Update README.md

README.md

@@ -1,3 +1,22 @@
----
-license: mit
----
+## USPTO_Condition
+
+### Overview
+This dataset contains reaction data in tabular format, with the following fields:
+- **source**: Source or reference ID of the reaction.
+- **canonical_rxn**: The canonical SMILES representation of the reaction (reactants >> products).
+- **catalyst1**: The catalyst used in the reaction (if available).
+- **solvent1**, **solvent2**: Solvents used in the reaction (if available).
+- **reagent1**, **reagent2**: Reagents involved in the reaction (if available).
+- **dataset**: Dataset category or tag.
+
+### Example Data
+| source         | canonical_rxn                                                                                   | catalyst1 | solvent1 | solvent2 | reagent1          | reagent2 | dataset |
+|----------------|------------------------------------------------------------------------------------------------|-----------|----------|----------|------------------|----------|---------|
+| US20070112015A1 | CCOC(=O)CN(CC(C)=O)c1c(C)cc(C)cc1C>>Cc1cc(C)c(N2CC(=O)CC(=O)C2)c(C)c1 |           | C1CCOC1 |          | CC(C)(C)[O-].[K+] |          | val     |
+| US20130053359A1 | COC(=O)c1cc(I)c(N)cc1OC.N#C[Zn]C#N>>COC(=O)c1cc(C#N)c(N)cc1OC                                | c1ccc([P]...)cc1 | CCOCC   | CN(C)C=O | CO       | val     |
+
+### Preprocessing
+The data was processed following the method described in [Parrot - USPTO condition script](https://github.com/wangxr0526/Parrot/blob/master/preprocess_script/uspto_script/uspto_condition.md), ensuring consistent SMILES representations and high-quality condition extraction.
+
+### License
+The dataset is provided under the [MIT License](https://opensource.org/licenses/MIT).