hexsha
string | size
int64 | ext
string | lang
string | max_stars_repo_path
string | max_stars_repo_name
string | max_stars_repo_head_hexsha
string | max_stars_repo_licenses
list | max_stars_count
int64 | max_stars_repo_stars_event_min_datetime
string | max_stars_repo_stars_event_max_datetime
string | max_issues_repo_path
string | max_issues_repo_name
string | max_issues_repo_head_hexsha
string | max_issues_repo_licenses
list | max_issues_count
int64 | max_issues_repo_issues_event_min_datetime
string | max_issues_repo_issues_event_max_datetime
string | max_forks_repo_path
string | max_forks_repo_name
string | max_forks_repo_head_hexsha
string | max_forks_repo_licenses
list | max_forks_count
int64 | max_forks_repo_forks_event_min_datetime
string | max_forks_repo_forks_event_max_datetime
string | content
string | avg_line_length
float64 | max_line_length
int64 | alphanum_fraction
float64 | qsc_code_num_words_quality_signal
int64 | qsc_code_num_chars_quality_signal
float64 | qsc_code_mean_word_length_quality_signal
float64 | qsc_code_frac_words_unique_quality_signal
float64 | qsc_code_frac_chars_top_2grams_quality_signal
float64 | qsc_code_frac_chars_top_3grams_quality_signal
float64 | qsc_code_frac_chars_top_4grams_quality_signal
float64 | qsc_code_frac_chars_dupe_5grams_quality_signal
float64 | qsc_code_frac_chars_dupe_6grams_quality_signal
float64 | qsc_code_frac_chars_dupe_7grams_quality_signal
float64 | qsc_code_frac_chars_dupe_8grams_quality_signal
float64 | qsc_code_frac_chars_dupe_9grams_quality_signal
float64 | qsc_code_frac_chars_dupe_10grams_quality_signal
float64 | qsc_code_frac_chars_replacement_symbols_quality_signal
float64 | qsc_code_frac_chars_digital_quality_signal
float64 | qsc_code_frac_chars_whitespace_quality_signal
float64 | qsc_code_size_file_byte_quality_signal
float64 | qsc_code_num_lines_quality_signal
float64 | qsc_code_num_chars_line_max_quality_signal
float64 | qsc_code_num_chars_line_mean_quality_signal
float64 | qsc_code_frac_chars_alphabet_quality_signal
float64 | qsc_code_frac_chars_comments_quality_signal
float64 | qsc_code_cate_xml_start_quality_signal
float64 | qsc_code_frac_lines_dupe_lines_quality_signal
float64 | qsc_code_cate_autogen_quality_signal
float64 | qsc_code_frac_lines_long_string_quality_signal
float64 | qsc_code_frac_chars_string_length_quality_signal
float64 | qsc_code_frac_chars_long_word_length_quality_signal
float64 | qsc_code_frac_lines_string_concat_quality_signal
float64 | qsc_code_cate_encoded_data_quality_signal
float64 | qsc_code_frac_chars_hex_words_quality_signal
float64 | qsc_code_frac_lines_prompt_comments_quality_signal
float64 | qsc_code_frac_lines_assert_quality_signal
float64 | qsc_codepython_cate_ast_quality_signal
float64 | qsc_codepython_frac_lines_func_ratio_quality_signal
float64 | qsc_codepython_cate_var_zero_quality_signal
bool | qsc_codepython_frac_lines_pass_quality_signal
float64 | qsc_codepython_frac_lines_import_quality_signal
float64 | qsc_codepython_frac_lines_simplefunc_quality_signal
float64 | qsc_codepython_score_lines_no_logic_quality_signal
float64 | qsc_codepython_frac_lines_print_quality_signal
float64 | qsc_code_num_words
int64 | qsc_code_num_chars
int64 | qsc_code_mean_word_length
int64 | qsc_code_frac_words_unique
null | qsc_code_frac_chars_top_2grams
int64 | qsc_code_frac_chars_top_3grams
int64 | qsc_code_frac_chars_top_4grams
int64 | qsc_code_frac_chars_dupe_5grams
int64 | qsc_code_frac_chars_dupe_6grams
int64 | qsc_code_frac_chars_dupe_7grams
int64 | qsc_code_frac_chars_dupe_8grams
int64 | qsc_code_frac_chars_dupe_9grams
int64 | qsc_code_frac_chars_dupe_10grams
int64 | qsc_code_frac_chars_replacement_symbols
int64 | qsc_code_frac_chars_digital
int64 | qsc_code_frac_chars_whitespace
int64 | qsc_code_size_file_byte
int64 | qsc_code_num_lines
int64 | qsc_code_num_chars_line_max
int64 | qsc_code_num_chars_line_mean
int64 | qsc_code_frac_chars_alphabet
int64 | qsc_code_frac_chars_comments
int64 | qsc_code_cate_xml_start
int64 | qsc_code_frac_lines_dupe_lines
int64 | qsc_code_cate_autogen
int64 | qsc_code_frac_lines_long_string
int64 | qsc_code_frac_chars_string_length
int64 | qsc_code_frac_chars_long_word_length
int64 | qsc_code_frac_lines_string_concat
null | qsc_code_cate_encoded_data
int64 | qsc_code_frac_chars_hex_words
int64 | qsc_code_frac_lines_prompt_comments
int64 | qsc_code_frac_lines_assert
int64 | qsc_codepython_cate_ast
int64 | qsc_codepython_frac_lines_func_ratio
int64 | qsc_codepython_cate_var_zero
int64 | qsc_codepython_frac_lines_pass
int64 | qsc_codepython_frac_lines_import
int64 | qsc_codepython_frac_lines_simplefunc
int64 | qsc_codepython_score_lines_no_logic
int64 | qsc_codepython_frac_lines_print
int64 | effective
string | hits
int64 |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
94553888d69c9264fdada0c0363badbaf30c59ca
| 304
|
py
|
Python
|
textattack/metrics/attack_metrics/__init__.py
|
srujanjoshi/TextAttack
|
b86d0f840b6f13b1eb8d0f17b3fceeeca62b08ed
|
[
"MIT"
] | null | null | null |
textattack/metrics/attack_metrics/__init__.py
|
srujanjoshi/TextAttack
|
b86d0f840b6f13b1eb8d0f17b3fceeeca62b08ed
|
[
"MIT"
] | null | null | null |
textattack/metrics/attack_metrics/__init__.py
|
srujanjoshi/TextAttack
|
b86d0f840b6f13b1eb8d0f17b3fceeeca62b08ed
|
[
"MIT"
] | 1
|
2022-03-06T22:41:03.000Z
|
2022-03-06T22:41:03.000Z
|
"""
attack_metrics package:
---------------------------------------------------------------------
TextAttack provide users common metrics on attacks' quality.
"""
from .attack_queries import AttackQueries
from .attack_success_rate import AttackSuccessRate
from .words_perturbed import WordsPerturbed
| 23.384615
| 69
| 0.638158
| 27
| 304
| 7
| 0.740741
| 0.10582
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.095395
| 304
| 12
| 70
| 25.333333
| 0.687273
| 0.509868
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
945a573532de5f16c4b4354385719ebffdfdc80b
| 242
|
py
|
Python
|
UltimateTicTacToe/Bot.py
|
m3rik/nn
|
96d630cbb9894957d17ca8291900ff3802a30637
|
[
"Apache-2.0"
] | null | null | null |
UltimateTicTacToe/Bot.py
|
m3rik/nn
|
96d630cbb9894957d17ca8291900ff3802a30637
|
[
"Apache-2.0"
] | null | null | null |
UltimateTicTacToe/Bot.py
|
m3rik/nn
|
96d630cbb9894957d17ca8291900ff3802a30637
|
[
"Apache-2.0"
] | null | null | null |
class Bot:
'''
state - state of the game
returns a move
'''
def move(self, state, symbol):
raise NotImplementedError('Abstractaaa')
def get_name(self):
raise NotImplementedError('Abstractaaa')
| 22
| 48
| 0.603306
| 25
| 242
| 5.8
| 0.68
| 0.331034
| 0.482759
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.297521
| 242
| 10
| 49
| 24.2
| 0.852941
| 0.165289
| 0
| 0.4
| 0
| 0
| 0.126437
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.4
| false
| 0
| 0
| 0
| 0.6
| 0
| 1
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
9465d06fb72f797af7607ca889bd481b18264799
| 91
|
py
|
Python
|
working-library/background/LoginAPI/apps.py
|
FredCof/Fresh-supermarket-Online
|
25c1cb28f5b5dc1f85e53ee7de5b055de438c491
|
[
"Apache-2.0"
] | 2
|
2021-03-12T16:35:27.000Z
|
2021-03-12T16:35:34.000Z
|
working-library/background/LoginAPI/apps.py
|
FredCof/Fresh-supermarket-Online
|
25c1cb28f5b5dc1f85e53ee7de5b055de438c491
|
[
"Apache-2.0"
] | 4
|
2021-03-19T13:16:08.000Z
|
2021-06-09T19:26:37.000Z
|
working-library/background/LoginAPI/apps.py
|
FredCof/Fresh-supermarket-Online
|
25c1cb28f5b5dc1f85e53ee7de5b055de438c491
|
[
"Apache-2.0"
] | null | null | null |
from django.apps import AppConfig
class LoginapiConfig(AppConfig):
name = 'LoginAPI'
| 15.166667
| 33
| 0.758242
| 10
| 91
| 6.9
| 0.9
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.164835
| 91
| 5
| 34
| 18.2
| 0.907895
| 0
| 0
| 0
| 0
| 0
| 0.087912
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
947828473b636b1609d039fe780a63c63434f7d9
| 213
|
py
|
Python
|
oozappa/_structure/_environment/fabfile/__init__.py
|
tsuyukimakoto/oozappa
|
51a8fad38a1ad34514853d0223619c6ec667c213
|
[
"MIT"
] | 8
|
2015-05-10T21:59:30.000Z
|
2017-11-24T03:49:12.000Z
|
oozappa/_structure/_environment/fabfile/__init__.py
|
frkwy/oozappa
|
92a631d26573ac53b3f2f852ab391a22561189e1
|
[
"MIT"
] | 12
|
2015-01-25T13:43:35.000Z
|
2018-11-01T17:37:26.000Z
|
oozappa/_structure/_environment/fabfile/__init__.py
|
frkwy/oozappa
|
92a631d26573ac53b3f2f852ab391a22561189e1
|
[
"MIT"
] | 4
|
2015-10-03T08:43:11.000Z
|
2017-12-15T08:57:23.000Z
|
# -*- coding:utf8 -*-
from fabric.api import task, local, run, sudo, env
from oozappa.config import get_config, procure_common_functions
_settings = get_config()
procure_common_functions()
# your own task below
| 23.666667
| 63
| 0.769953
| 30
| 213
| 5.233333
| 0.7
| 0.11465
| 0.203822
| 0.280255
| 0.394904
| 0
| 0
| 0
| 0
| 0
| 0
| 0.005405
| 0.131455
| 213
| 8
| 64
| 26.625
| 0.843243
| 0.183099
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.5
| 0
| 0.5
| 0
| 0
| 0
| 0
| null | 0
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
947e3f8031704f990091dfcbbbcfe194d5d16baa
| 204
|
py
|
Python
|
build/lib/mezzanine_smartling/urls.py
|
Appdynamics/mezzanine-smartling
|
76ca1dd929ff79e6c766eb46237edc6ab6d38a46
|
[
"Apache-2.0"
] | 3
|
2015-10-09T01:12:27.000Z
|
2015-10-10T09:41:56.000Z
|
build/lib/mezzanine_smartling/urls.py
|
Appdynamics/mezzanine-smartling
|
76ca1dd929ff79e6c766eb46237edc6ab6d38a46
|
[
"Apache-2.0"
] | null | null | null |
build/lib/mezzanine_smartling/urls.py
|
Appdynamics/mezzanine-smartling
|
76ca1dd929ff79e6c766eb46237edc6ab6d38a46
|
[
"Apache-2.0"
] | 2
|
2018-10-14T10:32:00.000Z
|
2019-08-22T06:07:28.000Z
|
from django.conf.urls import include, url
from django.contrib import admin
urlpatterns = [
url(r'^smartling_callback/$', 'mezzanine_smartling.views.smartling_callback', name='smartling_callback'),
]
| 29.142857
| 109
| 0.779412
| 25
| 204
| 6.2
| 0.64
| 0.329032
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.102941
| 204
| 6
| 110
| 34
| 0.846995
| 0
| 0
| 0
| 0
| 0
| 0.406863
| 0.318627
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.4
| 0
| 0.4
| 0
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
846c3ddd8708d943b4bedd8aee1bf379f7ad60ea
| 5,805
|
py
|
Python
|
ee569/hw5/model.py
|
chenying-wang/usc-ee-coursework-public
|
5bc94c2350bcebf1036fb058fe7dc4f7e31e1de1
|
[
"MIT"
] | 1
|
2021-03-24T10:46:20.000Z
|
2021-03-24T10:46:20.000Z
|
ee569/hw5/model.py
|
chenying-wang/usc-ee-coursework-public
|
5bc94c2350bcebf1036fb058fe7dc4f7e31e1de1
|
[
"MIT"
] | null | null | null |
ee569/hw5/model.py
|
chenying-wang/usc-ee-coursework-public
|
5bc94c2350bcebf1036fb058fe7dc4f7e31e1de1
|
[
"MIT"
] | 1
|
2021-03-25T09:18:45.000Z
|
2021-03-25T09:18:45.000Z
|
# Name: Chenying Wang
# Email: chenying.wang@usc.edu
# USC ID: ****-****-**
# Date: Friday, April 3, 2020
import tensorflow as tf
import argparse
import config
class BaseModel:
def __init__(self, inputs_shape, lr_rate = config.SGD_LEARNING_RATE, lr_decay_steps = config.SGD_LEARNING_RATE_DECAY_STEPS, \
lr_decay_rate = config.SGD_LEARNING_RATE_DECAY_RATE, name = 'model', **kwargs):
self._build_model(inputs_shape, lr_rate, lr_decay_steps, lr_decay_rate, name)
def fit(self, *args, **kwargs):
self._model.fit(*args, **kwargs)
def evaluate(self, *args, **kwargs):
self._model.evaluate(*args, **kwargs)
def load_weights(self, *args, **kwargs):
self._model.load_weights(*args, **kwargs)
def _build_model(self, inputs_shape, lr_rate, lr_decay_steps, lr_decay_rate, name):
inputs = tf.keras.Input(inputs_shape)
outputs = self.call(inputs)
self._model = tf.keras.Model(inputs = inputs, outputs = outputs, name = name)
self._model.summary()
if lr_decay_steps <= 0:
optimizer = tf.keras.optimizers.SGD(learning_rate = lr_rate, momentum = 0.9)
else:
lr_schedule = tf.keras.optimizers.schedules.ExponentialDecay(lr_rate, \
decay_steps = lr_decay_steps * config.TRAIN_SIZE // config.BATCH_SIZE, \
decay_rate = lr_decay_rate, staircase = True)
optimizer = tf.keras.optimizers.SGD(learning_rate = lr_schedule, momentum = 0.9)
self._model.compile(optimizer = optimizer, \
loss = tf.keras.losses.SparseCategoricalCrossentropy(), \
metrics = ['accuracy'])
class LeNet5Model(BaseModel):
def __init__(self, inputs_shape, lr_rate = config.SGD_LEARNING_RATE, lr_decay_steps = config.SGD_LEARNING_RATE_DECAY_STEPS, \
lr_decay_rate = config.SGD_LEARNING_RATE_DECAY_RATE, name = 'model', **kwargs):
self.conv_1 = tf.keras.layers.Conv2D(6, (5, 5), padding = 'valid', \
input_shape = (config.CHANNEL, config.HEIGHT, config.WIDTH), \
data_format = 'channels_first', name = 'Conv_1')
self.pool_1 = tf.keras.layers.MaxPool2D((2, 2), data_format = 'channels_first', name = 'Pool_1')
self.conv_2 = tf.keras.layers.Conv2D(16, (5, 5), padding = 'valid', \
data_format = 'channels_first', name = 'Conv_2')
self.pool_2 = tf.keras.layers.MaxPool2D((2, 2), data_format = 'channels_first', name = 'Pool_2')
self.flatten = tf.keras.layers.Flatten(name = 'Flatten')
self.fc_1 = tf.keras.layers.Dense(120, activation = tf.nn.swish, name = 'Fc_1')
self.dropout_1 = tf.keras.layers.Dropout(config.DROPOUT_RATE, name = 'Dropout_1')
self.fc_2 = tf.keras.layers.Dense(84, activation = tf.nn.swish, name = 'Fc_2')
self.dropout_2 = tf.keras.layers.Dropout(config.DROPOUT_RATE, name = 'Dropout_2')
self.fc_3 = tf.keras.layers.Dense(10, activation = tf.nn.softmax, name = 'Prediction')
super(LeNet5Model, self).__init__(inputs_shape, lr_rate, lr_decay_steps, lr_decay_rate, name, **kwargs)
def call(self, inputs, training = None):
x = self.conv_1(inputs)
x = tf.nn.relu(x)
x = self.pool_1(x)
x = self.conv_2(x)
x = tf.nn.relu(x)
x = self.pool_2(x)
x = self.flatten(x)
x = self.fc_1(x)
x = self.fc_2(x)
prediction = self.fc_3(x)
return prediction
class ModifiedLeNet5Model(BaseModel):
def __init__(self, inputs_shape, lr_rate = config.SGD_LEARNING_RATE, lr_decay_steps = config.SGD_LEARNING_RATE_DECAY_STEPS, \
lr_decay_rate = config.SGD_LEARNING_RATE_DECAY_RATE, name = 'model', **kwargs):
self.conv_1 = tf.keras.layers.Conv2D(32, (5, 5), padding = 'valid', \
kernel_regularizer = tf.keras.regularizers.l2(config.WEIGHT_DECAY), \
input_shape = (config.CHANNEL, config.HEIGHT, config.WIDTH), \
data_format = 'channels_first', name = 'Conv_1')
self.bn_1 = tf.keras.layers.BatchNormalization(axis = 1, name = 'BN_1')
self.pool_1 = tf.keras.layers.MaxPool2D((2, 2), data_format = 'channels_first', name = 'Pool_1')
self.conv_2 = tf.keras.layers.Conv2D(64, (5, 5), padding = 'valid', \
kernel_regularizer = tf.keras.regularizers.l2(config.WEIGHT_DECAY), \
data_format = 'channels_first', name = 'Conv_2')
self.bn_2 = tf.keras.layers.BatchNormalization(axis = 1, name = 'BN_2')
self.pool_2 = tf.keras.layers.MaxPool2D((2, 2), data_format = 'channels_first', name = 'Pool_2')
self.flatten = tf.keras.layers.Flatten(name = 'Flatten')
self.fc_1 = tf.keras.layers.Dense(200, activation = tf.nn.swish, name = 'Fc_1')
self.dropout_1 = tf.keras.layers.Dropout(config.DROPOUT_RATE, name = 'Dropout_1')
self.fc_2 = tf.keras.layers.Dense(100, activation = tf.nn.swish, name = 'Fc_2')
self.dropout_2 = tf.keras.layers.Dropout(config.DROPOUT_RATE, name = 'Dropout_2')
self.fc_3 = tf.keras.layers.Dense(10, activation = tf.nn.softmax, name = 'Prediction')
super(ModifiedLeNet5Model, self).__init__(inputs_shape, lr_rate, lr_decay_steps, lr_decay_rate, name, **kwargs)
def call(self, inputs, training = None):
x = self.conv_1(inputs)
x = self.bn_1(x, training = training)
x = tf.nn.swish(x)
x = self.pool_1(x)
x = self.conv_2(x)
x = self.bn_2(x, training = training)
x = tf.nn.swish(x)
x = self.pool_2(x)
x = self.flatten(x)
x = self.fc_1(x)
x = self.dropout_1(x, training = training)
x = self.fc_2(x)
x = self.dropout_2(x, training = training)
prediction = self.fc_3(x)
return prediction
| 50.043103
| 129
| 0.641171
| 809
| 5,805
| 4.349815
| 0.143387
| 0.059676
| 0.081273
| 0.053708
| 0.777778
| 0.741972
| 0.741972
| 0.722648
| 0.650753
| 0.650753
| 0
| 0.026655
| 0.224462
| 5,805
| 115
| 130
| 50.478261
| 0.754998
| 0.01671
| 0
| 0.531915
| 0
| 0
| 0.052078
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.095745
| false
| 0
| 0.031915
| 0
| 0.180851
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
84726d6d0823305456f2e6b568610386b66386bb
| 157
|
py
|
Python
|
turf/invariant/__init__.py
|
malroc/pyturf
|
c89b6ea7094bd5ca26cf589d9dcd15bd819d82e9
|
[
"MIT"
] | 11
|
2020-08-26T11:04:55.000Z
|
2022-01-26T14:53:10.000Z
|
turf/invariant/__init__.py
|
malroc/pyturf
|
c89b6ea7094bd5ca26cf589d9dcd15bd819d82e9
|
[
"MIT"
] | 36
|
2020-04-09T16:49:05.000Z
|
2020-06-01T14:39:37.000Z
|
turf/invariant/__init__.py
|
malroc/pyturf
|
c89b6ea7094bd5ca26cf589d9dcd15bd819d82e9
|
[
"MIT"
] | 5
|
2020-07-30T23:37:35.000Z
|
2021-08-24T08:10:28.000Z
|
from turf.invariant._invariant import (
get_coords_from_features,
get_coords_from_geometry,
get_geometry_from_features,
get_geometry_type,
)
| 22.428571
| 39
| 0.789809
| 20
| 157
| 5.6
| 0.45
| 0.160714
| 0.232143
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.159236
| 157
| 6
| 40
| 26.166667
| 0.848485
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.166667
| 0
| 0.166667
| 0
| 1
| 0
| 0
| null | 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
84cc4726f31db3c5dc0daf118ad72e6245b1f377
| 226
|
py
|
Python
|
usersmanagement/apps.py
|
Open-CMMS/openCMMS_backend
|
56511ebac83a5dc1fb8768a98bc675e88530a447
|
[
"BSD-3-Clause"
] | 3
|
2021-03-08T19:14:38.000Z
|
2022-02-01T17:57:31.000Z
|
usersmanagement/apps.py
|
Open-CMMS/openCMMS_backend
|
56511ebac83a5dc1fb8768a98bc675e88530a447
|
[
"BSD-3-Clause"
] | null | null | null |
usersmanagement/apps.py
|
Open-CMMS/openCMMS_backend
|
56511ebac83a5dc1fb8768a98bc675e88530a447
|
[
"BSD-3-Clause"
] | null | null | null |
"""This file is to register usermanagement as a django app."""
from django.apps import AppConfig
class UsersmanagementConfig(AppConfig):
"""This is the declaration of usermanagement app."""
name = 'usersmanagement'
| 25.111111
| 62
| 0.743363
| 27
| 226
| 6.222222
| 0.777778
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.163717
| 226
| 8
| 63
| 28.25
| 0.888889
| 0.455752
| 0
| 0
| 0
| 0
| 0.133929
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
84daace86eeabe1ca23f2b46ff081b8bf2a65fe7
| 226
|
py
|
Python
|
test.py
|
amirrr/django-legislation-polling
|
a833d4bb535ffeffadbc2ad1ef9bc6bcedb15703
|
[
"MIT"
] | null | null | null |
test.py
|
amirrr/django-legislation-polling
|
a833d4bb535ffeffadbc2ad1ef9bc6bcedb15703
|
[
"MIT"
] | null | null | null |
test.py
|
amirrr/django-legislation-polling
|
a833d4bb535ffeffadbc2ad1ef9bc6bcedb15703
|
[
"MIT"
] | null | null | null |
import os
from random import randint
def generate_verification_code():
n = 6
return ''.join(["{}".format(randint(0, 9)) for num in range(0, n)])
if __name__ == "__main__":
print(generate_verification_code())
| 16.142857
| 71
| 0.668142
| 31
| 226
| 4.483871
| 0.774194
| 0.28777
| 0.345324
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.021739
| 0.185841
| 226
| 14
| 72
| 16.142857
| 0.733696
| 0
| 0
| 0
| 1
| 0
| 0.044053
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.142857
| false
| 0
| 0.285714
| 0
| 0.571429
| 0.142857
| 0
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
84fe552ef6ab8a2e3de385d96a5875aebfb4a2fb
| 773
|
py
|
Python
|
relationship/serializers.py
|
Chren/FakeWechatServer
|
d6a94302ee242d01f74b59b17528e77d397e6e92
|
[
"MIT"
] | 4
|
2016-11-15T16:42:51.000Z
|
2018-10-20T06:14:22.000Z
|
relationship/serializers.py
|
Chren/FakeWechatServer
|
d6a94302ee242d01f74b59b17528e77d397e6e92
|
[
"MIT"
] | null | null | null |
relationship/serializers.py
|
Chren/FakeWechatServer
|
d6a94302ee242d01f74b59b17528e77d397e6e92
|
[
"MIT"
] | 2
|
2016-12-05T10:04:48.000Z
|
2018-11-06T14:15:27.000Z
|
from rest_framework import serializers
from relationship.models import IMUser, FriendShip
from django.contrib.auth.models import User
from rest_framework.fields import Field
class IMUserSerializer(serializers.HyperlinkedModelSerializer):
class Meta:
model = IMUser
fields = ('userid', 'phone', 'name',
'photo', 'bgimg')
class LoginUserSerializer(serializers.HyperlinkedModelSerializer):
class Meta:
model = IMUser
fields = ('userid', 'phone', 'name',
'photo', 'bgimg', 'token', 'rctoken')
class ResponseSerializer(serializers.HyperlinkedModelSerializer):
class Meta:
model = IMUser
fields = ('userid', 'phone', 'name',
'photo', 'bgimg', 'token', 'rctoken')
| 35.136364
| 66
| 0.655886
| 70
| 773
| 7.214286
| 0.414286
| 0.219802
| 0.249505
| 0.273267
| 0.570297
| 0.570297
| 0.570297
| 0.570297
| 0.570297
| 0.570297
| 0
| 0
| 0.231565
| 773
| 22
| 67
| 35.136364
| 0.850168
| 0
| 0
| 0.578947
| 0
| 0
| 0.127907
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.210526
| 0
| 0.526316
| 0
| 0
| 0
| 0
| null | 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
ca0d0c7baed43d68b540d99be74bffd5943fcf93
| 899
|
py
|
Python
|
api/serializers.py
|
crypticleopard/IIPEDIA
|
33717ccd2ff0f809dcb1953880769f423f64474c
|
[
"MIT"
] | 1
|
2021-05-01T19:20:32.000Z
|
2021-05-01T19:20:32.000Z
|
api/serializers.py
|
crypticleopard/IIPEDIA
|
33717ccd2ff0f809dcb1953880769f423f64474c
|
[
"MIT"
] | null | null | null |
api/serializers.py
|
crypticleopard/IIPEDIA
|
33717ccd2ff0f809dcb1953880769f423f64474c
|
[
"MIT"
] | null | null | null |
from rest_framework import serializers
from .models import Book,Review,Community
from django.contrib.auth.models import User
class BookSerializer(serializers.ModelSerializer):
class Meta:
model=Book
fields=('__all__')
class CreateReviewSerializer(serializers.ModelSerializer):
class Meta:
model=Review
fields=['main']
class CreateUserSerializer(serializers.ModelSerializer):
class Meta:
model=User
fields=('username','password','email','first_name','last_name')
class GetReviewSerializer(serializers.ModelSerializer):
class Meta:
model=Review
fields=('__all__')
class GetCommunitySerializer(serializers.ModelSerializer):
class Meta:
model=Community
fields=('__all__')
class CreateCommunitySerializer(serializers.ModelSerializer):
class Meta:
model=Community
fields=['main']
| 27.242424
| 71
| 0.714127
| 84
| 899
| 7.464286
| 0.380952
| 0.248804
| 0.296651
| 0.334928
| 0.4689
| 0.341308
| 0.341308
| 0
| 0
| 0
| 0
| 0
| 0.192436
| 899
| 33
| 72
| 27.242424
| 0.863636
| 0
| 0
| 0.555556
| 0
| 0
| 0.076667
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0.037037
| 0.111111
| 0
| 0.555556
| 0
| 0
| 0
| 0
| null | 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
ca1033f1e9db5a5cd3212551dbe84e331887865e
| 21
|
py
|
Python
|
models/unet/EfficientNet_PyTorch/tf_to_pytorch/convert_tf_to_pt/original_tf/__init__.py
|
harsimarsingh/fastmrimine
|
77c79a4ce83f63537eb775fa1eb40feb699338ef
|
[
"MIT"
] | null | null | null |
models/unet/EfficientNet_PyTorch/tf_to_pytorch/convert_tf_to_pt/original_tf/__init__.py
|
harsimarsingh/fastmrimine
|
77c79a4ce83f63537eb775fa1eb40feb699338ef
|
[
"MIT"
] | null | null | null |
models/unet/EfficientNet_PyTorch/tf_to_pytorch/convert_tf_to_pt/original_tf/__init__.py
|
harsimarsingh/fastmrimine
|
77c79a4ce83f63537eb775fa1eb40feb699338ef
|
[
"MIT"
] | null | null | null |
""" dummy comment """
| 21
| 21
| 0.571429
| 2
| 21
| 6
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.142857
| 21
| 1
| 21
| 21
| 0.666667
| 0.619048
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
ca10989707ee0ad9838a9b59928a0d604e96d599
| 210
|
py
|
Python
|
pitanja/views.py
|
denza/django-playground
|
a2eea580f4322973c51a0ea816b59513cd558b6c
|
[
"MIT"
] | 1
|
2021-08-14T13:47:01.000Z
|
2021-08-14T13:47:01.000Z
|
pitanja/views.py
|
denza/django-playground
|
a2eea580f4322973c51a0ea816b59513cd558b6c
|
[
"MIT"
] | null | null | null |
pitanja/views.py
|
denza/django-playground
|
a2eea580f4322973c51a0ea816b59513cd558b6c
|
[
"MIT"
] | null | null | null |
from django.shortcuts import render
from .models import Osoba
def poosobama(request):
svao = Osoba.objects.all()
return render(request, "pitanja/index.html", {'svao' : svao})
# Create your views here.
| 26.25
| 65
| 0.72381
| 28
| 210
| 5.428571
| 0.75
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.157143
| 210
| 7
| 66
| 30
| 0.858757
| 0.109524
| 0
| 0
| 0
| 0
| 0.118919
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.2
| false
| 0
| 0.4
| 0
| 0.8
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
ca223d5a1fb6bd31c31c21778e08ed2f82f8434a
| 28
|
py
|
Python
|
samples/sample_tap_countries/__init__.py
|
meltano/sdk
|
83dde4fe922f9f91bd3c57277849a2a2daa8f09a
|
[
"Apache-2.0"
] | 13
|
2021-06-21T17:30:32.000Z
|
2021-12-06T18:45:34.000Z
|
samples/sample_tap_countries/__init__.py
|
meltano/sdk
|
83dde4fe922f9f91bd3c57277849a2a2daa8f09a
|
[
"Apache-2.0"
] | null | null | null |
samples/sample_tap_countries/__init__.py
|
meltano/sdk
|
83dde4fe922f9f91bd3c57277849a2a2daa8f09a
|
[
"Apache-2.0"
] | null | null | null |
"""Countries API Sample."""
| 14
| 27
| 0.642857
| 3
| 28
| 6
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.107143
| 28
| 1
| 28
| 28
| 0.72
| 0.75
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
ca3ebc3ca74aba2e3008523848d23c4e2047c22c
| 219
|
py
|
Python
|
src/ui/components/__init__.py
|
Amin-egn/Recipient
|
51e98ef9e679b3f32db7ab2eb07f0a905f0dac24
|
[
"Apache-2.0"
] | null | null | null |
src/ui/components/__init__.py
|
Amin-egn/Recipient
|
51e98ef9e679b3f32db7ab2eb07f0a905f0dac24
|
[
"Apache-2.0"
] | null | null | null |
src/ui/components/__init__.py
|
Amin-egn/Recipient
|
51e98ef9e679b3f32db7ab2eb07f0a905f0dac24
|
[
"Apache-2.0"
] | null | null | null |
from .base_widget import BaseWidget
from .base_dialog import BaseDialog
from .table import Table
from .message import Message
from .confirm import Confirm
from .progress import Progress
from .table_list import TableList
| 31.285714
| 35
| 0.844749
| 31
| 219
| 5.870968
| 0.419355
| 0.087912
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.123288
| 219
| 7
| 36
| 31.285714
| 0.947917
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
ca40afa4d6bc3235c2086ba1bb9afb63b3dc6090
| 250
|
py
|
Python
|
api/serializers/subscribers.py
|
lucasmgana/Pharmacy-Light-weight
|
9d6efe714d60b3a04f78f174e1e6c2a2ab98bd9a
|
[
"MIT"
] | 192
|
2020-08-14T22:17:34.000Z
|
2022-03-29T05:56:26.000Z
|
api/serializers/subscribers.py
|
lucasmgana/Pharmacy-Light-weight
|
9d6efe714d60b3a04f78f174e1e6c2a2ab98bd9a
|
[
"MIT"
] | 9
|
2021-03-30T14:29:00.000Z
|
2022-02-27T11:06:35.000Z
|
api/serializers/subscribers.py
|
lucasmgana/Pharmacy-Light-weight
|
9d6efe714d60b3a04f78f174e1e6c2a2ab98bd9a
|
[
"MIT"
] | 28
|
2020-08-15T08:26:34.000Z
|
2022-03-17T01:15:52.000Z
|
from rest_framework import serializers
from backend.models.subscribers import Subscriber
class SubscribersSerializer(serializers.ModelSerializer):
class Meta:
model = Subscriber
fields = ('name', 'contact_method', 'contact_info')
| 35.714286
| 59
| 0.764
| 25
| 250
| 7.52
| 0.76
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.16
| 250
| 7
| 59
| 35.714286
| 0.895238
| 0
| 0
| 0
| 0
| 0
| 0.119522
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 0.666667
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
ca5b8b888005945b1aadc7c15ef8633a6f76980a
| 209
|
py
|
Python
|
docs/source/examples/substitutions.py
|
convexengineering/gpk
|
c8cf2b30ce1c3d28f135352bd584a0130e903e3f
|
[
"MIT"
] | 76
|
2017-10-24T18:38:48.000Z
|
2022-01-13T03:14:37.000Z
|
docs/source/examples/substitutions.py
|
convexengineering/gpk
|
c8cf2b30ce1c3d28f135352bd584a0130e903e3f
|
[
"MIT"
] | 485
|
2017-09-22T18:31:06.000Z
|
2022-03-02T20:34:11.000Z
|
docs/source/examples/substitutions.py
|
appliedopt/gpkit
|
647ef0a2a0ff625026943bfd7fb5ca560100898b
|
[
"MIT"
] | 23
|
2017-12-11T01:29:00.000Z
|
2022-02-14T07:53:16.000Z
|
"Example substitution; adapted from t_sub.py/t_NomialSubs /test_Basic"
from gpkit import Variable
x = Variable("x")
p = x**2
assert p.sub({x: 3}) == 9
assert p.sub({x.key: 3}) == 9
assert p.sub({"x": 3}) == 9
| 26.125
| 70
| 0.655502
| 40
| 209
| 3.35
| 0.5
| 0.156716
| 0.223881
| 0.246269
| 0.291045
| 0.291045
| 0
| 0
| 0
| 0
| 0
| 0.039326
| 0.148325
| 209
| 7
| 71
| 29.857143
| 0.713483
| 0.325359
| 0
| 0
| 0
| 0
| 0.334928
| 0.100478
| 0
| 0
| 0
| 0
| 0.428571
| 1
| 0
| false
| 0
| 0.142857
| 0
| 0.142857
| 0
| 0
| 0
| 0
| null | 0
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
ca6cd101eb285ec0cff7b321427c1e24a9fdfad5
| 59
|
py
|
Python
|
DSToolbox/cleaning_tools.py
|
RNEnriquez/DataScience-ToolBox
|
cb181673b63242f1253d8d078140369769eb06bf
|
[
"MIT"
] | 3
|
2019-08-14T20:58:00.000Z
|
2020-03-25T16:42:14.000Z
|
DSToolbox/cleaning_tools.py
|
RNEnriquez/DataScience-ToolBox
|
cb181673b63242f1253d8d078140369769eb06bf
|
[
"MIT"
] | null | null | null |
DSToolbox/cleaning_tools.py
|
RNEnriquez/DataScience-ToolBox
|
cb181673b63242f1253d8d078140369769eb06bf
|
[
"MIT"
] | 1
|
2019-10-02T16:32:14.000Z
|
2019-10-02T16:32:14.000Z
|
'''
Various tools for cleaning out nulls and imputing
'''
| 14.75
| 50
| 0.711864
| 8
| 59
| 5.25
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.186441
| 59
| 3
| 51
| 19.666667
| 0.875
| 0.830508
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
ca7cf913f5feb090e4698977a9edd8dc5becdc7c
| 526
|
py
|
Python
|
servee/frontendadmin/tests/frontendadmin_registry.py
|
servee/servee
|
59405663e1c30d3bcb3f6918932adfc02ae1a668
|
[
"MIT"
] | 3
|
2017-08-22T13:19:12.000Z
|
2021-12-28T23:58:17.000Z
|
servee/frontendadmin/tests/frontendadmin_registry.py
|
servee/servee
|
59405663e1c30d3bcb3f6918932adfc02ae1a668
|
[
"MIT"
] | null | null | null |
servee/frontendadmin/tests/frontendadmin_registry.py
|
servee/servee
|
59405663e1c30d3bcb3f6918932adfc02ae1a668
|
[
"MIT"
] | null | null | null |
from django.contrib.flatpages.models import FlatPage
from django.contrib.flatpages.admin import FlatPageAdmin
import frontendadmin
class FlatPageFrontendadminAdmin(FlatPageAdmin, frontendadmin.ServeeModelAdmin):
"""
This class extends from the normal FlatPageAdmin, as well as frontendadmin.ServeeModelAdmin
The later simply adds to the templates that should be processed when looking
for the templates to render this page.
"""
pass
frontendadmin.site.register(FlatPage, FlatPageFrontendadminAdmin)
| 35.066667
| 95
| 0.807985
| 59
| 526
| 7.20339
| 0.610169
| 0.047059
| 0.08
| 0.122353
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.144487
| 526
| 14
| 96
| 37.571429
| 0.944444
| 0.393536
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0.166667
| 0.5
| 0
| 0.666667
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 1
| 0
|
0
| 4
|
04ae497d164e29edd2337c15ce4e6474100f390b
| 51
|
py
|
Python
|
nowcasting_utils/metrics/__init__.py
|
openclimatefix/nowcasting_utils
|
7a45e9d24ce29693d96fd9c75a34ca1d205b64bc
|
[
"MIT"
] | 2
|
2021-12-20T15:56:40.000Z
|
2022-02-09T07:31:27.000Z
|
nowcasting_utils/metrics/__init__.py
|
openclimatefix/nowcasting_utils
|
7a45e9d24ce29693d96fd9c75a34ca1d205b64bc
|
[
"MIT"
] | 37
|
2021-09-08T14:36:00.000Z
|
2022-02-16T20:05:24.000Z
|
nowcasting_utils/metrics/__init__.py
|
openclimatefix/nowcasting_utils
|
7a45e9d24ce29693d96fd9c75a34ca1d205b64bc
|
[
"MIT"
] | null | null | null |
""" Metrics used for evaluating various models """
| 25.5
| 50
| 0.72549
| 6
| 51
| 6.166667
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.156863
| 51
| 1
| 51
| 51
| 0.860465
| 0.823529
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
04d52126ecb944a8eb132b01cbacc60fe85e28ab
| 25
|
py
|
Python
|
apps/controllerx/cx_version.py
|
Digital-Lemon/controllerx
|
6b90ede37fd7bfaa2771862e326bee48f7650d64
|
[
"MIT"
] | null | null | null |
apps/controllerx/cx_version.py
|
Digital-Lemon/controllerx
|
6b90ede37fd7bfaa2771862e326bee48f7650d64
|
[
"MIT"
] | null | null | null |
apps/controllerx/cx_version.py
|
Digital-Lemon/controllerx
|
6b90ede37fd7bfaa2771862e326bee48f7650d64
|
[
"MIT"
] | null | null | null |
__version__ = "v4.0.0b3"
| 12.5
| 24
| 0.68
| 4
| 25
| 3.25
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.181818
| 0.12
| 25
| 1
| 25
| 25
| 0.409091
| 0
| 0
| 0
| 0
| 0
| 0.32
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
b6c28b36d0a727aea394b47e8f0557a031ceae6b
| 5,663
|
py
|
Python
|
mayan/apps/motd/tests/test_api.py
|
sophiawa/Mayan-EDMS
|
42f20576d0c690b645a60bf53c5169cda4264231
|
[
"Apache-2.0"
] | null | null | null |
mayan/apps/motd/tests/test_api.py
|
sophiawa/Mayan-EDMS
|
42f20576d0c690b645a60bf53c5169cda4264231
|
[
"Apache-2.0"
] | 10
|
2021-03-20T00:01:17.000Z
|
2022-03-12T00:48:43.000Z
|
mayan/apps/motd/tests/test_api.py
|
sophiawa/Mayan-EDMS
|
42f20576d0c690b645a60bf53c5169cda4264231
|
[
"Apache-2.0"
] | 1
|
2020-12-17T02:35:09.000Z
|
2020-12-17T02:35:09.000Z
|
from rest_framework import status
from mayan.apps.rest_api.tests.base import BaseAPITestCase
from ..models import Message
from ..permissions import (
permission_message_create, permission_message_delete,
permission_message_edit, permission_message_view
)
from .literals import (
TEST_LABEL, TEST_LABEL_EDITED, TEST_MESSAGE, TEST_MESSAGE_EDITED
)
from .mixins import MOTDTestMixin
class MOTDAPITestCase(MOTDTestMixin, BaseAPITestCase):
def _request_message_create_view(self):
return self.post(
viewname='rest_api:message-list', data={
'label': TEST_LABEL, 'message': TEST_MESSAGE
}
)
def test_message_create_view_no_permission(self):
response = self._request_message_create_view()
self.assertEqual(response.status_code, status.HTTP_403_FORBIDDEN)
self.assertEqual(Message.objects.count(), 0)
def test_message_create_view_with_permission(self):
self.grant_permission(permission=permission_message_create)
response = self._request_message_create_view()
self.assertEqual(response.status_code, status.HTTP_201_CREATED)
message = Message.objects.first()
self.assertEqual(response.data['id'], message.pk)
self.assertEqual(response.data['label'], TEST_LABEL)
self.assertEqual(response.data['message'], TEST_MESSAGE)
self.assertEqual(Message.objects.count(), 1)
self.assertEqual(message.label, TEST_LABEL)
self.assertEqual(message.message, TEST_MESSAGE)
def _request_message_delete_view(self):
return self.delete(
viewname='rest_api:message-detail', kwargs={
'pk': self.test_message.pk
}
)
def test_message_delete_view_no_access(self):
self._create_test_message()
response = self._request_message_delete_view()
self.assertEqual(response.status_code, status.HTTP_404_NOT_FOUND)
self.assertEqual(Message.objects.count(), 1)
def test_message_delete_view_with_access(self):
self._create_test_message()
self.grant_access(
obj=self.test_message, permission=permission_message_delete
)
response = self._request_message_delete_view()
self.assertEqual(response.status_code, status.HTTP_204_NO_CONTENT)
self.assertEqual(Message.objects.count(), 0)
def _request_message_detail_view(self):
return self.get(
viewname='rest_api:message-detail', kwargs={
'pk': self.test_message.pk
}
)
def test_message_detail_view_no_access(self):
self._create_test_message()
response = self._request_message_detail_view()
self.assertEqual(response.status_code, status.HTTP_404_NOT_FOUND)
def test_message_detail_view_with_access(self):
self._create_test_message()
self.grant_access(
obj=self.test_message, permission=permission_message_view
)
response = self._request_message_detail_view()
self.assertEqual(response.status_code, status.HTTP_200_OK)
self.assertEqual(response.data['label'], TEST_LABEL)
def _request_message_edit_via_patch_view(self):
return self.patch(
viewname='rest_api:message-detail', kwargs={
'pk': self.test_message.pk
}, data={
'label': TEST_LABEL_EDITED,
'message': TEST_MESSAGE_EDITED
}
)
def test_message_edit_via_patch_view_no_access(self):
self._create_test_message()
response = self._request_message_edit_via_patch_view()
self.assertEqual(response.status_code, status.HTTP_404_NOT_FOUND)
self.test_message.refresh_from_db()
self.assertEqual(self.test_message.label, TEST_LABEL)
self.assertEqual(self.test_message.message, TEST_MESSAGE)
def test_message_edit_via_patch_view_with_access(self):
self._create_test_message()
self.grant_access(
obj=self.test_message, permission=permission_message_edit
)
response = self._request_message_edit_via_patch_view()
self.assertEqual(response.status_code, status.HTTP_200_OK)
self.test_message.refresh_from_db()
self.assertEqual(self.test_message.label, TEST_LABEL_EDITED)
self.assertEqual(self.test_message.message, TEST_MESSAGE_EDITED)
def _request_message_edit_via_put_view(self):
return self.put(
viewname='rest_api:message-detail', kwargs={
'pk': self.test_message.pk
}, data={
'label': TEST_LABEL_EDITED,
'message': TEST_MESSAGE_EDITED
}
)
def test_message_edit_via_put_view_no_access(self):
self._create_test_message()
response = self._request_message_edit_via_put_view()
self.assertEqual(response.status_code, status.HTTP_404_NOT_FOUND)
self.test_message.refresh_from_db()
self.assertEqual(self.test_message.label, TEST_LABEL)
self.assertEqual(self.test_message.message, TEST_MESSAGE)
def test_message_edit_via_put_view_with_access(self):
self._create_test_message()
self.grant_access(
obj=self.test_message, permission=permission_message_edit
)
response = self._request_message_edit_via_put_view()
self.assertEqual(response.status_code, status.HTTP_200_OK)
self.test_message.refresh_from_db()
self.assertEqual(self.test_message.label, TEST_LABEL_EDITED)
self.assertEqual(self.test_message.message, TEST_MESSAGE_EDITED)
| 34.742331
| 74
| 0.694685
| 671
| 5,663
| 5.445604
| 0.104322
| 0.14751
| 0.082102
| 0.071155
| 0.804324
| 0.745211
| 0.708539
| 0.643952
| 0.643952
| 0.643952
| 0
| 0.007699
| 0.220201
| 5,663
| 162
| 75
| 34.95679
| 0.819746
| 0
| 0
| 0.516393
| 0
| 0
| 0.031079
| 0.019954
| 0
| 0
| 0
| 0
| 0.229508
| 1
| 0.122951
| false
| 0
| 0.04918
| 0.040984
| 0.221311
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
b6dceec2e98b65db9e78348fb3495f6169c8700b
| 19
|
py
|
Python
|
Week 8_activity/controller/__init__.py
|
Kenny-WilliamsStockdale/PythonPlay
|
10c64ceba80fe2d0fc22d11288e5a738199b7f75
|
[
"MIT"
] | null | null | null |
Week 8_activity/controller/__init__.py
|
Kenny-WilliamsStockdale/PythonPlay
|
10c64ceba80fe2d0fc22d11288e5a738199b7f75
|
[
"MIT"
] | 1
|
2021-08-10T22:14:55.000Z
|
2021-08-10T22:14:55.000Z
|
Week 8_activity/controller/__init__.py
|
Kenny-WilliamsStockdale/PythonPlay
|
10c64ceba80fe2d0fc22d11288e5a738199b7f75
|
[
"MIT"
] | null | null | null |
__all__ = ["DES"]
| 9.5
| 18
| 0.526316
| 2
| 19
| 3
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.210526
| 19
| 1
| 19
| 19
| 0.4
| 0
| 0
| 0
| 0
| 0
| 0.166667
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
b6e38c9c189753d048a581796cbcc122883ba0a7
| 227
|
py
|
Python
|
task/serializer.py
|
ruchirs/ratestask
|
43e411325fec63e68b80ce68210120fc0fe55307
|
[
"MIT"
] | 1
|
2020-11-19T15:09:23.000Z
|
2020-11-19T15:09:23.000Z
|
task/serializer.py
|
ruchirs/ratestask
|
43e411325fec63e68b80ce68210120fc0fe55307
|
[
"MIT"
] | null | null | null |
task/serializer.py
|
ruchirs/ratestask
|
43e411325fec63e68b80ce68210120fc0fe55307
|
[
"MIT"
] | null | null | null |
from rest_framework import serializers
from .models import Prices
class PriceSerializer(serializers.ModelSerializer):
class Meta:
model = Prices
fields = ('date', 'origin_code', 'destination_code', 'price')
| 32.428571
| 69
| 0.726872
| 24
| 227
| 6.75
| 0.75
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.180617
| 227
| 7
| 69
| 32.428571
| 0.870968
| 0
| 0
| 0
| 0
| 0
| 0.157895
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 0.666667
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
8e360fac589a3025f974276b7180bd86ec6dbd6d
| 405
|
py
|
Python
|
utils/open_sites.py
|
SrGambiarra/KivyStudioDesigner
|
7f617b60aef3d5e99865cb559b9b5ee93a1988f5
|
[
"MIT"
] | 3
|
2022-03-05T21:54:34.000Z
|
2022-03-15T12:55:45.000Z
|
utils/open_sites.py
|
SrGambiarra/KivyStudioDesigner
|
7f617b60aef3d5e99865cb559b9b5ee93a1988f5
|
[
"MIT"
] | 2
|
2022-03-13T04:15:47.000Z
|
2022-03-30T11:51:41.000Z
|
utils/open_sites.py
|
SrGambiarra/KivyStudioDesigner
|
7f617b60aef3d5e99865cb559b9b5ee93a1988f5
|
[
"MIT"
] | null | null | null |
import webbrowser
def open_repo(*args):
'''
Open the Kivy Designer repository
'''
webbrowser.open("https://github.com/kivy/kivy-designer")
def open_docs(*args):
'''
Open the Kivy docs
'''
webbrowser.open("http://kivy.org/docs/")
def open_kd_docs(*args):
'''
Open the Kivy Designer documentation
'''
webbrowser.open("http://kivy-designer.readthedocs.org")
| 21.315789
| 60
| 0.641975
| 50
| 405
| 5.12
| 0.38
| 0.1875
| 0.128906
| 0.175781
| 0.269531
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.2
| 405
| 19
| 61
| 21.315789
| 0.790123
| 0.219753
| 0
| 0
| 0
| 0
| 0.346863
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.428571
| true
| 0
| 0.142857
| 0
| 0.571429
| 0
| 0
| 0
| 0
| null | 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
8e36e19c53569556966794ddee38664662296f13
| 241
|
py
|
Python
|
toontown/ai/HolidayBaseAI.py
|
LittleNed/toontown-stride
|
1252a8f9a8816c1810106006d09c8bdfe6ad1e57
|
[
"Apache-2.0"
] | 3
|
2020-01-02T08:43:36.000Z
|
2020-07-05T08:59:02.000Z
|
toontown/ai/HolidayBaseAI.py
|
NoraTT/Historical-Commits-Project-Altis-Source
|
fe88e6d07edf418f7de6ad5b3d9ecb3d0d285179
|
[
"Apache-2.0"
] | null | null | null |
toontown/ai/HolidayBaseAI.py
|
NoraTT/Historical-Commits-Project-Altis-Source
|
fe88e6d07edf418f7de6ad5b3d9ecb3d0d285179
|
[
"Apache-2.0"
] | 4
|
2019-06-20T23:45:23.000Z
|
2020-10-14T20:30:15.000Z
|
from direct.directnotify.DirectNotifyGlobal import *
class HolidayBaseAI:
def __init__(self, air, holidayId):
self.air = air
self.holidayId = holidayId
def start(self):
pass
def stop(self):
pass
| 20.083333
| 52
| 0.639004
| 26
| 241
| 5.769231
| 0.576923
| 0.093333
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.282158
| 241
| 12
| 53
| 20.083333
| 0.867052
| 0
| 0
| 0.222222
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.333333
| false
| 0.222222
| 0.111111
| 0
| 0.555556
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 1
| 0
|
0
| 4
|
8e48285ab1fdbab0ce5fd0cf1095c92ebb0fc537
| 2,138
|
py
|
Python
|
src/scs_core/aws/data/http_response.py
|
south-coast-science/scs_core
|
81ad4010abb37ca935f3a31ac805639ef53b1bcf
|
[
"MIT"
] | 3
|
2019-03-12T01:59:58.000Z
|
2020-09-12T07:27:42.000Z
|
src/scs_core/aws/data/http_response.py
|
south-coast-science/scs_core
|
81ad4010abb37ca935f3a31ac805639ef53b1bcf
|
[
"MIT"
] | 1
|
2018-04-20T07:58:38.000Z
|
2021-03-27T08:52:45.000Z
|
src/scs_core/aws/data/http_response.py
|
south-coast-science/scs_core
|
81ad4010abb37ca935f3a31ac805639ef53b1bcf
|
[
"MIT"
] | 4
|
2017-09-29T13:08:43.000Z
|
2019-10-09T09:13:58.000Z
|
"""
Created on 23 Apr 2021
@author: Bruno Beloff (bruno.beloff@southcoastscience.com)
https://docs.python.org/3/library/http.html
https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS
"""
from abc import ABC
from http import HTTPStatus
from scs_core.data.json import JSONable, JSONify
# --------------------------------------------------------------------------------------------------------------------
class HTTPResponse(JSONable, ABC):
"""
classdocs
"""
__CORS_HEADERS = { # Cross-Origin Resource Sharing
'Access-Control-Allow-Origin': '*',
'Access-Control-Allow-Credentials': True,
}
# ----------------------------------------------------------------------------------------------------------------
def __init__(self, status, reason=None):
"""
Constructor
"""
self.__status = status # HTTPStatus member
self.__reason = reason # string
# ----------------------------------------------------------------------------------------------------------------
def is_ok(self):
return self.status == HTTPStatus.OK
# ----------------------------------------------------------------------------------------------------------------
def as_http(self, cors=False):
jdict = {
'statusCode': self.status.value,
'body': JSONify.dumps(self)
}
if cors:
jdict['headers'] = self.__CORS_HEADERS
return jdict
def as_json(self):
return {'statusCode': self.status.value}
# ----------------------------------------------------------------------------------------------------------------
@property
def status(self):
return self.__status
@property
def reason(self):
return self.__reason
# ----------------------------------------------------------------------------------------------------------------
def __str__(self, *args, **kwargs):
return "HTTPResponse:{status:%s, reason:%s}" % (self.status, self.reason)
| 27.063291
| 118
| 0.382133
| 153
| 2,138
| 5.169935
| 0.470588
| 0.088496
| 0.053097
| 0.050569
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.004209
| 0.22217
| 2,138
| 78
| 119
| 27.410256
| 0.471437
| 0.440599
| 0
| 0.064516
| 0
| 0
| 0.110333
| 0.07268
| 0
| 0
| 0
| 0
| 0
| 1
| 0.225806
| false
| 0
| 0.096774
| 0.16129
| 0.580645
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 1
| 0
|
0
| 4
|
8e503607f525fe8b7db40e876ce2139a6a8bde5e
| 111
|
py
|
Python
|
configurations/auth.py
|
ValentineSean/product-catalog-api
|
7bd50555eba390a25920983daf01ee05a89cbf5f
|
[
"Apache-2.0"
] | null | null | null |
configurations/auth.py
|
ValentineSean/product-catalog-api
|
7bd50555eba390a25920983daf01ee05a89cbf5f
|
[
"Apache-2.0"
] | null | null | null |
configurations/auth.py
|
ValentineSean/product-catalog-api
|
7bd50555eba390a25920983daf01ee05a89cbf5f
|
[
"Apache-2.0"
] | null | null | null |
from flask_jwt_extended import JWTManager
from flask_bcrypt import Bcrypt
jwt = JWTManager()
bcrypt = Bcrypt()
| 22.2
| 41
| 0.81982
| 15
| 111
| 5.866667
| 0.466667
| 0.204545
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.126126
| 111
| 5
| 42
| 22.2
| 0.907216
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.5
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
f3dee8d4b998b40b2167ddd645732a0ad3fd79fb
| 9,930
|
py
|
Python
|
examples/ui/twente_temperature.py
|
abhishekgahlot/flexx
|
27a995603b5e9d758f9d38eababcc626aa661299
|
[
"BSD-2-Clause"
] | 1
|
2015-11-05T19:17:37.000Z
|
2015-11-05T19:17:37.000Z
|
examples/ui/twente_temperature.py
|
abhishekgahlot/flexx
|
27a995603b5e9d758f9d38eababcc626aa661299
|
[
"BSD-2-Clause"
] | null | null | null |
examples/ui/twente_temperature.py
|
abhishekgahlot/flexx
|
27a995603b5e9d758f9d38eababcc626aa661299
|
[
"BSD-2-Clause"
] | null | null | null |
"""
Examample data-viz app. It shows real temperature data from the region
where I live. The data are monthly average temperatures for the pas 65
years. The month can be selected with a slider. Via another slider, the
data can be smoothed so the upward trend can be made more apparent.
This app can be exported to a standalone HTML document.
"""
from flexx import app, ui, react
# Raw data obtained from
# http://www.knmi.nl/klimatologie/maandgegevens/datafiles/mndgeg_290_tg.txt
raw_data = """
Deze gegevens mogen vrij worden gebruikt mits de volgende bronvermelding wordt gegeven:
KONINKLIJK NEDERLANDS METEOROLOGISCH INSTITUUT (KNMI)
These data can be used freely provided that the following source is acknowledged:
ROYAL NETHERLANDS METEOROLOGICAL INSTITUTE
MAAND- en JAARGEMIDDELDE TEMPERATUREN (0.1 graden Celsius)
MONTHLY AND YEARLY MEAN TEMPERATURES (0.1 degrees Celsius)
STN = stationsnummer / WMO-number = 06... (235=De Kooy,240=Schiphol,260=De Bilt,270=Leeuwarden,280=Eelde,
290=Twenthe,310=Vlissingen,344=Rotterdam,370=Eindhoven,380=Maastricht)
STN,YYYY, JAN, FEB, MAR, APR, MAY, JUN, JUL, AUG, SEP, OCT, NOV, DEC, YEAR
290,1951, 35, 35, 34, 74, 120, 154, 169, 171, 155, 85, 82, 44, 97
290,1952, 19, 20, 43, 107, 129, 149, 172, 173, 111, 80, 23, 10, 86
290,1953, 11, 15, 47, 91, 133, 162, 170, 167, 140, 115, 71, 48, 98
290,1954, -11, -10, 57, 65, 128, 156, 142, 160, 138, 116, 65, 51, 88
290,1955, -1, -5, 16, 82, 100, 146, 179, 181, 146, 92, 58, 42, 86
290,1956, 17, -71, 50, 50, 127, 130, 166, 140, 146, 94, 46, 49, 79
290,1957, 32, 49, 80, 83, 102, 166, 176, 156, 124, 107, 60, 24, 97
290,1958, 16, 32, 15, 62, 129, 148, 168, 177, 157, 109, 54, 44, 93
290,1959, 12, 7, 72, 103, 131, 164, 192, 180, 156, 111, 52, 39, 102
290,1960, 21, 25, 55, 88, 130, 161, 153, 155, 133, 107, 73, 26, 94
290,1961, 14, 61, 71, 104, 106, 157, 152, 158, 172, 114, 45, 8, 97
290,1962, 31, 21, 14, 80, 99, 135, 145, 152, 127, 104, 39, -14, 78
290,1963, -63, -38, 45, 91, 112, 158, 165, 153, 137, 91, 81, -15, 76
290,1964, -1, 28, 23, 91, 143, 156, 169, 161, 142, 78, 58, 20, 89
290,1965, 24, 11, 37, 76, 117, 150, 147, 152, 131, 98, 19, 38, 83
290,1966, -3, 37, 46, 87, 135, 171, 155, 158, 134, 111, 38, 36, 92
290,1967, 32, 48, 64, 70, 128, 146, 181, 163, 141, 116, 47, 25, 97
290,1968, 7, 13, 59, 95, 106, 155, 161, 168, 142, 111, 50, -7, 88
290,1969, 37, -7, 13, 77, 129, 145, 175, 168, 137, 115, 60, -25, 85
290,1970, -4, 4, 21, 56, 125, 170, 154, 165, 136, 99, 72, 18, 85
290,1971, 22, 32, 23, 78, 138, 138, 170, 171, 125, 97, 46, 50, 91
290,1972, -3, 34, 61, 71, 116, 137, 172, 151, 108, 82, 53, 32, 85
290,1973, 23, 23, 49, 54, 119, 160, 171, 176, 145, 83, 49, 23, 90
290,1974, 51, 42, 55, 85, 112, 143, 147, 164, 129, 64, 62, 66, 93
290,1975, 62, 27, 43, 69, 108, 147, 176, 195, 148, 77, 45, 23, 93
290,1976, 26, 19, 22, 71, 129, 173, 188, 170, 134, 107, 61, 7, 92
290,1977, 22, 45, 68, 60, 117, 143, 161, 158, 126, 114, 61, 42, 93
290,1978, 27, 2, 61, 67, 121, 145, 150, 147, 136, 110, 66, 13, 87
290,1979, -39, -22, 41, 73, 116, 150, 150, 151, 125, 96, 45, 46, 78
290,1980, -8, 38, 38, 74, 115, 145, 153, 166, 146, 87, 42, 29, 85
290,1981, 16, 9, 81, 87, 138, 147, 163, 164, 148, 85, 60, -10, 91
290,1982, 3, 23, 50, 71, 122, 161, 186, 169, 160, 112, 76, 31, 97
290,1983, 57, 0, 56, 89, 111, 159, 191, 174, 134, 94, 54, 27, 96
290,1984, 23, 14, 33, 71, 100, 129, 150, 168, 124, 109, 73, 35, 86
290,1985, -46, -14, 35, 81, 132, 131, 165, 150, 132, 97, 17, 52, 78
290,1986, 16, -46, 45, 68, 137, 160, 162, 151, 105, 109, 77, 41, 85
290,1987, -40, 17, 13, 103, 99, 137, 163, 155, 145, 104, 61, 38, 83
290,1988, 58, 42, 43, 81, 144, 145, 160, 166, 139, 104, 53, 55, 99
290,1989, 41, 48, 77, 65, 138, 159, 178, 171, 154, 122, 50, 44, 104
290,1990, 50, 73, 79, 84, 138, 151, 161, 182, 122, 119, 54, 35, 104
290,1991, 29, -9, 83, 81, 97, 126, 188, 173, 147, 94, 50, 32, 91
290,1992, 22, 47, 64, 83, 154, 170, 182, 180, 143, 73, 74, 33, 102
290,1993, 42, 12, 51, 112, 142, 152, 157, 146, 125, 86, 15, 44, 90
290,1994, 44, 6, 70, 81, 123, 151, 213, 174, 133, 86, 87, 48, 101
290,1995, 27, 60, 46, 89, 124, 145, 200, 187, 136, 124, 55, -16, 98
290,1996, -16, -10, 23, 89, 106, 151, 161, 175, 115, 99, 52, -6, 78
290,1997, -17, 58, 72, 70, 124, 157, 173, 201, 134, 89, 57, 41, 97
290,1998, 43, 57, 67, 90, 144, 155, 159, 160, 144, 90, 29, 35, 98
290,1999, 45, 26, 66, 97, 135, 149, 188, 172, 177, 101, 59, 41, 105
290,2000, 37, 52, 63, 102, 145, 160, 152, 169, 150, 111, 77, 46, 105
290,2001, 22, 37, 42, 79, 140, 147, 183, 183, 128, 140, 61, 21, 99
290,2002, 39, 65, 64, 89, 135, 167, 174, 186, 139, 86, 71, 16, 103
290,2003, 16, 7, 68, 93, 134, 179, 185, 193, 139, 66, 78, 33, 99
290,2004, 27, 40, 53, 103, 116, 152, 165, 188, 149, 110, 54, 27, 99
290,2005, 43, 14, 58, 102, 125, 162, 176, 157, 152, 129, 61, 33, 101
290,2006, 4, 18, 32, 85, 143, 168, 222, 159, 177, 136, 88, 62, 108
290,2007, 61, 54, 74, 125, 139, 174, 169, 168, 133, 93, 61, 31, 107
290,2008, 59, 47, 53, 83, 150, 164, 180, 173, 131, 97, 62, 18, 101
290,2009, 1, 26, 55, 125, 137, 153, 178, 182, 144, 93, 94, 17, 100
290,2010, -17, 9, 58, 93, 100, 164, 204, 164, 126, 95, 52, -27, 85
290,2011, 27, 36, 52, 124, 138, 162, 158, 168, 152, 106, 60, 55, 103
290,2012, 36, 1, 77, 82, 145, 145, 169, 184, 134, 96, 64, 41, 98
290,2013, 15, 9, 12, 82, 116, 154, 188, 179, 138, 118, 59, 55, 94
290,2014, 48, 64, 81, 118, 127, 157, 195, 157, 153, 132, 80, 41, 113
"""
def parse_data(raw_data):
years, data = [], [[] for i in range(13)]
for line in raw_data.splitlines():
if line.startswith('290'):
parts = [int(i.strip()) for i in line.split(',')]
years.append(parts[1])
for i in range(13):
data[i].append(parts[i+2]/10.0)
return years, data
years, data = parse_data(raw_data)
@app.serve
class Twente(ui.Widget):
def init(self):
with ui.HBox():
ui.Widget(flex=1)
with ui.VBox():
with ui.Panel(title='Plot options'):
with ui.VBox():
self.month_label = ui.Label(text='Month')
self.month = ui.Slider(max=12, step=1)
self.smoothing_label = ui.Label(text='Smoothing')
self.smoothing = ui.Slider(max=20, step=2)
ui.Widget(flex=1)
with ui.VBox():
self.plot = ui.PlotWidget(size=(640, 480), xdata=years, yrange=(-5, 20),
title='Average monthly temperature',
xlabel='year', ylabel='temperature (°C)')
ui.Widget(flex=1)
ui.Widget(flex=1)
class JS:
data = data
months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec', 'total']
@react.connect('month.value', 'smoothing.value')
def _update_plot(self, month, smoothing):
self.month_label.text('Month (%s)' % self.months[month])
self.smoothing_label.text('Smoothing (%i)' % smoothing)
yy1 = self.data[month]
yy2 = []
sm2 = int(smoothing / 2)
for i in range(len(yy1)):
val = 0
n = 0
for j in range(max(0, i-sm2), min(len(yy1), i+sm2+1)):
val += yy1[j]
n += 1
if n == 0:
yy2.append(yy1[i])
else:
yy2.append(val / n)
self.plot.ydata(yy2)
if __name__ == '__main__':
m = app.launch(Twente, title='Temperature 1951 - 2014', size=(900, 400))
m.bgcolor('#eee') # more desktop-like
app.run()
| 61.296296
| 110
| 0.445317
| 1,411
| 9,930
| 3.119064
| 0.330971
| 0.006817
| 0.005453
| 0.011816
| 0.03272
| 0.026812
| 0.026812
| 0.01636
| 0.01636
| 0.01636
| 0
| 0.444021
| 0.418026
| 9,930
| 161
| 111
| 61.677019
| 0.317356
| 0.04572
| 0
| 0.053846
| 0
| 0.507692
| 0.768857
| 0.0131
| 0
| 0
| 0
| 0
| 0
| 1
| 0.023077
| false
| 0
| 0.007692
| 0
| 0.053846
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
f3e4a15c6cb96e12cf5361e321a719f097854df1
| 5,948
|
py
|
Python
|
DailyProgrammer/DP20160926A.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | 2
|
2020-12-23T18:59:22.000Z
|
2021-04-14T13:16:09.000Z
|
DailyProgrammer/DP20160926A.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | null | null | null |
DailyProgrammer/DP20160926A.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | null | null | null |
"""
[2016-09-26] Challenge #285 [Easy] Cross Platform/Language Data Encoding part 1
https://www.reddit.com/r/dailyprogrammer/comments/54lu54/20160926_challenge_285_easy_cross/
We will make a binary byte oriented encoding of data that is self describing and extensible, and aims to solve the
following problems:
* portability between 32 and 64 (and any other) bit systems, and languages, and endian-ness.
* type system independent of underlying language.
* Allow heterogeneous arrays (differing types of array elements) where the underlying language has poor support for
them.
* leverage power of homogeneous arrays in a language.
* support records regardless of underlying language (array of records is homogeneous, even though a record is a
heterogeneous list of fields)
* Allow ragged arrays (a table where each row is a list, but the rows do not have a uniform size (or shape))
* Provide basic in memory compression. Allow deferred decoding of partial data.
# 1. base64 encoding (used in later challenges)
To read and write binary data on reddit, we will use base64 encoding,
https://www.reddit.com/r/dailyprogrammer/comments/4xy6i1/20160816_challenge_279_easy_uuencoding/
# 2. Extendible byte base.
Any size integer can be coded into a variable byte array by using the maximum byte value as a marker to add the next
byte value to decode the total.
This is useful for coding numbers that you think can be limited to around 255 or close to it, without being "hard
constrained" by that limit. "256 possible op codes (or characters) ought to be enough for everyone forever thinking"
**unsigned byte input**
12
255
256
510
512 44 1024
last input is a list of 3 integers to encode
**sample outputs**
12
255 0
255 1
255 255 0
255 255 2 44 255 255 255 255 4
every element that is not 255 marks the end of "that integer" in a list. You should also write a decoder that
transforms output into input.
# 3. multibyte and variable byte encodings
Instead of a single byte target encoding, 2,4,8 and variable defined byte sizes are also desirable to cover integers
with larger ranges. An account balance might have a 40 bit practical limit, but you might not guarantee it forever.
64 bits might not be enough for Zimbabwe currency balances for example.
For compressing a list of numbers, often it is useful to set the whole list to one "byte size". Other choices include,
* setting an enum/table of possible byte size codings of 1 2 4 8 sizes, and then encoding, the number of elements, the
table/enum size and definition, and then 2 lists (enum key, data items)
* interleave bytesize, data
The latter will often be longer for long lists, but does not encode the table so is simpler to encode/decode.
**Encoding format for table definition:**
1. 4 bytes: first 30 bits - length of list. last 2 bits: key into 1 2 4 8. If first 30 bits are max value, then
following 4 bytes are added to count until a non-max value is taken. Similar to challenge #2.
2. list of byte lengths defined by key in 1. If last 2 bits of 1 are 3 (signifies up to 8 distinct integer sizes),
then this list has 8 items. If there only 6 distinct integer size codings, then the last 2 items in this list would be
ignored and set to 0. Values over 255 are encoded as in challenge 2.
3. list of ordered data encodings in boolean form, if there are more than 1. 1 bit for 2, 2 bits for 4, 3 bits for 8.
4. list of data elements.
**challenges**
encode list of integers from 0 to 1025 using 8 or 16 bit variable encoding. With the shortest encoding that will
contain the number. Just print the sum of all the bytes as result for output brevity.
**solution**
1. first 4 bytes are (1025 * 4) + 1 (leading 0 bytes for smaller than "full size" numbers)
2. 2 byte list: 1 2
3. 0 for first 256 bits, 1 for remaining bits (total 1032 bits long with padding)
4. 256 + (769 * 2) bytes long encoding of the numbers.
# 4. balanced signed numbers
Some numbers are negative. The common computer encoding for signed number ranges is to subtract half the max power of
2 from the value. A signed byte has range -128 to 127, where a 0 value corresponds to -128 (in our encoding).
For numbers outside this range encoded in a single byte, the process is to take the first byte to determine the sign,
and then following bytes add or subtract up to 255 per byte until a non 255 value is reached.
# 5. unbalanced signed numbers
Instead of the midpoint marking 0, a byte can encode a value within any defined range.
Another important application is to use "negative" numbers as codes of some sort. These include:
* An expectation that negative numbers are less frequent and smaller relative to 0
* coding special values such as null, infinity, undeterminable (0/0)
* Using codes to hint at extended byte encodings and sign of the number, or even data type
**sample 0 index codes** (for 16 reserved codes) (new paragraph for multiline explained codes)
Null
Infinity
Negative Infinity
Negative 1 byte
Negative 2 bytes
Negative 4 bytes
Negative 8 bytes
Negative custom byte length (value is encoded into 2 numbers. First is byte length (in 255 terminated bytes, followed
by that number of bytes to represent the number)
Positive 1 byte (first number indicates range of 468 to 723). 467 could have been encoded as 255 254 without this
special code.
Positive 2 byte
Positive 4 byte
Positive 8 byte
Positive 16 byte
Positive 64 byte
Positive custom byte length (3 to 262 excluding other defined lengths)
Positive custom 2 byte length (16 bit unsigned number defines byte length of number, followed by encoded number)
**sample inputs**
10
123123
-55
Null
**sample output**
26
9 123123
3 54 (minimum range value is -1)
0
**challenge input**
192387198237192837192837192387123817239182737 _44 981237123
array of 3 numbers (_44 is -44) to be encoded
"""
def main():
pass
if __name__ == "__main__":
main()
| 50.837607
| 120
| 0.763618
| 1,022
| 5,948
| 4.426614
| 0.350294
| 0.009284
| 0.001989
| 0.009284
| 0.018126
| 0.018126
| 0.018126
| 0
| 0
| 0
| 0
| 0.074174
| 0.19082
| 5,948
| 116
| 121
| 51.275862
| 0.86578
| 0.987727
| 0
| 0
| 0
| 0
| 0.125
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.25
| true
| 0.25
| 0
| 0
| 0.25
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
f3e52e8dfa92aa4a0885ad4bdd0caacd1478d83d
| 156
|
py
|
Python
|
pm4pymdl/algo/mvp/gen_framework/edge_freq/__init__.py
|
dorian1000/pm4py-mdl
|
71e0c2425abb183da293a58d31e25e50137c774f
|
[
"MIT"
] | 5
|
2021-01-31T22:45:29.000Z
|
2022-02-22T14:26:06.000Z
|
pm4pymdl/algo/mvp/gen_framework/edge_freq/__init__.py
|
Javert899/pm4py-mdl
|
4cc875999100f3f1ad60b925a20e40cf52337757
|
[
"MIT"
] | 3
|
2021-07-07T15:32:55.000Z
|
2021-07-07T16:15:36.000Z
|
pm4pymdl/algo/mvp/gen_framework/edge_freq/__init__.py
|
dorian1000/pm4py-mdl
|
71e0c2425abb183da293a58d31e25e50137c774f
|
[
"MIT"
] | 9
|
2020-09-23T15:34:11.000Z
|
2022-03-17T09:15:40.000Z
|
from pm4pymdl.algo.mvp.gen_framework.edge_freq import edge_freq_builder, type11, type12, type13, type211, type212, type221, \
type222, type231, type232
| 52
| 125
| 0.794872
| 21
| 156
| 5.714286
| 0.904762
| 0.133333
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.181159
| 0.115385
| 156
| 2
| 126
| 78
| 0.688406
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.5
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
6d2b872bff6c9060195409fbdcef0db70610fac6
| 151
|
py
|
Python
|
sandbox/lib/jumpscale/JumpscaleLibs/clients/gitea/GiteaRepoForNonOwner.py
|
threefoldtech/threebot_prebuilt
|
1f0e1c65c14cef079cd80f73927d7c8318755c48
|
[
"Apache-2.0"
] | null | null | null |
sandbox/lib/jumpscale/JumpscaleLibs/clients/gitea/GiteaRepoForNonOwner.py
|
threefoldtech/threebot_prebuilt
|
1f0e1c65c14cef079cd80f73927d7c8318755c48
|
[
"Apache-2.0"
] | 117
|
2019-09-01T11:59:19.000Z
|
2020-07-14T11:10:08.000Z
|
sandbox/lib/jumpscale/JumpscaleLibs/clients/gitea/GiteaRepoForNonOwner.py
|
threefoldtech/threebot_prebuilt
|
1f0e1c65c14cef079cd80f73927d7c8318755c48
|
[
"Apache-2.0"
] | 2
|
2020-04-06T15:21:23.000Z
|
2020-05-07T04:29:53.000Z
|
import json
from Jumpscale import j
from .GiteaRepo import GiteaRepo
JSBASE = j.baseclasses.object
class GiteaRepoForNonOwner(GiteaRepo):
pass
| 13.727273
| 38
| 0.794702
| 18
| 151
| 6.666667
| 0.666667
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.15894
| 151
| 10
| 39
| 15.1
| 0.944882
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0.166667
| 0.5
| 0
| 0.666667
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 1
| 0
|
0
| 4
|
6d3bc7320a841574284a3da1dffa188fee310518
| 2,330
|
py
|
Python
|
vacker/media/media.py
|
MatthewJohn/vacker
|
96746a20041035a87cb64518a9f1d3e4b3a46df4
|
[
"Apache-2.0"
] | 1
|
2022-01-24T04:46:14.000Z
|
2022-01-24T04:46:14.000Z
|
vacker/media/media.py
|
MatthewJohn/vacker
|
96746a20041035a87cb64518a9f1d3e4b3a46df4
|
[
"Apache-2.0"
] | 17
|
2017-10-14T11:40:45.000Z
|
2022-03-12T13:16:31.000Z
|
vacker/media/media.py
|
MatthewJohn/vacker
|
96746a20041035a87cb64518a9f1d3e4b3a46df4
|
[
"Apache-2.0"
] | null | null | null |
from bson.objectid import ObjectId
import datetime
import vacker.file_factory
import vacker.database
import vacker.config
from vacker.media import File
class Media(File):
def update_sets(self):
if not self.get_date():
return
database_connection = vacker.database.Database.get_database()
file_factory = vacker.file_factory.FileFactory()
surround_media = file_factory.get_media_date_range(
self.get_date(), datetime.timedelta(seconds=vacker.config.Config.get('DEFAULT_SET_INTERVAL'))
)
surround_media.sort(key=lambda x: x['datetime'])
sets = [x['set_id'] for x in surround_media if x['set_id'] is not None]
# Create set/get set ID and update all media
set_id = sets[0] if len(sets) else database_connection.sets.insert_one({'auto': True, 'backup_state': False, 'name': '', 'hidden': False}).inserted_id
database_connection.media.update({'_id': {'$in': [x['_id'] for x in surround_media]}},
{'$set': {'set_id': set_id}}, multi=True)
database_connection.media.update({'set_id': {'$in': sets}},
{'$set': {'set_id': set_id}}, multi=True)
def update_events(self):
if not self.get_date():
return
database_connection = vacker.database.Database.get_database()
file_factory = vacker.file_factory.FileFactory()
surround_media = file_factory.get_media_date_range(
self.get_date(), datetime.timedelta(seconds=vacker.config.Config.get('DEFAULT_EVENT_INTERVAL'))
)
surround_media.sort(key=lambda x: x['datetime'])
events = [x['event_id'] for x in surround_media if x['event_id'] is not None]
# Create set/get set ID and update all media
event_id = events[0] if len(events) else database_connection.events.insert_one({'auto': True, 'backup_state': False, 'name': '', 'hidden': False}).inserted_id
database_connection.media.update({'_id': {'$in': [x['_id'] for x in surround_media]}},
{'$set': {'event_id': event_id}}, multi=True)
database_connection.media.update({'set_id': {'$in': events}},
{'$set': {'event_id': event_id}}, multi=True)
| 47.55102
| 166
| 0.619313
| 295
| 2,330
| 4.664407
| 0.19661
| 0.039971
| 0.031977
| 0.023256
| 0.770349
| 0.770349
| 0.770349
| 0.72093
| 0.686047
| 0.622093
| 0
| 0.00114
| 0.246781
| 2,330
| 48
| 167
| 48.541667
| 0.782906
| 0.036481
| 0
| 0.486486
| 0
| 0
| 0.097321
| 0.009821
| 0
| 0
| 0
| 0
| 0
| 1
| 0.054054
| false
| 0
| 0.162162
| 0
| 0.297297
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
6d477c07768ce0f1e99a8a613ebd411b3ecf72e9
| 839
|
py
|
Python
|
src/boardcomputer/frontend/WebStream.py
|
eddex/pren2
|
336afade5a6f46eb955b1e9c0c1e5ebda9e19b9b
|
[
"MIT"
] | null | null | null |
src/boardcomputer/frontend/WebStream.py
|
eddex/pren2
|
336afade5a6f46eb955b1e9c0c1e5ebda9e19b9b
|
[
"MIT"
] | null | null | null |
src/boardcomputer/frontend/WebStream.py
|
eddex/pren2
|
336afade5a6f46eb955b1e9c0c1e5ebda9e19b9b
|
[
"MIT"
] | null | null | null |
import socketio
class WebStream:
def __init__(self, url: str):
"""
Interface for Logging on Web Server
Args:
url: URL of Webserver 'http://192.168.10.1:5000'
"""
self.sio = socketio.Client()
self.sio.connect('http://192.168.10.1:5000')
def write(self, msg):
self.sio.emit('message', msg)
def flush(self):
pass
def close(self):
self.sio.disconnect()
class WebLoggerStream:
def __init__(self, socket):
"""
Interface for Logging on Web Server
Args:
socket: URL of Webserver 'http://192.168.10.1:5000'
"""
self.sio = socket
def write(self, msg):
self.sio.emit('message', msg)
def flush(self):
pass
def close(self):
self.sio.disconnect()
| 18.644444
| 63
| 0.543504
| 103
| 839
| 4.349515
| 0.359223
| 0.109375
| 0.066964
| 0.080357
| 0.720982
| 0.720982
| 0.683036
| 0.53125
| 0.53125
| 0.53125
| 0
| 0.069272
| 0.328963
| 839
| 44
| 64
| 19.068182
| 0.726465
| 0.231228
| 0
| 0.6
| 0
| 0
| 0.067138
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.4
| false
| 0.1
| 0.05
| 0
| 0.55
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 1
| 0
|
0
| 4
|
6d47f0eb39c1922df58cb4141cabcf1e0054d386
| 320
|
py
|
Python
|
Python/Network_Programming.py
|
mmoccaro/Network_Programming
|
58c40574a7cb54eaa7b30bdf510d51bb891acd45
|
[
"Apache-2.0"
] | null | null | null |
Python/Network_Programming.py
|
mmoccaro/Network_Programming
|
58c40574a7cb54eaa7b30bdf510d51bb891acd45
|
[
"Apache-2.0"
] | null | null | null |
Python/Network_Programming.py
|
mmoccaro/Network_Programming
|
58c40574a7cb54eaa7b30bdf510d51bb891acd45
|
[
"Apache-2.0"
] | null | null | null |
# * =======================
# *
# * Author: Matthew Moccaro
# * File: Network_Programming.py
# * Type: Python Source File
# *
# * Creation Date: 1/2/19
# *
# * Description: Python
# * source file for the
# * network programming
# * project.
# *
# * ======================
print("Network Programming For Python")
| 18.823529
| 39
| 0.534375
| 30
| 320
| 5.666667
| 0.666667
| 0.317647
| 0.188235
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.015564
| 0.196875
| 320
| 16
| 40
| 20
| 0.645914
| 0.78125
| 0
| 0
| 0
| 0
| 0.545455
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
6d4e55cf1cf620ffb5944f026fd8cdd1d8f92853
| 60
|
py
|
Python
|
code/CM1_affiche.py
|
christophesaintjean/IntroProgS1_2020
|
99555d1e3681d88ee023592a16caecdec6f7c0b4
|
[
"CC0-1.0"
] | null | null | null |
code/CM1_affiche.py
|
christophesaintjean/IntroProgS1_2020
|
99555d1e3681d88ee023592a16caecdec6f7c0b4
|
[
"CC0-1.0"
] | null | null | null |
code/CM1_affiche.py
|
christophesaintjean/IntroProgS1_2020
|
99555d1e3681d88ee023592a16caecdec6f7c0b4
|
[
"CC0-1.0"
] | null | null | null |
print("Mon premier")
print("programme")
print("est affiche")
| 20
| 20
| 0.733333
| 8
| 60
| 5.5
| 0.75
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.066667
| 60
| 3
| 21
| 20
| 0.785714
| 0
| 0
| 0
| 0
| 0
| 0.508197
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
6d55705e682bea97b396a5838e11febf6a5504e9
| 158
|
py
|
Python
|
sht_sensor/__main__.py
|
mk-fg/sht-sensor
|
5a8f2fd7ca874d275f6890a55f7dc94ee8b04dd6
|
[
"WTFPL"
] | 13
|
2015-11-04T16:39:31.000Z
|
2018-09-08T19:07:39.000Z
|
sht_sensor/__main__.py
|
mk-fg/sht-sensor
|
5a8f2fd7ca874d275f6890a55f7dc94ee8b04dd6
|
[
"WTFPL"
] | 9
|
2016-02-05T19:20:08.000Z
|
2018-03-31T05:11:19.000Z
|
sht_sensor/__main__.py
|
kizniche/sht-sensor
|
e44758327eec781297e68f3f59b6937b7c5758e3
|
[
"WTFPL"
] | 3
|
2015-11-02T21:58:07.000Z
|
2018-03-31T01:19:22.000Z
|
# -*- coding: utf-8 -*-
from __future__ import print_function
from sht_sensor.sensor import main
import os, sys
if __name__ == '__main__': sys.exit(main())
| 19.75
| 43
| 0.721519
| 23
| 158
| 4.347826
| 0.695652
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.007407
| 0.14557
| 158
| 7
| 44
| 22.571429
| 0.733333
| 0.132911
| 0
| 0
| 0
| 0
| 0.059259
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.75
| 0
| 0.75
| 0.25
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
6d55a2e77bdf23d00009f5ba560ff82d1226f63c
| 234
|
py
|
Python
|
asynctb/__init__.py
|
shamrin/asynctb
|
d06a77cb2e496108e73adc65e27d1d313592685a
|
[
"Apache-2.0",
"MIT"
] | 6
|
2020-07-02T16:43:15.000Z
|
2021-11-29T06:30:57.000Z
|
asynctb/__init__.py
|
shamrin/asynctb
|
d06a77cb2e496108e73adc65e27d1d313592685a
|
[
"Apache-2.0",
"MIT"
] | 2
|
2020-07-02T09:00:50.000Z
|
2020-07-26T06:39:09.000Z
|
asynctb/__init__.py
|
shamrin/asynctb
|
d06a77cb2e496108e73adc65e27d1d313592685a
|
[
"Apache-2.0",
"MIT"
] | 2
|
2020-07-05T01:25:37.000Z
|
2021-01-26T08:00:06.000Z
|
from ._version import __version__
from ._traceback import FrameInfo, Traceback
from ._registry import (
register_unwrap_awaitable,
register_unwrap_context_manager,
register_get_target,
customize,
)
from . import _glue
| 23.4
| 44
| 0.790598
| 26
| 234
| 6.538462
| 0.576923
| 0.164706
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.162393
| 234
| 9
| 45
| 26
| 0.867347
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.444444
| 0
| 0.444444
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
ed914a2d738e15f32235a6cdd6eb054c4244ed44
| 100
|
py
|
Python
|
createTrend/Views_Predict/apps.py
|
junkwon-dev/createTrend_backend
|
8ec550c4c5d38f898ad0285045a57e50ad30fcdb
|
[
"MIT",
"Apache-2.0",
"BSD-3-Clause"
] | null | null | null |
createTrend/Views_Predict/apps.py
|
junkwon-dev/createTrend_backend
|
8ec550c4c5d38f898ad0285045a57e50ad30fcdb
|
[
"MIT",
"Apache-2.0",
"BSD-3-Clause"
] | null | null | null |
createTrend/Views_Predict/apps.py
|
junkwon-dev/createTrend_backend
|
8ec550c4c5d38f898ad0285045a57e50ad30fcdb
|
[
"MIT",
"Apache-2.0",
"BSD-3-Clause"
] | null | null | null |
from django.apps import AppConfig
class ViewsPredictConfig(AppConfig):
name = 'Views_Predict'
| 16.666667
| 36
| 0.78
| 11
| 100
| 7
| 0.909091
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.15
| 100
| 5
| 37
| 20
| 0.905882
| 0
| 0
| 0
| 0
| 0
| 0.13
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
6109d7f30755e74e960aa4b12f2fc1fefd4b43f2
| 40
|
py
|
Python
|
coders.py
|
shabd07/Python-code
|
63538c393ea05ad5d49599b944d8babd9dcf2a61
|
[
"MIT"
] | null | null | null |
coders.py
|
shabd07/Python-code
|
63538c393ea05ad5d49599b944d8babd9dcf2a61
|
[
"MIT"
] | null | null | null |
coders.py
|
shabd07/Python-code
|
63538c393ea05ad5d49599b944d8babd9dcf2a61
|
[
"MIT"
] | null | null | null |
a = input("enter your name: ")
print(a)
| 20
| 31
| 0.625
| 7
| 40
| 3.571429
| 0.857143
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.175
| 40
| 2
| 32
| 20
| 0.757576
| 0
| 0
| 0
| 0
| 0
| 0.425
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0.5
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
610f5b5b4f29fdbf051dfd4b439275a2c68a1464
| 1,735
|
py
|
Python
|
resp_base/Constraints.py
|
probablytom/msci-model
|
243f35dcfb1cb3704140e7616e0e767958875a08
|
[
"MIT"
] | null | null | null |
resp_base/Constraints.py
|
probablytom/msci-model
|
243f35dcfb1cb3704140e7616e0e767958875a08
|
[
"MIT"
] | null | null | null |
resp_base/Constraints.py
|
probablytom/msci-model
|
243f35dcfb1cb3704140e7616e0e767958875a08
|
[
"MIT"
] | null | null | null |
from abc import ABCMeta
from theatre_ag.theatre_ag import SynchronizingClock
class ImproperImportanceResetError(Exception):
pass
class AbstractConstraint:
__metaclass__ = ABCMeta
def __init__(self, factors: dict):
self.factors = factors
self.outcome = None
self.interpreted = False
self.original_importance = None
self.importance = None
def assign_importance(self, importance):
self.original_importance = self.importance
self.importance = importance
# Only assign if we haven't already.
if self.original_importance is None:
self.original_importance = importance # If this is the first assignment, keep track of the true original importance
self.interpreted = True
def reset_importance(self, new_score=None):
self.importance = self.original_importance
self.original_importance = None
self.interpreted = False
if new_score is not None:
self.assign_importance(new_score)
def record_outcome(self, outcome):
self.outcome = outcome
class Deadline(AbstractConstraint):
def __init__(self,
duration: int,
timeline: SynchronizingClock):
super().__init__({}) # Deadlines have only one factor, which is special
# This needs to be changed to time assigned
self.time_created = timeline.current_tick
self.timeline = timeline
self.duration = duration
# TODO: REMOVE THIS IN FAVOUR OF AGENT-BASED EVALUATION
def evaluate(self):
return self.factors['length'] < \
(self.timeline.current_tick - self.time_created)
class ResourceDelta(AbstractConstraint):
pass
| 29.913793
| 128
| 0.675504
| 191
| 1,735
| 5.95288
| 0.397906
| 0.098505
| 0.116095
| 0.084433
| 0.119613
| 0.070361
| 0
| 0
| 0
| 0
| 0
| 0
| 0.259942
| 1,735
| 57
| 129
| 30.438596
| 0.885514
| 0.146974
| 0
| 0.153846
| 0
| 0
| 0.004071
| 0
| 0
| 0
| 0
| 0.017544
| 0
| 1
| 0.153846
| false
| 0.051282
| 0.358974
| 0.025641
| 0.666667
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 1
| 0
|
0
| 4
|
61173c64f4145849e07e11a002f4c8c1b30c97c9
| 91
|
py
|
Python
|
Variables/3.2.5.py
|
ferrerinicolas/python_samples
|
107cead4fbee30b275a5e2be1257833129ce5e46
|
[
"MIT"
] | null | null | null |
Variables/3.2.5.py
|
ferrerinicolas/python_samples
|
107cead4fbee30b275a5e2be1257833129ce5e46
|
[
"MIT"
] | null | null | null |
Variables/3.2.5.py
|
ferrerinicolas/python_samples
|
107cead4fbee30b275a5e2be1257833129ce5e46
|
[
"MIT"
] | null | null | null |
string_variable = "Nicolas"
int_variable = 24
print(string_variable)
print(int_variable)
| 13
| 27
| 0.802198
| 12
| 91
| 5.75
| 0.5
| 0.405797
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.024691
| 0.10989
| 91
| 6
| 28
| 15.166667
| 0.82716
| 0
| 0
| 0
| 0
| 0
| 0.077778
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0.5
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
b61f14f815014a78519cd75e692e7a2c8852b020
| 37
|
py
|
Python
|
tests/services/simple_argument.py
|
berry-langerak/nanoinject
|
fc24df7534695fda5e0f078f3f9dd6f8861dcb65
|
[
"MIT"
] | null | null | null |
tests/services/simple_argument.py
|
berry-langerak/nanoinject
|
fc24df7534695fda5e0f078f3f9dd6f8861dcb65
|
[
"MIT"
] | 1
|
2020-03-25T09:58:28.000Z
|
2020-03-25T09:58:28.000Z
|
tests/services/simple_argument.py
|
berry-langerak/nanoinject
|
fc24df7534695fda5e0f078f3f9dd6f8861dcb65
|
[
"MIT"
] | null | null | null |
class SimpleArgument:
answer = 42
| 18.5
| 21
| 0.72973
| 4
| 37
| 6.75
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.068966
| 0.216216
| 37
| 2
| 22
| 18.5
| 0.862069
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 1
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
b6207b39004c8dafcf759f850fefcb23711a3ba5
| 19
|
py
|
Python
|
src/webrepl_cfg.py
|
holgerkenn/TheButtonProject
|
18cfbb37773c05a24a960b87c8677ec26d3160d6
|
[
"MIT"
] | null | null | null |
src/webrepl_cfg.py
|
holgerkenn/TheButtonProject
|
18cfbb37773c05a24a960b87c8677ec26d3160d6
|
[
"MIT"
] | null | null | null |
src/webrepl_cfg.py
|
holgerkenn/TheButtonProject
|
18cfbb37773c05a24a960b87c8677ec26d3160d6
|
[
"MIT"
] | null | null | null |
PASS = 'iotbutton'
| 9.5
| 18
| 0.684211
| 2
| 19
| 6.5
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.157895
| 19
| 1
| 19
| 19
| 0.8125
| 0
| 0
| 0
| 0
| 0
| 0.473684
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 1
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
b621d2763dcf2b9a7d363aaab3dc03bc9168f3c7
| 610
|
py
|
Python
|
tksugar/widgets/__init__.py
|
TakamiChie/TkSugar
|
417af2abef48fa09e7f52375855783fef8e73d56
|
[
"MIT"
] | 2
|
2020-09-11T23:09:00.000Z
|
2021-05-07T12:09:07.000Z
|
tksugar/widgets/__init__.py
|
TakamiChie/TkSugar
|
417af2abef48fa09e7f52375855783fef8e73d56
|
[
"MIT"
] | 7
|
2020-11-17T09:55:36.000Z
|
2021-07-18T14:11:11.000Z
|
tksugar/widgets/__init__.py
|
TakamiChie/TkSugar
|
417af2abef48fa09e7f52375855783fef8e73d56
|
[
"MIT"
] | null | null | null |
"""
Widgets that require Generator-specific custom processing are stored in this package.
For example, widgets such as tkinter.ttk.Notebook that do not display child elements on the GUI just by referencing them with the master argument of child elements are recorded here.
This package is referenced with the highest priority when the Generator is executed.
Therefore, even if there is a widget with the same name in another module, this module will be called.
"""
from tksugar.widgets.generatorsupport import GeneratorSupport
from tksugar.widgets.notebook import Notebook
from tksugar.widgets.menu import Menu
| 67.777778
| 182
| 0.82459
| 93
| 610
| 5.408602
| 0.655914
| 0.04175
| 0.107356
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.139344
| 610
| 9
| 183
| 67.777778
| 0.958095
| 0.747541
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
b6277b938a36af4b7c3b50f0df4a04586b3c1790
| 102
|
py
|
Python
|
fun_zone/other_fun/other_fun.py
|
viktor40/HammerBotPython
|
84b3cbc8fbba05666d81b442078e2281a1e766b1
|
[
"MIT"
] | 3
|
2020-10-29T15:15:55.000Z
|
2020-10-29T21:42:58.000Z
|
fun_zone/other_fun/other_fun.py
|
viktor40/HammerBotPython
|
84b3cbc8fbba05666d81b442078e2281a1e766b1
|
[
"MIT"
] | null | null | null |
fun_zone/other_fun/other_fun.py
|
viktor40/HammerBotPython
|
84b3cbc8fbba05666d81b442078e2281a1e766b1
|
[
"MIT"
] | 2
|
2020-07-14T13:42:47.000Z
|
2020-10-25T16:42:09.000Z
|
from discord.ext import commands
class OtherFun(commands.Cog):
def __init__(self):
pass
| 14.571429
| 32
| 0.696078
| 13
| 102
| 5.153846
| 0.923077
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.22549
| 102
| 6
| 33
| 17
| 0.848101
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.25
| false
| 0.25
| 0.25
| 0
| 0.75
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
b63998a75660414b1a8bc687d44fa83ebb0a0d08
| 40,516
|
py
|
Python
|
code_examples/popart/block_sparse/examples/test_block_sparse.py
|
payoto/graphcore_examples
|
46d2b7687b829778369fc6328170a7b14761e5c6
|
[
"MIT"
] | 260
|
2019-11-18T01:50:00.000Z
|
2022-03-28T23:08:53.000Z
|
code_examples/popart/block_sparse/examples/test_block_sparse.py
|
payoto/graphcore_examples
|
46d2b7687b829778369fc6328170a7b14761e5c6
|
[
"MIT"
] | 27
|
2020-01-28T23:07:50.000Z
|
2022-02-14T15:37:06.000Z
|
code_examples/popart/block_sparse/examples/test_block_sparse.py
|
payoto/graphcore_examples
|
46d2b7687b829778369fc6328170a7b14761e5c6
|
[
"MIT"
] | 56
|
2019-11-18T02:13:12.000Z
|
2022-02-28T14:36:09.000Z
|
# Copyright (c) 2020 Graphcore Ltd. All rights reserved.
import os
import numpy as np
from functools import reduce
from operator import mul
import popart
import pytest
# range for filling blocks
MATRIX_LOW_VALUE = -10
MATRIX_HIGH_VALUE = 10
# library provides support for 3 kinds of sparse MM's
# from set of 2 inputs and one output, 2 of them will be dense
# and the third will be sparse
g_sparseMatMulTypeLookup = {
'DENSE_LHS_SPARSE_RHS_DENSE_OUT': 0,
'DENSE_LHS_DENSE_RHS_SPARSE_OUT': 1,
'SPARSE_LHS_SPARSE_RHS_SPARSE_OUT': 2
}
# g_ -> global
#
g_input_data_type = "float32"
g_output_data_type = "float32"
g_pp_data_type = "float32"
np.set_printoptions(linewidth=500)
g_random_sparse_mask = np.random.RandomState()
g_random_data = np.random.RandomState()
g_random_labels = np.random.RandomState()
"""
Set seeds of random generatorts.
"""
g_random_sparse_mask.seed(1)
g_random_data.seed(1)
g_random_labels.seed(1)
def create_sparse_list(dims, block_size, sparsity, initial_value=0):
"""
dims: dimensions of the sparse matrix
block_size: size of a block (8x8, 16x16 etc)
sparsity: sparsity level (0.4 means 40% of blocks are empty)
returns--
block_sparse_matrix: np.array of num_blocks * block_sz
dense_matrix: np.array if size dim with a dense representation of the matrix.
i.e. explcit zeros for a zero block. Used to perform
dense MM's for a reference output
mask: list with sparsity pattern. size = num_blocks (both dense and sparse)
e.g for a sparse matrix of size (6, 6) with block size 2x2
Matrix contains 9 blocks of size 2x2, some sparse and some dense
If the 6x6 matrices has 2 non zero blocks, then ..
Inputs:
dims = [6, 6]
block_size = [2,2]
sparsity = 0.4 (say)
Outputs:
block_sparse_matrix = 2 x 4 array
dense_matrix = 6x6 array
sparsity = 9x1 list
"""
block_size_row = block_size[0]
block_size_col = block_size[1]
num_block_rows = dims[0] // block_size_row
num_block_cols = dims[1] // block_size_col
assert(sparsity < 1.0)
proportion = [sparsity, 1 - sparsity]
mask = g_random_sparse_mask.choice([0, 1], size=(num_block_rows, num_block_cols), p=proportion)
# dont want mask to be all zeros
while np.all(mask == 0):
mask = g_random_sparse_mask.choice([0, 1], size=(num_block_rows, num_block_cols), p=proportion)
if initial_value == 0:
dense_matrix = np.zeros((num_block_rows * block_size_row,
num_block_cols * block_size_col))
else:
dense_matrix = np.empty((num_block_rows * block_size_row,
num_block_cols * block_size_col))
dense_matrix.fill(initial_value)
block_sparse_matrix = []
for block_row in range(num_block_rows):
for block_col in range(num_block_cols):
if mask[block_row][block_col]:
block_data = g_random_data.randint(low=MATRIX_LOW_VALUE,
high=MATRIX_HIGH_VALUE,
size=block_size_row * block_size_col).astype("float32")
block_sparse_matrix.append(block_data)
dense_matrix[block_row * block_size_row: (block_row+1) * block_size_row,
block_col * block_size_col: (block_col+1) * block_size_col] = block_data.reshape(block_size_row, block_size_col)
# At this point mask is a 2D array, flatten it into 1D list and return, bsr_rhs is already a list (so convert to array)
return np.array(block_sparse_matrix), dense_matrix, mask.flatten().tolist()
def create_dense_matrix(dims):
return g_random_data.randint(low=MATRIX_LOW_VALUE, high=MATRIX_HIGH_VALUE, size=dims).astype(g_input_data_type)
def create_sparse_matrix(nominal_shape, block_size, sparsity, initial_value=0):
"""
Create a sparse_matrix.
