Upload folder using huggingface_hub
Browse filesThis view is limited to 50 files because it contains too many changes.
See raw diff
- .gitattributes +17 -0
- .gitignore +24 -0
- lcms/annotation.csv +0 -0
- lcms/customDB.csv +42 -0
- lcms/fbmn.mgf +2 -2
- lcms/fbmn/gnps2/flow_filelinking.yaml +30 -0
- lcms/fbmn/gnps2/job_dag.html +92 -178
- lcms/fbmn/gnps2/job_parameters.yaml +15 -13
- lcms/fbmn/gnps2/job_report.html +0 -0
- lcms/fbmn/gnps2/job_timeline.html +169 -137
- lcms/fbmn/gnps2/nextflow_stdout.log +0 -0
- lcms/fbmn/gnps2/nf_cmd.sh +1 -1
- lcms/fbmn/gnps2/nf_output/3-HYDROXY-ACYL-AMIDES-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/AASDB.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/BERKELEY-LAB.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/BILELIB19.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/BIRMINGHAM-UHPLC-MS-NEG.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/BIRMINGHAM-UHPLC-MS-POS.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/BMDMS-NP.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/CASMI.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/CMMC-FOOD-BIOMARKERS.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/DEREPLICATOR_IDENTIFIED_LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/DMIM-DRUG-METABOLITE-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/DRUGS-OF-ABUSE-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/ECG-ACYL-AMIDES-C4-C24-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/ECG-ACYL-ESTERS-C4-C24-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/ECRFS_DB.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/ELIXDB-LICHEN-DATABASE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-MISC.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-PESTICIDES-NEGATIVE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-PESTICIDES-POSITIVE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-D2-AMINO-LIPID-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-EMBL-MCF.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-FAULKNERLEGACY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-IOBA-NHC.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-MSMLS.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-N-ACYL-LIPIDS-MASSQL.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-CLINICALCOLLECTION1.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-CLINICALCOLLECTION2.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY_ROUND2_NEGATIVE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY_ROUND2_POSITIVE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIH-SMALLMOLECULEPHARMACOLOGICALLYACTIVE.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NIST14-MATCHES.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NUTRI-METAB-FEM-NEG.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-NUTRI-METAB-FEM-POS.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-PRESTWICKPHYTOCHEM.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-SAM-SIK-KANG-LEGACY-LIBRARY.mgf.tsv +1 -0
- lcms/fbmn/gnps2/nf_output/GNPS-SCIEX-LIBRARY.mgf.tsv +1 -0
.gitattributes
CHANGED
|
@@ -305,3 +305,20 @@ rnaseq/assemblies/piper56/annotations/tmhmm_pep.out filter=lfs diff=lfs merge=lf
|
|
| 305 |
rnaseq/assemblies/piper56/transcriptome.fasta filter=lfs diff=lfs merge=lfs -text
|
| 306 |
rnaseq/assemblies/piper56/transcriptome.pep filter=lfs diff=lfs merge=lfs -text
|
| 307 |
rnaseq/assemblies/piper56/transcriptome_expression_isoform.tsv filter=lfs diff=lfs merge=lfs -text
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 305 |
rnaseq/assemblies/piper56/transcriptome.fasta filter=lfs diff=lfs merge=lfs -text
|
| 306 |
rnaseq/assemblies/piper56/transcriptome.pep filter=lfs diff=lfs merge=lfs -text
|
| 307 |
rnaseq/assemblies/piper56/transcriptome_expression_isoform.tsv filter=lfs diff=lfs merge=lfs -text
|
| 308 |
+
lcms/fbmn/gnps2/nf_output/clustering/tall_raw_data.tsv filter=lfs diff=lfs merge=lfs -text
|
| 309 |
+
lcms/fbmn/mzmine/fbmn_fbmn.graphml filter=lfs diff=lfs merge=lfs -text
|
| 310 |
+
lcms/fbmn/mzmine/fbmn_iimn.graphml filter=lfs diff=lfs merge=lfs -text
|
| 311 |
+
lcms/speclibs/gnps_lib/ALL_GNPS_NO_PROPOGATED.json filter=lfs diff=lfs merge=lfs -text
|
| 312 |
+
lcms/speclibs/msnlib/20241003_enamdisc_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 313 |
+
lcms/speclibs/msnlib/20241003_enamdisc_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 314 |
+
lcms/speclibs/msnlib/20241003_enammol_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 315 |
+
lcms/speclibs/msnlib/20241003_enammol_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 316 |
+
lcms/speclibs/msnlib/20241003_mcebio_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 317 |
+
lcms/speclibs/msnlib/20241003_mcebio_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 318 |
+
lcms/speclibs/msnlib/20241003_mcedrug_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 319 |
+
lcms/speclibs/msnlib/20241003_mcescaf_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 320 |
+
lcms/speclibs/msnlib/20241003_mcescaf_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 321 |
+
lcms/speclibs/msnlib/20241003_nihnp_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 322 |
+
lcms/speclibs/msnlib/20241003_nihnp_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 323 |
+
lcms/speclibs/msnlib/20241003_otavapep_neg_ms2.json filter=lfs diff=lfs merge=lfs -text
|
| 324 |
+
lcms/speclibs/msnlib/20241003_otavapep_pos_ms2.json filter=lfs diff=lfs merge=lfs -text
|
.gitignore
ADDED
|
@@ -0,0 +1,24 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Ignore any folder named 'archive' anywhere
|
| 2 |
+
**/archive/
|
| 3 |
+
|
| 4 |
+
# Ignore all .DS_Store files
|
| 5 |
+
.DS_Store
|
| 6 |
+
|
| 7 |
+
# Ignore SIRIUS project file
|
| 8 |
+
lcms/sirius/pipernet.sirius
|
| 9 |
+
|
| 10 |
+
# Ignore everything inside rnaseq except assemblies folder
|
| 11 |
+
rnaseq/*
|
| 12 |
+
!rnaseq/assemblies/
|
| 13 |
+
|
| 14 |
+
# Inside assemblies, ignore all subfolders' contents except explicitly allowed files
|
| 15 |
+
rnaseq/assemblies/*/*
|
| 16 |
+
rnaseq/assemblies/*/aurum_data/
|
| 17 |
+
rnaseq/assemblies/*/pnigrum_genome/
|
| 18 |
+
|
| 19 |
+
# But do not ignore these specific files/folders in assemblies
|
| 20 |
+
!rnaseq/assemblies/*/busco_report.txt
|
| 21 |
+
!rnaseq/assemblies/*/transcriptome_expression_isoform.tsv
|
| 22 |
+
!rnaseq/assemblies/*/transcriptome.fasta
|
| 23 |
+
!rnaseq/assemblies/*/transcriptome.pep
|
| 24 |
+
!rnaseq/assemblies/*/annotations/
|
lcms/annotation.csv
ADDED
|
The diff for this file is too large to render.
See raw diff
|
|
|
lcms/customDB.csv
ADDED
|
@@ -0,0 +1,42 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
mz,rt,adduct,name,formula,neutral mass,CAS,PubChemCID,smiles,branch,confirmed_std,standard,fragments,samples,FeatID,USI,GNPSdash,comment
|
| 2 |
+
216.138,9.4,[M+H]+,Cinnamoylpiperidine,C14H17NO,215.131,,764160,O=C(N1CCCCC1)/C=C/C2=CC=CC=C2,PL,TRUE,PA03,,"P26, P55",6003,,,
|
| 3 |
+
276.159,8.58,[M+H]+,PL-prec276,C16H21NO3,275.1521,,2327270,COC1=C(OC)C=C(/C=C/C(N2CCCCC2)=O)C=C1,PL,TRUE,PA10,,P26,4968,,,
|
| 4 |
+
288.123,8.5,[M+H]+,Demethoxypiperlongumine,C16H17NO4,287.1157,,14707485,COC1=C(OC)C=C(/C=C/C(N2CCC=CC2=O)=O)C=C1,PL,TRUE,PA14,,"P09, P26",4858,,,
|
| 5 |
+
605.249,9.36,[M+H]+,PL-prec276-dimer,C33H36N2O9,604.242,,73046783,COC1=C(OC)C=C(C2C(C(N3CCC=CC3=O)=O)C(C4=CC(OC)=C(OC)C(OC)=C4)C2C(N5CCC=CC5=O)=O)C=C1,PL,,,,,5963,,,
|
| 6 |
+
306.17,8.9,[M+H]+,PL-prec306,C17H23NO4,305.1627,,1051540,COC1=CC(/C=C/C(N2CCCCC2)=O)=CC(OC)=C1OC,PL,TRUE,PA01,,"P09, P26",5384,,,
|
| 7 |
+
304.154,9.56,[M+H]+,PL-prec304,C17H21NO4,303.147,,,COC1=CC(/C=C/C(N2CCC=CC2)=O)=CC(OC)=C1OC,PL,,,,"P09, P26",6162,,,
|
| 8 |
+
320.149,9.07,[M+H]+,DehydroPL,C17H21NO5,319.142,,,[O]C1=CC(/C=C/C(N2C(CCCC2)=O)=O)=CC(OC)=C1OC,PL,TRUE,PA06,,"P09, P26",5585,,,
|
| 9 |
+
318.134,8.84,[M+H]+,PL,C17H19NO5,317.1263,,637858,COC1=CC(/C=C/C(N2CCC=CC2=O)=O)=CC(OC)=C1OC,PL,TRUE,Commercial,,"P09, P26",5295,,,
|
| 10 |
+
318.134,8.02,[M+H]+,PL-iso1,C17H19NO5,317.1263,,,COC1=CC(/C=C/C(N2CCC=CC2=O)=O)=CC(OC)=C1OC,PL,TRUE,Commercial,,"P09, P26",,,,
|
| 11 |
+
318.134,9.6,[M+H]+,PL-iso2,C17H19NO5,317.1263,,,COC1=CC(/C=C/C(N2CCC=CC2=O)=O)=CC(OC)=C1OC,PL,TRUE,Commercial,,"P09, P26",,,,
|
| 12 |
+
635.259,10.42,[M+H]+,PL-dimer,C34H38N2O10,634.2526,,14782642,COC1=C(OC)C=C([C@@H]2[C@@H](C(N3CCC=CC3=O)=O)[C@H](C4=CC(OC)=C(OC)C(OC)=C4)[C@H]2C(N5CCC=CC5=O)=O)C=C1OC,PL,,,,P09,7324,,,
|
| 13 |
+
635.259,9.34,[M+H]+,PL-dimer_iso1,C34H38N2O10,634.2526,,,COC1=C(OC)C=C([C@@H]2[C@@H](C(N3CCC=CC3=O)=O)[C@H](C4=CC(OC)=C(OC)C(OC)=C4)[C@H]2C(N5CCC=CC5=O)=O)C=C1OC,PL,,,,P09,,,,
|
| 14 |
+
635.259,9.98,[M+H]+,PL-dimer_iso2,C34H38N2O10,634.2526,,,COC1=C(OC)C=C([C@@H]2[C@@H](C(N3CCC=CC3=O)=O)[C@H](C4=CC(OC)=C(OC)C(OC)=C4)[C@H]2C(N5CCC=CC5=O)=O)C=C1OC,PL,,,,P09,,,,
|
| 15 |
+
202.122,8.29,[M+H]+,1-Cinnamoylpyrrolidine,C13H15NO,201.115,,765514,O=C(N1CCCC1)/C=C/C2=CC=CC=C2,Pyrrolidin-PL,TRUE,PA07,,"P26, P54",4697,,,
|
| 16 |
+
262.1438,7.53,[M+H]+,Pyrrolidin-PL-prec262,C15H19NO3,261.1365,,,COC1=C(OC)C=C(/C=C/C(N2CCCC2)=O)C=C1,Pyrrolidin-PL,TRUE,PA11,,"P25, P26, P54",4038,,,
|
| 17 |
+
292.154,7.87,[M+H]+,Pyrrolidin-PL," C16H21NO4",291.147,,121169,COC1=CC(=CC(=C1OC)OC)C=CC(=O)N2CCCC2,Pyrrolidin-PL,TRUE,PA02,,"P25, P26, P54",4322,,,
|
| 18 |
+
286.144,10.13,[M+H]+,Piperine,C17H19NO3,285.1364,,638024,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCCC3,Piperine,TRUE,Commercial,,"P23-Fr, P26, P27, P32, P55, P56",6908,,,
|
| 19 |
+
286.144,10.26,[M+H]+,Piperine-iso1,C17H19NO3,285.1364,,,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCCC3,Piperine,TRUE,Commercial,,"P23-Fr, P26, P27, P32, P55, P56",,,,
|
| 20 |
+
286.144,10.43,[M+H]+,Piperine-iso2,C17H19NO3,285.1364,,,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCCC3,Piperine,TRUE,Commercial,,"P23-Fr, P26, P27, P32, P55, P56",,,,
|
| 21 |
+
340.1907,12.17,[M+H]+,Dehydropipernonaline,C21H25NO3,339.1834,,147128,O=C(/C=C/C=C/CC/C=C/C1=CC2=C(OCO2)C=C1)N3CCCCC3,Piperine,,,,"P26, P32, P54, P56",9674,,,
|
| 22 |
+
274.143,9.66,[M+H]+,Piperlonguminine,C16H19NO3,273.1364,,5320621,CC(CNC(/C=C/C=C/C1=CC2=C(OCO2)C=C1)=O)C,Piperlonguminine,TRUE,PA20,,"P27, P32, P55, P56",6375,,,
|
| 23 |
+
274.143,9.89,[M+H]+,Piperlonguminine-iso1,C16H19NO3,273.1364,,,CC(CNC(/C=C/C=C/C1=CC2=C(OCO2)C=C1)=O)C,Piperlonguminine,TRUE,PA20,,"P27, P32, P55, P56",,,,
|
| 24 |
+
274.143,10.18,[M+H]+,Piperlonguminine-iso2,C16H19NO3,273.1364,,,CC(CNC(/C=C/C=C/C1=CC2=C(OCO2)C=C1)=O)C,Piperlonguminine,TRUE,PA20,,"P27, P32, P55, P56",,,,
|
| 25 |
+
276.159,9.67,[M+H]+,PubChem-71345969,C16H21NO3,275.1521,,71345969,CC(CNC(C=CCCC1=CC2=C(OCO2)C=C1)=O)C,Piperlonguminine,,,,"P27, P32, P55",,,,
|
| 26 |
+
384.2533,13.98,[M+H]+,Guineensine,C24H33NO3,383.246,,6442405,CC(C)CNC(=O)/C=C/C=C/CCCCCC/C=C/C1=CC2=C(C=C1)OCO2,Piperlonguminine,,,,"P27, P32, P55, P56",11124,,,
|
| 27 |
+
272.128,9.12,[M+H]+,Piperyline,C16H17NO3,271.1208,,636537,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCC3,Piperyline,TRUE,PA08,,"P23, P32, P54, P56",5648,,,
|
| 28 |
+
