diff --git a/.gitattributes b/.gitattributes index 3d6c0f9c697b76787b5e032559eed319dbfaf17e..11dac9c0c69e91a6ad03a3642f95dd99a926cef8 100644 --- a/.gitattributes +++ b/.gitattributes @@ -2031,3 +2031,15 @@ Styles/119/splatoon喷射战士斯普拉遁-155240.png filter=lfs diff=lfs merge Styles/12/afrobull.png filter=lfs diff=lfs merge=lfs -text Styles/120/style18-v2-153826.png filter=lfs diff=lfs merge=lfs -text Styles/121/sugimori[[:space:]]ken.png filter=lfs diff=lfs merge=lfs -text +Styles/122/tekuv1-10-136109.png filter=lfs diff=lfs merge=lfs -text +Styles/123/tenroy.png filter=lfs diff=lfs merge=lfs -text +Styles/124/ter.png filter=lfs diff=lfs merge=lfs -text +Styles/125/the_simpson_style-165106.png filter=lfs diff=lfs merge=lfs -text +Styles/126/waeroartist-21.png filter=lfs diff=lfs merge=lfs -text +Styles/127/wagashiv2smaller-88893.png filter=lfs diff=lfs merge=lfs -text +Styles/128/wanaca.png filter=lfs diff=lfs merge=lfs -text +Styles/129/watashinitenshigamaiorita_v10.png filter=lfs diff=lfs merge=lfs -text +Styles/13/aiartschannel_onimai_style-147622.png filter=lfs diff=lfs merge=lfs -text +Styles/130/yui[[:space:]]haga-152670.png filter=lfs diff=lfs merge=lfs -text +Styles/131/yukinominato.png filter=lfs diff=lfs merge=lfs -text +Styles/14/akami_mirai_style-223644.png filter=lfs diff=lfs merge=lfs -text diff --git a/Styles/121/sugimori ken.safetensors b/Styles/121/sugimori ken.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..e19296eac6f42c9194008d628dadfa3d098dba21 --- /dev/null +++ b/Styles/121/sugimori ken.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:970a5eb605c46aaec7097960a9c1ed2cee293f2c70a0ceb21cacf90f65b90576 +size 75575204 diff --git a/Styles/122/tekuv1-10-136109.png b/Styles/122/tekuv1-10-136109.png new file mode 100644 index 0000000000000000000000000000000000000000..aa2bbbaf2e87f030abad37cbc38ea1364920fb84 --- /dev/null +++ b/Styles/122/tekuv1-10-136109.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:33a4e38feb2920da6571857843d57e9eccc794d62480decdaa9f65701933c7ca +size 357431 diff --git a/Styles/122/tekuv1-10-136109.safetensors b/Styles/122/tekuv1-10-136109.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..ea268b3ea015c274ba9e43aa6e1e36487c019a4b --- /dev/null +++ b/Styles/122/tekuv1-10-136109.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:095196baee565265b55fae9c9fd6cb8790fb9a5e1ec82e8f33593ccf56360b0c +size 37863905 diff --git a/Styles/123/tenroy.png b/Styles/123/tenroy.png new file mode 100644 index 0000000000000000000000000000000000000000..3670835c85509b496c7c0ab9ca2465d8aafde611 --- /dev/null +++ b/Styles/123/tenroy.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6cea3ca729a2fcf3a5db35656ebebf4ba3aec969760e66db6b2b7888902d81f5 +size 484405 diff --git a/Styles/123/tenroy.safetensors b/Styles/123/tenroy.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..4e48ca6b86693b7fd0b377215c6e36e2abc97047 --- /dev/null +++ b/Styles/123/tenroy.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f2bcb80285ab96c178528ea20cd13836c9b76ea669379eaf47a3c66eeb623e87 +size 6875958 diff --git a/Styles/124/ter.png b/Styles/124/ter.png new file mode 100644 index 0000000000000000000000000000000000000000..f24589db7c052d06dc1f4f8a9c4cbbb0f9e11e21 --- /dev/null +++ b/Styles/124/ter.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:769c2e93cbf3c525d2991159c5cef2c9604d23f900c3ad534993197228ec8277 +size 412011 diff --git a/Styles/124/ter.safetensors b/Styles/124/ter.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..6ee3c3532d243156883db16c133f04390068887c --- /dev/null +++ b/Styles/124/ter.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2c25d1c3a2d952b1e9b44f95340f36a1827d48d759d69c9897d9c2fb854fdd02 +size 37892687 diff --git a/Styles/125/the_simpson_style-165106.png b/Styles/125/the_simpson_style-165106.png new file mode 100644 index 0000000000000000000000000000000000000000..4f918e390e19a425fd376a55c09131bf69d6a355 --- /dev/null +++ b/Styles/125/the_simpson_style-165106.