instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1033>?
The molecular formula for <BB_1033> (CCOC(C)CN.Cl) is C5H14ClNO.
Describe the ring structures in building block <BB_1033>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1033>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1033>.
**Token:** <BB_1033> **SMILES:** CCOC(C)CN.Cl **Molecular Formula:** C5H14ClNO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1034>.
CC(=O)c1cccc2ccccc12
What is the building block token for the following molecule?
CC(=O)c1cccc2ccccc12
<BB_1034>
What is the molecular formula for <BB_1034>?
The molecular formula for <BB_1034> (CC(=O)c1cccc2ccccc12) is C12H10O.
Describe the ring structures in building block <BB_1034>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1034>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1034>.
**Token:** <BB_1034> **SMILES:** CC(=O)c1cccc2ccccc12 **Molecular Formula:** C12H10O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1035>.
O=C(O)C1CCCN1S(=O)(=O)c1ccc(Br)cc1
What is the building block token for the following molecule?
O=C(O)C1CCCN1S(=O)(=O)c1ccc(Br)cc1
<BB_1035>
What is the molecular formula for <BB_1035>?
The molecular formula for <BB_1035> (O=C(O)C1CCCN1S(=O)(=O)c1ccc(Br)cc1) is C11H12BrNO4S.
Describe the ring structures in building block <BB_1035>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1035>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1035>.
**Token:** <BB_1035> **SMILES:** O=C(O)C1CCCN1S(=O)(=O)c1ccc(Br)cc1 **Molecular Formula:** C11H12BrNO4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1036>.
O=C(O)/C=C/c1ccc(F)nc1
What is the building block token for the following molecule?
O=C(O)/C=C/c1ccc(F)nc1
<BB_1036>
What is the molecular formula for <BB_1036>?
The molecular formula for <BB_1036> (O=C(O)/C=C/c1ccc(F)nc1) is C8H6FNO2.
Describe the ring structures in building block <BB_1036>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1036>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1036>.
**Token:** <BB_1036> **SMILES:** O=C(O)/C=C/c1ccc(F)nc1 **Molecular Formula:** C8H6FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1037>.
Cc1ccc2[nH]cc(C=O)c2c1
What is the building block token for the following molecule?
Cc1ccc2[nH]cc(C=O)c2c1
<BB_1037>
What is the molecular formula for <BB_1037>?
The molecular formula for <BB_1037> (Cc1ccc2[nH]cc(C=O)c2c1) is C10H9NO.
Describe the ring structures in building block <BB_1037>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1037>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1037>.
**Token:** <BB_1037> **SMILES:** Cc1ccc2[nH]cc(C=O)c2c1 **Molecular Formula:** C10H9NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1038>.
COC(=O)c1sncc1C=O
What is the building block token for the following molecule?
COC(=O)c1sncc1C=O
<BB_1038>
What is the molecular formula for <BB_1038>?
The molecular formula for <BB_1038> (COC(=O)c1sncc1C=O) is C6H5NO3S.
Describe the ring structures in building block <BB_1038>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1038>.
The molecule contains the following groups: Ester, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_1038>.
**Token:** <BB_1038> **SMILES:** COC(=O)c1sncc1C=O **Molecular Formula:** C6H5NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_1039>.
CCCS(=O)(=O)N1CCCCC1C(=O)O
What is the building block token for the following molecule?
CCCS(=O)(=O)N1CCCCC1C(=O)O
<BB_1039>
What is the molecular formula for <BB_1039>?
The molecular formula for <BB_1039> (CCCS(=O)(=O)N1CCCCC1C(=O)O) is C9H17NO4S.
Describe the ring structures in building block <BB_1039>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1039>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1039>.
**Token:** <BB_1039> **SMILES:** CCCS(=O)(=O)N1CCCCC1C(=O)O **Molecular Formula:** C9H17NO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1040>.
CNCC1(N)CC1.Cl.Cl
What is the building block token for the following molecule?
CNCC1(N)CC1.Cl.Cl
<BB_1040>
What is the molecular formula for <BB_1040>?
The molecular formula for <BB_1040> (CNCC1(N)CC1.Cl.Cl) is C5H14Cl2N2.
Describe the ring structures in building block <BB_1040>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1040>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1040>.
**Token:** <BB_1040> **SMILES:** CNCC1(N)CC1.Cl.Cl **Molecular Formula:** C5H14Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1041>.
Cl.Cl.c1ccc(CN2CCC23CNC3)cc1
What is the building block token for the following molecule?
Cl.Cl.c1ccc(CN2CCC23CNC3)cc1
<BB_1041>
What is the molecular formula for <BB_1041>?
The molecular formula for <BB_1041> (Cl.Cl.c1ccc(CN2CCC23CNC3)cc1) is C12H18Cl2N2.
Describe the ring structures in building block <BB_1041>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1041>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1041>.
