n + i;\\n\\t\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function _lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1],\\n ch = child.height;\\n\\n if (h < ch) {\\n chunk = child;\\n continue outer;\\n }\\n\\n h -= ch;\\n n += child.chunkSize();\\n }\\n\\n return n;\\n } while (!chunk.lines);\\n\\n var i = 0;\\n\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i],\\n lh = line.height;\\n\\n if (h < lh) {\\n break;\\n }\\n\\n h -= lh;\\n }\\n\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.76442444","0.7633338","0.760459","0.75937176","0.75937176","0.75937176","0.75879866","0.75715834","0.75715834","0.75715834","0.75715834","0.75715834","0.75715834","0.75715834","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7512249","0.7505289","0.7505289","0.6133257","0.6118993","0.61019176","0.60937756","0.6083303","0.6083303","0.6083303","0.6083303","0.6083303","0.6083303","0.6083303","0.60718286","0.60718286","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.6061608","0.60483843","0.60483843","0.6033139","0.60219336","0.6001372","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.5987521","0.59467924","0.5920573","0.5904709","0.58997875","0.5895681","0.5895681","0.5895681","0.5886846","0.588002","0.588002","0.588002"],"string":"[\n \"0.76442444\",\n \"0.7633338\",\n \"0.760459\",\n \"0.75937176\",\n \"0.75937176\",\n \"0.75937176\",\n \"0.75879866\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.75715834\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7512249\",\n \"0.7505289\",\n \"0.7505289\",\n \"0.6133257\",\n \"0.6118993\",\n \"0.61019176\",\n \"0.60937756\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.6083303\",\n \"0.60718286\",\n \"0.60718286\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.6061608\",\n \"0.60483843\",\n \"0.60483843\",\n \"0.6033139\",\n \"0.60219336\",\n \"0.6001372\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.5987521\",\n \"0.59467924\",\n \"0.5920573\",\n \"0.5904709\",\n \"0.58997875\",\n \"0.5895681\",\n \"0.5895681\",\n \"0.5895681\",\n \"0.5886846\",\n \"0.588002\",\n \"0.588002\",\n \"0.588002\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7587738"},"document_rank":{"kind":"string","value":"23"}}},{"rowIdx":4195,"cells":{"query":{"kind":"string","value":"Find the line at the given vertical position, using the height information in the document tree."},"document":{"kind":"string","value":"function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function updateLineHeight(line, height) {\n var diff = height - line.height;\n\n if (diff) {\n for (var n = line; n; n = n.parent) {\n n.height += diff;\n }\n }\n } // Given a line object, find its line number by walking up through","lineBlockAtHeight(height) {\n this.readMeasured();\n return this.viewState.lineBlockAtHeight(height);\n }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function lineAtHeight(chunk, h) {\n\t var n = chunk.first;\n\t outer: do {\n\t for (var i = 0; i < chunk.children.length; ++i) {\n\t var child = chunk.children[i], ch = child.height;\n\t if (h < ch) { chunk = child; continue outer; }\n\t h -= ch;\n\t n += child.chunkSize();\n\t }\n\t return n;\n\t } while (!chunk.lines);\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i], lh = line.height;\n\t if (h < lh) break;\n\t h -= lh;\n\t }\n\t return n + i;\n\t }","function lineAtHeight(chunk, h) {\n\t\t var n = chunk.first;\n\t\t outer: do {\n\t\t for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n\t\t var child = chunk.children[i$1], ch = child.height;\n\t\t if (h < ch) { chunk = child; continue outer }\n\t\t h -= ch;\n\t\t n += child.chunkSize();\n\t\t }\n\t\t return n\n\t\t } while (!chunk.lines)\n\t\t var i = 0;\n\t\t for (; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i], lh = line.height;\n\t\t if (h < lh) { break }\n\t\t h -= lh;\n\t\t }\n\t\t return n + i\n\t\t }","function lineAtHeight(chunk, h) {\n\t\t var n = chunk.first;\n\t\t outer: do {\n\t\t for (var i = 0; i < chunk.children.length; ++i) {\n\t\t var child = chunk.children[i], ch = child.height;\n\t\t if (h < ch) { chunk = child; continue outer; }\n\t\t h -= ch;\n\t\t n += child.chunkSize();\n\t\t }\n\t\t return n;\n\t\t } while (!chunk.lines);\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i], lh = line.height;\n\t\t if (h < lh) break;\n\t\t h -= lh;\n\t\t }\n\t\t return n + i;\n\t\t }","getYForLine(line) {\n const options = this.options;\n const spacing = options.spacing_between_lines_px;\n const headroom = options.space_above_staff_ln;\n\n const y = this.y + (line * spacing) + (headroom * spacing);\n\n return y;\n }","vertLineAt (x) { return this._vert[this.vertIdxAt(x)] }","function lineAtHeight(chunk, h) {\r\n var n = chunk.first;\r\n outer: do {\r\n for (var i = 0; i < chunk.children.length; ++i) {\r\n var child = chunk.children[i], ch = child.height;\r\n if (h < ch) { chunk = child; continue outer; }\r\n h -= ch;\r\n n += child.chunkSize();\r\n }\r\n return n;\r\n } while (!chunk.lines);\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i], lh = line.height;\r\n if (h < lh) break;\r\n h -= lh;\r\n }\r\n return n + i;\r\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i = 0; i < chunk.children.length; ++i) {\n var child = chunk.children[i], ch = child.height;\n if (h < ch) { chunk = child; continue outer; }\n h -= ch;\n n += child.chunkSize();\n }\n return n;\n } while (!chunk.lines);\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) break;\n h -= lh;\n }\n return n + i;\n }","function lineAtHeight(chunk, h) {\r\n var n = chunk.first;\r\n outer: do {\r\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\r\n var child = chunk.children[i$1], ch = child.height;\r\n if (h < ch) { chunk = child; continue outer }\r\n h -= ch;\r\n n += child.chunkSize();\r\n }\r\n return n\r\n } while (!chunk.lines)\r\n var i = 0;\r\n for (; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i], lh = line.height;\r\n if (h < lh) { break }\r\n h -= lh;\r\n }\r\n return n + i\r\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first;\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height;\n if (h < ch) { chunk = child; continue outer }\n h -= ch;\n n += child.chunkSize();\n }\n return n\n } while (!chunk.lines)\n var i = 0;\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height;\n if (h < lh) { break }\n h -= lh;\n }\n return n + i\n}","function _lineAtHeight(chunk, h) {\n var n = chunk.first;\n\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1],\n ch = child.height;\n\n if (h < ch) {\n chunk = child;\n continue outer;\n }\n\n h -= ch;\n n += child.chunkSize();\n }\n\n return n;\n } while (!chunk.lines);\n\n var i = 0;\n\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i],\n lh = line.height;\n\n if (h < lh) {\n break;\n }\n\n h -= lh;\n }\n\n return n + i;\n }","function lineAtHeight(chunk, h) {\n var n = chunk.first\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height\n if (h < ch) { chunk = child; continue outer }\n h -= ch\n n += child.chunkSize()\n }\n return n\n } while (!chunk.lines)\n var i = 0\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height\n if (h < lh) { break }\n h -= lh\n }\n return n + i\n}","function lineAtHeight(chunk, h) {\n var n = chunk.first\n outer: do {\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\n var child = chunk.children[i$1], ch = child.height\n if (h < ch) { chunk = child; continue outer }\n h -= ch\n n += child.chunkSize()\n }\n return n\n } while (!chunk.lines)\n var i = 0\n for (; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i], lh = line.height\n if (h < lh) { break }\n h -= lh\n }\n return n + i\n}","function getLocation(source, position) {\n let lastLineStart = 0;\n let line = 1;\n\n for (const match of source.body.matchAll(LineRegExp)) {\n typeof match.index === 'number' || invariant(false);\n\n if (match.index >= position) {\n break;\n }\n\n lastLineStart = match.index + match[0].length;\n line += 1;\n }\n\n return {\n line,\n column: position + 1 - lastLineStart,\n };\n}","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\t\t\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) break;\n\t\t else h += line.height;\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i = 0; i < p.children.length; ++i) {\n\t\t var cur = p.children[i];\n\t\t if (cur == chunk) break;\n\t\t else h += cur.height;\n\t\t }\n\t\t }\n\t\t return h;\n\t\t }","function heightAtLine(lineObj) {\n\t\t lineObj = visualLine(lineObj);\n\n\t\t var h = 0, chunk = lineObj.parent;\n\t\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t\t var line = chunk.lines[i];\n\t\t if (line == lineObj) { break }\n\t\t else { h += line.height; }\n\t\t }\n\t\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n\t\t var cur = p.children[i$1];\n\t\t if (cur == chunk) { break }\n\t\t else { h += cur.height; }\n\t\t }\n\t\t }\n\t\t return h\n\t\t }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj)\n\n var h = 0, chunk = lineObj.parent\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i]\n if (line == lineObj) { break }\n else { h += line.height }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1]\n if (cur == chunk) { break }\n else { h += cur.height }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj)\n\n var h = 0, chunk = lineObj.parent\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i]\n if (line == lineObj) { break }\n else { h += line.height }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1]\n if (cur == chunk) { break }\n else { h += cur.height }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\t\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","function heightAtLine(lineObj) {\r\n lineObj = visualLine(lineObj);\r\n\r\n var h = 0, chunk = lineObj.parent;\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i];\r\n if (line == lineObj) break;\r\n else h += line.height;\r\n }\r\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\r\n for (var i = 0; i < p.children.length; ++i) {\r\n var cur = p.children[i];\r\n if (cur == chunk) break;\r\n else h += cur.height;\r\n }\r\n }\r\n return h;\r\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) break;\n else h += line.height;\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i = 0; i < p.children.length; ++i) {\n var cur = p.children[i];\n if (cur == chunk) break;\n else h += cur.height;\n }\n }\n return h;\n }","getLine(x, y) {\n var cell = this.getCell(x, y)\n if (cell == null) return null\n if (cell.type !== 'line') return null\n return cell.line\n }","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","function heightAtLine(lineObj) {\n\t lineObj = visualLine(lineObj);\n\n\t var h = 0, chunk = lineObj.parent;\n\t for (var i = 0; i < chunk.lines.length; ++i) {\n\t var line = chunk.lines[i];\n\t if (line == lineObj) break;\n\t else h += line.height;\n\t }\n\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n\t for (var i = 0; i < p.children.length; ++i) {\n\t var cur = p.children[i];\n\t if (cur == chunk) break;\n\t else h += cur.height;\n\t }\n\t }\n\t return h;\n\t }","vertLine (idx) { return this._vert[idx] }","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\n lineObj = visualLine(lineObj);\n\n var h = 0, chunk = lineObj.parent;\n for (var i = 0; i < chunk.lines.length; ++i) {\n var line = chunk.lines[i];\n if (line == lineObj) { break }\n else { h += line.height; }\n }\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\n var cur = p.children[i$1];\n if (cur == chunk) { break }\n else { h += cur.height; }\n }\n }\n return h\n}","function heightAtLine(lineObj) {\r\n lineObj = visualLine(lineObj);\r\n\r\n var h = 0, chunk = lineObj.parent;\r\n for (var i = 0; i < chunk.lines.length; ++i) {\r\n var line = chunk.lines[i];\r\n if (line == lineObj) { break }\r\n else { h += line.height; }\r\n }\r\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\r\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\r\n var cur = p.children[i$1];\r\n if (cur == chunk) { break }\r\n else { h += cur.height; }\r\n }\r\n }\r\n return h\r\n}","function wordLinePosition() {\n $('.line-container').each(function () {\n line = $(this).find('.vertical-line');\n word = $(this).find('h2');\n wordInner = word.html();\n wordFuture = '';\n tran = .1 * wordInner.length;\n for (i = 0; i < wordInner.length; i++) {\n wordFuture += '<span style=\"right:' + 100 + 'px; \">' + wordInner[i] + '</span>';\n }\n word.html(wordFuture);\n line.attr('data-height', ($(this).height() - word.width() - 15));\n });\n}","function updateLineHeight(line, height) {\n\t\t var diff = height - line.height;\n\t\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t\t }","lineAt(pos) {\n if (pos < 0 || pos > this.length)\n throw new RangeError(`Invalid position ${pos} in document of length ${this.length}`);\n return this.lineInner(pos, false, 1, 0);\n }","function updateLineHeight(line, height) {\n\t var diff = height - line.height;\n\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t }","function updateLineHeight(line, height) {\n\t var diff = height - line.height;\n\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n\t }"],"string":"[\n \"function updateLineHeight(line, height) {\\n var diff = height - line.height;\\n\\n if (diff) {\\n for (var n = line; n; n = n.parent) {\\n n.height += diff;\\n }\\n }\\n } // Given a line object, find its line number by walking up through\",\n \"lineBlockAtHeight(height) {\\n this.readMeasured();\\n return this.viewState.lineBlockAtHeight(height);\\n }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t var n = chunk.first;\\n\\t outer: do {\\n\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t var child = chunk.children[i], ch = child.height;\\n\\t if (h < ch) { chunk = child; continue outer; }\\n\\t h -= ch;\\n\\t n += child.chunkSize();\\n\\t }\\n\\t return n;\\n\\t } while (!chunk.lines);\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i], lh = line.height;\\n\\t if (h < lh) break;\\n\\t h -= lh;\\n\\t }\\n\\t return n + i;\\n\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t\\t var n = chunk.first;\\n\\t\\t outer: do {\\n\\t\\t for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n\\t\\t var child = chunk.children[i$1], ch = child.height;\\n\\t\\t if (h < ch) { chunk = child; continue outer }\\n\\t\\t h -= ch;\\n\\t\\t n += child.chunkSize();\\n\\t\\t }\\n\\t\\t return n\\n\\t\\t } while (!chunk.lines)\\n\\t\\t var i = 0;\\n\\t\\t for (; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i], lh = line.height;\\n\\t\\t if (h < lh) { break }\\n\\t\\t h -= lh;\\n\\t\\t }\\n\\t\\t return n + i\\n\\t\\t }\",\n \"function lineAtHeight(chunk, h) {\\n\\t\\t var n = chunk.first;\\n\\t\\t outer: do {\\n\\t\\t for (var i = 0; i < chunk.children.length; ++i) {\\n\\t\\t var child = chunk.children[i], ch = child.height;\\n\\t\\t if (h < ch) { chunk = child; continue outer; }\\n\\t\\t h -= ch;\\n\\t\\t n += child.chunkSize();\\n\\t\\t }\\n\\t\\t return n;\\n\\t\\t } while (!chunk.lines);\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i], lh = line.height;\\n\\t\\t if (h < lh) break;\\n\\t\\t h -= lh;\\n\\t\\t }\\n\\t\\t return n + i;\\n\\t\\t }\",\n \"getYForLine(line) {\\n const options = this.options;\\n const spacing = options.spacing_between_lines_px;\\n const headroom = options.space_above_staff_ln;\\n\\n const y = this.y + (line * spacing) + (headroom * spacing);\\n\\n return y;\\n }\",\n \"vertLineAt (x) { return this._vert[this.vertIdxAt(x)] }\",\n \"function lineAtHeight(chunk, h) {\\r\\n var n = chunk.first;\\r\\n outer: do {\\r\\n for (var i = 0; i < chunk.children.length; ++i) {\\r\\n var child = chunk.children[i], ch = child.height;\\r\\n if (h < ch) { chunk = child; continue outer; }\\r\\n h -= ch;\\r\\n n += child.chunkSize();\\r\\n }\\r\\n return n;\\r\\n } while (!chunk.lines);\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i], lh = line.height;\\r\\n if (h < lh) break;\\r\\n h -= lh;\\r\\n }\\r\\n return n + i;\\r\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i = 0; i < chunk.children.length; ++i) {\\n var child = chunk.children[i], ch = child.height;\\n if (h < ch) { chunk = child; continue outer; }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n;\\n } while (!chunk.lines);\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) break;\\n h -= lh;\\n }\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\r\\n var n = chunk.first;\\r\\n outer: do {\\r\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\r\\n var child = chunk.children[i$1], ch = child.height;\\r\\n if (h < ch) { chunk = child; continue outer }\\r\\n h -= ch;\\r\\n n += child.chunkSize();\\r\\n }\\r\\n return n\\r\\n } while (!chunk.lines)\\r\\n var i = 0;\\r\\n for (; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i], lh = line.height;\\r\\n if (h < lh) { break }\\r\\n h -= lh;\\r\\n }\\r\\n return n + i\\r\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height;\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch;\\n n += child.chunkSize();\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0;\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height;\\n if (h < lh) { break }\\n h -= lh;\\n }\\n return n + i\\n}\",\n \"function _lineAtHeight(chunk, h) {\\n var n = chunk.first;\\n\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1],\\n ch = child.height;\\n\\n if (h < ch) {\\n chunk = child;\\n continue outer;\\n }\\n\\n h -= ch;\\n n += child.chunkSize();\\n }\\n\\n return n;\\n } while (!chunk.lines);\\n\\n var i = 0;\\n\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i],\\n lh = line.height;\\n\\n if (h < lh) {\\n break;\\n }\\n\\n h -= lh;\\n }\\n\\n return n + i;\\n }\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch\\n n += child.chunkSize()\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height\\n if (h < lh) { break }\\n h -= lh\\n }\\n return n + i\\n}\",\n \"function lineAtHeight(chunk, h) {\\n var n = chunk.first\\n outer: do {\\n for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {\\n var child = chunk.children[i$1], ch = child.height\\n if (h < ch) { chunk = child; continue outer }\\n h -= ch\\n n += child.chunkSize()\\n }\\n return n\\n } while (!chunk.lines)\\n var i = 0\\n for (; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i], lh = line.height\\n if (h < lh) { break }\\n h -= lh\\n }\\n return n + i\\n}\",\n \"function getLocation(source, position) {\\n let lastLineStart = 0;\\n let line = 1;\\n\\n for (const match of source.body.matchAll(LineRegExp)) {\\n typeof match.index === 'number' || invariant(false);\\n\\n if (match.index >= position) {\\n break;\\n }\\n\\n lastLineStart = match.index + match[0].length;\\n line += 1;\\n }\\n\\n return {\\n line,\\n column: position + 1 - lastLineStart,\\n };\\n}\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\t\\t\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) break;\\n\\t\\t else h += line.height;\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t\\t var cur = p.children[i];\\n\\t\\t if (cur == chunk) break;\\n\\t\\t else h += cur.height;\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h;\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\n\\t\\t lineObj = visualLine(lineObj);\\n\\n\\t\\t var h = 0, chunk = lineObj.parent;\\n\\t\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t\\t var line = chunk.lines[i];\\n\\t\\t if (line == lineObj) { break }\\n\\t\\t else { h += line.height; }\\n\\t\\t }\\n\\t\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t\\t for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n\\t\\t var cur = p.children[i$1];\\n\\t\\t if (cur == chunk) { break }\\n\\t\\t else { h += cur.height; }\\n\\t\\t }\\n\\t\\t }\\n\\t\\t return h\\n\\t\\t }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj)\\n\\n var h = 0, chunk = lineObj.parent\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i]\\n if (line == lineObj) { break }\\n else { h += line.height }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1]\\n if (cur == chunk) { break }\\n else { h += cur.height }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj)\\n\\n var h = 0, chunk = lineObj.parent\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i]\\n if (line == lineObj) { break }\\n else { h += line.height }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1]\\n if (cur == chunk) { break }\\n else { h += cur.height }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\t\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"function heightAtLine(lineObj) {\\r\\n lineObj = visualLine(lineObj);\\r\\n\\r\\n var h = 0, chunk = lineObj.parent;\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i];\\r\\n if (line == lineObj) break;\\r\\n else h += line.height;\\r\\n }\\r\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\r\\n for (var i = 0; i < p.children.length; ++i) {\\r\\n var cur = p.children[i];\\r\\n if (cur == chunk) break;\\r\\n else h += cur.height;\\r\\n }\\r\\n }\\r\\n return h;\\r\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) break;\\n else h += line.height;\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i = 0; i < p.children.length; ++i) {\\n var cur = p.children[i];\\n if (cur == chunk) break;\\n else h += cur.height;\\n }\\n }\\n return h;\\n }\",\n \"getLine(x, y) {\\n var cell = this.getCell(x, y)\\n if (cell == null) return null\\n if (cell.type !== 'line') return null\\n return cell.line\\n }\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"function heightAtLine(lineObj) {\\n\\t lineObj = visualLine(lineObj);\\n\\n\\t var h = 0, chunk = lineObj.parent;\\n\\t for (var i = 0; i < chunk.lines.length; ++i) {\\n\\t var line = chunk.lines[i];\\n\\t if (line == lineObj) break;\\n\\t else h += line.height;\\n\\t }\\n\\t for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n\\t for (var i = 0; i < p.children.length; ++i) {\\n\\t var cur = p.children[i];\\n\\t if (cur == chunk) break;\\n\\t else h += cur.height;\\n\\t }\\n\\t }\\n\\t return h;\\n\\t }\",\n \"vertLine (idx) { return this._vert[idx] }\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\n lineObj = visualLine(lineObj);\\n\\n var h = 0, chunk = lineObj.parent;\\n for (var i = 0; i < chunk.lines.length; ++i) {\\n var line = chunk.lines[i];\\n if (line == lineObj) { break }\\n else { h += line.height; }\\n }\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\n var cur = p.children[i$1];\\n if (cur == chunk) { break }\\n else { h += cur.height; }\\n }\\n }\\n return h\\n}\",\n \"function heightAtLine(lineObj) {\\r\\n lineObj = visualLine(lineObj);\\r\\n\\r\\n var h = 0, chunk = lineObj.parent;\\r\\n for (var i = 0; i < chunk.lines.length; ++i) {\\r\\n var line = chunk.lines[i];\\r\\n if (line == lineObj) { break }\\r\\n else { h += line.height; }\\r\\n }\\r\\n for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\\r\\n for (var i$1 = 0; i$1 < p.children.length; ++i$1) {\\r\\n var cur = p.children[i$1];\\r\\n if (cur == chunk) { break }\\r\\n else { h += cur.height; }\\r\\n }\\r\\n }\\r\\n return h\\r\\n}\",\n \"function wordLinePosition() {\\n $('.line-container').each(function () {\\n line = $(this).find('.vertical-line');\\n word = $(this).find('h2');\\n wordInner = word.html();\\n wordFuture = '';\\n tran = .1 * wordInner.length;\\n for (i = 0; i < wordInner.length; i++) {\\n wordFuture += '<span style=\\\"right:' + 100 + 'px; \\\">' + wordInner[i] + '</span>';\\n }\\n word.html(wordFuture);\\n line.attr('data-height', ($(this).height() - word.width() - 15));\\n });\\n}\",\n \"function updateLineHeight(line, height) {\\n\\t\\t var diff = height - line.height;\\n\\t\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t\\t }\",\n \"lineAt(pos) {\\n if (pos < 0 || pos > this.length)\\n throw new RangeError(`Invalid position ${pos} in document of length ${this.length}`);\\n return this.lineInner(pos, false, 1, 0);\\n }\",\n \"function updateLineHeight(line, height) {\\n\\t var diff = height - line.height;\\n\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t }\",\n \"function updateLineHeight(line, height) {\\n\\t var diff = height - line.height;\\n\\t if (diff) for (var n = line; n; n = n.parent) n.height += diff;\\n\\t }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.65733033","0.64114404","0.63363874","0.63363874","0.63363874","0.63167506","0.6293391","0.62653893","0.6253694","0.6222418","0.6202566","0.6202566","0.6202566","0.6202566","0.6202566","0.6202566","0.6202566","0.61813724","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61696094","0.61613566","0.61310756","0.61310756","0.6120014","0.60896236","0.60422105","0.6026916","0.6026916","0.60157615","0.5988982","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.59881324","0.5987036","0.5987036","0.5987036","0.5987036","0.5987036","0.5987036","0.5987036","0.59866166","0.59765464","0.59765464","0.5960052","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5952815","0.5944682","0.5912083","0.58298045","0.58115226","0.58009607","0.58009607"],"string":"[\n \"0.65733033\",\n \"0.64114404\",\n \"0.63363874\",\n \"0.63363874\",\n \"0.63363874\",\n \"0.63167506\",\n \"0.6293391\",\n \"0.62653893\",\n \"0.6253694\",\n \"0.6222418\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.6202566\",\n \"0.61813724\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61696094\",\n \"0.61613566\",\n \"0.61310756\",\n \"0.61310756\",\n \"0.6120014\",\n \"0.60896236\",\n \"0.60422105\",\n \"0.6026916\",\n \"0.6026916\",\n \"0.60157615\",\n \"0.5988982\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.59881324\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.5987036\",\n \"0.59866166\",\n \"0.59765464\",\n \"0.59765464\",\n \"0.5960052\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5952815\",\n \"0.5944682\",\n \"0.5912083\",\n \"0.58298045\",\n \"0.58115226\",\n \"0.58009607\",\n \"0.58009607\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.62214965"},"document_rank":{"kind":"string","value":"25"}}},{"rowIdx":4196,"cells":{"query":{"kind":"string","value":"A Pos instance represents a position within the text."},"document":{"kind":"string","value":"function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function Pos (line, ch) {\n if (!(this instanceof Pos)) { return new Pos(line, ch) }\n this.line = line; this.ch = ch\n}","function Pos(x, y) {\n this.x = x; this.y = y;\n}","function Pos(line, ch, sticky) {\n\t\t if ( sticky === void 0 ) sticky = null;\n\n\t\t if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n\t\t this.line = line;\n\t\t this.ch = ch;\n\t\t this.sticky = sticky;\n\t\t }","function Pos(x, y) {\n this.x = x || 0;\n this.y = y || 0;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line\n this.ch = ch\n this.sticky = sticky\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(line, ch, sticky) {\n if ( sticky === void 0 ) sticky = null;\n\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\n this.line = line;\n this.ch = ch;\n this.sticky = sticky;\n}","function Pos(x,y)\r\n{\r\n this.x = x;\r\n this.y = y;\r\n}","function Pos(line, ch, sticky) {\r\n if ( sticky === void 0 ) sticky = null;\r\n\r\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\r\n this.line = line;\r\n this.ch = ch;\r\n this.sticky = sticky;\r\n}","function Posn(x, y) {\n\tthis.x = x;\n \tthis.y = y;\n}","function Pos(row, col){\n this.row = row;\n this.col = col;\n this.toString = function(){\n return row + '/' + col;\n }\n}","function Position (x, y) {\n\t\tthis.x = x;\n\t\tthis.y = y;\n\t}","function position(val, norm_fn)\n{\n norm_fn = def(norm_fn, normalizePosition);\n\n var value = norm_fn(val);\n require(typeof value !== 'undefined',\n \"Cannot create Position instance from \" + repr(val));\n\n return new Position(value);\n}","function position(val, norm_fn)\n{\n norm_fn = def(norm_fn, normalizePosition);\n\n var value = norm_fn(val);\n require(typeof value !== 'undefined',\n \"Cannot create Position instance from \" + repr(val));\n\n return new Position(value);\n}","function Position (x, y) \n{\n\tthis.x = x;\n\tthis.y = y;\n}","function Position() {\n this.x = 0;\n this.y = 0;\n}","function Position(x, y)\n{\n\tthis.x = x;\n\tthis.y = y;\n}","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = { line: lineno, column: column };\n this.source = options.source;\n }","function Position(start) {\n this.start = start;\n this.end = {\n line: lineno,\n column\n };\n this.source = options.source;\n }","function Position(x,y){\n this.x = x;\n this.y = y;\n}","function Position(x,y){\n this.x = x;\n this.y = y;\n}","function Pos(x, y, z) {\r\n this.x = x;\r\n this.y = y;\r\n this.z = z;\r\n\r\n this.toString = function() {\r\n return this.x + ',' + this.y + (z ? ',' + z : '');\r\n };\r\n}","function Position(x, y){\n this.x = x;\n this.y = y;\n}","function Position(start) {\n this.start = start;\n this.end = now();\n }","function Position(start) {\n this.start = start;\n this.end = now();\n }","function Position(start) {\n this.start = start;\n this.end = now();\n }","function Position(start) {\n this.start = start;\n this.end = now();\n }","function Position(start) {\n this.start = start;\n this.end = now();\n }","function Position(start) {\n\t this.start = start;\n\t this.end = { line: lineno, column: column };\n\t this.source = options.source;\n\t }","function Position(start) {\n this.start = start\n this.end = {line: lineno, column: column}\n this.source = options.source\n }","constructor(pos) {\n this.pos = pos;\n }","function Position (x, y) {\n this.x = x;\n this.y = y;\n this.position = this;\n}","function pos() {\r\n var p = _pfa(arguments);\r\n\r\n if (p) {\r\n self.moveTo(p.x, p.y);\r\n }\r\n\r\n return new Pos(ie ? self.screenLeft : self.screenX,\r\n ie ? self.screenTop : self.screenY);\r\n}","function Position(start) {\n this.start = start\n this.end = now()\n }","function pos(...args) {\n return {\n id: \"pos\",\n pos: vec2(...args),\n\n // TODO: check physics here?\n move(...args) {\n const p = vec2(...args);\n const dx = p.x * dt();\n const dy = p.y * dt();\n\n this.pos.x += dx;\n this.pos.y += dy;\n },\n\n screenPos() {\n // If you disable this, camera Matrix still works\n return game.camMatrix.multVec2(this.pos);\n },\n\n inspect() {\n return {\n pos: `(${~~this.pos.x}, ${~~this.pos.y})`,\n };\n },\n };\n }","get pos()\n\t{\n\t\treturn new NodeGraph.Position(this.x, this.y);\n\t}","function Position() {\n /**\n * @param {integer} x\n * @param {integer} y\n */\n var Position = function(x, y) {\n this.x = x;\n this.y = y;\n }\n\n /**\n * @param {Position} anotherPosition\n * @returns {boolean}\n */\n Position.prototype.equals = function (anotherPosition) {\n return anotherPosition.x == this.x && anotherPosition.y == this.y;\n }\n\n return Position;\n }","coordsForChar(pos) {\n this.readMeasured();\n return this.docView.coordsForChar(pos);\n }","function Position(line, column) {\n\tvar self = new Position.create();\n\tself.line = line;\n\tself.column = column;\n\treturn self;\n}","function _pos() {\r\n var p = _pfa(arguments);\r\n if (p) {\r\n this.p = absPos(this, p);\r\n }\r\n return objCss(this, \"position\") == \"absolute\" ? this.p : absPos(this);\r\n}","function Position(left, top) {\n this.left = left;\n this.top = top;\n}","function Position(left, top) {\n this.left = left;\n this.top = top;\n}","set pos(newPos) {\n this._pos = newPos;\n }","function getPos() {\n\t\treturn _this.position;\n\t}","positionAt(offset) {\n const before = this.textDocument.slice(0, offset);\n const newLines = before.match(/\\n/g);\n const line = newLines ? newLines.length : 0;\n const preCharacters = before.match(/(\\n|^).*$/g);\n return new tokenizer_1.Position(line, preCharacters ? preCharacters[0].length : 0);\n }","constructor($pos) {\n let node = $pos.nodeAfter;\n let $end = $pos.node(0).resolve($pos.pos + node.nodeSize);\n super($pos, $end);\n this.node = node;\n }","function Player(pos) {\n this.type = 'player';\n this.pos = pos.plus(new Vector(0.1, 0.1));\n this.size = new Vector(0.9, 0.9);\n this.speed = new Vector(0, 0);\n}","function Line (position) {\n\tthis.position = position; \n}","function position(token) {\n return {start: point(token.start), end: point(token.end)}\n }","function PosWithInfo(line, ch, outside, xRel) {\n\t\t var pos = Pos(line, ch);\n\t\t pos.xRel = xRel;\n\t\t if (outside) pos.outside = true;\n\t\t return pos;\n\t\t }","constructor(x_pos, y_pos) {\n this.x_pos = x_pos;\n this.y_pos = y_pos;\n }","function position() {\n var before = now()\n\n return update\n\n // Add the position to a node.\n function update(node, indent) {\n var previous = node.position\n var start = previous ? previous.start : before\n var combined = []\n var n = previous && previous.end.line\n var l = before.line\n\n node.position = new Position(start)\n\n // If there was already a `position`, this node was merged. Fixing\n // `start` wasn’t hard, but the indent is different. Especially\n // because some information, the indent between `n` and `l` wasn’t\n // tracked. Luckily, that space is (should be?) empty, so we can\n // safely check for it now.\n if (previous && indent && previous.indent) {\n combined = previous.indent\n\n if (n < l) {\n while (++n < l) {\n combined.push((offset[n] || 0) + 1)\n }\n\n combined.push(before.column)\n }\n\n indent = combined.concat(indent)\n }\n\n node.position.indent = indent || []\n\n return node\n }\n }","addPosition(pos) {\n this.positions += '=\"'+pos.line + ':' + pos.linePosition + '\",';\n }","function PosWithInfo(line, ch, outside, xRel) {\n\t var pos = Pos(line, ch);\n\t pos.xRel = xRel;\n\t if (outside) pos.outside = true;\n\t return pos;\n\t }","function PosWithInfo(line, ch, outside, xRel) {\n\t var pos = Pos(line, ch);\n\t pos.xRel = xRel;\n\t if (outside) pos.outside = true;\n\t return pos;\n\t }","function PosWithInfo(line, ch, outside, xRel) {\n\t var pos = Pos(line, ch);\n\t pos.xRel = xRel;\n\t if (outside) pos.outside = true;\n\t return pos;\n\t }","constructor(pos, mark) {\n super();\n this.pos = pos;\n this.mark = mark;\n }","constructor(pos, mark) {\n super();\n this.pos = pos;\n this.mark = mark;\n }","function Coordinates(posX, posY){\n\tthis.posX = posX;\n\tthis.posY = posY;\n}","pos() {\n if (this.is_vertex()) {\n return this.position;\n } else {\n return this.offset;\n }\n }","createPosition () {\n\t\treturn {\n\t\t\tstart: {\n\t\t\t\tline: this.line,\n\t\t\t\tcolumn: this.col\n\t\t\t},\n\t\t\tsource: this.source,\n\t\t\trange: [ this.pos ]\n\t\t};\n\t}","positionAt(offset) {\n return (0, utils_1.positionAt)(offset, this.getText(), this.getLineOffsets());\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }","function PosWithInfo(line, ch, outside, xRel) {\n var pos = Pos(line, ch);\n pos.xRel = xRel;\n if (outside) pos.outside = true;\n return pos;\n }"],"string":"[\n \"function Pos (line, ch) {\\n if (!(this instanceof Pos)) { return new Pos(line, ch) }\\n this.line = line; this.ch = ch\\n}\",\n \"function Pos(x, y) {\\n this.x = x; this.y = y;\\n}\",\n \"function Pos(line, ch, sticky) {\\n\\t\\t if ( sticky === void 0 ) sticky = null;\\n\\n\\t\\t if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n\\t\\t this.line = line;\\n\\t\\t this.ch = ch;\\n\\t\\t this.sticky = sticky;\\n\\t\\t }\",\n \"function Pos(x, y) {\\n this.x = x || 0;\\n this.y = y || 0;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line\\n this.ch = ch\\n this.sticky = sticky\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(line, ch, sticky) {\\n if ( sticky === void 0 ) sticky = null;\\n\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\n this.line = line;\\n this.ch = ch;\\n this.sticky = sticky;\\n}\",\n \"function Pos(x,y)\\r\\n{\\r\\n this.x = x;\\r\\n this.y = y;\\r\\n}\",\n \"function Pos(line, ch, sticky) {\\r\\n if ( sticky === void 0 ) sticky = null;\\r\\n\\r\\n if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }\\r\\n this.line = line;\\r\\n this.ch = ch;\\r\\n this.sticky = sticky;\\r\\n}\",\n \"function Posn(x, y) {\\n\\tthis.x = x;\\n \\tthis.y = y;\\n}\",\n \"function Pos(row, col){\\n this.row = row;\\n this.col = col;\\n this.toString = function(){\\n return row + '/' + col;\\n }\\n}\",\n \"function Position (x, y) {\\n\\t\\tthis.x = x;\\n\\t\\tthis.y = y;\\n\\t}\",\n \"function position(val, norm_fn)\\n{\\n norm_fn = def(norm_fn, normalizePosition);\\n\\n var value = norm_fn(val);\\n require(typeof value !== 'undefined',\\n \\\"Cannot create Position instance from \\\" + repr(val));\\n\\n return new Position(value);\\n}\",\n \"function position(val, norm_fn)\\n{\\n norm_fn = def(norm_fn, normalizePosition);\\n\\n var value = norm_fn(val);\\n require(typeof value !== 'undefined',\\n \\\"Cannot create Position instance from \\\" + repr(val));\\n\\n return new Position(value);\\n}\",\n \"function Position (x, y) \\n{\\n\\tthis.x = x;\\n\\tthis.y = y;\\n}\",\n \"function Position() {\\n this.x = 0;\\n this.y = 0;\\n}\",\n \"function Position(x, y)\\n{\\n\\tthis.x = x;\\n\\tthis.y = y;\\n}\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = { line: lineno, column: column };\\n this.source = options.source;\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = {\\n line: lineno,\\n column\\n };\\n this.source = options.source;\\n }\",\n \"function Position(x,y){\\n this.x = x;\\n this.y = y;\\n}\",\n \"function Position(x,y){\\n this.x = x;\\n this.y = y;\\n}\",\n \"function Pos(x, y, z) {\\r\\n this.x = x;\\r\\n this.y = y;\\r\\n this.z = z;\\r\\n\\r\\n this.toString = function() {\\r\\n return this.x + ',' + this.y + (z ? ',' + z : '');\\r\\n };\\r\\n}\",\n \"function Position(x, y){\\n this.x = x;\\n this.y = y;\\n}\",\n \"function Position(start) {\\n this.start = start;\\n this.end = now();\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = now();\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = now();\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = now();\\n }\",\n \"function Position(start) {\\n this.start = start;\\n this.end = now();\\n }\",\n \"function Position(start) {\\n\\t this.start = start;\\n\\t this.end = { line: lineno, column: column };\\n\\t this.source = options.source;\\n\\t }\",\n \"function Position(start) {\\n this.start = start\\n this.end = {line: lineno, column: column}\\n this.source = options.source\\n }\",\n \"constructor(pos) {\\n this.pos = pos;\\n }\",\n \"function Position (x, y) {\\n this.x = x;\\n this.y = y;\\n this.position = this;\\n}\",\n \"function pos() {\\r\\n var p = _pfa(arguments);\\r\\n\\r\\n if (p) {\\r\\n self.moveTo(p.x, p.y);\\r\\n }\\r\\n\\r\\n return new Pos(ie ? self.screenLeft : self.screenX,\\r\\n ie ? self.screenTop : self.screenY);\\r\\n}\",\n \"function Position(start) {\\n this.start = start\\n this.end = now()\\n }\",\n \"function pos(...args) {\\n return {\\n id: \\\"pos\\\",\\n pos: vec2(...args),\\n\\n // TODO: check physics here?\\n move(...args) {\\n const p = vec2(...args);\\n const dx = p.x * dt();\\n const dy = p.y * dt();\\n\\n this.pos.x += dx;\\n this.pos.y += dy;\\n },\\n\\n screenPos() {\\n // If you disable this, camera Matrix still works\\n return game.camMatrix.multVec2(this.pos);\\n },\\n\\n inspect() {\\n return {\\n pos: `(${~~this.pos.x}, ${~~this.pos.y})`,\\n };\\n },\\n };\\n }\",\n \"get pos()\\n\\t{\\n\\t\\treturn new NodeGraph.Position(this.x, this.y);\\n\\t}\",\n \"function Position() {\\n /**\\n * @param {integer} x\\n * @param {integer} y\\n */\\n var Position = function(x, y) {\\n this.x = x;\\n this.y = y;\\n }\\n\\n /**\\n * @param {Position} anotherPosition\\n * @returns {boolean}\\n */\\n Position.prototype.equals = function (anotherPosition) {\\n return anotherPosition.x == this.x && anotherPosition.y == this.y;\\n }\\n\\n return Position;\\n }\",\n \"coordsForChar(pos) {\\n this.readMeasured();\\n return this.docView.coordsForChar(pos);\\n }\",\n \"function Position(line, column) {\\n\\tvar self = new Position.create();\\n\\tself.line = line;\\n\\tself.column = column;\\n\\treturn self;\\n}\",\n \"function _pos() {\\r\\n var p = _pfa(arguments);\\r\\n if (p) {\\r\\n this.p = absPos(this, p);\\r\\n }\\r\\n return objCss(this, \\\"position\\\") == \\\"absolute\\\" ? this.p : absPos(this);\\r\\n}\",\n \"function Position(left, top) {\\n this.left = left;\\n this.top = top;\\n}\",\n \"function Position(left, top) {\\n this.left = left;\\n this.top = top;\\n}\",\n \"set pos(newPos) {\\n this._pos = newPos;\\n }\",\n \"function getPos() {\\n\\t\\treturn _this.position;\\n\\t}\",\n \"positionAt(offset) {\\n const before = this.textDocument.slice(0, offset);\\n const newLines = before.match(/\\\\n/g);\\n const line = newLines ? newLines.length : 0;\\n const preCharacters = before.match(/(\\\\n|^).*$/g);\\n return new tokenizer_1.Position(line, preCharacters ? preCharacters[0].length : 0);\\n }\",\n \"constructor($pos) {\\n let node = $pos.nodeAfter;\\n let $end = $pos.node(0).resolve($pos.pos + node.nodeSize);\\n super($pos, $end);\\n this.node = node;\\n }\",\n \"function Player(pos) {\\n this.type = 'player';\\n this.pos = pos.plus(new Vector(0.1, 0.1));\\n this.size = new Vector(0.9, 0.9);\\n this.speed = new Vector(0, 0);\\n}\",\n \"function Line (position) {\\n\\tthis.position = position; \\n}\",\n \"function position(token) {\\n return {start: point(token.start), end: point(token.end)}\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n\\t\\t var pos = Pos(line, ch);\\n\\t\\t pos.xRel = xRel;\\n\\t\\t if (outside) pos.outside = true;\\n\\t\\t return pos;\\n\\t\\t }\",\n \"constructor(x_pos, y_pos) {\\n this.x_pos = x_pos;\\n this.y_pos = y_pos;\\n }\",\n \"function position() {\\n var before = now()\\n\\n return update\\n\\n // Add the position to a node.\\n function update(node, indent) {\\n var previous = node.position\\n var start = previous ? previous.start : before\\n var combined = []\\n var n = previous && previous.end.line\\n var l = before.line\\n\\n node.position = new Position(start)\\n\\n // If there was already a `position`, this node was merged. Fixing\\n // `start` wasn’t hard, but the indent is different. Especially\\n // because some information, the indent between `n` and `l` wasn’t\\n // tracked. Luckily, that space is (should be?) empty, so we can\\n // safely check for it now.\\n if (previous && indent && previous.indent) {\\n combined = previous.indent\\n\\n if (n < l) {\\n while (++n < l) {\\n combined.push((offset[n] || 0) + 1)\\n }\\n\\n combined.push(before.column)\\n }\\n\\n indent = combined.concat(indent)\\n }\\n\\n node.position.indent = indent || []\\n\\n return node\\n }\\n }\",\n \"addPosition(pos) {\\n this.positions += '=\\\"'+pos.line + ':' + pos.linePosition + '\\\",';\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n\\t var pos = Pos(line, ch);\\n\\t pos.xRel = xRel;\\n\\t if (outside) pos.outside = true;\\n\\t return pos;\\n\\t }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n\\t var pos = Pos(line, ch);\\n\\t pos.xRel = xRel;\\n\\t if (outside) pos.outside = true;\\n\\t return pos;\\n\\t }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n\\t var pos = Pos(line, ch);\\n\\t pos.xRel = xRel;\\n\\t if (outside) pos.outside = true;\\n\\t return pos;\\n\\t }\",\n \"constructor(pos, mark) {\\n super();\\n this.pos = pos;\\n this.mark = mark;\\n }\",\n \"constructor(pos, mark) {\\n super();\\n this.pos = pos;\\n this.mark = mark;\\n }\",\n \"function Coordinates(posX, posY){\\n\\tthis.posX = posX;\\n\\tthis.posY = posY;\\n}\",\n \"pos() {\\n if (this.is_vertex()) {\\n return this.position;\\n } else {\\n return this.offset;\\n }\\n }\",\n \"createPosition () {\\n\\t\\treturn {\\n\\t\\t\\tstart: {\\n\\t\\t\\t\\tline: this.line,\\n\\t\\t\\t\\tcolumn: this.col\\n\\t\\t\\t},\\n\\t\\t\\tsource: this.source,\\n\\t\\t\\trange: [ this.pos ]\\n\\t\\t};\\n\\t}\",\n \"positionAt(offset) {\\n return (0, utils_1.positionAt)(offset, this.getText(), this.getLineOffsets());\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\",\n \"function PosWithInfo(line, ch, outside, xRel) {\\n var pos = Pos(line, ch);\\n pos.xRel = xRel;\\n if (outside) pos.outside = true;\\n return pos;\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7744325","0.7327437","0.73072433","0.7230869","0.71548593","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.71528506","0.7148194","0.7127105","0.7103211","0.6844026","0.6655517","0.6566933","0.6566933","0.6507474","0.64926934","0.64920175","0.646197","0.646197","0.646197","0.646197","0.646197","0.646197","0.6434232","0.64169157","0.64169157","0.63986605","0.6389229","0.6337429","0.6337429","0.6337429","0.6337429","0.6337429","0.6327465","0.6300861","0.627286","0.6272165","0.62218726","0.6218545","0.6210536","0.6204215","0.61790115","0.60956097","0.60814655","0.60672486","0.60595465","0.60595465","0.5964843","0.58974004","0.5859352","0.58366567","0.5799277","0.57720196","0.57702565","0.57544386","0.5753342","0.5736101","0.57259005","0.5724562","0.5724562","0.5724562","0.56812173","0.56812173","0.56705624","0.5668737","0.5667145","0.5659565","0.56446326","0.56446326","0.56446326","0.56446326","0.56446326","0.56446326","0.56446326","0.56446326"],"string":"[\n \"0.7744325\",\n \"0.7327437\",\n \"0.73072433\",\n \"0.7230869\",\n \"0.71548593\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.71528506\",\n \"0.7148194\",\n \"0.7127105\",\n \"0.7103211\",\n \"0.6844026\",\n \"0.6655517\",\n \"0.6566933\",\n \"0.6566933\",\n \"0.6507474\",\n \"0.64926934\",\n \"0.64920175\",\n \"0.646197\",\n \"0.646197\",\n \"0.646197\",\n \"0.646197\",\n \"0.646197\",\n \"0.646197\",\n \"0.6434232\",\n \"0.64169157\",\n \"0.64169157\",\n \"0.63986605\",\n \"0.6389229\",\n \"0.6337429\",\n \"0.6337429\",\n \"0.6337429\",\n \"0.6337429\",\n \"0.6337429\",\n \"0.6327465\",\n \"0.6300861\",\n \"0.627286\",\n \"0.6272165\",\n \"0.62218726\",\n \"0.6218545\",\n \"0.6210536\",\n \"0.6204215\",\n \"0.61790115\",\n \"0.60956097\",\n \"0.60814655\",\n \"0.60672486\",\n \"0.60595465\",\n \"0.60595465\",\n \"0.5964843\",\n \"0.58974004\",\n \"0.5859352\",\n \"0.58366567\",\n \"0.5799277\",\n \"0.57720196\",\n \"0.57702565\",\n \"0.57544386\",\n \"0.5753342\",\n \"0.5736101\",\n \"0.57259005\",\n \"0.5724562\",\n \"0.5724562\",\n \"0.5724562\",\n \"0.56812173\",\n \"0.56812173\",\n \"0.56705624\",\n \"0.5668737\",\n \"0.5667145\",\n \"0.5659565\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\",\n \"0.56446326\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.72398067"},"document_rank":{"kind":"string","value":"16"}}},{"rowIdx":4197,"cells":{"query":{"kind":"string","value":"Compare two positions, return 0 if they are the same, a negative number when a is less, and a positive number otherwise."},"document":{"kind":"string","value":"function cmp(a, b) { return a.line - b.line || a.ch - b.ch }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function posCompare(a, b) {\n const yDiff = a[1] - b[1];\n if (yDiff !== 0) return yDiff;\n return a[0] - b[0];\n}","function compare(a,b) {\n if (a.x < b.x)\n return -1;\n if (a.x > b.x)\n return 1;\n return 0;\n }","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare (a, b) {\n return a > b ? 1 : a < b ? -1 : 0\n}","function compare(a, b) {\n if (a < b) {\n return -1\n } else if (b < a) {\n return 1\n } else {\n return 0\n }\n}","function compare(a, b) {\n return a < b ? -1 : a > b ? 1 : 0;\n}","function compare(a, b) {\n return a < b ? -1 : a > b ? 1 : 0;\n}","function compare(a, b) {\n return a < b ? -1 : a > b ? 1 : 0;\n}","function compare(a, b) {\n return a < b ? -1 : a > b ? 1 : 0;\n}","function compare(a, b) {\n return a < b ? -1 : a > b ? 1 : 0;\n}","function _comparePosition(a,b){return a.compareDocumentPosition?a.compareDocumentPosition(b):a.contains?(a!=b&&a.contains(b)&&16)+(a!=b&&b.contains(a)&&8)+(0<=a.sourceIndex&&0<=b.sourceIndex?(a.sourceIndex<b.sourceIndex&&4)+(a.sourceIndex>b.sourceIndex&&2):1)+0:0}","function compare(a, b) {\n\t return a < b ? -1 : a > b ? 1 : 0;\n\t}","function compare(a, b) {\n\t return a < b ? -1 : a > b ? 1 : 0;\n\t}","function compare(a, b) {\n return a > b ? 1 : a < b ? -1 : 0;\n}","function compare (a, b) {\n if (a > b) {\n return 1\n }\n else if (a < b) {\n return -1\n }\n return 0\n \n }","function compare(a, b) {\n if (a>b) return 1;\n if (a<b) return -1;\n }","function compare(a, b) {\n if (a.index < b.index)\n return -1;\n else (a.index > b.index)\n return 1;\n }","function compare(a, b) {\n if (a.index < b.index)\n return -1;\n else (a.index > b.index)\n return 1;\n }","function compare(a,b) {\n\t\t\t if (a.index < b.index)\n\t\t\t\treturn -1;\n\t\t\t if (a.index > b.index)\n\t\t\t\treturn 1;\n\t\t\t return 0;\n\t\t\t}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n }","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n }","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n var x = a.length;\n var y = b.length;\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n }","function compare( a, b ) {\n\tif ( a === b )\n\t\treturn 0;\n\tif ( a < b )\n\t\treturn -1;\n\treturn 1;\n}","function compare(a,b){\n var x = a.totalDiff;\n var y = b.totalDiff;\n if (x < y) {return -1;}\n if (x > y) {return 1;}\n return 0;\n }","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n\n if (y < x) {\n return 1;\n }\n\n return 0;\n }","comparePoints (a, b) {\n let comparison = 0\n\n if (a.points > b.points) {\n comparison = -1\n } else if (b.points > a.points) {\n comparison = 1\n }\n return comparison\n }","function compare(a, b){\n if(a.value < b.value)\n return -1;\n if(a.value > b.value)\n return 1;\n return 0;\n}","function compare(a, b) {\n if (a < b) return -1;\n if (a > b) return 1;\n return 0;\n}","compare(a, b) {\n if (a === b) return 0;\n return a < b ? -1 : 1;\n }","function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}","function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}","function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}","function compare(a, b) {\n if (a < b) {\n return -1;\n }\n if (a > b) {\n return 1;\n }\n // a must be equal to b\n return 0;\n }","function compare(a, b) {\n\t\t\tif (a.y === b.y) {\n\t\t\t return (a.x < b.x) ? -1 : 1;\n\t\t\t}\n\t\t\telse {\n\t\t\t return (a.y < b.y) ? -1 : 1;\n\t\t\t}\n\t\t}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n\n if (y < x) {\n return 1;\n }\n\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n\n if (y < x) {\n return 1;\n }\n\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n\n if (y < x) {\n return 1;\n }\n\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n\n if (y < x) {\n return 1;\n }\n\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}","function compare(a, b) {\n if (a === b) {\n return 0;\n }\n\n var x = a.length;\n var y = b.length;\n\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\n if (a[i] !== b[i]) {\n x = a[i];\n y = b[i];\n break;\n }\n }\n\n if (x < y) {\n return -1;\n }\n if (y < x) {\n return 1;\n }\n return 0;\n}"],"string":"[\n \"function posCompare(a, b) {\\n const yDiff = a[1] - b[1];\\n if (yDiff !== 0) return yDiff;\\n return a[0] - b[0];\\n}\",\n \"function compare(a,b) {\\n if (a.x < b.x)\\n return -1;\\n if (a.x > b.x)\\n return 1;\\n return 0;\\n }\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare (a, b) {\\n return a > b ? 1 : a < b ? -1 : 0\\n}\",\n \"function compare(a, b) {\\n if (a < b) {\\n return -1\\n } else if (b < a) {\\n return 1\\n } else {\\n return 0\\n }\\n}\",\n \"function compare(a, b) {\\n return a < b ? -1 : a > b ? 1 : 0;\\n}\",\n \"function compare(a, b) {\\n return a < b ? -1 : a > b ? 1 : 0;\\n}\",\n \"function compare(a, b) {\\n return a < b ? -1 : a > b ? 1 : 0;\\n}\",\n \"function compare(a, b) {\\n return a < b ? -1 : a > b ? 1 : 0;\\n}\",\n \"function compare(a, b) {\\n return a < b ? -1 : a > b ? 1 : 0;\\n}\",\n \"function _comparePosition(a,b){return a.compareDocumentPosition?a.compareDocumentPosition(b):a.contains?(a!=b&&a.contains(b)&&16)+(a!=b&&b.contains(a)&&8)+(0<=a.sourceIndex&&0<=b.sourceIndex?(a.sourceIndex<b.sourceIndex&&4)+(a.sourceIndex>b.sourceIndex&&2):1)+0:0}\",\n \"function compare(a, b) {\\n\\t return a < b ? -1 : a > b ? 1 : 0;\\n\\t}\",\n \"function compare(a, b) {\\n\\t return a < b ? -1 : a > b ? 1 : 0;\\n\\t}\",\n \"function compare(a, b) {\\n return a > b ? 1 : a < b ? -1 : 0;\\n}\",\n \"function compare (a, b) {\\n if (a > b) {\\n return 1\\n }\\n else if (a < b) {\\n return -1\\n }\\n return 0\\n \\n }\",\n \"function compare(a, b) {\\n if (a>b) return 1;\\n if (a<b) return -1;\\n }\",\n \"function compare(a, b) {\\n if (a.index < b.index)\\n return -1;\\n else (a.index > b.index)\\n return 1;\\n }\",\n \"function compare(a, b) {\\n if (a.index < b.index)\\n return -1;\\n else (a.index > b.index)\\n return 1;\\n }\",\n \"function compare(a,b) {\\n\\t\\t\\t if (a.index < b.index)\\n\\t\\t\\t\\treturn -1;\\n\\t\\t\\t if (a.index > b.index)\\n\\t\\t\\t\\treturn 1;\\n\\t\\t\\t return 0;\\n\\t\\t\\t}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n }\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n }\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n var x = a.length;\\n var y = b.length;\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n }\",\n \"function compare( a, b ) {\\n\\tif ( a === b )\\n\\t\\treturn 0;\\n\\tif ( a < b )\\n\\t\\treturn -1;\\n\\treturn 1;\\n}\",\n \"function compare(a,b){\\n var x = a.totalDiff;\\n var y = b.totalDiff;\\n if (x < y) {return -1;}\\n if (x > y) {return 1;}\\n return 0;\\n }\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n\\n if (y < x) {\\n return 1;\\n }\\n\\n return 0;\\n }\",\n \"comparePoints (a, b) {\\n let comparison = 0\\n\\n if (a.points > b.points) {\\n comparison = -1\\n } else if (b.points > a.points) {\\n comparison = 1\\n }\\n return comparison\\n }\",\n \"function compare(a, b){\\n if(a.value < b.value)\\n return -1;\\n if(a.value > b.value)\\n return 1;\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a < b) return -1;\\n if (a > b) return 1;\\n return 0;\\n}\",\n \"compare(a, b) {\\n if (a === b) return 0;\\n return a < b ? -1 : 1;\\n }\",\n \"function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}\",\n \"function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}\",\n \"function compare(a,b){if(a===b)return 0;for(var x=a.length,y=b.length,i=0,len=Math.min(x,y);i<len;++i)if(a[i]!==b[i]){x=a[i],y=b[i];break}return x<y?-1:y<x?1:0}\",\n \"function compare(a, b) {\\n if (a < b) {\\n return -1;\\n }\\n if (a > b) {\\n return 1;\\n }\\n // a must be equal to b\\n return 0;\\n }\",\n \"function compare(a, b) {\\n\\t\\t\\tif (a.y === b.y) {\\n\\t\\t\\t return (a.x < b.x) ? -1 : 1;\\n\\t\\t\\t}\\n\\t\\t\\telse {\\n\\t\\t\\t return (a.y < b.y) ? -1 : 1;\\n\\t\\t\\t}\\n\\t\\t}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n\\n if (y < x) {\\n return 1;\\n }\\n\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n\\n if (y < x) {\\n return 1;\\n }\\n\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n\\n if (y < x) {\\n return 1;\\n }\\n\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n\\n if (y < x) {\\n return 1;\\n }\\n\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\",\n \"function compare(a, b) {\\n if (a === b) {\\n return 0;\\n }\\n\\n var x = a.length;\\n var y = b.length;\\n\\n for (var i = 0, len = Math.min(x, y); i < len; ++i) {\\n if (a[i] !== b[i]) {\\n x = a[i];\\n y = b[i];\\n break;\\n }\\n }\\n\\n if (x < y) {\\n return -1;\\n }\\n if (y < x) {\\n return 1;\\n }\\n return 0;\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.798942","0.7316707","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7281275","0.7240236","0.7222929","0.7222929","0.7222929","0.7222929","0.7222929","0.7201643","0.72000194","0.72000194","0.71760553","0.7166889","0.7158215","0.71301687","0.71301687","0.7081427","0.7079217","0.7063667","0.70578253","0.7057233","0.70417905","0.7032547","0.70222205","0.7010204","0.70079434","0.6996345","0.6992868","0.6992868","0.6992868","0.69745326","0.697156","0.6964177","0.6964177","0.6964177","0.6964177","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577","0.69631577"],"string":"[\n \"0.798942\",\n \"0.7316707\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7281275\",\n \"0.7240236\",\n \"0.7222929\",\n \"0.7222929\",\n \"0.7222929\",\n \"0.7222929\",\n \"0.7222929\",\n \"0.7201643\",\n \"0.72000194\",\n \"0.72000194\",\n \"0.71760553\",\n \"0.7166889\",\n \"0.7158215\",\n \"0.71301687\",\n \"0.71301687\",\n \"0.7081427\",\n \"0.7079217\",\n \"0.7063667\",\n \"0.70578253\",\n \"0.7057233\",\n \"0.70417905\",\n \"0.7032547\",\n \"0.70222205\",\n \"0.7010204\",\n \"0.70079434\",\n \"0.6996345\",\n \"0.6992868\",\n \"0.6992868\",\n \"0.6992868\",\n \"0.69745326\",\n \"0.697156\",\n \"0.6964177\",\n \"0.6964177\",\n \"0.6964177\",\n \"0.6964177\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\",\n \"0.69631577\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4198,"cells":{"query":{"kind":"string","value":"Most of the external API clips given positions to make sure they actually exist within the document."},"document":{"kind":"string","value":"function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1))}"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function check_pos(){\n\t//Write our checking of all positions\n\n\tif (blob_pos_x > c_canvas.width - 20){\n\tblob_pos_x = blob_pos_x - 4;\n\t}\n\tif (blob_pos_x < 0){\n\tblob_pos_x = blob_pos_x + 4;\n\t}\n\tif (blob_pos_y > c_canvas.height - 20){\n\tblob_pos_y = blob_pos_y - 4;\n\t}\n\tif (blob_pos_y < 0){\n\tblob_pos_y = blob_pos_y + 4;\n\t}\n\n\n\t}","isValidPos(pos) {\n try {\n let x = pos[0];\n let y = pos[1];\n return ( (x > -1 && x < 8) && (y > -1 && y < 8) );\n } catch (error) {\n \n }\n }","function updateRelativePositions() {\n\n\tminPoiDistance = Number.MAX_VALUE;\n\tmaxPoiDistance = 0;\n\n\tfor (i=0, l=pois.length; i<l; i++) {\n\n\t\tvar poi = pois[i];\n\t\t\n\t\tif (poi.view) {\n\n\t\t\tpoi.distance = location_utils.calculateDistance(deviceLocation, poi);\n\t\t\t\n\t\t\t// this would ideally be more of a databinding event\n\t\t\tif (poi.controller) {\n\t\t\t\tpoi.controller.setDistance(location_utils.neatUSfromMeters(poi.distance));\n\t\t\t}\n\t\t\t\n\t\t\tif (poi.distance <= maxRange) {\n\t\t\t\t\n\t\t\t\tmaxPoiDistance = Math.max(maxPoiDistance, poi.distance);\n\t\t\t\tminPoiDistance = Math.min(minPoiDistance, poi.distance);\n\t\t\t\t\n\t\t\t\tpoi.inRange = true;\n\n\t\t\t\tpoi.bearing = location_utils.calculateBearing(deviceLocation, poi);\t\t\t\t\n\t\t\t} \n\t\t\telse {\n\t\t\t\t// don't show pois that are beyond maxDistance\n\t\t\t\tpoi.inRange = false;\n\t\t\t}\n\t\t}\n\t}\n\t\n\tpoiDistanceRange = maxPoiDistance - minPoiDistance;\n\n\t// Sort by Distance\n\tpois.sort(function(a, b) {\n\t\treturn b.distance - a.distance;\n\t});\n\n\t\t\t\t\n\tradarRange = Math.max(100, pois[0].distance);\n\n\tvar cnt = pois.length;\n\trankHeight = yRange / cnt;\n\t\n\tfor (i=0; i<cnt; i++) {\n\t\tpois[i].view.zIndex = i;\n\t\tpois[i].distanceRank = i;\n\t\tpositionRadarBlip(pois[i]);\n\t}\n}","function validatePosition()\n{\n this.p = collisionWithWallsInSector(this.p, this.prev_p, this.sector, DO_NOT_UPDATE_WALL_DIR);\n this.p = collisionWithSectorsInSector(this.p, this.prev_p, this.sector, DO_NOT_UPDATE_WALL_DIR);\n}","validatePosition() {\n\n }","static _checkRangesForContainment(rangeA, rangeB, collisionInfo, flipResultPositions)\n {\n if (flipResultPositions)\n {\n if (rangeA.max < rangeB.max || rangeA.min > rangeB.min) collisionInfo.shapeAContained = false;\t\t\t\t\n if (rangeB.max < rangeA.max || rangeB.min > rangeA.min) collisionInfo.shapeBContained = false;\t\n }\n else\n {\n if (rangeA.max > rangeB.max || rangeA.min < rangeB.min) collisionInfo.shapeAContained = false;\n if (rangeB.max > rangeA.max || rangeB.min < rangeA.min) collisionInfo.shapeBContained = false;\n }\n }","fullPositionsUpdate(positions) {\n const openPositions = [];\n\n for (const positionItem of positions) {\n const position = positionItem.data;\n\n if (position.symbol in this.positions && !['buy', 'sell'].includes(position.side.toLowerCase())) {\n delete this.positions[position.symbol];\n continue;\n }\n\n openPositions.push(position);\n }\n\n const currentPositions = {};\n\n for (const position of Bybit.createPositionsWithOpenStateOnly(openPositions)) {\n currentPositions[position.symbol] = position;\n }\n\n this.logger.debug(`Bybit: Positions via API updated: ${Object.keys(currentPositions).length}`);\n this.positions = currentPositions;\n }","function applyBoundaries(pos){\r\n\tif(pos.x < -planeWidth/2+5) pos.x = -planeWidth/2 + 5;\r\n\tif(pos.x > planeWidth/2-5) pos.x = planeWidth/2-5; \r\n\tif(pos.y > planeHeight/2-5) pos.y = planeHeight/2-5;\r\n\tif(pos.y < -planeHeight/2+5) pos.y = -planeHeight/2+5;\r\n}","function checkColl(position){\n if(position.x>=500 && position.y>380)\n return true;\n var platforms = document.getElementById(\"platforms\");\n for (var i = 0; i < platforms.childNodes.length; i++) {\n var node = platforms.childNodes.item(i);\n if (node.nodeName != \"rect\" && node.nodeName != \"line\") continue;\n\n if(node.nodeName == \"rect\"){\n var x = parseFloat(node.getAttribute(\"x\"));\n var y = parseFloat(node.getAttribute(\"y\"));\n var w = parseFloat(node.getAttribute(\"width\"));\n var h = parseFloat(node.getAttribute(\"height\"));\n var pos = new Point(x, y);\n var size = new Size(w, h);\n if (intersect(position, PLAYER_SIZE, pos, size))\n return true;\n } \n else if(node.nodeName == \"line\"){\n var x1 = parseFloat(node.getAttribute(\"x1\"));\n var x2 = parseFloat(node.getAttribute(\"x2\"));\n var y1 = parseFloat(node.getAttribute(\"y1\"));\n var y = y1-10.0;\n var w = x2-x1;\n var h = 20.0;\n var pos = new Point(x1, y);\n var size = new Size(w, h);\n\n if (intersect(position, PLAYER_SIZE, pos, size)) {\n return true;\n }\n }\n }\n return false;\n}","function checkPosition(id, x, y){\r\n let gameJson = reader.read(id).game;\r\n let gameMoves = gameJson.movements;\r\n if(x < 0 || x > 2 || y < 0 || y > 2)\r\n return WRONG_POS;\r\n for(let i = 0; i < gameMoves.length; i++){\r\n if(gameMoves[i].movement.x == x && gameMoves[i].movement.y == y)\r\n return WRONG_POS;\r\n }\r\n}","function checkAllShipsPlaced() {\n for (var p = 0; p < this.game.PLAYERS; p++) {\n for (var s = 0; s < fleet[p].length; s++) {\n\n if (fleet[p][s].length != fleet[p][s].coords.length) return false;\n\n for (var c = 0; c < fleet[p][s].coords.length; c++) {\n coords = fleet[p][s].coords[c];\n \n if (typeof layout[p][coords] == 'undefined') {\n return false;\n };\n }\n\n }\n }\n return true;\n }","function checkLoc(){\n for(var i = 0; i < food.length; i++){\n var distX = food[i].loc.x - snake.loc.x;\n var distY = food[i].loc.y - snake.loc.y;\n if(distX == (0) && distY == (0)){\n food.splice(i, 1);\n //removes the food\n //would add in a new food if that was the way I wanted it to be\n loadFood(0);\n snake.segments.push(createVector(0, 0));\n console.log(snake.segments.length)\n score++;\n }\n }\n}","checkAvailable(x, y, newShip, posNewShip) {\n const currentShips = _.flatten(this.allShipsPosition(this.ships));\n\n // Check to see if any overlap ?\n const overlapPos = _.find(currentShips, (ship) => {\n return _.find(posNewShip, (pos) => {\n return pos.x === ship.x && pos.y === ship.y;\n });\n });\n\n if (overlapPos || !this.checkRange(x, y, newShip)) {\n return false;\n }\n\n return true;\n }","isValidPosition(pos){\n return pos.x >=0 && pos.y >= 0 && pos.x < this.props.width && pos.y < this.props.height; \n }","function observeBoundaries(oldPos, newPos) {\r\n return (\r\n newPos[0] >= 0 &&\r\n newPos[0] <= MAP_WIDTH - SPRITE_SIZE &&\r\n newPos[1] >= 0 &&\r\n newPos[1] <= MAP_HEIGHT - SPRITE_SIZE\r\n );\r\n }","updatePositions(){\n this.api.get_positions(this.apiPositionListener)\n }","function checkCoordinates (startCoordinate, direction, length) {\n let noOverlap = true\n for (let i = 0; i < length; i++) {\n let newCoordinate = [startCoordinate[0] + i * direction[0], startCoordinate[1] + i * direction[1]]\n this.reservedCoordinates.forEach(coordinate => {\n let reservedX = coordinate[0]\n let reservedY = coordinate[1]\n let newX = newCoordinate[0]\n let newY = newCoordinate[1]\n if (reservedX === newX && reservedY === newY) {\n noOverlap = false\n } \n })\n }\n return noOverlap\n}","checkParticleBoundaries(){\n const particlesToRemove = [];\n Object.keys(this.particles).forEach( (id) => {\n const particle = this.particles[id];\n // if particle is out of bounds, add to particles to remove array\n if ( particle.posX > this.canvasWidth\n || particle.posX < 0\n || particle.posY > this.canvasHeight\n || particle.posY < 0\n ) {\n particlesToRemove.push(id);\n }\n });\n\n if (particlesToRemove.length > 0){\n\n particlesToRemove.forEach((id) => {\n // We're checking if the total particles exceed the max particles.\n // If the total particles exeeds max particles, we delete the particle\n // entry in the object. Otherwise, we just create a new particle\n // and insert it into the old particle's object id. This saves us\n // a little time above with generating a new UUID or running the delete command\n if (Object.keys(this.particles).length > this.maxParticles){\n delete this.particles[id];\n } else {\n this.particles[id] = this.makeRandomParticle();\n }\n });\n }\n }","function createClipping(pos){\n // Plane Equation is a*X + b*Y +c*Z + d = 0\n let res = TETRAMESH.makeSlice(0, 1, 0, Number(pos));\n let triCoord = res[\"vertex\"];\n let trisetData = res[\"data\"];\n let sliderValues;\n if (triCoord.length !== 0) {\n x3domUtils.updateCoordPoint(get(\"triSetCoordinate\"), triCoord);\n x3domUtils.updateDataValue(get(\"triSetAttr\"), trisetData);\n sliderValues = utils.getSliderMinMax(\"isoColor\", DATA_REAL_MIN, DATA_REAL_MAX);\n get(\"triSetIsoColor\").setAttribute(\"min\", sliderValues.min);\n get(\"triSetIsoColor\").setAttribute(\"max\", sliderValues.max);\n }\n}","isClear(positions) {\n const minX = min(positions.map(piece => piece.x));\n const maxX = max(positions.map(piece => piece.x));\n const minY = min(positions.map(piece => piece.y));\n const maxY = max(positions.map(piece => piece.y));\n\n if (minX < 0) { return false; }\n if (minY < 0) { return false; }\n if (maxX >= this.width) { return false; }\n if (maxY >= this.height) { return false; }\n\n return !some(positions, (position, a, b) => {\n if (this.getSquare(position.x, position.y)) { return true; }\n });\n }","checkCollisions(position) {\n\n // AABB collision\n function checkCollision(obj1, obj2) {\n // TODO: remove these magic numbers\n // obj1 is the player and obj2 are the blocks\n let w1 = 32;\n let h1 = 40;\n let w2 = 32;\n let h2 = 32;\n let collideX = obj1.x < obj2.x + w2 && obj1.x + w1 > obj2.x;\n let collideY = obj1.y < obj2.y + h2 && obj1.y + h1 > obj2.y;\n return collideX && collideY;\n }\n\n // some fancy ES6 to get the objects that aren't the player\n let notPlayer = objects.filter(o => o.sprite !== \"player\");\n for(let o of notPlayer) {\n if(checkCollision(position, o.location)) {\n // if we collide return what we collided with\n return o;\n }\n }\n\n // otherwise return null\n return null;\n }","function elementsOverlap(pos) {\n if (snake.x == pos.x && snake.y == pos.y)\n return true;\n if(food){\n if(food.x == pos.x && food.y == pos.y)\n return true;\n }\n if(barriers && barriers.length>0 && food){\n for(var i = 0; i < barriers.length; i++){\n for(var j = 0; j < barriers[i].positions.length; j++){\n if(barriers[i].positions[j].pos.x == pos.x && barriers[i].positions[j].pos.y == pos.y){\n return true;\n }\n if(barriers[i].positions[j].pos.x == food.x && barriers[i].positions[j].pos.y == food.y){\n return true;\n }\n }\n }\n }\n for (var i = 0; i < snake.tail.length; i++) {\n if (snake.tail[i].x == pos.x && snake.tail[i].y == pos.y)\n return true;\n }\n return false;\n}","function areCoordinatesInBounds (body) {\n var coordsValid = isMarkerInSFRectangleBoundary(parseFloat(body['loc_lat']), parseFloat(body['loc_long']))\n if (coordsValid) {\n console.log('coord in SF: pass')\n return true\n } else {\n console.log('coord in SF: fail')\n return false\n }\n}","function loadClippingURL(pos)\r\n\t{\r\n\tmarkRead(activeClippings[pos].id);\r\n\tn = open(activeClippings[pos].URL,\"win\"+activeClippings[pos].id);\r\n\t}","function observeBoundaries(oldPos, newPos) {\n return (newPos[0] >= 0 && newPos[0] <= MAP_WIDTH - SPRITE_SIZE) &&\n (newPos[1] >= 0 && newPos[1] <= MAP_HEIGHT - SPRITE_SIZE)\n}","function overlap(){ \n if(count === 0){\n console.log(\"Ok\");\n clearInterval(x);\n fall();\n }\n var fRect = floor.getBoundingClientRect();\n var cRect = cart.getBoundingClientRect();\n for(var i = 0; i < papers.length; i++){\n var p = document.querySelector(papers[i]);\n var pRect = p.getBoundingClientRect();\n var pcOffset = cRect.top - pRect.top;\n\tvar pcOffset2 = cRect.left - pRect.left;\n var pfOffset = pRect.top - fRect.top;\n if(pcOffset >= 0 && pcOffset <= 100){\n if(pcOffset2 >= -100 && pcOffset2 <= 100){\n p.style.display = \"none\";\n score += 1; \n count--;\n }\n }\n else if(pfOffset >= -200 && pfOffset <= -1){\n p.style.display = \"none\";\n count--;\n }\n }\n}","function check_for_isolated_squares(squares_pos) {\r\n\t//console.log(squares_pos);\r\n\tlet isolated = false;\r\n\tfor(let i in squares_pos) {\r\n\t\tif(squares_pos[i].x == -1 || squares_pos[i].y == -1) {\r\n\t\t\tconsole.log(\"Isolated square: \" + i);\r\n\t\t\tisolated = true;\r\n\t\t}\r\n\t}\r\n\treturn isolated;\r\n}","function legalmpos(x,y){\r\n\tif (x >= 0 && x <= 120 && y>=320) return false;\r\n var monsters = svgdoc.getElementById(\"monsters\");\r\n for (var i = 0; i < monsters.childNodes.length; i++) {\r\n\t\tpos1 = new Point(x,y);\r\n\t\tpos2 = new Point(monsters.childNodes[i].getAttribute(\"x\"), monsters.childNodes[i].getAttribute(\"y\"));\r\n\t\tif(intersect( pos1,OBJECT_DISTANCE,pos2,OBJECT_DISTANCE) )return false;\r\n\t}\r\n\treturn true;\r\n}","function goodThingCollides(position) {\n var platforms = document.getElementById(\"platforms\");\n\n for (var i = 0; i < platforms.childNodes.length; ++i) {\n var node = platforms.childNodes.item(i);\n\n if (node.nodeName != \"rect\")\n continue;\n\n if (collides(node, position, GOOD_THING_SIZE))\n return true;\n }\n\n var goodThings = document.getElementById(\"goodthings\");\n\n for (var i = 0; i < goodThings.childNodes.length; ++i) {\n var goodThing = goodThings.childNodes.item(i);\n var x = parseInt(goodThing.getAttribute(\"x\"));\n var y = parseInt(goodThing.getAttribute(\"y\"));\n\n if (intersect(position, GOOD_THING_SIZE, new Point(x, y), GOOD_THING_SIZE))\n return true;\n }\n\n if (intersect(position, GOOD_THING_SIZE, player.position, PLAYER_SIZE))\n return true;\n\n if (intersect(position, GOOD_THING_SIZE, EXIT_POSITION, EXIT_SIZE))\n return true;\n\n if (intersect(position, GOOD_THING_SIZE, PORTAL1_POSITION, PORTAL1_SIZE))\n return true;\n\n if (intersect(position, GOOD_THING_SIZE, PORTAL2_POSITION, PORTAL2_SIZE))\n return true;\n\n return false;\n}","function updatePositionsfinal() {\n var positions = line2.geometry.attributes.position.array;\n\n var x = 6; \n var y = 2.7; \n var z = -2.5;\n var index = 0;\n\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\n\n positions[ index ++ ] = x;\n positions[ index ++ ] = y;\n positions[ index ++ ] = z;\n\n x += (9/MAX_POINTS);\n y += (2.6/MAX_POINTS);\n }\n}","function updatePositionsincident() {\n var positions = line.geometry.attributes.position.array;\n\n var x = -16;\n var y = 0; \n var z = -2.5;\n var index = 0;\n\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\n\n positions[ index ++ ] = x;\n positions[ index ++ ] = y;\n positions[ index ++ ] = z;\n\n x += (11.78/MAX_POINTS);\n y += (3/MAX_POINTS);\n }\n}","fullPositionsUpdate(positions) {\n let openPositions = []\n\n for (const position of positions) {\n if (position['symbol'] in this.positions && !['buy', 'sell'].includes(position['side'].toLowerCase())) {\n delete this.positions[position.symbol]\n continue\n }\n\n openPositions.push(position)\n }\n\n let currentPositions = {}\n\n for(const position of Bybit.createPositionsWithOpenStateOnly(openPositions)) {\n currentPositions[position.symbol] = position\n }\n\n this.positions = currentPositions\n }","checkObstruction(startCoordinates, endCoordinates) {\n if (startCoordinates.x != endCoordinates.x) //moves in x\n {\n if (startCoordinates.x < endCoordinates.x)\n return this.checkObstructionForward(startCoordinates, endCoordinates, 'x')\n else if (startCoordinates.x > endCoordinates.x)\n return this.checkObstructionBackwards(startCoordinates, endCoordinates, 'x')\n } else if (startCoordinates.y != endCoordinates.y) //moves in y\n {\n if (startCoordinates.y < endCoordinates.y)\n return this.checkObstructionForward(startCoordinates, endCoordinates, 'y')\n else if (startCoordinates.y > endCoordinates.y)\n return this.checkObstructionBackwards(startCoordinates, endCoordinates, 'y')\n }\n\n }","checkForCollision(ps) {\n if( ps !== null ) { \n for(let i = 0; i < this.collisionSX.length; i++ ) {\n if( ps.position.x >= this.collisionSX[i] && ps.position.x <= this.collisionEX[i] ) {\n if( ps.position.y >= this.collisionSY[i] && ps.position.y <= this.collisionEY[i] ) {\n //print(\"collsion at shape \" + i);\n return true;\n }\n }\n }\n }\n\n return false; \n }","function confineInContainer(position, width, height, api) {\n\t var viewWidth = api.getWidth();\n\t var viewHeight = api.getHeight();\n\t position[0] = Math.min(position[0] + width, viewWidth) - width;\n\t position[1] = Math.min(position[1] + height, viewHeight) - height;\n\t position[0] = Math.max(position[0], 0);\n\t position[1] = Math.max(position[1], 0);\n\t}","function checkShipStatus(indShips, idAtPos, copyShips, ships) {\n\n for (var x = 0; x < indShips.length; x++) {\n\n //Looks for the ship position and removes it from indShips array\n if (indShips[x].includes(idAtPos)) {\n indShips[x].splice(indShips[x].indexOf(idAtPos), 1);\n\n //If after removing the ship returns an empty array, then return true\n if (indShips[x].length === 0) {\n copyShips.splice(copyShips.indexOf(ships[x]), 1);\n return [true, x, copyShips];\n }\n }\n }\n\n return [false, -1, copyShips];\n\n} //End checkShipStatus","getAround(pos) {\n var around = [];\n var aroundNotFree = [];\n var positions = [\n {\n x: pos.x,\n y: pos.y + 1\n },\n {\n x: pos.x,\n y: pos.y - 1\n },\n {\n x: pos.x + 1,\n y: pos.y\n },\n {\n x: pos.x - 1,\n y: pos.y\n },\n ];\n\n for (var index in positions) {\n var position = positions[index];\n try {\n this._handleBound(position);\n if (this.isFree(position)) {\n around.push(position);\n }\n else {\n aroundNotFree.push(position);\n }\n } catch (e) {\n //do nothing in this case\n }\n }\n\n return {free: around, notFree: aroundNotFree};\n }","function getNewPositionForFood(){\n // get all the xs and ys from snake body\n let xArr = yArr = [], xy;\n $.each(snake, function(index, value){\n if($.inArray(value.x, xArr) != -1){\n xArr.push(value.x);\n }\n if($.inArray(value.y, yArr) == -1) {\n yArr.push(value.y);\n }\n });\n xy = getEmptyXY(xArr, yArr);\n return xy;\n }","isValid(position) {\n\t\treturn position.x >= 0 && position.x < this.width\n\t\t && position.y >= 0 && position.y < this.height;\n\t}","function confineInContainer(position, width, height, api) {\n var viewWidth = api.getWidth();\n var viewHeight = api.getHeight();\n position[0] = Math.min(position[0] + width, viewWidth) - width;\n position[1] = Math.min(position[1] + height, viewHeight) - height;\n position[0] = Math.max(position[0], 0);\n position[1] = Math.max(position[1], 0);\n }","function confineInContainer(position, width, height, api) {\n var viewWidth = api.getWidth();\n var viewHeight = api.getHeight();\n position[0] = Math.min(position[0] + width, viewWidth) - width;\n position[1] = Math.min(position[1] + height, viewHeight) - height;\n position[0] = Math.max(position[0], 0);\n position[1] = Math.max(position[1], 0);\n }","function checkIfPosEmpty(targetPos: Vector3) { \n\tvar allObstacles: GameObject[] = GameObject.FindGameObjectsWithTag(\"Obstacle\"); \n\tfor each(var current in allObstacles) \n\t{ \n\t\tif(current.transform.position == targetPos){\n\t\t\t//Debug.Log(current.transform.position);\n\t\t\t// TODO: broadcast collide message\n\t\t\treturn false; \n\t\t}\n\t} \n\treturn true; \n}","function confineInContainer(position, width, height, api) {\n var viewWidth = api.getWidth();\n var viewHeight = api.getHeight();\n position[0] = Math.min(position[0] + width, viewWidth) - width;\n position[1] = Math.min(position[1] + height, viewHeight) - height;\n position[0] = Math.max(position[0], 0);\n position[1] = Math.max(position[1], 0);\n}","checkCoordinates(obj) {\n for (let elem of game.coordinates) {\n if (obj.x === elem.x && obj.y === elem.y) {\n if (elem.occupied) {\n return true;\n } else {\n return false;\n }\n }\n }\n }","function checkPosition() {\n // Für Ameise Schwarz\n for (let i = 0; i < Sem.ant.length; i++) {\n let a = Sem.ant[i];\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750 \n if (a.x >= 567 && a.x <= 750) {\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\n if (a.y >= 245 && a.y <= 429) {\n // Ruft Funktion für Game Over Screen auf\n gameLost();\n }\n }\n }\n // Für Ameise Braun\n for (let i = 0; i < Sem.antBrown.length; i++) {\n let b = Sem.antBrown[i];\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750\n if (b.x >= 567 && b.x <= 750) {\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\n if (b.y >= 245 && b.y <= 429) {\n // Ruft Funktion für Game Over Screen auf\n gameLost();\n }\n }\n }\n // Für Ameise Rot\n for (let i = 0; i < Sem.antRed.length; i++) {\n let r = Sem.antRed[i];\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750\n if (r.x >= 567 && r.x <= 750) {\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\n if (r.y >= 245 && r.y <= 429) {\n // Ruft Funktion für Game Over Screen auf\n gameLost();\n }\n }\n }\n }","function optimizeAnchors(positions) {\n return positions.map((position, index) => {\n const others = [...positions.slice(0, index), ...positions.slice(index + 1)];\n const othersBearing = getBearingFromOtherPoints(position, others);\n return {\n lngLat: position.lngLat,\n anchor: getAnchor(position.axis, othersBearing),\n };\n });\n}","function checkShipPlacement() {\n if (!displayGrid.querySelector('.ship')) allShipsPlaced = true;\n }","function checkFoodCordinates(){\n if (snakeCordinates[0].xaxis==foodxaxis && snakeCordinates[0].yaxis==foodyaxis){\n var addingTail={\n \txaxis:snakeCordinates[0].xaxis+dx,\n \tyaxis:snakeCordinates[0].yaxis+dy\n }\n snakeCordinates.unshift(addingTail);\n food();\n score+=1;\n functionscore();\n\n }\n}","static computeClippedPointIndices(clippedPoints, originalPoints) {\n const isClipped = (p) => originalPoints.find(q => q.equals(p)) === undefined;\n return new Set(clippedPoints.map((p, i) => (isClipped(p) ? i : -1)).filter(i => i !