|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
import collections |
|
|
import os |
|
|
import re |
|
|
import pkg_resources |
|
|
from typing import List |
|
|
from transformers import BertTokenizer |
|
|
from logging import getLogger |
|
|
|
|
|
logger = getLogger(__name__) |
|
|
""" |
|
|
SMI_REGEX_PATTERN: str |
|
|
SMILES regex pattern for tokenization. Designed by Schwaller et. al. |
|
|
|
|
|
References |
|
|
|
|
|
.. [1] Philippe Schwaller, Teodoro Laino, Théophile Gaudin, Peter Bolgar, Christopher A. Hunter, Costas Bekas, and Alpha A. Lee |
|
|
ACS Central Science 2019 5 (9): Molecular Transformer: A Model for Uncertainty-Calibrated Chemical Reaction Prediction |
|
|
1572-1583 DOI: 10.1021/acscentsci.9b00576 |
|
|
|
|
|
""" |
|
|
|
|
|
SMI_REGEX_PATTERN = r"""(\[[^\]]+]|Br?|Cl?|N|O|S|P|F|I|b|c|n|o|s|p|\(|\)|\.|=|#|-|\+|\\|\/|:|~|@|\?|>>?|\*|\$|\%[0-9]{2}|[0-9])""" |
|
|
|
|
|
|
|
|
VOCAB_FILES_NAMES = {"vocab_file": "vocab.txt"} |
|
|
|
|
|
|
|
|
def get_default_tokenizer(): |
|
|
default_vocab_path = pkg_resources.resource_filename( |
|
|
"deepchem", "feat/tests/vocab.txt" |
|
|
) |
|
|
return SmilesTokenizer(default_vocab_path) |
|
|
|
|
|
|
|
|
class SmilesTokenizer(BertTokenizer): |
|
|
""" |
|
|
Creates the SmilesTokenizer class. The tokenizer heavily inherits from the BertTokenizer |
|
|
implementation found in Huggingface's transformers library. It runs a WordPiece tokenization |
|
|
algorithm over SMILES strings using the tokenisation SMILES regex developed by Schwaller et. al. |
|
|
|
|
|
Please see https://github.com/huggingface/transformers |
|
|
and https://github.com/rxn4chemistry/rxnfp for more details. |
|
|
|
|
|
Examples |
|
|
-------- |
|
|
>>> from deepchem.feat.smiles_tokenizer import SmilesTokenizer |
|
|
>>> current_dir = os.path.dirname(os.path.realpath(__file__)) |
|
|
>>> vocab_path = os.path.join(current_dir, 'tests/data', 'vocab.txt') |
|
|
>>> tokenizer = SmilesTokenizer(vocab_path) |
|
|
>>> print(tokenizer.encode("CC(=O)OC1=CC=CC=C1C(=O)O")) |
|
|
[12, 16, 16, 17, 22, 19, 18, 19, 16, 20, 22, 16, 16, 22, 16, 16, 22, 16, 20, 16, 17, 22, 19, 18, 19, 13] |
|
|
|
|
|
|
|
|
References |
|
|
---------- |
|
|
.. [1] Schwaller, Philippe; Probst, Daniel; Vaucher, Alain C.; Nair, Vishnu H; Kreutter, David; |
|
|
Laino, Teodoro; et al. (2019): Mapping the Space of Chemical Reactions using Attention-Based Neural |
|
|
Networks. ChemRxiv. Preprint. https://doi.org/10.26434/chemrxiv.9897365.v3 |
|
|
|
|
|
Notes |
|
|
---- |
|
|
This class requires huggingface's transformers and tokenizers libraries to be installed. |
|
|
""" |
|
|
|
|
|
vocab_files_names = VOCAB_FILES_NAMES |
|
|
|
|
|
def __init__( |
|
|
self, |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
**kwargs |
|
|
): |
|
|
"""Constructs a SmilesTokenizer. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
vocab_file: str |
|
|
Path to a SMILES character per line vocabulary file. |
|
|
Default vocab file is found in deepchem/feat/tests/data/vocab.txt |
|
|
""" |
|
|
|
|
|
vocab_file = os.path.join(os.path.dirname(__file__), "data", "vocab.txt") |
|
|
|
|
|
super().__init__(vocab_file, **kwargs) |
|
|
|
|
|
self.sos = "[SOS]" |
|
|
self.eos = "[EOS]" |
|
|
|
|
|
if not os.path.isfile(vocab_file): |
|
|
raise ValueError("Can't find a vocab file at path '{}'.".format(vocab_file)) |