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6ef5f4805d7258b512f8f2675033cb318a6f274c5446d05df84328a6bacd6bcf +size 433927 diff --git a/Styles/125/the_simpson_style-165106.safetensors b/Styles/125/the_simpson_style-165106.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..8ee6f50ae959cf076fc224ec1dd0f54a777cf72a --- /dev/null +++ b/Styles/125/the_simpson_style-165106.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:63d3d488a205383a4f3692b26fbd5c444f13375eea5f7c981911f4dad612b348 +size 37917928 diff --git a/Styles/126/waeroartist-21.png b/Styles/126/waeroartist-21.png new file mode 100644 index 0000000000000000000000000000000000000000..e396f5b5cc44d0e5d9797883e8b8149ac8430952 --- /dev/null +++ b/Styles/126/waeroartist-21.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f701b2030e8b4e069fd0c949074dcd590a79871162951570fe390e4cc0de7f60 +size 379371 diff --git a/Styles/126/waeroartist-21.safetensors b/Styles/126/waeroartist-21.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..f60312cdd2dd03f03a2184e70378fad75e419c85 --- /dev/null +++ b/Styles/126/waeroartist-21.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f60c1d1f67f485be36c320d808e3a46c0c5f9509eb45b9efe477b74f2483b144 +size 37899131 diff --git a/Styles/127/wagashiv2smaller-88893.png b/Styles/127/wagashiv2smaller-88893.png new file mode 100644 index 0000000000000000000000000000000000000000..c8c836c70580bfdb22e7f5a1162b702025b38d1e --- /dev/null +++ b/Styles/127/wagashiv2smaller-88893.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6fdd567b2c1f7c94ebac13c56ff267e2f96c9de8338f231a1c17c8ac1c410bab +size 358716 diff --git a/Styles/127/wagashiv2smaller-88893.safetensors b/Styles/127/wagashiv2smaller-88893.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..1326b0686e8dbc7fc69e22666e6991b95d1c0a2f --- /dev/null +++ b/Styles/127/wagashiv2smaller-88893.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:f8915084db10a35f39828ea2d0509eba12e5f74687a39035e1016d524a1461f3 +size 20965882 diff --git a/Styles/128/wanaca.png b/Styles/128/wanaca.png new file mode 100644 index 0000000000000000000000000000000000000000..8571d2c6b204603daf51ef78a5f71a84afe27ae3 --- /dev/null +++ b/Styles/128/wanaca.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b8e4c646b6036293f08ad59bda2821c1d939f2570418315acfa0c47b29d70dd8 +size 151546 diff --git a/Styles/128/wanaca.safetensors b/Styles/128/wanaca.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..aea22b3d97467c8b0b2e84db460dfef5a9c0cad8 --- /dev/null +++ b/Styles/128/wanaca.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:613e8fca3b2dcfa11a40c879acb551b2ba7ec4e1b3c95c0ebe3380152f2f81de +size 75575204 diff --git a/Styles/129/watashinitenshigamaiorita_v10.png b/Styles/129/watashinitenshigamaiorita_v10.png new file mode 100644 index 0000000000000000000000000000000000000000..e809f0ba5f1e0ece733b4a91c187ffc3766fc2f9 --- /dev/null +++ b/Styles/129/watashinitenshigamaiorita_v10.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:dd1d9eb8b448aa3cb776910c10eadd1a48a0a77d1f5e07fc5f9fc2a75927eb7a +size 381553 diff --git a/Styles/129/watashinitenshigamaiorita_v10.safetensors b/Styles/129/watashinitenshigamaiorita_v10.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..24f409d2b071a6c86a49ec581734b1d2b5fda33c --- /dev/null +++ b/Styles/129/watashinitenshigamaiorita_v10.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:453d613e79bd57abf54384c6d2a900f1613a3552ecd65e87368d061ba89203f7 +size 30419284 diff --git a/Styles/13/aiartschannel_onimai_style-147622.png b/Styles/13/aiartschannel_onimai_style-147622.png new file mode 100644 index 0000000000000000000000000000000000000000..92d1bfef240163675208447d9c6cee5a25ec334d --- /dev/null +++ b/Styles/13/aiartschannel_onimai_style-147622.