272.128,9.4,[M+H]+,Piperyline-iso1,C16H17NO3,271.1208,,,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCC3,Piperyline,TRUE,PA08,,"P23, P32, P54, P56",,,,
|
| 29 |
+
272.128,9.57,[M+H]+,Piperyline-iso2,C16H17NO3,271.1208,,,O=C(/C=C/C=C/C1=CC2=C(OCO2)C=C1)N3CCCC3,Piperyline,TRUE,PA08,,"P23, P32, P54, P56",,,,
|
| 30 |
+
326.1758,11.26,[M+H]+,PubChem-73155234,C20H23NO3,325.1677,,73155234,C1CCN(C1)C(=O)C=CC=CCCC=CC2=CC3=C(C=C2)OCO3,Piperyline,,,,"P23, P25, P26, P27, P32, P54, P56",8527,,,
|
| 31 |
+
302.175,10.68,[M+H]+,PubChem-10638035,C18H23NO3,301.1677,,10638035,O=C(/C=C/CCCCC1=CC2=C(OCO2)C=C1)N3CCCC3,Piperyline,,,,"P26, P32, P54,P55",,,,
|
| 32 |
+
354.2064,12.6,[M+H]+,PubChem75597680,C22H27NO3,353.199,,75597680,O=C(C=CC=CCCCCC=CC1=CC2=C(OCO2)C=C1)N3CCCC3,Piperyline,,,,"P26, P54, P56",,,,
|
| 33 |
+
272.1286,3.3,[M+H]+,Norcoclaurine,C16H17NO3,271.1208,,114840,C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC=C(C=C3)O,Norcoclaurine,TRUE,Commercial,255.1017,,866,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:866,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A866&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04910278320312%2C%20143.04910278320312%2C%20161.0597381591797%2C%20272.12823486328125%2C%20255.10169982910156%2C%20237.09120178222656%2C%20209.09634399414062%5D%2C%20%5B%5D%5D,
|
| 34 |
+
286.1443,4.12,[M+H]+,Coclaurine,C17H19NO3,285.1364,,160487,COC1=C(C=C2C(NCCC2=C1)CC3=CC=C(C=C3)O)O,Norcoclaurine,,,269.1171,,1321,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:1321,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A1321&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04911041259766%2C%20143.04905700683594%2C%20161.0598907470703%2C%20209.09619140625%2C%20237.09092712402344%2C%20269.1170654296875%2C%20286.14385986328125%2C%20254.09352111816406%5D%2C%20%5B%5D%5D,
|
| 35 |
+
286.1443,5.1,[M+H]+,Coclaurine-iso,C17H19NO3,285.1364,,601299,COC1=C(C=C2CCNC(C2=C1)CC3=CC=C(C=C3)O)O,Norcoclaurine,,,269.1171,,2221,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:2221,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A2221&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04911041259766%2C%20269.1174011230469%2C%20286.1441345214844%2C%20237.0912628173828%5D%2C%20%5B%5D%5D,
|
| 36 |
+
286.1443,3.88,[M+H]+,N-methylnorcoclaurine,C17H19NO3,285.1364,,10589195,OC1=C(O)C=C2C(CC3=CC=C(O)C=C3)N(C)CCC2=C1,Norcoclaurine,,,255.1017,,1173,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:1173,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A1173&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04866790771484%2C%20143.0487518310547%2C%20161.05935668945312%2C%20209.09625244140625%2C%20237.09054565429688%2C%20255.1013641357422%2C%20286.14398193359375%5D%2C%20%5B%5D%5D,
|
| 37 |
+
300.1594,3.1,[M]+,N-dimethylnorcoclaurine,C18H22NO3+,300.1594,,156022266,OC1=C(O)C=C2C([N+](C)(C)CCC2=C1)CC3=CC=C(O)C=C3,Norcoclaurine,,,255.1017; 58.0652,,757,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:757,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A757&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04910278320312%2C%20237.09112548828125%2C%2058.065391540527344%2C%20300.1596374511719%2C%20255.1015625%5D%2C%20%5B%5D%5D,
|
| 38 |
+
300.1594,4.19,[M+H]+,N-Methylcoclaurine,C18H21NO3,299.1521,,2752274,CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)O)OC,Norcoclaurine,,,,,1371,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:1371,http://metabolomics-usi.gnps2.org/dashinterface?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A1371&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B58.065101623535156%2C%20107.04915618896484%2C%20237.09146118164062%2C%20300.1600646972656%2C%20269.11767578125%5D%2C%20%5B%5D%5D,
|
| 39 |
+
,,,,,,,,,,,,,,,,,
|
| 40 |
+
328.1913,4.47,[M]+,PubChem2752261,C20H26NO3+,328.1907,,2752261,C[N+]1(C)CCC2=CC(OC)=C(OC)C=C2C1CC3=CC=C(O)C=C3,Norcoclaurine,,,283.1331; 58.0652,,1599,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:1599,https://metabolomics-usi.gnps2.org/dashinterface/?usi1=mzspec%3AGNPS2%3ATASK-a844d8ee4f534c21950b031d70b7254f-nf_output%2Fclustering%2Fspectra_reformatted.mgf%3Ascan%3A1599&width=10.0&height=6.0&mz_min=None&mz_max=None&max_intensity=125&annotate_precision=4&annotation_rotation=90&cosine=standard&fragment_mz_tolerance=0.1&grid=True&annotate_peaks=%5B%5B107.04907989501953%2C%20283.1331481933594%2C%20328.1907958984375%2C%20189.0911407470703%5D%2C%20%5B%5D%5D,
|
| 41 |
+
330.2064,,[M+H]+,Joshclaurine-1,C20H27NO3,329.1991,,162938190,OC(C=C1)=CC=C1CCC2=CC(OC)=C(OC)C=C2CCN(C)C,Norcoclaurine,TRUE,Isolated,,,2987,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:2987,,
|
| 42 |
+
344.222,,[M]+,Joshclaurine-2,C21H30NO3+,344.222,,,C[N+](C)(C)CCC1=CC(OC)=C(OC)C=C1CCC2=CC=C(O)C=C2,Norcoclaurine,TRUE,Isolated,,,3013,mzspec:GNPS2:TASK-a844d8ee4f534c21950b031d70b7254f-nf_output/clustering/spectra_reformatted.mgf:scan:3013,,
|
lcms/fbmn.mgf
CHANGED
|
@@ -1,3 +1,3 @@
|
|
| 1 |
version https://git-lfs.github.com/spec/v1
|
| 2 |
-
oid sha256:
|
| 3 |
-
size
|
|
|
|
| 1 |
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:cf0431f03ce92390423c25c83d8f2ef9563b039284d1920adc43e93d4e232181
|
| 3 |
+
size 54763213
|
lcms/fbmn/gnps2/flow_filelinking.yaml
CHANGED
|
@@ -12,6 +12,8 @@
|
|
| 12 |
target: input_libraries/GNPS-COLLECTIONS-PESTICIDES-POSITIVE.mgf
|
| 13 |
- parameter: input_libraries
|
| 14 |
target: input_libraries/BMDMS-NP.mgf
|
|
|
|
|
|
|
| 15 |
- parameter: input_libraries
|
| 16 |
target: input_libraries/LEAFBOT.mgf
|
| 17 |
- parameter: input_libraries
|
|
@@ -22,6 +24,8 @@
|
|
| 22 |
target: input_libraries/GNPS-NIH-NATURALPRODUCTSLIBRARY.mgf
|
| 23 |
- parameter: input_libraries
|
| 24 |
target: input_libraries/RESPECT.mgf
|
|
|
|
|
|
|
| 25 |
- parameter: input_libraries
|
| 26 |
target: input_libraries/MIADB.mgf
|
| 27 |
- parameter: input_libraries
|
|
@@ -32,6 +36,8 @@
|
|
| 32 |
target: input_libraries/CASMI.mgf
|
| 33 |
- parameter: input_libraries
|
| 34 |
target: input_libraries/GNPS-COLLECTIONS-PESTICIDES-NEGATIVE.mgf
|
|
|
|
|
|
|
| 35 |
- parameter: input_libraries
|
| 36 |
target: input_libraries/PSU-MSMLS.mgf
|
| 37 |
- parameter: input_libraries
|
|
@@ -56,22 +62,34 @@
|
|
| 56 |
target: input_libraries/MASSBANK.mgf
|
| 57 |
- parameter: input_libraries
|
| 58 |
target: input_libraries/BILELIB19.mgf
|
|
|
|
|
|
|
| 59 |
- parameter: input_libraries
|
| 60 |
target: input_libraries/GNPS-IOBA-NHC.mgf
|
| 61 |
- parameter: input_libraries
|
| 62 |
target: input_libraries/GNPS-MSMLS.mgf
|
|
|
|
|
|
|
| 63 |
- parameter: input_libraries
|
| 64 |
target: input_libraries/GNPS-EMBL-MCF.mgf
|
| 65 |
- parameter: input_libraries
|
| 66 |
target: input_libraries/GNPS-NIH-CLINICALCOLLECTION2.mgf
|
|
|
|
|
|
|
| 67 |
- parameter: input_libraries
|
| 68 |
target: input_libraries/GNPS-LIBRARY.mgf
|
| 69 |
- parameter: input_libraries
|
| 70 |
target: input_libraries/ECG-ACYL-AMIDES-C4-C24-LIBRARY.mgf
|
|
|
|
|
|
|
| 71 |
- parameter: input_libraries
|
| 72 |
target: input_libraries/MONA.mgf
|
| 73 |
- parameter: input_libraries
|
| 74 |
target: input_libraries/GNPS-NUTRI-METAB-FEM-POS.mgf
|
|
|
|
|
|
|
|
|
|
|
|
|
| 75 |
- parameter: input_libraries
|
| 76 |
target: input_libraries/GNPS-SAM-SIK-KANG-LEGACY-LIBRARY.mgf
|
| 77 |
- parameter: input_libraries
|
|
@@ -84,24 +102,36 @@
|
|
| 84 |
target: input_libraries/LDB_POSITIVE.mgf
|
| 85 |
- parameter: input_libraries
|
| 86 |
target: input_libraries/MASSBANKEU.mgf
|
|
|
|
|
|
|
| 87 |
- parameter: input_libraries
|
| 88 |
target: input_libraries/GNPS-SELLECKCHEM-FDA-PART2.mgf
|
| 89 |
- parameter: input_libraries
|
| 90 |
target: input_libraries/GNPS-COLLECTIONS-MISC.mgf
|
| 91 |
- parameter: input_libraries
|
| 92 |
target: input_libraries/ECG-ACYL-ESTERS-C4-C24-LIBRARY.mgf
|
|
|
|
|
|
|
| 93 |
- parameter: input_libraries
|
| 94 |
target: input_libraries/GNPS-NIST14-MATCHES.mgf
|
| 95 |
- parameter: input_libraries
|
| 96 |
target: input_libraries/PNNL-LIPIDS-NEGATIVE.mgf
|
| 97 |
- parameter: input_libraries
|
| 98 |
target: input_libraries/GNPS-FAULKNERLEGACY.mgf
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 99 |
- parameter: input_libraries
|
| 100 |
target: input_libraries/GNPS-PRESTWICKPHYTOCHEM.mgf
|
| 101 |
- parameter: input_libraries
|
| 102 |
target: input_libraries/BERKELEY-LAB.mgf
|
| 103 |
- parameter: input_libraries
|
| 104 |
target: input_libraries/SUMNER.mgf
|
|
|
|
|
|
|
| 105 |
- parameter: input_libraries
|
| 106 |
target: input_libraries/GNPS-NIH-SMALLMOLECULEPHARMACOLOGICALLYACTIVE.mgf
|
| 107 |
- parameter: input_libraries
|
|
|
|
| 12 |
target: input_libraries/GNPS-COLLECTIONS-PESTICIDES-POSITIVE.mgf
|
| 13 |
- parameter: input_libraries
|
| 14 |
target: input_libraries/BMDMS-NP.mgf
|
| 15 |
+
- parameter: input_libraries
|
| 16 |
+
target: input_libraries/MSNLIB-POSITIVE.mgf
|
| 17 |
- parameter: input_libraries
|
| 18 |
target: input_libraries/LEAFBOT.mgf
|
| 19 |
- parameter: input_libraries
|
|
|
|
| 24 |
target: input_libraries/GNPS-NIH-NATURALPRODUCTSLIBRARY.mgf
|
| 25 |
- parameter: input_libraries
|
| 26 |
target: input_libraries/RESPECT.mgf
|
| 27 |
+
- parameter: input_libraries
|
| 28 |
+
target: input_libraries/WFSR-LIBRARY.mgf
|
| 29 |
- parameter: input_libraries
|
| 30 |
target: input_libraries/MIADB.mgf
|
| 31 |
- parameter: input_libraries
|
|
|
|
| 36 |
target: input_libraries/CASMI.mgf
|
| 37 |
- parameter: input_libraries
|
| 38 |
target: input_libraries/GNPS-COLLECTIONS-PESTICIDES-NEGATIVE.mgf
|
| 39 |
+
- parameter: input_libraries
|
| 40 |
+
target: input_libraries/MSNLIB-NEGATIVE.mgf
|
| 41 |
- parameter: input_libraries
|
| 42 |
target: input_libraries/PSU-MSMLS.mgf
|
| 43 |
- parameter: input_libraries
|
|
|
|
| 62 |
target: input_libraries/MASSBANK.mgf
|
| 63 |
- parameter: input_libraries
|
| 64 |
target: input_libraries/BILELIB19.mgf
|
| 65 |
+
- parameter: input_libraries
|
| 66 |
+
target: input_libraries/AASDB.mgf
|
| 67 |
- parameter: input_libraries
|
| 68 |
target: input_libraries/GNPS-IOBA-NHC.mgf
|
| 69 |
- parameter: input_libraries
|
| 70 |
target: input_libraries/GNPS-MSMLS.mgf
|
| 71 |
+
- parameter: input_libraries
|
| 72 |
+
target: input_libraries/MCE-DRUG.mgf
|
| 73 |
- parameter: input_libraries
|
| 74 |
target: input_libraries/GNPS-EMBL-MCF.mgf
|
| 75 |
- parameter: input_libraries
|
| 76 |
target: input_libraries/GNPS-NIH-CLINICALCOLLECTION2.mgf
|
| 77 |
+
- parameter: input_libraries
|
| 78 |
+
target: input_libraries/PYRROLIZIDINE-ALKALOID-SPECTRAL-LIBRARY.mgf
|
| 79 |
- parameter: input_libraries
|
| 80 |
target: input_libraries/GNPS-LIBRARY.mgf
|
| 81 |
- parameter: input_libraries
|
| 82 |
target: input_libraries/ECG-ACYL-AMIDES-C4-C24-LIBRARY.mgf
|
| 83 |
+
- parameter: input_libraries
|
| 84 |
+
target: input_libraries/CMMC-FOOD-BIOMARKERS.mgf
|
| 85 |
- parameter: input_libraries
|
| 86 |
target: input_libraries/MONA.mgf
|
| 87 |
- parameter: input_libraries
|
| 88 |
target: input_libraries/GNPS-NUTRI-METAB-FEM-POS.mgf
|
| 89 |
+
- parameter: input_libraries
|
| 90 |
+
target: input_libraries/ECRFS_DB.mgf
|
| 91 |
+
- parameter: input_libraries
|
| 92 |
+
target: input_libraries/WINE-DB-ORBITRAP.mgf
|
| 93 |
