Datasets:
virx
/
molecule

Dataset card Data Studio Files
xet
Community
1
instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_666>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_666>.
**Token:** <BB_666> **SMILES:** Cc1cccc(N2CCC(N)CC2)n1 **Molecular Formula:** C11H17N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_667>.
CC(C)(F)C#N
What is the building block token for the following molecule?
CC(C)(F)C#N
<BB_667>
What is the molecular formula for <BB_667>?
The molecular formula for <BB_667> (CC(C)(F)C#N) is C4H6FN.
Describe the ring structures in building block <BB_667>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_667>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_667>.
**Token:** <BB_667> **SMILES:** CC(C)(F)C#N **Molecular Formula:** C4H6FN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_668>.
C[C@@H](N)c1ccc(O)nc1.Cl.Cl
What is the building block token for the following molecule?
C[C@@H](N)c1ccc(O)nc1.Cl.Cl
<BB_668>
What is the molecular formula for <BB_668>?
The molecular formula for <BB_668> (C[C@@H](N)c1ccc(O)nc1.Cl.Cl) is C7H12Cl2N2O.
Describe the ring structures in building block <BB_668>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_668>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_668>.
**Token:** <BB_668> **SMILES:** C[C@@H](N)c1ccc(O)nc1.Cl.Cl **Molecular Formula:** C7H12Cl2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_669>.
CC(C)(C)OC(=O)N1CC2(CF)CC(C(=O)O)(C1)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(CF)CC(C(=O)O)(C1)C2
<BB_669>
What is the molecular formula for <BB_669>?
The molecular formula for <BB_669> (CC(C)(C)OC(=O)N1CC2(CF)CC(C(=O)O)(C1)C2) is C13H20FNO4.
Describe the ring structures in building block <BB_669>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_669>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_669>.
**Token:** <BB_669> **SMILES:** CC(C)(C)OC(=O)N1CC2(CF)CC(C(=O)O)(C1)C2 **Molecular Formula:** C13H20FNO4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_670>.
CC(C)(C)OC(=O)N1CC[C@H]2[C@H](CO)[C@H]2C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC[C@H]2[C@H](CO)[C@H]2C1
<BB_670>
What is the molecular formula for <BB_670>?
The molecular formula for <BB_670> (CC(C)(C)OC(=O)N1CC[C@H]2[C@H](CO)[C@H]2C1) is C12H21NO3.
Describe the ring structures in building block <BB_670>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_670>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_670>.
**Token:** <BB_670> **SMILES:** CC(C)(C)OC(=O)N1CC[C@H]2[C@H](CO)[C@H]2C1 **Molecular Formula:** C12H21NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_671>.
[2H]c1cccc(O)c1
What is the building block token for the following molecule?
[2H]c1cccc(O)c1
<BB_671>
What is the molecular formula for <BB_671>?
The molecular formula for <BB_671> ([2H]c1cccc(O)c1) is C6H6O.
Describe the ring structures in building block <BB_671>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_671>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_671>.
**Token:** <BB_671> **SMILES:** [2H]c1cccc(O)c1 **Molecular Formula:** C6H6O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_672>.
NNc1ncnc2ccccc12
What is the building block token for the following molecule?
NNc1ncnc2ccccc12
<BB_672>
What is the molecular formula for <BB_672>?
The molecular formula for <BB_672> (NNc1ncnc2ccccc12) is C8H8N4.
Describe the ring structures in building block <BB_672>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_672>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_672>.
**Token:** <BB_672> **SMILES:** NNc1ncnc2ccccc12 **Molecular Formula:** C8H8N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_673>.
F[B-](F)(F)C1CCSCC1.[K+]
What is the building block token for the following molecule?
F[B-](F)(F)C1CCSCC1.[K+]
<BB_673>
What is the molecular formula for <BB_673>?
The molecular formula for <BB_673> (F[B-](F)(F)C1CCSCC1.[K+]) is C5H9BF3KS.
Describe the ring structures in building block <BB_673>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_673>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_673>.
**Token:** <BB_673> **SMILES:** F[B-](F)(F)C1CCSCC1.[K+] **Molecular Formula:** C5H9BF3KS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_674>.
CC1CCCN(S(=O)(=O)c2ccc(CN)cc2)C1
What is the building block token for the following molecule?
CC1CCCN(S(=O)(=O)c2ccc(CN)cc2)C1
<BB_674>
What is the molecular formula for <BB_674>?
The molecular formula for <BB_674> (CC1CCCN(S(=O)(=O)c2ccc(CN)cc2)C1) is C13H20N2O2S.
Describe the ring structures in building block <BB_674>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_674>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_674>.