Inputs:
nominal_shape: List of dimensions of the sparse tensor e.g (2, 3, 4, 4)
block_size : size of each block (e.g. [8, 8, 8])
sparsity : block sparsity level (0.4 means, 40% of blocks are zeros)
Outputs:
bsr : sparse representation of matrix (nnz_blocks * block size)
lengths_per_2d_plane: List with num-non-zero blocks per group dim.
i.e. for a (2, 3, 4, 4) tensor with 2 nnz_blocks in each 4x4 matrix,
this will have shape of 6x1 and each row storing 2
dense_matrix: dense representation of the matrix (for ref calc)
mask : list of num_blocks (1 for non-zero blocks and 0 for others)
"""
# skip last two dimensions
# last 2 dims enter the MM, others form the group
num_grouped_dims = reduce(mul, nominal_shape[:-2], 1)
rows = nominal_shape[-2]
cols = nominal_shape[-1]
# Create dense matrix of nominal dims
if initial_value == 0:
dense_matrix = np.zeros(nominal_shape).astype(g_input_data_type)
else:
dense_matrix = np.empty(nominal_shape).astype(g_input_data_type)
dense_matrix.fill(initial_value)
dense_matrix = dense_matrix.reshape((num_grouped_dims, rows, cols))
dims = [nominal_shape[-2], nominal_shape[-1]]
bsr = []
bsr_lengths_per_2d_plane = []
mask = []
for dim in range(num_grouped_dims):
_bsr, dense_matrix[dim], _mask = create_sparse_list(dims, block_size, sparsity, initial_value)
# _bsr comes as array
# _mask comes as list
bsr.extend(_bsr)
mask.extend(_mask)
bsr_lengths_per_2d_plane.append(_bsr.shape[0])
dense_matrix = dense_matrix.reshape(nominal_shape)
mask = np.array(mask)
block_size_row = block_size[0]
block_size_col = block_size[1]
num_block_rows = dims[0] // block_size_row
num_block_cols = dims[1] // block_size_col
# all parameters are returned as numpy arrays
return np.array(bsr), np.array(bsr_lengths_per_2d_plane), dense_matrix, mask
def mm(lhs, rhs):
return np.matmul(lhs, rhs)
# Stable softmax numpy implementation
def softmax(x):
x_max = np.max(x, axis = -1)
x = x - np.expand_dims(x_max, axis=-1)
x = np.exp(x)
x_sum = np.sum(x, axis=-1)
x = x / np.expand_dims(x_sum, axis=-1)
return x
def sparse_mm_infer(sparse_mm_type, lhs_dims, vanilla_rhs_dims, block_size, sparsity_level, transpose_rhs, memory_cycle_ratio, inner_group_size):
""" """
if transpose_rhs:
matmul_dims = [lhs_dims[-2], vanilla_rhs_dims[-1], vanilla_rhs_dims[-2]]
else:
matmul_dims = [lhs_dims[-2], vanilla_rhs_dims[-2], vanilla_rhs_dims[-1]]
lhs = create_dense_matrix(lhs_dims)
if sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT']:
bsr_rhs, lengths_per_2d_plane, vanilla_rhs, sparsity_mask = create_sparse_matrix(vanilla_rhs_dims, block_size[1:], sparsity_level)
rhs = bsr_rhs
rhs_dims = bsr_rhs.shape
elif sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT']:
output_dims = lhs_dims[:-1]
output_dims.append(vanilla_rhs_dims[-1])
output_block_size = [block_size[0], block_size[2]]
bsr_output, lengths_per_2d_plane, _, sparsity_mask = create_sparse_matrix(output_dims, output_block_size, sparsity_level)
rhs_dims = vanilla_rhs_dims
rhs = create_dense_matrix(rhs_dims)
# Create a builder and construct a graph
builder = popart.Builder()
lhs_tensorInfo = popart.TensorInfo("FLOAT", lhs_dims)
rhs_tensorInfo = popart.TensorInfo("FLOAT", rhs_dims)
lhsTensor = builder.addInputTensor(lhs_tensorInfo)
rhsTensor = builder.addInputTensor(rhs_tensorInfo)
outTensor = builder.customOp(opName = "BSMatMul",
opVersion=1,
domain = "ai.graphcore",
inputs = [lhsTensor, rhsTensor],
attributes = {
"bsr_rhs_lengths_per_2d_plane": lengths_per_2d_plane.tolist(),
"matrix_dims": matmul_dims,
"block_size": block_size,
"sparsity_mask": sparsity_mask.tolist(),
"bsmatmul_type": sparse_mm_type,
"transpose_rhs": transpose_rhs,
"memory_cycle_ratio": memory_cycle_ratio,
"inner_group_size": inner_group_size,
"in_type": g_input_data_type,
"out_type": g_output_data_type,
"pp_type": g_pp_data_type
})[0]
builder.addOutputTensor(outTensor)
proto = builder.getModelProto()
# Describe how to run the model
dataFlow = popart.DataFlow(1, {outTensor: popart.AnchorReturnType("ALL")})
# Create a session to compile and execute the graph
session = popart.InferenceSession(
fnModel=proto,
dataFlow=dataFlow,
deviceInfo=popart.DeviceManager().acquireAvailableDevice(1))
# Compile graph
session.prepareDevice()
# Create buffers to receive results from the execution
anchors = session.initAnchorArrays()
rhs = np.array(rhs, dtype=g_input_data_type)
stepio = popart.PyStepIO({lhsTensor: lhs, rhsTensor: rhs}, anchors)
session.run(stepio)
ipuOutput = anchors[outTensor]
if sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT']:
if transpose_rhs:
transpose_indices = list(range(len(vanilla_rhs_dims)))
transpose_indices[-2], transpose_indices[-1] = transpose_indices[-1], transpose_indices[-2]
vanilla_rhs = vanilla_rhs.transpose(tuple(transpose_indices))
goldOutput = mm(lhs, vanilla_rhs)
else:
goldOutput = mm(lhs, vanilla_rhs)
else:
assert len(lhs.shape) == len(rhs.shape)
if(len(lhs.shape) == 2):
lhs = np.expand_dims(lhs, 0)
rhs = np.expand_dims(rhs, 0)
mmOutput = mm(lhs, rhs)
totalGroupDims = int(np.prod(lhs_dims[:-2]))
num_rows_sparsity_mask_2d = output_dims[-2] // block_size[0]
num_cols_sparsity_mask_2d = output_dims[-1] // block_size[2]
assert sparsity_mask.shape == (totalGroupDims * num_rows_sparsity_mask_2d * num_cols_sparsity_mask_2d,)
mmOutput = mmOutput.reshape((totalGroupDims, lhs_dims[-2], rhs_dims[-1]))
goldOutput = []
for dim in range(totalGroupDims):
offset = num_rows_sparsity_mask_2d * num_cols_sparsity_mask_2d
mmOutput_2d = mmOutput[dim]
sliced_sparsity_mask = sparsity_mask[dim * offset: dim * offset + offset]
for sparsity_mask_idx in range(len(sliced_sparsity_mask)):
if sliced_sparsity_mask[sparsity_mask_idx]:
mmOutput_2d_row_start = (sparsity_mask_idx // num_cols_sparsity_mask_2d) * block_size[0]
mmOutput_2d_row_end = mmOutput_2d_row_start + block_size[0]
mmOutput_2d_col_start = (sparsity_mask_idx % num_cols_sparsity_mask_2d) * block_size[2]
mmOutput_2d_col_end = mmOutput_2d_col_start + block_size[2]
mmOutput_2d_sliced = mmOutput_2d[mmOutput_2d_row_start: mmOutput_2d_row_end, mmOutput_2d_col_start: mmOutput_2d_col_end]
goldOutput.append(mmOutput_2d_sliced.reshape(block_size[0] * block_size[2]))
goldOutput = np.array(goldOutput)
return ipuOutput, goldOutput
def sparse_mm_train(sparse_mm_type, lhs_dims, vanilla_rhs_dims, block_size, sparsity_level, transpose_rhs, memory_cycle_ratio, inner_group_size):
if transpose_rhs:
matmul_dims = [lhs_dims[-2], vanilla_rhs_dims[-1], vanilla_rhs_dims[-2]]
else:
matmul_dims = [lhs_dims[-2], vanilla_rhs_dims[-2], vanilla_rhs_dims[-1]]
lhs = create_dense_matrix(lhs_dims)
if sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT']:
bsr_rhs, lengths_per_2d_plane, vanilla_rhs, sparsity_mask = create_sparse_matrix(vanilla_rhs_dims, block_size[1:], sparsity_level)
rhs = bsr_rhs
rhs_dims = bsr_rhs.shape
elif sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT']:
output_dims = lhs_dims[:-1]
output_dims.append(vanilla_rhs_dims[-1])
output_block_size = [block_size[0], block_size[2]]
bsr_output, lengths_per_2d_plane, vanilla_output, sparsity_mask = create_sparse_matrix(output_dims, output_block_size, sparsity_level)
lhs_inv = np.linalg.inv(lhs)
rhs = np.matmul(lhs_inv, vanilla_output)
rhs_dims = vanilla_rhs_dims
# MODEL CREATION
builder = popart.Builder()
lhs_tensorInfo = popart.TensorInfo("FLOAT", lhs_dims)
lhsTensor = builder.addInputTensor(lhs_tensorInfo)
rhsTensor = builder.addInitializedInputTensor(rhs)
outTensor = builder.customOp(opName = "BSMatMul",
opVersion=1,
domain = "ai.graphcore",
inputs = [lhsTensor, rhsTensor],
attributes = {
"bsr_rhs_lengths_per_2d_plane": lengths_per_2d_plane.tolist(),
"matrix_dims": matmul_dims,
"block_size": block_size,
"sparsity_mask": sparsity_mask.tolist(),
"bsmatmul_type": sparse_mm_type,
"transpose_rhs": transpose_rhs,
"memory_cycle_ratio": memory_cycle_ratio,
"inner_group_size": inner_group_size,
"in_type": g_input_data_type,
"out_type": g_output_data_type,
"pp_type": g_pp_data_type
})[0]
builder.addOutputTensor(outTensor)
probs = builder.aiOnnx.softmax([outTensor], axis=1)
if sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT']:
labels_shape = lhs_dims[:-1]
elif sparse_mm_type == g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT']:
labels_shape = [np.sum(sparsity_mask)]
label_tensorInfo = popart.TensorInfo("INT32", labels_shape)
labelTensor = builder.addInputTensor(label_tensorInfo)
loss = builder.aiGraphcore.nllloss([probs, labelTensor], debugContext = "nllLossVal")
proto = builder.getModelProto()
#######################
# Describe how to run the model
anchor_desc = {
outTensor: popart.AnchorReturnType("ALL"),
loss: popart.AnchorReturnType("ALL")
}
dataFlow = popart.DataFlow(1, anchor_desc)
label_data = g_random_labels.choice(9, labels_shape)
session = popart.TrainingSession(fnModel=proto,
loss=loss,
deviceInfo=popart.DeviceManager().acquireAvailableDevice(1),
optimizer=popart.ConstSGD(0.01),
dataFlow=dataFlow)
# Compile graph
session.prepareDevice()
# Create buffers to receive results from the execution
anchors = session.initAnchorArrays()
# TRAINING
session.weightsFromHost()
stepio = popart.PyStepIO({
lhsTensor: lhs,
labelTensor: label_data}, anchors)
session.run(stepio)
def sparse_softmax(dims, block_size, sparsity_level, inner_group_size):
""" """
sparse_input, lengths_per_2d_plane, dense_input, sparsity_mask = create_sparse_matrix(dims, block_size, sparsity_level, -1000)
# Create a builder and construct a graph
builder = popart.Builder()
tensor_info = popart.TensorInfo("FLOAT", sparse_input.shape)
input_tensor = builder.addInputTensor(tensor_info)
output_tensor = builder.customOp(opName = "BsSoftmax",
opVersion = 1,
domain = "ai.graphcore",
inputs = [input_tensor],
attributes = {
"matrixDims": dims,
"blockSize": block_size,
"sparsity": sparsity_mask.tolist(),
"groupSizes": lengths_per_2d_plane.tolist(),
"innerGroupSize": inner_group_size,
"subBlockMaskPerGroup": "None" * len(lengths_per_2d_plane)
})[0]
builder.addOutputTensor(output_tensor)
proto = builder.getModelProto()
# Describe how to run the model
dataFlow = popart.DataFlow(1, {output_tensor: popart.AnchorReturnType("ALL")})
# Create a session to compile and execute the graph
session = popart.InferenceSession(
fnModel=proto,
dataFlow=dataFlow,
deviceInfo=popart.DeviceManager().acquireAvailableDevice(1))
# Compile graph
session.prepareDevice()
# Create buffers to receive results from the execution
anchors = session.initAnchorArrays()
sparse_input = np.array(sparse_input, dtype=g_input_data_type)
stepio = popart.PyStepIO({input_tensor: sparse_input}, anchors)
session.run(stepio)
ipu_output = anchors[output_tensor]
group_dims = dims[:-2]
mat_dims = dims[-2:]
blocks_2d = [mat_dims[0] // block_size[0], mat_dims[1] // block_size[1]]
num_blocks_2d = blocks_2d[0] * blocks_2d[1]
block_area = block_size[0] * block_size[1]
total_group_dims = int(np.prod(group_dims))
assert sparsity_mask.shape == (total_group_dims * num_blocks_2d,)
cpu_output = softmax(dense_input)
np.set_printoptions(precision=2)
np.set_printoptions(suppress=True)
cpu_output = cpu_output.reshape([total_group_dims, blocks_2d[0], block_size[0], blocks_2d[1], block_size[1]])
cpu_output = np.transpose(cpu_output, [0, 1, 3, 2, 4])
cpu_output = cpu_output.reshape(total_group_dims, num_blocks_2d, block_area)
gold_output = []
offset = 0
for g in range(total_group_dims):
cpu_output_2d = cpu_output[g]
sliced_sparsity_mask = sparsity_mask[offset: offset + num_blocks_2d]
offset = offset + num_blocks_2d
for sparsity_mask_idx in range(num_blocks_2d):
if sliced_sparsity_mask[sparsity_mask_idx]:
gold_output.append(cpu_output_2d[sparsity_mask_idx])
gold_output = np.array(gold_output)
assert ipu_output.shape == gold_output.shape
return ipu_output, gold_output
#
# INFERENCE TEST
#
# test_data_infer tuple --> (matMulType, lhs_dims, rhs_dims, block_size, sparsity, transpose_rhs, inner_group_size)
test_data_infer = [
# 2D
("tag_inf_0", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_1", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, False, 1),
("tag_inf_2", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [32, 32], [32, 32], [16, 8, 8], 0.8, False, 1),
("tag_inf_3", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [64, 64], [64, 256], [64, 8, 64], 0.9, False, 1),
("tag_inf_4", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [128, 128], [128, 128], [32, 8, 16], 0.2, False, 1),
# 3D, False
("tag_inf_5", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 8, 8], [2, 8, 8], [8, 8, 8], 0.1, False, 1),
("tag_inf_6", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [5, 16, 16], [5, 16, 16], [8, 8, 8], 0.3, False, 1),
("tag_inf_7", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [7, 32, 32], [7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_8", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [11, 64, 64], [11, 64, 64], [64, 8, 64], 0.6, False, 1),
("tag_inf_9", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [12, 128, 128], [12, 128, 128], [32, 8, 16], 0.8, False, 1),
# 4D, False
("tag_inf_10", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 8, 8], [1, 1, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_11", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 16, 16], [1, 1, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_12", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 32, 32], [1, 1, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_13", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 64, 128], [1, 1, 128, 256], [64, 8, 64], 0.5, False, 1),
("tag_inf_14", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 128, 64], [1, 1, 64, 128], [32, 8, 16], 0.5, False, 1),
("tag_inf_14", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 2, 8, 8], [1, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_16", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 5, 16, 16], [1, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_17", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 7, 32, 32], [1, 7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_18", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 5, 64, 128], [1, 5, 128, 256], [64, 8, 64], 0.5, False, 1),
("tag_inf_19", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 12, 128, 64], [1, 12, 64, 128], [32, 8, 16], 0.5, False, 1),
("tag_inf_20", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 2, 8, 8], [2, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_21", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [5, 5, 16, 16], [5, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_22", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [13, 7, 32, 32], [13, 7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_24", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 12, 128, 64], [1, 12, 64, 128], [32, 8, 16], 0.5, False, 1),
# 2D, lhs has to be square to take inverse, False
("tag_inf_25", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_26", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, False, 1),
("tag_inf_27", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [32, 32], [32, 32], [16, 8, 8], 0.8, False, 1),
("tag_inf_28", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [64, 64], [64, 64], [64, 8, 64], 0.9, False, 1),
("tag_inf_29", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [128, 128], [128, 128], [32, 8, 16], 0.7, False, 1),
# 3D, lhs has to be square to take, False
("tag_inf_30", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [2, 8, 8], [2, 8, 8], [8, 8, 8], 0.1, False, 1),
("tag_inf_31", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [5, 16, 16], [5, 16, 16], [8, 8, 8], 0.3, False, 1),
("tag_inf_32", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [7, 32, 32], [7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_33", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [11, 64, 64], [11, 64, 64], [64, 8, 64], 0.6, False, 1),
("tag_inf_34", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [12, 128, 128], [12, 128, 128], [32, 8, 16], 0.1, False, 1),
# 4D, lhs has to be square to take, False
("tag_inf_36", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 8, 8], [1, 1, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_36", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 16, 16], [1, 1, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_37", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 32, 32], [1, 1, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_38", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 64, 64], [1, 1, 64, 256], [64, 8, 64], 0.5, False, 1),
("tag_inf_39", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 128, 128], [1, 1, 128, 128], [32, 8, 16], 0.5, False, 1),
("tag_inf_40", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 2, 8, 8], [1, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_41", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 5, 16, 16], [1, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_42", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 7, 32, 32], [1, 7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_43", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 11, 64, 64], [1, 11, 64, 256], [64, 8, 64], 0.5, False, 1),
("tag_inf_44", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 12, 128, 128], [1, 12, 128, 128], [32, 8, 16], 0.5, False, 1),
("tag_inf_45", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [2, 2, 8, 8], [2, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_inf_46", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [5, 5, 16, 16], [5, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_inf_47", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [13, 7, 32, 32], [13, 7, 32, 32], [16, 8, 8], 0.5, False, 1),
("tag_inf_49", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 12, 128, 128], [1, 12, 128, 1024], [32, 8, 16], 0.5, False, 1),
# For transpose_rhs True case, last 2 dimensions of block_size must be 8
("tag_inf_50", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, True, 1),
("tag_inf_51", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, True, 1),
("tag_inf_52", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [32, 32], [32, 32], [16, 8, 8], 0.8, True, 1),
("tag_inf_53", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [64, 64], [256, 64], [64, 8, 8], 0.9, True, 1),
("tag_inf_54", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [128, 128], [128, 128], [32, 8, 8], 0.2, True, 1),
("tag_inf_55", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 8, 8], [2, 8, 8], [8, 8, 8], 0.5, True, 1),
("tag_inf_56", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [3, 16, 16], [3, 16, 16], [8, 8, 8], 0.1, True, 1),
("tag_inf_57", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [7, 128, 128], [7, 128, 128], [32, 8, 8], 0.2, True, 1),
("tag_inf_58", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [3, 5, 8, 8], [3, 5, 8, 8], [8, 8, 8], 0.5, True, 1),
("tag_inf_59", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 6, 16, 16], [1, 6, 16, 16], [8, 8, 8], 0.1, True, 1),
("tag_inf_60", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [4, 4, 32, 32], [4, 4, 32, 32], [16, 8, 8], 0.8, True, 1),
# 3D, inner group size > 1
("tag_inf_61", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [12, 128, 128], [12, 128, 128], [32, 8, 16], 0.8, False, 3),
("tag_inf_62", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [12, 128, 128], [12, 128, 128], [32, 8, 16], 0.1, False, 4),
# 4D, inner group size > 1
("tag_inf_23", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [4, 8, 64, 128], [4, 8, 128, 256], [64, 8, 64], 0.5, False, 4),
("tag_inf_48", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [3, 11, 64, 64], [3, 11, 64, 256], [64, 8, 64], 0.5, False, 3),
]
@pytest.mark.parametrize("tag, matmul_type, lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size", test_data_infer)
def test_bsmatmul_infer(custom_ops, tag, matmul_type, lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size):
print("Running test_bsmatmul_infer() with tag: {}, matmul_type:{}, lhs_dims:{}, rhs_dims:{}, block_size:{}, sparsity_level:{}, transpose_rhs:{}, inner_group_size {}"
.format(tag, "DENSE_LHS_SPARSE_RHS_DENSE_OUT" if matmul_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'] else "DENSE_LHS_DENSE_RHS_SPARSE_OUT",
lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size))
memory_cycle_ratio = 1.0
ipuOutput, goldOutput = sparse_mm_infer(matmul_type,
lhs_dims,
rhs_dims,
block_size,
sparsity_level,
transpose_rhs,
memory_cycle_ratio,
inner_group_size)
rtol = 1e-3
atol = 1e-3
np.testing.assert_allclose(ipuOutput, goldOutput, rtol=rtol, atol=atol)
#
# TRAINING TEST
#
# test_data_train tuple --> (matMulType, lhs_dims, rhs_dims, block_size, sparsity, transpose_rhs, inner_group_size)
test_data_train = [
# 2D
("tag_tr_0", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_1", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, False, 1),
("tag_tr_2", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [32, 32], [32, 32], [8, 8, 8], 0.8, False, 1),
("tag_tr_3", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [64, 64], [64, 256], [8, 8, 8], 0.9, False, 1),
("tag_tr_4", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [128, 128], [128, 128], [8, 8, 8], 0.2, False, 1),
# 3D,
("tag_tr_5", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 16, 16], [2, 16, 16], [8, 8, 8], 0.1, False, 1),
("tag_tr_6", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [5, 16, 16], [5, 16, 16], [8, 8, 8], 0.3, False, 1),
("tag_tr_7", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [7, 32, 32], [7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_8", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [11, 64, 64], [11, 64, 64], [8, 8, 8], 0.6, False, 1),
("tag_tr_9", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [12, 128, 128], [12, 128, 128], [8, 8, 8], 0.8, False, 1),
# 4D,
("tag_tr_10", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 8, 8], [1, 1, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_11", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 16, 16], [1, 1, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_12", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 32, 32], [1, 1, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_13", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 64, 128], [1, 1, 128, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_14", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 1, 128, 64], [1, 1, 64, 128], [8, 8, 8], 0.5, False, 1),
("tag_tr_15", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 2, 8, 8], [1, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_16", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 5, 16, 16], [1, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_17", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 7, 32, 32], [1, 7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_18", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 11, 64, 128], [1, 11, 128, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_19", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 12, 128, 64], [1, 12, 64, 128], [8, 8, 8], 0.5, False, 1),
("tag_tr_20", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 2, 8, 8], [2, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_21", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [5, 5, 16, 16], [5, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_22", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [13, 7, 32, 32], [13, 7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_23", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [3, 11, 64, 128], [3, 11, 128, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_24", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 12, 128, 64], [1, 12, 64, 128], [8, 8, 8], 0.5, False, 1),
# 2D, lhs has to be square to take inverse
("tag_tr_25", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_26", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, False, 1),
("tag_tr_27", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [32, 32], [32, 32], [8, 8, 8], 0.8, False, 1),
("tag_tr_28", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [64, 64], [64, 256], [8, 8, 8], 0.9, False, 1),
("tag_tr_29", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [128, 128], [128, 128], [8, 8, 8], 0.2, False, 1),
# 3D, lhs has to be square to take
("tag_tr_30", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [2, 8, 8], [2, 8, 8], [8, 8, 8], 0.1, False, 1),
("tag_tr_31", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [5, 16, 16], [5, 16, 16], [8, 8, 8], 0.3, False, 1),
("tag_tr_32", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [7, 32, 32], [7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_33", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [11, 64, 64], [11, 64, 64], [8, 8, 8], 0.6, False, 1),
("tag_tr_34", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [12, 128, 128], [12, 128, 128], [8, 8, 8], 0.3, False, 1),
# 4D, lhs has to be square to take
("tag_tr_35", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 8, 8], [1, 1, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_36", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 16, 16], [1, 1, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_37", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 32, 32], [1, 1, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_38", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 64, 64], [1, 1, 64, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_39", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 1, 128, 128], [1, 1, 128, 128], [8, 8, 8], 0.5, False, 1),
("tag_tr_40", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 2, 8, 8], [1, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_41", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 5, 16, 16], [1, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_42", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 7, 32, 32], [1, 7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_43", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 11, 64, 64], [1, 11, 64, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_44", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 12, 128, 128], [1, 12, 128, 128], [8, 8, 8], 0.5, False, 1),
("tag_tr_45", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [2, 2, 8, 8], [2, 2, 8, 8], [8, 8, 8], 0.5, False, 1),
("tag_tr_46", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [5, 5, 16, 16], [5, 5, 16, 16], [8, 8, 8], 0.8, False, 1),
("tag_tr_47", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [13, 7, 32, 32], [13, 7, 32, 32], [8, 8, 8], 0.5, False, 1),
("tag_tr_48", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [3, 11, 64, 64], [3, 11, 64, 256], [8, 8, 8], 0.5, False, 1),
("tag_tr_49", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [1, 12, 128, 128], [1, 12, 128, 1024], [8, 8, 8], 0.5, False, 1),
# For transpose_rhs True case, last 2 dimensions of block_size must be 8
("tag_tr_50", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [8, 8], [8, 8], [8, 8, 8], 0.5, True, 1),
("tag_tr_51", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [16, 16], [16, 16], [8, 8, 8], 0.1, True, 1),
("tag_tr_52", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [32, 32], [32, 32], [8, 8, 8], 0.8, True, 1),
("tag_tr_53", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [64, 64], [256, 64], [8, 8, 8], 0.9, True, 1),
("tag_tr_54", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [128, 128], [128, 128], [8, 8, 8], 0.2, True, 1),
("tag_tr_55", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [2, 8, 8], [2, 8, 8], [8, 8, 8], 0.5, True, 1),
("tag_tr_56", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [3, 16, 16], [3, 16, 16], [8, 8, 8], 0.1, True, 1),
("tag_tr_57", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [7, 128, 128], [7, 128, 128], [8, 8, 8], 0.2, True, 1),
("tag_tr_58", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [3, 5, 8, 8], [3, 5, 8, 8], [8, 8, 8], 0.5, True, 1),
("tag_tr_59", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [1, 6, 16, 16], [1, 6, 16, 16], [8, 8, 8], 0.1, True, 1),
("tag_tr_60", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [4, 4, 32, 32], [4, 4, 32, 32], [8, 8, 8], 0.8, True, 1),
# 3D, inner group size > 1
("tag_tr_61", g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'], [12, 128, 128], [12, 128, 128], [8, 8, 8], 0.8, False, 3),
("tag_tr_62", g_sparseMatMulTypeLookup['DENSE_LHS_DENSE_RHS_SPARSE_OUT'], [12, 128, 128], [12, 128, 128], [8, 8, 8], 0.1, False, 4),
]
@pytest.mark.parametrize("tag, matmul_type, lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size", test_data_train)
def test_bsmatmul_train(custom_ops, tag, matmul_type, lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size):
print("Running test_bsmatmul_train() with tag: {}, matmul_type:{}, lhs_dims:{}, rhs_dims:{}, block_size:{}, sparsity_level:{}, transpose_rhs:{}, inner_group_size {}"
.format(tag, "DENSE_LHS_SPARSE_RHS_DENSE_OUT" if matmul_type == g_sparseMatMulTypeLookup['DENSE_LHS_SPARSE_RHS_DENSE_OUT'] else "DENSE_LHS_DENSE_RHS_SPARSE_OUT",
lhs_dims, rhs_dims, block_size, sparsity_level, transpose_rhs, inner_group_size))
memory_cycle_ratio = 1.0
sparse_mm_train(matmul_type,
lhs_dims,
rhs_dims,
block_size,
sparsity_level,
transpose_rhs,
memory_cycle_ratio,
inner_group_size)
# test_data_softmax tuple --> (dims, block_size, sparsity, inner_group_size)
test_data_softmax = [
# 2D
("tag_sm_0", [8, 8], [8, 8], 0.0, 1),
# 3D
("tag_sm_1", [16, 16], [8, 8], 0.4, 1),
# 4D
("tag_sm_2", [2, 2, 16, 16], [8, 8], 0.3, 1),
# 5D, inner group size = 1
("tag_sm_3", [2, 3, 2, 16, 16], [8, 8], 0.1, 1),
# 5D, inner group size > 1
("tag_sm_4", [2, 3, 2, 16, 16], [8, 8], 0.1, 0),
("tag_sm_5", [2, 3, 2, 16, 16], [8, 8], 0.1, 6),
]
@pytest.mark.parametrize("tag, dims, block_size, sparsity_level, inner_group_size", test_data_softmax)
def test_bs_softmax(custom_ops, tag, dims, block_size, sparsity_level, inner_group_size):
print("Running test_bs_softmax() with tag: {}, dims:{}, block_size:{}, sparsity_level:{}, inner_group_size {}"
.format(tag, dims, block_size, sparsity_level, inner_group_size))
ipu_output, gold_output = sparse_softmax(dims,
block_size,
sparsity_level,
inner_group_size)
np.testing.assert_allclose(ipu_output, gold_output, rtol=1e-2, atol=1e-2)
if __name__ == "__main__":
ipu_output, gold_output = sparse_softmax([2, 2, 16, 16],
[8, 8],
0.3,
1)
np.testing.assert_allclose(ipu_output, gold_output, rtol=1e-2, atol=1e-2)
| 55.048913
| 171
| 0.635699
| 6,120
| 40,516
| 3.877614
| 0.063562
| 0.024019
| 0.019468
| 0.177658
| 0.769416
| 0.726223
| 0.705744
| 0.697231
| 0.677215
| 0.649067
| 0
| 0.090033
| 0.218432
| 40,516
| 735
| 172
| 55.12381
| 0.659382
| 0.08414
| 0
| 0.308333
| 0
| 0.004167
| 0.180863
| 0.11842
| 0
| 0
| 0
| 0
| 0.016667
| 1
| 0.022917
| false
| 0
| 0.0125
| 0.004167
| 0.05
| 0.0125
| 0
| 0
| 0
| null | 0
| 0
| 1
| 0
| 1
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
b646e70957f42088d6111a5dc7519a69d0f4b90e
| 263
|
py
|
Python
|
divedownload.py
|
AmoghRRao/Game-Recommendation-System
|
c2abbd699fca22f863fa49c26fc42fd98a3d5177
|
[
"Apache-2.0"
] | null | null | null |
divedownload.py
|
AmoghRRao/Game-Recommendation-System
|
c2abbd699fca22f863fa49c26fc42fd98a3d5177
|
[
"Apache-2.0"
] | null | null | null |
divedownload.py
|
AmoghRRao/Game-Recommendation-System
|
c2abbd699fca22f863fa49c26fc42fd98a3d5177
|
[
"Apache-2.0"
] | null | null | null |
from google_drive_downloader import GoogleDriveDownloader as gdd
gdd.download_file_from_google_drive(file_id='14LXxwldPTV5K1EmrDr-HQc1svBhMKDvT',
dest_path='./similarity.pkl',
unzip=False)
| 37.571429
| 80
| 0.623574
| 24
| 263
| 6.5
| 0.791667
| 0.128205
| 0.192308
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.027778
| 0.315589
| 263
| 6
| 81
| 43.833333
| 0.838889
| 0
| 0
| 0
| 0
| 0
| 0.186312
| 0.125475
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.25
| 0
| 0.25
| 0
| 1
| 0
| 0
| null | 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
b686f562b278bea748b1a7f47ef4eebd0183debb
| 419
|
py
|
Python
|
DailyProgrammer/DP20150107W.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | 2
|
2020-12-23T18:59:22.000Z
|
2021-04-14T13:16:09.000Z
|
DailyProgrammer/DP20150107W.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | null | null | null |
DailyProgrammer/DP20150107W.py
|
DayGitH/Python-Challenges
|
bc32f1332a92fcc2dfa6f5ea4d95f8a8d64c3edf
|
[
"MIT"
] | null | null | null |
"""
[Weekly #19] Looking forward into 2015 - Predictions.
https://www.reddit.com/r/dailyprogrammer/comments/2rfexe/weekly_19_looking_forward_into_2015_predictions/
As we enter the new year - What are some trends/predictions you see in computer science, software engineering,
programming or related fields forth coming or happening for this new year?
"""
def main():
pass
if __name__ == "__main__":
main()
| 24.647059
| 110
| 0.761337
| 59
| 419
| 5.169492
| 0.779661
| 0.052459
| 0.098361
| 0.144262
| 0.268852
| 0.268852
| 0.268852
| 0
| 0
| 0
| 0
| 0.036517
| 0.150358
| 419
| 16
| 111
| 26.1875
| 0.820225
| 0.828162
| 0
| 0
| 0
| 0
| 0.125
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.25
| true
| 0.25
| 0
| 0
| 0.25
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
b69c1b3771e1541308260da20d12a22f3aa1240d
| 27
|
py
|
Python
|
lang/Python/increment-a-numerical-string-1.py
|
ethansaxenian/RosettaDecode
|
8ea1a42a5f792280b50193ad47545d14ee371fb7
|
[
"MIT"
] | 5
|
2021-01-29T20:08:05.000Z
|
2022-03-22T06:16:05.000Z
|
lang/Python/increment-a-numerical-string-1.py
|
ethansaxenian/RosettaDecode
|
8ea1a42a5f792280b50193ad47545d14ee371fb7
|
[
"MIT"
] | null | null | null |
lang/Python/increment-a-numerical-string-1.py
|
ethansaxenian/RosettaDecode
|
8ea1a42a5f792280b50193ad47545d14ee371fb7
|
[
"MIT"
] | 1
|
2018-11-09T22:08:40.000Z
|
2018-11-09T22:08:40.000Z
|
next = str(int('123') + 1)
| 13.5
| 26
| 0.518519
| 5
| 27
| 2.8
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.181818
| 0.185185
| 27
| 1
| 27
| 27
| 0.454545
| 0
| 0
| 0
| 0
| 0
| 0.111111
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
fcb219589f7f6fae701c64ddba094835676e7327
| 3,153
|
py
|
Python
|
moniter/index.py
|
tjandy/work
|
f9179a6a8e87de4127ebef2f886818c149a32a59
|
[
"MIT"
] | null | null | null |
moniter/index.py
|
tjandy/work
|
f9179a6a8e87de4127ebef2f886818c149a32a59
|
[
"MIT"
] | null | null | null |
moniter/index.py
|
tjandy/work
|
f9179a6a8e87de4127ebef2f886818c149a32a59
|
[
"MIT"
] | null | null | null |
import json
from flask import Flask,request,render_template
import os
import time
app = Flask(__name__)
def getTime(timestr,interval):
process = os.popen('cat data/'+timestr+'.log|grep date |awk \'{print $2}\'|sed \'s/$/,/g\'|awk \'{printf("%s",$0);}\'')
data = process.read()
process.close()
return data
def getServerMem(timestr,name,interval):
process = os.popen('cat data/'+timestr+'.log|grep -w '+name+' |awk \'{print $3}\'|sed \'s/$/,/g\'|awk \'{printf("%s",$0);}\'')
data = process.read()
process.close()
return data
def getServerCpu(timestr,name,interval):
process = os.popen('cat data/'+timestr+'.log|grep -w '+name+' |awk \'{print $2}\'|sed \'s/$/,/g\'|awk \'{printf("%s",$0);}\'')
data = process.read()
process.close()
return data
def getOnline(timestr):
process = os.popen('tail -n7 data/'+timestr+'.log|grep online |awk \'{print $2}\'')
data = process.read()
process.close()
return data
def tojson(name,data):
return {'name':name,'data':data}
@app.route('/info.do',methods=['GET'])
def GetInfo():
curtime=time.localtime()
timestr = time.strftime("%Y-%m-%d", curtime)
interval = time.strftime("%H:%M",curtime)
tt = getTime(timestr,interval)
cur = getOnline(timestr)
name = ["mapserver","mapserver2","loginserver","baseserver","dbserver","connectserver"]
mem=[]
cpu=[]
for index,value in enumerate(name):
mem.append(getServerMem(timestr,value,interval))
for value in name:
cpu.append(getServerCpu(timestr,value,interval))
memdata=[]
for index,value in enumerate(name):
memdata.append(tojson(value,mem[index]))
cpudata=[]
for index,value in enumerate(name):
cpudata.append(tojson(value,cpu[index]))
return render_template('mon.html',timedata=tt,online=cur,memdata=memdata,cpudata=cpudata)
@app.route('/cpu.do',methods=['GET'])
def GetCpuInfo():
curtime=time.localtime()
timestr = time.strftime("%Y-%m-%d", curtime)
interval = time.strftime("%H:%M",curtime)
tt = getTime(timestr,interval)
cur = getOnline(timestr)
name = ["mapserver","mapserver2","loginserver","baseserver","dbserver","connectserver"]
cpu=[]
for value in name:
cpu.append(getServerCpu(timestr,value,interval))
cpudata=[]
for index,value in enumerate(name):
cpudata.append(tojson(value,cpu[index]))
return render_template('mon.html',timedata=tt,online=cur,cpudata=cpudata)
@app.route('/mem.do',methods=['GET'])
def GetMemInfo():
curtime=time.localtime()
timestr = time.strftime("%Y-%m-%d", curtime)
interval = time.strftime("%H:%M",curtime)
tt = getTime(timestr,interval)
cur = getOnline(timestr)
name = ["mapserver","mapserver2","loginserver","baseserver","dbserver","connectserver"]
mem=[]
for value in name:
mem.append(getServerMem(timestr,value,interval))
data=[]
for index,value in enumerate(name):
data.append(tojson(value,mem[index]))
return render_template('mon.html',timedata=tt,online=cur,memdata=data)
app.run(host='0.0.0.0',port=8888,debug=True)
| 28.926606
| 130
| 0.643514
| 400
| 3,153
| 5.0525
| 0.21
| 0.027709
| 0.032162
| 0.03711
| 0.779317
| 0.757051
| 0.717467
| 0.672934
| 0.653142
| 0.631865
| 0
| 0.007233
| 0.166825
| 3,153
| 108
| 131
| 29.194444
| 0.762086
| 0
| 0
| 0.632911
| 0
| 0
| 0.145576
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | null | 0
| 0.050633
| null | null | 0.050633
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
fcfd593d20dab4f4702c9ba9bc12d66859e22310
| 90
|
py
|
Python
|
quickumls/__init__.py
|
equipe22/QuickUMLS
|
950383385ab28cb1c0cd4a67a46ee3a49a4a501e
|
[
"MIT"
] | 283
|
2016-07-21T10:22:33.000Z
|
2022-03-28T22:15:21.000Z
|
quickumls/__init__.py
|
equipe22/QuickUMLS
|
950383385ab28cb1c0cd4a67a46ee3a49a4a501e
|
[
"MIT"
] | 65
|
2016-08-11T04:33:13.000Z
|
2022-03-22T18:40:08.000Z
|
quickumls/__init__.py
|
equipe22/QuickUMLS
|
950383385ab28cb1c0cd4a67a46ee3a49a4a501e
|
[
"MIT"
] | 74
|
2017-10-14T04:37:05.000Z
|
2022-01-27T07:37:30.000Z
|
from .core import QuickUMLS
from .client import get_quickumls_client
from .about import *
| 22.5
| 40
| 0.822222
| 13
| 90
| 5.538462
| 0.538462
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.133333
| 90
| 3
| 41
| 30
| 0.923077
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
1e26ea7e48eb165042de4428a92a508779072563
| 116
|
py
|
Python
|
settings.py
|
kavehkm/MiddleWareSystem
|
de5484d7fab6582904506dcf7db19ecfffcc8df7
|
[
"Apache-2.0"
] | null | null | null |
settings.py
|
kavehkm/MiddleWareSystem
|
de5484d7fab6582904506dcf7db19ecfffcc8df7
|
[
"Apache-2.0"
] | null | null | null |
settings.py
|
kavehkm/MiddleWareSystem
|
de5484d7fab6582904506dcf7db19ecfffcc8df7
|
[
"Apache-2.0"
] | null | null | null |
MIDDLEWARES = (
'middlewares.middle_a',
'middlewares.middle_b',
'middlewares.middle_c',
'middlewares.middle_d'
)
| 19.333333
| 24
| 0.75
| 13
| 116
| 6.384615
| 0.461538
| 0.819277
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.094828
| 116
| 6
| 25
| 19.333333
| 0.790476
| 0
| 0
| 0
| 0
| 0
| 0.683761
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
1e3d891bf17ddc54a3059b850dc2489217abb579
| 164
|
py
|
Python
|
problem0325.py
|
kmarcini/Project-Euler-Python
|
d644e8e1ec4fac70a9ab407ad5e1f0a75547c8d3
|
[
"BSD-3-Clause"
] | null | null | null |
problem0325.py
|
kmarcini/Project-Euler-Python
|
d644e8e1ec4fac70a9ab407ad5e1f0a75547c8d3
|
[
"BSD-3-Clause"
] | null | null | null |
problem0325.py
|
kmarcini/Project-Euler-Python
|
d644e8e1ec4fac70a9ab407ad5e1f0a75547c8d3
|
[
"BSD-3-Clause"
] | null | null | null |
###########################
#
# #325 Stone Game II - Project Euler
# https://projecteuler.net/problem=325
#
# Code by Kevin Marciniak
#
###########################
| 18.222222
| 38
| 0.463415
| 15
| 164
| 5.066667
| 0.933333
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.041667
| 0.121951
| 164
| 8
| 39
| 20.5
| 0.486111
| 0.573171
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
1e3df4f8080941db8b932d73b60ea38707fc8cc7
| 3,915
|
py
|
Python
|
resources/Wireshark/WiresharkDissectorFoo/test/suite_follow.py
|
joshis1/C_Programming
|
4a8003321251448a167bfca0b595c5eeab88608d
|
[
"MIT"
] | 2
|
2020-09-11T05:51:42.000Z
|
2020-12-31T11:42:02.000Z
|
resources/Wireshark/WiresharkDissectorFoo/test/suite_follow.py
|
joshis1/C_Programming
|
4a8003321251448a167bfca0b595c5eeab88608d
|
[
"MIT"
] | null | null | null |
resources/Wireshark/WiresharkDissectorFoo/test/suite_follow.py
|
joshis1/C_Programming
|
4a8003321251448a167bfca0b595c5eeab88608d
|
[
"MIT"
] | null | null | null |
#
# -*- coding: utf-8 -*-
# Wireshark tests
#
# Copyright (c) 2018 Peter Wu <peter@lekensteyn.nl>
#
# SPDX-License-Identifier: GPL-2.0-or-later
#
'''Follow Stream tests'''
import subprocesstest
import fixtures
@fixtures.mark_usefixtures('test_env')
@fixtures.uses_fixtures
class case_follow_tcp(subprocesstest.SubprocessTestCase):
def test_follow_tcp_bad_conditions(self, cmd_tshark, capture_file):
'''Checks whether Follow TCP correctly handles lots of edge cases.'''
# Edge cases include:
# 1. two sequential segments
# 2. out-of-order (swapped two sequential segments)
# 3. Bad overlap (second overlap with different data should be ignored)
# 4. Ignore bad retransmitted data, but extend with remaining data.
# 5. Check handling of overlapping data while fragments are incomplete
# (out-of-order - cannot add fragments to stream)
# 6. lost but acked segments
# 7. lost 3/5 fragments, but acked
# Not checked: lost and not acked (currently truncated, is that OK?)
proc = self.assertRun((cmd_tshark,
'-r', capture_file('tcp-badsegments.pcap'),
'-qz', 'follow,tcp,hex,0',
))
self.assertIn("""\
===================================================================
Follow: tcp,hex
Filter: tcp.stream eq 0
Node 0: 10.0.0.1:32323
Node 1: 10.0.0.2:80
00000000 47 45 54 20 2f 20 48 54 54 50 2f 31 2e 31 0d 0a GET / HT TP/1.1..
00000010 48 6f 73 74 3a 6c 6f 63 61 6c 68 6f 73 74 0d 0a Host:loc alhost..
00000020 58 2d 53 77 61 70 70 65 64 3a 20 31 73 74 0d 0a X-Swappe d: 1st..
00000030 58 2d 53 77 61 70 70 65 64 3a 20 32 6e 64 0d 0a X-Swappe d: 2nd..
00000040 58 2d 4f 76 65 72 6c 61 70 2d 50 61 63 6b 65 74 X-Overla p-Packet
00000050 3a 20 65 78 74 72 61 20 64 61 74 61 2d 2d 0d 0a : extra data--..
00000060 58 2d 4f 6f 4f 2d 4f 76 65 72 6c 61 70 3a 20 74 X-OoO-Ov erlap: t
00000070 68 69 73 20 69 73 20 64 65 6c 61 79 65 64 0d 0a his is d elayed..
00000080 58 2d 4f 6f 4f 2d 4f 76 65 72 6c 61 70 32 3a 20 X-OoO-Ov erlap2:
00000090 73 65 63 6f 6e 64 20 64 65 6c 61 79 65 64 0d 0a second d elayed..
000000A0 58 2d 4f 6f 4f 2d 4f 76 65 72 6c 61 70 33 3a 65 X-OoO-Ov erlap3:e
000000B0 78 74 65 6e 64 20 66 72 61 67 6d 65 6e 74 0d 0a xtend fr agment..
000000C0 5b 33 32 20 62 79 74 65 73 20 6d 69 73 73 69 6e [32 byte s missin
000000D0 67 20 69 6e 20 63 61 70 74 75 72 65 20 66 69 6c g in cap ture fil
000000E0 65 5d 00 e].
000000E3 58 2d 4d 69 73 73 69 6e 67 2d 42 75 74 2d 41 63 X-Missin g-But-Ac
000000F3 6b 65 64 2d 50 72 65 76 69 6f 75 73 3a 31 0d 0a ked-Prev ious:1..
00000103 5b 31 36 20 62 79 74 65 73 20 6d 69 73 73 69 6e [16 byte s missin
00000113 67 20 69 6e 20 63 61 70 74 75 72 65 20 66 69 6c g in cap ture fil
00000123 65 5d 00 e].
00000126 3a :
00000127 5b 31 33 20 62 79 74 65 73 20 6d 69 73 73 69 6e [13 byte s missin
00000137 67 20 69 6e 20 63 61 70 74 75 72 65 20 66 69 6c g in cap ture fil
00000147 65 5d 00 e].
0000014A 0d .
0000014B 5b 31 20 62 79 74 65 73 20 6d 69 73 73 69 6e 67 [1 bytes missing
0000015B 20 69 6e 20 63 61 70 74 75 72 65 20 66 69 6c 65 in capt ure file
0000016B 5d 00 ].
0000016D 58 2d 4d 69 73 73 69 6e 67 2d 33 2d 4f 75 74 2d X-Missin g-3-Out-
0000017D 4f 66 2d 35 2d 42 75 74 2d 41 43 4b 3a 59 0d 0a Of-5-But -ACK:Y..
0000018D 0d 0a ..
===================================================================
""".replace("\r\n", "\n"),
proc.stdout_str.replace("\r\n", "\n"))
| 52.2
| 79
| 0.576501
| 723
| 3,915
| 3.102351
| 0.337483
| 0.019617
| 0.01605
| 0.0214
| 0.23852
| 0.22782
| 0.21712
| 0.21712
| 0.209987
| 0.209987
| 0
| 0.365085
| 0.326948
| 3,915
| 74
| 80
| 52.905405
| 0.486148
| 0.177267
| 0
| 0.04
| 0
| 0.48
| 0.812715
| 0.041967
| 0
| 0
| 0
| 0
| 0.04
| 1
| 0.02
| false
| 0
| 0.04
| 0
| 0.08
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
1e6bb3c332ceba0fd537b955e1377973268d2f3a
| 137
|
py
|
Python
|
FlyHigh_Personal_Project_ParkSeHwan/once.py
|
MaengSanHa/flyhigh
|
461c8f7ce787b3961cdbcbc5c7c77a7ec45f7aeb
|
[
"Apache-2.0"
] | null | null | null |
FlyHigh_Personal_Project_ParkSeHwan/once.py
|
MaengSanHa/flyhigh
|
461c8f7ce787b3961cdbcbc5c7c77a7ec45f7aeb
|
[
"Apache-2.0"
] | null | null | null |
FlyHigh_Personal_Project_ParkSeHwan/once.py
|
MaengSanHa/flyhigh
|
461c8f7ce787b3961cdbcbc5c7c77a7ec45f7aeb
|
[
"Apache-2.0"
] | 1
|
2019-10-18T06:52:37.000Z
|
2019-10-18T06:52:37.000Z
|
import mw24
import nhis
import safedriving
if __name__ == "once":
mw24.go_popup()
nhis.once_go()
safedriving.go()
| 13.7
| 23
| 0.635036
| 17
| 137
| 4.764706
| 0.529412
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.039604
| 0.262774
| 137
| 9
| 24
| 15.222222
| 0.762376
| 0
| 0
| 0
| 0
| 0
| 0.031496
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.428571
| 0
| 0.428571
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
1ea7e1d0ef79c0ff756a9285244254eb9e3efcfe
| 71
|
py
|
Python
|
neurolib/models/bold/__init__.py
|
leonidas228/neurolib
|
a7aa6f487db73c3b64471007ac5a965da4a65f9a
|
[
"MIT"
] | 258
|
2020-01-26T14:38:09.000Z
|
2022-03-31T14:54:04.000Z
|
neurolib/models/bold/__init__.py
|
leonidas228/neurolib
|
a7aa6f487db73c3b64471007ac5a965da4a65f9a
|
[
"MIT"
] | 172
|
2020-01-27T11:02:28.000Z
|
2022-03-22T22:25:38.000Z
|
neurolib/models/bold/__init__.py
|
leonidas228/neurolib
|
a7aa6f487db73c3b64471007ac5a965da4a65f9a
|
[
"MIT"
] | 49
|
2020-02-04T08:34:44.000Z
|
2022-03-28T09:29:12.000Z
|
from .model import BOLDModel
from .timeIntegration import simulateBOLD
| 23.666667
| 41
| 0.859155
| 8
| 71
| 7.625
| 0.75
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.112676
| 71
| 2
| 42
| 35.5
| 0.968254
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
1eaf8b72c9dc1bb2c4f6f30372bed6e42a3ae2ab
| 116
|
py
|
Python
|
gems/forms.py
|
0xOddrey/DroppingGemsNFT
|
536c0c3f0f53ac9437d88625709609037306848e
|
[
"MIT"
] | null | null | null |
gems/forms.py
|
0xOddrey/DroppingGemsNFT
|
536c0c3f0f53ac9437d88625709609037306848e
|
[
"MIT"
] | null | null | null |
gems/forms.py
|
0xOddrey/DroppingGemsNFT
|
536c0c3f0f53ac9437d88625709609037306848e
|
[
"MIT"
] | null | null | null |
from django import forms
from .models import *
class gemSearchForm(forms.Form):
tokenId = forms.IntegerField()
| 19.333333
| 34
| 0.758621
| 14
| 116
| 6.285714
| 0.714286
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.155172
| 116
| 6
| 34
| 19.333333
| 0.897959
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.5
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
1ed00ee5a8f6c68165ca177e0725d198d84f82b6
| 345,403
|
py
|
Python
|
3algo/homo/5_3_7datap.py
|
allengrr/deadlock_project
|
933878077c45a7df04daa087407bb2620c064617
|
[
"MIT"
] | null | null | null |
3algo/homo/5_3_7datap.py
|
allengrr/deadlock_project
|
933878077c45a7df04daa087407bb2620c064617
|
[
"MIT"
] | null | null | null |
3algo/homo/5_3_7datap.py
|
allengrr/deadlock_project
|
933878077c45a7df04daa087407bb2620c064617
|
[
"MIT"
] | 1
|
2021-03-21T17:54:26.000Z
|
2021-03-21T17:54:26.000Z
|
wt5_3_7 = {'192.168.122.110': [5.7199, 8.4411, 8.0381, 7.3759, 7.1777, 6.9974, 6.816, 6.7848, 6.811, 6.8666, 6.7605, 7.1659, 7.1058, 7.117, 7.4091, 7.3653, 7.602, 7.5046, 7.5051, 7.4195, 7.3659, 7.2974, 7.2932, 7.4615, 7.6061, 7.7395, 7.7409, 7.699, 7.6546, 7.631, 7.5707, 7.562, 7.5218, 7.4742, 7.6148, 7.5669, 7.5131, 7.4565, 7.5446, 7.4987, 7.4847, 7.469, 7.455, 7.4362, 7.3925, 7.3703, 7.3292, 7.2921, 7.2536, 7.2169, 7.2086, 7.1715, 7.1411, 7.2064, 7.1991, 7.1839, 7.2477, 7.2161, 7.1854, 7.2516, 7.2309, 7.2014, 7.1876, 7.1603, 7.1456, 7.1199, 7.1144, 7.1117, 7.0925, 7.1097, 7.0892, 7.0843, 7.0802, 7.0686, 7.0576, 7.1146, 7.0925, 7.1456, 7.1249, 7.1094, 7.1615, 7.1413, 7.1328, 7.1263, 7.1173, 7.0967, 7.0823, 7.0844, 7.0699, 7.0684, 7.0536, 7.0364, 7.0224, 7.0092, 6.9916, 7.0371, 7.022, 7.034, 7.0179, 7.0132, 7.0539, 7.0557, 7.0478, 7.0415, 7.0298, 7.0144, 7.0508, 7.0598, 7.0598, 7.045, 7.0393, 7.025, 7.0613, 7.0544, 7.0981, 7.1295, 7.125, 7.1609, 7.1487, 7.1351, 7.167, 7.1551, 7.144, 7.1356, 7.1228, 7.1115, 7.0986, 7.0956, 7.0849, 7.0873, 7.0759, 7.0657, 7.1389, 7.1669, 7.1615, 7.1502, 7.1496, 7.1461, 7.1349, 7.128, 7.1166, 7.1035, 7.1017, 7.0924, 7.0807, 7.0907, 7.0797, 7.087, 7.1103, 7.1043, 7.0988, 7.0925, 7.081, 7.0861, 7.0744, 7.0664, 7.0682, 7.0653, 7.0572, 7.0468, 7.0369, 7.0261, 7.0227, 7.0141, 7.0102, 7.0079, 7.0045, 6.9978, 6.9899, 7.0137, 7.0415, 7.0339, 7.0542, 7.0484, 7.0391, 7.0322, 7.0252, 7.0232, 7.0215, 7.016, 7.0126, 7.0046, 7.0024, 6.9977, 7.0017, 7.0237, 7.0439, 7.043, 7.0357, 7.0297, 7.0276, 7.0209, 7.0192, 7.0439, 7.0585, 7.0511, 7.0521, 7.0485, 7.0627, 7.0841, 7.0762, 7.073, 7.0723, 7.0649, 7.0661, 7.0579, 7.0799, 7.0756, 7.0681, 7.0889, 7.0812, 7.0805, 7.0731, 7.097, 7.0953, 7.0871, 7.0793, 7.0981, 7.1166, 7.1088, 7.1109, 7.1036, 7.1212, 7.1238, 7.1225, 7.1187, 7.1114, 7.1036, 7.1207, 7.1157, 7.1078, 7.1245, 7.2723, 7.2693, 7.2658, 7.2614, 7.2774, 7.2931, 7.2884, 7.306, 7.3014, 7.3174, 7.3184, 7.3108, 7.3048, 7.3256, 7.3223, 7.3164, 7.3139, 7.3063, 7.3235, 7.3188, 7.3179, 7.3122, 7.3048, 7.3402, 7.3334, 7.3303, 7.3311, 7.3247, 7.3197, 7.3169, 7.2936, 7.2879, 7.2825, 7.2777, 7.2937, 7.288, 7.2812, 7.2752, 7.2701, 7.2635, 7.2567, 7.2705, 7.2667, 7.2604, 7.2672, 7.273, 7.2941, 7.2878, 7.3024, 7.2964, 7.2918, 7.2921, 7.2884, 7.2857, 7.279, 7.2748, 7.276, 7.2702, 7.2686, 7.2699, 7.2631, 7.2622, 7.2556, 7.2507, 7.2461, 7.2448, 7.2402, 7.2419, 7.2393, 7.2401, 7.2347, 7.2302, 7.2238, 7.2192, 7.2329, 7.2451, 7.2404, 7.2369, 7.2335, 7.2277, 7.2389, 7.2514, 7.2469, 7.2435, 7.2425, 7.2537, 7.2487, 7.2428, 7.2561, 7.2518, 7.2497, 7.2623, 7.2577, 7.2559, 7.2547, 7.2536, 7.2501, 7.2609, 7.2551, 7.25, 7.248, 7.2475, 7.2443, 7.2388, 7.2493, 7.244, 7.2414, 7.2411, 7.239, 7.2521, 7.2482, 7.2457, 7.241, 7.2363, 7.2304, 7.2279, 7.24, 7.2346, 7.2347, 7.2166, 7.2594, 7.2537, 7.265, 7.2599, 7.2696, 7.265, 7.2602, 7.3208, 7.3167, 7.3302, 7.3272, 7.3426, 7.3436, 7.344, 7.3382, 7.3369, 7.3351, 7.3347, 7.3451, 7.3408, 7.3361, 7.3313, 7.3259, 7.3236, 7.3188, 7.3147, 7.3093, 7.3193, 7.3285, 7.3266, 7.3256, 7.32, 7.3177, 7.3186, 7.3151, 7.3611, 7.384, 7.3812, 7.3776, 7.3861, 7.3819, 7.3767, 7.3749, 7.37, 7.3675, 7.3627, 7.3702, 7.3789, 7.3743, 7.369, 7.3679, 7.3628, 7.3604, 7.3591, 7.355, 7.3576, 7.3549, 7.3505, 7.3458, 7.3414, 7.3412, 7.3515, 7.3474, 7.3432, 7.3388, 7.3485, 7.3441, 7.3433, 7.3385, 7.3376, 7.3466, 7.342, 7.3406, 7.3357, 7.331, 7.3267, 7.3239, 7.3323, 7.3301, 7.3283, 7.3264, 7.3361, 7.3462, 7.3419, 7.3421, 7.3394, 7.3387, 7.3348, 7.3328, 7.3283, 7.3287, 7.3246, 7.323, 7.3206, 7.3165, 7.3159, 7.3123, 7.3084, 7.3067, 7.3059, 7.3029, 7.3019, 7.2979, 7.2967, 7.2933, 7.2901, 7.2898, 7.287, 7.284, 7.2832, 7.2921, 7.2898, 7.286, 7.2893, 7.3164, 7.3159, 7.3118, 7.3131, 7.31, 7.318, 7.3136, 7.3098, 7.3082, 7.3054, 7.3019, 7.2981, 7.2956, 7.3034, 7.3124, 7.3211, 7.3173, 7.3135, 7.31, 7.3063, 7.3041, 7.3, 7.2972, 7.3076, 7.3047, 7.3131, 7.3328, 7.3289, 7.3263, 7.3446, 7.3427, 7.3398, 7.3363, 7.3332, 7.3317, 7.3514, 7.3573, 7.3543, 7.3533, 7.3747, 7.3718, 7.3793, 7.3753, 7.3741, 7.3702, 7.3664, 7.3635, 7.3625, 7.359, 7.3558, 7.3571, 7.3559, 7.3543, 7.352, 7.3495, 7.3519, 7.3479, 7.3469, 7.3457, 7.3422, 7.3495, 7.3472, 7.3538, 7.3509, 7.3492, 7.3642, 7.3607, 7.3599, 7.3775, 7.3738, 7.3712, 7.3685, 7.3649, 7.3635, 7.3603, 7.3568, 7.3752, 7.3811, 7.3798, 7.3763, 7.3757, 7.3723, 7.3686, 7.3672, 7.3649, 7.3613, 7.3581, 7.3477, 7.3382, 7.3358, 7.3345, 7.3309, 7.3278, 7.325, 7.3322, 7.3297, 7.3278, 7.3408, 7.3473, 7.3443, 7.3479, 7.3448, 7.3572, 7.3543, 7.3513, 7.3569, 7.3563, 7.3556, 7.357, 7.3637, 7.3617, 7.3584, 7.3549, 7.3518, 7.3495, 7.347, 7.3529, 7.3517, 7.3481, 7.3452, 7.3423, 7.339, 7.3451, 7.3433, 7.3489, 7.3645, 7.3705, 7.3768, 7.3762, 7.3739, 7.3718, 7.3704, 7.3674, 7.3735, 7.3708, 7.3686, 7.3665, 7.3643, 7.3705, 7.3689, 7.3658, 7.372, 7.3688, 7.3675, 7.3641, 7.3641, 7.3633, 7.3687, 7.3749, 7.3717, 7.3685, 7.3651, 7.3642, 7.3747, 7.3803, 7.4141, 7.4136, 7.4115, 7.4097, 7.4067, 7.4161, 7.4131, 7.4051, 7.4029, 7.4005, 7.406, 7.4049, 7.4043, 7.4268, 7.4248, 7.4409, 7.4395, 7.437, 7.4357, 7.4413, 7.448, 7.4488, 7.4459, 7.4448, 7.4522, 7.4578, 7.4553, 7.4519, 7.4568, 7.4552, 7.4528, 7.4497, 7.4465, 7.4518, 7.4488, 7.4467, 7.4516, 7.4811, 7.4782, 7.4835, 7.4905, 7.4884, 7.4877, 7.4897, 7.4949, 7.4924, 7.4973, 7.4942, 7.5004, 7.4977, 7.4955, 7.4929, 7.4895, 7.4869, 7.4849, 7.4823, 7.4797, 7.4769, 7.4826, 7.4797, 7.4812, 7.4797, 7.4777, 7.4749, 7.4727, 7.478, 7.4764, 7.4737, 7.4793, 7.4766, 7.4738, 7.4719, 7.4692, 7.4673, 7.4648, 7.4711, 7.4762, 7.4797, 7.4853, 7.4838, 7.4834, 7.482, 7.4791, 7.4763, 7.4752, 7.473, 7.4786, 7.4765, 7.4751, 7.4726, 7.4708, 7.4688, 7.4667, 7.4637, 7.4624, 7.4598, 7.4589, 7.45, 7.4553, 7.4537, 7.4513, 7.4483, 7.4473, 7.4443, 7.4417, 7.4478, 7.4452, 7.4482, 7.4546, 7.4699, 7.4674, 7.4652, 7.4702, 7.4673, 7.4656, 7.4706, 7.4701, 7.4749, 7.4721, 7.4774, 7.4817, 7.4867, 7.4919, 7.4915, 7.4889, 7.4873, 7.4861, 7.4851, 7.4822, 7.4811, 7.4797, 7.4783, 7.4774, 7.4762, 7.4737, 7.4782, 7.4772, 7.4819, 7.4805, 7.4798, 7.4798, 7.4785, 7.4771, 7.4749, 7.4799, 7.4772, 7.4748, 7.4724, 7.4697, 7.4676, 7.4663, 7.4646, 7.4635, 7.4627, 7.46, 7.458, 7.4554, 7.4529, 7.4534, 7.4522, 7.4509, 7.4499, 7.4541, 7.4539, 7.4511, 7.4491, 7.447, 7.4454, 7.4445, 7.4421, 7.4397, 7.4478, 7.4456, 7.4501, 7.448, 7.4534, 7.4513, 7.4505, 7.456, 7.4564, 7.4548, 7.4521, 7.4496, 7.4538, 7.4581, 7.4562, 7.4555, 7.4601, 7.4577, 7.4624, 7.4611, 7.4589, 7.4635, 7.4615, 7.459, 7.4568, 7.4614, 7.4601, 7.4579, 7.4565, 7.4544, 7.4521, 7.4498, 7.4557, 7.4616, 7.4595, 7.4588, 7.4565, 7.463, 7.4629, 7.4628, 7.467, 7.4669, 7.4647, 7.4623, 7.4667, 7.4661, 7.4643, 7.4635, 7.47, 7.4678, 7.466, 7.4639, 7.4699, 7.4673, 7.4712, 7.4696, 7.4737, 7.4713, 7.4694, 7.4681, 7.467, 7.4655, 7.4694, 7.4671, 7.4648, 7.4624, 7.4599, 7.4584, 7.4574, 7.4562, 7.4599, 7.4648, 7.4625, 7.4607, 7.4604, 7.4586, 7.463, 7.4671, 7.4713, 7.4749, 7.4744, 7.4738, 7.4716, 7.4691, 7.4727, 7.4765, 7.4769, 7.4761, 7.4737, 7.4779, 7.476, 7.4738, 7.4845, 7.4838, 7.4819, 7.48, 7.4835, 7.4813, 7.4808, 7.4787, 7.4826, 7.4803, 7.4782, 7.482, 7.4802, 7.478, 7.4759, 7.474, 7.4717, 7.4701, 7.468, 7.4657, 7.4644, 7.4643, 7.4629, 7.463, 7.4679, 7.4668, 7.4646, 7.4624, 7.4604, 7.4583, 7.4624, 7.4664, 7.4657, 7.47, 7.4687, 7.4681, 7.4665, 7.4649, 7.4626, 7.4663, 7.4645, 7.4624, 7.4603, 7.4586, 7.4577, 7.4611, 7.4595, 7.4573, 7.4551, 7.4591, 7.458, 7.4565, 7.4565, 7.4794, 7.4828, 7.4806, 7.4788, 7.4779, 7.4766, 7.4754, 7.475, 7.4732, 7.4709, 7.4687, 7.4667, 7.465, 7.4643, 7.4651, 7.4656, 7.4643, 7.4629, 7.4662, 7.4655, 7.4637, 7.4623, 7.4621, 7.4605, 7.4585, 7.4567, 7.4556, 7.4536, 7.4515, 7.455, 7.4548, 7.4526, 7.4513, 7.449, 7.4527, 7.4518, 7.45, 7.4486, 7.4489, 7.4468, 7.4505, 7.4484, 7.4462, 7.4499, 7.448, 7.4516, 7.451, 7.4497, 7.4621, 7.4711, 7.4766, 7.4748, 7.4732, 7.4725, 7.4763, 7.4742, 7.4732, 7.4717, 7.4704, 7.4695, 7.4691, 7.4725, 7.4716, 7.4697, 7.4676, 7.4654, 7.4646, 7.4625, 7.4617, 7.4648, 7.4629, 7.4611, 7.4602, 7.46, 7.4581, 7.4568, 7.4546, 7.4583, 7.4562, 7.4547, 7.4538, 7.4543, 7.4523, 7.4505, 7.449, 7.4529, 7.4518, 7.4501, 7.4482, 7.4484, 7.4478, 7.4469, 7.4452, 7.444, 7.4425, 7.4514, 7.4668, 7.4648, 7.4629, 7.461, 7.4595, 7.4576, 7.4559, 7.4543, 7.4531, 7.4522, 7.4506, 7.4545, 7.4534, 7.4514, 7.4511, 7.4496, 7.4526, 7.4557, 7.4539, 7.453, 7.4628, 7.4613, 7.4654, 7.4737, 7.4723, 7.4664, 7.4651, 7.463, 7.4629, 7.4612, 7.4595, 7.4547, 7.4527, 7.4519, 7.455, 7.4542, 7.4522, 7.4503, 7.4508, 7.449, 7.4481, 7.4463, 7.4443, 7.4433, 7.4467, 7.4454, 7.4436, 7.4423, 7.4406, 7.4438, 7.4426, 7.4417, 7.44, 7.443, 7.4411, 7.4446, 7.4452, 7.444, 7.4427, 7.4417, 7.44, 7.4392, 7.4427, 7.4418, 7.4408, 7.4402, 7.4445, 7.4435, 7.4426, 7.4461, 7.445, 7.4495, 7.4495, 7.4534, 7.4515, 7.4552, 7.4537, 7.4531, 7.4525, 7.4515, 7.4497, 7.448, 7.447, 7.4459, 7.4454, 7.4441, 7.4435, 7.4417, 7.4426, 7.4456, 7.4437, 7.4424, 7.4411, 7.44, 7.4389, 7.4373, 7.4369, 7.4404, 7.4387, 7.4369, 7.4363, 7.4357, 7.4344, 7.4338, 7.4322, 7.4309, 7.4344, 7.433, 7.4316, 7.4304, 7.4297, 7.4282, 7.4268, 7.4262, 7.425, 7.4236, 7.4269, 7.4255, 7.4243, 7.4188, 7.4173, 7.4175, 7.4183, 7.4167, 7.4165, 7.4148, 7.4143, 7.4131, 7.4115, 7.415, 7.4132, 7.4123, 7.4107, 7.4089, 7.4072, 7.4057, 7.4087, 7.4074, 7.4057, 7.4044, 7.4026, 7.4009, 7.3992, 7.3975, 7.3969, 7.4006, 7.4012, 7.4009, 7.4042, 7.4025, 7.4009, 7.3997, 7.3995, 7.3978, 7.397, 7.3953, 7.3987, 7.3979, 7.3963, 7.3993, 7.3983, 7.398, 7.4012, 7.4005, 7.4006, 7.4005, 7.3995, 7.3978, 7.3968, 7.3955, 7.3941, 7.3929, 7.3914, 7.3959, 7.3956, 7.3941, 7.3935, 7.3921, 7.3921, 7.3914, 7.3901, 7.3889, 7.3843, 7.3868, 7.39, 7.3884, 7.3868, 7.3851, 7.3834, 7.3824, 7.3853, 7.3836, 7.3866, 7.3868, 7.3852, 7.3836, 7.3838, 7.3872, 7.3876, 7.3885, 7.388, 7.3873, 7.3857, 7.3844, 7.3829, 7.3813, 7.38, 7.3787, 7.3788, 7.3779, 7.3763, 7.3809, 7.3806, 7.3823, 7.3821, 7.385, 7.3836, 7.3825, 7.3809, 7.3836, 7.3827, 7.383, 7.3831, 7.382, 7.3856, 7.3862, 7.3847, 7.3831, 7.382, 7.3826, 7.382, 7.3803, 7.3798, 7.3786, 7.3813, 7.3797, 7.3783, 7.3771, 7.3804, 7.3789, 7.3814, 7.3926, 7.4068, 7.4087, 7.409, 7.4078, 7.4065, 7.4051, 7.4052, 7.4042, 7.4027, 7.4014, 7.4003, 7.3992, 7.3981, 7.3982, 7.3974, 7.3965, 7.3954, 7.3946, 7.3944, 7.3978, 7.4011, 7.3996, 7.3983, 7.3969, 7.3957, 7.3955, 7.3961, 7.3945, 7.3942, 7.3932, 7.3919, 7.3995, 7.3984, 7.398, 7.3971, 7.3963, 7.3947, 7.3936, 7.3921, 7.3907, 7.3897, 7.3886, 7.3873, 7.3872, 7.3899, 7.3975, 7.3961, 7.3955, 7.3942, 7.3971, 7.3967, 7.3968, 7.3955, 7.3948, 7.3934, 7.3928, 7.392, 7.3905, 7.3893, 7.3883, 7.3868, 7.3853, 7.3881, 7.3875, 7.3868, 7.3853, 7.3841, 7.3825, 7.3817, 7.3803, 7.3792, 7.3777, 7.3803, 7.3801, 7.3826, 7.3817, 7.3803, 7.379, 7.3783, 7.3779, 7.3775, 7.376, 7.3749, 7.3746, 7.3734, 7.3731, 7.3721, 7.3767, 7.3807, 7.3793, 7.3779, 7.377, 7.3755, 7.3742, 7.3728, 7.3714, 7.37, 7.3694, 7.3718, 7.3709, 7.3698, 7.3723, 7.371, 7.3736, 7.3737, 7.3723, 7.375, 7.3736, 7.373, 7.3719, 7.3711, 7.3704, 7.3691, 7.3677, 7.3666, 7.3659, 7.3652, 7.3637, 7.3631, 7.3624, 7.3744, 7.3729, 7.3755, 7.3782, 7.3771, 7.3758, 7.3747, 7.3734, 7.3771, 7.3761, 7.3763, 7.3749, 7.3778, 7.3806, 7.3796, 7.3793, 7.3784, 7.3807, 7.3834, 7.3862, 7.3861, 7.3854, 7.3848, 7.3842, 7.3831, 7.386, 7.3848, 7.3835, 7.3822, 7.381, 7.3834, 7.3822, 7.3809, 7.3835, 7.3821, 7.3847, 7.387, 7.3858, 7.3845, 7.3834, 7.3822, 7.3808, 7.3863, 7.3851, 7.3887, 7.3914, 7.3899, 7.3886, 7.3913, 7.3942, 7.3932, 7.3924, 7.3909, 7.39, 7.3886, 7.3881, 7.3874, 7.3895, 7.3883, 7.3908, 7.3897, 7.3883, 7.387, 7.3894, 7.3889, 7.3893, 7.3897, 7.3883, 7.3879, 7.3868, 7.3862, 7.3851, 7.3836, 7.3851, 7.3838, 7.3867, 7.3865, 7.3854, 7.3851, 7.3885, 7.3882, 7.3872, 7.387, 7.3862, 7.3858, 7.3889, 7.3876, 7.3866, 7.3892, 7.3879, 7.391, 7.3901, 7.3893, 7.3879, 7.387, 7.3856, 7.388, 7.391, 7.3896, 7.3946, 7.3986, 7.3981, 7.3976, 7.4008, 7.3998, 7.3986, 7.3989, 7.3979, 7.3986, 7.3982, 7.397, 7.3964, 7.3954, 7.3943, 7.397, 7.3969, 7.3994, 7.3987, 7.3988, 7.4011, 7.4001, 7.3989, 7.3978, 7.3971, 7.3959, 7.3946, 7.3938, 7.3937, 7.3933, 7.3927, 7.3953, 7.3929, 7.3927, 7.3923, 7.3911, 7.3935, 7.3923, 7.3917, 7.3906, 7.3896, 7.3922, 7.3945, 7.3941, 7.3942, 7.3931, 7.3953, 7.3949, 7.3974, 7.3998, 7.3998, 7.3986, 7.3974, 7.396, 7.3951, 7.3943, 7.3938, 7.3927, 7.3926, 7.3921, 7.3911, 7.3902, 7.39, 7.3886, 7.3884, 7.3843, 7.3832, 7.3826, 7.3851, 7.3844, 7.3832, 7.382, 7.3816, 7.3805, 7.3802, 7.3794, 7.3781, 7.377, 7.3761, 7.376, 7.3785, 7.3778, 7.377, 7.3759, 7.3748, 7.3736, 7.3724, 7.3716, 7.3704, 7.3692, 7.3679, 7.367, 7.369, 7.3679, 7.3674, 7.3663, 7.3698, 7.3687, 7.3713, 7.3708, 7.3698, 7.3686, 7.368, 7.3706, 7.3702, 7.3694, 7.3702, 7.3663, 7.3687, 7.3711, 7.3706, 7.3701, 7.369, 7.3715, 7.3707, 7.3711, 7.3704, 7.3694, 7.372, 7.3712, 7.3736, 7.3729, 7.3758, 7.3747, 7.3738, 7.37, 7.3694, 7.3693, 7.3683, 7.3672, 7.367, 7.3661, 7.3653, 7.3642, 7.3638, 7.363, 7.3623, 7.3611, 7.3599, 7.3587, 7.3586, 7.3574, 7.3575, 7.3565, 7.3555, 7.355, 7.3541, 7.3531, 7.3519, 7.3514, 7.3503, 7.3492, 7.3484, 7.3482, 7.3477, 7.3503, 7.3496, 7.3489, 7.3486, 7.3509, 7.3515, 7.3509, 7.3497, 7.3491, 7.3486, 7.3485, 7.3513, 7.3537, 7.3533, 7.3522, 7.3512, 7.351, 7.35, 7.3489, 7.3494, 7.3486, 7.348, 7.3474, 7.3494, 7.3486, 7.3474, 7.3498, 7.3486, 7.3482, 7.3475, 7.3496, 7.3503, 7.3495, 7.3491, 7.3517, 7.3585, 7.3583, 7.3615, 7.3642, 7.3638, 7.3633, 7.3625, 7.3615, 7.361, 7.3604, 7.3594, 7.3589, 7.358, 7.3577, 7.3569, 7.3558, 7.3586, 7.3611, 7.3605, 7.3595, 7.3588, 7.361, 7.3629, 7.3679, 7.3698, 7.3758, 7.3748, 7.3773, 7.3799, 7.3787, 7.3777, 7.3766, 7.3765, 7.3753, 7.375, 7.3773, 7.3762, 7.3751, 7.3742, 7.3737, 7.3727, 7.3753, 7.3741, 7.3761, 7.3758, 7.3777, 7.3767, 7.379, 7.3811, 7.3833, 7.3821, 7.3812, 7.3862, 7.3853, 7.382, 7.3816, 7.3818, 7.3814, 7.3804, 7.3792, 7.378, 7.3772, 7.3764, 7.379, 7.3791, 7.3783, 7.3773, 7.3764, 7.3754, 7.3778, 7.3771, 7.3762, 7.3756, 7.3776, 7.3765, 7.3755, 7.3744, 7.3768, 7.3772, 7.3794, 7.3818, 7.3808, 7.383, 7.3824, 7.3816, 7.3815, 7.3814, 7.3843, 7.3853, 7.3846, 7.3843, 7.3838, 7.3829, 7.3848, 7.3844, 7.3835, 7.3827, 7.3817, 7.3813, 7.3809, 7.38, 7.379, 7.381, 7.38, 7.3796, 7.3792, 7.3785, 7.378, 7.3774, 7.3771, 7.3825, 7.3819, 7.3841, 7.3861, 7.3851, 7.3852, 7.3847, 7.3865, 7.3854, 7.3876, 7.3865, 7.3854, 7.3851, 7.384, 7.3835, 7.3824, 7.382, 7.3809, 7.3802, 7.3823, 7.3815, 7.384, 7.3829, 7.3827, 7.3822, 7.3859, 7.3851, 7.3847, 7.3845, 7.3837, 7.3873, 7.3865, 7.3861, 7.3851, 7.3844, 7.3835, 7.383, 7.3821, 7.381, 7.3833, 7.3827, 7.3847, 7.3864, 7.3853, 7.3842, 7.3831, 7.382, 7.3812, 7.3807, 7.3796, 7.3846, 7.3836, 7.3827, 7.3817, 7.3837, 7.3803, 7.3824, 7.3846, 7.3874, 7.3864, 7.3889, 7.3885, 7.3881, 7.3878, 7.3868, 7.3863, 7.3852, 7.3844, 7.3836, 7.3833, 7.3825, 7.3817, 7.3812, 7.3802, 7.3821, 7.3812, 7.381, 7.3805, 7.38, 7.3801, 7.3818, 7.3786, 7.3753, 7.3753, 7.3771, 7.376, 7.3752, 7.377, 7.376, 7.375, 7.3739, 7.373, 7.3719, 7.3769, 7.3789, 7.3783, 7.3806, 7.3825, 7.3821, 7.3813, 7.3804, 7.382, 7.3811, 7.3811, 7.3806, 7.3795, 7.379, 7.3839, 7.3831, 7.3822, 7.3818, 7.3837, 7.3856, 7.3846, 7.3844, 7.3834, 7.3826, 7.3818, 7.3813, 7.3804, 7.3825, 7.3817, 7.3815, 7.3806, 7.3798, 7.3816, 7.3807, 7.3822, 7.3814, 7.381, 7.3834, 7.3803, 7.38, 7.3798, 7.3793, 7.3791, 7.3781, 7.3776, 7.3778, 7.3773, 7.3771, 7.3766, 7.3761, 7.3755, 7.375, 7.3743, 7.3735, 7.3755, 7.3744, 7.3735, 7.3727, 7.3723, 7.374, 7.3757, 7.3779, 7.3796, 7.3825, 7.3818, 7.3807, 7.3799, 7.3845, 7.3897, 7.3888, 7.3882, 7.3874, 7.4006, 7.4, 7.399, 7.4008, 7.3998, 7.3988, 7.3978, 7.3975, 7.3966, 7.3957, 7.3947, 7.3944, 7.3947, 7.394, 7.3933, 7.3928, 7.3927, 7.3918, 7.3937, 7.3929, 7.392, 7.3917, 7.3911, 7.3903, 7.3894, 7.3914, 7.3904, 7.3902, 7.3892, 7.3911, 7.3901, 7.3919, 7.3909, 7.3901, 7.3895, 7.3887, 7.3887, 7.3883, 7.3881, 7.3871, 7.3893, 7.3884, 7.3874, 7.3895, 7.3899, 7.3895, 7.3889, 7.388, 7.3877, 7.3875, 7.3866, 7.3855, 7.3848, 7.384, 7.3841, 7.3836, 7.3838, 7.3833, 7.3829, 7.3831, 7.3829, 7.3854, 7.3847, 7.3837, 7.3832, 7.3823, 7.382, 7.3819, 7.3811, 7.3804, 7.3795, 7.3787, 7.3805, 7.3796, 7.3786, 7.3776, 7.3768, 7.3764, 7.3761, 7.3754, 7.3752, 7.3747, 7.3746, 7.3764, 7.3754, 7.3747, 7.3766, 7.3762, 7.3757, 7.3752, 7.3746, 7.3741, 7.3758, 7.3748, 7.3738, 7.3759, 7.3751, 7.3744, 7.3737, 7.3731, 7.3722, 7.3713, 7.3703, 7.3722, 7.3715, 7.3707, 7.3701, 7.3695, 7.3714, 7.3732, 7.3727, 7.3723, 7.374, 7.3737, 7.3732, 7.3727, 7.3725, 7.3717, 7.371, 7.371, 7.37, 7.3696, 7.3686, 7.3682, 7.3672, 7.3694, 7.371, 7.3727, 7.3718, 7.3716, 7.3742, 7.3734, 7.3731, 7.3733, 7.3724, 7.3714, 7.373, 7.3747, 7.3747, 7.3742, 7.3733, 7.3728, 7.3726, 7.3716, 7.3712, 7.3704, 7.3724, 7.3721, 7.3712, 7.3708, 7.3698, 7.3715, 7.3712, 7.3706, 7.37, 7.3697, 7.3742, 7.3736, 7.373, 7.3748, 7.3743, 7.376, 7.3763, 7.3781, 7.3775, 7.3767, 7.3834, 7.3852, 7.3869, 7.3867, 7.3862, 7.3873, 7.3864, 7.3856, 7.3865, 7.3837, 7.3819, 7.3867, 7.3883, 7.3898, 7.3893, 7.3894, 7.3891, 7.389, 7.3883, 7.3877, 7.3872, 7.3892, 7.3884, 7.3878, 7.3883, 7.3904, 7.3924, 7.3915, 7.3915, 7.3912, 7.393, 7.3924, 7.3945, 7.3946, 7.3945, 7.3937, 7.3932, 7.3928, 7.3929, 7.3921, 7.3914, 7.3904, 7.3894, 7.391, 7.3904, 7.39, 7.3893, 7.3893, 7.3909, 7.3884, 7.3879, 7.3877, 7.3871, 7.3888, 7.3879, 7.3871, 7.3862, 7.3879, 7.3873, 7.3867, 7.3874, 7.3867, 7.3861, 7.3879, 7.3871, 7.3896, 7.3906, 7.3897, 7.3892, 7.3883, 7.3876, 7.3895, 7.3911, 7.3906, 7.3898, 7.392, 7.3913, 7.3904, 7.3901, 7.3922, 7.3915, 7.3906, 7.3897, 7.3893, 7.3909, 7.3902, 7.3893, 7.3889, 7.3883, 7.3873, 7.3871, 7.3867, 7.3859, 7.3851, 7.3844, 7.3837, 7.3828, 7.382, 7.3817, 7.3815, 7.3831, 7.3806, 7.3797, 7.3813, 7.3834, 7.3832, 7.3823, 7.3824, 7.3816, 7.3808, 7.3824, 7.3822, 7.3838, 7.3828, 7.3825, 7.3823, 7.3819, 7.3845, 7.3842, 7.3843, 7.3862, 7.3855, 7.3852, 7.3847, 7.3839, 7.3831, 7.3823, 7.3843, 7.3839, 7.383, 7.3826, 7.3822, 7.3813, 7.3806, 7.3797, 7.3813, 7.3804, 7.3798, 7.3824, 7.382, 7.3836, 7.3829, 7.3828, 7.3819, 7.3811, 7.3828, 7.3819, 7.3814, 7.3832, 7.3824, 7.3838, 7.3831, 7.3828, 7.382, 7.3819, 7.3848, 7.3846, 7.384, 7.3832, 7.3828, 7.3829, 7.3834, 7.383, 7.3849, 7.3871, 7.3874, 7.3868, 7.3861, 7.3854, 7.385, 7.3842, 7.3839, 7.3854, 7.3847, 7.3844, 7.3836, 7.3831, 7.3836, 7.386, 7.386, 7.3853, 7.3845, 7.3836, 7.3807, 7.3805, 7.3799, 7.379, 7.3806, 7.3797, 7.3811, 7.3803, 7.3796, 7.38, 7.3799, 7.3799, 7.3832, 7.383, 7.3826, 7.3842, 7.384, 7.3856, 7.3848, 7.3846, 7.3839, 7.3832, 7.3823, 7.3841, 7.3832, 7.383, 7.3823, 7.3816, 7.3807, 7.3804, 7.3795, 7.3788, 7.3807, 7.3826, 7.3818, 7.3815, 7.3807, 7.3801, 7.3797, 7.3794, 7.3788, 7.3783, 7.3777, 7.3769, 7.3761, 7.3754, 7.3749, 7.3747, 7.3747, 7.3744, 7.3736, 7.3749, 7.3767, 7.376, 7.3754, 7.3755, 7.3754, 7.3755, 7.375, 7.3767, 7.3764, 7.3756, 7.3749, 7.3765, 7.3784, 7.3776, 7.3772, 7.3765, 7.376, 7.3753, 7.3747, 7.374, 7.3753, 7.3768, 7.3782, 7.3774, 7.3766, 7.376, 7.3754, 7.373, 7.3747, 7.374, 7.3756, 7.3749, 7.3765, 7.3739, 7.376, 7.3755, 7.3748, 7.3742, 7.3738, 7.3736, 7.373, 7.3723, 7.3722, 7.3737, 7.3733, 7.3748, 7.3745, 7.3744, 7.3757, 7.375, 7.3764, 7.378, 7.3794, 7.3809, 7.3802, 7.3798, 7.3791, 7.3783, 7.3775, 7.3767, 7.3783, 7.3777, 7.3771, 7.3769, 7.3768, 7.3761, 7.3753, 7.3745, 7.374, 7.3735, 7.3726, 7.3741, 7.3733, 7.3726, 7.372, 7.3717, 7.3712, 7.3705, 7.3697, 7.3698, 7.3694, 7.371, 7.3704, 7.3685, 7.3678, 7.3702, 7.3716, 7.3714, 7.3717, 7.3709, 7.3725, 7.3721, 7.3713, 7.3706, 7.3721, 7.3714, 7.3706, 7.3703, 7.3722, 7.3715, 7.3709, 7.3704, 7.3699, 7.3696, 7.3691, 7.3686, 7.3688, 7.3706, 