- parameter: input_libraries
|
| 94 |
target: input_libraries/GNPS-SAM-SIK-KANG-LEGACY-LIBRARY.mgf
|
| 95 |
- parameter: input_libraries
|
|
|
|
| 102 |
target: input_libraries/LDB_POSITIVE.mgf
|
| 103 |
- parameter: input_libraries
|
| 104 |
target: input_libraries/MASSBANKEU.mgf
|
| 105 |
+
- parameter: input_libraries
|
| 106 |
+
target: input_libraries/GNPS-N-ACYL-LIPIDS-MASSQL.mgf
|
| 107 |
- parameter: input_libraries
|
| 108 |
target: input_libraries/GNPS-SELLECKCHEM-FDA-PART2.mgf
|
| 109 |
- parameter: input_libraries
|
| 110 |
target: input_libraries/GNPS-COLLECTIONS-MISC.mgf
|
| 111 |
- parameter: input_libraries
|
| 112 |
target: input_libraries/ECG-ACYL-ESTERS-C4-C24-LIBRARY.mgf
|
| 113 |
+
- parameter: input_libraries
|
| 114 |
+
target: input_libraries/DMIM-DRUG-METABOLITE-LIBRARY.mgf
|
| 115 |
- parameter: input_libraries
|
| 116 |
target: input_libraries/GNPS-NIST14-MATCHES.mgf
|
| 117 |
- parameter: input_libraries
|
| 118 |
target: input_libraries/PNNL-LIPIDS-NEGATIVE.mgf
|
| 119 |
- parameter: input_libraries
|
| 120 |
target: input_libraries/GNPS-FAULKNERLEGACY.mgf
|
| 121 |
+
- parameter: input_libraries
|
| 122 |
+
target: input_libraries/PHENOLICSDB.mgf
|
| 123 |
+
- parameter: input_libraries
|
| 124 |
+
target: input_libraries/WINE-DB-QTOF.mgf
|
| 125 |
+
- parameter: input_libraries
|
| 126 |
+
target: input_libraries/3-HYDROXY-ACYL-AMIDES-LIBRARY.mgf
|
| 127 |
- parameter: input_libraries
|
| 128 |
target: input_libraries/GNPS-PRESTWICKPHYTOCHEM.mgf
|
| 129 |
- parameter: input_libraries
|
| 130 |
target: input_libraries/BERKELEY-LAB.mgf
|
| 131 |
- parameter: input_libraries
|
| 132 |
target: input_libraries/SUMNER.mgf
|
| 133 |
+
- parameter: input_libraries
|
| 134 |
+
target: input_libraries/ELIXDB-LICHEN-DATABASE.mgf
|
| 135 |
- parameter: input_libraries
|
| 136 |
target: input_libraries/GNPS-NIH-SMALLMOLECULEPHARMACOLOGICALLYACTIVE.mgf
|
| 137 |
- parameter: input_libraries
|
lcms/fbmn/gnps2/job_dag.html
CHANGED
|
@@ -1,5 +1,5 @@
|
|
| 1 |
<!--
|
| 2 |
-
~ Copyright 2013-
|
| 3 |
~
|
| 4 |
~ Licensed under the Apache License, Version 2.0 (the "License");
|
| 5 |
~ you may not use this file except in compliance with the License.
|
|
@@ -13,183 +13,97 @@
|
|
| 13 |
~ See the License for the specific language governing permissions and
|
| 14 |
~ limitations under the License.
|
| 15 |
-->
|
| 16 |
-
|
| 17 |
<html>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 18 |
|
| 19 |
-
|
| 20 |
-
|
| 21 |
-
|
| 22 |
-
|
| 23 |
-
|
| 24 |
-
|
| 25 |
-
var prot = (("https:" == document.location.protocol) ? "https://" : "http://");
|
| 26 |
-
document.write(unescape("%3Cscript src='" + prot + "code.jquery.com/jquery-2.0.3.min.js' type='text/javascript' %3E%3C/script%3E"));
|
| 27 |
-
document.write(unescape("%3Cscript src='" + prot + "cdnjs.cloudflare.com/ajax/libs/cytoscape/2.6.12/cytoscape.min.js' type='text/javascript' %3E%3C/script%3E"));
|
| 28 |
-
document.write(unescape("%3Cscript src='" + prot + "cdn.rawgit.com/cpettitt/dagre/v0.7.4/dist/dagre.min.js' type='text/javascript' %3E%3C/script%3E"));
|
| 29 |
-
document.write(unescape("%3Cscript src='" + prot + "cdn.rawgit.com/cytoscape/cytoscape.js-dagre/1.1.2/cytoscape-dagre.js' type='text/javascript' %3E%3C/script%3E"));
|
| 30 |
-
</script>
|
| 31 |
-
|
| 32 |
-
<style>
|
| 33 |
-
body {
|
| 34 |
-
font-family: helvetica;
|
| 35 |
-
font-size: 14px;
|
| 36 |
-
}
|
| 37 |
-
|
| 38 |
-
#cy {
|
| 39 |
-
width: 100%;
|
| 40 |
-
height: 100%;
|
| 41 |
-
position: absolute;
|
| 42 |
-
left: 0;
|
| 43 |
-
top: 0;
|
| 44 |
-
z-index: 999;
|
| 45 |
-
}
|
| 46 |
-
|
| 47 |
-
h1 {
|
| 48 |
-
opacity: 0.5;
|
| 49 |
-
font-size: 1em;
|
| 50 |
-
}
|
| 51 |
-
</style>
|
| 52 |
-
|
| 53 |
-
<script>
|
| 54 |
-
$(function(){
|
| 55 |
-
var cy = window.cy = cytoscape({
|
| 56 |
-
container: document.getElementById('cy'),
|
| 57 |
-
boxSelectionEnabled: false,
|
| 58 |
-
autounselectify: true,
|
| 59 |
-
|
| 60 |
-
layout: {
|
| 61 |
-
name: 'dagre'
|
| 62 |
-
},
|
| 63 |
-
|
| 64 |
-
style: cytoscape.stylesheet()
|
| 65 |
-
.selector( 'node')
|
| 66 |
-
.css({
|
| 67 |
-
'width': 10,
|
| 68 |
-
'height': 10,
|
| 69 |
-
'content': 'data(label)',
|
| 70 |
-
'text-valign': 'center',
|
| 71 |
-
'text-halign': 'center',
|
| 72 |
-
'text-opacity': 0.5,
|
| 73 |
-
})
|
| 74 |
-
.selector('node.PROCESS')
|
| 75 |
-
.css({
|
| 76 |
-
'width': 100,
|
| 77 |
-
'height': 50,
|
| 78 |
-
'text-opacity': 0.9,
|
| 79 |
-
'background-color': '#009911'
|
| 80 |
-
})
|
| 81 |
-
.selector('node.OPERATOR')
|
| 82 |
-
.css({
|
| 83 |
-
'background-color': '#11479e',
|
| 84 |
-
'text-halign': 'right',
|
| 85 |
-
})
|
| 86 |
-
.selector('node.ORIGIN')
|
| 87 |
-
.css({
|
| 88 |
-
'background-color': '#999999',
|
| 89 |
-
'text-halign': 'right',
|
| 90 |
-
})
|
| 91 |
-
.selector('node.TERMINATION')
|
| 92 |
-
.css({
|
| 93 |
-
'background-color': '#999999',
|
| 94 |
-
'text-halign': 'right',
|
| 95 |
-
})
|
| 96 |
-
.selector('edge')
|
| 97 |
-
.css({
|
| 98 |
-
'content': 'data(label)',
|
| 99 |
-
'text-opacity': 0.5,
|
| 100 |
-
'width': 4,
|
| 101 |
-
'target-arrow-shape': 'triangle',
|
| 102 |
-
'line-color': '#9dbaea',
|
| 103 |
-
'target-arrow-color': '#9dbaea'
|
| 104 |
-
}),
|
| 105 |
-
|
| 106 |
-
elements: {
|
| 107 |
-
nodes: [
|
| 108 |
-
{ data: { id: 'p0', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 109 |
-
{ data: { id: 'p1'}, classes: 'ORIGIN' },
|
| 110 |
-
{ data: { id: 'p2', label: 'filesummary'}, classes: 'PROCESS' },
|
| 111 |
-
{ data: { id: 'p3'}, classes: 'NODE' },
|
| 112 |
-
{ data: { id: 'p4', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 113 |
-
{ data: { id: 'p5', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 114 |
-
{ data: { id: 'p6', label: 'quantification_table_reformatted'}, classes: 'PROCESS' },
|
| 115 |
-
{ data: { id: 'p7', label: 'filter_spectra'}, classes: 'PROCESS' },
|
| 116 |
-
{ data: { id: 'p8'}, classes: 'NODE' },
|
| 117 |
-
{ data: { id: 'p9', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 118 |
-
{ data: { id: 'p10', label: 'librarySearchData'}, classes: 'PROCESS' },
|
| 119 |
-
{ data: { id: 'p11', label: 'collect'}, classes: 'OPERATOR' },
|
| 120 |
-
{ data: { id: 'p12', label: 'librarymergeResults'}, classes: 'PROCESS' },
|
| 121 |
-
{ data: { id: 'p13', label: 'ifEmpty'}, classes: 'OPERATOR' },
|
| 122 |
-
{ data: { id: 'p14', label: 'summaryLibrary'}, classes: 'PROCESS' },
|
| 123 |
-
{ data: { id: 'p15', label: 'collectFile'}, classes: 'OPERATOR' },
|
| 124 |
-
{ data: { id: 'p16', label: 'ifEmpty'}, classes: 'OPERATOR' },
|
| 125 |
-
{ data: { id: 'p17', label: 'librarygetGNPSAnnotations'}, classes: 'PROCESS' },
|
| 126 |
-
{ data: { id: 'p18', label: 'ifEmpty'}, classes: 'OPERATOR' },
|
| 127 |
-
{ data: { id: 'p19', label: 'networkingGNPSPrepParams'}, classes: 'PROCESS' },
|
| 128 |
-
{ data: { id: 'p20', label: 'collect'}, classes: 'OPERATOR' },
|
| 129 |
-
{ data: { id: 'p21', label: 'calculatePairs'}, classes: 'PROCESS' },
|
| 130 |
-
{ data: { id: 'p22', label: 'collectFile'}, classes: 'OPERATOR' },
|
| 131 |
-
{ data: { id: 'p23', label: 'filterNetwork'}, classes: 'PROCESS' },
|
| 132 |
-
{ data: { id: 'p24', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 133 |
-
{ data: { id: 'p25', label: 'first'}, classes: 'OPERATOR' },
|
| 134 |
-
{ data: { id: 'p26', label: 'createMetadataFile'}, classes: 'PROCESS' },
|
| 135 |
-
{ data: { id: 'p27', label: 'calculateGroupings'}, classes: 'PROCESS' },
|
| 136 |
-
{ data: { id: 'p28', label: 'enrichClusterSummary'}, classes: 'PROCESS' },
|
| 137 |
-
{ data: { id: 'p29', label: 'Channel.fromPath'}, classes: 'ORIGIN' },
|
| 138 |
-
{ data: { id: 'p30', label: 'createNetworkGraphML'}, classes: 'PROCESS' },
|
| 139 |
-
{ data: { id: 'p31'}, classes: 'NODE' },
|
| 140 |
-
{ data: { id: 'p32'}, classes: 'NODE' },
|
| 141 |
-
],
|
| 142 |
-
edges: [
|
| 143 |
-
{ data: { source: 'p0', target: 'p2', label: 'input_spectra_ch' } },
|
| 144 |
-
{ data: { source: 'p1', target: 'p2', label: 'ready' } },
|
| 145 |
-
{ data: { source: 'p2', target: 'p3'} },
|
| 146 |
-
{ data: { source: 'p4', target: 'p6', label: 'input_features' } },
|
| 147 |
-
{ data: { source: 'p5', target: 'p6', label: 'input_spectra' } },
|
| 148 |
-
{ data: { source: 'p6', target: 'p7', label: '_features_reformatted_ch' } },
|
| 149 |
-
{ data: { source: 'p6', target: 'p7', label: '_spectra_reformatted_ch' } },
|
| 150 |
-
{ data: { source: 'p7', target: 'p8', label: '_spectra_reformatted_ch2' } },
|
| 151 |
-
{ data: { source: 'p7', target: 'p10', label: '_spectra_filtered_ch' } },
|
| 152 |
-
{ data: { source: 'p9', target: 'p10', label: 'libraries_ch' } },
|
| 153 |
-
{ data: { source: 'p10', target: 'p11'} },
|
| 154 |
-
{ data: { source: 'p11', target: 'p12'} },
|
| 155 |
-
{ data: { source: 'p12', target: 'p13'} },
|
| 156 |
-
{ data: { source: 'p13', target: 'p17', label: 'merged_results_ch' } },
|
| 157 |
-
{ data: { source: 'p9', target: 'p14', label: 'libraries_ch' } },
|
| 158 |
-
{ data: { source: 'p14', target: 'p15'} },
|
| 159 |
-
{ data: { source: 'p15', target: 'p16', label: 'library_summary_merged_ch' } },
|
| 160 |
-
{ data: { source: 'p16', target: 'p17', label: 'library_summary_merged_ch' } },
|
| 161 |
-
{ data: { source: 'p17', target: 'p18'} },
|
| 162 |
-
{ data: { source: 'p18', target: 'p28', label: 'gnps_library_results_ch' } },
|
| 163 |
-
{ data: { source: 'p7', target: 'p19', label: '_spectra_filtered_ch' } },
|
| 164 |
-
{ data: { source: 'p19', target: 'p20'} },
|
| 165 |
-
{ data: { source: 'p20', target: 'p21'} },
|
| 166 |
-
{ data: { source: 'p7', target: 'p21', label: '_spectra_filtered_ch' } },
|
| 167 |
-
{ data: { source: 'p21', target: 'p22'} },
|
| 168 |
-
{ data: { source: 'p22', target: 'p23', label: 'merged_networking_pairs_ch' } },
|
| 169 |
-
{ data: { source: 'p23', target: 'p28'} },
|
| 170 |
-
{ data: { source: 'p24', target: 'p25'} },
|
| 171 |
-
{ data: { source: 'p25', target: 'p26', label: 'input_metadata_ch' } },
|
| 172 |
-
{ data: { source: 'p26', target: 'p27'} },
|
| 173 |
-
{ data: { source: 'p6', target: 'p27', label: '_features_reformatted_ch' } },
|
| 174 |
-
{ data: { source: 'p27', target: 'p28'} },
|
| 175 |
-
{ data: { source: 'p28', target: 'p30'} },
|
| 176 |
-
{ data: { source: 'p29', target: 'p30', label: 'supplemental_edges_ch' } },
|
| 177 |
-
{ data: { source: 'p23', target: 'p30', label: 'input_filtered_pairs' } },
|
| 178 |
-
{ data: { source: 'p18', target: 'p30', label: 'gnps_library_results_ch' } },
|
| 179 |
-
{ data: { source: 'p30', target: 'p32'} },
|
| 180 |
-
{ data: { source: 'p30', target: 'p31'} },
|
| 181 |
-
],
|
| 182 |
-
},
|
| 183 |
-
|
| 184 |
-
});
|
| 185 |
-
|
| 186 |
-
});
|
| 187 |
-
</script>
|
| 188 |
-
</head>
|
| 189 |
-
|
| 190 |
-
<body>
|
| 191 |
-
<h1>Nextflow Cytoscape.js with Dagre</h1>
|
| 192 |
-
<div id="cy"></div>
|
| 193 |
-
</body>
|
| 194 |
-
|
| 195 |
</html>
|
|
|
|
| 1 |
<!--
|
| 2 |
+
~ Copyright 2013-2024, Seqera Labs
|
| 3 |
~
|
| 4 |
~ Licensed under the Apache License, Version 2.0 (the "License");
|
| 5 |
~ you may not use this file except in compliance with the License.