== -1));\n }","function checkStandingFLC(pos) {\n let legX = bodyParts[PartEnums.TORSO].x - bodyParts[PartEnums.TORSO].width / 2.5;\n let legY = bodyParts[PartEnums.TORSO].y;\n return pos.x >= legX && pos.x <= (legX + 30) && pos.y >= legY && pos.y <= legY + 100;\n}","function checkForGuideArea(dataArray, position) {\n let possibleGuideAreas = getClosest(dataArray,position);\n if (possibleGuideAreas.distance < 0.1) {\n addGuide(possibleGuideAreas.closest.text);\n } else {\n removeGuide();\n }\n}","fullPositionsUpdate(positions) {\n const openPositions = [];\n\n for (const position of positions) {\n if (position.symbol in this.positions && position.isOpen !== true) {\n delete this.positions[position.symbol];\n } else {\n openPositions.push(position);\n }\n }\n\n const currentPositions = {};\n\n for (const position of Bitmex.createPositionsWithOpenStateOnly(openPositions)) {\n currentPositions[position.symbol] = position;\n }\n\n this.positions = currentPositions;\n }","getEmptyPositionsWithSpaceWithWalls() {\n var emptyPositions = this.getEmptyPositions();\n var res = emptyPositions.filter(p => (((GameConfig.WIDTH - 3) >= p.x) && ((GameConfig.HEIGHT - 3) >= p.y)) && ((2 <= p.x) && (2 <= p.y)));\n return res;\n }","get positionOptions() {\n if (!this.args.positions) {\n return [];\n }\n\n // Include INACTVE positions if the person has it so it can be unchecked\n let filteredPositions = this.args.positions.filter(position => {\n return position.active || this.args.positionIds.includes(position.id)\n });\n\n return filteredPositions.map((position) => {\n return [positionLabel([position]), position.id];\n });\n }","checkCollide(pos1, pos2){\n if (Math.abs(pos1[0] - pos2[0]) < 50 &&\n pos1[1] === pos2[1]){\n\n return true;\n } else {\n return false;\n }\n }","function checkPos(androidReq){\n console.log(\"CHECK\");\n\n if(pos != null) {\n var point = null;\n var dist = null;\n\n Tour.find({_id: \"58d26bd01c539c795303bb2f\"}, function (err, docs) {\n if(pos < docs[0].tour.length) {\n if (!err) {\n point = docs[0].tour[pos];\n if (point != null) {\n dist = getDistanceFromLatLonInKm(point.latitude, point.longitude, androidReq.latitude, androidReq.longitude) * 1000;\n }\n }\n console.log(\"Distance: \" + dist);\n if (dist < 5) {\n console.log(point.name);\n if(pos + 1 < docs[0].tour.length){\n pos++;\n point =docs[0].tour[pos];\n main.updateDronePos(\n {\n \"latitude\": point.latitude,\n \"longitude\": point.longitude\n }\n );\n }\n\n }\n current_pos = docs[0].tour[pos-1];\n }\n });\n }\n}","function usePositions(props, hostElement, calloutElement, targetRef, getBounds) {\n var _a = react__WEBPACK_IMPORTED_MODULE_0__.useState(), positions = _a[0], setPositions = _a[1];\n var positionAttempts = react__WEBPACK_IMPORTED_MODULE_0__.useRef(0);\n var previousTarget = react__WEBPACK_IMPORTED_MODULE_0__.useRef();\n var async = (0,_fluentui_react_hooks__WEBPACK_IMPORTED_MODULE_6__.useAsync)();\n var hidden = props.hidden, target = props.target, finalHeight = props.finalHeight, onPositioned = props.onPositioned, directionalHint = props.directionalHint;\n react__WEBPACK_IMPORTED_MODULE_0__.useEffect(function () {\n if (!hidden) {\n var timerId_1 = async.requestAnimationFrame(function () {\n // If we expect a target element to position against, we need to wait until `targetRef.current`\n // is resolved. Otherwise we can try to position.\n var expectsTarget = !!target;\n if (hostElement.current && calloutElement.current && (!expectsTarget || targetRef.current)) {\n var currentProps = (0,tslib__WEBPACK_IMPORTED_MODULE_7__.__assign)((0,tslib__WEBPACK_IMPORTED_MODULE_7__.__assign)({}, props), { target: targetRef.current, bounds: getBounds() });\n var previousPositions = previousTarget.current === target ? positions : undefined;\n // If there is a finalHeight given then we assume that the user knows and will handle\n // additional positioning adjustments so we should call positionCard\n var newPositions = finalHeight\n ? (0,_Positioning__WEBPACK_IMPORTED_MODULE_5__.positionCard)(currentProps, hostElement.current, calloutElement.current, previousPositions)\n : (0,_Positioning__WEBPACK_IMPORTED_MODULE_5__.positionCallout)(currentProps, hostElement.current, calloutElement.current, previousPositions);\n // Set the new position only when the positions are not exists or one of the new callout positions\n // are different. The position should not change if the position is within 2 decimal places.\n if ((!positions && newPositions) ||\n (positions && newPositions && !arePositionsEqual(positions, newPositions) && positionAttempts.current < 5)) {\n // We should not reposition the callout more than a few times, if it is then the content is likely resizing\n // and we should stop trying to reposition to prevent a stack overflow.\n positionAttempts.current++;\n setPositions(newPositions);\n }\n else if (positionAttempts.current > 0) {\n // Only call the onPositioned callback if the callout has been re-positioned at least once.\n positionAttempts.current = 0;\n onPositioned === null || onPositioned === void 0 ? void 0 : onPositioned(positions);\n }\n }\n }, calloutElement.current);\n previousTarget.current = target;\n return function () {\n async.cancelAnimationFrame(timerId_1);\n previousTarget.current = undefined;\n };\n }\n }, [\n hidden,\n directionalHint,\n async,\n calloutElement,\n hostElement,\n targetRef,\n finalHeight,\n getBounds,\n onPositioned,\n positions,\n props,\n target,\n ]);\n return positions;\n}","closestPointTo(position, closest, exclude) {\n if (this.visible && this.objects !== undefined) {\n for (let i = 0; i < this.objects.length; i++) {\n this.objects[i].closestPointTo(position, closest, exclude);\n }\n }\n }","function validate_click(posClicked) {\r\n for(var i = 0;i<$scope.movidasPosibles.length;i++){\r\n var pos = JSON.parse(\"[\" + posClicked + \"]\");\r\n if($scope.movidasPosibles[i][0]===pos[0] && $scope.movidasPosibles[i][1] ===pos[1]){\r\n $scope.http_request.body.x = pos[0];//guarda las posiciones clickeadas\r\n $scope.http_request.body.y = pos[1];//al final se va mantener siempre una posicion guardada\r\n return true;\r\n }\r\n }\r\n return false;\r\n }","function addClipping()\r\n\t{\r\n\tnewClipping = this.id.substring(3,this.id.length)\r\n\tduplicate = false;\r\n\tfor (i=0; i < allClippings.length; i++) //find the position the allClippings array of the selected clipping\r\n\t\t{\r\n\t\tif (newClipping == allClippings[i].id) {pos = i; i = allClippings.length}\r\n\t\t}\r\n\t\t\r\n\tif (activeClippings.length > 0)\tcheckForDuplicates() //make sure clipping is not already seletected\r\n\t\r\n\tif (!duplicate)\r\n\t{\t\r\n\t\teventCheckForCookies();\r\n\t\tif (cookiesOn == true)\r\n\t\t\t{\r\n\t\t\tactiveClippings[activeClippings.length] = new Clipping(allClippings[pos].id,allClippings[pos].headline,allClippings[pos].URL);\r\n\t\t\t\r\n\t\t\t//find all instances of the clipping in article and hides it\r\n\t \t\tclippingInstanceVisibility(this.id,'hidden') \r\n\t \t\t\r\n\t \t\tdrawClippings();\t\r\n\t \t\tevent.cancleBubble = true;\r\n\t \t\tupdateClippingCounter();\r\n\t\t\tsaveClippings();\r\n\t\t \t}\r\n\t \t}\r\n\t}","moveTo(pos) {\n let { cursor } = this, p = pos - this.offset;\n while (!this.done && cursor.from < p) {\n if (cursor.to >= pos && cursor.enter(p, 1, exports.IterMode.IgnoreOverlays | exports.IterMode.ExcludeBuffers)) ;\n else if (!cursor.next(false))\n this.done = true;\n }\n }","function checkPosition() {\n const offset = reposition(prevFocused);\n if (offset.top !== prevOffset.top || offset.left !== prevOffset.left || offset.width !== prevOffset.width || offset.height !== prevOffset.height) {\n // console.log(\"Changed focus position\", offset, prevFocused);\n prevOffset = offset;\n staticCounter = 0;\n } else {\n staticCounter++;\n }\n if (staticCounter < 3) {\n // at the beginning and as long as we see position changes\n // we will check the position/bounds more often\n positionTimeout = setTimeout(checkPosition, 100);\n } else {\n // we want to measure at least every 2 seconds\n positionTimeout = setTimeout(checkPosition, 1000);\n }\n }","function checkLaps(laps, lapCount) {\n\n for (var j = 0;\n j < laps.length;\n j++) {\n\n // Has name?\n var name = laps[j].name;\n // if (name == undefined || name.length == 0) {\n\n // alert(\"Warning: invalid name for element \" + j);\n // }\n\n // Has placings?\n var places = laps[j].placing;\n // if (places == undefined) {\n\n // alert(\"Warning: missing placings for element \" + j + \" (\" + name + \")\");\n // }\n // else if (places.length == 0 || places.length > lapCount + 1) {\n\n // alert(\"Warning: invalid number of placings (\" + places.length + \") for element \" + j +\n // \" (\" + name + \") - expected between 1 and \" + (lapCount - 1));\n // }\n\n // Check markers.\n var maxLaps = places.length;\n //checkMarker(laps[j].pitstops, \"pitstop\", maxLaps, j, name);\n //checkMarker(laps[j].mechanical, \"mechanical\", maxLaps, j, name);\n checkMarker(laps[j].accident, \"accident\", maxLaps, j, name);\n }\n\n for (var i = 0;\n i < lapCount;\n i++) {\n\n var positions = [];\n for (j = 0;\n j < laps.length;\n j++) {\n\n places = laps[j].placing;\n if (places.length > i) {\n\n // Valid placing?\n var placing = places[i];\n // if (isNaN(placing) || placing < 1 || placing % 1 != 0) {\n\n // alert(\"Warning: invalid placing '\" + placing + \"' for \" + laps[j].name)\n // }\n // else {\n\n // var count = positions[placing];\n // positions[placing] = isNaN(count) ? 1 : count + 1\n // }\n }\n }\n\n // Check for duplicate/missing positions.\n for (j = 1;\n j < positions.length;\n j++) {\n\n count = positions[j];\n if (count != 1) {\n\n alert(\"Warning: data inconsistent: lap \" + i + \", position \" + j + \", count \" + count);\n }\n }\n }\n}","ifInBound(currentPos, coordinates1, coordinates2){\n \n //check for inverted squares\n if(coordinates1.latitude < coordinates2.latitude){\n //swap\n var temp = coordinates1\n coordinates1 = coordinates2\n coordinates2 = temp\n }\n else{\n\n }\n console.log(\"====ALL MY COORDINATES ==== \")\n console.log(currentPos)\n console.log(coordinates1)\n console.log(coordinates2)\n\n if((currentPos.coords.latitude <= coordinates1.latitude) && (currentPos.coords.latitude >= coordinates2.latitude)){\n console.log(\"latitude inbound\")\n if((currentPos.coords.longitude >= coordinates1.longitude) && (currentPos.coords.longitude <= coordinates2.longitude)){\n console.log(\"longitude inbound\")\n return true\n }\n }\n return false\n\n }","function markOccupiedSpots() {\n \n\t\tif(!spotsInitialized || playersInitialized < 2) {\n \n\t\t\treturn null;\n \n } // end if statement\n\t\n\t\tfor(var i = 0; i<10; i++) {\n \n\t\t\tfindClosestSpot(myMarbles[i].x, myMarbles[i].y).isEmpty = false;\n\t\t\tfindClosestSpot(othersMarbles[i].x, othersMarbles[i].y).isEmpty = false;\n \n\t\t} // end for loop\n \n\t} // end markOccupiedSpots()","checkPosition(){\r\n if(isCriticalPosition(this.pos)){\r\n //if((this.pos.x-8)%16 == 0 && (this.pos.y-8)%16 == 0){//checks if pacman is on a critical spot\r\n //let arrPosition = createVector((this.pos.x-8)/16, (this.pos.y-8)/16);//changes location to an array position\r\n let arrPosition = pixelToTile(this.pos);\r\n //resets all paths for the ghosts\r\n //this.blinky.setPath();\r\n //this.pinky.setPath();\r\n //this.clyde.setPath();\r\n //this.inky.setPath();\r\n //Checks if the position has been eaten or not, blank spaces are considered eaten\r\n if(!this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten){\r\n this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten = true;\r\n //score+=10;//adds points for eating\r\n this.score+=1;\r\n this.dotsEaten++;\r\n this.ttl = 600;\r\n if(this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].bigDot){//checks if the big dot is eaten\r\n //set all ghosts to frightened mode\r\n if(!this.blinky.goHome && !this.blinky.tempDead){\r\n this.blinky.frightened = true;\r\n this.blinky.flashCount = 0;\r\n }if(!this.clyde.goHome && !this.clyde.tempDead){\r\n this.clyde.frightened = true;\r\n this.clyde.flashCount = 0;\r\n }if(!this.pinky.goHome && !this.pinky.tempDead){\r\n this.pinky.frightened = true;\r\n this.pinky.flashCount = 0;\r\n }if(!this.inky.goHome && !this.inky.tempDead){\r\n this.inky.frightened = true;\r\n this.inky.flashCount = 0;\r\n }\r\n }\r\n }\r\n //the position in the tiles array that pacman is turning towards\r\n let positionToCheck = new createVector(arrPosition.x + this.goTo.x, arrPosition.y + this.goTo.y);\r\n //console.log(\"Position to Check X: \", positionToCheck.x, \" Y: \", positionToCheck.y);\r\n if(this.tiles[floor(positionToCheck.y)][floor(positionToCheck.x)].tunnel){//checks if the next position will be in the tunnel\r\n this.specialCase(this.pos);\r\n }if(this.tiles[floor(positionToCheck.y)][floor(positionToCheck.x)].wall){//checks if the space is not a wall\r\n if(tiles[floor(arrPosition.y + vel.y)][floor(arrPosition.x + vel.x)].wall){\r\n this.vel = createVector(this.goTo.x, this.goTo.y);//Not sure about this line...\r\n return false;\r\n }else{//moving ahead is free\r\n return true;\r\n }//return !(this.tiles[floor(arrPosition.y + this.vel.y)][floor(arrPosition.x + this.vel.x)].wall);//if both are walls then don't move\r\n }else{//allows pacman to turn\r\n this.vel = createVector(this.goTo.x, this.goTo.y);\r\n return true;\r\n }\r\n }else{//if pacman is not on a critial spot\r\n let ahead = createVector(this.pos.x+10*this.vel.x, this.pos.y+10*this.vel.y);\r\n //if((this.pos.x+10*this.vel.x-8)%16 == 0 && (this.pos.y+10*this.vel.y-8)%16 == 0){\r\n if(isCriticalPosition(ahead)){\r\n //let arrPosition = createVector((this.pos.x+10*this.vel.y-8)/16, (this.pos.y+10*this.vel.y)/16);\r\n let arrPostion = pixelToTile(ahead);//convert to an array position\r\n if(!this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten){\r\n this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten = true;//eat the dot\r\n this.score+=1;//10\r\n this.dotsEaten++;\r\n ttl = 600;\r\n if(this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].bigDot && bigDotsActive){\r\n //this.score+=40;//could be used to give a better reward for getting the big dots\r\n //sets all ghosts to frightened mode\r\n if(!this.blinky.goHome && !this.blinky.tempDead){\r\n this.blinky.frightened = true;\r\n this.blinky.flashCount = 0;\r\n }if(!this.clyde.goHome && !this.clyde.tempDead){\r\n this.clyde.frightened = true;\r\n this.clyde.flashCount = 0;\r\n }if(!this.pinky.goHome && !this.pinky.tempDead){\r\n this.pinky.frightened = true;\r\n this.pinky.flashCount = 0;\r\n }if(!this.inky.goHome && !this.inky.tempDead){\r\n this.inky.frightened = true;\r\n this.inky.flashCount = 0;\r\n }\r\n }\r\n } \r\n }if(this.goTo.x+this.vel.x == 0 && this.vel.y+this.goTo.y == 0){//if turning change directions entirely, 180 degrees\r\n this.vel = createVector(this.goTo.x, this.goTo.y);//turn\r\n return true;\r\n }return true;//if it is not a critical position then it will continue forward\r\n }\r\n }","function checkHasPositionalTracking () {\n\t var vrDisplay = controls.getVRDisplay();\n\t if (isMobile() || isGearVR()) { return false; }\n\t return vrDisplay && vrDisplay.capabilities.hasPosition;\n\t}","function observeBoundaries(oldPos, newPos) {\n return (newPos[0] >= 0 && newPos[0] <= mapWidth - spriteSize) &&\n (newPos[1] >= 0 && newPos[1] <= mapHeight - spriteSize)\n }","function isClippedInViewport(domElement) {\n var rect = domElement.getBoundingClientRect();\n return rect.top < 0 || rect.bottom > document.documentElement.clientHeight || rect.left < 0 || rect.right > document.documentElement.clientWidth;\n } // don't need to check for \"both items null/empty\", and don't need to null-check item, since item required to be length-1 JQ object","_checkCollision() {\n\n for (let ship of this.ships) {\n let pos = ship.getPosition();\n if (pos.y >= this.canvas.height) {\n // Killed ships are not moved, they stay at their location, but are invisible.\n // I don't want to kill the player with one invisible ship :)\n if (!ship.dead) {\n ship.kill();\n this.score.damage();\n this.base.removeShield();\n }\n }\n }\n }","function updatePositionsRandincident() {\n var positions = new Array(4);\n\n for(var i =0 ;i<4 ; i++) {\n positions[i] = new Array(MAX_POINTS * 3);\n positions[i] = randAllLines[i].geometry.attributes.position.array;\n }\n\n var x = [-16,-16,-16,-16]; \n var y = [-0.5,-0.3,0.3,0.5]; \n var y2 = [1,0.5,1.5,2];\n var z = -2.5;\n var index = 0;\n\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\n for(var j=0;j<4;j++){\n positions[j][ index ++ ] = x[j];\n positions[j][ index ++ ] = y[j];\n positions[j][ index ++ ] = z;\n\n x[j] += ((4.5)/MAX_POINTS);\n if(j==0 || j==1){\n y[j] -= ((y2[j])/MAX_POINTS);\n } else {\n y[j] += ((y2[j])/MAX_POINTS);\n }\n index-=3;\n }\n index+=3;\n }\n}","function getpositions(id){\n let res = [];\n let pos = id.split('_');\n let xLastPos = parseInt(pos[0]);\n let yLastPos = parseInt(pos[1]);\n\n for(let i = 0 ; i < offsets.length ; i++){\n\n let xNewPos = xLastPos + offsets[i][0];\n\n if(xNewPos >= 1 && xNewPos <= 8 ){\n let yNewPos = yLastPos + offsets[i][1];\n\n if(yNewPos >= 1 && yNewPos <= 8){\n \n res.push(xNewPos+\"_\"+yNewPos);\n }\n }\n }\n return res;\n}","inBounds(){\n if (this.pos.x <= 0) {\n this.pos.x = 0;\n }\n if (this.pos.y <= 0) {\n this.pos.y = 0;\n }\n if (this.pos.x >= width ) {\n this.pos.x = width;\n }\n if (this.pos.y >= height) {\n this.pos.y = height;\n }\n }","calculate() {\n let mvecs = [];\n super.setPkt(Status.GRAB,\"SOLID\");\n let i = 0;\n if(super.getResp()[0]){\n let data = super.getResp()[0];\n data.forEach(element => {\n if(PVector.getDistance(this.pos,element.pos) < 64){\n let mtv = Polygon.isColliding(this.hitbox,element.hitbox);\n if(mtv){\n mvecs.push(element.hitbox);\n }\n }\n });\n }\n if(mvecs.length > 0){;\n this.rot *= -1;\n this.movement.scale(-1);\n this.applyMovement();\n this.applyRotation();\n this.movement.scale(-1);\n this.rot *= -1;\n }\n super.clearResp();\n }","_isOverlappingExisting(x, y, w, h) {\n if(!this._positions.length) return false;\n let over = false;\n this._positions.forEach((item) => {\n if (!(item.x > x + w ||\n item.x + item.width < x ||\n item.y > y + h ||\n item.y + item.height < y)) over = true;\n });\n\n return over;\n }","updateOlliPositionsAoSimNoSmooth(positions) {\n for (let position of positions) {\n let coordinates = [position.coordinates[0], position.coordinates[1]];\n const data = {\n 'type': 'FeatureCollection',\n 'features': [{\n 'type': 'Feature',\n 'geometry': {\n 'type': 'Point',\n 'coordinates': coordinates\n }\n }]\n };\n let layerId = `olli-bus-${position.olliId}`;\n let layer = this.map.getSource(layerId);\n if (layer) {\n layer.setData(data);\n }\n else {\n this.map.addLayer({\n 'id': layerId,\n 'source': {\n 'type': 'geojson',\n 'data': data\n },\n 'type': 'symbol',\n 'layout': {\n 'icon-image': 'olli',\n 'icon-size': 0.75\n }\n });\n }\n }\n }","function captureSquareOffsets () {\n squareElsOffsets = {}\n\n for (var i in squareElsIds) {\n if (!squareElsIds.hasOwnProperty(i)) continue\n\n squareElsOffsets[i] = $('#' + squareElsIds[i]).offset()\n }\n }","function positions() {\n\t\t\tfor (var z=0;z<divs.length;z++) {\n\t\t\t\tvar xPos = $( \"#\" + z ).css(\"left\");\n\t\t\t\tvar word = $( \"#\" + z ).text();\n\t\t\t\tvar t = $( \"#\" + z ).text();\n\n\t\t\t\tif (parseInt(xPos) > 700) {\n\t\t\t\t\t$( \"#\" + z ).css(\"background-color\", \"red\");\n\t\t\t\t\tnewSentence.push(word);\n\n\t\t\t\t\tnewSentence = newSentence.filter(function(item,index,inputArray) {\n\t\t\t return inputArray.indexOf(item) == index;\n\t\t\t \t});\n\t\t\t\t};\n\t\t\t\t\n\t\t\t\t// join newly formed sentence \n\t\t\t\tvar yes = newSentence.join(' ');\n\t\t\t\t// send sentence via socket to server to text \n\t\t\t\tsocket.emit('text', yes);\n\t\t\t};\n\t\t}","function thereIsRover(position) {\n for (rover in RoversDeployed) {\n if (rover.position == position) {\n return true;\n }\n }\n return false;\n}","function checkForDuplicates()\r\n\t{\r\n\tfor (i=0; i < activeClippings.length; i++)\r\n\t\t{\r\n\t\tif (newClipping == activeClippings[i].id) {i = allClippings.length; duplicate = true;}\r\n\t\t}\r\n\t}","function isFoodPosOK(x,y){\n //not on snake0\n for (var i = 0; i < snakes[0].body.length; i++){\n if (x == snakes[0].body[i][0] && y == snakes[0].body[i][1])\n return false;\n }\n //not on snake1\n for (var i = 0; i < snakes[1].body.length; i++){\n if (x == snakes[1].body[i][0] && y == snakes[1].body[i][1])\n return false;\n }\n return true;\n }","createObstacleAt(position) {\n this.worldCubes[toKey(position)] = true //data not that important I think\n if (this.hasCubeAt(position)) {\n this.respawnParentsOfCubeAt(position)\n }\n }","function checkHits(coords) {\n var hits = Object.values(roaches).filter(function(x){\n return Math.abs(x.x - coords.x) + Math.abs(x.y - coords.y) < HITBOX;\n });\n return hits;\n}","validCoords(coords) {\n const [r, c] = coords;\n return r >= 0 && r < this.rows && c >= 0 && c < this.cols;\n }","function initPositionBonus() {\n xBonus = Math.trunc(Math.random()*nombreBlockParWidth)*tailleSerp;\n yBonus = Math.trunc(Math.random()*nombreBlockParHeight)*tailleSerp;\n\n // Verification que le Bonus soit en-dehors du Serpent\n for (var i = 0; i < bodySerp.length; i++) {\n if (xBonus == xSerp && yBonus == xSerp) {\n initPositionBonus();\n }\n }\n }","checkCoordinates(ship,position){\n if(ship.vertical == false){\n // prevents a ship from extending horizontally off of grid when placed\n if(10 - parseInt(position.charAt(1)) < ship.length){\n this.message = 'Not Enough Space'\n return false\n }\n else{\n // checks each potential position the ship could occupy, based on length, horizontally from the right of the position coordinate\n for(let i = 0; i < ship.length; i++){\n // if the grid is empty at a given coordinate the next is checked, the process is repeated for the length of the ship\n if(this.grid[parseInt(position.charAt(0))][(parseInt(position.charAt(1)))+i] === ''){\n continue\n }\n else{\n this.message = 'A ship cannot be placed over another ship'\n return false\n }\n }\n return true\n }\n }\n // '10' is the botom of the grid and so a vertical ship cannot begin in the '10' row / (9'x')\n else if(ship.vertical == true){\n if(10 - parseInt(position.charAt(0)) < ship.length){\n this.message = 'Not Enough Space'\n return false\n }\n else{\n // checks each potential position the ship could occupy, based on length, horizontally from the right of the position coordinate\n for(let i = 0; i < ship.length; i++){\n // if the grid is empty at a given coordinate the next is checked, the process is repeated for the length of the ship\n if(this.grid[(parseInt(position.charAt(0))+i)][parseInt(position.charAt(1))] === ''){\n continue\n }\n else{\n this.message = 'A ship cannot be placed over another ship'\n return false\n }\n }\n return true\n }\n } \n }","function movesFromPos(pos,plyr){\n \"use strict\";\n var mvs = cartesianProd([0,1,2],[0,1,2]);\n mvs = mvs.filter(function(loc){\n\t\t\t return pos[loc[0]][loc[1]] === 0;\n\t\t });\n return mvs.map(function(l){\n\t\t return [l]\n\t\t ;});\n}","intersectsWith(object, position) {\n let direction = new THREE.Vector3(-1, 0, 0).normalize();\n const raycaster = new THREE.Raycaster();\n raycaster.set(position, direction);\n const intersects = raycaster.intersectObject(object);\n if (intersects.length === 0) { return false; }\n else { return true; }\n }","function isOccupied(position) {\n let div = document.getElementById(position)\n // if (div == null)\n // return false;\n console.log(position)\n if (div.firstChild.className === 'none') {\n return false\n } else {\n return true\n }\n }","contains(i) { return this.#pos[i] != 0; }","function checkHasPositionalTracking () {\n var vrDisplay = getVRDisplay();\n if (isMobile() || isGearVR()) { return false; }\n return vrDisplay && vrDisplay.capabilities.hasPosition;\n}","function isSnakePosOK(x,y){\n //not on the other snake\n for (var k = 0; k < snakes[1-i].body.length; k++){\n if ((x == snakes[1-i].body[k][0] || x-1 == snakes[1-i].body[k][0] || x-2 == snakes[1-i].body[k][0]) && y == snakes[1-i].body[k][1])\n return false; \n }\n //not on food\n if ((x == foodPos[0] || x-1 == foodPos[0] || x-2 == foodPos[0]) && y == foodPos[1])\n return false;\n return true;\n }","_updatePosition() {\n const position = this._overlayRef.getConfig().positionStrategy;\n const origin = this._getOrigin();\n const overlay = this._getOverlayPosition();\n position.withPositions([\n Object.assign(Object.assign({}, origin.main), overlay.main),\n Object.assign(Object.assign({}, origin.fallback), overlay.fallback)\n ]);\n }","function checkPlacement() {\r\n for(index of shipArray) {\r\n if(boardObj.message[index].ship != \"none\") { //If there is already a ship here...\r\n shipArray = finalShipArray.slice();\r\n return false; //...don't move the ship here!\r\n }\r\n }\r\n return true; //If all cells at the indices of shipArray are empty, then return true\r\n}","query(range, found) {\n if (!found) {\n found = [];\n }\n if (!this.boundary.intersects(range)) {\n return found;\n } else {\n for (let p of this.particles) {\n if (range.contains(p.x, p.y)) {\n found.push(p);\n }\n }\n if (this.divided) {\n this.northeast.query(range, found);\n this.northwest.query(range, found);\n this.southeast.query(range, found);\n this.southwest.query(range, found);\n }\n return found;\n }\n }","function fetchPositions() {\n console.log('Querying Critical Maps Api');\n\n get(config.criticalmaps.baseUrl, processResult);\n}","checkCollide(pos1, pos2){\n\t if (Math.abs(pos1[0] - pos2[0]) < 50 &&\n\t pos1[1] === pos2[1]){\n\t\n\t return true;\n\t } else {\n\t return false;\n\t }\n\t }","function _testRectPolyCollision_clipRectSegs(mRect, moveBox) {\n return _.chain(mRect.toSegments())\n .filter(seg => {\n let u = VecMath.sub(seg[1], seg[0]);\n let testPt = [seg[0][0], moveBox.height*2, 1];\n let v = VecMath.sub(testPt, seg[0]);\n let cross = VecMath.cross(u, v);\n\n // Keep the segment if the test point is on its \"left\" side.\n return cross[2] < 0;\n })\n .map(seg => {\n let p = seg[0];\n let q = seg[1];\n\n // let p be the leftmost point.\n if(p[0] > q[0]) {\n let swap = q;\n q = p;\n p = swap;\n }\n\n // Get the segment's line equation data.\n let dx = q[0] - p[0];\n let dy = q[1] - p[1];\n let m = dy/dx;\n let b = p[1] - m*p[0];\n let newSeg = [p, q];\n newSeg.m = m;\n newSeg.b = b;\n return newSeg;\n })\n .value();\n }","function snakeAtPosition(pos) {\n\n\t\tvar conflict = false;\n\n\t\tfor (var i = 0; i < snake.snakePieces.length; i++) {\n\n\t\t\tif (snake.snakePieces[i].position.x == pos.x && snake.snakePieces[i].position.y == pos.y) {\n\t\t\t\tconflict == true;\n\t\t\t\tbreak;\n\t\t\t}\n\t\t}\n\n\t\treturn conflict;\n\t}","function clampPosition (pos) {\n var line = pos.line\n var column = pos.column\n return {\n // According to\n // <https://github.com/gotwarlost/istanbul/blob/d919f7355027e3c213aa81af5464962d9dc8350b/coverage.json.md#location-objects>\n // lines start at 1 and columns at 0.\n line: Math.max(1, line),\n column: Math.max(0, column)\n }\n}","function aiCheck(posX,posY){\n let moves = [];\n if(posX+1 < 10 && posX +1 >=0 && map[posX+1][posY] !== \"-1\")\n {//right\n moves.push({x:posX+1,y:posY});\n }\n if(posX -1 < 10 && posX -1 >=0 && map[posX-1][posY] !== \"-1\")\n {//left\n moves.push({x:posX-1,y:posY});\n }\n if(posY +1 < 10 && posY +1 >=0 && map[posX][posY+1] !== \"-1\")\n {//down\n moves.push({x:posX,y:posY+1});\n }\n if(posY -1 < 10 && posY -1 >=0 && map[posX][posY-1] !== \"-1\")\n {//up\n moves.push({x:posX,y:posY-1});\n }\n //console.log(moves);\n return moves;\n}"],"string":"[\n \"function check_pos(){\\n\\t//Write our checking of all positions\\n\\n\\tif (blob_pos_x > c_canvas.width - 20){\\n\\tblob_pos_x = blob_pos_x - 4;\\n\\t}\\n\\tif (blob_pos_x < 0){\\n\\tblob_pos_x = blob_pos_x + 4;\\n\\t}\\n\\tif (blob_pos_y > c_canvas.height - 20){\\n\\tblob_pos_y = blob_pos_y - 4;\\n\\t}\\n\\tif (blob_pos_y < 0){\\n\\tblob_pos_y = blob_pos_y + 4;\\n\\t}\\n\\n\\n\\t}\",\n \"isValidPos(pos) {\\n try {\\n let x = pos[0];\\n let y = pos[1];\\n return ( (x > -1 && x < 8) && (y > -1 && y < 8) );\\n } catch (error) {\\n \\n }\\n }\",\n \"function updateRelativePositions() {\\n\\n\\tminPoiDistance = Number.MAX_VALUE;\\n\\tmaxPoiDistance = 0;\\n\\n\\tfor (i=0, l=pois.length; i<l; i++) {\\n\\n\\t\\tvar poi = pois[i];\\n\\t\\t\\n\\t\\tif (poi.view) {\\n\\n\\t\\t\\tpoi.distance = location_utils.calculateDistance(deviceLocation, poi);\\n\\t\\t\\t\\n\\t\\t\\t// this would ideally be more of a databinding event\\n\\t\\t\\tif (poi.controller) {\\n\\t\\t\\t\\tpoi.controller.setDistance(location_utils.neatUSfromMeters(poi.distance));\\n\\t\\t\\t}\\n\\t\\t\\t\\n\\t\\t\\tif (poi.distance <= maxRange) {\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tmaxPoiDistance = Math.max(maxPoiDistance, poi.distance);\\n\\t\\t\\t\\tminPoiDistance = Math.min(minPoiDistance, poi.distance);\\n\\t\\t\\t\\t\\n\\t\\t\\t\\tpoi.inRange = true;\\n\\n\\t\\t\\t\\tpoi.bearing = location_utils.calculateBearing(deviceLocation, poi);\\t\\t\\t\\t\\n\\t\\t\\t} \\n\\t\\t\\telse {\\n\\t\\t\\t\\t// don't show pois that are beyond maxDistance\\n\\t\\t\\t\\tpoi.inRange = false;\\n\\t\\t\\t}\\n\\t\\t}\\n\\t}\\n\\t\\n\\tpoiDistanceRange = maxPoiDistance - minPoiDistance;\\n\\n\\t// Sort by Distance\\n\\tpois.sort(function(a, b) {\\n\\t\\treturn b.distance - a.distance;\\n\\t});\\n\\n\\t\\t\\t\\t\\n\\tradarRange = Math.max(100, pois[0].distance);\\n\\n\\tvar cnt = pois.length;\\n\\trankHeight = yRange / cnt;\\n\\t\\n\\tfor (i=0; i<cnt; i++) {\\n\\t\\tpois[i].view.zIndex = i;\\n\\t\\tpois[i].distanceRank = i;\\n\\t\\tpositionRadarBlip(pois[i]);\\n\\t}\\n}\",\n \"function validatePosition()\\n{\\n this.p = collisionWithWallsInSector(this.p, this.prev_p, this.sector, DO_NOT_UPDATE_WALL_DIR);\\n this.p = collisionWithSectorsInSector(this.p, this.prev_p, this.sector, DO_NOT_UPDATE_WALL_DIR);\\n}\",\n \"validatePosition() {\\n\\n }\",\n \"static _checkRangesForContainment(rangeA, rangeB, collisionInfo, flipResultPositions)\\n {\\n if (flipResultPositions)\\n {\\n if (rangeA.max < rangeB.max || rangeA.min > rangeB.min) collisionInfo.shapeAContained = false;\\t\\t\\t\\t\\n if (rangeB.max < rangeA.max || rangeB.min > rangeA.min) collisionInfo.shapeBContained = false;\\t\\n }\\n else\\n {\\n if (rangeA.max > rangeB.max || rangeA.min < rangeB.min) collisionInfo.shapeAContained = false;\\n if (rangeB.max > rangeA.max || rangeB.min < rangeA.min) collisionInfo.shapeBContained = false;\\n }\\n }\",\n \"fullPositionsUpdate(positions) {\\n const openPositions = [];\\n\\n for (const positionItem of positions) {\\n const position = positionItem.data;\\n\\n if (position.symbol in this.positions && !['buy', 'sell'].includes(position.side.toLowerCase())) {\\n delete this.positions[position.symbol];\\n continue;\\n }\\n\\n openPositions.push(position);\\n }\\n\\n const currentPositions = {};\\n\\n for (const position of Bybit.createPositionsWithOpenStateOnly(openPositions)) {\\n currentPositions[position.symbol] = position;\\n }\\n\\n this.logger.debug(`Bybit: Positions via API updated: ${Object.keys(currentPositions).length}`);\\n this.positions = currentPositions;\\n }\",\n \"function applyBoundaries(pos){\\r\\n\\tif(pos.x < -planeWidth/2+5) pos.x = -planeWidth/2 + 5;\\r\\n\\tif(pos.x > planeWidth/2-5) pos.x = planeWidth/2-5; \\r\\n\\tif(pos.y > planeHeight/2-5) pos.y = planeHeight/2-5;\\r\\n\\tif(pos.y < -planeHeight/2+5) pos.y = -planeHeight/2+5;\\r\\n}\",\n \"function checkColl(position){\\n if(position.x>=500 && position.y>380)\\n return true;\\n var platforms = document.getElementById(\\\"platforms\\\");\\n for (var i = 0; i < platforms.childNodes.length; i++) {\\n var node = platforms.childNodes.item(i);\\n if (node.nodeName != \\\"rect\\\" && node.nodeName != \\\"line\\\") continue;\\n\\n if(node.nodeName == \\\"rect\\\"){\\n var x = parseFloat(node.getAttribute(\\\"x\\\"));\\n var y = parseFloat(node.getAttribute(\\\"y\\\"));\\n var w = parseFloat(node.getAttribute(\\\"width\\\"));\\n var h = parseFloat(node.getAttribute(\\\"height\\\"));\\n var pos = new Point(x, y);\\n var size = new Size(w, h);\\n if (intersect(position, PLAYER_SIZE, pos, size))\\n return true;\\n } \\n else if(node.nodeName == \\\"line\\\"){\\n var x1 = parseFloat(node.getAttribute(\\\"x1\\\"));\\n var x2 = parseFloat(node.getAttribute(\\\"x2\\\"));\\n var y1 = parseFloat(node.getAttribute(\\\"y1\\\"));\\n var y = y1-10.0;\\n var w = x2-x1;\\n var h = 20.0;\\n var pos = new Point(x1, y);\\n var size = new Size(w, h);\\n\\n if (intersect(position, PLAYER_SIZE, pos, size)) {\\n return true;\\n }\\n }\\n }\\n return false;\\n}\",\n \"function checkPosition(id, x, y){\\r\\n let gameJson = reader.read(id).game;\\r\\n let gameMoves = gameJson.movements;\\r\\n if(x < 0 || x > 2 || y < 0 || y > 2)\\r\\n return WRONG_POS;\\r\\n for(let i = 0; i < gameMoves.length; i++){\\r\\n if(gameMoves[i].movement.x == x && gameMoves[i].movement.y == y)\\r\\n return WRONG_POS;\\r\\n }\\r\\n}\",\n \"function checkAllShipsPlaced() {\\n for (var p = 0; p < this.game.PLAYERS; p++) {\\n for (var s = 0; s < fleet[p].length; s++) {\\n\\n if (fleet[p][s].length != fleet[p][s].coords.length) return false;\\n\\n for (var c = 0; c < fleet[p][s].coords.length; c++) {\\n coords = fleet[p][s].coords[c];\\n \\n if (typeof layout[p][coords] == 'undefined') {\\n return false;\\n };\\n }\\n\\n }\\n }\\n return true;\\n }\",\n \"function checkLoc(){\\n for(var i = 0; i < food.length; i++){\\n var distX = food[i].loc.x - snake.loc.x;\\n var distY = food[i].loc.y - snake.loc.y;\\n if(distX == (0) && distY == (0)){\\n food.splice(i, 1);\\n //removes the food\\n //would add in a new food if that was the way I wanted it to be\\n loadFood(0);\\n snake.segments.push(createVector(0, 0));\\n console.log(snake.segments.length)\\n score++;\\n }\\n }\\n}\",\n \"checkAvailable(x, y, newShip, posNewShip) {\\n const currentShips = _.flatten(this.allShipsPosition(this.ships));\\n\\n // Check to see if any overlap ?\\n const overlapPos = _.find(currentShips, (ship) => {\\n return _.find(posNewShip, (pos) => {\\n return pos.x === ship.x && pos.y === ship.y;\\n });\\n });\\n\\n if (overlapPos || !this.checkRange(x, y, newShip)) {\\n return false;\\n }\\n\\n return true;\\n }\",\n \"isValidPosition(pos){\\n return pos.x >=0 && pos.y >= 0 && pos.x < this.props.width && pos.y < this.props.height; \\n }\",\n \"function observeBoundaries(oldPos, newPos) {\\r\\n return (\\r\\n newPos[0] >= 0 &&\\r\\n newPos[0] <= MAP_WIDTH - SPRITE_SIZE &&\\r\\n newPos[1] >= 0 &&\\r\\n newPos[1] <= MAP_HEIGHT - SPRITE_SIZE\\r\\n );\\r\\n }\",\n \"updatePositions(){\\n this.api.get_positions(this.apiPositionListener)\\n }\",\n \"function checkCoordinates (startCoordinate, direction, length) {\\n let noOverlap = true\\n for (let i = 0; i < length; i++) {\\n let newCoordinate = [startCoordinate[0] + i * direction[0], startCoordinate[1] + i * direction[1]]\\n this.reservedCoordinates.forEach(coordinate => {\\n let reservedX = coordinate[0]\\n let reservedY = coordinate[1]\\n let newX = newCoordinate[0]\\n let newY = newCoordinate[1]\\n if (reservedX === newX && reservedY === newY) {\\n noOverlap = false\\n } \\n })\\n }\\n return noOverlap\\n}\",\n \"checkParticleBoundaries(){\\n const particlesToRemove = [];\\n Object.keys(this.particles).forEach( (id) => {\\n const particle = this.particles[id];\\n // if particle is out of bounds, add to particles to remove array\\n if ( particle.posX > this.canvasWidth\\n || particle.posX < 0\\n || particle.posY > this.canvasHeight\\n || particle.posY < 0\\n ) {\\n particlesToRemove.push(id);\\n }\\n });\\n\\n if (particlesToRemove.length > 0){\\n\\n particlesToRemove.forEach((id) => {\\n // We're checking if the total particles exceed the max particles.\\n // If the total particles exeeds max particles, we delete the particle\\n // entry in the object. Otherwise, we just create a new particle\\n // and insert it into the old particle's object id. This saves us\\n // a little time above with generating a new UUID or running the delete command\\n if (Object.keys(this.particles).length > this.maxParticles){\\n delete this.particles[id];\\n } else {\\n this.particles[id] = this.makeRandomParticle();\\n }\\n });\\n }\\n }\",\n \"function createClipping(pos){\\n // Plane Equation is a*X + b*Y +c*Z + d = 0\\n let res = TETRAMESH.makeSlice(0, 1, 0, Number(pos));\\n let triCoord = res[\\\"vertex\\\"];\\n let trisetData = res[\\\"data\\\"];\\n let sliderValues;\\n if (triCoord.length !