7.3721, 7.3717, 7.3709, 7.3704, 7.3697, 7.369, 7.3683, 7.37, 7.3693, 7.3709, 7.3701, 7.3678, 7.3672, 7.3668, 7.3661, 7.3653, 7.3645, 7.3658, 7.365, 7.3643, 7.3636, 7.3629, 7.3626, 7.3629, 7.3643, 7.3641, 7.3656, 7.3663, 7.3656, 7.3649, 7.3725, 7.3738, 7.3731, 7.3726, 7.3724, 7.3734, 7.3726, 7.3699, 7.3692, 7.3691, 7.3684, 7.3681, 7.3678, 7.3671, 7.3666, 7.366, 7.3653, 7.3648, 7.364, 7.3632, 7.3645, 7.3644, 7.3643, 7.3681, 7.3673, 7.367, 7.3686, 7.3679, 7.3676, 7.3669, 7.3683, 7.3677, 7.3674, 7.3666, 7.3681, 7.3693, 7.3686, 7.3699, 7.3712, 7.3704, 7.3701, 7.3714, 7.371, 7.3708, 7.3701, 7.3693, 7.3688, 7.3687, 7.3702, 7.3703, 7.3699, 7.3677, 7.3682, 7.3674, 7.3687, 7.3681, 7.3683, 7.3677, 7.3669, 7.3674, 7.3668, 7.366, 7.3654, 7.3651, 7.3647, 7.3645, 7.3641, 7.3639, 7.365, 7.3648, 7.3663, 7.3664, 7.3657, 7.3652, 7.3667, 7.3663, 7.3659, 7.3659, 7.3652, 7.3648, 7.3642, 7.3643, 7.364, 7.3635, 7.3635, 7.3628, 7.3622, 7.3616, 7.364, 7.3636, 7.3631, 7.3637, 7.3631, 7.3646, 7.364, 7.3637, 7.3633, 7.363, 7.3623, 7.3615, 7.3607, 7.3602, 7.3617, 7.363, 7.3644, 7.3638, 7.3636, 7.3631, 7.3628, 7.3625, 7.3617, 7.3615, 7.3612, 7.3627, 7.3642, 7.3642, 7.3627, 7.3619, 7.3612, 7.3608, 7.3604, 7.3599, 7.3603, 7.3601, 7.3614, 7.3609, 7.3606, 7.3599, 7.3591, 7.3585, 7.3599, 7.3596, 7.3589, 7.3583, 7.3598, 7.3596, 7.3589, 7.3582, 7.3574, 7.357, 7.3567, 7.3563, 7.3557, 7.356, 7.3555, 7.3556, 7.355, 7.3566, 7.3564, 7.3558, 7.3553, 7.3547, 7.3562, 7.3597, 7.3591, 7.359, 7.3591, 7.3584, 7.3582, 7.3576, 7.3586, 7.3579, 7.3573, 7.3568, 7.3561, 7.3554, 7.3549, 7.3545, 7.3557, 7.355, 7.3547, 7.3543, 7.3556, 7.3549, 7.3542, 7.3535, 7.3528, 7.3524, 7.3522, 7.3559, 7.3552, 7.3529, 7.3521, 7.3521, 7.3534, 7.3534, 7.3527, 7.352, 7.3518, 7.3511, 7.3508, 7.3501, 7.3499, 7.3493, 7.3491, 7.3504, 7.3498, 7.3491, 7.3487, 7.3481, 7.3473, 7.3471, 7.3485, 7.3499, 7.3492, 7.3503, 7.3496, 7.3492, 7.3506, 7.35, 7.3516, 7.3531, 7.3546, 7.3544, 7.3542, 7.3542, 7.3536, 7.3528, 7.3528, 7.352, 7.3523, 7.3516, 7.3509, 7.3524, 7.3518, 7.3512, 7.3506, 7.3499, 7.3493, 7.3508, 7.3501, 7.3494, 7.3488, 7.3486, 7.348, 7.3479, 7.3471, 7.3464, 7.3457, 7.3455, 7.3448, 7.3462, 7.3445, 7.3422, 7.3421, 7.3439, 7.3432, 7.3428, 7.3441, 7.3436, 7.3429, 7.3424, 7.3437, 7.3435, 7.3447, 7.3445, 7.3438, 7.3431, 7.3428, 7.3421, 7.3416, 7.3409, 7.3402, 7.3395, 7.3393, 7.339, 7.3383, 7.3376, 7.3372, 7.3407, 7.3402, 7.3398, 7.3391, 7.3424, 7.3417, 7.3411, 7.3409, 7.3407, 7.3421, 7.3416, 7.3414, 7.3411, 7.3407, 7.34, 7.3393, 7.3389, 7.3387, 7.3381, 7.3376, 7.3371, 7.3368, 7.3366, 7.3365, 7.3381, 7.3394, 7.3391, 7.3405, 7.3398, 7.3391, 7.339, 7.3388, 7.3386, 7.3379, 7.3372, 7.3374, 7.3378, 7.339, 7.3383, 7.3395, 7.3407, 7.3406, 7.341, 7.3403, 7.3397, 7.3392, 7.3386, 7.3382, 7.3382, 7.3376, 7.3369, 7.3364, 7.3357, 7.3357, 7.335, 7.3349, 7.3343, 7.3358, 7.3351, 7.3353, 7.335, 7.3351, 7.3347, 7.334, 7.3336, 7.3336, 7.3331, 7.3324, 7.3317, 7.33, 7.3293, 7.3286, 7.3279, 7.3294, 7.3309, 7.3306, 7.33, 7.3297, 7.3291, 7.3285, 7.3282, 7.3276, 7.3304, 7.3301, 7.3298, 7.3292, 7.3288, 7.3283, 7.3298, 7.3312, 7.3312, 7.3307, 7.3301, 7.3295, 7.3295, 7.329, 7.3285, 7.3299, 7.3295, 7.3294, 7.329, 7.3285, 7.3285, 7.3288, 7.3281, 7.3274, 7.327, 7.3264, 7.3273, 7.3319, 7.332, 7.3342, 7.3342, 7.3338, 7.3332, 7.3328, 7.3321, 7.3317, 7.3315, 7.3311, 7.3327, 7.3324, 7.3321, 7.3315, 7.3309, 7.3302, 7.3299, 7.3311, 7.3308, 7.332, 7.3332, 7.3328, 7.3321, 7.3314, 7.3307, 7.3301, 7.3296, 7.329, 7.3284, 7.328, 7.3277, 7.3271, 7.3265, 7.3277, 7.3274, 7.3289, 7.3283, 7.3278, 7.3275, 7.3319, 7.3384, 7.3396, 7.3408, 7.3419, 7.3416, 7.3414, 7.3408, 7.3404, 7.3417, 7.341, 7.3407, 7.3401, 7.3415, 7.3409, 7.3403, 7.3399, 7.3392, 7.339, 7.3384, 7.3378, 7.3373, 7.3386, 7.3398, 7.3392, 7.3389, 7.3382, 7.3376, 7.3389, 7.3388, 7.3382, 7.3377, 7.339, 7.3386, 7.3387, 7.34, 7.3413, 7.3425, 7.3436, 7.3433, 7.3432, 7.3426, 7.3419, 7.3431, 7.3485, 7.3485, 7.3485, 7.3479, 7.3472, 7.3485, 7.3488, 7.3482, 7.3479, 7.3489, 7.3485, 7.3478, 7.3471, 7.345, 7.3453, 7.3465, 7.3461, 7.3457, 7.3451, 7.3463, 7.3477, 7.3475, 7.3469, 7.3464, 7.3476, 7.3474, 7.3469, 7.3464, 7.3476, 7.3469, 7.3465, 7.3466, 7.3481, 7.3537, 7.3532, 7.3538, 7.3534, 7.3529, 7.3541, 7.3536, 7.353, 7.3524, 7.3522, 7.3517, 7.3515, 7.351, 7.3506, 7.35, 7.3495, 7.3489, 7.3488, 7.3501, 7.3497, 7.3496, 7.349, 7.3485, 7.3479, 7.3475, 7.3474, 7.3487, 7.348, 7.3477, 7.3472, 7.3471, 7.3472, 7.3468, 7.3462, 7.3458, 7.3452, 7.3446, 7.3443, 7.3439, 7.3451, 7.3464, 7.3459, 7.3453, 7.3448, 7.3442, 7.3438, 7.3434, 7.343, 7.3426, 7.3436, 7.3431, 7.343, 7.3452, 7.3446, 7.3489, 7.3485, 7.3478, 7.3472, 7.3468, 7.3465, 7.3479, 7.348, 7.3475, 7.3472, 7.3471, 7.3506, 7.3521, 7.3517, 7.3514, 7.3512, 7.3505, 7.3501, 7.3503, 7.3496, 7.3492, 7.3489, 7.3485, 7.3479, 7.3475, 7.3473, 7.3473, 7.3471, 7.3469, 7.3463, 7.3458, 7.3453, 7.3466, 7.346, 7.3454, 7.3449, 7.3444, 7.3442, 7.3441, 7.3436, 7.3434, 7.343, 7.3425, 7.3422, 7.3416, 7.341, 7.3405, 7.34, 7.3397, 7.3393, 7.3388, 7.3382, 7.3394, 7.339, 7.3385, 7.3378, 7.3392, 7.3406, 7.3402, 7.3396, 7.3391, 7.3389, 7.3401, 7.3395, 7.3408, 7.3403, 7.3398, 7.3397, 7.3392, 7.3387, 7.3382, 7.3375, 7.337, 7.3383, 7.3395, 7.3389, 7.3402, 7.3413, 7.3408, 7.3403, 7.3397, 7.3391, 7.3385, 7.3379, 7.3376, 7.337, 7.3364, 7.3361, 7.3361, 7.3359, 7.3358, 7.337, 7.3367, 7.3363, 7.336, 7.3355, 7.3366, 7.336, 7.3356, 7.335, 7.3344, 7.3342, 7.3336, 7.3332, 7.3326, 7.332, 7.3331, 7.3331, 7.3326, 7.3305, 7.3302, 7.3296, 7.3291, 7.3285, 7.3282, 7.328, 7.3291, 7.3285, 7.3279, 7.3273, 7.3271, 7.3266, 7.326, 7.3256, 7.325, 7.3248, 7.326, 7.3254, 7.3251, 7.3262, 7.3256, 7.325, 7.3247, 7.3259, 7.3258, 7.3271, 7.3266, 7.3278, 7.329, 7.3285, 7.328, 7.3279, 7.3277, 7.3271, 7.3266, 7.3265, 7.3261, 7.3296, 7.3294, 7.3293, 7.3305, 7.33, 7.3296, 7.3291, 7.331, 7.3307, 7.3297, 7.3294, 7.3291, 7.3285, 7.3285, 7.3287, 7.3308, 7.3303, 7.3301, 7.3299, 7.3294, 7.329, 7.3286, 7.328, 7.3279, 7.3278, 7.3272, 7.3269, 7.3267, 7.3262, 7.3258, 7.327, 7.3264, 7.3259, 7.3256, 7.3254, 7.3249, 7.3243, 7.3239, 7.3237, 7.3232, 7.323, 7.3227, 7.3225, 7.3221, 7.3233, 7.3231, 7.3226, 7.3222, 7.3219, 7.3213, 7.3226, 7.3222, 7.3218, 7.3212, 7.3209, 7.322, 7.3216, 7.3211, 7.3205, 7.3206, 7.3201, 7.3181, 7.3175, 7.3187, 7.3187, 7.3188, 7.3198, 7.3194, 7.319, 7.3217, 7.3211, 7.3206, 7.3206, 7.3202, 7.3201, 7.3199, 7.3214, 7.3226, 7.324, 7.3235, 7.3229, 7.3239, 7.3251, 7.3245, 7.3239, 7.337, 7.3365, 7.336, 7.3354, 7.3349, 7.3344, 7.3339, 7.3366, 7.3365, 7.3377, 7.3389, 7.3385, 7.3382, 7.338, 7.3374, 7.3369, 7.337, 7.3365, 7.3366, 7.3364, 7.336, 7.3359, 7.3353, 7.3337, 7.3334, 7.3329, 7.3323, 7.3318, 7.3312, 7.3306, 7.3301, 7.3295, 7.3289, 7.3283, 7.3293, 7.329, 7.3284, 7.3284, 7.328, 7.3277, 7.3272, 7.3282, 7.3279, 7.329, 7.3289, 7.3285, 7.3279, 7.3274, 7.3269, 7.3264, 7.3259, 7.3286, 7.3301, 7.3299, 7.331, 7.3321, 7.3316, 7.3328, 7.3322, 7.3336, 7.3331, 7.3343, 7.3338, 7.3336, 7.3347, 7.3342, 7.3339, 7.3335, 7.333, 7.3341, 7.3337, 7.3334, 7.3331, 7.3326, 7.3328, 7.3329, 7.3324, 7.3322, 7.3321, 7.332, 7.3315, 7.331, 7.3307, 7.332, 7.3314, 7.3314, 7.3312, 7.3306, 7.3303, 7.3298, 7.3301, 7.3299, 7.3294, 7.329, 7.3285, 7.3295, 7.3292, 7.329, 7.33, 7.33, 7.3298, 7.3292, 7.3303, 7.3298, 7.3308, 7.3304, 7.33, 7.3311, 7.3306, 7.33, 7.3297, 7.3296, 7.329, 7.33, 7.33, 7.3294, 7.3295, 7.3311, 7.3312, 7.331, 7.3306, 7.3308, 7.3306, 7.3309, 7.3306, 7.3336, 7.3339, 7.3379, 7.338, 7.3375, 7.3369, 7.3364, 7.3359, 7.3359, 7.3354, 7.3366, 7.336, 7.3355, 7.3349, 7.3346, 7.3356, 7.3352, 7.3346, 7.3327, 7.3321, 7.3315, 7.3312, 7.3306, 7.3301, 7.3297, 7.3291, 7.3322, 7.3317, 7.3305, 7.3325, 7.3341, 7.3351, 7.3346, 7.3346, 7.3344, 7.3356, 7.337, 7.3369, 7.3412, 7.3407, 7.3402, 7.3397, 7.3414, 7.3412, 7.3407, 7.342, 7.3402, 7.3398, 7.3393, 7.3389, 7.3388, 7.3414, 7.3425, 7.342, 7.3416, 7.3413, 7.3411, 7.3412, 7.3409, 7.3404, 7.3403, 7.3398, 7.3393, 7.3389, 7.3401, 7.3412, 7.3411, 7.3406, 7.3405, 7.3418, 7.343, 7.3442, 7.3456, 7.3452, 7.345, 7.3446, 7.3441, 7.3435, 7.3429, 7.3459, 7.3457, 7.3452, 7.3447, 7.3446, 7.3444, 7.3444, 7.3441, 7.3442, 7.3441, 7.3439, 7.3437, 7.3432, 7.3428, 7.3426, 7.3421, 7.3416, 7.3416, 7.3411, 7.3406, 7.34, 7.3404, 7.3415, 7.3413, 7.3409, 7.3406, 7.3401, 7.3396, 7.3398, 7.3407, 7.3402, 7.3398, 7.3394, 7.3404, 7.34, 7.3411, 7.3423, 7.3433, 7.3429, 7.3426, 7.3421, 7.3442, 7.344, 7.3436, 7.3434, 7.3431, 7.3426, 7.3421, 7.3421, 7.3437, 7.3435, 7.3446, 7.3441, 7.3436, 7.3434, 7.3429, 7.3426, 7.343, 7.3426, 7.342, 7.3419, 7.3415, 7.3416, 7.341, 7.3409, 7.3406, 7.3401, 7.3412, 7.3422, 7.3417, 7.3412, 7.3409, 7.3404, 7.34, 7.3397, 7.3394, 7.339, 7.3386, 7.3383, 7.338, 7.3378, 7.3375, 7.3372, 7.3367, 7.3364, 7.3359, 7.3357, 7.3353, 7.3354, 7.3349, 7.3344, 7.3354, 7.3354, 7.3353, 7.3348, 7.3358, 7.3355, 7.3354, 7.3409, 7.3406, 7.3404, 7.3403, 7.3398, 7.3408, 7.3404, 7.3399, 7.3394, 7.339, 7.3389, 7.3383, 7.3378, 7.3373, 7.3372, 7.3367, 7.3364, 7.3366, 7.3362, 7.3373, 7.3373, 7.3383, 7.3379, 7.3389, 7.3386, 7.3383, 7.338, 7.3378, 7.3388, 7.3383, 7.3378, 7.3376, 7.3371, 7.3366, 7.3365, 7.3366, 7.3364, 7.3361, 7.3372, 7.3367, 7.3363, 7.3358, 7.3356, 7.3352, 7.3363, 7.3365, 7.3362, 7.336, 7.3355, 7.3384, 7.338, 7.3374, 7.337, 7.337, 7.3366, 7.3362, 7.336, 7.3388, 7.3386, 7.3386, 7.3414, 7.3431, 7.3427, 7.3422, 7.3435, 7.343, 7.3427, 7.3428, 7.3426, 7.3421, 7.3465, 7.346, 7.3471, 7.3467, 7.3466, 7.3462, 7.3461, 7.3456, 7.3453, 7.3448, 7.3444, 7.344, 7.3435, 7.3433, 7.3437, 7.3433, 7.3429, 7.3426, 7.3426, 7.347, 7.3466, 7.3464, 7.3474, 7.3485, 7.3496, 7.3495, 7.3491, 7.3488, 7.3483, 7.3496, 7.3492, 7.3501, 7.3501, 7.3498, 7.3493, 7.3489, 7.3484, 7.3481, 7.3475, 7.3472, 7.347, 7.3468, 7.3468, 7.3464, 7.3476, 7.3487, 7.3483, 7.3479, 7.3475, 7.3475, 7.349, 7.3485, 7.3528, 7.3524, 7.352, 7.3561, 7.3557, 7.3557, 7.3567, 7.3562, 7.356, 7.3557, 7.3552, 7.3548, 7.3543, 7.3539, 7.3534, 7.3531, 7.3541, 7.3536, 7.3531, 7.3541, 7.3552, 7.3562, 7.3558, 7.3556, 7.3554, 7.3552, 7.3563, 7.356, 7.3557, 7.3566, 7.3561, 7.357, 7.358, 7.3589, 7.3585, 7.3585, 7.358, 7.3576, 7.3572, 7.3572, 7.3583, 7.3595, 7.3589, 7.3584, 7.3581, 7.3576, 7.3585, 7.358, 7.3581, 7.3578, 7.3575, 7.357, 7.3566, 7.3561, 7.3557, 7.3554, 7.355, 7.3545, 7.354, 7.3535, 7.3532, 7.3527, 7.3525, 7.3521, 7.3521, 7.3531, 7.3542, 7.3537, 7.3532, 7.353, 7.3525, 7.3521, 7.3516, 7.3539, 7.355, 7.3549, 7.3546, 7.3544, 7.3544, 7.3539, 7.3535, 7.3534, 7.3546, 7.3544, 7.3544, 7.3555, 7.355, 7.3549, 7.3558, 7.3555, 7.3567, 7.3562, 7.3561, 7.3559, 7.3555, 7.355, 7.3548, 7.3557, 7.3552, 7.3549, 7.3552, 7.3575, 7.3572, 7.3568, 7.3568, 7.3563, 7.3565, 7.3563, 7.3558, 7.3558, 7.3556, 7.3554, 7.3549, 7.3546, 7.3546, 7.3549, 7.3544, 7.3556, 7.3552, 7.3548, 7.3547, 7.3544, 7.3546, 7.3542, 7.3554, 7.3552, 7.3548, 7.3542, 7.3543, 7.3542, 7.3537, 7.3534, 7.3531, 7.3526, 7.3522, 7.3531, 7.3528, 7.3539, 7.3537, 7.3535, 7.3532, 7.3528, 7.3525, 7.3524, 7.352, 7.3524, 7.3519, 7.3516, 7.3525, 7.3522, 7.3521, 7.3517, 7.3514, 7.3527, 7.3526, 7.3523, 7.3562, 7.3571, 7.3568, 7.3563, 7.3576, 7.3572, 7.3568, 7.3563, 7.3573, 7.3568, 7.3567, 7.3564, 7.3559, 7.3556, 7.3551, 7.3546, 7.3542, 7.3539, 7.3535, 7.353, 7.3525, 7.3525, 7.3536, 7.3531, 7.3526, 7.3523, 7.3518, 7.3513, 7.3508, 7.3505, 7.3504, 7.351, 7.3508, 7.3517, 7.3515, 7.351, 7.3519, 7.3515, 7.3525, 7.3534, 7.3558, 7.3573, 7.357, 7.3568, 7.3567, 7.3576, 7.3575, 7.3571, 7.357, 7.3579, 7.3574, 7.3583, 7.358, 7.3575, 7.3572, 7.3567, 7.3567, 7.3578, 7.3577, 7.3576, 7.3573, 7.3568, 7.3563, 7.3548, 7.3545, 7.354, 7.3537, 7.3555, 7.3552, 7.3562, 7.3557, 7.3555, 7.3564, 7.356, 7.3556, 7.3551, 7.355, 7.3547, 7.3547, 7.3558, 7.3554, 7.3553, 7.3566, 7.3563, 7.356, 7.3555, 7.3553, 7.3549, 7.3548, 7.3543, 7.3551, 7.3547, 7.3544, 7.3554, 7.3552, 7.355, 7.3546, 7.3542, 7.3538, 7.3537, 7.3533, 7.3533, 7.3546, 7.3542, 7.3537, 7.3532, 7.3528, 7.3539, 7.354, 7.3536, 7.3534, 7.353, 7.3526, 7.3524, 7.3541, 7.3537, 7.3534, 7.3531, 7.3542, 7.3553, 7.3552, 7.356, 7.357, 7.3569, 7.3565, 7.3576, 7.3571, 7.3572, 7.357, 7.3571, 7.3569, 7.3565, 7.3561, 7.3559, 7.3554, 7.3551, 7.3566, 7.3561, 7.357, 7.3569, 7.3568, 7.3563, 7.356, 7.3561, 7.3556, 7.3542, 7.3542, 7.3538, 7.3541, 7.3549, 7.3548, 7.3545, 7.3542, 7.3551, 7.3548, 7.3545, 7.354, 7.3541, 7.3536, 7.3545, 7.354, 7.3538, 7.3537, 7.3546, 7.3546, 7.3541, 7.3542, 7.3537, 7.3536, 7.3545, 7.3544, 7.3542, 7.3552, 7.3549, 7.3558, 7.3554, 7.3551, 7.356, 7.3569, 7.358, 7.3577, 7.3573, 7.357, 7.3567, 7.3568, 7.3573, 7.3569, 7.3571, 7.3569, 7.3577, 7.3574, 7.3571, 7.3568, 7.3564, 7.3563, 7.3558, 7.3553, 7.3548, 7.3546, 7.3555, 7.3551, 7.3561, 7.3556, 7.3551, 7.3547, 7.3556, 7.3552, 7.3548, 7.3547, 7.3545, 7.3541, 7.3537, 7.3535, 7.3546, 7.3542, 7.3538, 7.3536, 7.3531, 7.3542, 7.3553, 7.3549, 7.3545, 7.3543, 7.3539, 7.3542, 7.3601, 7.3598, 7.3594, 7.3595, 7.3595, 7.3592, 7.3592, 7.3588, 7.3598, 7.3595, 7.359, 7.36, 7.3599, 7.3602, 7.364, 7.3625, 7.3611, 7.3597, 7.3593, 7.3589, 7.3588, 7.359, 7.3587, 7.3583, 7.3581, 7.359, 7.3601, 7.3597, 7.3592, 7.3589, 7.3586, 7.3581, 7.3579, 7.3575, 7.3572, 7.3569, 7.3566, 7.355, 7.3545, 7.3541, 7.3539, 7.3534, 7.3544, 7.3542, 7.354, 7.3535, 7.3532, 7.3532, 7.3534, 7.353, 7.354, 7.3541, 7.3542, 7.3542, 7.3541, 7.3544, 7.354, 7.3538, 7.3537, 7.3537, 7.3546, 7.3542, 7.3539, 7.3548, 7.3558, 7.3567, 7.3576, 7.3572, 7.3568, 7.3567, 7.3564, 7.3593, 7.359, 7.3587, 7.3583, 7.3579, 7.3578, 7.3586, 7.3582, 7.3577, 7.3586, 7.3581, 7.3589, 7.3585, 7.3581, 7.3577, 7.3573, 7.3575, 7.3572, 7.3572, 7.3582, 7.3577, 7.3572, 7.3571, 7.3569, 7.3564, 7.3559, 7.3555, 7.3553, 7.3552, 7.355, 7.3546, 7.3533, 7.3542, 7.3538, 7.3536, 7.3531, 7.3527, 7.3527, 7.3537, 7.3524, 7.3524, 7.3521, 7.353, 7.354, 7.3536, 7.3533, 7.3529, 7.3527, 7.3522, 7.3528, 7.3523, 7.3519, 7.3531, 7.3616, 7.3611, 7.361, 7.3606, 7.3601, 7.3599, 7.3596, 7.3592, 7.3587, 7.3584, 7.3579, 7.3574, 7.3581, 7.3592, 7.3587, 7.3598, 7.3595, 7.3591, 7.3589, 7.3587, 7.3583, 7.3578, 7.3575, 7.357, 7.3579, 7.3578, 7.3576, 7.3583, 7.358, 7.3577, 7.3595, 7.3607, 7.3602, 7.3598, 7.3607, 7.3605, 7.3601, 7.3597, 7.3596, 7.3592, 7.3589, 7.3589, 7.3589, 7.3585, 7.3583, 7.358, 7.358, 7.3575, 7.3571, 7.3595, 7.3593, 7.3589, 7.3585, 7.358, 7.3577, 7.3575, 7.357, 7.3566, 7.3561, 7.3569, 7.3566, 7.3563, 7.3574, 7.3572, 7.3567, 7.3563, 7.3562, 7.3558, 7.3554, 7.3566, 7.3564, 7.356, 7.3556, 7.3552, 7.3547, 7.355, 7.3549, 7.3545, 7.3553, 7.355, 7.3536, 7.3559, 7.3556, 7.3564, 7.3561, 7.3557, 7.3555, 7.3566, 7.3576, 7.3575, 7.3571, 7.357, 7.3581, 7.3579, 7.3576, 7.3574, 7.3573, 7.3569, 7.3567, 7.3563, 7.3614, 7.361, 7.3606, 7.3604, 7.3613, 7.3609, 7.3606, 7.3602, 7.3612, 7.3609, 7.3605, 7.3601, 7.3598, 7.3599, 7.3598, 7.3594, 7.3595, 7.3591, 7.3589, 7.3635, 7.3636, 7.3632, 7.363, 7.3628, 7.3625, 7.3624, 7.3646, 7.3645, 7.3644, 7.363, 7.3627, 7.3636, 7.3634, 7.362, 7.3605, 7.3602, 7.3601, 7.3601, 7.3598, 7.3608, 7.3609, 7.3618, 7.3614, 7.3615, 7.3615, 7.3612, 7.3598, 7.3597, 7.3593, 7.359, 7.3587, 7.3575, 7.3572, 7.3568, 7.3565, 7.3561, 7.3559, 7.3556, 7.3565, 7.3561, 7.3559, 7.3556, 7.3551, 7.3562, 7.3559, 7.3573, 7.3569, 7.3555, 7.3554, 7.3549, 7.3546, 7.3541, 7.3543, 7.3541, 7.354, 7.3548, 7.3547, 7.3551, 7.3567, 7.3578, 7.3575, 7.3571, 7.3579, 7.3578, 7.3574, 7.3582, 7.3578, 7.3574, 7.357, 7.3565, 7.355, 7.3545, 7.3545, 7.3543, 7.3543, 7.3552, 7.3548, 7.3544, 7.354, 7.355, 7.3547, 7.3543, 7.3539, 7.3535, 7.3533, 7.3529, 7.3537, 7.3535, 7.3531, 7.3532, 7.3534, 7.353, 7.3527, 7.3536, 7.3533, 7.3533, 7.3531, 7.3527, 7.3523, 7.3519, 7.3515, 7.3513, 7.3512, 7.3508, 7.3507, 7.3515, 7.3512, 7.3499, 7.3498, 7.3537, 7.3534, 7.3533, 7.353, 7.3528, 7.3526, 7.3536, 7.3546, 7.3542, 7.3539, 7.3537, 7.3533, 7.3541, 7.355, 7.3547, 7.3545, 7.354, 7.354, 7.3538, 7.3534, 7.3543, 7.3552, 7.356, 7.3563, 7.3565, 7.3567, 7.357, 7.357, 7.3581, 7.3591, 7.3591, 7.3587, 7.3586, 7.3582, 7.3579, 7.3576, 7.3574, 7.357, 7.3567, 7.3563, 7.3561, 7.356, 7.3569, 7.3565, 7.3563, 7.3559, 7.3555, 7.3554, 7.3552, 7.356, 7.3568, 7.3567, 7.3564, 7.3567, 7.3554, 7.355, 7.3549, 7.3571, 7.3568, 7.3583, 7.3581, 7.358, 7.3577, 7.3564, 7.356, 7.3557, 7.3553, 7.3561, 7.3557, 7.3553, 7.3551, 7.3547, 7.3554, 7.3549, 7.3556, 7.3553, 7.3549, 7.3547, 7.3543, 7.3541, 7.3541, 7.3549, 7.3546, 7.3555, 7.3564, 7.3561, 7.3559, 7.3557, 7.3553, 7.3561, 7.3559, 7.3568, 7.3565, 7.3564, 7.3572, 7.3571, 7.357, 7.3579, 7.3578, 7.3577, 7.3572, 7.3571, 7.3569, 7.3566, 7.3562, 7.3562, 7.3575, 7.3583, 7.3582, 7.3577, 7.3573, 7.3582, 7.359, 7.359, 7.359, 7.3598, 7.3649, 7.3645, 7.3653, 7.3661, 7.366, 7.3658, 7.3667, 7.3663, 7.3662, 7.3661, 7.3658, 7.3655, 7.3653, 7.3652, 7.3652, 7.3651, 7.365, 7.3658, 7.3646, 7.3646, 7.3642, 7.3639, 7.3635, 7.3636, 7.3633, 7.3632, 7.3631, 7.3627, 7.3623, 7.3621, 7.3616, 7.3623, 7.3623, 7.3621, 7.3607, 7.3605, 7.3601, 7.3609, 7.3618, 7.3627, 7.3623, 7.3621, 7.3608, 7.3617, 7.3614, 7.3637, 7.3634, 7.3633, 7.3641, 7.364, 7.3655, 7.3651, 7.3649, 7.3647, 7.3646, 7.3653, 7.3661, 7.3657, 7.3653, 7.3662, 7.3683, 7.3691, 7.3688, 7.3696, 7.3705, 7.3731, 7.373, 7.3728, 7.3725, 7.3729, 7.3726, 7.3725, 7.3733, 7.3732, 7.373, 7.373, 7.3728, 7.3727, 7.3723, 7.3723, 7.3721, 7.3717, 7.3714, 7.3713, 7.3709, 7.3718, 7.3716, 7.3713, 7.371, 7.371, 7.372, 7.3736, 7.3746, 7.3744, 7.374, 7.3737, 7.3735, 7.3731, 7.3728, 7.3726, 7.3723, 7.3718, 7.3726, 7.3723, 7.3731, 7.3726, 7.3726, 7.3726, 7.3733, 7.3728, 7.3724, 7.3723, 7.372, 7.3716, 7.3714, 7.3711, 7.3718, 7.3725, 7.3725, 7.3722, 7.3722, 7.3719, 7.3715, 7.3701, 7.3698, 7.3707, 7.3705, 7.3703, 7.3702, 7.3698, 7.3694, 7.3692, 7.3688, 7.3676, 7.3676, 7.3673, 7.3673, 7.3671, 7.3669, 7.3672, 7.3679, 7.3677, 7.3676, 7.3675, 7.3684, 7.3692, 7.3689, 7.3689, 7.3686, 7.3685, 7.3693, 7.369, 7.3686, 7.3682, 7.3679, 7.3676, 7.3674, 7.3672, 7.367, 7.3667, 7.3676, 7.3675, 7.3673, 7.3683, 7.369, 7.3687, 7.3687, 7.3686, 7.3675, 7.3675, 7.3684, 7.3692, 7.369, 7.3685, 7.3681, 7.3677, 7.3673, 7.367, 7.3678, 7.3686, 7.3685, 7.3681, 7.3677, 7.3676, 7.3672, 7.3668, 7.3664, 7.366, 7.3658, 7.3657, 7.3643, 7.3641, 7.3646, 7.3643, 7.3639, 7.3646, 7.3642, 7.3638, 7.3626, 7.3634, 7.363, 7.3639, 7.3636, 7.3633, 7.3629, 7.364, 7.3636, 7.3632, 7.3629, 7.3638, 7.3636, 7.3624, 7.3623, 7.3621, 7.3628, 7.3623, 7.3619, 7.3615, 7.3613, 7.3601, 7.3609, 7.3605, 7.3601, 7.3608, 7.3607, 7.3616, 7.3612, 7.3608, 7.3604, 7.3614, 7.3612, 7.3614, 7.3613, 7.3609, 7.3609, 7.3607, 7.3604, 7.3604, 7.3602, 7.3599, 7.3595, 7.3593, 7.36, 7.3596, 7.3594, 7.3594, 7.3581, 7.3581, 7.3597, 7.3606, 7.3606, 7.3603, 7.36, 7.3599, 7.3596, 7.3605, 7.3615, 7.3614, 7.3613, 7.3622, 7.3621, 7.3618, 7.3615, 7.3612, 7.3608, 7.3637, 7.3637, 7.3634, 7.3632, 7.3644, 7.364, 7.3637, 7.3636, 7.3633, 7.3631, 7.363, 7.3627, 7.3624, 7.3633, 7.3631, 7.3627, 7.3625, 7.3636, 7.3637, 7.3636, 7.3634, 7.363, 7.3628, 7.3624, 7.3621, 7.3628, 7.3624, 7.3633, 7.363, 7.364, 7.3636, 7.3636, 7.3635, 7.3633, 7.3631, 7.364, 7.3637, 7.3633, 7.3642, 7.3639, 7.3638, 7.3634, 7.3641, 7.3648, 7.3648, 7.3646, 7.3644, 7.3641, 7.363, 7.3659, 7.3668, 7.3681, 7.3679, 7.3675, 7.3673, 7.3669, 7.3665, 7.3662, 7.3658, 7.3658, 7.3659, 7.3656, 7.3653, 7.3652, 7.366, 7.366, 7.3658, 7.3655, 7.3664, 7.3662, 7.366, 7.3666, 7.3662, 7.367, 7.3666, 7.3674, 7.3671, 7.367, 7.3678, 7.3665, 7.3662, 7.3662, 7.366, 7.3656, 7.3699, 7.3717, 7.3713, 7.3709, 7.3705, 7.3703, 7.3701, 7.3699, 7.3697, 7.3684, 7.368, 7.3687, 7.3683, 7.3682, 7.3679, 7.3686, 7.3682, 7.3678, 7.3676, 7.3674, 7.3673, 7.3672, 7.3669, 7.3677, 7.3676, 7.3675, 7.3684, 7.3692, 7.369, 7.3689, 7.3689, 7.3686, 7.3685, 7.3686, 7.3684, 7.3681, 7.3677, 7.3673, 7.3669, 7.3667, 7.3663, 7.3673, 7.367, 7.3666, 7.3664, 7.366, 7.3656, 7.3652, 7.3648, 7.3663, 7.3697, 7.3715, 7.3722, 7.372, 7.3719, 7.3715, 7.3716, 7.3735, 7.3753, 7.376, 7.3757, 7.3747, 7.3743, 7.3751, 7.3759, 7.3769, 7.3765, 7.3815, 7.3823, 7.382, 7.3817, 7.3814, 7.3811, 7.381, 7.3817, 7.3813, 7.382, 7.3818, 7.3817, 7.3814, 7.3822, 7.3821, 7.3828, 7.3826, 7.3822, 7.3819, 7.3818, 7.3828, 7.3845, 7.3842, 7.3849, 7.3846, 7.3843, 7.3841, 7.3837, 7.3833, 7.383, 7.3838, 7.3844, 7.3852, 7.386, 7.3857, 7.3853, 7.3849, 7.3856, 7.3853, 7.3861, 7.3858, 7.3854, 7.3868, 7.3871, 7.3868, 7.3866, 7.3865, 7.3861, 7.3857, 7.3864, 7.3868, 7.3855, 7.3851, 7.3858, 7.3855, 7.3852, 7.3859, 7.3855, 7.3862, 7.3858, 7.3855, 7.3852, 7.385, 7.3847, 7.3847, 7.3847, 7.3836, 7.3832, 7.3841, 7.3839, 7.3843, 7.384, 7.3847, 7.3844, 7.3845, 7.3841, 7.3838, 7.3835, 7.3841, 7.3849, 7.3847, 7.3844, 7.3852, 7.3853, 7.3849, 7.3845, 7.3844, 7.3843, 7.385, 7.3847, 7.3844, 7.3842, 7.3848, 7.3845, 7.3842, 7.384, 7.3851, 7.3847, 7.3844, 7.384, 7.3842, 7.384, 7.3848, 7.3846, 7.3842, 7.3838, 7.3842, 7.3845, 7.3841, 7.3838, 7.3835, 7.3824, 7.3821, 7.3827, 7.3834, 7.383, 7.3829, 7.3838, 7.3836, 7.3843, 7.384, 7.3846, 7.3844, 7.3842, 7.3838, 7.3846, 7.3844, 7.3843, 7.384, 7.3837, 7.3835, 7.3836, 7.3834, 7.383, 7.3829, 7.3831, 7.3838, 7.3839, 7.3835, 7.3843, 7.3851, 7.3847, 7.3846, 7.3844, 7.3843, 7.3841, 7.384, 7.3838, 7.3846, 7.3842, 7.3841, 7.3848, 7.3844, 7.3842, 7.3842, 7.3838, 7.3835, 7.3831, 7.3828, 7.3825, 7.3833, 7.383, 7.3827, 7.3823, 7.3819, 7.3817, 7.3815, 7.3822, 7.3821, 7.3818, 7.3817, 7.3815, 7.3814, 7.3812, 7.3817, 7.3815, 7.3812, 7.381, 7.3809, 7.3818, 7.3815, 7.3812, 7.3809, 7.3817, 7.382, 7.3819, 7.3816, 7.3815, 7.3813, 7.3809, 7.3809, 7.3818, 7.3814, 7.3813, 7.3825, 7.3822, 7.383, 7.3827, 7.3823, 7.3831, 7.3828, 7.3825, 7.3821, 7.3818, 7.3815, 7.3813, 7.381, 7.3809, 7.3827, 7.3824, 7.3814, 7.3824, 7.3821, 7.3822, 7.3823, 7.382, 7.3828, 7.3837, 7.3835, 7.3844, 7.3845, 7.3841, 7.3838, 7.3835, 7.3832, 7.383, 7.3826, 7.3826, 7.3825, 7.3824, 7.3824, 7.3831, 7.3829, 7.3836, 7.3833, 7.3842, 7.3839, 7.3835, 7.3842, 7.384, 7.3837, 7.3834, 7.3831, 7.3828, 7.3828, 7.3835, 7.3832, 7.3829, 7.3826, 7.3825, 7.3823, 7.3819, 7.3826, 7.3824, 7.3822, 7.383, 7.3828, 7.3827, 7.3826, 7.3822, 7.3819, 7.3828, 7.3827, 7.3827, 7.3827, 7.3824, 7.382, 7.3818, 7.3815, 7.3811, 7.3799, 7.3789, 7.3804, 7.3801, 7.3807, 7.3804, 7.3806, 7.3797, 7.3794, 7.3791, 7.3791, 7.3787, 7.3786, 7.3783, 7.3781, 7.3788, 7.3785, 7.3783, 7.3782, 7.3779, 7.3788, 7.3785, 7.3783, 7.378, 7.3777, 7.3774, 7.377, 7.3767, 7.3766, 7.3763, 7.376, 7.3757, 7.3764, 7.3797, 7.3794, 7.3793, 7.3801, 7.3797, 7.3793, 7.3807, 7.3803, 7.3799, 7.3803, 7.38, 7.3797, 7.3804, 7.3801, 7.38, 7.3808, 7.3825, 7.3822, 7.3828, 7.3827, 7.3823, 7.3819, 7.3816, 7.3814, 7.3812, 7.382, 7.3828, 7.3824, 7.3821, 7.382, 7.3827, 7.3815, 7.3821, 7.3818, 7.3819, 7.3825, 7.3824, 7.3822, 7.3821, 7.3817, 7.3814, 7.3821, 7.3822, 7.3819, 7.3817, 7.3814, 7.3811, 7.3808, 7.3805, 7.3804, 7.38, 7.3789, 7.3785, 7.3781, 7.3777, 7.3774, 7.3772, 7.3769, 7.3766, 7.3775, 7.3765, 7.3753, 7.3743, 7.3748, 7.3756, 7.3744, 7.3742, 7.374, 7.3747, 7.3743, 7.3742, 7.3742, 7.3739, 7.3738, 7.3736, 7.3743, 7.3751, 7.375, 7.3748, 7.3744, 7.3742, 7.3758, 7.3758, 7.3754, 7.3752, 7.3749, 7.3747, 7.3753, 7.3786, 7.3782, 7.3778, 7.3776, 7.3773, 7.3771, 7.3768, 7.3767, 7.3764, 7.3761, 7.3761, 7.3759, 7.3765, 7.3761, 7.3758, 7.3755, 7.3751, 7.3748, 7.3755, 7.376, 7.3757, 7.3756, 7.3753, 7.376, 7.3758, 7.3758, 7.3754, 7.3753, 7.375, 7.3756, 7.3752, 7.3759, 7.3805, 7.3806, 7.3805, 7.3802, 7.38, 7.3799, 7.3797, 7.3803, 7.3802, 7.3801, 7.3797, 7.3798, 7.3807, 7.3804, 7.38, 7.3806, 7.3805, 7.3803, 7.38, 7.3796, 7.3793, 7.3799, 7.3796, 7.3803, 7.3801, 7.3801, 7.38, 7.3797, 7.3795, 7.3794, 7.3791, 7.3798, 7.3794, 7.3793, 7.3791, 7.3801, 7.3808, 7.3805, 7.3802, 7.38, 7.3797, 7.3795, 7.3792, 7.3789, 7.3777, 7.3784, 7.379, 7.3787, 7.3785, 7.3801, 7.3791, 7.3789, 7.3786, 7.3784, 7.3782, 7.3772, 7.3779, 7.3786, 7.379, 7.3797, 7.3813, 7.3811, 7.3809, 7.3806, 7.3803, 7.38, 7.3797, 7.3794, 7.3794, 7.3792, 7.3789, 7.3785, 7.3781, 7.3798, 7.3796, 7.3792, 7.3789, 7.3779, 7.3779, 7.3776, 7.3766, 7.3755, 7.3762, 7.3762, 7.3759, 7.3756, 7.3765, 7.3767, 7.3756, 7.3753, 7.3749, 7.3746, 7.3745, 7.3742, 7.3739, 7.3738, 7.3735, 7.3731, 7.3731, 7.3728, 7.3729, 7.3727, 7.3723, 7.3723, 7.372, 7.3717, 7.3724, 7.3721, 7.3718, 7.3716, 7.3713, 7.3713, 7.371, 7.3717, 7.3714, 7.3712, 7.3709, 7.3705, 7.3704, 7.3703, 7.3696, 7.3696, 7.3693, 7.369, 7.3687, 7.3684, 7.369, 7.3687, 7.3694, 7.369, 7.369, 7.3686, 7.3685, 7.3683, 7.3681, 7.369, 7.3686, 7.3692, 7.3695, 7.3692, 7.3689, 7.3685, 7.3694, 7.369, 7.3679, 7.3676, 7.3693, 7.3689, 7.3685, 7.3684, 7.3682, 7.3678, 7.3684, 7.368, 7.368, 7.3676, 7.3683, 7.3689, 7.3687, 7.3684, 7.3683, 7.3682, 7.3683, 7.3691, 7.3681, 7.3671, 7.3669, 7.3671, 7.3668, 7.3665, 7.3662, 7.3661, 7.365, 7.3649, 7.3649, 7.3646, 7.3644, 7.364, 7.3657, 7.3663, 7.3708, 7.3706, 7.3703, 7.3706, 7.3712, 7.3719, 7.3717, 7.3714, 7.3711, 7.3701, 7.3698, 7.3695, 7.3692, 7.369, 7.3693, 7.3692, 7.3688, 7.3686, 7.3684, 7.3681, 7.3677, 7.3685, 7.3683, 7.3682, 7.3679, 7.3676, 7.3673, 7.3674, 7.3671, 7.367, 7.3669, 7.3666, 7.3672, 7.3678, 7.3677, 7.3684, 7.368, 7.3676, 7.3674, 7.368, 7.3686, 7.3682, 7.3679, 7.3676, 7.3683, 7.368, 7.3678, 7.3674, 7.3671, 7.3672, 7.3678, 7.3677, 7.3683, 7.37, 7.3689, 7.3696, 7.3693, 7.3699, 7.37, 7.3699, 7.3698, 7.3696, 7.3695, 7.3702, 7.37, 7.3697, 7.3703, 7.3701, 7.3698, 7.3699, 7.3697, 7.3694, 7.37, 7.3697, 7.3704, 7.37, 7.3699, 7.3696, 7.3703, 7.371, 7.3707, 7.3714, 7.3711, 7.3708, 7.3705, 7.3704, 7.3705, 7.3701, 7.3698, 7.3696, 7.3697, 7.3694, 7.3694, 7.3701, 7.3698, 7.37, 7.3698, 7.3695, 7.3713, 7.3712, 7.3719, 7.3725, 7.3728, 7.3724, 7.3722, 7.3719, 7.3718, 7.3716, 7.3713, 7.3711, 7.3717, 7.3723, 7.3721, 7.3719, 7.3718, 7.3716, 7.3713, 7.3711, 7.3708, 7.3714, 7.3712, 7.3709, 7.3707, 7.3713, 7.371, 7.3708, 7.3707, 7.3704, 7.3711, 7.3708, 7.3704, 7.3702, 7.3708, 7.3706, 7.3703, 7.3699, 7.3705, 7.3702, 7.3717, 7.3727, 7.3725, 7.3733, 7.3739, 7.3744, 7.3743, 7.374, 7.3739, 7.3738, 7.3734, 7.3741, 7.3737, 7.3754, 7.3752, 7.3751, 7.3777, 7.3775, 7.3774, 7.3773, 7.3808, 7.3805, 7.3803, 7.3799, 7.3796, 7.3793, 7.3791, 7.3789, 7.3787, 7.3784, 7.3782, 7.378, 7.3777, 7.3774, 7.378, 7.3778, 7.3777, 7.3774, 7.3771, 7.3768, 7.3764, 7.377, 7.3768, 7.3767, 7.3773, 7.3772, 7.3778, 7.3778, 7.3776, 7.3773, 7.3771, 7.377, 7.3767, 7.3766, 7.3774, 7.3771, 7.377, 7.3777, 7.3784, 7.3783, 7.3789, 7.3791, 7.3788, 7.3795, 7.3793, 7.3791, 7.3788, 7.3785, 7.3784, 7.3781, 7.3778, 7.3794, 7.3803, 7.3821, 7.3831, 7.3831, 7.3827, 7.3824, 7.3831, 7.3829, 7.3834, 7.384, 7.3847, 7.3853, 7.3851, 7.3851, 7.3848, 7.3848, 7.3849, 7.3855, 7.3852, 7.3859, 7.3858, 7.3855, 7.3853, 7.3852, 7.385, 7.3848, 7.3845, 7.386, 7.3858, 7.3865, 7.3862, 7.3862, 7.3859, 7.3866, 7.3865, 7.3862, 7.3868, 7.3865, 7.3862, 7.386, 7.3856, 7.3854, 7.3853, 7.3853, 7.385, 7.3847, 7.3844, 7.3851, 7.3857, 7.3863, 7.386, 7.3861, 7.3868, 7.3867, 7.3866, 7.3863, 7.386, 7.3866, 7.3873, 7.3872, 7.3869, 7.3866, 7.3863, 7.3862, 7.3861, 7.3861, 7.386, 7.3858, 7.3856, 7.3853, 7.3851, 7.385, 7.3848, 7.3846, 7.3842, 7.3838, 7.3843, 7.3839, 7.3836, 7.3834, 7.3839, 7.3835, 7.3832, 7.3847, 7.3846, 7.3843, 7.3851, 7.3859, 7.3856, 7.3854, 7.3851, 7.385, 7.3848, 7.3847, 7.3854, 7.3851, 7.3848, 7.3846, 7.3853, 7.3852, 7.385, 7.3849, 7.3847, 7.3845, 7.3844, 7.3843, 7.3849, 7.3846, 7.3845, 7.3841, 7.3838, 7.3835, 7.3833, 7.3831, 7.383, 7.3827, 7.3833, 7.3829, 7.3826, 7.3832, 7.3829, 7.3834, 7.3831, 7.3828, 7.3824, 7.3824, 7.3821, 7.3821, 7.3819, 7.3829, 7.3826, 7.3836, 7.3836, 7.3843, 7.3849, 7.3855, 7.3853, 7.385, 7.3856, 7.3862, 7.3859, 7.3856, 7.3872, 7.3879, 7.3878, 7.3876, 7.3873, 7.387, 7.387, 7.3869, 7.3866, 7.3863, 7.3872, 7.3871, 7.3871, 7.3877, 7.3877, 7.3875, 7.3873, 7.3871, 7.3868, 7.3867, 7.3864, 7.387, 7.3867, 7.3864, 7.3861, 7.386, 7.3857, 7.3862, 7.3858, 7.3855, 7.3853, 7.385, 7.3849, 7.3849, 7.3852, 7.3849, 7.3847, 7.3844, 7.3851, 7.3851, 7.385, 7.3848, 7.3848, 7.3845, 7.3852, 7.3849, 7.3846, 7.3843, 7.3841, 7.3842, 7.384, 7.3839, 7.3836, 7.3842, 7.384, 7.3838, 7.3837, 7.384, 7.3839, 7.3836, 7.3834, 7.3832, 7.3829, 7.3827, 7.3823, 7.3822, 7.3819, 7.3817, 7.3815, 7.3822, 7.3822, 7.382, 7.3817, 7.3815, 7.3812, 7.3811, 7.3817, 7.3824, 7.3823, 7.3825, 7.3831, 7.3828, 7.3824, 7.3822, 7.382, 7.3854, 7.3851, 7.3848, 7.3847, 7.3846, 7.3843, 7.3849, 7.3846, 7.3843, 7.384, 7.3836, 7.3833, 7.3839, 7.3845, 7.3842, 7.3839, 7.3838, 7.3835, 7.3832, 7.3828, 7.3826, 7.3832, 7.383, 7.3827, 7.3833, 7.3832, 7.383, 7.3829, 7.3826, 7.3823, 7.382, 7.3817, 7.3815, 7.3812, 7.381, 7.3807, 7.3806, 7.3803, 7.38, 7.38, 7.3797, 7.3794, 7.3792, 7.3792, 7.3789, 7.3785, 7.3791, 7.3789, 7.3786, 7.3784, 7.3783, 7.3781, 7.3778, 7.3784, 7.378, 7.378, 7.3787, 7.3793, 7.3799, 7.3796, 7.3793, 7.379, 7.3789, 7.3787, 7.3784, 7.3782, 7.3779, 7.3815, 7.3812, 7.3809, 7.3806, 7.3803, 7.3808, 7.3805, 7.3803, 7.38, 7.3797, 7.3803, 7.3811, 7.3817, 7.3814, 7.3813, 7.3819, 7.3817, 7.3814, 7.3813, 7.3813, 7.3811, 7.381, 7.3819, 7.3838, 7.3836, 7.3834, 7.3841, 7.384, 7.3838, 7.3836, 7.3834, 7.3833, 7.3833, 7.3835, 7.3835, 7.3832, 7.3839, 7.3837, 7.3837, 7.3835, 7.384, 7.3846, 7.3843, 7.385, 7.3846, 7.3845, 7.3842, 7.3839, 7.3845, 7.385, 7.3856, 7.3862, 7.3859, 7.3862], '192.168.122.111': [12.8591, 9.6321, 8.4709, 7.7046, 7.2502, 7.1512, 7.1076, 6.9708, 6.8312, 6.7373, 6.6969, 6.5837, 6.5682, 6.493, 6.8074, 6.7252, 6.6819, 6.6436, 6.6111, 6.5545, 6.5628, 6.5383, 6.5481, 6.4984, 6.4812, 6.4362, 6.599, 6.8248, 6.97, 6.9293, 6.9054, 6.9004, 6.8544, 6.9723, 7.0869, 7.0812, 7.0523, 7.0334, 7.0091, 6.9806, 6.9656, 6.9545, 6.9349, 6.9103, 6.8951, 6.8632, 6.8416, 6.8207, 6.8142, 6.8069, 6.789, 6.7633, 6.8421, 6.8299, 6.8255, 6.803, 6.791, 6.8685, 6.843, 6.8185, 6.7967, 6.796, 6.7823, 6.7835, 6.7681, 6.7627, 6.7439, 6.7292, 6.7175, 6.6975, 6.6787, 6.7396, 6.7224, 6.7193, 6.7063, 6.6936, 6.6828, 6.7344, 6.7191, 6.7138, 6.7083, 6.7693, 6.7571, 6.7644, 6.7512, 6.7514, 6.7396, 6.7289, 6.7183, 6.7119, 6.7025, 6.6876, 6.7355, 6.7202, 6.7055, 6.6964, 6.6816, 6.7248, 6.765, 6.7583, 6.7454, 6.7337, 6.7212, 6.7189, 6.7137, 6.7006, 6.6974, 6.687, 6.6931, 6.8695, 6.86, 6.846, 6.838, 6.8328, 6.8252, 6.9776, 6.9731, 7.0441, 7.0751, 7.0653, 7.0549, 7.0428, 7.0287, 7.0167, 7.0508, 7.0382, 7.0702, 7.0592, 7.0488, 7.0412, 7.0284, 7.0165, 7.004, 6.9969, 6.9894, 6.9831, 6.9446, 6.972, 6.9654, 6.9605, 6.9574, 6.9692, 6.9656, 6.966600000000001, 6.967600000000001, 6.968600000000001, 6.9629, 6.9598, 6.9519, 6.9457, 6.9367, 6.9666, 6.9949, 6.9908, 7.0207, 7.0121, 7.0408, 7.0395, 7.033, 7.0321, 7.0639, 7.0601, 7.0548, 7.0282, 7.034, 7.0275, 7.0828, 7.1131, 7.1113, 7.1364, 7.1281, 7.125, 7.1182, 7.18, 7.2003, 7.2202, 7.215, 7.2129, 7.2094, 7.2324, 7.2277, 7.2201, 7.243, 7.2378, 7.2271, 7.2194, 7.2148, 7.214, 7.2036, 7.1998, 7.1897, 7.182, 7.2023, 7.1951, 7.1958, 7.1874, 7.1827, 7.1797, 7.1732, 7.1657, 7.1866, 7.1834, 7.2028, 7.2211, 7.2132, 7.2076, 7.2022, 7.2243, 7.216, 7.2357, 7.2285, 7.2239, 7.2229, 7.216, 7.2335, 7.2504, 7.2674, 7.2847, 7.3012, 7.2966, 7.2883, 7.2818, 7.3249, 7.317, 7.3314, 7.3478, 7.3426, 7.3576, 7.3581, 7.3741, 7.3653, 7.4306, 7.4545, 7.4911, 7.5058, 7.4964, 7.4883, 7.5028, 7.5202, 7.4958, 7.4907, 7.4866, 7.5022, 7.4938, 7.4899, 7.5018, 7.4948, 7.49, 7.5033, 7.497, 7.4919, 7.4879, 7.483, 7.4783, 7.4738, 7.469, 7.482, 7.4758, 7.4719, 7.4639, 7.4802, 7.4747, 7.4906, 7.5064, 7.5019, 7.5171, 7.5136, 7.5103, 7.5074, 7.501, 7.4947, 7.5068, 7.5013, 7.5173, 7.5333, 7.5269, 7.5194, 7.5116, 7.5254, 7.5194, 7.5132, 7.526, 7.5257, 7.5178, 7.5164, 7.5106, 7.5047, 7.4984, 7.492, 7.4842, 7.4787, 7.4751, 7.4693, 7.4684, 7.4629, 7.4589, 7.456, 7.4903, 7.4845, 7.4774, 7.471, 7.4642, 7.4575, 7.4504, 7.4441, 7.4391, 7.4341, 7.4274, 7.4229, 7.4364, 7.4349, 7.4302, 7.4254, 7.4203, 7.4135, 7.4254, 7.4206, 7.4337, 7.4316, 7.429, 7.4405, 7.4517, 7.4636, 7.4573, 7.4528, 7.465, 7.4617, 7.4606, 7.4714, 7.465, 7.4622, 7.4722, 7.4679, 7.466, 7.4604, 7.4546, 7.4493, 7.4434, 7.4496, 7.4449, 7.4574, 7.4517, 7.4473, 7.4296, 7.4408, 7.4349, 7.4298, 7.4256, 7.4343, 7.429, 7.4231, 7.4175, 7.4121, 7.4062, 7.4024, 7.3968, 7.393, 7.3909, 7.3886, 7.3863, 7.3974, 7.3939, 7.3901, 7.3876, 7.3835, 7.3819, 7.379, 7.3776, 7.3733, 7.3709, 7.367, 7.3825, 7.393, 7.3879, 7.3978, 7.3973, 7.3942, 7.392, 7.3872, 7.3826, 7.384, 7.3823, 7.392, 7.389, 7.3889, 7.3989, 7.3952, 7.3912, 7.3857, 7.3807, 7.3755, 7.3863, 7.381, 7.3797, 7.3765, 7.3717, 7.3833, 7.3801, 7.3888, 7.3852, 7.3799, 7.3774, 7.3725, 7.3677, 7.3629, 7.3604, 7.3562, 7.3538, 7.3505, 7.3528, 7.3481, 7.3449, 7.3405, 7.3494, 7.3455, 7.3431, 7.3757, 7.3716, 7.3684, 7.3682, 7.378, 7.3735, 7.3718, 7.3674, 7.3633, 7.3588, 7.3661, 7.363, 7.3582, 7.3671, 7.3766, 7.3757, 7.3716, 7.3809, 7.3776, 7.373, 7.3715, 7.3675, 7.365, 7.3623, 7.3604, 7.3571, 7.3528, 7.3608, 7.3577, 7.3533, 7.349, 7.345, 7.3408, 7.3377, 7.3402, 7.3382, 7.3365, 7.3325, 7.3291, 7.3368, 7.3445, 7.3405, 7.3367, 7.3335, 7.3289, 7.3247, 7.3324, 7.3516, 7.3484, 7.3456, 7.3415, 7.3506, 7.3531, 7.3726, 7.3695, 7.3675, 7.3641, 7.3622, 7.3579, 7.3549, 7.3743, 7.3715, 7.3797, 7.3761, 7.3829, 7.3786, 7.3865, 7.3845, 7.3812, 7.3794, 7.3754, 7.3741, 7.3812, 7.3769, 7.3734, 7.3727, 7.3693, 7.3763, 7.3738, 7.3727, 7.3704, 7.3675, 7.366, 7.3648, 7.3725, 7.3808, 7.377, 7.385, 7.382, 7.3792, 7.3762, 7.3754, 7.3727, 7.3694, 7.3672, 7.3764, 7.3856, 7.383, 7.38, 7.3876, 7.386, 7.385, 7.3815, 7.3824, 7.3896, 7.3882, 7.3854, 7.3818, 7.3891, 7.3869, 7.383, 7.379, 7.3801, 7.377, 7.3741, 7.3808, 7.3779, 7.3754, 7.374, 7.3737, 7.3745, 7.3708, 7.3672, 7.3653, 7.3618, 7.3682, 7.3656, 7.3625, 7.3588, 7.3553, 7.3539, 7.3506, 7.348, 7.3457, 7.3533, 7.3497, 7.3485, 7.3455, 7.3425, 7.3495, 7.3462, 7.3428, 7.3392, 7.3381, 7.335, 7.3602, 7.3569, 7.3551, 7.361, 7.3587, 7.3551, 7.379, 7.3768, 7.3732, 7.3705, 7.3759, 7.3742, 7.3727, 7.3746, 7.3727, 7.3702, 7.3681, 7.3659, 7.3726, 7.3706, 7.3682, 7.3741, 7.3707, 7.3695, 7.3752, 7.3722, 7.3703, 7.3681, 7.3644, 7.3616, 7.3595, 7.3576, 7.3546, 7.3525, 7.3498, 7.3469, 7.3435, 7.3516, 7.3487, 7.346, 7.3525, 7.3587, 7.3651, 7.3632, 7.3606, 7.3576, 7.3576, 7.3549, 7.3963, 7.3942, 7.3911, 7.3888, 7.3857, 7.3834, 7.38, 7.3853, 7.3825, 7.4156, 7.4207, 7.4183, 7.4149, 7.4198, 7.4176, 7.4226, 7.4135, 7.4042, 7.4021, 7.3991, 7.396, 7.3934, 7.3916, 7.3887, 7.3862, 7.384, 7.3812, 7.3784, 7.384, 7.3806, 7.3783, 7.3753, 7.3732, 7.3703, 7.3674, 7.3651, 7.3635, 7.3608, 7.3662, 7.3647, 7.3632, 7.3687, 7.3738, 7.3721, 7.3704, 7.3676, 7.3661, 7.3645, 7.3619, 7.3671, 7.3645, 7.3629, 7.36, 7.3653, 7.3628, 7.3859, 7.3833, 7.3736, 7.3829, 7.3766, 7.3764, 7.3737, 7.3717, 7.3691, 7.3667, 7.3641, 7.3613, 7.3584, 7.3577, 7.3633, 7.3628, 7.368, 7.3658, 7.3714, 7.3701, 7.3687, 7.3672, 7.3642, 7.3627, 7.3615, 7.3622, 7.3596, 7.3568, 7.3551, 7.355, 7.353, 7.3503, 7.3502, 7.3483, 7.3546, 7.3538, 7.3514, 7.357, 7.3555, 7.3534, 7.3507, 7.3562, 7.3565, 7.3619, 7.3595, 7.3575, 7.3623, 7.3614, 7.3617, 7.3601, 7.3654, 7.3713, 7.3721, 7.3745, 7.3733, 7.3707, 7.3684, 7.366, 7.3638, 7.3616, 7.359, 7.3564, 7.3546, 7.3536, 7.3583, 7.3567, 7.355, 7.3534, 7.351, 7.3492, 7.3533, 7.3531, 7.3509, 7.3429, 7.3403, 7.3457, 7.3443, 7.3353, 7.3401, 7.3383, 7.3361, 7.335, 7.333, 7.3309, 7.3361, 7.3347, 7.3408, 7.3387, 7.3369, 7.3354, 7.3332, 7.3313, 7.3293, 7.3274, 7.3339, 7.3318, 7.33, 7.3351, 7.3394, 7.3372, 7.3345, 7.3401, 7.3378, 7.3378, 7.3362, 7.3346, 7.3323, 7.3444, 7.3497, 7.3582, 7.3562, 7.3485, 7.354, 7.3529, 7.351, 7.3485, 7.3528, 7.3575, 7.3626, 7.3609, 7.3586, 7.3564, 7.3609, 7.3547, 7.353, 7.3512, 7.3489, 7.3483, 7.3474, 7.3453, 7.343, 7.3426, 7.3366, 7.3353, 7.3348, 7.3389, 7.3368, 7.3357, 7.3336, 7.3381, 7.3363, 7.3346, 7.3324, 7.3299, 7.3277, 7.3258, 7.3256, 7.3236, 7.3281, 7.3259, 7.3239, 7.3215, 7.3203, 7.318, 7.3156, 7.3085, 7.3063, 7.3041, 7.3021, 7.3067, 7.3044, 7.3027, 7.3004, 7.2983, 7.3029, 7.3017, 7.3009, 7.2994, 7.2992, 7.297, 7.2953, 7.2997, 7.2978, 7.2957, 7.2935, 7.2914, 7.2894, 7.288, 7.2925, 7.2904, 7.2948, 7.2934, 7.2919, 7.2902, 7.2893, 7.2881, 7.2925, 7.2919, 7.2898, 7.2945, 7.2926, 7.2907, 7.2888, 7.2934, 7.2918, 7.2899, 7.2882, 7.2861, 7.2841, 7.2828, 7.2815, 7.28, 7.2782, 7.2765, 7.2747, 7.2792, 7.2787, 7.2775, 7.2766, 7.2759, 7.2753, 7.2746, 7.2731, 7.2712, 7.2691, 7.2672, 7.2657, 7.2637, 7.2563, 7.2548, 7.2535, 7.2518, 7.2503, 7.2483, 7.2471, 7.2452, 7.2431, 7.2416, 7.2401, 7.2442, 7.2423, 7.2411, 7.2394, 7.2378, 7.2368, 7.2349, 7.2394, 7.2377, 7.236, 7.2366, 7.2407, 7.2395, 7.2378, 7.236, 7.2349, 7.2334, 7.2315, 7.2299, 7.2344, 7.2347, 7.2358, 7.2345, 7.2329, 7.232, 7.2365, 7.2354, 7.2367, 7.2408, 7.2459, 7.2444, 7.2425, 7.2414, 7.2406, 7.2399, 7.2389, 7.2368, 7.2363, 7.2346, 7.2331, 7.2331, 7.2321, 7.2308, 7.2289, 7.227, 7.226, 7.2302, 7.2286, 7.2275, 7.2257, 7.2242, 7.2224, 7.2214, 7.2199, 7.2234, 7.2283, 7.2273, 7.226, 7.2249, 7.2246, 7.224, 7.2226, 7.2271, 7.2257, 7.2244, 7.2294, 7.2278, 7.2329, 7.2318, 7.2307, 7.2399, 7.2386, 7.2384, 7.237, 7.2352, 7.234, 7.2387, 7.2369, 7.2354, 7.2342, 7.2384, 7.2421, 7.2405, 7.2623, 7.2604, 7.2585, 7.257, 7.255, 7.2544, 7.2526, 7.2514, 7.2498, 7.2487, 7.2499, 7.2483, 7.2607, 7.2594, 7.2587, 7.2594, 7.2588, 7.2582, 7.2581, 7.2573, 7.2563, 7.2564, 7.2553, 7.2594, 7.2578, 7.2563, 7.2557, 7.2544, 7.2526, 7.2507, 7.2491, 7.2479, 7.2518, 7.2501, 7.2541, 7.2524, 7.2508, 7.2495, 7.2493, 7.2486, 7.2529, 7.2511, 7.2502, 7.2483, 7.2473, 7.2418, 7.2462, 7.2452, 7.2436, 7.2417, 7.24, 7.2382, 7.2366, 7.235, 7.2388, 7.2375, 7.2359, 7.2344, 7.2333, 7.2322, 7.2307, 7.2289, 7.2282, 7.2269, 7.2259, 7.2296, 7.2278, 7.2319, 7.2303, 7.2337, 7.2328, 7.2363, 7.2401, 7.2387, 7.237, 7.2371, 7.2359, 7.2451, 7.2439, 7.2422, 7.2408, 7.2392, 7.2378, 7.236, 7.2347, 7.233, 7.2312, 7.2334, 7.2327, 7.2314, 7.23, 7.2341, 7.2379, 7.2419, 7.2456, 7.2447, 7.244, 7.2439, 7.2425, 7.2411, 7.2394, 7.2386, 7.2371, 7.2366, 7.2358, 7.2345, 7.2382, 7.2417, 7.2405, 7.2387, 7.2381, 7.2365, 7.2348, 7.2334, 7.2369, 7.2406, 7.2391, 7.239, 7.2391, 7.2377, 7.241, 7.2392, 7.2387, 7.2373, 7.2358, 7.235, 7.2333, 7.2365, 7.2349, 7.2336, 7.2319, 7.2302, 7.2251, 7.2239, 7.2227, 7.2211, 7.2196, 7.2184, 7.2216, 7.2199, 7.2184, 7.2168, 7.2151, 7.2134, 7.2168, 7.2198, 7.2181, 7.225, 7.2282, 7.227, 7.2256, 7.2332, 7.2324, 7.236, 7.2353, 7.2386, 7.2369, 7.2356, 7.2387, 7.2374, 7.2416, 7.2503, 7.2536, 7.248, 7.247, 7.2454, 7.2438, 7.2422, 7.2408, 7.244, 7.2423, 7.2407, 7.2441, 7.2426, 7.2419, 7.241, 7.2398, 7.2386, 7.2374, 7.2362, 7.2348, 7.2334, 7.233, 7.2371, 7.236, 7.2353, 7.2339, 7.2326, 7.2309, 7.2341, 7.2374, 7.2361, 7.2355, 7.2391, 7.2393, 7.2426, 7.241, 7.2459, 7.2443, 7.2521, 7.251, 7.2542, 7.2531, 7.252, 7.2503, 7.2488, 7.2478, 7.251, 7.2543, 7.2528, 7.2511, 7.25, 7.249, 7.2479, 7.2605, 7.2595, 7.2583, 7.2614, 7.2603, 7.2586, 7.2615, 7.26, 7.2591, 7.2574, 7.2558, 7.2546, 7.253, 7.2514, 7.2501, 7.2491, 7.252, 7.2504, 7.2492, 7.2485, 7.2472, 7.2467, 7.2454, 7.2444, 7.2433, 7.2423, 7.2412, 7.2444, 7.2473, 7.2505, 7.2488, 7.248, 7.2465, 7.245, 7.245, 7.2483, 7.2477, 7.2471, 7.246, 7.2444, 7.2472, 7.2458, 7.2445, 7.2437, 7.2428, 7.2506, 7.2496, 7.248, 7.2473, 7.2459, 7.245, 7.248, 7.2467, 7.2452, 7.2444, 7.2448, 7.2432, 7.2436, 7.2424, 7.2413, 7.2405, 7.2403, 7.2399, 7.2383, 7.2368, 7.2357, 7.2349, 7.2337, 7.2336, 7.2365, 7.2395, 7.2344, 7.2333, 7.2329, 7.2324, 7.231, 7.2344, 7.2342, 7.2328, 7.2331, 7.2329, 7.2318, 7.2321, 7.2317, 7.2305, 7.2297, 7.2284, 7.227, 7.2261, 7.2295, 7.2287, 7.2275, 7.2261, 7.2254, 7.224, 7.2274, 7.2265, 7.2253, 7.2281, 7.2267, 7.2296, 7.2284, 7.2271, 7.2267, 7.2252, 7.2238, 7.2231, 7.2223, 7.2254, 7.228, 7.2271, 7.2297, 7.2324, 7.2318, 7.2308, 7.234, 7.2331, 7.2331, 7.2316, 7.2348, 7.2337, 7.2326, 7.2313, 7.2303, 7.2289, 7.2278, 7.231, 7.2345, 7.2332, 7.2336, 7.2371, 7.2331, 7.2317, 7.2309, 7.2342, 7.2331, 7.2373, 7.2371, 7.2366, 7.2363, 7.2351, 7.2347, 7.2333, 7.2321, 7.2307, 7.2295, 7.2285, 7.2277, 7.2308, 7.2296, 7.2315, 7.2303, 7.2289, 7.2275, 7.2307, 7.2335, 7.2324, 7.2313, 7.2303, 7.2292, 7.2319, 7.2311, 7.2338, 7.2324, 7.2319, 7.2313, 7.234, 7.233, 7.2316, 7.2303, 7.2292, 7.2253, 7.224, 7.2227, 7.2226, 7.2221, 7.2247, 7.2235, 7.2226, 7.2217, 7.221, 7.2236, 7.2224, 7.2217, 7.2204, 7.2193, 7.2182, 7.2173, 7.2169, 7.2178, 7.2213, 7.2202, 7.2191, 7.2183, 7.2171, 7.216, 7.2146, 7.2132, 7.2118, 7.2104, 7.209, 7.2079, 7.2107, 7.2133, 7.2166, 7.2161, 7.2148, 7.2139, 7.2129, 7.2127, 7.2123, 7.2111, 7.2106, 7.213, 7.2137, 7.2133, 7.214300000000001, 7.215300000000001, 7.2178, 7.2215, 7.2241, 7.2268, 7.2295, 7.2282, 7.2273, 7.226, 7.227, 7.2265, 7.2252, 7.2241, 7.2267, 7.2254, 7.2247, 7.2236, 7.2265, 7.2265, 7.2294, 7.2281, 7.227, 7.2261, 7.2259, 7.2247, 7.2241, 7.2233, 7.2223, 7.2212, 7.2206, 7.2198, 7.2189, 7.2176, 7.2204, 7.223, 7.2263, 7.225, 7.2238, 7.2228, 7.2253, 7.2248, 7.2277, 7.2307, 7.23, 7.2289, 7.2315, 7.2306, 7.2299, 7.2327, 7.2321, 7.2309, 7.2297, 7.2294, 7.2283, 7.2312, 7.2301, 7.2288, 7.2279, 7.2237, 7.223, 7.2219, 7.2225, 7.2213, 7.2171, 7.2163, 7.219, 7.2182, 7.2211, 7.2203, 7.2227, 7.2215, 7.2207, 7.2198, 7.2188, 7.2182, 7.218, 7.2172, 7.2167, 7.216, 7.2154, 7.2182, 7.2172, 7.2166, 7.216, 7.2153, 7.2141, 7.2137, 7.213, 7.2125, 7.213500000000001, 7.2128, 7.2122, 7.2113, 7.2106, 7.2095, 7.2119, 7.2112, 7.2108, 7.2135, 7.2129, 7.2117, 7.2108, 7.2096, 7.2119, 7.2107, 7.2127, 7.2156, 7.2143, 7.2134, 7.2125, 7.2117, 7.212700000000001, 7.213700000000001, 7.2147000000000014, 7.2134, 7.2128, 7.2152, 7.2141, 7.2165, 7.2153, 7.2144, 7.2143, 7.2136, 7.2161, 7.2186, 7.2182, 7.2169, 7.2192, 7.218, 7.2175, 7.2162, 7.2153, 7.2144, 7.2138, 7.2133, 7.2167, 7.217700000000001, 7.2169, 7.2161, 7.2153, 7.2143, 7.2134, 7.2121, 7.2126, 7.215, 7.2146, 7.2135, 7.216, 7.2151, 7.2176, 7.2166, 7.2154, 7.2142, 7.2132, 7.213, 7.2121, 7.2111, 7.2101, 7.2126, 7.2126, 7.2117, 7.2112, 7.2101, 7.2091, 7.2079, 7.2073, 7.2099, 7.2094, 7.2119, 7.2108, 7.21, 7.2088, 7.2079, 7.2104, 7.2095, 7.2096, 7.2092, 7.2091, 7.2097, 7.2089, 7.2085, 7.2109, 7.2102, 7.2092, 7.2116, 7.2106, 7.2094, 7.2085, 7.2154, 7.2143, 7.2133, 7.2129, 7.213900000000001, 7.2162, 7.2157, 7.2152, 7.2174, 7.2297, 7.2286, 7.2274, 7.2266, 7.2255, 7.225, 7.2246, 7.2235, 7.2226, 7.2217, 7.2208, 7.2198, 7.2193, 7.2191, 7.218, 7.2179, 7.2168, 7.2161, 7.2149, 7.217, 7.218, 7.2204, 7.2193, 7.2185, 7.2178, 7.2201, 7.2161, 7.2171, 7.216, 7.2153, 7.2148, 7.2136, 7.2137, 7.213, 7.2124, 7.2114, 7.2137, 7.2128, 7.2124, 7.2113, 7.2108, 7.2111, 7.2101, 7.2105, 7.2099, 7.2124, 7.2113, 7.2104, 7.2094, 7.2085, 7.2077, 7.2067, 7.2058, 7.2049, 7.204, 7.2065, 7.2061, 7.212, 7.2111, 7.2169, 7.2194, 7.2215, 7.2212, 7.2236, 7.2226, 7.2249, 7.2238, 7.2262, 7.2252, 7.2242, 7.2234, 7.2226, 7.2246, 7.2267, 7.2262, 7.2256, 7.225, 7.2272, 7.2264, 7.2285, 7.2274, 7.2265, 7.2285, 7.2308, 7.23, 7.2291, 7.2281, 7.2276, 7.2265, 7.2256, 7.2248, 7.2237, 7.2226, 7.2235, 7.2262, 7.2251, 7.2245, 7.2267, 7.226, 7.225, 7.2243, 7.2273, 7.227, 7.2262, 7.2255, 7.225, 7.2245, 7.2271, 7.2262, 7.2255, 7.2246, 7.2235, 7.2229, 7.2218, 7.221, 7.2198, 7.2198, 7.2194, 7.220400000000001, 7.221400000000001, 7.2238, 7.2267, 7.2263, 7.2257, 7.2253, 7.2249, 7.2242, 7.2236, 7.224600000000001, 7.2271, 7.2262, 7.2251, 7.2245, 7.2246, 7.2238, 7.2233, 7.2262, 7.2257, 7.2261, 7.2253, 7.2245, 7.2267, 7.226, 7.2257, 7.2248, 7.2247, 7.2247, 7.2267, 7.229, 7.2281, 7.2306, 7.2296, 7.2288, 7.2312, 7.2308, 7.2297, 7.232, 7.2318, 7.2338, 7.2361, 7.2358, 7.2347, 7.2339, 7.2357, 7.235, 7.2342, 7.2339, 7.2333, 7.2323, 7.2312, 7.2301, 7.2323, 7.2314, 7.2305, 7.2297, 7.2318, 7.2308, 7.2297, 7.2291, 7.2282, 7.2274, 7.2268, 7.2266, 7.226, 7.2251, 7.2249, 7.2238, 7.223, 7.2225, 7.2218, 7.2209, 7.2202, 7.2226, 7.2217, 7.2208, 7.2201, 7.221100000000001, 7.2203, 7.2224, 7.2251, 7.2245, 7.2239, 7.223, 7.2221, 7.2212, 7.2235, 7.2257, 7.225, 7.225, 7.2269, 7.2263, 7.2255, 7.2254, 7.2246, 7.2239, 7.2329, 7.2382, 7.2375, 7.2367, 7.2358, 7.2348, 7.2339, 7.2329, 7.2352, 7.2343, 7.2367, 7.236, 7.2352, 7.2371, 7.2389, 7.2378, 7.2401, 7.2393, 7.2386, 7.2351, 7.2347, 7.2339, 7.2329, 7.2323, 7.2374, 7.2365, 7.2372, 7.2367, 7.2357, 7.2354, 7.2344, 7.2335, 7.2326, 7.2316, 7.2313, 7.2309, 7.2299, 7.2323, 7.2345, 7.2337, 7.2334, 7.2331, 7.2326, 7.2317, 7.2308, 7.2307, 7.2297, 7.2294, 7.2313, 7.2331, 7.2322, 7.2316, 7.2309, 7.23, 7.2292, 7.2283, 7.2278, 7.2268, 7.226, 7.2251, 7.2217, 7.2214, 7.2208, 7.22, 7.2192, 7.2214, 7.2209, 7.2211, 7.2233, 7.2229, 7.2223, 7.2216, 7.2238, 7.223, 7.2223, 7.2215, 7.2206, 7.2201, 7.2191, 7.2183, 7.2174, 7.2167, 7.2166, 7.2156, 7.2151, 7.214, 7.2129, 7.2122, 7.2113, 7.2163, 7.2152, 7.2145, 7.2155000000000005, 7.2177, 7.2142, 7.2133, 7.2214, 7.2263, 7.2268, 7.229, 7.2282, 7.2276, 7.227, 7.2261, 7.2282, 7.228, 7.2305, 7.2299, 7.2295, 7.2289, 7.2287, 7.2287, 7.2279, 7.2274, 7.2265, 7.2286, 7.2306, 7.2297, 7.2296, 7.2263, 7.2286, 7.2279, 7.2276, 7.227, 7.2269, 7.2261, 7.2252, 7.2242, 7.2262, 7.2283, 7.2303, 7.2301, 7.2295, 7.2289, 7.2307, 7.2298, 7.2293, 7.231, 7.2305, 7.2298, 7.2292, 7.2282, 7.2273, 7.2266, 7.2257, 7.2275, 7.2269, 7.2259, 7.2253, 7.2244, 7.2235, 7.2233, 7.2233, 7.2232, 7.2254, 7.2273, 7.2273, 7.2295, 7.2288, 7.2376, 7.2412, 7.2439, 7.2432, 7.2422, 7.2414, 7.244, 7.2438, 7.2432, 7.2449, 7.2443, 7.2438, 7.2436, 7.2431, 7.2422, 7.2414, 7.2438, 7.2434, 7.2427, 7.2454, 7.245, 7.2441, 7.2431, 7.2451, 7.2443, 7.2463, 7.2458, 7.2453, 7.2445, 7.2462, 7.2481, 7.2476, 7.247, 7.2461, 7.2456, 7.2449, 7.2455, 7.2447, 7.2447, 7.2438, 7.2433, 7.2455, 7.2446, 7.2441, 7.2437, 7.2429, 7.2446, 7.2442, 7.2463, 7.2483, 7.2505, 7.2496, 7.2488, 7.251, 7.2505, 7.2499, 7.2496, 7.2492, 7.2486, 7.2481, 7.2471, 7.2462, 7.2466, 7.2489, 7.2488, 7.2485, 7.2481, 7.2476, 7.2496, 7.2471, 7.2466, 7.2458, 7.2476, 7.2468, 7.246, 7.2457, 7.2478, 7.2476, 7.2471, 7.2466, 7.2459, 7.2478, 7.2471, 7.2467, 7.2458, 7.2478, 7.247, 7.2468, 7.2459, 7.2451, 7.2443, 7.2436, 7.2453, 7.2445, 7.2437, 7.243, 7.2422, 7.2414, 7.2411, 7.2404, 7.2397, 7.2389, 7.2383, 7.2375, 7.2368, 7.2361, 7.2358, 7.2353, 7.2345, 7.2338, 7.2331, 7.2324, 7.2317, 7.2309, 7.2325, 7.2342, 7.2336, 7.2331, 7.2325, 7.232, 7.2318, 7.2311, 7.2303, 7.2297, 7.2291, 7.2308, 7.2325, 7.2316, 7.2308, 7.235, 7.2341, 7.2336, 7.2417, 7.2408, 7.2425, 7.2418, 7.2409, 7.2403, 7.242, 7.2414, 7.2407, 7.2423, 7.2419, 7.2413, 7.2422, 7.2417, 7.2446, 7.2446, 7.2439, 7.2432, 7.245, 7.2469, 7.2488, 7.2514, 7.2513, 7.2505, 7.2498, 7.2491, 7.2487, 7.2509, 7.2506, 7.2504, 7.2495, 7.2487, 7.2478, 7.2474, 7.2493, 7.2486, 7.2482, 7.2474, 7.2465, 7.2459, 7.2503, 7.2548, 7.2548, 7.2543, 7.2541, 7.2533, 7.2531, 7.2527, 7.2518, 7.2536, 7.2552, 7.2545, 7.2589, 7.2583, 7.2601, 7.2594, 7.2611, 7.2604, 7.2621, 7.2617, 7.2634, 7.265, 7.2641, 7.2657, 7.2652, 7.2645, 7.2662, 7.2654, 7.2648, 7.2644, 7.2638, 7.2631, 7.2624, 7.2615, 7.2612, 7.2605, 7.2601, 7.2593, 7.2584, 7.26, 7.2591, 7.2582, 7.2576, 7.2606, 7.2606, 7.2598, 7.2592, 7.2588, 7.2583, 7.2577, 7.2569, 7.2566, 7.256, 7.2551, 7.2542, 7.2534, 7.2526, 7.2522, 7.2537, 7.2553, 7.2554, 7.258, 7.2573, 7.2566, 7.2559, 7.2552, 7.2572, 7.2568, 7.2586, 7.2581, 7.258, 7.2573, 7.2564, 7.2558, 7.2574, 7.2593, 7.2588, 7.258, 7.2594, 7.2608, 7.2604, 7.2604, 7.2597, 7.2593, 7.2596, 7.2591, 7.2584, 7.2575, 7.2571, 7.2564, 7.256, 7.2575, 7.2569, 7.2564, 7.2583, 7.2577, 7.2574, 7.2566, 7.2608, 7.26, 7.2593, 7.2586, 7.2558, 7.2551, 7.2543, 7.2542, 7.2534, 7.2533, 7.2527, 7.2525, 7.2526, 7.2523, 7.2515, 7.2508, 7.2502, 7.2498, 7.2492, 7.2507, 7.25, 7.2494, 7.249, 7.2482, 7.2475, 7.2467, 7.2459, 7.2477, 7.2469, 7.2464, 7.2458, 7.245, 7.2446, 7.2487, 7.2481, 7.2472, 7.2464, 7.2456, 7.2473, 7.2489, 7.2514, 7.2508, 7.2502, 7.2494, 7.2487, 7.2483, 7.2506, 7.2499, 7.2497, 7.2489, 7.2481, 7.2473, 7.2465, 7.2459, 7.2452, 7.2445, 7.2437, 7.243, 7.2425, 7.2442, 7.2434, 7.2451, 7.2444, 7.2437, 7.2431, 7.2426, 7.2419, 7.2436, 7.2456, 7.2449, 7.2464, 7.246, 7.2476, 7.2468, 7.2462, 7.2456, 7.2448, 7.2447, 7.2461, 7.2452, 7.2443, 7.2435, 7.2453, 7.2447, 7.244, 7.2436, 7.2428, 7.2424, 7.2424, 7.2421, 7.2415, 7.2434, 7.2434, 7.2426, 7.242, 7.2414, 7.2408, 7.2426, 7.242, 7.2412, 7.2404, 7.2405, 7.2423, 7.2417, 7.241, 7.2426, 7.2442, 7.2458, 7.2473, 7.2465, 7.246, 7.2452, 7.2447, 7.2509, 7.2504, 7.2496, 7.2491, 7.2482, 7.2476, 7.2492, 7.2514, 7.2506, 7.2503, 7.2495, 7.2494, 7.2488, 7.2482, 7.2475, 7.2496, 7.2489, 7.2482, 7.2499, 7.2492, 7.2487, 7.2503, 7.2499, 7.2495, 7.251, 7.2507, 7.2502, 7.2495, 7.2489, 7.2482, 7.2476, 7.2492, 7.2486, 7.2478, 7.247, 7.2485, 7.2477, 7.2493, 7.2485, 7.2479, 7.2473, 7.2468, 7.2461, 7.2456, 7.2448, 7.2445, 7.244, 7.2435, 7.2453, 7.2495, 7.249, 7.2495, 7.2514, 7.251, 7.2503, 7.2502, 7.2497, 7.249, 7.2482, 7.2497, 7.2492, 7.2486, 7.2479, 7.2473, 7.2468, 7.247, 7.247, 7.2465, 7.246, 7.2452, 7.2444, 7.246, 7.2456, 7.2451, 7.2456, 7.2455, 7.247, 7.2465, 7.2461, 7.2476, 7.2468, 7.2461, 7.2475, 7.247, 7.2486, 7.2486, 7.2483, 7.2478, 7.2472, 7.2464, 7.2458, 7.2472, 7.2489, 7.2481, 7.2497, 7.2489, 7.2504, 7.2499, 7.2491, 7.2484, 7.2479, 7.2494, 7.2488, 7.248, 7.2494, 7.2487, 7.2479, 7.2471, 7.2465, 7.2462, 7.2456, 7.2456, 7.2452, 7.2446, 7.2441, 7.2436, 7.2432, 7.2425, 7.2423, 7.2416, 7.2412, 7.2405, 7.2399, 7.2395, 7.2372, 7.2366, 7.238, 7.2372, 7.2386, 7.2378, 7.2371, 7.2366, 7.2382, 7.2356, 7.2352, 7.2428, 7.2421, 7.2465, 7.2464, 7.246, 7.2453, 7.2471, 7.2464, 7.248, 7.2494, 7.2487, 7.2483, 7.2476, 7.247, 7.2468, 7.2462, 7.2477, 7.2475, 7.2469, 7.2463, 7.2456, 7.2452, 7.2448, 7.2441, 7.2439, 7.2438, 7.2435, 7.2428, 7.2427, 7.244, 7.2433, 7.2435, 7.245, 7.2467, 7.2463, 7.2459, 7.2471, 7.2468, 7.2486, 7.248, 7.2474, 7.2468, 7.2462, 7.246, 7.2455, 7.2451, 7.2444, 7.25, 7.2494, 7.2486, 7.2535, 7.2555, 7.255, 7.2543, 7.2536, 7.2533, 7.253, 7.2544, 7.2537, 7.2532, 7.2573, 7.2588, 7.2581, 7.2578, 7.2577, 7.2582, 7.2575, 7.2568, 7.2564, 7.2559, 7.2561, 7.2576, 7.2576, 7.257, 7.2564, 7.2557, 7.2532, 7.2526, 7.2521, 7.2519, 7.2513, 7.2528, 7.2522, 7.2515, 7.2511, 7.2509, 7.2506, 7.2506, 7.2502, 7.2497, 7.2495, 7.2489, 7.2483, 7.2477, 7.247, 7.2464, 7.248, 7.2474, 7.2466, 7.2459, 7.2453, 7.2447, 7.2444, 7.2458, 7.2434, 7.2428, 7.2445, 7.2438, 7.2431, 7.2427, 7.2422, 7.2419, 7.2413, 7.2407, 7.24, 7.2393, 7.2389, 7.2385, 7.2398, 7.2395, 7.2409, 7.2425, 7.2417, 7.241, 7.2403, 7.2396, 7.2391, 7.2385, 7.2399, 7.2393, 7.2388, 7.2382, 7.2375, 7.2369, 7.2364, 7.2358, 7.2352, 7.2348, 7.2361, 7.2374, 7.2367, 7.2363, 7.2356, 7.2349, 7.2348, 7.2344, 7.2361, 7.2355, 7.2349, 7.2345, 7.2339, 7.2333, 7.2334, 7.2329, 7.2324, 7.2321, 7.2317, 7.2311, 7.2304, 7.2326, 7.2323, 7.2325, 7.2319, 7.2314, 7.2308, 7.2304, 7.2298, 7.2293, 7.2292, 7.229, 7.2284, 7.228, 7.2276, 7.2272, 7.2285, 7.2298, 7.2291, 7.2287, 7.2282, 7.2276, 7.2269, 7.2284, 7.228, 7.2273, 7.2267, 7.2261, 7.2277, 7.227, 7.2264, 7.2258, 7.2254, 7.2248, 7.2263, 7.2259, 7.2253, 7.2268, 7.2265, 7.226, 7.2253, 7.2247, 7.2242, 7.2238, 7.2254, 7.2247, 7.2241, 7.2237, 7.223, 7.2225, 7.224, 7.2233, 7.2229, 7.2222, 7.2216, 7.2212, 7.2207, 7.2201, 7.221100000000001, 7.2223, 7.2218, 7.2213, 7.2206, 7.22, 7.2195, 7.219, 7.2188, 7.2185, 7.2183, 7.2199, 7.2196, 7.2191, 7.2206, 7.2205, 7.2213, 7.2226, 7.222, 7.2215, 7.2208, 7.2208, 7.2204, 7.2201, 7.2198, 7.221, 7.2203, 7.2199, 7.2214, 7.2234, 7.2229, 7.2228, 7.2223, 7.2219, 7.2234, 7.2231, 7.2228, 7.2223, 7.2218, 7.2213, 7.2229, 7.2241, 7.2236, 7.2231, 7.2248, 7.2263, 7.2276, 7.2271, 7.2264, 7.2266, 7.2261, 7.2256, 7.2249, 7.2264, 7.2261, 7.2273, 7.227, 7.2266, 7.2265, 7.2259, 7.2276, 7.227, 7.2283, 7.2278, 7.2273, 7.2268, 7.2263, 7.2262, 7.2256, 7.2255, 7.225, 7.2243, 7.2241, 7.224, 7.2236, 7.224600000000001, 7.2244, 7.2241, 7.2236, 7.2232, 7.2244, 7.2239, 7.2236, 7.2231, 7.2246, 7.2244, 7.2237, 7.2231, 7.2227, 7.2241, 7.2236, 7.2232, 7.221, 7.2223, 7.2216, 7.2213, 7.2207, 7.2203, 7.2197, 7.2195, 7.2191, 7.2192, 7.2187, 7.2182, 7.2179, 7.2176, 7.2173, 7.2166, 7.216, 7.2156, 7.215, 7.2146, 7.2143, 7.2159, 7.2173, 7.2169, 7.2179, 7.2189000000000005, 7.2184, 7.2178, 7.2172, 7.2182, 7.2179, 7.2173, 7.2167, 7.2161, 7.2156, 7.217, 7.2164, 7.2162, 7.2158, 7.2171, 7.2168, 7.2164, 7.2158, 7.2153, 7.2167, 7.2163, 7.2157, 7.2152, 7.2149, 7.2143, 7.2167, 7.218, 7.2176, 7.217, 7.2163, 7.2157, 7.2171, 7.2166, 7.2159, 7.216900000000001, 7.2181, 7.2176, 7.219, 7.2183, 7.2195, 7.2207, 7.2201, 7.2196, 7.2192, 7.2206, 7.2201, 7.2197, 7.2193, 7.2187, 7.2188, 7.2205, 7.22, 7.2279, 7.2273, 7.227, 7.2264, 7.2258, 7.2252, 7.2266, 7.226, 7.2257, 7.2252, 7.2247, 7.224, 7.2235, 7.2248, 7.226, 7.2256, 7.225, 7.2247, 7.2241, 7.2236, 7.2231, 7.2225, 7.2222, 7.2216, 7.2229, 7.2225, 7.2219, 7.2229, 7.2246, 7.2242, 7.2238, 7.2234, 7.223, 7.2246, 7.2262, 7.2258, 7.2254, 7.2251, 7.2265, 7.2277, 7.2271, 7.2265, 7.226, 7.2254, 7.2249, 7.2246, 7.224, 7.2235, 7.2236, 7.2231, 7.2233, 7.2228, 7.2222, 7.2216, 7.2211, 7.2209, 7.2207, 7.2205, 7.2201, 7.2213, 7.2228, 7.2225, 7.222, 7.2214, 7.2208, 7.2219, 7.2213, 7.2217, 7.2211, 7.2241, 7.2254, 7.2249, 7.225, 7.225, 7.226, 7.2273, 7.2267, 7.2267, 7.2263, 7.2257, 7.2255, 7.2269, 7.2264, 7.2277, 7.2291, 7.2285, 7.2298, 7.2294, 7.2291, 7.2303, 7.23, 7.2298, 7.2291, 7.2286, 7.228, 7.2274, 7.2273, 7.2267, 7.2281, 7.228, 7.2292, 7.2288, 7.2285, 7.2283, 7.2277, 7.2272, 7.2287, 7.2299, 7.2294, 7.2288, 7.2285, 7.2279, 7.2274, 7.2268, 7.2265, 7.226, 7.2257, 7.2254, 7.2248, 7.2246, 7.2259, 7.2274, 7.2268, 7.2266, 7.2263, 7.226, 7.2254, 7.2267, 7.2263, 7.226, 7.226, 7.2255, 7.2251, 7.2246, 7.2294, 7.2289, 7.2283, 7.2294, 7.2289, 7.2283, 7.2296, 7.2292, 7.2289, 7.2285, 7.2279, 7.2276, 7.227, 7.2265, 7.2261, 7.226, 7.2258, 7.2253, 7.225, 7.2245, 7.2239, 7.2251, 7.2246, 7.224, 7.2236, 7.2233, 7.2228, 7.224, 7.2254, 7.2252, 7.2264, 7.2276, 7.2272, 7.2273, 7.2267, 7.2263, 7.2259, 7.2273, 7.2267, 7.2262, 7.226, 7.2258, 7.2253, 7.2247, 7.2244, 7.2241, 7.2237, 7.2234, 7.2228, 7.2224, 7.2219, 7.2216, 7.221, 7.2205, 7.22, 7.2199, 7.2194, 7.219, 7.2203, 7.2216, 7.221, 7.2204, 7.2215, 7.2209, 7.2203, 7.2198, 7.221, 7.2208, 7.2202, 7.2198, 7.2192, 7.2187, 7.2181, 7.2186, 7.2185, 7.2182, 7.2177, 7.2175, 7.2177, 7.2176, 7.2173, 7.2167, 7.2165, 7.2163, 7.2158, 7.2153, 7.2156, 7.2151, 7.2167, 7.218, 7.2192, 7.2205, 7.2203, 7.2198, 7.2194, 7.2189, 7.2183, 7.2177, 7.2172, 7.2169, 7.2165, 7.2159, 7.2155, 7.2168, 7.2167, 7.218, 7.2177, 7.2172, 7.2167, 7.218, 7.2192, 7.2189, 7.2184, 7.2181, 7.2178, 7.2172, 7.2167, 7.2164, 7.2159, 7.2172, 7.2169, 7.2165, 7.216, 7.2156, 7.2151, 7.2161, 7.2156, 7.2159, 7.2155, 7.2149, 7.2144, 7.2158, 7.2154, 7.2167, 7.2178, 7.2177, 7.2174, 7.2169, 7.2163, 7.216, 7.2157, 7.2152, 7.2165, 7.2162, 7.2157, 7.2153, 7.2148, 7.2143, 7.213, 7.2127, 7.2125, 7.2121, 7.2117, 7.2111, 7.2107, 7.2103, 7.2115, 7.211, 7.2108, 7.2104, 7.2099, 7.2095, 7.209, 7.2088, 7.2082, 7.2097, 7.2077, 7.2089, 7.2101, 7.2114, 7.2108, 7.2103, 7.2115, 7.2111, 7.2114, 7.212400000000001, 7.213400000000001, 7.2131, 7.2127, 7.2138, 7.2141, 7.2138, 7.2154, 7.2153, 7.2148, 7.2142, 7.2136, 7.2131, 7.2126, 7.2158, 7.2155, 7.2166, 7.2161, 7.2171, 7.215, 7.2162, 7.2158, 7.2153, 7.2165, 7.2161, 7.2172, 7.2169, 7.2181, 7.2193, 7.2203, 7.2198, 7.2195, 7.219, 7.2187, 7.2185, 7.2181, 7.218, 7.2176, 7.2171, 7.2167, 7.2163, 7.2159, 7.2154, 7.215, 7.215, 7.2145, 7.2139, 7.2149, 7.2159, 7.216900000000001, 7.218, 7.2175, 7.2186, 7.2182, 7.2184, 7.2179, 7.2175, 7.2169, 7.2181, 7.2177, 7.2188, 7.2198, 7.2181, 7.2175, 7.2171, 7.2165, 7.2159, 7.216900000000001, 7.2165, 7.2176, 7.217, 7.2181, 7.2179, 7.2173, 7.217, 7.2166, 7.2177, 7.2171, 7.2165, 7.2161, 7.2172, 7.2166, 7.2178, 7.2175, 7.2169, 7.2163, 7.2175, 7.217, 7.217, 7.2165, 7.2162, 7.2158, 7.2154, 7.2149, 7.2144, 7.2138, 7.2149, 7.2144, 7.2138, 7.2134, 7.2129, 7.2123, 7.2117, 7.2113, 7.2109, 7.2103, 7.2098, 7.2113, 7.2132, 7.215, 7.2138, 7.2148, 7.2144, 7.2139, 7.2136, 7.2135, 7.2132, 7.2127, 7.2122, 7.212, 7.213, 7.2125, 7.2122, 7.212, 7.2116, 7.2113, 7.2107, 7.2104, 7.2102, 7.2101, 7.2099, 7.2097, 7.2109, 7.2108, 7.2121, 7.2116, 7.2112, 7.2123, 7.2118, 7.2115, 7.2113, 7.211, 7.2108, 7.212, 7.2133, 7.2129, 7.2124, 7.212, 7.2116, 7.2113, 7.2123, 7.2117, 7.2111, 7.2122, 7.2117, 7.2112, 7.2107, 7.2105, 7.2103, 7.2098, 7.211, 7.2106, 7.2101, 7.2113, 7.2109, 7.2119, 7.2115, 7.2109, 7.2104, 7.2114, 7.211, 7.2105, 7.2117, 7.2112, 7.2123, 7.2118, 7.2113, 7.2109, 7.2104, 7.21, 7.2114, 7.2108, 7.2121, 7.2117, 7.2128, 7.2124, 7.2151, 7.2148, 7.2142, 7.2155, 7.2152, 7.2163, 7.216, 7.2154, 7.215, 7.2146, 7.2143, 7.2155, 7.2165, 7.216, 7.2155, 7.215, 7.2162, 7.2174, 7.2172, 7.2187, 7.2184, 7.2195, 7.2191, 7.2186, 7.2183, 7.2181, 7.2178, 7.2173, 7.217, 7.2197, 7.2193, 7.2215, 7.2227, 7.2223, 7.2232, 7.2231, 7.23, 7.2296, 7.2293, 7.2288, 7.2283, 7.2278, 7.229, 7.2287, 7.2302, 7.2298, 7.2311, 7.2307, 7.2302, 7.2297, 7.2293, 7.2289, 7.2286, 7.2296, 7.2307, 7.2302, 7.2301, 7.2298, 7.2293, 7.2295, 7.2292, 7.2288, 7.2284, 7.2283, 7.2282, 7.2293, 7.2288, 7.2284, 7.2281, 7.2292, 7.2288, 7.2299, 7.2297, 7.2293, 7.2289, 7.2285, 7.2282, 7.2293, 7.2306, 7.2319, 7.2315, 7.2311, 7.2306, 7.2315, 7.2311, 7.2305, 7.2316, 7.2312, 7.2308, 7.2292, 7.2287, 7.2282, 7.2281, 7.2291, 7.2288, 7.2283, 7.2278, 7.2275, 7.2271, 7.2266, 7.2263, 7.2258, 7.2253, 7.225, 7.2249, 7.2248, 7.2259, 7.2256, 7.2253, 7.2248, 7.2251, 7.225, 7.2247, 7.2242, 7.2254, 7.2251, 7.2253, 7.2253, 7.2248, 7.226, 7.2256, 7.2253, 7.2249, 7.2245, 7.2242, 7.2239, 7.2234, 7.2245, 7.2257, 7.2256, 7.2251, 7.2246, 7.2243, 7.2254, 7.2249, 7.2246, 7.2274, 7.2287, 7.2284, 7.2283, 7.2278, 7.229, 7.2286, 7.2282, 7.2276, 7.2274, 7.227, 7.2268, 7.2265, 7.2265, 7.226, 7.2255, 7.2252, 7.2247, 7.2243, 7.2239, 7.2237, 7.2233, 7.223, 7.2226, 7.2238, 7.2233, 7.223, 7.2242, 7.2237, 7.2235, 7.2247, 7.2244, 7.2241, 7.2237, 7.2239, 7.2235, 7.223, 7.2225, 7.2221, 7.2221, 7.2217, 7.223, 7.2226, 7.2224, 7.222, 7.2217, 7.2213, 7.2213, 7.2208, 7.2203, 7.2198, 7.2196, 7.2194, 7.2205, 7.2203, 7.2199, 7.2194, 7.220400000000001, 7.22, 7.2199, 7.2196, 7.22, 7.2198, 7.2209, 7.2208, 7.2207, 7.2203, 7.2201, 7.2185, 7.2198, 7.2208, 7.2204, 7.22, 7.2199, 7.2202, 7.2201, 7.2213, 7.2208, 7.2208, 7.2205, 7.2203, 7.2198, 7.2194, 7.2189, 7.2184, 7.2185, 7.2181, 7.2177, 7.2172, 7.2169, 7.2166, 7.2163, 7.2158, 7.2154, 7.215, 7.2148, 7.2159, 7.2155, 7.2154, 7.2149, 7.2159, 7.2201, 7.2196, 7.2208, 7.2204, 7.2199, 7.2211, 7.2208, 7.2218, 7.2229, 7.2224, 7.2221, 7.2219, 7.223, 7.2226, 7.2208, 7.2218, 7.2214, 7.221, 7.222, 7.2219, 7.2216, 7.2211, 7.2223, 7.2218, 7.2215, 7.2211, 7.2211, 7.2208, 7.2219, 7.2215, 7.2212, 7.2209, 7.2204, 7.22, 7.2196, 7.2192, 7.219, 7.2185, 7.2183, 7.2189, 7.2185, 7.22, 7.2196, 7.2192, 7.2188, 7.2188, 7.2184, 7.2181, 7.2176, 7.2172, 7.2167, 7.2162, 7.2158, 7.2154, 7.215, 7.2173, 7.2169, 7.2167, 7.2178, 7.2175, 7.2216, 7.2213, 7.221, 7.2205, 7.2203, 7.2214, 7.2239, 7.225, 7.2259, 7.2256, 7.2271, 7.2267, 7.2262, 7.2245, 7.2242, 7.224, 7.2237, 7.2232, 7.2232, 7.2216, 7.2211, 7.2207, 7.2218, 7.2214, 7.2225, 7.2221, 7.222, 7.2215, 7.2212, 7.2222, 7.2218, 7.2214, 7.2225, 7.222, 7.2216, 7.2214, 7.2209, 7.2212, 7.2208, 7.2204, 7.2202, 7.2198, 7.2196, 7.2194, 7.2192, 7.2192, 7.2187, 7.2199, 7.2195, 7.2205, 7.2201, 7.2198, 7.2196, 7.2192, 7.2188, 7.2198, 7.2197, 7.2192, 7.219, 7.2187, 7.2198, 7.2207, 7.2203, 7.2201, 7.2196, 7.2191, 7.219, 7.2185, 7.2168, 7.2178, 7.2173, 7.2169, 7.2165, 7.216, 7.2162, 7.2158, 7.2169, 7.2165, 7.216, 7.2169, 7.2167, 7.2163, 7.2173, 7.2171, 7.2168, 7.2165, 7.2163, 7.2159, 7.2156, 7.2151, 7.2146, 7.2142, 7.2151, 7.2152, 7.2167, 7.2177, 7.2172, 7.2168, 7.2166, 7.2176, 7.2171, 7.2168, 7.2163, 7.2173, 7.217, 7.2166, 7.2161, 7.2157, 7.2168, 7.2178, 7.2176, 7.2173, 7.2168, 7.2178, 7.2178, 7.2174, 7.217, 7.218, 7.219, 7.2186, 7.2183, 7.2179, 7.2192, 7.2188, 7.2186, 7.2181, 7.2178, 7.2176, 7.2172, 7.2182, 7.2178, 7.2177, 7.2173, 7.2169, 7.2169, 7.2168, 7.2164, 7.2175, 7.2171, 7.2182, 7.218, 7.2178, 7.2174, 7.2169, 7.2166, 7.2162, 7.2158, 7.2155, 7.215, 7.2161, 7.2157, 7.2156, 7.2153, 7.2163, 7.217300000000001, 7.2169, 7.2164, 7.2159, 7.216900000000001, 7.2166, 7.2167, 7.2165, 7.2162, 7.2157, 7.2152, 7.216200000000001, 7.2172, 7.217, 7.217, 7.2168, 7.2165, 7.2162, 7.2159, 7.2155, 7.2165, 7.2162, 7.2163, 7.2158, 7.216, 7.2173, 7.2169, 7.2225, 7.2221, 7.223, 7.2226, 7.2222, 7.2219, 7.2217, 7.2229, 7.224, 7.2239, 7.2235, 7.2244, 7.2253, 7.2278, 7.2295, 7.2291, 7.2293, 7.2291, 7.2288, 7.2283, 7.2279, 7.2276, 7.2272, 7.227, 7.2267, 7.2276, 7.2272, 7.2269, 7.2278, 7.2273, 7.227, 7.2265, 7.226, 7.2257, 7.2267, 7.2269, 7.2266, 7.2262, 7.2257, 7.2253, 7.225, 7.2246, 7.2256, 7.2253, 7.2249, 7.2246, 7.2241, 7.2236, 7.2232, 7.2243, 7.2253, 7.2249, 7.226, 7.227, 7.2266, 7.2264, 7.226, 7.2256, 7.2252, 7.2247, 7.2244, 7.224, 7.2237, 7.2246, 7.2243, 7.2242, 7.2238, 7.2235, 7.223, 7.2228, 7.2236, 7.2233, 7.223, 7.2239, 7.2248, 7.2245, 7.2241, 7.2236, 7.2259, 7.2269, 7.2264, 7.2259, 7.2269, 7.2269, 7.2264, 7.2261, 7.2258, 7.2254, 7.225, 7.2261, 7.2256, 7.2251, 7.225, 7.2247, 7.2244, 7.224, 7.2236, 7.2235, 7.2235, 7.2219, 7.2214, 7.2212, 7.2209, 7.2204, 7.2203, 7.2199, 7.2208, 7.2205, 7.22, 7.2196, 7.2205, 7.2201, 7.2186, 7.2182, 7.2178, 7.2176, 7.2172, 7.2183, 7.218, 7.2178, 7.2178, 7.2175, 7.2171, 7.2169, 7.2165, 7.216, 7.2159, 7.2158, 7.2155, 7.2153, 7.2149, 7.2158, 7.2154, 7.2149, 7.2146, 7.2155, 7.2152, 7.2147, 7.2144, 7.2141, 7.2137, 7.2137, 7.2134, 7.2135, 7.2132, 7.2127, 7.2127, 7.2136, 7.2136, 7.2146, 7.2143, 7.2148, 7.2145, 7.214, 7.2136, 7.2146, 7.2156, 7.2152, 7.2149, 7.2145, 7.2142, 7.2141, 7.2137, 7.2132, 7.2142, 7.2137, 7.2134, 7.2131, 7.2128, 7.2126, 7.2125, 7.2122, 7.2117, 7.2114, 7.2125, 7.2122, 7.2118, 7.2114, 7.211, 7.2119, 7.2129, 7.2153, 7.2139, 7.2136, 7.2133, 7.2131, 7.2141, 7.2151, 7.2147, 7.2143, 7.214, 7.2136, 7.2145, 7.2154, 7.2149, 7.2148, 7.2143, 7.2154, 7.2149, 7.2159, 7.2168, 7.2178, 7.2189, 7.2201, 7.2198, 7.2198, 7.2194, 7.2193, 7.2191, 7.2186, 7.2173, 7.216, 7.2184, 7.2182, 7.2178, 7.2175, 7.2173, 7.2171, 7.2169, 7.2164, 7.2159, 7.2154, 7.2154, 7.2162, 7.2173, 7.2172, 7.2158, 7.2156, 7.2165, 7.2164, 7.216, 7.2155, 7.2165, 7.2162, 7.2159, 7.2168, 7.2164, 7.216, 7.2156, 7.2152, 7.2148, 7.2147, 7.2144, 7.2142, 7.214, 7.2135, 7.2132, 7.2128, 7.2127, 7.2137, 7.2146, 7.2143, 7.2139, 7.2149, 7.2159, 7.2154, 7.2151, 7.2154, 7.2163, 7.216, 7.2156, 7.2152, 7.2149, 7.2147, 7.2157, 7.2167, 7.2175, 7.2185, 7.2181, 7.2178, 7.2174, 7.2169, 7.217, 7.2165, 7.2161, 7.217, 7.2169, 7.2165, 7.2166, 7.2163, 7.2161, 7.2157, 7.2153, 7.2151, 7.2148, 7.2143, 7.2139, 7.2138, 7.2135, 7.2121, 7.2106, 7.2093, 7.2102, 7.2098, 7.2107, 7.2104, 7.2099, 7.2095, 7.2091, 7.2088, 7.2085, 7.2069, 7.2065, 7.2061, 7.2047, 7.2056, 7.2053, 7.2063, 7.2061, 7.2058, 7.2045, 7.2047, 7.2044, 7.2041, 7.2047, 7.2033, 7.2019, 7.2016, 7.2013, 7.2022, 7.2007, 7.1992, 7.199, 7.1989, 7.1986, 7.1985, 7.1995, 7.1992, 7.2001, 7.2011, 7.2022, 7.202, 7.2016, 7.2012, 7.2011, 7.2008, 7.2007, 7.2017, 7.2014, 7.201, 7.2008, 7.2018, 7.2014, 7.2012, 7.2021, 7.2019, 7.2015, 7.2012, 7.2008, 7.2006, 7.2006, 7.2003, 7.2002, 7.2012, 7.2011, 7.2021, 7.203, 7.2025, 7.2023, 7.2022, 7.2019, 7.2017, 7.2013, 7.2023, 7.2021, 7.203, 7.2027, 7.2026, 7.2025, 7.2027, 7.2035, 7.2046, 7.2056, 7.2052, 7.2049, 7.2058, 7.2043, 7.204, 7.204, 7.2038, 7.2036, 7.2034, 7.2069, 7.2066, 7.2061, 7.2069, 7.2067, 7.2065, 7.2061, 7.2058, 7.2057, 7.2055, 7.2051, 7.2046, 7.2043, 7.2052, 7.2061, 7.207, 7.2068, 7.2079, 7.2076, 7.2086, 7.2083, 7.2095, 7.2094, 7.2091, 7.2088, 7.2086, 7.2083, 7.2093, 7.2092, 7.2102, 7.2098, 7.210800000000001, 7.2105, 7.2103, 7.2124, 7.2142, 7.2151, 7.2149, 7.2146, 7.2147, 7.2155, 7.2151, 7.2148, 7.2145, 7.2144, 7.2144, 7.214, 7.2136, 7.2157, 7.2153, 7.2162, 7.216, 7.2156, 7.2152, 7.2149, 7.2148, 7.2144, 7.2153, 7.2151, 7.216, 7.2147, 7.2144, 7.214, 7.2137, 7.2133, 7.2129, 7.2126, 7.2135, 7.2132, 7.213, 7.2126, 7.2123, 7.2121, 7.2118, 7.2116, 7.2113, 7.2099, 7.2097, 7.2094, 7.209, 7.2086, 7.2085, 7.2094, 7.209, 7.2076, 7.2074, 7.2072, 7.2068, 7.2066, 7.2075, 7.2071, 7.2067, 7.2063, 7.2071, 7.2067, 7.2063, 7.2059, 7.2056, 7.2052, 7.2048, 7.2044, 7.2041, 7.2037, 7.2034, 7.202, 7.2017, 7.2013, 7.2011, 7.2019, 7.2028, 7.2028, 7.2025, 7.2021, 7.2019, 7.2018, 7.2015, 7.2014, 7.2012, 7.201, 7.2008, 7.2004, 7.2001, 7.1999, 7.1995, 7.1991, 7.1988, 7.1986, 7.1985, 7.1981, 7.1979, 7.1989, 7.1986, 7.1981, 7.1977, 7.1986, 7.1983, 7.1981, 7.1978, 7.1974, 7.197, 7.1967, 7.1975, 7.1971, 7.1967, 7.1977, 7.1973, 7.1973, 7.197, 7.1966, 7.1962, 7.1951, 7.1948, 7.1945, 7.1944, 7.1941, 7.1951, 7.1947, 7.1946, 7.1943, 7.194, 7.1952, 7.195, 7.1947, 7.1958, 7.1968, 7.1967, 7.1965, 7.197500000000001, 7.198500000000001, 7.1988, 7.1987, 7.1983, 7.198, 7.1977, 7.1976, 7.198600000000001, 7.1986, 7.1983, 7.1993, 7.2003, 7.2, 7.2029, 7.2026, 7.2017, 7.2002, 7.2, 7.1998, 7.2008, 7.2004, 7.2014, 7.2022, 7.203200000000001, 7.2029, 7.2038, 7.2074, 7.2084, 7.2105, 7.2122, 7.212, 7.2119, 7.2117, 7.2114, 7.2113, 7.2111, 7.211, 7.2132, 7.212, 7.212, 7.2118, 7.2126, 7.2135, 7.2133, 7.2129, 7.2129, 7.2151, 7.2162, 7.2159, 7.2156, 7.2153, 7.2162, 7.2158, 7.2156, 7.2164, 7.2163, 7.2161, 7.2157, 7.2153, 7.2152, 7.2161, 7.2157, 7.2153, 7.2149, 7.2147, 7.2143, 7.2152, 7.2148, 7.2157, 7.2156, 7.2152, 7.216, 7.2156, 7.2152, 7.215, 7.2148, 7.2145, 7.2153, 7.215, 7.2148, 7.2144, 7.2143, 7.2139, 7.2136, 7.2132, 7.2129, 7.2127, 7.2124, 7.2133, 7.2129, 7.2126, 7.2122, 7.2118, 7.2115, 7.2111, 7.212, 7.2122, 7.2118, 7.2126, 7.2123, 7.2119, 7.2115, 7.2115, 7.2115, 7.2123, 7.212, 7.2116, 7.2113, 7.2118, 7.2115, 7.2114, 7.2112, 7.2108, 7.2108, 7.2105, 7.2103, 7.2101, 7.2125, 7.2122, 7.2122, 7.2123, 7.2125, 7.2135, 7.2144, 7.2141, 7.2151, 7.2161, 7.2162, 7.2158, 7.2167, 7.2178, 7.2174, 7.2171, 7.2167, 7.2166, 7.2165, 7.2162, 7.2158, 7.2157, 7.2154, 7.2151, 7.215, 7.2147, 7.2145, 7.2141, 7.2161, 7.2157, 7.2153, 7.2142, 7.2145, 7.2142, 7.2138, 7.2136, 7.2122, 7.2146, 7.2145, 7.2154, 7.2153, 7.215, 7.2138, 7.2137, 7.2136, 7.2124, 7.2135, 7.2131, 7.2128, 7.2129, 7.2127, 7.2115, 7.2111, 7.2119, 7.2117, 7.2125, 7.2123, 7.212, 7.2128, 7.2137, 7.2135, 7.2143, 7.2139, 7.2135, 7.2135, 7.2143, 7.2141, 7.214, 7.2138, 7.2136, 7.2134, 7.213, 7.2138, 7.2136, 7.2132, 7.213, 7.2138, 7.2136, 7.2133, 7.2129, 7.2125, 7.2122, 7.2121, 7.2119, 7.2118, 7.2117, 7.2118, 7.2131, 7.2128, 7.2137, 7.2134, 7.2133, 7.2129, 7.2126, 7.2123, 7.2121, 7.2129, 7.2126, 7.2134, 7.2132, 7.2128, 7.2124, 7.2133, 7.213, 7.2128, 7.2125, 7.2149, 7.2146, 7.2142, 7.2138, 7.2135, 7.2131, 7.214, 7.2137, 7.2135, 7.2131, 7.2129, 7.2128, 7.2124, 7.2122, 7.2118, 7.2116, 7.2123, 7.2119, 7.2117, 7.2113, 7.2111, 7.2134, 7.2142, 7.2139, 7.2147, 7.2145, 7.2143, 7.2139, 7.2136, 7.2132, 7.214, 7.2137, 7.2133, 7.213, 7.2138, 7.2135, 7.2133, 7.2129, 7.2127, 7.2136, 7.2132, 7.2131, 7.2128, 7.2125, 7.2126, 7.2123, 7.213, 7.2126, 7.2113, 7.211, 7.2107, 7.2104, 7.2102, 7.2112, 7.2109, 7.2116, 7.2115, 7.2101, 7.2087, 7.2074, 7.207, 7.2068, 7.2066, 7.2075, 7.2072, 7.2073, 7.2083, 7.2079, 7.2075, 7.2083, 7.2081, 7.2077, 7.2073, 7.2071, 7.2067, 7.2065, 7.2063, 7.2059, 7.2058, 7.2056, 7.2052, 7.205, 7.2049, 7.2048, 7.2048, 7.2037, 7.2034, 7.2032, 7.2041, 7.2037, 7.2034, 7.2032, 7.2031, 7.2027, 7.2025, 7.2021, 7.2029, 7.2026, 7.2023, 7.2032, 7.202, 7.2018, 7.2017, 7.2014, 7.2013, 7.2009, 7.2005, 7.2001, 7.1998, 7.1995, 7.1991, 7.2, 7.1997, 7.1993, 7.1993, 7.2006, 7.2007, 7.2004, 7.199, 7.1987, 7.2011, 7.2007, 7.2053, 7.2065, 7.2062, 7.207, 7.2079, 7.2086, 7.2084, 7.2083, 7.2079, 7.2076, 7.2073, 7.2081, 7.209, 7.2088, 7.2085, 7.2084, 7.2083, 7.2091, 7.2079, 7.2076, 7.2073, 7.2062, 7.2058, 7.2054, 7.2064, 7.2072, 7.2069, 7.2066, 7.2063, 7.2061, 7.2059, 7.2055, 7.2063, 7.2071, 7.2067, 7.2064, 7.2063, 7.205, 7.2037, 7.2036, 7.2034, 7.2031, 7.2027, 7.2014, 7.201, 7.2008, 7.2018, 