|
|
|
|
| 13 |
~ See the License for the specific language governing permissions and
|
| 14 |
~ limitations under the License.
|
| 15 |
-->
|
|
|
|
| 16 |
<html>
|
| 17 |
+
<head>
|
| 18 |
+
<meta name="viewport" content="width=device-width, user-scalable=no, initial-scale=1, maximum-scale=1">
|
| 19 |
+
</head>
|
| 20 |
+
<body>
|
| 21 |
+
<pre class="mermaid" style="text-align: center;">
|
| 22 |
+
flowchart TB
|
| 23 |
+
subgraph " "
|
| 24 |
+
v0["Channel.fromPath"]
|
| 25 |
+
v1["ready"]
|
| 26 |
+
v4["Channel.fromPath"]
|
| 27 |
+
v5["Channel.fromPath"]
|
| 28 |
+
v10["Channel.fromPath"]
|
| 29 |
+
v25["Channel.fromPath"]
|
| 30 |
+
v30["Channel.fromPath"]
|
| 31 |
+
end
|
| 32 |
+
v2([filesummary])
|
| 33 |
+
subgraph " "
|
| 34 |
+
v3[" "]
|
| 35 |
+
v7["_embedded_metadata_ch"]
|
| 36 |
+
v9["_spectra_reformatted_ch2"]
|
| 37 |
+
v32[" "]
|
| 38 |
+
v33[" "]
|
| 39 |
+
v35[" "]
|
| 40 |
+
end
|
| 41 |
+
v6([quantification_table_reformatted])
|
| 42 |
+
v8([filter_spectra])
|
| 43 |
+
v11([librarySearchData])
|
| 44 |
+
v13([librarymergeResults])
|
| 45 |
+
v15([summaryLibrary])
|
| 46 |
+
v18([librarygetGNPSAnnotations])
|
| 47 |
+
v20([networkingGNPSPrepParams])
|
| 48 |
+
v22([calculatePairs])
|
| 49 |
+
v24([filterNetwork])
|
| 50 |
+
v27([createMetadataFile])
|
| 51 |
+
v28([calculateGroupings])
|
| 52 |
+
v29([enrichClusterSummary])
|
| 53 |
+
v31([createNetworkGraphML])
|
| 54 |
+
v34([createTallRawData])
|
| 55 |
+
v12(( ))
|
| 56 |
+
v14(( ))
|
| 57 |
+
v16(( ))
|
| 58 |
+
v19(( ))
|
| 59 |
+
v21(( ))
|
| 60 |
+
v23(( ))
|
| 61 |
+
v26(( ))
|
| 62 |
+
v0 --> v2
|
| 63 |
+
v0 --> v34
|
| 64 |
+
v1 --> v2
|
| 65 |
+
v2 --> v3
|
| 66 |
+
v4 --> v6
|
| 67 |
+
v5 --> v6
|
| 68 |
+
v6 --> v8
|
| 69 |
+
v6 --> v7
|
| 70 |
+
v6 --> v28
|
| 71 |
+
v6 --> v34
|
| 72 |
+
v8 --> v9
|
| 73 |
+
v8 --> v11
|
| 74 |
+
v8 --> v20
|
| 75 |
+
v8 --> v22
|
| 76 |
+
v10 --> v11
|
| 77 |
+
v10 --> v15
|
| 78 |
+
v11 --> v12
|
| 79 |
+
v12 --> v13
|
| 80 |
+
v13 --> v14
|
| 81 |
+
v15 --> v16
|
| 82 |
+
v14 --> v18
|
| 83 |
+
v16 --> v18
|
| 84 |
+
v18 --> v19
|
| 85 |
+
v20 --> v21
|
| 86 |
+
v21 --> v22
|
| 87 |
+
v22 --> v23
|
| 88 |
+
v23 --> v24
|
| 89 |
+
v24 --> v29
|
| 90 |
+
v24 --> v31
|
| 91 |
+
v25 --> v26
|
| 92 |
+
v26 --> v27
|
| 93 |
+
v27 --> v28
|
| 94 |
+
v28 --> v29
|
| 95 |
+
v19 --> v29
|
| 96 |
+
v29 --> v31
|
| 97 |
+
v30 --> v31
|
| 98 |
+
v19 --> v31
|
| 99 |
+
v31 --> v33
|
| 100 |
+
v31 --> v32
|
| 101 |
+
v34 --> v35
|
| 102 |
|
| 103 |
+
</pre>
|
| 104 |
+
<script type="module">
|
| 105 |
+
import mermaid from 'https://cdn.jsdelivr.net/npm/mermaid@10/dist/mermaid.esm.min.mjs';
|
| 106 |
+
mermaid.initialize({ startOnLoad: true });
|
| 107 |
+
</script>
|
| 108 |
+
</body>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 109 |
</html>
|
lcms/fbmn/gnps2/job_parameters.yaml
CHANGED
|
@@ -1,31 +1,33 @@
|
|
| 1 |
OMETAFLOW_SERVER: http://ometaflow-launchserver:4000
|
| 2 |
OMETALIBRARY_SERVER: http://ometalibrary-web:5000/library
|
| 3 |
OMETAMASST_SERVER: http://ometamasst-web:5000/masst
|
| 4 |
-
OMETATASK:
|
| 5 |
OMETAUSER: Tito_Damiani
|
| 6 |
-
create_time:
|
| 7 |
-
description:
|
| 8 |
featurefindingtool: MZMINE
|
| 9 |
fragment_tolerance: '0.01'
|
| 10 |
-
input_libraries: /data/nf_data/server/nf_tasks/
|
| 11 |
input_raw_spectra: NO_FILE
|
| 12 |
input_supplemental_edges: NO_FILE
|
| 13 |
-
inputfeatures: /data/nf_data/server/nf_tasks/
|
| 14 |
-
inputspectra: /data/nf_data/server/nf_tasks/
|
|
|
|
| 15 |
library_analog_search: '1'
|
| 16 |
library_min_cosine: '0.7'
|
| 17 |
library_min_matched_peaks: '6'
|
| 18 |
library_topk: '1'
|
| 19 |
-
metadata_filename: /data/nf_data/server/nf_tasks/
|
| 20 |
-
min_peak_intensity: '0.0'
|
| 21 |
networking_max_shift: '1999'
|
| 22 |
networking_min_cosine: '0.7'
|
| 23 |
networking_min_matched_peaks: '6'
|
| 24 |
normalization: None
|
| 25 |
pm_tolerance: '0.01'
|
| 26 |
-
precursor_filter: '
|
| 27 |
-
publishdir: /data/nf_data/server/nf_tasks/
|
| 28 |
-
task:
|
| 29 |
-
|
| 30 |
-
|
|
|
|
|
|
|
| 31 |
workflowname: feature_based_molecular_networking_workflow
|
|
|
|
| 1 |
OMETAFLOW_SERVER: http://ometaflow-launchserver:4000
|
| 2 |
OMETALIBRARY_SERVER: http://ometalibrary-web:5000/library
|
| 3 |
OMETAMASST_SERVER: http://ometamasst-web:5000/masst
|
| 4 |
+
OMETATASK: 16b6a354fd68486e9638497b8e105437
|
| 5 |
OMETAUSER: Tito_Damiani
|
| 6 |
+
create_time: 2025-07-13 23:18:51 PDT-0700
|
| 7 |
+
description: 20250714_PiperNET_fbmn
|
| 8 |
featurefindingtool: MZMINE
|
| 9 |
fragment_tolerance: '0.01'
|
| 10 |
+
input_libraries: /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/input_libraries
|
| 11 |
input_raw_spectra: NO_FILE
|
| 12 |
input_supplemental_edges: NO_FILE
|
| 13 |
+
inputfeatures: /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/inputfeatures/fbmn_quant.csv
|
| 14 |
+
inputspectra: /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/inputspectra
|
| 15 |
+
library_analog_max_shift: '1999'
|
| 16 |
library_analog_search: '1'
|
| 17 |
library_min_cosine: '0.7'
|
| 18 |
library_min_matched_peaks: '6'
|
| 19 |
library_topk: '1'
|
| 20 |
+
metadata_filename: /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/metadata_filename/fbmn_metadata.tsv
|
|
|
|
| 21 |
networking_max_shift: '1999'
|
| 22 |
networking_min_cosine: '0.7'
|
| 23 |
networking_min_matched_peaks: '6'
|
| 24 |
normalization: None
|
| 25 |
pm_tolerance: '0.01'
|
| 26 |
+
precursor_filter: '1'
|
| 27 |
+
publishdir: /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437
|
| 28 |
+
task: 16b6a354fd68486e9638497b8e105437
|
| 29 |
+
topology_maxcomponent: '100'
|
| 30 |
+
topology_topk: '10'
|
| 31 |
+
window_filter: '1'
|
| 32 |
+
workflow_version: SERVER:2025.06.17;WORKFLOW:2025.07.09
|
| 33 |
workflowname: feature_based_molecular_networking_workflow
|
lcms/fbmn/gnps2/job_report.html
CHANGED
|
The diff for this file is too large to render.
See raw diff
|
|
|
lcms/fbmn/gnps2/job_timeline.html
CHANGED
|
@@ -1,6 +1,6 @@
|
|
| 1 |
<!doctype html>
|
| 2 |
<!--
|
| 3 |
-
~ Copyright 2013-
|
| 4 |
~
|
| 5 |
~ Licensed under the Apache License, Version 2.0 (the "License");
|
| 6 |
~ you may not use this file except in compliance with the License.