== 0) {\\n x3domUtils.updateCoordPoint(get(\\\"triSetCoordinate\\\"), triCoord);\\n x3domUtils.updateDataValue(get(\\\"triSetAttr\\\"), trisetData);\\n sliderValues = utils.getSliderMinMax(\\\"isoColor\\\", DATA_REAL_MIN, DATA_REAL_MAX);\\n get(\\\"triSetIsoColor\\\").setAttribute(\\\"min\\\", sliderValues.min);\\n get(\\\"triSetIsoColor\\\").setAttribute(\\\"max\\\", sliderValues.max);\\n }\\n}\",\n \"isClear(positions) {\\n const minX = min(positions.map(piece => piece.x));\\n const maxX = max(positions.map(piece => piece.x));\\n const minY = min(positions.map(piece => piece.y));\\n const maxY = max(positions.map(piece => piece.y));\\n\\n if (minX < 0) { return false; }\\n if (minY < 0) { return false; }\\n if (maxX >= this.width) { return false; }\\n if (maxY >= this.height) { return false; }\\n\\n return !some(positions, (position, a, b) => {\\n if (this.getSquare(position.x, position.y)) { return true; }\\n });\\n }\",\n \"checkCollisions(position) {\\n\\n // AABB collision\\n function checkCollision(obj1, obj2) {\\n // TODO: remove these magic numbers\\n // obj1 is the player and obj2 are the blocks\\n let w1 = 32;\\n let h1 = 40;\\n let w2 = 32;\\n let h2 = 32;\\n let collideX = obj1.x < obj2.x + w2 && obj1.x + w1 > obj2.x;\\n let collideY = obj1.y < obj2.y + h2 && obj1.y + h1 > obj2.y;\\n return collideX && collideY;\\n }\\n\\n // some fancy ES6 to get the objects that aren't the player\\n let notPlayer = objects.filter(o => o.sprite !== \\\"player\\\");\\n for(let o of notPlayer) {\\n if(checkCollision(position, o.location)) {\\n // if we collide return what we collided with\\n return o;\\n }\\n }\\n\\n // otherwise return null\\n return null;\\n }\",\n \"function elementsOverlap(pos) {\\n if (snake.x == pos.x && snake.y == pos.y)\\n return true;\\n if(food){\\n if(food.x == pos.x && food.y == pos.y)\\n return true;\\n }\\n if(barriers && barriers.length>0 && food){\\n for(var i = 0; i < barriers.length; i++){\\n for(var j = 0; j < barriers[i].positions.length; j++){\\n if(barriers[i].positions[j].pos.x == pos.x && barriers[i].positions[j].pos.y == pos.y){\\n return true;\\n }\\n if(barriers[i].positions[j].pos.x == food.x && barriers[i].positions[j].pos.y == food.y){\\n return true;\\n }\\n }\\n }\\n }\\n for (var i = 0; i < snake.tail.length; i++) {\\n if (snake.tail[i].x == pos.x && snake.tail[i].y == pos.y)\\n return true;\\n }\\n return false;\\n}\",\n \"function areCoordinatesInBounds (body) {\\n var coordsValid = isMarkerInSFRectangleBoundary(parseFloat(body['loc_lat']), parseFloat(body['loc_long']))\\n if (coordsValid) {\\n console.log('coord in SF: pass')\\n return true\\n } else {\\n console.log('coord in SF: fail')\\n return false\\n }\\n}\",\n \"function loadClippingURL(pos)\\r\\n\\t{\\r\\n\\tmarkRead(activeClippings[pos].id);\\r\\n\\tn = open(activeClippings[pos].URL,\\\"win\\\"+activeClippings[pos].id);\\r\\n\\t}\",\n \"function observeBoundaries(oldPos, newPos) {\\n return (newPos[0] >= 0 && newPos[0] <= MAP_WIDTH - SPRITE_SIZE) &&\\n (newPos[1] >= 0 && newPos[1] <= MAP_HEIGHT - SPRITE_SIZE)\\n}\",\n \"function overlap(){ \\n if(count === 0){\\n console.log(\\\"Ok\\\");\\n clearInterval(x);\\n fall();\\n }\\n var fRect = floor.getBoundingClientRect();\\n var cRect = cart.getBoundingClientRect();\\n for(var i = 0; i < papers.length; i++){\\n var p = document.querySelector(papers[i]);\\n var pRect = p.getBoundingClientRect();\\n var pcOffset = cRect.top - pRect.top;\\n\\tvar pcOffset2 = cRect.left - pRect.left;\\n var pfOffset = pRect.top - fRect.top;\\n if(pcOffset >= 0 && pcOffset <= 100){\\n if(pcOffset2 >= -100 && pcOffset2 <= 100){\\n p.style.display = \\\"none\\\";\\n score += 1; \\n count--;\\n }\\n }\\n else if(pfOffset >= -200 && pfOffset <= -1){\\n p.style.display = \\\"none\\\";\\n count--;\\n }\\n }\\n}\",\n \"function check_for_isolated_squares(squares_pos) {\\r\\n\\t//console.log(squares_pos);\\r\\n\\tlet isolated = false;\\r\\n\\tfor(let i in squares_pos) {\\r\\n\\t\\tif(squares_pos[i].x == -1 || squares_pos[i].y == -1) {\\r\\n\\t\\t\\tconsole.log(\\\"Isolated square: \\\" + i);\\r\\n\\t\\t\\tisolated = true;\\r\\n\\t\\t}\\r\\n\\t}\\r\\n\\treturn isolated;\\r\\n}\",\n \"function legalmpos(x,y){\\r\\n\\tif (x >= 0 && x <= 120 && y>=320) return false;\\r\\n var monsters = svgdoc.getElementById(\\\"monsters\\\");\\r\\n for (var i = 0; i < monsters.childNodes.length; i++) {\\r\\n\\t\\tpos1 = new Point(x,y);\\r\\n\\t\\tpos2 = new Point(monsters.childNodes[i].getAttribute(\\\"x\\\"), monsters.childNodes[i].getAttribute(\\\"y\\\"));\\r\\n\\t\\tif(intersect( pos1,OBJECT_DISTANCE,pos2,OBJECT_DISTANCE) )return false;\\r\\n\\t}\\r\\n\\treturn true;\\r\\n}\",\n \"function goodThingCollides(position) {\\n var platforms = document.getElementById(\\\"platforms\\\");\\n\\n for (var i = 0; i < platforms.childNodes.length; ++i) {\\n var node = platforms.childNodes.item(i);\\n\\n if (node.nodeName != \\\"rect\\\")\\n continue;\\n\\n if (collides(node, position, GOOD_THING_SIZE))\\n return true;\\n }\\n\\n var goodThings = document.getElementById(\\\"goodthings\\\");\\n\\n for (var i = 0; i < goodThings.childNodes.length; ++i) {\\n var goodThing = goodThings.childNodes.item(i);\\n var x = parseInt(goodThing.getAttribute(\\\"x\\\"));\\n var y = parseInt(goodThing.getAttribute(\\\"y\\\"));\\n\\n if (intersect(position, GOOD_THING_SIZE, new Point(x, y), GOOD_THING_SIZE))\\n return true;\\n }\\n\\n if (intersect(position, GOOD_THING_SIZE, player.position, PLAYER_SIZE))\\n return true;\\n\\n if (intersect(position, GOOD_THING_SIZE, EXIT_POSITION, EXIT_SIZE))\\n return true;\\n\\n if (intersect(position, GOOD_THING_SIZE, PORTAL1_POSITION, PORTAL1_SIZE))\\n return true;\\n\\n if (intersect(position, GOOD_THING_SIZE, PORTAL2_POSITION, PORTAL2_SIZE))\\n return true;\\n\\n return false;\\n}\",\n \"function updatePositionsfinal() {\\n var positions = line2.geometry.attributes.position.array;\\n\\n var x = 6; \\n var y = 2.7; \\n var z = -2.5;\\n var index = 0;\\n\\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\\n\\n positions[ index ++ ] = x;\\n positions[ index ++ ] = y;\\n positions[ index ++ ] = z;\\n\\n x += (9/MAX_POINTS);\\n y += (2.6/MAX_POINTS);\\n }\\n}\",\n \"function updatePositionsincident() {\\n var positions = line.geometry.attributes.position.array;\\n\\n var x = -16;\\n var y = 0; \\n var z = -2.5;\\n var index = 0;\\n\\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\\n\\n positions[ index ++ ] = x;\\n positions[ index ++ ] = y;\\n positions[ index ++ ] = z;\\n\\n x += (11.78/MAX_POINTS);\\n y += (3/MAX_POINTS);\\n }\\n}\",\n \"fullPositionsUpdate(positions) {\\n let openPositions = []\\n\\n for (const position of positions) {\\n if (position['symbol'] in this.positions && !['buy', 'sell'].includes(position['side'].toLowerCase())) {\\n delete this.positions[position.symbol]\\n continue\\n }\\n\\n openPositions.push(position)\\n }\\n\\n let currentPositions = {}\\n\\n for(const position of Bybit.createPositionsWithOpenStateOnly(openPositions)) {\\n currentPositions[position.symbol] = position\\n }\\n\\n this.positions = currentPositions\\n }\",\n \"checkObstruction(startCoordinates, endCoordinates) {\\n if (startCoordinates.x != endCoordinates.x) //moves in x\\n {\\n if (startCoordinates.x < endCoordinates.x)\\n return this.checkObstructionForward(startCoordinates, endCoordinates, 'x')\\n else if (startCoordinates.x > endCoordinates.x)\\n return this.checkObstructionBackwards(startCoordinates, endCoordinates, 'x')\\n } else if (startCoordinates.y != endCoordinates.y) //moves in y\\n {\\n if (startCoordinates.y < endCoordinates.y)\\n return this.checkObstructionForward(startCoordinates, endCoordinates, 'y')\\n else if (startCoordinates.y > endCoordinates.y)\\n return this.checkObstructionBackwards(startCoordinates, endCoordinates, 'y')\\n }\\n\\n }\",\n \"checkForCollision(ps) {\\n if( ps !== null ) { \\n for(let i = 0; i < this.collisionSX.length; i++ ) {\\n if( ps.position.x >= this.collisionSX[i] && ps.position.x <= this.collisionEX[i] ) {\\n if( ps.position.y >= this.collisionSY[i] && ps.position.y <= this.collisionEY[i] ) {\\n //print(\\\"collsion at shape \\\" + i);\\n return true;\\n }\\n }\\n }\\n }\\n\\n return false; \\n }\",\n \"function confineInContainer(position, width, height, api) {\\n\\t var viewWidth = api.getWidth();\\n\\t var viewHeight = api.getHeight();\\n\\t position[0] = Math.min(position[0] + width, viewWidth) - width;\\n\\t position[1] = Math.min(position[1] + height, viewHeight) - height;\\n\\t position[0] = Math.max(position[0], 0);\\n\\t position[1] = Math.max(position[1], 0);\\n\\t}\",\n \"function checkShipStatus(indShips, idAtPos, copyShips, ships) {\\n\\n for (var x = 0; x < indShips.length; x++) {\\n\\n //Looks for the ship position and removes it from indShips array\\n if (indShips[x].includes(idAtPos)) {\\n indShips[x].splice(indShips[x].indexOf(idAtPos), 1);\\n\\n //If after removing the ship returns an empty array, then return true\\n if (indShips[x].length === 0) {\\n copyShips.splice(copyShips.indexOf(ships[x]), 1);\\n return [true, x, copyShips];\\n }\\n }\\n }\\n\\n return [false, -1, copyShips];\\n\\n} //End checkShipStatus\",\n \"getAround(pos) {\\n var around = [];\\n var aroundNotFree = [];\\n var positions = [\\n {\\n x: pos.x,\\n y: pos.y + 1\\n },\\n {\\n x: pos.x,\\n y: pos.y - 1\\n },\\n {\\n x: pos.x + 1,\\n y: pos.y\\n },\\n {\\n x: pos.x - 1,\\n y: pos.y\\n },\\n ];\\n\\n for (var index in positions) {\\n var position = positions[index];\\n try {\\n this._handleBound(position);\\n if (this.isFree(position)) {\\n around.push(position);\\n }\\n else {\\n aroundNotFree.push(position);\\n }\\n } catch (e) {\\n //do nothing in this case\\n }\\n }\\n\\n return {free: around, notFree: aroundNotFree};\\n }\",\n \"function getNewPositionForFood(){\\n // get all the xs and ys from snake body\\n let xArr = yArr = [], xy;\\n $.each(snake, function(index, value){\\n if($.inArray(value.x, xArr) != -1){\\n xArr.push(value.x);\\n }\\n if($.inArray(value.y, yArr) == -1) {\\n yArr.push(value.y);\\n }\\n });\\n xy = getEmptyXY(xArr, yArr);\\n return xy;\\n }\",\n \"isValid(position) {\\n\\t\\treturn position.x >= 0 && position.x < this.width\\n\\t\\t && position.y >= 0 && position.y < this.height;\\n\\t}\",\n \"function confineInContainer(position, width, height, api) {\\n var viewWidth = api.getWidth();\\n var viewHeight = api.getHeight();\\n position[0] = Math.min(position[0] + width, viewWidth) - width;\\n position[1] = Math.min(position[1] + height, viewHeight) - height;\\n position[0] = Math.max(position[0], 0);\\n position[1] = Math.max(position[1], 0);\\n }\",\n \"function confineInContainer(position, width, height, api) {\\n var viewWidth = api.getWidth();\\n var viewHeight = api.getHeight();\\n position[0] = Math.min(position[0] + width, viewWidth) - width;\\n position[1] = Math.min(position[1] + height, viewHeight) - height;\\n position[0] = Math.max(position[0], 0);\\n position[1] = Math.max(position[1], 0);\\n }\",\n \"function checkIfPosEmpty(targetPos: Vector3) { \\n\\tvar allObstacles: GameObject[] = GameObject.FindGameObjectsWithTag(\\\"Obstacle\\\"); \\n\\tfor each(var current in allObstacles) \\n\\t{ \\n\\t\\tif(current.transform.position == targetPos){\\n\\t\\t\\t//Debug.Log(current.transform.position);\\n\\t\\t\\t// TODO: broadcast collide message\\n\\t\\t\\treturn false; \\n\\t\\t}\\n\\t} \\n\\treturn true; \\n}\",\n \"function confineInContainer(position, width, height, api) {\\n var viewWidth = api.getWidth();\\n var viewHeight = api.getHeight();\\n position[0] = Math.min(position[0] + width, viewWidth) - width;\\n position[1] = Math.min(position[1] + height, viewHeight) - height;\\n position[0] = Math.max(position[0], 0);\\n position[1] = Math.max(position[1], 0);\\n}\",\n \"checkCoordinates(obj) {\\n for (let elem of game.coordinates) {\\n if (obj.x === elem.x && obj.y === elem.y) {\\n if (elem.occupied) {\\n return true;\\n } else {\\n return false;\\n }\\n }\\n }\\n }\",\n \"function checkPosition() {\\n // Für Ameise Schwarz\\n for (let i = 0; i < Sem.ant.length; i++) {\\n let a = Sem.ant[i];\\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750 \\n if (a.x >= 567 && a.x <= 750) {\\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\\n if (a.y >= 245 && a.y <= 429) {\\n // Ruft Funktion für Game Over Screen auf\\n gameLost();\\n }\\n }\\n }\\n // Für Ameise Braun\\n for (let i = 0; i < Sem.antBrown.length; i++) {\\n let b = Sem.antBrown[i];\\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750\\n if (b.x >= 567 && b.x <= 750) {\\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\\n if (b.y >= 245 && b.y <= 429) {\\n // Ruft Funktion für Game Over Screen auf\\n gameLost();\\n }\\n }\\n }\\n // Für Ameise Rot\\n for (let i = 0; i < Sem.antRed.length; i++) {\\n let r = Sem.antRed[i];\\n // Wenn Ameisen Position auf X - Achse zwischen 567 & 750\\n if (r.x >= 567 && r.x <= 750) {\\n // Wenn Ameisen Position auf Y - Achse zwischen 245 & 429\\n if (r.y >= 245 && r.y <= 429) {\\n // Ruft Funktion für Game Over Screen auf\\n gameLost();\\n }\\n }\\n }\\n }\",\n \"function optimizeAnchors(positions) {\\n return positions.map((position, index) => {\\n const others = [...positions.slice(0, index), ...positions.slice(index + 1)];\\n const othersBearing = getBearingFromOtherPoints(position, others);\\n return {\\n lngLat: position.lngLat,\\n anchor: getAnchor(position.axis, othersBearing),\\n };\\n });\\n}\",\n \"function checkShipPlacement() {\\n if (!displayGrid.querySelector('.ship')) allShipsPlaced = true;\\n }\",\n \"function checkFoodCordinates(){\\n if (snakeCordinates[0].xaxis==foodxaxis && snakeCordinates[0].yaxis==foodyaxis){\\n var addingTail={\\n \\txaxis:snakeCordinates[0].xaxis+dx,\\n \\tyaxis:snakeCordinates[0].yaxis+dy\\n }\\n snakeCordinates.unshift(addingTail);\\n food();\\n score+=1;\\n functionscore();\\n\\n }\\n}\",\n \"static computeClippedPointIndices(clippedPoints, originalPoints) {\\n const isClipped = (p) => originalPoints.find(q => q.equals(p)) === undefined;\\n return new Set(clippedPoints.map((p, i) => (isClipped(p) ? i : -1)).filter(i => i !== -1));\\n }\",\n \"function checkStandingFLC(pos) {\\n let legX = bodyParts[PartEnums.TORSO].x - bodyParts[PartEnums.TORSO].width / 2.5;\\n let legY = bodyParts[PartEnums.TORSO].y;\\n return pos.x >= legX && pos.x <= (legX + 30) && pos.y >= legY && pos.y <= legY + 100;\\n}\",\n \"function checkForGuideArea(dataArray, position) {\\n let possibleGuideAreas = getClosest(dataArray,position);\\n if (possibleGuideAreas.distance < 0.1) {\\n addGuide(possibleGuideAreas.closest.text);\\n } else {\\n removeGuide();\\n }\\n}\",\n \"fullPositionsUpdate(positions) {\\n const openPositions = [];\\n\\n for (const position of positions) {\\n if (position.symbol in this.positions && position.isOpen !== true) {\\n delete this.positions[position.symbol];\\n } else {\\n openPositions.push(position);\\n }\\n }\\n\\n const currentPositions = {};\\n\\n for (const position of Bitmex.createPositionsWithOpenStateOnly(openPositions)) {\\n currentPositions[position.symbol] = position;\\n }\\n\\n this.positions = currentPositions;\\n }\",\n \"getEmptyPositionsWithSpaceWithWalls() {\\n var emptyPositions = this.getEmptyPositions();\\n var res = emptyPositions.filter(p => (((GameConfig.WIDTH - 3) >= p.x) && ((GameConfig.HEIGHT - 3) >= p.y)) && ((2 <= p.x) && (2 <= p.y)));\\n return res;\\n }\",\n \"get positionOptions() {\\n if (!this.args.positions) {\\n return [];\\n }\\n\\n // Include INACTVE positions if the person has it so it can be unchecked\\n let filteredPositions = this.args.positions.filter(position => {\\n return position.active || this.args.positionIds.includes(position.id)\\n });\\n\\n return filteredPositions.map((position) => {\\n return [positionLabel([position]), position.id];\\n });\\n }\",\n \"checkCollide(pos1, pos2){\\n if (Math.abs(pos1[0] - pos2[0]) < 50 &&\\n pos1[1] === pos2[1]){\\n\\n return true;\\n } else {\\n return false;\\n }\\n }\",\n \"function checkPos(androidReq){\\n console.log(\\\"CHECK\\\");\\n\\n if(pos != null) {\\n var point = null;\\n var dist = null;\\n\\n Tour.find({_id: \\\"58d26bd01c539c795303bb2f\\\"}, function (err, docs) {\\n if(pos < docs[0].tour.length) {\\n if (!err) {\\n point = docs[0].tour[pos];\\n if (point != null) {\\n dist = getDistanceFromLatLonInKm(point.latitude, point.longitude, androidReq.latitude, androidReq.longitude) * 1000;\\n }\\n }\\n console.log(\\\"Distance: \\\" + dist);\\n if (dist < 5) {\\n console.log(point.name);\\n if(pos + 1 < docs[0].tour.length){\\n pos++;\\n point =docs[0].tour[pos];\\n main.updateDronePos(\\n {\\n \\\"latitude\\\": point.latitude,\\n \\\"longitude\\\": point.longitude\\n }\\n );\\n }\\n\\n }\\n current_pos = docs[0].tour[pos-1];\\n }\\n });\\n }\\n}\",\n \"function usePositions(props, hostElement, calloutElement, targetRef, getBounds) {\\n var _a = react__WEBPACK_IMPORTED_MODULE_0__.useState(), positions = _a[0], setPositions = _a[1];\\n var positionAttempts = react__WEBPACK_IMPORTED_MODULE_0__.useRef(0);\\n var previousTarget = react__WEBPACK_IMPORTED_MODULE_0__.useRef();\\n var async = (0,_fluentui_react_hooks__WEBPACK_IMPORTED_MODULE_6__.useAsync)();\\n var hidden = props.hidden, target = props.target, finalHeight = props.finalHeight, onPositioned = props.onPositioned, directionalHint = props.directionalHint;\\n react__WEBPACK_IMPORTED_MODULE_0__.useEffect(function () {\\n if (!hidden) {\\n var timerId_1 = async.requestAnimationFrame(function () {\\n // If we expect a target element to position against, we need to wait until `targetRef.current`\\n // is resolved. Otherwise we can try to position.\\n var expectsTarget = !!target;\\n if (hostElement.current && calloutElement.current && (!expectsTarget || targetRef.current)) {\\n var currentProps = (0,tslib__WEBPACK_IMPORTED_MODULE_7__.__assign)((0,tslib__WEBPACK_IMPORTED_MODULE_7__.__assign)({}, props), { target: targetRef.current, bounds: getBounds() });\\n var previousPositions = previousTarget.current === target ? positions : undefined;\\n // If there is a finalHeight given then we assume that the user knows and will handle\\n // additional positioning adjustments so we should call positionCard\\n var newPositions = finalHeight\\n ? (0,_Positioning__WEBPACK_IMPORTED_MODULE_5__.positionCard)(currentProps, hostElement.current, calloutElement.current, previousPositions)\\n : (0,_Positioning__WEBPACK_IMPORTED_MODULE_5__.positionCallout)(currentProps, hostElement.current, calloutElement.current, previousPositions);\\n // Set the new position only when the positions are not exists or one of the new callout positions\\n // are different. The position should not change if the position is within 2 decimal places.\\n if ((!positions && newPositions) ||\\n (positions && newPositions && !arePositionsEqual(positions, newPositions) && positionAttempts.current < 5)) {\\n // We should not reposition the callout more than a few times, if it is then the content is likely resizing\\n // and we should stop trying to reposition to prevent a stack overflow.\\n positionAttempts.current++;\\n setPositions(newPositions);\\n }\\n else if (positionAttempts.current > 0) {\\n // Only call the onPositioned callback if the callout has been re-positioned at least once.\\n positionAttempts.current = 0;\\n onPositioned === null || onPositioned === void 0 ? void 0 : onPositioned(positions);\\n }\\n }\\n }, calloutElement.current);\\n previousTarget.current = target;\\n return function () {\\n async.cancelAnimationFrame(timerId_1);\\n previousTarget.current = undefined;\\n };\\n }\\n }, [\\n hidden,\\n directionalHint,\\n async,\\n calloutElement,\\n hostElement,\\n targetRef,\\n finalHeight,\\n getBounds,\\n onPositioned,\\n positions,\\n props,\\n target,\\n ]);\\n return positions;\\n}\",\n \"closestPointTo(position, closest, exclude) {\\n if (this.visible && this.objects !== undefined) {\\n for (let i = 0; i < this.objects.length; i++) {\\n this.objects[i].closestPointTo(position, closest, exclude);\\n }\\n }\\n }\",\n \"function validate_click(posClicked) {\\r\\n for(var i = 0;i<$scope.movidasPosibles.length;i++){\\r\\n var pos = JSON.parse(\\\"[\\\" + posClicked + \\\"]\\\");\\r\\n if($scope.movidasPosibles[i][0]===pos[0] && $scope.movidasPosibles[i][1] ===pos[1]){\\r\\n $scope.http_request.body.x = pos[0];//guarda las posiciones clickeadas\\r\\n $scope.http_request.body.y = pos[1];//al final se va mantener siempre una posicion guardada\\r\\n return true;\\r\\n }\\r\\n }\\r\\n return false;\\r\\n }\",\n \"function addClipping()\\r\\n\\t{\\r\\n\\tnewClipping = this.id.substring(3,this.id.length)\\r\\n\\tduplicate = false;\\r\\n\\tfor (i=0; i < allClippings.length; i++) //find the position the allClippings array of the selected clipping\\r\\n\\t\\t{\\r\\n\\t\\tif (newClipping == allClippings[i].id) {pos = i; i = allClippings.length}\\r\\n\\t\\t}\\r\\n\\t\\t\\r\\n\\tif (activeClippings.length > 0)\\tcheckForDuplicates() //make sure clipping is not already seletected\\r\\n\\t\\r\\n\\tif (!duplicate)\\r\\n\\t{\\t\\r\\n\\t\\teventCheckForCookies();\\r\\n\\t\\tif (cookiesOn == true)\\r\\n\\t\\t\\t{\\r\\n\\t\\t\\tactiveClippings[activeClippings.length] = new Clipping(allClippings[pos].id,allClippings[pos].headline,allClippings[pos].URL);\\r\\n\\t\\t\\t\\r\\n\\t\\t\\t//find all instances of the clipping in article and hides it\\r\\n\\t \\t\\tclippingInstanceVisibility(this.id,'hidden') \\r\\n\\t \\t\\t\\r\\n\\t \\t\\tdrawClippings();\\t\\r\\n\\t \\t\\tevent.cancleBubble = true;\\r\\n\\t \\t\\tupdateClippingCounter();\\r\\n\\t\\t\\tsaveClippings();\\r\\n\\t\\t \\t}\\r\\n\\t \\t}\\r\\n\\t}\",\n \"moveTo(pos) {\\n let { cursor } = this, p = pos - this.offset;\\n while (!this.done && cursor.from < p) {\\n if (cursor.to >= pos && cursor.enter(p, 1, exports.IterMode.IgnoreOverlays | exports.IterMode.ExcludeBuffers)) ;\\n else if (!cursor.next(false))\\n this.done = true;\\n }\\n }\",\n \"function checkPosition() {\\n const offset = reposition(prevFocused);\\n if (offset.top !== prevOffset.top || offset.left !== prevOffset.left || offset.width !== prevOffset.width || offset.height !== prevOffset.height) {\\n // console.log(\\\"Changed focus position\\\", offset, prevFocused);\\n prevOffset = offset;\\n staticCounter = 0;\\n } else {\\n staticCounter++;\\n }\\n if (staticCounter < 3) {\\n // at the beginning and as long as we see position changes\\n // we will check the position/bounds more often\\n positionTimeout = setTimeout(checkPosition, 100);\\n } else {\\n // we want to measure at least every 2 seconds\\n positionTimeout = setTimeout(checkPosition, 1000);\\n }\\n }\",\n \"function checkLaps(laps, lapCount) {\\n\\n for (var j = 0;\\n j < laps.length;\\n j++) {\\n\\n // Has name?\\n var name = laps[j].name;\\n // if (name == undefined || name.length == 0) {\\n\\n // alert(\\\"Warning: invalid name for element \\\" + j);\\n // }\\n\\n // Has placings?\\n var places = laps[j].placing;\\n // if (places == undefined) {\\n\\n // alert(\\\"Warning: missing placings for element \\\" + j + \\\" (\\\" + name + \\\")\\\");\\n // }\\n // else if (places.length == 0 || places.length > lapCount + 1) {\\n\\n // alert(\\\"Warning: invalid number of placings (\\\" + places.length + \\\") for element \\\" + j +\\n // \\\" (\\\" + name + \\\") - expected between 1 and \\\" + (lapCount - 1));\\n // }\\n\\n // Check markers.\\n var maxLaps = places.length;\\n //checkMarker(laps[j].pitstops, \\\"pitstop\\\", maxLaps, j, name);\\n //checkMarker(laps[j].mechanical, \\\"mechanical\\\", maxLaps, j, name);\\n checkMarker(laps[j].accident, \\\"accident\\\", maxLaps, j, name);\\n }\\n\\n for (var i = 0;\\n i < lapCount;\\n i++) {\\n\\n var positions = [];\\n for (j = 0;\\n j < laps.length;\\n j++) {\\n\\n places = laps[j].placing;\\n if (places.length > i) {\\n\\n // Valid placing?\\n var placing = places[i];\\n // if (isNaN(placing) || placing < 1 || placing % 1 != 0) {\\n\\n // alert(\\\"Warning: invalid placing '\\\" + placing + \\\"' for \\\" + laps[j].name)\\n // }\\n // else {\\n\\n // var count = positions[placing];\\n // positions[placing] = isNaN(count) ? 1 : count + 1\\n // }\\n }\\n }\\n\\n // Check for duplicate/missing positions.\\n for (j = 1;\\n j < positions.length;\\n j++) {\\n\\n count = positions[j];\\n if (count != 1) {\\n\\n alert(\\\"Warning: data inconsistent: lap \\\" + i + \\\", position \\\" + j + \\\", count \\\" + count);\\n }\\n }\\n }\\n}\",\n \"ifInBound(currentPos, coordinates1, coordinates2){\\n \\n //check for inverted squares\\n if(coordinates1.latitude < coordinates2.latitude){\\n //swap\\n var temp = coordinates1\\n coordinates1 = coordinates2\\n coordinates2 = temp\\n }\\n else{\\n\\n }\\n console.log(\\\"====ALL MY COORDINATES ==== \\\")\\n console.log(currentPos)\\n console.log(coordinates1)\\n console.log(coordinates2)\\n\\n if((currentPos.coords.latitude <= coordinates1.latitude) && (currentPos.coords.latitude >= coordinates2.latitude)){\\n console.log(\\\"latitude inbound\\\")\\n if((currentPos.coords.longitude >= coordinates1.longitude) && (currentPos.coords.longitude <= coordinates2.longitude)){\\n console.log(\\\"longitude inbound\\\")\\n return true\\n }\\n }\\n return false\\n\\n }\",\n \"function markOccupiedSpots() {\\n \\n\\t\\tif(!spotsInitialized || playersInitialized < 2) {\\n \\n\\t\\t\\treturn null;\\n \\n } // end if statement\\n\\t\\n\\t\\tfor(var i = 0; i<10; i++) {\\n \\n\\t\\t\\tfindClosestSpot(myMarbles[i].x, myMarbles[i].y).isEmpty = false;\\n\\t\\t\\tfindClosestSpot(othersMarbles[i].x, othersMarbles[i].y).isEmpty = false;\\n \\n\\t\\t} // end for loop\\n \\n\\t} // end markOccupiedSpots()\",\n \"checkPosition(){\\r\\n if(isCriticalPosition(this.pos)){\\r\\n //if((this.pos.x-8)%16 == 0 && (this.pos.y-8)%16 == 0){//checks if pacman is on a critical spot\\r\\n //let arrPosition = createVector((this.pos.x-8)/16, (this.pos.y-8)/16);//changes location to an array position\\r\\n let arrPosition = pixelToTile(this.pos);\\r\\n //resets all paths for the ghosts\\r\\n //this.blinky.setPath();\\r\\n //this.pinky.setPath();\\r\\n //this.clyde.setPath();\\r\\n //this.inky.setPath();\\r\\n //Checks if the position has been eaten or not, blank spaces are considered eaten\\r\\n if(!this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten){\\r\\n this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten = true;\\r\\n //score+=10;//adds points for eating\\r\\n this.score+=1;\\r\\n this.dotsEaten++;\\r\\n this.ttl = 600;\\r\\n if(this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].bigDot){//checks if the big dot is eaten\\r\\n //set all ghosts to frightened mode\\r\\n if(!this.blinky.goHome && !this.blinky.tempDead){\\r\\n this.blinky.frightened = true;\\r\\n this.blinky.flashCount = 0;\\r\\n }if(!this.clyde.goHome && !this.clyde.tempDead){\\r\\n this.clyde.frightened = true;\\r\\n this.clyde.flashCount = 0;\\r\\n }if(!this.pinky.goHome && !this.pinky.tempDead){\\r\\n this.pinky.frightened = true;\\r\\n this.pinky.flashCount = 0;\\r\\n }if(!this.inky.goHome && !this.inky.tempDead){\\r\\n this.inky.frightened = true;\\r\\n this.inky.flashCount = 0;\\r\\n }\\r\\n }\\r\\n }\\r\\n //the position in the tiles array that pacman is turning towards\\r\\n let positionToCheck = new createVector(arrPosition.x + this.goTo.x, arrPosition.y + this.goTo.y);\\r\\n //console.log(\\\"Position to Check X: \\\", positionToCheck.x, \\\" Y: \\\", positionToCheck.y);\\r\\n if(this.tiles[floor(positionToCheck.y)][floor(positionToCheck.x)].tunnel){//checks if the next position will be in the tunnel\\r\\n this.specialCase(this.pos);\\r\\n }if(this.tiles[floor(positionToCheck.y)][floor(positionToCheck.x)].wall){//checks if the space is not a wall\\r\\n if(tiles[floor(arrPosition.y + vel.y)][floor(arrPosition.x + vel.x)].wall){\\r\\n this.vel = createVector(this.goTo.x, this.goTo.y);//Not sure about this line...\\r\\n return false;\\r\\n }else{//moving ahead is free\\r\\n return true;\\r\\n }//return !(this.tiles[floor(arrPosition.y + this.vel.y)][floor(arrPosition.x + this.vel.x)].wall);//if both are walls then don't move\\r\\n }else{//allows pacman to turn\\r\\n this.vel = createVector(this.goTo.x, this.goTo.y);\\r\\n return true;\\r\\n }\\r\\n }else{//if pacman is not on a critial spot\\r\\n let ahead = createVector(this.pos.x+10*this.vel.x, this.pos.y+10*this.vel.y);\\r\\n //if((this.pos.x+10*this.vel.x-8)%16 == 0 && (this.pos.y+10*this.vel.y-8)%16 == 0){\\r\\n if(isCriticalPosition(ahead)){\\r\\n //let arrPosition = createVector((this.pos.x+10*this.vel.y-8)/16, (this.pos.y+10*this.vel.y)/16);\\r\\n let arrPostion = pixelToTile(ahead);//convert to an array position\\r\\n if(!this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten){\\r\\n this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].eaten = true;//eat the dot\\r\\n this.score+=1;//10\\r\\n this.dotsEaten++;\\r\\n ttl = 600;\\r\\n if(this.tiles[floor(arrPosition.y)][floor(arrPosition.x)].bigDot && bigDotsActive){\\r\\n //this.score+=40;//could be used to give a better reward for getting the big dots\\r\\n //sets all ghosts to frightened mode\\r\\n if(!this.blinky.goHome && !this.blinky.tempDead){\\r\\n this.blinky.frightened = true;\\r\\n this.blinky.flashCount = 0;\\r\\n }if(!this.clyde.goHome && !this.clyde.tempDead){\\r\\n this.clyde.frightened = true;\\r\\n this.clyde.flashCount = 0;\\r\\n }if(!this.pinky.goHome && !this.pinky.tempDead){\\r\\n this.pinky.frightened = true;\\r\\n this.pinky.flashCount = 0;\\r\\n }if(!this.inky.goHome && !this.inky.tempDead){\\r\\n this.inky.frightened = true;\\r\\n this.inky.flashCount = 0;\\r\\n }\\r\\n }\\r\\n } \\r\\n }if(this.goTo.x+this.vel.x == 0 && this.vel.y+this.goTo.y == 0){//if turning change directions entirely, 180 degrees\\r\\n this.vel = createVector(this.goTo.x, this.goTo.y);//turn\\r\\n return true;\\r\\n }return true;//if it is not a critical position then it will continue forward\\r\\n }\\r\\n }\",\n \"function checkHasPositionalTracking () {\\n\\t var vrDisplay = controls.getVRDisplay();\\n\\t if (isMobile() || isGearVR()) { return false; }\\n\\t return vrDisplay && vrDisplay.capabilities.hasPosition;\\n\\t}\",\n \"function observeBoundaries(oldPos, newPos) {\\n return (newPos[0] >= 0 && newPos[0] <= mapWidth - spriteSize) &&\\n (newPos[1] >= 0 && newPos[1] <= mapHeight - spriteSize)\\n }\",\n \"function isClippedInViewport(domElement) {\\n var rect = domElement.getBoundingClientRect();\\n return rect.top < 0 || rect.bottom > document.documentElement.clientHeight || rect.left < 0 || rect.right > document.documentElement.clientWidth;\\n } // don't need to check for \\\"both items null/empty\\\", and don't need to null-check item, since item required to be length-1 JQ object\",\n \"_checkCollision() {\\n\\n for (let ship of this.ships) {\\n let pos = ship.getPosition();\\n if (pos.y >= this.canvas.height) {\\n // Killed ships are not moved, they stay at their location, but are invisible.\\n // I don't want to kill the player with one invisible ship :)\\n if (!ship.dead) {\\n ship.kill();\\n this.score.damage();\\n this.base.removeShield();\\n }\\n }\\n }\\n }\",\n \"function updatePositionsRandincident() {\\n var positions = new Array(4);\\n\\n for(var i =0 ;i<4 ; i++) {\\n positions[i] = new Array(MAX_POINTS * 3);\\n positions[i] = randAllLines[i].geometry.attributes.position.array;\\n }\\n\\n var x = [-16,-16,-16,-16]; \\n var y = [-0.5,-0.3,0.3,0.5]; \\n var y2 = [1,0.5,1.5,2];\\n var z = -2.5;\\n var index = 0;\\n\\n for ( var i = 0, l = MAX_POINTS; i < l; i ++ ) {\\n for(var j=0;j<4;j++){\\n positions[j][ index ++ ] = x[j];\\n positions[j][ index ++ ] = y[j];\\n positions[j][ index ++ ] = z;\\n\\n x[j] += ((4.5)/MAX_POINTS);\\n if(j==0 || j==1){\\n y[j] -= ((y2[j])/MAX_POINTS);\\n } else {\\n y[j] += ((y2[j])/MAX_POINTS);\\n }\\n index-=3;\\n }\\n index+=3;\\n }\\n}\",\n \"function getpositions(id){\\n let res = [];\\n let pos = id.split('_');\\n let xLastPos = parseInt(pos[0]);\\n let yLastPos = parseInt(pos[1]);\\n\\n for(let i = 0 ; i < offsets.length ; i++){\\n\\n let xNewPos = xLastPos + offsets[i][0];\\n\\n if(xNewPos >= 1 && xNewPos <= 8 ){\\n let yNewPos = yLastPos + offsets[i][1];\\n\\n if(yNewPos >= 1 && yNewPos <= 8){\\n \\n res.push(xNewPos+\\\"_\\\"+yNewPos);\\n }\\n }\\n }\\n return res;\\n}\",\n \"inBounds(){\\n if (this.pos.x <= 0) {\\n this.pos.x = 0;\\n }\\n if (this.pos.y <= 0) {\\n this.pos.y = 0;\\n }\\n if (this.pos.x >= width ) {\\n this.pos.x = width;\\n }\\n if (this.pos.y >= height) {\\n this.pos.y = height;\\n }\\n }\",\n \"calculate() {\\n let mvecs = [];\\n super.setPkt(Status.GRAB,\\\"SOLID\\\");\\n let i = 0;\\n if(super.getResp()[0]){\\n let data = super.getResp()[0];\\n data.forEach(element => {\\n if(PVector.getDistance(this.pos,element.pos) < 64){\\n let mtv = Polygon.isColliding(this.hitbox,element.hitbox);\\n if(mtv){\\n mvecs.push(element.hitbox);\\n }\\n }\\n });\\n }\\n if(mvecs.length > 0){;\\n this.rot *= -1;\\n this.movement.scale(-1);\\n this.applyMovement();\\n this.applyRotation();\\n this.movement.scale(-1);\\n this.rot *= -1;\\n }\\n super.clearResp();\\n }\",\n \"_isOverlappingExisting(x, y, w, h) {\\n if(!this._positions.length) return false;\\n let over = false;\\n this._positions.forEach((item) => {\\n if (!(item.x > x + w ||\\n item.x + item.width < x ||\\n item.y > y + h ||\\n item.y + item.height < y)) over = true;\\n });\\n\\n return over;\\n }\",\n \"updateOlliPositionsAoSimNoSmooth(positions) {\\n for (let position of positions) {\\n let coordinates = [position.coordinates[0], position.coordinates[1]];\\n const data = {\\n 'type': 'FeatureCollection',\\n 'features': [{\\n 'type': 'Feature',\\n 'geometry': {\\n 'type': 'Point',\\n 'coordinates': coordinates\\n }\\n }]\\n };\\n let layerId = `olli-bus-${position.olliId}`;\\n let layer = this.map.getSource(layerId);\\n if (layer) {\\n layer.setData(data);\\n }\\n else {\\n this.map.addLayer({\\n 'id': layerId,\\n 'source': {\\n 'type': 'geojson',\\n 'data': data\\n },\\n 'type': 'symbol',\\n 'layout': {\\n 'icon-image': 'olli',\\n 'icon-size': 0.75\\n }\\n });\\n }\\n }\\n }\",\n \"function captureSquareOffsets () {\\n squareElsOffsets = {}\\n\\n for (var i in squareElsIds) {\\n if (!squareElsIds.hasOwnProperty(i)) continue\\n\\n squareElsOffsets[i] = $('#' + squareElsIds[i]).offset()\\n }\\n }\",\n \"function positions() {\\n\\t\\t\\tfor (var z=0;z<divs.length;z++) {\\n\\t\\t\\t\\tvar xPos = $( \\\"#\\\" + z ).css(\\\"left\\\");\\n\\t\\t\\t\\tvar word = $( \\\"#\\\" + z ).text();\\n\\t\\t\\t\\tvar t = $( \\\"#\\\" + z ).text();\\n\\n\\t\\t\\t\\tif (parseInt(xPos) > 700) {\\n\\t\\t\\t\\t\\t$( \\\"#\\\" + z ).css(\\\"background-color\\\", \\\"red\\\");\\n\\t\\t\\t\\t\\tnewSentence.push(word);\\n\\n\\t\\t\\t\\t\\tnewSentence = newSentence.filter(function(item,index,inputArray) {\\n\\t\\t\\t return inputArray.indexOf(item) == index;\\n\\t\\t\\t \\t});\\n\\t\\t\\t\\t};\\n\\t\\t\\t\\t\\n\\t\\t\\t\\t// join newly formed sentence \\n\\t\\t\\t\\tvar yes = newSentence.join(' ');\\n\\t\\t\\t\\t// send sentence via socket to server to text \\n\\t\\t\\t\\tsocket.emit('text', yes);\\n\\t\\t\\t};\\n\\t\\t}\",\n \"function thereIsRover(position) {\\n for (rover in RoversDeployed) {\\n if (rover.position == position) {\\n return true;\\n }\\n }\\n return false;\\n}\",\n \"function checkForDuplicates()\\r\\n\\t{\\r\\n\\tfor (i=0; i < activeClippings.length; i++)\\r\\n\\t\\t{\\r\\n\\t\\tif (newClipping == activeClippings[i].id) {i = allClippings.length; duplicate = true;}\\r\\n\\t\\t}\\r\\n\\t}\",\n \"function isFoodPosOK(x,y){\\n //not on snake0\\n for (var i = 0; i < snakes[0].body.length; i++){\\n if (x == snakes[0].body[i][0] && y == snakes[0].body[i][1])\\n return false;\\n }\\n //not on snake1\\n for (var i = 0; i < snakes[1].body.length; i++){\\n if (x == snakes[1].body[i][0] && y == snakes[1].body[i][1])\\n return false;\\n }\\n return true;\\n }\",\n \"createObstacleAt(position) {\\n this.worldCubes[toKey(position)] = true //data not that important I think\\n if (this.hasCubeAt(position)) {\\n this.respawnParentsOfCubeAt(position)\\n }\\n }\",\n \"function checkHits(coords) {\\n var hits = Object.values(roaches).filter(function(x){\\n return Math.abs(x.x - coords.x) + Math.abs(x.y - coords.y) < HITBOX;\\n });\\n return hits;\\n}\",\n \"validCoords(coords) {\\n const [r, c] = coords;\\n return r >= 0 && r < this.rows && c >= 0 && c < this.cols;\\n }\",\n \"function initPositionBonus() {\\n xBonus = Math.trunc(Math.random()*nombreBlockParWidth)*tailleSerp;\\n yBonus = Math.trunc(Math.random()*nombreBlockParHeight)*tailleSerp;\\n\\n // Verification que le Bonus soit en-dehors du Serpent\\n for (var i = 0; i < bodySerp.length; i++) {\\n if (xBonus == xSerp && yBonus == xSerp) {\\n initPositionBonus();\\n }\\n }\\n }\",\n \"checkCoordinates(ship,position){\\n if(ship.vertical == false){\\n // prevents a ship from extending horizontally off of grid when placed\\n if(10 - parseInt(position.charAt(1)) < ship.length){\\n this.message = 'Not Enough Space'\\n return false\\n }\\n else{\\n // checks each potential position the ship could occupy, based on length, horizontally from the right of the position coordinate\\n for(let i = 0; i < ship.length; i++){\\n // if the grid is empty at a given coordinate the next is checked, the process is repeated for the length of the ship\\n if(this.grid[parseInt(position.charAt(0))][(parseInt(position.charAt(1)))+i] === ''){\\n continue\\n }\\n else{\\n this.message = 'A ship cannot be placed over another ship'\\n return false\\n }\\n }\\n return true\\n }\\n }\\n // '10' is the botom of the grid and so a vertical ship cannot begin in the '10' row / (9'x')\\n else if(ship.vertical == true){\\n if(10 - parseInt(position.charAt(0)) < ship.length){\\n this.message = 'Not Enough Space'\\n return false\\n }\\n else{\\n // checks each potential position the ship could occupy, based on length, horizontally from the right of the position coordinate\\n for(let i = 0; i < ship.length; i++){\\n // if the grid is empty at a given coordinate the next is checked, the process is repeated for the length of the ship\\n if(this.grid[(parseInt(position.charAt(0))+i)][parseInt(position.charAt(1))] === ''){\\n continue\\n }\\n else{\\n this.message = 'A ship cannot be placed over another ship'\\n return false\\n }\\n }\\n return true\\n }\\n } \\n }\",\n \"function movesFromPos(pos,plyr){\\n \\\"use strict\\\";\\n var mvs = cartesianProd([0,1,2],[0,1,2]);\\n mvs = mvs.filter(function(loc){\\n\\t\\t\\t return pos[loc[0]][loc[1]] === 0;\\n\\t\\t });\\n return mvs.map(function(l){\\n\\t\\t return [l]\\n\\t\\t ;});\\n}\",\n \"intersectsWith(object, position) {\\n let direction = new THREE.Vector3(-1, 0, 0).normalize();\\n const raycaster = new THREE.Raycaster();\\n raycaster.set(position, direction);\\n const intersects = raycaster.intersectObject(object);\\n if (intersects.length === 0) { return false; }\\n else { return true; }\\n }\",\n \"function isOccupied(position) {\\n let div = document.getElementById(position)\\n // if (div == null)\\n // return false;\\n console.log(position)\\n if (div.firstChild.className === 'none') {\\n return false\\n } else {\\n return true\\n }\\n }\",\n \"contains(i) { return this.