**Token:** <BB_674> **SMILES:** CC1CCCN(S(=O)(=O)c2ccc(CN)cc2)C1 **Molecular Formula:** C13H20N2O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_675>.
O=[N+]([O-])c1ccc2c(c1)NCCN2
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc2c(c1)NCCN2
<BB_675>
What is the molecular formula for <BB_675>?
The molecular formula for <BB_675> (O=[N+]([O-])c1ccc2c(c1)NCCN2) is C8H9N3O2.
Describe the ring structures in building block <BB_675>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_675>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_675>.
**Token:** <BB_675> **SMILES:** O=[N+]([O-])c1ccc2c(c1)NCCN2 **Molecular Formula:** C8H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_676>.
O=C(O)CC1(c2ccccc2Cl)CC1
What is the building block token for the following molecule?
O=C(O)CC1(c2ccccc2Cl)CC1
<BB_676>
What is the molecular formula for <BB_676>?
The molecular formula for <BB_676> (O=C(O)CC1(c2ccccc2Cl)CC1) is C11H11ClO2.
Describe the ring structures in building block <BB_676>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_676>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_676>.
**Token:** <BB_676> **SMILES:** O=C(O)CC1(c2ccccc2Cl)CC1 **Molecular Formula:** C11H11ClO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_677>.
Cc1nc(N)ccc1C#N
What is the building block token for the following molecule?
Cc1nc(N)ccc1C#N
<BB_677>
What is the molecular formula for <BB_677>?
The molecular formula for <BB_677> (Cc1nc(N)ccc1C#N) is C7H7N3.
Describe the ring structures in building block <BB_677>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_677>.
The molecule contains the following groups: Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_677>.
**Token:** <BB_677> **SMILES:** Cc1nc(N)ccc1C#N **Molecular Formula:** C7H7N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Nitrile
Provide the SMILES representation for the building block token <BB_678>.
Cl.NCc1cccc(F)c1C1CC1
What is the building block token for the following molecule?
Cl.NCc1cccc(F)c1C1CC1
<BB_678>
What is the molecular formula for <BB_678>?
The molecular formula for <BB_678> (Cl.NCc1cccc(F)c1C1CC1) is C10H13ClFN.
Describe the ring structures in building block <BB_678>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_678>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_678>.
**Token:** <BB_678> **SMILES:** Cl.NCc1cccc(F)c1C1CC1 **Molecular Formula:** C10H13ClFN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_679>.
CC1C(N)CC1O
What is the building block token for the following molecule?
CC1C(N)CC1O
<BB_679>
What is the molecular formula for <BB_679>?
The molecular formula for <BB_679> (CC1C(N)CC1O) is C5H11NO.
Describe the ring structures in building block <BB_679>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_679>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_679>.
**Token:** <BB_679> **SMILES:** CC1C(N)CC1O **Molecular Formula:** C5H11NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_680>.
CC1C(=O)NCC1C1CC1
What is the building block token for the following molecule?
CC1C(=O)NCC1C1CC1
<BB_680>
What is the molecular formula for <BB_680>?
The molecular formula for <BB_680> (CC1C(=O)NCC1C1CC1) is C8H13NO.
Describe the ring structures in building block <BB_680>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_680>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_680>.
**Token:** <BB_680> **SMILES:** CC1C(=O)NCC1C1CC1 **Molecular Formula:** C8H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_681>.
C=Cc1ccc(OC)nc1
What is the building block token for the following molecule?
C=Cc1ccc(OC)nc1
<BB_681>
What is the molecular formula for <BB_681>?
The molecular formula for <BB_681> (C=Cc1ccc(OC)nc1) is C8H9NO.
Describe the ring structures in building block <BB_681>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_681>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_681>.
**Token:** <BB_681> **SMILES:** C=Cc1ccc(OC)nc1 **Molecular Formula:** C8H9NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_682>.
COC(=O)c1cc(F)ccc1S
What is the building block token for the following molecule?
COC(=O)c1cc(F)ccc1S
<BB_682>
What is the molecular formula for <BB_682>?
The molecular formula for <BB_682> (COC(=O)c1cc(F)ccc1S) is C8H7FO2S.
Describe the ring structures in building block <BB_682>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_682>.
The molecule contains the following groups: Ester, Ether, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_682>.
**Token:** <BB_682> **SMILES:** COC(=O)c1cc(F)ccc1S **Molecular Formula:** C8H7FO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_683>.
Cc1ccc2ccc(N)c(O)c2n1
What is the building block token for the following molecule?
Cc1ccc2ccc(N)c(O)c2n1
<BB_683>