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c238d123a9a638d07c2e1050c4fbee7af15f3993d041d442bda957b04946fbfc +size 306542 diff --git a/Styles/13/aiartschannel_onimai_style-147622.safetensors b/Styles/13/aiartschannel_onimai_style-147622.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..90d8372ca338ef106af21c880d74b8b6d91acb73 --- /dev/null +++ b/Styles/13/aiartschannel_onimai_style-147622.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:df591934762f1444fd09587872a28fe6471b9c0e33a942efdfcd801e40e126a6 +size 75617840 diff --git a/Styles/130/yui haga-152670.png b/Styles/130/yui haga-152670.png new file mode 100644 index 0000000000000000000000000000000000000000..545b3ad14155aaee1aff2045585fb067b4c4735c --- /dev/null +++ b/Styles/130/yui haga-152670.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:81a33cdc12c105bc0e7cb36e710a8851f5bd530f468d781cd9efef5f60410ef6 +size 479094 diff --git a/Styles/130/yui haga-152670.safetensors b/Styles/130/yui haga-152670.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..6d334e5abde5ff5534eca5c3dd2d52c850857136 --- /dev/null +++ b/Styles/130/yui haga-152670.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:741f0bf6931085e5cadb3abdc6668ccfb74616803978843731d1f11edfb3e183 +size 75623000 diff --git a/Styles/131/yukinominato.png b/Styles/131/yukinominato.png new file mode 100644 index 0000000000000000000000000000000000000000..485d6d93aeea841b64a7274a3194cceba0487c53 --- /dev/null +++ b/Styles/131/yukinominato.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:abb83fb3e149531e0b7dd88c31efa8fedb2f99a23b882d9fb0b6ec4e65004a3b +size 3315831 diff --git a/Styles/131/yukinominato.safetensors b/Styles/131/yukinominato.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..80136433e0ae2641ebc9a38f520223a75b2c183f --- /dev/null +++ b/Styles/131/yukinominato.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:267d02864276d423bf1dbf7c465985e4cbc5d822111c457eaa1bd755df1b3097 +size 9570024 diff --git a/Styles/132/(PW)SailorMoon-NAI-128.safetensors b/Styles/132/(PW)SailorMoon-NAI-128.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..83e11202f97b78bd90b9ea62358dcacdb1236db5 --- /dev/null +++ b/Styles/132/(PW)SailorMoon-NAI-128.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:bc96452f7062c6d428aae704bd31ac5cfb969a41698ef314c8f5652b61f1576b +size 151129764 diff --git a/Styles/133/(PW)SailorMoon-v2-NAI-128.safetensors b/Styles/133/(PW)SailorMoon-v2-NAI-128.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..ba6eeb4ce8a714344d6818298afb105706d241b8 --- /dev/null +++ b/Styles/133/(PW)SailorMoon-v2-NAI-128.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6280f39f75404275aa34a55dfa5b66b63dbd3536f18f3522518a1fe95b0e5aa0 +size 151126689 diff --git a/Styles/134/ajifurai nai.safetensors b/Styles/134/ajifurai nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..0c5fe85302db7361de80487c596672dde6ecfa3a --- /dev/null +++ b/Styles/134/ajifurai nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:266d6ccd3d860b577da321b1edf584f4e7b35c54d94daa84543b5fa3e7744067 +size 151074552 diff --git a/Styles/135/aki99 nai.safetensors b/Styles/135/aki99 nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..194b84c668151020229f70f6aa0abe8f26f4faa7 --- /dev/null +++ b/Styles/135/aki99 nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:04e3512b63c2b48e730a195dbf38ce941020a5e5c6ae96cecdf9526b390303df +size 151074552 diff --git a/Styles/136/akkan bi nai.safetensors b/Styles/136/akkan bi nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..99b5f11575cf13c7f5a35713645e2598fa1edeef --- /dev/null +++ b/Styles/136/akkan bi nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:7eef0a61620c42953e62e53f624a72c1e8f90868cfc647dfbb800385d79edbe1 +size 151074552 diff --git a/Styles/137/alexi_tits nai.safetensors b/Styles/137/alexi_tits nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..653ca3ac07dd439f4655781a1b660712f315e583 --- /dev/null +++ b/Styles/137/alexi_tits nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a2edc5731732094bb58d6be8d0ca9a5ba443a854e502576374480ae600b8de52 +size 151074553 diff --git a/Styles/138/alicesoft nai.safetensors b/Styles/138/alicesoft nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..7daf0a766096c5e3fa5601ac71750f97b7274f81 --- /dev/null +++ b/Styles/138/alicesoft nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:89a12d167ea033321d5167dcbfbda36ec3daed2a9a2eb7b564094118c15f3f5d +size 151074552 diff --git a/Styles/139/alkemanubis nai.safetensors b/Styles/139/alkemanubis nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..cfbe4f830292ba6e1123993b6d5233cadf582ed8 --- /dev/null +++ b/Styles/139/alkemanubis nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:e8759c7552b535c3d5d8149542e77eb7fb93961b87f38c8d1d95461bc6c9d214 +size 151074553 diff --git a/Styles/14/akami_mirai_style-223644.png b/Styles/14/akami_mirai_style-223644.png new file mode 100644 index 0000000000000000000000000000000000000000..337efc47a28829f8482048a77dd12c2356b46c28 --- /dev/null +++ b/Styles/14/akami_mirai_style-223644.png @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:83093f1bff74963af9a38fc66422b16566a928f9d3b3839953f160a540be4cf1 +size 450244 diff --git a/Styles/14/akami_mirai_style-223644.safetensors b/Styles/14/akami_mirai_style-223644.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..7116c414969210f0d0f29a6855d530a6939154fc --- /dev/null +++ b/Styles/14/akami_mirai_style-223644.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:c53cdc50599d70c926404cf5c06a22c465ed6fcbe2ea245df10a4bcbaaa1e075 +size 37866896 diff --git a/Styles/140/alphonse nai.safetensors b/Styles/140/alphonse nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..3aa04197840dc88a27cfc8bf746b78bf15d9eff8 --- /dev/null +++ b/Styles/140/alphonse nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:d956b47396ae5c2ec438aeaaf424deb9831e9e089f21c7fb214cdc442f2d6854 +size 151074551 diff --git a/Styles/141/Amatarou nai.safetensors b/Styles/141/Amatarou nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..31a4aef08aef1698b26eea7129a6def2c0453c1c --- /dev/null +++ b/Styles/141/Amatarou nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:610860dd638c23a32fb9b7854dca65e612eab6bf77ed07affac412edfef3ae48 +size 151074550 diff --git a/Styles/142/andava-128dimension.safetensors b/Styles/142/andava-128dimension.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..efe40233282c1f35812a17157a60a10dfc95a56a --- /dev/null +++ b/Styles/142/andava-128dimension.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:5d55d30b7b4cf8935fc35ef7972006db5e9babadb4521c3e25aea7f1d27b0430 +size 302068911 diff --git a/Styles/143/andava-4dimension.safetensors b/Styles/143/andava-4dimension.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..b76471808b4f538482409cf5367d0e89f41fa4ef --- /dev/null +++ b/Styles/143/andava-4dimension.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6e96fc4fc5f997ee772761c665c75dcd4a7453fe0775ddd0e7869f771b4cbaec +size 9513367 diff --git a/Styles/144/andava-64dimension.safetensors b/Styles/144/andava-64dimension.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..bef588737bb25948e0f8247cefd8fb7273c19fdd --- /dev/null +++ b/Styles/144/andava-64dimension.