|
|
@@ -19,6 +19,7 @@
|
|
| 19 |
<head>
|
| 20 |
<meta charset="utf-8">
|
| 21 |
<meta http-equiv="X-UA-Compatible" content="IE=edge" />
|
|
|
|
| 22 |
<style type="text/css">
|
| 23 |
* {
|
| 24 |
font-family: 'Lato', 'Helvetica Neue', Arial, Helvetica, sans-serif;
|
|
@@ -205,143 +206,174 @@ $(function() {
|
|
| 205 |
|
| 206 |
// Nextflow report data
|
| 207 |
window.data = {
|
| 208 |
-
"elapsed": "
|
| 209 |
-
"beginningMillis":
|
| 210 |
-
"endingMillis":
|
| 211 |
"processes": [
|
| 212 |
-
{"label": "
|
| 213 |
-
{"label": "summaryLibrary (
|
| 214 |
-
{"label": "summaryLibrary (
|
| 215 |
-
{"label": "summaryLibrary (
|
| 216 |
-
{"label": "summaryLibrary (
|
| 217 |
-
{"label": "summaryLibrary (
|
| 218 |
-
{"label": "summaryLibrary (
|
| 219 |
-
{"label": "summaryLibrary (
|
| 220 |
-
{"label": "
|
| 221 |
-
{"label": "
|
| 222 |
-
{"label": "summaryLibrary (
|
| 223 |
-
{"label": "summaryLibrary (
|
| 224 |
-
{"label": "summaryLibrary (
|
| 225 |
-
{"label": "summaryLibrary (
|
| 226 |
-
{"label": "summaryLibrary (
|
| 227 |
-
{"label": "
|
| 228 |
-
{"label": "summaryLibrary (
|
| 229 |
-
{"label": "summaryLibrary (
|
| 230 |
-
{"label": "summaryLibrary (
|
| 231 |
-
{"label": "summaryLibrary (
|
| 232 |
-
{"label": "summaryLibrary (
|
| 233 |
-
{"label": "summaryLibrary (
|
| 234 |
-
{"label": "summaryLibrary (
|
| 235 |
-
{"label": "summaryLibrary (
|
| 236 |
-
{"label": "summaryLibrary (
|
| 237 |
-
{"label": "summaryLibrary (
|
| 238 |
-
{"label": "summaryLibrary (
|
| 239 |
-
{"label": "summaryLibrary (
|
| 240 |
-
{"label": "summaryLibrary (
|
| 241 |
-
{"label": "summaryLibrary (
|
| 242 |
-
{"label": "
|
| 243 |
-
{"label": "summaryLibrary (
|
| 244 |
-
{"label": "summaryLibrary (
|
| 245 |
-
{"label": "summaryLibrary (
|
| 246 |
-
{"label": "summaryLibrary (
|
| 247 |
-
{"label": "summaryLibrary (
|
| 248 |
-
{"label": "summaryLibrary (
|
| 249 |
-
{"label": "summaryLibrary (
|
| 250 |
-
{"label": "
|
| 251 |
-
{"label": "
|
| 252 |
-
{"label": "
|
| 253 |
-
{"label": "summaryLibrary (
|
| 254 |
-
{"label": "summaryLibrary (
|
| 255 |
-
{"label": "summaryLibrary (
|
| 256 |
-
{"label": "summaryLibrary (
|
| 257 |
-
{"label": "summaryLibrary (
|
| 258 |
-
{"label": "summaryLibrary (
|
| 259 |
-
{"label": "summaryLibrary (
|
| 260 |
-
{"label": "summaryLibrary (
|
| 261 |
-
{"label": "summaryLibrary (
|
| 262 |
-
{"label": "summaryLibrary (
|
| 263 |
-
{"label": "summaryLibrary (
|
| 264 |
-
{"label": "summaryLibrary (
|
| 265 |
-
{"label": "summaryLibrary (
|
| 266 |
-
{"label": "summaryLibrary (
|
| 267 |
-
{"label": "summaryLibrary (
|
| 268 |
-
{"label": "summaryLibrary (
|
| 269 |
-
{"label": "
|
| 270 |
-
{"label": "
|
| 271 |
-
{"label": "
|
| 272 |
-
{"label": "
|
| 273 |
-
{"label": "
|
| 274 |
-
{"label": "
|
| 275 |
-
{"label": "
|
| 276 |
-
{"label": "
|
| 277 |
-
{"label": "
|
| 278 |
-
{"label": "
|
| 279 |
-
{"label": "
|
| 280 |
-
{"label": "
|
| 281 |
-
{"label": "
|
| 282 |
-
{"label": "
|
| 283 |
-
{"label": "
|
| 284 |
-
{"label": "
|
| 285 |
-
{"label": "
|
| 286 |
-
{"label": "
|
| 287 |
-
{"label": "
|
| 288 |
-
{"label": "librarySearchData (
|
| 289 |
-
{"label": "librarySearchData (
|
| 290 |
-
{"label": "librarySearchData (
|
| 291 |
-
{"label": "librarySearchData (
|
| 292 |
-
{"label": "librarySearchData (
|
| 293 |
-
{"label": "librarySearchData (
|
| 294 |
-
{"label": "librarySearchData (
|
| 295 |
-
{"label": "librarySearchData (
|
| 296 |
-
{"label": "librarySearchData (
|
| 297 |
-
{"label": "librarySearchData (
|
| 298 |
-
{"label": "librarySearchData (
|
| 299 |
-
{"label": "librarySearchData (
|
| 300 |
-
{"label": "librarySearchData (
|
| 301 |
-
{"label": "librarySearchData (
|
| 302 |
-
{"label": "librarySearchData (
|
| 303 |
-
{"label": "librarySearchData (
|
| 304 |
-
{"label": "
|
| 305 |
-
{"label": "
|
| 306 |
-
{"label": "
|
| 307 |
-
{"label": "
|
| 308 |
-
{"label": "
|
| 309 |
-
{"label": "
|
| 310 |
-
{"label": "
|
| 311 |
-
{"label": "
|
| 312 |
-
{"label": "
|
| 313 |
-
{"label": "
|
| 314 |
-
{"label": "
|
| 315 |
-
{"label": "
|
| 316 |
-
{"label": "
|
| 317 |
-
{"label": "
|
| 318 |
-
{"label": "librarySearchData (
|
| 319 |
-
{"label": "librarySearchData (
|
| 320 |
-
{"label": "librarySearchData (
|
| 321 |
-
{"label": "librarySearchData (
|
| 322 |
-
{"label": "librarySearchData (
|
| 323 |
-
{"label": "librarySearchData (
|
| 324 |
-
{"label": "librarySearchData (
|
| 325 |
-
{"label": "
|
| 326 |
-
{"label": "
|
| 327 |
-
{"label": "
|
| 328 |
-
{"label": "
|
| 329 |
-
{"label": "
|
| 330 |
-
{"label": "
|
| 331 |
-
{"label": "
|
| 332 |
-
{"label": "
|
| 333 |
-
{"label": "
|
| 334 |
-
{"label": "
|
| 335 |
-
{"label": "
|
| 336 |
-
{"label": "
|
| 337 |
-
{"label": "
|
| 338 |
-
{"label": "
|
| 339 |
-
{"label": "
|
| 340 |
-
{"label": "
|
| 341 |
-
{"label": "
|
| 342 |
-
{"label": "
|
| 343 |
-
{"label": "
|
| 344 |
-
{"label": "
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 345 |
]
|
| 346 |
}
|
| 347 |
;
|
|
|
|
| 1 |
<!doctype html>
|
| 2 |
<!--
|
| 3 |
+
~ Copyright 2013-2024, Seqera Labs
|
| 4 |
~
|
| 5 |
~ Licensed under the Apache License, Version 2.0 (the "License");
|
| 6 |
~ you may not use this file except in compliance with the License.
|
|
|
|
| 19 |
<head>
|
| 20 |
<meta charset="utf-8">
|
| 21 |
<meta http-equiv="X-UA-Compatible" content="IE=edge" />
|
| 22 |
+
<link rel="icon" type="image/png" href="https://www.nextflow.io/img/favicon.png" />
|
| 23 |
<style type="text/css">
|
| 24 |
* {
|
| 25 |
font-family: 'Lato', 'Helvetica Neue', Arial, Helvetica, sans-serif;
|
|
|
|
| 206 |
|
| 207 |
// Nextflow report data
|
| 208 |
window.data = {
|
| 209 |
+
"elapsed": "6h 21m 38s",
|
| 210 |
+
"beginningMillis": 1752473935805,
|
| 211 |
+
"endingMillis": 1752496834251,
|
| 212 |
"processes": [
|
| 213 |
+
{"label": "quantification_table_reformatted (1)", "cached": false, "index": 0, "times": [{"starting_time": 1752473937715, "ending_time": 1752473942031}, {"starting_time": 1752473942031, "ending_time": 1752473947143, "label": "9.3s \/ 120.2 MB"}]},
|
| 214 |
+
{"label": "summaryLibrary (11)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937742, "ending_time": 1752473942134}, {"starting_time": 1752473942134, "ending_time": 1752473944800, "label": "9.3s \/ 38 MB"}, {"starting_time": 1752473944800, "ending_time": 1752473947033}]},
|
| 215 |
+
{"label": "summaryLibrary (4)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937766, "ending_time": 1752473942138}, {"starting_time": 1752473942138, "ending_time": 1752473944827, "label": "9.3s \/ 47 MB"}, {"starting_time": 1752473944827, "ending_time": 1752473947035}]},
|
| 216 |
+
{"label": "summaryLibrary (10)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937788, "ending_time": 1752473942141}, {"starting_time": 1752473942141, "ending_time": 1752473946448, "label": "9.2s \/ 100.9 MB"}, {"starting_time": 1752473946448, "ending_time": 1752473947036}]},
|
| 217 |
+
{"label": "summaryLibrary (6)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937810, "ending_time": 1752473942143}, {"starting_time": 1752473942143, "ending_time": 1752473944799, "label": "4.3s \/ 24 MB"}]},
|
| 218 |
+
{"label": "summaryLibrary (8)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937831, "ending_time": 1752473942153}, {"starting_time": 1752473942153, "ending_time": 1752473947397, "label": "9.2s \/ 495.3 MB"}]},
|
| 219 |
+
{"label": "summaryLibrary (14)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937852, "ending_time": 1752473942206}, {"starting_time": 1752473942206, "ending_time": 1752473944935, "label": "4.4s \/ 49 MB"}]},
|
| 220 |
+
{"label": "summaryLibrary (5)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937876, "ending_time": 1752473942210}, {"starting_time": 1752473942210, "ending_time": 1752473948732, "label": "9.2s \/ 434.1 MB"}]},
|
| 221 |
+
{"label": "filesummary (1)", "cached": false, "index": 2, "times": [{"starting_time": 1752473937901, "ending_time": 1752473942213}, {"starting_time": 1752473942213, "ending_time": 1752473944992, "label": "9.1s \/ 47 MB"}, {"starting_time": 1752473944992, "ending_time": 1752473947041}]},
|
| 222 |
+
{"label": "summaryLibrary (1)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937925, "ending_time": 1752473942215}, {"starting_time": 1752473942215, "ending_time": 1752473944931, "label": "9.1s \/ 31 MB"}, {"starting_time": 1752473944931, "ending_time": 1752473947043}]},
|
| 223 |
+
{"label": "summaryLibrary (7)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937946, "ending_time": 1752473942218}, {"starting_time": 1752473942218, "ending_time": 1752473944973, "label": "4.3s \/ 48 MB"}]},
|
| 224 |
+
{"label": "summaryLibrary (3)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937971, "ending_time": 1752473942222}, {"starting_time": 1752473942222, "ending_time": 1752473943816, "label": "9.1s \/ 56 MB"}, {"starting_time": 1752473943816, "ending_time": 1752473947048}]},
|
| 225 |
+
{"label": "summaryLibrary (15)", "cached": false, "index": 1, "times": [{"starting_time": 1752473937993, "ending_time": 1752473942223}, {"starting_time": 1752473942223, "ending_time": 1752473944248, "label": "9.1s \/ 20 MB"}, {"starting_time": 1752473944248, "ending_time": 1752473947049}]},
|
| 226 |
+
{"label": "summaryLibrary (12)", "cached": false, "index": 1, "times": [{"starting_time": 1752473938013, "ending_time": 1752473942225}, {"starting_time": 1752473942225, "ending_time": 1752473944845, "label": "9s \/ 42 MB"}, {"starting_time": 1752473944845, "ending_time": 1752473947051}]},
|
| 227 |
+
{"label": "summaryLibrary (9)", "cached": false, "index": 1, "times": [{"starting_time": 1752473938033, "ending_time": 1752473942226}, {"starting_time": 1752473942226, "ending_time": 1752473944582, "label": "9s \/ 24 MB"}, {"starting_time": 1752473944582, "ending_time": 1752473947053}]},
|
| 228 |
+
{"label": "createMetadataFile", "cached": false, "index": 3, "times": [{"starting_time": 1752473938054, "ending_time": 1752473942232}, {"starting_time": 1752473942232, "ending_time": 1752473944100, "label": "9s \/ 21 MB"}, {"starting_time": 1752473944100, "ending_time": 1752473947054}]},
|
| 229 |
+
{"label": "summaryLibrary (16)", "cached": false, "index": 1, "times": [{"starting_time": 1752473938077, "ending_time": 1752473942234}, {"starting_time": 1752473942234, "ending_time": 1752473944279, "label": "9s \/ 21 MB"}, {"starting_time": 1752473944279, "ending_time": 1752473947056}]},
|
| 230 |
+
{"label": "summaryLibrary (2)", "cached": false, "index": 1, "times": [{"starting_time": 1752473938102, "ending_time": 1752473942236}, {"starting_time": 1752473942236, "ending_time": 1752473943972, "label": "9s \/ 51 MB"}, {"starting_time": 1752473943972, "ending_time": 1752473947058}]},
|
| 231 |
+
{"label": "summaryLibrary (13)", "cached": false, "index": 1, "times": [{"starting_time": 1752473938127, "ending_time": 1752473942239}, {"starting_time": 1752473942239, "ending_time": 1752473944073, "label": "8.9s \/ 40 MB"}, {"starting_time": 1752473944073, "ending_time": 1752473947060}]},
|
| 232 |
+
{"label": "summaryLibrary (17)", "cached": false, "index": 1, "times": [{"starting_time": 1752473942224, "ending_time": 1752473947061}, {"starting_time": 1752473947061, "ending_time": 1752473948939, "label": "4.8s \/ 37 MB"}]},
|
| 233 |
+
{"label": "summaryLibrary (18)", "cached": false, "index": 1, "times": [{"starting_time": 1752473942255, "ending_time": 1752473947065}, {"starting_time": 1752473947065, "ending_time": 1752473948542, "label": "4.8s \/ 66 MB"}]},
|
| 234 |
+
{"label": "summaryLibrary (19)", "cached": false, "index": 1, "times": [{"starting_time": 1752473942283, "ending_time": 1752473947069}, {"starting_time": 1752473947069, "ending_time": 1752473948586, "label": "4.8s \/ 135.9 MB"}]},
|
| 235 |
+
{"label": "summaryLibrary (20)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947060, "ending_time": 1752473952032}, {"starting_time": 1752473952032, "ending_time": 1752473953704, "label": "5.1s \/ 51 MB"}]},
|
| 236 |
+
{"label": "summaryLibrary (21)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947089, "ending_time": 1752473952119}, {"starting_time": 1752473952119, "ending_time": 1752473954436, "label": "5s \/ 49 MB"}]},
|
| 237 |
+
{"label": "summaryLibrary (22)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947111, "ending_time": 1752473952125}, {"starting_time": 1752473952125, "ending_time": 1752473954025, "label": "5s \/ 47 MB"}]},
|
| 238 |
+
{"label": "summaryLibrary (23)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947136, "ending_time": 1752473952128}, {"starting_time": 1752473952128, "ending_time": 1752473954147, "label": "5s \/ 50 MB"}]},
|
| 239 |
+
{"label": "summaryLibrary (24)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947202, "ending_time": 1752473952132}, {"starting_time": 1752473952132, "ending_time": 1752473953633, "label": "4.9s \/ 9 MB"}]},
|
| 240 |
+
{"label": "summaryLibrary (25)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947269, "ending_time": 1752473952134}, {"starting_time": 1752473952134, "ending_time": 1752473955065, "label": "9.8s \/ 20 MB"}, {"starting_time": 1752473955065, "ending_time": 1752473957033}]},
|
| 241 |
+
{"label": "summaryLibrary (26)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947347, "ending_time": 1752473952136}, {"starting_time": 1752473952136, "ending_time": 1752473954642, "label": "9.7s \/ 33 MB"}, {"starting_time": 1752473954642, "ending_time": 1752473957035}]},
|
| 242 |
+