7.2014, 7.2012, 7.201, 7.2007, 7.2019, 7.2017, 7.2015, 7.2035, 7.2032, 7.2046, 7.2042, 7.2049, 7.2047, 7.2055, 7.2065, 7.2064, 7.2063, 7.2059, 7.2057, 7.2057, 7.2065, 7.2053, 7.2062, 7.2058, 7.2066, 7.2074, 7.2071, 7.207, 7.2067, 7.2064, 7.2073, 7.2071, 7.2067, 7.2076, 7.2075, 7.2072, 7.208, 7.2077, 7.2073, 7.2081, 7.2078, 7.2074, 7.2073, 7.207, 7.2069, 7.2067, 7.2065, 7.2062, 7.2069, 7.2076, 7.2074, 7.2073, 7.207, 7.2068, 7.2065, 7.2061, 7.2058, 7.2055, 7.2063, 7.2071, 7.208, 7.2089, 7.2087, 7.2083, 7.209, 7.2088, 7.2085, 7.2084, 7.2081, 7.2078, 7.2075, 7.2071, 7.2071, 7.2069, 7.2067, 7.2067, 7.2074, 7.2072, 7.2069, 7.2068, 7.2067, 7.2067, 7.2075, 7.2074, 7.2082, 7.2082, 7.2079, 7.2078, 7.2075, 7.2073, 7.2071, 7.2068, 7.2065, 7.2062, 7.2082, 7.2089, 7.2086, 7.2084, 7.2081, 7.2078, 7.2074, 7.2071, 7.2067, 7.2064, 7.2083, 7.208, 7.2077, 7.2076, 7.2072, 7.2079, 7.2076, 7.2072, 7.2071, 7.2068, 7.2065, 7.2061, 7.2059, 7.2067, 7.2063, 7.206, 7.2067, 7.2074, 7.2071, 7.207, 7.2068, 7.2064, 7.2061, 7.2067, 7.2063, 7.2076, 7.2073, 7.208, 7.2077, 7.2077, 7.2075, 7.2079, 7.2076, 7.2075, 7.2072, 7.2072, 7.2079, 7.2076, 7.2073, 7.2078, 7.2074, 7.2071, 7.2068, 7.2068, 7.2076, 7.2076, 7.2073, 7.2104, 7.2101, 7.2109, 7.2107, 7.2114, 7.2123, 7.212, 7.2118, 7.2114, 7.2111, 7.2108, 7.2105, 7.2105, 7.2103, 7.2101, 7.2098, 7.2096, 7.2083, 7.208, 7.209, 7.2086, 7.2093, 7.2091, 7.209, 7.2077, 7.2073, 7.207, 7.2069, 7.2068, 7.2064, 7.206, 7.2058, 7.2057, 7.2065, 7.2063, 7.2061, 7.2059, 7.2057, 7.2055, 7.2054, 7.2052, 7.205, 7.2046, 7.2045, 7.2043, 7.2041, 7.2029, 7.2026, 7.2024, 7.2022, 7.202, 7.2018, 7.2027, 7.2024, 7.2022, 7.2019, 7.2015, 7.2024, 7.2021, 7.202, 7.2029, 7.2026, 7.2023, 7.202, 7.204, 7.204, 7.2036, 7.2044, 7.204, 7.2037, 7.2035, 7.2031, 7.2038, 7.2036, 7.2033, 7.203, 7.2018, 7.2016, 7.2013, 7.2011, 7.1998, 7.1995, 7.1993, 7.1981, 7.1969, 7.1972, 7.196, 7.1957, 7.196700000000001, 7.1965, 7.1973, 7.197, 7.1967, 7.1966, 7.1975, 7.1973, 7.197, 7.1968, 7.1966, 7.1964, 7.1962, 7.196, 7.196, 7.1958, 7.1956, 7.1953, 7.195, 7.1947, 7.1943, 7.1984, 7.1982, 7.198, 7.1978, 7.1974, 7.1971, 7.1969, 7.1966, 7.1974, 7.1971, 7.1968, 7.1965, 7.1973, 7.197, 7.1977, 7.1976, 7.1983, 7.1981, 7.1978, 7.1978, 7.1975, 7.1963, 7.1952, 7.1941, 7.193, 7.1922, 7.1918, 7.1925, 7.1924, 7.1921, 7.1918, 7.1915, 7.1914, 7.1911, 7.1909, 7.1906, 7.1895, 7.1892, 7.1891, 7.1888, 7.1887, 7.1895, 7.1893, 7.1892, 7.1902, 7.1899, 7.1897, 7.1895, 7.1894, 7.1892, 7.1902, 7.1902, 7.1901, 7.19, 7.1897, 7.1895, 7.1904, 7.1892, 7.1888, 7.1886, 7.1895, 7.1893, 7.19, 7.1898, 7.1896, 7.1896, 7.1896, 7.1892, 7.189, 7.1897, 7.1894, 7.1893, 7.1891, 7.1901, 7.1898, 7.1896, 7.1894, 7.1891, 7.1888, 7.1886, 7.1884, 7.1892, 7.1889, 7.1886, 7.1883, 7.1882, 7.188, 7.1882, 7.1892000000000005, 7.189, 7.1888, 7.1896, 7.1894, 7.1892, 7.1901, 7.1899, 7.1896, 7.1894, 7.192, 7.1918, 7.1907, 7.1895, 7.1893, 7.190300000000001, 7.1901, 7.1944, 7.1945, 7.1945, 7.1942, 7.1939, 7.1928, 7.1924, 7.1932, 7.1941, 7.1949, 7.1947, 7.1944, 7.1952, 7.1949, 7.1957, 7.1954, 7.1952, 7.196, 7.1959, 7.1958, 7.1978, 7.1975, 7.1974, 7.197, 7.197, 7.1967, 7.1964, 7.1963, 7.1963, 7.1971, 7.1968, 7.1967, 7.1963, 7.196, 7.1956, 7.1954, 7.1952, 7.195, 7.1948, 7.1947, 7.1947, 7.1948, 7.1937, 7.1934, 7.1931, 7.1928, 7.1926, 7.1933, 7.194, 7.1937, 7.1935, 7.1942, 7.1939, 7.1928, 7.1927, 7.1924, 7.1921, 7.1929, 7.1928, 7.1925, 7.1923, 7.1921, 7.1919, 7.1916, 7.1913, 7.191, 7.1908, 7.1904, 7.1913, 7.1911, 7.1907, 7.1905, 7.1901, 7.1901, 7.1908, 7.1907, 7.1914, 7.1921, 7.1928, 7.1925, 7.1934, 7.1932, 7.1939, 7.1937, 7.1935, 7.1934, 7.1931, 7.1939, 7.1936, 7.1932, 7.1929, 7.1926, 7.1925, 7.1922, 7.192, 7.1917, 7.1915, 7.1915, 7.1912, 7.1909, 7.1918, 7.1915, 7.1923, 7.1931, 7.1927, 7.1925, 7.1933, 7.193, 7.1929, 7.1933, 7.1931, 7.1938, 7.1935, 7.1933, 7.1929, 7.1926, 7.1925, 7.1931, 7.1919, 7.1916, 7.1921, 7.1921, 7.1918, 7.1916, 7.1913, 7.1911, 7.1907, 7.1915, 7.1923, 7.192, 7.1918, 7.1914, 7.1904, 7.1902, 7.1899, 7.1897, 7.1896, 7.1893, 7.19, 7.1897, 7.1894, 7.1892, 7.1889, 7.1886, 7.1883, 7.189, 7.1897, 7.1905, 7.1902, 7.1901, 7.1898, 7.1905, 7.1924, 7.1922, 7.192, 7.1918, 7.1917, 7.1925, 7.1935, 7.1932, 7.1939, 7.1937, 7.1935, 7.1933, 7.1932, 7.193, 7.1939, 7.1939, 7.194, 7.1939, 7.1936, 7.1946, 7.1944, 7.1942, 7.1939, 7.1938, 7.1936, 7.1935, 7.1932, 7.193, 7.1928, 7.1925, 7.1921, 7.1918, 7.1917, 7.1924, 7.1922, 7.1929, 7.1928, 7.1916, 7.1913, 7.191, 7.1907, 7.1907, 7.1905, 7.1903, 7.1902, 7.189, 7.1887, 7.1885, 7.1882, 7.1879, 7.1889, 7.189900000000001, 7.1898, 7.1895, 7.1893, 7.1891, 7.1889, 7.1886, 7.1874, 7.1872, 7.1869, 7.1867, 7.1874, 7.1882, 7.188, 7.1877, 7.1875, 7.1873, 7.187, 7.1867, 7.1875, 7.1872, 7.1881, 7.1878, 7.1875, 7.1873, 7.1861, 7.1859, 7.1856, 7.1854, 7.1853, 7.185, 7.1846, 7.1843, 7.184, 7.1837, 7.1837, 7.1844, 7.1844, 7.1841, 7.1838, 7.1836, 7.1834, 7.1831, 7.1829, 7.1826, 7.1826, 7.1827, 7.1827, 7.1824, 7.1822, 7.1829, 7.1827, 7.1823, 7.182, 7.1827, 7.1833, 7.183, 7.1829, 7.1827, 7.1825, 7.1823, 7.1812, 7.1809, 7.1807, 7.1816, 7.1813, 7.1811, 7.1809, 7.1807, 7.1795, 7.1794, 7.1792, 7.179, 7.1797, 7.1794, 7.1791, 7.178, 7.178, 7.1777, 7.1774, 7.1772, 7.177, 7.1768, 7.1766, 7.1769, 7.1767, 7.1765, 7.1763, 7.177, 7.1768, 7.1765, 7.1763, 7.1752, 7.1749, 7.1748, 7.1745, 7.1743, 7.174, 7.1737, 7.1747000000000005, 7.1745, 7.1752, 7.1751, 7.175, 7.1748, 7.1745, 7.1752, 7.1749, 7.1738, 7.1736, 7.1743, 7.1742, 7.1741, 7.1739, 7.1746, 7.1748, 7.1745, 7.1744, 7.1751, 7.1749, 7.1747, 7.1747, 7.1744, 7.175, 7.1749, 7.1747, 7.1747, 7.1744, 7.1743, 7.1742, 7.174, 7.1755, 7.1761, 7.1769, 7.1766, 7.1774, 7.1772, 7.177, 7.1771, 7.178100000000001, 7.179100000000001, 7.1799, 7.1798, 7.1796, 7.1795, 7.1793, 7.1791, 7.1791, 7.1789, 7.1788, 7.1785, 7.1783, 7.1782, 7.1779, 7.1779, 7.1776, 7.1775, 7.1774, 7.1771, 7.1779, 7.1776, 7.1775, 7.1772, 7.1771, 7.177, 7.1777, 7.1775, 7.1773, 7.1781, 7.1791, 7.1811, 7.1808, 7.1818, 7.1827, 7.1837, 7.1847, 7.1854, 7.1852, 7.1849, 7.1848, 7.1845, 7.1857, 7.1857, 7.1857, 7.1863, 7.1869, 7.1867, 7.1864, 7.1872, 7.187, 7.1869, 7.1866, 7.1864, 7.1863, 7.1861, 7.1859, 7.1857, 7.1856, 7.1856, 7.1854, 7.1854, 7.1862, 7.1859, 7.1858, 7.1865, 7.1862, 7.1859, 7.1856, 7.1873, 7.1879, 7.1876, 7.1893, 7.1894, 7.1891, 7.1888, 7.1885, 7.1882, 7.1881, 7.1881, 7.187, 7.1868, 7.1865, 7.1862, 7.1869, 7.187, 7.1868, 7.1876, 7.1874, 7.1881, 7.1888, 7.1885, 7.1892, 7.1889, 7.1887, 7.1876, 7.1886, 7.1884, 7.1881, 7.1879, 7.1877, 7.1914, 7.1911, 7.191, 7.1908, 7.1916, 7.1916, 7.1914, 7.1912, 7.1909, 7.1899, 7.1896, 7.1903, 7.19, 7.1898, 7.1895, 7.1893, 7.189, 7.1887, 7.1885, 7.1882, 7.188, 7.1887, 7.1886, 7.1884, 7.1892, 7.1889, 7.1886, 7.1886, 7.1883, 7.1883, 7.188, 7.1877, 7.1883, 7.188, 7.1879, 7.1879, 7.1877, 7.1884, 7.1884, 7.1881, 7.1879, 7.1876, 7.1899, 7.1899, 7.19, 7.1897, 7.1904, 7.1902, 7.19, 7.1897, 7.1887, 7.1885, 7.1882, 7.188, 7.1886, 7.1892, 7.189, 7.1888, 7.1885, 7.1883, 7.188, 7.1878, 7.1885, 7.1883, 7.1891, 7.1888, 7.1886, 7.1883, 7.189, 7.1887, 7.1885, 7.1882, 7.1879, 7.1878, 7.1875, 7.1872, 7.1869, 7.1866, 7.1873, 7.187, 7.1867, 7.1866, 7.1874, 7.1874, 7.1871, 7.1869, 7.1867, 7.1865, 7.1864, 7.1861, 7.1858, 7.1855, 7.1862, 7.186, 7.1858, 7.1855, 7.1862, 7.1869, 7.1868, 7.1865, 7.1863, 7.1862, 7.1859, 7.1869000000000005, 7.1867, 7.1866, 7.1864, 7.1871, 7.1869, 7.1875, 7.1872, 7.1872, 7.1878, 7.1876, 7.1873, 7.1872, 7.1869, 7.1867, 7.1873, 7.187, 7.1868, 7.1865, 7.1864, 7.1861, 7.1858, 7.1925, 7.1924, 7.1923, 7.193, 7.193, 7.1929, 7.1926, 7.1924, 7.1921, 7.192, 7.1930000000000005, 7.1927, 7.1933, 7.1931, 7.1928, 7.1935, 7.1932, 7.1931, 7.1937, 7.1934, 7.1943, 7.1941, 7.194, 7.1939, 7.1938, 7.1944, 7.1943, 7.1953000000000005, 7.195, 7.196000000000001, 7.1957, 7.1966, 7.1966, 7.1964, 7.1961, 7.1967, 7.1966, 7.1973, 7.197, 7.1959, 7.1966, 7.1965, 7.1964, 7.1962, 7.196, 7.196, 7.1961, 7.196, 7.1968, 7.1986, 7.1984, 7.1981, 7.199, 7.1987, 7.1993, 7.1999, 7.2007, 7.2004, 7.2001, 7.1998, 7.1997, 7.1994, 7.1992, 7.2001, 7.2007, 7.2006, 7.2003, 7.2001, 7.1999, 7.1996, 7.1993, 7.1991, 7.1989, 7.1986, 7.1986, 7.1993, 7.1992, 7.1989, 7.1986, 7.1983, 7.199, 7.1987, 7.1994, 7.2, 7.1999, 7.1996, 7.1993, 7.1983, 7.1982, 7.2004, 7.2004, 7.2011, 7.2027, 7.2025, 7.2023, 7.203, 7.2027, 7.2029, 7.2037, 7.2028, 7.2035, 7.2035, 7.2032, 7.2033, 7.203, 7.2027, 7.2025, 7.2022, 7.202, 7.2018, 7.2046, 7.2056, 7.2053, 7.2069, 7.2076, 7.2103, 7.21, 7.2097, 7.2103, 7.21, 7.2097, 7.2103, 7.2102, 7.21, 7.2097, 7.2094, 7.2101, 7.211, 7.2117, 7.2116, 7.2113, 7.2115, 7.2112, 7.2137, 7.2138, 7.2139, 7.215, 7.2148, 7.2155, 7.2154, 7.216, 7.2158, 7.2156, 7.2155, 7.2153, 7.215, 7.215, 7.2148, 7.2145, 7.2152, 7.2159, 7.2158, 7.2156, 7.2156, 7.2156, 7.2153, 7.2151, 7.2158, 7.2155, 7.2154, 7.2151, 7.215, 7.2147, 7.2145, 7.2143, 7.2141, 7.2139, 7.2137, 7.2135, 7.2133, 7.2131, 7.2139, 7.2136, 7.2135, 7.2134, 7.2132, 7.2142, 7.214, 7.2139, 7.2136, 7.2133, 7.2132, 7.213, 7.2137, 7.2136, 7.2133, 7.2139, 7.2136, 7.2135, 7.2134, 7.2133, 7.2131, 7.2129, 7.2128, 7.2126, 7.2124, 7.2124, 7.2121, 7.2146, 7.2144, 7.2143, 7.2142, 7.2142, 7.214, 7.2138, 7.2135, 7.2143, 7.215, 7.2149, 7.2147, 7.2144, 7.2144, 7.2143, 7.2141, 7.2138, 7.2144, 7.2143, 7.215, 7.2148, 7.2147, 7.2145, 7.2151, 7.2148, 7.2155, 7.2154, 7.2153, 7.2151, 7.2149, 7.2146, 7.2153, 7.2151, 7.2158, 7.2165, 7.2162, 7.2159, 7.2166, 7.2166, 7.2173, 7.2171, 7.217, 7.2168, 7.2175, 7.2174, 7.2181, 7.2178, 7.2176, 7.2174, 7.2181, 7.2178, 7.2176, 7.2174, 7.2172, 7.2179, 7.218, 7.2177, 7.2175, 7.2165, 7.2166, 7.2166, 7.2163, 7.216, 7.2157, 7.2155, 7.2162, 7.216, 7.2157, 7.2155, 7.2153, 7.2155, 7.2153, 7.2143, 7.2132, 7.2121, 7.2128, 7.2127, 7.2124, 7.2122, 7.2119, 7.2117, 7.2116, 7.2114, 7.2112, 7.211, 7.2107, 7.2107, 7.2108, 7.2097, 7.2094, 7.2093, 7.2092, 7.2099, 7.2098, 7.2105, 7.2102, 7.2108, 7.2106, 7.2104, 7.2103, 7.2102, 7.2099, 7.2097, 7.2107, 7.2105, 7.2131, 7.2132, 7.2129, 7.2127, 7.2127, 7.2129, 7.2146, 7.2144, 7.2141, 7.2147, 7.2146, 7.2145, 7.2143, 7.214, 7.2138, 7.2136, 7.2143, 7.214, 7.2145, 7.2143, 7.2143, 7.2143, 7.2142, 7.2142, 7.214, 7.2137, 7.2134, 7.2132, 7.2129, 7.2126, 7.2124, 7.2121, 7.2119, 7.2116, 7.2122, 7.2119, 7.2117, 7.2114, 7.2104, 7.2104, 7.2101, 7.21, 7.2097, 7.2094, 7.2092, 7.2089, 7.2087, 7.2093, 7.2091, 7.2089, 7.2096, 7.2093, 7.21, 7.2099, 7.2096, 7.2093, 7.209, 7.2088, 7.2095, 7.2086, 7.2084, 7.2082, 7.208, 7.2077, 7.2074, 7.2071, 7.207, 7.2061, 7.205, 7.2041, 7.2032, 7.2024, 7.2021, 7.2019, 7.201, 7.2016, 7.2015, 7.2012, 7.2012, 7.2009, 7.2008, 7.2014, 7.2011, 7.2012, 7.2036, 7.2042, 7.2039, 7.2036, 7.2033, 7.203, 7.2029, 7.2026, 7.2033, 7.2031, 7.2028, 7.2026, 7.2023, 7.2023, 7.2021, 7.202, 7.2017, 7.2015, 7.2014, 7.2012, 7.201, 7.2007, 7.2007, 7.2006, 7.2005, 7.2003, 7.2011, 7.2026, 7.2016, 7.2013, 7.2011, 7.2009, 7.2007, 7.2005, 7.2003, 7.2001, 7.1999, 7.1996, 7.1993, 7.1992, 7.1989, 7.199, 7.1995, 7.1993, 7.1993, 7.199, 7.1988, 7.1985, 7.1984, 7.1985, 7.1993, 7.1984, 7.199, 7.1989, 7.1986, 7.1985, 7.1984, 7.1991, 7.1997, 7.1995, 7.1992, 7.1993, 7.1992, 7.1991, 7.199, 7.1988, 7.1986, 7.1985, 7.1983, 7.1991, 7.1989, 7.1986, 7.1984, 7.1982, 7.198, 7.199000000000001, 7.1988, 7.1986, 7.1987, 7.1985, 7.1983, 7.1982, 7.199, 7.1997, 7.1999, 7.2, 7.2006, 7.2013, 7.2019, 7.2035, 7.2032, 7.2029, 7.2039, 7.2036, 7.2035, 7.2043, 7.204, 7.2038, 7.2036, 7.2035, 7.2034, 7.2024, 7.2021, 7.2019, 7.2016, 7.2014, 7.2011, 7.2001, 7.1998, 7.1996, 7.1993, 7.1992, 7.2009, 7.2026, 7.2024, 7.2023, 7.2044, 7.2042, 7.204, 7.2037, 7.2034, 7.2031, 7.2029, 7.2028, 7.2025, 7.2022, 7.2019, 7.2016, 7.2015, 7.2012, 7.2018, 7.2016, 7.2014, 7.2012, 7.2018, 7.2015, 7.2004, 7.1994, 7.1992, 7.1998, 7.1997, 7.1996, 7.2002, 7.1997, 7.1988, 7.1979, 7.1969, 7.1967, 7.1966, 7.1965, 7.1972, 7.1969, 7.1968, 7.1975, 7.1982, 7.1979, 7.1986, 7.1986, 7.1984, 7.199, 7.1988, 7.1994, 7.1991, 7.1988, 7.1986, 7.1992, 7.1998, 7.2005, 7.2002, 7.2002, 7.2, 7.1999, 7.1999, 7.1998, 7.1995, 7.1994, 7.1991, 7.1988, 7.1988, 7.1978, 7.1975, 7.1972, 7.1969, 7.197900000000001, 7.1976, 7.1967, 7.1972, 7.197, 7.1967, 7.1958, 7.1955, 7.1952, 7.1959, 7.1956, 7.1953, 7.1952, 7.1951, 7.1958, 7.1966, 7.1964, 7.1962, 7.196, 7.1957, 7.1957, 7.1963, 7.1961, 7.1959, 7.1956, 7.1963, 7.1962, 7.196, 7.1966, 7.1966, 7.1966, 7.1964, 7.1962, 7.196, 7.1957, 7.1955, 7.1952, 7.1951, 7.1949, 7.1947, 7.1953, 7.195, 7.1949, 7.1947, 7.1954, 7.1961, 7.1951, 7.1949, 7.1947, 7.1945, 7.1937, 7.1927, 7.1925, 7.1922, 7.192, 7.1918, 7.1916, 7.1915, 7.1905, 7.1912, 7.1909, 7.1906, 7.1898, 7.1904, 7.1901, 7.1899, 7.1906, 7.1904, 7.1902, 7.1902, 7.19, 7.1898, 7.1895, 7.1894, 7.1891, 7.1895, 7.1893, 7.189, 7.1887, 7.1884, 7.1883, 7.1882, 7.188, 7.189, 7.1888, 7.1898, 7.1908, 7.1907, 7.1905, 7.1911, 7.1923, 7.1925, 7.1924, 7.1922, 7.1933, 7.1943, 7.1942, 7.1941, 7.1939, 7.1963, 7.197, 7.1986, 7.1983, 7.1989, 7.1987, 7.1992, 7.1989, 7.1987, 7.1984, 7.1981, 7.1981, 7.198, 7.1978, 7.1976, 7.1975, 7.1973, 7.1974, 7.198, 7.1978, 7.1985, 7.1982, 7.198, 7.1986, 7.1986, 7.1976, 7.1982, 7.1982, 7.1979, 7.1977, 7.1983, 7.198, 7.1977, 7.1975, 7.1973, 7.1979, 7.1977, 7.1975, 7.1974, 7.198, 7.1979, 7.1977, 7.1975, 7.1981, 7.1978, 7.1976, 7.1973, 7.197, 7.1967, 7.1965, 7.1962, 7.196, 7.1966, 7.1964, 7.1969, 7.1968, 7.1967, 7.1973, 7.1971, 7.1977, 7.1976, 7.1976, 7.1974, 7.198, 7.1979, 7.1977, 7.1983, 7.1983, 7.1981, 7.1979, 7.1977, 7.1974, 7.1972, 7.197, 7.1976, 7.1974, 7.1973, 7.197, 7.1969, 7.1967, 7.1972, 7.197, 7.1976, 7.1973, 7.197, 7.1976, 7.1974, 7.1971, 7.197, 7.1967, 7.1965, 7.1972, 7.1978, 7.1984, 7.1982, 7.1979, 7.1978, 7.1978, 7.1977, 7.1975, 7.1981, 7.1979, 7.1976, 7.1973, 7.1971, 7.1969, 7.1968, 7.1966, 7.1971, 7.1968, 7.1967, 7.1964, 7.1969, 7.1966, 7.1963, 7.1969, 7.1966, 7.1965, 7.1962, 7.196, 7.1966, 7.1965, 7.1962, 7.1959, 7.1965, 7.1962, 7.1968, 7.1965, 7.1963, 7.196, 7.1957, 7.1963, 7.1961, 7.1958, 7.1956, 7.1954, 7.1951, 7.1965, 7.1962, 7.196, 7.1958, 7.1956, 7.1955, 7.1953, 7.195, 7.1947, 7.1946, 7.1944, 7.1942, 7.1948, 7.1945, 7.1943, 7.194, 7.1937, 7.1934, 7.1933, 7.1931, 7.1953, 7.1952, 7.195, 7.1951, 7.1977, 7.1978, 7.1981, 7.1982, 7.1992, 7.1997, 7.1995, 7.1996, 7.1993, 7.1991, 7.1989, 7.2003, 7.2001, 7.2, 7.1998, 7.1997, 7.2011, 7.2018, 7.2016, 7.2013, 7.2011, 7.2017, 7.2016, 7.2014, 7.2021, 7.2028, 7.2027, 7.2025, 7.2031, 7.2032, 7.2031, 7.2037, 7.2052, 7.2049, 7.2047, 7.2055, 7.2061, 7.2059, 7.2074, 7.2073, 7.2065, 7.2064, 7.2063, 7.2061, 7.2067, 7.2066, 7.2065, 7.211, 7.2145, 7.2143, 7.2142, 7.2148, 7.2154, 7.2152, 7.2149, 7.2146, 7.2152, 7.2149, 7.2155, 7.2153, 7.2151, 7.2149, 7.2155, 7.2153, 7.215, 7.2149, 7.2156, 7.2153, 7.215, 7.2147, 7.2153, 7.2159, 7.2158, 7.2157, 7.2156, 7.2166, 7.2181, 7.2179, 7.2176, 7.2182, 7.2189, 7.2189, 7.2188, 7.2186, 7.2184, 7.2181, 7.218, 7.2186, 7.2184, 7.2181, 7.2187, 7.2184, 7.2181, 7.2179, 7.2184, 7.2183, 7.2181, 7.2179, 7.2176, 7.2173, 7.2171, 7.2169, 7.2174, 7.218, 7.2177, 7.2177, 7.2174, 7.2173, 7.2171, 7.2171, 7.2168, 7.2165, 7.2171, 7.2169, 7.2175, 7.2173, 7.217, 7.2167, 7.2165, 7.2163, 7.2161, 7.2167, 7.2164, 7.2163, 7.2161, 7.2158, 7.2155, 7.2161, 7.2159, 7.2157, 7.2163, 7.2185, 7.2182, 7.2188, 7.2186, 7.22, 7.2197, 7.2196, 7.2194, 7.2199, 7.2217, 7.2214, 7.2213, 7.221, 7.2207, 7.2228, 7.2226, 7.2224, 7.223, 7.2228, 7.2233, 7.2246, 7.2245, 7.2243, 7.2242, 7.224, 7.2239, 7.2244, 7.2241, 7.2246, 7.2251, 7.2257, 7.2256, 7.2261, 7.2275, 7.2272, 7.2271, 7.2269, 7.2268, 7.2266, 7.2264, 7.2264, 7.2262, 7.2269, 7.2267, 7.2265, 7.2271, 7.227, 7.2276, 7.2275, 7.2272, 7.2278, 7.2276, 7.2274, 7.2272, 7.2272, 7.2278, 7.2284, 7.2289, 7.2287, 7.2287, 7.2284, 7.2282, 7.2319, 7.2316, 7.2316, 7.2307, 7.2308, 7.2306, 7.2304, 7.231, 7.2311, 7.2308, 7.2306, 7.2305, 7.2303, 7.2301, 7.2314, 7.2328, 7.2333, 7.2331, 7.2337, 7.2335, 7.2332, 7.233, 7.2327, 7.2325, 7.2323, 7.2322, 7.2319, 7.2317, 7.2315, 7.2313, 7.2319, 7.2317, 7.2315, 7.2313, 7.2323, 7.2322, 7.2329, 7.2328, 7.2327, 7.2325, 7.2348, 7.2346, 7.2346, 7.2345, 7.2337, 7.2339, 7.2337, 7.2329, 7.2335, 7.2333, 7.2333, 7.234, 7.2356, 7.2353, 7.2351, 7.2356, 7.2353, 7.2351, 7.2348, 7.2357, 7.2355, 7.236, 7.2357, 7.2356, 7.2353, 7.2352, 7.235, 7.235, 7.2347, 7.2344, 7.2341, 7.2338, 7.2335, 7.2332, 7.2329, 7.2334, 7.2331, 7.233, 7.2331, 7.2336, 7.2334, 7.2331, 7.2329, 7.2335, 7.2333, 7.2349, 7.2346, 7.2343, 7.2341, 7.2346, 7.2343, 7.234, 7.2338, 7.2335, 7.2333, 7.2341, 7.2349, 7.2347, 7.2348, 7.2346, 7.2343, 7.2341, 7.2365, 7.237, 7.2367, 7.2366, 7.2365, 7.2362, 7.236, 7.2357, 7.2362, 7.2367, 7.2367, 7.2372, 7.2377, 7.2375, 7.2373, 7.2371, 7.2368, 7.2365, 7.2362, 7.2367, 7.2364, 7.2361, 7.2359, 7.2357, 7.2363, 7.2361, 7.2361, 7.236, 7.2359, 7.2358, 7.2356, 7.2353, 7.235, 7.2348, 7.2347, 7.2345, 7.2343, 7.2349, 7.2355, 7.2353, 7.2352, 7.235, 7.2348, 7.2346, 7.2345, 7.2344, 7.2341, 7.2338, 7.2336, 7.2334, 7.2332, 7.233, 7.2328, 7.2325, 7.2325, 7.2323, 7.2322, 7.2319, 7.2324, 7.2322, 7.2319, 7.2316, 7.2314, 7.2319, 7.2325, 7.2323, 7.2331, 7.2328, 7.2334, 7.2333, 7.2341, 7.2341, 7.2339, 7.2337, 7.2343, 7.2341, 7.2339, 7.2337, 7.2335, 7.2333, 7.2331, 7.2328, 7.2334, 7.2332, 7.2338, 7.2336, 7.2342], '192.168.122.112': [10.3512, 10.5099, 8.9685, 8.5216, 8.0372, 7.649, 7.3723, 7.8898, 7.6171, 7.5333, 7.4328, 7.2926, 7.2379, 7.1381, 7.0644, 6.989, 6.9769, 6.9304, 6.915, 6.8952, 6.8467, 6.7972, 6.7457, 6.8056, 6.7979, 6.779, 6.7527, 6.7013, 6.724, 6.6991, 7.0212, 7.0223, 6.9715, 6.9457, 7.0555, 7.0345, 6.9879, 7.2579, 7.3748, 7.3362, 7.2881, 7.3705, 7.3243, 7.2945, 7.324, 7.3237, 7.3204, 7.3101, 7.2778, 7.2932, 7.3019, 7.3976, 7.379, 7.3692, 7.4266, 7.4062, 7.3703, 7.3378, 7.3056, 7.2225, 7.3745, 7.473, 7.4399, 7.4145, 7.4021, 7.3914, 7.3614, 7.3356, 7.3913, 7.3642, 7.3743, 7.3574, 7.3385, 7.3162, 7.3083, 7.2887, 7.3356, 7.3228, 7.3015, 7.2803, 7.2607, 7.247, 7.2266, 7.2069, 7.1854, 7.1648, 7.1433, 7.1227, 7.1628, 7.1468, 7.1304, 7.1167, 7.1002, 7.086, 7.0729, 7.0625, 7.0516, 7.0343, 7.0215, 7.068, 7.0629, 7.0569, 6.9989, 6.9844, 6.9708, 6.9697, 6.9641, 6.9584, 6.9482, 6.9404, 6.935, 6.9241, 6.9106, 6.9445, 6.9298, 6.9224, 6.9095, 6.9062, 6.9034, 6.9335, 6.9214, 6.9141, 7.1295, 7.1166, 7.1464, 7.1343, 7.1233, 7.1083, 7.0959, 7.1222, 7.1145, 7.101, 7.0994, 7.1316, 7.1213, 7.1146, 7.1018, 7.0901, 7.0802, 7.0706, 7.0595, 7.0555, 7.0845, 7.075, 7.0668, 7.0554, 7.0811, 7.1066, 7.0969, 7.0882, 7.0804, 7.0745, 7.0706, 7.0633, 7.0585, 7.0822, 7.1057, 7.1273, 7.1211, 7.1116, 7.1016, 7.1289, 7.1207, 7.1119, 7.109, 7.1324, 7.1212, 7.1435, 7.1695, 7.1585, 7.1475, 7.1395, 7.1317, 7.1251, 7.1456, 7.1671, 7.163, 7.1564, 7.152, 7.1443, 7.1754, 7.1672, 7.1628, 7.1866, 7.2084, 7.2292, 7.2214, 7.2125, 7.2036, 7.1993, 7.1985, 7.1894, 7.1844, 7.1782, 7.1727, 7.1653, 7.2097, 7.2279, 7.2273, 7.2199, 7.2454, 7.2362, 7.2278, 7.275, 7.2692, 7.2675, 7.2619, 7.3453, 7.3392, 7.3361, 7.3267, 7.3476, 7.3763, 7.3708, 7.3658, 7.359, 7.3505, 7.3454, 7.3431, 7.3357, 7.352, 7.3459, 7.3378, 7.3292, 7.3462, 7.3394, 7.3575, 7.3497, 7.3815, 7.3755, 7.3679, 7.3592, 7.3512, 7.3437, 7.3418, 7.3355, 7.3126, 7.3064, 7.3003, 7.3071, 7.3038, 7.3286, 7.3273, 7.3206, 7.3155, 7.3077, 7.2855, 7.2787, 7.2746, 7.27, 7.2682, 7.2866, 7.2793, 7.2728, 7.2698, 7.2622, 7.2581, 7.2607, 7.2561, 7.2727, 7.2671, 7.2837, 7.2772, 7.2912, 7.2846, 7.2796, 7.297, 7.2978, 7.2943, 7.2948, 7.2897, 7.3048, 7.3002, 7.3153, 7.3093, 7.3038, 7.298, 7.3135, 7.3119, 7.3048, 7.2995, 7.2939, 7.2887, 7.2837, 7.2782, 7.2731, 7.2694, 7.2821, 7.2969, 7.2918, 7.2863, 7.2812, 7.2759, 7.271, 7.2678, 7.2651, 7.2624, 7.2572, 7.2542, 7.2668, 7.2816, 7.2762, 7.2729, 7.2841, 7.2794, 7.2774, 7.2755, 7.2708, 7.2649, 7.2604, 7.2689, 7.2647, 7.261, 7.2783, 7.2718, 7.2832, 7.2785, 7.2721, 7.2674, 7.2632, 7.2602, 7.2714, 7.2653, 7.2634, 7.3262, 7.3375, 7.3321, 7.3289, 7.3243, 7.3362, 7.3466, 7.3404, 7.3368, 7.3312, 7.327, 7.3395, 7.3356, 7.348, 7.3423, 7.337, 7.3315, 7.3279, 7.3226, 7.3201, 7.3179, 7.3123, 7.3084, 7.3186, 7.3127, 7.3087, 7.3195, 7.3153, 7.3098, 7.3044, 7.2987, 7.2808, 7.2906, 7.287, 7.2817, 7.292, 7.3025, 7.3014, 7.297, 7.2956, 7.3069, 7.3032, 7.3, 7.2963, 7.2915, 7.2881, 7.2875, 7.2824, 7.278, 7.2743, 7.2734, 7.2751, 7.2721, 7.2682, 7.2641, 7.2635, 7.274, 7.2723, 7.2813, 7.3044, 7.3042, 7.3025, 7.3112, 7.3213, 7.3452, 7.3398, 7.3238, 7.3213, 7.3183, 7.328, 7.3256, 7.3341, 7.3293, 7.3399, 7.3349, 7.3444, 7.3419, 7.3372, 7.3457, 7.3863, 7.3827, 7.3788, 7.3741, 7.3737, 7.3717, 7.3677, 7.3654, 7.3742, 7.3702, 7.3667, 7.365, 7.3603, 7.3697, 7.3786, 7.3757, 7.3841, 7.3799, 7.3753, 7.3723, 7.3697, 7.3653, 7.3607, 7.3578, 7.3553, 7.3536, 7.3619, 7.36, 7.3601, 7.3579, 7.3542, 7.3503, 7.3716, 7.3809, 7.376, 7.3857, 7.3839, 7.3802, 7.3766, 7.3843, 7.3806, 7.3769, 7.374, 7.3831, 7.3783, 7.3757, 7.3834, 7.3801, 7.3784, 7.3742, 7.3826, 7.3819, 7.3803, 7.3796, 7.3753, 7.3713, 7.399, 7.3959, 7.4033, 7.4103, 7.406, 7.4167, 7.4244, 7.4213, 7.4168, 7.4133, 7.41, 7.4075, 7.4143, 7.4129, 7.4207, 7.4549, 7.4508, 7.4465, 7.4449, 7.4523, 7.4479, 7.4553, 7.4563, 7.4527, 7.4525, 7.4502, 7.4503, 7.4481, 7.4448, 7.4522, 7.4532, 7.4613, 7.4521, 7.4482, 7.4681, 7.469, 7.476, 7.4734, 7.4767, 7.4736, 7.4695, 7.4699, 7.5003, 7.5079, 7.504, 7.5116, 7.5081, 7.5184, 7.5172, 7.5154, 7.5115, 7.5104, 7.5075, 7.5211, 7.5182, 7.5154, 7.5112, 7.5073, 7.516, 7.5147, 7.5124, 7.5092, 7.5059, 7.5068, 7.5071, 7.5061, 7.5027, 7.5003, 7.4973, 7.494, 7.4904, 7.5001, 7.4975, 7.4942, 7.4912, 7.4874, 7.4834, 7.4904, 7.4864, 7.4932, 7.4902, 7.4879, 7.4856, 7.4816, 7.4893, 7.4958, 7.4925, 7.489, 7.4886, 7.485, 7.4826, 7.4787, 7.4844, 7.4902, 7.4975, 7.4942, 7.5014, 7.5083, 7.507, 7.5033, 7.4995, 7.4962, 7.4925, 7.4888, 7.4861, 7.4933, 7.4907, 7.487, 7.4847, 7.491, 7.4878, 7.4848, 7.4814, 7.4821, 7.4791, 7.4758, 7.4721, 7.4787, 7.4752, 7.4715, 7.4706, 7.4669, 7.4633, 7.4697, 7.4672, 7.4637, 7.4608, 7.4574, 7.4542, 7.4511, 7.4474, 7.4453, 7.4435, 7.4416, 7.4399, 7.4371, 7.4339, 7.4312, 7.4366, 7.4336, 7.4481, 7.4464, 7.4436, 7.4417, 7.4391, 7.437, 7.4339, 7.4325, 7.431, 7.4288, 7.426, 7.4315, 7.428, 7.4339, 7.4307, 7.4294, 7.4354, 7.434, 7.4307, 7.4279, 7.4255, 7.4228, 7.428, 7.426, 7.4226, 7.4191, 7.4165, 7.4215, 7.412, 7.4026, 7.3995, 7.3972, 7.3943, 7.3916, 7.3898, 7.3889, 7.4041, 7.4014, 7.3986, 7.404, 7.4013, 7.3983, 7.4224, 7.4305, 7.4287, 7.4256, 7.4224, 7.4197, 7.4253, 7.4231, 7.4201, 7.417, 7.4228, 7.4219, 7.4203, 7.4191, 7.4182, 7.4155, 7.4258, 7.4243, 7.4295, 7.4264, 7.4235, 7.4218, 7.4272, 7.4255, 7.4241, 7.4294, 7.4264, 7.4239, 7.4284, 7.4262, 7.4318, 7.4295, 7.4272, 7.4359, 7.434, 7.4387, 7.4362, 7.434, 7.4315, 7.4306, 7.4277, 7.4248, 7.4223, 7.4276, 7.4331, 7.4384, 7.4375, 7.435, 7.4318, 7.429, 7.4284, 7.4336, 7.4333, 7.4304, 7.4288, 7.4341, 7.4392, 7.4559, 7.453, 7.4508, 7.4491, 7.4665, 7.4712, 7.4689, 7.4684, 7.4661, 7.4642, 7.4614, 7.4598, 7.4646, 7.4619, 7.4677, 7.4659, 7.4639, 7.4616, 7.4596, 7.4642, 7.4953, 7.4938, 7.4923, 7.4911, 7.4888, 7.4865, 7.4777, 7.4758, 7.4807, 7.4849, 7.4985, 7.496, 7.4943, 7.4917, 7.4894, 7.4871, 7.4853, 7.4825, 7.48, 7.4784, 7.476, 7.4734, 7.4779, 7.4754, 7.4731, 7.4703, 7.4751, 7.4723, 7.4773, 7.4751, 7.4724, 7.4719, 7.4711, 7.4693, 7.4672, 7.4664, 7.4644, 7.4623, 7.46, 7.4663, 7.4667, 7.4647, 7.4627, 7.4787, 7.4764, 7.4737, 7.4711, 7.4696, 7.4669, 7.4661, 7.4635, 7.4621, 7.4629, 7.4612, 7.4589, 7.4565, 7.4612, 7.4597, 7.4575, 7.4697, 7.4685, 7.4673, 7.4654, 7.4786, 7.4717, 7.4698, 7.4888, 7.5005, 7.4978, 7.4953, 7.4936, 7.4986, 7.5031, 7.5009, 7.5007, 7.5055, 7.5038, 7.503, 7.5072, 7.5064, 7.5036, 7.5015, 7.4988, 7.4962, 7.4934, 7.4973, 7.4952, 7.4995, 7.497, 7.4943, 7.4939, 7.4912, 7.4884, 7.4863, 7.4838, 7.4878, 7.4919, 7.4902, 7.4878, 7.4865, 7.4846, 7.4823, 7.4804, 7.4846, 7.4824, 7.4863, 7.4898, 7.4873, 7.4858, 7.485, 7.4833, 7.4808, 7.479, 7.478, 7.4771, 7.4762, 7.4742, 7.4722, 7.4722, 7.4707, 7.463, 7.4614, 7.4596, 7.4573, 7.4557, 7.4539, 7.4587, 7.4626, 7.4609, 7.4654, 7.4697, 7.4676, 7.4667, 7.4651, 7.4692, 7.468, 7.4666, 7.4657, 7.4634, 7.4613, 7.4606, 7.4649, 7.4695, 7.467, 7.4645, 7.4626, 7.4613, 7.4649, 7.4628, 7.4607, 7.4585, 7.4562, 7.4537, 7.4578, 7.4566, 7.4556, 7.4545, 7.4589, 7.4571, 7.4617, 7.4653, 7.4639, 7.4686, 7.4662, 7.4637, 7.4625, 7.4604, 7.4592, 7.457, 7.4548, 7.4587, 7.4636, 7.467, 7.4651, 7.4626, 7.4613, 7.4629, 7.4571, 7.4553, 7.4541, 7.4577, 7.4614, 7.4656, 7.4646, 7.4695, 7.4679, 7.4669, 7.4645, 7.4626, 7.4619, 7.4613, 7.4596, 7.4655, 7.4634, 7.4628, 7.462, 7.4601, 7.4644, 7.4685, 7.4677, 7.4656, 7.4643, 7.4622, 7.46, 7.4638, 7.4618, 7.4607, 7.4592, 7.4585, 7.4625, 7.4612, 7.4592, 7.4572, 7.4552, 7.4537, 7.4516, 7.4495, 7.4537, 7.4524, 7.4503, 7.449, 7.4475, 7.4455, 7.4445, 7.4483, 7.4463, 7.4441, 7.444, 7.4428, 7.4409, 7.439, 7.4373, 7.4361, 7.4342, 7.4327, 7.4374, 7.4364, 7.4412, 7.4399, 7.4384, 7.4432, 7.4416, 7.4399, 7.4383, 7.4366, 7.4354, 7.4337, 7.432, 7.4298, 7.4285, 7.428, 7.4266, 7.4309, 7.4297, 7.4286, 7.4272, 7.4262, 7.4249, 7.4235, 7.4276, 7.4258, 7.4301, 7.4286, 7.4279, 7.4271, 7.4264, 7.4243, 7.4226, 7.4264, 7.4258, 7.4237, 7.4224, 7.421, 7.4195, 7.4192, 7.4186, 7.4166, 7.4254, 7.4248, 7.424, 7.4224, 7.4209, 7.419, 7.417, 7.4154, 7.4197, 7.4182, 7.4174, 7.4158, 7.4137, 7.4127, 7.4114, 7.4153, 7.4142, 7.4129, 7.4167, 7.4155, 7.4199, 7.4188, 7.4172, 7.421, 7.4189, 7.4173, 7.4224, 7.4263, 7.4294, 7.4335, 7.4325, 7.4313, 7.4349, 7.4329, 7.431, 7.4292, 7.4279, 7.4315, 7.4296, 7.4329, 7.4313, 7.4293, 7.4283, 7.4277, 7.4259, 7.4239, 7.4219, 7.4205, 7.4198, 7.4183, 7.4178, 7.4211, 7.4193, 7.4177, 7.417, 7.416, 7.42, 7.418, 7.4162, 7.4145, 7.4129, 7.4113, 7.4098, 7.4084, 7.4067, 7.406, 7.4042, 7.4028, 7.4076, 7.4063, 7.4044, 7.4026, 7.4006, 7.4039, 7.4033, 7.4067, 7.4099, 7.4083, 7.4064, 7.4062, 7.4049, 7.4044, 7.4025, 7.4061, 7.4063, 7.405, 7.4042, 7.4028, 7.4013, 7.3996, 7.3986, 7.3973, 7.3964, 7.3947, 7.3934, 7.3915, 7.3951, 7.3937, 7.392, 7.391, 7.3945, 7.3926, 7.3911, 7.3913, 7.3903, 7.3895, 7.388, 7.3863, 7.3848, 7.3829, 7.3834, 7.3816, 7.3797, 7.3796, 7.378, 7.3763, 7.3748, 7.3735, 7.3826, 7.3814, 7.3801, 7.3787, 7.377, 7.3756, 7.3741, 7.3771, 7.3758, 7.3753, 7.3736, 7.3879, 7.3865, 7.3847, 7.383, 7.3822, 7.3805, 7.3837, 7.3821, 7.3854, 7.3836, 7.3821, 7.4004, 7.3988, 7.4017, 7.4002, 7.3984, 7.3926, 7.3911, 7.3892, 7.3922, 7.3953, 7.3946, 7.3929, 7.3911, 7.3905, 7.39, 7.389, 7.3881, 7.3868, 7.386, 7.3892, 7.3875, 7.3906, 7.3895, 7.388, 7.3865, 7.3851, 7.3834, 7.3822, 7.3808, 7.3792, 7.3779, 7.3764, 7.3746, 7.3735, 7.3719, 7.3747, 7.3734, 7.3718, 7.3709, 7.3738, 7.3721, 7.3703, 7.3695, 7.3686, 7.367, 7.3656, 7.3687, 7.367, 7.3661, 7.3688, 7.3717, 7.3701, 7.3702, 7.3689, 7.3676, 7.3662, 7.3648, 7.3641, 7.3628, 7.3625, 7.3615, 7.3599, 7.3595, 7.3588, 7.3575, 7.3564, 7.3644, 7.3587, 7.358, 7.3609, 7.3601, 7.3595, 7.3587, 7.3569, 7.3606, 7.3594, 7.3581, 7.3568, 7.3559, 7.3547, 7.3534, 7.3579, 7.3567, 7.3552, 7.3537, 7.3524, 7.3552, 7.359, 7.358, 7.3563, 7.3592, 7.3618, 7.3601, 7.3587, 7.3578, 7.3611, 7.3602, 7.359, 7.3575, 7.3564, 7.3551, 7.3534, 7.3524, 7.3519, 7.3506, 7.3493, 7.3525, 7.3512, 7.3497, 7.3484, 7.3471, 7.3456, 7.3448, 7.3439, 7.3429, 7.3418, 7.3408, 7.3395, 7.3385, 7.3375, 7.339, 7.3488, 7.3565, 7.355, 7.3581, 7.3575, 7.3565, 7.3577, 7.3614, 7.3603, 7.3611, 7.3655, 7.3655, 7.3651, 7.3644, 7.3632, 7.3624, 7.3612, 7.3595, 7.3585, 7.358, 7.3564, 7.3555, 7.354, 7.3526, 7.3511, 7.35, 7.3491, 7.3484, 7.3521, 7.3512, 7.3539, 7.3536, 7.3483, 7.3474, 7.3465, 7.3461, 7.3451, 7.3442, 7.3469, 7.3496, 7.3487, 7.3481, 7.347, 7.3457, 7.3443, 7.3432, 7.3424, 7.3421, 7.3449, 7.3435, 7.3467, 7.3456, 7.3453, 7.3482, 7.3467, 7.3459, 7.3445, 7.3436, 7.3464, 7.3458, 7.3448, 7.3437, 7.3424, 7.3415, 7.3411, 7.34, 7.3385, 7.3373, 7.3399, 7.339, 7.3375, 7.3363, 7.3351, 7.3337, 7.3328, 7.3314, 7.3304, 7.33, 7.3289, 7.3281, 7.327, 7.3302, 7.3295, 7.3287, 7.3316, 7.3341, 7.3368, 7.3353, 7.3341, 7.3334, 7.332, 7.3347, 7.3341, 7.3334, 7.3322, 7.3309, 7.3333, 7.3325, 7.3317, 7.3313, 7.3339, 7.3325, 7.3311, 7.3297, 7.3331, 7.332, 7.3306, 7.3333, 7.332, 7.3308, 7.3301, 7.3286, 7.3286, 7.3271, 7.3257, 7.3243, 7.3233, 7.3226, 7.3218, 7.3204, 7.3195, 7.3192, 7.3216, 7.3209, 7.3234, 7.3259, 7.3258, 7.3252, 7.3237, 7.3229, 7.3214, 7.321, 7.3236, 7.3221, 7.3206, 7.3194, 7.318, 7.3166, 7.3164, 7.3155, 7.318, 7.3166, 7.3152, 7.3145, 7.3136, 7.3124, 7.3146, 7.3139, 7.3125, 7.3111, 7.31, 7.3087, 7.3073, 7.314, 7.3126, 7.3129, 7.3124, 7.3192, 7.3182, 7.3168, 7.3156, 7.3143, 7.317, 7.3166, 7.3197, 7.3203, 7.3213, 7.3257, 7.3286, 7.3278, 7.3267, 7.3333, 7.3334, 7.3325, 7.3312, 7.3336, 7.3334, 7.333, 7.3319, 7.3321, 7.331, 7.3297, 7.3323, 7.3314, 7.3342, 7.3336, 7.3322, 7.3308, 7.3303, 7.3295, 7.3284, 7.3314, 7.3304, 7.3332, 7.3324, 7.3316, 7.3435, 7.3434, 7.3421, 7.3413, 7.3403, 7.3392, 7.3381, 7.3373, 7.3361, 7.3385, 7.3381, 7.346, 7.3525, 7.3518, 7.3505, 7.3507, 7.3531, 7.3555, 7.3548, 7.3538, 7.3533, 7.356, 7.3549, 7.3538, 7.3532, 7.3529, 7.3522, 7.351, 7.3503, 7.3531, 7.3519, 7.3505, 7.3496, 7.3484, 7.3475, 7.3464, 7.3459, 7.3453, 7.3478, 7.3467, 7.3462, 7.3449, 7.3437, 7.3433, 7.3497, 7.349, 7.3494, 7.3482, 7.3474, 7.3476, 7.3463, 7.3456, 7.3442, 7.3436, 7.3427, 7.3419, 7.3409, 7.3405, 7.3395, 7.342, 7.3413, 7.3436, 7.3423, 7.342, 7.3437, 7.3428, 7.3415, 7.3405, 7.3394, 7.3385, 7.3374, 7.3368, 7.336, 7.3348, 7.3371, 7.3394, 7.3381, 7.3368, 7.3361, 7.3387, 7.3375, 7.3362, 7.3349, 7.3371, 7.3358, 7.3346, 7.3332, 7.3352, 7.3349, 7.3373, 7.3361, 7.3348, 7.3337, 7.3331, 7.3325, 7.3315, 7.3308, 7.3295, 7.3283, 7.3281, 7.3276, 7.3274, 7.3265, 7.3287, 7.3282, 7.3276, 7.3269, 7.3261, 7.3249, 7.3243, 7.3231, 7.3225, 7.3213, 7.3203, 7.3191, 7.3185, 7.3208, 7.3202, 7.3189, 7.3183, 7.3172, 7.3163, 7.3152, 7.3139, 7.3129, 7.3167, 7.3244, 7.327, 7.3295, 7.332, 7.3309, 7.3296, 7.3312, 7.3302, 7.3301, 7.3292, 7.328, 7.3267, 7.3262, 7.3249, 7.3269, 7.3258, 7.325, 7.3273, 7.3262, 7.3284, 7.3276, 7.3297, 7.3285, 7.3281, 7.3286, 7.3274, 7.3264, 7.3255, 7.3244, 7.3232, 7.3219, 7.321, 7.3202, 7.3195, 7.3219, 7.3218, 7.3206, 7.3197, 7.3189, 7.3183, 7.3242, 7.3238, 7.323, 7.3226, 7.3214, 7.3207, 7.3201, 7.3191, 7.3194, 7.3188, 7.3184, 7.3174, 7.3165, 7.3193, 7.3184, 7.3173, 7.3167, 7.3193, 7.316, 7.3151, 7.3175, 7.3165, 7.316, 7.3154, 7.3147, 7.3139, 7.3139, 7.3129, 7.312, 7.3116, 7.314, 7.3128, 7.3159, 7.3146, 7.3167, 7.3158, 7.3183, 7.3177, 7.3198, 7.319, 7.3178, 7.3173, 7.3161, 7.3183, 7.3171, 7.3167, 7.3155, 7.3146, 7.3167, 7.3157, 7.3145, 7.3133, 7.312, 7.3107, 7.3102, 7.309, 7.3084, 7.3078, 7.3065, 7.3081, 7.307, 7.3061, 7.3048, 7.304, 7.3017, 7.3037, 7.3107, 7.3107, 7.3097, 7.3097, 7.3088, 7.3108, 7.3102, 7.3096, 7.3084, 7.3077, 7.3069, 7.3087, 7.3111, 7.3102, 7.3092, 7.3085, 7.3104, 7.3092, 7.3081, 7.3069, 7.3061, 7.3054, 7.3042, 7.3033, 7.3025, 7.3017, 7.301, 7.3005, 7.2996, 7.2986, 7.3013, 7.304, 7.3032, 7.3058, 7.305, 7.3046, 7.3038, 7.303, 7.3052, 7.3042, 7.3031, 7.3019, 7.3011, 7.3001, 7.2991, 7.298, 7.2973, 7.2966, 7.2956, 7.2944, 7.297, 7.2962, 7.2983, 7.2973, 7.2963, 7.2954, 7.2943, 7.2962, 7.2952, 7.2976, 7.2968, 7.2959, 7.2948, 7.2939, 7.2931, 7.292, 7.291, 7.2929, 7.2949, 7.2971, 7.296, 7.2982, 7.2971, 7.2961, 7.2949, 7.294, 7.2935, 7.2928, 7.2923, 7.2915, 7.2933, 7.2954, 7.2966, 7.296, 7.2952, 7.2943, 7.2933, 7.2951, 7.2951, 7.2943, 7.2964, 7.2955, 7.2946, 7.2938, 7.2932, 7.2925, 7.2925, 7.2919, 7.2908, 7.2906, 7.2898, 7.2891, 7.2881, 7.2875, 7.2866, 7.2866, 7.2887, 7.2881, 7.2872, 7.2893, 7.2882, 7.2873, 7.2867, 7.2889, 7.2908, 7.2899, 7.289, 7.2879, 7.287, 7.2861, 7.2884, 7.2873, 7.2867, 7.2862, 7.2853, 7.2843, 7.2833, 7.2823, 7.2814, 7.2803, 7.2828, 7.2847, 7.2845, 7.2838, 7.2829, 7.2851, 7.2842, 7.2836, 7.2827, 7.2823, 7.2823, 7.2812, 7.2803, 7.2793, 7.2787, 7.2779, 7.2771, 7.2763, 7.2757, 7.2755, 7.275, 7.2745, 7.2735, 7.2758, 7.2754, 7.2743, 7.2733, 7.2725, 7.2718, 7.2715, 7.2706, 7.2698, 7.275, 7.2747, 7.2738, 7.273, 7.2723, 7.2722, 7.2717, 7.2742, 7.2764, 7.2757, 7.2747, 7.2739, 7.273, 7.2721, 7.2714, 7.2703, 7.2698, 7.2689, 7.268, 7.2671, 7.2669, 7.2665, 7.2656, 7.2651, 7.2644, 7.2635, 7.2638, 7.2659, 7.2652, 7.2645, 7.2635, 7.2631, 7.2628, 7.2646, 7.2643, 7.2636, 7.2655, 7.2651, 7.2646, 7.2636, 7.2628, 7.2618, 7.2608, 7.2599, 7.2592, 7.2615, 7.2605, 7.2625, 7.2617, 7.2608, 7.2598, 7.2591, 7.2585, 7.2608, 7.26, 7.2594, 7.2585, 7.261, 7.2632, 7.2627, 7.2618, 7.2612, 7.2632, 7.2624, 7.2622, 7.2614, 7.2607, 7.2598, 7.2591, 7.2584, 7.2582, 7.2573, 7.2567, 7.2568, 7.2561, 7.2553, 7.2548, 7.2543, 7.2537, 7.2533, 7.2523, 7.2514, 7.2533, 7.2559, 7.2549, 7.2541, 7.2534, 7.2525, 7.2516, 7.2506, 7.2529, 7.2523, 7.2516, 7.2535, 7.2526, 7.2547, 7.2513, 7.2506, 7.2497, 7.2489, 7.2482, 7.2488, 7.2479, 7.247, 7.2462, 7.2461, 7.2458, 7.2453, 7.2449, 7.2441, 7.2437, 7.2432, 7.2424, 7.2444, 7.2436, 7.2429, 7.2422, 7.2415, 7.2414, 7.2405, 7.2398, 7.239, 7.2381, 7.2373, 7.2371, 7.2373, 7.2364, 7.2383, 7.2389, 7.2383, 7.2378, 7.2377, 7.2371, 7.2365, 7.2359, 7.2355, 7.2348, 7.2367, 7.2358, 7.235, 7.236000000000001, 7.2387, 7.2407, 7.2399, 7.239, 7.2407, 7.2402, 7.2393, 7.2387, 7.2379, 7.2373, 7.2364, 7.2354, 7.2352, 7.2344, 7.2392, 7.2386, 7.2378, 7.2374, 7.2432, 7.2497, 7.2493, 7.2513, 7.2504, 7.2497, 7.2492, 7.2486, 7.2479, 7.2476, 7.2471, 7.2464, 7.2457, 7.2453, 7.2473, 7.2469, 7.2464, 7.2461, 7.2471000000000005, 7.248100000000001, 7.2541, 7.254, 7.2585, 7.2579, 7.2571, 7.2592, 7.2584, 7.2575, 7.2566, 7.2585, 7.2577, 7.2597, 7.2589, 7.2584, 7.2575, 7.2566, 7.2557, 7.255, 7.2542, 7.2536, 7.2531, 7.2525, 7.2518, 7.2511, 7.2482, 7.2604, 7.2602, 7.2595, 7.2587, 7.2603, 7.2594, 7.2586, 7.2581, 7.2573, 7.2564, 7.2558, 7.2549, 7.254, 7.2536, 7.2529, 7.2522, 7.2513, 7.2506, 7.2526, 7.2519, 7.251, 7.2529, 7.2522, 7.2519, 7.2514, 7.251, 7.2503, 7.2494, 7.2486, 7.2484, 7.2478, 7.2452, 7.2447, 7.2438, 7.2433, 7.2429, 7.2421, 7.2427, 7.2422, 7.2417, 7.241, 7.2401, 7.2421, 7.2417, 7.2409, 7.2404, 7.2396, 7.2392, 7.2384, 7.2376, 7.2371, 7.2365, 7.2356, 7.2354, 7.235, 7.2346, 7.2338, 7.2329, 7.2324, 7.2315, 7.2306, 7.2308, 7.2302, 7.2295, 7.2312, 7.2309, 7.2329, 7.2349, 7.2346, 7.2339, 7.2336, 7.2329, 7.2323, 7.2343, 7.2401, 7.2394, 7.2387, 7.2385, 7.2381, 7.2401, 7.2393, 7.2385, 7.2379, 7.2373, 7.2347, 7.2341, 7.2353, 7.2372, 7.237, 7.2387, 7.2404, 7.2397, 7.2391, 7.2383, 7.24, 7.2396, 7.239, 7.2381, 7.2372, 7.239, 7.2382, 7.2375, 7.2367, 7.2361, 7.2377, 7.2394, 7.2386, 7.2386, 7.238, 7.2373, 7.2364, 7.2355, 7.2348, 7.2341, 7.2335, 7.2332, 7.2334, 7.2327, 7.2324, 7.2341, 7.2333, 7.2325, 7.2324, 7.2317, 7.2333, 7.2332, 7.2328, 7.2327, 7.2319, 7.2313, 7.2328, 7.2319, 7.2313, 7.2312, 7.232200000000001, 7.2315, 7.2309, 7.2342, 7.2336, 7.2329, 7.2322, 7.2314, 7.2405, 7.2413, 7.2414, 7.2406, 7.2401, 7.2397, 7.2413, 7.2429, 7.2422, 7.2441, 7.246, 7.2457, 7.2453, 7.2446, 7.2442, 7.2437, 7.2429, 7.2445, 7.2436, 7.2427, 7.2421, 7.2412, 7.2413, 7.2408, 7.2402, 7.2394, 7.2387, 7.2383, 7.2386, 7.2379, 7.2372, 7.237, 7.2367, 7.2362, 7.2356, 7.2363, 7.2358, 7.2351, 7.2327, 7.2338, 7.2332, 7.2312, 7.2305, 7.23, 7.2315, 7.2311, 7.2304, 7.2297, 7.2364, 7.2383, 7.2375, 7.2372, 7.2364, 7.2358, 7.2353, 7.2351, 7.2344, 7.234, 7.2339, 7.2335, 7.2329, 7.2332, 7.2323, 7.2317, 7.2314, 7.231, 7.2325, 7.2317, 7.2314, 7.2332, 7.2327, 7.2326, 7.2323, 7.2316, 7.2309, 7.2329, 7.2321, 7.2313, 7.2328, 7.23, 7.2292, 7.2284, 7.2301, 7.2295, 7.2305, 7.2297, 7.2293, 7.2309, 7.2326, 7.2322, 7.2318, 7.2333, 7.2328, 7.2333, 7.2325, 7.2366, 7.2384, 7.2385, 7.238, 7.2376, 7.2373, 7.2366, 7.2363, 7.2391, 7.2385, 7.2378, 7.2417, 7.241, 7.2404, 7.242, 7.2436, 7.2428, 7.2423, 7.2415, 7.2409, 7.2406, 7.2398, 7.2415, 7.2406, 7.2401, 7.2394, 7.2434, 7.2427, 7.242, 7.2411, 7.2408, 7.2409, 7.241, 7.2457, 7.2449, 7.2443, 7.2445, 7.2441, 7.2433, 7.2429, 7.2422, 7.2397, 7.2389, 7.2408, 7.2402, 7.2394, 7.239, 7.2385, 7.2376, 7.237, 7.2367, 7.2381, 7.2374, 7.2388, 7.2385, 7.2381, 7.2376, 7.2373, 7.2389, 7.2385, 7.2382, 7.2379, 7.2371, 7.2388, 7.2382, 7.2374, 7.2392, 7.2391, 7.2383, 7.2402, 7.2432, 7.2427, 7.2419, 7.242, 7.2467, 7.2465, 7.2481, 7.2481, 7.2479, 7.2473, 7.249, 7.2506, 7.2502, 7.2527, 7.2524, 7.2516, 7.2535, 7.2539, 7.2535, 7.2528, 7.2522, 7.2541, 7.2538, 7.2517, 7.2509, 7.2504, 7.2497, 7.2512, 7.2504, 7.2499, 7.2492, 7.2487, 7.2479, 7.2472, 7.2467, 7.2459, 7.2477, 7.2471, 7.2486, 7.2484, 7.2479, 7.2471, 7.2463, 7.2455, 7.2449, 7.2443, 7.2507, 7.2501, 7.2499, 7.2493, 7.2488, 7.2483, 7.2481, 7.2473, 7.2469, 7.2468, 7.2463, 7.2459, 7.2451, 7.2449, 7.2446, 7.2448, 7.2464, 7.2462, 7.2457, 7.2449, 7.2443, 7.2437, 7.2431, 7.2425, 7.242, 7.2412, 7.2405, 7.2399, 7.2393, 7.2393, 7.2386, 7.238, 7.2397, 7.239, 7.2404, 7.24, 7.2392, 7.2388, 7.238, 7.2379, 7.2393, 7.2386, 7.24, 7.2395, 7.2389, 7.2382, 7.2377, 7.2377, 7.237, 7.2365, 7.2364, 7.236, 7.2354, 7.2355, 7.2373, 7.2367, 7.2362, 7.2354, 7.2369, 7.2365, 7.2359, 7.2351, 7.2345, 7.2319, 7.232900000000001, 7.2327, 7.2341, 7.235, 7.2347, 7.2362, 7.2355, 7.2347, 7.2346, 7.2342, 7.2338, 7.2332, 7.233, 7.2322, 7.2318, 7.2314, 7.2311, 7.2305, 7.2308, 7.2304, 7.2297, 7.2292, 7.2285, 7.2279, 7.2272, 7.2268, 7.2261, 7.2275, 7.2273, 7.2265, 7.2258, 7.2254, 7.2247, 7.2242, 7.2236, 7.2255, 7.2248, 7.2241, 7.2238, 7.2231, 7.2227, 7.2222, 7.2218, 7.2213, 7.2211, 7.2206, 7.2203, 7.2201, 7.2228, 7.2223, 7.2219, 7.2213, 7.2206, 7.22, 7.2195, 7.2211, 7.2204, 7.2201, 7.2196, 7.2192, 7.2186, 7.2181, 7.2196, 7.2191, 7.2186, 7.218, 7.2172, 7.2167, 7.2161, 7.2156, 7.2172, 7.2165, 7.2157, 7.215, 7.2146, 7.2144, 7.2141, 7.2166, 7.2159, 7.2157, 7.2151, 7.2167, 7.2162, 7.2158, 7.2152, 7.2167, 7.2161, 7.2177, 7.2171, 7.218100000000001, 7.2173, 7.2187, 7.218, 7.2175, 7.2171, 7.2165, 7.2163, 7.2157, 7.215, 7.2145, 7.214, 7.214, 7.2138, 7.2135, 7.2138, 7.2133, 7.2151, 7.2147, 7.2139, 7.2133, 7.2127, 7.212, 7.2116, 7.2112, 7.2111, 7.2126, 7.214, 7.2156, 7.2152, 7.2145, 7.2141, 7.2135, 7.2129, 7.2124, 7.2117, 7.2111, 7.2107, 7.212, 7.2116, 7.2113, 7.2128, 7.2124, 7.2119, 7.2133, 7.2131, 7.2145, 7.216, 7.2154, 7.2149, 7.2146, 7.2145, 7.214, 7.2134, 7.2148, 7.2189, 7.2204, 7.2216, 7.221, 7.2207, 7.2203, 7.22, 7.2194, 7.2208, 7.2203, 7.2217, 7.2213, 7.2208, 7.2201, 7.2195, 7.2191, 7.2185, 7.2201, 7.2195, 7.2213, 7.222300000000001, 7.2221, 7.2218, 7.2233, 7.2228, 7.2246, 7.2256, 7.2272, 7.2269, 7.2279, 7.2294, 7.2296, 7.229, 7.2283, 7.2276, 7.2276, 7.2271, 7.2284, 7.2297, 7.2292, 7.2307, 7.2301, 7.2313, 7.2308, 7.2307, 7.2301, 7.2294, 7.2289, 7.2283, 7.2297, 7.2315, 7.2309, 7.2303, 7.2297, 7.2313, 7.2308, 7.2302, 7.2299, 7.2293, 7.2308, 7.2303, 7.2296, 7.229, 7.2305, 7.2321, 7.2316, 7.2312, 7.2328, 7.2323, 7.232, 7.234, 7.2335, 7.235, 7.2368, 7.2364, 7.2361, 7.2355, 7.2348, 7.2364, 7.2377, 7.2393, 7.2387, 7.2384, 7.2383, 7.2379, 7.2373, 7.2366, 7.2365, 7.2359, 7.2357, 7.2373, 7.2373, 7.2371, 7.2366, 7.2362, 7.2377, 7.2373, 7.2369, 7.2364, 7.2377, 7.2371, 7.2371, 7.2364, 7.2361, 7.2373, 7.237, 7.2384, 7.2379, 7.2376, 7.2372, 7.2367, 7.2372, 7.2389, 7.2384, 7.2426, 7.2419, 7.2416, 7.2463, 7.2459, 7.2455, 7.2454, 7.2453, 7.2448, 7.2442, 7.2439, 7.2434, 7.2435, 7.2432, 7.2428, 7.2423, 7.242, 7.2414, 7.2414, 7.2407, 7.2402, 7.2399, 7.2394, 7.2391, 7.2406, 7.242, 7.2417, 7.2431, 7.2425, 7.242, 7.2413, 7.2415, 7.2452, 7.2448, 7.2443, 7.2459, 7.2473, 7.2469, 7.2486, 7.2482, 7.2476, 7.2472, 7.2468, 7.2461, 7.2475, 7.2469, 7.2462, 7.2441, 7.2435, 7.2428, 7.2422, 7.2417, 7.2411, 7.241, 7.2404, 7.2417, 7.241, 7.2404, 7.2399, 7.2395, 7.2389, 7.2388, 7.2401, 7.2396, 7.2412, 7.2407, 7.2404, 7.2405, 7.2399, 7.2392, 7.2389, 7.2386, 7.2381, 7.2374, 7.2371, 7.2366, 7.2362, 7.236, 7.2354, 7.2367, 7.2365, 7.2378, 7.2371, 7.2365, 7.236, 7.2354, 7.2366, 7.2381, 7.2377, 7.2374, 7.2369, 7.2364, 7.2357, 7.2352, 7.2348, 7.2342, 7.2336, 7.2329, 7.2322, 7.2328, 7.2334, 7.2328, 7.2323, 7.2336, 7.2332, 7.2329, 7.2326, 7.2324, 7.2324, 7.2318, 7.2312, 7.231, 7.2307, 7.2301, 7.2298, 7.2293, 7.2288, 7.2285, 7.2299, 7.2293, 7.2291, 7.2304, 7.2298, 7.2295, 7.229, 7.2284, 7.2278, 7.2271, 7.2269, 7.2263, 7.2259, 7.2255, 7.2249, 7.2247, 7.2243, 7.2238, 7.2275, 7.2288, 7.2291, 7.2291, 7.2285, 7.2282, 7.2262, 7.2257, 7.2252, 7.2247, 7.2242, 7.2235, 7.2249, 7.225, 7.2245, 7.2243, 7.2237, 7.2235, 7.2249, 7.2263, 7.2257, 7.2269, 7.2265, 7.2258, 7.2253, 7.225, 7.2247, 7.2241, 7.2236, 7.2229, 7.2228, 7.223800000000001, 7.2237, 7.2273, 7.2288, 7.2287, 7.2283, 7.2277, 7.2274, 7.2271, 7.2285, 7.2279, 7.2275, 7.2273, 7.2267, 7.2262, 7.226, 7.2254, 7.2249, 7.2247, 7.2246, 7.2241, 7.2237, 7.2232, 7.2243, 7.2239, 7.2234, 7.2229, 7.2231, 7.2232, 7.223, 7.2244, 7.2239, 7.2238, 7.2233, 7.2228, 7.2221, 7.2216, 7.2209, 7.2203, 7.2198, 7.2208000000000006, 7.2221, 7.2234, 7.2231, 7.2245, 7.224, 7.2252, 7.2249, 7.2243, 7.2256, 7.2269, 7.2264, 7.2257, 7.2252, 7.2248, 7.2245, 7.2257, 7.2263, 7.2258, 7.2255, 7.2272, 7.2277, 7.2271, 7.2265, 7.2262, 7.2259, 7.2253, 7.2248, 7.2241, 7.2253, 7.2251, 7.2246, 7.224, 7.2253, 7.2249, 7.2247, 7.2244, 7.224, 7.2235, 7.223, 7.2228, 7.2224, 7.223400000000001, 7.2248, 7.2242, 7.2238, 7.2233, 7.2227, 7.2222, 7.2219, 7.2215, 7.2208, 7.2203, 7.2213, 7.2226, 7.2223, 7.222, 7.2233, 7.2227, 7.2223, 7.2219, 7.2232, 7.224200000000001, 7.2239, 7.2234, 7.2229, 7.2224, 7.2246, 7.2251, 7.2264, 7.2277, 7.2272, 7.2269, 7.2268, 7.2262, 7.2256, 7.2271, 7.2265, 7.226, 7.2255, 7.2267, 7.2264, 7.2277, 7.229, 7.229, 7.2284, 7.2281, 7.2293, 7.2293, 7.2288, 7.2286, 7.2299, 7.2297, 7.2309, 7.2306, 7.2302, 7.2315, 7.2295, 7.2294, 7.2288, 7.2284, 7.2278, 7.2273, 7.2267, 7.2265, 7.2277, 7.229, 7.2287, 7.2282, 7.2261, 7.2272, 7.2265, 7.226, 7.2254, 7.225, 7.2244, 7.2242, 7.224, 7.2235, 7.2232, 7.2226, 7.2238, 7.225, 7.2246, 7.2243, 7.2237, 7.2234, 7.2249, 7.2245, 7.2241, 7.2235, 7.2245, 7.224, 7.2235, 7.223, 7.2242, 7.2236, 7.2233, 7.2227, 7.2224, 7.222, 7.2214, 7.2208, 7.2202, 7.22, 7.2213, 7.2207, 7.2203, 7.22, 7.2195, 7.2208, 7.2203, 7.2197, 7.221, 7.2206, 7.2202, 7.2197, 7.2193, 7.219, 7.2185, 7.2197, 7.2209, 7.2203, 7.22, 7.2195, 7.2192, 7.2188, 7.2188, 7.2183, 7.2179, 7.2173, 7.2171, 7.2166, 7.2184, 7.2196, 7.2192, 7.2187, 7.2184, 7.2179, 7.2192, 7.2188, 7.2187, 7.2182, 7.2177, 7.2174, 7.2168, 7.2162, 7.2158, 7.2153, 7.217, 7.217, 7.2183, 7.2182, 7.2179, 7.2175, 7.2171, 7.2167, 7.2181, 7.2181, 7.2193, 7.2187, 7.2183, 7.2182, 7.218, 7.2177, 7.2177, 7.2172, 7.2168, 7.2166, 7.2161, 7.2182, 7.2195, 7.2175, 7.2169, 7.2163, 7.2177, 7.2172, 7.2166, 7.2163, 7.2191, 7.227, 7.2273, 7.2286, 7.2285, 7.2347, 7.2342, 7.237, 7.2382, 7.2394, 7.2376, 7.2358, 7.234, 7.2338, 7.2385, 7.2379, 7.2406, 7.2418, 7.2432, 7.2428, 7.2422, 7.2419, 7.2413, 7.2409, 7.2404, 7.2402, 7.2396, 7.2393, 7.2388, 7.2393, 7.2422, 7.2416, 7.2412, 7.2408, 7.2404, 7.2401, 7.2397, 7.2393, 7.239, 7.2404, 7.2398, 7.2393, 7.2407, 7.2419, 7.2416, 7.2416, 7.2419, 7.2431, 7.2426, 7.2437, 7.2448, 7.2449, 7.2446, 7.2444, 7.2457, 7.2453, 7.2449, 7.2446, 7.2441, 7.2437, 7.2431, 7.2431, 7.2426, 7.2406, 7.2401, 7.2398, 7.2409, 7.2404, 7.2399, 7.2409, 7.2438, 7.2436, 7.2433, 7.2427, 7.2422, 7.2417, 7.2412, 7.2424, 7.2419, 7.2413, 7.2425, 7.2419, 7.2414, 7.2425, 7.2421, 7.2418, 7.2415, 7.2409, 7.2419, 7.2416, 7.2427, 7.2424, 7.2439, 7.2435, 7.2432, 7.2433, 7.243, 7.2427, 7.2425, 7.2423, 7.2421, 7.2415, 7.2409, 7.2404, 7.2398, 7.2394, 7.239, 7.2384, 7.2395, 7.2389, 7.2385, 7.2381, 7.2378, 7.239, 7.2386, 7.2381, 7.2376, 7.2376, 7.237, 7.2365, 7.2359, 7.2359, 7.2357, 7.2352, 7.2346, 7.2342, 7.2338, 7.2335, 7.2348, 7.2346, 7.2342, 7.2339, 7.2335, 7.2333, 7.2346, 7.2342, 7.234, 7.234, 7.2335, 7.2348, 7.2356, 7.2367, 7.2362, 7.2373, 7.2367, 7.2373, 7.237, 7.2366, 7.2377, 7.2388, 7.2383, 7.2395, 7.2408, 7.2421, 7.2416, 7.2413, 7.2412, 7.2408, 7.2405, 7.2401, 7.2413, 7.2441, 7.2435, 7.2432, 7.243, 7.2426, 7.2424, 7.2421, 7.2426, 7.2421, 7.242, 7.243, 7.2425, 7.2422, 7.2417, 7.2413, 7.2425, 7.2421, 7.2418, 7.2414, 7.2411, 7.2406, 7.24, 7.2394, 7.2389, 7.2401, 7.2399, 7.2394, 7.2391, 7.2386, 7.2384, 7.238, 7.2375, 7.2371, 7.2368, 7.2366, 7.2362, 7.2359, 7.2354, 7.2353, 7.2349, 7.2344, 7.2355, 7.2354, 7.2352, 7.2363, 7.236, 7.2359, 7.2356, 7.2352, 7.2347, 7.2356, 7.2353, 7.2348, 7.2343, 7.2339, 7.2334, 7.2344, 7.2357, 7.2351, 7.2346, 7.2342, 7.2338, 7.2335, 7.2333, 7.2344, 7.2342, 7.2353, 7.2365, 7.2362, 7.2359, 7.2373, 7.2399, 7.2395, 7.2392, 7.2387, 7.2382, 7.2377, 7.2372, 7.2366, 7.2361, 7.2371, 7.2367, 7.2363, 7.2359, 7.2353, 7.2348, 7.2342, 7.234, 7.2338, 7.2365, 7.2376, 7.2372, 7.2414, 7.241, 7.2408, 7.2402, 7.2397, 7.2392, 7.2389, 7.2384, 7.2393, 7.2394, 7.2391, 7.239, 7.2393, 7.2391, 7.2416, 7.2415, 7.2427, 7.2457, 7.2472, 7.2467, 7.2481, 7.2477, 7.2473, 7.2468, 7.2463, 7.2459, 7.2444, 7.2448, 7.2443, 7.2439, 7.2435, 7.2448, 7.2447, 7.2447, 7.2447, 7.2459, 7.2456, 7.2457, 7.2452, 7.2447, 7.2442, 7.2454, 7.2453, 7.2448, 7.2446, 7.2443, 7.2443, 7.2455, 7.2452, 7.2448, 7.2459, 7.2456, 7.2453, 7.2454, 7.245, 7.2446, 7.2458, 7.2454, 7.2466, 7.2464, 7.2445, 7.244, 7.2435, 7.2431, 7.2426, 7.2426, 7.2423, 7.2433, 7.2429, 7.2439, 7.2434, 7.2431, 7.2428, 7.2424, 7.2419, 7.2414, 7.2409, 7.242, 7.2431, 7.2428, 7.244, 7.2442, 7.2437, 7.2435, 7.2433, 7.2429, 7.2482, 7.2479, 7.2476, 7.2472, 7.2483, 7.248, 7.2478, 7.2474, 7.2469, 7.2469, 7.2465, 7.2479, 7.2477, 7.2472, 7.2484, 7.2496, 7.2508, 7.2518, 7.2515, 7.251, 7.2505, 7.25, 7.2495, 7.2491, 7.2488, 7.2486, 7.2485, 7.2481, 7.2477, 7.2474, 7.2474, 7.247, 7.2466, 7.246, 7.2458, 7.2453, 7.245, 7.2447, 7.2444, 7.2442, 7.2455, 7.245, 7.2446, 7.2442, 7.2454, 7.245, 7.2461, 7.2456, 7.2452, 7.2447, 7.2443, 7.2441, 7.2441, 7.2438, 7.2437, 7.2433, 7.2431, 7.2428, 7.2426, 7.2439, 7.2455, 7.2455, 7.2485, 7.2516, 7.2512, 7.2511, 7.2506, 7.2504, 7.2514, 7.251, 7.2508, 7.2504, 7.25, 7.2494, 7.249, 7.2487, 7.2482, 7.2493, 7.2491, 7.2485, 7.248, 7.2491, 7.2502, 7.2498, 7.2493, 7.2489, 7.2499, 7.2495, 7.249, 7.2488, 7.2482, 7.248, 7.2476, 7.2503, 7.2514, 7.2509, 7.2584, 7.2579, 7.2589, 7.259, 7.2592, 7.2589, 7.2599, 7.2593, 7.2589, 7.26, 7.2613, 7.2623, 7.2633, 7.263, 7.2641, 7.2639, 7.2636, 7.2631, 7.2626, 7.2622, 7.2618, 7.2616, 7.2627, 7.2624, 7.262, 7.2618, 7.2617, 7.2646, 7.2643, 7.264, 7.2635, 7.2631, 7.2626, 7.2636, 7.2631, 7.2626, 7.2621, 7.2616, 7.2611, 7.2608, 7.2619, 7.2616, 7.2611, 7.2606, 7.2602, 7.2599, 7.2594, 7.2592, 7.2587, 7.2582, 7.2578, 7.2588, 7.2597, 7.2594, 7.2591, 7.2587, 7.2598, 7.2608, 7.2617, 7.2612, 7.2608, 7.2603, 7.2609, 7.2606, 7.2617, 7.2612, 7.2622, 7.2618, 7.2627, 7.2624, 7.262, 7.267, 7.2665, 7.266, 7.2655, 7.2666, 7.2664, 7.2661, 7.2672, 7.2668, 7.2665, 7.266, 7.2656, 7.2667, 7.2662, 7.2672, 7.2667, 7.2663, 7.2674, 7.2685, 7.2711, 7.2722, 7.272, 7.2715, 7.2713, 7.2709, 7.2707, 7.2703, 7.27, 7.2714, 7.2725, 7.2721, 7.2733, 7.2745, 7.2741, 7.2739, 7.2735, 7.2731, 7.2743, 7.274, 7.275, 7.2746, 7.2743, 7.2744, 7.2742, 7.2739, 7.2736, 7.2731, 7.2729, 7.273, 7.2726, 7.2724, 7.2719, 7.2715, 7.2725, 7.2721, 7.2717, 7.2712, 7.2709, 7.2719, 7.2714, 7.274, 7.2749, 7.2744, 7.274, 7.2735, 7.274, 7.2741, 7.2738, 7.2737, 7.2732, 7.2733, 7.2731, 7.2727, 7.2737, 7.2732, 7.2742, 7.2738, 7.2749, 7.2745, 7.274, 7.2736, 7.2734, 7.2744, 7.2739, 7.2734, 7.2729, 7.2725, 7.272, 7.2715, 7.2712, 7.2708, 7.2704, 7.2703, 7.2699, 7.2695, 7.269, 7.2687, 7.274, 7.2735, 7.2733, 7.2729, 7.2727, 7.2725, 7.2721, 7.2732, 7.2727, 7.2725, 7.2721, 7.2731, 7.2728, 7.2725, 7.2735, 7.2731, 7.2715, 7.2712, 7.2707, 7.2705, 7.2701, 7.2696, 7.2693, 7.2691, 7.2689, 7.2687, 7.2682, 7.2678, 7.2675, 7.269, 7.2688, 7.2685, 7.2686, 7.2684, 7.268, 7.2675, 7.2674, 7.2672, 7.2669, 7.2666, 7.2664, 7.2664, 7.2662, 7.2661, 7.2658, 7.2653, 7.2666, 7.2679, 7.2675, 7.2685, 7.2682, 7.2682, 7.2682, 7.268, 7.2677, 7.2676, 7.2676, 7.2673, 7.2669, 7.2665, 7.2663, 7.2674, 7.2686, 7.2684, 7.2693, 7.2689, 7.2728, 7.2772, 7.2768, 7.2764, 7.2775, 7.2773, 7.2769, 7.2783, 7.2784, 7.2795, 7.279, 7.2788, 7.2787, 7.2788, 7.2785, 7.278, 7.279, 7.2789, 7.2784, 7.2782, 7.2795, 7.2792, 7.2788, 7.2788, 7.2786, 7.2771, 7.2766, 7.2765, 7.2763, 7.2759, 7.2755, 7.2751, 7.2746, 7.2742, 7.2751, 7.2761, 7.277, 7.2765, 7.2775, 7.277, 7.2765, 7.276, 7.2769, 7.2766, 7.2761, 7.2756, 7.2752, 7.2763, 7.2759, 7.2755, 7.275, 7.2746, 7.2741, 7.2737, 7.2752, 7.2747, 7.2771, 7.2767, 7.2763, 7.2772, 7.2767, 7.2766, 7.2761, 7.2776, 7.2761, 7.2759, 7.2757, 7.2756, 7.2753, 7.2762, 7.276, 7.2755, 7.2752, 7.275, 7.2746, 7.2741, 7.2752, 7.2747, 7.2742, 7.2739, 7.2734, 7.2729, 7.2725, 7.2721, 7.2736, 7.2734, 7.2731, 7.2728, 7.2725, 7.272, 7.2715, 7.2724, 7.2732, 7.2727, 7.2725, 7.2734, 7.2729, 7.2725, 7.272, 7.2717, 7.2726, 7.2723, 7.272, 7.2716, 7.27, 7.2696, 7.2707, 7.2703, 7.2701, 7.271, 7.2707, 7.2702, 7.2698, 7.2695, 7.2692, 7.2703, 7.2698, 7.2698, 7.2696, 7.2693, 7.2703, 7.2714, 7.271, 7.2706, 7.2704, 7.2702, 7.2698, 7.2693, 7.2688, 7.2698, 7.2695, 7.2691, 7.2686, 7.2681, 7.2678, 7.2676, 7.2674, 7.2673, 7.2669, 7.2706, 7.2705, 7.2701, 7.2711, 7.2707, 7.2707, 7.2704, 7.2701, 7.2698, 7.2706, 7.2703, 7.2702, 7.2697, 7.2693, 7.269, 7.2686, 7.2683, 7.268, 7.2704, 7.27, 7.2695, 7.2692, 7.2688, 7.2683, 7.2669, 7.2666, 7.2663, 7.2658, 7.2666, 7.2662, 7.2659, 7.2656, 7.2651, 7.266, 7.2656, 7.266, 7.2657, 7.2655, 7.2669, 7.2679, 7.2675, 7.267, 7.2666, 7.2661, 7.2658, 7.2654, 7.2649, 7.2644, 7.2641, 7.2638, 7.264, 7.265, 7.2646, 7.2641, 7.265, 7.2645, 7.2644, 7.2644, 7.2643, 7.2653, 7.2649, 7.2645, 7.2668, 7.2679, 7.2691, 7.269, 7.2676, 7.2662, 7.2671, 7.2667, 7.2664, 7.2662, 7.2657, 7.2653, 7.269, 7.2686, 7.2684, 7.2683, 7.269, 7.2685, 7.2681, 7.2711, 7.2711, 7.2707, 7.2707, 7.2702, 7.2714, 7.2711, 7.272, 7.2715, 7.271, 7.2705, 7.27, 7.2697, 7.2693, 7.2702, 7.2699, 7.2695, 7.2691, 7.2689, 7.2685, 7.268, 7.2678, 7.2676, 7.2672, 7.2658, 7.2655, 7.2651, 7.2651, 7.2647, 7.2658, 7.2653, 7.2664, 7.2661, 7.2659, 7.2655, 7.2652, 7.2647, 7.2642, 7.2652, 7.2648, 7.2657, 7.2655, 7.265, 7.2647, 7.2643, 7.2639, 7.2635, 7.263, 7.2626, 7.2621, 7.2619, 7.2617, 7.2614, 7.2622, 7.262, 7.2618, 7.2615, 7.2612, 7.261, 7.2607, 7.2592, 7.2585, 7.2581, 7.2576, 7.2573, 7.2588, 7.2585, 7.2581, 7.2576, 7.2584, 7.2582, 7.2578, 7.2575, 7.2572, 7.2558, 7.2554, 7.2552, 7.2548, 7.255, 7.255, 7.2572, 7.2568, 7.2566, 7.2562, 7.2558, 7.2555, 7.2541, 7.2528, 7.2526, 7.2522, 7.2518, 7.2502, 7.2489, 7.25, 7.2497, 7.2496, 7.2493, 7.2502, 7.2497, 7.2493, 7.2489, 7.2486, 7.2486, 7.2489, 7.25, 7.2509, 7.2507, 7.2505, 7.2501, 7.2498, 7.2494, 7.2505, 7.2503, 7.2526, 7.2524, 7.2521, 7.2519, 7.2517, 7.2513, 7.2509, 7.2519, 7.2515, 7.2513, 7.2509, 7.2518, 7.2505, 7.2516, 7.2514, 7.2513, 7.2509, 7.2504, 7.2515, 7.254, 7.2548, 7.2547, 7.255, 7.257, 7.2578, 7.2575, 7.2574, 7.2572, 7.2577, 7.2585, 7.2581, 7.2566, 7.2561, 7.2573, 7.2569, 7.2565, 7.2573, 7.2568, 7.2564, 7.2559, 7.2556, 7.2565, 7.2586, 7.2595, 7.2591, 7.2589, 7.2587, 7.2597, 7.2592, 7.2589, 7.2588, 7.2585, 7.2596, 7.2593, 7.259, 7.2587, 7.2585, 7.2582, 7.2582, 7.2578, 7.2576, 7.2572, 7.2581, 7.2577, 7.2586, 7.2585, 7.2582, 7.2581, 7.259, 7.2586, 7.2582, 7.2584, 7.258, 7.2577, 7.2586, 7.2584, 7.2579, 7.2575, 7.2575, 7.2573, 7.2583, 7.2582, 7.2592, 7.2588, 7.2575, 7.2562, 7.2559, 7.2557, 7.2553, 7.2551, 7.2549, 7.2545, 7.2533, 7.2532, 7.2529, 7.2525, 7.2534, 7.253, 7.2527, 7.2524, 7.2524, 7.2519, 7.2516, 7.2525, 7.2521, 7.2519, 7.2516, 7.2511, 7.2507, 7.2502, 7.2511, 7.2508, 7.2505, 7.2501, 7.2497, 7.2494, 7.249, 7.2486, 7.2482, 7.248, 7.2489, 7.2486, 7.2482, 7.2478, 7.2475, 7.2474, 7.247, 7.2467, 7.2463, 7.2462, 7.2459, 7.2458, 7.2455, 7.2452, 7.2439, 7.2435, 7.2434, 7.2442, 7.2439, 7.2435, 7.2431, 7.2427, 7.2424, 7.242, 7.2417, 7.2413, 7.2421, 7.2419, 7.2416, 7.2414, 7.2412, 7.2408, 7.2406, 7.2402, 7.2398, 7.2395, 7.2391, 7.2388, 7.2384, 7.2393, 7.2389, 7.2386, 7.2382, 7.2379, 7.2388, 7.2424, 7.242, 7.2416, 7.2413, 7.2409, 7.2407, 7.2403, 7.2399, 7.2399, 7.2395, 7.2394, 7.239, 7.2388, 7.2385, 7.2383, 7.2392, 7.2391, 7.2389, 7.2387, 7.2383, 7.2379, 7.2388, 7.2373, 7.2383, 7.2393, 7.239, 7.2389, 7.2386, 7.2415, 7.2411, 7.2411, 7.2408, 7.2405, 7.2402, 7.2399, 7.2395, 7.2392, 7.239, 7.2402, 7.2399, 7.2399, 7.2395, 7.2393, 7.2389, 7.2387, 7.2384, 7.2381, 7.2391, 7.2387, 7.2398, 7.2394, 7.2391, 7.2388, 7.2385, 7.2422, 7.242, 7.2421, 7.2418, 7.2427, 7.2423, 7.2452, 7.2451, 7.2449, 7.2446, 7.2444, 7.2447, 7.2445, 7.2454, 7.245, 7.2446, 7.2443, 7.2439, 7.2437, 7.2433, 7.2442, 7.2438, 7.2438, 7.2437, 7.2433, 7.243, 7.2429, 7.2427, 7.2423, 7.2421, 7.2417, 7.2416, 7.2425, 7.2445, 7.2441, 7.245, 7.2446, 7.2444, 7.2441, 7.2437, 7.2445, 7.2441, 7.2438, 7.2425, 7.2434, 7.2434, 7.2433, 7.2429, 7.2429, 7.2426, 7.2423, 7.2419, 7.2417, 7.2413, 7.2402, 7.24, 7.2397, 7.2395, 7.2403, 7.2402, 7.2398, 7.2398, 7.2397, 7.2394, 7.2394, 7.2402, 7.2411, 7.2407, 7.2404, 7.2402, 7.2399, 7.2408, 7.2404, 7.2403, 7.2399, 7.241, 7.2407, 7.2405, 7.2402, 7.24, 7.2398, 7.2396, 7.2392, 7.2389, 7.2386, 7.2383, 7.2381, 7.239, 7.2398, 7.2398, 7.2407, 7.2404, 7.2402, 7.241, 7.2408, 7.2404, 7.2413, 7.241, 7.2419, 7.2418, 7.2414, 7.2423, 7.242, 7.2421, 7.2419, 7.2415, 7.2412, 7.2422, 7.2421, 7.2418, 7.2432, 7.2449, 7.2446, 7.2456, 7.2452, 7.245, 7.245, 7.247, 7.2481, 7.2478, 7.2483, 7.2481, 7.2489, 7.2486, 7.2482, 7.2481, 7.248, 7.2479, 7.2477, 7.2487, 7.2495, 7.2505, 7.2505, 7.2502, 7.2488, 7.2485, 7.2495, 7.2502, 7.2498, 7.2507, 7.2494, 7.2492, 7.2491, 7.2487, 7.2485, 7.2481, 7.2477, 7.2477, 7.2475, 7.2484, 7.2482, 7.2493, 7.2489, 7.2476, 7.2487, 7.2483, 7.2479, 7.2475, 7.2471, 7.2479, 7.2501, 7.2497, 7.2508, 7.2506, 7.2514, 7.251, 7.2518, 7.2516, 7.2514, 7.2512, 7.2508, 7.2519, 7.2538, 7.2536, 7.2524, 7.2521, 7.2519, 7.2518, 7.2514, 7.2511, 7.2508, 7.2504, 7.2501, 7.2498, 7.2495, 7.2495, 7.2492, 7.2492, 7.249, 7.2499, 7.2509, 7.2508, 7.2505, 7.2512, 7.2508, 7.2504, 7.2501, 7.2498, 7.2505, 7.2501, 7.2499, 7.2507, 7.2504, 7.25, 7.2498, 7.2506, 7.2504, 7.25, 7.2497, 7.2493, 7.2501, 7.2498, 7.2494, 7.2494, 7.2492, 7.249, 7.2487, 7.2484, 7.248, 7.2489, 7.2497, 7.2494, 7.2492, 7.2488, 7.2489, 7.2486, 7.2484, 7.2505, 7.2502, 7.2499, 7.2496, 7.2494, 7.2494, 7.2504, 7.2502, 7.2499, 7.2509, 7.2505, 7.2514, 7.2528, 7.2527, 7.2527, 7.2524, 7.2521, 7.2518, 7.2515, 7.2524, 7.2523, 7.252, 7.2517, 7.2514, 7.25, 7.2486, 7.2473, 7.2469, 7.2468, 7.2478, 7.2476, 7.2484, 7.248, 7.2476, 7.2474, 7.247, 7.2468, 7.2466, 7.2464, 7.2462, 7.2459, 7.2457, 7.2453, 7.2462, 7.2459, 7.2457, 7.2465, 7.2462, 7.246, 7.2456, 7.2442, 7.2451, 7.2448, 7.2434, 7.2431, 7.2428, 7.2426, 7.2435, 7.2432, 7.2429, 7.2438, 7.2447, 7.2456, 7.2464, 7.2461, 7.2458, 7.2455, 7.2464, 7.2461, 7.2447, 7.2443, 7.245, 7.2457, 7.2458, 7.2456, 7.2453, 7.2461, 7.246, 7.246, 7.2457, 7.2465, 7.2463, 7.2461, 7.2457, 7.2465, 7.2461, 7.2447, 7.2445, 7.2442, 7.244, 7.2437, 7.2434, 7.2431, 7.2427, 7.2425, 7.2422, 7.2419, 7.2427, 7.2434, 7.2454, 7.2452, 7.2449, 7.2459, 7.2456, 7.2452, 7.246, 7.2458, 7.2466, 7.2462, 7.2449, 7.2446, 7.2443, 7.2451, 7.2447, 7.2443, 7.2451, 7.2449, 7.2447, 7.2444, 7.2432, 7.2428, 7.2425, 7.2449, 7.2458, 7.2454, 7.2451, 7.2448, 7.2456, 7.2448, 7.2436, 7.2433, 7.2441, 7.245, 7.2446, 7.2434, 7.243, 7.2438, 7.2446, 7.2454, 7.2462, 7.247, 7.2467, 7.2464, 7.246, 7.2457, 7.2453, 7.2461, 7.2469, 7.2476, 7.2472, 7.2468, 7.2479, 7.2476, 7.2476, 7.2475, 7.2478, 7.2476, 7.2484, 7.2491, 7.2487, 7.2486, 7.2493, 7.249, 7.2488, 7.2485, 7.2482, 7.2513, 7.2511, 7.251, 7.2507, 7.2504, 7.25, 7.2498, 7.2494, 7.2492, 7.2489, 7.2486, 7.2484, 7.2481, 7.2478, 7.2474, 7.2471, 7.2469, 7.2477, 7.2474, 7.2472, 7.2469, 7.2468, 7.2467, 7.2464, 7.2461, 7.2458, 7.2466, 7.2464, 7.2461, 7.246, 7.2469, 7.2465, 7.2473, 7.2482, 7.248, 7.2477, 7.2474, 7.2483, 7.248, 7.2487, 7.2485, 7.2481, 7.2478, 7.2475, 7.2472, 7.2469, 7.2465, 7.2473, 7.2469, 7.2466, 7.2474, 7.2471, 7.2468, 7.2465, 7.2462, 7.2458, 7.2454, 7.2441, 7.2439, 7.2436, 7.2434, 7.243, 7.2427, 7.2437, 7.2436, 7.2436, 7.2433, 7.2429, 7.2426, 7.2434, 7.243, 7.2426, 7.2423, 7.242, 7.2418, 7.2415, 7.2413, 7.2421, 7.2417, 7.2416, 7.2414, 7.2411, 7.2409, 7.2407, 7.2406, 7.2407, 7.2404, 7.2401, 7.2399, 7.2397, 7.2394, 7.239, 7.2398, 7.2406, 7.2404, 7.2413, 7.2422, 7.2419, 7.2416, 7.2413, 7.2414, 7.2421, 7.2418, 7.2417, 7.2425, 7.2438, 7.2445, 7.2442, 7.244, 7.2442, 7.2439, 7.2436, 7.2445, 7.2453, 7.245, 7.2458, 7.2455, 7.2463, 7.2461, 7.2457, 7.2456, 7.2454, 7.2464, 7.2473, 7.2471, 7.247, 7.2467, 7.2466, 7.2474, 7.2471, 7.2467, 7.2464, 7.2461, 7.2459, 7.2459, 7.2455, 7.2452, 7.245, 7.2457, 7.2455, 7.2444, 7.2442, 7.2441, 7.2437, 7.2433, 7.2429, 7.2438, 7.2436, 7.2433, 7.2445, 7.2454, 7.245, 7.2447, 7.2443, 7.2442, 7.244, 7.2436, 7.2423, 7.241, 7.2408, 7.2419, 7.2407, 7.2403, 7.2412, 7.2419, 7.2426, 7.2435, 7.2432, 7.2429, 7.2436, 7.2445, 7.2433, 7.2448, 7.2445, 7.2452, 7.2449, 7.2448, 7.2445, 7.2453, 7.245, 7.2458, 7.2455, 7.2452, 7.2449, 7.2449, 7.2445, 7.2442, 7.2444, 7.2442, 7.2431, 7.2438, 7.2446, 7.2442, 7.243, 7.2446, 7.2443, 7.2442, 7.2439, 7.2437, 7.2433, 7.2421, 7.241, 7.2407, 7.2394, 7.239, 7.239, 7.2387, 7.2388, 7.2386, 7.2382, 7.238, 7.2378, 7.238, 7.2378, 7.2386, 7.2383, 7.2381, 7.2378, 7.2387, 7.2384, 7.2383, 7.2382, 7.2379, 7.2377, 7.2373, 7.238, 7.2392, 7.2401, 7.2398, 7.2395, 7.2393, 7.2389, 7.2387, 7.2383, 7.238, 7.2378, 7.2375, 7.2371, 7.2368, 7.2386, 7.2383, 7.238, 7.238, 7.2377, 7.2373, 7.2373, 7.2376, 7.2364, 7.2352, 7.2341, 7.2328, 7.2325, 7.2322, 7.2319, 7.2317, 7.2314, 7.2318, 7.2315, 7.2315, 7.2312, 7.2309, 7.2317, 7.2314, 7.2311, 7.2308, 7.2304, 7.2302, 7.2302, 7.231, 7.2317, 7.2324, 7.2321, 7.2317, 7.2315, 7.2312, 7.2308, 7.2307, 7.2304, 7.2302, 7.2309, 7.2306, 7.2304, 7.2303, 7.231, 7.2306, 7.2304, 7.2303, 7.2311, 7.231, 7.2306, 7.2303, 7.2299, 7.2295, 7.2302, 7.23, 7.2298, 7.2294, 7.229, 7.2289, 7.2286, 7.2283, 7.2281, 7.2277, 7.2283, 7.2291, 7.2298, 7.2294, 7.2291, 7.2288, 7.2284, 7.2283, 7.2281, 7.2278, 7.2274, 7.2271, 7.2268, 7.2266, 7.2265, 7.2265, 7.2262, 7.2258, 7.2266, 7.2264, 7.2261, 7.225, 7.2238, 7.2226, 7.2234, 7.2241, 7.2238, 7.2235, 7.2232, 7.2229, 7.2226, 7.2225, 7.2213, 7.2211, 7.2219, 7.2221, 7.2219, 7.2229, 7.2238, 7.2238, 7.2235, 7.2234, 7.2231, 7.2235, 7.2234, 7.2242, 7.2239, 7.2247, 7.2243, 7.224, 7.2238, 7.2236, 7.2245, 7.2253, 7.225, 7.2257, 7.2264, 7.2263, 7.2261, 7.2271, 7.2269, 7.2266, 7.2274, 7.2273, 7.2269, 7.2259, 7.2294, 7.2336, 7.2324, 7.2327, 7.2334, 7.2341, 7.2348, 7.2347, 7.2346, 7.2344, 7.2342, 7.233, 7.2327, 7.2324, 7.2321, 7.233, 7.2339, 7.2338, 7.2336, 7.2333, 7.233, 7.2327, 7.2324, 7.2321, 7.2318, 7.2326, 7.2323, 7.232, 7.2319, 7.2326, 7.2325, 7.2322, 7.2321, 7.2319, 7.2317, 7.2315, 7.2312, 7.2309, 7.2306, 7.2314, 7.2312, 7.231, 7.2317, 7.2314, 7.2311, 7.2309, 7.2306, 7.2303, 7.23, 7.2297, 7.2296, 7.2293, 7.2289, 7.2277, 7.2276, 7.2269, 7.2266, 7.2273, 7.2281, 7.2277, 7.2273, 7.228, 7.2277, 7.2274, 7.227, 7.2269, 7.2265, 7.2263, 7.2271, 7.2261, 7.2259, 7.2256, 7.2254, 7.2253, 7.225, 7.2248, 7.2245, 7.2252, 7.224, 7.2237, 7.2234, 7.2231, 7.2228, 7.2225, 7.2222, 7.2218, 7.2216, 7.2213, 7.2219, 7.2219, 7.2216, 7.2203, 7.2199, 7.2195, 7.2192, 7.2189, 7.2187, 7.2183, 7.2182, 7.2181, 7.2179, 7.2176, 7.2173, 7.217, 7.2167, 7.2165, 7.2162, 7.2162, 7.217, 7.2168, 7.2166, 7.2164, 7.2161, 7.217, 7.2169, 7.2166, 7.2174, 7.2172, 7.2168, 7.2165, 7.2166, 7.2162, 7.217, 7.2167, 7.2164, 7.216, 7.2156, 7.2153, 7.2152, 7.216, 7.2157, 7.2156, 7.2154, 7.2151, 7.2159, 7.2157, 7.2155, 7.2164, 7.216, 7.2158, 7.2155, 7.2163, 7.2161, 7.2158, 7.2156, 7.2172, 7.2179, 7.2177, 7.2177, 7.2174, 7.2171, 7.2167, 7.2165, 7.2162, 7.2179, 7.2177, 7.2174, 7.2171, 7.2159, 7.2156, 7.2163, 7.216, 7.2159, 7.2155, 7.2152, 7.2151, 7.2149, 7.2138, 7.2135, 7.2133, 7.213, 7.2127, 7.2125, 7.2123, 7.2121, 7.2119, 7.2116, 7.2114, 7.2122, 7.2119, 7.2116, 7.2114, 7.2111, 7.2109, 7.2117, 7.2105, 7.2103, 7.2101, 7.2109, 7.2106, 7.2104, 7.2101, 7.2098, 7.2096, 7.2094, 7.2091, 7.2089, 7.2079, 7.2093, 7.2089, 7.2088, 7.2087, 7.2084, 7.2081, 7.2071, 7.2059, 7.2056, 7.2063, 7.2061, 7.2063, 7.206, 7.2056, 7.2064, 7.2061, 7.2058, 7.2057, 7.2054, 7.2052, 7.205, 7.2049, 7.2049, 7.2039, 7.2047, 7.2055, 7.2053, 7.2051, 7.2068, 7.2056, 7.2053, 7.2061, 7.2069, 7.2066, 7.2064, 7.2071, 7.206, 7.2059, 7.2067, 7.2064, 7.2061, 7.2059, 7.2057, 7.2066, 7.2063, 7.206, 7.2058, 7.2055, 7.2051, 7.2049, 7.2037, 7.2036, 7.2033, 7.204, 7.2037, 7.2037, 7.2034, 7.2043, 7.2049, 7.2058, 7.2056, 7.2063, 7.2052, 7.205, 7.2047, 7.2054, 7.2062, 7.2058, 7.2056, 7.2054, 7.2051, 7.2048, 7.2038, 7.2037, 7.2035, 7.2042, 7.204, 7.2037, 7.2033, 7.2031, 7.2028, 7.2027, 7.2024, 7.2059, 7.2058, 7.2057, 7.2055, 7.2055, 7.2064, 7.2061, 7.2058, 7.2057, 7.2055, 7.2053, 7.2051, 7.206, 7.2057, 7.2055, 7.2053, 7.2066, 7.2068, 7.2064, 7.2062, 7.206, 7.2058, 7.2055, 7.2063, 7.206, 7.2058, 7.2055, 7.2053, 7.2051, 7.205, 7.2057, 7.2056, 7.2053, 7.2051, 7.2048, 7.2055, 7.2052, 7.2052, 7.2049, 7.2046, 7.2054, 7.2052, 7.2064, 7.2062, 7.2059, 7.2057, 7.2065, 7.2073, 7.2081, 7.2079, 7.2075, 7.2073, 7.2071, 7.2071, 7.2068, 7.2077, 7.2084, 7.2081, 7.2078, 7.2077, 7.208, 7.2079, 7.2078, 7.2076, 7.2083, 7.2081, 7.2079, 7.2077, 7.2085, 7.2082, 7.2081, 7.2081, 7.2089, 7.2086, 7.2083, 7.2084, 7.2082, 7.2079, 7.2077, 7.2084, 7.2083, 7.2079, 7.2076, 7.2074, 7.2073, 7.207, 7.2068, 7.2066, 7.2063, 7.206, 7.2057, 7.2054, 7.2054, 7.2061, 7.2068, 7.2067, 7.2064, 7.2062, 7.2059, 7.2048, 7.2045, 7.2043, 7.2042, 7.2039, 7.2037, 7.2037, 7.2026, 7.2025, 7.2023, 7.202, 7.2017, 7.2025, 7.2033, 7.204, 7.2037, 7.2034, 7.2031, 7.2038, 7.2035, 7.2041, 7.2038, 7.2046, 7.2053, 7.2057, 7.2057, 7.2073, 7.2072, 7.2071, 7.2071, 7.2068, 7.2069, 7.2068, 7.2065, 7.2065, 7.2067, 7.2065, 7.2063, 7.2062, 7.206, 7.2058, 7.2055, 7.2063, 7.206, 7.2057, 7.2066, 7.2073, 7.207, 7.2067, 7.2064, 7.2061, 7.2051, 7.2044, 7.2041, 7.2047, 7.2044, 7.2043, 7.2051, 7.2049, 7.2046, 7.2053, 7.205, 7.2047, 7.2044, 7.2041, 7.2038, 7.2035, 7.2032, 7.2031, 7.2061, 7.2068, 7.2067, 7.2064, 7.207, 7.2068, 7.2065, 7.2062, 7.206, 7.2057, 7.2064, 7.2079, 7.2088, 7.2085, 7.2082, 7.2088, 7.2085, 7.2103, 7.2111, 7.2109, 7.211, 7.2109, 7.2115, 7.2112, 7.2109, 7.2107, 7.2104, 7.2102, 7.2108, 7.2115, 7.2112, 7.2113, 7.2113, 7.2122, 7.212, 7.2117, 7.2114, 7.2125, 7.2123, 7.212, 7.2118, 7.2115, 7.2112, 7.2111, 7.2118, 7.2115, 7.2114, 7.2112, 7.2109, 7.2107, 7.2104, 7.2092, 7.2091, 7.209, 7.2087, 7.2084, 7.2081, 7.208, 7.2086, 7.2086, 7.2083, 7.208, 7.2077, 7.2074, 7.2073, 7.2079, 7.2076, 7.2083, 7.208, 7.2078, 7.2075, 7.2073, 7.207, 7.2068, 7.2074, 7.2071, 7.2069, 7.2066, 7.2063, 7.2061, 7.2077, 7.2074, 7.2071, 7.2068, 7.2067, 7.2057, 7.2055, 7.2053, 7.2051, 7.2048, 7.2047, 7.2055, 7.2054, 7.2052, 7.2051, 7.2058, 7.2056, 7.2074, 7.2086, 7.2092, 7.2091, 7.2089, 7.2087, 7.2085, 7.2085, 7.2091, 7.2097, 7.2094, 7.2091, 7.2088, 7.2086, 7.2082, 7.208, 7.2087, 7.2086, 7.2103, 7.2102, 7.21, 7.2097, 7.2094, 7.2085, 7.2082, 7.2081, 7.2079, 7.2076, 7.2073, 7.207, 7.2067, 7.2064, 7.2061, 7.2068, 7.2057, 7.2046, 7.2053, 7.205, 7.2047, 7.2046, 7.2053, 7.2052, 7.2049, 7.2046, 7.2052, 7.2067, 7.2065, 7.2063, 7.2061, 7.2059, 7.2058, 7.2056, 7.2063, 7.206, 7.2057, 7.2054, 7.2052, 7.2049, 7.2047, 7.2045, 7.2042, 7.2039, 7.2028, 7.2038, 7.2037, 7.204700000000001, 7.2046, 7.2052, 7.205, 7.2048, 7.2047, 7.2046, 7.2043, 7.2041, 7.2038, 7.2035, 7.2033, 7.203, 7.2028, 7.2038, 7.2048000000000005, 7.2046, 7.2043, 7.204, 7.2037, 7.2045, 7.2042, 7.2039, 7.2045, 7.2043, 7.2042, 7.2039, 7.2036, 7.2062, 7.2069, 7.2077, 7.2093, 7.209, 7.2098, 7.2098, 7.2095, 7.2094, 7.2091, 7.2088, 7.2085, 7.2085, 7.2112, 7.211, 7.2107, 7.2104, 7.2111, 7.2109, 7.2107, 7.2108, 7.2126, 7.2126, 7.2123, 7.2122, 7.212, 7.2128, 7.2136, 7.2134, 7.2132, 7.213, 7.2129, 7.2127, 7.2125, 7.2122, 7.2121, 7.2119, 7.2118, 7.2116, 7.2116, 7.2124, 7.2122, 7.2121, 7.2129, 7.2127, 7.2129, 7.2126, 7.2124, 7.2114, 7.2114, 7.2111, 7.211, 7.2108, 7.2106, 7.2104, 7.2101, 7.2099, 7.2097, 7.2095, 7.2095, 7.2094, 7.2092, 7.21, 7.2097, 7.2095, 7.2093, 7.2102, 7.2102, 7.21, 7.2097, 7.2106, 7.2107, 7.2105, 7.2102, 7.2099, 7.2096, 7.2107, 7.2114, 7.2105, 7.2103, 7.21, 7.21, 7.2102, 7.2109, 7.2116, 7.2113, 7.2112, 7.212, 7.2128, 7.2125, 7.2132, 7.2131, 7.2137, 7.2144, 7.2142, 7.214, 7.2138, 7.2144, 7.2152, 7.215, 7.2157, 7.2164, 7.2171, 7.2169, 7.2177, 7.2184, 7.2182, 7.2181, 7.2181, 7.2181, 7.2181, 7.2178, 7.2176, 7.2173, 7.2171, 7.217, 7.2168, 7.2166, 7.2165, 7.2162, 7.2159, 7.2156, 7.2153, 7.2143, 7.2132, 7.2122, 7.212, 7.2118, 7.2116, 7.2114, 7.2114, 7.2111, 7.2112, 7.211, 7.2117, 7.2115, 7.2114, 7.2112, 7.2112, 7.2119, 7.2117, 7.2123, 7.2122, 7.2119, 7.2117, 7.2115, 7.2113, 7.2113, 7.2111, 7.2108, 7.2108, 7.2115, 7.2113, 7.2111, 7.2117, 7.2115, 7.2106, 7.2153, 7.2152, 7.215, 7.2148, 7.2147, 7.2148, 7.2149, 7.2146, 7.2144, 7.2143, 7.214, 7.2138, 7.2137, 7.2134, 7.2131, 7.2128, 7.2125, 7.2123, 7.2121, 7.2119, 7.2117, 7.2114, 7.2113, 7.2111, 7.2109, 7.2108, 7.2105, 7.2102, 7.21, 7.2106, 7.2104, 7.2094, 7.2092, 7.2089, 7.2087, 7.2093, 7.2092, 7.2092, 7.2091, 7.2098, 7.2095, 7.2093, 7.209, 7.2087, 7.2093, 7.2091, 7.208, 7.2077, 7.2076, 7.2082, 7.2079, 7.2081, 7.2079, 7.2077, 7.2075, 7.2073, 7.2071, 7.2069, 7.2059, 7.2048, 7.2038, 7.2027, 7.2017, 7.2014, 7.2012, 7.2018, 7.2015, 7.2012, 7.201, 7.2017, 7.2014, 7.2013, 7.202, 7.2026, 7.2023, 7.2029, 7.2027, 7.2025, 7.2024, 7.2022, 7.2023, 7.202, 7.2017, 7.2016, 7.2013, 7.201, 7.2008, 7.2013, 7.2023, 7.2021, 7.2019, 7.2016, 7.2015, 7.2012, 7.2009, 7.2008, 7.2006, 7.2006, 7.2006, 7.2004, 7.201, 7.2007, 7.2005, 7.2003, 7.2001, 7.1999, 7.1997, 7.1996, 7.1993, 7.201, 7.2007, 7.1998, 7.2004, 7.2002, 7.2, 7.1997, 7.1994, 7.1992, 7.1999, 7.1996, 7.1993, 7.199, 7.1988, 7.1985, 7.1983, 7.1974, 7.1972, 7.1971, 7.197, 7.1969, 7.1977, 7.1975, 7.1973, 7.1972, 7.197, 7.1977, 7.1974, 7.1972, 7.1978, 7.1985, 7.1984, 7.1982, 7.198, 7.1987, 7.1985, 7.1985, 7.1995000000000005, 7.1993, 7.2008, 7.2032, 7.2039, 7.2047, 7.2046, 7.2053, 7.2051, 7.2048, 7.2045, 7.2044, 7.2042, 7.204, 7.2038, 7.2038, 7.2046, 7.2052, 7.2051, 7.2049, 7.2047, 7.2045, 7.2047, 7.2054, 7.2051, 7.2048, 7.2045, 7.2045, 7.2051, 7.2048, 7.2046, 7.2045, 7.2044, 7.2056, 7.2053, 7.206, 7.2059, 7.2065, 7.2071, 7.2068, 7.2066, 7.2063, 7.206, 7.2057, 7.2055, 7.2061, 7.2077, 7.2084, 7.2082, 7.2079, 7.208, 7.2078, 7.2086, 7.2078, 7.2078, 7.2076, 7.2076, 7.2073, 7.208, 7.207, 7.206, 7.2051, 7.2058, 7.2056, 7.2054, 7.2063, 7.2054, 7.2052, 7.2049, 7.2046, 7.2043, 7.205, 7.2047, 7.2044, 7.2044, 7.2042, 7.2049, 7.2048, 7.2045, 7.2051, 7.2049, 7.2046, 7.2046, 7.2061, 7.206, 7.2057, 7.2056, 7.2053, 7.2051, 7.2057, 7.2055, 7.2054, 7.2044, 7.2041, 7.2038, 7.2037, 7.2037, 7.2027, 7.2025, 7.2027, 7.2026, 7.2023, 7.2013, 7.2022, 7.2019, 7.2016, 7.2014, 7.2013, 7.201, 7.2007, 7.2006, 7.2004, 7.2002, 7.2001, 7.1999, 7.1998, 7.1997, 7.1995, 7.1994, 7.1992, 7.1984, 7.1974, 7.1972, 7.1979, 7.1976, 7.1982, 7.1988, 7.1985, 7.1983, 7.1981, 7.1978, 7.1976, 7.1974, 7.1965, 7.1971, 7.1969, 7.1977, 7.1968, 7.1968, 7.1967, 7.1967, 7.1958, 7.1956, 7.1953, 7.1951, 7.1958, 7.1956, 7.1954, 7.1944, 7.1943, 7.194, 7.194, 7.1939, 7.1938, 7.1944, 7.1941, 7.1941, 7.1948, 7.1947, 7.1954, 7.1961, 7.1959, 7.1966, 7.1965, 7.1956, 7.1955, 7.1954, 7.1954, 7.1951, 7.1951, 7.1958, 7.1991, 7.1999, 7.2001, 7.2007, 7.2005, 7.2012, 7.2009, 7.2008, 7.2006, 7.2004, 7.2003, 7.2009, 7.2008, 7.2006, 7.2005, 7.2003, 7.2008, 7.2014, 7.2012, 7.201, 7.2016, 7.2014, 7.202, 7.2018, 7.2024, 7.2023, 7.2029, 7.2026, 7.2033, 7.2031, 7.2029, 7.2026, 7.2032, 7.203, 7.2028, 7.2018, 7.2016, 7.2005, 7.2004, 7.2003, 7.2, 7.1998, 7.1995, 7.1994, 7.1991, 7.1989, 7.1986, 7.1984, 7.1982, 7.1979, 7.1977, 7.1974, 7.1973, 7.197, 7.1968, 7.1967, 7.1965, 7.1962, 7.196, 7.1957, 7.1959, 7.1957, 