#pos[i] != 0; }\",\n \"function checkHasPositionalTracking () {\\n var vrDisplay = getVRDisplay();\\n if (isMobile() || isGearVR()) { return false; }\\n return vrDisplay && vrDisplay.capabilities.hasPosition;\\n}\",\n \"function isSnakePosOK(x,y){\\n //not on the other snake\\n for (var k = 0; k < snakes[1-i].body.length; k++){\\n if ((x == snakes[1-i].body[k][0] || x-1 == snakes[1-i].body[k][0] || x-2 == snakes[1-i].body[k][0]) && y == snakes[1-i].body[k][1])\\n return false; \\n }\\n //not on food\\n if ((x == foodPos[0] || x-1 == foodPos[0] || x-2 == foodPos[0]) && y == foodPos[1])\\n return false;\\n return true;\\n }\",\n \"_updatePosition() {\\n const position = this._overlayRef.getConfig().positionStrategy;\\n const origin = this._getOrigin();\\n const overlay = this._getOverlayPosition();\\n position.withPositions([\\n Object.assign(Object.assign({}, origin.main), overlay.main),\\n Object.assign(Object.assign({}, origin.fallback), overlay.fallback)\\n ]);\\n }\",\n \"function checkPlacement() {\\r\\n for(index of shipArray) {\\r\\n if(boardObj.message[index].ship != \\\"none\\\") { //If there is already a ship here...\\r\\n shipArray = finalShipArray.slice();\\r\\n return false; //...don't move the ship here!\\r\\n }\\r\\n }\\r\\n return true; //If all cells at the indices of shipArray are empty, then return true\\r\\n}\",\n \"query(range, found) {\\n if (!found) {\\n found = [];\\n }\\n if (!this.boundary.intersects(range)) {\\n return found;\\n } else {\\n for (let p of this.particles) {\\n if (range.contains(p.x, p.y)) {\\n found.push(p);\\n }\\n }\\n if (this.divided) {\\n this.northeast.query(range, found);\\n this.northwest.query(range, found);\\n this.southeast.query(range, found);\\n this.southwest.query(range, found);\\n }\\n return found;\\n }\\n }\",\n \"function fetchPositions() {\\n console.log('Querying Critical Maps Api');\\n\\n get(config.criticalmaps.baseUrl, processResult);\\n}\",\n \"checkCollide(pos1, pos2){\\n\\t if (Math.abs(pos1[0] - pos2[0]) < 50 &&\\n\\t pos1[1] === pos2[1]){\\n\\t\\n\\t return true;\\n\\t } else {\\n\\t return false;\\n\\t }\\n\\t }\",\n \"function _testRectPolyCollision_clipRectSegs(mRect, moveBox) {\\n return _.chain(mRect.toSegments())\\n .filter(seg => {\\n let u = VecMath.sub(seg[1], seg[0]);\\n let testPt = [seg[0][0], moveBox.height*2, 1];\\n let v = VecMath.sub(testPt, seg[0]);\\n let cross = VecMath.cross(u, v);\\n\\n // Keep the segment if the test point is on its \\\"left\\\" side.\\n return cross[2] < 0;\\n })\\n .map(seg => {\\n let p = seg[0];\\n let q = seg[1];\\n\\n // let p be the leftmost point.\\n if(p[0] > q[0]) {\\n let swap = q;\\n q = p;\\n p = swap;\\n }\\n\\n // Get the segment's line equation data.\\n let dx = q[0] - p[0];\\n let dy = q[1] - p[1];\\n let m = dy/dx;\\n let b = p[1] - m*p[0];\\n let newSeg = [p, q];\\n newSeg.m = m;\\n newSeg.b = b;\\n return newSeg;\\n })\\n .value();\\n }\",\n \"function snakeAtPosition(pos) {\\n\\n\\t\\tvar conflict = false;\\n\\n\\t\\tfor (var i = 0; i < snake.snakePieces.length; i++) {\\n\\n\\t\\t\\tif (snake.snakePieces[i].position.x == pos.x && snake.snakePieces[i].position.y == pos.y) {\\n\\t\\t\\t\\tconflict == true;\\n\\t\\t\\t\\tbreak;\\n\\t\\t\\t}\\n\\t\\t}\\n\\n\\t\\treturn conflict;\\n\\t}\",\n \"function clampPosition (pos) {\\n var line = pos.line\\n var column = pos.column\\n return {\\n // According to\\n // <https://github.com/gotwarlost/istanbul/blob/d919f7355027e3c213aa81af5464962d9dc8350b/coverage.json.md#location-objects>\\n // lines start at 1 and columns at 0.\\n line: Math.max(1, line),\\n column: Math.max(0, column)\\n }\\n}\",\n \"function aiCheck(posX,posY){\\n let moves = [];\\n if(posX+1 < 10 && posX +1 >=0 && map[posX+1][posY] !== \\\"-1\\\")\\n {//right\\n moves.push({x:posX+1,y:posY});\\n }\\n if(posX -1 < 10 && posX -1 >=0 && map[posX-1][posY] !== \\\"-1\\\")\\n {//left\\n moves.push({x:posX-1,y:posY});\\n }\\n if(posY +1 < 10 && posY +1 >=0 && map[posX][posY+1] !== \\\"-1\\\")\\n {//down\\n moves.push({x:posX,y:posY+1});\\n }\\n if(posY -1 < 10 && posY -1 >=0 && map[posX][posY-1] !== \\\"-1\\\")\\n {//up\\n moves.push({x:posX,y:posY-1});\\n }\\n //console.log(moves);\\n return moves;\\n}\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.5863681","0.567558","0.55955523","0.5533016","0.5504405","0.5477774","0.54361933","0.53989476","0.53916335","0.5389024","0.53696203","0.53577834","0.5323233","0.5317081","0.53043234","0.5301511","0.5299161","0.52897173","0.52891934","0.5287068","0.5286049","0.52851397","0.5281775","0.5276503","0.52589065","0.52556026","0.5240848","0.52302295","0.52159846","0.5215851","0.5215459","0.5200798","0.5173935","0.51733696","0.5162185","0.5159454","0.514752","0.5143993","0.5142886","0.5142212","0.5142212","0.51350904","0.5132171","0.5120605","0.5098377","0.5082311","0.5069712","0.50482213","0.50475377","0.5036875","0.5035051","0.5028514","0.50195324","0.5017675","0.5007365","0.5004944","0.5004662","0.5002809","0.4992773","0.4989175","0.4985771","0.49764794","0.49659407","0.49648023","0.4958415","0.49442315","0.49417457","0.4936201","0.49360856","0.49292326","0.49253744","0.49204987","0.49185568","0.4914108","0.4911316","0.49090236","0.49090117","0.49084213","0.49010077","0.48964614","0.4895796","0.48953053","0.48885828","0.48884264","0.48801932","0.48793632","0.48790523","0.48700768","0.48680055","0.48663983","0.48663583","0.48551786","0.48524776","0.48513538","0.48482403","0.48481554","0.48467597","0.48466673","0.48465565","0.48449543","0.48438546"],"string":"[\n \"0.5863681\",\n \"0.567558\",\n \"0.55955523\",\n \"0.5533016\",\n \"0.5504405\",\n \"0.5477774\",\n \"0.54361933\",\n \"0.53989476\",\n \"0.53916335\",\n \"0.5389024\",\n \"0.53696203\",\n \"0.53577834\",\n \"0.5323233\",\n \"0.5317081\",\n \"0.53043234\",\n \"0.5301511\",\n \"0.5299161\",\n \"0.52897173\",\n \"0.52891934\",\n \"0.5287068\",\n \"0.5286049\",\n \"0.52851397\",\n \"0.5281775\",\n \"0.5276503\",\n \"0.52589065\",\n \"0.52556026\",\n \"0.5240848\",\n \"0.52302295\",\n \"0.52159846\",\n \"0.5215851\",\n \"0.5215459\",\n \"0.5200798\",\n \"0.5173935\",\n \"0.51733696\",\n \"0.5162185\",\n \"0.5159454\",\n \"0.514752\",\n \"0.5143993\",\n \"0.5142886\",\n \"0.5142212\",\n \"0.5142212\",\n \"0.51350904\",\n \"0.5132171\",\n \"0.5120605\",\n \"0.5098377\",\n \"0.5082311\",\n \"0.5069712\",\n \"0.50482213\",\n \"0.50475377\",\n \"0.5036875\",\n \"0.5035051\",\n \"0.5028514\",\n \"0.50195324\",\n \"0.5017675\",\n \"0.5007365\",\n \"0.5004944\",\n \"0.5004662\",\n \"0.5002809\",\n \"0.4992773\",\n \"0.4989175\",\n \"0.4985771\",\n \"0.49764794\",\n \"0.49659407\",\n \"0.49648023\",\n \"0.4958415\",\n \"0.49442315\",\n \"0.49417457\",\n \"0.4936201\",\n \"0.49360856\",\n \"0.49292326\",\n \"0.49253744\",\n \"0.49204987\",\n \"0.49185568\",\n \"0.4914108\",\n \"0.4911316\",\n \"0.49090236\",\n \"0.49090117\",\n \"0.49084213\",\n \"0.49010077\",\n \"0.48964614\",\n \"0.4895796\",\n \"0.48953053\",\n \"0.48885828\",\n \"0.48884264\",\n \"0.48801932\",\n \"0.48793632\",\n \"0.48790523\",\n \"0.48700768\",\n \"0.48680055\",\n \"0.48663983\",\n \"0.48663583\",\n \"0.48551786\",\n \"0.48524776\",\n \"0.48513538\",\n \"0.48482403\",\n \"0.48481554\",\n \"0.48467597\",\n \"0.48466673\",\n \"0.48465565\",\n \"0.48449543\",\n \"0.48438546\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.0"},"document_rank":{"kind":"string","value":"-1"}}},{"rowIdx":4199,"cells":{"query":{"kind":"string","value":"Search an array of spans for a span matching the given marker."},"document":{"kind":"string","value":"function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n }"},"metadata":{"kind":"string","value":"{\n \"objective\": {\n \"self\": [],\n \"paired\": [],\n \"triplet\": [\n [\n \"query\",\n \"document\",\n \"negatives\"\n ]\n ]\n }\n}"},"negatives":{"kind":"list like","value":["function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }","function getMarkedSpanFor(spans, marker) {\n\t\t if (spans) for (var i = 0; i < spans.length; ++i) {\n\t\t var span = spans[i];\n\t\t if (span.marker == marker) return span;\n\t\t }\n\t\t }","function getMarkedSpanFor(spans, marker) {\r\n if (spans) for (var i = 0; i < spans.length; ++i) {\r\n var span = spans[i];\r\n if (span.marker == marker) return span;\r\n }\r\n }","function getMarkedSpanFor(spans, marker) {\n\t\t if (spans) { for (var i = 0; i < spans.length; ++i) {\n\t\t var span = spans[i];\n\t\t if (span.marker == marker) { return span }\n\t\t } }\n\t\t }","function getMarkedSpanFor(spans, marker) {\n\t if (spans) for (var i = 0; i < spans.length; ++i) {\n\t var span = spans[i];\n\t if (span.marker == marker) return span;\n\t }\n\t }","function getMarkedSpanFor(spans, marker) {\n\t if (spans) for (var i = 0; i < spans.length; ++i) {\n\t var span = spans[i];\n\t if (span.marker == marker) return span;\n\t }\n\t }","function getMarkedSpanFor(spans, marker) {\n\t if (spans) for (var i = 0; i < spans.length; ++i) {\n\t var span = spans[i];\n\t if (span.marker == marker) return span;\n\t }\n\t }","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i]\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i]\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\r\n if (spans) { for (var i = 0; i < spans.length; ++i) {\r\n var span = spans[i];\r\n if (span.marker == marker) { return span }\r\n } }\r\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function getMarkedSpanFor(spans, marker) {\n if (spans) { for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) { return span }\n } }\n}","function findMarker(markers, place) {\n return markers.find(function (value) {\n return value.title.toLowerCase() === place.toLowerCase();\n });\n }","function findMarker(datasetNum, arrayOfMarkers) {\n return arrayOfMarkers[datasetNum].current.marker;\n }","function findMarker(buffer, position) {\n var index;\n for (index = position; index < buffer.length; index++) {\n if ((buffer[index] == marker1) && (buffer[index + 1] == marker2))\n return index;\n }\n return -1;\n}","function findMarkerIndex(name) {\n //name 'SFO - San Fr...'\n return markers.findIndex(function (m) {\n return m.title === name;\n });\n}","function highlight_marker(data) {\n for (var i = 0; i < markers.length; i++) {\n if (markers[i].title == data) {\n makeItBounce( markers[ i ] );\n populateInfoWindow(markers[i], largeInfowindow);\n break;\n }\n }\n}","function findMarker(lat, lng) {\r\n\t\t\tvar marker = null;\r\n\r\n\t\t\tfor (var i = 0; i < _markers.length; i++) {\r\n\t\t\t\tvar m = _markers[i];\r\n\t\t\t\tif (m.position.lat() == lat && m.position.lng() == lng) {\r\n\t\t\t\t\tmarker = m;\r\n\t\t\t\t\tbreak;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\r\n\t\t\treturn marker;\r\n\r\n\t\t} // findMarker","function findInArray(arr, val){\n var foundIt = arr.indexOf(val);\n if(arr[foundIt] === val) {\n return true;\n }\n else return false;\n}","function findNeedle(array) {\n\n for (let i=0; i < array.length; i++){\n if (array[i] === 'needle') return 'found the needle at position ' + i;\n }\n \n}","function search() {\n // Retrieves the value in the search text <input> tag\n // For loop to search through all students names and emails for a match to student text <input> entry\n // If a match is found it is added to the visibleStudents[] array \n let entry = studentSearchInput.value;\n for (let i = 0; i < students.length; i++) {\n let studentName = students[i].querySelector('div h3').textContent;\n let studentEmail = students[i].querySelector('.email').textContent;\n\n if (studentName.indexOf(entry) >= 0 || studentEmail.indexOf(entry) >= 0) {\n visibleStudents.push(i);\n }\n }\n}","function linearSearchIndexOf(arr, val) {\n for (let i = 0; i < arr.length; i++) {\n if (val === arr[i]) return i;\n }\n return -1;\n}","function linearSearch(arr, val){\n for(let i=0; i<arr.length; i++){\n if(arr[i] === val){\n return i;\n }\n return -1;\n }\n console.log('Hello World!')\n}","function search(arr, item) {\n return arr.indexOf(item);\n }","function linearSearch(arr, val) {\n for (let i = 0; i < arr.length; i++) {\n if (arr[i] === val) return i\n }\n return -1\n}","function search(arr, item) {\n return arr.indexOf(item)\n }","function indexOf(arr, searchItem) {\n // code here\n}","function indexOf(arr, searchItem) {\n // code here\n}","function findWaldo(arr, found) {\n for (var i = 0; i < arr.length; i++) {\n debugger;\n if (arr[i] == \"Waldo\") {\n found(i); // execute callback\n }\n }\n}","function removeMarkedSpan(spans, span) {\n\t\t for (var r, i = 0; i < spans.length; ++i)\n\t\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\n\t\t return r;\n\t\t }","function linearSearch(arr, val){\n for (var i = 0; i < arr.length; i++) {\n if (arr[i] === val) {\n return i;\n }\n }\n return -1;\n}","function linear_search(arr, n){\n for(var elem of arr){\n if(elem === n){\n return arr.indexOf(elem);\n }\n }\n}","function addlistenertoMarkers(k) {\n for (var i = 0; i < snowCaps.peaks.length; i++) {\n if (snowCaps.peaks[i].marker.id == k) {\n locateSelected(snowCaps.peaks[i]);\n }\n }\n}","function search(arr, item) {\n\treturn arr.indexOf(item)\n}","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function removeMarkedSpan(spans, span) {\n for (var r, i = 0; i < spans.length; ++i)\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\n return r;\n }","function search(arr, item) {\n return arr.indexOf(item);\n}","function removeMarkedSpan(spans, span) {\n\t for (var r, i = 0; i < spans.length; ++i)\n\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\n\t return r;\n\t }","function removeMarkedSpan(spans, span) {\n\t for (var r, i = 0; i < spans.length; ++i)\n\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\n\t return r;\n\t }","function removeMarkedSpan(spans, span) {\n\t for (var r, i = 0; i < spans.length; ++i)\n\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\n\t return r;\n\t }","function removeMarkedSpan(spans, span) {\r\n for (var r, i = 0; i < spans.length; ++i)\r\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\r\n return r;\r\n }","function renderSpan(sid, spanIds) {\n var element = document.createElement('span');\n element.setAttribute('id', sid);\n element.setAttribute('title', '[' + sid + '] ');\n element.setAttribute('class', 'span');\n\n var pid = getPidBySid(sid);\n var beg = spans[sid].begin;\n var end = spans[sid].end;\n var len = end - beg;\n\n var c; // index of current span\n for (c = 0; c < spanIds.length; c++) if (spanIds[c] == sid) break;\n\n var begnode = document.getElementById(pid).childNodes[0];\n var begoff = beg - pars[pid].begin;\n\n // adjust the begin node and offset\n if (c > 0) {\n var p = c - 1; // index of preceding span\n\n // when the previous span includes the region\n if (spans[spanIds[p]].end > beg) {\n begnode = document.getElementById(spanIds[p]).childNodes[0];\n begoff = beg - spans[spanIds[p]].begin;\n }\n\n else {\n if (getPidBySid(spanIds[p]) == pid) {\n // find the outermost preceding span\n var pnode = document.getElementById(spanIds[p]);\n while (pnode.parentElement &&\n spans[pnode.parentElement.id] &&\n spans[pnode.parentElement.id].end > spans[pnode.id].begin &&\n spans[pnode.parentElement.id].end < end) {pnode = pnode.parentElement}\n\n begnode = pnode.nextSibling;\n begoff = beg - spans[pnode.id].end;\n }\n }\n }\n\n var endnode = begnode;\n var endoff = begoff + len;\n\n // if there is an intervening span, adjust the end node and offset\n if ((c < spanIds.length - 1) && (end > spans[spanIds[c + 1]].begin)) {\n var i = c + 1; // index of the rightmost intervening span\n // if there is a room for further intervening\n while (i < spanIds.length - 1) {\n // find the next span at the same level\n var n = i + 1;\n while ((n < spanIds.length) && (spans[spanIds[n]].begin < spans[spanIds[i]].end)) n++;\n if (n == spanIds.length) break;\n if (end > spans[spanIds[n]].begin) i = n;\n else break;\n }\n endnode = document.getElementById(spanIds[i]).nextSibling;\n endoff = end - spans[spanIds[i]].end;\n }\n\n var range = document.createRange();\n range.setStart(begnode, begoff);\n range.setEnd(endnode, endoff);\n range.surroundContents(element);\n\n $('#' + sid).off('mouseup', spanClicked).on('mouseup', spanClicked);\n }","function linearSearch(arr, val) {\n // Loop through the array and check if the current array element is equal to the value\n for (let i = 0; i < arr.length; i++) {\n // If it is, return the index at which the element is found\n if (arr[i] === val) return i;\n \n }\n // if the value is never found, return -1;\n return -1;\n}","function searchLocations(str) {\n var input = str.toLowerCase();\n var locations = LVM.getLocations();\n var temp_array = []\n console.log('input: \"' + input + '\"');\n\n // Do nothing if input has not changed.\n if (LVM.searchInput() == str) { return; }\n\n // Body\n for (var i = 0; i < locations.length; i++) {\n var item = LVM.currLocations()[i];\n var marker = markers[i];\n // I chose to use `setMap()` instead of `setVisible()` because the\n // infowindow doesn't automatically hide in `setVisible()`.\n if (locations[i].title.toLowerCase().includes(input)) {\n item.toHide(false);\n marker.setVisible(true);\n temp_array.push(marker);\n } else {\n item.toHide(true);\n marker.setVisible(false);\n\n // Hide infowindow if marker is not shown\n if (largeInfowindow.marker == marker) {\n console.log(\"close infowindow\");\n largeInfowindow.close();\n console.log(largeInfowindow);\n }\n }\n }\n\n // Closing\n if (temp_array.length > 0) { fitBounds(temp_array); }\n LVM.searchInput(str);\n}","function search(arr, val) {\n for (let i = 0; i < arr.length; i++) {\n if (arr[i] === val) {\n return i;\n }\n }\n return -1\n}","function removeMarkedSpan(spans, span) {\n\t\t var r;\n\t\t for (var i = 0; i < spans.length; ++i)\n\t\t { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n\t\t return r\n\t\t }","function linearSearch(arr, num) {\n // add whatever parameters you deem necessary - good luck!\n let indexOfItem = -1;\n for (let i = 0; i < arr.length; i++) {\n if (arr[i] === num) indexOfItem = i;\n }\n return indexOfItem;\n}","function search(arr, val) {\n for (let i = 0; i < arr.length; i++) {\n if (arr[i] === val) {\n return i\n }\n }\n return -1\n}","function removeMarkedSpan(spans, span) {\n var r;\n\n for (var i = 0; i < spans.length; ++i) {\n if (spans[i] != span) {\n (r || (r = [])).push(spans[i]);\n }\n }\n\n return r;\n } // Add a span to a line.","function removeMarkedSpan(spans, span) {\n var r\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]) } }\n return r\n}","function removeMarkedSpan(spans, span) {\n var r\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]) } }\n return r\n}","function linearSearch(arr, val){\n// loop through the array and check if the\n for(let i = 0; i < arr.length; i++){\n // current array element is equal to the value\n if(arr[i] === val)return i;//if it is, return the index at which the element is found\n }\n return -1;// if the value is never found, return -1\n \n }","function search (arr, val) {\n for (let i = 0; i < arr.length; i++) {\n if (arr[i] === value) {\n return i\n }\n }\n return -1;\n}","function linearSearch(arr, val) {\n\n ////// doesn't work because return statement returns \n ////// the inner anonymous callback function to forEach not linearSearch itself!\n // arr.forEach((element, index) => {\n // console.log(element, index, element === val);\n // if (element === val) {\n // console.log('found it!');\n // return index;\n // }\n // });\n\n for (let i = 0; i < arr.length; i++) {\n let element = arr[i];\n if (element === val) {\n return i;\n }\n }\n\n return -1;\n}","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }","function removeMarkedSpan(spans, span) {\n var r;\n for (var i = 0; i < spans.length; ++i)\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\n return r\n }"],"string":"[\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) return span;\\n }\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n\\t\\t if (spans) for (var i = 0; i < spans.length; ++i) {\\n\\t\\t var span = spans[i];\\n\\t\\t if (span.marker == marker) return span;\\n\\t\\t }\\n\\t\\t }\",\n \"function getMarkedSpanFor(spans, marker) {\\r\\n if (spans) for (var i = 0; i < spans.length; ++i) {\\r\\n var span = spans[i];\\r\\n if (span.marker == marker) return span;\\r\\n }\\r\\n }\",\n \"function getMarkedSpanFor(spans, marker) {\\n\\t\\t if (spans) { for (var i = 0; i < spans.length; ++i) {\\n\\t\\t var span = spans[i];\\n\\t\\t if (span.marker == marker) { return span }\\n\\t\\t } }\\n\\t\\t }\",\n \"function getMarkedSpanFor(spans, marker) {\\n\\t if (spans) for (var i = 0; i < spans.length; ++i) {\\n\\t var span = spans[i];\\n\\t if (span.marker == marker) return span;\\n\\t }\\n\\t }\",\n \"function getMarkedSpanFor(spans, marker) {\\n\\t if (spans) for (var i = 0; i < spans.length; ++i) {\\n\\t var span = spans[i];\\n\\t if (span.marker == marker) return span;\\n\\t }\\n\\t }\",\n \"function getMarkedSpanFor(spans, marker) {\\n\\t if (spans) for (var i = 0; i < spans.length; ++i) {\\n\\t var span = spans[i];\\n\\t if (span.marker == marker) return span;\\n\\t }\\n\\t }\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i]\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i]\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\r\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\r\\n var span = spans[i];\\r\\n if (span.marker == marker) { return span }\\r\\n } }\\r\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function getMarkedSpanFor(spans, marker) {\\n if (spans) { for (var i = 0; i < spans.length; ++i) {\\n var span = spans[i];\\n if (span.marker == marker) { return span }\\n } }\\n}\",\n \"function findMarker(markers, place) {\\n return markers.find(function (value) {\\n return value.title.toLowerCase() === place.toLowerCase();\\n });\\n }\",\n \"function findMarker(datasetNum, arrayOfMarkers) {\\n return arrayOfMarkers[datasetNum].current.marker;\\n }\",\n \"function findMarker(buffer, position) {\\n var index;\\n for (index = position; index < buffer.length; index++) {\\n if ((buffer[index] == marker1) && (buffer[index + 1] == marker2))\\n return index;\\n }\\n return -1;\\n}\",\n \"function findMarkerIndex(name) {\\n //name 'SFO - San Fr...'\\n return markers.findIndex(function (m) {\\n return m.title === name;\\n });\\n}\",\n \"function highlight_marker(data) {\\n for (var i = 0; i < markers.length; i++) {\\n if (markers[i].title == data) {\\n makeItBounce( markers[ i ] );\\n populateInfoWindow(markers[i], largeInfowindow);\\n break;\\n }\\n }\\n}\",\n \"function findMarker(lat, lng) {\\r\\n\\t\\t\\tvar marker = null;\\r\\n\\r\\n\\t\\t\\tfor (var i = 0; i < _markers.length; i++) {\\r\\n\\t\\t\\t\\tvar m = _markers[i];\\r\\n\\t\\t\\t\\tif (m.position.lat() == lat && m.position.lng() == lng) {\\r\\n\\t\\t\\t\\t\\tmarker = m;\\r\\n\\t\\t\\t\\t\\tbreak;\\r\\n\\t\\t\\t\\t}\\r\\n\\t\\t\\t}\\r\\n\\r\\n\\t\\t\\treturn marker;\\r\\n\\r\\n\\t\\t} // findMarker\",\n \"function findInArray(arr, val){\\n var foundIt = arr.indexOf(val);\\n if(arr[foundIt] === val) {\\n return true;\\n }\\n else return false;\\n}\",\n \"function findNeedle(array) {\\n\\n for (let i=0; i < array.length; i++){\\n if (array[i] === 'needle') return 'found the needle at position ' + i;\\n }\\n \\n}\",\n \"function search() {\\n // Retrieves the value in the search text <input> tag\\n // For loop to search through all students names and emails for a match to student text <input> entry\\n // If a match is found it is added to the visibleStudents[] array \\n let entry = studentSearchInput.value;\\n for (let i = 0; i < students.length; i++) {\\n let studentName = students[i].querySelector('div h3').textContent;\\n let studentEmail = students[i].querySelector('.email').textContent;\\n\\n if (studentName.indexOf(entry) >= 0 || studentEmail.indexOf(entry) >= 0) {\\n visibleStudents.push(i);\\n }\\n }\\n}\",\n \"function linearSearchIndexOf(arr, val) {\\n for (let i = 0; i < arr.length; i++) {\\n if (val === arr[i]) return i;\\n }\\n return -1;\\n}\",\n \"function linearSearch(arr, val){\\n for(let i=0; i<arr.length; i++){\\n if(arr[i] === val){\\n return i;\\n }\\n return -1;\\n }\\n console.log('Hello World!')\\n}\",\n \"function search(arr, item) {\\n return arr.indexOf(item);\\n }\",\n \"function linearSearch(arr, val) {\\n for (let i = 0; i < arr.length; i++) {\\n if (arr[i] === val) return i\\n }\\n return -1\\n}\",\n \"function search(arr, item) {\\n return arr.indexOf(item)\\n }\",\n \"function indexOf(arr, searchItem) {\\n // code here\\n}\",\n \"function indexOf(arr, searchItem) {\\n // code here\\n}\",\n \"function findWaldo(arr, found) {\\n for (var i = 0; i < arr.length; i++) {\\n debugger;\\n if (arr[i] == \\\"Waldo\\\") {\\n found(i); // execute callback\\n }\\n }\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n\\t\\t for (var r, i = 0; i < spans.length; ++i)\\n\\t\\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n\\t\\t return r;\\n\\t\\t }\",\n \"function linearSearch(arr, val){\\n for (var i = 0; i < arr.length; i++) {\\n if (arr[i] === val) {\\n return i;\\n }\\n }\\n return -1;\\n}\",\n \"function linear_search(arr, n){\\n for(var elem of arr){\\n if(elem === n){\\n return arr.indexOf(elem);\\n }\\n }\\n}\",\n \"function addlistenertoMarkers(k) {\\n for (var i = 0; i < snowCaps.peaks.length; i++) {\\n if (snowCaps.peaks[i].marker.id == k) {\\n locateSelected(snowCaps.peaks[i]);\\n }\\n }\\n}\",\n \"function search(arr, item) {\\n\\treturn arr.indexOf(item)\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n for (var r, i = 0; i < spans.length; ++i)\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n return r;\\n }\",\n \"function search(arr, item) {\\n return arr.indexOf(item);\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n\\t for (var r, i = 0; i < spans.length; ++i)\\n\\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n\\t return r;\\n\\t }\",\n \"function removeMarkedSpan(spans, span) {\\n\\t for (var r, i = 0; i < spans.length; ++i)\\n\\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n\\t return r;\\n\\t }\",\n \"function removeMarkedSpan(spans, span) {\\n\\t for (var r, i = 0; i < spans.length; ++i)\\n\\t if (spans[i] != span) (r || (r = [])).push(spans[i]);\\n\\t return r;\\n\\t }\",\n \"function removeMarkedSpan(spans, span) {\\r\\n for (var r, i = 0; i < spans.length; ++i)\\r\\n if (spans[i] != span) (r || (r = [])).push(spans[i]);\\r\\n return r;\\r\\n }\",\n \"function renderSpan(sid, spanIds) {\\n var element = document.createElement('span');\\n element.setAttribute('id', sid);\\n element.setAttribute('title', '[' + sid + '] ');\\n element.setAttribute('class', 'span');\\n\\n var pid = getPidBySid(sid);\\n var beg = spans[sid].begin;\\n var end = spans[sid].end;\\n var len = end - beg;\\n\\n var c; // index of current span\\n for (c = 0; c < spanIds.length; c++) if (spanIds[c] == sid) break;\\n\\n var begnode = document.getElementById(pid).childNodes[0];\\n var begoff = beg - pars[pid].begin;\\n\\n // adjust the begin node and offset\\n if (c > 0) {\\n var p = c - 1; // index of preceding span\\n\\n // when the previous span includes the region\\n if (spans[spanIds[p]].end > beg) {\\n begnode = document.getElementById(spanIds[p]).childNodes[0];\\n begoff = beg - spans[spanIds[p]].begin;\\n }\\n\\n else {\\n if (getPidBySid(spanIds[p]) == pid) {\\n // find the outermost preceding span\\n var pnode = document.getElementById(spanIds[p]);\\n while (pnode.parentElement &&\\n spans[pnode.parentElement.id] &&\\n spans[pnode.parentElement.id].end > spans[pnode.id].begin &&\\n spans[pnode.parentElement.id].end < end) {pnode = pnode.parentElement}\\n\\n begnode = pnode.nextSibling;\\n begoff = beg - spans[pnode.id].end;\\n }\\n }\\n }\\n\\n var endnode = begnode;\\n var endoff = begoff + len;\\n\\n // if there is an intervening span, adjust the end node and offset\\n if ((c < spanIds.length - 1) && (end > spans[spanIds[c + 1]].begin)) {\\n var i = c + 1; // index of the rightmost intervening span\\n // if there is a room for further intervening\\n while (i < spanIds.length - 1) {\\n // find the next span at the same level\\n var n = i + 1;\\n while ((n < spanIds.length) && (spans[spanIds[n]].begin < spans[spanIds[i]].end)) n++;\\n if (n == spanIds.length) break;\\n if (end > spans[spanIds[n]].begin) i = n;\\n else break;\\n }\\n endnode = document.getElementById(spanIds[i]).nextSibling;\\n endoff = end - spans[spanIds[i]].end;\\n }\\n\\n var range = document.createRange();\\n range.setStart(begnode, begoff);\\n range.setEnd(endnode, endoff);\\n range.surroundContents(element);\\n\\n $('#' + sid).off('mouseup', spanClicked).on('mouseup', spanClicked);\\n }\",\n \"function linearSearch(arr, val) {\\n // Loop through the array and check if the current array element is equal to the value\\n for (let i = 0; i < arr.length; i++) {\\n // If it is, return the index at which the element is found\\n if (arr[i] === val) return i;\\n \\n }\\n // if the value is never found, return -1;\\n return -1;\\n}\",\n \"function searchLocations(str) {\\n var input = str.toLowerCase();\\n var locations = LVM.getLocations();\\n var temp_array = []\\n console.log('input: \\\"' + input + '\\\"');\\n\\n // Do nothing if input has not changed.\\n if (LVM.searchInput() == str) { return; }\\n\\n // Body\\n for (var i = 0; i < locations.length; i++) {\\n var item = LVM.currLocations()[i];\\n var marker = markers[i];\\n // I chose to use `setMap()` instead of `setVisible()` because the\\n // infowindow doesn't automatically hide in `setVisible()`.\\n if (locations[i].title.toLowerCase().includes(input)) {\\n item.toHide(false);\\n marker.setVisible(true);\\n temp_array.push(marker);\\n } else {\\n item.toHide(true);\\n marker.setVisible(false);\\n\\n // Hide infowindow if marker is not shown\\n if (largeInfowindow.marker == marker) {\\n console.log(\\\"close infowindow\\\");\\n largeInfowindow.close();\\n console.log(largeInfowindow);\\n }\\n }\\n }\\n\\n // Closing\\n if (temp_array.length > 0) { fitBounds(temp_array); }\\n LVM.searchInput(str);\\n}\",\n \"function search(arr, val) {\\n for (let i = 0; i < arr.length; i++) {\\n if (arr[i] === val) {\\n return i;\\n }\\n }\\n return -1\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n\\t\\t var r;\\n\\t\\t for (var i = 0; i < spans.length; ++i)\\n\\t\\t { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n\\t\\t return r\\n\\t\\t }\",\n \"function linearSearch(arr, num) {\\n // add whatever parameters you deem necessary - good luck!\\n let indexOfItem = -1;\\n for (let i = 0; i < arr.length; i++) {\\n if (arr[i] === num) indexOfItem = i;\\n }\\n return indexOfItem;\\n}\",\n \"function search(arr, val) {\\n for (let i = 0; i < arr.length; i++) {\\n if (arr[i] === val) {\\n return i\\n }\\n }\\n return -1\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n\\n for (var i = 0; i < spans.length; ++i) {\\n if (spans[i] != span) {\\n (r || (r = [])).push(spans[i]);\\n }\\n }\\n\\n return r;\\n } // Add a span to a line.\",\n \"function removeMarkedSpan(spans, span) {\\n var r\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]) } }\\n return r\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n var r\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]) } }\\n return r\\n}\",\n \"function linearSearch(arr, val){\\n// loop through the array and check if the\\n for(let i = 0; i < arr.length; i++){\\n // current array element is equal to the value\\n if(arr[i] === val)return i;//if it is, return the index at which the element is found\\n }\\n return -1;// if the value is never found, return -1\\n \\n }\",\n \"function search (arr, val) {\\n for (let i = 0; i < arr.length; i++) {\\n if (arr[i] === value) {\\n return i\\n }\\n }\\n return -1;\\n}\",\n \"function linearSearch(arr, val) {\\n\\n ////// doesn't work because return statement returns \\n ////// the inner anonymous callback function to forEach not linearSearch itself!\\n // arr.forEach((element, index) => {\\n // console.log(element, index, element === val);\\n // if (element === val) {\\n // console.log('found it!');\\n // return index;\\n // }\\n // });\\n\\n for (let i = 0; i < arr.length; i++) {\\n let element = arr[i];\\n if (element === val) {\\n return i;\\n }\\n }\\n\\n return -1;\\n}\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\",\n \"function removeMarkedSpan(spans, span) {\\n var r;\\n for (var i = 0; i < spans.length; ++i)\\n { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }\\n return r\\n }\"\n]","isConversational":false},"negative_scores":{"kind":"list like","value":["0.7195285","0.7195285","0.7195285","0.7195285","0.7195285","0.7195285","0.7195285","0.7165243","0.7141147","0.71237963","0.7118984","0.7118984","0.7118984","0.7104211","0.7104211","0.71036065","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.70881194","0.6291824","0.5888308","0.55972856","0.55906487","0.5536975","0.5481095","0.53504705","0.534119","0.533259","0.52397794","0.5206674","0.5190822","0.5182659","0.5180181","0.51685643","0.51685643","0.51681036","0.5159172","0.5142567","0.5125742","0.51129997","0.5110917","0.5109743","0.5109743","0.5109743","0.5109743","0.5109743","0.5109743","0.5109743","0.51064223","0.5100045","0.5100045","0.5100045","0.50987095","0.5093999","0.50936925","0.50378525","0.5036692","0.5032118","0.5027147","0.50094205","0.5006988","0.5006471","0.5006471","0.5000879","0.49964815","0.49902797","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993","0.4989993"],"string":"[\n \"0.7195285\",\n \"0.7195285\",\n \"0.7195285\",\n \"0.7195285\",\n \"0.7195285\",\n \"0.7195285\",\n \"0.7195285\",\n \"0.7165243\",\n \"0.7141147\",\n \"0.71237963\",\n \"0.7118984\",\n \"0.7118984\",\n \"0.7118984\",\n \"0.7104211\",\n \"0.7104211\",\n \"0.71036065\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.70881194\",\n \"0.6291824\",\n \"0.5888308\",\n \"0.55972856\",\n \"0.55906487\",\n \"0.5536975\",\n \"0.5481095\",\n \"0.53504705\",\n \"0.534119\",\n \"0.533259\",\n \"0.52397794\",\n \"0.5206674\",\n \"0.5190822\",\n \"0.5182659\",\n \"0.5180181\",\n \"0.51685643\",\n \"0.51685643\",\n \"0.51681036\",\n \"0.5159172\",\n \"0.5142567\",\n \"0.5125742\",\n \"0.51129997\",\n \"0.5110917\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.5109743\",\n \"0.51064223\",\n \"0.5100045\",\n \"0.5100045\",\n \"0.5100045\",\n \"0.50987095\",\n \"0.5093999\",\n \"0.50936925\",\n \"0.50378525\",\n \"0.5036692\",\n \"0.5032118\",\n \"0.5027147\",\n \"0.50094205\",\n \"0.5006988\",\n \"0.5006471\",\n \"0.5006471\",\n \"0.5000879\",\n \"0.49964815\",\n \"0.49902797\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\",\n \"0.4989993\"\n]","isConversational":false},"document_score":{"kind":"string","value":"0.7182503"},"document_rank":{"kind":"string","value":"19"}}}],"truncated":false,"partial":true},"paginationData":{"pageIndex":41,"numItemsPerPage":100,"numTotalItems":82052,"offset":4100,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc3Mzc1OTU0OCwic3ViIjoiL2RhdGFzZXRzL25vbWljLWFpL2Nvcm5zdGFjay1qYXZhc2NyaXB0LXYxIiwiZXhwIjoxNzczNzYzMTQ4LCJpc3MiOiJodHRwczovL2h1Z2dpbmdmYWNlLmNvIn0.sq3qeaH2sdaCkj6uqsPdgQJW47ATAD0kXCiaCWwtlr_wypaI7vEf8hTcUcovz1PTgHp5yy1yXdjuypShcq1sBg","displayUrls":true,"splitSizeSummaries":[{"config":"default","split":"train","numRows":82052,"numBytesParquet":1713312505}]},"discussionsStats":{"closed":0,"open":0,"total":0},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
Search is not available for this dataset
query stringlengths 7 355k | document stringlengths 9 341k | metadata dict | negatives listlengths 0 101 | negative_scores listlengths 0 101 | document_score stringlengths 3 10 | document_rank stringclasses 102 values |
|---|---|---|---|---|---|---|
var recursivePromise = Promise.promisify( | function recursiveDataGrabber(query, max, data, callback_0){
console.log('Controller: Data with Max: '+data.length +' MAX: '+ max);
search.getAllUserInstancesAgain(query,max).then(function (results){
results = JSON.parse(results);
data = data.concat(results);
if (data.length >= limit || results.length < 200) {
console.log('Controller: Recursion DONE LENGTH:'+data.length);
callback_0(data);
return;
}
else
{
recursiveDataGrabber(query, results[199].id_str, data, callback_0);
}
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function promisify(inner) {\n return new Promise((resolve, reject) =>\n inner((err, res) => {\n if (err) return reject(err);\n else return resolve(res);\n })\n );\n}",
"function promisify(fn) {\n return function(...args) {\n return new Promise( function(resolve, reject) {\n ... | [
"0.6813291",
"0.6415146",
"0.640557",
"0.6283072",
"0.62223774",
"0.6081148",
"0.60807854",
"0.6064911",
"0.60550886",
"0.60303",
"0.5965134",
"0.5840433",
"0.5803601",
"0.5795231",
"0.5795231",
"0.5795231",
"0.5770007",
"0.57583547",
"0.57022774",
"0.5701393",
"0.5701393",
... | 0.0 | -1 |
CODILITY PROBLEMS ============================================================================================== Lesson 4 Counting Elements ============================================================================================== L4 Perm Checker / A nonempty zeroindexed array A consisting of N integers is given. A permutation is a sequence containing each element from 1 to N once, and only once. For example, array A such that: A[0] = 4 A[1] = 1 A[2] = 3 A[3] = 2 is a permutation, but array A such that: A[0] = 4 A[1] = 1 A[2] = 3 is not a permutation, because value 2 is missing. The goal is to check whether array A is a permutation. Write a function: function solution(A); that, given a zeroindexed array A, returns 1 if array A is a permutation and 0 if it is not. For example, given array A such that: A[0] = 4 A[1] = 1 A[2] = 3 A[3] = 2 the function should return 1. Given array A such that: A[0] = 4 A[1] = 1 A[2] = 3 the function should return 0. Assume that: N is an integer within the range [1..100,000]; each element of array A is an integer within the range [1..1,000,000,000]. Complexity: expected worstcase time complexity is O(N); expected worstcase space complexity is O(N), beyond input storage (not counting the storage required for input arguments). Elements of input arrays can be modified. Perm Check permutation checker, given a zeroindexed array A, returns 1 if array A is a permutation and 0 if it is not | function permCheck(A) {
var distinctNumberObject = {}, len = A.length, largest = Math.max.apply(Math,A), distinctNumbersCounted = 0;
// largest number must equal size of array for it to be a permutation.
if (largest === len) {
for (i = 0; i < len; i++) {
var distinctNumberIndex = A[i] - 1;
if (!distinctNumberObject[distinctNumberIndex]) {
distinctNumberObject[distinctNumberIndex] = true;
distinctNumbersCounted++;
if (distinctNumbersCounted === largest) {
return 1;
}
}
}
}
return 0;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function solution(A) {\n // write your code in JavaScript (Node.js 8.9.4)\n const N = A.length;\n let count = new Array(N+1).fill(0);\n \n for(let i in A){\n if(A[i] > N){\n return 0;\n }\n if(count[A[i]] > 0){\n return 0;\n }\n count[A[i]]++;... | [
"0.68444836",
"0.66633946",
"0.6649471",
"0.6557802",
"0.64224577",
"0.63520896",
"0.62780696",
"0.62755716",
"0.62748027",
"0.62715364",
"0.6223827",
"0.61813194",
"0.61736655",
"0.6140965",
"0.61363196",
"0.610516",
"0.6084023",
"0.6071268",
"0.6035077",
"0.59985274",
"0.59... | 0.77779937 | 0 |
Create the function to run for both events | function runEnter() {
// Prevent the page from refreshing
d3.event.preventDefault();
// Select the input element and get the raw HTML node
var inputElementDate = d3.select("#datetime");
// var inputElementCity = d3.select("#city");
// var inputElementState = d3.select("#state");
// var inputElementCountry = d3.select("#country");
// var inputElementShape = d3.select("#shape");
// Get the value property of the input element
var inputValue = inputElementDate.property("value").trim();
console.log(inputValue);
var filteredData = dataList.filter(dataList => dataList.datetime === inputValue);
console.log(filteredData);
tbody.html("");
let response = {
filteredData
};
if(response.filteredData.length !== 0) {
getData(filteredData);
}
else {
tbody.append("tr").append("td").text("There are no sightings for the current search criteria. Please try again!");
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Events(){}//",
"function Events(){}//",
"onEvent() {\n \n }",
"function EventHelper (possibleEvents) {\n }",
"function constroiEventos(){}",
"handleEvents() {\n }",
"function Events() {}",
"function Events() {}",
"function Events() {}",
"function Events() {}",
"function Events... | [
"0.6424834",
"0.6424834",
"0.6390404",
"0.6353437",
"0.63517565",
"0.62114793",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
"0.6175389",
... | 0.0 | -1 |
random float for specifying ball direction | function randomFloat(min,max){
return min+(Math.random()*(max-min));
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function BallStartPosition()\n {\n var randomNum = Math.floor(Math.random()*2)\n if(randomNum == 0)\n {\n ball.speedX = -ball.speedX;\n ball.speedY = -ball.speedY;\n }\n if(randomNum == 1)\n {\n ball.speedX = Math.abs(ball.speedX);\n ball.speedY = Math.abs(ball.speedY);\n }\n ... | [
"0.7768337",
"0.77296907",
"0.74361587",
"0.73115885",
"0.7135385",
"0.71310353",
"0.7108028",
"0.7074491",
"0.7020762",
"0.7005384",
"0.7002904",
"0.6989081",
"0.6962469",
"0.6896277",
"0.6894648",
"0.6847753",
"0.6826241",
"0.67911685",
"0.6751009",
"0.67328095",
"0.6731257... | 0.0 | -1 |
random color for balls | function randomColor(){
return `rgb(${randomInt(0,256)},${randomInt(0,256)},${randomInt(0,256)})`;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function randomColor() {\n r = random(255);\n g = random(255);\n b = random(255);\n}",
"function ballsBgColor() {\n const randomNumber = Math.floor(Math.random() * balls.length);// Random number between 0 and 5\n for (let i = 0; i < balls.length; i += 1) {\n if (i === randomNumber) { // To put the answer... | [
"0.81134444",
"0.7710204",
"0.77017725",
"0.77001345",
"0.76753265",
"0.767251",
"0.76707643",
"0.7653003",
"0.76454043",
"0.7631624",
"0.76299345",
"0.7571218",
"0.7569614",
"0.75645864",
"0.75579494",
"0.7557005",
"0.75545645",
"0.7542439",
"0.75405586",
"0.7533367",
"0.752... | 0.0 | -1 |
generates balls on screen | function generate(){
for (let i=0;i<randomInt(40,300);i++){
var x = randomInt(50,1150);
var y = randomInt(50,650);
var r = randomInt(10,30);
cond = false;
if(i!==0){
do{
x = randomInt(50,1150);
y = randomInt(50,650);
r = randomInt(10,30);
for(j = 0; j < ballarray.length; j++){
if (dist(x,y,ballarray[j].x,ballarray[j].y) -(r + ballarray[j].size)< 10){
cond = true;
break;
}
else{
cond =false;
}
}
}while(cond);
}
ballarray.push(new ball(x,y,r));
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function initBalls() {\n container.css({'position':'relative'});\n for (i=0;i<ballCount;i++) {\n var newBall = $('<b />').appendTo(container),\n size = rand(ballMinSize,ballMaxSize);\n newBall.css({\n 'position':'absolute',\n 'width': '5em',\n 'height': '5em',\n 'background-image... | [
"0.79297787",
"0.77312446",
"0.76148176",
"0.7614811",
"0.7538535",
"0.7502164",
"0.74750805",
"0.7460339",
"0.74571425",
"0.73702365",
"0.7358047",
"0.73537654",
"0.73315406",
"0.73086935",
"0.7247816",
"0.7241751",
"0.7214185",
"0.7196349",
"0.7102294",
"0.708334",
"0.70823... | 0.6984431 | 24 |
Retrieve the search results. | componentWillMount(): void {
this._updateSearch(this.props.filter);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function searchAndResults() {\n return messenger.searchIsReady().then(function (data) {\n var bag = data;\n quickSearch.getFormConfig($stateParams.entityId, $stateParams.userId, $stateParams.formId).then(function (data) {\n vm.data = data;\n ... | [
"0.7297593",
"0.72167414",
"0.7154665",
"0.70559335",
"0.7008465",
"0.7007643",
"0.69624525",
"0.69535667",
"0.6947637",
"0.6902696",
"0.6847962",
"0.6824126",
"0.67735595",
"0.67410344",
"0.67110157",
"0.66888815",
"0.6644403",
"0.6642325",
"0.66234",
"0.66161823",
"0.660391... | 0.0 | -1 |
const socket = io.connect(); Function that will get the Streamer's camera | async function startVideo() {
console.log("Requesting Local Media");
try {
// TODO: Add checking for camera and audio
const userMedia = await navigator.mediaDevices.getUserMedia({
audio: false,
video: true,
});
console.log("Recieved Local Media");
stream = userMedia;
videoElementHTML.srcObject = stream;
socket.emit("stream_online");
} catch (err) {
console.error(`Error getting local media: ${err}`);
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function onLoad() {\n // opens websocket\n function isOpen(ws) {\n return socket.readyState === ws.OPEN;\n }\n //connecting to camera using websocket\n var socket = new WebSocket(\"ws://\" + window.location.host + \"/ws\");\n var img_socket = new WebSocket(\n \"ws://\" + window.location.host + \"/ws_ca... | [
"0.7234021",
"0.7009632",
"0.6764083",
"0.6715808",
"0.6542103",
"0.6523225",
"0.6460521",
"0.6446046",
"0.6441944",
"0.643081",
"0.6361702",
"0.62628293",
"0.6206829",
"0.61739737",
"0.6143523",
"0.612827",
"0.6116145",
"0.6101446",
"0.60846347",
"0.60835785",
"0.6079427",
... | 0.59327835 | 32 |
Only show the star counter if the number of star is greater than 2 | showStarCounter() {
const currentBoard = Boards.findOne(Session.get('currentBoard'));
return currentBoard && currentBoard.stars >= 2;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function starCount() {\n if (moves == 22 || moves == 27 || moves == 32) {\n hideStar();\n }\n}",
"function starCount() {\n if (moveCount >= starChart4 && moveCount < starChart3) {\n $('.star4').hide();\n starResult = 3;\n\t}\n else if (moveCount >= starChart3 && moveCount < starChart2) {\n $('.st... | [
"0.75931925",
"0.75653076",
"0.75070995",
"0.7431751",
"0.74291766",
"0.7384715",
"0.72422016",
"0.7238542",
"0.71884614",
"0.71672255",
"0.71468824",
"0.71317893",
"0.7130833",
"0.70577246",
"0.70502913",
"0.7042862",
"0.7031024",
"0.7030213",
"0.6967661",
"0.69583267",
"0.6... | 0.75144744 | 2 |
Limit amount of threads used for each image sharp.concurrency(1); Create preview for image path Image file path. resizeConfig width height max_width max_height jpeg_quality gif_animation skip_size imageType gif, jpeg, png, etc | async function createPreview(image, resizeConfig, imageType) {
// To scale image, we calculate new width and height,
// resize image by height, and crop by width
let saveAsIs = false;
let u = resize_outline(image.width, image.height, resizeConfig);
let scaledWidth = u.crop_width;
let scaledHeight = u.crop_height;
let outType = resizeConfig.type || imageType;
if (imageType === outType) {
// If image size is smaller than 'skip_size', skip resizing;
// this saves image as is, including metadata like EXIF
//
if (resizeConfig.skip_size && image.length < resizeConfig.skip_size) {
saveAsIs = true;
}
// If image is smaller than needed already, save it as is
//
if (scaledWidth >= image.width && scaledHeight >= image.height) {
if (!resizeConfig.max_size || image.length < resizeConfig.max_size) {
saveAsIs = true;
}
}
}
// Do not repack small non-jpeg images,
// we always process jpegs to fix orientation
//
if (saveAsIs && imageType !== 'jpeg') {
return { image, type: imageType };
}
let sharpInstance = sharp(image.buffer);
let formatOptions = {};
if (outType === 'jpeg') {
// Set quality for jpeg image (default sharp quality is 80)
formatOptions.quality = resizeConfig.jpeg_quality;
// Rotate image / fix Exif orientation
sharpInstance.rotate();
// Jpeg doesn't support alpha channel, so substitute it with white background
if (imageType === 'gif' || imageType === 'png') {
sharpInstance.flatten({ background: 'white' });
}
}
if (!saveAsIs) {
if (resizeConfig.unsharp) {
sharpInstance.sharpen();
}
sharpInstance.resize(Math.round(scaledWidth), Math.round(scaledHeight), {
fit: 'cover',
position: 'attention',
withoutEnlargement: true
});
}
let res = await sharpInstance.toFormat(outType, formatOptions)
.withMetadata()
.toBuffer({ resolveWithObject: true });
return {
image: {
buffer: res.data,
length: res.info.size,
width: res.info.width,
height: res.info.height,
type: res.info.type
},
type: outType
};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function previewImages(input, imgId, parentId, cssClass, maxImages) {\n // Ensure at least one image is selected and there's no more than maxImagess\n if (input.files[0] && (input.files.length <= maxImages)) {\n // counter to keep track of the element ID to be modified\n var i = 0; \n //... | [
"0.6110448",
"0.56923664",
"0.5627865",
"0.5626599",
"0.56240946",
"0.5608498",
"0.5601916",
"0.5593498",
"0.558684",
"0.55845207",
"0.55675715",
"0.55589616",
"0.5557858",
"0.5547128",
"0.55332875",
"0.5467738",
"0.54672444",
"0.5462436",
"0.54510015",
"0.54483396",
"0.54419... | 0.6013363 | 1 |
Remove all metadata (Exif, ICC, photoshop stuff, etc.) | function filterJpegPreview(buffer) {
buffer = image_traverse.jpeg_segments_filter(buffer, segment => {
if (segment.id >= 0xE1 && segment.id < 0xF0) return false;
return true;
});
return buffer;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function stripMetadata(data) {\n return data.Properties;\n }",
"function cleanMeta(obj) {\n delete obj._id;\n delete obj._rev;\n delete obj.docType;\n}",
"function i(e){var t=[];for(var n in e){var i=e[n];delete i.metadata,t.push(i)}return t}",
"function m(e){var t=[];for(var n in e){var i... | [
"0.6675288",
"0.640114",
"0.63121706",
"0.61797065",
"0.5982011",
"0.59794635",
"0.5946059",
"0.59440136",
"0.5847914",
"0.58420014",
"0.5819018",
"0.57720083",
"0.57626057",
"0.573764",
"0.56843233",
"0.562532",
"0.5587533",
"0.5587533",
"0.5422192",
"0.54016703",
"0.5361417... | 0.0 | -1 |
Remove metadata (ICC, photoshop stuff, etc.), and filter exif | function filterJpegImage(buffer, comment) {
buffer = image_traverse.jpeg_segments_filter(buffer, segment => {
if (segment.id >= 0xE2 && segment.id < 0xF0) return false;
return true;
});
buffer = image_traverse.jpeg_exif_tags_filter(buffer, entry => {
return entry.data_length < 100;
});
if (comment) {
buffer = image_traverse.jpeg_add_comment(buffer, comment);
}
return buffer;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getExifPropClean(prop, value) {\n\tvar cleansed=new Object();\n\tcleansed.name=null;\n\tcleansed.desc=null;\n\tswitch(prop) {\n\t\tcase \"Make\": \n\t\t\tcleansed.name=\"Camera\";\n\t\t\tcleansed.desc=value;\n\t\tbreak;\n\t\tcase \"Model\": \n\t\t\tcleansed.name=prop; \n\t\t\tcleansed.desc=value;\n\t\tbre... | [
"0.599326",
"0.59427935",
"0.56942064",
"0.55306035",
"0.54907334",
"0.5378107",
"0.536386",
"0.53288746",
"0.5325352",
"0.5261711",
"0.5199587",
"0.51725966",
"0.51718825",
"0.5148193",
"0.5137347",
"0.50965416",
"0.50762236",
"0.5048262",
"0.5035441",
"0.50271004",
"0.50232... | 0.5274883 | 9 |
Origin of coordinates is topright. | function posToBrgDst(x1, y1, x2, y2) {
var dx = x2-x1;
var dy = y2-y1;
return [
Math.atan2(dx,dy),
Math.sqrt(dx*dx+dy*dy)
];
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"get right() {\n // x is left position + the width to get end point\n return this.x + this.width\n }",
"reverse() {\n return Point(\n 0 - this.x,\n 0 - this.y\n )\n }",
"moveToBottomRight([horizontal, vertical], context) {\n return context.changeHorizontalPosition(horizontal... | [
"0.61981183",
"0.6040655",
"0.60228854",
"0.6018739",
"0.5838677",
"0.5786062",
"0.576662",
"0.57398444",
"0.5737066",
"0.5726313",
"0.5708169",
"0.5681476",
"0.567363",
"0.56489915",
"0.5635827",
"0.5630266",
"0.5628155",
"0.56176966",
"0.5615726",
"0.55727214",
"0.5563737",... | 0.0 | -1 |
Given an angle in Artemis' format, return the angle in degrees as a prettyprinted string.. Pi becomes 0 (north) Pi/2 becomes 90 (east) 0 becomes 180 (south) Pi/2 becomes 270 (west) Pi becomes 360 (north) | function radianToDegrees(rad) {
if (isNaN(rad)) {
return 'N/A';
}
var degrees = 180 + ( 180*rad/Math.PI );
return degrees.toFixed(1);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function format_angle(x, pos_char, neg_char, is_html, a) {\n if (!a)\n a = expand_angle(Math.abs(x), settings.degrees_format);\n var s = '';\n var symbols = [is_html? '°' : '', \"'\", '\"'];\n var space = is_html? ' ' : ' ';\n for (var i = 0; i <= settings.degrees_format; i++)\n s += (i == 0? '... | [
"0.7214117",
"0.702506",
"0.69961894",
"0.6696864",
"0.6584051",
"0.65414405",
"0.6492527",
"0.649025",
"0.6393008",
"0.6379663",
"0.6338646",
"0.6286558",
"0.6284792",
"0.626988",
"0.6259668",
"0.62576634",
"0.624441",
"0.6235654",
"0.62316",
"0.6228806",
"0.622699",
"0.61... | 0.0 | -1 |
Function to find numbers with repeated digits | function findRepeatedDigit(number) {
let tempNumber = number;
if (number > 10) {
let lastDigit = number % 10;
number = parseInt(number / 10);
let firstDigit = number % 10;
if (lastDigit == firstDigit)
return tempNumber;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function sameDigits(a,b) {\n //solution here\n}",
"function findDigits(n) {\n let digitArray = n.toString();\n let count = 0;\n for (let i = 0; i <= digitArray.length; i += 1) {\n if (n % digitArray[i] === 0) {\n count++;\n }\n }\n return count;\n}",
"function findDigits(n) {\r\n var k=n.... | [
"0.70402455",
"0.7035918",
"0.68731666",
"0.67960244",
"0.6695744",
"0.6534807",
"0.653358",
"0.6532217",
"0.6479978",
"0.64749825",
"0.6473566",
"0.64413553",
"0.6434672",
"0.64343786",
"0.64313453",
"0.64313453",
"0.64313453",
"0.64313453",
"0.64313453",
"0.64313453",
"0.64... | 0.7518012 | 0 |
zone format list pages | function formatToList(arr){ //array to format number list
//var arr = [1,2,3,4,8,15,16,17,20,21,30]
//arr = arr.map(Number);
arr = arr.sort(function(a, b){return a - b});
var start = arr[0];
var end = arr[0];
var result = "";
for(var i in arr){
i = parseInt(i);
if (arr[i] === arr[i+1]-1){
end = arr[i+1];
}
else{
if (start >= end){
result += start+",";
}else{
result += start+"-"+end+",";
}
start = arr[i+1];
}
}
result = result.slice(0, result.length-1)
result = result.split(",")
return result
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"displaySetup(page,list){\n const end = ( (page*8+8<list.length)?(page*8+8) : list.length )\n this.setState({lastInd: end});\n return(list.slice((page*8), end));\n }",
"function CakePhpListLayer() {\n\n}",
"function set_up_regions_template(data)\n\t{\n\t\tvar temp;\n\t\tvar str;\n\t\tstr... | [
"0.5775443",
"0.5446374",
"0.53642035",
"0.5326982",
"0.53079766",
"0.5255189",
"0.52353305",
"0.52117807",
"0.5188642",
"0.5186896",
"0.51785135",
"0.51746905",
"0.51744676",
"0.5137783",
"0.51350546",
"0.5133172",
"0.5131016",
"0.51281786",
"0.5119937",
"0.5109162",
"0.5107... | 0.0 | -1 |
14/11/2018: Aula 7 Marcio Justo: JavaScript | function subtracao() {
var numeroUm = document.getElementById("valor-um").value;
var numeroDois= document.getElementById("valor-dois").value;
if (isNaN(numeroUm)) {
alert('Número Um inválido!');
}
if (isNaN(numeroDois)) {
alert('Número Dois inválido!');
}
alert(parseInt(numeroUm) - parseInt(numeroDois));
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function calcola_jdUT0(){\n\n // funzione per il calcolo del giorno giuliano per l'ora 0 di oggi in T.U.\n // by Salvatore Ruiu Irgoli-Sardegna (Italy) giugno 2010.\n // restituisce il valore numerico dataGiuliana.\n \n \n var data=new Date();\n\n var anno = data.getYear(); // anno\n var mese ... | [
"0.6087893",
"0.59904623",
"0.5989278",
"0.5923899",
"0.5849531",
"0.584033",
"0.5806088",
"0.5794761",
"0.57887447",
"0.5749848",
"0.5729964",
"0.5703972",
"0.56496435",
"0.5645243",
"0.56417555",
"0.5634543",
"0.5623934",
"0.5607767",
"0.5607352",
"0.5607352",
"0.56040776",... | 0.0 | -1 |
Verifica Campo da Cidade/Pais | function verificaCampoPreenchido(cidade) {
var preenchido;
if(cidade != ""){
preenchido = true;
}
return preenchido;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function esCampo(campo)\n{\n\tif (campo==null) return false;\n\tif (campo.name==null) return false;\n\treturn true;\n}",
"function check_ciudad() {\n\n\t\tif($(\"#Ciudad option:selected\").val() == 0) {\n \t\t$(\"#errorciudad\").html(\"Seleccione una ciudad\");\n\t\t\t$(\"#rrorciudad\").show();\n\t\t\terror_v... | [
"0.6524344",
"0.5869477",
"0.578313",
"0.57750964",
"0.5773307",
"0.5652721",
"0.5649926",
"0.56426054",
"0.55872846",
"0.556624",
"0.55623364",
"0.55515414",
"0.55429775",
"0.5536049",
"0.55336326",
"0.55009115",
"0.549372",
"0.5457524",
"0.54054654",
"0.53910077",
"0.536918... | 0.5916437 | 1 |
Fala com o OpenWeather | function recebeOpenWeather(cidade) {
$.ajax({
url:'http://api.openweathermap.org/data/2.5/weather?q=' + cidade + "&units=metric&lang=pt" + "&APPID=0799ebbcad862deddeeebe1f4ccc65d7",
type:"GET",
dataType:"json",
success: function(data){
var widget = show(data);
$("#show").html (widget);
}
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getGeoWeather() {\n \tweather.getGeoWeather()\n\t\t.then((results) => {\n\t\t\tui.display(results);\n\t\t})\n\t\t.catch((err) => err);\n}",
"function getCurrentWeather() {\n \tvar dataObj = {\n \t\tlat: '',\n \t\tlon: '',\n \t\tAPPID: '923ac7c7344b6f742666617a0e4bd311',\n \t\tu... | [
"0.68570834",
"0.68568385",
"0.68553346",
"0.684191",
"0.68400156",
"0.6828727",
"0.67853075",
"0.67686415",
"0.6762652",
"0.67233264",
"0.67045337",
"0.669729",
"0.66521275",
"0.6651089",
"0.6646564",
"0.6644218",
"0.6620485",
"0.6620354",
"0.66140944",
"0.66072685",
"0.6590... | 0.0 | -1 |
VoterGroup Constructor for a VoterGroup object. VoterGroup has a ownerId. | constructor(ownerId, name) {
this.ownerId = ownerId;
this.membersId = new Array();
this.membersId.push(this.ownerId);
this.name = name;
this.groupId = 'group' + Math.random().toString(36).substring(2, 15) + Math.random().toString(36).substring(2, 15);
this.type = 'group';
this.electionsId = new Array();
if (this.__isContract) {
delete this.__isContract;
}
return this;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"constructor(groupid, ownerusername, createdAt) {\n\n this.groupid = groupid;\n this.ownerusername = ownerusername;\n this.createdAt = createdAt\n\n }",
"constructor(scope, id, props) {\n super(scope, id, { type: CfnUserHierarchyGroup.CFN_RESOURCE_TYPE_NAME, properties: props });\n ... | [
"0.5636722",
"0.56194675",
"0.5404564",
"0.5368507",
"0.52721876",
"0.5157866",
"0.50252116",
"0.50024897",
"0.49790817",
"0.49592012",
"0.49435183",
"0.48780602",
"0.4846979",
"0.48254502",
"0.47996077",
"0.46718708",
"0.46257457",
"0.45946336",
"0.4593044",
"0.45650542",
"0... | 0.700676 | 0 |
function that sets page to homepage | function loadHome() {
app.innerHTML = nav + homepage;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function load_home_page() {\n page = home_page;\n load_page();\n}",
"function homepage()\n{\n window.location.href = '/';\n}",
"function homePage() {\n window.location.href = initApi.homeUrl;\n //location.reload();\n }",
"function loadHome(){\r\n switchToContent(\"pag... | [
"0.7465852",
"0.72381514",
"0.7149455",
"0.69634235",
"0.6876936",
"0.67171496",
"0.65555054",
"0.65536964",
"0.6534664",
"0.65315646",
"0.6530716",
"0.65119815",
"0.64897424",
"0.64876705",
"0.6478199",
"0.6460957",
"0.64606",
"0.64464563",
"0.643787",
"0.64369375",
"0.64284... | 0.6657743 | 6 |
fucntion that sets page to about page | function loadAbout() {
app.innerHTML = nav + about;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"toAbout() {\r\n window.location.replace('/about');\r\n }",
"function navToAbout() {\r\n location = \"about.html\"\r\n}",
"function aboutPage() {\n location.href = \"about.html\"\n}",
"function goToAboutPage () {\n window.location.href = \"about.html\"\n}",
"function updateAboutPage(urlObj, opt... | [
"0.7394527",
"0.727566",
"0.7153666",
"0.6941263",
"0.69326866",
"0.6881046",
"0.68727916",
"0.68418753",
"0.68418753",
"0.6720247",
"0.6711964",
"0.6683728",
"0.6677873",
"0.66585505",
"0.6645836",
"0.66351163",
"0.65251905",
"0.6488229",
"0.63894325",
"0.6367094",
"0.636120... | 0.6780121 | 9 |
Extend an existing object with a method from another | function augment(receivingClass, givingClass) {
//only provide certain methods
if (arguments[2]) {
for (var i=2, len=arguments.length; i<len; i++) {
receivingClass.prototype[arguments[i]] = givingClass.prototype[arguments[i]];
}
}
// provide all methods
else {
for (var methodName in givingClass.prototype) {
if (!Object.hasOwnProperty.call(receivingClass.prototype, methodName)) {
receivingClass.prototype[methodName] = givingClass.prototype[methodName];
}
}
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"extend() {}",
"extend() {}",
"function extendNode(source, target, avoid) {\n Object.getOwnPropertyNames(source).forEach(mymethod => {\n if (!avoid || !avoid.includes(mymethod)) {\n target[mymethod]=source[mymethod];\n }\n });\n }",
"function ExtraMethods() {}",
"function Extend(targ... | [
"0.673649",
"0.673649",
"0.6684899",
"0.65976304",
"0.6497918",
"0.6474648",
"0.643005",
"0.6369684",
"0.6351232",
"0.63347876",
"0.6291876",
"0.628176",
"0.6256702",
"0.62486285",
"0.62427306",
"0.62427306",
"0.62427306",
"0.62391615",
"0.62263936",
"0.6223693",
"0.6223693",... | 0.0 | -1 |
Populate's info panel with $this_element's information | function populate_info_panel(this_element){
$('#pregunta_info_name').html(this_element.name);
$('#pregunta_info_type').html(convert_type(this_element.type));
if(this_element.type == 'MULTI' || this_element.type == 'CONDITIONAL'){
var answers_content = '';
$.each(connections_array, function(i){
if(this_element.connect_id == this.source){
var label_text;
if(this_element.type == 'CONDITIONAL'){
//console.log(this.label.substring(0,2))
switch(this.label.substring(0,2)){
case 'lt':
label_text = 'Menor que ' +this.label.substring(2);
break;
case 'gt':
label_text = 'Mayor que ' +this.label.substring(2);
break;
case 'eq':
label_text = 'Igual que ' +this.label.substring(2);
break;
case 'ne':
label_text = 'No igual a ' +this.label.substring(2);
break;
case 'le':
label_text = 'Menor o igual que ' +this.label.substring(2);
break;
case 'ge':
label_text = 'Mayor o igual que ' +this.label.substring(2);
break;
case 'ra':
label_text = 'En rango '+this.label.substring(2);
break;
case '!r':
label_text = 'Afuera del rango';
break;
default:
label_text = 'ERROR: ha escrito condicion incorrectamente';
}
} else {
label_text = this.label;
}
answers_content += "<li class='list-group-item'>"+label_text+"</li>";
}
});
$('#pregunta_info_responses').html(answers_content);
$('#possible_answers').show();
} else {
$('#possible_answers').hide();
}
// set id values of info panel buttons
$('#btn_edit_item').attr('data-id', this_element.id);
$('#btn_delete_item').attr('data-id', this_element.id);
$('#btn_delete_item').attr('source-id', this_element.connect_id);
$('#btn_edit').attr('data-id', this_element.id);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function build_protein_info_panel(data, div) {\n div.empty();\n var protein = data.controller.get_current_protein();\n div.append(protein['description']);\n div.append(\"<br>----<br>\");\n div.append(dict_html(protein['attr']));\n}",
"renderInformationAdditional() {\n document.getElementsByClassName(... | [
"0.68516606",
"0.6616169",
"0.6546088",
"0.653402",
"0.64927727",
"0.64778954",
"0.64655906",
"0.6436454",
"0.6373621",
"0.6226559",
"0.6214764",
"0.6151009",
"0.6143463",
"0.6140021",
"0.61026335",
"0.60969007",
"0.6077895",
"0.60622436",
"0.6056217",
"0.6040273",
"0.6028269... | 0.68623334 | 0 |
check if labels for an element's connections have the same name | function check_equal_labels(element, the_label){
for(var j = 0; j< connections_array.length; j++){
if(element.connect_id == connections_array[j].source){
if(the_label == connections_array[j].label){
return false;
}
}
}
return true;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function checkSameLabel(label){ \n // if already have label return false.\n return $(data.selectedDiv).has(label).length == 0;\n}",
"function isLabeledBy(node, labelName) {\n for (var owner = node.parent; owner.kind === 214 /* LabeledStatement */; owner = owner.parent) {\n if (owner.label... | [
"0.6721919",
"0.6202323",
"0.60005915",
"0.5977667",
"0.596287",
"0.5962072",
"0.59042984",
"0.5884175",
"0.5784174",
"0.5713267",
"0.5676578",
"0.5655946",
"0.5605312",
"0.5587715",
"0.5550891",
"0.5538444",
"0.55327916",
"0.5512373",
"0.5485291",
"0.5386358",
"0.53746575",
... | 0.7951297 | 0 |
gets first and end item ids from elements_array, if they exist | function check_for_endpoints(){
var first_item = -1
, end_item = -1;
for(var i=0; i<elements_array.length; i++){
if(elements_array[i].type == 'START'){
for(var x=0; x<connections_array.length; x++){
if(elements_array[i].connect_id == connections_array[x].source){
first_item = connections_array[x].target; // 'START' item's target
}
}
} else if(elements_array[i].type == 'END'){
/* for(var x=0; x<connections_array.length; x++){
if(elements_array[i].id == connections_array[x].target){
end_item = connections_array[x].source;
}
}*/
end_item = elements_array[i].id; // 'END' item
}
}
return {first_id: first_item, end_id: end_item};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"checkIds(elements) {\r\n let len = elements ? elements.length : 0\r\n let ids = []\r\n for (let i = 0; i < len; i++) {\r\n const regexToSearchFor = /id=\".*\"/g;\r\n let id = elements[i].match(regexToSearchFor);\r\n if (id) {\r\n id = id[0]\r\n ... | [
"0.66241837",
"0.63447386",
"0.60591054",
"0.6016531",
"0.57674015",
"0.5758919",
"0.5662905",
"0.5604465",
"0.5570588",
"0.5519695",
"0.5519374",
"0.5504044",
"0.5468202",
"0.5363117",
"0.53249633",
"0.5312236",
"0.53068423",
"0.53050715",
"0.528641",
"0.52692664",
"0.525966... | 0.5562735 | 9 |
Check item type == 'START' is a source in only one connection all items where type != 'END' || 'START' are a source in at least one connection and item type == 'END' is a target in at least one connection not used when user just saves a flowchart under construction | function check_item_connections(){
var start_count = 0;
var end_count = 0;
var valid_item_count = 0;
var multi_count = 0;
var this_element;
var element_num; //substring(5)
for(var i = 0; i < elements_array.length; i++){
this_element = elements_array[i];
multi_count = 0;
for(var j = 0; j < connections_array.length; j++){
if(this_element.type == 'START'){
if(this_element.connect_id == connections_array[j].source){
start_count++;
}
} else if(this_element.type == 'END'){
if(this_element.id == connections_array[j].target){
end_count++;
}
} else {
if(this_element.connect_id == connections_array[j].source){
if(this_element.type == 'MULTI' || this_element.type == 'CONDITIONAL'){
if(multi_count < 2){
if(multi_count < 1){
valid_item_count++;
}
multi_count++;
}
} else {
valid_item_count++;
}
}
}
}
console.log('Item type and multi count');
console.log(this_element.type);
console.log(multi_count);
if((this_element.type == 'CONDITIONAL' && multi_count !=2) || (this_element.type == 'MULTI' && multi_count <2) ){
return false;
}
}
console.log(valid_item_count + ' - '+elements_array.length);
if(start_count == 1 && end_count > 0 && (valid_item_count==elements_array.length-2)){
return true;
} else {
return false;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function check_for_endpoints(){\n \t\tvar first_item = -1\n \t\t\t, end_item = -1;\n \t\tfor(var i=0; i<elements_array.length; i++){\n \t\t\tif(elements_array[i].type == 'START'){\n \t\t\t\tfor(var x=0; x<connections_array.length; x++){\n \t\t\t\t\tif(elements_array[i].connect_id == connections_array[x].source){\n... | [
"0.5933772",
"0.5715553",
"0.56843007",
"0.5162468",
"0.5143154",
"0.5106443",
"0.5103366",
"0.5038628",
"0.4990879",
"0.4868909",
"0.48651686",
"0.48592144",
"0.4838532",
"0.48267353",
"0.48130965",
"0.48036492",
"0.4798051",
"0.4791079",
"0.47841564",
"0.47574243",
"0.47364... | 0.66712964 | 0 |
starting Listen to the stream | function startStreamListener() {
var streamListenerParams = {
ip: self.streamingSource.sourceIP,
port: self.streamingSource.sourcePort
};
return self.streamListener.startListen(streamListenerParams)
.then(function() {
self.streamStatusTimer.setInterval(function() {
self.streamingSourceDAL.notifySourceListening(self.streamingSource.sourceID);
});
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function start () {\n listen()\n}",
"function start() {\n listen();\n}",
"startListening() {\n\t\tthis.server.listen(this.port, () => {\n\t\t\tconsole.log('Server started listening on port', this.port);\n\t\t});\n\t}",
"start() {\n this._.on('request', this.onRequest.bind(this));\n this._.on(... | [
"0.7836865",
"0.77568483",
"0.74000734",
"0.73328316",
"0.7128523",
"0.6870402",
"0.68618375",
"0.6771315",
"0.6771315",
"0.6764348",
"0.6750333",
"0.6674343",
"0.6624101",
"0.66183174",
"0.6602114",
"0.66013116",
"0.65961766",
"0.65927386",
"0.65927386",
"0.6592643",
"0.6564... | 0.76290655 | 2 |
/ Helper Methods / Sets a keep alive status notifier | function StatusTimer() {
var self = this;
self.timer = undefined;
self.setInterval = function(logic) {
clearInterval(self.timer);
self.timer = setInterval(function() {
console.log(PROCESS_NAME + ' updating status....' + moment().format());
logic();
}, process.env.INTERVAL_TIME || 5000);
};
self.clearInterval = function() {
clearInterval(self.timer);
};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"keepAlive () {\n this._debug('keep-alive')\n this._push(MESSAGE_KEEP_ALIVE)\n }",
"keepAlive () {\n this._debug('keep-alive')\n this._push(MESSAGE_KEEP_ALIVE)\n }",
"function keepAlive(){\n if(config.goPro.states.btIsConnected){\n if(config.goPro.debug){\n writeLo... | [
"0.70818067",
"0.70818067",
"0.64973027",
"0.62764436",
"0.6215074",
"0.6156061",
"0.61108315",
"0.60774845",
"0.60590804",
"0.5965632",
"0.58807564",
"0.58602786",
"0.58516806",
"0.5770064",
"0.5758256",
"0.5744246",
"0.57267475",
"0.5680734",
"0.56549466",
"0.56378686",
"0.... | 0.6176098 | 5 |
Stop the ffmpeg process | function stopFFmpegProcess(command) {
if (command) {
command.kill('SIGKILL');
}
return Promise.resolve();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function KillFFMPEG() {}",
"function stopFFmpegProcess(command, callBack) {\n\tif (command) {\n\t\tcommand.kill('SIGKILL');\n\t}\n\tif (callBack) {\n\t\tcallBack();\n\t}\n}",
"stopDownload() {\n this.pauseDownload();\n // TODO also close down the child_process\n sendMessage({\n type: 'stop',\n ... | [
"0.7947673",
"0.78819054",
"0.74968666",
"0.70088404",
"0.67729497",
"0.6588766",
"0.6461295",
"0.6461295",
"0.64297754",
"0.6427138",
"0.64257956",
"0.6357758",
"0.6352739",
"0.63090664",
"0.6295381",
"0.62878144",
"0.62599164",
"0.62579614",
"0.6221325",
"0.6200186",
"0.618... | 0.7672127 | 2 |
Send message to the next service. | function sendToJobQueue(params) {
var message = {
sourceId: params.streamingSource.sourceID,
videoName: params.videoName,
fileRelativePath: params.fileRelativePath,
storagePath: params.storagePath,
receivingMethod: {
standard: params.streamingSource.streamingMethod.standard,
version: params.streamingSource.streamingMethod.version
},
startTime: params.startTime,
endTime: params.endTime,
duration: params.duration,
sourceType: params.streamingSource.sourceType,
transactionId: new mongoose.Types.ObjectId()
};
return rabbit.produce('TransportStreamProcessingQueue', message);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function sendNextMessage() {\n\n if (messages.length === 0) {\n return;\n }\n\n var message = messages.shift();\n Pebble.sendAppMessage(message, ack, nack);\n\n function ack() {\n sendNextMessage();\n }\n\n function nack() {\n messages.unshift(message);\n sendNextMessage();\n }\n\n}",
"functi... | [
"0.6442721",
"0.6365403",
"0.6322822",
"0.62296045",
"0.6013765",
"0.58336097",
"0.5808982",
"0.5791974",
"0.57835656",
"0.57725286",
"0.575897",
"0.5624304",
"0.56158185",
"0.5615164",
"0.5578212",
"0.5565591",
"0.55626184",
"0.5545951",
"0.5539238",
"0.5539238",
"0.55251294... | 0.0 | -1 |
getText() function definition. This is the pdf reader function. | function getText(typedarray) {
//PDFJS should be able to read this typedarray content
var pdf = PDFJS.getDocument(typedarray);
return pdf.then(function(pdf) {
// get all pages text
var maxPages = pdf.pdfInfo.numPages;
var countPromises = [];
// collecting all page promises
for (var j = 1; j <= maxPages; j++) {
var page = pdf.getPage(j);
var txt = "";
countPromises.push(page.then(function(page) {
// add page promise
var textContent = page.getTextContent();
return textContent.then(function(text) {
// return content promise
return text.items.map(function(s) {
return s.str;
}).join(''); // value page text
});
}));
}
// Wait for all pages and join text
return Promise.all(countPromises).then(function(texts) {
return texts.join('');
});
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"getTextContent() {}",
"get text() {}",
"get text() {}",
"get richText() {}",
"getText() { return this.text; }",
"getText() {\r\n return this.getParsed(new TextParser());\r\n }",
"retriveText() {\n let exactText;\n let currentElement;\n if (!isNullOrUndefined(this.currentC... | [
"0.7546426",
"0.7202497",
"0.7202497",
"0.69531816",
"0.68463546",
"0.68114513",
"0.67314905",
"0.6698512",
"0.6619906",
"0.6591739",
"0.65905195",
"0.65711683",
"0.6474766",
"0.64540803",
"0.64246804",
"0.6400987",
"0.6400413",
"0.6400413",
"0.63825047",
"0.6376834",
"0.6367... | 0.7144465 | 3 |
Obtener los elementos del DOM | function sendMsg(e) {
var event = e.originalEvent;
console.log(event.keyCode);
if (event.keyCode == 13) {
if (!myName) {
myName = $("#input").val();
socket.send(myName);
} else {
var txt = $("#input").val();
socket.send(myName, txt, myColor, new Date());
}
$("#input").val("");
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getElementsFromHTML() {\n toRight = document.querySelectorAll(\".to-right\");\n toLeft = document.querySelectorAll(\".to-left\");\n toTop = document.querySelectorAll(\".to-top\");\n toBottom = document.querySelectorAll(\".to-bottom\");\n }",
"get elements() {\n retu... | [
"0.6786884",
"0.6704521",
"0.65489024",
"0.6393473",
"0.63381106",
"0.63148445",
"0.62871164",
"0.6268687",
"0.62674445",
"0.62099886",
"0.6190549",
"0.61761427",
"0.6168426",
"0.616649",
"0.616649",
"0.6152311",
"0.61339843",
"0.61271375",
"0.6087979",
"0.6082071",
"0.606406... | 0.0 | -1 |
permite somente valores numericos | function valCPF(e,campo){
var tecla=(window.event)?event.keyCode:e.which;
if((tecla > 47 && tecla < 58 )){
mascara(campo, '###.###.###-##');
return true;
}
else{
if (tecla != 8 ) return false;
else return true;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function transformInt() {\n for (let i = 0; i < ctmc.length; i++) {\n for (let j = 0; j < ctmc[i].length; j++) {\n ctmc[i][j] = parseFloat(ctmc[i][j]);\n }\n }\n}",
"function number(numbers) { }",
"function toNum(result) {\n var numResult = [];\n result.forEach(function (perm) {\n ... | [
"0.5909197",
"0.5904456",
"0.5852405",
"0.584672",
"0.57996047",
"0.573682",
"0.5629319",
"0.56083274",
"0.55588317",
"0.55496305",
"0.55267036",
"0.5480462",
"0.54790115",
"0.546418",
"0.5455055",
"0.5451508",
"0.54338056",
"0.5421527",
"0.5399548",
"0.5389518",
"0.5387216",... | 0.0 | -1 |
permite somente valores numericos | function valPHONE(e,campo){
var tecla=(window.event)?event.keyCode:e.which;
if((tecla > 47 && tecla < 58 )){
mascara(campo, '(##)####-####');
return true;
}
else{
if (tecla != 8 ) return false;
else return true;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function transformInt() {\n for (let i = 0; i < ctmc.length; i++) {\n for (let j = 0; j < ctmc[i].length; j++) {\n ctmc[i][j] = parseFloat(ctmc[i][j]);\n }\n }\n}",
"function number(numbers) { }",
"function toNum(result) {\n var numResult = [];\n result.forEach(function (perm) {\n ... | [
"0.59080625",
"0.59049714",
"0.5852714",
"0.5846675",
"0.5799497",
"0.573698",
"0.56282127",
"0.5607934",
"0.5558825",
"0.5549639",
"0.5525883",
"0.54795027",
"0.5478957",
"0.54642093",
"0.54571474",
"0.5451614",
"0.5434455",
"0.5420768",
"0.5399625",
"0.5388181",
"0.53860056... | 0.0 | -1 |
permite somente valores numericos | function valCEP(e,campo){
var tecla=(window.event)?event.keyCode:e.which;
if((tecla > 47 && tecla < 58 )){
mascara(campo, '#####-###');
return true;
}
else{
if (tecla != 8 ) return false;
else return true;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function transformInt() {\n for (let i = 0; i < ctmc.length; i++) {\n for (let j = 0; j < ctmc[i].length; j++) {\n ctmc[i][j] = parseFloat(ctmc[i][j]);\n }\n }\n}",
"function number(numbers) { }",
"function toNum(result) {\n var numResult = [];\n result.forEach(function (perm) {\n ... | [
"0.59080625",
"0.59049714",
"0.5852714",
"0.5846675",
"0.5799497",
"0.573698",
"0.56282127",
"0.5607934",
"0.5558825",
"0.5549639",
"0.5525883",
"0.54795027",
"0.5478957",
"0.54642093",
"0.54571474",
"0.5451614",
"0.5434455",
"0.5420768",
"0.5399625",
"0.5388181",
"0.53860056... | 0.0 | -1 |
NOTE: we are using structure of active panel as template for new one, currently we are replicating the structure of metadata fields | getTemplateFromCurrentPanel() {
const currentIndex = this.getCurrentPanelIndex();
const firstPanel = this.getPanels()[currentIndex];
return {
metadata: firstPanel
.resolve('metadata')
.map(metadataField => ({ type: MetadataField.type, name: metadataField.name, value: '' })),
};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function fmdf_initComponentMeta() {\n\t\n\t//all containers wrapper\n\tfmdmeta_prop = {};\n\n\t//icon path\n\tfmdmeta_prop.iconpath = \"/images/designer/prop/\";\n\n\t//properties grid configuration\n\tfmdmeta_prop.gridconf = {};\n\tfmdmeta_prop.gridconf.isTreeGrid = true;\n\t//fmdmeta_prop.gridconf.treeIconPath =... | [
"0.6136295",
"0.61114705",
"0.5857351",
"0.5809938",
"0.577988",
"0.57367694",
"0.5733026",
"0.5688529",
"0.56878614",
"0.56536007",
"0.5622596",
"0.5618403",
"0.5572465",
"0.5551668",
"0.55448836",
"0.55206007",
"0.55187744",
"0.5518138",
"0.5501968",
"0.54950213",
"0.547837... | 0.708944 | 0 |
$Author: pallabib $ $Date: 20161223 12:20:54 $ xenos Dashboard business feed infrastructure Object | function xenos$DBD$SavedQuery(parent) {
// inherit
this.inherit = xenos$DBD$Content;
this.inherit(parent, 'xenos$DBD$SavedQuery');
// self
var self = this;
// attributes
self.parent.hasGraph = false;
// feeds
this.count = 0;
this.feeds = {};
this.feedsOrder = {};
// has feeds
this.hasFeeds = function() {
return self.count != 0;
};
this.feedByPk = function(pk) {
return self.feeds[pk];
};
// preparation
this.prepareActivity = function() {
// reset first
this.feeds = {};
this.feedsOrder = {};
jQuery.each(this.json.value[0].feeds, function(order, rawFeed) {
var feed = {
pk: rawFeed.pk,
selector: self.parent.parent.pk + 'x' + self.parent.pk + 'x' + rawFeed.pk,
name: rawFeed.name,
originalName: rawFeed.name,
order: order,
maiden: true,
viewUri: rawFeed.feedUrl
};
// prepare
self.count++;
self.feeds[feed.pk] = feed;
self.feedsOrder[order] = feed.pk;
});
};
// rendition
this.renderer = new xenos$DBD$SavedQuery$renderer(this);
// other functions
// content updater
this.saveNames = function(update) {
if (update) {
self.updateNames();
} else {
self.discardNames();
}
};
// update content
this.updateNames = function(callback, delegator) {
jQuery.each(self.feeds, function(pk, feed) {
self.updateName(pk, callback, delegator);
});
};
// discard update
this.discardNames = function() {
jQuery.each(self.feeds, function(pk, feed) {
feed.name = feed.originalName;
feed.dirty = false;
});
};
this.updateName = function(pk, callback, delegator, errorCallback) {
var feed = self.feeds[pk];
if (feed.dirty) {
var savedQryName = $.trim(feed.name);
if(savedQryName==''){
xenos.postNotice(xenos.notice.type.error, xenos.i18n.utilcommonvalidationmessage.provide_criteria);
return;
}
var maxLength = 30;
if(savedQryName.length>maxLength){
xenos.postNotice(xenos.notice.type.error, xenos.utils.evaluateMessage(xenos.i18n.message.invalid_namelength,[maxLength]));
return;
}
var data = ''
+ '{'
+ '"feedPk": [' + pk + '],'
+ '"workSpacePk": ' + self.parent.parent.pk + ','
+ '"widgetPk": ' + self.parent.pk + ','
+ '"feedName": "' + encodeURIComponent(savedQryName) + '",'
+ '"widgetType": "SAVED_QUERY"'
+ '}';
jQuery.ajax({
url: xenos.context.path + "/secure/ref/savedqueryfeed/edit.json",
type: 'POST',
contentType: 'application/json',
data: data,
success: function(content) {
if(!content.success) {
xenos.postNotice(xenos.notice.type.error, content.value[0]);
if(errorCallback){
errorCallback.call();
}
return;
}
feed.originalName = savedQryName;
feed.dirty = false;
xenos.postNotice(xenos.notice.type.info, savedQryName + xenos$DBD$i18n.saved_query.saved_query_renamed);
if (callback) callback.call(delegator ? delegator : self, self);
}
});
}
};
// edit name
this.editName = function(pk, name, callback, delegator) {
// fixed name
if (!name || name == '') return false;
// edited
var feed = self.feeds[pk];
if (feed.name == name) return false;
feed.name = name;
feed.dirty = true;
if (callback) callback.call(delegator ? delegator : self, feed);
return true;
};
// add feeds
this.addFeeds = function(feedsPk, callback, delegator) {
if (feedsPk.length == 0) return false;
var uri = xenos.context.path + '/secure/ref/savedqueryfeed/addfeed.json';
var json = ''
+ '{'
+ '"feedPk": '
+ '[';
for (var p = 0, length = feedsPk.length, lengthMinus1 = feedsPk.length - 1; p < length; p++) {
json += feedsPk[p].pk;
if (p < lengthMinus1)
json += ',';
}
json += ''
+ '],'
+ '"workSpacePk": ' + self.parent.parent.pk + ','
+ '"widgetPk": ' + self.parent.pk + ','
+ '"widgetType": "' + self.parent.widgetType + '"'
+ '}';
jQuery.ajax({
url: uri,
type: 'POST',
contentType: 'application/json',
data: json,
success: function(json) {
var messages = [];
if (!json.success) {
if(json.value[0]) {
messages.push(json.value[0]);
} else {
jQuery.each(feedsPk, function(p, pk) {
var feed = self.parent.feeds[pk.displayRowNum];
messages.push(xenos$DBD$i18n.saved_query.saved_query_not_added + feed.name);
});
}
xenos.postNotice(xenos.notice.type.error, messages);
return;
}
//updating the feeds after add to get the newly created custom_saved_query pk
jQuery.getJSON(self.parent.contentUri, function(response) {
if (!response.success) {
if(response.value[0]) {
messages.push(response.value[0]);
} else {
jQuery.each(feedsPk, function(p, pk) {
var feed = self.parent.feeds[pk.displayRowNum];
messages.push(xenos$DBD$i18n.saved_query.saved_query_not_added + feed.name);
});
}
xenos.postNotice(xenos.notice.type.error, messages);
return;
}
// prepare
jQuery.each(feedsPk, function(p, pk) {
var feed = self.parent.feeds[pk.displayRowNum];
// prepare
feed.selector = self.parent.parent.pk + 'x' + self.parent.pk + 'x' + feed.pk;
feed.order = self.count++;
feed.maiden = true;
feed.viewUri = response.value[0].feeds[feed.order].feedUrl;
self.feeds[feed.pk] = feed;
self.feedsOrder[feed.order] = feed.pk;
messages.push(feed.name + xenos$DBD$i18n.saved_query.saved_query_added);
});
xenos.postNotice(xenos.notice.type.info, messages);
if (callback) callback.call(delegator ? delegator : self, feedsPk);
});
}
});
return true;
};
// remove feed
this.removeFeed = function(feedPk, callback, delegator) {
var feed = self.feedByPk(feedPk);
// First check the feed whether it is present.