{"label": "summaryLibrary (27)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947439, "ending_time": 1752473952140}, {"starting_time": 1752473952140, "ending_time": 1752473955225, "label": "9.6s \/ 19 MB"}, {"starting_time": 1752473955225, "ending_time": 1752473957036}]},
|
| 243 |
+
{"label": "summaryLibrary (29)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947468, "ending_time": 1752473952142}, {"starting_time": 1752473952142, "ending_time": 1752473955080, "label": "9.6s \/ 51 MB"}, {"starting_time": 1752473955080, "ending_time": 1752473957037}]},
|
| 244 |
+
{"label": "summaryLibrary (28)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947493, "ending_time": 1752473952144}, {"starting_time": 1752473952144, "ending_time": 1752473955603, "label": "9.5s \/ 269.2 MB"}, {"starting_time": 1752473955603, "ending_time": 1752473957039}]},
|
| 245 |
+
{"label": "summaryLibrary (30)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947518, "ending_time": 1752473952146}, {"starting_time": 1752473952146, "ending_time": 1752473955468, "label": "9.5s \/ 278.5 MB"}, {"starting_time": 1752473955468, "ending_time": 1752473957041}]},
|
| 246 |
+
{"label": "summaryLibrary (31)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947544, "ending_time": 1752473952148}, {"starting_time": 1752473952148, "ending_time": 1752473954693, "label": "9.5s \/ 16 MB"}, {"starting_time": 1752473954693, "ending_time": 1752473957043}]},
|
| 247 |
+
{"label": "summaryLibrary (32)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947572, "ending_time": 1752473952151}, {"starting_time": 1752473952151, "ending_time": 1752473954071, "label": "9.5s \/ 7 MB"}, {"starting_time": 1752473954071, "ending_time": 1752473957044}]},
|
| 248 |
+
{"label": "summaryLibrary (33)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947596, "ending_time": 1752473952152}, {"starting_time": 1752473952152, "ending_time": 1752473954680, "label": "9.5s \/ 28 MB"}, {"starting_time": 1752473954680, "ending_time": 1752473957046}]},
|
| 249 |
+
{"label": "summaryLibrary (34)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947622, "ending_time": 1752473952154}, {"starting_time": 1752473952154, "ending_time": 1752473955108, "label": "9.4s \/ 19 MB"}, {"starting_time": 1752473955108, "ending_time": 1752473957049}]},
|
| 250 |
+
{"label": "summaryLibrary (35)", "cached": false, "index": 1, "times": [{"starting_time": 1752473947649, "ending_time": 1752473952155}, {"starting_time": 1752473952155, "ending_time": 1752473957144, "label": "9.4s \/ 760.8 MB"}]},
|
| 251 |
+
{"label": "calculateGroupings (1)", "cached": false, "index": 4, "times": [{"starting_time": 1752473947670, "ending_time": 1752473952157}, {"starting_time": 1752473952157, "ending_time": 1752475147150, "label": "20m \/ 791.9 MB"}, {"starting_time": 1752475147150, "ending_time": 1752475147172}]},
|
| 252 |
+
{"label": "createTallRawData (1)", "cached": false, "index": 5, "times": [{"starting_time": 1752473947693, "ending_time": 1752473952158}, {"starting_time": 1752473952158, "ending_time": 1752473963703, "label": "14.3s \/ 476.9 MB"}]},
|
| 253 |
+
{"label": "filter_spectra (1)", "cached": false, "index": 6, "times": [{"starting_time": 1752473947715, "ending_time": 1752473952160}, {"starting_time": 1752473952160, "ending_time": 1752473969686, "label": "19.3s \/ 413 MB"}]},
|
| 254 |
+
{"label": "summaryLibrary (36)", "cached": false, "index": 1, "times": [{"starting_time": 1752473952150, "ending_time": 1752473957052}, {"starting_time": 1752473957052, "ending_time": 1752473959142, "label": "4.9s \/ 115 MB"}]},
|
| 255 |
+
{"label": "summaryLibrary (37)", "cached": false, "index": 1, "times": [{"starting_time": 1752473952183, "ending_time": 1752473957055}, {"starting_time": 1752473957055, "ending_time": 1752473958912, "label": "4.9s \/ 31 MB"}]},
|
| 256 |
+
{"label": "summaryLibrary (38)", "cached": false, "index": 1, "times": [{"starting_time": 1752473952228, "ending_time": 1752473957058}, {"starting_time": 1752473957058, "ending_time": 1752473959010, "label": "4.8s \/ 54 MB"}]},
|
| 257 |
+
{"label": "summaryLibrary (39)", "cached": false, "index": 1, "times": [{"starting_time": 1752473952251, "ending_time": 1752473957061}, {"starting_time": 1752473957061, "ending_time": 1752473960434, "label": "9.8s \/ 17 MB"}, {"starting_time": 1752473960434, "ending_time": 1752473962035}]},
|
| 258 |
+
{"label": "summaryLibrary (40)", "cached": false, "index": 1, "times": [{"starting_time": 1752473952274, "ending_time": 1752473957063}, {"starting_time": 1752473957063, "ending_time": 1752473960034, "label": "9.8s \/ 19 MB"}, {"starting_time": 1752473960034, "ending_time": 1752473962037}]},
|
| 259 |
+
{"label": "summaryLibrary (41)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957059, "ending_time": 1752473962038}, {"starting_time": 1752473962038, "ending_time": 1752473964964, "label": "10s \/ 50 MB"}, {"starting_time": 1752473964964, "ending_time": 1752473967037}]},
|
| 260 |
+
{"label": "summaryLibrary (42)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957082, "ending_time": 1752473962044}, {"starting_time": 1752473962044, "ending_time": 1752473964788, "label": "10s \/ 109.3 MB"}, {"starting_time": 1752473964788, "ending_time": 1752473967039}]},
|
| 261 |
+
{"label": "summaryLibrary (43)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957106, "ending_time": 1752473962049}, {"starting_time": 1752473962049, "ending_time": 1752473964560, "label": "9.9s \/ 12 MB"}, {"starting_time": 1752473964560, "ending_time": 1752473967046}]},
|
| 262 |
+
{"label": "summaryLibrary (44)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957134, "ending_time": 1752473962051}, {"starting_time": 1752473962051, "ending_time": 1752473964881, "label": "9.9s \/ 152.1 MB"}, {"starting_time": 1752473964881, "ending_time": 1752473967048}]},
|
| 263 |
+
{"label": "summaryLibrary (45)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957158, "ending_time": 1752473962052}, {"starting_time": 1752473962052, "ending_time": 1752473965225, "label": "9.9s \/ 163.5 MB"}, {"starting_time": 1752473965225, "ending_time": 1752473967049}]},
|
| 264 |
+
{"label": "summaryLibrary (47)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957183, "ending_time": 1752473962054}, {"starting_time": 1752473962054, "ending_time": 1752473964561, "label": "9.9s \/ 11 MB"}, {"starting_time": 1752473964561, "ending_time": 1752473967051}]},
|
| 265 |
+
{"label": "summaryLibrary (48)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957217, "ending_time": 1752473962056}, {"starting_time": 1752473962056, "ending_time": 1752473964625, "label": "9.8s \/ 10 MB"}, {"starting_time": 1752473964625, "ending_time": 1752473967052}]},
|
| 266 |
+
{"label": "summaryLibrary (46)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957245, "ending_time": 1752473962057}, {"starting_time": 1752473962057, "ending_time": 1752473964678, "label": "9.8s \/ 54 MB"}, {"starting_time": 1752473964678, "ending_time": 1752473967054}]},
|
| 267 |
+
{"label": "summaryLibrary (51)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957272, "ending_time": 1752473962058}, {"starting_time": 1752473962058, "ending_time": 1752473964765, "label": "9.8s \/ 11 MB"}, {"starting_time": 1752473964765, "ending_time": 1752473967056}]},
|
| 268 |
+
{"label": "summaryLibrary (50)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957296, "ending_time": 1752473962060}, {"starting_time": 1752473962060, "ending_time": 1752473964865, "label": "4.8s \/ 39 MB"}]},
|
| 269 |
+
{"label": "summaryLibrary (49)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957322, "ending_time": 1752473962063}, {"starting_time": 1752473962063, "ending_time": 1752473964765, "label": "9.7s \/ 33 MB"}, {"starting_time": 1752473964765, "ending_time": 1752473967058}]},
|
| 270 |
+
{"label": "summaryLibrary (52)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957347, "ending_time": 1752473962065}, {"starting_time": 1752473962065, "ending_time": 1752473964940, "label": "9.7s \/ 40 MB"}, {"starting_time": 1752473964940, "ending_time": 1752473967062}]},
|
| 271 |
+
{"label": "summaryLibrary (55)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957374, "ending_time": 1752473962067}, {"starting_time": 1752473962067, "ending_time": 1752473964978, "label": "9.7s \/ 37 MB"}, {"starting_time": 1752473964978, "ending_time": 1752473967066}]},
|
| 272 |
+
{"label": "summaryLibrary (56)", "cached": false, "index": 1, "times": [{"starting_time": 1752473957399, "ending_time": 1752473962069}, {"starting_time": 1752473962069, "ending_time": 1752473964927, "label": "9.7s \/ 45 MB"}, {"starting_time": 1752473964927, "ending_time": 1752473967069}]},
|
| 273 |
+
{"label": "summaryLibrary (54)", "cached": false, "index": 1, "times": [{"starting_time": 1752473962068, "ending_time": 1752473967071}, {"starting_time": 1752473967071, "ending_time": 1752473968408, "label": "5s \/ 10 MB"}]},
|
| 274 |
+
{"label": "summaryLibrary (69)", "cached": false, "index": 1, "times": [{"starting_time": 1752473962117, "ending_time": 1752473967074}, {"starting_time": 1752473967074, "ending_time": 1752473968513, "label": "5s \/ 81.1 MB"}]},
|
| 275 |
+
{"label": "summaryLibrary (53)", "cached": false, "index": 1, "times": [{"starting_time": 1752473962177, "ending_time": 1752473967081}, {"starting_time": 1752473967081, "ending_time": 1752473968178, "label": "4.9s \/ 11 MB"}]},
|
| 276 |
+
{"label": "summaryLibrary (57)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967224, "ending_time": 1752473972034}, {"starting_time": 1752473972034, "ending_time": 1752473975272, "label": "9.8s \/ 48 MB"}, {"starting_time": 1752473975272, "ending_time": 1752473977040}]},
|
| 277 |
+
{"label": "summaryLibrary (58)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967307, "ending_time": 1752473972039}, {"starting_time": 1752473972039, "ending_time": 1752473975489, "label": "9.7s \/ 57.7 MB"}, {"starting_time": 1752473975489, "ending_time": 1752473977043}]},
|
| 278 |
+
{"label": "summaryLibrary (59)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967490, "ending_time": 1752473972042}, {"starting_time": 1752473972042, "ending_time": 1752473983849, "label": "19.5s \/ 3 GB"}, {"starting_time": 1752473983849, "ending_time": 1752473987038}]},
|
| 279 |
+
{"label": "summaryLibrary (62)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967514, "ending_time": 1752473972045}, {"starting_time": 1752473972045, "ending_time": 1752473975477, "label": "9.5s \/ 56.6 MB"}, {"starting_time": 1752473975477, "ending_time": 1752473977045}]},
|
| 280 |
+
{"label": "summaryLibrary (63)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967539, "ending_time": 1752473972049}, {"starting_time": 1752473972049, "ending_time": 1752473975978, "label": "9.5s \/ 29 MB"}, {"starting_time": 1752473975978, "ending_time": 1752473977051}]},
|
| 281 |
+
{"label": "summaryLibrary (61)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967561, "ending_time": 1752473972052}, {"starting_time": 1752473972052, "ending_time": 1752473982368, "label": "14.6s \/ 1.5 GB"}]},
|
| 282 |
+
{"label": "summaryLibrary (60)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967604, "ending_time": 1752473972141}, {"starting_time": 1752473972141, "ending_time": 1752473976670, "label": "9.5s \/ 81.9 MB"}, {"starting_time": 1752473976670, "ending_time": 1752473977054}]},
|
| 283 |
+
{"label": "summaryLibrary (64)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967626, "ending_time": 1752473972149}, {"starting_time": 1752473972149, "ending_time": 1752473976409, "label": "9.4s \/ 30 MB"}, {"starting_time": 1752473976409, "ending_time": 1752473977056}]},
|
| 284 |
+
{"label": "summaryLibrary (65)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967652, "ending_time": 1752473972157}, {"starting_time": 1752473972157, "ending_time": 1752473975333, "label": "9.4s \/ 51 MB"}, {"starting_time": 1752473975333, "ending_time": 1752473977057}]},
|
| 285 |
+
{"label": "summaryLibrary (66)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967673, "ending_time": 1752473972159}, {"starting_time": 1752473972159, "ending_time": 1752473982605, "label": "14.4s \/ 921.8 MB"}]},
|
| 286 |
+
{"label": "summaryLibrary (67)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967691, "ending_time": 1752473972161}, {"starting_time": 1752473972161, "ending_time": 1752473974856, "label": "9.4s \/ 82 MB"}, {"starting_time": 1752473974856, "ending_time": 1752473977060}]},
|
| 287 |
+
{"label": "summaryLibrary (68)", "cached": false, "index": 1, "times": [{"starting_time": 1752473967709, "ending_time": 1752473972163}, {"starting_time": 1752473972163, "ending_time": 1752473974665, "label": "9.4s \/ 15 MB"}, {"starting_time": 1752473974665, "ending_time": 1752473977063}]},
|
| 288 |
+
{"label": "networkingGNPSPrepParams (1)", "cached": false, "index": 7, "times": [{"starting_time": 1752473967735, "ending_time": 1752473972166}, {"starting_time": 1752473972166, "ending_time": 1752473973385, "label": "4.4s \/ 2 MB"}]},
|
| 289 |
+
{"label": "librarySearchData (2)", "cached": false, "index": 8, "times": [{"starting_time": 1752473967935, "ending_time": 1752473972170}, {"starting_time": 1752473972170, "ending_time": 1752474179337, "label": "3m 29s \/ 79 MB"}]},
|
| 290 |
+
{"label": "librarySearchData (16)", "cached": false, "index": 8, "times": [{"starting_time": 1752473967956, "ending_time": 1752473972172}, {"starting_time": 1752473972172, "ending_time": 1752474051282, "label": "1m 24s \/ 76.1 MB"}, {"starting_time": 1752474051282, "ending_time": 1752474052044}]},
|
| 291 |
+