**Token:** <BB_1041> **SMILES:** Cl.Cl.c1ccc(CN2CCC23CNC3)cc1 **Molecular Formula:** C12H18Cl2N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1042>.
CC(=O)c1cc(C(C)(C)C)ccc1N
What is the building block token for the following molecule?
CC(=O)c1cc(C(C)(C)C)ccc1N
<BB_1042>
What is the molecular formula for <BB_1042>?
The molecular formula for <BB_1042> (CC(=O)c1cc(C(C)(C)C)ccc1N) is C12H17NO.
Describe the ring structures in building block <BB_1042>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1042>.
The molecule contains the following groups: Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_1042>.
**Token:** <BB_1042> **SMILES:** CC(=O)c1cc(C(C)(C)C)ccc1N **Molecular Formula:** C12H17NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ketone
Provide the SMILES representation for the building block token <BB_1043>.
Cc1ccc(Cn2cnc3cc(C)c(C)cc32)cc1
What is the building block token for the following molecule?
Cc1ccc(Cn2cnc3cc(C)c(C)cc32)cc1
<BB_1043>
What is the molecular formula for <BB_1043>?
The molecular formula for <BB_1043> (Cc1ccc(Cn2cnc3cc(C)c(C)cc32)cc1) is C17H18N2.
Describe the ring structures in building block <BB_1043>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1043>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1043>.
**Token:** <BB_1043> **SMILES:** Cc1ccc(Cn2cnc3cc(C)c(C)cc32)cc1 **Molecular Formula:** C17H18N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1044>.
Cc1ccc(CS(=O)(=O)F)c(C)c1
What is the building block token for the following molecule?
Cc1ccc(CS(=O)(=O)F)c(C)c1
<BB_1044>
What is the molecular formula for <BB_1044>?
The molecular formula for <BB_1044> (Cc1ccc(CS(=O)(=O)F)c(C)c1) is C9H11FO2S.
Describe the ring structures in building block <BB_1044>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1044>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1044>.
**Token:** <BB_1044> **SMILES:** Cc1ccc(CS(=O)(=O)F)c(C)c1 **Molecular Formula:** C9H11FO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1045>.
Cc1ccc(Cl)cc1NC(N)=S
What is the building block token for the following molecule?
Cc1ccc(Cl)cc1NC(N)=S
<BB_1045>
What is the molecular formula for <BB_1045>?
The molecular formula for <BB_1045> (Cc1ccc(Cl)cc1NC(N)=S) is C8H9ClN2S.
Describe the ring structures in building block <BB_1045>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1045>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1045>.
**Token:** <BB_1045> **SMILES:** Cc1ccc(Cl)cc1NC(N)=S **Molecular Formula:** C8H9ClN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1046>.
C=Cc1cc(OC)cc(OC)c1
What is the building block token for the following molecule?
C=Cc1cc(OC)cc(OC)c1
<BB_1046>
What is the molecular formula for <BB_1046>?
The molecular formula for <BB_1046> (C=Cc1cc(OC)cc(OC)c1) is C10H12O2.
Describe the ring structures in building block <BB_1046>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1046>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1046>.
**Token:** <BB_1046> **SMILES:** C=Cc1cc(OC)cc(OC)c1 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1047>.
Cc1ccnc(NC(C)C)c1N
What is the building block token for the following molecule?
Cc1ccnc(NC(C)C)c1N
<BB_1047>
What is the molecular formula for <BB_1047>?
The molecular formula for <BB_1047> (Cc1ccnc(NC(C)C)c1N) is C9H15N3.
Describe the ring structures in building block <BB_1047>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1047>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1047>.
**Token:** <BB_1047> **SMILES:** Cc1ccnc(NC(C)C)c1N **Molecular Formula:** C9H15N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_1048>.
Nc1nnc(NC2CCc3ccccc32)[nH]1
What is the building block token for the following molecule?
Nc1nnc(NC2CCc3ccccc32)[nH]1
<BB_1048>
What is the molecular formula for <BB_1048>?
The molecular formula for <BB_1048> (Nc1nnc(NC2CCc3ccccc32)[nH]1) is C11H13N5.
Describe the ring structures in building block <BB_1048>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1048>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1048>.
**Token:** <BB_1048> **SMILES:** Nc1nnc(NC2CCc3ccccc32)[nH]1 **Molecular Formula:** C11H13N5 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_1049>.
COc1cc(C)ncc1C(=O)[O-].[K+]
What is the building block token for the following molecule?
COc1cc(C)ncc1C(=O)[O-].[K+]
<BB_1049>
What is the molecular formula for <BB_1049>?
The molecular formula for <BB_1049> (COc1cc(C)ncc1C(=O)[O-].[K+]) is C8H8KNO3.
Describe the ring structures in building block <BB_1049>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1049>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1049>.
**Token:** <BB_1049> **SMILES:** COc1cc(C)ncc1C(=O)[O-].[K+] **Molecular Formula:** C8H8KNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether