Update README.md
Browse files
README.md
CHANGED
|
@@ -6,13 +6,15 @@ This is the model of __PolyNC__ from the paper entitled as _"PolyNC: a natural a
|
|
| 6 |
You can perform some the demos with huggingface API in the box on the right side, such as try this: _Predict the Tg of the following SMILES: c1cc(Oc2ccc(Oc3ccc(-n4c(=O)c5cc6c(c(=O)n()c6=O)cc5c4=O)cc3)cc2)ccc1_ or _Predict the heat resistance class of the following SMILES: c1cc(Oc2ccc(Oc3ccc(-n4c(=O)c5cc6c(c(=O)n()c6=O)cc5c4=O)cc3)cc2)ccc1_. Just enjoy it!
|
| 7 |
|
| 8 |
# Cite this:
|
| 9 |
-
```
|
|
|
|
| 10 |
author ="Qiu, Haoke and Liu, Lunyang and Qiu, Xuepeng and Dai, Xuemin and Ji, Xiangling and Sun, Zhao-Yan",
|
| 11 |
-
title ="PolyNC: a natural and chemical language model for unified polymer properties
|
| 12 |
journal ="Chem. Sci.",
|
| 13 |
-
year ="
|
| 14 |
-
|
|
|
|
|
|
|
| 15 |
publisher ="The Royal Society of Chemistry",
|
| 16 |
doi ="10.1039/D3SC05079C",
|
| 17 |
-
url ="http://dx.doi.org/10.1039/D3SC05079C"
|
| 18 |
-
}
|
|
|
|
| 6 |
You can perform some the demos with huggingface API in the box on the right side, such as try this: _Predict the Tg of the following SMILES: c1cc(Oc2ccc(Oc3ccc(-n4c(=O)c5cc6c(c(=O)n()c6=O)cc5c4=O)cc3)cc2)ccc1_ or _Predict the heat resistance class of the following SMILES: c1cc(Oc2ccc(Oc3ccc(-n4c(=O)c5cc6c(c(=O)n()c6=O)cc5c4=O)cc3)cc2)ccc1_. Just enjoy it!
|
| 7 |
|
| 8 |
# Cite this:
|
| 9 |
+
```
|
| 10 |
+
@Article{D3SC05079C,
|
| 11 |
author ="Qiu, Haoke and Liu, Lunyang and Qiu, Xuepeng and Dai, Xuemin and Ji, Xiangling and Sun, Zhao-Yan",
|
| 12 |
+
title ="PolyNC: a natural and chemical language model for the prediction of unified polymer properties",
|
| 13 |
journal ="Chem. Sci.",
|
| 14 |
+
year ="2024",
|
| 15 |
+
volume ="15",
|
| 16 |
+
issue ="2",
|
| 17 |
+
pages ="534-544",
|
| 18 |
publisher ="The Royal Society of Chemistry",
|
| 19 |
doi ="10.1039/D3SC05079C",
|
| 20 |
+
url ="http://dx.doi.org/10.1039/D3SC05079C"}
|
|
|