{"label": "librarySearchData (15)", "cached": false, "index": 8, "times": [{"starting_time": 1752473967973, "ending_time": 1752473972174}, {"starting_time": 1752473972174, "ending_time": 1752474166268, "label": "3m 19s \/ 77 MB"}, {"starting_time": 1752474166268, "ending_time": 1752474167059}]},
|
| 292 |
+
{"label": "librarySearchData (9)", "cached": false, "index": 8, "times": [{"starting_time": 1752473967999, "ending_time": 1752473972181}, {"starting_time": 1752473972181, "ending_time": 1752474079114, "label": "1m 49s \/ 78.6 MB"}]},
|
| 293 |
+
{"label": "librarySearchData (12)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968025, "ending_time": 1752473972209}, {"starting_time": 1752473972209, "ending_time": 1752474083036, "label": "1m 54s \/ 103.8 MB"}]},
|
| 294 |
+
{"label": "librarySearchData (3)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968053, "ending_time": 1752473972216}, {"starting_time": 1752473972216, "ending_time": 1752474040272, "label": "1m 14s \/ 78 MB"}, {"starting_time": 1752474040272, "ending_time": 1752474042045}]},
|
| 295 |
+
{"label": "librarySearchData (6)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968076, "ending_time": 1752473972225}, {"starting_time": 1752473972225, "ending_time": 1752474053615, "label": "1m 24s \/ 74 MB"}]},
|
| 296 |
+
{"label": "librarySearchData (5)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968096, "ending_time": 1752473972226}, {"starting_time": 1752473972226, "ending_time": 1752475868894, "label": "31m 39s \/ 316 MB"}]},
|
| 297 |
+
{"label": "librarySearchData (4)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968114, "ending_time": 1752473972228}, {"starting_time": 1752473972228, "ending_time": 1752473986185, "label": "18.9s \/ 75 MB"}, {"starting_time": 1752473986185, "ending_time": 1752473987043}]},
|
| 298 |
+
{"label": "librarySearchData (11)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968142, "ending_time": 1752473972230}, {"starting_time": 1752473972230, "ending_time": 1752474002332, "label": "33.9s \/ 76.2 MB"}]},
|
| 299 |
+
{"label": "librarySearchData (1)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968166, "ending_time": 1752473972231}, {"starting_time": 1752473972231, "ending_time": 1752474037402, "label": "1m 14s \/ 87 MB"}, {"starting_time": 1752474037402, "ending_time": 1752474042047}]},
|
| 300 |
+
{"label": "librarySearchData (8)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968189, "ending_time": 1752473972233}, {"starting_time": 1752473972233, "ending_time": 1752477150378, "label": "53m 4s \/ 247 MB"}, {"starting_time": 1752477150378, "ending_time": 1752477152440}]},
|
| 301 |
+
{"label": "librarySearchData (7)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968211, "ending_time": 1752473972236}, {"starting_time": 1752473972236, "ending_time": 1752474011195, "label": "43.8s \/ 80 MB"}, {"starting_time": 1752474011195, "ending_time": 1752474012042}]},
|
| 302 |
+
{"label": "librarySearchData (10)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968247, "ending_time": 1752473972239}, {"starting_time": 1752473972239, "ending_time": 1752474248454, "label": "4m 44s \/ 194 MB"}, {"starting_time": 1752474248454, "ending_time": 1752474252073}]},
|
| 303 |
+
{"label": "librarySearchData (13)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968272, "ending_time": 1752473972241}, {"starting_time": 1752473972241, "ending_time": 1752474032959, "label": "1m 9s \/ 83.9 MB"}, {"starting_time": 1752474032959, "ending_time": 1752474037045}]},
|
| 304 |
+
{"label": "librarySearchData (14)", "cached": false, "index": 8, "times": [{"starting_time": 1752473968296, "ending_time": 1752473972242}, {"starting_time": 1752473972242, "ending_time": 1752473986990, "label": "23.7s \/ 82 MB"}, {"starting_time": 1752473986990, "ending_time": 1752473992039}]},
|
| 305 |
+
{"label": "calculatePairs (7)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973386, "ending_time": 1752473977066}, {"starting_time": 1752473977066, "ending_time": 1752474037104, "label": "1m 4s \/ 33 MB"}]},
|
| 306 |
+
{"label": "calculatePairs (8)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973409, "ending_time": 1752473977068}, {"starting_time": 1752473977068, "ending_time": 1752474032395, "label": "58.6s \/ 32 MB"}]},
|
| 307 |
+
{"label": "calculatePairs (9)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973431, "ending_time": 1752473977070}, {"starting_time": 1752473977070, "ending_time": 1752474024450, "label": "53.6s \/ 32 MB"}, {"starting_time": 1752474024450, "ending_time": 1752474027044}]},
|
| 308 |
+
{"label": "calculatePairs (2)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973456, "ending_time": 1752473977071}, {"starting_time": 1752473977071, "ending_time": 1752474042266, "label": "1m 9s \/ 33 MB"}]},
|
| 309 |
+
{"label": "calculatePairs (5)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973489, "ending_time": 1752473977073}, {"starting_time": 1752473977073, "ending_time": 1752473987526, "label": "13.6s \/ 33 MB"}]},
|
| 310 |
+
{"label": "calculatePairs (4)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973562, "ending_time": 1752473977074}, {"starting_time": 1752473977074, "ending_time": 1752473992930, "label": "18.5s \/ 32 MB"}]},
|
| 311 |
+
{"label": "calculatePairs (6)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973600, "ending_time": 1752473977076}, {"starting_time": 1752473977076, "ending_time": 1752473980966, "label": "8.5s \/ 34 MB"}, {"starting_time": 1752473980966, "ending_time": 1752473982123}]},
|
| 312 |
+
{"label": "calculatePairs (1)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973621, "ending_time": 1752473977082}, {"starting_time": 1752473977082, "ending_time": 1752474044426, "label": "1m 13s \/ 33 MB"}, {"starting_time": 1752474044426, "ending_time": 1752474047045}]},
|
| 313 |
+
{"label": "calculatePairs (3)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973644, "ending_time": 1752473977084}, {"starting_time": 1752473977084, "ending_time": 1752473996696, "label": "23.4s \/ 32 MB"}, {"starting_time": 1752473996696, "ending_time": 1752473997040}]},
|
| 314 |
+
{"label": "calculatePairs (12)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973748, "ending_time": 1752473977085}, {"starting_time": 1752473977085, "ending_time": 1752474009955, "label": "38.3s \/ 32 MB"}, {"starting_time": 1752474009955, "ending_time": 1752474012044}]},
|
| 315 |
+
{"label": "calculatePairs (10)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973786, "ending_time": 1752473977087}, {"starting_time": 1752473977087, "ending_time": 1752474018188, "label": "48.3s \/ 34 MB"}, {"starting_time": 1752474018188, "ending_time": 1752474022045}]},
|
| 316 |
+
{"label": "calculatePairs (13)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973903, "ending_time": 1752473977088}, {"starting_time": 1752473977088, "ending_time": 1752474005795, "label": "33.2s \/ 33 MB"}, {"starting_time": 1752474005795, "ending_time": 1752474007071}]},
|
| 317 |
+
{"label": "calculatePairs (14)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973948, "ending_time": 1752473977090}, {"starting_time": 1752473977090, "ending_time": 1752474001496, "label": "28.1s \/ 33 MB"}, {"starting_time": 1752474001496, "ending_time": 1752474002047}]},
|
| 318 |
+
{"label": "calculatePairs (11)", "cached": false, "index": 9, "times": [{"starting_time": 1752473973980, "ending_time": 1752473977091}, {"starting_time": 1752473977091, "ending_time": 1752474015110, "label": "43.1s \/ 33 MB"}, {"starting_time": 1752474015110, "ending_time": 1752474017044}]},
|
| 319 |
+
{"label": "librarySearchData (17)", "cached": false, "index": 8, "times": [{"starting_time": 1752473987079, "ending_time": 1752473992043}, {"starting_time": 1752473992043, "ending_time": 1752474130502, "label": "2m 25s \/ 81 MB"}, {"starting_time": 1752474130502, "ending_time": 1752474132054}]},
|
| 320 |
+
{"label": "librarySearchData (18)", "cached": false, "index": 8, "times": [{"starting_time": 1752473992063, "ending_time": 1752473997041}, {"starting_time": 1752473997041, "ending_time": 1752474151523, "label": "2m 40s \/ 96.7 MB"}, {"starting_time": 1752474151523, "ending_time": 1752474152058}]},
|
| 321 |
+
{"label": "librarySearchData (20)", "cached": false, "index": 8, "times": [{"starting_time": 1752474002075, "ending_time": 1752474007072}, {"starting_time": 1752474007072, "ending_time": 1752474072325, "label": "1m 10s \/ 91 MB"}]},
|
| 322 |
+
{"label": "librarySearchData (19)", "cached": false, "index": 8, "times": [{"starting_time": 1752474012076, "ending_time": 1752474017046}, {"starting_time": 1752474017046, "ending_time": 1752475915690, "label": "31m 45s \/ 142 MB"}, {"starting_time": 1752475915690, "ending_time": 1752475917275}]},
|
| 323 |
+
{"label": "librarySearchData (23)", "cached": false, "index": 8, "times": [{"starting_time": 1752474037064, "ending_time": 1752474042049}, {"starting_time": 1752474042049, "ending_time": 1752475170482, "label": "18m 55s \/ 166 MB"}, {"starting_time": 1752475170482, "ending_time": 1752475172176}]},
|
| 324 |
+
{"label": "librarySearchData (21)", "cached": false, "index": 8, "times": [{"starting_time": 1752474042157, "ending_time": 1752474047048}, {"starting_time": 1752474047048, "ending_time": 1752474843351, "label": "13m 20s \/ 196 MB"}]},
|
| 325 |
+
{"label": "librarySearchData (22)", "cached": false, "index": 8, "times": [{"starting_time": 1752474042258, "ending_time": 1752474047050}, {"starting_time": 1752474047050, "ending_time": 1752474131916, "label": "1m 30s \/ 124.6 MB"}, {"starting_time": 1752474131916, "ending_time": 1752474132056}]},
|
| 326 |
+
{"label": "filterNetwork (1)", "cached": false, "index": 10, "times": [{"starting_time": 1752474048071, "ending_time": 1752474052047}, {"starting_time": 1752474052047, "ending_time": 1752474060229, "label": "14s \/ 330.8 MB"}, {"starting_time": 1752474060229, "ending_time": 1752474062051}]},
|
| 327 |
+
{"label": "librarySearchData (25)", "cached": false, "index": 8, "times": [{"starting_time": 1752474052069, "ending_time": 1752474057045}, {"starting_time": 1752474057045, "ending_time": 1752474109950, "label": "55s \/ 84.2 MB"}]},
|
| 328 |
+
{"label": "librarySearchData (26)", "cached": false, "index": 8, "times": [{"starting_time": 1752474052119, "ending_time": 1752474057048}, {"starting_time": 1752474057048, "ending_time": 1752474069428, "label": "14.9s \/ 91 MB"}]},
|
| 329 |
+
{"label": "librarySearchData (27)", "cached": false, "index": 8, "times": [{"starting_time": 1752474067089, "ending_time": 1752474072048}, {"starting_time": 1752474072048, "ending_time": 1752474104416, "label": "35s \/ 83 MB"}]},
|
| 330 |
+
{"label": "librarySearchData (28)", "cached": false, "index": 8, "times": [{"starting_time": 1752474072074, "ending_time": 1752474077049}, {"starting_time": 1752474077049, "ending_time": 1752474839345, "label": "12m 45s \/ 152 MB"}]},
|
| 331 |
+
{"label": "librarySearchData (24)", "cached": false, "index": 8, "times": [{"starting_time": 1752474077069, "ending_time": 1752474082051}, {"starting_time": 1752474082051, "ending_time": 1752474099854, "label": "25s \/ 83 MB"}, {"starting_time": 1752474099854, "ending_time": 1752474102054}]},
|
| 332 |
+
{"label": "librarySearchData (29)", "cached": false, "index": 8, "times": [{"starting_time": 1752474082069, "ending_time": 1752474087049}, {"starting_time": 1752474087049, "ending_time": 1752476901137, "label": "47m \/ 159.7 MB"}, {"starting_time": 1752476901137, "ending_time": 1752476902343}]},
|
| 333 |
+
{"label": "librarySearchData (31)", "cached": false, "index": 8, "times": [{"starting_time": 1752474102078, "ending_time": 1752474107055}, {"starting_time": 1752474107055, "ending_time": 1752474142222, "label": "40s \/ 93 MB"}]},
|
| 334 |
+
{"label": "librarySearchData (34)", "cached": false, "index": 8, "times": [{"starting_time": 1752474102104, "ending_time": 1752474107058}, {"starting_time": 1752474107058, "ending_time": 1752474851906, "label": "12m 30s \/ 105.6 MB"}, {"starting_time": 1752474851906, "ending_time": 1752474852140}]},
|
| 335 |
+
{"label": "librarySearchData (35)", "cached": false, "index": 8, "times": [{"starting_time": 1752474107077, "ending_time": 1752474112052}, {"starting_time": 1752474112052, "ending_time": 1752489900806, "label": "4h 23m 16s \/ 508 MB"}, {"starting_time": 1752489900806, "ending_time": 1752489903113}]},
|
| 336 |
+
{"label": "librarySearchData (32)", "cached": false, "index": 8, "times": [{"starting_time": 1752474132078, "ending_time": 1752474137055}, {"starting_time": 1752474137055, "ending_time": 1752474237955, "label": "1m 45s \/ 94 MB"}]},
|
| 337 |
+
{"label": "librarySearchData (33)", "cached": false, "index": 8, "times": [{"starting_time": 1752474132104, "ending_time": 1752474137058}, {"starting_time": 1752474137058, "ending_time": 1752474187300, "label": "55s \/ 92 MB"}]},
|
| 338 |
+
{"label": "librarySearchData (36)", "cached": false, "index": 8, "times": [{"starting_time": 1752474142085, "ending_time": 1752474147057}, {"starting_time": 1752474147057, "ending_time": 1752476697610, "label": "42m 35s \/ 153.8 MB"}]},
|
| 339 |
+
{"label": "librarySearchData (30)", "cached": false, "index": 8, "times": [{"starting_time": 1752474152094, "ending_time": 1752474157060}, {"starting_time": 1752474157060, "ending_time": 1752474424390, "label": "4m 35s \/ 142 MB"}, {"starting_time": 1752474424390, "ending_time": 1752474427111}]},
|
| 340 |
+
{"label": "librarySearchData (37)", "cached": false, "index": 8, "times": [{"starting_time": 1752474167096, "ending_time": 1752474172060}, {"starting_time": 1752474172060, "ending_time": 1752474188680, "label": "25s \/ 86 MB"}, {"starting_time": 1752474188680, "ending_time": 1752474192067}]},