7.1964, 7.1962, 7.1959, 7.1956, 7.1957, 7.1964, 7.1964, 7.1978, 7.1975, 7.1973, 7.197, 7.1968, 7.1966, 7.1965, 7.1963, 7.1961, 7.1959, 7.1958, 7.1956, 7.1963, 7.1969, 7.1975, 7.1981, 7.1979, 7.1984, 7.1983, 7.198, 7.1977, 7.1974, 7.1973, 7.1972, 7.1969, 7.1967, 7.1965, 7.1962, 7.1959, 7.1957, 7.1954, 7.1951, 7.1948, 7.1946, 7.1945, 7.1944, 7.1942, 7.194, 7.1946, 7.1943, 7.1942, 7.194, 7.1937, 7.194, 7.1938, 7.1938, 7.1936, 7.1942, 7.1948, 7.1946, 7.1944, 7.1942, 7.1942, 7.1941, 7.1939, 7.1947, 7.1944, 7.1942, 7.194, 7.194, 7.1938, 7.1951, 7.1958, 7.1975, 7.1982, 7.1976, 7.1988, 7.1986, 7.1987, 7.1997, 7.2004, 7.201, 7.2007, 7.2004, 7.2002, 7.1999, 7.2005, 7.2005, 7.2002, 7.1999, 7.1998, 7.1997, 7.1997, 7.1994, 7.1992, 7.1989, 7.1986, 7.1984, 7.1982, 7.1979, 7.1978, 7.1976, 7.1975, 7.198, 7.1978, 7.1976, 7.1973, 7.197, 7.1975, 7.1973, 7.1979, 7.1977, 7.1976, 7.1975, 7.1973, 7.197, 7.1967, 7.1965, 7.1971, 7.1968, 7.1965, 7.1963, 7.1961, 7.1967, 7.1964, 7.1965, 7.1962, 7.1963, 7.1962, 7.1959, 7.1957, 7.1955, 7.1954, 7.1961, 7.1967, 7.1965, 7.1972, 7.197, 7.1969, 7.1968, 7.1966, 7.1964, 7.197, 7.1969, 7.1968, 7.1967, 7.1965, 7.1963, 7.197, 7.1969, 7.1967, 7.1967, 7.1964, 7.1961, 7.1959, 7.1957, 7.1954, 7.1952, 7.1949, 7.1955, 7.1953, 7.1952, 7.1949, 7.1948, 7.1946, 7.1944, 7.1943, 7.194, 7.1939, 7.1937, 7.1934, 7.1933, 7.193, 7.1927, 7.1933, 7.1931, 7.1928, 7.1925, 7.1925, 7.1922, 7.1921, 7.1918, 7.1917, 7.1923, 7.192, 7.1918, 7.1915, 7.1921, 7.1927, 7.1934, 7.194, 7.1937, 7.1935, 7.1941, 7.1938, 7.1935, 7.1933, 7.194, 7.1938, 7.1937, 7.1935, 7.1934, 7.1934, 7.1932, 7.1929, 7.1928, 7.1934, 7.1932, 7.1938, 7.1937, 7.1943, 7.1941, 7.1941, 7.1938, 7.1935, 7.1938, 7.1935, 7.1932, 7.1929, 7.1927, 7.1926, 7.1932, 7.1932, 7.193, 7.1928, 7.1927, 7.1925, 7.1926, 7.1926, 7.1925, 7.1923, 7.1921, 7.193, 7.1943, 7.1941, 7.194, 7.1938, 7.1944, 7.1942, 7.1949, 7.1949, 7.1947, 7.1945, 7.1943, 7.1941, 7.1939, 7.1937, 7.1936, 7.1933, 7.1931, 7.1931, 7.1929, 7.1935, 7.1934, 7.1932, 7.1925, 7.1923, 7.1921, 7.1928, 7.1934, 7.1946, 7.1944, 7.1942, 7.194, 7.1946, 7.1943, 7.1942, 7.1951, 7.1949, 7.1955, 7.1958, 7.1956, 7.1962, 7.196, 7.196, 7.1969, 7.1967, 7.1964, 7.197, 7.1967, 7.1964, 7.1987, 7.1984, 7.199, 7.1996, 7.1995, 7.1992, 7.199, 7.1996, 7.2026, 7.2032, 7.2045, 7.2042, 7.204, 7.2037, 7.2042, 7.204, 7.2038, 7.2035, 7.2032, 7.2029, 7.2034, 7.2031, 7.2028, 7.2025, 7.2023, 7.2036, 7.2042, 7.2039, 7.2044, 7.2046, 7.2048, 7.2046, 7.2046, 7.2045, 7.2043, 7.2041, 7.2038, 7.2036, 7.2034, 7.2032, 7.203, 7.2028, 7.2027, 7.2026, 7.2023, 7.202, 7.202, 7.2019, 7.2016, 7.2014, 7.2011, 7.2009, 7.2001, 7.1999, 7.201, 7.2008, 7.2006, 7.2004, 7.2001, 7.2008, 7.2006, 7.2007, 7.2004, 7.1997, 7.2003, 7.2009, 7.2024, 7.2021, 7.2019, 7.2017, 7.2014, 7.2012, 7.201, 7.2007, 7.1997, 7.2003, 7.2, 7.1997, 7.1995, 7.1993, 7.1998, 7.2005, 7.2004, 7.2009, 7.2025, 7.2022, 7.2028, 7.2033, 7.2039, 7.2039, 7.2049, 7.2047, 7.2053, 7.2052, 7.2058, 7.2055, 7.2065, 7.2063, 7.2068, 7.2065, 7.2063, 7.2061, 7.206, 7.2058, 7.2055, 7.2053, 7.2058, 7.2056, 7.2054, 7.2052, 7.2057, 7.2063, 7.2061, 7.2066, 7.2064, 7.2062, 7.2059, 7.2057, 7.2055, 7.206, 7.2065, 7.2056, 7.2053, 7.205, 7.2047, 7.2052, 7.2049, 7.2046, 7.2051, 7.2056, 7.2053, 7.205, 7.2048, 7.2046, 7.2044, 7.2042, 7.2047, 7.2044, 7.2042, 7.204, 7.2045, 7.2043, 7.2049, 7.2048, 7.2045, 7.2043, 7.204, 7.2039, 7.2036, 7.2033, 7.2039, 7.2036, 7.2042, 7.204, 7.2039, 7.2045, 7.2051, 7.2048, 7.2061, 7.2066, 7.2064, 7.207, 7.2075, 7.2073, 7.2071, 7.2069, 7.2066, 7.2064, 7.2062, 7.2092, 7.2089, 7.2095, 7.2097, 7.2094, 7.2092, 7.2114, 7.212, 7.2118, 7.2117, 7.2114, 7.2114, 7.2121, 7.2119, 7.2124, 7.2122, 7.2131, 7.2123, 7.2129, 7.2128, 7.2126, 7.2124, 7.2124, 7.2132, 7.2151, 7.2157, 7.2155, 7.2153, 7.215, 7.2148, 7.2147, 7.2165, 7.2165, 7.217, 7.2168, 7.2166, 7.2164, 7.217, 7.2176, 7.22, 7.2192, 7.2189], '192.168.122.113': [5.6195, 5.4783, 5.5253, 5.5977, 5.5827, 6.5141, 6.4418, 6.4432, 6.9594, 7.4582, 7.3164, 7.1822, 7.1415, 7.3162, 7.2297, 7.1628, 7.0961, 6.9994, 6.9561, 6.9104, 6.8447, 6.7863, 6.7342, 6.7358, 6.7597, 7.158, 7.0944, 7.0366, 7.0083, 6.981, 6.9465, 6.9447, 7.4037, 7.6664, 7.7659, 7.7283, 7.6816, 7.6543, 7.6056, 7.7844, 7.7372, 7.7163, 7.6631, 7.6138, 7.5745, 7.6394, 7.6038, 7.6744, 7.6475, 7.6036, 7.5838, 7.5517, 7.5101, 7.3811, 7.4372, 7.4116, 7.3869, 7.3795, 7.3571, 7.3293, 7.3863, 7.3577, 7.3308, 7.3091, 7.2792, 7.2682, 7.2496, 7.3042, 7.3555, 7.3252, 7.3014, 7.279, 7.3354, 7.3186, 7.3089, 7.308, 7.2245, 7.2109, 7.2028, 7.2589, 7.2418, 7.2208, 7.2104, 7.188, 7.1773, 7.1637, 7.1487, 7.1341, 7.1145, 7.0988, 7.0798, 7.0604, 7.0564, 7.0473, 7.0365, 7.0203, 7.0091, 6.9957, 6.9795, 6.9649, 7.0012, 7.0401, 7.0861, 7.0847, 7.1215, 7.1553, 7.1377, 7.1225, 7.1057, 7.1119, 7.0954, 7.1295, 7.1239, 7.1071, 7.1087, 7.0963, 7.0828, 7.0676, 7.0552, 7.0441, 7.0322, 7.0699, 7.0614, 7.0468, 7.0878, 7.0769, 7.0685, 7.1004, 7.0949, 7.0898, 7.0756, 7.0689, 7.0938, 7.0898, 7.076, 7.0699, 7.0599, 7.0883, 7.0779, 7.0709, 7.0725, 7.0624, 7.0577, 7.0829, 7.0806, 7.0709, 7.0618, 7.0513, 7.0486, 7.0465, 7.0393, 7.0343, 7.0597, 7.0574, 7.061, 7.0516, 7.0403, 7.036, 7.0302, 7.0222, 7.0451, 7.0132, 7.0198, 7.009, 6.9982, 6.9878, 7.0128, 7.0057, 7.0307, 7.0238, 7.014, 7.0376, 7.1053, 7.1262, 7.1158, 7.1061, 7.0962, 7.0922, 7.0846, 7.0785, 7.0793, 7.073, 7.0636, 7.0543, 7.0522, 7.1103, 7.1014, 7.0993, 7.1202, 7.1409, 7.1376, 7.1308, 7.1511, 7.1432, 7.1381, 7.1593, 7.1538, 7.1739, 7.1699, 7.1896, 7.1815, 7.2032, 7.1947, 7.1894, 7.1839, 7.1789, 7.1771, 7.1777, 7.1715, 7.1656, 7.1585, 7.1554, 7.1501, 7.1426, 7.1388, 7.1318, 7.1279, 7.1254, 7.1436, 7.1361, 7.1318, 7.1306, 7.1229, 7.1419, 7.1367, 7.1299, 7.1226, 7.1156, 7.1108, 7.1073, 7.1057, 7.0991, 7.0941, 7.112, 7.113, 7.1264, 7.1239, 7.1162, 7.1122, 7.1484, 7.1406, 7.1387, 7.1361, 7.1514, 7.1459, 7.139, 7.1334, 7.1337, 7.1313, 7.1254, 7.1443, 7.159, 7.1569, 7.1501, 7.1508, 7.1514, 7.1482, 7.1637, 7.1619, 7.1576, 7.1746, 7.1697, 7.187, 7.1818, 7.1829, 7.1801, 7.196, 7.1909, 7.1901, 7.1854, 7.1783, 7.1731, 7.1703, 7.169, 7.1646, 7.161, 7.1585, 7.1537, 7.1488, 7.1465, 7.1438, 7.1214, 7.117, 7.112, 7.1058, 7.1012, 7.0988, 7.0935, 7.0885, 7.0845, 7.0962, 7.0901, 7.0853, 7.0994, 7.0949, 7.1107, 7.1097, 7.1078, 7.1028, 7.0966, 7.0916, 7.089, 7.0834, 7.0808, 7.0782, 7.0757, 7.0748, 7.0752, 7.0877, 7.0856, 7.082, 7.0791, 7.078, 7.0757, 7.0912, 7.0885, 7.0874, 7.0838, 7.0798, 7.0834, 7.098, 7.1006, 7.1186, 7.1337, 7.1471, 7.1419, 7.1373, 7.1343, 7.1304, 7.128, 7.1243, 7.1358, 7.1302, 7.1254, 7.1234, 7.1178, 7.114, 7.1089, 7.1234, 7.1202, 7.1161, 7.1151, 7.1097, 7.1078, 7.12, 7.1172, 7.1166, 7.112, 7.1112, 7.1062, 7.1054, 7.1007, 7.0991, 7.0943, 7.0899, 7.0848, 7.0827, 7.0817, 7.0791, 7.0753, 7.0793, 7.0788, 7.079, 7.0764, 7.0881, 7.0836, 7.0791, 7.0769, 7.0779000000000005, 7.106, 7.1018, 7.0997, 7.098, 7.0933, 7.0883, 7.0849, 7.0834, 7.0809, 7.0674, 7.0631, 7.0609, 7.0574, 7.0529, 7.0483, 7.0456, 7.0432, 7.0448, 7.0411, 7.0424, 7.0801, 7.0761, 7.0721, 7.0698, 7.0674, 7.1485, 7.1442, 7.14, 7.1373, 7.135, 7.1442, 7.1398, 7.1496, 7.1595, 7.1435, 7.141, 7.1371, 7.1389, 7.1393, 7.1354, 7.1318, 7.1316, 7.1294, 7.1248, 7.1349, 7.1324, 7.1285, 7.1257, 7.1245, 7.1206, 7.1186, 7.1148, 7.1116, 7.1223, 7.1198, 7.1217, 7.1188, 7.1155, 7.1164, 7.1302, 7.1393, 7.167, 7.1629, 7.1597, 7.1597, 7.1572, 7.1538, 7.1633, 7.1679, 7.164, 7.1611, 7.1597, 7.1572, 7.1546, 7.1519, 7.1482, 7.1707, 7.1942, 7.1833, 7.183, 7.1788, 7.1757, 7.1846, 7.1939, 7.1906, 7.187, 7.2038, 7.204, 7.2009, 7.1987, 7.1974, 7.1944, 7.1911, 7.187, 7.1836, 7.1806, 7.1776, 7.1784, 7.1752, 7.1715, 7.1692, 7.1673, 7.1753, 7.172, 7.1683, 7.1648, 7.173, 7.1808, 7.1772, 7.1872, 7.2115, 7.2082, 7.2157, 7.213, 7.2114, 7.2091, 7.2058, 7.2024, 7.2009, 7.1988, 7.195, 7.193, 7.19, 7.1867, 7.1828, 7.181, 7.1773, 7.1847, 7.1808, 7.1774, 7.1752, 7.1739, 7.1712, 7.1691, 7.1654, 7.1627, 7.1604, 7.158, 7.1559, 7.1537, 7.1612, 7.159, 7.1589, 7.1571, 7.1544, 7.1522, 7.152, 7.1489, 7.1489, 7.1474, 7.1486, 7.1575, 7.1552, 7.1535, 7.1617, 7.159, 7.1666, 7.166, 7.1631, 7.1607, 7.1584, 7.1653, 7.1654, 7.1621, 7.1586, 7.1587, 7.157, 7.1543, 7.1517, 7.1498, 7.158, 7.1549, 7.1559, 7.1527, 7.1608, 7.1578, 7.1569, 7.1552, 7.1526, 7.1504, 7.1471, 7.1438, 7.1419, 7.1385, 7.1364, 7.1359, 7.1328, 7.1295, 7.1264, 7.1337, 7.1311, 7.129, 7.1259, 7.1361, 7.1432, 7.1429, 7.1398, 7.1391, 7.1465, 7.146, 7.1435, 7.1409, 7.1483, 7.1466, 7.1527, 7.1514, 7.148, 7.1543, 7.1512, 7.1572, 7.1549, 7.1615, 7.1602, 7.1569, 7.1548, 7.1608, 7.1589, 7.1573, 7.1568, 7.1538, 7.16, 7.1578, 7.1549, 7.153, 7.1517, 7.1501, 7.1477, 7.145, 7.1464, 7.1451, 7.1445, 7.1427, 7.1402, 7.1373, 7.1544, 7.1515, 7.1498, 7.1567, 7.1558, 7.1539, 7.1509, 7.1494, 7.1466, 7.1454, 7.1509, 7.1498, 7.1469, 7.1439, 7.1511, 7.1499, 7.1394, 7.1499, 7.147, 7.1459, 7.1429, 7.1345, 7.125, 7.1306, 7.1295, 7.1267, 7.1252, 7.1256, 7.1149, 7.1129, 7.1357, 7.1336, 7.139, 7.145, 7.1428, 7.1398, 7.1456, 7.151, 7.1486, 7.1459, 7.1439, 7.141, 7.1466, 7.1527, 7.1507, 7.1479, 7.1453, 7.1428, 7.1403, 7.1388, 7.144, 7.1414, 7.1392, 7.1446, 7.1422, 7.14, 7.1389, 7.1366, 7.1348, 7.133, 7.1307, 7.1288, 7.1342, 7.1318, 7.1292, 7.1352, 7.1343, 7.1325, 7.1311, 7.1294, 7.1276, 7.1262, 7.1245, 7.122, 7.12, 7.1188, 7.1167, 7.1145, 7.1409, 7.1459, 7.1434, 7.1424, 7.14, 7.1378, 7.1432, 7.1489, 7.1466, 7.1446, 7.1427, 7.1405, 7.1379, 7.1432, 7.1486, 7.1545, 7.1524, 7.1508, 7.1486, 7.1477, 7.1454, 7.1433, 7.1489, 7.1476, 7.1545, 7.1528, 7.1502, 7.1732, 7.1708, 7.1682, 7.1734, 7.1792, 7.1775, 7.1756, 7.1808, 7.1796, 7.1777, 7.1829, 7.1807, 7.1781, 7.1779, 7.1767, 7.1825, 7.1799, 7.1861, 7.1839, 7.1823, 7.1804, 7.1791, 7.177, 7.1758, 7.1777, 7.1764, 7.1925, 7.1918, 7.1897, 7.1825, 7.1811, 7.1861, 7.1881, 7.1873, 7.1946, 7.1922, 7.1904, 7.1884, 7.1864, 7.1841, 7.1891, 7.1869, 7.1858, 7.1847, 7.1894, 7.1875, 7.1854, 7.1837, 7.1817, 7.1794, 7.1776, 7.1756, 7.1811, 7.1796, 7.1848, 7.1839, 7.1816, 7.1805, 7.1882, 7.1862, 7.1849, 7.184, 7.1817, 7.1861, 7.1845, 7.189, 7.1868, 7.1844, 7.1834, 7.1814, 7.1807, 7.1787, 7.1835, 7.1814, 7.1798, 7.1847, 7.1825, 7.187, 7.185, 7.1854, 7.184, 7.1887, 7.1867, 7.1845, 7.1825, 7.1802, 7.1781, 7.1825, 7.1936, 7.1979, 7.197, 7.1951, 7.1931, 7.1975, 7.1966, 7.1949, 7.193, 7.1906, 7.1882, 7.1932, 7.1911, 7.1893, 7.1885, 7.1884, 7.1968, 7.195, 7.1881, 7.1864, 7.191, 7.1888, 7.1866, 7.1843, 7.1826, 7.1803, 7.1848, 7.1872, 7.1915, 7.1905, 7.1889, 7.1874, 7.1864, 7.1848, 7.1831, 7.1815, 7.1811, 7.1809, 7.1792, 7.1771, 7.1762, 7.1741, 7.1793, 7.1788, 7.177, 7.1751, 7.174, 7.1786, 7.1834, 7.1879, 7.1863, 7.1852, 7.183, 7.1809, 7.1799, 7.1847, 7.1843, 7.1825, 7.1804, 7.1797, 7.1778, 7.1829, 7.1821, 7.193, 7.1911, 7.1905, 7.19, 7.1952, 7.1938, 7.1921, 7.1906, 7.1887, 7.1874, 7.1924, 7.197, 7.2017, 7.2058, 7.2039, 7.2091, 7.21, 7.2083, 7.2126, 7.2112, 7.209, 7.2069, 7.2048, 7.2096, 7.2084, 7.2071, 7.2049, 7.2029, 7.2012, 7.1997, 7.1975, 7.1953, 7.1943, 7.1925, 7.1915, 7.1905, 7.1896, 7.1875, 7.1853, 7.1833, 7.183, 7.1811, 7.182, 7.1804, 7.1853, 7.1839, 7.1881, 7.1876, 7.1917, 7.1897, 7.1876, 7.1805, 7.1789, 7.178, 7.1768, 7.1755, 7.1736, 7.1717, 7.1705, 7.1692, 7.1675, 7.1663, 7.1647, 7.1687, 7.1672, 7.166, 7.1644, 7.1646, 7.1695, 7.1798, 7.1797, 7.19, 7.1895, 7.1891, 7.1878, 7.1869, 7.1852, 7.1849, 7.1842, 7.1825, 7.1807, 7.1817, 7.18, 7.1792, 7.1802, 7.1812000000000005, 7.1793, 7.184, 7.1825, 7.1816, 7.1806, 7.1796, 7.1836, 7.182, 7.1802, 7.1792, 7.1776, 7.1762, 7.175, 7.1749, 7.1745, 7.1739, 7.172, 7.1766, 7.1755, 7.1803, 7.1813, 7.18, 7.1787, 7.1833, 7.1819, 7.1859, 7.1844, 7.1838, 7.1828, 7.182, 7.1803, 7.1793, 7.1782, 7.1764, 7.1762, 7.1745, 7.173, 7.1714, 7.1751, 7.1789, 7.1771, 7.1761, 7.1748, 7.1761, 7.1744, 7.1726, 7.1764, 7.1753, 7.1739, 7.1721, 7.173100000000001, 7.1715, 7.1703, 7.1656, 7.1697, 7.1678, 7.1674, 7.1655, 7.1639, 7.162, 7.1653, 7.1647, 7.1637, 7.1627, 7.1613, 7.1596, 7.1586, 7.157, 7.163, 7.1705, 7.1689, 7.1674, 7.1677, 7.1713, 7.1701, 7.1696, 7.1678, 7.1668, 7.1659, 7.1644, 7.1729, 7.173900000000001, 7.1726, 7.1709, 7.1697, 7.176, 7.1796, 7.1782, 7.1763, 7.1752, 7.1691, 7.1675, 7.1713, 7.1697, 7.1682, 7.1667, 7.1657, 7.169, 7.1725, 7.172, 7.1704, 7.1695, 7.1685, 7.1668, 7.1667, 7.1655, 7.1656, 7.1691, 7.1676, 7.1713, 7.1711, 7.1699, 7.169, 7.1729, 7.1716, 7.1754, 7.1797, 7.1834, 7.1827, 7.1812, 7.1852, 7.1836, 7.1822, 7.1853, 7.1849, 7.1847, 7.1834, 7.1819, 7.1858, 7.1893, 7.193, 7.1973, 7.1969, 7.1953, 7.1989, 7.1978, 7.1961, 7.1948, 7.1938, 7.1976, 7.1971, 7.1966, 7.1955, 7.199, 7.1983, 7.1975, 7.1963, 7.1949, 7.1933, 7.1969, 7.1955, 7.1941, 7.1926, 7.1912, 7.1898, 7.1891, 7.1876, 7.1907, 7.2029, 7.2022, 7.2016, 7.21, 7.2085, 7.2075, 7.2059, 7.1999, 7.1983, 7.198, 7.2015, 7.2004, 7.1997, 7.1983, 7.1967, 7.1952, 7.1941, 7.1951, 7.1961, 7.1945, 7.1985, 7.198, 7.1967, 7.1955, 7.1965, 7.1948, 7.1933, 7.1927, 7.1922, 7.191, 7.19, 7.189, 7.1879, 7.1868, 7.1851, 7.1837, 7.1821, 7.1852, 7.1836, 7.1827, 7.186, 7.1846, 7.183, 7.1815, 7.1802, 7.1796, 7.179, 7.180000000000001, 7.1834, 7.1844, 7.1831, 7.1816, 7.181, 7.1795, 7.1779, 7.1809, 7.1841, 7.1836, 7.1832, 7.1828, 7.186, 7.1812, 7.1844, 7.1881, 7.1888, 7.1876, 7.1859, 7.1845, 7.1842, 7.1835, 7.1823, 7.1811, 7.1942, 7.193, 7.1916, 7.1902, 7.1898, 7.1933, 7.1922, 7.1905, 7.189, 7.188, 7.1873, 7.1859, 7.1849, 7.1836, 7.1821, 7.1831000000000005, 7.1817, 7.18, 7.1788, 7.1776, 7.1813, 7.1798, 7.18, 7.1786, 7.178, 7.1769, 7.1755, 7.1742, 7.1727, 7.1728, 7.1715, 7.1725, 7.1721, 7.171, 7.1698, 7.1683, 7.1716, 7.1704, 7.1691, 7.1722, 7.1714, 7.1703, 7.1693, 7.1678, 7.1676, 7.1664, 7.1707, 7.1705, 7.1689, 7.1676, 7.1665, 7.1654, 7.1643, 7.1676, 7.1668, 7.1652, 7.1639, 7.1676, 7.1686, 7.1676, 7.1686000000000005, 7.169600000000001, 7.170600000000001, 7.1702, 7.1739, 7.1727, 7.1711, 7.1701, 7.1739, 7.1725, 7.1711, 7.174, 7.173, 7.1724, 7.1713, 7.1707, 7.1694, 7.168, 7.1711, 7.1702, 7.1692, 7.1721, 7.1712, 7.1708, 7.1694, 7.1726, 7.1755, 7.1742, 7.1774, 7.1767, 7.18, 7.1747, 7.1735, 7.1723, 7.1709, 7.1695, 7.1682, 7.1713, 7.1705, 7.1693, 7.1732, 7.1726, 7.1716, 7.1709, 7.17, 7.1687, 7.1673, 7.1702, 7.1691, 7.1679, 7.1682, 7.1676, 7.1715, 7.17, 7.1692, 7.1681, 7.1667, 7.1657, 7.1646, 7.1635, 7.1621, 7.1627, 7.1617, 7.161, 7.1595, 7.1623, 7.1658, 7.1651, 7.1638, 7.1624, 7.1611, 7.1602, 7.1589, 7.1618, 7.1608, 7.1594, 7.1591, 7.1578, 7.1609, 7.1604, 7.159, 7.1641, 7.1634, 7.1665, 7.1652, 7.1649, 7.164, 7.1628, 7.1662, 7.1656, 7.165, 7.1685, 7.1721, 7.1756, 7.1792, 7.1802, 7.1812000000000005, 7.1804, 7.1791, 7.182, 7.181, 7.1802, 7.1792, 7.1784, 7.1775, 7.1841, 7.1836, 7.187, 7.1858, 7.1888, 7.1919, 7.192900000000001, 7.1918, 7.1916, 7.2054, 7.2042, 7.2072, 7.2062, 7.2059, 7.2052, 7.2091, 7.2083, 7.2091, 7.2088, 7.2119, 7.2115, 7.2164, 7.216, 7.2148, 7.2173, 7.2166, 7.2157, 7.2181, 7.2168, 7.2158, 7.2185, 7.2179, 7.2177, 7.2171, 7.2161, 7.2187, 7.2214, 7.2204, 7.223, 7.2222, 7.2251, 7.2241, 7.2251, 7.226100000000001, 7.2249, 7.2294, 7.2319, 7.2348, 7.2335, 7.2323, 7.2318, 7.2305, 7.2303, 7.237, 7.2359, 7.2347, 7.2345, 7.2332, 7.236, 7.2358, 7.2347, 7.2336, 7.2324, 7.2349, 7.2337, 7.2332, 7.232, 7.24, 7.2427, 7.2414, 7.24, 7.24, 7.2389, 7.2413, 7.2411, 7.2399, 7.239, 7.2384, 7.2381, 7.2407, 7.24, 7.2387, 7.2373, 7.2362, 7.2351, 7.2343, 7.2332, 7.2324, 7.2317, 7.2304, 7.2292, 7.2287, 7.2327, 7.2315, 7.2341, 7.2332, 7.2322, 7.231, 7.2299, 7.2288, 7.2275, 7.2261, 7.2249, 7.2239, 7.2262, 7.2249, 7.2239, 7.2226, 7.2223, 7.2214, 7.2207, 7.2197, 7.2192, 7.2181, 7.2169, 7.2163, 7.2154, 7.2179, 7.2167, 7.2159, 7.216900000000001, 7.2128, 7.2122, 7.2112, 7.2107, 7.2097, 7.2123, 7.2147, 7.2135, 7.2134, 7.2121, 7.2182, 7.2174, 7.2168, 7.2193, 7.2194, 7.2184, 7.2209, 7.2203, 7.2192, 7.2225, 7.2219, 7.2208, 7.2197, 7.2186, 7.2176, 7.2217, 7.2214, 7.2173, 7.2198, 7.2225, 7.2218, 7.221, 7.2212, 7.2237, 7.223, 7.2259, 7.2255, 7.228, 7.2308, 7.2336, 7.2329, 7.2318, 7.2313, 7.2307, 7.2302, 7.2292, 7.2317, 7.2348, 7.2377, 7.2368, 7.2395, 7.2387, 7.2377, 7.2369, 7.2364, 7.2355, 7.2353, 7.2347, 7.2337, 7.2327, 7.2317, 7.231, 7.2338, 7.2335, 7.2323, 7.2356, 7.2349, 7.2349, 7.2336, 7.233, 7.2318, 7.2339, 7.2328, 7.2318, 7.2411, 7.2399, 7.2388, 7.2379, 7.2369, 7.2358, 7.2392, 7.2381, 7.2399, 7.2425, 7.242, 7.2445, 7.2468, 7.2456, 7.2444, 7.2435, 7.2422, 7.241, 7.2409, 7.2399, 7.2387, 7.2383, 7.2372, 7.2359, 7.235, 7.2343, 7.2337, 7.2334, 7.2329, 7.2316, 7.2305, 7.2296, 7.2293, 7.2286, 7.2275, 7.2264, 7.2256, 7.225, 7.2244, 7.2236, 7.2229, 7.2224, 7.2213, 7.2202, 7.2189, 7.2178, 7.2167, 7.2157, 7.215, 7.2138, 7.2162, 7.2151, 7.215, 7.2145, 7.2144, 7.2136, 7.2127, 7.2118, 7.2111, 7.2134, 7.2123, 7.2111, 7.21, 7.2125, 7.2114, 7.2109, 7.211, 7.2101, 7.2092, 7.208, 7.2071, 7.2066, 7.2064, 7.2053, 7.2048, 7.2073, 7.2067, 7.2056, 7.2082, 7.2128, 7.2119, 7.2129, 7.2123, 7.2115, 7.2159, 7.2151, 7.2223, 7.2247, 7.2243, 7.2235, 7.2224, 7.2244, 7.2232, 7.229, 7.2284, 7.2275, 7.2267, 7.2255, 7.2244, 7.2273, 7.23, 7.2293, 7.2282, 7.2271, 7.2264, 7.2318, 7.2307, 7.2296, 7.2291, 7.228, 7.2268, 7.2258, 7.2249, 7.224, 7.2233, 7.2257, 7.2255, 7.2248, 7.2236, 7.2225, 7.2224, 7.222, 7.221, 7.2201, 7.2191, 7.2181, 7.2174, 7.2167, 7.2162, 7.2187, 7.2181, 7.2174, 7.2169, 7.2159, 7.2148, 7.2138, 7.2134, 7.2158, 7.2148, 7.211, 7.21, 7.2141, 7.2201, 7.2189, 7.2179, 7.2179, 7.2172, 7.2167, 7.2252, 7.2244, 7.2239, 7.2298, 7.2287, 7.2289, 7.2285, 7.2282, 7.2275, 7.2265, 7.2255, 7.2244, 7.2241, 7.2255, 7.2246, 7.2247, 7.2241, 7.2239, 7.2263, 7.2253, 7.2272, 7.2296, 7.2287, 7.2276, 7.227, 7.2292, 7.2286, 7.2275, 7.2267, 7.2292, 7.2319, 7.2308, 7.23, 7.2332, 7.2361, 7.2356, 7.2355, 7.2347, 7.2348, 7.2346, 7.2338, 7.2327, 7.2356, 7.2349, 7.2342, 7.2332, 7.2323, 7.2314, 7.2341, 7.2349, 7.2339, 7.2368, 7.2369, 7.2367, 7.236, 7.2352, 7.2344, 7.2338, 7.2361, 7.2358, 7.2353, 7.2346, 7.2344, 7.2339, 7.2365, 7.2356, 7.2346, 7.2343, 7.2334, 7.2356, 7.2377, 7.2366, 7.2363, 7.2352, 7.2348, 7.234, 7.2331, 7.2328, 7.2317, 7.2339, 7.2328, 7.2324, 7.2312, 7.2304, 7.2295, 7.2285, 7.2276, 7.2269, 7.2259, 7.2254, 7.2337, 7.2327, 7.2319, 7.231, 7.2305, 7.2329, 7.2323, 7.232, 7.2316, 7.2307, 7.2296, 7.2317, 7.2309, 7.2301, 7.2311000000000005, 7.232100000000001, 7.2316, 7.2307, 7.2302, 7.2297, 7.232, 7.231, 7.2307, 7.236, 7.2351, 7.2341, 7.2336, 7.2326, 7.2317, 7.2319, 7.2314, 7.2339, 7.2336, 7.2328, 7.232, 7.2312, 7.2306, 7.2298, 7.2292, 7.2283, 7.2273, 7.2296, 7.2288, 7.2285, 7.2305, 7.2298, 7.2321, 7.2314, 7.2307, 7.23, 7.2322, 7.2316, 7.2307, 7.2299, 7.23, 7.2293, 7.2285, 7.2276, 7.2267, 7.2288, 7.2281, 7.2277, 7.2274, 7.2264, 7.2263, 7.2254, 7.2245, 7.2236, 7.2258, 7.225, 7.2247, 7.2246, 7.2247, 7.23, 7.2355, 7.2348, 7.2398, 7.239, 7.2382, 7.238, 7.2371, 7.2419, 7.2408, 7.24, 7.2419, 7.2413, 7.2403, 7.2396, 7.2389, 7.2381, 7.2372, 7.2365, 7.2362, 7.2354, 7.2346, 7.2341, 7.2331, 7.2322, 7.2317, 7.2307, 7.2298, 7.229, 7.2283, 7.2275, 7.2264, 7.2261, 7.2255, 7.2254, 7.2276, 7.2327, 7.2346, 7.2424, 7.2418, 7.2414, 7.2403, 7.2396, 7.2417, 7.2411, 7.241, 7.2406, 7.2396, 7.2396, 7.2389, 7.2385, 7.2377, 7.237, 7.2364, 7.2356, 7.2378, 7.2368, 7.236, 7.2379, 7.2369, 7.2359, 7.2384, 7.2376, 7.237, 7.2364, 7.2361, 7.2357, 7.2389, 7.238, 7.2375, 7.2367, 7.2361, 7.2352, 7.2379, 7.2371, 7.2374, 7.2372, 7.2394, 7.2386, 7.2378, 7.2401, 7.2393, 7.2391, 7.2362, 7.2359, 7.235, 7.2342, 7.2335, 7.2328, 7.232, 7.2319, 7.2298, 7.2293, 7.2299, 7.2293, 7.2287, 7.2277, 7.2275, 7.2321, 7.2319, 7.2314, 7.2304, 7.2302, 7.2349, 7.234, 7.2338, 7.2356, 7.235, 7.2341, 7.2336, 7.2327, 7.2322, 7.232, 7.2314, 7.2312, 7.2311, 7.2308, 7.2304, 7.2299, 7.2293, 7.2287, 7.228, 7.227, 7.2263, 7.2283, 7.2274, 7.2266, 7.226, 7.226, 7.2253, 7.2273, 7.2265, 7.2344, 7.2346, 7.2368, 7.2362, 7.2359, 7.2356, 7.2347, 7.2338, 7.2356, 7.2354, 7.2352, 7.2374, 7.2396, 7.2386, 7.2379, 7.2373, 7.2368, 7.236, 7.2353, 7.2347, 7.2365, 7.2358, 7.2349, 7.2369, 7.2387, 7.2382, 7.2375, 7.2366, 7.2357, 7.235, 7.2347, 7.2396, 7.2415, 7.2407, 7.2399, 7.2393, 7.2388, 7.2408, 7.243, 7.2478, 7.247, 7.2464, 7.2457, 7.2449, 7.2441, 7.2461, 7.2472, 7.2463, 7.2461, 7.2454, 7.2473, 7.2465, 7.2456, 7.2477, 7.2471, 7.2494, 7.2516, 7.2507, 7.2502, 7.2495, 7.2486, 7.2478, 7.2482, 7.2487, 7.2479, 7.2554, 7.2574, 7.2565, 7.2556, 7.2549, 7.2569, 7.2562, 7.2553, 7.2548, 7.2544, 7.2536, 7.2552, 7.2544, 7.2538, 7.253, 7.2522, 7.2513, 7.2531, 7.2522, 7.2515, 7.251, 7.2504, 7.2525, 7.2516, 7.2516, 7.2513, 7.253, 7.2525, 7.2522, 7.2516, 7.2513, 7.2504, 7.2496, 7.249, 7.2482, 7.2478, 7.247, 7.2463, 7.2455, 7.2448, 7.2465, 7.2457, 7.2472, 7.2466, 7.246, 7.2451, 7.2447, 7.2443, 7.246, 7.2454, 7.2449, 7.2441, 7.2432, 7.2423, 7.2415, 7.241, 7.2401, 7.2395, 7.2387, 7.2378, 7.2369, 7.236, 7.2352, 7.2348, 7.2365, 7.2357, 7.2348, 7.2339, 7.2331, 7.2323, 7.2314, 7.2306, 7.2299, 7.229, 7.2282, 7.2276, 7.2286, 7.2284, 7.2276, 7.2273, 7.2268, 7.2262, 7.2253, 7.225, 7.2243, 7.2285, 7.2278, 7.2271, 7.2264, 7.2274, 7.2266, 7.2264, 7.2281, 7.2276, 7.227, 7.229, 7.2284, 7.2305, 7.2326, 7.2317, 7.2315, 7.2309, 7.2303, 7.2299, 7.229, 7.2284, 7.2277, 7.227, 7.2268, 7.2263, 7.2257, 7.2277, 7.2271, 7.2263, 7.2257, 7.2252, 7.2244, 7.2262, 7.2279, 7.2297, 7.2294, 7.231, 7.2281, 7.225, 7.2242, 7.2233, 7.2229, 7.2226, 7.2242, 7.2234, 7.2227, 7.2219, 7.2216, 7.2245, 7.2255, 7.226500000000001, 7.2258, 7.225, 7.225, 7.228, 7.228, 7.2271, 7.2287, 7.2282, 7.2299, 7.2296, 7.2313, 7.2307, 7.2301, 7.2293, 7.230300000000001, 7.2318, 7.2314, 7.2306, 7.2323, 7.2316, 7.2312, 7.2304, 7.2345, 7.234, 7.2336, 7.2328, 7.232, 7.2336, 7.2327, 7.2321, 7.2341, 7.2334, 7.2327, 7.2346, 7.2339, 7.2334, 7.2331, 7.233, 7.2324, 7.232, 7.2323, 7.2315, 7.2306, 7.2298, 7.2314, 7.2307, 7.2301, 7.2299, 7.2296, 7.229, 7.2283, 7.228, 7.2274, 7.2267, 7.2261, 7.2253, 7.2245, 7.226, 7.2254, 7.2247, 7.2264, 7.226, 7.2276, 7.2293, 7.2286, 7.2284, 7.228, 7.2273, 7.2267, 7.2262, 7.2258, 7.2252, 7.2249, 7.2247, 7.2242, 7.2238, 7.2232, 7.2251, 7.2248, 7.224, 7.2237, 7.2233, 7.225, 7.2242, 7.2237, 7.2229, 7.2222, 7.2214, 7.2207, 7.2201, 7.2193, 7.2209, 7.2203, 7.2195, 7.2189, 7.2206, 7.2222, 7.2218, 7.2241, 7.2233, 7.225, 7.2242, 7.2239, 7.2236, 7.2229, 7.2221, 7.2237, 7.2234, 7.2251, 7.2247, 7.2239, 7.2253, 7.225, 7.2244, 7.2259, 7.2274, 7.2265, 7.2277, 7.2271, 7.2263, 7.2312, 7.2315, 7.2322, 7.2315, 7.2311, 7.2304, 7.2299, 7.2315, 7.2311, 7.2327, 7.2319, 7.2311, 7.2306, 7.2299, 7.2293, 7.2287, 7.2282, 7.2276, 7.2267, 7.2259, 7.2258, 7.2253, 7.2248, 7.2243, 7.2235, 7.2234, 7.225, 7.229, 7.23, 7.231000000000001, 7.232000000000001, 7.2317, 7.231, 7.2303, 7.2299, 7.2316, 7.2308, 7.2302, 7.2298, 7.229, 7.2283, 7.2279, 7.2274, 7.2275, 7.2272, 7.2269, 7.2263, 7.2264, 7.2258, 7.2254, 7.225, 7.2245, 7.2242, 7.2237, 7.2229, 7.2247, 7.2242, 7.2234, 7.2227, 7.2222, 7.2215, 7.2235, 7.2253, 7.225, 7.2245, 7.2238, 7.2232, 7.2246, 7.2262, 7.2255, 7.2282, 7.2311, 7.2353, 7.2367, 7.2359, 7.2356, 7.2349, 7.2359, 7.2355, 7.2349, 7.2341, 7.2335, 7.2327, 7.2342, 7.2335, 7.2336, 7.2331, 7.2323, 7.2339, 7.2334, 7.2348, 7.2364, 7.2361, 7.2353, 7.2345, 7.2337, 7.2352, 7.2347, 7.2341, 7.2335, 7.2329, 7.2323, 7.2317, 7.2315, 7.2309, 7.2306, 7.2303, 7.2317, 7.2314, 7.2311, 7.233, 7.2324, 7.2322, 7.2317, 7.2312, 7.2307, 7.2299, 7.2291, 7.234, 7.2335, 7.2333, 7.233, 7.2345, 7.234, 7.2334, 7.2331, 7.2331, 7.2323, 7.2339, 7.2339, 7.2331, 7.2326, 7.2321, 7.2316, 7.231, 7.2302, 7.2319, 7.232900000000001, 7.2346, 7.2341, 7.2345, 7.2339, 7.2334, 7.2328, 7.232, 7.2317, 7.2311, 7.2308, 7.2303, 7.2298, 7.2293, 7.2285, 7.2282, 7.228, 7.2279, 7.2272, 7.2288, 7.2287, 7.2279, 7.2275, 7.2272, 7.2286, 7.2282, 7.2275, 7.2269, 7.2266, 7.2259, 7.2257, 7.2254, 7.2249, 7.2264, 7.2256, 7.2251, 7.2245, 7.2261, 7.2258, 7.2274, 7.229, 7.2285, 7.228, 7.229, 7.23, 7.231000000000001, 7.2303, 7.2295, 7.2289, 7.2281, 7.2273, 7.2272, 7.2289, 7.2305, 7.2299, 7.2291, 7.2306, 7.2301, 7.2317, 7.2312, 7.2326, 7.2336, 7.2346, 7.2339, 7.2331, 7.2323, 7.2336, 7.233, 7.2326, 7.2302, 7.2317, 7.2327, 7.2319, 7.2313, 7.2356, 7.2348, 7.2364, 7.2362, 7.2355, 7.2371, 7.2384, 7.2384, 7.2379, 7.2394, 7.239, 7.2382, 7.2379, 7.2374, 7.2372, 7.2368, 7.2362, 7.2356, 7.235, 7.2343, 7.2336, 7.2329, 7.2324, 7.2318, 7.2314, 7.2311, 7.2306, 7.2305, 7.2304, 7.2297, 7.2292, 7.2287, 7.2323, 7.2316, 7.231, 7.2325, 7.2318, 7.2314, 7.2308, 7.2302, 7.2298, 7.2291, 7.2298, 7.2297, 7.229, 7.2288, 7.2281, 7.2278, 7.2273, 7.2291, 7.2285, 7.2281, 7.2295, 7.229, 7.2285, 7.2281, 7.2276, 7.2272, 7.2272, 7.2265, 7.226, 7.2263, 7.2278, 7.2276, 7.2271, 7.2267, 7.226, 7.2255, 7.225, 7.2244, 7.2292, 7.2272, 7.2266, 7.2267, 7.2262, 7.2256, 7.2251, 7.2245, 7.2238, 7.2253, 7.2249, 7.2242, 7.2239, 7.2233, 7.2247, 7.224, 7.2237, 7.2233, 7.2227, 7.222, 7.2217, 7.2214, 7.2213, 7.2209, 7.2203, 7.2196, 7.2193, 7.219, 7.2185, 7.2179, 7.2174, 7.2193, 7.2189, 7.2183, 7.2177, 7.2187, 7.2183, 7.2176, 7.2173, 7.2185, 7.2224, 7.2217, 7.2213, 7.2213, 7.2206, 7.2199, 7.2192, 7.2185, 7.218, 7.2174, 7.217, 7.2146, 7.216, 7.2154, 7.215, 7.2144, 7.2139, 7.2134, 7.213, 7.2174, 7.2173, 7.2166, 7.224, 7.2253, 7.2247, 7.2241, 7.2235, 7.2228, 7.2223, 7.2217, 7.2213, 7.2208, 7.2204, 7.2197, 7.2196, 7.2192, 7.2186, 7.2182, 7.2178, 7.2171, 7.2228, 7.2227, 7.2224, 7.2223, 7.2217, 7.225, 7.2299, 7.2295, 7.2292, 7.2307, 7.2301, 7.2298, 7.2293, 7.2318, 7.2315, 7.2419, 7.2434, 7.2431, 7.2446, 7.2444, 7.2438, 7.2431, 7.2426, 7.242, 7.2414, 7.2446, 7.2443, 7.242, 7.2454, 7.2472, 7.2468, 7.2466, 7.246, 7.2458, 7.2472, 7.2465, 7.2463, 7.2456, 7.2497, 7.2493, 7.2486, 7.2461, 7.2455, 7.2449, 7.2461, 7.2439, 7.2437, 7.2432, 7.2428, 7.2422, 7.2437, 7.2436, 7.2431, 7.2432, 7.2427, 7.2424, 7.2421, 7.2416, 7.2414, 7.2409, 7.2424, 7.2421, 7.2416, 7.2412, 7.241, 7.2406, 7.24, 7.2397, 7.2395, 7.2389, 7.2383, 7.238, 7.2395, 7.2389, 7.2386, 7.2398, 7.2391, 7.2385, 7.2379, 7.2379, 7.2388, 7.2383, 7.2378, 7.2373, 7.2366, 7.2361, 7.2375, 7.2368, 7.2384, 7.2383, 7.2397, 7.2392, 7.2388, 7.2381, 7.2375, 7.2372, 7.2386, 7.2398, 7.2391, 7.2389, 7.2386, 7.2381, 7.2378, 7.2374, 7.2371, 7.2385, 7.2378, 7.2371, 7.2364, 7.236, 7.236, 7.2353, 7.2353, 7.2347, 7.2342, 7.2339, 7.2334, 7.2331, 7.2343, 7.2342, 7.2341, 7.2337, 7.2332, 7.2328, 7.2327, 7.2325, 7.232, 7.2316, 7.2328, 7.2323, 7.2317, 7.2332, 7.233, 7.2325, 7.2323, 7.232, 7.2313, 7.2307, 7.2302, 7.2298, 7.2295, 7.2308, 7.2304, 7.2301, 7.2295, 7.2292, 7.2308, 7.2302, 7.2296, 7.2291, 7.2288, 7.2303, 7.2298, 7.2291, 7.2288, 7.2299, 7.2293, 7.229, 7.2283, 7.2276, 7.227, 7.2265, 7.2265, 7.2267, 7.2244, 7.2257, 7.2254, 7.2248, 7.2265, 7.2264, 7.226, 7.2257, 7.2252, 7.2265, 7.226, 7.2257, 7.2256, 7.2251, 7.2246, 7.224, 7.2234, 7.2247, 7.2242, 7.2237, 7.2231, 7.225, 7.2248, 7.2262, 7.2259, 7.2254, 7.2248, 7.2242, 7.2239, 7.2252, 7.2248, 7.2241, 7.2254, 7.2267, 7.2265, 7.2278, 7.2271, 7.2267, 7.2263, 7.2277, 7.2256, 7.2269, 7.2267, 7.2281, 7.2275, 7.2268, 7.2283, 7.228, 7.2277, 7.2273, 7.2271, 7.2284, 7.2297, 7.229, 7.2284, 7.2282, 7.2295, 7.229, 7.2287, 7.2282, 7.2277, 7.2278, 7.2273, 7.2267, 7.2283, 7.2295, 7.229, 7.2303, 7.2316, 7.2313, 7.2309, 7.2322, 7.2335, 7.233, 7.2324, 7.2319, 7.2333, 7.2335, 7.2329, 7.2324, 7.2338, 7.2335, 7.233, 7.2324, 7.2322, 7.2336, 7.2334, 7.2347, 7.2328, 7.2326, 7.2324, 7.2319, 7.2313, 7.2308, 7.2306, 7.2327, 7.2323, 7.2319, 7.2332, 7.2326, 7.2319, 7.2333, 7.2345, 7.2339, 7.2333, 7.2328, 7.2324, 7.2318, 7.2316, 7.2312, 7.2307, 7.2306, 7.2303, 7.2299, 7.2311, 7.2326, 7.2324, 7.2323, 7.2317, 7.2314, 7.2312, 7.229, 7.2303, 7.2298, 7.2314, 7.231, 7.2304, 7.2298, 7.2293, 7.2307, 7.2304, 7.2317, 7.2312, 7.2307, 7.2301, 7.2298, 7.2293, 7.2274, 7.2272, 7.2267, 7.2261, 7.2256, 7.225, 7.2245, 7.226, 7.2253, 7.2249, 7.2264, 7.2258, 7.2251, 7.2245, 7.2257, 7.2251, 7.2247, 7.2241, 7.2237, 7.2233, 7.2227, 7.2221, 7.2216, 7.2213, 7.2227, 7.2222, 7.2217, 7.223, 7.2228, 7.2241, 7.2236, 7.2233, 7.2229, 7.2226, 7.222, 7.2214, 7.2208, 7.2204, 7.22, 7.2194, 7.2191, 7.2185, 7.2179, 7.2182, 7.2175, 7.2187, 7.2182, 7.2194, 7.2188, 7.2202, 7.2214, 7.2212, 7.2242, 7.2239, 7.2252, 7.2297, 7.2292, 7.2289, 7.2287, 7.2282, 7.2276, 7.2274, 7.2269, 7.2263, 7.2257, 7.2252, 7.2248, 7.2242, 7.2237, 7.2236, 7.2231, 7.2227, 7.222, 7.223000000000001, 7.224000000000001, 7.2252, 7.2248, 7.2244, 7.2238, 7.2234, 7.2247, 7.2241, 7.2253, 7.2251, 7.2249, 7.2242, 7.2237, 7.2235, 7.2231, 7.2226, 7.2222, 7.2218, 7.2214, 7.2209, 7.2204, 7.22, 7.2197, 7.2192, 7.219, 7.2184, 7.2181, 7.2177, 7.2172, 7.2167, 7.2162, 7.2157, 7.2152, 7.2164, 7.2161, 7.2158, 7.2153, 7.215, 7.2144, 7.2141, 7.2154, 7.2149, 7.2143, 7.2138, 7.2149, 7.2159, 7.2172, 7.2169, 7.2165, 7.2177, 7.2174, 7.2181, 7.2177, 7.2171, 7.2169, 7.2183, 7.2205, 7.2211, 7.2223, 7.2222, 7.2218, 7.2216, 7.2213, 7.2214, 7.2211, 7.2205, 7.2199, 7.2212, 7.2207, 7.2219, 7.2213, 7.2208, 7.2203, 7.2201, 7.2195, 7.2205, 7.221500000000001, 7.2228, 7.2222, 7.2216, 7.2228, 7.2223, 7.2217, 7.2211, 7.2224, 7.2218, 7.2215, 7.2212, 7.2224, 7.2218, 7.2216, 7.2214, 7.2226, 7.2221, 7.2217, 7.2234, 7.2246, 7.2242, 7.2236, 7.223, 7.2225, 7.2237, 7.2248, 7.226, 7.2254, 7.225, 7.2245, 7.2242, 7.2238, 7.2233, 7.2228, 7.2239, 7.2252, 7.2246, 7.2242, 7.2236, 7.223, 7.2253, 7.2252, 7.2247, 7.2242, 7.2237, 7.2249, 7.2262, 7.2256, 7.2263, 7.2258, 7.2253, 7.2251, 7.225, 7.2245, 7.224, 7.2239, 7.2236, 7.2232, 7.2229, 7.2224, 7.2219, 7.2214, 7.2227, 7.2222, 7.2219, 7.2232, 7.2243, 7.2237, 7.2233, 7.2228, 7.2229, 7.223, 7.2252, 7.2248, 7.2245, 7.2257, 7.2269, 7.2282, 7.2276, 7.2289, 7.2347, 7.2359, 7.2354, 7.2351, 7.2348, 7.2345, 7.234, 7.2337, 7.2331, 7.2359, 7.2382, 7.2377, 7.2372, 7.2399, 7.2396, 7.2393, 7.2375, 7.2355, 7.2335, 7.2347, 7.2342, 7.2336, 7.2331, 7.2325, 7.2319, 7.2317, 7.2313, 7.2343, 7.234, 7.2336, 7.2335, 7.2332, 7.2326, 7.2322, 7.2316, 7.231, 7.2322, 7.2316, 7.2328, 7.2327, 7.2339, 7.2333, 7.2328, 7.2323, 7.2319, 7.2315, 7.2353, 7.2351, 7.235, 7.2345, 7.2341, 7.2339, 7.2334, 7.2333, 7.2328, 7.2323, 7.2317, 7.2328, 7.2323, 7.232, 7.23, 7.2298, 7.2292, 7.2287, 7.2285, 7.2283, 7.2281, 7.2278, 7.2274, 7.227, 7.2266, 7.2256, 7.2251, 7.2248, 7.2244, 7.2242, 7.2237, 7.2249, 7.2244, 7.2239, 7.2236, 7.223, 7.2245, 7.2242, 7.2237, 7.2233, 7.2237, 7.2233, 7.2232, 7.2229, 7.2224, 7.2234, 7.2234, 7.223, 7.2225, 7.2221, 7.2215, 7.221, 7.2209, 7.2204, 7.2201, 7.2197, 7.221, 7.2204, 7.2202, 7.2214, 7.2213, 7.2208, 7.2202, 7.2215, 7.221, 7.2204, 7.2216, 7.221, 7.2207, 7.2219, 7.2216, 7.223, 7.2228, 7.2224, 7.2235, 7.2231, 7.2225, 7.2219, 7.2213, 7.2215, 7.2228, 7.2224, 7.2218, 7.2214, 7.2195, 7.2179, 7.2176, 7.2175, 7.2171, 7.2167, 7.2161, 7.2175, 7.2172, 7.217, 7.2166, 7.2163, 7.2159, 7.2156, 7.2152, 7.215, 7.2163, 7.2162, 7.2158, 7.2154, 7.2149, 7.2145, 7.2143, 7.2142, 7.2152, 7.2146, 7.2143, 7.2138, 7.2134, 7.2131, 7.2128, 7.2126, 7.2123, 7.2122, 7.2135, 7.2131, 7.2127, 7.2123, 7.212, 7.2118, 7.2114, 7.211, 7.2109, 7.2106, 7.2101, 7.2101, 7.2107, 7.2105, 7.2103, 7.2098, 7.2112, 7.2115, 7.2126, 7.2122, 7.2117, 7.2112, 7.2108, 7.2103, 7.2113, 7.2107, 7.2103, 7.2113, 7.2108, 7.2103, 7.2098, 7.2108, 7.2117, 7.2112, 7.2123, 7.2118, 7.2114, 7.211, 7.2107, 7.2106, 7.21, 7.2112, 7.2107, 7.2102, 7.2097, 7.2091, 7.2086, 7.208, 7.2076, 7.2073, 7.207, 7.2067, 7.2066, 7.2062, 7.2058, 7.2054, 7.205, 7.2045, 7.2039, 7.2034, 7.2032, 7.204, 7.2035, 7.2045, 7.2041, 7.2039, 7.2037, 7.2034, 7.2029, 7.2025, 7.2036, 7.2031, 7.2043, 7.2055, 7.2053, 7.206300000000001, 7.2059, 7.2071, 7.2131, 7.213, 7.2127, 7.2123, 7.2121, 7.2116, 7.2111, 7.2105, 7.2103, 7.2098, 7.2094, 7.2089, 7.2084, 7.208, 7.2077, 7.2075, 7.2072, 7.2068, 7.2068, 7.2066, 7.2061, 7.207, 7.2067, 7.2068, 7.2067, 7.2067, 7.2066, 7.2076, 7.2073, 7.207, 7.2081, 7.208, 7.2076, 7.208600000000001, 7.2082, 7.2094, 7.2093, 7.2091, 7.2088, 7.2098, 7.2109, 7.2105, 7.2116, 7.2127, 7.2123, 7.2119, 7.2129, 7.2125, 7.2121, 7.213100000000001, 7.214100000000001, 7.215100000000001, 7.2146, 7.2142, 7.2158, 7.2158, 7.2143, 7.2139, 7.2134, 7.2147, 7.2158, 7.2153, 7.2151, 7.2147, 7.2143, 7.2139, 7.2136, 7.2146, 7.2156, 7.2156, 7.2166, 7.2176, 7.2173, 7.2171, 7.2168, 7.2164, 7.2162, 7.2159, 7.217, 7.2166, 7.2187, 7.2215, 7.2227, 7.2223, 7.2221, 7.2217, 7.2215, 7.221, 7.2205, 7.2202, 7.2201, 7.2197, 7.2192, 7.219, 7.2185, 7.2183, 7.2184, 7.218, 7.2183, 7.2178, 7.2181, 7.2177, 7.2172, 7.2168, 7.2162, 7.2173, 7.2173, 7.2168, 7.2179, 7.219, 7.2186, 7.2184, 7.2195, 7.2221, 7.2232, 7.2227, 7.2238, 7.2236, 7.2233, 7.2244, 7.2276, 7.2288, 7.2283, 7.2284, 7.228, 7.2277, 7.2278, 7.229, 7.2285, 7.2283, 7.2284, 7.2279, 7.2277, 7.2289, 7.2301, 7.2297, 7.2291, 7.2285, 7.2281, 7.2277, 7.2272, 7.2267, 7.2268, 7.2264, 7.2259, 7.227, 7.2265, 7.2277, 7.2288, 7.2283, 7.2279, 7.2274, 7.2269, 7.2265, 7.226, 7.2261, 7.2273, 7.2269, 7.2295, 7.2291, 7.2287, 7.2298, 7.2293, 7.2303, 7.2299, 7.2295, 7.2291, 7.2287, 7.2282, 7.2279, 7.2276, 7.2272, 7.2267, 7.2262, 7.2262, 7.2259, 7.2268, 7.2266, 7.2261, 7.226, 7.2257, 7.2251, 7.2246, 7.2243, 7.2241, 7.2236, 7.225, 7.2247, 7.2242, 7.2241, 7.2236, 7.2234, 7.2229, 7.2228, 7.2237, 7.2233, 7.2231, 7.2227, 7.2222, 7.2233, 7.2243, 7.2241, 7.2236, 7.2249, 7.2247, 7.2245, 7.2241, 7.2251, 7.2266, 7.2262, 7.2257, 7.2252, 7.2262, 7.2257, 7.2252, 7.2262, 7.2258, 7.2269, 7.2266, 7.2248, 7.2244, 7.224, 7.2235, 7.223, 7.224, 7.2235, 7.2231, 7.2228, 7.2227, 7.2224, 7.2236, 7.2231, 7.223, 7.224, 7.2235, 7.223, 7.2227, 7.2225, 7.2221, 7.2217, 7.2225, 7.2235, 7.2233, 7.2243, 7.2238, 7.2235, 7.2231, 7.2227, 7.2222, 7.2221, 7.2215, 7.2212, 7.2207, 7.222, 7.2217, 7.2212, 7.2209, 7.2204, 7.2199, 7.2194, 7.2191, 7.2188, 7.2184, 7.2181, 7.2191, 7.219, 7.2186, 7.2182, 7.2177, 7.2173, 7.2183, 7.2194, 7.2189, 7.2184, 7.2196, 7.2198, 7.2196, 7.2206, 7.2202, 7.2198, 7.2194, 7.2189, 7.2199, 7.2195, 7.2207, 7.2204, 7.2201, 7.2197, 7.2208, 7.2206, 7.2206, 7.2202, 7.2212000000000005, 7.2223, 7.2233, 7.2243, 7.2252, 7.2247, 7.2246, 7.2248, 7.2246, 7.2241, 7.2237, 7.2235, 7.2231, 7.223, 7.2226, 7.2223, 7.2219, 7.2218, 7.2227, 7.2222, 7.2218, 7.2218, 7.2215, 7.2211, 7.2222, 7.2218, 7.2213, 7.2209, 7.2206, 7.2204, 7.2201, 7.2197, 7.2207, 7.2203, 7.2198, 7.2209, 7.2208, 7.2219, 7.2228, 7.2239, 7.2249, 7.2244, 7.2242, 7.2237, 7.2232, 7.2243, 7.2241, 7.2252, 7.2248, 7.225, 7.2245, 7.2242, 7.2238, 7.2233, 7.223, 7.2225, 7.2238, 7.225, 7.2246, 7.2242, 7.2237, 7.2233, 7.223, 7.2227, 7.2236, 7.2246, 7.2244, 7.224, 7.2236, 7.2233, 7.2228, 7.2225, 7.2222, 7.2234, 7.2229, 7.2226, 7.2222, 7.222, 7.2215, 7.2215, 7.2212, 7.2208, 7.2203, 7.2187, 7.2185, 7.218, 7.2176, 7.2172, 7.2196, 7.2192, 7.2205, 7.2205, 7.2201, 7.2198, 7.2194, 7.2194, 7.2204, 7.2203, 7.2214, 7.221, 7.2206, 7.2202, 7.2197, 7.221, 7.2207, 7.2205, 7.2202, 7.2198, 7.2193, 7.2192, 7.2187, 7.2184, 7.2195, 7.2208, 7.2205, 7.2204, 7.22, 7.2225, 7.2223, 7.2221, 7.2218, 7.2215, 7.221, 7.2206, 7.2204, 7.22, 7.2199, 7.2194, 7.219, 7.2187, 7.2184, 7.2181, 7.2192, 7.2189, 7.2187, 7.2185, 7.218, 7.2179, 7.2175, 7.2171, 7.2167, 7.2163, 7.2161, 7.2157, 7.2166, 7.2162, 7.2157, 7.2153, 7.2163, 7.2159, 7.2155, 7.2166, 7.2176, 7.2187, 7.2184, 7.2195, 7.2217, 7.2215, 7.2211, 7.2206, 7.2203, 7.2201, 7.2197, 7.2193, 7.2193, 7.2207, 7.2203, 7.2201, 7.2197, 7.2192, 7.2187, 7.2183, 7.2169, 7.2165, 7.2162, 7.2157, 7.2154, 7.2152, 7.2148, 7.2156, 7.2151, 7.2147, 7.2145, 7.2142, 7.2151, 7.2161, 7.2158, 7.2169, 7.2166, 7.2162, 7.2173, 7.2159, 7.2154, 7.2152, 7.2161, 7.2156, 7.2166, 7.2162, 7.2157, 7.2153, 7.215, 7.2146, 7.2143, 7.2153, 7.2149, 7.2148, 7.2144, 7.2155, 7.215, 7.2146, 7.2156, 7.2167, 7.2164, 7.2203, 7.2199, 7.2209, 7.2205, 7.2201, 7.221, 7.2237, 7.2235, 7.2231, 7.2227, 7.2222, 7.2219, 7.2218, 7.2229, 7.2227, 7.2225, 7.222, 7.2215, 7.2211, 7.2206, 7.2201, 7.2197, 7.2206, 7.2189, 7.2185, 7.218, 7.2175, 7.2171, 7.2166, 7.2189, 7.2185, 7.2196, 7.2209, 7.2207, 7.2203, 7.22, 7.2195, 7.2191, 7.2187, 7.2184, 7.2181, 7.2177, 7.2187, 7.2196, 7.2181, 7.2179, 7.2175, 7.2187, 7.2184, 7.2168, 7.2166, 7.2164, 7.2161, 7.2157, 7.2167, 7.2178, 7.2173, 7.2158, 7.2168, 7.2166, 7.2175, 7.2172, 7.2183, 7.2181, 7.2178, 7.2175, 7.2186, 7.2183, 7.218, 7.2177, 7.2174, 7.2172, 7.217, 7.2166, 7.2163, 7.216, 7.2156, 7.2167, 7.2167, 7.2166, 7.2175, 7.217, 7.2168, 7.2166, 7.2175, 7.2173, 7.2175, 7.2171, 7.2182, 7.22, 7.2196, 7.2207, 7.2203, 7.2201, 7.2197, 7.2193, 7.2191, 7.2188, 7.2184, 7.2181, 7.2205, 7.2203, 7.2199, 7.2209, 7.2207, 7.2217, 7.2215, 7.2214, 7.2211, 7.2209, 7.2204, 7.22, 7.2196, 7.2192, 7.2215, 7.2211, 7.2208, 7.2204, 7.2199, 7.2196, 7.2192, 7.2188, 7.2187, 7.2183, 7.2182, 7.2177, 7.2174, 7.2172, 7.218, 7.2176, 7.2172, 7.217, 7.2167, 7.2162, 7.217, 7.2166, 7.2163, 7.2161, 7.216, 7.2158, 7.2153, 7.2153, 7.2163, 7.2174, 7.2172, 7.2168, 7.2165, 7.2162, 7.2158, 7.2156, 7.2154, 7.2152, 7.2136, 7.2123, 7.214, 7.215000000000001, 7.2149, 7.2158, 7.2157, 7.2154, 7.215, 7.2146, 7.2143, 7.2152, 7.2151, 7.2151, 7.2147, 7.2143, 7.214, 7.2136, 7.2134, 7.2169, 7.2167, 7.2163, 7.2162, 7.2174, 7.2173, 7.2182, 7.2193, 7.2204, 7.22, 7.2195, 7.2191, 7.2189, 7.2187, 7.2198, 7.2196, 7.2192, 7.2188, 7.2197, 7.2192, 7.2178, 7.2176, 7.2174, 7.2173, 7.2169, 7.2168, 7.2165, 7.2161, 7.2172, 7.2169, 7.2171, 7.2167, 7.2167, 7.2164, 7.2162, 7.2159, 7.2155, 7.2151, 7.216, 7.2158, 7.2167, 7.217700000000001, 7.2174, 7.2172, 7.2181, 7.2191, 7.22, 7.2196, 7.2192, 7.219, 7.2187, 7.2184, 7.2181, 7.2191, 7.2188, 7.2184, 7.2183, 7.2168, 7.2154, 7.2141, 7.2138, 7.2135, 7.2132, 7.2129, 7.214, 7.2144, 7.2141, 7.2138, 7.2177, 7.2174, 7.2174, 7.2175, 7.216, 7.2156, 7.2152, 7.215, 7.2146, 7.2146, 7.2154, 7.2152, 7.2162, 7.2158, 7.2154, 7.215, 7.2137, 7.2136, 7.2145, 7.2155, 7.2154, 7.2139, 7.2126, 7.2123, 7.2121, 7.2122, 7.2119, 7.2117, 7.2113, 7.2122, 7.2118, 7.2116, 7.2112, 7.211, 7.2119, 7.2119, 7.2118, 7.2114, 7.2111, 7.2107, 7.2117, 7.2113, 7.2111, 7.2108, 7.2104, 7.2102, 7.2098, 7.2094, 7.2092, 7.2088, 7.2099, 7.2095, 7.2107, 7.2104, 7.2101, 7.2099, 7.2099, 7.2096, 7.2093, 7.2089, 7.2087, 7.2085, 7.2083, 7.2093, 7.2091, 7.2093, 7.2107, 7.2103, 7.2099, 7.2096, 7.2082, 7.2081, 7.2079, 7.2087, 7.2085, 7.2081, 7.2088, 7.2085, 7.2094, 7.209, 7.2087, 7.2083, 7.2079, 7.2075, 7.2072, 7.2069, 7.2066, 7.2063, 7.206, 7.2059, 7.2056, 7.2065, 7.2062, 7.206, 7.2057, 7.2123, 7.212, 7.2116, 7.2113, 7.2111, 7.2112, 7.2108, 7.2106, 7.2104, 7.2112, 7.2109, 7.2105, 7.2102, 7.2098, 7.2128, 7.2126, 7.2121, 7.2131, 7.2128, 7.2125, 7.2122, 7.212, 7.2117, 7.2114, 7.2112, 7.2109, 7.2106, 7.2115, 7.2111, 7.2107, 7.2103, 7.2099, 7.2109, 7.2106, 7.211600000000001, 7.2114, 7.2113, 7.2109, 7.2117, 7.2113, 7.2109, 7.2095, 7.2083, 7.2079, 7.2077, 7.2073, 7.2069, 7.2065, 7.2061, 7.206, 7.2069, 7.2068, 7.2064, 7.2061, 7.2059, 7.2058, 7.2055, 7.2052, 7.2061, 7.2058, 7.2059, 7.2056, 7.2066, 7.2063, 7.2059, 7.2046, 7.2045, 7.2054, 7.2064, 7.2074, 7.2086, 7.2085, 7.2083, 7.2079, 7.2077, 7.2075, 7.2073, 7.2069, 7.2078, 7.2074, 7.207, 7.2079, 7.2075, 7.2061, 7.206, 7.2059, 7.2069, 7.2065, 7.2062, 7.206, 7.2079, 7.2077, 7.2085, 7.2082, 7.208, 7.2089, 7.2085, 7.2082, 7.208, 7.2077, 7.2073, 7.2069, 7.2065, 7.2062, 7.2058, 7.2054, 7.2051, 7.2059, 7.2055, 7.2054, 7.2051, 7.2048, 7.2057, 7.2055, 7.2053, 7.2051, 7.2049, 7.2072, 7.2068, 7.2065, 7.2063, 7.2059, 7.2055, 7.2055, 7.2051, 7.2049, 7.2048, 7.2048, 7.2048, 7.2045, 7.2042, 7.2079, 7.2089, 7.2086, 7.2083, 7.2079, 7.2082, 7.2081, 7.2078, 7.2075, 7.2072, 7.2082, 7.2081, 7.2083, 7.208, 7.2077, 7.2086, 7.2095, 7.2094, 7.2091, 7.2101, 7.21, 7.2097, 7.2094, 7.2091, 7.2088, 7.2085, 7.2082, 7.2081, 7.2077, 7.2074, 7.2061, 7.2058, 7.2068, 7.2065, 7.2076, 7.2074, 7.2072, 7.2081, 7.2079, 7.2076, 7.208600000000001, 7.2072, 7.2092, 7.2089, 7.2086, 7.2094, 7.2103, 7.2113000000000005, 7.211, 7.2107, 7.2104, 7.21, 7.2096, 7.2093, 7.209, 7.2099, 7.2098, 7.2095, 7.2093, 7.2101, 7.211, 7.2107, 7.2103, 7.2103, 7.2099, 7.2097, 7.2093, 7.209, 7.2087, 7.209700000000001, 7.210700000000001, 7.2103, 7.2102, 7.2099, 7.2095, 7.2092, 7.2093, 7.2089, 7.2099, 7.2108, 7.2104, 7.2103, 7.2099, 7.2096, 7.2093, 7.2089, 7.2085, 7.2094, 7.2083, 7.208, 7.2077, 7.2074, 7.2071, 7.2081, 7.2091, 7.210100000000001, 7.211100000000001, 7.2109, 7.2105, 7.2105, 7.2103, 7.21, 7.2109, 7.2107, 7.2103, 7.2099, 7.2107, 7.2103, 7.2099, 7.2096, 7.2104, 7.2102, 7.211, 7.2107, 7.2103, 7.2099, 7.2095, 7.2093, 7.2091, 7.2088, 7.2086, 7.2083, 7.2079, 7.2076, 7.2074, 7.2082, 7.2078, 7.2076, 7.2074, 7.207, 7.2066, 7.2063, 7.2073, 7.207, 7.2071, 7.2068, 7.2064, 7.2072, 7.2071, 7.2069, 7.2078, 7.2075, 7.2071, 7.208, 7.2077, 7.2074, 7.2071, 7.2069, 7.2068, 7.2067, 7.2075, 7.2072, 7.2069, 7.2066, 7.2064, 7.2073, 7.207, 7.2067, 7.2063, 7.2071, 7.2071, 7.207, 7.207, 7.207, 7.2067, 7.2064, 7.2063, 7.2061, 7.2058, 7.2055, 7.2052, 7.2062, 7.206, 7.2057, 7.2056, 7.2066, 7.2075, 7.2085, 7.2081, 7.2078, 7.2075, 7.2074, 7.2073, 7.207, 7.2066, 7.2062, 7.207, 7.2069, 7.2066, 7.2055, 7.2052, 7.2049, 7.2046, 7.2044, 7.204, 7.2036, 7.2024, 7.2035, 7.2031, 7.2027, 7.2023, 7.2021, 7.202, 7.2016, 7.2014, 7.2013, 7.201, 7.2006, 7.2004, 7.1991, 7.1987, 7.1988, 7.1985, 7.1982, 7.199, 7.1998, 7.1994, 7.1992, 7.200200000000001, 7.2023, 7.2031, 7.2027, 7.2023, 7.2031, 7.2028, 7.2024, 7.2023, 7.2021, 7.2017, 7.2025, 7.2032, 7.2029, 7.2025, 7.2021, 7.2018, 7.2014, 7.201, 7.2008, 7.2005, 7.2001, 7.2, 7.1998, 7.1997, 7.1995, 7.1992, 7.1997, 7.1994, 7.1995, 7.1994, 7.1993, 7.1991, 7.1989, 7.1986, 7.1984, 7.1992, 7.200200000000001, 7.1999, 7.1995, 7.1992, 7.2, 7.2007, 7.2005, 7.2003, 7.1999, 7.1996, 7.1993, 7.1989, 7.1986, 7.1985, 7.1983, 7.1979, 7.1975, 7.1983, 7.198, 7.1978, 7.1974, 7.1971, 7.1968, 7.1966, 7.1964, 7.1961, 7.1957, 7.1953, 7.1949, 7.1946, 7.1943, 7.194, 7.1938, 7.1936, 7.1934, 7.1931, 7.1939, 7.1935, 7.1946, 7.1955, 7.1953, 7.1951, 7.1948, 7.1944, 7.1942, 7.1942, 7.195, 7.1947, 7.1958, 7.1955, 7.1952, 7.1951, 7.1948, 7.1947, 7.1946, 7.1943, 7.1939, 7.1935, 7.1934, 7.1942, 7.1952, 7.1939, 7.1927, 7.1924, 7.1921, 7.193, 7.1927, 7.1935, 7.194500000000001, 7.1944, 7.194, 7.1938, 7.1938, 7.1934, 7.193, 7.1939, 7.1936, 7.1946, 7.195600000000001, 7.1952, 7.1961, 7.1959, 7.1956, 7.1953, 7.1961, 7.197, 7.1979, 7.1978, 7.1977, 7.1975, 7.1974, 7.1972, 7.1971, 7.196, 7.1957, 7.1957, 7.1956, 7.1954, 7.1951, 7.196, 7.1958, 7.1967, 7.1976, 7.1973, 7.197, 7.1979, 7.1976, 7.1976, 7.1963, 7.1961, 7.1958, 7.1955, 7.1952, 7.1953, 7.1949, 7.1959, 7.1969, 7.1979, 7.1976, 7.1974, 7.1971, 7.1979, 7.1986, 7.1982, 7.198, 7.1977, 7.1975, 7.1972, 7.197, 7.1966, 7.1964, 7.1961, 7.1957, 7.1954, 7.1951, 7.1949, 7.1946, 7.195600000000001, 7.1952, 7.1951, 7.1947, 7.1946, 7.1954, 7.1941, 7.1938, 7.1938, 7.1934, 7.1931, 7.1928, 7.1925, 7.1921, 7.192, 7.1917, 7.1905, 7.1902, 7.1899, 7.1895, 7.1892, 7.1902, 7.1898, 7.1896, 7.1894, 7.1891, 7.1889, 7.1889, 7.1885, 7.1881, 7.1877, 7.1875, 7.1884, 7.188, 7.1878, 7.1876, 7.1872, 7.1859, 7.1856, 7.1864, 7.186, 7.1857, 7.1845, 7.1844, 7.184, 7.185, 7.1858, 7.1855, 7.1864, 7.186, 7.1858, 7.1856, 7.1852, 7.1854, 7.1853, 7.1851, 7.1848, 7.1855, 7.1863, 7.1859, 7.1857, 7.1853, 7.185, 7.1847, 7.1845, 7.1843, 7.1839, 7.1835, 7.1831, 7.1829, 7.1825, 7.1822, 7.1819, 7.1817, 7.1814, 7.181, 7.182, 7.183000000000001, 7.184000000000001, 7.1836, 7.1825, 7.1825, 7.1832, 7.183, 7.1827, 7.1824, 7.1823, 7.182, 7.1816, 7.1825, 7.1823, 7.1821, 7.1818, 7.1826, 7.1823, 7.1821, 7.1829, 7.1838, 7.1846, 7.1842, 7.1839, 7.1847, 7.1844, 7.1841, 7.1848, 7.1846, 7.1853, 7.1861, 7.1857, 7.1856, 7.1853, 7.186, 7.1867, 7.1874, 7.1871, 7.1868, 7.1865, 7.1864, 7.1862, 7.1859, 7.1856, 7.1852, 7.1849, 7.1846, 7.1843, 7.1841, 7.1838, 7.1848, 7.1858, 7.1854, 7.1853, 7.185, 7.1846, 7.1854, 7.1852, 7.1849, 7.1846, 7.1843, 7.184, 7.1838, 7.1834, 7.1831, 7.1828, 7.1836, 7.1834, 7.1834, 7.1831, 7.1839, 7.1836, 7.1843, 7.1841, 7.1839, 7.1836, 7.1832, 7.1828, 7.1827, 7.1837, 7.1847, 7.1843, 7.184, 7.1864, 7.1862, 7.1859, 7.1889, 7.1885, 7.1883, 7.1889, 7.1887, 7.1883, 7.1879, 7.1876, 7.1872, 7.1869, 7.1876, 7.1874, 7.1872, 7.1871, 7.187, 7.1868, 7.1865, 7.1862, 7.1858, 7.1865, 7.1862, 7.187, 7.1868, 7.1866, 7.1874, 7.1871, 7.1869, 7.1866, 7.1863, 7.1888, 7.1886, 7.1895, 7.1892, 7.19, 7.1896, 7.1893, 7.1882, 7.189, 7.1897, 7.1904, 7.1901, 7.1899, 7.1899, 7.1896, 7.1943, 7.194, 7.195, 7.1983, 7.1982, 7.1989, 7.1988, 7.1987, 7.1984, 7.1983, 7.1981, 7.2002, 7.2001, 7.201, 7.2007, 7.2017, 7.2014, 7.2011, 7.2018, 7.2016, 7.2003, 7.2, 7.1997, 7.1995, 7.1995, 7.1992, 7.1989, 7.1987, 7.1976, 7.1976, 7.1985, 7.1982, 7.1978, 7.1977, 7.1966, 7.1964, 7.1954, 7.1954, 7.1954, 7.1952, 7.1948, 7.1946, 7.1942, 7.1939, 7.1938, 7.1939, 7.1927, 7.1923, 7.1921, 7.1917, 7.1904, 7.1902, 7.1902, 7.1902, 7.1898, 7.1895, 7.1892, 7.1892, 7.189, 7.19, 7.1909, 7.1906, 7.1904, 7.1903, 7.1921, 7.1932, 7.1921, 7.1919, 7.192900000000001, 7.193900000000001, 7.1936, 7.1933, 7.1941, 7.1951, 7.195, 7.1948, 7.1948, 7.1944, 7.194, 7.1938, 7.1934, 7.193, 7.1928, 7.1926, 7.1923, 7.1932, 7.194, 7.1937, 7.1934, 7.1944, 7.1954, 7.1962, 7.1963, 7.196, 7.1957, 7.1953, 7.1941, 7.1954, 7.1956, 7.1954, 7.196400000000001, 7.1961, 7.197100000000001, 7.1969, 7.1966, 7.1965, 7.1963, 7.1961, 7.1988, 7.1988, 7.1984, 7.1981, 7.1989, 7.1987, 7.1984, 7.1993, 7.1992, 7.1991, 7.1988, 7.1985, 7.1983, 7.1983, 7.1982, 7.1991, 7.1987, 7.1983, 7.198, 7.1988, 7.1985, 7.1983, 7.1981, 7.1979, 7.1976, 7.1983, 7.199, 7.1987, 7.1986, 7.1983, 7.1994, 7.1991, 7.1988, 7.1985, 7.1993, 7.1991, 7.1999, 7.1998, 7.1997, 7.1985, 7.1973, 7.1961, 7.195, 7.1957, 7.1953, 7.195, 7.1949, 7.1948, 7.1945, 7.1942, 7.1942, 7.1949, 7.1946, 7.1945, 7.1944, 7.1944, 7.1941, 7.1948, 7.1945, 7.1933, 7.193, 7.1937, 7.1934, 7.1933, 7.1932, 7.1929, 7.1927, 7.1924, 7.1931, 7.1929, 7.1926, 7.1924, 7.1925, 7.1922, 7.1929, 7.1926, 7.1933, 7.1931, 7.1929, 7.1937, 7.1935, 7.1932, 7.1931, 7.193, 7.1937, 7.1934, 7.1933, 7.1932, 7.193, 7.1928, 7.1925, 7.1923, 7.1922, 7.1931, 7.1939, 7.1945, 7.1941, 7.1937, 7.1935, 7.1931, 7.193, 7.1927, 7.1934, 7.1934, 7.1932, 7.1939, 7.1935, 7.1933, 7.193, 7.1927, 7.1924, 7.1923, 7.1911, 7.1908, 7.1907, 7.1904, 7.1902, 7.191, 7.1907, 7.1904, 7.1893, 7.1883, 7.1893, 7.189, 7.1887, 7.1884, 7.1884, 7.1894, 7.1902, 7.1903, 7.1892, 7.1889, 7.1888, 7.1887, 7.1896, 7.1898, 7.1897, 7.1907000000000005, 7.191700000000001, 7.1916, 7.1924, 7.1921, 7.1921, 7.192, 7.1917, 7.1915, 7.1912, 7.1909, 7.1908, 7.1905, 7.1903, 7.19, 7.1897, 7.1894, 7.1903, 7.191, 7.1919, 7.1927, 7.1924, 7.1934, 7.1932, 7.193, 7.1929, 7.1936, 7.1944, 7.1943, 7.1941, 7.1937, 7.1944, 7.1932, 7.1929, 7.1926, 7.1933, 7.194, 7.1937, 7.1934, 7.1932, 7.193, 7.1927, 7.1925, 7.1922, 7.192, 7.1909, 7.1906, 7.1903, 7.1901, 7.1899, 7.1897, 7.1904, 7.1904, 7.1901, 7.19, 7.1898, 7.1897, 7.1894, 7.1893, 7.189, 7.1887, 7.1885, 7.1882, 7.188, 7.1878, 7.1876, 7.1873, 7.188, 7.1877, 7.1865, 7.1863, 7.187, 7.1866, 7.1863, 7.1862, 7.1861, 7.1858, 7.186800000000001, 7.187800000000001, 7.1877, 7.1885, 7.1882, 7.1881, 7.189, 7.1891, 7.1889, 7.1891, 7.1889, 7.1902, 7.1902, 7.1898, 7.1904, 7.1902, 7.1899, 7.1896, 7.1894, 7.1892, 7.189, 7.1897, 7.1894, 7.1894, 7.1901, 7.1908, 7.1916, 7.1914, 7.1912, 7.1911, 7.191, 7.1907, 7.1895, 7.1902, 7.1912, 7.1919, 7.1916, 7.1914, 7.1911, 7.1908, 7.1923, 7.1922, 7.1929, 7.1917, 7.1916, 7.1913, 7.1912, 7.191, 7.1907, 7.1904, 7.1902, 7.19, 7.1897, 7.1904, 7.1903, 7.1949, 7.1966, 7.1954, 7.1961, 7.1958, 7.1955, 7.1954, 7.1952, 7.196, 7.1964, 7.1971, 7.197, 7.197, 7.1968, 7.1976, 7.1975, 7.1986, 7.1986, 7.1982, 7.1981, 7.1991, 7.1988, 7.1984, 7.1982, 7.198, 7.1979, 7.1978, 7.1975, 7.2008, 7.2007, 7.2006, 7.201, 7.2009, 7.2016, 7.2013, 7.2011, 7.2018, 7.2017, 7.2014, 7.201, 7.2008, 7.2006, 7.2013, 7.2021, 7.202, 7.2019, 7.2016, 7.2014, 7.2012, 7.2012, 7.2019, 7.2016, 7.2022, 7.202, 7.2026, 7.2024, 7.2032, 7.2029, 7.2036, 7.2043, 7.2053, 7.205, 7.2038, 7.2047, 7.2044, 7.2041, 7.2058, 7.2048, 7.2048, 7.2047, 7.2045, 7.2046, 7.2036, 7.2034, 7.2031, 7.2028, 7.2025, 7.2024, 7.2031, 7.2027, 7.2026, 7.2026, 7.2024, 7.2021, 7.2018, 7.2016, 7.2014, 7.2012, 7.2021, 7.202, 7.2021, 7.202, 7.2017, 7.2015, 7.2013, 7.201, 7.2007, 7.2005, 7.2005, 7.2003, 7.2001, 7.1991, 7.1989, 7.1987, 7.1984, 7.1982, 7.1989, 7.1986, 7.1985, 7.1981, 7.1981, 7.1977, 7.1974, 7.1974, 7.1981, 7.198, 7.1977, 7.1975, 7.1973, 7.1972, 7.1979, 7.1978, 7.1985, 7.1974, 7.1971, 7.1968, 7.1965, 7.1964, 7.1962, 7.1968, 7.1966, 7.1965, 7.1962, 7.1959, 7.1958, 7.1956, 7.1956, 7.1956, 7.1944, 7.1942, 7.1951, 7.195, 7.1948, 7.1947, 7.1945, 7.1946, 7.1934, 7.194, 7.1938, 7.1936, 7.1934, 7.1931, 7.1928, 7.1921, 7.1918, 7.1916, 7.1913, 7.191, 7.1907, 7.1914, 7.1913, 7.1903, 7.1903, 7.1901, 7.1898, 7.1896, 7.1895, 7.1903, 7.1905, 7.1894, 7.1891, 7.1897, 7.1895, 7.1894, 7.189, 7.1896, 7.1893, 7.1891, 7.1889, 7.1889, 7.1896, 7.1893, 7.1891, 7.1888, 7.1878, 7.1885, 7.1882, 7.1881, 7.1878, 7.1877, 7.1885, 7.1882, 7.1879, 7.1894, 7.19, 7.1898, 7.1899, 7.1905, 7.1911, 7.1909, 7.1908, 7.1915, 7.1923, 7.192, 7.1917, 7.1906, 7.1906, 7.1904, 7.1902, 7.1914, 7.1912, 7.1909, 7.193, 7.1928, 7.1926, 7.1926, 7.1925, 7.1923, 7.1921, 7.1919, 7.1917, 7.1924, 7.1922, 7.192, 7.1917, 7.1925, 7.1933, 7.1931, 7.1928, 7.1926, 7.1923, 7.192, 7.1919, 7.1928, 7.1936, 7.1933, 7.1932, 7.1929, 7.1927, 7.1926, 7.1925, 7.1923, 7.192, 7.192, 7.192, 7.1917, 7.1924, 7.1923, 7.1921, 7.1923, 7.192, 7.1919, 7.1917, 7.1919, 7.1927, 7.1934, 7.194, 7.1937, 7.1936, 7.1944, 7.1944, 7.1951, 7.1948, 7.1945, 7.1942, 7.1942, 7.1939, 7.1938, 7.1936, 7.1934, 7.1933, 7.194, 7.1937, 7.1937, 7.1936, 7.1944, 7.1941, 7.1938, 7.1935, 7.1933, 7.1933, 7.1939, 7.1938, 7.1936, 7.1933, 7.1939, 7.1937, 7.1935, 7.1925, 7.1924, 7.1923, 7.193, 7.1927, 7.1924, 7.193, 7.1927, 7.1924, 7.1921, 7.1928, 7.1925, 7.1932, 7.1931, 7.192, 7.1918, 7.1915, 7.1912, 7.192, 7.1918, 7.1958, 7.1955, 7.1959, 7.1956, 7.1963, 7.1952, 7.196, 7.1957, 7.1955, 7.1977, 7.1975, 7.1982, 7.198, 7.198, 7.1977, 7.1976, 7.1982, 7.1988, 7.1985, 7.1982, 7.1979, 7.1978, 7.1976, 7.1973, 7.1962, 7.1962, 7.1959, 7.1956, 7.1954, 7.1961, 7.1959, 7.1956, 7.1953, 7.1951, 7.1957, 7.1957, 7.1957, 7.1957, 7.1954, 7.1962, 7.1963, 7.1971, 7.1978, 7.1986, 7.1984, 7.1991, 7.1989, 7.1986, 7.1984, 7.1973, 7.197, 7.1976, 7.1976, 7.1973, 7.197, 7.1967, 7.1967, 7.1964, 7.1961, 7.1959, 7.1979, 7.1978, 7.1985, 7.1974, 7.1971, 7.1968, 7.1965, 7.1962, 7.1959, 7.1956, 7.1953, 7.1952, 7.1949, 7.1947, 7.1954, 7.1951, 7.1948, 7.1947, 7.1944, 7.1943, 7.1941, 7.1938, 7.1935, 7.1936, 7.1936, 7.1937, 7.1935, 7.1932, 7.1939, 7.1937, 7.1934, 7.1932, 7.1939, 7.1937, 7.1936, 7.1934, 7.1932, 7.1929, 7.1926, 7.1923, 7.192, 7.1917, 7.1916, 7.1924, 7.1931, 7.1929, 7.1928, 7.1926, 7.1924, 7.1922, 7.193, 7.1928, 7.1927, 7.1934, 7.1933, 7.1933, 7.1931, 7.1929, 7.1926, 7.1932, 7.194, 7.1947, 7.1953, 7.1951, 7.1957, 7.1954, 7.1962, 7.1959, 7.1957, 7.1956, 7.1954, 7.1952, 7.1959, 7.1957, 7.1956, 7.1964, 7.1962, 7.1961, 7.1958, 7.1956, 7.1962, 7.1959, 7.1956, 7.1956, 7.1974, 7.1974, 7.1972, 7.1971, 7.1977, 7.1986, 7.1986, 7.1975, 7.1972, 7.1971, 7.1968, 7.1965, 7.1964, 7.2003, 7.2001, 7.199, 7.1987, 7.1994, 7.1992, 7.1989, 7.1995, 7.1992, 7.199, 7.1979, 7.1977, 7.1975, 7.1973, 7.1972, 7.197, 7.1986, 7.1987, 7.1987, 7.1986, 7.1983, 7.199, 7.2, 7.1999, 7.1996, 7.1994, 7.1992, 7.1991, 7.1988, 7.1985, 7.1984, 7.1982, 7.1979, 7.1978, 7.1975, 7.1984, 7.1981, 7.2005, 7.2002, 7.1999, 7.1996, 7.2003, 7.2001, 7.2001, 7.2002, 7.1999, 7.1997, 7.1995, 7.1992, 7.199, 7.1987, 7.1994, 7.2009, 7.2041, 7.2051, 7.2049, 7.2055, 7.2062, 7.2059, 7.2068, 7.2067, 7.2064, 7.2061, 7.206, 7.2059, 7.2056, 7.2053, 7.2051, 7.2058, 7.2056, 7.2054, 7.2051, 7.2049, 7.2046, 7.2043, 7.205, 7.2086, 7.2083, 7.208, 7.2097, 7.2094, 7.2093, 7.209, 7.2087, 7.2087, 7.2084, 7.2084, 7.2081, 7.2078, 7.2075, 7.2072, 7.207, 7.2067, 7.2066, 7.2064, 7.2061, 7.2059, 7.2056, 7.2053, 7.205, 7.205, 7.2047, 7.2047, 7.2047, 7.2056, 7.2054, 7.206, 7.2059, 7.2056, 7.2066, 7.2064, 7.2062, 7.206, 7.2058, 7.2056, 7.2055, 7.2054, 7.2052, 7.2052, 7.2052, 7.2049, 7.2056, 7.2054, 7.2051, 7.2048, 7.2049, 7.2047, 7.2054, 7.2055, 7.2054, 7.2051, 7.2057, 7.2055, 7.2062, 7.2061, 7.2059, 7.2057, 7.2057, 7.2055, 7.2055, 7.2061, 7.2059, 7.2057, 7.2055, 7.2053, 7.2053, 7.2052, 7.2067, 7.2066, 7.2085, 7.2094, 7.2092, 7.2104, 7.2108, 7.2114, 7.2105, 7.2104, 7.2116, 7.2114, 7.2112, 7.211, 7.2109, 7.2106, 7.2105, 7.2103, 7.2111, 7.2109, 7.2117, 7.2114, 7.2112, 7.211, 7.2119, 7.2117, 7.2115, 7.2115, 7.2123, 7.2122, 7.2119, 7.2116, 7.2113, 7.2111, 7.2109, 7.2106, 7.2105, 7.2102, 7.2101, 7.2107, 7.2105, 7.2103, 7.2104, 7.2103, 7.2102, 7.2099, 7.2117, 7.2115, 7.2122, 7.212, 7.2126, 7.2124, 7.2122, 7.212, 7.2126, 7.2124, 7.2122, 7.212, 7.2127, 7.2127, 7.2126, 7.2125, 7.2122, 7.212, 7.2118, 7.2124, 7.2121, 7.212, 7.2117, 7.2116, 7.2115, 7.2112, 7.211, 7.2107, 7.2126, 7.2123, 7.2114, 7.2112, 7.2112, 7.2119, 7.2117, 7.2114, 7.2114, 7.2113, 7.2111, 7.2109, 7.2107, 7.2105, 7.2103, 7.2102, 7.2125, 7.2137, 7.2134, 7.2124, 7.2113, 7.2104, 7.2095, 7.2092, 7.209, 7.209, 7.2087, 7.2086, 7.2083, 7.2094, 7.2092, 7.2111, 7.2119, 7.2123, 7.212, 7.211, 7.2108, 7.2114, 7.2111, 7.2108, 7.2106, 7.2122, 7.212, 7.2126, 7.2123, 7.2131, 7.2128, 7.2127, 7.2132, 7.213, 7.2146, 7.2144, 7.2143, 7.2141, 7.2139, 7.2145, 7.215, 7.2147, 7.2145, 7.2143, 7.2149, 7.2148, 7.2146, 7.2147, 7.2148, 7.2145, 7.2143, 7.215, 7.2147, 7.2145, 7.2147, 7.2147, 7.2144, 7.2142, 7.2155, 7.2152, 7.2149, 7.2156, 7.2155, 7.2161, 7.2158, 7.2156, 7.2154, 7.2152, 7.215, 7.2148, 7.2147, 7.2149, 7.214, 7.2137, 7.2135, 7.2134, 7.2132, 7.2131, 7.2138, 7.2145, 7.2142, 7.2139, 7.2148, 7.2146, 7.2148, 7.2148, 7.2146, 7.2152, 7.2149, 7.2138, 7.2146, 7.2143, 7.2148, 7.2145, 7.2142, 7.214, 7.2138, 7.2143, 7.214, 7.2138, 7.2136, 7.2135, 7.2125, 7.2114, 7.2104, 7.2094, 7.2084, 7.2082, 7.2079, 7.2068, 7.2065, 7.2064, 7.2071, 7.2069, 7.2067, 7.2075, 7.2072, 7.207, 7.2076, 7.2074, 7.2072, 7.2071, 7.2072, 7.207, 7.2062, 7.2059, 7.2056, 7.2063, 7.206, 7.2057, 7.2054, 7.2053, 7.2053, 7.2051, 7.2049, 7.2046, 7.2043, 7.2041, 7.204, 7.2037, 7.2043, 7.2041, 7.2041, 7.2038, 7.2044, 7.2044, 7.2043, 7.2043, 7.2041, 7.2056, 7.2062, 7.206, 7.2094, 7.2093, 7.2092, 7.2092, 7.2089, 7.2087, 7.2086, 7.2093, 7.2099, 7.2098, 7.2095, 7.2093, 7.2091, 7.209, 7.2088, 7.2099, 7.2096, 7.2086, 7.2084, 7.2081, 7.2074, 7.2073, 7.207, 7.2061, 7.2059, 7.2058, 7.2057, 7.2055, 7.2052, 7.2058, 7.2057, 7.2056, 7.2054, 7.2061, 7.206, 7.2057, 7.2063, 7.206, 7.2058, 7.2056, 7.2055, 7.2054, 7.2053, 7.2051, 7.205, 7.2048, 7.2054, 7.2051, 7.2042, 7.2041, 7.2047, 7.2053, 7.206, 7.2058, 7.2056, 7.2056, 7.2053, 7.206, 7.2059, 7.2065, 7.2063, 7.2062, 7.206, 7.2066, 7.2057, 7.2056, 7.2055, 7.2065, 7.208, 7.2079, 7.2069, 7.2087, 7.2084, 7.2102, 7.2101, 7.2107, 7.2104, 7.2094, 7.2091, 7.2098, 7.2095, 7.2094, 7.2091, 7.2089, 7.209, 7.2087, 7.2084, 7.2082, 7.2081, 7.2078, 7.2078, 7.2084, 7.2082, 7.2079, 7.2077, 7.2085, 7.2083, 7.2083, 7.2081, 7.2093, 7.2085, 7.2092, 7.2089, 7.2086, 7.2085, 7.2091, 7.2094, 7.2085, 7.2075, 7.2065, 7.2062, 7.2066, 7.2064, 7.2061, 7.2059, 7.2057, 7.2068, 7.2073, 7.208, 7.2079, 7.2076, 7.2076, 7.2082, 7.2079, 7.2077, 7.2074, 7.208, 7.2078, 7.2068, 7.2065, 7.2065, 7.2071, 7.2077, 7.2074, 7.208, 7.2077, 7.2075, 7.2072, 7.207, 7.207, 7.2068, 7.2074, 7.2073, 7.207, 7.2076, 7.2073, 7.207, 7.206, 7.2058, 7.2057, 7.2055, 7.2054, 7.2051, 7.2057, 7.2055, 7.2061, 7.2059, 7.2065, 7.2062, 7.2061, 7.2058, 7.2055, 7.2053, 7.2051, 7.205, 7.2048, 7.2045, 7.2051, 7.2049, 7.2047, 7.2044, 7.205, 7.2047, 7.2045, 7.2052, 7.2051, 7.2049, 7.2055, 7.2052, 7.205, 7.2047, 7.2044, 7.2049, 7.2046, 7.2053, 7.2051, 7.2048, 7.2046, 7.2045, 7.2035, 7.2032, 7.2022, 7.2021, 7.2028, 7.2026, 7.2017, 7.2008, 7.2006, 7.2004, 7.2002, 7.2008, 7.2006, 7.2005, 7.1996, 7.1993, 7.1999, 7.2006, 7.1998, 7.1995, 7.1993, 7.199, 7.1996, 7.1995, 7.1992, 7.1991, 7.1989, 7.1988, 7.1986, 7.1985, 7.1984, 7.1982, 7.1973, 7.198, 7.198, 7.1986, 7.1984, 7.1982, 7.1981, 7.1979, 7.1977, 7.1975, 7.1974, 7.1972, 7.197, 7.1968, 7.1966, 7.1972, 7.1971, 7.1969, 7.1975, 7.1974, 7.198, 7.1978, 7.1977, 7.1975, 7.1972, 7.197, 7.1968, 7.1969, 7.1967, 7.1965, 7.1964, 7.1962, 7.196, 7.1958, 7.1956, 7.1957, 7.1956, 7.1954, 7.1952, 7.1951, 7.1949, 7.1947, 7.1945, 7.1943, 7.1942, 7.1939, 7.1938, 7.1936, 7.1935, 7.1934, 7.194, 7.194, 7.1945, 7.1945, 7.1942, 7.194, 7.1938, 7.1936, 7.1942, 7.1939, 7.1938, 7.1938, 7.1937, 7.1937, 7.1942, 7.1942, 7.1941, 7.1947, 7.1944, 7.1942, 7.1939, 7.1936, 7.1941, 7.1939, 7.1938, 7.1935, 7.1933, 7.1931, 7.1929, 7.1934, 7.1933, 7.1939, 7.1944, 7.1942, 7.1939, 7.1936, 7.1935, 7.1933, 7.1931, 7.1929, 7.1928, 7.1934, 7.1934, 7.1932, 7.1938, 7.1936, 7.1933, 7.1931, 7.1935, 7.1932, 7.1931, 7.1928, 7.1926, 7.1924, 7.193, 7.1928, 7.1925, 7.1922, 7.192, 7.1918, 7.1917, 7.1917, 7.1916, 7.1914, 7.1913, 7.191, 7.1909, 7.1906, 7.1904, 7.1902, 7.19, 7.1922, 7.192, 7.1917, 7.1917, 7.1915, 7.1921, 7.1927, 7.1925, 7.1922, 7.192, 7.1918, 7.1916, 7.1922, 7.1919, 7.1925, 7.1922, 7.1921, 7.192, 7.192, 7.1918, 7.1916, 7.1914, 7.1911, 7.1917, 7.1914, 7.1912, 7.191, 7.1908, 7.1905, 7.1903, 7.19, 7.1897, 7.1894, 7.1892, 7.1889, 7.1888, 7.1886, 7.1884, 7.1881, 7.1887, 7.1886, 7.1884, 7.1882, 7.1888, 7.1901, 7.1899, 7.1899, 7.1897, 7.1891, 7.1893, 7.1892, 7.1891, 7.1898, 7.1896, 7.1896, 7.19, 7.1899, 7.1904, 7.1909, 7.1906, 7.1905, 7.1911, 7.191, 7.1916, 7.1915, 7.1913, 7.1919, 7.1926, 7.1931, 7.193, 7.193, 7.1929, 7.1928, 7.1927, 7.1925, 7.1924, 7.1924, 7.1931, 7.1929, 7.1936, 7.1933, 7.1931, 7.193, 7.1928, 7.1926, 7.1932, 7.193, 7.1928, 7.1934, 7.1932, 7.1938, 7.1935, 7.1942, 7.1946, 7.1947, 7.1953, 7.1951, 7.1958, 7.1955, 7.1954, 7.1952, 7.1952, 7.195, 7.1947, 7.1946, 7.1944, 7.1942, 7.1939, 7.1938, 7.1935, 7.1941, 7.1939, 7.1936, 7.1934, 7.1932, 7.193, 7.1929, 7.1935, 7.1941, 7.194, 7.1938, 7.1945, 7.1942, 7.1948, 7.1953, 7.1961, 7.196, 7.1959, 7.1957, 7.1955, 7.1953, 7.1953, 7.1958, 7.1956, 7.1961, 7.1975, 7.1968, 7.1974, 7.1972, 7.197, 7.1969, 7.1968, 7.1965, 7.1964, 7.1963, 7.1969, 7.1967, 7.1966, 7.1972, 7.197, 7.1967, 7.1966, 7.1963, 7.1962, 7.196, 7.196, 7.1957, 7.1979, 7.1977, 7.1975, 7.1973, 7.197, 7.1969, 7.1967, 7.1966, 7.1963, 7.1961, 7.1959, 7.1957, 7.1955, 7.1953, 7.195, 7.1956, 7.1986, 7.1986, 7.1992, 7.1998, 7.1996, 7.1994, 7.1993, 7.2, 7.2001, 7.1993, 7.2011, 7.2017, 7.2051, 7.2051, 7.2049, 7.2054, 7.2052, 7.2045, 7.2069, 7.2075, 7.2075, 7.2081, 7.2082, 7.2081, 7.209, 7.2088, 7.2085, 7.2083, 7.2088, 7.2085, 7.209, 7.2087, 7.2085, 7.2083, 7.208, 7.2085, 7.2082, 7.2087, 7.2085, 7.2098, 7.2095, 7.21, 7.2098, 7.2096, 7.2095, 7.2092, 7.2089, 7.2086, 7.2083, 7.208, 7.2077, 7.2075, 7.2072, 7.2069, 7.2066, 7.2072, 7.207, 7.2068, 7.2066, 7.2063, 7.2061, 7.2058, 7.2055, 7.2053, 7.2051, 7.205, 7.2064, 7.2073, 7.2073, 7.2079, 7.2077, 7.2092, 7.2092, 7.2091, 7.2091, 7.21, 7.2114, 7.2133, 7.2131, 7.2136, 7.2149, 7.2147, 7.2152, 7.2165, 7.2164, 7.22, 7.2198, 7.2195, 7.2202, 7.2201, 7.2199, 7.2199, 7.2212, 7.2227, 7.2224, 7.2237, 7.2235, 7.2234, 7.2248, 7.2246, 7.2244, 7.2251, 7.2249, 7.2247, 7.2245, 7.2251, 7.2258, 7.2256, 7.2254, 7.2252, 7.225, 7.2247, 7.2253, 7.2254, 7.226, 7.2265, 7.2262, 7.2262, 7.2261, 7.2264, 7.2266, 7.2281, 7.228, 7.2281, 7.2279, 7.2277, 7.2275, 7.2273, 7.2279, 7.2286, 7.2284, 7.229, 7.2288, 7.2285, 7.2283, 7.2282, 7.2291, 7.2288, 7.2288, 7.2285, 7.2284, 7.2283, 7.2288, 7.2286, 7.2291, 7.2289, 7.2288, 7.2285, 7.2291, 7.2288, 7.2286, 7.2284, 7.2283, 7.228, 7.2277, 7.2275, 7.2274, 7.2271, 7.2269, 7.2267, 7.2266, 7.2264, 7.2261, 7.2259, 7.2258, 7.2264, 7.2264, 7.2262, 7.226, 7.2258, 7.2256, 7.2261, 7.2259, 7.2264, 7.2262, 7.226, 7.2259, 7.2257, 7.2255, 7.2253, 7.2258, 7.2263, 7.226, 7.2259, 7.2257, 7.2255, 7.2253, 7.2258, 7.2257, 7.2255, 7.2252, 7.225, 7.2248, 7.2254, 7.2259, 7.2265, 7.2273, 7.2272, 7.227, 7.227, 7.2286, 7.2278, 7.2276, 7.2289, 7.2303, 7.2301, 7.2306, 7.2304, 7.2303, 7.2309, 7.2308, 7.2306, 7.2319, 7.2316, 7.2313, 7.2318, 7.2323, 7.2321, 7.2319, 7.2316, 7.2315, 7.2313, 7.2323, 7.2321, 7.2318, 7.2316, 7.2322, 7.2319, 7.2317, 7.2315, 7.2313, 7.2311, 7.231, 7.2309, 7.2314, 7.2311, 7.2308, 7.2315, 7.2314, 7.2314, 7.2313, 7.2311, 7.231, 7.2308, 7.2305, 7.2302, 7.2299, 7.2304, 7.2318, 7.2319, 7.2317, 7.2323, 7.2329, 7.2327, 7.2325, 7.2323, 7.2321, 7.232, 7.2318, 7.2316, 7.2314, 7.2313, 7.2312, 7.2312, 7.231, 7.2307, 7.2306, 7.2305, 7.2307, 7.2305, 7.2303], '192.168.122.114': [5.3751, 5.5183, 5.9349, 5.8571, 5.9484, 5.8592, 6.1894, 5.5516, 5.6446, 6.1853, 6.1591, 6.2215, 6.2652, 6.3113, 6.655, 6.6232, 6.6016, 6.567, 6.5267, 6.5279, 6.487, 6.714, 6.6597, 6.6309, 6.7994, 6.7505, 6.7381, 6.719, 6.6713, 6.6567, 6.6306, 6.612, 6.6109, 6.5766, 6.7266, 6.6884, 6.7048, 6.6743, 6.7821, 6.776, 6.8883, 7.0137, 6.9821, 6.9577, 6.9308, 7.0112, 7.0295, 7.0541, 7.0355, 7.0046, 6.9092, 6.8896, 6.9667, 6.9391, 7.0119, 7.0872, 7.0676, 7.0374, 7.0147, 6.9868, 6.9799, 6.957, 7.0192, 7.0076, 6.9886, 6.9656, 6.9533, 6.9344, 6.9105, 6.8902, 6.8128, 6.8047, 6.802, 6.7868, 6.7777, 6.8335, 6.8256, 6.8747, 6.855, 6.8516, 6.8417, 6.8225, 6.8123, 6.8074, 6.7907, 6.7739, 6.7673, 6.7526, 6.7965, 6.7803, 6.7654, 6.7607, 6.8084, 6.8001, 6.8418, 6.8366, 6.8207, 6.8193, 6.8034, 6.7912, 6.7782, 6.7644, 6.7611, 6.7566, 6.7562, 6.7532, 6.74, 6.7345, 6.7249, 6.7154, 6.7324, 6.9672, 7.0783, 7.0792, 7.0688, 7.0611, 7.0533, 7.0537, 7.0414, 7.031, 7.0174, 7.0032, 6.9901, 6.9856, 6.9716, 7.0015, 6.9954, 6.9885, 6.9756, 6.9649, 6.9597, 6.9939, 6.9877, 6.976, 6.9786, 6.9673, 6.9963, 6.9902, 6.9781, 7.0093, 7.0, 6.9937, 7.0229, 7.0239, 7.0146, 7.0042, 7.007, 7.0356, 7.0247, 7.0157, 7.0131, 7.0044, 6.9973, 6.9947, 6.9868, 6.9794, 6.977, 6.9664, 6.9603, 6.9596, 6.96, 6.9857, 6.9835, 6.9805, 7.0116, 7.0057, 6.9994, 6.9937, 6.9925, 7.0147, 7.0119, 7.0041, 6.9993, 6.9955, 6.9895, 6.9905, 6.9849, 6.9764, 6.9685, 6.9695, 6.9652, 6.9574, 6.9493, 6.9419, 6.9646, 6.9569, 6.9499, 6.9431, 6.9387, 6.9368, 6.9331, 6.9297, 6.9226, 6.945, 6.9381, 6.9347, 6.9327, 6.9251, 7.0271, 7.0202, 7.0175, 7.0169, 7.0093, 7.0103, 7.035, 7.0282, 7.0298, 7.0257, 7.0183, 7.0135, 7.0059, 7.0257, 7.0206, 7.0386, 7.034, 7.0266, 7.021, 7.0387, 7.0551, 7.0731, 7.0685, 7.0842, 7.077, 7.0698, 7.0683, 7.0884, 7.065, 7.0589, 7.0373, 7.0597, 7.0943, 7.1108, 7.103, 7.1411, 7.1361, 7.1288, 7.1479, 7.1422, 7.1362, 7.1314, 7.1292, 7.1219, 7.1145, 7.108, 7.1082, 7.1055, 7.1209, 7.1394, 7.1326, 7.1309, 7.1522, 7.1451, 7.1415, 7.1766, 7.1757, 7.1804, 7.1787, 7.1738, 7.1715, 7.1659, 7.1644, 7.1598, 7.1776, 7.1756, 7.1706, 7.1673, 7.1612, 7.1736, 7.1686, 7.1632, 7.1694, 7.1647, 7.1621, 7.1783, 7.1734, 7.1752, 7.1706, 7.167, 7.1616, 7.161, 7.1556, 7.151, 7.1485, 7.1462, 7.1449, 7.1419, 7.1412, 7.1366, 7.1316, 7.1268, 7.1222, 7.1191, 7.1146, 7.1089, 7.124, 7.1181, 7.1317, 7.1267, 7.1396, 7.1525, 7.1483, 7.1469, 7.1448, 7.1645, 7.1605, 7.1607, 7.1603, 7.1592, 7.1529, 7.1487, 7.1452, 7.1438, 7.1575, 7.1735, 7.1672, 7.1651, 7.1591, 7.1547, 7.1497, 7.1466, 7.1473, 7.146, 7.1444, 7.1391, 7.1366, 7.1309, 7.1255, 7.1368, 7.1491, 7.1448, 7.1565, 7.1516, 7.1475, 7.1594, 7.1561, 7.1529, 7.1737, 7.173, 7.186, 7.198, 7.2092, 7.2049, 7.2015, 7.1992, 7.1944, 7.1893, 7.2001, 7.195, 7.193, 7.1917, 7.1872, 7.1837, 7.1796, 7.1931, 7.191, 7.2042, 7.2001, 7.1959, 7.2082, 7.2203, 7.2158, 7.2124, 7.2078, 7.204, 7.2003, 7.199, 7.211, 7.2065, 7.2038, 7.2223, 7.2323, 7.2419, 7.2386, 7.2496, 7.2455, 7.2405, 7.2378, 7.2469, 7.2443, 7.241, 7.2375, 7.2352, 7.2306, 7.2397, 7.237, 7.2354, 7.2466, 7.259, 7.2772, 7.2723, 7.2818, 7.2773, 7.2749, 7.2723, 7.2711, 7.2803, 7.2786, 7.2911, 7.2862, 7.2812, 7.2766, 7.2724, 7.2808, 7.2765, 7.2727, 7.2685, 7.2661, 7.2632, 7.2613, 7.2697, 7.2656, 7.2626, 7.2579, 7.2536, 7.2516, 7.2621, 7.26, 7.2698, 7.2654, 7.2746, 7.2701, 7.2676, 7.2661, 7.2632, 7.26, 7.2714, 7.2681, 7.2774, 7.2738, 7.2713, 7.2685, 7.2654, 7.2662, 7.2626, 7.2719, 7.271, 7.2686, 7.278, 7.2776, 7.2746, 7.2831, 7.2801, 7.288, 7.296, 7.2914, 7.2994, 7.3082, 7.3173, 7.3129, 7.3212, 7.3286, 7.3247, 7.3228, 7.3186, 7.3168, 7.3134, 7.3118, 7.3076, 7.3041, 7.3008, 7.2981, 7.2941, 7.2899, 7.2855, 7.2739, 7.2714, 7.2687, 7.2662, 7.2644, 7.2628, 7.2589, 7.2662, 7.2625, 7.2586, 7.2663, 7.2625, 7.2701, 7.2667, 7.2648, 7.2762, 7.2722, 7.2925, 7.2913, 7.2884, 7.3073, 7.3032, 7.2997, 7.3075, 7.3152, 7.3121, 7.3095, 7.3231, 7.3189, 7.3266, 7.3244, 7.3207, 7.3182, 7.3271, 7.3486, 7.3568, 7.3537, 7.3627, 7.3735, 7.3712, 7.3709, 7.3694, 7.3665, 7.3636, 7.3634, 7.3605, 7.3583, 7.356, 7.3529, 7.3731, 7.3697, 7.3692, 7.3656, 7.3632, 7.36, 7.3565, 7.3562, 7.3534, 7.3694, 7.3706, 7.3682, 7.3649, 7.3628, 7.3701, 7.3667, 7.3631, 7.3595, 7.3581, 7.356, 7.3528, 7.3524, 7.3488, 7.3454, 7.3417, 7.3396, 7.3379, 7.3445, 7.3424, 7.3402, 7.3381, 7.3351, 7.3326, 7.3292, 7.3354, 7.3321, 7.3304, 7.3269, 7.3234, 7.321, 7.3276, 7.3251, 7.3255, 7.3218, 7.3184, 7.3153, 7.3131, 7.3106, 7.3114, 7.3083, 7.305, 7.3016, 7.2982, 7.2966, 7.2938, 7.2914, 7.2878, 7.2855, 7.285, 7.2917, 7.2892, 7.2875, 7.294, 7.3014, 7.2981, 7.3046, 7.3013, 7.3018, 7.2999, 7.2971, 7.2957, 7.3027, 7.3002, 7.297, 7.2958, 7.2967, 7.3035, 7.3018, 7.3001, 7.2974, 7.2956, 7.3019, 7.3003, 7.3156, 7.3399, 7.3392, 7.3363, 7.3437, 7.3419, 7.3392, 7.3485, 7.3672, 7.38, 7.3776, 7.3751, 7.3728, 7.3703, 7.3618, 7.361, 7.3609, 7.3581, 7.356, 7.3528, 7.3505, 7.3832, 7.3836, 7.3811, 7.3881, 7.386, 7.3846, 7.3817, 7.3798, 7.3766, 7.3794, 7.3776, 7.3746, 7.3725, 7.3693, 7.3665, 7.365, 7.3703, 7.3673, 7.3652, 7.3848, 7.3834, 7.3807, 7.3783, 7.3758, 7.3736, 7.379, 7.3776, 7.3749, 7.3718, 7.3781, 7.3753, 7.3721, 7.3691, 7.3663, 7.3716, 7.3685, 7.3671, 7.3652, 7.3635, 7.361, 7.3601, 7.357, 7.3629, 7.3604, 7.3668, 7.3638, 7.3695, 7.3669, 7.364, 7.3613, 7.3595, 7.3578, 7.363, 7.3623, 7.3602, 7.3659, 7.3645, 7.3624, 7.3605, 7.3575, 7.3627, 7.3682, 7.3653, 7.3707, 7.3706, 7.3762, 7.3821, 7.3798, 7.3853, 7.3822, 7.381, 7.3853, 7.3829, 7.3813, 7.3795, 7.377, 7.3749, 7.373, 7.3995, 7.3974, 7.3945, 7.3931, 7.3983, 7.3962, 7.3942, 7.3927, 7.3911, 7.3968, 7.3944, 7.3918, 7.3901, 7.3946, 7.3925, 7.3901, 7.3883, 7.3857, 7.3915, 7.389, 7.3878, 7.4153, 7.4127, 7.4121, 7.4096, 7.4153, 7.414, 7.4114, 7.4089, 7.4073, 7.4053, 7.4048, 7.4025, 7.3996, 7.3982, 7.3955, 7.3935, 7.3921, 7.4076, 7.4053, 7.3963, 7.3948, 7.392, 7.3903, 7.3874, 7.3851, 7.3838, 7.3816, 7.3867, 7.3853, 7.3836, 7.3826, 7.381, 7.3784, 7.3775, 7.3763, 7.375, 7.3737, 7.3715, 7.3693, 7.3675, 7.3668, 7.3666, 7.3642, 7.3618, 7.3592, 7.358, 7.3552, 7.3538, 7.3526, 7.3502, 7.3494, 7.3544, 7.3528, 7.3502, 7.348, 7.3457, 7.3512, 7.349, 7.3466, 7.3444, 7.342, 7.3398, 7.3376, 7.3365, 7.3412, 7.353, 7.3577, 7.3621, 7.3602, 7.3591, 7.3653, 7.3699, 7.3701, 7.3743, 7.3857, 7.3832, 7.3806, 7.3781, 7.3822, 7.3808, 7.3789, 7.3768, 7.3743, 7.3721, 7.3707, 7.3681, 7.3663, 7.3647, 7.3621, 7.36, 7.3576, 7.3552, 7.353, 7.3511, 7.3493, 7.3474, 7.3464, 7.3503, 7.3543, 7.3525, 7.3516, 7.3496, 7.3484, 7.3469, 7.346, 7.3437, 7.3424, 7.3416, 7.3393, 7.3372, 7.3365, 7.3411, 7.3395, 7.3388, 7.3368, 7.3385, 7.3371, 7.3348, 7.3327, 7.3402, 7.338, 7.3366, 7.3409, 7.3387, 7.3366, 7.3344, 7.3327, 7.3306, 7.3294, 7.3284, 7.3284, 7.326, 7.325, 7.3174, 7.3213, 7.3309, 7.3418, 7.3399, 7.3388, 7.3373, 7.3355, 7.3342, 7.3321, 7.3299, 7.3279, 7.3267, 7.3251, 7.3227, 7.3278, 7.3262, 7.3247, 7.3233, 7.3271, 7.3257, 7.3233, 7.3211, 7.3253, 7.3267, 7.3248, 7.3225, 7.3211, 7.3249, 7.3226, 7.3204, 7.318, 7.3218, 7.3255, 7.3232, 7.3217, 7.3255, 7.3254, 7.3238, 7.3215, 7.3257, 7.3243, 7.323, 7.3212, 7.3191, 7.3182, 7.3226, 7.3211, 7.3194, 7.3179, 7.3159, 7.3208, 7.3294, 7.3381, 7.3432, 7.342, 7.3404, 7.3388, 7.343, 7.341, 7.3388, 7.3368, 7.3354, 7.3345, 7.3335, 7.3325, 7.331, 7.3291, 7.3278, 7.3258, 7.3237, 7.3219, 7.3208, 7.3198, 7.3179, 7.3179, 7.3158, 7.3138, 7.3119, 7.3101, 7.3154, 7.3202, 7.3219, 7.3172, 7.316, 7.3143, 7.3125, 7.3128, 7.3129, 7.3113, 7.3095, 7.3084, 7.3065, 7.3137, 7.3131, 7.3177, 7.3163, 7.3242, 7.3229, 7.3222, 7.3211, 7.3193, 7.3179, 7.3162, 7.3147, 7.3194, 7.3176, 7.3242, 7.3223, 7.3219, 7.3213, 7.3197, 7.3182, 7.3165, 7.3144, 7.313, 7.312, 7.3111, 7.3096, 7.3078, 7.3104, 7.3092, 7.3136, 7.3122, 7.316, 7.3153, 7.3189, 7.3169, 7.3155, 7.3139, 7.312, 7.3113, 7.3096, 7.3079, 7.3065, 7.3054, 7.3045, 7.3033, 7.3071, 7.3061, 7.3049, 7.3102, 7.3089, 7.3094, 7.3077, 7.3065, 7.3047, 7.3038, 7.3025, 7.3017, 7.3055, 7.3049, 7.3088, 7.3073, 7.3067, 7.3105, 7.3089, 7.3073, 7.3172, 7.3159, 7.3142, 7.3134, 7.3223, 7.3215, 7.3152, 7.3133, 7.3121, 7.3154, 7.3144, 7.3131, 7.3172, 7.3165, 7.3145, 7.3136, 7.3177, 7.3217, 7.3204, 7.319, 7.323, 7.3213, 7.3201, 7.3186, 7.3172, 7.3162, 7.3198, 7.3191, 7.3179, 7.3285, 7.3276, 7.3277, 7.3264, 7.3262, 7.3243, 7.3229, 7.3213, 7.3195, 7.3179, 7.3167, 7.3149, 7.3135, 7.3125, 7.3107, 7.3141, 7.3172, 7.3158, 7.3191, 7.3177, 7.3178, 7.3173, 7.3158, 7.3151, 7.3185, 7.3177, 7.3159, 7.3197, 7.3179, 7.3188, 7.3177, 7.3167, 7.3148, 7.3133, 7.3119, 7.3106, 7.3088, 7.3036, 7.3077, 7.3065, 7.3049, 7.3041, 7.3076, 7.3066, 7.3051, 7.3138, 7.312, 7.3108, 7.3089, 7.3072, 7.3055, 7.3039, 7.3031, 7.3013, 7.2995, 7.2982, 7.2967, 7.295, 7.2935, 7.2934, 7.299, 7.2976, 7.3046, 7.3132, 7.3122, 7.3107, 7.3095, 7.3081, 7.3063, 7.3058, 7.309, 7.3077, 7.3071, 7.3103, 7.3087, 7.3074, 7.3056, 7.309, 7.3082, 7.3067, 7.31, 7.3095, 7.3089, 7.3081, 7.3065, 7.3062, 7.3047, 7.3076, 7.3063, 7.3049, 7.3045, 7.3176, 7.3177, 7.3161, 7.3201, 7.3233, 7.3268, 7.3302, 7.3299, 7.3283, 7.3322, 7.3346, 7.3378, 7.3373, 7.3362, 7.3348, 7.3337, 7.3341, 7.3329, 7.3283, 7.3276, 7.3271, 7.3258, 7.3247, 7.3229, 7.3217, 7.3204, 7.3195, 7.3183, 7.3166, 7.3158, 7.3151, 7.3138, 7.3136, 7.3119, 7.3103, 7.3099, 7.3085, 7.307, 7.3063, 7.3051, 7.3083, 7.3077, 7.3063, 7.3047, 7.3031, 7.3014, 7.3049, 7.3032, 7.3058, 7.3059, 7.3047, 7.3031, 7.3061, 7.3092, 7.3077, 7.3098, 7.3083, 7.3072, 7.3099, 7.3087, 7.308, 7.3064, 7.3051, 7.304, 7.3029, 7.3013, 7.3001, 7.2988, 7.2973, 7.296, 7.2992, 7.2975, 7.2962, 7.2992, 7.298, 7.297, 7.2958, 7.2944, 7.2893, 7.2983, 7.3015, 7.301, 7.2993, 7.2982, 7.2967, 7.296, 7.2947, 7.294, 7.2969, 7.3002, 7.2991, 7.2975, 7.298, 7.2973, 7.3006, 7.2995, 7.2989, 7.2976, 7.2964, 7.2949, 7.2939, 7.2969, 7.2956, 7.2946, 7.2932, 7.2919, 7.291, 7.2901, 7.2886, 7.287, 7.2856, 7.2898, 7.289, 7.2878, 7.2869, 7.2853, 7.284, 7.2872, 7.2861, 7.2855, 7.2841, 7.2825, 7.2859, 7.2844, 7.2829, 7.2815, 7.2801, 7.2794, 7.2783, 7.2772, 7.2766, 7.2755, 7.2744, 7.2826, 7.2813, 7.2808, 7.2805, 7.2791, 7.2781, 7.2772, 7.2801, 7.2788, 7.2775, 7.2767, 7.2764, 7.2759, 7.2745, 7.2736, 7.2764, 7.2751, 7.2741, 7.2891, 7.293, 7.2928, 7.2925, 7.2916, 7.291, 7.2896, 7.2887, 7.2874, 7.2861, 7.2848, 7.2844, 7.2841, 7.2832, 7.2822, 7.281, 7.28, 7.2787, 7.2774, 7.2805, 7.2799, 7.2789, 7.2823, 7.285, 7.2839, 7.2828, 7.2814, 7.2842, 7.2834, 7.282, 7.2807, 7.2793, 7.2864, 7.2849, 7.2835, 7.2825, 7.282, 7.2813, 7.2801, 7.2829, 7.2817, 7.2848, 7.284, 7.283, 7.282, 7.2813, 7.2801, 7.2789, 7.2776, 7.2774, 7.2803, 7.2837, 7.2827, 7.2851, 7.2877, 7.2905, 7.3015, 7.3007, 7.2992, 7.2984, 7.2971, 7.2998, 7.3025, 7.3012, 7.3005, 7.2991, 7.3018, 7.3053, 7.3039, 7.3025, 7.3011, 7.2998, 7.2985, 7.2975, 7.2968, 7.2954, 7.2943, 7.2969, 7.2998, 7.3023, 7.3009, 7.2995, 7.2982, 7.2967, 7.2953, 7.298, 7.3005, 7.2994, 7.3018, 7.3045, 7.3075, 7.3036, 7.3066, 7.3056, 7.3183, 7.3176, 7.3166, 7.3154, 7.3144, 7.3167, 7.316, 7.3148, 7.3173, 7.316, 7.3148, 7.3134, 7.3133, 7.3131, 7.3122, 7.3116, 7.3103, 7.3137, 7.3128, 7.3156, 7.3147, 7.3138, 7.3127, 7.3116, 7.3103, 7.3089, 7.3124, 7.3111, 7.3144, 7.3134, 7.3159, 7.3149, 7.3135, 7.316, 7.3153, 7.3139, 7.3165, 7.3152, 7.3138, 7.3124, 7.3112, 7.3137, 7.313, 7.312, 7.3109, 7.3137, 7.3125, 7.3116, 7.3074, 7.3067, 7.3093, 7.3082, 7.3107, 7.3132, 7.3123, 7.3116, 7.3143, 7.3167, 7.3153, 7.314, 7.3132, 7.3124, 7.3112, 7.3105, 7.313, 7.3116, 7.3103, 7.3129, 7.316, 7.3184, 7.3171, 7.3209, 7.3199, 7.3226, 7.3212, 7.3204, 7.319, 7.3179, 7.3166, 7.3252, 7.3239, 7.3263, 7.3292, 7.3279, 7.327, 7.3295, 7.3286, 7.3275, 7.3303, 7.3292, 7.3279, 7.3268, 7.3256, 7.3285, 7.3278, 7.3266, 7.3259, 7.3262, 7.3261, 7.3288, 7.3281, 7.3309, 7.3299, 7.3295, 7.3322, 7.3308, 7.3301, 7.3302, 7.3295, 7.3282, 7.3271, 7.3268, 7.3293, 7.3281, 7.327, 7.3296, 7.3287, 7.3274, 7.3272, 7.3261, 7.3283, 7.3309, 7.3312, 7.3317, 7.3306, 7.3296, 7.332, 7.3306, 7.33, 7.3325, 7.3318, 7.3308, 7.3299, 7.3286, 7.3309, 7.3298, 7.3286, 7.3287, 7.3287, 7.3282, 7.328, 7.3274, 7.3272, 7.3263, 7.3253, 7.3247, 7.3235, 7.3222, 7.3212, 7.32, 7.3191, 7.3181, 7.3172, 7.316, 7.3152, 7.3141, 7.3136, 7.3124, 7.3115, 7.3138, 7.3132, 7.3124, 7.3124, 7.312, 7.3108, 7.3095, 7.3085, 7.3075, 7.3068, 7.3059, 7.3048, 7.3042, 7.3066, 7.3053, 7.3042, 7.3069, 7.3067, 7.3112, 7.3134, 7.3129, 7.3117, 7.3111, 7.3142, 7.3291, 7.3365, 7.3359, 7.3351, 7.3379, 7.3373, 7.3361, 7.3348, 7.3373, 7.336, 7.3351, 7.3341, 7.3365, 7.3356, 7.3349, 7.3375, 7.3364, 7.3355, 7.3396, 7.3385, 7.3373, 7.3436, 7.3426, 7.3416, 7.3405, 7.3397, 7.3391, 7.3383, 7.337, 7.3358, 7.3346, 7.334, 7.3364, 7.3355, 7.3346, 7.3335, 7.3336, 7.3358, 7.3345, 7.3333, 7.3323, 7.3348, 7.337, 7.3359, 7.3351, 7.3339, 7.3326, 7.3317, 7.3312, 7.327, 7.3261, 7.3253, 7.3241, 7.3234, 7.3229, 7.3229, 7.3217, 7.3209, 7.3201, 7.319, 7.3185, 7.3175, 7.3171, 7.3162, 7.3158, 7.3181, 7.3171, 7.3161, 7.3152, 7.3141, 7.3129, 7.3124, 7.3114, 7.3103, 7.3095, 7.3099, 7.3087, 7.3114, 7.311, 7.3108, 7.3101, 7.3091, 7.3116, 7.3144, 7.3131, 7.3129, 7.312, 7.3084, 7.3114, 7.3103, 7.3187, 7.3184, 7.3205, 7.3199, 7.3226, 7.3223, 7.3214, 7.3241, 7.3263, 7.3262, 7.3282, 7.327, 7.3258, 7.3246, 7.3237, 7.3228, 7.3223, 7.3215, 7.3208, 7.3196, 7.3192, 7.3183, 7.3172, 7.3168, 7.3158, 7.3148, 7.3141, 7.3137, 7.3134, 7.3165, 7.3157, 7.3176, 7.3164, 7.3157, 7.3176, 7.3167, 7.3155, 7.3143, 7.3135, 7.3153, 7.3144, 7.3132, 7.3123, 7.3116, 7.3111, 7.3102, 7.3125, 7.3117, 7.3109, 7.3101, 7.3098, 7.3096, 7.3089, 7.3112, 7.3105, 7.3133, 7.316, 7.3154, 7.3145, 7.3138, 7.313, 7.3155, 7.3187, 7.3225, 7.3219, 7.3244, 7.3267, 7.3261, 7.3253, 7.3242, 7.3233, 7.3255, 7.3279, 7.3272, 7.3265, 7.326, 7.3254, 7.325, 7.3271, 7.3262, 7.3283, 7.3274, 7.3265, 7.3253, 7.3246, 7.3267, 7.326, 7.3256, 7.3251, 7.3255, 7.3243, 7.3236, 7.3225, 7.3214, 7.321, 7.3207, 7.3206, 7.3198, 7.3193, 7.319, 7.3184, 7.3175, 7.3169, 7.316, 7.3181, 7.3203, 7.3194, 7.3214, 7.3204, 7.3201, 7.3192, 7.3187, 7.3178, 7.3201, 7.3199, 7.3189, 7.3183, 7.3177, 7.3165, 7.3129, 7.3119, 7.3142, 7.3133, 7.3122, 7.3116, 7.311, 7.3106, 7.3095, 7.3115, 7.3109, 7.31, 7.3091, 7.3085, 7.3075, 7.3098, 7.3104, 7.3094, 7.3117, 7.3108, 7.3104, 7.3127, 7.312, 7.3119, 7.3109, 7.3128, 7.3118, 7.3117, 7.3135, 7.3127, 7.3148, 7.3141, 7.3159, 7.3151, 7.3171, 7.3162, 7.3153, 7.3144, 7.3163, 7.3159, 7.3149, 7.3139, 7.3133, 7.3124, 7.3117, 7.3138, 7.3133, 7.3122, 7.3115, 7.3114, 7.3105, 7.3128, 7.3118, 7.3112, 7.3109, 7.31, 7.3094, 7.3108, 7.3109, 7.3103, 7.3097, 7.3087, 7.3079, 7.307, 7.3091, 7.3113, 7.3105, 7.3128, 7.3117, 7.3109, 7.3133, 7.3126, 7.3123, 7.3116, 7.3107, 7.3132, 7.313, 7.3123, 7.3118, 7.3109, 7.3108, 7.3109, 7.3102, 7.3101, 7.3094, 7.3115, 7.3106, 7.3097, 7.3118, 7.3109, 7.3102, 7.3095, 7.3119, 7.3136, 7.3128, 7.3117, 7.3169, 7.3164, 7.3155, 7.3157, 7.3152, 7.3142, 7.3135, 7.3128, 7.3183, 7.3174, 7.3217, 7.3209, 7.32, 7.3223, 7.3217, 7.3212, 7.3207, 7.3229, 7.325, 7.324, 7.3231, 7.3225, 7.3244, 7.3235, 7.3233, 7.3225, 7.3247, 7.3239, 7.3239, 7.326, 7.325, 7.3242, 7.3237, 7.3231, 7.3223, 7.3214, 7.3208, 7.3228, 7.3221, 7.3213, 7.3204, 7.3195, 7.3186, 7.3177, 7.3198, 7.3193, 7.3186, 7.3179, 7.3172, 7.3165, 7.3159, 7.3153, 7.315, 7.3148, 7.3142, 7.3165, 7.3158, 7.3177, 7.3177, 7.3175, 7.3169, 7.3169, 7.3162, 7.3152, 7.3174, 7.3197, 7.3192, 7.3183, 7.3175, 7.3169, 7.3161, 7.313, 7.3148, 7.3139, 7.3134, 7.3127, 7.3122, 7.3145, 7.3135, 7.3132, 7.3153, 7.3149, 7.3152, 7.3144, 7.3133, 7.3126, 7.312, 7.3113, 7.3136, 7.3126, 7.312, 7.3141, 7.3139, 7.3139, 7.313, 7.3122, 7.3118, 7.3113, 7.3111, 7.3103, 7.3101, 7.312, 7.3139, 7.3133, 7.3126, 7.3117, 7.3107, 7.3099, 7.3092, 7.3096, 7.3086, 7.3136, 7.3129, 7.3154, 7.3162, 7.3187, 7.3179, 7.3173, 7.3166, 7.3157, 7.3148, 7.312, 7.3132, 7.3124, 7.3142, 7.3136, 7.3155, 7.3177, 7.3174, 7.3167, 7.3158, 7.3157, 7.3178, 7.3176, 7.3234, 7.3227, 7.3226, 7.3224, 7.3215, 7.3207, 7.3202, 7.3194, 7.3185, 7.3184, 7.3175, 7.3165, 7.3159, 7.3152, 7.3173, 7.317, 7.3165, 7.3157, 7.3149, 7.3143, 7.3134, 7.3132, 7.3122, 7.3113, 7.3131, 7.3151, 7.3142, 7.3134, 7.3128, 7.3118, 7.3136, 7.3154, 7.3122, 7.3116, 7.3108, 7.31, 7.3096, 7.3091, 7.3109, 7.3128, 7.3119, 7.3109, 7.3099, 7.3091, 7.3087, 7.3079, 7.3071, 7.3068, 7.3063, 7.3055, 7.3046, 7.3038, 7.3032, 7.3024, 7.3042, 7.3034, 7.3027, 7.302, 7.3015, 7.3007, 7.2998, 7.299, 7.2982, 7.2972, 7.2963, 7.2953, 7.2944, 7.2935, 7.2929, 7.2947, 7.2938, 7.2928, 7.2928, 7.2947, 7.2939, 7.2931, 7.2923, 7.2914, 7.291, 7.2879, 7.2871, 7.2863, 7.2854, 7.2849, 7.284, 7.2834, 7.2827, 7.2817, 7.2809, 7.28, 7.2793, 7.2785, 7.2775, 7.2772, 7.2792, 7.2788, 7.2783, 7.2775, 7.2767, 7.276, 7.2755, 7.2756, 7.2777, 7.277, 7.2764, 7.2755, 7.2748, 7.2741, 7.2734, 7.2728, 7.2726, 7.2721, 7.2717, 7.2709, 7.2703, 7.2697, 7.2693, 7.2711, 7.2729, 7.2724, 7.2717, 7.2709, 7.2729, 7.2723, 7.2739, 7.2713, 7.271, 7.2706, 7.2699, 7.2692, 7.2683, 7.2675, 7.2693, 7.2688, 7.2707, 7.2699, 7.2691, 7.2708, 7.27, 7.27, 7.2698, 7.2715, 7.2711, 7.2706, 7.2697, 7.2693, 7.2711, 7.2704, 7.2697, 7.2719, 7.2713, 7.273, 7.2746, 7.2744, 7.2739, 7.273, 7.2746, 7.2737, 7.2755, 7.2771, 7.2767, 7.2767, 7.276, 7.2751, 7.2749, 7.2742, 7.2741, 7.2732, 7.2731, 7.2728, 7.2727, 7.2721, 7.2723, 7.2765, 7.2766, 7.285, 7.2849, 7.2841, 7.2835, 7.2852, 7.2871, 7.2889, 7.2879, 7.2872, 7.2868, 7.286, 7.2854, 7.285, 7.2869, 7.2862, 7.2853, 7.2847, 7.2865, 7.2858, 7.2851, 7.2849, 7.2844, 7.2835, 7.2829, 7.2823, 7.282, 7.2847, 7.2866, 7.2858, 7.2849, 7.2865, 7.286, 7.2859, 7.2878, 7.2871, 7.2866, 7.2865, 7.2893, 7.2889, 7.2908, 7.2901, 7.2894, 7.2886, 7.2903, 7.2899, 7.2897, 7.2891, 7.289, 7.2883, 7.2877, 7.287, 7.2864, 7.2859, 7.2851, 7.2843, 7.2842, 7.2834, 7.2832, 7.2846, 7.2861, 7.2857, 7.2851, 7.2844, 7.2863, 7.2855, 7.2852, 7.2844, 7.2837, 7.2831, 7.2827, 7.2842, 7.2839, 7.2835, 7.2833, 7.2829, 7.282, 7.2836, 7.2828, 7.2822, 7.2816, 7.2812, 7.2829, 7.2845, 7.2836, 7.2829, 7.2822, 7.2815, 7.2807, 7.2799, 7.2771, 7.2762, 7.2754, 7.2772, 7.2788, 7.2785, 7.2779, 7.2771, 7.2765, 7.2779, 7.2773, 7.2765, 7.2782, 7.2774, 7.2771, 7.2765, 7.276, 7.2776, 7.277, 7.2786, 7.2778, 7.277, 7.2762, 7.2754, 7.2745, 7.2738, 7.2754, 7.2747, 7.274, 7.2758, 7.2749, 7.2744, 7.2735, 7.2726, 7.2742, 7.2738, 7.2801, 7.282, 7.2838, 7.283, 7.2846, 7.2838, 7.2834, 7.2828, 7.2873, 7.2896, 7.2893, 7.2914, 7.2907, 7.2899, 7.294, 7.2943, 7.2937, 7.2929, 7.2925, 7.2919, 7.2911, 7.2904, 7.29, 7.2895, 7.2891, 7.2885, 7.2877, 7.287, 7.2889, 7.2882, 7.2874, 7.2867, 7.2866, 7.288, 7.288, 7.2878, 7.2921, 7.2936, 7.2934, 7.296, 7.2977, 7.2971, 7.2989, 7.2989, 7.2983, 7.2978, 7.2974, 7.2991, 7.2983, 7.3001, 7.2999, 7.2995, 7.2994, 7.3009, 7.3023, 7.3016, 7.3009, 7.3027, 7.3021, 7.3041, 7.3034, 7.3053, 7.3046, 7.3045, 7.3061, 7.3053, 7.3025, 7.3018, 7.3033, 7.3026, 7.3021, 7.3016, 7.3016, 7.3018, 7.3015, 7.301, 7.3059, 7.3051, 7.3046, 7.3038, 7.3034, 7.3031, 7.3024, 7.3038, 7.3033, 7.3025, 7.3019, 7.3011, 7.3033, 7.3049, 7.3044, 7.3062, 7.3057, 7.305, 7.3021, 7.3013, 7.3007, 7.3001, 7.2994, 7.3008, 7.3005, 7.2998, 7.2992, 7.2988, 7.298, 7.2973, 7.2966, 7.296, 7.2954, 7.2949, 7.2941, 7.2956, 7.2953, 7.2945, 7.2939, 7.2955, 7.2948, 7.2942, 7.2945, 7.2939, 7.2933, 7.293, 7.2924, 7.2926, 7.295, 7.2966, 7.2961, 7.2956, 7.2948, 7.2942, 7.2934, 7.2929, 7.2925, 7.2918, 7.2933, 7.2949, 7.2946, 7.294, 7.2934, 7.295, 7.2966, 7.2962, 7.2955, 7.295, 7.2945, 7.2945, 7.2937, 7.2973, 7.2966, 7.2982, 7.2974, 7.3031, 7.3027, 7.3023, 7.3015, 7.3007, 7.3022, 7.302, 7.3035, 7.3032, 7.3029, 7.3044, 7.3037, 7.3032, 7.3027, 7.3023, 7.3016, 7.3013, 7.3005, 7.3001, 7.3002, 7.2996, 7.2992, 7.2989, 7.2982, 7.2975, 7.2967, 7.2967, 7.296, 7.2953, 7.2948, 7.2948, 7.2941, 7.2934, 7.2957, 7.2956, 7.2976, 7.2998, 7.3014, 7.3033, 7.3025, 7.3018, 7.3057, 7.3055, 7.305, 7.3043, 7.3036, 7.3035, 7.3027, 7.304, 7.3034, 7.3027, 7.3023, 7.3021, 7.3014, 7.3032, 7.3026, 7.3019, 7.3035, 7.3029, 7.3042, 7.3036, 7.3037, 7.303, 7.3023, 7.3018, 7.301, 7.3003, 7.2997, 7.2989, 7.2982, 7.2975, 7.2989, 7.2981, 7.2976, 7.2971, 7.2966, 7.2959, 7.2951, 7.2951, 7.2945, 7.2961, 7.2958, 7.2952, 7.2968, 7.2967, 7.2962, 7.2958, 7.2956, 7.2966, 7.2981, 7.2978, 7.2971, 7.2964, 7.2957, 7.2953, 7.2993, 7.2986, 7.2982, 7.2974, 7.2967, 7.2985, 7.3002, 7.2997, 7.299, 7.2985, 7.2978, 7.2994, 7.3024, 7.302, 7.3037, 7.3031, 7.3027, 7.3027, 7.302, 7.3015, 7.3008, 7.3023, 7.3016, 7.301, 7.3004, 7.2978, 7.2971, 7.2965, 7.2941, 7.2934, 7.2928, 7.2925, 7.2924, 7.2918, 7.2913, 7.2913, 7.2905, 7.2897, 7.2933, 7.2932, 7.2926, 7.2942, 7.2935, 7.2932, 7.2925, 7.2921, 7.2913, 7.2908, 7.2903, 7.2896, 7.2909, 7.2905, 7.2902, 7.2894, 7.2888, 7.2864, 7.2878, 7.2873, 7.2888, 7.2901, 7.2914, 7.2906, 7.2899, 7.2896, 7.2982, 7.2996, 7.2989, 7.3003, 7.2996, 7.2989, 7.2983, 7.2996, 7.2993, 7.3016, 7.3031, 7.3027, 7.3023, 7.3016, 7.3013, 7.3007, 7.3002, 7.2996, 7.2995, 7.299, 7.2985, 7.298, 7.2974, 7.2989, 7.2985, 7.2978, 7.2953, 7.2948, 7.2942, 7.2943, 7.2939, 7.2935, 7.2929, 7.2921, 7.2914, 7.291, 7.2904, 7.29, 7.2898, 7.2892, 7.2868, 7.2881, 7.2883, 7.2876, 7.2869, 7.2848, 7.2841, 7.2849, 7.2844, 7.2838, 7.2853, 7.2853, 7.2848, 7.2842, 7.2839, 7.2838, 7.2835, 7.2829, 7.2847, 7.2842, 7.2858, 7.2875, 7.2872, 7.2866, 7.2863, 7.2856, 7.2981, 7.2978, 7.2972, 7.2964, 7.2959, 7.2951, 7.2944, 7.2936, 7.2929, 7.2924, 7.2942, 7.2935, 7.2932, 7.2928, 7.2921, 7.2916, 7.291, 7.2904, 7.2898, 7.2911, 7.2907, 7.2903, 7.2917, 7.291, 7.2903, 7.2898, 7.2891, 7.2884, 7.2884, 7.2899, 7.2896, 7.2891, 7.2887, 7.288, 7.2875, 7.287, 7.2867, 7.287, 7.2865, 7.2863, 7.2858, 7.2853, 7.2853, 7.2848, 7.2843, 7.2956, 7.297, 7.2965, 7.296, 7.2956, 7.296, 7.2956, 7.2951, 7.2966, 7.296, 7.2955, 7.295, 7.2947, 7.2963, 7.2957, 7.2951, 7.2947, 7.2963, 7.2977, 7.2971, 7.2967, 7.296, 7.2976, 7.2973, 7.2966, 7.2981, 7.2997, 7.2989, 7.2982, 7.2982, 7.2976, 7.297, 7.2966, 7.2963, 7.2956, 7.2969, 7.2963, 7.2956, 7.2951, 7.2945, 7.2923, 7.2917, 7.2911, 7.2948, 7.2962, 7.2957, 7.2972, 7.2968, 7.2961, 7.2955, 7.2949, 7.2943, 7.2937, 7.293, 7.2943, 7.2938, 7.2952, 7.2945, 7.2938, 7.2935, 7.2928, 7.2925, 7.2918, 7.2916, 7.2933, 7.2929, 7.294, 7.2955, 7.295, 7.2946, 7.2939, 7.2933, 7.2926, 7.2919, 7.2915, 7.293, 7.2936, 7.2933, 7.2928, 7.2922, 7.2916, 7.291, 7.2903, 7.29, 7.2914, 7.2908, 7.2903, 7.2896, 7.2889, 7.2886, 7.2882, 7.2896, 7.2889, 7.2887, 7.2882, 7.2877, 7.289, 7.2884, 7.2879, 7.2891, 7.2903, 7.2916, 7.291, 7.2904, 7.2937, 7.2932, 7.2927, 7.2921, 7.2934, 7.2967, 7.2961, 7.2956, 7.295, 7.2944, 7.2957, 7.2952, 7.2945, 7.2939, 7.2938, 7.2936, 7.2951, 7.2963, 7.2961, 7.2975, 7.2976, 7.297, 7.2966, 7.2959, 7.2953, 7.2949, 7.2947, 7.2941, 7.294, 7.2956, 7.295, 7.2946, 7.296, 7.3007, 7.3, 7.2995, 7.299, 7.2983, 7.298, 7.2973, 7.2987, 7.2981, 7.2994, 7.299, 7.2983, 7.2977, 7.2989, 7.3001, 7.2995, 7.2989, 7.2983, 7.2978, 7.2975, 7.2968, 7.2964, 7.2959, 7.2954, 7.2947, 7.294, 7.2934, 7.295, 7.2948, 7.2944, 7.2938, 7.2952, 7.2929, 7.2943, 7.2937, 7.2936, 7.295, 7.2944, 7.2938, 7.2935, 7.293, 7.2926, 7.2922, 7.2918, 7.2911, 7.2906, 7.2901, 7.2906, 7.2909, 7.2904, 7.2897, 7.2896, 7.2889, 7.2902, 7.29, 7.2896, 7.2908, 7.2907, 7.292, 7.2934, 7.2931, 7.2925, 7.2923, 7.2916, 7.2929, 7.2926, 7.2922, 7.2915, 7.291, 7.2923, 7.2918, 7.2914, 7.2908, 7.2903, 7.2897, 7.2891, 7.2918, 7.2913, 7.2911, 7.2905, 7.2898, 7.2893, 7.2887, 7.288, 7.2875, 7.2873, 7.2884, 7.2878, 7.2873, 7.2868, 7.2864, 7.2858, 7.2854, 7.2853, 7.285, 7.2851, 7.2852, 7.2846, 7.2839, 7.2833, 7.2846, 7.2919, 7.295, 7.2945, 7.2949, 7.2943, 7.2923, 7.2939, 7.2951, 7.2947, 7.3009, 7.3016, 7.3011, 7.3008, 7.3003, 7.3033, 7.3016, 7.301, 7.3022, 7.3063, 7.3058, 7.3056, 7.3051, 7.3048, 7.3047, 7.3044, 7.3041, 7.3035, 7.303, 7.3027, 7.3026, 7.3019, 7.3031, 7.3025, 7.3021, 7.3017, 7.3014, 7.3027, 7.302, 7.3033, 7.3027, 7.3027, 7.3021, 7.3035, 7.3033, 7.3027, 7.3021, 7.3021, 7.3015, 7.3012, 7.3009, 7.3005, 7.3003, 7.2998, 7.2992, 7.2993, 7.2987, 7.2982, 7.2976, 7.2988, 7.3, 7.2994, 7.2989, 7.2985, 7.2996, 7.2991, 7.2987, 7.2981, 7.2976, 7.2972, 7.2966, 7.296, 7.2955, 7.2951, 7.2947, 7.2945, 7.2939, 7.2936, 7.2932, 7.2928, 7.2921, 7.2914, 7.2925, 7.2919, 7.2914, 7.2908, 7.2903, 7.2916, 7.2929, 7.293, 7.2927, 7.2924, 7.2937, 7.2933, 7.2945, 7.2938, 7.2931, 7.2928, 7.2923, 7.2916, 7.2927, 7.2926, 7.2925, 7.3007, 7.3006, 7.3001, 7.2999, 7.2996, 7.3009, 7.3005, 7.3003, 7.3, 7.2995, 7.2989, 7.2984, 7.2978, 7.299, 7.2986, 7.2981, 7.2976, 7.297, 7.2966, 7.296, 7.2954, 7.2949, 7.2947, 7.2943, 7.2941, 7.2936, 7.2934, 7.2928, 7.2922, 7.2916, 7.2911, 7.2906, 7.2901, 7.2897, 7.2891, 7.2889, 7.2884, 7.2896, 7.2891, 7.2886, 7.2884, 7.2866, 7.286, 7.2881, 7.2881, 7.2894, 7.289, 7.2903, 7.2915, 7.2912, 7.2907, 7.2903, 7.2901, 7.2895, 7.2894, 7.2928, 7.2924, 7.2918, 7.2928, 7.2922, 7.2916, 7.2911, 7.2922, 7.2918, 7.2922, 7.2919, 7.2898, 7.291, 7.2904, 7.2902, 7.2897, 7.2891, 7.2885, 7.288, 7.2876, 7.2887, 7.2882, 7.2895, 7.289, 7.2884, 7.2878, 7.2874, 7.2871, 7.285, 7.2831, 7.281, 7.2808, 7.2802, 7.2798, 7.281, 7.282, 7.2832, 7.2844, 7.2839, 7.2836, 7.2832, 7.2827, 7.2821, 7.2817, 7.2814, 7.2812, 7.2806, 7.28, 7.2811, 7.2805, 7.2799, 7.2794, 7.279, 7.2785, 7.2781, 7.2775, 7.2769, 7.2764, 7.2758, 7.2755, 7.2751, 7.2745, 7.2743, 7.2755, 7.2751, 7.2746, 7.2744, 7.2739, 7.2734, 7.273, 7.2742, 7.274, 7.2736, 7.2718, 7.2715, 7.2729, 7.2739, 7.2751, 7.2748, 7.2761, 7.2773, 7.277, 7.2768, 7.2762, 7.2774, 7.2775, 7.2771, 7.2768, 7.2766, 7.2763, 7.2761, 7.2758, 7.2754, 7.275, 7.2744, 7.2738, 7.2749, 7.2748, 7.2743, 7.2754, 7.2751, 7.2745, 7.2757, 7.2754, 7.2748, 7.276, 7.2756, 7.2776, 7.2772, 7.2754, 7.2748, 7.2744, 7.2738, 7.2732, 7.2729, 7.2726, 7.2762, 7.2757, 7.2753, 7.2754, 7.275, 7.2745, 7.2742, 7.2738, 7.2734, 7.273, 7.274, 7.2734, 7.2749, 7.2745, 7.2755, 7.2751, 7.2747, 7.2743, 7.274, 7.2735, 7.2731, 7.2727, 7.2723, 7.2705, 7.2701, 7.2695, 7.2696, 7.2692, 7.2687, 7.2682, 7.2695, 7.269, 7.2702, 7.2697, 7.2694, 7.269, 7.2702, 7.2714, 7.271, 7.2705, 7.27, 7.2696, 7.2691, 7.2687, 7.2685, 7.268, 7.2674, 7.2672, 7.2667, 7.2678, 7.2676, 7.2683, 7.268, 7.2675, 7.267, 7.2682, 7.2694, 7.2691, 7.2703, 7.2698, 7.2699, 7.2696, 7.2693, 7.2692, 7.2688, 7.2687, 7.2684, 7.2678, 7.2672, 7.2668, 7.2663, 7.2659, 7.2655, 7.265, 7.2665, 7.2662, 7.2673, 7.2698, 7.2692, 7.2687, 7.2682, 7.2679, 7.269, 7.2685, 7.2694, 7.2691, 7.2685, 7.268, 7.2693, 7.2687, 7.2699, 7.2694, 7.2689, 7.2688, 7.2685, 7.2785, 7.2788, 7.2801, 7.2798, 7.2809, 7.2805, 7.28, 7.2798, 7.2797, 7.2798, 7.2793, 7.2788, 7.2784, 7.2779, 7.2774, 7.2788, 7.2801, 7.2798, 7.2793, 7.2791, 7.2787, 7.2781, 7.2776, 7.2788, 7.2784, 7.2781, 7.2775, 7.2769, 7.2768, 7.2768, 7.2765, 7.2778, 7.2773, 7.2772, 7.2767, 7.2765, 7.2841, 7.2836, 7.2847, 7.2842, 7.2839, 7.2835, 7.2833, 7.2828, 7.2839, 7.2834, 7.2829, 7.2823, 7.2822, 7.2821, 7.2819, 7.2815, 7.2812, 7.2806, 7.2802, 7.2796, 7.2808, 7.2804, 7.2803, 7.2815, 7.281, 7.2823, 7.2819, 7.2831, 7.2841, 7.2837, 7.2832, 7.2827, 7.2822, 7.2819, 7.2814, 7.2828, 7.2826, 7.2824, 7.282, 7.2816, 7.2812, 7.2808, 7.2803, 7.2799, 7.2801, 7.2799, 7.2794, 7.279, 7.2806, 7.2802, 7.2796, 7.2794, 7.279, 7.2786, 7.2784, 7.2798, 7.2795, 7.2806, 7.2808, 7.2803, 7.2798, 7.2796, 7.2792, 7.2787, 7.2786, 7.2782, 7.2811, 7.2807, 7.2804, 7.2805, 7.28, 7.2795, 7.279, 7.2802, 7.2797, 7.2796, 7.2792, 7.2787, 7.2799, 7.2795, 7.2794, 7.2789, 7.2786, 7.278, 7.2776, 7.2772, 7.2783, 7.2795, 7.2792, 7.2787, 7.2799, 7.2794, 7.282, 7.2819, 7.2831, 7.2844, 7.2841, 7.2839, 7.2834, 7.2829, 7.284, 7.2835, 7.2832, 7.2843, 7.284, 7.2834, 7.2831, 7.2826, 7.2821, 7.2818, 7.2813, 7.2811, 7.2806, 7.2801, 7.2802, 7.2797, 7.2793, 7.279, 7.2806, 7.2801, 7.28, 7.2795, 7.2791, 7.279, 7.2787, 7.2783, 7.2781, 7.2775, 7.277, 7.2765, 7.276, 7.2756, 7.2755, 7.2753, 7.2749, 7.2761, 7.2755, 7.2751, 7.2761, 7.2786, 7.2783, 7.2779, 7.2775, 7.2771, 7.2784, 7.2778, 7.2772, 7.2784, 7.2797, 7.2793, 7.2789, 7.2785, 7.2795, 7.2806, 7.2817, 7.2814, 7.2812, 7.2808, 7.2806, 7.2801, 7.2795, 7.2791, 7.2787, 7.2782, 7.2781, 7.2779, 7.2777, 7.276, 7.2742, 7.2753, 7.2752, 7.2749, 7.2745, 7.2741, 7.2752, 7.2748, 7.2761, 7.2755, 7.275, 7.2746, 7.274, 7.275, 7.2761, 7.2755, 7.2751, 7.2747, 7.2757, 7.2753, 7.2749, 7.2745, 7.2743, 7.2738, 7.2733, 7.2728, 7.2724, 7.2721, 7.2733, 7.2745, 7.2743, 7.2741, 7.2737, 7.2732, 7.2734, 7.2731, 7.2726, 7.2721, 7.2717, 7.2712, 7.2707, 7.2701, 7.2711, 7.2706, 7.2716, 7.2711, 7.2693, 7.2688, 7.2686, 7.2681, 7.2693, 7.2689, 7.2687, 7.2683, 7.2678, 7.2674, 7.2672, 7.2667, 7.2677, 7.2675, 7.2674, 7.2687, 7.2683, 7.268, 7.2679, 7.269, 7.2688, 7.2685, 7.268, 7.2675, 7.2671, 7.2666, 7.2663, 7.2662, 7.2659, 7.2669, 7.2664, 7.266, 7.2655, 7.2653, 7.2649, 7.2647, 7.2642, 7.2642, 7.2637, 7.2632, 7.2628, 7.2625, 7.2638, 7.2635, 7.2666, 7.2662, 7.2671, 7.2671, 7.2667, 7.2663, 7.2674, 7.267, 7.2681, 7.2692, 7.2703, 7.2698, 7.2693, 7.2705, 7.2702, 7.2699, 7.2697, 7.2692, 7.2703, 7.2699, 7.2694, 7.269, 7.2699, 7.2716, 7.2712, 7.2707, 7.2737, 7.2733, 7.2728, 7.2725, 7.2725, 7.2722, 7.2733, 7.2729, 7.2727, 7.2727, 7.2728, 7.2739, 7.2737, 7.2732, 7.2727, 7.2725, 7.272, 7.2715, 7.2715, 7.2735, 7.2735, 7.2731, 7.273, 7.2729, 7.2725, 7.2738, 7.2736, 7.2732, 7.2731, 7.273, 7.2726, 7.2724, 7.272, 7.2716, 7.2713, 7.2722, 7.272, 7.2716, 7.2711, 7.272, 7.2715, 7.2711, 7.2707, 7.2788, 7.2786, 7.2781, 7.2776, 7.2772, 7.2768, 7.2764, 7.276, 7.2755, 7.2752, 7.2747, 7.2756, 7.2751, 7.2746, 7.2741, 7.2738, 7.2733, 7.2728, 7.2738, 7.2737, 7.2747, 7.2742, 7.2737, 7.2735, 7.2733, 7.2731, 7.2728, 7.2726, 7.2722, 7.2731, 7.2728, 7.2723, 7.2721, 7.2715, 7.271, 7.2705, 7.2702, 7.2697, 7.2707, 7.2702, 7.2697, 7.2693, 7.2691, 7.2688, 7.2684, 7.268, 7.2676, 7.2671, 7.2668, 7.2664, 7.266, 7.2658, 7.2653, 7.265, 7.2645, 7.2641, 7.2638, 7.2635, 7.2633, 7.263, 7.2614, 7.2611, 7.2622, 7.2617, 7.2612, 7.2609, 7.2605, 7.26, 7.2612, 7.2607, 7.2602, 7.2597, 7.2592, 7.2602, 7.2599, 7.2611, 7.2608, 7.2605, 7.26, 7.2596, 7.2591, 7.2587, 7.2582, 7.2578, 7.2573, 7.2584, 7.2583, 7.2594, 7.2591, 7.2587, 7.2584, 7.2579, 7.259, 7.26, 7.2597, 7.2594, 7.2592, 7.2588, 7.2583, 7.2581, 7.2592, 7.2587, 7.2583, 7.2579, 7.2589, 7.2585, 7.2583, 7.2597, 7.2607, 7.2604, 7.2614, 7.2611, 7.2606, 7.2602, 7.2612, 7.2608, 7.2605, 7.2616, 7.2612, 7.2608, 7.2605, 7.26, 7.2597, 7.2607, 7.2603, 7.2599, 7.2595, 7.2591, 7.2586, 7.2581, 7.2576, 7.2575, 7.2571, 7.2566, 7.2565, 7.2564, 7.2559, 7.2555, 7.255, 7.2547, 7.2544, 7.2541, 7.2543, 7.2538, 7.2536, 7.2532, 7.253, 7.254, 7.2543, 7.254, 7.2549, 7.255, 7.2546, 7.2542, 7.2538, 7.2537, 7.2534, 7.2532, 7.2527, 7.2523, 7.2519, 7.2514, 7.2538, 7.2533, 7.2529, 7.2527, 7.2522, 7.2518, 7.2514, 7.2509, 7.2506, 7.2504, 7.2502, 7.2501, 7.2537, 7.2535, 7.253, 7.2528, 7.2525, 7.2521, 7.2517, 7.2512, 7.2509, 7.252, 7.2517, 7.2526, 7.2535, 7.2531, 7.2527, 7.2524, 7.2533, 7.2531, 7.2526, 7.2521, 7.2518, 7.2513, 7.2509, 7.2506, 7.2502, 7.2501, 7.2499, 7.2495, 7.2492, 7.2501, 7.2497, 7.2496, 7.2495, 7.2491, 7.2489, 7.2484, 7.248, 7.2475, 7.247, 7.2468, 7.2466, 7.2475, 7.2496, 7.2496, 7.2506, 7.2501, 7.2498, 7.2494, 7.2491, 7.2488, 7.2486, 7.2482, 7.2479, 7.249, 7.2499, 7.2521, 7.2517, 7.2528, 7.2525, 7.2522, 7.252, 7.2518, 7.2516, 7.2511, 7.2507, 7.2503, 7.2492, 7.2502, 7.25, 7.2499, 7.251, 7.2507, 7.2517, 7.2514, 7.2524, 7.2522, 7.2517, 7.2526, 7.2521, 7.2546, 7.2543, 7.254, 7.2536, 7.2547, 7.2542, 7.2553, 7.2561, 7.2571, 7.2568, 7.2564, 7.2562, 7.256, 7.2557, 7.2554, 7.2619, 7.2642, 7.2639, 7.2635, 7.2646, 7.2642, 7.2639, 7.2635, 7.263, 7.2629, 7.2633, 7.263, 7.2626, 7.2622, 7.262, 7.2616, 7.2613, 7.2611, 7.2608, 7.2603, 7.26, 7.2596, 7.2607, 7.2604, 7.2599, 7.2595, 7.2605, 7.2601, 7.2596, 7.2607, 7.2617, 7.2612, 7.2607, 7.2603, 7.2598, 7.2597, 7.2596, 7.2591, 7.2589, 7.2584, 7.2579, 7.2574, 7.2569, 7.2569, 7.2566, 7.2563, 7.2561, 7.2557, 7.2553, 7.255, 7.2546, 7.2542, 7.2528, 7.2514, 7.2514, 7.2509, 7.2506, 7.2505, 7.252, 7.2515, 7.2524, 7.2519, 7.2516, 7.2514, 7.251, 7.2532, 7.253, 7.2526, 7.2536, 7.2533, 7.253, 7.2528, 7.2524, 7.2525, 7.2523, 7.2534, 7.2531, 7.2526, 7.2522, 7.2521, 7.2519, 7.2515, 7.2524, 7.2521, 7.2517, 7.2513, 7.251, 7.252, 7.2515, 7.2499, 7.2496, 7.2493, 7.2488, 7.2511, 7.2507, 7.2503, 7.2503, 7.25, 7.2517, 7.2513, 7.2509, 7.2505, 7.2503, 7.2517, 7.2527, 7.2523, 7.2522, 7.2518, 7.2514, 7.2512, 7.2507, 7.2503, 7.2499, 7.2495, 7.2505, 7.2502, 7.2498, 7.2496, 7.2505, 7.2501, 7.251, 7.2508, 7.2504, 7.2503, 7.2512, 7.2512, 7.2496, 7.2485, 7.2481, 7.2477, 7.2473, 7.2468, 7.2464, 7.2473, 7.247, 7.2478, 7.2474, 7.2483, 7.2479, 7.2475, 7.246, 7.2457, 7.2466, 7.2475, 7.2474, 7.247, 7.2468, 7.2464, 7.246, 7.2456, 7.2452, 7.2462, 7.2446, 7.2431, 7.2427, 7.2424, 7.242, 7.242, 7.2406, 7.2391, 7.24, 7.2407, 7.2403, 7.2399, 7.2408, 7.2406, 7.2402, 7.2401, 7.241, 7.2408, 7.2419, 7.242, 7.2417, 7.2413, 7.2422, 7.2433, 7.243, 7.2427, 7.2424, 7.242, 7.243, 7.244, 7.2449, 7.2447, 7.2445, 7.2441, 7.2438, 7.2434, 7.2429, 7.2425, 7.2422, 7.2417, 7.2401, 7.241, 7.2408, 7.2419, 7.2415, 7.2412, 7.2421, 7.242, 7.2416, 7.2426, 7.2435, 7.243, 7.2425, 7.2423, 7.242, 7.2416, 7.2415, 7.2411, 7.2407, 7.2405, 7.239, 7.2386, 7.2381, 7.2368, 7.2364, 7.2361, 7.2356, 7.2352, 7.2348, 7.2346, 7.2343, 7.2338, 7.2336, 7.2332, 7.2329, 7.2337, 7.2348, 7.2346, 7.2345, 7.2354, 7.2419, 7.243, 7.2428, 7.2424, 7.2427, 7.2423, 7.2437, 7.2433, 7.243, 7.2427, 7.2452, 7.2448, 7.2443, 7.244, 7.2436, 7.2433, 7.2431, 7.2427, 7.2436, 7.2432, 7.243, 7.2427, 7.2423, 7.2432, 7.2429, 7.2427, 7.2425, 7.2434, 7.2431, 7.2427, 7.2425, 7.2425, 7.2426, 7.2423, 7.2432, 7.2428, 7.2428, 7.2424, 7.242, 7.2421, 7.2416, 7.2412, 7.242, 7.2417, 7.2405, 7.2404, 7.2401, 7.2397, 7.2393, 7.2389, 7.2385, 7.2383, 7.2382, 7.2405, 7.24, 7.2421, 7.2419, 7.2427, 7.2423, 7.242, 7.2416, 7.2413, 7.2409, 7.2408, 7.2404, 7.2413, 7.2408, 7.2404, 7.2412, 7.2408, 7.2403, 7.2399, 7.2409, 7.2406, 7.2403, 7.2399, 7.2396, 7.2392, 7.24, 7.241, 7.2418, 7.2416, 7.2413, 7.241, 7.2406, 7.2404, 7.2401, 7.241, 7.2397, 7.2393, 7.2392, 7.2389, 7.2397, 7.2395, 7.2391, 7.2386, 7.2384, 7.2383, 7.238, 7.2375, 7.2372, 7.2368, 7.2364, 7.2361, 7.2359, 7.2354, 7.235, 7.2359, 7.2355, 7.2353, 7.2348, 7.2344, 7.2352, 7.235, 7.24, 7.2398, 7.2394, 7.239, 7.24, 7.2396, 7.2392, 7.2388, 7.2384, 7.2392, 7.2388, 7.2389, 7.2385, 7.2383, 7.2383, 7.2382, 7.2378, 7.2376, 7.2372, 7.2371, 7.2372, 7.2382, 7.2432, 7.2443, 7.2454, 7.2451, 7.2448, 7.2445, 7.2441, 7.2438, 7.2435, 7.2432, 7.2428, 7.2424, 7.2421, 7.2417, 7.2416, 7.2414, 7.2411, 7.2418, 7.2415, 7.2413, 7.2411, 7.2421, 7.2418, 7.2414, 7.2411, 7.241, 7.2397, 7.2394, 7.2402, 7.2398, 7.2394, 7.2393, 7.2394, 7.2404, 7.24, 7.241, 7.2395, 7.2391, 7.2388, 7.2385, 7.2382, 7.2379, 7.2376, 7.2373, 7.2382, 7.2391, 7.2399, 7.2408, 7.2405, 7.2403, 7.2399, 7.2387, 7.2397, 7.2385, 7.2381, 7.2398, 7.2395, 7.2393, 7.2396, 7.2398, 7.2408, 7.2407, 7.2404, 7.2403, 7.2399, 7.2397, 7.2393, 7.2402, 7.24, 7.2398, 7.2394, 7.2391, 7.2387, 7.2385, 7.2394, 7.239, 7.2388, 7.2397, 7.2385, 7.2393, 7.239, 7.2399, 7.2408, 7.2405, 7.2401, 7.2398, 7.2394, 7.2391, 7.2387, 7.2383, 7.2392, 7.2401, 7.2399, 7.2408, 7.2407, 7.2405, 7.2403, 7.2399, 7.2398, 7.2398, 7.2383, 7.2379, 7.2387, 7.2395, 7.2391, 7.2387, 7.2386, 7.2382, 7.2389, 7.2386, 7.2384, 7.238, 7.2377, 7.2373, 7.2369, 7.2369, 7.2379, 7.2389, 7.2397, 7.2393, 7.239, 7.2386, 7.2385, 7.2381, 7.239, 7.2386, 7.2383, 7.2379, 7.2375, 7.2374, 7.2372, 7.2371, 7.2369, 7.2378, 7.2389, 7.2389, 7.2385, 7.2393, 7.2389, 7.2386, 7.2383, 7.2381, 7.2381, 7.2392, 7.2389, 7.2386, 7.2383, 7.238, 7.2377, 7.2376, 7.2377, 7.2377, 7.2376, 7.2385, 7.2382, 7.2391, 7.2387, 7.2397, 7.2395, 7.2391, 7.239, 7.2386, 7.2391, 7.2387, 7.2398, 7.2396, 7.2403, 7.2414, 7.2411, 7.2408, 7.2394, 7.2391, 7.2388, 7.2385, 7.2385, 7.2393, 7.239, 7.2377, 7.2365, 7.2364, 7.2362, 7.2358, 7.2372, 7.2369, 7.238, 7.2378, 7.2408, 7.2405, 7.2403, 7.2388, 7.2387, 7.2383, 7.2387, 7.241, 7.2407, 7.2417, 7.2406, 7.2405, 7.2401, 7.24, 7.2397, 7.2406, 7.2414, 7.2412, 7.2408, 7.2404, 7.24, 7.2399, 7.2408, 7.2418, 7.2414, 7.2421, 7.2418, 7.2416, 7.2415, 7.2412, 7.241, 7.2408, 7.2406, 7.2402, 7.24, 7.2398, 7.2407, 7.2404, 7.2402, 7.2398, 7.2395, 7.2391, 7.2377, 7.2373, 7.238, 7.2377, 7.2385, 7.2383, 7.2379, 7.2377, 7.2374, 7.237, 7.2367, 7.2377, 7.2374, 7.237, 7.237, 7.2368, 7.2366, 7.2365, 7.2365, 7.2374, 7.2371, 7.237, 7.2366, 7.2363, 7.236, 7.2357, 7.2353, 7.2351, 7.2362, 7.236, 7.2356, 7.2344, 7.2364, 7.2361, 7.2359, 7.2356, 7.2354, 7.2362, 7.236, 7.2358, 7.2367, 7.2366, 7.2366, 7.2363, 7.236, 7.2356, 7.2365, 7.2373, 7.237, 7.2369, 7.2368, 7.2365, 7.2361, 7.2359, 7.2357, 7.2365, 7.2361, 7.2369, 7.2366, 7.2376, 7.2372, 7.2359, 7.2345, 7.238, 7.2378, 7.2375, 7.2374, 7.2383, 7.2381, 7.2391, 7.24, 7.2398, 7.2406, 7.2404, 7.2402, 7.2398, 7.2394, 7.2392, 7.239, 7.239, 7.2387, 7.2397, 7.2394, 7.2391, 7.2389, 7.2375, 7.2374, 7.2371, 7.2358, 7.2355, 7.2353, 7.2352, 7.235, 7.2348, 7.2346, 7.2345, 7.2344, 7.2341, 7.234, 7.2339, 7.2336, 7.2323, 7.232, 7.2316, 7.2314, 7.2323, 7.2321, 7.2318, 7.2314, 7.2323, 7.233, 7.2326, 7.2323, 7.232, 7.2317, 7.2318, 7.2315, 7.2312, 7.231, 7.2309, 7.2316, 7.2324, 7.231, 7.2307, 7.2303, 7.2311, 7.2308, 7.2307, 7.2303, 7.23, 7.2308, 7.2306, 7.2293, 7.2289, 7.2285, 7.2281, 7.2278, 7.2277, 7.2275, 7.2276, 7.2272, 7.2263, 7.2272, 7.2275, 7.2274, 7.2272, 7.2271, 7.2279, 7.2276, 7.2274, 7.2272, 7.2268, 7.2266, 7.2275, 7.2271, 7.2268, 7.2268, 7.2266, 7.2264, 7.2272, 7.2259, 7.2255, 7.2264, 7.2261, 7.2258, 7.2244, 7.2241, 7.224, 7.2238, 7.225, 7.2248, 7.2246, 7.2243, 7.2242, 7.2239, 7.2237, 7.2234, 7.2242, 7.2239, 7.2229, 7.2249, 7.2257, 7.2255, 7.2263, 7.2271, 7.2269, 7.2267, 7.2264, 7.2265, 7.2264, 7.2262, 7.2258, 7.2266, 7.2274, 7.227, 7.2257, 7.2255, 7.2242, 7.2239, 7.2235, 7.2243, 7.2252, 7.2249, 7.2257, 7.2254, 7.2252, 7.2252, 7.2251, 7.2238, 7.2234, 7.2231, 7.223, 7.2228, 7.2225, 7.2232, 7.2228, 7.2231, 7.2229, 7.2228, 7.2227, 7.2223, 7.2229, 7.2227, 7.2228, 7.2225, 7.2234, 7.2231, 7.2228, 7.2254, 7.2243, 7.2257, 7.2268, 7.2265, 7.2267, 7.2291, 7.2292, 7.2305, 7.2307, 7.2322, 7.2319, 7.2348, 7.2355, 7.2352, 7.2349, 7.2357, 7.2353, 7.235, 7.2359, 7.2356, 7.2354, 7.2351, 7.2359, 7.2355, 7.2342, 7.234, 7.2337, 7.2333, 7.233, 7.2337, 7.2345, 7.2341, 7.2339, 7.2335, 7.2332, 7.2329, 7.2336, 7.2332, 7.233, 7.2327, 7.2323, 7.2321, 7.2318, 7.2315, 7.2313, 7.231, 7.2309, 7.2306, 7.2313, 7.231, 7.2306, 7.2303, 7.2299, 7.2296, 7.2295, 7.2292, 7.229, 7.2299, 7.2296, 7.2293, 7.2306, 7.2327, 7.2324, 7.2355, 7.2353, 7.2352, 7.2349, 7.2348, 7.2344, 7.2333, 7.2333, 7.2332, 7.2329, 7.2326, 7.2322, 7.2331, 7.2328, 7.2326, 7.2323, 7.233, 7.2328, 7.2324, 7.2321, 7.2329, 7.2326, 7.2323, 7.232, 7.2328, 7.2325, 7.2322, 7.2321, 7.2318, 7.2317, 7.2314, 7.2311, 7.231, 7.2311, 7.2309, 7.2306, 7.2303, 7.23, 7.2298, 7.2308, 7.2306, 7.2295, 7.2293, 7.2301, 7.2298, 7.2294, 7.2291, 7.229, 7.2278, 7.2275, 7.2273, 7.2281, 7.2277, 7.2273, 7.2272, 7.2268, 7.2255, 7.2251, 7.225, 7.2247, 7.2254, 7.2251, 7.2251, 7.2259, 7.2255, 7.2253, 7.2241, 7.2248, 7.225, 7.2247, 7.2234, 7.2231, 7.2238, 7.2238, 7.2236, 7.2233, 7.2231, 7.2251, 7.2251, 7.2276, 7.2273, 7.227, 7.2269, 7.2266, 7.2263, 7.226, 7.2257, 7.2256, 7.2253, 7.2252, 7.2248, 7.2244, 7.224, 7.224, 7.2238, 7.2234, 7.2233, 7.2231, 7.2229, 7.2227, 7.2223, 7.2221, 7.222, 7.2217, 7.2214, 7.2211, 7.2208, 7.2205, 7.2201, 7.2198, 7.2186, 7.2184, 7.2191, 7.2191, 7.2188, 7.2196, 7.2193, 7.2191, 7.2191, 7.219, 7.2189, 7.2185, 7.2182, 7.2179, 7.2187, 7.2183, 7.2181, 7.2179, 7.2191, 7.2187, 7.2184, 7.2192, 7.2188, 7.2186, 7.2183, 7.2179, 7.2184, 7.2192, 7.2188, 7.2185, 7.2183, 7.218, 7.2178, 7.2186, 7.2183, 7.2181, 7.2178, 7.2175, 7.2172, 7.2179, 7.2176, 7.2173, 7.217, 7.2168, 7.2175, 7.2172, 7.218, 7.2177, 7.2166, 7.2153, 7.2151, 7.2139, 7.2138, 7.2137, 7.2134, 7.2131, 7.2129, 7.2126, 7.2124, 7.2121, 7.2119, 7.2115, 7.2112, 7.212, 7.2117, 7.2114, 7.2111, 7.2122, 7.213, 7.2127, 7.2124, 7.2121, 7.213, 7.2128, 7.2125, 7.2123, 7.212, 7.2117, 7.2115, 7.2114, 7.2121, 7.2118, 7.2115, 7.2111, 7.2108, 7.2106, 7.2102, 7.2113, 7.211, 7.2109, 7.2107, 7.2104, 7.2102, 7.2102, 7.2099, 7.2096, 7.2094, 7.2102, 7.2103, 7.2101, 7.2099, 7.2097, 7.2093, 7.2091, 7.2088, 7.2086, 7.2082, 7.2078, 7.2085, 7.2083, 7.209, 7.2098, 7.2105, 7.2102, 7.21, 7.2099, 7.2096, 7.2092, 7.2089, 7.2086, 7.2083, 7.208, 7.2079, 7.2077, 7.2075, 7.2063, 7.2051, 7.2039, 7.2036, 7.2033, 7.2091, 7.2099, 7.2097, 7.2106, 7.2102, 7.2099, 7.2105, 7.2093, 7.2092, 7.2089, 7.2096, 7.2093, 7.2093, 7.2091, 7.2099, 7.2097, 7.2107, 7.2105, 7.2103, 7.2101, 7.2108, 7.2105, 7.2104, 7.2101, 7.21, 7.2097, 7.2104, 7.2102, 7.2099, 7.2096, 7.2104, 7.2101, 7.2108, 7.2105, 7.2103, 7.2111, 7.2108, 7.2117, 7.2114, 7.2102, 7.2102, 7.21, 7.2097, 7.2095, 7.2095, 7.2092, 7.2088, 7.2086, 7.2093, 7.209, 7.2087, 7.2075, 7.2072, 7.2079, 7.2087, 7.2083, 7.208, 7.2087, 7.2095, 7.2093, 7.2097, 7.2093, 7.2101, 7.2118, 7.2117, 7.2119, 7.2127, 7.2124, 7.2132, 7.2128, 7.2135, 7.2131, 7.2127, 7.2125, 7.2132, 7.2121, 7.2119, 7.2126, 7.2123, 7.2122, 7.2121, 7.2119, 7.2116, 7.2124, 7.2123, 7.212, 7.2117, 7.2114, 7.2112, 7.2109, 7.2106, 7.2113, 7.2111, 7.2109, 7.211, 7.2155, 7.2142, 7.2139, 7.2146, 7.2144, 7.2142, 7.2139, 7.2136, 7.2142, 7.2186, 7.2241, 7.2237, 7.2235, 7.2232, 7.2232, 7.2229, 7.2226, 7.2224, 7.2222, 7.2219, 7.2226, 7.2224, 7.2221, 7.2219, 7.2218, 7.2215, 7.2212, 7.2209, 7.2207, 7.2203, 7.2201, 7.2197, 7.2202, 7.2199, 7.2196, 7.2203, 7.22, 7.2196, 7.2202, 7.219, 7.2186, 7.2185, 7.2192, 7.2189, 7.2185, 7.2181, 7.2178, 7.2175, 7.2172, 7.217, 7.2167, 7.2174, 7.217, 7.2176, 7.2183, 7.2181, 7.2188, 7.2185, 7.2187, 7.2194, 7.2192, 7.2201, 7.2198, 7.2195, 7.2192, 7.2191, 7.2189, 7.2187, 7.2185, 7.2181, 7.2188, 7.2186, 7.2183, 7.218, 7.2188, 7.2185, 7.2183, 7.2181, 7.2187, 7.2184, 7.2182, 7.218, 7.2179, 7.2186, 7.2184, 7.2182, 7.2181, 7.2179, 7.2185, 7.2184, 7.2192, 7.2189, 7.2187, 7.2184, 7.2192, 7.22, 7.2198, 7.2195, 7.2184, 7.2181, 7.2188, 7.2185, 7.2183, 7.2181, 7.2178, 7.2176, 7.2183, 7.2171, 7.2178, 7.2178, 7.2175, 7.2173, 7.217, 7.2166, 7.2163, 7.217, 7.2167, 7.2167, 7.2156, 7.2153, 7.215, 7.2149, 7.2147, 7.2144, 7.2152, 7.2149, 7.2148, 7.2145, 7.2142, 7.2139, 7.2137, 7.2135, 7.2133, 7.2131, 7.2129, 7.2127, 7.2116, 7.2113, 7.211, 7.2109, 7.2107, 7.2104, 7.2101, 7.21, 7.2097, 7.2095, 7.2093, 7.2095, 7.2094, 7.2092, 7.2089, 7.2097, 7.2094, 7.2101, 7.2098, 7.2111, 7.211, 7.2107, 7.2105, 7.2102, 7.2101, 7.21, 7.2099, 7.2097, 7.2094, 7.2093, 7.209, 7.2088, 7.2086, 7.2082, 7.2089, 7.2095, 7.2092, 7.2101, 7.2099, 7.2096, 7.2104, 7.2102, 7.2099, 7.2087, 7.2104, 7.2102, 7.2099, 7.2104, 7.2115, 7.2112, 7.2114, 7.2122, 7.212, 7.2118, 7.2116, 7.2113, 7.212, 7.2109, 7.2107, 7.2104, 7.2101, 7.2098, 7.2095, 7.2093, 7.2081, 7.209, 7.209, 7.2087, 7.2094, 7.2102, 7.21, 7.2098, 7.2098, 7.2095, 7.2093, 7.2091, 7.2089, 7.2079, 7.2075, 7.2074, 7.2073, 7.2071, 7.2069, 7.2076, 7.2076, 7.2072, 7.2069, 7.2057, 7.2055, 7.2052, 7.2048, 7.2054, 7.2052, 7.2049, 7.2056, 7.2054, 7.205, 7.2079, 7.2076, 7.2074, 7.2073, 7.2061, 7.206, 7.2067, 7.2065, 7.2062, 7.2071, 7.2069, 7.2067, 7.2064, 7.2062, 7.2059, 7.2057, 7.2055, 7.2053, 7.2051, 7.2049, 7.2047, 7.2045, 7.2053, 7.2061, 7.2058, 7.2088, 7.2085, 7.2084, 7.2092, 7.2093, 7.2101, 7.2099, 7.2098, 7.2106, 7.2105, 7.2113, 7.2112, 7.2109, 7.2106, 7.2103, 7.2102, 7.2101, 7.2098, 7.2098, 7.2095, 7.2091, 7.2089, 7.2098, 7.2097, 7.2097, 7.2097, 7.2094, 7.2092, 7.209, 7.2089, 7.2079, 7.2086, 7.2075, 7.2082, 7.208, 7.2077, 7.2074, 7.2071, 7.2069, 7.2066, 7.2064, 7.2062, 7.2059, 7.2057, 7.2055, 7.2054, 7.205, 7.2058, 7.2055, 7.2052, 7.2049, 7.2046, 7.2043, 7.2041, 7.2049, 7.2047, 7.2047, 7.2048, 7.2045, 7.2046, 7.2042, 7.204, 7.2037, 7.2034, 7.2041, 7.2038, 7.2036, 7.2034, 7.2051, 7.2059, 7.2067, 7.2065, 7.2065, 7.2064, 7.2062, 7.206, 7.2057, 7.2055, 7.2063, 7.2063, 7.2061, 7.2069, 7.2066, 7.2065, 7.2063, 7.207, 7.2067, 7.2064, 7.2061, 7.2058, 7.2056, 7.2054, 7.2051, 7.2048, 7.2048, 7.2046, 7.2043, 7.2051, 7.2053, 7.2044, 7.2042, 7.2039, 7.2036, 7.2033, 7.2039, 7.2037, 7.2034, 7.2051, 7.2048, 7.2046, 7.2043, 7.2043, 7.2041, 7.204, 7.2038, 7.2037, 7.2047, 7.2055, 7.2062, 7.207, 7.2069, 7.2066, 7.2072, 7.207, 7.2067, 7.2056, 7.2053, 7.206, 7.2058, 7.2055, 7.2052, 7.2049, 7.2046, 7.2052, 7.2049, 7.2055, 7.2052, 7.205, 7.2046, 7.2062, 7.2061, 7.2068, 7.2066, 7.2073, 7.2071, 7.2078, 7.2077, 7.2074, 7.2071, 7.2067, 7.2066, 7.2073, 7.2071, 7.2069, 7.2076, 7.2075, 7.2074, 7.2071, 7.207, 7.2077, 7.2084, 7.2091, 7.2088, 7.2086, 7.2092, 7.2089, 7.2086, 7.2084, 7.2091, 7.209, 7.2089, 7.2089, 7.2096, 7.2095, 7.2106, 7.2122, 7.2129, 7.2129, 7.2127, 7.2124, 7.2121, 7.2119, 7.2141, 7.2139, 7.2137, 7.2134, 7.2131, 7.2139, 7.2137, 7.2136, 7.2133, 7.213, 7.2137, 7.2136, 7.2134, 7.2132, 7.2121, 7.2119, 7.212, 7.2116, 7.2113, 7.211, 7.2107, 7.2104, 7.2101, 7.2108, 7.2105, 7.2095, 7.2104, 7.2103, 7.2101, 7.21, 7.2097, 7.2094, 7.2093, 7.209, 7.2088, 7.2086, 7.2083, 7.2081, 7.2079, 7.2086, 7.2083, 7.208, 7.2077, 7.2074, 7.2072, 7.2069, 7.2085, 7.2091, 7.2095, 7.2092, 7.209, 7.2087, 7.2077, 7.2075, 7.2073, 7.207, 7.2077, 7.2074, 7.2072, 7.207, 7.2067, 7.2065, 7.2074, 7.2072, 7.207, 7.2078, 7.2076, 7.2074, 7.2101, 7.2099, 7.2097, 7.2095, 7.2093, 7.2119, 7.2117, 7.2124, 7.213, 7.2128, 7.2126, 7.2123, 7.212, 7.2117, 7.2114, 7.216, 7.2157, 7.2154, 7.2155, 7.2152, 7.2149, 7.2149, 7.2146, 7.2152, 7.2158, 7.2155, 7.2152, 7.215, 7.2147, 7.2144, 7.2141, 7.2151, 7.2148, 7.2145, 7.2142, 7.214, 7.214, 7.2174, 7.2202, 7.22, 7.2198, 7.2214, 7.2216, 7.2213, 7.222, 7.2219, 7.222, 7.2219, 7.2217, 7.2224, 7.223, 7.2237, 7.2244, 7.2251, 7.2249, 7.2255, 7.2254, 7.2253, 7.2251, 7.2249, 7.2247, 7.2244, 7.2243, 7.224, 7.2237, 7.2234, 7.2231, 7.2228, 7.2228, 7.2225, 7.2222, 7.2235, 7.2243, 7.224, 7.2237, 7.2237, 7.2244, 7.2241, 7.224, 7.2238, 7.2237, 7.2234, 7.2231, 7.2248, 7.2245, 7.2242, 7.224, 7.2237, 7.2236, 7.2243, 7.224, 7.2248, 7.2246, 7.2246, 7.2253, 7.225, 7.2258, 7.2256, 7.2265, 7.2264, 7.2273, 7.2271, 7.2268, 7.2268, 7.2266, 7.2263, 7.2263, 7.2262, 7.2262, 7.226, 7.2268, 7.2299, 7.2297, 7.2304, 7.2302, 7.23, 7.2298, 7.2296, 7.2293, 7.229, 7.2288, 7.2306, 7.2306, 7.2313, 7.2311, 7.2319, 7.2318, 7.2316, 7.2317, 7.2315, 7.2312, 7.231, 7.2318, 7.2316, 7.2314, 7.2313, 7.2321, 7.2319, 7.2317, 7.2315, 7.2304, 7.2312, 7.231, 7.2308, 7.2307, 7.2337, 7.2336, 7.2343, 7.2351, 7.2359, 7.2357, 7.2358, 7.2355, 7.2352, 7.2359, 7.2367, 7.2366, 7.2363, 7.2393, 7.2392, 7.2391, 7.239, 7.2387, 7.2394, 7.241, 7.2408, 7.2405, 7.2404, 7.2402, 7.2412, 7.2401, 7.2399, 7.2397, 7.2394, 7.2404, 7.2401, 7.2398, 7.2395, 7.2393, 7.2391, 7.239, 7.2397, 7.2394, 7.2391, 7.2389, 7.2387, 7.2386, 7.2384, 7.2381, 7.2378, 7.2385, 7.2384, 7.239, 7.2388, 7.2386, 7.2384, 7.2381, 7.2379, 7.2378, 7.2377, 7.2374, 7.2371, 7.2377, 7.2367, 7.2365, 7.2363, 7.237, 7.2369, 7.2367, 7.2365, 7.2363, 7.236, 7.2359, 7.2366, 7.2364, 7.2361, 7.2358, 7.2348, 7.2339, 7.2329, 7.2327, 7.2325, 7.2323, 7.2322, 7.2319, 7.2316, 7.2322, 7.2321, 7.2328, 7.2326, 7.2326, 7.2323, 7.2313, 7.2312, 7.2309, 7.2325, 7.2336, 7.2338, 7.2336, 7.2333, 7.2331, 7.2358, 7.2357, 7.2356, 7.2358, 7.2358, 7.2357, 7.2367, 7.2365, 7.2371, 7.2369, 7.2366, 7.2372, 7.2372, 7.2369, 7.2366, 7.2372, 7.2378, 7.2376, 7.2438, 7.2435, 7.2433, 7.243, 7.2427, 7.2425, 7.2425, 7.2424, 7.2421, 7.2419, 7.2417, 7.2415, 7.2421, 7.2419, 7.2418, 7.2417, 7.2414, 7.2414, 7.2411, 7.241, 7.2407, 7.2405, 7.2402, 7.2408, 7.2415, 7.2415, 7.2414, 7.2405, 7.2404, 7.2401, 7.2399, 7.2398, 7.2405, 7.2403, 7.241, 7.2408, 7.2407, 7.2404, 7.2411, 7.2409, 7.2398, 7.2405, 7.2402, 7.2399, 7.2396, 7.2405, 7.2404, 7.2401, 7.2407, 7.2407, 7.2427, 7.2424, 7.2422, 7.2419, 7.2416, 7.2414, 7.2413, 7.2403, 7.2392, 7.2382, 7.2372, 7.2362, 7.2361, 7.2362, 7.2356, 7.2353, 7.235, 7.2347, 7.2345, 7.2363, 7.236, 7.236, 7.2358, 7.2355, 7.2361, 7.2359, 7.2362, 7.2361, 7.236, 7.2358, 7.2357, 7.2354, 7.236, 7.2359, 7.2366, 7.2365, 7.2364, 7.2362, 7.237, 7.2368, 7.2367, 7.2364, 7.2362, 7.236, 7.2357, 7.2355, 7.2353, 7.2352, 7.2359, 7.2356, 7.2358, 7.2365, 7.2363, 7.236, 7.2359, 7.2359, 7.2372, 7.2369, 7.2375, 7.2381, 7.238, 7.2384, 7.2383, 7.2381, 7.2397, 7.2398, 7.2395, 7.2393, 7.2393, 7.239, 7.2388, 7.2395, 7.2402, 7.2399, 7.2389, 7.2387, 7.2385, 7.2384, 7.2382, 7.2381, 7.2372, 7.2371, 7.2369, 7.2368, 7.2367, 7.2366, 7.2367, 7.2365, 7.2371, 7.2369, 7.2366, 7.2372, 7.2378, 7.2376, 7.2382, 7.2389, 7.2386, 7.2384, 7.239, 7.2388, 7.2393, 7.2399, 7.2415, 7.2412, 7.2419, 7.2417, 7.2431, 7.243, 7.2436, 7.2443, 7.244, 7.2438, 7.2445, 7.2443, 7.244, 7.2438, 7.2436, 7.2433, 7.2431, 7.2428, 7.2426, 7.2415, 7.2412, 7.2409, 7.2407, 7.2405, 7.2402, 7.2392, 7.2393, 7.2399, 7.2406, 7.2412, 7.241, 7.2408, 7.2397, 7.2394, 7.2391, 7.24, 7.2397, 7.2395, 7.2392, 7.2392, 7.2398, 7.2395, 7.2393, 7.2392, 7.239, 7.2388, 7.2385, 7.2382, 7.2379, 7.2386, 7.2391, 7.2397, 7.2404, 7.2402, 7.2391, 7.2382, 7.2388, 7.2386, 7.2384, 7.2382, 7.2379, 7.2377, 7.2367, 7.2357, 7.2348, 7.2345, 7.2335, 7.2333, 7.2339, 7.2337, 7.2352, 7.2351, 7.2349, 7.2346, 7.2352, 7.2349, 7.2365, 7.2364, 7.2371, 7.2368, 7.2369, 7.2367, 7.2365, 7.2381, 7.2379, 7.2407, 7.2406, 7.2405, 7.2403, 7.24, 7.2416, 7.2424, 7.2432, 7.2439, 7.2436, 7.2433, 7.243, 7.2419, 7.2418, 7.2415, 7.2412, 7.2411, 7.2401, 7.2399, 7.2397, 7.2403, 7.2402, 7.2399, 7.2425, 7.2422, 7.242, 7.2419, 7.2417, 7.2414, 7.2413, 7.241, 7.2408, 7.2405, 7.2403, 7.2402, 7.2409, 7.2406, 7.2403, 7.2408, 7.2405, 7.2402, 7.241, 7.2408, 7.2406, 7.2395, 7.2392, 7.2393, 7.2415, 7.2413, 7.2407, 7.2413, 7.2412, 7.2418, 7.2417, 7.2415, 7.2412, 7.241, 7.2416, 7.2416, 7.2423, 7.2431, 7.2429, 7.2428, 7.2437, 7.2434, 7.2425, 7.2415, 7.2412, 7.2411, 7.241, 7.2407, 7.2405, 7.2403, 7.2393, 7.2391, 7.2389, 7.2388, 7.2381, 7.2387, 7.2384, 7.2383, 7.2389, 7.2396, 7.2396, 7.2395, 7.2392, 7.2391, 7.239, 7.2388, 7.2387, 7.2384, 7.2375, 7.2373, 7.238, 7.2378, 7.2376, 7.2375, 7.2373, 7.2395, 7.2393, 7.239, 7.2388, 7.2386, 7.2384, 7.2382, 7.2381, 7.238, 7.2378, 7.2375, 7.2375, 7.2373, 7.2371, 7.2369, 7.2367, 7.2367, 7.2365, 7.237, 7.2369, 7.2367, 7.2374, 7.2372, 7.237, 7.2367, 7.2365, 7.2362, 7.2359, 7.2356, 7.2355, 7.2352, 7.2351, 7.2348, 7.2346, 7.2345, 7.2344, 7.2342, 7.234, 7.2337, 7.2336, 7.2335, 7.2334, 7.2335, 7.2333, 7.2331, 7.2337, 7.2336, 7.2361, 7.2358, 7.2355, 7.2359, 7.2357, 7.2373, 7.237, 7.2367, 7.2366, 7.2364, 7.2383, 7.238, 7.2389, 7.2391, 7.2391, 7.2388, 7.2385, 7.2384, 7.2391, 7.2393, 7.2391, 7.2389, 7.2388, 7.2396, 7.2394, 7.2394, 7.2401, 7.24, 7.2397, 7.2394, 7.2391, 7.2389, 7.2387, 7.2394, 7.2392, 7.2397, 7.2394, 7.2393, 7.2398, 7.2396, 7.2394, 7.2392, 7.2398, 7.2398, 7.2397, 7.2398, 7.2409, 7.2406, 7.2404, 7.2402, 7.2401, 7.2399, 7.2398, 7.2397, 7.2396, 7.2396, 7.2402, 7.2399, 7.2396, 7.2403, 7.2401, 7.24, 7.2399, 7.2405, 7.2404, 7.2401, 7.24, 7.2398, 7.2397, 7.2394, 7.2392, 7.2389, 7.2388, 7.2385, 7.2382, 7.238, 7.2378, 7.2384, 7.2381, 7.2378, 7.2376, 7.2374, 7.2371, 7.2377, 7.2384, 7.239, 7.2387, 7.2386, 7.2392, 7.2389, 7.2387, 7.2387, 7.2384, 7.2383, 7.2389, 7.2387, 7.2384, 7.2382, 7.2379, 7.2377, 7.2376, 7.2375, 7.2373, 7.2371, 7.237, 7.2376, 7.2374, 7.2371, 7.2368, 7.2366, 7.2363, 7.2361, 7.2368, 7.2366, 7.2364, 7.2371, 7.2369, 7.2368, 7.2367, 7.2372, 7.2377, 7.2375, 7.2381, 7.2379, 7.2376, 7.2373, 7.2372, 7.2378, 7.2375, 7.2372, 7.2369, 7.2367, 7.2364, 7.2361, 7.2359, 7.2356, 7.2353, 7.2351, 7.2348, 7.2347, 7.2345, 7.2345, 7.2343, 7.2341, 7.2339, 7.2345, 7.2342, 7.234, 7.2338, 7.2336, 7.2334, 7.234, 7.2339, 7.2345, 7.2343, 7.2349, 7.2348, 7.2345, 7.2343, 7.2342, 7.2339, 7.2345, 7.2343, 7.235, 7.2349, 7.2347, 7.2344, 7.2343, 7.2349, 7.2355, 7.2352, 7.2358, 7.2356, 7.2362, 7.236, 7.2358, 7.2371, 7.2372, 7.237, 7.2368, 7.2368, 7.2367, 7.2373, 7.237, 7.2368, 7.2367, 7.2365, 7.2363, 7.2361, 7.2367, 7.2365, 7.2372, 7.2369, 7.2395, 7.2396, 7.2411, 7.2413, 7.2414, 7.242, 7.2428, 7.2427, 7.2442, 7.2441, 7.2432, 7.2431, 7.2446, 7.2444, 7.245, 7.2456, 7.2453, 7.2459, 7.2458, 7.2455, 7.2452, 7.2458, 7.2463, 7.2469, 7.2468, 7.2465, 7.2463, 7.246, 7.2457, 7.2457, 7.2455, 7.2452, 7.2449, 7.2446, 7.2444, 7.2442, 7.2441, 7.2447, 7.2446, 7.2443, 7.2441, 7.2439, 7.2437, 7.2442, 7.2447, 7.2445, 7.2443, 7.244, 7.2437, 7.2442, 7.2448, 7.2446, 7.2444, 7.2442, 7.2448, 7.2453, 7.245, 7.2497, 7.2494, 7.2492, 7.249, 7.2489, 7.2494, 7.2494, 7.2492, 7.249, 7.2495, 7.2492, 7.249, 7.2487, 7.2485, 7.2482, 7.248, 7.2479, 7.2484, 7.2483, 7.2488, 7.2487, 7.2493, 7.2507, 7.2505, 7.2511, 7.2508, 7.2506, 7.2503, 7.2501, 7.2501, 7.25, 7.2498, 7.2503, 7.2509, 7.2514, 7.2529, 7.2527, 7.2524, 7.2538, 7.2544, 7.2541, 7.2532, 7.2531, 7.2537, 7.2539, 7.2537, 7.2536, 7.2554, 7.256, 7.2566, 7.2563, 7.2577, 7.2575, 7.259, 7.2582, 7.258, 7.2596, 7.2593, 7.2591, 7.2588, 7.2586, 7.2583, 7.2582, 7.2588, 7.2585, 7.2583, 7.258, 7.2578, 7.2576, 7.2578, 7.2584, 7.2582, 7.2589, 7.2587, 7.2595, 7.2585, 7.2584, 7.2593, 7.2592, 7.2584, 7.2589, 7.2594, 7.26, 7.2597, 7.2589, 7.2598, 7.2604, 7.2601, 7.26, 7.2598, 7.2605, 7.2604, 7.2602, 7.26, 7.2606, 7.2612, 7.2609, 7.2616, 7.2613, 7.2619, 7.2617, 7.2617, 7.2614, 7.2612, 7.2609, 7.2607, 7.2604, 7.261, 7.2608, 7.2631, 7.2629, 7.2628, 7.2635, 7.2634, 7.264, 7.2646, 7.2644, 7.2643, 7.2665, 7.2664, 7.2662, 7.2661, 7.2667, 7.2674, 7.2672, 7.2679, 7.2677, 7.2676, 7.2673, 7.2671, 7.2669, 7.2668, 7.2667, 7.2666, 7.2672, 7.2672, 7.2669, 7.2675, 7.2674, 7.268, 7.2686, 7.2683, 7.2688, 7.2686, 7.2683, 7.2682, 7.2681, 7.2679, 7.2677, 7.2675, 7.2672, 7.267, 7.2676, 7.2673, 7.267, 7.2667, 7.2665, 7.2662, 7.2667, 7.2667, 7.2665, 7.2662, 7.266, 7.2666, 7.2664, 7.2669, 7.2668, 7.2666, 7.2671, 7.2668, 7.2666, 7.2664, 7.2661, 7.266, 7.2666, 7.2664, 7.2662, 7.2668, 7.2673, 7.2671, 7.267, 7.2668, 7.2674, 7.2673, 7.2679, 7.2676, 7.2682, 7.2681, 7.2678, 7.2677, 7.2676, 7.2673, 7.2678, 7.2676, 7.2675, 7.2674, 7.2674, 7.268, 7.2677, 7.2683, 7.2682, 7.2682, 7.268, 7.2679, 7.2684, 7.2682, 7.2687, 7.2684, 7.2682, 7.268, 7.2685, 7.2683, 7.268, 7.2678, 7.2676, 7.2674, 7.2673, 7.2679, 7.2684, 7.2683, 7.2681, 7.2679, 7.2677, 7.2676, 7.2682, 7.2679, 7.2684, 7.2682, 7.2681, 7.2686, 7.2683, 7.268, 7.2685, 7.2684, 7.2681, 7.2679, 7.2687, 7.27, 7.2705, 7.2704, 7.2702, 7.2707, 7.2705, 7.2702, 7.27, 7.2713, 7.2711, 7.2713, 7.2711, 7.272, 7.2725, 7.2723, 7.2723, 7.2721, 7.2719, 7.2716, 7.2715, 7.2714, 7.2715, 7.2717, 7.2715, 7.2721], '192.168.122.116': [11.6343, 9.1549, 8.628, 7.8345, 8.7598, 8.3031, 7.9929, 7.715, 7.4677, 7.8351, 8.1835, 8.4537, 8.6738, 8.5203, 8.3057, 8.1233, 8.3219, 8.1574, 8.0207, 7.9092, 7.8341, 7.7384, 7.8675, 7.7738, 7.7307, 7.8603, 7.7828, 7.7078, 7.8235, 7.9222, 7.8722, 7.808, 7.7361, 7.8237, 7.7695, 7.7173, 7.7975, 7.7536, 7.8511, 7.7899, 7.7703, 7.754, 7.6972, 7.7744, 7.7201, 7.6738, 7.7459, 7.9257, 7.88, 7.8291, 7.7887, 7.7581, 7.7296, 7.7207, 7.6848, 7.6688, 7.6292, 7.5989, 7.5663, 7.5492, 7.5316, 7.4953, 7.4687, 7.4421, 7.3393, 7.3135, 7.2866, 7.2879, 7.2728, 7.2604, 7.1658, 7.2178, 7.2704, 7.2443, 7.2318, 7.2064, 7.1888, 7.1776, 7.1597, 7.0773, 7.1287, 7.1176, 7.1094, 7.0904, 7.0901, 7.0766, 7.1261, 7.1712, 7.1595, 7.1394, 7.1317, 7.1156, 7.1544, 7.1343, 7.1146, 7.1502, 7.136, 7.1178, 7.1183, 7.1011, 7.0961, 7.1055, 7.0913, 7.0746, 7.0617, 7.1011, 7.0933, 7.1291, 7.1148, 7.1089, 7.0974, 7.0912, 7.0783, 7.0753, 7.0736, 7.067, 7.0543, 7.0915, 7.0755, 7.0617, 7.092, 7.0892, 7.0778, 7.0675, 7.0594, 7.0531, 7.0445, 7.0748, 7.0665, 7.0611, 7.049, 7.0415, 7.0311, 7.0256, 7.0157, 7.0032, 7.0316, 7.0299, 7.0203, 7.0117, 7.0046, 6.9977, 6.9892, 6.9766, 6.9774, 6.9772, 7.0054, 6.997, 6.9914, 7.0195, 7.0169, 7.0449, 7.069, 7.0579, 7.0466, 7.0381, 7.031, 7.0202, 7.0144, 7.005, 7.0293, 7.0523, 7.0765, 7.0664, 7.0567, 7.0805, 7.1054, 7.0953, 7.0919, 7.1165, 7.1093, 7.1051, 7.0993, 7.0896, 7.0841, 7.0779, 7.0712, 7.0663, 7.0587, 7.0533, 7.1096, 7.1006, 7.0958, 7.0878, 7.0777, 7.0696, 7.061, 7.0524, 7.0452, 7.0387, 7.0307, 7.0802, 7.0715, 7.0627, 7.0532, 7.0569, 7.0518, 7.0722, 7.0911, 7.0876, 7.089, 7.0812, 7.0734, 7.0643, 7.0583, 7.0549, 7.0742, 7.072, 7.0718, 7.0672, 7.0646, 7.0593, 7.0532, 7.0471, 7.0426, 7.0634, 7.0618, 7.0591, 7.054, 7.0468, 7.0416, 7.0372, 7.0389, 7.0559, 7.0485, 7.0411, 7.0348, 7.0273, 7.0217, 7.0159, 7.034, 7.0307, 7.0279, 7.0445, 7.0455000000000005, 7.0387, 7.0364, 7.0314, 7.0284, 7.0255, 7.0232, 7.0183, 7.0335, 7.03, 7.0257, 7.0237, 7.0182, 7.0132, 7.0082, 6.9882, 7.0041, 7.0029, 6.9988, 6.9978, 6.9934, 6.9927, 6.9909, 6.9885, 7.0303, 7.0238, 7.0428, 7.0439, 7.0559, 7.0597, 7.0558, 7.0535, 7.0491, 7.0448, 7.0446, 7.0425, 7.0377, 7.0515, 7.0496, 7.0671, 7.0639, 7.0604, 7.0786, 7.074, 7.0696, 7.0653, 7.081, 7.0754, 7.0791, 7.080100000000001, 7.0771, 7.0739, 7.0689, 7.0645, 7.0591, 7.0549, 7.0677, 7.063, 7.0581, 7.0574, 7.0726, 7.0841, 7.0803, 7.093, 7.0912, 7.0873, 7.0832, 7.0957, 7.1107, 7.127, 7.1222, 7.1166, 7.1283, 7.1277, 7.122, 7.1194, 7.1177, 7.1309, 7.1419, 7.1365, 7.1325, 7.1302, 7.1428, 7.1391, 7.1342, 7.1301, 7.1266, 7.125, 7.1233, 7.1188, 7.1158, 7.112, 7.1067, 7.1052, 7.1001, 7.0952, 7.0933, 7.092, 7.0872, 7.0941, 7.0913, 7.0757, 7.0936, 7.108, 7.103, 7.0992, 7.0946, 7.0903, 7.0868, 7.09, 7.075, 7.0721, 7.069, 7.0661, 7.0554, 7.051, 7.068, 7.0655, 7.0667, 7.062, 7.0742, 7.0874, 7.0839, 7.0849, 7.0815, 7.0793, 7.0742, 7.0715, 7.0672, 7.0627, 7.0753, 7.074, 7.0694, 7.0648, 7.0624, 7.0576, 7.0676, 7.0757, 7.0712, 7.0678, 7.0644, 7.0623, 7.0589, 7.0693, 7.0661, 7.0757, 7.0856, 7.0809, 7.0787, 7.077, 7.0724, 7.0825, 7.0786, 7.0766, 7.0723, 7.0937, 7.091, 7.0884, 7.0877, 7.0838, 7.0812, 7.0792, 7.0746, 7.0733, 7.0709, 7.0682, 7.078, 7.088, 7.0869, 7.0996, 7.0952, 7.0913, 7.0875, 7.0965, 7.0947, 7.0923, 7.0885, 7.0848, 7.0944, 7.104, 7.1004, 7.11, 7.1139, 7.1113, 7.0977, 7.0942, 7.0911, 7.1071, 7.1038, 7.1141, 7.1108, 7.1338, 7.1295, 7.1397, 7.1358, 7.1317, 7.1275, 7.113, 7.1217, 7.1315, 7.1275, 7.1252, 7.1333, 7.1292, 7.1334, 7.1302, 7.1388, 7.1349, 7.1426, 7.1397, 7.1404, 7.1493, 7.145, 7.1415, 7.1376, 7.1339, 7.1298, 7.1272, 7.123, 7.1196, 7.117, 7.1041, 7.1009, 7.0977, 7.106, 7.1032, 7.1026, 7.111, 7.1093, 7.106, 7.107, 7.1059, 7.1026, 7.1036, 7.1011, 7.0997, 7.0963, 7.0927, 7.0889, 7.0864, 7.0833, 7.084300000000001, 7.0828, 7.0819, 7.0821, 7.0795, 7.0812, 7.0822, 7.0821, 7.0786, 7.0753, 7.0832, 7.0813, 7.0788, 7.0755, 7.0835, 7.0845, 7.0813, 7.0788, 7.0757, 7.0736, 7.0712, 7.0796, 7.0763, 7.0742, 7.0836, 7.093, 7.0947, 7.0943, 7.0912, 7.0912, 7.0881, 7.0856, 7.0823, 7.079, 7.0767, 7.0748, 7.0729, 7.0705, 7.0683, 7.0672, 7.0666, 7.0645, 7.0627, 7.0607, 7.0626, 7.0608, 7.0578, 7.066, 7.0651, 7.0629, 7.0622, 7.0606, 7.0617, 7.0611, 7.0587, 7.0673, 7.0663, 7.0632, 7.0619, 7.0617, 7.0597, 7.0609, 7.061, 7.0582, 7.0665, 7.0737, 7.0716, 7.0689, 7.067, 7.0641, 7.0639, 7.0712, 7.07, 7.0681, 7.0749, 7.0717, 7.07, 7.0677, 7.0653, 7.063, 7.064, 7.0616, 7.0595, 7.067, 7.0791, 7.0873, 7.0855, 7.0823, 7.0848, 7.085800000000001, 7.0837, 7.0806, 7.0783, 7.0761, 7.0767, 7.0751, 7.0744, 7.0755, 7.0725, 7.0723, 7.0719, 7.0689, 7.066, 7.0657, 7.0725, 7.0797, 7.0869, 7.0855, 7.0837, 7.083, 7.0828, 7.0805, 7.0781, 7.0749, 7.0815, 7.0805, 7.0871, 7.086, 7.0829, 7.0811, 7.0782, 7.0861, 7.0832, 7.0815, 7.083, 7.0812, 7.0804, 7.0775, 7.0756, 7.0741, 7.0716, 7.0783, 7.0754, 7.0736, 7.0712, 7.0697, 7.0685, 7.069500000000001, 7.0667, 7.0672, 7.0648, 7.062, 7.0598, 7.0574, 7.0581, 7.0563, 7.0471, 7.0447, 7.0429, 7.0353, 7.0418, 7.0485, 7.0461, 7.0471, 7.0465, 7.0475, 7.0553, 7.0622, 7.0608, 7.0593, 7.0581, 7.0565, 7.0575, 7.0733, 7.0722, 7.0713, 7.0686, 7.0745, 7.0734, 7.0708, 7.0702, 7.0683, 7.0673, 7.0731, 7.0705, 7.0684, 7.0658, 7.0717, 7.0774, 7.0747, 7.0801, 7.078, 7.0754, 7.0772, 7.0764, 7.0738, 7.0719, 7.0698, 7.076, 7.0738, 7.0722, 7.0713, 7.0719, 7.0699, 7.0677, 7.0655, 7.0637, 7.0619, 7.0602, 7.0669, 7.0644, 7.0703, 7.0761, 7.0823, 7.0803, 7.0795, 7.080500000000001, 7.081500000000001, 7.0872, 7.0847, 7.0842, 7.0845, 7.0824, 7.0802, 7.0783, 7.0757, 7.0734, 7.0724, 7.0708, 7.071, 7.0702, 7.0692, 7.0669, 7.0651, 7.064, 7.0618, 7.0855, 7.0907, 7.0892, 7.0944, 7.0938, 7.0937, 7.0934, 7.0952, 7.0927, 7.0905, 7.09, 7.091, 7.0889, 7.088, 7.086, 7.0845, 7.0844, 7.083, 7.0889, 7.087, 7.0923, 7.0974, 7.0965, 7.0947, 7.0927, 7.0979, 7.1122, 7.1103, 7.1083, 7.1071, 7.1046, 7.1023, 7.1005, 7.0987, 7.1063, 7.1157, 7.1138, 7.1272, 7.126, 7.1238, 7.1295, 7.1275, 7.1322, 7.1332, 7.134200000000001, 7.1329, 7.1377, 7.1363, 7.1338, 7.1502, 7.148, 7.1502, 7.1487, 7.1487, 7.1472, 7.1466, 7.145, 7.1477, 7.1459, 7.1467, 7.1446, 7.1431, 7.1414, 7.1465, 7.1515, 7.1503, 7.1492, 7.150200000000001, 7.1482, 7.146, 7.1439, 7.1415, 7.1406, 7.1389, 7.1391, 7.1401, 7.1639, 7.1922, 7.1913, 7.1889, 7.1866, 7.1857, 7.1837, 7.1831, 7.1876, 7.1855, 7.1905, 7.1885, 7.1867, 7.186, 7.1836, 7.1811, 7.1791, 7.184, 7.182, 7.1873, 7.1862, 7.1842, 7.1825, 7.1865, 7.1841, 7.1818, 7.1798, 7.1839, 7.1815, 7.1864, 7.1908, 7.195, 7.1932, 7.1975, 7.1958, 7.2003, 7.2048, 7.2025, 7.2002, 7.198, 7.1967, 7.1959, 7.1937, 7.1932, 7.191, 7.1899, 7.1956, 7.1935, 7.1924, 7.1917, 7.1916, 7.1962, 7.1945, 7.1928, 7.1909, 7.1907, 7.1889, 7.1875, 7.1888, 7.1867, 7.1847, 7.1828, 7.1809, 7.1789, 7.1771, 7.176, 7.1772, 7.1767, 7.1762, 7.1801, 7.1783, 7.1765, 7.1745, 7.1732, 7.1726, 7.1773, 7.1754, 7.1801, 7.1791, 7.1851, 7.1897, 7.1886, 7.1867, 7.1859, 7.1961, 7.1953, 7.1936, 7.1917, 7.1973, 7.1962, 7.2006, 7.1987, 7.2036, 7.2014, 7.1998, 7.1981, 7.1963, 7.1944, 7.1931, 7.1925, 7.1907, 7.1893, 7.1885, 7.1879, 7.1872, 7.1867, 7.1857, 7.1837, 7.1841, 7.1826, 7.1811, 7.1851, 7.1848, 7.1847, 7.1896, 7.1877, 7.1864, 7.1848, 7.1863, 7.1872, 7.1864, 7.1906, 7.1951, 7.1929, 7.1968, 7.1948, 7.1939, 7.1935, 7.1926, 7.1858, 7.1906, 7.1886, 7.188, 7.1867, 7.186, 7.1849, 7.1837, 7.1822, 7.1871, 7.1854, 7.1837, 7.1826, 7.1808, 7.1845, 7.1828, 7.187, 7.185, 7.1894, 7.1881, 7.1871, 7.1856, 7.1848, 7.1838, 7.1884, 7.1871, 7.1858, 7.186, 7.184, 7.1841, 7.1885, 7.1928, 7.1971, 7.1967, 7.195, 7.2001, 7.1995, 7.1989, 7.1987, 7.1977, 7.196, 7.1944, 7.1933, 7.1917, 7.1898, 7.1888, 7.1927, 7.1913, 7.1901, 7.1884, 7.1883, 7.1932, 7.1983, 7.203, 7.2019, 7.2018, 7.2003, 7.1989, 7.1978, 7.1982, 7.1967, 7.2017, 7.2014, 7.2007, 7.205, 7.2093, 7.2078, 7.2077, 7.2061, 7.2105, 7.2145, 7.2127, 7.2115, 7.2111, 7.2103, 7.2092, 7.2082, 7.2118, 7.2099, 7.2099, 7.209, 7.2078, 7.2126, 7.212, 7.2106, 7.209, 7.2298, 7.2286, 7.2332, 7.2317, 7.2309, 7.2293, 7.2279, 7.2263, 7.2301, 7.229, 7.233, 7.2324, 7.231, 7.2301, 7.2284, 7.2266, 7.225, 7.2242, 7.2227, 7.221, 7.2216, 7.2201, 7.2188, 7.2228, 7.2213, 7.2252, 7.2238, 7.2227, 7.2208, 7.2195, 7.2194, 7.2182, 7.2166, 7.215, 7.2142, 7.2123, 7.2111, 7.2152, 7.2146, 7.2148, 7.2153, 7.2138, 7.2133, 7.2131, 7.2116, 7.2112, 7.2118, 7.2106, 7.2091, 7.2131, 7.2122, 7.2105, 7.2095, 7.2133, 7.212, 7.2158, 7.215, 7.2139, 7.2077, 7.2061, 7.2045, 7.2039, 7.203, 7.2014, 7.1998, 7.2038, 7.2083, 7.2117, 7.211, 7.2097, 7.2084, 7.207, 7.2057, 7.2042, 7.2027, 7.2117, 7.2108, 7.2094, 7.2088, 7.2123, 7.2157, 7.219, 7.2173, 7.2168, 7.2155, 7.2192, 7.2174, 7.2157, 7.214, 7.2127, 7.2162, 7.215, 7.2133, 7.2116, 7.2099, 7.2085, 7.2069, 7.2056, 7.204, 7.2033, 7.2022, 7.206, 7.2042, 7.2032, 7.2016, 7.2007, 7.2002, 7.1989, 7.198, 7.1968, 7.2003, 7.2093, 7.2076, 7.2108, 7.2095, 7.2082, 7.2073, 7.2059, 7.2046, 7.2035, 7.207, 7.2055, 7.2039, 7.2072, 7.206, 7.2044, 7.2035, 7.2067, 7.2103, 7.2086, 7.2073, 7.2111, 7.211, 7.2098, 7.2086, 7.207, 7.2057, 7.2051, 7.2042, 7.2078, 7.2066, 7.209, 7.2154, 7.2146, 7.2157, 7.2151, 7.2234, 7.222, 7.2207, 7.2242, 7.2225, 7.2213, 7.2198, 7.2233, 7.2218, 7.2201, 7.2193, 7.2197, 7.229, 7.2275, 7.2263, 7.2256, 7.2242, 7.2234, 7.222, 7.2212, 7.2197, 7.2231, 7.2223, 7.2255, 7.2243, 7.2227, 7.221, 7.2194, 7.2183, 7.2175, 7.2166, 7.215, 7.2136, 7.2131, 7.2122, 7.2107, 7.2138, 7.2124, 7.2115, 7.2103, 7.2094, 7.2108, 7.2188, 7.2264, 7.2253, 7.2261, 7.2246, 7.223, 7.2214, 7.2198, 7.2183, 7.2213, 7.2255, 7.2285, 7.227, 7.2259, 7.2243, 7.2232, 7.2263, 7.2247, 7.2233, 7.2218, 7.2249, 7.2285, 7.2274, 7.2259, 7.2253, 7.2238, 7.2266, 7.2253, 7.2242, 7.2242, 7.2239, 7.2222, 7.2207, 7.2241, 7.2226, 7.2211, 7.2201, 7.2233, 7.2272, 7.2276, 7.2264, 7.2256, 7.229, 7.2275, 7.2265, 7.2271, 7.2299, 7.2283, 7.2267, 7.2253, 7.2249, 7.2284, 7.2317, 7.2303, 7.2298, 7.2284, 7.2272, 7.2262, 7.2257, 7.2292, 7.2282, 7.2276, 7.2284, 7.2271, 7.23, 7.2294, 7.2325, 7.2314, 7.2304, 7.2344, 7.2331, 7.2323, 7.2311, 7.2312, 7.2297, 7.2288, 7.2283, 7.2276, 7.227, 7.2265, 7.2277, 7.2266, 7.2256, 7.2247, 7.2249, 7.2239, 7.227, 7.2256, 7.2252, 7.2239, 7.2224, 7.2214, 7.2243, 7.2232, 7.2221, 7.2206, 7.2234, 7.2226, 7.2212, 7.2203, 7.2195, 7.2191, 7.2281, 7.2272, 7.2295, 7.2343, 7.2333, 7.2318, 7.2311, 7.2302, 7.229, 7.2379, 7.2365, 7.2357, 7.2344, 7.2343, 7.233, 7.2322, 7.2314, 7.2305, 7.2343, 7.2331, 7.2326, 7.2313, 7.2348, 7.2383, 7.2415, 7.2411, 7.2401, 7.2435, 7.243, 7.2465, 7.2492, 7.2481, 7.2473, 7.2462, 7.2456, 7.2446, 7.2434, 7.2421, 7.2414, 7.2409, 7.2482, 7.2552, 7.2546, 7.2574, 7.2604, 7.2591, 7.2582, 7.2577, 7.2567, 7.2559, 7.2585, 7.2584, 7.2612, 7.26, 7.2592, 7.2589, 7.2576, 7.2567, 7.2559, 7.2549, 7.2537, 7.2531, 7.2561, 7.2559, 7.2544, 7.2531, 7.2519, 7.2514, 7.2511, 7.2497, 7.2485, 7.2478, 7.2467, 7.2454, 7.2449, 7.2447, 7.2435, 7.2429, 7.242, 7.2406, 7.2437, 7.2463, 7.2501, 7.2493, 7.2482, 7.2476, 7.2463, 7.2489, 7.2519, 7.2509, 7.2497, 7.2488, 7.2477, 7.2469, 7.246, 7.2485, 7.2477, 7.2467, 7.2455, 7.2447, 7.2434, 7.242, 7.2445, 7.2469, 7.2455, 7.2451, 7.2497, 7.2561, 7.2562, 7.2565, 7.2552, 7.2617, 7.2607, 7.2636, 7.2664, 7.2653, 7.2648, 7.2636, 7.2625, 7.2613, 7.2608, 7.2599, 7.2624, 7.261, 7.2597, 7.2582, 7.2573, 7.256, 7.2557, 7.2547, 7.2576, 7.2604, 7.259, 7.2577, 7.257, 7.2596, 7.2626, 7.2622, 7.261, 7.2601, 7.2626, 7.2613, 7.2605, 7.2603, 7.2601, 7.2558, 7.2552, 7.2543, 7.2533, 7.2529, 7.2523, 7.2513, 7.2503, 7.2496, 7.2486, 7.2475, 7.2462, 7.2455, 7.2441, 7.2439, 7.2429, 7.246, 7.2453, 7.2487, 7.2477, 7.2477, 7.2499, 7.2487, 7.2517, 7.2509, 7.2535, 7.2523, 7.2518, 7.2543, 7.2567, 7.2558, 7.2546, 7.2534, 7.2523, 7.2551, 7.2542, 7.2537, 7.2532, 7.252, 7.2512, 7.2541, 7.253, 7.2524, 7.2551, 7.2542, 7.2542, 7.2534, 7.2529, 7.2518, 7.2514, 7.2504, 7.2493, 7.248, 7.2469, 7.2467, 7.2456, 7.2481, 7.247, 7.2461, 7.245, 7.2443, 7.2434, 7.2434, 7.2466, 7.2496, 7.2484, 7.2508, 7.2532, 7.2519, 7.2513, 7.2536, 7.2524, 7.2513, 7.2502, 7.2492, 7.2481, 7.2472, 7.246, 7.2457, 7.2447, 7.244, 7.2465, 7.2453, 7.2442, 7.2429, 7.242, 7.2408, 7.2434, 7.2425, 7.2419, 7.2409, 7.2438, 7.2462, 7.2457, 7.2479, 7.2608, 7.2596, 7.262, 7.2611, 7.2598, 7.259, 7.2582, 7.2575, 7.2604, 7.2601, 7.2591, 7.2585, 7.2574, 7.2568, 7.2556, 7.2581, 7.2571, 7.2564, 7.2557, 7.2584, 7.2606, 7.2602, 7.2647, 7.2642, 7.2668, 7.2692, 7.2687, 7.2681, 7.2706, 7.2697, 7.2724, 7.2714, 7.2708, 7.2698, 7.2705, 7.2695, 7.2718, 7.2707, 7.2695, 7.2683, 7.2671, 7.2661, 7.2649, 7.264, 7.2628, 7.2617, 7.2605, 7.26, 7.2624, 7.2615, 7.2604, 7.2591, 7.2581, 7.257, 7.2591, 7.2582, 7.264, 7.2631, 7.2619, 7.2609, 7.2602, 7.2591, 7.2579, 7.2567, 7.2559, 7.2547, 7.2536, 7.2559, 7.2549, 7.2538, 7.2561, 7.2555, 7.2548, 7.2547, 7.257, 7.2563, 7.2555, 7.2549, 7.2538, 7.2561, 7.2553, 7.2542, 7.2565, 7.2554, 7.2543, 7.2531, 7.2489, 7.2477, 7.2467, 7.2457, 7.2446, 7.2436, 7.2429, 7.2417, 7.2405, 7.2396, 7.2386, 7.2411, 7.2408, 7.2462, 7.2451, 7.2445, 7.244, 7.243, 7.2391, 7.2454, 7.2449, 7.2442, 7.243, 7.2423, 7.2419, 7.2416, 7.2406, 7.2397, 7.2421, 7.2411, 7.2404, 7.2425, 7.2413, 7.2405, 7.2398, 7.2395, 7.2383, 7.2376, 7.2366, 7.2363, 7.2383, 7.2371, 7.2363, 7.2419, 7.2408, 7.2398, 7.2389, 7.238, 7.2371, 7.2359, 7.2349, 7.2369, 7.236, 7.2354, 7.2347, 7.2341, 7.2337, 7.2329, 7.2318, 7.234, 7.2329, 7.232, 7.2315, 7.2313, 7.2333, 7.2325, 7.2329, 7.2408, 7.2429, 7.2419, 7.2443, 7.2462, 7.2455, 7.2448, 7.2451, 7.2475, 7.2466, 7.2454, 7.2443, 7.2462, 7.2456, 7.2449, 7.2442, 7.2432, 7.2424, 7.245, 7.2443, 7.2436, 7.2429, 7.2421, 7.2412, 7.2411, 7.2408, 7.24, 7.2396, 7.2389, 7.2382, 7.2374, 7.2434, 7.2427, 7.2426, 7.2448, 7.2443, 7.2436, 7.2464, 7.2484, 7.2474, 7.2466, 7.2486, 7.2514, 7.2504, 7.2497, 7.2485, 7.2476, 7.2465, 7.2472, 7.2469, 7.2462, 7.2457, 7.2449, 7.244, 7.2449, 7.2443, 7.2438, 7.2432, 7.2433, 7.2427, 7.2417, 7.2416, 7.2407, 7.2398, 7.2388, 7.2411, 7.2402, 7.2393, 7.2383, 7.2371, 7.2362, 7.2383, 7.2403, 7.2394, 7.2414, 7.2448, 7.2466, 7.2457, 7.2446, 7.2437, 7.2434, 7.2427, 7.2416, 7.2407, 7.2396, 7.2389, 7.241, 7.2508, 7.2505, 7.2496, 7.2498, 7.2492, 7.2482, 7.2472, 7.2493, 7.2484, 7.2504, 7.2494, 7.2485, 7.2482, 7.2473, 7.2454, 7.2444, 7.2433, 7.2424, 7.2413, 7.2404, 7.2398, 7.239, 7.2382, 7.2371, 7.2393, 7.2384, 7.2381, 7.2382, 7.2373, 7.2365, 7.2356, 7.2376, 7.2397, 7.2389, 7.2382, 7.2376, 7.2369, 7.2363, 7.2357, 7.2353, 7.2348, 7.2342, 7.2364, 7.2353, 7.2376, 7.2366, 7.2363, 7.2354, 7.2346, 7.2342, 7.2337, 7.2327, 7.2329, 7.2341, 7.2332, 7.2322, 7.2354, 7.2344, 7.2354, 7.2375, 7.2365, 7.2385, 7.2379, 7.2369, 7.2362, 7.2355, 7.2347, 7.2342, 7.234, 7.2334, 7.2357, 7.2349, 7.2348, 7.234, 7.2342, 7.2362, 7.2352, 7.235, 7.2344, 7.2342, 7.2409, 7.2411, 7.2468, 7.2464, 7.2473, 7.2469, 7.2491, 7.2536, 7.2529, 7.2521, 7.2511, 7.2533, 7.2527, 7.2519, 7.2511, 7.2505, 7.2498, 7.2488, 7.2479, 7.2476, 7.2475, 7.2472, 7.2494, 7.2465, 7.243, 7.2432, 7.2497, 7.2497, 7.2491, 7.2486, 7.2508, 7.2498, 7.2516, 7.2507, 7.25, 7.2494, 7.2496, 7.2489, 7.2481, 7.2485, 7.2477, 7.2469, 7.2467, 7.2457, 7.2449, 7.2443, 7.2433, 7.2455, 7.245, 7.2448, 7.244, 7.2461, 7.246, 7.2454, 7.2454, 7.2446, 7.2441, 7.2432, 7.2426, 7.2427, 7.2417, 7.2409, 7.2454, 7.2449, 7.2443, 7.244, 7.2461, 7.2458, 7.2451, 7.2469, 7.246, 7.245, 7.2441, 7.2438, 7.2428, 7.2422, 7.2416, 7.2438, 7.2457, 7.2451, 7.2473, 7.2472, 7.2465, 7.2455, 7.2476, 7.2493, 7.2513, 7.2509, 7.2527, 7.2521, 7.2539, 7.2532, 7.253, 7.2522, 7.2521, 7.2546, 7.2541, 7.2538, 7.2531, 7.2523, 7.2523, 7.2513, 7.251, 7.2503, 7.2494, 7.2486, 7.248, 7.2484, 7.2481, 7.2504, 7.2498, 7.2489, 7.2479, 7.2469, 7.2468, 7.2466, 7.2457, 7.2505, 7.2498, 7.2492, 7.2483, 7.248, 7.2502, 7.2502, 7.2494, 7.2493, 7.2493, 7.2522, 7.2515, 7.2535, 7.2536, 7.2615, 7.2605, 7.2596, 7.259, 7.2587, 7.258, 7.257, 7.2561, 7.2555, 7.2551, 7.2543, 7.2541, 7.2538, 7.2536, 7.2557, 7.2549, 7.2542, 7.2541, 7.2572, 7.2565, 7.2589, 7.2584, 7.2583, 7.2574, 7.2573, 7.2571, 7.2563, 7.2557, 7.2554, 7.2549, 7.2571, 7.2562, 7.2564, 7.2535, 7.2554, 7.2554, 7.2546, 7.2562, 7.2555, 7.2575, 7.2596, 7.259, 7.2582, 7.2577, 7.2568, 7.2587, 7.2603, 7.2595, 7.259, 7.2584, 7.258, 7.2577, 7.2571, 7.2569, 7.2563, 7.2536, 7.2527, 7.2545, 7.2541, 7.2536, 7.2531, 7.2562, 7.2553, 7.2548, 7.2539, 7.2531, 7.2527, 7.2517, 7.2509, 7.2503, 7.2495, 7.2487, 7.2481, 7.2477, 7.2467, 7.2462, 7.2479, 7.2472, 7.2464, 7.2476, 7.2469, 7.2486, 7.248, 7.25, 7.25, 7.2491, 7.2511, 7.2522, 7.2513, 7.2507, 7.2503, 7.2494, 7.2485, 7.2477, 7.2468, 7.2462, 7.2454, 7.2446, 7.2467, 7.2493, 7.2487, 7.2478, 7.2469, 7.2467, 7.2467, 7.2458, 7.2452, 7.2442, 7.2436, 7.2426, 7.2443, 7.2437, 7.243, 7.2421, 7.2438, 7.2433, 7.2435, 7.2426, 7.2475, 7.2469, 7.2463, 7.2454, 7.2473, 7.2478, 7.2475, 7.247, 7.2468, 7.2461, 7.2453, 7.2447, 7.2465, 7.2455, 7.245, 7.2443, 7.2446, 7.244, 7.2435, 7.2427, 7.2419, 7.2411, 7.2407, 7.2398, 7.239, 7.2384, 7.2376, 7.2394, 7.2412, 7.2456, 7.2456, 7.2448, 7.244, 7.2431, 7.2446, 7.2463, 7.254, 7.2567, 7.2596, 7.2641, 7.2634, 7.263, 7.2628, 7.2621, 7.2614, 7.2606, 7.26, 7.2623, 7.2619, 7.2593, 7.2587, 7.2588, 7.2582, 7.2599, 7.2596, 7.2592, 7.2584, 7.2575, 7.2566, 7.2557, 7.255, 7.2543, 7.2542, 7.2557, 7.2549, 7.2565, 7.2558, 7.2549, 7.2545, 7.2539, 7.2531, 7.2547, 7.2538, 7.2529, 7.2521, 7.2515, 7.2508, 7.2566, 7.2564, 7.256, 7.2553, 7.2549, 7.2541, 7.2532, 7.2528, 7.2525, 7.2517, 7.2509, 7.2502, 7.252, 7.2512, 7.2508, 7.2501, 7.252, 7.2511, 7.2503, 7.2496, 7.249, 7.2488, 7.248, 7.2471, 7.2464, 7.2479, 7.2477, 7.2494, 7.2487, 7.248, 7.2472, 7.2465, 7.2465, 7.2467, 7.2461, 7.2454, 7.2446, 7.2439, 7.2431, 7.2424, 7.242, 7.2413, 7.2408, 7.2448, 7.2445, 7.2442, 7.2436, 7.2435, 7.2453, 7.2451, 7.2467, 7.2459, 7.2453, 7.2446, 7.2437, 7.2436, 7.2432, 7.2446, 7.2441, 7.2433, 7.2451, 7.2468, 7.246, 7.2463, 7.2459, 7.2452, 7.2467, 7.2459, 7.2455, 7.2451, 7.2443, 7.2437, 7.2429, 7.2423, 7.2416, 7.241, 7.2426, 7.2419, 7.2412, 7.2405, 7.2422, 7.2417, 7.2411, 7.2405, 7.243, 7.2427, 7.242, 7.2412, 7.2404, 7.2396, 7.241, 7.2408, 7.24, 7.2416, 7.2407, 7.2401, 7.2392, 7.2387, 7.2379, 7.2373, 7.2367, 7.2362, 7.2358, 7.2389, 7.2383, 7.2375, 7.2369, 7.2365, 7.2361, 7.2353, 7.2345, 7.2337, 7.2338, 7.233, 7.2346, 7.2343, 7.2337, 7.2334, 7.2327, 7.2322, 7.2336, 7.2329, 7.2322, 7.2314, 7.2306, 7.2301, 7.2295, 7.2292, 7.2285, 7.2315, 7.2307, 7.2301, 7.2297, 7.2316, 7.2309, 7.2301, 7.2297, 7.2312, 7.2329, 7.2327, 7.2322, 7.2314, 7.2311, 7.233, 7.2325, 7.2316, 7.2355, 7.2373, 7.2392, 7.2388, 7.2363, 7.236, 7.2353, 7.237, 7.2361, 7.2375, 7.2367, 7.2361, 7.2359, 7.2353, 7.235, 7.2367, 7.236, 7.2355, 7.2353, 7.235, 7.2342, 7.2334, 7.2327, 7.2324, 7.2343, 7.2358, 7.2382, 7.2374, 7.2392, 7.2384, 7.2402, 7.2418, 7.241, 7.2404, 7.2419, 7.2416, 7.2511, 7.2507, 7.25, 7.2495, 7.2488, 7.2496, 7.2543, 7.2539, 7.2534, 7.2526, 7.2552, 7.2545, 7.2586, 7.2649, 7.2644, 7.2639, 7.2655, 7.2647, 7.2643, 7.266, 7.2653, 7.2647, 7.2641, 7.2639, 7.2633, 7.2627, 7.2624, 7.2619, 7.2635, 7.2629, 7.2621, 7.2614, 7.2611, 7.2603, 7.2601, 7.2595, 7.261, 7.2604, 7.2601, 7.2595, 7.26, 7.2597, 7.2596, 7.2595, 7.2623, 7.262, 7.2612, 7.2608, 7.2628, 7.2625, 7.2617, 7.2614, 7.2607, 7.2602, 7.26, 7.2594, 7.2593, 7.261, 7.2604, 7.2602, 7.2594, 7.2587, 7.2579, 7.2572, 7.2567, 7.256, 7.2555, 7.255, 7.2542, 7.2535, 7.253, 7.2523, 7.2516, 7.251, 7.2505, 7.2498, 7.2492, 7.2486, 7.2502, 7.2502, 7.2496, 7.2512, 7.2508, 7.2503, 7.2499, 7.2491, 7.2486, 7.2501, 7.2495, 7.249, 7.2488, 7.2504, 7.25, 7.2494, 7.249, 7.2482, 7.2477, 7.2472, 7.2465, 7.2467, 7.2459, 7.2499, 7.2494, 7.2487, 7.2479, 7.2472, 7.2466, 7.2461, 7.2476, 7.2469, 7.2484, 7.2477, 7.2471, 7.2464, 7.248, 7.2475, 7.2468, 7.2462, 7.2479, 7.2476, 7.2473, 7.2473, 7.2469, 7.2462, 7.2456, 7.2451, 7.2446, 7.2439, 7.2434, 7.2429, 7.2443, 7.2459, 7.2452, 7.2446, 7.2443, 7.2436, 7.2452, 7.2448, 7.2441, 7.2456, 7.245, 7.2443, 7.2436, 7.2454, 7.2447, 7.2441, 7.2438, 7.243, 7.2422, 7.2423, 7.2417, 7.2411, 7.2405, 7.2398, 7.2396, 7.2411, 7.2408, 7.2432, 7.2449, 7.2442, 7.2436, 7.2432, 7.2429, 7.2424, 7.2417, 7.2413, 7.2408, 7.2425, 7.242, 7.2413, 7.2426, 7.2419, 7.2434, 7.2429, 7.2423, 7.2418, 7.2523, 7.2517, 7.2512, 7.2525, 7.2521, 7.2535, 7.2551, 7.2543, 7.2535, 7.2528, 7.2528, 7.2521, 7.2537, 7.2532, 7.2537, 7.2531, 7.2545, 7.254, 7.2533, 7.255, 7.2545, 7.2539, 7.2534, 7.2528, 7.2546, 7.254, 7.2538, 7.2532, 7.2525, 7.253, 7.2565, 7.2561, 7.2554, 7.2547, 7.2564, 7.2558, 7.2552, 7.2548, 