if (feed) {
var uri = xenos.context.path + '/secure/ref/savedqueryfeed/remove/' + self.parent.parent.pk + '/' + self.parent.pk + '/' + feedPk + '.json';
jQuery.getJSON(uri, function(json) {
if (!json.success) {
console.log(json);
xenos.postNotice(xenos.notice.type.error, xenos$DBD$i18n.saved_query.saved_query_not_removed + feed.name);
return;
}
// remove from feeds
self.removeAndReorderFeed(feedPk);
xenos.postNotice(xenos.notice.type.info, feed.name + xenos$DBD$i18n.saved_query.saved_query_removed);
if (callback) callback.call(delegator ? delegator : self, feed);
});
}
return true;
};
/**
* Remove a feed from the feed array and reorder the remaining feeds.
*/
this.removeAndReorderFeed = function(feedPk){
var feed = self.feedByPk(feedPk);
self.count--;
delete self.feeds[feedPk];
for (var newOrder = 0; newOrder < self.count; newOrder++) {
if (newOrder >= feed.order) {
self.feedsOrder[newOrder] = self.feedsOrder[newOrder + 1];
self.feeds[self.feedsOrder[newOrder]].order = newOrder;
}
}
delete self.feedsOrder[self.count];
};
/**
* Remove a saved query from widget only.
*/
this.removeDirtyFeed = function(feedPk, callback) {
var feed = self.feedByPk(feedPk);
self.removeAndReorderFeed(feedPk);
if (callback) callback.call(self, feed);
};
/**
* Refresh a saved query widget.
*/
this.refresh = function() {
var _func = function(row) {
self.renderer.fixSaver();
$(row).remove();
};
var $widget = jQuery('#Widget' + self.parent.selector);
$widget.find('.addFeed.contentArea').remove();
$widget.find('.addFeedButton').parent().parent().addClass('addButtonOpc');
jQuery.each($widget.find('.contentHolder').find('.row'), function(rowOrder, row){
self.removeDirtyFeed($(row).attr('pk'), _func(row));
});
$widget.find('.contentHolder').jScrollPane({showArrows: true});
self.prepareActivity();
self.renderer.render(true);
if(!self.parent.parent.parent.editable){
$widget.find('.saveQuery-edit-ico-holder').hide();
$widget.find('.saveQuery-close-ico-holder').hide();
}
};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function xenos$DBD$BusinessFeed(parent) {\n // inherit\n this.inherit = xenos$DBD$Content;\n this.inherit(parent, 'xenos$DBD$BusinessFeed');\n // self\n var self = this;\n\n\n // attributes\n\n self.parent.hasGraph = true;\n\n\n // feeds\n this.count = 0;\n\n this.feeds = {};\n this.feedsOrder = {};\n\n... | [
"0.63348174",
"0.54379946",
"0.5367656",
"0.52795196",
"0.52003944",
"0.5195895",
"0.5131012",
"0.51104456",
"0.5095767",
"0.5040104",
"0.5009075",
"0.5009075",
"0.498304",
"0.498304",
"0.49781817",
"0.49781817",
"0.49781817",
"0.49778026",
"0.49778026",
"0.49695635",
"0.4966... | 0.0 | -1 |
utility method to get a value from json using key | function getValue(myJSON, test){
var str = '';
for (var key in myJSON) {
if (myJSON.hasOwnProperty(key) && String(test) === String(key)) {
str = myJSON[key];
}
}
return str;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"getValue(key, jsonObj=this.config) {\n if(typeof(key) != 'string') return\n return key.split('.').reduce((p,c)=>p&&p[c]||null, jsonObj)\n }",
"function getEntryValue(json,key){\n\tvar entry = json[ENTRY];\n\tif(entry != undefined){\n\t\tfor(var i = 0; i < entry.length; i++){\n\t\t\tif(entry[i][K... | [
"0.76459277",
"0.75812715",
"0.73374736",
"0.7189652",
"0.6905238",
"0.6902459",
"0.67366785",
"0.6709172",
"0.6602449",
"0.65832",
"0.6447544",
"0.6441811",
"0.64086366",
"0.6374087",
"0.63648623",
"0.63648623",
"0.6360102",
"0.6334987",
"0.6334987",
"0.6334987",
"0.6312089"... | 0.65923405 | 9 |
set values in the localstorage json obj'z | function setValue(jsonID, test, value){
var myJSON = JSON.parse(localStorage[jsonID]);
for (var key in myJSON) {
if (myJSON.hasOwnProperty(key) && String(test) === String(key)) {
myJSON[key] = value;
}
}
localStorage[jsonID] = JSON.stringify(myJSON);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function setJsonStorage (chave, valor){\n localStorage.setItem(chave,valor);\n}",
"function setFromLocal () {\n _.each(settings, (v, k) => {\n var value = localStorage.getItem(k);\n if (value) {\n settings[k] = JSON.parse(value);\n }\n });\n}",
"function setData(id, obj){... | [
"0.7622409",
"0.74646574",
"0.7352124",
"0.729354",
"0.7283864",
"0.72609043",
"0.716526",
"0.70970756",
"0.7091086",
"0.7067295",
"0.7057939",
"0.7045395",
"0.69681346",
"0.6931148",
"0.6924947",
"0.69090265",
"0.68853825",
"0.68849415",
"0.6863318",
"0.68631524",
"0.6856915... | 0.7021132 | 12 |
Toggle populating of data autofilling on the tab the user is on | function doPaxClickEvt(jsonID, id, value) {
chrome.tabs.getSelected(null, function (tab){
if(id.length){
chrome.tabs.sendRequest(tab.id, {data: getValue(JSON.parse(localStorage[jsonID]), id)});
}
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"static expandData () {\n $('tbody#bindOutput tr:visible a.json-toggle.collapsed').click();\n }",
"function toggleData() {\n $log.debug('toggleData');\n $scope.forecastData = $scope.forecastData ? false : true;\n $scope.locationInfo = $scope.locationInfo ? false : true;\n }",
"function activ... | [
"0.60708004",
"0.602053",
"0.59717333",
"0.5875353",
"0.5814023",
"0.57533926",
"0.5748533",
"0.570951",
"0.57019645",
"0.56947684",
"0.5630799",
"0.56304824",
"0.562682",
"0.5615515",
"0.55662537",
"0.55248034",
"0.55217755",
"0.5504217",
"0.54916185",
"0.54766643",
"0.54679... | 0.0 | -1 |
Using the httpGetAsync function, we make a call to the API | function getNameGender() {
name = document.getElementById("BoyOrGirl").value; // Sets the value of name to what is currently in the text field
let fullURL = baseURL + name; // Appends the name to the base URL
httpGetAsync(fullURL, assignGender); // Returns the API's response to the function assignGender
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getJSON(){\n console.log(\"GET\");\n\n var api_url = _api_url; \n httpGetAsync(api_url,function(resp){\n console.log(resp);\n console.log(\"data returned successfully\");\n })\n }",
"async call(url) {\n let response ... | [
"0.71720654",
"0.69026273",
"0.67888665",
"0.67399114",
"0.6732096",
"0.6583978",
"0.6529626",
"0.65093875",
"0.64764583",
"0.647266",
"0.64715976",
"0.64651954",
"0.64473623",
"0.6402314",
"0.63828963",
"0.63732713",
"0.6365959",
"0.63620025",
"0.63422495",
"0.63290656",
"0.... | 0.0 | -1 |
Makes an async call for JSON (Vanilla Javascript) | function httpGetAsync(theUrl, callback) {
let xmlHttp = new XMLHttpRequest();
xmlHttp.onreadystatechange = function() {
if (xmlHttp.readyState == 4 && xmlHttp.status == 200)
callback(xmlHttp.responseText);
}
xmlHttp.open("GET", theUrl, true); // true for asynchronous
xmlHttp.send(null);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getJSON(){\n console.log(\"GET\");\n\n var api_url = _api_url; \n httpGetAsync(api_url,function(resp){\n console.log(resp);\n console.log(\"data returned successfully\");\n })\n }",
"function jsonGet(url, callback) {\r\n ... | [
"0.69577837",
"0.6871555",
"0.6697894",
"0.6639638",
"0.66031355",
"0.6577278",
"0.65710926",
"0.65608686",
"0.65596676",
"0.6525416",
"0.650286",
"0.64965796",
"0.64847726",
"0.6478799",
"0.64455163",
"0.6435472",
"0.64192384",
"0.64064324",
"0.6401296",
"0.63964915",
"0.636... | 0.6388427 | 20 |
Analyzes the data of the JSON response, then sets the webpage text | function assignGender(data) {
let dataJSON = JSON.parse(data);
console.log(dataJSON);
gender = dataJSON.gender;
probability = dataJSON.probability;
if(probability == 1) {
probability = 100;
} else {
probability = probability * 100;
}
setText(name, gender, probability);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"handleResponse(response) {\n // the key of pages is a number so need to look for it\n if (\n typeof this.searchResponse !== typeof undefined &&\n this.searchResponse.query\n ) {\n for (var key in this.searchResponse.query.pages) {\n // skip anything that's prototype object\n i... | [
"0.6448625",
"0.63172257",
"0.62099475",
"0.6195737",
"0.6032959",
"0.59932435",
"0.59388494",
"0.592739",
"0.5917632",
"0.5908263",
"0.5878492",
"0.5875593",
"0.5871572",
"0.5838862",
"0.5823197",
"0.5788406",
"0.57790446",
"0.57763577",
"0.57739234",
"0.5770813",
"0.5767071... | 0.0 | -1 |
Replaces color and lives states with their corresponding next states Reset next states for colors and lives | goToNextState() {
this.colors = this.nextStateColors
this.lives = this.nextStateLives
this.nextStateColors = new Array(COLS * ROWS).fill(COLOR.BLANK)
this.nextStateLives = new Array(COLS * ROWS).fill(false)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function color_fsm() {\n if (color_stage == 0) {\n if (lorenz_red >= 255) {\n color_stage = 1;\n } else {\n lorenz_red++;\n }\n } else if (color_stage == 1) {\n if (lorenz_green >= 255) {\n color_stage = 2;\n } else {\n lorenz_gre... | [
"0.6521679",
"0.6233091",
"0.61860305",
"0.6176525",
"0.6149748",
"0.6134702",
"0.6133651",
"0.61126596",
"0.6107905",
"0.609987",
"0.6096422",
"0.6093109",
"0.6082121",
"0.60687214",
"0.60281116",
"0.6026596",
"0.6013014",
"0.599194",
"0.5981862",
"0.5972272",
"0.59706837",
... | 0.68152267 | 0 |
When a player disconnects | function disconnection() {
playersOnline--
primus.forEach(spark => spark.emit(GAME_EVENT.PLAYERS_ONLINE, playersOnline))
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function onClientDisconnect() {\r\n\tconsole.log(\"Client has disconnected: \"+this.id);\r\n\tvar nsp = url.parse(this.handshake.headers.origin).hostname;\r\n\t// Broadcast removed player to connected socket clients\r\n\tio.of(nsp).emit(\"userLeft\",{id: this.id});\r\n}",
"async onPlayerRemoved(player) {}",
"f... | [
"0.77410567",
"0.76328975",
"0.7587706",
"0.74763983",
"0.74763983",
"0.74500006",
"0.73989964",
"0.7319388",
"0.72578377",
"0.7221466",
"0.7197808",
"0.7197808",
"0.7197808",
"0.7197808",
"0.71698797",
"0.7167089",
"0.7140136",
"0.70863324",
"0.7080301",
"0.7052136",
"0.7042... | 0.7418078 | 6 |
When player clicks on a pattern | function playerPattern(color, pattern) {
const draw = {
beehive: drawBeehive,
toad: drawToad,
lwss: drawLwss,
glider: drawGlider,
}
if (draw[pattern]) {
draw[pattern](color)
primus.forEach(spark => spark.emit(GAME_EVENT.STATE, game.colors))
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function clickButton(e) {\n click++;\n for(let i=0; i<buttonArray.length; i++) {\n if (buttonArray[i].name == e.target.id){\n let tBut = buttonArray[i];\n\n // IS IT RIGHT\n if (tBut == pattern[click-1]){\n tBut.highlight(true);\n } else {\n tBut.highlight(false);\n if... | [
"0.67241156",
"0.67115504",
"0.65197575",
"0.65104765",
"0.6507557",
"0.6486095",
"0.6462057",
"0.64502066",
"0.6405715",
"0.6399276",
"0.6349016",
"0.6344962",
"0.63189083",
"0.630866",
"0.6296425",
"0.6259184",
"0.6250643",
"0.6241446",
"0.62042123",
"0.6201719",
"0.6200987... | 0.6195708 | 22 |
Runs Game of Life algorithm every X milliseconds Uses setTimeout to allow for dynamic interval logic e.g. pending timeout is reset and longer interval is applied when a player clicks on the game | function gameTick() {
for (let y = 0; y < ROWS; y++) {
for (let x = 0; x < COLS; x++) {
const { count, colors } = countNeighbors(x, y)
// Any live cell with fewer than two live neighbours dies,
// as if caused by under-population.
if (count < 2 && game.getLife(x, y)) {
game.setNextStateColor(x, y, COLOR.BLANK)
game.setNextStateLife(x, y, false)
}
// Any live cell with two or three live neighbours lives on to the next generation.
if ((count === 2 || count === 3) &&
game.getLife(x, y)) {
game.setNextStateColor(x, y, game.getColor(x, y))
game.setNextStateLife(x, y, true)
}
// Any live cell with more than three live neighbours dies, as if by overcrowding.
if (count > 3 && game.getLife(x, y)) {
game.setNextStateColor(x, y, COLOR.BLANK)
game.setNextStateLife(x, y, false)
}
// Any dead cell with exactly three live neighbours becomes a live cell,
// as if by reproduction.
if (count === 3 && game.getLife(x, y) === false) {
game.setNextStateColor(x, y, averageColor(colors))
game.setNextStateLife(x, y, true)
}
}
}
game.goToNextState()
primus.forEach(spark => spark.emit(GAME_EVENT.STATE, game.colors))
gameTickTimeoutId = setTimeout(gameTick, GAME_TICK_INTERVAL.DEFAULT)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"startGame() {\n this.interval = this.$interval(() => {\n this.loopCellMatrix();\n this.updateCellsFuture();\n this.iteration++;\n }, 300);\n }",
"function runLifeGame() {\n gameLifeRunning = setInterval(nextGeneration, parseInt($(\"#input-board-time-between-generations\").val()));\n $... | [
"0.71145606",
"0.6455918",
"0.6368944",
"0.6345281",
"0.6343472",
"0.63268125",
"0.63065046",
"0.62905174",
"0.6288947",
"0.6288491",
"0.6271798",
"0.6271258",
"0.6206848",
"0.6195654",
"0.61904025",
"0.61895394",
"0.6187302",
"0.61579275",
"0.6148401",
"0.6147209",
"0.613571... | 0.6970416 | 1 |
When an error occurs | function error(err) {
console.error(err.stack)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"onError() {}",
"function OnErr() {\r\n}",
"function errorHandler(){\n\tconsole.log (\"Sorry, your data didn't make it. Please try again.\");\n}",
"onerror() {}",
"onerror() {}",
"error(error) {}",
"error_handler(err) {\n console.log(`Problem encountered. Detail:${err.message}`);\n }",
"err... | [
"0.72318196",
"0.7045342",
"0.69672513",
"0.6871869",
"0.6871869",
"0.68540317",
"0.6835327",
"0.6827477",
"0.68122786",
"0.68010694",
"0.6767789",
"0.6708222",
"0.67029554",
"0.66992927",
"0.66774154",
"0.6667396",
"0.6632698",
"0.66249675",
"0.6624722",
"0.6624722",
"0.6613... | 0.0 | -1 |
Returns a random integer between min (inclusive) and max (inclusive) | function getRandomInt(min, max) {
return Math.floor(Math.random() * (max - min + 1)) + min
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function randInt(min, max) { return Math.random() * (max - min) + min; }",
"function randInt(min, max) { return Math.random() * (max - min) + min; }",
"static randomInt(min, max) {\n return Math.floor(Math.random() * (max - min + 1) ) + min;\n }",
"static randomInt(min, max) {\n return Math.floor(Math... | [
"0.91688913",
"0.91688913",
"0.9098652",
"0.9098652",
"0.9088164",
"0.9072013",
"0.9070401",
"0.907029",
"0.907029",
"0.9065955",
"0.90646225",
"0.9064371",
"0.90606767",
"0.90605736",
"0.9057691",
"0.905767",
"0.90568143",
"0.9046989",
"0.90434307",
"0.9043087",
"0.90397924"... | 0.0 | -1 |
tabContent array of contents where we need to highlight single one while clicking on aproppriate headliner info parent element of all headliners tab array of directly headliners | constructor(tabContent, info, tab) {
this.tabContent = document.querySelectorAll(tabContent);
this.info = document.querySelector(info);
this.tab = document.querySelectorAll(tab);
this.hideTabContent(1);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function tabActivate( prmCanvasLoc, prmtabHdrLoc, prmtabCntLoc ) \n{\n var i, nChildCount;\n var strChildId;\n var oChild;\n\n //--- get the number of children in canvas\n nChildCount = prmCanvasLoc.children.length;\n \n //--- loop thru the child objects to manage CONTENT-TABS\n for( i = 0; i < nChildCount... | [
"0.59540534",
"0.56489235",
"0.56340986",
"0.56049067",
"0.5487487",
"0.5484926",
"0.54815036",
"0.5443754",
"0.54291767",
"0.54273295",
"0.54246753",
"0.54069763",
"0.53767556",
"0.5370489",
"0.5359896",
"0.5335871",
"0.53325075",
"0.53235507",
"0.53230447",
"0.5320344",
"0.... | 0.5251374 | 26 |
timerId directly id of your HTML timer deadline time point in future wich will be the end of some stoke/offer | constructor(timerId, deadline) {
this.timerId = timerId;
this.deadline = deadline;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateTimer() {\n const time = getTimeDiff(endTime);\n\n days.textContent = `${addZero(time.days)}`;\n hours.textContent = `${addZero(time.hours)}`;\n minutes.textContent = `${addZero(time.minutes)}`;\n seconds.textContent = `${addZero(time.seconds)}`... | [
"0.70178294",
"0.6563851",
"0.6534657",
"0.64944714",
"0.646196",
"0.63344854",
"0.62769777",
"0.6259683",
"0.6190972",
"0.61873555",
"0.61490804",
"0.6144597",
"0.61356187",
"0.6126994",
"0.6050897",
"0.6045961",
"0.6030836",
"0.5978928",
"0.59745365",
"0.59099877",
"0.58996... | 0.7397024 | 0 |
overlay directly overlay seeMore button "show info" closeOverlay cross "hidde info" | constructor(overlay, seeMore, closeOverlay){
this.overlay = document.querySelector(overlay);
this.seeMore = document.querySelector(seeMore);
this.closeOverlay = document.querySelector(closeOverlay);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function viewMoreFalcon() {\n var moreInfo = document.getElementById(\"falconHidden\");\n var buttonText = document.getElementById(\"falconMore\");\n if (moreInfo.style.display === \"none\") {\n moreInfo.style.display = \"block\";\n buttonText.textContent = \"VIEW LESS\"\n ... | [
"0.6611223",
"0.6574282",
"0.6565525",
"0.65614545",
"0.649946",
"0.648657",
"0.6478878",
"0.6437157",
"0.6414701",
"0.64052093",
"0.6360753",
"0.6330158",
"0.6325318",
"0.63181925",
"0.6298709",
"0.62806916",
"0.6241217",
"0.61726886",
"0.61504227",
"0.6112824",
"0.61088246"... | 0.63589 | 11 |
your properties here, remember the constructor | constructor(newName,newLastName,newBirthDate){
this.name = newName;
this.lastName = newLastName;
this.birthDate = newBirthDate;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"constructor() {\n\t this.properties = [];\n\t }",
"constructor () {\r\n\t\t\r\n\t}",
"function _construct()\n\t\t{;\n\t\t}",
"constructor(props) {\n // TODO: add pitch\n super(props);\n this.init();\n }",
"constructor(props)\n {\n super(props)\n\n }",
... | [
"0.7340601",
"0.7231188",
"0.71833366",
"0.71735567",
"0.7137835",
"0.71242106",
"0.70871973",
"0.7083722",
"0.7034825",
"0.7022215",
"0.70178336",
"0.7006535",
"0.69997036",
"0.69972163",
"0.6995877",
"0.6995616",
"0.6978119",
"0.6957174",
"0.6957174",
"0.6940146",
"0.693370... | 0.0 | -1 |
FCC first and third solutions: | function fearNotLetter(str) {
for(let i = 0; i < str.length; i++) {
if (str.charCodeAt(i) != str.charCodeAt(0) + i) {
return String.fromCharCode(str.charCodeAt(i) - 1);
}
}
return undefined;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function fpb(angka1, angka2) \n{\n console.log('\\n', 'case for - FPB', angka1, angka2, '\\n ------------------------------------');\n\n var factorAngkaSatu = []\n var factorAngkaDua = []\n\n\n for (var x = 1; x<=angka1; x++)\n {\n if( angka1 % x === 0)\n {\n factorAngkaSatu.push(x)\n ... | [
"0.614259",
"0.5963369",
"0.56967306",
"0.56478345",
"0.56116265",
"0.5596889",
"0.55865747",
"0.5432951",
"0.5354453",
"0.53440905",
"0.5309049",
"0.5304373",
"0.52926075",
"0.52814436",
"0.5281253",
"0.52663386",
"0.526267",
"0.52441716",
"0.5233243",
"0.52302456",
"0.52232... | 0.0 | -1 |
AJAX call to the include directory to delete an item from a package | function deletePackageItem() {
$.ajax({
type: "GET",
url: '../include/getPackageItems.php?action=deletePackageItem&packageID='+globalPackageID+'&categoryID='+globalCategoryID,
success: function (data) {
getPackageItems(globalPackageID);
},
failure: function(data) {
alert("Delete Failed.");
},
dataType: "json"
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function deleteItemData() {\n var options = {\n url: \"http://localhost:3000/projects\" + \"/\" + Itemid,\n method: \"DELETE\",\n data: \"\",\n success: function() {\n deleteItem();\n },\n error: function(error) {\n console.log(\"error\",error);\n }\n }\n ajax(options);\n}",
"fu... | [
"0.7104768",
"0.6778447",
"0.67659724",
"0.66179925",
"0.66160184",
"0.65829587",
"0.65274787",
"0.6504329",
"0.6479114",
"0.6477967",
"0.6452176",
"0.64471936",
"0.64339083",
"0.6427579",
"0.64122874",
"0.6392828",
"0.637997",
"0.63762397",
"0.6365855",
"0.6365851",
"0.63485... | 0.77091926 | 0 |
Listing function for packages | function getPackageItems(packageID) {
document.getElementById("packageItemsList" + packageID).innerHTML = "";
$.ajax({
type: "GET",
url: '../include/getPackageItems.php?action=getOnePackageItems&packageID='+packageID,
success: function (data) {
if (data.length > 0) {
for (var i = 0; i < data.length; i++) {
deleteString = "<a class='deletePackageItem' data-packageID=" + data[i]['packageID'] + " data-categoryID=" + data[i]['pCategory'] + " title='Delete from package'><i class='zmdi zmdi-delete'></i><a>";
document.getElementById("packageItemsList" + packageID).innerHTML += '<li class="list-group-item">' + data[i]['pName']+ ", " + data[i]["pDescription"] + " " + deleteString + '</li>';
}
}
},
failure: function(data) {
console.log("failure");
},
dataType: "json"
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function listAll() {\n setPackageList(completeList);\n _setCurPackage(null);\n }",
"async getPackages() {\n return [];\n }",
"function getAllPackageNames() {\n return new Promise(function(resolve, reject) {\n exec('npm ls', {cwd: '.'},(error, stdout, stderr) => {\n var packages ... | [
"0.68251574",
"0.6792283",
"0.64070106",
"0.61430895",
"0.5931086",
"0.57915926",
"0.57597333",
"0.5693645",
"0.5690494",
"0.56225806",
"0.5613035",
"0.5594061",
"0.5540519",
"0.55251276",
"0.5511008",
"0.5500252",
"0.5499476",
"0.54880375",
"0.5484183",
"0.54774046",
"0.5475... | 0.0 | -1 |
Allow biometric usage on iOS if it isn't already accepted | allowIosBiometricUsage() {
// See the wdio.shared.conf.js file in the `before` hook for what this property does
if (!driver.isBioMetricAllowed) {
// Wait for the alert
try {
this.iosAllowBiometry.waitForDisplayed({timeout: 3000});
this.allowBiometry.click();
} catch (e) {
// This means that allow using touch/facID has already been accepted
}
// See the wdio.shared.conf.js file in the `before` hook for what this property does
// Set it to accept
driver.isBioMetricAllowed = true;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function checkiOS() {\n\t\treturn /iPad|iPhone|iPod/.test(navigator.userAgent) && ! window.MSStream;\n\t}",
"function checkiOS() {\n return /iPad|iPhone|iPod/.test(navigator.userAgent) && !window.MSStream;\n }",
"iOS():boolean {\n\n\t\treturn this.agent.match(/iPhone|iPad|iPod/i) ? true : false;\n\t}... | [
"0.5587254",
"0.5523544",
"0.54189044",
"0.5293914",
"0.52858055",
"0.51660085",
"0.51615787",
"0.5161381",
"0.5151987",
"0.51505095",
"0.5066032",
"0.50423324",
"0.5026151",
"0.501396",
"0.501396",
"0.501396",
"0.501396",
"0.501396",
"0.50037426",
"0.5000443",
"0.4967216",
... | 0.73278826 | 0 |
fetch the users orders and items | function fetchMyOrders() {
/*
$.get('controller/app.php', {
req : "fetch-my-orders",
}, function(data) {
console.log(data);
$("#data-table").jsonTable({
head:["Order Number",'Item ID','Due Date','Quantity'],
json:['order_number','item_id','due_date','quantity'],
source:data
});
}, "json");*/
$.ajax({
url : 'controller/app.php?req=fetch-my-orders',
dataType : 'json',
success : function(json) {
dataTable = $('#data-table').columns({
data : json,
schema : [{
"header" : "Order Number",
"key" : "order_number"
}, {
"header" : "Item ID",
"key" : "item_id"
}, {
"header" : "Due Date",
"key" : "due_date"
}, {
"header" : "Quantity",
"key" : "quantity"
}]
});
}
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"fetchOrdersList(user_id) {\r\n return axios.get(USER_API_BASE_URL + '/orders/' + user_id);\r\n }",
"function get_users_items_normal(users) {\n var items = [];\n for (user of users) {\n for (order of user.orders) {\n for (item of order.items) {\n items.push(item);\... | [
"0.7409201",
"0.69241416",
"0.6918097",
"0.6792871",
"0.6756308",
"0.6727229",
"0.6671801",
"0.667033",
"0.66540277",
"0.66072905",
"0.64724755",
"0.6466617",
"0.6462575",
"0.64583296",
"0.6456917",
"0.6400723",
"0.6395485",
"0.6376045",
"0.6358382",
"0.63574594",
"0.63159496... | 0.0 | -1 |
Start a transition that interpolates the data based on year. svg.transition() .duration(30000) .ease("linear") .tween("year", tweenYear) .each("end", enableInteraction); Positions the dots based on data. | function position(dot) {
dot .attr("cx", function(d) { return xScale(x(d)); })
.attr("cy", function(d) { return yScale(y(d)); })
.attr("r", function(d) {
if (typeof(imageURL(d))=="undefined" || radius(d) == 0)
{return radiusScale(radius(d)); }
else if (key(d) == "Saturn+Rings") { return size(d)*1.1; }
else { return size(d); }
})
.attr("opacity", function(d) {
if (typeof(imageURL(d))=="undefined")
{ return 0.7; }
else { return 1.0; }
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function animate(){\n svg.transition()\n .duration(30000)\n .ease(d3.easeLinear)\n .tween(\"year\", tweenYear);\n }",
"function tweenYear() {\n var curYear = $(\"#ci-years-selector\").val();\n if(curYear == endYear) curYear = startYear;\n va... | [
"0.7556511",
"0.69782275",
"0.6917286",
"0.68596864",
"0.68596864",
"0.68596864",
"0.68346024",
"0.6830071",
"0.6796774",
"0.67512006",
"0.6744672",
"0.6722959",
"0.6712583",
"0.6712583",
"0.6712583",
"0.659057",
"0.65314245",
"0.6507085",
"0.64613783",
"0.64039415",
"0.63982... | 0.0 | -1 |
Defines a sort order so that the smallest dots are drawn on top. | function order(a, b) {
return radius(b) - radius(a);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"set sortingOrder(value) {}",
"function setSortOrder() {\n\tif (sortOrder == \"high to low\") {\n\t\tsortOrder = \"low to high\";\n\t} else {\n\t\tsortOrder = \"high to low\";\n\t}\n}",
"get sortingOrder() {}",
"function simulateSorting() {\n for (let i = 0; i < values.length; i++) {\n stroke(100, 143, 14... | [
"0.70932597",
"0.6748984",
"0.65615803",
"0.6527891",
"0.65183043",
"0.648535",
"0.63484126",
"0.63200426",
"0.6301433",
"0.6278715",
"0.6212716",
"0.62029046",
"0.618244",
"0.61444837",
"0.6119178",
"0.6102705",
"0.6078246",
"0.6061914",
"0.60590714",
"0.605402",
"0.6027519"... | 0.0 | -1 |
After the transition finishes, you can mouseover to change the year. | function enableInteraction() {
var yearScale = d3.scale.linear()
.domain([1600, 1900])
.range([box.x + 10, box.x + box.width - 10])
.clamp(true);
// Cancel the current transition, if any.
svg.transition().duration(0);
overlay
.on("mouseover", mouseover)
.on("mouseout", mouseout)
.on("mousemove", mousemove)
.on("touchmove", mousemove);
function mouseover() {
label.classed("active", true);
}
function mouseout() {
label.classed("active", false);
}
function mousemove() {
displayYear(yearScale.invert(d3.mouse(this)[0]));
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function mouseOverHandle(){\n circle.transition().duration(200).attr('opacity',1);\n caption.transition().duration(200).attr('opacity',1);\n curYear.transition().duration(200).attr('opacity',1);\n d3.selectAll(\".x.axis\")\n .transition()\n .duration(500)\n ... | [
"0.7115008",
"0.70984393",
"0.7043693",
"0.70283806",
"0.70166534",
"0.7011093",
"0.7011093",
"0.7011093",
"0.6968958",
"0.696625",
"0.6958392",
"0.68476284",
"0.68476284",
"0.68476284",
"0.677184",
"0.67223704",
"0.6708116",
"0.6690718",
"0.6662201",
"0.6662063",
"0.66049767... | 0.0 | -1 |
Tweens the entire chart by first tweening the year, and then the data. For the interpolated data, the dots and label are redrawn. | function tweenYear() {
var year = d3.interpolateNumber(1600, 1900);
return function(t) { displayYear(year(t)); };
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function tweenYear() {\n\t\t \tvar year = d3.interpolateNumber(1976,2014);\n\t\t return function(t) { updateChart(year(t)); };\n\t }",
"function tweenYear() {\n var year = d3.interpolateNumber(2005, 2016);\n return function(t) {\n yearLabel.text(Math.round(year(t)));\n transitionYear((year... | [
"0.77247405",
"0.74827653",
"0.7420117",
"0.7420117",
"0.7420117",
"0.7399845",
"0.72967744",
"0.72514355",
"0.72514355",
"0.72514355",
"0.72077",
"0.713376",
"0.7099649",
"0.67113674",
"0.66833615",
"0.6644465",
"0.66187274",
"0.6426622",
"0.63636434",
"0.6308051",
"0.628011... | 0.7283489 | 7 |
Updates the display to show the specified year. | function displayYear(year) {
dot.data(interpolateData(Math.round(year)), key).call(position).sort(order);
label.text(Math.round(year));
dotNames.data(interpolateData(Math.round(year)), key).call(showLabel);
// Updates texts in sidebar.
titles.data(interpolateTeleData(year), key).call(changeTitle);
texts.data(interpolateTeleData(year), key).call(changeText);
if ( year >= 1842 && year < 1847) {
document.getElementById("description").style.height = "285px";
}
else {
document.getElementById("description").style.height = "350px";
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"updateYear() {\n O('year-label').innerHTML = this.year;\n }",
"function updateYear(year) {\n yearSelected = year;\n updateShotChart();\n updateSeasonRank();\n}",
"function displayYear(year) {\n d3.selectAll(\".dot\").data(interpolateData(year), key)\n .call(position)\n .sort(order);... | [
"0.77693564",
"0.75446963",
"0.72150356",
"0.71750224",
"0.7142512",
"0.70484203",
"0.70484203",
"0.7007036",
"0.7007036",
"0.7007036",
"0.6965553",
"0.69503665",
"0.69503665",
"0.69503665",
"0.6885591",
"0.6857341",
"0.67369026",
"0.67194164",
"0.66810894",
"0.6652801",
"0.6... | 0.77194196 | 1 |
Interpolates the dataset for the given (fractional) year. | function interpolateData(year) {
return testData.map(function(d) {
return {
xPos: d.xPos,
yPos: d.yPos,
name: d.name,
size: d.size,
region: d.region,
number: interpolateValues(d.number, year),
textLabel: setLabel(d.name, d.number, year),
magnitude: d.magnitude,
image: d.image,
caption: d.caption
};
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function interpolateData(year) {\n return data.map(function(d) {\n return {\n country: d.country,\n region: d.region,\n code: d.code,\n xVal: interpolateValues(d.x, year),\n yVal: interpolateValues(d.y, year),\n zVal: interpolateValues(d.z, year)\n };\n });... | [
"0.75805336",
"0.7532873",
"0.74065244",
"0.731408",
"0.7296949",
"0.72798663",
"0.72255176",
"0.71993214",
"0.71993214",
"0.71993214",
"0.7172246",
"0.7163488",
"0.7104056",
"0.7104056",
"0.7104056",
"0.70994294",
"0.7004463",
"0.69604856",
"0.691536",
"0.6687981",
"0.668798... | 0.7617787 | 0 |
Finds (and possibly interpolates) the value for the specified year. | function interpolateValues(values, year) {
var i = bisect.right(values, year, 0, values.length - 1),
a = values[i];
if (i > 0) {
var b = values[i - 1],
t = (year - a[0]) / (b[0] - a[0]);
if (b[1] == 0) { return 0; }
else { return a[1] * (1 - t) + b[1] * t; }
}
return a[1];
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function interpolateValues(values, year) {\n for (i in values) {\n if (year == values[i][0] && null != values[i][1]) {\n return values[i][1]\n }\n }\n return null\n }",
"function interpolateValues(values, year) {\n let i = bisect.left(values, year, 0, values.length -... | [
"0.7394559",
"0.67821807",
"0.6722554",
"0.6722554",
"0.6722554",
"0.6698918",
"0.6695649",
"0.66823447",
"0.66584456",
"0.66584456",
"0.66584456",
"0.6650481",
"0.6599824",
"0.6586608",
"0.6535596",
"0.62672585",
"0.6051055",
"0.6016964",
"0.5964394",
"0.5964394",
"0.5893825... | 0.66540956 | 11 |
VERIFICA SE O USUARIO ESTA CONECTADO | function isOnlineLogin(){
//var page = prefix+"adx/mobile/professor/leitura/testeConecao.php"; //TESTE!!
var page = prefix+unidade+"/mobile/professor/leitura/testeConecao.php"; //OFICIAL
//var page = prefix+"/mobile/professor/leitura/testeConecao.php"; //teste basse de dados oficial
var resultado = 0;
$.ajax({
url: page,
data: {},
dataType: "text",
method: "post",
async: false,
}).done(function(dados){
resultado = dados;
}).fail(function(a,b,c){
console.log(a);
console.log(b);
console.log(c);
});
return resultado;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function iniciarSesion(dataUsuario) {\n usuarioLogueado = new Usuario(dataUsuario.data._id, dataUsuario.data.nombre, dataUsuario.data.apellido, dataUsuario.data.email, dataUsuario.data.direccion, null);\n tokenGuardado = dataUsuario.data.token;\n localStorage.setItem(\"AppUsuarioToken\", tokenGuardado);\n... | [
"0.6406209",
"0.6242268",
"0.6239344",
"0.62221223",
"0.6219718",
"0.6177213",
"0.6155958",
"0.61553663",
"0.61300033",
"0.611397",
"0.61103666",
"0.60612863",
"0.6054931",
"0.6033202",
"0.60165095",
"0.60002303",
"0.5997748",
"0.59918493",
"0.59654176",
"0.5947931",
"0.59340... | 0.0 | -1 |
CRIA UM MODAL COM A ANIMACAO DE ESPERA | function esperaconectar(){
var load = "\
<div id='modalLogin' class='modal' style='color:rgba(84, 150, 252, 0.97); background: transparent; box-shadow: 0 0 0 0 rgba(0, 0, 0, 0), 0 0 0 0 rgba(0, 0, 0, 0); height: 30%;'>\
<div class='modal-content'>\
<div class='preloader-wrapper big active' style='margin-left: 40%;'>\
<div class='spinner-layer spinner-blue-only'>\
<div class='circle-clipper left'>\
<div class='circle'></div>\
</div><div class='gap-patch'>\
<div class='circle'></div>\
</div><div class='circle-clipper right'>\
<div class='circle'></div>\
</div>\
</div>\
</div>\
</div>\
</div>\
";
$("main").append(load);
$('#modalLogin').openModal({
dismissible: false,
opacity: .5,
});
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function ClickGerarPersonagem(modo) {\n GeraPersonagem(modo);\n}",
"function ClickGerarPontosDeVida(modo) {\n GeraPontosDeVida(modo);\n AtualizaGeral();\n}",
"function ClickVisualizacaoModoMestre() {\n gEntradas.modo_mestre = Dom('input-modo-mestre').checked;\n AtualizaGeralSemLerEntradas();\n}",
"funct... | [
"0.63150495",
"0.63056695",
"0.6178775",
"0.60582364",
"0.605514",
"0.60519964",
"0.6022779",
"0.6020148",
"0.5992247",
"0.5986929",
"0.59642833",
"0.5946956",
"0.5946167",
"0.5915311",
"0.589851",
"0.58791566",
"0.587016",
"0.5854482",
"0.5838816",
"0.5838363",
"0.5785085",
... | 0.0 | -1 |
workaround bug in FF 3.6 | function token() {
if (re.lastIndex >= text.length) return EOF; // special case: end of file
if (eol) { eol = false; return EOL; } // special case: end of line
// special case: quotes
var j = re.lastIndex;
if (text.charCodeAt(j) === 34) {
var i = j;
while (i++ < text.length) {
if (text.charCodeAt(i) === 34) {
if (text.charCodeAt(i + 1) !== 34) break;
i++;
}
}
re.lastIndex = i + 2;
var c = text.charCodeAt(i + 1);
if (c === 13) {
eol = true;
if (text.charCodeAt(i + 2) === 10) re.lastIndex++;
} else if (c === 10) {
eol = true;
}
return text.substring(j + 1, i).replace(/""/g, "\"");
}
// common case
var m = re.exec(text);
if (m) {
eol = m[0].charCodeAt(0) !== 44;
return text.substring(j, m.index);
}
re.lastIndex = text.length;
return text.substring(j);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function fixIeBug(e){return browser.msie?e.length-e.replace(/\\r*/g,\"\").length:0}",
"private internal function m248() {}",
"function fixIESelect() {\n return false;\n }",
"function StupidBug() {}",
"protected internal function m252() {}",
"function Ze(){if(ea)t.innerHTML=ha;else if(ia)t.inner... | [
"0.5764417",
"0.57277346",
"0.5568826",
"0.5524992",
"0.55239373",
"0.55047923",
"0.54650784",
"0.5458367",
"0.54365754",
"0.53885704",
"0.53885704",
"0.5355408",
"0.5353211",
"0.53430164",
"0.5336466",
"0.5324651",
"0.5320176",
"0.5297509",
"0.5296868",
"0.5290672",
"0.52633... | 0.0 | -1 |
create start function with listerners | function start(){
//create listener for the mouse being down
document.addEventListener("mousedown", beginDrag, false);
//create listener for the mouse button release
document.addEventListener("mouseup", stopDrag, false);
aImage = document.getElementById("pic");
zIndex = 0;
mouseX = 0;
mouseY = 0;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function startPoint()\n{\n\n}",
"function createIncremontor(start) {\n return function () { // 1\n start++;\n return start\n }\n}",
"set start(value) {}",
"function makeStartingList(){\n for(var i = 0; i<1; i++){\n addListItem( {task: \"Make the list\"});\n addListItem( {task: \"Test the lis... | [
"0.6626864",
"0.65649986",
"0.6478278",
"0.635719",
"0.6303357",
"0.6303357",
"0.6161959",
"0.6160001",
"0.6154346",
"0.5970895",
"0.5966612",
"0.5965385",
"0.59398353",
"0.5855967",
"0.57817835",
"0.5769968",
"0.57034665",
"0.567525",
"0.567525",
"0.567525",
"0.56513834",
... | 0.0 | -1 |
uzdavinio esme kad vienu metu reikia sumuoti dvi reiksmes t.y. asmenu/vaiku counta/kieki ir amziaus counta | function averageAge(asmuo) {
let childCount = 1; // vaiku kiekis = 1 , nes pedro jau yra 1
let childAgeSum = asmuo.age; // vaiku amziaus suma
if (asmuo.children) { // jeigu vaiku yra, suskaiciuoti kiek
for (let i = 0; i < asmuo.children.length; i++){
const child = asmuo.children[i]; // kiekvienas vaikas
const childInfo = averageAge(child);
childCount += childInfo.childCount;
childAgeSum += childInfo.ageSum;
}
}
return {
childCount: childCount,
ageSum: childAgeSum
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function contadoresArgentina() {\n $('#provPymes').html('Argentina');\n var pymesCountUp = new CountUp(\"totalPymes\", totalPymes_var, totalPymes_ARG, 0, 0.5, options);\n pymesCountUp.start();\n\n var pymes_porCountUp = new CountUp(\"porcPymes\", porcPymes_var*100, porcPymes_ARG*100, 0, 0.5, options);\n pymes... | [
"0.63130164",
"0.62169874",
"0.61833024",
"0.61737436",
"0.6134403",
"0.6064927",
"0.60555124",
"0.60259974",
"0.59764886",
"0.59751385",
"0.5957782",
"0.5929572",
"0.59239525",
"0.5910305",
"0.59076947",
"0.5887431",
"0.58761317",
"0.58727163",
"0.5870127",
"0.5848806",
"0.5... | 0.0 | -1 |
Check if the given character code, or the character code at the first character, is a whitespace character. | function whitespace(character) {
return re.test(
typeof character === 'number' ? fromCode(character) : character.charAt(0)
)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function is_whitespace(char) {\n return \" \\t\\n\".indexOf(char) >= 0;\n }",
"function isWhiteSpace(code) {\n return isNewline(code) || code === 0x0020 || code === 0x0009;\n}",
"function isWhitespace(char) {\n\treturn /\\s/.test(char);\n}",
"function sc_isCharWhitespace(c) {\n var tmp = c.va... | [
"0.7842182",
"0.7834264",
"0.7832752",
"0.78228",
"0.77745175",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7719465",
"0.7682491",
"0.76666844",
"0.7659627",
"0.76204914",
"0.7570898",
"0.7570898",
... | 0.77966636 | 8 |
Check if the given character code, or the character code at the first character, is decimal. | function decimal(character) {
var code = typeof character === 'string' ? character.charCodeAt(0) : character
return code >= 48 && code <= 57 /* 0-9 */
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function decimal(character) {\n var code = typeof character === 'string' ? character.charCodeAt(0) : character;\n return code >= 48 && code <= 57; /* 0-9 */\n}",
"function _isDecimalDigit(ch) {\n return ch >= 48 && ch <= 57; // 0...9\n }",
"function isdecimal(num) {\n return (/^\\d+(\\.\\d+)?$/.te... | [
"0.79072535",
"0.7269267",
"0.67055756",
"0.6648749",
"0.6647464",
"0.6595899",
"0.65650105",
"0.6528613",
"0.6525254",
"0.6490702",
"0.6490702",
"0.6467799",
"0.6428777",
"0.6407652",
"0.6407652",
"0.639504",
"0.63804865",
"0.6337335",
"0.6335508",
"0.6280799",
"0.62789047",... | 0.7950802 | 5 |
Wrap to ensure clean parameters are given to `parse`. | function parseEntities(value, options) {
var settings = {}
var option
var key
if (!options) {
options = {}
}
for (key in defaults) {
option = options[key]
settings[key] =
option === null || option === undefined ? defaults[key] : option
}
if (settings.position.indent || settings.position.start) {
settings.indent = settings.position.indent || []
settings.position = settings.position.start
}
return parse(value, settings)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function sanitize( params, cb ){\n\n var clean = {};\n\n // ensure the input params are a valid object\n if( Object.prototype.toString.call( params ) !== '[object Object]' ){\n params = {};\n }\n\n // input text\n if('string' !== typeof params.input || !params.input.length){\n return cb( 'invalid param... | [
"0.5849934",
"0.5465816",
"0.5398534",
"0.5267196",
"0.5057463",
"0.50056684",
"0.4993291",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49829757",
"0.49773252",
"0.4934223",
"0.49293447",
"0.4920151",
"0.4... | 0.0 | -1 |
Get character at position. | function at(position) {
return value.charAt(position)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function at(position) {\n return value.charAt(position);\n }",
"function getchar(position){\n return $(position).text();\n}",
"function getCharFromPosition(pos) {\n\t\tvar index = pos.row * 5;\n\t\tindex = index + pos.col;\n\t\treturn keyPhrase.charAt(index);\n\t}",
"function charAt (str='', position) {... | [
"0.80307126",
"0.7923145",
"0.7504489",
"0.7345628",
"0.72849643",
"0.7173458",
"0.71678835",
"0.7005721",
"0.69420445",
"0.69145226",
"0.69129384",
"0.6879252",
"0.6852267",
"0.6845846",
"0.6806128",
"0.6754075",
"0.6754075",
"0.66977465",
"0.6695774",
"0.6644064",
"0.661924... | 0.7991142 | 4 |
Flush `queue` (normal text). Macro invoked before each entity and at the end of `value`. Does nothing when `queue` is empty. | function flush() {
if (queue) {
result.push(queue)
if (handleText) {
handleText.call(textContext, queue, {start: prev, end: now()})
}
queue = ''
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function flush () {\n flushing = true\n run(queue)\n run(userQueue)\n reset()\n}",
"function flush () {\n flushing = true\n run(queue)\n run(userQueue)\n reset()\n}",
"function flush () {\n flushing = true\n run(queue)\n run(userQueue)\n reset()\n}",
"function flush() {\n if (queue) {\n ... | [
"0.7087387",
"0.7087387",
"0.7087387",
"0.6971163",
"0.69597924",
"0.6915335",
"0.6880378",
"0.6880378",
"0.65975094",
"0.653583",
"0.63974905",
"0.6274862",
"0.6236151",
"0.62098926",
"0.6177881",
"0.6177881",
"0.6177881",
"0.6148284",
"0.6148284",
"0.6148284",
"0.613334",
... | 0.69163615 | 12 |
Check if `character` is outside the permissible unicode range. | function prohibited(code) {
return (code >= 0xd800 && code <= 0xdfff) || code > 0x10ffff
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function isCharAndNotRestricted(c) {\n return (c === 0x9) ||\n (c === 0xA) ||\n (c === 0xD) ||\n (c > 0x1F && c < 0x7F) ||\n (c === 0x85) ||\n (c > 0x9F && c <= 0xD7FF) ||\n (c >= 0xE000 && c <= 0xFFFD) ||\n (c >= 0x10000 && c <= 0x10FFFF);\n}",
"function isRes... | [
"0.67489797",
"0.6671416",
"0.6548199",
"0.6439609",
"0.6376556",
"0.636672",
"0.6355649",
"0.6336511",
"0.61371344",
"0.61371344",
"0.61335915",
"0.6131919",
"0.6103784",
"0.6095146",
"0.60744405",
"0.60734296",
"0.6037238",
"0.6001221",
"0.59768313",
"0.596549",
"0.596392",... | 0.0 | -1 |
Check if `character` is disallowed. | function disallowed(code) {
return (
(code >= 0x0001 && code <= 0x0008) ||
code === 0x000b ||
(code >= 0x000d && code <= 0x001f) ||
(code >= 0x007f && code <= 0x009f) ||
(code >= 0xfdd0 && code <= 0xfdef) ||
(code & 0xffff) === 0xffff ||
(code & 0xffff) === 0xfffe
)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function isCharAndNotRestricted(c) {\n return (c === 0x9) ||\n (c === 0xA) ||\n (c === 0xD) ||\n (c > 0x1F && c < 0x7F) ||\n (c === 0x85) ||\n (c > 0x9F && c <= 0xD7FF) ||\n (c >= 0xE000 && c <= 0xFFFD) ||\n (c >= 0x10000 && c <= 0x10FFFF);\n}",
"function isVal... | [
"0.7253733",
"0.72172964",
"0.70964015",
"0.7084406",
"0.69946593",
"0.6974858",
"0.6965145",
"0.69241107",
"0.6893851",
"0.6864202",
"0.6696537",
"0.6636918",
"0.66188204",
"0.6596767",
"0.6581353",
"0.6559648",
"0.65311134",
"0.65260786",
"0.6522246",
"0.65065336",
"0.64783... | 0.0 | -1 |
Remove final newline characters from `value`. | function trimTrailingLines(value) {
var val = String(value)
var index = val.length
while (val.charAt(--index) === line) {
/* Empty */
}
return val.slice(0, index + 1)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function trimTrailingLines(value) {\n return String(value).replace(/\\n+$/, '')\n}",
"function trimTrailingLines(value) {\n var val = String(value);\n var index = val.length;\n\n while (val.charAt(--index) === line) { /* empty */ }\n\n return val.slice(0, index + 1);\n}",
"function trimTrailingLines(value... | [
"0.79480493",
"0.7229775",
"0.7213269",
"0.7213269",
"0.7213269",
"0.69982606",
"0.6687853",
"0.6399552",
"0.63851583",
"0.6329458",
"0.6270205",
"0.6220877",
"0.6215881",
"0.6215881",
"0.62151474",
"0.62026143",
"0.6172999",
"0.6161238",
"0.61498433",
"0.61375123",
"0.613751... | 0.7208231 | 6 |
Normalize an identifier. Collapses multiple white space characters into a single space, and removes casing. | function normalize(value) {
return collapseWhiteSpace(value).toLowerCase();
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function normalize(name) {\n return name.replace(/[- _]+/g, '').toLowerCase();\n }",
"function normalize(name) {\n return name.replace(/[- _]+/g, '').toLowerCase();\n }",
"function normalizeName(name) {\n s = name;\n var pos = 0;\n while (true)\n {\n pos = s.search(' ');\n if (pos... | [
"0.664014",
"0.664014",
"0.66295314",
"0.65128195",
"0.6494406",
"0.6434182",
"0.642196",
"0.6413547",
"0.63303286",
"0.6327255",
"0.63266134",
"0.63184613",
"0.63184613",
"0.63148844",
"0.6298321",
"0.6298321",
"0.6298321",
"0.6298321",
"0.6298321",
"0.6298321",
"0.6298321",... | 0.631888 | 14 |
v8 likes predictible objects | function Item(fun, array) {
this.fun = fun;
this.array = array;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function compareLike(a,b){\n var al = a.idLikesProp.length;\n var bl = b.idLikesProp.length;\n if(al > bl) return -1;\n if(bl > al) return 1;\n return 0;\n}",
"function lookAround() {\n var objectDescription = \"\"\n tj.see().then(function(objects) {\n objects.forEach(function(each) {\n ... | [
"0.527866",
"0.52612406",
"0.51951283",
"0.518796",
"0.51302594",
"0.5044646",
"0.48934332",
"0.4857401",
"0.484017",
"0.48302925",
"0.482028",
"0.4812441",
"0.4808473",
"0.47852293",
"0.47828078",
"0.47574478",
"0.47493434",
"0.4739314",
"0.47239366",
"0.4703992",
"0.4703992... | 0.0 | -1 |
Copyright Joyent, Inc. and other Node contributors. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. resolves . and .. elements in a path array with directory names there must be no slashes, empty elements, or device names (c:\) in the array (so also no leading and trailing slashes it does not distinguish relative and absolute paths) | function normalizeArray(parts, allowAboveRoot) {
// if the path tries to go above the root, `up` ends up > 0
var up = 0;
for (var i = parts.length - 1; i >= 0; i--) {
var last = parts[i];
if (last === '.') {
parts.splice(i, 1);
} else if (last === '..') {
parts.splice(i, 1);
up++;
} else if (up) {
parts.splice(i, 1);
up--;
}
}
// if the path is allowed to go above the root, restore leading ..s
if (allowAboveRoot) {
for (; up--; up) {
parts.unshift('..');
}
}
return parts;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function rationalizePaths(array){\n for(var i = 0, len = array.length; i < len; i++){\n //I know, this is very unneeded, but I like having it because of it's over bearing round-a-bout-ness\n array[i] = require.resolve(array[i]).split('\\\\').filter(function(o,i,a){ return (a.length-1) !== i; }).jo... | [
"0.62572104",
"0.6090412",
"0.5959142",
"0.5926828",
"0.59113187",
"0.5872586",
"0.58484083",
"0.58189994",
"0.5759454",
"0.5741373",
"0.5709317",
"0.5640396",
"0.55562675",
"0.55114317",
"0.5476231",
"0.5438098",
"0.5435966",
"0.54343283",
"0.5427441",
"0.54015446",
"0.53997... | 0.0 | -1 |
Check if the given character code, or the character code at the first character, is alphabetical. | function alphabetical(character) {
var code = typeof character === 'string' ? character.charCodeAt(0) : character
return (
(code >= 97 && code <= 122) /* a-z */ ||
(code >= 65 && code <= 90) /* A-Z */
)
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function alphabetical(character) {\n var code = typeof character === 'string' ? character.charCodeAt(0) : character;\n return code >= 97 && code <= 122 /* a-z */ || code >= 65 && code <= 90 /* A-Z */;\n}",
"function sc_isCharAlphabetic(c)\n { return sc_isCharOfClass(c.val, SC_LOWER_CLASS) ||\n\t sc_isCharO... | [
"0.8075103",
"0.8058104",
"0.7876275",
"0.78079677",
"0.7781606",
"0.7738573",
"0.77375126",
"0.7683825",
"0.7683825",
"0.7679425",
"0.7608251",
"0.7583648",
"0.7579424",
"0.75713086",
"0.75505906",
"0.74917066",
"0.74879587",
"0.74806297",
"0.74661064",
"0.7437811",
"0.74378... | 0.7922871 | 8 |
Gets indentation information for a line. | function indentation(value) {
var index = 0;
var indent = 0;
var character = value.charAt(index);
var stops = {};
var size;
while (character in characters) {
size = characters[character];
indent += size;
if (size > 1) {
indent = Math.floor(indent / size) * size;
}
stops[indent] = index;
character = value.charAt(++index);
}
return {indent: indent, stops: stops};
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getIndent (line) {\n return line.match(/^\\s*/)[0].length\n}",
"getCurrentLineIndentation() {\n return this.currentLine.length - Utils.ltrim(this.currentLine, ' ').length;\n }",
"function indentLevel(linea) {\n var level = 0;\n for ( i in linea ) {\n if ( linea[i] != ' ' ) { brea... | [
"0.7321178",
"0.68024457",
"0.673355",
"0.6241265",
"0.6205445",
"0.6142215",
"0.61237204",
"0.5931858",
"0.5885914",
"0.58800983",
"0.58800983",
"0.58800983",
"0.58800983",
"0.58800983",
"0.58320516",
"0.57890755",
"0.5771645",
"0.57372",
"0.5698956",
"0.565636",
"0.5610286"... | 0.0 | -1 |
wrapper for elt, which removes the elt from the accessibility tree | function eltP(tag, content, className, style) {
var e = elt(tag, content, className, style);
e.setAttribute("role", "presentation");
return e
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"removeElement() {\n this.el.parentNode.removeChild(this.el);\n }",
"function removeElement(elem){ if (elem) elem.parentNode.removeChild(elem) }",
"function removeElement(elem){ if (elem) elem.parentNode.removeChild(elem) }",
"@chained\n\tremove() {\n\t\tlet parent = this.element.parentNode;\n\t\tpa... | [
"0.6625357",
"0.66057837",
"0.66057837",
"0.6573982",
"0.6454482",
"0.63668096",
"0.6310595",
"0.6301675",
"0.6279491",
"0.6267398",
"0.62233317",
"0.6215944",
"0.6156988",
"0.6145581",
"0.6128828",
"0.61132556",
"0.60445356",
"0.6018156",
"0.6015969",
"0.6015648",
"0.6008385... | 0.0 | -1 |
Counts the column offset in a string, taking tabs into account. Used mostly to find indentation. | function countColumn(string, end, tabSize, startIndex, startValue) {
if (end == null) {
end = string.search(/[^\s\u00a0]/);
if (end == -1) { end = string.length; }
}
for (var i = startIndex || 0, n = startValue || 0;;) {
var nextTab = string.indexOf("\t", i);
if (nextTab < 0 || nextTab >= end)
{ return n + (end - i) }
n += nextTab - i;
n += tabSize - (n % tabSize);
i = nextTab + 1;
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function countColumn(string, end, tabSize) {\n if (end == null) {\n end = string.search(/[^\\s\\u00a0]/);\n if (end == -1) end = string.length;\n }\n for (var i = 0, n = 0; i < end; ++i) {\n if (string.charAt(i) == \"\\t\") n += tabSize - (n % tabSize);\n else ++n;\n }\n return n... | [
"0.78494596",
"0.78494596",
"0.78494596",
"0.78494596",
"0.78494596",
"0.78494596",
"0.78313595",
"0.78313595",
"0.78313595",
"0.77288246",
"0.77288246",
"0.77288246",
"0.77288246",
"0.7564648",
"0.7547028",
"0.7547028",
"0.75413024",
"0.7519291",
"0.7494119",
"0.7494119",
"0... | 0.7577807 | 26 |
The inverse of countColumn find the offset that corresponds to a particular column. | function findColumn(string, goal, tabSize) {
for (var pos = 0, col = 0;;) {
var nextTab = string.indexOf("\t", pos);
if (nextTab == -1) { nextTab = string.length; }
var skipped = nextTab - pos;
if (nextTab == string.length || col + skipped >= goal)
{ return pos + Math.min(skipped, goal - col) }
col += nextTab - pos;
col += tabSize - (col % tabSize);
pos = nextTab + 1;
if (col >= goal) { return pos }
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function firstInColumnLocation(col) {\r\n\t\tvar sets = $['mapsettings'];\r\n\t\tvar point = new Point(sets.columns[col],0);\r\n\t\tvar offset = getRelativePoint(point);\r\n\t\treturn offset.x;\r\n\t}",
"function getRelativeColStart(col) {\r\n\t\tvar loc = new Point(sets.columns[col],0);\r\n\t\tvar offset = getR... | [
"0.70207864",
"0.6774466",
"0.6547042",
"0.65317714",
"0.6513608",
"0.6411472",
"0.64103985",
"0.6358958",
"0.63435084",
"0.6293746",
"0.62447125",
"0.62313",
"0.62138146",
"0.62027305",
"0.6194549",
"0.6194549",
"0.6194549",
"0.6194549",
"0.6194549",
"0.6194549",
"0.615899",... | 0.6172878 | 32 |
Returns a number from the range [`0`; `str.length`] unless `pos` is outside that range. | function skipExtendingChars(str, pos, dir) {
while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }
return pos
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getStart (pos, len) {\n if (pos == null) return 0;\n return pos < 0 ? (len + (pos % len)) : Math.min(len, pos);\n}",
"function getPosAsInt(str) {\n\treturn parseInt(str.substr(0, str.length - 2));\n}",
"function collectDigits(input, pos) {\n\t\t'use strict';\n\t\twhile (pos < input.length && inp... | [
"0.6600404",
"0.65358627",
"0.61570245",
"0.5993589",
"0.57630634",
"0.57247585",
"0.5646826",
"0.56274575",
"0.5462163",
"0.543008",
"0.54007566",
"0.53785247",
"0.5377223",
"0.5372194",
"0.5372194",
"0.5349353",
"0.5318074",
"0.5312245",
"0.5266459",
"0.526095",
"0.5196307"... | 0.49225366 | 78 |
Returns the value from the range [`from`; `to`] that satisfies `pred` and is closest to `from`. Assumes that at least `to` satisfies `pred`. Supports `from` being greater than `to`. | function findFirst(pred, from, to) {
// At any point we are certain `to` satisfies `pred`, don't know
// whether `from` does.
var dir = from > to ? -1 : 1;
for (;;) {
if (from == to) { return from }
var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);
if (mid == from) { return pred(mid) ? from : to }
if (pred(mid)) { to = mid; }
else { from = mid + dir; }
}
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function findFirst(pred, from, to) {\n // At any point we are certain `to` satisfies `pred`, don't know\n // whether `from` does.\n var dir = from > to ? -1 : 1;\n for (;;) {\n if (from == to) { return from }\n var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);\n if (mid =... | [
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.72160196",
"0.71898764",
"0.71822035",
"0.71509534",
"0.70096433",
"0.65164363",
"0.60557735",
"0.60172063",
"0.60172063",
"0.60172063",
"0.60172063"... | 0.71492475 | 27 |
The display handles the DOM integration, both for input reading and content drawing. It holds references to DOM nodes and displayrelated state. | function Display(place, doc, input) {
var d = this;
this.input = input;
// Covers bottom-right square when both scrollbars are present.
d.scrollbarFiller = elt("div", null, "CodeMirror-scrollbar-filler");
d.scrollbarFiller.setAttribute("cm-not-content", "true");
// Covers bottom of gutter when coverGutterNextToScrollbar is on
// and h scrollbar is present.
d.gutterFiller = elt("div", null, "CodeMirror-gutter-filler");
d.gutterFiller.setAttribute("cm-not-content", "true");
// Will contain the actual code, positioned to cover the viewport.
d.lineDiv = eltP("div", null, "CodeMirror-code");
// Elements are added to these to represent selection and cursors.
d.selectionDiv = elt("div", null, null, "position: relative; z-index: 1");
d.cursorDiv = elt("div", null, "CodeMirror-cursors");
// A visibility: hidden element used to find the size of things.
d.measure = elt("div", null, "CodeMirror-measure");
// When lines outside of the viewport are measured, they are drawn in this.
d.lineMeasure = elt("div", null, "CodeMirror-measure");
// Wraps everything that needs to exist inside the vertically-padded coordinate system
d.lineSpace = eltP("div", [d.measure, d.lineMeasure, d.selectionDiv, d.cursorDiv, d.lineDiv],
null, "position: relative; outline: none");
var lines = eltP("div", [d.lineSpace], "CodeMirror-lines");
// Moved around its parent to cover visible view.
d.mover = elt("div", [lines], null, "position: relative");
// Set to the height of the document, allowing scrolling.
d.sizer = elt("div", [d.mover], "CodeMirror-sizer");
d.sizerWidth = null;
// Behavior of elts with overflow: auto and padding is
// inconsistent across browsers. This is used to ensure the
// scrollable area is big enough.
d.heightForcer = elt("div", null, null, "position: absolute; height: " + scrollerGap + "px; width: 1px;");
// Will contain the gutters, if any.
d.gutters = elt("div", null, "CodeMirror-gutters");
d.lineGutter = null;
// Actual scrollable element.
d.scroller = elt("div", [d.sizer, d.heightForcer, d.gutters], "CodeMirror-scroll");
d.scroller.setAttribute("tabIndex", "-1");
// The element in which the editor lives.
d.wrapper = elt("div", [d.scrollbarFiller, d.gutterFiller, d.scroller], "CodeMirror");
// Work around IE7 z-index bug (not perfect, hence IE7 not really being supported)
if (ie && ie_version < 8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; }
if (!webkit && !(gecko && mobile)) { d.scroller.draggable = true; }
if (place) {
if (place.appendChild) { place.appendChild(d.wrapper); }
else { place(d.wrapper); }
}
// Current rendered range (may be bigger than the view window).
d.viewFrom = d.viewTo = doc.first;
d.reportedViewFrom = d.reportedViewTo = doc.first;
// Information about the rendered lines.
d.view = [];
d.renderedView = null;
// Holds info about a single rendered line when it was rendered
// for measurement, while not in view.
d.externalMeasured = null;
// Empty space (in pixels) above the view
d.viewOffset = 0;
d.lastWrapHeight = d.lastWrapWidth = 0;
d.updateLineNumbers = null;
d.nativeBarWidth = d.barHeight = d.barWidth = 0;
d.scrollbarsClipped = false;
// Used to only resize the line number gutter when necessary (when
// the amount of lines crosses a boundary that makes its width change)
d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null;
// Set to true when a non-horizontal-scrolling line widget is
// added. As an optimization, line widget aligning is skipped when
// this is false.
d.alignWidgets = false;
d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;
// Tracks the maximum line length so that the horizontal scrollbar
// can be kept static when scrolling.
d.maxLine = null;
d.maxLineLength = 0;
d.maxLineChanged = false;
// Used for measuring wheel scrolling granularity
d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null;
// True when shift is held down.
d.shift = false;
// Used to track whether anything happened since the context menu
// was opened.
d.selForContextMenu = null;
d.activeTouch = null;
input.init(d);
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function displayDOM(){\r\n\t\tvar str = '';\r\n\t\tcontainer.getChildren().each(function(item){\r\n\t\t\tstr += '<div style=\"' + item.style.cssText + '\">' + item.get('text') + '</div>\\n';\r\n\t\t});\r\n\t\tdocument.id('output').set('text', str);\r\n\t}",
"displayScene() {\n\n //Process all component n... | [
"0.7111654",
"0.6606583",
"0.6553395",
"0.62436736",
"0.62331814",
"0.62235034",
"0.61459774",
"0.6129759",
"0.611871",
"0.611871",
"0.610078",
"0.60716736",
"0.60686475",
"0.6026015",
"0.60221195",
"0.60136545",
"0.60071284",
"0.5978854",
"0.58669174",
"0.5864605",
"0.579738... | 0.0 | -1 |
Find the line object corresponding to the given line number. | function getLine(doc, n) {
n -= doc.first;
if (n < 0 || n >= doc.size) { throw new Error("There is no line " + (n + doc.first) + " in the document.") }
var chunk = doc;
while (!chunk.lines) {
for (var i = 0;; ++i) {
var child = chunk.children[i], sz = child.chunkSize();
if (n < sz) { chunk = child; break }
n -= sz;
}
}
return chunk.lines[n]
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function code_line(code, line) {\n return code.findIndex(l => l.line === line)\n}",
"function getSourceLine(lineNo) {\n\t\tif ((lineNo >= 1) && (lineNo <= sourceList.length)) {\n\t\t\treturn sourceList[lineNo - 1];\n\t\t}\n\t\telse {\n\t\t\treturn null;\n\t\t}\n\t}",
"getLine(x, y) {\n var cell = this.getC... | [
"0.6920249",
"0.64912915",
"0.6366571",
"0.6360952",
"0.6341226",
"0.6221371",
"0.62164265",
"0.62164265",
"0.6216259",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0.62154245",
"0... | 0.59749305 | 78 |
Get the part of a document between two positions, as an array of strings. | function getBetween(doc, start, end) {
var out = [], n = start.line;
doc.iter(start.line, end.line + 1, function (line) {
var text = line.text;
if (n == end.line) { text = text.slice(0, end.ch); }
if (n == start.line) { text = text.slice(start.ch); }
out.push(text);
++n;
});
return out
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getBetween(doc, start, end) {\n\t var out = [], n = start.line;\n\t doc.iter(start.line, end.line + 1, function(line) {\n\t var text = line.text;\n\t if (n == end.line) text = text.slice(0, end.ch);\n\t if (n == start.line) text = text.slice(start.ch);\n\t out.push(text);\n\t ... | [
"0.7319094",
"0.7319094",
"0.7319094",
"0.7309015",
"0.7309015",
"0.7307082",
"0.7307082",
"0.7307082",
"0.7307082",
"0.7307082",
"0.7307082",
"0.7307082",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"0.7296952",
"... | 0.73343515 | 13 |
Get the lines between from and to, as array of strings. | function getLines(doc, from, to) {
var out = [];
doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value
return out
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }",
"function getLines(doc, from, to) {\n var out = [];\n doc.iter(from, to, function(line) { out.push(line.text); });\n return out;\n }",
"function getLines(doc... | [
"0.78904086",
"0.78904086",
"0.78904086",
"0.78904086",
"0.78904086",
"0.78904086",
"0.78513694",
"0.7843995",
"0.7843995",
"0.7843995",
"0.7803603",
"0.77783775",
"0.7767557",
"0.7767557",
"0.7767557",
"0.7767557",
"0.7767557",
"0.7767557",
"0.7767557",
"0.7767557",
"0.77675... | 0.7850108 | 22 |
Update the height of a line, propagating the height change upwards to parent nodes. | function updateLineHeight(line, height) {
var diff = height - line.height;
if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateLineHeight(line, height) {\n\t\t var diff = height - line.height;\n\t\t if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }\n\t\t }",
"function updateLineHeight(line, height) {\n\t\t var diff = height - line.height;\n\t\t if (diff) for (var n = line; n; n = n.paren... | [
"0.8322016",
"0.830631",
"0.8282418",
"0.8282418",
"0.8282418",
"0.8282418",
"0.8282418",
"0.8282418",
"0.8282418",
"0.82768357",
"0.82768357",
"0.82768357",
"0.8260964",
"0.8210703",
"0.8163414",
"0.81575036",
"0.81575036",
"0.81119776",
"0.81119776",
"0.81119776",
"0.811197... | 0.82786244 | 25 |
Given a line object, find its line number by walking up through its parent links. | function lineNo(line) {
if (line.parent == null) { return null }
var cur = line.parent, no = indexOf(cur.lines, line);
for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {
for (var i = 0;; ++i) {
if (chunk.children[i] == cur) { break }
no += chunk.children[i].chunkSize();
}
}
return no + cur.first
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function lineNo(line) {\n\t\t if (line.parent == null) { return null }\n\t\t var cur = line.parent, no = indexOf(cur.lines, line);\n\t\t for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n\t\t for (var i = 0;; ++i) {\n\t\t if (chunk.children[i] == cur) { break }\n\t\t ... | [
"0.76442444",
"0.7633338",
"0.760459",
"0.75937176",
"0.75937176",
"0.75937176",
"0.75879866",
"0.75715834",
"0.75715834",
"0.75715834",
"0.75715834",
"0.75715834",
"0.75715834",
"0.75715834",
"0.7512249",
"0.7512249",
"0.7512249",
"0.7512249",
"0.7512249",
"0.7512249",
"0.75... | 0.7587738 | 23 |
Find the line at the given vertical position, using the height information in the document tree. | function lineAtHeight(chunk, h) {
var n = chunk.first;
outer: do {
for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {
var child = chunk.children[i$1], ch = child.height;
if (h < ch) { chunk = child; continue outer }
h -= ch;
n += child.chunkSize();
}
return n
} while (!chunk.lines)
var i = 0;
for (; i < chunk.lines.length; ++i) {
var line = chunk.lines[i], lh = line.height;
if (h < lh) { break }
h -= lh;
}
return n + i
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function updateLineHeight(line, height) {\n var diff = height - line.height;\n\n if (diff) {\n for (var n = line; n; n = n.parent) {\n n.height += diff;\n }\n }\n } // Given a line object, find its line number by walking up through",
"lineBlockAtHeight(height) {\n this.readMeasu... | [
"0.65733033",
"0.64114404",
"0.63363874",
"0.63363874",
"0.63363874",
"0.63167506",
"0.6293391",
"0.62653893",
"0.6253694",
"0.6222418",
"0.6202566",
"0.6202566",
"0.6202566",
"0.6202566",
"0.6202566",
"0.6202566",
"0.6202566",
"0.61813724",
"0.61696094",
"0.61696094",
"0.616... | 0.62214965 | 25 |
A Pos instance represents a position within the text. | function Pos(line, ch, sticky) {
if ( sticky === void 0 ) sticky = null;
if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }
this.line = line;
this.ch = ch;
this.sticky = sticky;
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function Pos (line, ch) {\n if (!(this instanceof Pos)) { return new Pos(line, ch) }\n this.line = line; this.ch = ch\n}",
"function Pos(x, y) {\n this.x = x; this.y = y;\n}",
"function Pos(line, ch, sticky) {\n\t\t if ( sticky === void 0 ) sticky = null;\n\n\t\t if (!(this instanceof Pos)) { return n... | [
"0.7744325",
"0.7327437",
"0.73072433",
"0.7230869",
"0.71548593",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.71528506",
"0.7148194",
"0.7127105",
"0.7103211",
"0.6844026",
"0.... | 0.72398067 | 16 |
Compare two positions, return 0 if they are the same, a negative number when a is less, and a positive number otherwise. | function cmp(a, b) { return a.line - b.line || a.ch - b.ch } | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function posCompare(a, b) {\n const yDiff = a[1] - b[1];\n if (yDiff !== 0) return yDiff;\n return a[0] - b[0];\n}",
"function compare(a,b) {\n if (a.x < b.x)\n return -1;\n if (a.x > b.x)\n return 1;\n return 0;\n }",
"function compare (a, b) {\n return a > b ?... | [
"0.798942",
"0.7316707",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7281275",
"0.7240236",
"0.7222929",
"0.7222929",
"0.7222929",
"0.7222929",
"0... | 0.0 | -1 |
Most of the external API clips given positions to make sure they actually exist within the document. | function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1))} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function check_pos(){\n\t//Write our checking of all positions\n\n\tif (blob_pos_x > c_canvas.width - 20){\n\tblob_pos_x = blob_pos_x - 4;\n\t}\n\tif (blob_pos_x < 0){\n\tblob_pos_x = blob_pos_x + 4;\n\t}\n\tif (blob_pos_y > c_canvas.height - 20){\n\tblob_pos_y = blob_pos_y - 4;\n\t}\n\tif (blob_pos_y < 0){\n\tblo... | [
"0.5863681",
"0.567558",
"0.55955523",
"0.5533016",
"0.5504405",
"0.5477774",
"0.54361933",
"0.53989476",
"0.53916335",
"0.5389024",
"0.53696203",
"0.53577834",
"0.5323233",
"0.5317081",
"0.53043234",
"0.5301511",
"0.5299161",
"0.52897173",
"0.52891934",
"0.5287068",
"0.52860... | 0.0 | -1 |
Search an array of spans for a span matching the given marker. | function getMarkedSpanFor(spans, marker) {
if (spans) { for (var i = 0; i < spans.length; ++i) {
var span = spans[i];
if (span.marker == marker) { return span }
} }
} | {
"objective": {
"self": [],
"paired": [],
"triplet": [
[
"query",
"document",
"negatives"
]
]
}
} | [
"function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans[i];\n if (span.marker == marker) return span;\n }\n }",
"function getMarkedSpanFor(spans, marker) {\n if (spans) for (var i = 0; i < spans.length; ++i) {\n var span = spans... | [
"0.7195285",
"0.7195285",
"0.7195285",
"0.7195285",
"0.7195285",
"0.7195285",
"0.7195285",
"0.7165243",
"0.7141147",
"0.71237963",
"0.7118984",
"0.7118984",
"0.7118984",
"0.7104211",
"0.7104211",
"0.71036065",
"0.70881194",
"0.70881194",
"0.70881194",
"0.70881194",
"0.7088119... | 0.7182503 | 19 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.