|
|
self.vocab = load_vocab(vocab_file) |
|
|
self.highest_unused_index = max( |
|
|
[i for i, v in enumerate(self.vocab.keys()) if v.startswith("[unused")] |
|
|
) |
|
|
self.ids_to_tokens = collections.OrderedDict( |
|
|
[(ids, tok) for tok, ids in self.vocab.items()] |
|
|
) |
|
|
self.basic_tokenizer = BasicSmilesTokenizer() |
|
|
|
|
|
@property |
|
|
def vocab_size(self): |
|
|
return len(self.vocab) |
|
|
|
|
|
@property |
|
|
def vocab_list(self): |
|
|
return list(self.vocab.keys()) |
|
|
|
|
|
def _tokenize(self, text: str): |
|
|
""" |
|
|
Tokenize a string into a list of tokens. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
text: str |
|
|
Input string sequence to be tokenized. |
|
|
""" |
|
|
|
|
|
split_tokens = [token for token in self.basic_tokenizer.tokenize(text)] |
|
|
return split_tokens |
|
|
|
|
|
def _convert_token_to_id(self, token): |
|
|
""" |
|
|
Converts a token (str/unicode) in an id using the vocab. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
token: str |
|
|
String token from a larger sequence to be converted to a numerical id. |
|
|
""" |
|
|
|
|
|
return self.vocab.get(token, self.vocab.get(self.unk_token)) |
|
|
|
|
|
def _convert_id_to_token(self, index): |
|
|
""" |
|
|
Converts an index (integer) in a token (string/unicode) using the vocab. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
index: int |
|
|
Integer index to be converted back to a string-based token as part of a larger sequence. |
|
|
""" |
|
|
|
|
|
return self.ids_to_tokens.get(index, self.unk_token) |
|
|
|
|
|
def convert_tokens_to_string(self, tokens: List[str]): |
|
|
"""Converts a sequence of tokens (string) in a single string. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
tokens: List[str] |
|
|
List of tokens for a given string sequence. |
|
|
|
|
|
Returns |
|
|
------- |
|
|
out_string: str |
|
|
Single string from combined tokens. |
|
|
""" |
|
|
|
|
|
out_string: str = " ".join(tokens).replace(" ##", "").strip() |
|
|
return out_string |
|
|
|
|
|
def add_special_tokens_ids_single_sequence(self, token_ids: List[int]): |
|
|
""" |
|
|
Adds special tokens to the a sequence for sequence classification tasks. |
|
|
A BERT sequence has the following format: [CLS] X [SEP] |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
|
|
|
token_ids: list[int] |
|
|
list of tokenized input ids. Can be obtained using the encode or encode_plus methods. |
|
|
""" |
|
|
|
|
|
return [self.cls_token_id] + token_ids + [self.sep_token_id] |
|
|
|
|
|
def add_special_tokens_single_sequence(self, tokens: List[str]): |
|
|
""" |
|
|
Adds special tokens to the a sequence for sequence classification tasks. |
|
|
A BERT sequence has the following format: [CLS] X [SEP] |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
tokens: List[str] |
|
|
List of tokens for a given string sequence. |
|
|
|
|
|
""" |
|
|
return [self.cls_token] + tokens + [self.sep_token] |
|
|
|
|
|
def add_special_tokens_ids_sequence_pair( |
|
|
self, token_ids_0: List[int], token_ids_1: List[int] |
|
|
) -> List[int]: |
|
|
""" |
|
|
Adds special tokens to a sequence pair for sequence classification tasks. |
|
|
A BERT sequence pair has the following format: [CLS] A [SEP] B [SEP] |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
token_ids_0: List[int] |
|
|