7.2545, 7.2541, 7.2535, 7.2528, 7.2525, 7.2521, 7.2539, 7.2536, 7.253, 7.2588, 7.2583, 7.2598, 7.2593, 7.2586, 7.2584, 7.2581, 7.2574, 7.2566, 7.2607, 7.2609, 7.2607, 7.2621, 7.2614, 7.2607, 7.262, 7.2613, 7.2605, 7.2597, 7.259, 7.2584, 7.2576, 7.2572, 7.2565, 7.2559, 7.2554, 7.2569, 7.2561, 7.2568, 7.2566, 7.2572, 7.2587, 7.2581, 7.2577, 7.257, 7.2563, 7.2559, 7.2556, 7.2553, 7.2547, 7.2606, 7.2621, 7.2614, 7.2609, 7.2587, 7.258, 7.2575, 7.2571, 7.2587, 7.2581, 7.2579, 7.2572, 7.2567, 7.2563, 7.2561, 7.2554, 7.2569, 7.2563, 7.2556, 7.2554, 7.2551, 7.2546, 7.256, 7.2558, 7.2553, 7.255, 7.2544, 7.254, 7.2536, 7.2552, 7.2548, 7.2547, 7.2542, 7.254, 7.2534, 7.2529, 7.2542, 7.258, 7.2574, 7.2569, 7.2566, 7.2559, 7.2554, 7.2551, 7.2567, 7.2563, 7.2563, 7.2558, 7.2574, 7.2567, 7.2562, 7.2557, 7.2553, 7.2568, 7.2561, 7.2554, 7.2548, 7.2544, 7.2557, 7.255, 7.2545, 7.2539, 7.2533, 7.2527, 7.254, 7.2541, 7.2536, 7.2529, 7.2523, 7.2517, 7.2532, 7.2528, 7.2521, 7.2534, 7.255, 7.2565, 7.2601, 7.2595, 7.2589, 7.2603, 7.2602, 7.2597, 7.2613, 7.2608, 7.2601, 7.2598, 7.2651, 7.2656, 7.2652, 7.2653, 7.2675, 7.2672, 7.2669, 7.2664, 7.268, 7.2696, 7.2692, 7.2712, 7.2711, 7.2736, 7.2731, 7.2746, 7.2761, 7.2756, 7.2754, 7.275, 7.2746, 7.276, 7.2756, 7.2751, 7.2769, 7.2767, 7.2762, 7.2757, 7.275, 7.2745, 7.2742, 7.2757, 7.2752, 7.2747, 7.2741, 7.2721, 7.2701, 7.2681, 7.2696, 7.2677, 7.2671, 7.2672, 7.2693, 7.2687, 7.2682, 7.2679, 7.2673, 7.2666, 7.2684, 7.2691, 7.2685, 7.2701, 7.2695, 7.2756, 7.2752, 7.2802, 7.2797, 7.279, 7.2788, 7.2783, 7.278, 7.2774, 7.2752, 7.2746, 7.2742, 7.2777, 7.2773, 7.2766, 7.2779, 7.2777, 7.279, 7.2787, 7.2782, 7.278, 7.2774, 7.2772, 7.2766, 7.276, 7.2757, 7.2753, 7.2747, 7.2762, 7.2755, 7.2748, 7.2742, 7.2735, 7.273, 7.2725, 7.2719, 7.2717, 7.2718, 7.2731, 7.2745, 7.2742, 7.2755, 7.2748, 7.2741, 7.2734, 7.2734, 7.2748, 7.2744, 7.2778, 7.2778, 7.2773, 7.2767, 7.2761, 7.2756, 7.2749, 7.2784, 7.2779, 7.2793, 7.2788, 7.2781, 7.2778, 7.2771, 7.2765, 7.2758, 7.2752, 7.2765, 7.2761, 7.2757, 7.277, 7.2763, 7.2757, 7.2751, 7.2747, 7.2743, 7.274, 7.2736, 7.2731, 7.2724, 7.2717, 7.271, 7.2703, 7.2698, 7.2691, 7.2704, 7.2698, 7.2709, 7.2723, 7.2716, 7.2711, 7.2723, 7.2721, 7.2716, 7.2717, 7.2713, 7.2707, 7.2726, 7.2761, 7.2755, 7.2748, 7.2746, 7.274, 7.2734, 7.2746, 7.276, 7.2754, 7.2748, 7.2749, 7.2762, 7.2776, 7.2789, 7.2802, 7.2858, 7.2869, 7.2865, 7.2859, 7.2855, 7.2849, 7.2847, 7.284, 7.2836, 7.2831, 7.2825, 7.2821, 7.2833, 7.2826, 7.2824, 7.2819, 7.2814, 7.281, 7.2806, 7.2821, 7.2833, 7.2828, 7.2823, 7.2819, 7.2813, 7.2808, 7.2803, 7.2798, 7.2813, 7.281, 7.2829, 7.2826, 7.2823, 7.2818, 7.2815, 7.281, 7.2805, 7.2801, 7.2814, 7.2809, 7.2802, 7.2796, 7.2792, 7.2788, 7.2788, 7.2802, 7.2799, 7.2796, 7.2793, 7.2787, 7.2782, 7.2793, 7.2788, 7.2784, 7.2779, 7.2773, 7.277, 7.2763, 7.2775, 7.2771, 7.2767, 7.2762, 7.2767, 7.2765, 7.276, 7.2754, 7.2749, 7.2742, 7.2737, 7.2732, 7.293, 7.2944, 7.2938, 7.2934, 7.2927, 7.292, 7.2914, 7.2911, 7.291, 7.289, 7.2893, 7.289, 7.2885, 7.2882, 7.2876, 7.2886, 7.2879, 7.2892, 7.2886, 7.2898, 7.291, 7.2904, 7.2898, 7.2891, 7.2885, 7.2896, 7.2932, 7.2926, 7.2927, 7.2927, 7.2942, 7.294, 7.2935, 7.295, 7.2947, 7.2943, 7.2938, 7.2932, 7.2925, 7.2927, 7.2927, 7.2928, 7.2964, 7.296, 7.2994, 7.299, 7.2986, 7.2985, 7.2979, 7.2975, 7.2989, 7.2989, 7.2986, 7.299, 7.2988, 7.3016, 7.2999, 7.2998, 7.3014, 7.301, 7.3005, 7.3032, 7.3057, 7.3055, 7.305, 7.3045, 7.3065, 7.3059, 7.3055, 7.3068, 7.3064, 7.306, 7.3056, 7.3052, 7.3048, 7.3048, 7.3029, 7.3031, 7.3025, 7.3026, 7.3019, 7.3013, 7.3007, 7.3002, 7.2996, 7.3009, 7.304, 7.3036, 7.303, 7.3008, 7.3001, 7.2997, 7.3007, 7.3019, 7.3014, 7.3007, 7.3002, 7.3017, 7.3047, 7.3032, 7.3047, 7.3042, 7.3048, 7.3044, 7.3038, 7.3037, 7.3033, 7.3031, 7.3025, 7.3019, 7.3013, 7.3009, 7.3002, 7.2999, 7.3011, 7.3005, 7.3004, 7.2998, 7.2992, 7.2986, 7.298, 7.2979, 7.2975, 7.2973, 7.2971, 7.2965, 7.2962, 7.2957, 7.2969, 7.2963, 7.2963, 7.2957, 7.2987, 7.2987, 7.3022, 7.3035, 7.3046, 7.3042, 7.3054, 7.3051, 7.3045, 7.3041, 7.3038, 7.3032, 7.3029, 7.3041, 7.3036, 7.3036, 7.3032, 7.3028, 7.3024, 7.3037, 7.3031, 7.3026, 7.3022, 7.3016, 7.3012, 7.3006, 7.3, 7.2995, 7.2995, 7.2989, 7.2984, 7.2995, 7.3033, 7.3028, 7.3065, 7.3059, 7.3054, 7.3052, 7.3054, 7.305, 7.3046, 7.3044, 7.3042, 7.3037, 7.3033, 7.3046, 7.3041, 7.304, 7.3034, 7.3028, 7.3038, 7.3034, 7.3028, 7.3039, 7.3036, 7.3031, 7.3029, 7.3024, 7.3019, 7.3017, 7.3011, 7.3018, 7.3013, 7.3009, 7.3005, 7.3005, 7.3006, 7.3004, 7.3017, 7.3029, 7.3023, 7.3019, 7.3013, 7.301, 7.3007, 7.3003, 7.3001, 7.298, 7.2962, 7.2944, 7.2941, 7.2938, 7.2948, 7.2959, 7.2956, 7.295, 7.2945, 7.2947, 7.2945, 7.2941, 7.2938, 7.2935, 7.2932, 7.2929, 7.2923, 7.2956, 7.295, 7.2945, 7.2955, 7.2954, 7.2967, 7.2966, 7.296, 7.2956, 7.2967, 7.2978, 7.2976, 7.297, 7.2968, 7.2962, 7.2956, 7.295, 7.2944, 7.2938, 7.2935, 7.2946, 7.294, 7.2951, 7.2962, 7.2974, 7.2986, 7.2965, 7.296, 7.2953, 7.2947, 7.2943, 7.2942, 7.2953, 7.2949, 7.2946, 7.2943, 7.2937, 7.2934, 7.2928, 7.2923, 7.2922, 7.2918, 7.2912, 7.291, 7.2908, 7.2902, 7.2914, 7.291, 7.2923, 7.2924, 7.292, 7.2915, 7.2909, 7.2922, 7.2916, 7.2913, 7.2907, 7.2903, 7.2913, 7.2908, 7.2918, 7.2913, 7.2911, 7.2905, 7.2899, 7.2893, 7.2905, 7.2915, 7.291, 7.2904, 7.29, 7.2897, 7.2895, 7.2889, 7.2902, 7.2913, 7.2907, 7.2904, 7.2898, 7.2894, 7.2908, 7.2905, 7.2903, 7.2916, 7.2912, 7.2924, 7.2921, 7.2915, 7.2925, 7.2921, 7.2932, 7.2929, 7.2925, 7.2906, 7.2918, 7.2914, 7.291, 7.2907, 7.2902, 7.2899, 7.2898, 7.2893, 7.2905, 7.2901, 7.2899, 7.2895, 7.2908, 7.2906, 7.2901, 7.2897, 7.2891, 7.2889, 7.2885, 7.2896, 7.2891, 7.2887, 7.2882, 7.2876, 7.2872, 7.2869, 7.2865, 7.2861, 7.2859, 7.2854, 7.2865, 7.2862, 7.2857, 7.2869, 7.2866, 7.2862, 7.2859, 7.2854, 7.2848, 7.2843, 7.284, 7.2836, 7.2832, 7.2829, 7.2824, 7.2818, 7.2813, 7.2807, 7.2804, 7.2802, 7.2798, 7.2794, 7.279, 7.2784, 7.2781, 7.2776, 7.2777, 7.2803, 7.2802, 7.2786, 7.2782, 7.2779, 7.2775, 7.2769, 7.2768, 7.2763, 7.2757, 7.2754, 7.2751, 7.2732, 7.2729, 7.2725, 7.2719, 7.2714, 7.2709, 7.2705, 7.2716, 7.2713, 7.2734, 7.2732, 7.2726, 7.2736, 7.2731, 7.2731, 7.2725, 7.2721, 7.2717, 7.2728, 7.2722, 7.2718, 7.2712, 7.2708, 7.2719, 7.272, 7.2717, 7.2716, 7.2711, 7.2706, 7.2701, 7.2696, 7.269, 7.2686, 7.2697, 7.2694, 7.269, 7.2684, 7.268, 7.269, 7.2685, 7.2681, 7.2678, 7.2672, 7.2666, 7.266, 7.2655, 7.2654, 7.265, 7.2647, 7.2658, 7.2658, 7.2654, 7.2651, 7.2646, 7.2643, 7.2654, 7.2649, 7.2644, 7.2639, 7.2639, 7.2634, 7.2629, 7.2625, 7.2634, 7.2692, 7.2673, 7.267, 7.2667, 7.2662, 7.271, 7.2721, 7.2719, 7.2715, 7.271, 7.2723, 7.2719, 7.2714, 7.271, 7.2708, 7.2704, 7.2702, 7.27, 7.2696, 7.269, 7.2718, 7.2714, 7.2758, 7.2756, 7.2758, 7.2754, 7.2752, 7.2747, 7.2743, 7.2738, 7.2752, 7.2758, 7.2753, 7.2749, 7.2744, 7.2739, 7.2739, 7.2749, 7.2761, 7.2756, 7.2755, 7.275, 7.2761, 7.2773, 7.2771, 7.2766, 7.2761, 7.2757, 7.2752, 7.2747, 7.2759, 7.2754, 7.2749, 7.2761, 7.2756, 7.2755, 7.2765, 7.2765, 7.2779, 7.2774, 7.277, 7.2767, 7.2763, 7.2757, 7.2752, 7.2749, 7.2744, 7.2738, 7.2735, 7.2746, 7.2756, 7.2751, 7.2746, 7.2757, 7.2752, 7.2733, 7.2728, 7.2723, 7.2737, 7.2746, 7.274, 7.2737, 7.2732, 7.2729, 7.2724, 7.2719, 7.2729, 7.2725, 7.2722, 7.2717, 7.2713, 7.2709, 7.2707, 7.2721, 7.2715, 7.2711, 7.2705, 7.27, 7.2694, 7.269, 7.2685, 7.2684, 7.2681, 7.2678, 7.2675, 7.2673, 7.2671, 7.2684, 7.268, 7.2675, 7.2672, 7.2666, 7.2665, 7.2661, 7.2673, 7.2669, 7.2665, 7.2659, 7.2656, 7.2654, 7.2652, 7.2648, 7.2646, 7.2657, 7.2656, 7.2651, 7.265, 7.2648, 7.2642, 7.2639, 7.2651, 7.2645, 7.2641, 7.2637, 7.2632, 7.2641, 7.2635, 7.2631, 7.264, 7.2635, 7.2617, 7.2599, 7.2596, 7.2594, 7.2605, 7.2618, 7.2614, 7.2609, 7.2606, 7.2604, 7.26, 7.2594, 7.2591, 7.2587, 7.2585, 7.258, 7.2579, 7.2573, 7.2584, 7.258, 7.2591, 7.2601, 7.2596, 7.259, 7.2585, 7.258, 7.2575, 7.2572, 7.2585, 7.2583, 7.2578, 7.2573, 7.2554, 7.2565, 7.2576, 7.2572, 7.2567, 7.2577, 7.2572, 7.2567, 7.2564, 7.2561, 7.2556, 7.2554, 7.2549, 7.2546, 7.2541, 7.2537, 7.2535, 7.2531, 7.2528, 7.2523, 7.252, 7.253, 7.2526, 7.2523, 7.2518, 7.2513, 7.2508, 7.2504, 7.2514, 7.251, 7.2508, 7.2504, 7.2501, 7.2512, 7.2509, 7.2505, 7.25, 7.2495, 7.249, 7.2485, 7.2482, 7.2477, 7.2473, 7.2468, 7.2464, 7.2461, 7.2457, 7.2453, 7.245, 7.2451, 7.2446, 7.2445, 7.2442, 7.2453, 7.2452, 7.2447, 7.2429, 7.2426, 7.2421, 7.243, 7.2426, 7.2437, 7.2433, 7.2435, 7.2441, 7.2439, 7.2449, 7.2444, 7.244, 7.2449, 7.2444, 7.244, 7.2454, 7.2464, 7.2461, 7.2457, 7.2454, 7.2452, 7.2447, 7.2444, 7.2443, 7.244, 7.2438, 7.244, 7.2437, 7.2433, 7.243, 7.2442, 7.244, 7.2436, 7.2447, 7.2458, 7.2454, 7.2449, 7.2444, 7.2456, 7.2455, 7.2455, 7.2451, 7.2464, 7.2498, 7.2496, 7.2492, 7.2488, 7.2483, 7.2482, 7.2465, 7.2478, 7.2488, 7.25, 7.2498, 7.2494, 7.249, 7.249, 7.2487, 7.2485, 7.2483, 7.2478, 7.2475, 7.247, 7.2465, 7.2474, 7.2486, 7.2481, 7.2476, 7.2472, 7.2467, 7.2466, 7.2463, 7.2466, 7.2448, 7.2444, 7.244, 7.2436, 7.2436, 7.2431, 7.2426, 7.2421, 7.243, 7.2426, 7.2436, 7.2431, 7.2426, 7.2421, 7.2417, 7.2429, 7.2426, 7.2423, 7.242, 7.2415, 7.2415, 7.2413, 7.241, 7.2406, 7.2417, 7.2413, 7.2408, 7.2404, 7.24, 7.2397, 7.2394, 7.2404, 7.2403, 7.2401, 7.2399, 7.2394, 7.239, 7.2388, 7.2384, 7.2383, 7.2379, 7.239, 7.2424, 7.2422, 7.2418, 7.2428, 7.2426, 7.2421, 7.2423, 7.2419, 7.2416, 7.2412, 7.2424, 7.2421, 7.2419, 7.243, 7.2425, 7.2423, 7.2407, 7.2404, 7.2401, 7.2396, 7.2435, 7.2434, 7.2431, 7.2471, 7.2468, 7.2463, 7.2475, 7.2479, 7.2476, 7.2471, 7.2471, 7.2467, 7.2476, 7.2486, 7.2482, 7.2477, 7.2475, 7.2471, 7.2466, 7.2461, 7.2456, 7.2467, 7.2463, 7.2473, 7.2534, 7.2537, 7.2533, 7.2528, 7.2539, 7.2534, 7.2529, 7.2528, 7.2524, 7.2521, 7.2517, 7.2519, 7.2531, 7.2529, 7.2525, 7.2521, 7.2518, 7.2516, 7.2514, 7.2514, 7.2509, 7.2521, 7.2532, 7.253, 7.2541, 7.2552, 7.2548, 7.2545, 7.2541, 7.2536, 7.2532, 7.2532, 7.2527, 7.2523, 7.252, 7.2518, 7.2515, 7.2512, 7.2509, 7.2508, 7.2503, 7.2498, 7.2496, 7.2492, 7.2491, 7.2501, 7.25, 7.2495, 7.2492, 7.2509, 7.2505, 7.2503, 7.2501, 7.2497, 7.2492, 7.249, 7.2489, 7.2498, 7.2497, 7.2495, 7.2492, 7.249, 7.2486, 7.2483, 7.2478, 7.2474, 7.247, 7.2465, 7.2461, 7.2459, 7.2458, 7.2456, 7.2453, 7.2449, 7.2444, 7.2441, 7.2451, 7.2448, 7.2447, 7.2443, 7.244, 7.2441, 7.2437, 7.2432, 7.2434, 7.243, 7.2428, 7.2424, 7.242, 7.2416, 7.2425, 7.2422, 7.2417, 7.244, 7.2451, 7.2449, 7.2446, 7.2441, 7.2443, 7.2439, 7.2449, 7.2459, 7.2455, 7.2452, 7.2448, 7.2443, 7.244, 7.2451, 7.2449, 7.2445, 7.244, 7.2437, 7.2432, 7.2427, 7.2422, 7.2417, 7.2414, 7.2423, 7.2433, 7.2433, 7.243, 7.243, 7.2487, 7.2482, 7.2477, 7.2474, 7.2474, 7.2487, 7.2486, 7.2486, 7.2483, 7.2494, 7.2491, 7.2488, 7.2486, 7.2482, 7.2481, 7.2477, 7.2473, 7.2484, 7.248, 7.2491, 7.2501, 7.2506, 7.2502, 7.2499, 7.2503, 7.2504, 7.25, 7.2498, 7.2493, 7.2489, 7.2485, 7.2495, 7.2492, 7.2488, 7.2486, 7.2483, 7.2481, 7.2497, 7.2493, 7.2488, 7.2483, 7.2481, 7.2478, 7.2481, 7.2477, 7.2475, 7.2473, 7.2469, 7.2465, 7.2462, 7.2473, 7.2471, 7.2467, 7.2468, 7.2464, 7.2462, 7.2458, 7.2455, 7.2466, 7.2491, 7.2515, 7.2526, 7.2538, 7.2539, 7.2536, 7.2536, 7.2533, 7.253, 7.2527, 7.2526, 7.2523, 7.2518, 7.2513, 7.251, 7.252, 7.2515, 7.2511, 7.2508, 7.2503, 7.2514, 7.251, 7.2519, 7.2515, 7.2512, 7.2509, 7.2507, 7.2506, 7.2504, 7.249, 7.2487, 7.2482, 7.2477, 7.2472, 7.2502, 7.2498, 7.2494, 7.2491, 7.2487, 7.2483, 7.2493, 7.2504, 7.2514, 7.2526, 7.2523, 7.2507, 7.2492, 7.2489, 7.2484, 7.2539, 7.2541, 7.2563, 7.2559, 7.2556, 7.2552, 7.2552, 7.2548, 7.2563, 7.256, 7.2564, 7.258, 7.2589, 7.2586, 7.2582, 7.258, 7.2576, 7.2572, 7.2568, 7.2565, 7.2562, 7.256, 7.2556, 7.2556, 7.2552, 7.2563, 7.2588, 7.2585, 7.2595, 7.2591, 7.2601, 7.2598, 7.2611, 7.2619, 7.2616, 7.2612, 7.2622, 7.2619, 7.2615, 7.2627, 7.2623, 7.2619, 7.2628, 7.2624, 7.2623, 7.2619, 7.2629, 7.2626, 7.2635, 7.2631, 7.2627, 7.2623, 7.2621, 7.2617, 7.2615, 7.2613, 7.2609, 7.2604, 7.2601, 7.2597, 7.2593, 7.259, 7.2587, 7.2583, 7.2578, 7.2575, 7.257, 7.2579, 7.2575, 7.2572, 7.2569, 7.2565, 7.2549, 7.2535, 7.253, 7.2527, 7.2522, 7.2518, 7.2516, 7.2515, 7.2511, 7.252, 7.2517, 7.2502, 7.25, 7.2503, 7.2488, 7.2485, 7.2483, 7.2478, 7.2474, 7.2472, 7.2468, 7.2465, 7.2475, 7.2485, 7.2483, 7.2481, 7.2467, 7.2451, 7.2449, 7.2459, 7.2456, 7.2441, 7.2429, 7.2427, 7.2437, 7.2434, 7.2443, 7.244, 7.2449, 7.245, 7.2446, 7.2442, 7.244, 7.2438, 7.2434, 7.2444, 7.2441, 7.2444, 7.244, 7.2436, 7.2432, 7.2456, 7.2466, 7.2476, 7.2472, 7.2471, 7.2467, 7.2463, 7.2461, 7.2458, 7.2458, 7.2468, 7.2465, 7.2478, 7.2475, 7.247, 7.2471, 7.2469, 7.2464, 7.2465, 7.2463, 7.246, 7.2457, 7.2455, 7.2453, 7.245, 7.2458, 7.2453, 7.2449, 7.2458, 7.2453, 7.2457, 7.2453, 7.2437, 7.2433, 7.2442, 7.2431, 7.2427, 7.2423, 7.2419, 7.2417, 7.2426, 7.2424, 7.2433, 7.2443, 7.2438, 7.2436, 7.2433, 7.2432, 7.2443, 7.2444, 7.2441, 7.2438, 7.2436, 7.2433, 7.243, 7.2427, 7.2438, 7.2443, 7.244, 7.245, 7.246, 7.2485, 7.2483, 7.2479, 7.2489, 7.2485, 7.2495, 7.2507, 7.2504, 7.25, 7.2498, 7.2519, 7.2527, 7.255, 7.2563, 7.256, 7.2557, 7.2553, 7.2551, 7.2547, 7.2549, 7.2546, 7.2542, 7.254, 7.2536, 7.2534, 7.2532, 7.2528, 7.2525, 7.2534, 7.2533, 7.2529, 7.253, 7.2529, 7.255, 7.2535, 7.2533, 7.2529, 7.2525, 7.2528, 7.2537, 7.2534, 7.2532, 7.254, 7.2548, 7.2545, 7.2541, 7.2539, 7.2536, 7.2536, 7.2532, 7.253, 7.2526, 7.2525, 7.252, 7.253, 7.2528, 7.2525, 7.2521, 7.2508, 7.2504, 7.2514, 7.2522, 7.2519, 7.2515, 7.2511, 7.251, 7.2506, 7.2503, 7.25, 7.2497, 7.2494, 7.249, 7.2489, 7.2496, 7.2492, 7.2488, 7.2486, 7.2471, 7.2498, 7.2498, 7.2495, 7.2492, 7.2502, 7.2499, 7.2495, 7.2491, 7.2487, 7.2482, 7.2478, 7.2474, 7.247, 7.2466, 7.2465, 7.2461, 7.246, 7.2456, 7.2452, 7.2449, 7.2445, 7.2455, 7.2451, 7.2459, 7.2454, 7.2452, 7.2448, 7.2444, 7.2448, 7.246, 7.2469, 7.2478, 7.2488, 7.2484, 7.248, 7.2479, 7.2488, 7.2486, 7.2482, 7.2477, 7.2473, 7.2471, 7.2469, 7.2469, 7.2471, 7.2482, 7.2478, 7.2489, 7.2489, 7.2488, 7.2484, 7.248, 7.2481, 7.2479, 7.2478, 7.2474, 7.2471, 7.2469, 7.2455, 7.2452, 7.2451, 7.2449, 7.2448, 7.2444, 7.2441, 7.2437, 7.2434, 7.2431, 7.243, 7.2427, 7.2436, 7.2432, 7.2429, 7.2426, 7.2423, 7.2421, 7.2418, 7.2416, 7.2414, 7.241, 7.2406, 7.2403, 7.2413, 7.241, 7.2407, 7.2404, 7.2413, 7.2421, 7.2417, 7.2414, 7.2412, 7.241, 7.2407, 7.2416, 7.2414, 7.2411, 7.2408, 7.2404, 7.2401, 7.2398, 7.2394, 7.2391, 7.2387, 7.2386, 7.2394, 7.239, 7.2386, 7.2395, 7.2391, 7.2391, 7.2387, 7.2383, 7.238, 7.2378, 7.2375, 7.2373, 7.2373, 7.237, 7.2367, 7.2376, 7.2376, 7.2373, 7.2359, 7.2355, 7.2352, 7.2348, 7.2347, 7.2343, 7.2342, 7.2341, 7.2339, 7.2336, 7.2334, 7.2334, 7.233, 7.2339, 7.2352, 7.2348, 7.2357, 7.2354, 7.235, 7.2347, 7.2355, 7.2351, 7.235, 7.2346, 7.2345, 7.2345, 7.2343, 7.2341, 7.2338, 7.2337, 7.2335, 7.2332, 7.234, 7.2349, 7.2346, 7.2345, 7.2346, 7.2343, 7.2339, 7.2335, 7.2333, 7.2329, 7.2326, 7.2324, 7.2321, 7.2318, 7.2315, 7.2323, 7.233, 7.2328, 7.2329, 7.2326, 7.2335, 7.2331, 7.2328, 7.2325, 7.2321, 7.2318, 7.2315, 7.2314, 7.231, 7.2307, 7.2303, 7.23, 7.2296, 7.2293, 7.2293, 7.2289, 7.2287, 7.2284, 7.2322, 7.2321, 7.232, 7.2318, 7.2317, 7.2328, 7.2327, 7.2325, 7.2322, 7.2319, 7.2329, 7.2341, 7.234, 7.2337, 7.2334, 7.2322, 7.2322, 7.2334, 7.2331, 7.2341, 7.2338, 7.2338, 7.2335, 7.2331, 7.2341, 7.2338, 7.2337, 7.2337, 7.2334, 7.2331, 7.2318, 7.2328, 7.2324, 7.2323, 7.2321, 7.2321, 7.2321, 7.233, 7.2327, 7.2323, 7.2333, 7.2343, 7.2339, 7.2325, 7.2322, 7.2318, 7.2315, 7.2311, 7.2307, 7.2303, 7.2301, 7.2302, 7.2325, 7.2358, 7.2355, 7.2353, 7.2349, 7.2359, 7.2359, 7.2369, 7.2368, 7.2364, 7.2362, 7.2358, 7.2353, 7.2349, 7.2347, 7.2355, 7.2351, 7.2363, 7.2361, 7.2358, 7.2355, 7.2356, 7.2352, 7.2349, 7.2345, 7.2344, 7.2353, 7.2351, 7.2347, 7.2345, 7.2353, 7.235, 7.2347, 7.2345, 7.2354, 7.2363, 7.2359, 7.2372, 7.2369, 7.2366, 7.2362, 7.2358, 7.2356, 7.2364, 7.2361, 7.2358, 7.2356, 7.2353, 7.2349, 7.2348, 7.2344, 7.234, 7.2336, 7.2332, 7.2328, 7.2327, 7.2348, 7.2345, 7.2342, 7.234, 7.2348, 7.2344, 7.2343, 7.2341, 7.2338, 7.2341, 7.2338, 7.2335, 7.2344, 7.2345, 7.2341, 7.2339, 7.2337, 7.2333, 7.2342, 7.2339, 7.2338, 7.2339, 7.2343, 7.2351, 7.2349, 7.2345, 7.2342, 7.2338, 7.2347, 7.2345, 7.2366, 7.2364, 7.2374, 7.2396, 7.2393, 7.24, 7.2398, 7.2395, 7.2392, 7.2378, 7.2366, 7.2352, 7.236, 7.2356, 7.2366, 7.2366, 7.2363, 7.2361, 7.2358, 7.2356, 7.2352, 7.2348, 7.2344, 7.234, 7.2339, 7.2346, 7.2357, 7.2366, 7.2362, 7.237, 7.2367, 7.2364, 7.2374, 7.2371, 7.2369, 7.2365, 7.2373, 7.2382, 7.2368, 7.2375, 7.2384, 7.2392, 7.2389, 7.2398, 7.2395, 7.2392, 7.2388, 7.2385, 7.2381, 7.2378, 7.2374, 7.2383, 7.238, 7.2389, 7.2376, 7.2374, 7.2374, 7.237, 7.2368, 7.2365, 7.2362, 7.2358, 7.2355, 7.2363, 7.2361, 7.2359, 7.2367, 7.2364, 7.2372, 7.2368, 7.2365, 7.2363, 7.2361, 7.2357, 7.2366, 7.2362, 7.236, 7.2368, 7.2364, 7.2362, 7.2358, 7.2355, 7.2366, 7.2362, 7.2358, 7.2357, 7.2343, 7.2342, 7.234, 7.2336, 7.2334, 7.2332, 7.233, 7.2326, 7.2334, 7.2332, 7.2321, 7.2317, 7.2314, 7.2345, 7.2343, 7.2342, 7.2351, 7.235, 7.2358, 7.2355, 7.2353, 7.2362, 7.237, 7.2366, 7.2364, 7.2384, 7.238, 7.2377, 7.2366, 7.2354, 7.2351, 7.2359, 7.2359, 7.2367, 7.2365, 7.2353, 7.2349, 7.2345, 7.2341, 7.2337, 7.2345, 7.2353, 7.2349, 7.2345, 7.2341, 7.233, 7.2327, 7.2323, 7.232, 7.2316, 7.2323, 7.232, 7.2316, 7.2312, 7.2308, 7.2304, 7.2304, 7.23, 7.2298, 7.2306, 7.2302, 7.231, 7.2317, 7.2314, 7.231, 7.2306, 7.2303, 7.2311, 7.2308, 7.2305, 7.2292, 7.2288, 7.2286, 7.2283, 7.228, 7.2277, 7.2278, 7.2277, 7.2274, 7.2288, 7.2296, 7.2323, 7.2324, 7.232, 7.2318, 7.2338, 7.2346, 7.2343, 7.2341, 7.2338, 7.2358, 7.2355, 7.2363, 7.236, 7.2358, 7.2354, 7.2352, 7.2349, 7.2345, 7.2342, 7.2372, 7.2369, 7.2378, 7.2375, 7.2384, 7.2384, 7.238, 7.2377, 7.2385, 7.2382, 7.2378, 7.2376, 7.2373, 7.2382, 7.2382, 7.238, 7.2377, 7.2374, 7.2382, 7.2383, 7.2383, 7.238, 7.2377, 7.2378, 7.2377, 7.2375, 7.2408, 7.2404, 7.24, 7.2399, 7.2407, 7.2405, 7.2402, 7.2398, 7.2395, 7.2392, 7.239, 7.2386, 7.2397, 7.2405, 7.2401, 7.2399, 7.2396, 7.2396, 7.2392, 7.2389, 7.2386, 7.24, 7.2424, 7.2423, 7.2421, 7.2434, 7.2421, 7.2419, 7.243, 7.243, 7.2427, 7.2426, 7.2425, 7.2422, 7.2441, 7.2448, 7.2445, 7.2454, 7.2454, 7.2463, 7.246, 7.2457, 7.2457, 7.2456, 7.2453, 7.2451, 7.246, 7.2467, 7.2464, 7.2463, 7.246, 7.2457, 7.2454, 7.2451, 7.2447, 7.2443, 7.244, 7.2436, 7.2432, 7.2429, 7.2426, 7.2433, 7.2441, 7.2438, 7.2439, 7.2448, 7.2445, 7.2442, 7.2439, 7.2436, 7.2434, 7.2448, 7.2459, 7.2488, 7.2488, 7.2487, 7.2473, 7.2471, 7.2474, 7.2471, 7.2468, 7.2465, 7.2463, 7.2472, 7.247, 7.2478, 7.2474, 7.2472, 7.2469, 7.2465, 7.2461, 7.2457, 7.2444, 7.2442, 7.2439, 7.2437, 7.2434, 7.2421, 7.2417, 7.2414, 7.2412, 7.2409, 7.2407, 7.2394, 7.239, 7.2389, 7.2386, 7.2386, 7.2385, 7.2384, 7.2371, 7.2389, 7.2389, 7.2407, 7.2394, 7.2401, 7.2399, 7.2408, 7.2415, 7.2425, 7.2422, 7.242, 7.2418, 7.2416, 7.2415, 7.2414, 7.2412, 7.2412, 7.2409, 7.2406, 7.2404, 7.24, 7.2397, 7.2394, 7.2402, 7.2429, 7.2426, 7.2431, 7.2442, 7.244, 7.2436, 7.2433, 7.2443, 7.2486, 7.2475, 7.2473, 7.2469, 7.2466, 7.2475, 7.2472, 7.247, 7.2467, 7.2464, 7.246, 7.2447, 7.2437, 7.2434, 7.2422, 7.242, 7.2418, 7.2427, 7.2425, 7.2434, 7.2432, 7.244, 7.2452, 7.2449, 7.2447, 7.2465, 7.249, 7.2489, 7.2498, 7.2496, 7.2525, 7.2522, 7.2532, 7.253, 7.2528, 7.2524, 7.2513, 7.2513, 7.251, 7.2509, 7.2521, 7.2519, 7.2522, 7.252, 7.2516, 7.2557, 7.2565, 7.2562, 7.2558, 7.2554, 7.2564, 7.2561, 7.2559, 7.2557, 7.2553, 7.255, 7.2557, 7.2553, 7.2549, 7.2538, 7.2526, 7.2523, 7.2512, 7.251, 7.2507, 7.2506, 7.2503, 7.251, 7.2509, 7.2506, 7.2505, 7.2501, 7.2499, 7.2496, 7.2494, 7.2491, 7.2487, 7.2485, 7.2494, 7.2494, 7.249, 7.2494, 7.249, 7.2498, 7.2506, 7.2505, 7.2512, 7.2509, 7.2521, 7.2517, 7.2513, 7.252, 7.2524, 7.252, 7.2518, 7.2514, 7.2513, 7.2509, 7.2507, 7.2504, 7.2503, 7.25, 7.2498, 7.2496, 7.2496, 7.2516, 7.2517, 7.2515, 7.2524, 7.2526, 7.2522, 7.2519, 7.2517, 7.2525, 7.2533, 7.2541, 7.2539, 7.2536, 7.2534, 7.2531, 7.2528, 7.2525, 7.2521, 7.2528, 7.2524, 7.2523, 7.252, 7.2529, 7.2526, 7.2524, 7.2522, 7.2519, 7.2516, 7.2513, 7.2511, 7.251, 7.2507, 7.2505, 7.2503, 7.249, 7.2479, 7.2467, 7.2463, 7.2479, 7.2466, 7.2464, 7.2462, 7.246, 7.2457, 7.2445, 7.2442, 7.2439, 7.2435, 7.2433, 7.243, 7.2427, 7.2435, 7.2431, 7.2429, 7.2428, 7.2425, 7.2422, 7.2429, 7.2425, 7.2421, 7.2418, 7.2414, 7.2412, 7.241, 7.2406, 7.2402, 7.2399, 7.2395, 7.2394, 7.2402, 7.2399, 7.2398, 7.2394, 7.239, 7.2389, 7.2396, 7.2395, 7.2393, 7.2391, 7.2392, 7.2388, 7.2376, 7.2373, 7.2382, 7.2379, 7.238, 7.2387, 7.2384, 7.2382, 7.2378, 7.2375, 7.2374, 7.2372, 7.2369, 7.2358, 7.2356, 7.2356, 7.2354, 7.2352, 7.2349, 7.2347, 7.2354, 7.2361, 7.2358, 7.2355, 7.2363, 7.2359, 7.2356, 7.2353, 7.2349, 7.2356, 7.2354, 7.2351, 7.2353, 7.235, 7.2349, 7.2356, 7.2355, 7.2353, 7.2341, 7.2338, 7.2334, 7.2331, 7.2328, 7.2335, 7.2332, 7.2328, 7.2336, 7.2333, 7.2329, 7.2325, 7.2321, 7.2317, 7.2314, 7.2311, 7.2308, 7.2305, 7.2301, 7.2299, 7.2308, 7.2295, 7.2304, 7.23, 7.2307, 7.2305, 7.2311, 7.2309, 7.2306, 7.2304, 7.2305, 7.2302, 7.2299, 7.2307, 7.2305, 7.2313, 7.2334, 7.2341, 7.234, 7.233, 7.2343, 7.2341, 7.2339, 7.235, 7.2347, 7.2354, 7.2352, 7.2342, 7.235, 7.235, 7.2357, 7.2354, 7.2352, 7.2353, 7.235, 7.2348, 7.2346, 7.2344, 7.2345, 7.2346, 7.2344, 7.2332, 7.2343, 7.234, 7.2351, 7.2359, 7.236, 7.2367, 7.2365, 7.2363, 7.2361, 7.236, 7.2367, 7.2366, 7.2364, 7.237, 7.2367, 7.2367, 7.2364, 7.2372, 7.237, 7.2367, 7.2365, 7.2372, 7.2371, 7.237, 7.2378, 7.2376, 7.2373, 7.2371, 7.2369, 7.2368, 7.2365, 7.2365, 7.2364, 7.2361, 7.2357, 7.2354, 7.2361, 7.236, 7.2357, 7.2355, 7.2362, 7.2358, 7.2356, 7.2354, 7.235, 7.235, 7.2348, 7.2347, 7.2345, 7.2341, 7.2341, 7.2337, 7.2335, 7.2335, 7.2332, 7.234, 7.2338, 7.2335, 7.2343, 7.2335, 7.2323, 7.2323, 7.232, 7.2317, 7.2316, 7.2322, 7.2318, 7.2314, 7.2322, 7.2311, 7.231, 7.2307, 7.2304, 7.2302, 7.23, 7.2298, 7.2296, 7.2294, 7.2292, 7.2289, 7.2277, 7.2275, 7.2294, 7.2291, 7.2288, 7.2286, 7.2283, 7.228, 7.2279, 7.2278, 7.2275, 7.2272, 7.2279, 7.2286, 7.2283, 7.2281, 7.2279, 7.2276, 7.2265, 7.2254, 7.2262, 7.227, 7.2277, 7.2274, 7.2272, 7.2269, 7.2269, 7.2266, 7.2265, 7.2262, 7.2259, 7.2256, 7.2253, 7.225, 7.2247, 7.2255, 7.2252, 7.225, 7.225, 7.2257, 7.2245, 7.2244, 7.2241, 7.2238, 7.2235, 7.2233, 7.223, 7.2229, 7.2229, 7.2227, 7.2227, 7.2227, 7.2223, 7.2221, 7.2209, 7.2206, 7.2203, 7.2204, 7.2216, 7.2224, 7.2222, 7.2219, 7.2208, 7.2205, 7.2202, 7.22, 7.2198, 7.2196, 7.2199, 7.2221, 7.2228, 7.2228, 7.223, 7.2227, 7.223, 7.2239, 7.2237, 7.2235, 7.2241, 7.2239, 7.2236, 7.2233, 7.2242, 7.2239, 7.2228, 7.2236, 7.2234, 7.2233, 7.223, 7.2227, 7.2225, 7.2225, 7.2232, 7.2229, 7.2227, 7.2234, 7.2233, 7.2221, 7.2219, 7.2217, 7.2205, 7.2211, 7.2208, 7.2216, 7.2213, 7.2211, 7.221, 7.221, 7.2198, 7.2195, 7.2191, 7.2188, 7.2185, 7.2181, 7.2187, 7.2185, 7.2183, 7.2179, 7.2177, 7.2174, 7.217, 7.2168, 7.2156, 7.2145, 7.2142, 7.2148, 7.2145, 7.2143, 7.214, 7.2137, 7.2134, 7.2132, 7.2149, 7.2148, 7.2156, 7.2162, 7.2159, 7.2167, 7.2164, 7.216, 7.2168, 7.2166, 7.2165, 7.2173, 7.2172, 7.2169, 7.2168, 7.2166, 7.2165, 7.2162, 7.2162, 7.2159, 7.2157, 7.2154, 7.2151, 7.2149, 7.2147, 7.2155, 7.2152, 7.215, 7.2146, 7.2154, 7.2151, 7.2148, 7.2156, 7.2155, 7.2153, 7.215, 7.2147, 7.2153, 7.2159, 7.2157, 7.2156, 7.2154, 7.2151, 7.2148, 7.2145, 7.2143, 7.2141, 7.213, 7.2128, 7.2117, 7.2115, 7.2123, 7.212, 7.2119, 7.2107, 7.2107, 7.2104, 7.2111, 7.2108, 7.2107, 7.2106, 7.2116, 7.2115, 7.2112, 7.211, 7.2108, 7.2113, 7.211, 7.2118, 7.2116, 7.2124, 7.2121, 7.2118, 7.2115, 7.2103, 7.21, 7.2099, 7.2097, 7.2095, 7.2093, 7.209, 7.2098, 7.2097, 7.2094, 7.2115, 7.2114, 7.2113, 7.212, 7.2119, 7.2108, 7.2108, 7.2106, 7.2104, 7.2104, 7.2101, 7.2115, 7.2105, 7.2112, 7.2111, 7.211, 7.2099, 7.2097, 7.2095, 7.2092, 7.2103, 7.21, 7.2097, 7.2104, 7.2103, 7.21, 7.2098, 7.2097, 7.2094, 7.2091, 7.2089, 7.2086, 7.2084, 7.2081, 7.208, 7.2068, 7.2067, 7.2064, 7.2062, 7.206, 7.2056, 7.2063, 7.2062, 7.2059, 7.2057, 7.2054, 7.2052, 7.2059, 7.2056, 7.2056, 7.2053, 7.2051, 7.2048, 7.2056, 7.206, 7.2072, 7.2076, 7.2083, 7.2081, 7.2093, 7.2085, 7.2083, 7.2081, 7.2078, 7.2076, 7.2073, 7.2073, 7.207, 7.2068, 7.2065, 7.2075, 7.2073, 7.2071, 7.2068, 7.2067, 7.2064, 7.2062, 7.2059, 7.2056, 7.2052, 7.2071, 7.2069, 7.2066, 7.2063, 7.206, 7.2088, 7.2094, 7.2091, 7.2108, 7.2107, 7.2104, 7.2106, 7.2103, 7.21, 7.2107, 7.2107, 7.2115, 7.2122, 7.2121, 7.2118, 7.2115, 7.2114, 7.2112, 7.2111, 7.2109, 7.2107, 7.2105, 7.2111, 7.2109, 7.2115, 7.2112, 7.2119, 7.2117, 7.2114, 7.212, 7.2118, 7.2116, 7.2115, 7.2122, 7.2119, 7.2116, 7.2113, 7.211, 7.2107, 7.2104, 7.2101, 7.2099, 7.2097, 7.2096, 7.2094, 7.2091, 7.2089, 7.2079, 7.2106, 7.2104, 7.2101, 7.2099, 7.2096, 7.2103, 7.2104, 7.2111, 7.2117, 7.2115, 7.2113, 7.2136, 7.2155, 7.2152, 7.2149, 7.2148, 7.2145, 7.2152, 7.2149, 7.2147, 7.2154, 7.2157, 7.2164, 7.2163, 7.2161, 7.2168, 7.2165, 7.2164, 7.2162, 7.216, 7.2167, 7.2174, 7.2172, 7.2169, 7.2179, 7.2177, 7.2175, 7.2164, 7.2162, 7.2159, 7.2157, 7.2156, 7.2153, 7.2151, 7.2149, 7.2147, 7.2144, 7.2153, 7.2151, 7.2148, 7.2145, 7.2151, 7.2158, 7.2157, 7.2154, 7.216, 7.2159, 7.2156, 7.2155, 7.2157, 7.2164, 7.2161, 7.2159, 7.2157, 7.2154, 7.2151, 7.2148, 7.2145, 7.2143, 7.214, 7.2146, 7.2158, 7.2157, 7.2154, 7.2153, 7.2159, 7.2159, 7.2157, 7.2156, 7.2153, 7.2171, 7.217, 7.2168, 7.2167, 7.2174, 7.218, 7.2178, 7.2175, 7.2182, 7.2181, 7.2179, 7.2179, 7.2177, 7.2184, 7.22, 7.2208, 7.2233, 7.2236, 7.2233, 7.223, 7.2228, 7.2226, 7.2223, 7.2242, 7.224, 7.2238, 7.2246, 7.2243, 7.2243, 7.2241, 7.2238, 7.2244, 7.225, 7.2247, 7.2244, 7.2241, 7.2239, 7.2236, 7.2242, 7.2239, 7.2245, 7.2243, 7.2241, 7.2238, 7.2244, 7.2241, 7.2238, 7.224, 7.224, 7.2238, 7.2237, 7.2234, 7.2233, 7.2231, 7.2229, 7.2228, 7.2235, 7.2232, 7.2249, 7.2247, 7.2246, 7.2243, 7.224, 7.2247, 7.2254, 7.2251, 7.2242, 7.2239, 7.2238, 7.2245, 7.2272, 7.2269, 7.2266, 7.2264, 7.2262, 7.226, 7.2257, 7.2255, 7.2252, 7.2249, 7.2248, 7.2247, 7.2255, 7.2252, 7.225, 7.2248, 7.2246, 7.2254, 7.2261, 7.2268, 7.2265, 7.2263, 7.2261, 7.2262, 7.2262, 7.226, 7.2258, 7.2256, 7.2254, 7.2262, 7.2262, 7.2259, 7.2257, 7.2255, 7.2253, 7.226, 7.2258, 7.2255, 7.2255, 7.2255, 7.2254, 7.2252, 7.2252, 7.2249, 7.2247, 7.2255, 7.2253, 7.2252, 7.225, 7.2257, 7.2256, 7.2254, 7.2251, 7.2251, 7.2249, 7.2257, 7.2255, 7.2252, 7.2251, 7.2259, 7.2267, 7.2265, 7.2273, 7.228, 7.2278, 7.2275, 7.2275, 7.2284, 7.2281, 7.2288, 7.2287, 7.2284, 7.2281, 7.2279, 7.2276, 7.2279, 7.2277, 7.2275, 7.2273, 7.227, 7.2268, 7.2266, 7.2273, 7.2281, 7.2278, 7.2275, 7.2275, 7.2282, 7.2289, 7.2287, 7.2294, 7.2291, 7.2288, 7.2295, 7.2293, 7.2291, 7.229, 7.2297, 7.2294, 7.2291, 7.2307, 7.2333, 7.233, 7.2327, 7.2334, 7.2339, 7.2337, 7.2334, 7.2331, 7.2345, 7.2343, 7.234, 7.2331, 7.2328, 7.2319, 7.2317, 7.2314, 7.2313, 7.2311, 7.2309, 7.2299, 7.2289, 7.228, 7.227, 7.2269, 7.2268, 7.2265, 7.2273, 7.2271, 7.2269, 7.2267, 7.2276, 7.2273, 7.2271, 7.227, 7.2268, 7.2257, 7.2255, 7.2252, 7.2249, 7.2247, 7.2244, 7.2251, 7.225, 7.224, 7.2237, 7.2235, 7.2232, 7.2231, 7.223, 7.2228, 7.2227, 7.2218, 7.2216, 7.2235, 7.2233, 7.2231, 7.2229, 7.2227, 7.2224, 7.2318, 7.2324, 7.2322, 7.2321, 7.2319, 7.2316, 7.2314, 7.2316, 7.2315, 7.2313, 7.2312, 7.2309, 7.2315, 7.2312, 7.2309, 7.2308, 7.2314, 7.2312, 7.231, 7.2308, 7.2307, 7.2308, 7.2306, 7.2305, 7.2305, 7.2321, 7.2318, 7.2315, 7.2313, 7.2303, 7.2302, 7.2301, 7.2298, 7.2296, 7.2293, 7.229, 7.2305, 7.2312, 7.2309, 7.2306, 7.2303, 7.23, 7.229, 7.2297, 7.2305, 7.2313, 7.231, 7.2316, 7.2322, 7.2328, 7.2325, 7.2323, 7.2322, 7.232, 7.2326, 7.2323, 7.2329, 7.2339, 7.2337, 7.2326, 7.2318, 7.2309, 7.2299, 7.2289, 7.2287, 7.2284, 7.2273, 7.2274, 7.2273, 7.227, 7.2267, 7.2264, 7.2261, 7.2259, 7.2265, 7.2264, 7.2263, 7.2262, 7.226, 7.2259, 7.2258, 7.2256, 7.2263, 7.2278, 7.2279, 7.2294, 7.2292, 7.229, 7.2288, 7.2286, 7.2302, 7.23, 7.2306, 7.2304, 7.231, 7.2309, 7.2309, 7.2315, 7.2321, 7.2331, 7.2337, 7.2342, 7.2357, 7.2355, 7.2352, 7.2359, 7.2366, 7.2363, 7.236, 7.2357, 7.2365, 7.2372, 7.2361, 7.236, 7.2367, 7.2365, 7.2362, 7.2359, 7.2358, 7.2356, 7.2356, 7.2364, 7.2372, 7.2369, 7.2367, 7.2367, 7.2375, 7.2371, 7.2368, 7.2357, 7.2355, 7.2353, 7.2344, 7.2341, 7.2339, 7.2337, 7.2335, 7.2332, 7.234, 7.2337, 7.2335, 7.2334, 7.2332, 7.2333, 7.2348, 7.2346, 7.2345, 7.2336, 7.2334, 7.2332, 7.2348, 7.2345, 7.2343, 7.2341, 7.2339, 7.2355, 7.2354, 7.2352, 7.2349, 7.2347, 7.2346, 7.2343, 7.2341, 7.2339, 7.2336, 7.2333, 7.234, 7.2337, 7.2344, 7.2342, 7.2349, 7.2346, 7.2343, 7.235, 7.2357, 7.2364, 7.2362, 7.2359, 7.2356, 7.2353, 7.235, 7.2348, 7.2349, 7.2346, 7.2343, 7.2342, 7.234, 7.234, 7.2347, 7.2353, 7.235, 7.2348, 7.2346, 7.2343, 7.2341, 7.2339, 7.2337, 7.2343, 7.2345, 7.2335, 7.2349, 7.2347, 7.2353, 7.235, 7.2347, 7.2346, 7.2343, 7.234, 7.2339, 7.2328, 7.2317, 7.2323, 7.2321, 7.2319, 7.2316, 7.2322, 7.2328, 7.2319, 7.2309, 7.2306, 7.2304, 7.2302, 7.2299, 7.2297, 7.2295, 7.2293, 7.2291, 7.2289, 7.2288, 7.2287, 7.2285, 7.2291, 7.2288, 7.2285, 7.2284, 7.2281, 7.2279, 7.2278, 7.2285, 7.2282, 7.2281, 7.2288, 7.2286, 7.2293, 7.229, 7.2289, 7.2287, 7.2294, 7.2293, 7.229, 7.2288, 7.2286, 7.2284, 7.229, 7.2287, 7.2284, 7.2274, 7.2272, 7.2269, 7.226, 7.2251, 7.2249, 7.2239, 7.2245, 7.2248, 7.2256, 7.2263, 7.2267, 7.2265, 7.2262, 7.2259, 7.2265, 7.2263, 7.226, 7.2266, 7.2263, 7.226, 7.2257, 7.2263, 7.2269, 7.2267, 7.2266, 7.2264, 7.227, 7.2275, 7.2272, 7.2269, 7.2275, 7.2272, 7.227, 7.2267, 7.2264, 7.2261, 7.2259, 7.2257, 7.2255, 7.2253, 7.225, 7.2248, 7.2247, 7.2245, 7.2242, 7.2241, 7.2239, 7.223, 7.222, 7.222, 7.2219, 7.2218, 7.2226, 7.2224, 7.2222, 7.2212, 7.2209, 7.2214, 7.2211, 7.2202, 7.2208, 7.2206, 7.2204, 7.2202, 7.2199, 7.2197, 7.2203, 7.2209, 7.2206, 7.2204, 7.2202, 7.2201, 7.22, 7.2191, 7.2189, 7.2187, 7.2184, 7.2191, 7.2188, 7.2186, 7.2202, 7.2201, 7.2208, 7.2208, 7.2206, 7.2204, 7.2202, 7.2199, 7.2196, 7.2193, 7.2191, 7.2188, 7.2186, 7.2184, 7.2183, 7.2181, 7.2187, 7.2185, 7.2185, 7.2177, 7.2175, 7.2181, 7.2179, 7.2178, 7.2178, 7.2176, 7.2182, 7.2188, 7.2194, 7.2192, 7.2192, 7.219, 7.2196, 7.2194, 7.2193, 7.2191, 7.2189, 7.2187, 7.2185, 7.2184, 7.219, 7.2187, 7.2185, 7.2191, 7.2197, 7.2194, 7.22, 7.2198, 7.2204, 7.221, 7.2207, 7.2205, 7.2202, 7.2199, 7.2196, 7.2195, 7.2201, 7.2208, 7.2207, 7.2204, 7.2202, 7.22, 7.22, 7.2198, 7.2195, 7.2192, 7.2192, 7.2198, 7.2197, 7.2203, 7.2201, 7.2199, 7.2197, 7.2195, 7.2195, 7.2193, 7.2199, 7.2197, 7.2196, 7.2193, 7.2193, 7.2193, 7.2191, 7.2189, 7.2187, 7.219, 7.2187, 7.2186, 7.2192, 7.2189, 7.2188, 7.2187, 7.2184, 7.2182, 7.2179, 7.2177, 7.2175, 7.2173, 7.2172, 7.2178, 7.2175, 7.2172, 7.217, 7.2167, 7.2173, 7.2173, 7.2179, 7.2176, 7.2181, 7.218, 7.2178, 7.2183, 7.2181, 7.2179, 7.2192, 7.2198, 7.2197, 7.2195, 7.2194, 7.22, 7.2206, 7.2204, 7.2203, 7.2202, 7.2208, 7.2208, 7.2205, 7.2204, 7.221, 7.2216, 7.2215, 7.2222, 7.222, 7.2218, 7.2218, 7.2216, 7.2223, 7.223, 7.2236, 7.2235, 7.2233, 7.223, 7.2228, 7.2233, 7.2231, 7.2228, 7.2234, 7.2231, 7.2228, 7.2225, 7.2223, 7.2221, 7.2219, 7.2216, 7.2214, 7.222, 7.2217, 7.2223, 7.2229, 7.2226, 7.2223, 7.2221, 7.2219, 7.2217, 7.2217, 7.2216, 7.2214, 7.2212, 7.2218, 7.2216, 7.2216, 7.2232, 7.2238, 7.2237, 7.2235, 7.2233, 7.223, 7.2229, 7.2235, 7.2232, 7.2229, 7.2227, 7.2225, 7.2223, 7.2221, 7.2219, 7.2225, 7.2224, 7.2222, 7.2228, 7.2225, 7.2222, 7.222, 7.2217, 7.2215, 7.2221, 7.2219, 7.2217, 7.2215, 7.2214, 7.2212, 7.2209, 7.2206, 7.2205, 7.2203, 7.2209, 7.2206, 7.2221, 7.2227, 7.2233, 7.223, 7.2227, 7.2226, 7.2225, 7.2225, 7.2222, 7.222, 7.2218, 7.2224, 7.2221, 7.222, 7.2218, 7.2216, 7.2213, 7.221, 7.2207, 7.2205, 7.2204, 7.2203, 7.2202, 7.22, 7.2198, 7.2196, 7.2194, 7.2191, 7.2189, 7.2195, 7.2194, 7.22, 7.2206, 7.2204, 7.221, 7.2208, 7.2206, 7.2213, 7.2219, 7.2242, 7.2248, 7.2246, 7.2243, 7.224, 7.224, 7.2238, 7.2236, 7.2233, 7.2239, 7.2236, 7.2242, 7.2241, 7.224, 7.2238, 7.2236, 7.2235, 7.2234, 7.224, 7.2239, 7.2237, 7.2234, 7.224, 7.2239, 7.2238, 7.2244, 7.2243, 7.224, 7.2241, 7.2247, 7.2245, 7.2243, 7.2241, 7.2238, 7.2237, 7.2235, 7.2233, 7.2231, 7.2229, 7.2226, 7.2224, 7.2221, 7.2218, 7.2216, 7.2214, 7.2212, 7.221, 7.2208, 7.2205, 7.2202, 7.22, 7.2198, 7.2204, 7.2201, 7.2215, 7.2221, 7.2218, 7.2216, 7.2213, 7.2219, 7.2225, 7.223, 7.2228, 7.2225, 7.2222, 7.2219, 7.2216, 7.2213, 7.2218, 7.2215, 7.2212, 7.221, 7.222, 7.2225, 7.2223, 7.2222, 7.2219, 7.2225, 7.2233, 7.2231, 7.2237, 7.2243, 7.2241, 7.2238, 7.2252, 7.2258, 7.2263, 7.2261, 7.2259, 7.2256, 7.2254, 7.2259, 7.2265, 7.2262, 7.2276, 7.2281, 7.2279, 7.2276, 7.2273, 7.227, 7.2268, 7.2265, 7.2262, 7.2259, 7.2265, 7.2262, 7.226, 7.2257, 7.2254, 7.2252, 7.2258, 7.2263, 7.2262, 7.226, 7.2251, 7.2248, 7.2253, 7.225, 7.2248, 7.2246, 7.2243, 7.2249, 7.2247, 7.2244, 7.2242, 7.2248, 7.2246, 7.2244, 7.225, 7.2249, 7.2248, 7.2245, 7.2244, 7.2244, 7.2243, 7.2241, 7.2239, 7.2245, 7.2243, 7.2241, 7.2247, 7.2252, 7.2249, 7.2247, 7.2245, 7.2243, 7.2241, 7.2247, 7.2245, 7.2243, 7.224, 7.2238, 7.2236, 7.2233, 7.2238, 7.2237, 7.2243, 7.2249, 7.2246, 7.2252, 7.2258, 7.2257, 7.2255, 7.227, 7.2268, 7.2265, 7.2262, 7.226, 7.2266, 7.2256, 7.2254, 7.2253, 7.2251, 7.2249, 7.2246, 7.2251, 7.228, 7.2286, 7.229, 7.2288, 7.228, 7.2278, 7.2275, 7.2272, 7.2269, 7.2283, 7.2284, 7.2308, 7.2306, 7.2311, 7.2308, 7.2314, 7.2312, 7.2309, 7.2314, 7.2319, 7.2324, 7.2322, 7.2328, 7.2333, 7.2338, 7.2343, 7.2341, 7.2339, 7.2337, 7.2335, 7.2344, 7.2341, 7.2339, 7.2337, 7.2338, 7.233, 7.2327, 7.2326, 7.2324, 7.2321, 7.2319, 7.2324, 7.2321, 7.2319, 7.2316, 7.2314, 7.2312, 7.2309, 7.2307, 7.2305, 7.2303, 7.2301, 7.2302, 7.23, 7.2297, 7.2294, 7.2291, 7.229, 7.2289, 7.2299, 7.2315, 7.2324, 7.233, 7.2328, 7.2325, 7.2322, 7.232, 7.2318, 7.2315, 7.2313, 7.2311, 7.2309, 7.2308, 7.2322, 7.2319, 7.2317, 7.2314, 7.2312, 7.2318, 7.2317, 7.2315, 7.2313, 7.231, 7.2307, 7.2306, 7.2303, 7.2301, 7.2307, 7.2314, 7.232, 7.2327, 7.2325, 7.233, 7.2329, 7.2326, 7.2336, 7.2334, 7.2331, 7.233, 7.2335, 7.234, 7.2339, 7.2337, 7.2336, 7.2333, 7.2333, 7.234, 7.2338, 7.2336, 7.2333, 7.2332, 7.2332, 7.2329, 7.2326, 7.2324, 7.2323, 7.2314, 7.232, 7.2318, 7.2316, 7.2321, 7.2318, 7.2315, 7.2313, 7.2322, 7.233, 7.2329, 7.233, 7.2338, 7.2336, 7.2345, 7.2344, 7.2349, 7.2354, 7.236]}
rtt5_3_7 = {'192.168.122.110': [5.7418, 5.5912, 5.7623, 5.8136, 6.8142, 5.9493, 6.7647, 5.6145, 7.7074, 10.9298, 7.6172, 5.9526, 7.2, 6.5827, 5.5602, 5.8513, 5.81, 6.8536, 6.0802, 17.602, 6.7866, 7.7755, 11.2736, 5.4832, 11.8182, 5.9073, 6.7189, 5.3635, 7.2784, 5.379, 5.2912, 11.4913, 11.5299, 10.8726, 5.9435, 5.8331, 5.3208, 5.4748, 11.6992, 6.9065, 5.5239, 5.7344, 11.2438, 18.1613, 5.6195, 12.1634, 6.2578, 22.3002, 5.311, 7.0944, 7.5758, 6.7163, 5.4159, 11.0042, 11.4937, 5.4042, 5.9385, 5.8849, 11.8179, 11.539, 7.1597, 5.379, 7.5817, 5.2736, 16.443, 7.0481, 5.4076, 5.45, 6.8381, 6.7081, 12.0151, 7.3781, 5.9516, 5.8839, 8.1282, 5.4452, 13.047, 5.3794, 5.6658, 12.0046, 7.4153, 6.7677, 6.2497, 10.8204, 5.4839, 6.7205, 5.7104, 5.5275, 5.2724, 5.8911, 5.3215, 6.9821, 8.559, 5.7766, 6.6798, 5.7213, 6.0017, 6.0022, 5.6901, 14.169, 7.2641, 5.5411, 11.831, 6.7291, 5.8498, 6.9916, 5.5454, 11.106, 7.19, 7.1571, 6.2933, 6.6957, 11.1473, 6.0964, 5.8696, 6.9008, 7.736, 5.4917, 11.9805, 5.4231, 5.5256, 5.373, 5.765, 5.7654, 5.4505, 10.8511, 5.6624, 5.4431, 7.2479, 11.4362, 5.4991, 5.6171, 11.3196, 5.8417, 5.393, 6.3946, 11.2491, 5.337, 5.415, 5.2719, 9.2359, 6.1848, 5.9154, 17.5953, 5.4929, 7.4434, 8.6834, 11.2009, 6.5482, 0.9754, 11.9412, 5.7795, 5.7061, 7.1058, 11.807, 12.6138, 5.3539, 5.2118, 5.8668, 8.0407, 5.7375, 5.8603, 12.6426, 6.2943, 7.7164, 10.8011, 11.2612, 11.3089, 5.383, 11.3721, 30.2, 5.708, 6.5193, 5.8839, 5.7106, 6.3088, 5.4991, 5.661, 5.7478, 10.6087, 6.9911, 6.8479, 5.9617, 5.7516, 5.3968, 5.5974, 6.8388, 6.3548, 21.2278, 5.6105, 7.062, 5.8208, 17.2422, 7.6184, 10.9956, 6.9187, 11.4303, 5.8017, 5.2738, 5.6026, 5.6942, 5.5709, 5.7378, 5.8072, 10.5624, 11.3566, 11.1203, 6.2106, 6.8407, 5.3704, 5.4088, 6.5238, 6.489, 8.3065, 7.0024, 1.0071, 10.8268, 5.4884, 5.5254, 8.5967, 11.0495, 11.0748, 5.6016, 5.5714, 5.9211, 5.6129, 6.6261, 6.8102, 6.5825, 17.5495, 5.7769, 5.6877, 11.132, 5.7285, 16.7601, 7.4415, 5.6131, 5.522, 7.7443, 5.5673, 6.1178, 11.0009, 10.5436, 5.7201, 7.4151, 5.5258, 5.5959, 7.2384, 5.6751, 16.2807, 11.4007, 5.3964, 6.4242, 7.3049, 5.4786, 6.6326, 7.1919, 5.5275, 6.1519, 6.6049, 6.0365, 6.0158, 7.045, 5.6663, 1.8182, 7.0906, 7.0586, 5.3859, 11.1737, 5.4119, 5.5752, 6.0337, 5.7766, 5.4593, 30.8173, 6.4254, 7.3693, 5.6705, 0.6154, 7.3366, 10.9227, 7.2227, 6.6149, 16.0146, 11.1823, 11.364, 5.4898, 7.0698, 5.7142, 6.3961, 11.4803, 5.4266, 5.7242, 5.4638, 5.9576, 7.7, 0.8557, 11.0607, 5.6114, 7.1723, 11.4491, 10.8805, 5.8744, 5.2636, 7.0059, 6.7978, 7.0403, 11.5914, 6.3066, 6.6798, 6.6686, 7.2031, 6.8548, 10.7169, 5.5342, 6.0618, 10.8116, 5.5482, 6.6886, 5.5013, 5.9843, 12.1019, 5.7216, 11.1966, 5.4545, 6.2807, 22.9719, 6.4881, 5.6856, 5.5254, 7.175, 5.6057, 8.5371, 5.9128, 5.4801, 11.6374, 6.0608, 1.8256, 5.4958, 12.4965, 5.7228, 5.5664, 10.494, 5.6648, 6.3374, 12.0685, 6.4294, 5.481, 7.0255, 5.7628, 5.5921, 5.5776, 7.1738, 11.4613, 6.0091, 12.0089, 5.4598, 10.2985, 6.8865, 11.5132, 5.981, 7.174, 7.3063, 5.5573, 5.8064, 5.4767, 2.3754, 1.3101, 6.8402, 6.8583, 5.3627, 9.0668], '192.168.122.116': [6.216, 5.6813, 6.1519, 5.6264, 16.3548, 6.8312, 6.9361, 5.4777, 11.0321, 5.7559, 11.9383, 5.8777, 5.5287, 5.2731, 6.753, 6.1119, 7.2286, 7.0581, 16.649, 5.8382, 5.5168, 10.9491, 5.4035, 5.4214, 5.5687, 7.6652, 11.0776, 6.8538, 11.0886, 5.8978, 6.3112, 6.3014, 5.4126, 6.2237, 10.5853, 5.919, 10.3533, 10.9162, 11.7607, 6.0871, 6.8052, 11.5182, 6.104, 5.722, 5.5659, 6.7904, 11.1268, 5.3473, 5.3897, 6.5091, 5.7421, 7.0274, 11.3978, 6.0103, 6.1162, 6.9284, 5.7847, 5.981, 5.4307, 12.2597, 7.1595, 5.5134, 5.9595, 10.488, 10.9036, 10.9611, 5.3332, 7.4203, 6.2861, 5.811, 6.2077, 7.1263, 6.2337, 5.729, 5.9085, 5.4502, 6.1448, 7.0486, 5.5673, 11.4028, 6.4509, 6.2296, 5.6634, 5.4302, 5.5616, 5.4994, 6.3832, 6.0358, 10.761, 5.4619, 10.9484, 5.6589, 11.3826, 11.3394, 6.8953, 5.7318, 5.6829, 5.1816, 5.3425, 5.4991, 6.5563, 6.0608, 5.5804, 5.7199, 10.4501, 10.9031, 5.6281, 6.2897, 6.4485, 6.6605, 5.7552, 5.5416, 5.7631, 40.4885, 5.9803, 6.7978, 6.8071, 22.315, 5.409, 5.9483, 6.8612, 5.9891, 6.7644, 6.783, 6.3529, 6.5448, 5.4414, 5.2922, 11.3931, 5.6753, 6.0577, 5.3864, 10.9446, 5.4319, 6.6347, 5.4369, 5.9743, 5.6903, 5.7526, 5.882, 5.8124, 5.8129, 6.7451, 5.3389, 7.2832, 5.6095, 6.9585, 6.3167, 5.9888, 0.9103, 11.1032, 11.3683, 6.3043, 6.861, 12.0127, 11.9112, 12.0702, 5.9018, 11.3966, 6.2799, 17.1914, 5.666, 21.8124, 11.2901, 5.7576, 5.549, 5.6279, 7.3855, 5.3768, 6.4294, 5.532, 5.9936, 6.3674, 11.2593, 5.5506, 11.112, 6.8645, 6.7275, 6.4547, 5.7244, 11.5461, 5.5125, 17.1847, 5.7936, 5.8708, 11.389, 5.5456, 5.4336, 10.8123, 7.2916, 6.7711, 5.8489, 6.2656, 16.5453, 5.7313, 7.0677, 5.6717, 10.9613, 5.7576, 11.2114, 6.4046, 6.5231, 6.2513, 11.9674, 11.0407, 11.3118, 16.5284, 6.0081, 6.4995, 6.4263, 5.2841, 6.3827, 5.3813, 11.0033, 22.4736, 11.8887, 11.2886, 5.4426, 5.939, 5.4901, 5.8551, 5.6243, 6.3825, 5.6431, 5.4741, 6.6059, 5.7518, 11.3318, 11.1015, 5.7535, 6.0043, 5.8279, 10.7601, 5.4657, 5.975, 5.6672, 5.5754, 6.8443, 5.7919, 5.625, 5.7113, 11.1432, 6.4065, 11.0292, 8.5962, 6.35, 6.273, 11.7998, 6.0387, 5.6286, 11.1685, 5.6834, 6.4235, 6.8674, 6.4013, 5.779, 5.394, 10.9668, 12.3765, 16.8364, 5.3957, 17.5536, 6.0606, 6.0425, 1.0397, 6.6884, 5.5888, 6.6731, 5.5988, 5.5385, 5.3682, 11.4405, 17.4673, 6.5899, 5.5494, 5.343, 6.8753, 5.6157, 16.3419, 5.7576, 6.2788, 6.4104, 6.1543, 5.4126, 5.7204, 11.193, 6.1748, 6.18, 5.7056, 5.9068, 11.5561, 10.8149, 6.3784, 7.0195, 11.873, 6.8901, 6.2952, 5.6469, 6.1886, 11.8244, 6.0999, 5.3852, 6.7391, 6.0637, 6.8183, 7.3712, 5.6927, 6.2187, 10.8292, 11.204, 5.9144, 5.882, 6.1252, 6.0973, 6.0225, 5.4183, 6.0189, 5.3015, 6.4974, 10.9811, 10.8593, 6.299, 7.22, 11.1675, 6.0983, 5.362, 5.2299, 5.9547, 11.8368, 7.472, 5.4321, 19.0353, 5.8923, 5.403, 5.6219, 12.5532, 11.0545, 6.4905, 6.2957, 11.3742, 6.3882, 10.9184, 5.6689, 5.3051, 11.2586, 7.0601, 6.3927, 16.7482, 6.6493, 6.4235, 6.4657, 12.6224, 10.6783, 5.775, 16.8424, 6.0129, 10.9315, 5.4367, 5.9118, 11.7278, 10.8495, 12.0196, 6.1953, 6.1107, 7.3748, 22.7888, 1.6785, 0.5362, 5.3549, 6.4311, 5.5668, 11.9424], '192.168.122.114': [10.9031, 11.5664, 10.9518, 5.6214, 5.8041, 5.5125, 6.0971, 5.4414, 10.8771, 11.4815, 5.2669, 10.6688, 6.3779, 6.7213, 11.7977, 6.6776, 6.1665, 5.6741, 10.9823, 1.5109, 5.5058, 5.6579, 6.9532, 10.9599, 7.6034, 6.9201, 6.6569, 11.5786, 5.5001, 12.6204, 11.0672, 11.4577, 6.7251, 5.9998, 5.6782, 5.5809, 5.3005, 10.8206, 5.2981, 17.0293, 11.1237, 5.7518, 5.6415, 6.2604, 5.6021, 5.4519, 5.5871, 5.6274, 6.6001, 6.8409, 6.969, 5.8279, 11.2758, 11.9972, 6.0947, 5.3663, 5.4011, 11.8561, 5.6002, 5.8088, 10.7033, 17.2269, 5.3499, 5.3923, 5.4638, 5.8937, 5.4607, 17.6828, 5.8377, 11.3044, 5.6679, 11.1251, 10.9928, 26.8269, 6.7902, 5.4581, 6.134, 11.6513, 5.537, 6.2802, 6.3729, 5.8947, 6.2342, 5.8503, 5.7216, 11.2495, 5.7788, 6.4244, 6.4802, 10.7617, 10.8581, 5.2049, 11.2762, 12.8372, 5.4688, 5.8925, 5.9094, 6.3875, 5.78, 5.6815, 7.9737, 6.5231, 8.1785, 6.3789, 5.3246, 5.748, 5.4901, 6.3441, 5.8601, 6.7606, 16.9299, 15.8, 5.3675, 6.767, 11.2867, 7.1023, 5.614, 10.8783, 5.4615, 5.482, 5.7585, 5.2743, 6.1584, 10.932, 10.864, 10.905, 6.1932, 5.3847, 5.5637, 5.8703, 6.0258, 10.7327, 5.5437, 10.9737, 6.2551, 5.5256, 6.8855, 5.9114, 5.9979, 5.6314, 5.5771, 5.3258, 5.8725, 10.6068, 7.4475, 6.7189, 28.0523, 5.2152, 5.7058, 6.5403, 6.006, 5.6176, 5.3415, 6.371, 6.8452, 11.6007, 6.0647, 6.0825, 6.3488, 5.8033, 5.636, 12.0718, 5.5845, 11.3583, 5.6703, 5.6295, 11.1306, 6.1595, 6.3851, 10.9184, 6.0976, 5.6672, 10.4206, 5.3046, 5.4238, 6.3941, 5.4419, 6.1512, 6.3381, 5.7688, 7.8802, 6.0396, 6.4504, 11.5125, 25.9848, 5.9292, 5.9831, 6.2494, 5.852, 7.3745, 11.3456, 11.7784, 6.5598, 17.2217, 5.2783, 5.9762, 10.8957, 10.9987, 10.4444, 5.5993, 11.2004, 5.8062, 6.1073, 7.0877, 10.8173, 11.3819, 17.0045, 11.4543, 11.1463, 6.525, 5.8472, 11.1196, 5.5635, 6.2337, 5.6171, 5.5089, 7.1239, 5.8186, 5.9078, 0.7417, 11.1837, 7.1104, 11.4551, 10.7677, 6.0511, 8.0519, 5.8353, 5.5656, 6.4692, 6.6185, 6.16, 5.2042, 5.8401, 11.0586, 5.626, 6.8784, 6.2971, 5.4672, 6.7306, 7.1175, 5.8334, 11.3616, 5.7595, 6.6719, 6.6531, 11.1542, 6.4104, 6.196, 6.1226, 6.0155, 6.7103, 11.2324, 10.4861, 5.4445, 6.505, 6.4635, 5.8198, 5.6329, 7.0586, 11.8961, 11.5089, 5.9555, 5.7678, 5.5344, 1.435, 6.254, 13.2563, 5.5842, 10.9031, 6.1932, 6.2408, 5.9581, 5.6884, 6.6209, 10.5026, 5.7805, 6.9482, 6.1011, 5.7356, 12.8975, 6.2904, 6.2952, 6.3379, 10.6854, 5.9757, 10.9677, 5.5068, 1.3182, 6.4189, 10.7729, 5.4607, 5.662, 6.4826, 5.7478, 5.7232, 11.9548, 0.8645, 5.8742, 11.3358, 10.989, 6.0308, 5.306, 5.4579, 10.9606, 6.8755, 12.8193, 5.5733, 11.9109, 5.3751, 7.5331, 6.13, 6.5992, 7.288, 5.4162, 5.3718, 6.8867, 5.3906, 6.223, 22.402, 5.2879, 11.1284, 7.3094, 6.0823, 5.2543, 5.7211, 10.9792, 6.3937, 5.4312, 7.1144, 11.6792, 7.2868, 5.842, 11.7245, 5.5041, 5.6791, 6.5742, 5.4877, 11.2717, 6.4096, 10.8447, 0.849, 10.8883, 10.9553, 5.2209, 5.8749, 11.0869, 5.7111, 11.2472, 5.6298, 11.2059, 6.4101, 6.3767, 5.9397, 6.3961, 12.0356, 11.0033, 10.8898, 11.0526, 11.2648, 6.5708, 10.7749, 7.0539, 5.7871, 5.9421, 6.9363, 6.3424, 1.7903, 0.6416, 10.9346, 11.2748, 11.6773, 12.8179], '192.168.122.113': [5.6868, 5.3084, 6.6319, 5.7895, 5.6329, 6.701, 5.584, 5.5737, 11.6305, 10.8993, 7.103, 6.0372, 5.5537, 6.9289, 13.2542, 5.9576, 5.5223, 5.8372, 6.943, 0.9937, 5.6937, 16.5586, 6.429, 5.5013, 5.6498, 5.8146, 6.1452, 6.3822, 10.9558, 5.3992, 11.4341, 11.5414, 5.8701, 6.1724, 6.351, 5.4796, 10.721, 6.9346, 5.4827, 10.7784, 5.8019, 5.8038, 6.3367, 5.4977, 11.2736, 11.0476, 11.2445, 5.5647, 11.0016, 5.8739, 11.4868, 5.5387, 5.5468, 13.4237, 6.2149, 10.9129, 5.8455, 10.4182, 11.797, 5.8455, 5.4331, 5.481, 5.9214, 5.3482, 11.1296, 5.2755, 6.398, 11.5507, 16.0899, 5.2559, 11.1871, 7.2346, 6.7916, 6.0351, 5.3606, 5.9965, 11.5702, 6.2802, 5.5015, 6.3045, 11.4088, 5.7175, 6.2058, 11.7114, 5.2521, 5.7049, 6.3686, 6.4893, 11.447, 11.0378, 7.6435, 6.2275, 11.2469, 11.1513, 11.404, 7.2887, 6.6838, 10.7729, 16.6698, 5.5549, 5.4896, 5.9648, 5.666, 6.9416, 6.3536, 12.9912, 5.5988, 6.5243, 11.4441, 5.4715, 0.6876, 5.6641, 5.8479, 6.8402, 5.7178, 10.8738, 6.1681, 5.4433, 6.2437, 6.2811, 5.9736, 5.6353, 16.372, 11.0989, 11.075, 6.3913, 6.4514, 5.9984, 6.9621, 6.5203, 11.0066, 6.5782, 6.1083, 11.411, 11.8518, 10.8862, 7.4401, 11.4796, 11.8539, 5.764, 10.7622, 11.2331, 6.5286, 5.4734, 6.5496, 5.8289, 6.4566, 6.2551, 6.2928, 5.6288, 6.4704, 16.0139, 17.1504, 6.9683, 6.0194, 16.4127, 22.0706, 17.4413, 5.9767, 6.3486, 5.8875, 5.6212, 5.9614, 5.409, 6.026, 5.59, 11.3883, 11.4307, 17.3185, 6.5196, 6.2647, 6.3815, 5.8782, 5.4135, 5.969, 6.4347, 11.1444, 10.8371, 5.8584, 11.4081, 5.6071, 16.8617, 10.7272, 10.9575, 6.3682, 5.9404, 11.4443, 10.9978, 5.3387, 6.2351, 5.5625, 5.4166, 5.5871, 6.4223, 10.6349, 6.7322, 6.0689, 5.5628, 5.8703, 5.8117, 5.6996, 11.1265, 6.16, 28.5983, 5.8534, 6.3033, 11.4424, 6.0005, 6.2542, 5.2917, 5.8594, 10.5739, 5.5943, 6.4955, 5.8317, 5.7843, 10.9928, 5.403, 7.0593, 0.664, 5.8265, 5.4927, 6.8812, 6.4151, 5.4908, 11.4543, 16.4399, 5.8324, 5.7278, 6.6757, 6.0663, 5.3673, 11.1845, 6.0689, 5.4877, 11.8833, 5.4417, 6.8815, 5.7786, 6.1247, 5.8258, 11.4627, 11.3444, 6.5451, 6.9764, 5.434, 5.4743, 5.8079, 5.5077, 10.7801, 0.8874, 6.4361, 5.296, 6.6998, 5.3372, 10.9968, 6.5618, 6.5463, 6.32, 6.7945, 5.8818, 10.7825, 7.225, 6.1839, 12.1679, 12.4755, 6.6805, 10.9401, 5.9199, 5.7349, 6.592, 12.7192, 5.362, 5.4224, 6.0389, 5.4321, 7.5016, 5.3635, 5.6696, 5.4545, 10.746, 11.5001, 5.3065, 5.3437, 5.2726, 5.9898, 5.4126, 1.1477, 5.3134, 5.4986, 5.841, 11.8852, 5.5194, 10.9091, 5.5075, 18.0783, 0.6781, 5.4424, 5.429, 5.7859, 6.1865, 5.388, 6.8626, 6.3474, 6.9685, 6.3252, 10.7238, 6.4156, 6.0661, 6.6092, 6.8543, 16.5091, 6.2206, 17.3028, 6.1226, 5.4913, 5.517, 5.5153, 6.4008, 5.3706, 6.7642, 6.1557, 11.1396, 5.8224, 6.3164, 5.4116, 5.2605, 10.6194, 5.9302, 7.6964, 7.6387, 11.5385, 5.5261, 6.1085, 6.6998, 11.1411, 5.1959, 13.9742, 10.9434, 11.3432, 7.7698, 6.4168, 6.0475, 5.8963, 6.7217, 5.5571, 11.2929, 15.9118, 11.9593, 6.4049, 11.0693, 6.366, 12.1486, 5.661, 6.2129, 6.2041, 16.2616, 6.259, 6.2733, 6.8326, 11.3366, 6.7275, 11.2216, 11.5855, 6.4054, 11.5452, 1.961, 0.6692, 5.4557, 11.1191, 6.0055, 5.7545], '192.168.122.112': [11.1682, 5.5051, 11.4298, 5.553, 5.3208, 5.7635, 5.3575, 5.6124, 6.5689, 5.6558, 7.1027, 11.0595, 5.4808, 10.8654, 6.777, 6.0601, 5.8117, 11.344, 6.15, 3.5248, 5.4963, 6.6192, 5.796, 10.8788, 5.796, 8.0986, 6.8352, 10.4513, 6.1119, 5.9981, 16.9849, 5.8117, 5.7292, 6.3896, 6.0718, 11.1439, 5.4517, 5.399, 6.0773, 5.8272, 5.9524, 17.5586, 5.7409, 5.5585, 11.3754, 5.5602, 5.3959, 5.5535, 6.3982, 6.0024, 6.0334, 6.2044, 6.2125, 12.2447, 6.8073, 6.9389, 11.2379, 5.8699, 5.8556, 5.3654, 11.1525, 5.3568, 5.3391, 10.3784, 5.9617, 11.0059, 6.5506, 12.4283, 5.7082, 10.8709, 5.4467, 6.9239, 6.4628, 11.965, 6.1052, 6.0277, 10.783, 10.9708, 5.6398, 6.9468, 6.2411, 6.2397, 5.8513, 5.7597, 5.3968, 5.3892, 10.8407, 10.8173, 11.1113, 10.9417, 11.0292, 6.1307, 12.8794, 5.7764, 6.398, 5.7416, 6.4571, 6.3097, 5.2013, 5.4674, 36.0093, 6.3105, 6.7997, 5.5382, 5.8284, 6.4924, 5.4941, 7.2474, 5.6167, 7.2684, 0.6182, 11.3413, 6.0015, 6.825, 6.1238, 6.2609, 1.5457, 11.1399, 5.3256, 6.4855, 23.1094, 10.7505, 10.8647, 11.7874, 6.0277, 5.7476, 5.2068, 10.9172, 5.722, 10.9782, 5.63, 6.7875, 6.6931, 5.7018, 5.358, 6.541, 5.5387, 11.3034, 6.1376, 5.5027, 10.7942, 6.875, 5.81, 10.7367, 5.698, 22.9304, 5.5716, 6.0711, 5.959, 6.1214, 11.2922, 11.6313, 5.6851, 6.5541, 5.7487, 6.9716, 5.6562, 5.4462, 5.8525, 7.1845, 17.0591, 17.4079, 6.0673, 6.5892, 7.0977, 5.7917, 12.567, 5.6858, 5.8799, 5.9283, 16.4685, 6.3598, 11.0219, 5.7397, 5.7948, 5.9712, 10.8855, 10.9458, 6.4845, 5.6837, 6.9287, 10.9091, 5.9965, 10.874, 11.0719, 7.6275, 5.2354, 6.5987, 5.2307, 5.2271, 11.375, 5.3234, 6.5041, 11.0083, 22.3899, 7.1034, 10.4954, 10.9792, 5.378, 11.843, 10.6583, 6.33, 5.6281, 6.011, 5.8382, 5.517, 11.8434, 6.9897, 5.7819, 10.8426, 0.8812, 6.7525, 11.2917, 6.1157, 5.6031, 11.3926, 11.23, 5.6157, 6.9525, 0.7479, 7.2491, 6.8934, 6.1638, 11.3225, 10.9286, 6.2668, 5.6481, 6.0792, 6.3179, 5.5406, 12.126, 6.2068, 11.9627, 11.0567, 11.3211, 5.6007, 6.3689, 6.9034, 7.1576, 5.2335, 5.7237, 6.3963, 11.4725, 16.9244, 10.5932, 11.8115, 5.6899, 5.877, 5.6977, 5.748, 0.8471, 6.4647, 5.271, 5.7914, 7.2386, 5.7261, 10.7887, 5.7318, 6.1831, 11.9271, 5.6839, 6.0198, 5.6956, 6.0451, 6.2463, 6.9788, 6.7651, 5.4085, 7.5438, 16.7279, 5.3241, 5.4219, 5.2664, 5.904, 5.9352, 5.4774, 6.6934, 10.987, 5.7256, 17.5037, 6.1684, 6.4526, 5.9984, 11.0357, 7.3524, 6.3622, 6.726, 2.1064, 5.6715, 5.8606, 5.3957, 23.7916, 5.7654, 5.8727, 5.2168, 5.6908, 0.7579, 11.2338, 6.7272, 10.9372, 6.7909, 5.9395, 6.2962, 10.8454, 5.3694, 5.6026, 5.4162, 6.5119, 11.3738, 5.5714, 5.4266, 5.4798, 6.9532, 5.5587, 6.608, 11.0195, 11.0242, 5.7189, 6.464, 6.7937, 10.8125, 7.7326, 5.9063, 6.8712, 5.5048, 5.6436, 5.9006, 5.3337, 7.8127, 6.8052, 18.2049, 6.9659, 6.1638, 5.4469, 5.6505, 22.2657, 6.0112, 5.5175, 5.7909, 10.6876, 6.4316, 10.9839, 7.4825, 5.9266, 7.0181, 6.8278, 10.7493, 5.4255, 5.9695, 10.8473, 11.0326, 11.3068, 11.9221, 5.7051, 6.4399, 6.3639, 11.1055, 10.8392, 5.3728, 5.7194, 6.7816, 5.8725, 5.6951, 5.5377, 5.6014, 12.5191, 2.1255, 0.6893, 5.3668, 5.8596, 6.175, 6.5114], '192.168.122.111': [6.6345, 6.1345, 6.3729, 7.261, 5.2731, 11.1215, 11.27, 5.594, 11.4608, 27.3635, 6.4099, 5.4297, 6.5155, 6.4731, 5.5912, 6.5651, 5.9199, 18.3983, 6.3841, 2.8131, 11.1773, 5.9786, 16.9294, 11.2877, 6.5246, 11.796, 5.3301, 5.7089, 5.9712, 23.0181, 11.096, 6.3722, 17.1824, 6.4294, 11.0197, 11.1296, 5.3082, 10.4997, 5.2042, 11.1148, 5.3852, 5.9419, 7.3678, 5.363, 11.3537, 5.9631, 5.2211, 5.5039, 6.3953, 5.3444, 12.0678, 6.7139, 6.1913, 5.9469, 5.3763, 10.8764, 11.2388, 6.6051, 6.0954, 16.7813, 5.9476, 5.2891, 6.5145, 10.4053, 5.492, 5.8062, 5.5833, 5.6622, 17.4685, 11.0044, 5.4612, 11.4181, 24.358, 10.9622, 11.3754, 5.6493, 6.15, 5.6856, 6.4421, 5.6918, 11.9996, 5.9552, 5.4173, 5.8146, 5.8181, 6.2189, 17.3972, 10.8864, 11.1234, 7.5855, 6.5067, 5.5256, 6.5122, 6.0201, 5.425, 12.0051, 5.8804, 5.3918, 5.8558, 5.8122, 5.9597, 5.4164, 19.8553, 6.2449, 6.2222, 6.8593, 10.7393, 6.0139, 6.4764, 6.839, 1.1322, 11.308, 6.7642, 11.1268, 6.0582, 10.9072, 6.6335, 6.4712, 12.1634, 5.9755, 5.7786, 21.5223, 5.2485, 6.9849, 6.072, 10.9022, 5.2955, 5.9011, 5.5103, 5.6365, 6.8648, 11.2667, 5.8486, 11.4312, 5.3663, 5.8577, 6.2287, 8.3051, 5.3303, 5.3377, 5.9204, 5.8939, 6.66, 6.1607, 6.443, 11.1046, 5.7039, 11.138, 6.6156, 10.8523, 11.2746, 11.4753, 10.8488, 5.3558, 6.1738, 11.3163, 5.9955, 5.9049, 11.4999, 6.8879, 6.0723, 7.0066, 5.7096, 11.641, 5.5873, 5.7375, 6.7115, 5.6176, 6.8018, 5.585, 5.7802, 5.8568, 10.4933, 5.4286, 16.042, 5.4142, 5.3203, 6.0227, 10.8521, 11.631, 5.631, 5.321, 5.3446, 5.43, 5.9102, 6.8872, 5.5501, 10.9708, 5.4729, 5.4355, 5.1756, 6.1605, 5.8086, 5.7037, 10.8449, 5.9984, 5.2519, 11.0745, 5.918, 5.2462, 5.619, 6.7461, 6.8197, 6.0282, 5.8889, 5.6586, 5.4984, 16.196, 5.8639, 6.4399, 0.7203, 5.8258, 6.4514, 6.0477, 6.566, 5.1823, 11.0316, 17.8201, 5.9121, 0.7136, 11.6415, 11.1032, 5.5616, 10.7911, 5.512, 11.519, 6.2084, 11.3115, 6.5296, 10.2863, 16.0427, 5.2853, 10.9529, 5.8048, 6.1698, 11.4539, 5.4581, 5.3978, 5.9166, 10.735, 5.4994, 6.5103, 11.7834, 10.9813, 10.9751, 6.5234, 11.2023, 11.3914, 11.4379, 5.8112, 0.7119, 5.6162, 6.4113, 5.7056, 10.4713, 6.3665, 11.2405, 5.4541, 11.622, 11.8814, 11.2131, 10.8385, 6.4104, 5.481, 21.9378, 5.6574, 6.8638, 5.4331, 11.2338, 6.3093, 11.2498, 6.4931, 10.7641, 6.3014, 5.2681, 10.7012, 5.6696, 5.9721, 6.1009, 5.6446, 7.2432, 6.4073, 5.4643, 5.2562, 5.765, 6.4545, 12.0897, 1.4639, 5.5518, 5.3215, 5.8801, 5.5707, 7.123, 11.1296, 5.7869, 11.4949, 6.4487, 5.388, 6.8591, 11.8008, 5.7652, 5.2509, 5.4469, 10.9112, 6.0425, 11.2166, 5.4004, 6.2778, 5.7395, 11.5163, 6.9625, 5.594, 6.6011, 6.2408, 6.618, 5.3225, 5.3413, 5.6376, 7.4029, 21.2684, 6.1805, 5.7323, 5.6312, 11.5707, 6.4867, 16.2802, 6.3066, 5.6565, 6.7551, 7.4124, 7.2184, 6.9749, 7.0655, 6.922, 10.9255, 11.4038, 5.3391, 10.7393, 10.8893, 10.8671, 6.8126, 5.7025, 5.3096, 5.2793, 5.6324, 5.3627, 5.4815, 5.769, 12.6433, 6.4793, 5.7907, 7.2279, 5.9752, 5.6522, 11.5063, 6.0449, 6.0046, 5.5757, 5.5163, 5.4588, 5.3062, 7.1051, 11.2276, 11.2698, 11.0755, 5.5482, 1.3607, 0.6292, 5.5237, 5.2774, 5.5358, 5.8711]}
cpu5_3_7 = [19.0, 30.3, 0.4, 1.0, 1.1, 0.6, 1.4, 1.6, 1.1, 1.4, 1.0, 0.2, 0.2, 0.7, 1.7, 0.0, 0.4, 1.4, 2.5, 1.6, 1.5, 4.2, 3.1, 0.6, 0.9, 0.5, 0.2, 0.3, 0.6, 0.5, 1.0, 1.8, 0.5, 1.6, 0.3, 0.4, 0.0, 0.0, 0.8, 1.1, 1.9, 3.1, 0.8, 0.8, 1.6, 1.3, 0.2, 0.6, 0.2, 1.2, 0.8, 0.3, 0.4, 0.5, 0.2, 0.4, 0.7, 1.6, 1.2, 0.1, 0.4, 0.1, 0.1, 1.4, 0.1, 0.6, 0.2, 0.8, 2.2, 0.9, 1.2, 0.9, 1.4, 5.6, 5.2, 0.2, 0.6, 0.6, 0.5, 0.4, 0.2, 0.5, 1.6, 1.2, 0.9, 0.9, 0.2, 1.0, 1.2, 0.6, 0.9, 0.3, 1.0, 0.5, 3.6, 4.1, 0.8, 0.5, 0.2, 0.5, 0.1, 0.5, 0.6, 1.0, 0.7, 1.3, 0.6, 0.6, 0.3, 0.1, 0.1, 0.1, 0.8, 0.8, 0.3, 0.6, 1.0, 1.5, 0.2, 0.2, 0.2, 1.2, 1.4, 0.1, 0.4, 0.2, 0.7, 0.5, 2.0, 3.4, 0.6, 0.8, 1.7, 0.3, 0.3, 0.5, 0.6, 0.5, 1.1, 1.1, 1.2, 0.9, 0.2, 0.4, 0.2, 0.6, 0.6, 2.5, 2.5, 0.8, 0.7, 0.1, 1.8, 2.1, 0.4, 1.5, 1.8, 1.8, 1.7, 0.4, 0.8, 0.5, 2.4, 1.1, 1.0, 1.1, 1.2, 2.4, 2.6, 1.2, 1.8, 1.8, 0.1, 0.2, 0.6, 0.3, 0.1, 4.7, 4.7, 0.4, 0.3, 0.7, 0.7, 1.0, 1.0, 0.8, 0.4, 1.4, 1.1, 1.1, 1.7, 1.0, 0.2, 1.2, 0.8, 1.3, 0.1, 1.0, 0.5, 0.8, 0.5, 0.6, 0.8, 1.2, 1.6, 1.1, 0.1, 1.1, 0.8, 0.7, 0.4, 0.5, 1.2, 0.6, 0.4, 0.1, 0.3, 0.8, 0.7, 0.4, 1.3, 1.2, 0.9, 0.5, 0.7, 0.1, 1.1, 0.3, 0.8, 0.4, 1.4, 1.1, 1.5, 0.6, 0.8, 2.1, 1.4, 1.4, 1.6, 1.7, 1.2, 0.4, 0.4, 1.4, 3.2, 3.7, 0.9, 0.0, 0.5, 0.3, 0.6, 0.5, 0.6, 0.1, 0.1, 0.2, 0.4, 0.0, 0.8, 0.1, 0.3, 0.8, 0.3, 0.4, 6.1, 7.2, 0.2, 0.7, 0.1, 0.1, 1.1, 0.0, 1.4, 0.0, 0.2, 5.6, 5.5, 1.9, 1.7, 1.5, 0.8, 2.1, 2.0, 0.8, 0.4, 2.2, 1.9, 0.3, 0.1, 0.6, 0.8, 4.3, 4.3, 1.4, 1.4, 0.1, 0.2, 1.9, 3.3, 0.7, 0.2, 1.1, 0.4, 0.6, 1.4, 1.5, 1.7, 1.2, 0.5, 1.4, 0.8, 1.7, 0.5, 0.2, 0.5, 0.5, 0.3, 0.7, 0.1, 0.9, 1.5, 0.4, 1.4, 0.4, 0.8, 1.3, 0.6, 1.6, 8.4, 6.4, 5.6, 4.9, 0.5, 0.3, 2.1, 2.4, 2.2, 0.3, 1.1, 2.4, 2.4, 2.7, 1.0, 2.3, 0.6, 3.1, 3.2, 1.1, 0.0, 0.2, 1.4, 3.1, 2.1, 0.0, 0.6, 0.3, 5.1, 3.2, 0.5, 1.4, 0.4, 0.2, 0.7, 1.0, 0.6, 0.5, 0.2, 2.0, 0.3, 0.6, 0.5, 1.1]
off_mec5_3_7 = 242
off_cloud5_3_7 = 264
inward_mec5_3_7 = 180
loc5_3_7 = 763
deadlock5_3_7 = [6]
memory5_3_7 = [0.2175, 0.218, 0.218, 0.2185, 0.2186, 0.2186, 0.2187, 0.2187, 0.2187, 0.2187, 0.2187, 0.2188, 0.2189, 0.2189, 0.2189, 0.219, 0.219, 0.219, 0.219, 0.219, 0.2191, 0.2191, 0.2191, 0.2192, 0.2192, 0.2192, 0.2193, 0.2193, 0.2193, 0.2195, 0.2195, 0.2195, 0.2195, 0.2195, 0.2195, 0.2196, 0.2196, 0.2196, 0.22, 0.2201, 0.2201, 0.2201, 0.2201, 0.2202, 0.2202, 0.2203, 0.2203, 0.2204, 0.2204, 0.2204, 0.2205, 0.2205, 0.2205, 0.2205, 0.2205, 0.2206, 0.2206, 0.2206, 0.2206, 0.2208, 0.2208, 0.2208, 0.2208, 0.2208, 0.2208, 0.2208, 0.2208, 0.2209, 0.2209, 0.2209, 0.2209, 0.2209, 0.221, 0.221, 0.221, 0.2211, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2212, 0.2213, 0.2213, 0.2213, 0.2213, 0.2214, 0.2214, 0.2215, 0.2215, 0.2215, 0.2215, 0.2217, 0.2217, 0.2218, 0.2218, 0.2218, 0.2218, 0.2218, 0.2219, 0.2219, 0.2221, 0.2221, 0.2221, 0.2222, 0.2222, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2223, 0.2224, 0.2224, 0.2224, 0.2225, 0.2225, 0.2225, 0.2225, 0.2225, 0.2225, 0.2227, 0.2228, 0.2229, 0.2229, 0.2229, 0.2229, 0.2229, 0.2229, 0.223, 0.223, 0.223, 0.223, 0.223, 0.223, 0.2231, 0.2231, 0.2232, 0.2232, 0.2232, 0.2232, 0.2232, 0.2232, 0.2234, 0.2234, 0.2235, 0.2235, 0.2235, 0.2235, 0.2235, 0.2235, 0.2236, 0.2236, 0.2236, 0.2236, 0.2236, 0.2236, 0.2237, 0.2237, 0.2238, 0.2238, 0.2238, 0.2238, 0.2238, 0.2238, 0.2238, 0.2238, 0.2239, 0.2239, 0.2239, 0.2239, 0.2239, 0.2239, 0.224, 0.224, 0.224, 0.224, 0.224, 0.224, 0.224, 0.224, 0.224, 0.2241, 0.2242, 0.2243, 0.2243, 0.2243, 0.2245, 0.2245, 0.2245, 0.2245, 0.2247, 0.2247, 0.2248, 0.2248, 0.2248, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.2249, 0.225, 0.225, 0.225, 0.225, 0.225, 0.225, 0.2251, 0.2252, 0.2252, 0.2252, 0.2252, 0.2252, 0.2252, 0.2253, 0.2253, 0.2253, 0.2253, 0.2253, 0.2253, 0.2254, 0.2254, 0.2254, 0.2254, 0.2254, 0.2254, 0.2254, 0.2254, 0.2255, 0.2255, 0.2255, 0.2255, 0.2255, 0.2256, 0.2256, 0.2256, 0.2256, 0.2256, 0.2256, 0.2256, 0.2257, 0.2257, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2258, 0.2259, 0.2259, 0.2259, 0.2259, 0.2259, 0.2259, 0.2259, 0.2259, 0.226, 0.226, 0.226, 0.2262, 0.2263, 0.2263, 0.2263, 0.2263, 0.2263, 0.2263, 0.2263, 0.2264, 0.2265, 0.2265, 0.2265, 0.2265, 0.2265, 0.2265, 0.2265, 0.2265, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2266, 0.2267, 0.2267, 0.2267, 0.2268, 0.2268, 0.2268, 0.2268, 0.2268, 0.2268, 0.2268, 0.2268, 0.2268, 0.2269, 0.227, 0.227, 0.2271, 0.2271, 0.2275, 0.2278, 0.2278, 0.2279, 0.228, 0.228, 0.228, 0.228, 0.228, 0.228, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2281, 0.2282, 0.2282, 0.2282, 0.2282, 0.2282, 0.2283, 0.2283, 0.2283, 0.2283, 0.2283, 0.2283, 0.2283, 0.2283, 0.2285, 0.2285, 0.2285, 0.2285, 0.2286]
task_received5_3_7 = 1269
sent_t5_3_7 = {'124': 471, '125': 396, '126': 402}
cooperate5_3_7 = {'mec': 242, 'cloud': 264}
task_record5_3_7 = {}
outward_mec5_3_7 = 39
offload_check5_3_7 = []
timed_out_tasks5_3_7 = 0
| 20,317.823529
| 321,918
| 0.620924
| 87,268
| 345,403
| 2.457109
| 0.065706
| 0.001213
| 0.001492
| 0.000933
| 0.661521
| 0.323373
| 0.322777
| 0.104609
| 0.104609
| 0.027012
| 0
| 0.710174
| 0.126363
| 345,403
| 17
| 321,919
| 20,317.823529
| 0.000421
| 0
| 0
| 0
| 0
| 0
| 0.00057
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
94c2d3f1c8844f2f91cede88d7e526135be23826
| 95
|
py
|
Python
|
checkerapp/apps.py
|
sahilr05/sitechecker
|
9c5d99109cfe2cbf46eb9f3cb397fc0f3505f039
|
[
"MIT"
] | 2
|
2021-02-21T09:24:54.000Z
|
2021-05-12T18:42:37.000Z
|
checkerapp/apps.py
|
sahilr05/sitechecker
|
9c5d99109cfe2cbf46eb9f3cb397fc0f3505f039
|
[
"MIT"
] | null | null | null |
checkerapp/apps.py
|
sahilr05/sitechecker
|
9c5d99109cfe2cbf46eb9f3cb397fc0f3505f039
|
[
"MIT"
] | null | null | null |
from django.apps import AppConfig
class CheckerappConfig(AppConfig):
name = "checkerapp"
| 15.833333
| 34
| 0.768421
| 10
| 95
| 7.3
| 0.9
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.157895
| 95
| 5
| 35
| 19
| 0.9125
| 0
| 0
| 0
| 0
| 0
| 0.105263
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
94d3831a6017bc91f6221fb11c2e658d06876a1b
| 97
|
py
|
Python
|
orientation/apps.py
|
rahulgrover99/Django-Assignment-JCNU-task
|
5a610a0b0b1a0eccd438aca08bec2f2e1aee7451
|
[
"MIT"
] | null | null | null |
orientation/apps.py
|
rahulgrover99/Django-Assignment-JCNU-task
|
5a610a0b0b1a0eccd438aca08bec2f2e1aee7451
|
[
"MIT"
] | null | null | null |
orientation/apps.py
|
rahulgrover99/Django-Assignment-JCNU-task
|
5a610a0b0b1a0eccd438aca08bec2f2e1aee7451
|
[
"MIT"
] | null | null | null |
from django.apps import AppConfig
class OrientationConfig(AppConfig):
name = 'orientation'
| 16.166667
| 35
| 0.773196
| 10
| 97
| 7.5
| 0.9
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.154639
| 97
| 5
| 36
| 19.4
| 0.914634
| 0
| 0
| 0
| 0
| 0
| 0.113402
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
94dc8b8400fb784f93cde3e0cf01c08e61eb1e33
| 182
|
py
|
Python
|
locationandfeedback/forms.py
|
singh-sushil/minorproject
|
02fe8c1dce41109447d5f394bb37e10cb34d9316
|
[
"MIT"
] | 2
|
2020-12-27T11:28:02.000Z
|
2021-01-04T07:52:38.000Z
|
locationandfeedback/forms.py
|
singh-sushil/minorproject
|
02fe8c1dce41109447d5f394bb37e10cb34d9316
|
[
"MIT"
] | 1
|
2020-12-26T13:36:12.000Z
|
2020-12-26T13:36:12.000Z
|
locationandfeedback/forms.py
|
singh-sushil/minorproject
|
02fe8c1dce41109447d5f394bb37e10cb34d9316
|
[
"MIT"
] | null | null | null |
from django import forms
from .models import Feedback
class FeedbackForm(forms.ModelForm):
class Meta():
model = Feedback
fields = ['feedback_text',]
| 18.2
| 37
| 0.642857
| 19
| 182
| 6.105263
| 0.684211
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.274725
| 182
| 9
| 38
| 20.222222
| 0.878788
| 0
| 0
| 0
| 0
| 0
| 0.075145
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.333333
| 0
| 0.666667
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
a21c20f617b9a99660f5647bb1d341ef720f3d73
| 433
|
py
|
Python
|
bradfield/test_x1_02_roman.py
|
savarin/algorithms
|
4d1f8f2361de12a02f376883f648697562d177ae
|
[
"MIT"
] | 1
|
2020-06-16T23:22:54.000Z
|
2020-06-16T23:22:54.000Z
|
bradfield/test_x1_02_roman.py
|
savarin/algorithms
|
4d1f8f2361de12a02f376883f648697562d177ae
|
[
"MIT"
] | null | null | null |
bradfield/test_x1_02_roman.py
|
savarin/algorithms
|
4d1f8f2361de12a02f376883f648697562d177ae
|
[
"MIT"
] | null | null | null |
from x1_02_roman import to_roman
def test_to_roman():
assert to_roman(1) == "i"
assert to_roman(2) == "ii"
assert to_roman(3) == "iii"
assert to_roman(4) == "iv"
assert to_roman(5) == "v"
assert to_roman(6) == "vi"
assert to_roman(7) == "vii"
assert to_roman(8) == "viii"
assert to_roman(9) == "ix"
assert to_roman(10) == "x"
assert to_roman(11) == "xi"
assert to_roman(12) == "xii"
| 25.470588
| 32
| 0.586605
| 71
| 433
| 3.338028
| 0.464789
| 0.413502
| 0.658228
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.054711
| 0.240185
| 433
| 16
| 33
| 27.0625
| 0.665654
| 0
| 0
| 0
| 0
| 0
| 0.060046
| 0
| 0
| 0
| 0
| 0
| 0.857143
| 1
| 0.071429
| true
| 0
| 0.071429
| 0
| 0.142857
| 0
| 0
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
bf41b3184bd3e63550da04859c56c0cfae317902
| 381
|
py
|
Python
|
Cartwheel/lib/Python26/Lib/site-packages/OpenGL/GL/NV/vertex_program1_1.py
|
MontyThibault/centre-of-mass-awareness
|
58778f148e65749e1dfc443043e9fc054ca3ff4d
|
[
"MIT"
] | null | null | null |
Cartwheel/lib/Python26/Lib/site-packages/OpenGL/GL/NV/vertex_program1_1.py
|
MontyThibault/centre-of-mass-awareness
|
58778f148e65749e1dfc443043e9fc054ca3ff4d
|
[
"MIT"
] | null | null | null |
Cartwheel/lib/Python26/Lib/site-packages/OpenGL/GL/NV/vertex_program1_1.py
|
MontyThibault/centre-of-mass-awareness
|
58778f148e65749e1dfc443043e9fc054ca3ff4d
|
[
"MIT"
] | null | null | null |
'''OpenGL extension NV.vertex_program1_1
This module customises the behaviour of the
OpenGL.raw.GL.NV.vertex_program1_1 to provide a more
Python-friendly API
'''
from OpenGL import platform, constants, constant, arrays
from OpenGL import extensions, wrapper
from OpenGL.GL import glget
import ctypes
from OpenGL.raw.GL.NV.vertex_program1_1 import *
### END AUTOGENERATED SECTION
| 31.75
| 56
| 0.813648
| 58
| 381
| 5.241379
| 0.586207
| 0.131579
| 0.157895
| 0.167763
| 0.184211
| 0.184211
| 0.184211
| 0
| 0
| 0
| 0
| 0.01791
| 0.120735
| 381
| 12
| 57
| 31.75
| 0.889552
| 0.48294
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 0
| 0
| 0
| null | 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
bf7373cf3f5427580c3173ae34cf4970b206c0c1
| 689
|
py
|
Python
|
Comentarios.py
|
SaulPerezP/Proyecto2-IPC1-API
|
2488c7105fd63d0d8d5b1048a452f613bab4a5b3
|
[
"Apache-2.0"
] | null | null | null |
Comentarios.py
|
SaulPerezP/Proyecto2-IPC1-API
|
2488c7105fd63d0d8d5b1048a452f613bab4a5b3
|
[
"Apache-2.0"
] | null | null | null |
Comentarios.py
|
SaulPerezP/Proyecto2-IPC1-API
|
2488c7105fd63d0d8d5b1048a452f613bab4a5b3
|
[
"Apache-2.0"
] | null | null | null |
class Comentarios:
def __init__(self, videojuego, usuario, comentario):
self.videojuego = videojuego
self.usuario = usuario
self.comentario = comentario
#MÉTODOS GET
def getVideojuego(self):
return self.videojuego
def getUsuario(self):
return self.usuario
def getComentario(self):
return self.comentario
#MÉTODOS SET
def setVideojuego(self, videojuego):
self.videojuego = videojuego
def setUsuario(self, usuario):
self.usuario = usuario
def setComentario(self, comentario):
self.comentario = comentario
#DUMP
def dump(self):
return {
'videojuego' : self.videojuego,
'usuario': self.usuario,
'comentario': self.comentario
}
| 16.804878
| 53
| 0.718433
| 74
| 689
| 6.635135
| 0.256757
| 0.171079
| 0.08554
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.187228
| 689
| 41
| 54
| 16.804878
| 0.876786
| 0.037736
| 0
| 0.26087
| 0
| 0
| 0.040909
| 0
| 0
| 0
| 0
| 0.02439
| 0
| 1
| 0.347826
| false
| 0
| 0
| 0.173913
| 0.565217
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 1
| 0
|
0
| 4
|
bf80efefe124c8e4d7515de93e5c0cd98539f7a0
| 247
|
py
|
Python
|
fancy/trainer/training/data_loader_collection.py
|
susautw/fancy-trainer
|
eeb7ba1a541a8070171f1be972f8d99f81a4bff9
|
[
"MIT"
] | null | null | null |
fancy/trainer/training/data_loader_collection.py
|
susautw/fancy-trainer
|
eeb7ba1a541a8070171f1be972f8d99f81a4bff9
|
[
"MIT"
] | null | null | null |
fancy/trainer/training/data_loader_collection.py
|
susautw/fancy-trainer
|
eeb7ba1a541a8070171f1be972f8d99f81a4bff9
|
[
"MIT"
] | null | null | null |
from dataclasses import dataclass
from typing import Optional
from torch.utils.data import DataLoader
@dataclass
class DataLoaderCollection:
train_loader: DataLoader
test_loader: DataLoader
valid_loader: Optional[DataLoader] = None
| 20.583333
| 45
| 0.805668
| 28
| 247
| 7
| 0.607143
| 0.163265
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.153846
| 247
| 11
| 46
| 22.454545
| 0.937799
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.375
| 0
| 0.875
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
bf8a9f710adffd125e4c29ad2253ff8eb275f128
| 773
|
py
|
Python
|
backend/accounts/permissions.py
|
eliefrancois/project2-diabetesapplication-api
|
e0fd904b1f50eb7ed68fe1ceb74c2a1784e8dc40
|
[
"MIT"
] | null | null | null |
backend/accounts/permissions.py
|
eliefrancois/project2-diabetesapplication-api
|
e0fd904b1f50eb7ed68fe1ceb74c2a1784e8dc40
|
[
"MIT"
] | null | null | null |
backend/accounts/permissions.py
|
eliefrancois/project2-diabetesapplication-api
|
e0fd904b1f50eb7ed68fe1ceb74c2a1784e8dc40
|
[
"MIT"
] | null | null | null |
from rest_framework import permissions
class UpdateOwnProfile(permissions.BasePermission):
"""Allows patient to edit their own profile"""
def has_object_permission(self, request, view, obj):
"""Validates that patient is trying to edit their own profile"""
if request.method in permissions.SAFE_METHODS:
return True
return obj.id == request.user.id
class UpdateOwnReading(permissions.BasePermission):
"""Allows patient to edit their own readings"""
def has_object_permission(self, request, view, obj):
"""Validates that patient is trying to edit their own reading"""
if request.method in permissions.SAFE_METHODS:
return True
return obj.user_profile.id == request.user.id
| 35.136364
| 72
| 0.69599
| 95
| 773
| 5.578947
| 0.410526
| 0.045283
| 0.083019
| 0.10566
| 0.750943
| 0.724528
| 0.724528
| 0.724528
| 0.528302
| 0.528302
| 0
| 0
| 0.225097
| 773
| 22
| 73
| 35.136364
| 0.884808
| 0.258732
| 0
| 0.545455
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.181818
| false
| 0
| 0.090909
| 0
| 0.818182
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
|
0
| 4
|
bf8f3e1397150b62a09d3383ecb1db11c3034a33
| 1,721
|
py
|
Python
|
monstercreator.py
|
David132639/GUTS2017
|
fbb06842523713a7998f096f4d785dcc002d6ea5
|
[
"CC-BY-3.0"
] | 1
|
2018-03-11T21:00:01.000Z
|
2018-03-11T21:00:01.000Z
|
monstercreator.py
|
David132639/GUTS2017
|