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:b73e88d1b2c35f98a8c8acfd66b77f1e07c9f6c7f6b91984cecb4e2e12c888c0 +size 151073137 diff --git a/Styles/145/Anime801 nai.safetensors b/Styles/145/Anime801 nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..67f741d1d67150a08c41f1c33d17a7b6dafd12c6 --- /dev/null +++ b/Styles/145/Anime801 nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:6fd77a0bd8a2a096282cf5801f28a47ed84a9da54049f399f6dc6c441c2ba145 +size 151074550 diff --git a/Styles/146/aoi kumiko Nai.safetensors b/Styles/146/aoi kumiko Nai.safetensors new file mode 100644 index 0000000000000000000000000000000000000000..31d259769a0f794763476660b54e0bb63e3eb506 --- /dev/null +++ b/Styles/146/aoi kumiko Nai.safetensors @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:2a1c35ef71235c6a58836bcf198180b7f0db6b42d09e6544761fa175276a87bf +size 151074552 diff --git a/Styles/215/extracted_simpsons_style_dim16-metadata.json b/Styles/215/extracted_simpsons_style_dim16-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..fa95d498c67b3c4499b1f1d2d721533d1a952c6e --- /dev/null +++ b/Styles/215/extracted_simpsons_style_dim16-metadata.json @@ -0,0 +1,6 @@ +{ + "ss_network_alpha": "16", + "ss_network_dim": "16", + "sshs_legacy_hash": "ae208ba1", + "sshs_model_hash": "da1f1013ca5026a910413a2ee92333056b93b8651db51754eb89288d944ef026" +} \ No newline at end of file diff --git a/Styles/22/arknightschibilora_v1-metadata.json b/Styles/22/arknightschibilora_v1-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..8bee04a144e791e787fefaf7a5afb65eddcc55fb --- /dev/null +++ b/Styles/22/arknightschibilora_v1-metadata.json @@ -0,0 +1,1216 @@ +{ + "ss_sd_model_name": "model.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "1105", + "ss_tag_frequency": { + "AKTEST": { + "chibi": 1105, + "full body": 1104, + "solo": 1097, + "transparent background": 1094, + "standing": 958, + "1girl": 916, + "simple background": 820, + "black footwear": 701, + "holding": 691, + "jacket": 647, + "animal ears": 603, + "bangs": 586, + "long sleeves": 561, + "long hair": 557, + "tail": 529, + "boots": 500, + "gloves": 485, + "white background": 480, + "weapon": 461, + "closed mouth": 406, + "shirt": 373, + "holding weapon": 346, + "from behind": 345, + "black jacket": 325, + "shoes": 294, + "smile": 281, + "black gloves": 273, + "brown hair": 264, + "grey hair": 253, + "open clothes": 250, + "pants": 242, + "short hair": 241, + "open jacket": 239, + "horns": 222, + "hat": 216, + "male focus": 199, + "1boy": 198, + "official alternate costume": 194, + "facing away": 184, + "skirt": 184, + "multicolored hair": 182, + "dress": 182, + "ponytail": 173, + "white hair": 172, + "shorts": 171, + "hair between eyes": 171, + "black hair": 169, + "very long hair": 153, + "thighhighs": 150, + "sword": 144, + "blue eyes": 140, + "white jacket": 139, + "black headwear": 136, + "ahoge": 136, + "black pants": 133, + "white shirt": 130, + "hood": 130, + "hair ornament": 130, + "socks": 127, + "pantyhose": 127, + "blonde hair": 126, + "black shorts": 121, + "brown eyes": 119, + "red eyes": 117, + "black skirt": 112, + "yellow eyes": 110, + "pointy ears": 106, + "white footwear": 100, + "animal ear fluff": 100, + "staff": 98, + "black shirt": 94, + "gun": 92, + "looking at viewer": 88, + "holding staff": 87, + "grey eyes": 87, + "braid": 86, + "blue hair": 83, + "streaked hair": 82, + "red hair": 81, + "holding sword": 79, + "black thighhighs": 78, + "shield": 78, + "green eyes": 78, + "bag": 77, + "fingerless gloves": 77, + "cat ears": 76, + "fur trim": 73, + "twintails": 73, + "holding gun": 71, + "black dress": 71, + "cape": 70, + "purple eyes": 67, + "jewelry": 67, + "bow": 66, + "orange eyes": 66, + "purple hair": 65, + "short shorts": 64, + "coat": 62, + "white dress": 62, + "rabbit ears": 62, + "white gloves": 58, + "cat tail": 57, + "horse ears": 56, + "sidelocks": 55, + "hood up": 54, + "open mouth": 54, + "black pantyhose": 54, + "holding shield": 51, + "dragon horns": 51, + "pink hair": 50, + "bare shoulders": 49, + "hair over one eye": 48, + "fox ears": 48, + "infection monitor (arknights)": 47, + "hairclip": 47, + "hair bow": 47, + "crossbow": 45, + "sandals": 45, + "short sleeves": 45, + "high heels": 45, + "horse tail": 45, + "dog ears": 45, + "off shoulder": 44, + "v-shaped