List of ids for the first string sequence in the sequence pair (A). |
|
|
|
|
|
token_ids_1: List[int] |
|
|
List of tokens for the second string sequence in the sequence pair (B). |
|
|
""" |
|
|
|
|
|
sep = [self.sep_token_id] |
|
|
cls = [self.cls_token_id] |
|
|
|
|
|
return cls + token_ids_0 + sep + token_ids_1 + sep |
|
|
|
|
|
def add_padding_tokens( |
|
|
self, token_ids: List[int], length: int, right: bool = True |
|
|
) -> List[int]: |
|
|
""" |
|
|
Adds padding tokens to return a sequence of length max_length. |
|
|
By default padding tokens are added to the right of the sequence. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
token_ids: list[int] |
|
|
list of tokenized input ids. Can be obtained using the encode or encode_plus methods. |
|
|
|
|
|
length: int |
|
|
|
|
|
right: bool (True by default) |
|
|
|
|
|
Returns |
|
|
---------- |
|
|
token_ids : |
|
|
list of tokenized input ids. Can be obtained using the encode or encode_plus methods. |
|
|
|
|
|
padding: int |
|
|
Integer to be added as padding token |
|
|
|
|
|
""" |
|
|
padding = [self.pad_token_id] * (length - len(token_ids)) |
|
|
|
|
|
if right: |
|
|
return token_ids + padding |
|
|
else: |
|
|
return padding + token_ids |
|
|
|
|
|
def save_vocabulary( |
|
|
self, vocab_path: str |
|
|
): |
|
|
""" |
|
|
Save the tokenizer vocabulary to a file. |
|
|
|
|
|
Parameters |
|
|
---------- |
|
|
vocab_path: obj: str |
|
|
The directory in which to save the SMILES character per line vocabulary file. |
|
|
Default vocab file is found in deepchem/feat/tests/data/vocab.txt |
|
|
|
|
|
Returns |
|
|
---------- |
|
|
vocab_file: :obj:`Tuple(str)`: |
|
|
Paths to the files saved. |
|
|
typle with string to a SMILES character per line vocabulary file. |
|
|
Default vocab file is found in deepchem/feat/tests/data/vocab.txt |
|
|
|
|
|
""" |
|
|
index = 0 |
|
|
if os.path.isdir(vocab_path): |
|
|
vocab_file = os.path.join(vocab_path, VOCAB_FILES_NAMES["vocab_file"]) |
|
|
else: |
|
|
vocab_file = vocab_path |
|
|
with open(vocab_file, "w", encoding="utf-8") as writer: |
|
|
for token, token_index in sorted(self.vocab.items(), key=lambda kv: kv[1]): |
|
|
if index != token_index: |
|
|
logger.warning( |
|
|
"Saving vocabulary to {}: vocabulary indices are not consecutive." |
|
|
" Please check that the vocabulary is not corrupted!".format( |
|
|
vocab_file |
|
|
) |
|
|
) |
|
|
index = token_index |
|
|
writer.write(token + "\n") |
|
|
index += 1 |
|
|
return (vocab_file,) |
|
|
|
|
|
|
|
|
class BasicSmilesTokenizer(object): |
|
|
""" |
|
|
|
|
|
Run basic SMILES tokenization using a regex pattern developed by Schwaller et. al. This tokenizer is to be used |
|
|
when a tokenizer that does not require the transformers library by HuggingFace is required. |
|
|
|
|
|
Examples |
|
|
-------- |
|
|
>>> from deepchem.feat.smiles_tokenizer import BasicSmilesTokenizer |
|
|
>>> tokenizer = BasicSmilesTokenizer() |
|
|
>>> print(tokenizer.tokenize("CC(=O)OC1=CC=CC=C1C(=O)O")) |
|
|
['C', 'C', '(', '=', 'O', ')', 'O', 'C', '1', '=', 'C', 'C', '=', 'C', 'C', '=', 'C', '1', 'C', '(', '=', 'O', ')', 'O'] |
|
|
|
|
|
|
|
|
References |
|
|
---------- |
|
|
.. [1] Philippe Schwaller, Teodoro Laino, Théophile Gaudin, Peter Bolgar, Christopher A. Hunter, Costas Bekas, and Alpha A. Lee |
|
|