fbb06842523713a7998f096f4d785dcc002d6ea5
|
[
"CC-BY-3.0"
] | null | null | null |
monstercreator.py
|
David132639/GUTS2017
|
fbb06842523713a7998f096f4d785dcc002d6ea5
|
[
"CC-BY-3.0"
] | null | null | null |
##Gives a list of obstacles given by the case number
##VERSION 1.1 SOHVA fixed a bug with the test case
##Version 1.2 Marija added a boss monster to be in the list by default
import monster
def createMonsters(case):
monsters = [monster.Monster((8,13), [(8, 13), (8, 12), (8, 11), (7,11), (6, 11), (6, 12), (6, 13), (7,13)])]
print case
if case == 1:
monsters += [monster.Monster((3,1),[(3,1),(3,2),(2,2),(2,1)])]
monsters += [monster.Monster((7,1),[(7,1),(7,2),(6,2),(6,1)])]
monsters += [monster.Monster((7,5),[(7,5),(7,4)])]
elif case == 2:
monsters += [monster.Monster((2,10),[(2,10),(2,11),(2,12),(3,12),(3,11),(3,10)])]
monsters += [monster.Monster((4,8),[(4,8),(5,8),(6,8),(7,8),(8,8),(7,8),(6,8),(5,8)])]
route = []
for i in range(1,14):
route += [(4,i)]
for i in [4,3,2,1]:
route += [(i,13)]
for i in range(13,0,-1):
route += [(1,i)]
routeCopy = route + []
for i in reversed(routeCopy[:-1]):
route+= [i]
monsters += [monster.Monster((4,1),route)]
elif case == 3:
monsters += [monster.Monster((1,3),[(1,3),(2,3)])]
monsters += [monster.Monster((3,1),[(3,1),(3,2),(3,3),(3,2)])]
monsters += [monster.Monster((2,8),[(2,8),(2,9),(2,10),(2,11),(2,10),(2,9)])]
monsters += [monster.Monster((4,12),[(4,12),(4,12),(4,13),(4,13)])]
monsters += [monster.Monster((6,8),[(6,8),(6,9)])]
monsters += [monster.Monster((2,1),[(3,1),(4,1),(5,1),(6,1),(7,1),(8,1),(8,1),\
(7,1),(6,1),(5,1),(4,1),(3,1),(2,1),(1,1)])]
return monsters
| 46.513514
| 113
| 0.46136
| 288
| 1,721
| 2.756944
| 0.184028
| 0.245592
| 0.360202
| 0.086902
| 0.230479
| 0.079345
| 0.070529
| 0.070529
| 0.070529
| 0
| 0
| 0.157031
| 0.256246
| 1,721
| 36
| 114
| 47.805556
| 0.463281
| 0.096456
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | null | 0
| 0.032258
| null | null | 0.032258
| 0
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
bf9a42a17d51850e07e6e338c4e02e029f384126
| 60
|
py
|
Python
|
secrets.py
|
nainish2/TinderBot
|
ff7435bcc1974bfe178fb942cda22d7a5933e932
|
[
"bzip2-1.0.6"
] | null | null | null |
secrets.py
|
nainish2/TinderBot
|
ff7435bcc1974bfe178fb942cda22d7a5933e932
|
[
"bzip2-1.0.6"
] | null | null | null |
secrets.py
|
nainish2/TinderBot
|
ff7435bcc1974bfe178fb942cda22d7a5933e932
|
[
"bzip2-1.0.6"
] | null | null | null |
username= 'aggarwal.nanish@gmail.com'
password= 'aggarwal2a'
| 30
| 37
| 0.8
| 7
| 60
| 6.857143
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.017544
| 0.05
| 60
| 2
| 38
| 30
| 0.824561
| 0
| 0
| 0
| 0
| 0
| 0.57377
| 0.409836
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0.5
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
bfc2fd685a83c8d4340bbdea5c4527494c3c0c02
| 67
|
py
|
Python
|
python/testData/resolve/multiFile/reimportExported/ReimportExported.py
|
jnthn/intellij-community
|
8fa7c8a3ace62400c838e0d5926a7be106aa8557
|
[
"Apache-2.0"
] | 2
|
2019-04-28T07:48:50.000Z
|
2020-12-11T14:18:08.000Z
|
python/testData/resolve/multiFile/reimportExported/ReimportExported.py
|
jnthn/intellij-community
|
8fa7c8a3ace62400c838e0d5926a7be106aa8557
|
[
"Apache-2.0"
] | 173
|
2018-07-05T13:59:39.000Z
|
2018-08-09T01:12:03.000Z
|
python/testData/resolve/multiFile/reimportExported/ReimportExported.py
|
jnthn/intellij-community
|
8fa7c8a3ace62400c838e0d5926a7be106aa8557
|
[
"Apache-2.0"
] | 2
|
2020-03-15T08:57:37.000Z
|
2020-04-07T04:48:14.000Z
|
import mypackage.foo
mypackage.bar.dostuff()
# <ref>
| 13.4
| 23
| 0.597015
| 7
| 67
| 5.714286
| 0.857143
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.283582
| 67
| 4
| 24
| 16.75
| 0.833333
| 0.074627
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.5
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
bfd717b31b063d444539cc7fed12cd158972bc53
| 72
|
py
|
Python
|
ch2/2-9.favorite_num.py
|
AngangGuo/pycrash
|
de48aa4198022c301f5cd3ce388c195a177be1b5
|
[
"MIT"
] | null | null | null |
ch2/2-9.favorite_num.py
|
AngangGuo/pycrash
|
de48aa4198022c301f5cd3ce388c195a177be1b5
|
[
"MIT"
] | null | null | null |
ch2/2-9.favorite_num.py
|
AngangGuo/pycrash
|
de48aa4198022c301f5cd3ce388c195a177be1b5
|
[
"MIT"
] | null | null | null |
favorite_number = 23
print(f"My favorite number is {favorite_number}.")
| 24
| 50
| 0.777778
| 11
| 72
| 4.909091
| 0.636364
| 0.777778
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.03125
| 0.111111
| 72
| 2
| 51
| 36
| 0.8125
| 0
| 0
| 0
| 0
| 0
| 0.555556
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0.5
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
44c6f31866c5683f3f87e1562e15eb8eebd5c75c
| 8,713
|
py
|
Python
|
test/api/test_radarr.py
|
shovon668/pycliarr
|
21ce35e8a63eed8e2bf755a244c66ee3ca9ab278
|
[
"MIT"
] | 10
|
2020-08-25T08:14:49.000Z
|
2022-02-27T02:14:19.000Z
|
test/api/test_radarr.py
|
shovon668/pycliarr
|
21ce35e8a63eed8e2bf755a244c66ee3ca9ab278
|
[
"MIT"
] | 27
|
2020-11-25T05:29:40.000Z
|
2022-01-22T17:43:42.000Z
|
test/api/test_radarr.py
|
shovon668/pycliarr
|
21ce35e8a63eed8e2bf755a244c66ee3ca9ab278
|
[
"MIT"
] | 1
|
2021-06-15T16:23:46.000Z
|
2021-06-15T16:23:46.000Z
|
import pytest
from copy import deepcopy
from unittest.mock import patch
from pycliarr.api.radarr import RadarrCli, RadarrMovieItem
from pycliarr.api.exceptions import RadarrCliError
TEST_ROOT_PATH = [{"path": "some/path/", "id": 1},{"path": "yet/otherpath/", "id": 3}]
TEST_JSON = {'somefield': "some value"}
TEST_MOVIE = {'title': "some movie", "year": 2020}
TEST_HOST = "http://example.com"
TEST_APIKEY = "abcd1234"
TEST_MOVIEINFO = {
"title": "some movie",
"sortTitle": "",
"sizeOnDisk": 0,
"overview": "",
"inCinemas": None,
"physicalRelease": None,
"status": "",
"images": [],
"website": "",
"downloaded": False,
"year": 0,
"hasFile": False,
"youTubeTrailerId": "",
"studio": "",
"path": "",
"rootFolderPath": "",
"profileId": 0,
"monitored": True,
"minimumAvailability": "",
"isAvailable": "",
"folderName": "",
"runtime": 0,
"cleanTitle": "",
"imdbId": "",
"tmdbId": 0,
"titleSlug": "",
"certification": "",
"genres": [],
"tags": [],
"added": None,
"ratings": {},
"collection": {},
"alternativeTitles": [],
"qualityProfileId": 0,
"id": 0,
}
@pytest.fixture
def cli():
return RadarrCli(TEST_HOST, TEST_APIKEY)
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_item", return_value=TEST_MOVIE)
def test_get_movie(mock_base, cli):
res = cli.get_movie()
mock_base.assert_called_with(None)
assert res.title == "some movie"
assert res.year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_item", return_value=[TEST_MOVIE])
def test_get_movie_with_id(mock_base, cli):
res = cli.get_movie(movie_id=1234)
mock_base.assert_called_with(1234)
assert res[0].title == "some movie"
assert res[0].year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.lookup_item", return_value=[TEST_MOVIE, TEST_MOVIE])
def test_lookup_movie_with_term(mock_base, cli):
res = cli.lookup_movie(term="some title")
mock_base.assert_called_with("some title")
assert res[0].title == "some movie"
assert res[0].year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.lookup_item", return_value=[TEST_MOVIE])
def test_lookup_movie_with_term_single_res(mock_base, cli):
res = cli.lookup_movie(term="some title")
mock_base.assert_called_with("some title")
assert res.title == "some movie"
assert res.year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIE)
def test_lookup_movie_with_imdb(mock_base, cli):
res = cli.lookup_movie(imdb_id="tt1234")
mock_base.assert_called_with(f"{cli.api_url_itemlookup}/imdb", url_params={"imdbId": "tt1234"})
assert res.title == "some movie"
assert res.year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIE)
def test_lookup_movie_with_tmdb(mock_base, cli):
res = cli.lookup_movie(tmdb_id=1234)
mock_base.assert_called_with(f"{cli.api_url_itemlookup}/tmdb", url_params={"tmdbId": 1234})
assert res.title == "some movie"
assert res.year == 2020
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIE)
def test_lookup_movie_with_all(mock_base, cli):
res = cli.lookup_movie(term="some title", tmdb_id=1234, imdb_id="tt1234")
mock_base.assert_called_with(f"{cli.api_url_itemlookup}/tmdb", url_params={"tmdbId": 1234})
assert res.title == "some movie"
assert res.year == 2020
def test_lookup_movie_with_noparam(cli):
with pytest.raises(RadarrCliError):
cli.lookup_movie()
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_root_folder", return_value=TEST_ROOT_PATH)
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIEINFO)
@patch("pycliarr.api.radarr.BaseCliMediaApi.add_item", return_value=TEST_JSON)
def test_add_movie_withpath(mock_add, mock_root, mock_get, cli):
exp = deepcopy(TEST_MOVIEINFO)
exp.update({
"title": "some movie",
"path": "some/other_path/some_other_movie",
"profileId": 1,
"qualityProfileId": 1,
"monitored": True,
"addOptions": {"searchForMovie": True}
})
cli.add_movie(quality=1, tmdb_id=1234, path="some/other_path/some_other_movie")
mock_add.assert_called_with(json_data=exp)
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_root_folder", return_value=TEST_ROOT_PATH)
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIEINFO)
@patch("pycliarr.api.radarr.BaseCliMediaApi.add_item", return_value=TEST_JSON)
def test_add_movie_withtmdb(mock_add, mock_root, mock_get, cli):
exp = deepcopy(TEST_MOVIEINFO)
exp.update({
"title": "some movie",
"path": "some/path/some movie",
"profileId": 1,
"qualityProfileId": 1,
"monitored": True,
"addOptions": {"searchForMovie": True}
})
cli.add_movie(quality=1, tmdb_id=1234)
mock_add.assert_called_with(json_data=exp)
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_root_folder", return_value=TEST_ROOT_PATH)
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value=TEST_MOVIEINFO)
@patch("pycliarr.api.radarr.BaseCliMediaApi.add_item", return_value=TEST_JSON)
def test_add_movie_withimdb(mock_add, mock_root, mock_get, cli):
exp = deepcopy(TEST_MOVIEINFO)
exp.update({
"title": "some movie",
"path": "some/path/some movie",
"profileId": 2,
"qualityProfileId": 2,
"monitored": True,
"addOptions": {"searchForMovie": True}
})
cli.add_movie(quality=2, imdb_id="tt1234")
mock_add.assert_called_with(json_data=exp)
@patch("pycliarr.api.radarr.BaseCliMediaApi.get_root_folder", return_value=TEST_ROOT_PATH)
@patch("pycliarr.api.radarr.BaseCliMediaApi.add_item", return_value=TEST_JSON)
def test_add_movie_withinfo(mock_add, mock_root, cli):
exp = deepcopy(TEST_MOVIEINFO)
exp.update({
"title": "some movie",
"path": "some/path/some movie",
"profileId": 1,
"qualityProfileId": 1,
"monitored": False,
"addOptions": {"searchForMovie": False}
})
info = RadarrMovieItem(title="some movie")
cli.add_movie(quality=1, movie_info=info, monitored=False, search=False)
mock_add.assert_called_with(json_data=exp)
@patch("pycliarr.api.radarr.BaseCliMediaApi.request_get", return_value={})
def test_add_movie_noresults(mock_get, cli):
with pytest.raises(RadarrCliError):
cli.add_movie(quality=2, imdb_id="tt1234")
def test_add_movie_noparam(cli):
with pytest.raises(RadarrCliError):
cli.add_movie(quality=2)
@patch("pycliarr.api.radarr.BaseCliMediaApi.delete_item", return_value=TEST_JSON)
def test_delete_movie(mock_base, cli):
res = cli.delete_movie(1234)
mock_base.assert_called_with(1234, True, {})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi.delete_item", return_value=TEST_JSON)
def test_delete_movie_withoptions(mock_base, cli):
res = cli.delete_movie(1234, delete_files=False, add_exclusion=True)
mock_base.assert_called_with(1234, False, {"addExclusion": True})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi._sendCommand", return_value=TEST_JSON)
def test_refresh_movies(mock_base, cli):
res = cli.refresh_movie()
mock_base.assert_called_with({"name": "RefreshMovie"})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi._sendCommand", return_value=TEST_JSON)
def test_refresh_movie(mock_base, cli):
res = cli.refresh_movie(1234)
mock_base.assert_called_with({"name": "RefreshMovie", "movieId": 1234})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi._sendCommand", return_value=TEST_JSON)
def test_rescan_movies(mock_base, cli):
res = cli.rescan_movie()
mock_base.assert_called_with({"name": "RescanMovie"})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi._sendCommand", return_value=TEST_JSON)
def test_rescan_movie(mock_base, cli):
res = cli.rescan_movie(1234)
mock_base.assert_called_with({"name": "RescanMovie", "movieId": 1234})
assert res == TEST_JSON
@patch("pycliarr.api.radarr.BaseCliMediaApi.build_item_path")
def test_build_movie_path_no_year(mock_buildpath, cli):
movie = RadarrMovieItem(title="some movie", year=0)
cli.build_movie_path(movie)
mock_buildpath.assert_called_with("some movie")
@patch("pycliarr.api.radarr.BaseCliMediaApi.build_item_path")
def test_build_movie_path_year(mock_buildpath, cli):
movie = RadarrMovieItem(title="some movie", year=2020)
cli.build_movie_path(movie, root_folder_id=3)
mock_buildpath.assert_called_with("some movie (2020)")
| 34.852
| 99
| 0.715024
| 1,147
| 8,713
| 5.153444
| 0.115955
| 0.053967
| 0.080528
| 0.100491
| 0.818474
| 0.799695
| 0.786331
| 0.692438
| 0.658264
| 0.641008
| 0
| 0.021051
| 0.144038
| 8,713
| 249
| 100
| 34.991968
| 0.771521
| 0
| 0
| 0.445545
| 0
| 0
| 0.290715
| 0.164123
| 0
| 0
| 0
| 0
| 0.193069
| 1
| 0.113861
| false
| 0
| 0.024752
| 0.00495
| 0.143564
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
44d2dd32a031c2393f11c750ac9b78bfa9459442
| 111
|
py
|
Python
|
check/__init__.py
|
FluvialGeomorph/FluvialGeomorph-toolbox
|
d7b0712d4841af5cc341443d695bf0481eeccb23
|
[
"CC0-1.0"
] | null | null | null |
check/__init__.py
|
FluvialGeomorph/FluvialGeomorph-toolbox
|
d7b0712d4841af5cc341443d695bf0481eeccb23
|
[
"CC0-1.0"
] | 1
|
2021-03-25T12:38:23.000Z
|
2021-03-25T12:38:23.000Z
|
check/__init__.py
|
FluvialGeomorph/FluvialGeomorph-toolbox
|
d7b0712d4841af5cc341443d695bf0481eeccb23
|
[
"CC0-1.0"
] | null | null | null |
"""The FluvialGeomorph check package contains a set of tools to check the
validity of FG feature classes.
"""
| 27.75
| 74
| 0.765766
| 17
| 111
| 5
| 0.823529
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.171171
| 111
| 3
| 75
| 37
| 0.923913
| 0.927928
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
44f7e10fc7d4a95a36020a0c6c4a3203a5a29693
| 85
|
py
|
Python
|
examples/Tuning/testing_estimators/nbeats.py
|
arangatang/Crayon
|
ff1ca68fe676028a8209ad56c108b8d8179ba2d7
|
[
"MIT"
] | null | null | null |
examples/Tuning/testing_estimators/nbeats.py
|
arangatang/Crayon
|
ff1ca68fe676028a8209ad56c108b8d8179ba2d7
|
[
"MIT"
] | null | null | null |
examples/Tuning/testing_estimators/nbeats.py
|
arangatang/Crayon
|
ff1ca68fe676028a8209ad56c108b8d8179ba2d7
|
[
"MIT"
] | null | null | null |
from gluonts.model.n_beats import NBEATSEnsembleEstimator
NBEATSEnsembleEstimator()
| 21.25
| 57
| 0.882353
| 8
| 85
| 9.25
| 0.875
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.070588
| 85
| 3
| 58
| 28.333333
| 0.936709
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.5
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
7803936d5334854af0c64870adcd7f48c61b8602
| 151
|
py
|
Python
|
virtual/lib/python3.6/site-packages/pylint/test/functional/yield_from_iterable_py33.py
|
drewheathens/The-Moringa-Tribune
|
98ee4d63c9df6f1f7497fc6876960a822d914500
|
[
"MIT"
] | 463
|
2015-01-15T08:17:42.000Z
|
2022-03-28T15:10:20.000Z
|
virtual/lib/python3.6/site-packages/pylint/test/functional/yield_from_iterable_py33.py
|
drewheathens/The-Moringa-Tribune
|
98ee4d63c9df6f1f7497fc6876960a822d914500
|
[
"MIT"
] | 52
|
2015-01-06T02:43:59.000Z
|
2022-03-14T11:15:21.000Z
|
virtual/lib/python3.6/site-packages/pylint/test/functional/yield_from_iterable_py33.py
|
drewheathens/The-Moringa-Tribune
|
98ee4d63c9df6f1f7497fc6876960a822d914500
|
[
"MIT"
] | 249
|
2015-01-07T22:49:49.000Z
|
2022-03-18T02:32:06.000Z
|
"""
Check that `yield from`-statement takes an iterable.
"""
# pylint: disable=missing-docstring
def to_ten():
yield from 10 # [not-an-iterable]
| 18.875
| 52
| 0.688742
| 21
| 151
| 4.904762
| 0.809524
| 0.174757
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.015873
| 0.165563
| 151
| 7
| 53
| 21.571429
| 0.801587
| 0.695364
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.5
| true
| 0
| 0
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
780ab328d9eee00616536473f2fb2467d5d340e9
| 61
|
py
|
Python
|
soft_deletion/__init__.py
|
SocialGouv/ecollecte
|
1bfce2e0700b563c111c11452356b46ecb2630e4
|
[
"MIT"
] | 9
|
2018-11-28T07:36:37.000Z
|
2022-02-04T12:56:11.000Z
|
soft_deletion/__init__.py
|
betagouv/e-controle
|
b6f790ca2590ac257a47930a1e521b86ce3edb29
|
[
"MIT"
] | 154
|
2018-11-22T14:41:17.000Z
|
2022-02-12T08:48:57.000Z
|
soft_deletion/__init__.py
|
betagouv/e-controle
|
b6f790ca2590ac257a47930a1e521b86ce3edb29
|
[
"MIT"
] | 10
|
2018-11-13T06:57:10.000Z
|
2022-03-21T13:04:49.000Z
|
default_app_config = 'soft_deletion.apps.SoftDeletionConfig'
| 30.5
| 60
| 0.868852
| 7
| 61
| 7.142857
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.04918
| 61
| 1
| 61
| 61
| 0.862069
| 0
| 0
| 0
| 0
| 0
| 0.606557
| 0.606557
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
785f789dc5d71ff6dbbc2e8cb2cca2ed5b078535
| 90
|
py
|
Python
|
runserver.py
|
jasonost/clinicaltrials
|
b6d003b434e70cf4015215e4c9509df6092cfd97
|
[
"MIT"
] | 12
|
2015-11-26T22:23:05.000Z
|
2021-03-23T21:10:53.000Z
|
runserver.py
|
jasonost/clinicaltrials
|
b6d003b434e70cf4015215e4c9509df6092cfd97
|
[
"MIT"
] | 1
|
2019-01-18T08:33:55.000Z
|
2019-01-18T08:33:55.000Z
|
runserver.py
|
jasonost/clinicaltrials
|
b6d003b434e70cf4015215e4c9509df6092cfd97
|
[
"MIT"
] | 4
|
2015-10-28T05:54:50.000Z
|
2019-05-09T22:23:11.000Z
|
from ctapp import app
if __name__ == '__main__':
app.run(host='0.0.0.0', port=61011)
| 18
| 39
| 0.655556
| 16
| 90
| 3.1875
| 0.75
| 0.117647
| 0.117647
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.12
| 0.166667
| 90
| 4
| 40
| 22.5
| 0.56
| 0
| 0
| 0
| 0
| 0
| 0.166667
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.333333
| 0
| 0.333333
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
786431e2157ae39d16b9144515372d4a369c12f8
| 370
|
py
|
Python
|
crawler/crawler/spiders/MyDupeFilter.py
|
jiady/htdb
|
70ab10ba8f8031ecd6aa22facaee005d658a387b
|
[
"MIT"
] | null | null | null |
crawler/crawler/spiders/MyDupeFilter.py
|
jiady/htdb
|
70ab10ba8f8031ecd6aa22facaee005d658a387b
|
[
"MIT"
] | null | null | null |
crawler/crawler/spiders/MyDupeFilter.py
|
jiady/htdb
|
70ab10ba8f8031ecd6aa22facaee005d658a387b
|
[
"MIT"
] | null | null | null |
from scrapy.dupefilters import RFPDupeFilter
import redis
from crawler import redis_const
class MyDupeFilter(RFPDupeFilter):
def __init__(self, path=None, debug=False):
RFPDupeFilter.__init__(self, path=None, debug=False)
self.rclient = redis.StrictRedis(host="localhost", port=6379, db=0)
def request_seen(self, request):
return False
| 28.461538
| 75
| 0.737838
| 46
| 370
| 5.717391
| 0.608696
| 0.08365
| 0.091255
| 0.121673
| 0.197719
| 0.197719
| 0
| 0
| 0
| 0
| 0
| 0.016287
| 0.17027
| 370
| 12
| 76
| 30.833333
| 0.840391
| 0
| 0
| 0
| 0
| 0
| 0.024324
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.222222
| false
| 0
| 0.333333
| 0.111111
| 0.777778
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 1
| 1
| 0
|
0
| 4
|
78ac0de8c5e587e65a19d661a4a73d792840ced0
| 1,746
|
py
|
Python
|
irrexplorer/tests/test_clean_query.py
|
dashcare/irrexplorer
|
70977f745769b9d0c761f4d1a92091ec2ae84984
|
[
"BSD-2-Clause"
] | 17
|
2021-02-12T14:18:16.000Z
|
2021-08-02T13:20:18.000Z
|
irrexplorer/tests/test_clean_query.py
|
dashcare/irrexplorer
|
70977f745769b9d0c761f4d1a92091ec2ae84984
|
[
"BSD-2-Clause"
] | 76
|
2021-02-12T13:08:25.000Z
|
2021-08-19T15:17:14.000Z
|
irrexplorer/tests/test_clean_query.py
|
dashcare/irrexplorer
|
70977f745769b9d0c761f4d1a92091ec2ae84984
|
[
"BSD-2-Clause"
] | 2
|
2021-06-09T12:44:54.000Z
|
2021-06-17T14:32:35.000Z
|
import pytest
pytestmark = pytest.mark.asyncio
async def test_clean_query_prefix(client):
response = await client.get("/api/clean_query/192.0.2/24")
assert response.status_code == 200
assert response.json() == {"cleanedValue": "192.0.2.0/24", "category": "prefix"}
async def test_clean_query_prefix_misaligned(client):
response = await client.get("/api/clean_query/192.0.2.3/24")
assert response.status_code == 200
assert response.json() == {"cleanedValue": "192.0.2.0/24", "category": "prefix"}
async def test_clean_query_asn_bare(client):
response = await client.get("/api/clean_query/192")
assert response.status_code == 200
assert response.json() == {"cleanedValue": "AS192", "category": "asn"}
async def test_clean_query_asn(client):
response = await client.get("/api/clean_query/AS64500")
assert response.status_code == 200
assert response.json() == {"cleanedValue": "AS64500", "category": "asn"}
async def test_clean_query_as_set(client):
response = await client.get("/api/clean_query/foobar")
assert response.status_code == 200
assert response.json() == {"cleanedValue": "FOOBAR", "category": "as-set"}
async def test_clean_query_invalid(client):
response = await client.get("/api/clean_query/--invalid-💩")
assert response.status_code == 400
assert "valid prefix" in response.text
async def test_clean_query_prefix_too_large(client):
response = await client.get("/api/clean_query/192.0.0.0/8")
assert response.status_code == 400
assert "the minimum prefix length" in response.text
response = await client.get("/api/clean_query/2001::/16")
assert response.status_code == 400
assert "the minimum prefix length" in response.text
| 34.92
| 84
| 0.712486
| 243
| 1,746
| 4.950617
| 0.205761
| 0.124688
| 0.126351
| 0.146301
| 0.866999
| 0.848712
| 0.764755
| 0.680798
| 0.578554
| 0.399834
| 0
| 0.056376
| 0.146621
| 1,746
| 49
| 85
| 35.632653
| 0.750336
| 0
| 0
| 0.363636
| 0
| 0
| 0.247995
| 0.105956
| 0
| 0
| 0
| 0
| 0.484848
| 1
| 0
| false
| 0
| 0.030303
| 0
| 0.030303
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
78b0e8ce1317e231da9dc2ca6bfb101b3156fd6d
| 89
|
py
|
Python
|
src/files/admin.py
|
kaleelcsa/Dive-into-AWS-Course---Direct-to-S3-via-Django-JavaScript
|
b6a5e61288ce745851848eb4853fb70b3e67f1f7
|
[
"MIT"
] | 31
|
2018-12-17T05:53:01.000Z
|
2022-01-11T21:54:10.000Z
|
src/files/admin.py
|
kaleelcsa/Dive-into-AWS-Course---Direct-to-S3-via-Django-JavaScript
|
b6a5e61288ce745851848eb4853fb70b3e67f1f7
|
[
"MIT"
] | 5
|
2020-06-05T19:46:46.000Z
|
2021-09-08T00:48:21.000Z
|
src/files/admin.py
|
codingforentrepreneurs/Dive-into-AWS-Course---Direct-to-S3-via-Django-JavaScript
|
b6a5e61288ce745851848eb4853fb70b3e67f1f7
|
[
"MIT"
] | 14
|
2019-01-09T18:33:40.000Z
|
2022-03-02T20:21:54.000Z
|
from django.contrib import admin
from .models import S3File
admin.site.register(S3File)
| 17.8
| 32
| 0.820225
| 13
| 89
| 5.615385
| 0.692308
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.025316
| 0.11236
| 89
| 5
| 33
| 17.8
| 0.898734
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.666667
| 0
| 0.666667
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
78bd07a79327d10729adf154c2c302ed30bfefd8
| 57
|
py
|
Python
|
exercise1-knn/psyc272cava/classifiers/__init__.py
|
psyc230/cava_exercises
|
fe7d0107db214e04aa1ed30996373a894e47531f
|
[
"BSD-2-Clause"
] | 1
|
2019-10-29T01:31:27.000Z
|
2019-10-29T01:31:27.000Z
|
exercise1-knn/psyc272cava/classifiers/__init__.py
|
psyc230/cava_exercises
|
fe7d0107db214e04aa1ed30996373a894e47531f
|
[
"BSD-2-Clause"
] | 3
|
2021-02-02T22:11:28.000Z
|
2022-01-13T03:03:36.000Z
|
exercise1-knn/psyc272cava/classifiers/__init__.py
|
psyc230/cava_exercises
|
fe7d0107db214e04aa1ed30996373a894e47531f
|
[
"BSD-2-Clause"
] | 2
|
2019-10-01T00:48:23.000Z
|
2019-10-22T01:32:46.000Z
|
from psyc272cava.classifiers.k_nearest_neighbor import *
| 28.5
| 56
| 0.877193
| 7
| 57
| 6.857143
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.056604
| 0.070175
| 57
| 1
| 57
| 57
| 0.849057
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 1
| 0
| 1
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
78d6ae0d024aa8ec5e5cface12b0dd79f20b82af
| 65
|
py
|
Python
|
lesson6/theory/matplotlib.py
|
karina-marques/programming-exercises
|
ecce7ed3fee02b717bff8e4b8405ea65a574d93b
|
[
"MIT"
] | null | null | null |
lesson6/theory/matplotlib.py
|
karina-marques/programming-exercises
|
ecce7ed3fee02b717bff8e4b8405ea65a574d93b
|
[
"MIT"
] | null | null | null |
lesson6/theory/matplotlib.py
|
karina-marques/programming-exercises
|
ecce7ed3fee02b717bff8e4b8405ea65a574d93b
|
[
"MIT"
] | null | null | null |
# https://matplotlib.org/stable/tutorials/index.html#introductory
| 65
| 65
| 0.830769
| 8
| 65
| 6.75
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.015385
| 65
| 1
| 65
| 65
| 0.84375
| 0.953846
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
152d40963c407276ecf59d8614f78f4f258d8d9e
| 314
|
py
|
Python
|
thumt/utils/utils.py
|
Demon-JieHao/Modeling-Structure-for-Transformer-Network
|
329831964731ccb7361b847e0ff7c2d809ab7231
|
[
"BSD-3-Clause"
] | 145
|
2018-12-03T05:47:26.000Z
|
2022-02-25T07:55:52.000Z
|
thumt/utils/utils.py
|
Demon-JieHao/Modeling-Structure-for-Transformer-Network
|
329831964731ccb7361b847e0ff7c2d809ab7231
|
[
"BSD-3-Clause"
] | 11
|
2018-12-03T06:03:25.000Z
|
2021-11-16T12:18:59.000Z
|
thumt/utils/utils.py
|
Demon-JieHao/Modeling-Structure-for-Transformer-Network
|
329831964731ccb7361b847e0ff7c2d809ab7231
|
[
"BSD-3-Clause"
] | 24
|
2018-12-16T08:42:38.000Z
|
2021-07-13T04:08:47.000Z
|
# coding=utf-8
# Copyright 2018 The THUMT Authors
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import tensorflow as tf
def session_run(monitored_session, args):
# Call raw TF session directly
return monitored_session._tf_sess().run(args)
| 22.428571
| 49
| 0.802548
| 44
| 314
| 5.295455
| 0.636364
| 0.128755
| 0.206009
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.018727
| 0.149682
| 314
| 13
| 50
| 24.153846
| 0.853933
| 0.235669
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.166667
| false
| 0
| 0.666667
| 0.166667
| 1
| 0.166667
| 0
| 0
| 0
| null | 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 1
| 0
|
0
| 4
|
15401f355aa641a84784a5bf0cf86b597b686b05
| 107
|
py
|
Python
|
FDApy/clustering/optimalK/__init__.py
|
vishalbelsare/FDApy
|
50feb99e34f265b1c17a6f234a9d2f942ceb8f6d
|
[
"MIT"
] | 19
|
2019-02-11T08:35:29.000Z
|
2022-01-27T16:51:10.000Z
|
FDApy/clustering/optimalK/__init__.py
|
vishalbelsare/FDApy
|
50feb99e34f265b1c17a6f234a9d2f942ceb8f6d
|
[
"MIT"
] | 4
|
2020-04-07T07:10:26.000Z
|
2022-02-09T16:33:19.000Z
|
FDApy/clustering/optimalK/__init__.py
|
vishalbelsare/FDApy
|
50feb99e34f265b1c17a6f234a9d2f942ceb8f6d
|
[
"MIT"
] | 7
|
2020-04-24T13:24:02.000Z
|
2022-02-18T17:28:30.000Z
|
"""
OptimalK module.
This module is used to determine the best number of clusters in functional
data.
"""
| 15.285714
| 74
| 0.747664
| 16
| 107
| 5
| 0.9375
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.17757
| 107
| 6
| 75
| 17.833333
| 0.909091
| 0.915888
| 0
| null | 0
| null | 0
| 0
| null | 0
| 0
| 0
| null | 1
| null | true
| 0
| 0
| null | null | null | 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
15b9d4d595ce224511e4fec52c70f675c385829a
| 30
|
py
|
Python
|
tests/input_example.py
|
kangwonlee/reposetman
|
ca35026a37a9f60479bf19ad542761a56ecd0783
|
[
"MIT"
] | null | null | null |
tests/input_example.py
|
kangwonlee/reposetman
|
ca35026a37a9f60479bf19ad542761a56ecd0783
|
[
"MIT"
] | 109
|
2018-09-18T05:50:02.000Z
|
2020-03-19T04:55:35.000Z
|
tests/input_example.py
|
kangwonlee/reposetman
|
ca35026a37a9f60479bf19ad542761a56ecd0783
|
[
"MIT"
] | 1
|
2018-09-17T15:39:21.000Z
|
2018-09-17T15:39:21.000Z
|
a = input()
b = input('b=?')
| 7.5
| 16
| 0.433333
| 5
| 30
| 2.6
| 0.6
| 0.923077
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.233333
| 30
| 3
| 17
| 10
| 0.565217
| 0
| 0
| 0
| 0
| 0
| 0.1
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
15baa7424bf6129d348a094387efb2ad95f3f5b3
| 636
|
py
|
Python
|
pyaranet4/exceptions.py
|
stijn-uva/pyaranet4
|
8d1ed4880db10af2f25ea0e5d4e01461ae695f40
|
[
"MIT"
] | 7
|
2021-09-14T00:56:26.000Z
|
2022-01-30T06:08:04.000Z
|
pyaranet4/exceptions.py
|
stijn-uva/pyaranet4
|
8d1ed4880db10af2f25ea0e5d4e01461ae695f40
|
[
"MIT"
] | null | null | null |
pyaranet4/exceptions.py
|
stijn-uva/pyaranet4
|
8d1ed4880db10af2f25ea0e5d4e01461ae695f40
|
[
"MIT"
] | 1
|
2021-09-12T20:39:14.000Z
|
2021-09-12T20:39:14.000Z
|
class Aranet4Exception(BaseException):
"""
Base exception for pyaranet4
"""
pass
class Aranet4NotFoundException(Aranet4Exception):
"""
Exception that occurs when no suitable Aranet4 device is available
"""
pass
class Aranet4BusyException(Aranet4Exception):
"""
Exception that occurs when one attempts to fetch history from the device
while history for another sensor is being read
"""
pass
class Aranet4UnpairedException(Aranet4Exception):
"""
Exception that occurs when the Aranet4 device is detected but unpaired, and
no data can be read from it.
"""
pass
| 21.931034
| 79
| 0.70283
| 69
| 636
| 6.478261
| 0.57971
| 0.060403
| 0.194631
| 0.234899
| 0.261745
| 0
| 0
| 0
| 0
| 0
| 0
| 0.020619
| 0.237421
| 636
| 28
| 80
| 22.714286
| 0.901031
| 0.503145
| 0
| 0.5
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0.5
| 0
| 0
| 0.5
| 0
| 0
| 0
| 0
| null | 0
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
ec732a4ce7b010b2c9882ee22f31d39cc5b06797
| 1,184
|
py
|
Python
|
test/Python/Compiler/type_inference.py
|
marbre/mlir-npcomp
|
30adf9e6b0c1e94db38050a9e143f20a5a461d17
|
[
"Apache-2.0"
] | 11
|
2020-03-30T23:31:03.000Z
|
2021-06-16T01:17:58.000Z
|
test/Python/Compiler/type_inference.py
|
marbre/mlir-npcomp
|
30adf9e6b0c1e94db38050a9e143f20a5a461d17
|
[
"Apache-2.0"
] | 1
|
2020-04-26T21:19:30.000Z
|
2020-04-29T18:22:59.000Z
|
test/Python/Compiler/type_inference.py
|
marbre/mlir-npcomp
|
30adf9e6b0c1e94db38050a9e143f20a5a461d17
|
[
"Apache-2.0"
] | null | null | null |
# RUN: %PYTHON %s | npcomp-opt -split-input-file -basicpy-type-inference | FileCheck %s --dump-input=fail
from npcomp.compiler import test_config
import_global = test_config.create_import_dump_decorator()
# CHECK-LABEL: func @arithmetic_expression
# CHECK-SAME: () -> i64
@import_global
def arithmetic_expression():
# CHECK: basicpy.binary_expr{{.*}} : (i64, i64) -> i64
# CHECK: basicpy.binary_expr{{.*}} : (i64, i64) -> i64
# CHECK: basicpy.binary_expr{{.*}} : (i64, i64) -> i64
# CHECK: basicpy.unknown_cast{{.*}} : i64 -> i64
# CHECK: return{{.*}} : i64
return 1 + 2 - 3 * 4
# CHECK-LABEL: func @arg_inference
# CHECK-SAME: (%arg0: i64, %arg1: i64) -> i64
@import_global
def arg_inference(a, b):
# CHECK: basicpy.binary_expr{{.*}} : (i64, i64) -> i64
# CHECK: basicpy.binary_expr{{.*}} : (i64, i64) -> i64
# CHECK: basicpy.unknown_cast{{.*}} : i64 -> i64
# CHECK: return{{.*}} : i64
return a + 2 * b
# CHECK-LABEL: func @conditional_inference
# CHECK-SAME: (%arg0: i64, %arg1: !basicpy.BoolType, %arg2: i64) -> !basicpy.BoolType
@import_global
def conditional_inference(cond, a, b):
# CHECK-NOT: UnknownType
return a if cond + 1 else not (b * 4)
| 32
| 105
| 0.654561
| 160
| 1,184
| 4.70625
| 0.325
| 0.103586
| 0.102258
| 0.146082
| 0.413015
| 0.413015
| 0.335989
| 0.335989
| 0.335989
| 0.335989
| 0
| 0.066532
| 0.162162
| 1,184
| 36
| 106
| 32.888889
| 0.69254
| 0.677365
| 0
| 0.272727
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.272727
| false
| 0
| 0.454545
| 0.272727
| 1
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 1
| 1
| 0
|
0
| 4
|
ec8974a09e42c122cd04de286650c63acbd53983
| 544
|
py
|
Python
|
pyspedas/mms/tests/validation/scm.py
|
MAVENSDC/pyspedas
|
05ede2603acb514bc7803be054016142c0851685
|
[
"MIT"
] | 1
|
2020-07-07T19:52:40.000Z
|
2020-07-07T19:52:40.000Z
|
pyspedas/mms/tests/validation/scm.py
|
MAVENSDC/pyspedas
|
05ede2603acb514bc7803be054016142c0851685
|
[
"MIT"
] | null | null | null |
pyspedas/mms/tests/validation/scm.py
|
MAVENSDC/pyspedas
|
05ede2603acb514bc7803be054016142c0851685
|
[
"MIT"
] | null | null | null |
from pyspedas import mms_load_scm
from pytplot import get_data
mms_load_scm()
t, d = get_data('mms1_scm_acb_gse_scsrvy_srvy_l2')
print(t[0:10].round(6).tolist())
print(d[10000].tolist())
print(d[50000].tolist())
print(d[100000].tolist())
print(d[200000].tolist())
print(d[300000].tolist())
print(d[400000].tolist())
print(d[500000].tolist())
print(d[600000].tolist())
print(d[700000].tolist())
print(d[800000].tolist())
print(d[900000].tolist())
print(d[1000000].tolist())
print(d[1500000].tolist())
print(d[2000000].tolist())
| 14.702703
| 50
| 0.702206
| 88
| 544
| 4.204545
| 0.420455
| 0.416216
| 0.454054
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.182365
| 0.082721
| 544
| 36
| 51
| 15.111111
| 0.559118
| 0
| 0
| 0
| 0
| 0
| 0.056985
| 0.056985
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.105263
| 0
| 0.105263
| 0.789474
| 0
| 0
| 0
| null | 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 1
|
0
| 4
|
ec998f3461ff848d48a9fd74a474645111e4a732
| 1,644
|
py
|
Python
|
transformation/functions/tonalfunctions/tonality_permutation_function.py
|
dpazel/music_rep
|
2f9de9b98b13df98f1a0a2120b84714725ce527e
|
[
"MIT"
] | 1
|
2021-05-06T19:45:54.000Z
|
2021-05-06T19:45:54.000Z
|
transformation/functions/tonalfunctions/tonality_permutation_function.py
|
dpazel/music_rep
|
2f9de9b98b13df98f1a0a2120b84714725ce527e
|
[
"MIT"
] | null | null | null |
transformation/functions/tonalfunctions/tonality_permutation_function.py
|
dpazel/music_rep
|
2f9de9b98b13df98f1a0a2120b84714725ce527e
|
[
"MIT"
] | null | null | null |
"""
File: tonality_permutation_function.py
Purpose: Class defining a function based on a permutation of a tonality's tones.
"""
from transformation.functions.tonalfunctions.tonal_function import TonalFunction
from transformation.functions.tonalfunctions.tonality_permutation import TonalityPermutation
class TonalityPermutationFunction(TonalFunction):
"""
Class implementation of a function based on a tonality permutation.
"""
def __init__(self, tonality_permutation, extension_map=None):
"""
Concstructor using a tonality permutation.
:param domain_tonality:
:param tonality_permutation: TonalityPermutation.
:param extension_map:
Note: the permutation_cycles is strictly used for initialization. During usage, settings and deletes may
change the mapping of the given tonality's tones.
"""
self._tonality_permutation = tonality_permutation
domain_tonality = tonality_permutation.tonality
primary_map = tonality_permutation.map
TonalFunction.__init__(self, domain_tonality, domain_tonality, primary_map, extension_map)
@staticmethod
def create(tonality, cycles, extension_map = None):
"""
Construction using a tonality and cycles.
:param tonality:
:param cycles:
:param extension_map:
:return:
"""
return TonalityPermutationFunction(TonalityPermutation(tonality, cycles), extension_map)
@property
def tonality_permutation(self):
return self._tonality_permutation
def __str__(self):
return str(self.tonality_permutation)
| 32.88
| 112
| 0.723236
| 167
| 1,644
| 6.88024
| 0.347305
| 0.21497
| 0.08007
| 0.02785
| 0.029591
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.213504
| 1,644
| 49
| 113
| 33.55102
| 0.888631
| 0.357664
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.25
| false
| 0
| 0.125
| 0.125
| 0.625
| 0
| 0
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 1
| 0
|
0
| 4
|
eca90320bde86d20e960c7c410d4d58f9955ed61
| 23
|
py
|
Python
|
src/iris/__init__.py
|
minhaz1/iris
|
6f251a915e77d7882db13d7900ae37324b077520
|
[
"BSD-2-Clause"
] | null | null | null |
src/iris/__init__.py
|
minhaz1/iris
|
6f251a915e77d7882db13d7900ae37324b077520
|
[
"BSD-2-Clause"
] | null | null | null |
src/iris/__init__.py
|
minhaz1/iris
|
6f251a915e77d7882db13d7900ae37324b077520
|
[
"BSD-2-Clause"
] | null | null | null |
__version__ = "1.0.36"
| 11.5
| 22
| 0.652174
| 4
| 23
| 2.75
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.2
| 0.130435
| 23
| 1
| 23
| 23
| 0.35
| 0
| 0
| 0
| 0
| 0
| 0.26087
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
01b774ac8cbffe9b27293fc638eb7e268f29e750
| 132
|
py
|
Python
|
app/resources/hello_world.py
|
daveflr/Flask-Restful-Template
|
2e6c5de0347bf82ccd3a4244202eee79d263d762
|
[
"MIT"
] | null | null | null |
app/resources/hello_world.py
|
daveflr/Flask-Restful-Template
|
2e6c5de0347bf82ccd3a4244202eee79d263d762
|
[
"MIT"
] | null | null | null |
app/resources/hello_world.py
|
daveflr/Flask-Restful-Template
|
2e6c5de0347bf82ccd3a4244202eee79d263d762
|
[
"MIT"
] | null | null | null |
from flask_restful import Resource
class HelloWorld(Resource):
@staticmethod
def get():
return {"hello": "world"}
| 16.5
| 34
| 0.666667
| 14
| 132
| 6.214286
| 0.928571
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.227273
| 132
| 7
| 35
| 18.857143
| 0.852941
| 0
| 0
| 0
| 0
| 0
| 0.075758
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.2
| true
| 0
| 0.2
| 0.2
| 0.8
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 1
| 0
| 0
|
0
| 4
|
bf1ef78ba4d3ce8d11e09c4693724f3af8f59630
| 23
|
py
|
Python
|
examples/py27-0026-set-literals2.py
|
jwilk-forks/python-grammar-changes
|
5cbc14e520fadfef8539760a4ffdbe14b9d02f39
|
[
"MIT"
] | 8
|
2020-11-21T22:39:41.000Z
|
2022-03-13T18:45:53.000Z
|
examples/py27-0026-set-literals2.py
|
jwilk-forks/python-grammar-changes
|
5cbc14e520fadfef8539760a4ffdbe14b9d02f39
|
[
"MIT"
] | 1
|
2021-12-10T10:45:38.000Z
|
2021-12-10T10:45:38.000Z
|
examples/py27-0026-set-literals2.py
|
jwilk-forks/python-grammar-changes
|
5cbc14e520fadfef8539760a4ffdbe14b9d02f39
|
[
"MIT"
] | 1
|
2022-02-07T11:16:38.000Z
|
2022-02-07T11:16:38.000Z
|
{i for i in range(3)}
| 7.666667
| 21
| 0.565217
| 6
| 23
| 2.166667
| 0.833333
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.058824
| 0.26087
| 23
| 2
| 22
| 11.5
| 0.705882
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
171142041890920f4a9b87780fb50ce13766b470
| 237
|
py
|
Python
|
tests/test_nsct.py
|
njarvis/nsct
|
acad19818ab097363e6fba1c1e75bf47c6a41381
|
[
"MIT"
] | 4
|
2018-02-26T04:46:09.000Z
|
2018-09-06T06:28:51.000Z
|
tests/test_nsct.py
|
njarvis/nsct
|
acad19818ab097363e6fba1c1e75bf47c6a41381
|
[
"MIT"
] | null | null | null |
tests/test_nsct.py
|
njarvis/nsct
|
acad19818ab097363e6fba1c1e75bf47c6a41381
|
[
"MIT"
] | null | null | null |
# -*- coding: utf-8 -*-
"""
test_nsct
----------------------------------
Tests for `nsct` module.
"""
class TestNsct(object):
@classmethod
def set_up(self):
pass
@classmethod
def tear_down(self):
pass
| 13.166667
| 34
| 0.485232
| 24
| 237
| 4.666667
| 0.791667
| 0.25
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.005618
| 0.248945
| 237
| 17
| 35
| 13.941176
| 0.623596
| 0.392405
| 0
| 0.571429
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.285714
| false
| 0.285714
| 0
| 0
| 0.428571
| 0
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
172e74efb205df7a3151a47e62e7fd3fd367fe10
| 1,307
|
bzl
|
Python
|
third_party/com_fasterxml_jackson_module.bzl
|
wix/exodus
|
dfb0c9713b07a8b6a49b548b7b543021e748d80b
|
[
"MIT"
] | 186
|
2019-06-05T01:02:53.000Z
|
2022-03-31T10:44:19.000Z
|
third_party/com_fasterxml_jackson_module.bzl
|
wix/exodus
|
dfb0c9713b07a8b6a49b548b7b543021e748d80b
|
[
"MIT"
] | 25
|
2019-06-04T23:18:55.000Z
|
2021-09-22T03:44:25.000Z
|
third_party/com_fasterxml_jackson_module.bzl
|
wix/exodus
|
dfb0c9713b07a8b6a49b548b7b543021e748d80b
|
[
"MIT"
] | 17
|
2019-06-04T18:45:19.000Z
|
2022-01-20T09:40:04.000Z
|
load("//:import_external.bzl", import_external = "safe_wix_scala_maven_import_external")
def dependencies():
import_external(
name = "com_fasterxml_jackson_module_jackson_module_paranamer",
artifact = "com.fasterxml.jackson.module:jackson-module-paranamer:2.9.6",
artifact_sha256 = "dfd66598c0094d9a7ef0b6e6bb3140031fc833f6cf2e415da27bc9357cdfe63b",
srcjar_sha256 = "375052d977a4647b49a8512a2e269f3296c455544f080a94bc8855dbfd24ad75",
deps = [
"@com_fasterxml_jackson_core_jackson_databind",
"@com_thoughtworks_paranamer_paranamer"
],
)
import_external(
name = "com_fasterxml_jackson_module_jackson_module_scala_2_12",
artifact = "com.fasterxml.jackson.module:jackson-module-scala_2.12:2.9.6",
artifact_sha256 = "c775854c1da6fc4602d5850b65513d18cb9d955b3c0f64551dd58ccb24a85aba",
srcjar_sha256 = "5446419113a48ceb4fa802cd785edfc06531ab32763d2a2f7906293d1e445957",
deps = [
"@com_fasterxml_jackson_core_jackson_annotations",
"@com_fasterxml_jackson_core_jackson_core",
"@com_fasterxml_jackson_core_jackson_databind",
"@com_fasterxml_jackson_module_jackson_module_paranamer",
"@org_scala_lang_scala_library",
"@org_scala_lang_scala_reflect"
],
)
| 42.16129
| 91
| 0.753634
| 119
| 1,307
| 7.731092
| 0.302521
| 0.141304
| 0.18587
| 0.13587
| 0.506522
| 0.436957
| 0.395652
| 0.180435
| 0.180435
| 0
| 0
| 0.175663
| 0.163734
| 1,307
| 30
| 92
| 43.566667
| 0.666057
| 0
| 0
| 0.307692
| 0
| 0.038462
| 0.661056
| 0.661056
| 0
| 0
| 0
| 0
| 0
| 1
| 0.038462
| true
| 0
| 0.115385
| 0
| 0.153846
| 0
| 0
| 0
| 0
| null | 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
173db5f145cdf33a6c0d4b3a0a022a091270db97
| 222
|
py
|
Python
|
proxy_overrides/related.py
|
datamade/django-proxy-overrides
|
d8ad7e7ba33507a77ee17444cb1da7a630e2b479
|
[
"BSD-3-Clause"
] | 7
|
2018-12-13T13:12:31.000Z
|
2021-06-15T14:34:36.000Z
|
proxy_overrides/related.py
|
datamade/django-proxy-overrides
|
d8ad7e7ba33507a77ee17444cb1da7a630e2b479
|
[
"BSD-3-Clause"
] | 5
|
2018-11-27T21:13:48.000Z
|
2020-05-15T12:24:49.000Z
|
proxy_overrides/related.py
|
datamade/django-proxy-overrides
|
d8ad7e7ba33507a77ee17444cb1da7a630e2b479
|
[
"BSD-3-Clause"
] | 4
|
2018-11-30T16:21:20.000Z
|
2019-09-17T23:03:51.000Z
|
from django.db.models import ForeignKey
from .base import ProxyField
class ProxyForeignKey(ProxyField):
def __init__(self, *args, **kwargs):
super(ProxyForeignKey, self).__init__(ForeignKey(*args, **kwargs))
| 27.75
| 74
| 0.743243
| 25
| 222
| 6.28
| 0.64
| 0.127389
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.13964
| 222
| 7
| 75
| 31.714286
| 0.82199
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.2
| false
| 0
| 0.4
| 0
| 0.8
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
|
0
| 4
|
173eb525ddbe7b3e57a2d6eb7b7a4aa5434fe599
| 225
|
py
|
Python
|
rangeesh/star_wars/admin.py
|
Rangeeshar/Django-Project
|
7f229c726a22228a335c6e993e3852f16c5552b1
|
[
"MIT"
] | null | null | null |
rangeesh/star_wars/admin.py
|
Rangeeshar/Django-Project
|
7f229c726a22228a335c6e993e3852f16c5552b1
|
[
"MIT"
] | null | null | null |
rangeesh/star_wars/admin.py
|
Rangeeshar/Django-Project
|
7f229c726a22228a335c6e993e3852f16c5552b1
|
[
"MIT"
] | null | null | null |
from django.contrib import admin
from star_wars.models import People, Species
@admin.register(People)
class PeopleAdmin(admin.ModelAdmin):
pass
@admin.register(Species)
class SpeciesAdmin(admin.ModelAdmin):
pass
| 16.071429
| 44
| 0.782222
| 28
| 225
| 6.25
| 0.571429
| 0.148571
| 0.217143
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.133333
| 225
| 13
| 45
| 17.307692
| 0.897436
| 0
| 0
| 0.25
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0.25
| 0.25
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
| 0
| 0
| 0
|
0
| 4
|
17586891f27f087e90f361d842150e56ba710561
| 158
|
py
|
Python
|
jrnl/__main__.py
|
TonyRoomZ/jrnl
|
75459bb9fcd19107d56b9560094137924e88959f
|
[
"MIT"
] | null | null | null |
jrnl/__main__.py
|
TonyRoomZ/jrnl
|
75459bb9fcd19107d56b9560094137924e88959f
|
[
"MIT"
] | null | null | null |
jrnl/__main__.py
|
TonyRoomZ/jrnl
|
75459bb9fcd19107d56b9560094137924e88959f
|
[
"MIT"
] | null | null | null |
#!/usr/bin/env python
# encoding: utf-8
from __future__ import absolute_import, unicode_literals
from . import cli
if __name__ == "__main__":
cli.run()
| 17.555556
| 56
| 0.727848
| 22
| 158
| 4.590909
| 0.818182
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.007519
| 0.158228
| 158
| 8
| 57
| 19.75
| 0.75188
| 0.227848
| 0
| 0
| 0
| 0
| 0.066667
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| true
| 0
| 0.5
| 0
| 0.5
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 1
| 0
| 0
| 0
|
0
| 4
|
1761fceb95910d0d663d2148909d3b1ac01da55d
| 284
|
py
|
Python
|
src/data_generator/day_ahead_extractors/pse/real_basic_data.py
|
BlooAM/Day-ahead-prices
|
e5c51682de4bb2b093fd6412b2131012e7e836ca
|
[
"MIT"
] | null | null | null |
src/data_generator/day_ahead_extractors/pse/real_basic_data.py
|
BlooAM/Day-ahead-prices
|
e5c51682de4bb2b093fd6412b2131012e7e836ca
|
[
"MIT"
] | null | null | null |
src/data_generator/day_ahead_extractors/pse/real_basic_data.py
|
BlooAM/Day-ahead-prices
|
e5c51682de4bb2b093fd6412b2131012e7e836ca
|
[
"MIT"
] | null | null | null |
from src.data_generator.day_ahead_extractors.pse.base_day_ahead_extractor import PseDataDayAheadExtractor
__all__ = ('RealBasicDataDayAheadExtractor',)
class RealBasicDataDayAheadExtractor(PseDataDayAheadExtractor):
def _get_prediction_flag(self) -> bool:
return False
| 31.555556
| 105
| 0.830986
| 27
| 284
| 8.259259
| 0.851852
| 0.071749
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.105634
| 284
| 8
| 106
| 35.5
| 0.877953
| 0
| 0
| 0
| 0
| 0
| 0.105634
| 0.105634
| 0
| 0
| 0
| 0
| 0
| 1
| 0.2
| false
| 0
| 0.2
| 0.2
| 0.8
| 0
| 1
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 1
| 0
|
0
| 4
|
1771546d9586b3e008225b64eba03c9691a016f2
| 28,053
|
py
|
Python
|
configuration/alexa_responses.py
|
gruporofex/alexa_rofex
|
338eb1e08da37a45f44eaab70a633e255d4b2be7
|
[
"Apache-2.0"
] | null | null | null |
configuration/alexa_responses.py
|
gruporofex/alexa_rofex
|
338eb1e08da37a45f44eaab70a633e255d4b2be7
|
[
"Apache-2.0"
] | null | null | null |
configuration/alexa_responses.py
|
gruporofex/alexa_rofex
|
338eb1e08da37a45f44eaab70a633e255d4b2be7
|
[
"Apache-2.0"
] | 1
|
2019-06-02T14:17:14.000Z
|
2019-06-02T14:17:14.000Z
|
# -*- coding: utf-8 -*-
"""
Alexa responses for the english version
"""
import config as conf
INIT_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Welcome to ROFEX Skill",
'card_output': "Please, tell me an instrument and I'll give you the last price "
"available for the contract. "
"If you need help asking me questions just say 'HELP'",
'speech_output': "<speak>Welcome to ROFEX Skill. "
"<s>Please, tell me an instrument and I'll give you the last price "
"available for the contract.</s> "
"<s>If you need help just say 'HELP'</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Bienvenido al Skill de ROFEX",
'card_output': "Por favor, dime un instrumento y te diré el último precio disponible para ese contrato. "
"Si necesitas ayuda solo dí la palabra 'AYUDA'",
'speech_output': "<speak>Bienvenido al Skill de ROFEX. "
"<s>Por favor, dime un instrumento y te diré el último precio disponible para ese contrato.</s> "
"<s>Si necesitas ayuda solo dí 'AYUDA'.</s></speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
DEFAULT_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Default Response",
'card_output': "Sorry, I didn't get that. Please repeat it.",
'speech_output': "Sorry, I didn't get that. Please repeat it.",
'reprompt_text': "Could you repeat it please?",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Respuesta Genérica",
'card_output': "Perdón, no entendí lo que dijiste. ¿Podrías repetirlo por favor?",
'speech_output': "Perdón, no entendí lo que dijiste. ¿Podrías repetirlo por favor?",
'reprompt_text': "¿Podrías repetirlo por favor?",
'should_end_session': False
}
}
ASK_INSTRUMENT_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Tell me the Instrument",
'card_output': "Please, tell me the instrument you want to know.",
'speech_output': "<speak>Please, tell me the instrument you want to know.</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'.",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Hasta luego",
'card_output': "Por favor, dime el instrumento que desas saber.",
'speech_output': "<speak>Por favor, dime el instrumento que deseas saber.</speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
END_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Bye Bye",
'card_output': "Thank you! Have a nice day.",
'speech_output': "Thank you! Have a nice day.",
'reprompt_text': "",
'should_end_session': True
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Hasta luego",
'card_output': "Gracias! Que tengas un lindo día.",
'speech_output': "Gracias! Que tengas un lindo día.",
'reprompt_text': "",
'should_end_session': True
}
}
LANGUAGE_NOT_SUPPORTED = {
'session_attributes': {},
'card_title': "Language Not Supported",
'card_output': "Sorry, I do not recognize this language: {0}.",
'speech_output': "<speak>Sorry, I don't recognize this language: {0}.</speak>",
'reprompt_text': "",
'should_end_session': True
}
ERROR_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "An Error Occurred",
'card_output': "Sorry, I couldn't process your request. Please, try again.",
'speech_output': "<speak><s>Sorry, an error has occurred and I couldn't process your request.</s> "
"Please, ask me again.</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Ocurrió un Error",
'card_output': "Lo siento, no pude procesar tu consulta. Por favor, inténtalo de nuevo.",
'speech_output': "<speak><s>Lo siento, ocurrió un error y no pude procesar tu consulta.</s> "
"Por favor, inténtalo de nuevo.</speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
LAST_PRICE_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "ROFEX Price",
'card_output': "",
'speech_output': "",
'reprompt_text': "",
'should_end_session': False
},
conf.Language.ES: {
'session_attributes': {},
'card_title': "Precios ROFEX",
'card_output': "",
'speech_output': "",
'reprompt_text': "",
'should_end_session': False
}
}
LAST_PRICE_OK_RESPONSE = {
conf.Language.EN : {
'card_output': "The price for {0} future {1} contract is {2}. "
"Can I help you with another instrument?",
'speech_output': '<speak><s>The price for {0} future {1} contract is {2}.</s> '
'<break time="1s"/>Can I help you with another instrument?</speak>',
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "El precio para el futuro de {0} posición {1} es {2}. "
"¿Puedo ayudarte con otro instrumento?",
'speech_output': '<speak><s>El precio para el futuro de {0} posición {1} es {2}.</s> '
'<break time="1s"/>¿Puedo ayudarte con otro instrumento?</speak>',
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'."
}
}
LAST_PRICE_OK_RESPONSE_SPOT = {
conf.Language.EN : {
'card_output': "Last price for {0} is {1}. "
"Can I help you with another instrument?",
'speech_output': "<speak><s>Last price for {0} is {1}.</s> "
"<break time='1s'/>Can I help you with another instrument?</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "El último precio para el {0} es {1}. "
"¿Quieres consultarme otro instrumento?",
'speech_output': "<speak><s>El último precio para el {0} es {1}.</s> "
"<break time='1s'/>¿Quieres consultarme otro instrumento?</speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'."
}
}
ENTRY_PRICE_OK_RESPONSE = {
conf.Language.EN : {
'card_output': "{0} for {1} future {2} contract is {3}. Want to try it again?",
'speech_output': "<speak><s>{0} for {1} future {2} contract is {3}.</s> "
"<break time='1s'/>Can I help you with another instrument?</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "El {0} para el futuro de {1} posición {2} es {3}. "
"¿Quieres consultarme otro instrumento?",
'speech_output': "<speak><s>El {0} para el futuro de {1} posición {2} es {3}.</s> "
"<break time='1s'/>¿Quieres consultarme otro instrumento?</speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'."
}
}
LAST_PRICE_ERROR_RESPONSE = {
conf.Language.EN : {
'card_output': "Sorry, this is not a valid instrument. Please ask me again.",
'speech_output': "<speak><s>Sorry, this is not a valid instrument.</s> Please, try with another instrument.</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "Perdón, ese no es un instrumento válido. Por favor, intenta con otro instrumento.",
'speech_output': "<speak><s>Perdón, ese no es un instrumento válido.</s> Por favor, intenta con otro instrumento.</speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'."
}
}
LAST_PRICE_INSTRUMENT_NOT_FOUND_RESPONSE = {
conf.Language.EN : {
'card_output': "I could not find a valid instrument for {0} future {1} contract. "
"The most recent position for this instrument is {2}. "
"Please try again with this position.",
'speech_output': "<speak><s>I could not find a valid instrument for {0} future {1} contract.</s> "
"<s>The most recent position for this instrument is {2}</s>. "
"<s>Please try again with this position.</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "El futuro de {0} no posee una posición abierta para el mes de {1}. "
"La posición más reciente para este instrumento es {2}. "
"Por favor, intenta de vuelta con dicha posición.",
'speech_output': "<speak><s>El futuro de {0} no posee una posición abierta para el mes de {1}.</s> "
"<s>La posición más reciente para este instrumento es {2}.</s> "
"<s>Por favor, intenta de vuelta con dicha posición.</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'."
}
}
LAST_PRICE_MD_NOT_FOUND_RESPONSE = {
conf.Language.EN : {
'card_output': "Sorry, there are no data available for {0} future {1} contract. "
"Please, try again with another instrument.",
'speech_output': "<speak>Sorry, there are no data available for {0} future {1} contract. "
"Please, try again with another instrument.</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "Perdón, en estos momentos no hay datos disponible para el futuro de {0} posición {1}. "
"¿Quieres consultarme otro instrumento?",
'speech_output': "<speak><s>Perdón, no hay datos disponible para este futuro todavía.</s> "
"¿Quieres consultarme otro instrumento?</speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'."
}
}
ENTRY_PRICE_MD_NOT_FOUND_RESPONSE = {
conf.Language.EN : {
'card_output': "Sorry, {0} is not available for this instrument now. "
"Please, try again with another data or instrument.",
'speech_output': "<speak><s>Sorry, {0} is not available for this instrument now.</s> "
"<s>Please, try again with another data or instrument.</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'"
},
conf.Language.ES: {
'card_output': "Perdón, en este momento no hay {0} disponible para este instrumento. "
"Por favor, intentalo de nuevo con otro dato o instrumento.",
'speech_output': "<speak><s>Perdón, en este momento no hay {0} disponible para este instrumento.</s> "
"<s>Por favor, intentalo de nuevo con otro dato o instrumento.</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'."
}
}
###############################################################################################
###############################################################################################
# 1 - Help Possibilities
HELP_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Help!",
'card_output': "If you want to know how to ask the price of an instrument, "
"say 'Question' and I'll help you. "
"Also, I can tell you the list of valid instruments, just say 'Instruments', "
"and to know the list of available data of an "
"instruments, say 'Instruments Data'. Want to try it?",
'speech_output': "<speak>If you want to know how to ask the price of an instrument, say "
"<s><prosody volume='x-loud'>'Question'</prosody></s> "
"and I'll help you. Also, I can tell you the list of valid instruments, just say "
"<s><prosody volume='x-loud'>'Instruments'</prosody></s>, "
"and to know the list of available data of an instrument, say "
"<s><prosody volume='x-loud'>'Instruments Data'</prosody></s>. "
"<break time='1s'/>Want to try it?</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "AYUDA!",
'card_output': "Si quieres saber como preguntarme el precio de un instrumento, "
"dime 'Preguntar' y te ayudaré. "
"También te puedo decir la lista de instrumentos válidos, "
"solo dí 'Instrumentos', "
"y para conocer la lista de datos disponibles sobre "
"un instrumento, dí 'Datos Instrumentos'. "
"¿Quieres intentarlo?",
'speech_output': "<speak>Si quieres saber como preguntarme el precio de un instrumento, dime "
"<s><prosody volume='x-loud'>'Preguntar'</prosody></s>"
" y te ayudaré. También te puedo decir la lista de instrumentos válidos, solo dí "
"<s><prosody volume='x-loud'>'Instrumentos'</prosody></s>"
", y para conocer la lista de datos disponibles sobre un instrumento, dí "
"<s><prosody volume='x-loud'>'Datos Instrumentos'</prosody></s>. "
"<break time='1s'/>¿Quieres intentarlo?</speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
# 1.1 - Question Response
QUESTION_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "How to ask me?",
'card_output': "To know the price of an instrument just tell me "
"the instrument's name and, optionally, "
"the month of the contract. Additionally, "
"you could specify the market data you want to know. "
"Want to try it?",
'speech_output': "<speak><s>To know the price of an instrument just tell me "
"the instrument's name and, optionally, "
"the month of the contract.</s> <s>Additionally, "
"you could specify the market data you want to know.</s> "
"<break time='1s'/>Want to try it?</speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Como preguntar?",
'card_output': "Para saber el precio de un instrumento solo tienes que "
"decirme el nombre del instrumento y, opcionalmente, "
"el mes del contrato. Adicionalmente, puedes especificar "
"el dato de mercado que deseas saber. "
"¿Quieres intentarlo?",
'speech_output': "<speak><s>Para saber el precio de un instrumento solo tienes que "
"decirme el nombre del instrumento y, opcionalmente, "
"el mes del contrato.</s> <s>Adicionalmente, puedes especificar "
"el dato de mercado que deseas saber.</s> "
"<break time='1s'/>¿Quieres intentarlo?</speak>",
'reprompt_text': "Si deseas terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
# 1.2 - Instruments List Response
INSTRUMENT_LIST_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Instruments List",
'card_output': "You can ask me for the following instruments: "
"Dollar: for dollar futures. "
"ROFEX Index: for ROFEX 20 Index futures. "
"Gold: for gold futures. "
"Oil: for oil futures. "
"Soybean: for soybean futures. "
"Corn: for corn futures. "
"Wheat: for wheat futures. "
"If you want more details about any instrument "
"just say 'Help' and the name of the instrument. "
"Want to try it?",
'speech_output': "<speak><s>You can ask me for the following instruments:</s> "
"<s><prosody volume='x-loud'>Dollar</prosody>: for dollar futures.</s> "
"<s><prosody volume='x-loud'>ROFEX Index</prosody>: for ROFEX 20 Index futures.</s> "
"<s><prosody volume='x-loud'>Gold</prosody>: for gold futures.</s> "
"<s><prosody volume='x-loud'>Oil</prosody>: for oil futures.</s> "
"<s><prosody volume='x-loud'>Soybean</prosody>: for soybean futures.</s> "
"<s><prosody volume='x-loud'>Corn</prosody>: for corn futures.</s> "
"<s><prosody volume='x-loud'>Wheat</prosody>: for wheat futures.</s> "
"<s>If you want more details about any instrument "
"just say <s><prosody volume='x-loud'>'Help'</prosody></s> and the name of the instrument.</s> "
"<break time='1s'/><s>Want to try it?</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Lista Instrumentos",
'card_output': "Puedes consultarme los siguientes instrumentos: "
"Dólar: para futuros de dólar. "
"Índice ROFEX: para futuros sobre el Índice ROFEX 20. "
"Oro: para futuros de oro. "
"Petróleo: para futuros de petróleo. "
"Soja: para futuros de soja. "
"Maíz: para futuros de maíz. "
"Trigo: para futuros de trigo. "
"Si quieres saber más detalles acerca de algún instrumento "
"solo dí 'Ayuda' y el nombre del instrumento. "
"¿Quieres intentarlo?",
'speech_output': "<speak>Puedes consultarme los siguientes instrumentos: "
"<s><prosody volume='x-loud'>Dólar</prosody>: para futuros de dólar.</s> "
"<s><prosody volume='x-loud'>Índice ROFEX</prosody>: para futuros sobre el Índice ROFEX 20.</s> "
"<s><prosody volume='x-loud'>Oro</prosody>: para futuros de oro.</s> "
"<s><prosody volume='x-loud'>Petróleo</prosody>: para futuros de petróleo.</s> "
"<s><prosody volume='x-loud'>Soja</prosody>: para futuros de soja.</s> "
"<s><prosody volume='x-loud'>Maíz</prosody>: para futuros de maíz.</s> "
"<s><prosody volume='x-loud'>Trigo</prosody>: para futuros de trigo.</s> "
"<s>Si quieres saber más detalles acerca de algún instrumento "
"solo dí <prosody volume='x-loud'>'Ayuda'</prosody> y el nombre del instrumento.</s> "
"<break time='1s'/><s>¿Quieres intentarlo?</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
# 1.2.1 - Instruments Detailed Response
HELP_RELATED_INST_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Instrument Detail",
'card_output': "Ok, when you mention the instrument '{0}', I will tell you "
"the last price available for the contract. "
"Also, let me tell you that there are other {0} "
"related instruments, like: {1}. "
"Just tell me the instrument full name and I will tell you the price. "
"Want to try it?",
'speech_output': "<speak><s>Ok, when you mention the instrument <prosody volume='x-loud'>'{0}'</prosody>, "
"I will tell you the last price available for the contract.</s> "
"<s>Also, let me tell you that there are other {0} "
"related instruments, like:</s> {1}. "
"<s>Just tell me the instrument full name and I will tell you the price.</s> "
"<break time='1s'/><s>Want to try it?</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Detalle Instrumento",
'card_output': "Bien, cuando menciones el instrumento '{0}' te diré el "
"último percio disponible para ese contrato. "
"También puedes consultar otros instrumentos relacionados con {0} como: {1}. "
"Solo dí el nombre del instrumento completo y te diré el precio. "
"¿Quieres intentarlo?",
'speech_output': "<speak><s>Bien, cuando menciones el instrumento <prosody volume='x-loud'>'{0}'</prosody> "
"te diré el último percio disponible para ese contrato.</s> "
"<s>También puedes consultar otros instrumentos relacionados con {0} como:</s> {1}. "
"<s>Solo dí el nombre del instrumento completo y te diré el precio.</s> "
"<break time='1s'/><s>¿Quieres intentarlo?</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
# 1.2.2 - Instruments Detailed Response Default
HELP_INSTRUMENT_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Instrument Detail",
'card_output': "Ok, when you mention the instrument '{0}', I will tell you "
"the last price available for the contract. For example, to know the "
"price of {0} future June contract, just say '{0} June'. "
"Want to try it?",
'speech_output': "<speak><s>Ok, when you mention the instrument <prosody volume='x-loud'>'{0}'</prosody>, "
"I will tell you the last price available for the contract.</s> <s>For example, to know the "
"price of {0} future June contract, just say <prosody volume='x-loud'>'{0} June'</prosody>.</s> "
"<break time='1s'/><s>Want to try it?</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Detalle Instrumento",
'card_output': "Bien, cuando menciones el instrumento '{0}' te diré el "
"último percio disponible para ese contrato. Por ejemplo, para saber "
"el precio del futuro sobre {0} posición Junio, "
"solo tienes que decir '{0} Junio'. ¿Quieres intentarlo?",
'speech_output': "<speak><s>Bien, cuando menciones el instrumento <prosody volume='x-loud'>'{0}'</prosody>"
" te diré el último percio disponible para ese contrato.</s> <s>Por ejemplo, para saber "
"el precio del futuro sobre {0} posición Junio, solo tienes que decir "
"<prosody volume='x-loud'>'{0} Junio'</prosody>.</s>"
"<break time='1s'/><s>¿Quieres intentarlo?</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
# 1.3 - Market Data List
ENTRY_LIST_RESPONSE = {
conf.Language.EN : {
'session_attributes': {},
'card_title': "Market Data List",
'card_output': "When asking for an instrument you could also "
"specify the market data you want to know about. "
"Now, the available data are: "
"Last Price, Settlement Price, Effective Volume, "
"Nominal Volume and Open Interest. "
"Want to try it?",
'speech_output': "<speak><s>When asking for an instrument you could also "
"specify the market data you want to know about.</s> "
"<s>Now, the available data are:</s> "
"<prosody volume='x-loud'>Last Price</prosody>, "
"<prosody volume='x-loud'>Settlement Price</prosody>, "
"<prosody volume='x-loud'>Effective Volume</prosody>, "
"<prosody volume='x-loud'>Nominal Volume</prosody> and "
"<prosody volume='x-loud'>Open Interest</prosody>. "
"<break time='1s'/><s>Want to try it?</s></speak>",
'reprompt_text': "If you want to end the conversation just say 'Goodbye'",
'should_end_session': False
},
conf.Language.ES : {
'session_attributes': {},
'card_title': "Lista Datos de Mercado",
'card_output': "Al consultar un instrumento también puedes especificar "
"el dato de mercado que deseas saber. "
"Por ahora, los datos disponibles son: "
"Último Precio, Precio de Ajuste, Volumen Efectivo, "
"Volumen Nominal e Interés Abierto. "
"¿Quieres intentarlo?",
'speech_output': "<speak><s>Al consultar un instrumento también puedes especificar "
"el dato de mercado que deseas saber.</s> "
"<s>Por ahora, los datos disponibles son:</s> "
"<prosody volume='x-loud'>Último Precio</prosody>, "
"<prosody volume='x-loud'>Precio de Ajuste</prosody>, "
"<prosody volume='x-loud'>Volumen Efectivo</prosody>, "
"<prosody volume='x-loud'>Volumen Nominal</prosody> e "
"<prosody volume='x-loud'>Interés Abierto</prosody>. "
"<break time='1s'/><s>¿Quieres intentarlo?</s></speak>",
'reprompt_text': "Si quieres terminar la conversación solo dí 'Adiós Alexa'.",
'should_end_session': False
}
}
| 53.741379
| 131
| 0.554807
| 3,304
| 28,053
| 4.637107
| 0.092918
| 0.025455
| 0.034724
| 0.044645
| 0.841916
| 0.789961
| 0.727629
| 0.678611
| 0.622544
| 0.573331
| 0
| 0.006471
| 0.316971
| 28,053
| 521
| 132
| 53.84453
| 0.791921
| 0.00884
| 0
| 0.376299
| 0
| 0.060291
| 0.653272
| 0.048699
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| false
| 0
| 0.002079
| 0
| 0.002079
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 1
| 1
| 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0
| null | 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
|
0
| 4
|
178fc4bc5799fef4d49a269da036bef10307919b
| 217
|
py
|
Python
|
math/average.py
|
parmalatinter/ai
|
2bf7ae17013e8ae48d62b4c2892ee3a1d0a21648
|
[
"MIT"
] | null | null | null |
math/average.py
|
parmalatinter/ai
|
2bf7ae17013e8ae48d62b4c2892ee3a1d0a21648
|
[
"MIT"
] | 7
|
2021-03-25T23:01:51.000Z
|
2022-03-12T00:26:49.000Z
|
math/average.py
|
parmalatinter/ai
|
2bf7ae17013e8ae48d62b4c2892ee3a1d0a21648
|
[
"MIT"
] | null | null | null |
#!/usr/bin/env python
# 平均の求め方
def Average(numList):
return sum(numList) / len(numList)
def main():
numList = [1, 2, 3]
print(Average(numList))
if __name__ == "__main__":
main()
| 12.764706
| 39
| 0.562212
| 26
| 217
| 4.384615
| 0.692308
| 0.245614
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0.019355
| 0.285714
| 217
| 16
| 40
| 13.5625
| 0.716129
| 0.124424
| 0
| 0
| 0
| 0
| 0.046512
| 0
| 0
| 0
| 0
| 0
| 0
| 1
| 0.285714
| false
| 0
| 0
| 0.142857
| 0.428571
| 0.142857
| 1
| 0
| 0
| null | 1
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| 0
| null | 0
| 0
| 0
| 0
| 0
| 1
| 0
| 0
| 0
| 1
| 0
| 0
|
0
| 4
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.