|
| 341 |
+
{"label": "librarySearchData (50)", "cached": false, "index": 8, "times": [{"starting_time": 1752474177088, "ending_time": 1752474182062}, {"starting_time": 1752474182062, "ending_time": 1752474214591, "label": "40s \/ 89.8 MB"}, {"starting_time": 1752474214591, "ending_time": 1752474217066}]},
|
| 342 |
+
{"label": "librarySearchData (40)", "cached": false, "index": 8, "times": [{"starting_time": 1752474187126, "ending_time": 1752474192069}, {"starting_time": 1752474192069, "ending_time": 1752474256723, "label": "1m 10s \/ 86 MB"}, {"starting_time": 1752474256723, "ending_time": 1752474257076}]},
|
| 343 |
+
{"label": "librarySearchData (38)", "cached": false, "index": 8, "times": [{"starting_time": 1752474192092, "ending_time": 1752474197065}, {"starting_time": 1752474197065, "ending_time": 1752474489944, "label": "5m \/ 98.1 MB"}, {"starting_time": 1752474489944, "ending_time": 1752474492102}]},
|
| 344 |
+
{"label": "librarySearchData (44)", "cached": false, "index": 8, "times": [{"starting_time": 1752474217099, "ending_time": 1752474222110}, {"starting_time": 1752474222110, "ending_time": 1752474920347, "label": "11m 45s \/ 122.7 MB"}, {"starting_time": 1752474920347, "ending_time": 1752474922147}]},
|
| 345 |
+
{"label": "librarySearchData (41)", "cached": false, "index": 8, "times": [{"starting_time": 1752474237095, "ending_time": 1752474242071}, {"starting_time": 1752474242071, "ending_time": 1752474267409, "label": "30s \/ 90 MB"}]},
|
| 346 |
+
{"label": "librarySearchData (42)", "cached": false, "index": 8, "times": [{"starting_time": 1752474252100, "ending_time": 1752474257079}, {"starting_time": 1752474257079, "ending_time": 1752474968576, "label": "11m 55s \/ 101.8 MB"}]},
|
| 347 |
+
{"label": "librarySearchData (39)", "cached": false, "index": 8, "times": [{"starting_time": 1752474257105, "ending_time": 1752474262076}, {"starting_time": 1752474262076, "ending_time": 1752474353376, "label": "1m 35s \/ 86.9 MB"}]},
|
| 348 |
+
{"label": "librarySearchData (45)", "cached": false, "index": 8, "times": [{"starting_time": 1752474267102, "ending_time": 1752474272077}, {"starting_time": 1752474272077, "ending_time": 1752481651023, "label": "2h 3m 6s \/ 275 MB"}, {"starting_time": 1752481651023, "ending_time": 1752481652638}]},
|
| 349 |
+
{"label": "librarySearchData (46)", "cached": false, "index": 8, "times": [{"starting_time": 1752474352109, "ending_time": 1752474357087}, {"starting_time": 1752474357087, "ending_time": 1752474428783, "label": "1m 15s \/ 84.7 MB"}]},
|
| 350 |
+
{"label": "librarySearchData (43)", "cached": false, "index": 8, "times": [{"starting_time": 1752474427139, "ending_time": 1752474432094}, {"starting_time": 1752474432094, "ending_time": 1752474468465, "label": "40s \/ 84 MB"}]},
|
| 351 |
+
{"label": "librarySearchData (47)", "cached": false, "index": 8, "times": [{"starting_time": 1752474427162, "ending_time": 1752474432097}, {"starting_time": 1752474432097, "ending_time": 1752474446708, "label": "19.9s \/ 84 MB"}, {"starting_time": 1752474446708, "ending_time": 1752474447096}]},
|
| 352 |
+
{"label": "librarySearchData (48)", "cached": false, "index": 8, "times": [{"starting_time": 1752474447119, "ending_time": 1752474452096}, {"starting_time": 1752474452096, "ending_time": 1752474551112, "label": "1m 45s \/ 87.8 MB"}, {"starting_time": 1752474551112, "ending_time": 1752474552111}]},
|
| 353 |
+
{"label": "librarySearchData (49)", "cached": false, "index": 8, "times": [{"starting_time": 1752474467120, "ending_time": 1752474472100}, {"starting_time": 1752474472100, "ending_time": 1752474479503, "label": "10s \/ 85 MB"}]},
|
| 354 |
+
{"label": "librarySearchData (51)", "cached": false, "index": 8, "times": [{"starting_time": 1752474477124, "ending_time": 1752474482101}, {"starting_time": 1752474482101, "ending_time": 1752474784002, "label": "5m 5s \/ 86.8 MB"}]},
|
| 355 |
+
{"label": "librarySearchData (53)", "cached": false, "index": 8, "times": [{"starting_time": 1752474492124, "ending_time": 1752474497103}, {"starting_time": 1752474497103, "ending_time": 1752475084853, "label": "9m 50s \/ 103.3 MB"}]},
|
| 356 |
+
{"label": "librarySearchData (52)", "cached": false, "index": 8, "times": [{"starting_time": 1752474552136, "ending_time": 1752474557115}, {"starting_time": 1752474557115, "ending_time": 1752474588230, "label": "35s \/ 87 MB"}]},
|
| 357 |
+
{"label": "librarySearchData (55)", "cached": false, "index": 8, "times": [{"starting_time": 1752474587140, "ending_time": 1752474592118}, {"starting_time": 1752474592118, "ending_time": 1752474613366, "label": "25s \/ 91.4 MB"}]},
|
| 358 |
+
{"label": "librarySearchData (56)", "cached": false, "index": 8, "times": [{"starting_time": 1752474612147, "ending_time": 1752474617121}, {"starting_time": 1752474617121, "ending_time": 1752474623636, "label": "10s \/ 88 MB"}]},
|
| 359 |
+
{"label": "librarySearchData (54)", "cached": false, "index": 8, "times": [{"starting_time": 1752474622147, "ending_time": 1752474627121}, {"starting_time": 1752474627121, "ending_time": 1752474680402, "label": "60s \/ 91 MB"}, {"starting_time": 1752474680402, "ending_time": 1752474682128}]},
|
| 360 |
+
{"label": "librarySearchData (58)", "cached": false, "index": 8, "times": [{"starting_time": 1752474682151, "ending_time": 1752474687128}, {"starting_time": 1752474687128, "ending_time": 1752474749289, "label": "1m 5s \/ 86.6 MB"}]},
|
| 361 |
+
{"label": "librarySearchData (57)", "cached": false, "index": 8, "times": [{"starting_time": 1752474747153, "ending_time": 1752474752132}, {"starting_time": 1752474752132, "ending_time": 1752474759092, "label": "10s \/ 92 MB"}]},
|
| 362 |
+
{"label": "librarySearchData (59)", "cached": false, "index": 8, "times": [{"starting_time": 1752474757161, "ending_time": 1752474762133}, {"starting_time": 1752474762133, "ending_time": 1752482670514, "label": "2h 11m 56s \/ 1.1 GB"}, {"starting_time": 1752482670514, "ending_time": 1752482672694}]},
|
| 363 |
+
{"label": "librarySearchData (60)", "cached": false, "index": 8, "times": [{"starting_time": 1752474782175, "ending_time": 1752474787155}, {"starting_time": 1752474787155, "ending_time": 1752475119828, "label": "5m 40s \/ 103.1 MB"}, {"starting_time": 1752475119828, "ending_time": 1752475122221}]},
|
| 364 |
+
{"label": "librarySearchData (68)", "cached": false, "index": 8, "times": [{"starting_time": 1752474837191, "ending_time": 1752474842142}, {"starting_time": 1752474842142, "ending_time": 1752474890336, "label": "55s \/ 90 MB"}, {"starting_time": 1752474890336, "ending_time": 1752474892146}]},
|
| 365 |
+
{"label": "librarySearchData (65)", "cached": false, "index": 8, "times": [{"starting_time": 1752474842174, "ending_time": 1752474847156}, {"starting_time": 1752474847156, "ending_time": 1752474908409, "label": "1m 5s \/ 81 MB"}]},
|
| 366 |
+
{"label": "librarySearchData (67)", "cached": false, "index": 8, "times": [{"starting_time": 1752474852165, "ending_time": 1752474857141}, {"starting_time": 1752474857141, "ending_time": 1752475550746, "label": "11m 40s \/ 98.7 MB"}, {"starting_time": 1752475550746, "ending_time": 1752475552251}]},
|
| 367 |
+
{"label": "librarySearchData (66)", "cached": false, "index": 8, "times": [{"starting_time": 1752474892168, "ending_time": 1752474897144}, {"starting_time": 1752474897144, "ending_time": 1752496294268, "label": "5h 56m 41s \/ 679 MB"}]},
|
| 368 |
+
{"label": "librarySearchData (64)", "cached": false, "index": 8, "times": [{"starting_time": 1752474907195, "ending_time": 1752474912146}, {"starting_time": 1752474912146, "ending_time": 1752475193609, "label": "4m 45s \/ 97.4 MB"}]},
|
| 369 |
+
{"label": "librarySearchData (61)", "cached": false, "index": 8, "times": [{"starting_time": 1752474922169, "ending_time": 1752474927147}, {"starting_time": 1752474927147, "ending_time": 1752496151902, "label": "5h 53m 46s \/ 844 MB"}]},
|
| 370 |
+
{"label": "librarySearchData (63)", "cached": false, "index": 8, "times": [{"starting_time": 1752474967197, "ending_time": 1752474972154}, {"starting_time": 1752474972154, "ending_time": 1752474984136, "label": "15s \/ 88 MB"}]},
|
| 371 |
+
{"label": "librarySearchData (69)", "cached": false, "index": 8, "times": [{"starting_time": 1752474982178, "ending_time": 1752474987155}, {"starting_time": 1752474987155, "ending_time": 1752475221746, "label": "4m \/ 101.9 MB"}, {"starting_time": 1752475221746, "ending_time": 1752475222182}]},
|
| 372 |
+
{"label": "librarySearchData (62)", "cached": false, "index": 8, "times": [{"starting_time": 1752475082192, "ending_time": 1752475087183}, {"starting_time": 1752475087183, "ending_time": 1752475112381, "label": "30s \/ 86 MB"}]},
|
| 373 |
+
{"label": "librarymergeResults", "cached": false, "index": 11, "times": [{"starting_time": 1752496293640, "ending_time": 1752496298487}, {"starting_time": 1752496298487, "ending_time": 1752496299714, "label": "4.9s \/ 11 MB"}]},
|
| 374 |
+
{"label": "librarygetGNPSAnnotations (1)", "cached": false, "index": 12, "times": [{"starting_time": 1752496298527, "ending_time": 1752496303487}, {"starting_time": 1752496303487, "ending_time": 1752496777459, "label": "8m \/ 88.5 MB"}, {"starting_time": 1752496777459, "ending_time": 1752496778527}]},
|
| 375 |
+
{"label": "enrichClusterSummary (1)", "cached": false, "index": 13, "times": [{"starting_time": 1752496778572, "ending_time": 1752496783526}, {"starting_time": 1752496783526, "ending_time": 1752496785960, "label": "5s \/ 130.2 MB"}]},
|
| 376 |
+
{"label": "createNetworkGraphML (1)", "cached": false, "index": 14, "times": [{"starting_time": 1752496783587, "ending_time": 1752496788526}, {"starting_time": 1752496788526, "ending_time": 1752496827284, "label": "44.9s \/ 907.3 MB"}, {"starting_time": 1752496827284, "ending_time": 1752496828529}]}
|
| 377 |
]
|
| 378 |
}
|
| 379 |
;
|
lcms/fbmn/gnps2/nextflow_stdout.log
CHANGED
|
The diff for this file is too large to render.
See raw diff
|
|
|
lcms/fbmn/gnps2/nf_cmd.sh
CHANGED
|
@@ -1 +1 @@
|
|
| 1 |
-
nextflow run /app/workflows_user/feature_based_molecular_networking_workflow/nf_workflow.nf -params-file /data/nf_data/server/nf_tasks/
|
|
|
|
| 1 |
+
nextflow run /app/workflows_user/feature_based_molecular_networking_workflow/nf_workflow.nf -params-file /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/job_parameters.yaml -w /data/nf_data/server/nf_work/16b6a354fd68486e9638497b8e105437 -with-report /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/job_report.html -with-timeline /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/job_timeline.html -with-dag /data/nf_data/server/nf_tasks/16b6a354fd68486e9638497b8e105437/job_dag.html -with-weblog http://localhost:4000/nf_weblog/16b6a354fd68486e9638497b8e105437 -c /app/launchserver/nextflow.config
|
lcms/fbmn/gnps2/nf_output/3-HYDROXY-ACYL-AMIDES-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/AASDB.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/BERKELEY-LAB.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/BILELIB19.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/BIRMINGHAM-UHPLC-MS-NEG.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/BIRMINGHAM-UHPLC-MS-POS.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/BMDMS-NP.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/CASMI.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/CMMC-FOOD-BIOMARKERS.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/DEREPLICATOR_IDENTIFIED_LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/DMIM-DRUG-METABOLITE-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/DRUGS-OF-ABUSE-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/ECG-ACYL-AMIDES-C4-C24-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/ECG-ACYL-ESTERS-C4-C24-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/ECRFS_DB.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/ELIXDB-LICHEN-DATABASE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-MISC.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-PESTICIDES-NEGATIVE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-COLLECTIONS-PESTICIDES-POSITIVE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-D2-AMINO-LIPID-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-EMBL-MCF.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-FAULKNERLEGACY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-IOBA-NHC.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-MSMLS.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-N-ACYL-LIPIDS-MASSQL.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-CLINICALCOLLECTION1.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-CLINICALCOLLECTION2.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY_ROUND2_NEGATIVE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-NATURALPRODUCTSLIBRARY_ROUND2_POSITIVE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIH-SMALLMOLECULEPHARMACOLOGICALLYACTIVE.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NIST14-MATCHES.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NUTRI-METAB-FEM-NEG.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-NUTRI-METAB-FEM-POS.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-PRESTWICKPHYTOCHEM.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-SAM-SIK-KANG-LEGACY-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
lcms/fbmn/gnps2/nf_output/GNPS-SCIEX-LIBRARY.mgf.tsv
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|