ACS Central Science 2019 5 (9): Molecular Transformer: A Model for Uncertainty-Calibrated Chemical Reaction Prediction |
|
|
1572-1583 DOI: 10.1021/acscentsci.9b00576 |
|
|
|
|
|
""" |
|
|
|
|
|
def __init__(self, regex_pattern: str = SMI_REGEX_PATTERN): |
|
|
"""Constructs a BasicSMILESTokenizer. |
|
|
Parameters |
|
|
---------- |
|
|
|
|
|
regex: string |
|
|
SMILES token regex |
|
|
|
|
|
""" |
|
|
self.regex_pattern = regex_pattern |
|
|
self.regex = re.compile(self.regex_pattern) |
|
|
|
|
|
def tokenize(self, text): |
|
|
"""Basic Tokenization of a SMILES.""" |
|
|
tokens = [token for token in self.regex.findall(text)] |
|
|
return tokens |
|
|
|
|
|
|
|
|
def load_vocab(vocab_file): |
|
|
"""Loads a vocabulary file into a dictionary.""" |
|
|
vocab = collections.OrderedDict() |
|
|
with open(vocab_file, "r", encoding="utf-8") as reader: |
|
|
tokens = reader.readlines() |
|
|
for index, token in enumerate(tokens): |
|
|
token = token.rstrip("\n") |
|
|
vocab[token] = index |
|
|
return vocab |
|
|
|
|
|
|
|
|
class BasicSmilesTokenizer(object): |
|
|
""" |
|
|
|
|
|
Run basic SMILES tokenization using a regex pattern developed by Schwaller et. al. This tokenizer is to be used |
|
|
when a tokenizer that does not require the transformers library by HuggingFace is required. |
|
|
|
|
|
Examples |
|
|
-------- |
|
|
>>> from deepchem.feat.smiles_tokenizer import BasicSmilesTokenizer |
|
|
>>> tokenizer = BasicSmilesTokenizer() |
|
|
>>> print(tokenizer.tokenize("CC(=O)OC1=CC=CC=C1C(=O)O")) |
|
|
['C', 'C', '(', '=', 'O', ')', 'O', 'C', '1', '=', 'C', 'C', '=', 'C', 'C', '=', 'C', '1', 'C', '(', '=', 'O', ')', 'O'] |
|
|
|
|
|
|
|
|
References |
|
|
---------- |
|
|
.. [1] Philippe Schwaller, Teodoro Laino, Théophile Gaudin, Peter Bolgar, Christopher A. Hunter, Costas Bekas, and Alpha A. Lee |
|
|
ACS Central Science 2019 5 (9): Molecular Transformer: A Model for Uncertainty-Calibrated Chemical Reaction Prediction |
|
|
1572-1583 DOI: 10.1021/acscentsci.9b00576 |
|
|
|
|
|
""" |
|
|
|
|
|
def __init__(self, regex_pattern: str = SMI_REGEX_PATTERN): |
|
|
"""Constructs a BasicSMILESTokenizer. |
|
|
Parameters |
|
|
---------- |
|
|
|
|
|
regex: string |
|
|
SMILES token regex |
|
|
|
|
|
""" |
|
|
self.regex_pattern = regex_pattern |
|
|
self.regex = re.compile(self.regex_pattern) |
|
|
|
|
|
def tokenize(self, text): |
|
|
"""Basic Tokenization of a SMILES.""" |
|
|
tokens = [token for token in self.regex.findall(text)] |
|
|
return tokens |
|
|
|
|
|
|
|
|
def load_vocab(vocab_file): |
|
|
"""Loads a vocabulary file into a dictionary.""" |
|
|
vocab = collections.OrderedDict() |
|
|
with open(vocab_file, "r", encoding="utf-8") as reader: |
|
|
tokens = reader.readlines() |
|
|
for index, token in enumerate(tokens): |
|
|
token = token.rstrip("\n") |
|
|
vocab[token] = index |
|
|
return vocab |
|
|
|
|
|
|
|
|
if __name__ == "__main__": |
|
|
current_dir = os.path.dirname(os.path.realpath(__file__)) |
|
|
vocab_path = os.path.join(current_dir, "tests/data", "vocab.txt") |
|
|
tokenizer = SmilesTokenizer() |
|
|
|
|
|
tokens = tokenizer.encode( |
|
|
"CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3[C@H](C=C4)O" |
|
|
) |
|
|
print([tokenizer._convert_id_to_token(t) for t in tokens]) |
|
|
|
|
|
enc = tokenizer.encode("CC=O") |
|
|
print(enc) |
|
|
print(tokenizer.decode(enc, skip_special_tokens=True).replace(" ", "")) |
|
|
|