eyebrows": 44, + "fox tail": 44, + "ears through headwear": 43, + "hooded jacket": 43, + "dragon tail": 43, + "swimsuit": 42, + "orange hair": 42, + "necktie": 42, + "furry": 42, + "horse girl": 42, + "bear ears": 41, + "brown footwear": 40, + "backpack": 40, + "black cape": 40, + "polearm": 40, + "puffy long sleeves": 39, + "flower": 39, + "sunglasses": 38, + ":d": 38, + "hairband": 38, + "ear piercing": 38, + "white headwear": 38, + "breasts": 37, + "armor": 37, + "cat girl": 36, + "bow (weapon)": 36, + "scarf": 36, + "knee pads": 35, + "piercing": 35, + "arrow (projectile)": 35, + "black bow": 35, + "furry male": 35, + "sheath": 34, + "puffy sleeves": 34, + "wings": 33, + "fox girl": 33, + "dragon girl": 33, + "demon horns": 33, + "wolf ears": 33, + "goggles": 32, + "parted bangs": 32, + "hood down": 32, + "halo": 32, + "dog tail": 32, + "glasses": 31, + "white socks": 31, + "earrings": 31, + "parted lips": 30, + "sleeveless": 30, + "headphones": 30, + "sheathed": 29, + "quiver": 29, + "blue jacket": 29, + "black socks": 29, + "holding polearm": 29, + "eyewear on head": 28, + "oripathy lesion (arknights)": 28, + "wolf tail": 28, + "dark skin": 27, + "thick eyebrows": 27, + "fur-trimmed jacket": 27, + "wolf girl": 27, + "midriff": 26, + "collared shirt": 26, + "hair flower": 26, + "pleated skirt": 26, + "bikini": 26, + "umbrella": 26, + "mask": 26, + "animal": 25, + "helmet": 25, + "food": 25, + "looking away": 25, + "closed eyes": 24, + "crop top": 24, + "knife": 24, + "holding bow (weapon)": 24, + "green jacket": 24, + "black coat": 23, + "white pants": 23, + "striped": 23, + "navel": 23, + "white coat": 23, + "two-tone hair": 23, + "detached wings": 23, + "handgun": 23, + "leopard ears": 23, + "brown pantyhose": 23, + "red jacket": 23, + "blue gloves": 22, + "low twintails": 22, + "belt": 22, + "dog girl": 22, + "leopard tail": 22, + "antlers": 21, + "grey pants": 21, + "holding knife": 21, + "cow horns": 21, + "baseball cap": 20, + "black scarf": 20, + "grey shirt": 20, + "twin braids": 20, + "cow ears": 20, + "tiger ears": 20, + "blunt bangs": 19, + "single braid": 19, + "capelet": 19, + "feather hair": 19, + "sitting": 19, + "goggles on head": 19, + "single horn": 19, + "demon tail": 19, + "antenna hair": 19, + "sleeves past wrists": 18, + "red shirt": 18, + "beret": 18, + "blue dress": 18, + "bandages": 18, + "grey footwear": 18, + "hand on hip": 18, + "tiger tail": 18, + "red footwear": 18, + "rabbit boy": 18, + "white thighhighs": 17, + "hair bun": 17, + "id card": 17, + "necklace": 17, + "book": 17, + "energy wings": 17, + "chain": 17, + "bird": 17, + "dark-skinned female": 16, + "goat ears": 16, + "sweater": 16, + "black necktie": 16, + "pink eyes": 16, + "visor cap": 16, + "axe": 16, + "kneehighs": 16, + "white fur": 16, + "horns through headwear": 16, + "goat horns": 15, + "katana": 15, + "cloak": 15, + "holding umbrella": 15, + "vest": 15, + "armored boots": 15, + "short eyebrows": 15, + "bandaid": 15, + "scar": 15, + "spear": 15, + "green hair": 15, + "red pantyhose": 15, + "red gloves": 14, + "white pantyhose": 14, + "rifle": 14, + "sneakers": 14, + "blue headwear": 14, + "single thighhigh": 14, + "asymmetrical legwear": 14, + "squirrel girl": 14, + "grey jacket": 14, + "sleeveless dress": 14, + "tachi-e": 14, + "head wings": 14, + "one-piece swimsuit": 14, + "semi-rimless eyewear": 14, + "goat girl": 13, + "uniform": 13, + "see-through": 13, + "white skirt": 13, + "closed umbrella": 13, + "red necktie": 13, + "heterochromia": 13, + "squirrel ears": 13, + "squirrel tail": 13, + "bandaged leg": 13, + "holding book": 13, + "black hairband": 13, + "barefoot": 13, + "fang": 13, + "medium breasts": 13, + "torn clothes": 13, + "low ponytail": 13, + "open coat": 12, + "fur-trimmed hood": 12, + "blue skirt": 12, + "x hair ornament": 12, + "gauntlets": 12, + "tiger girl": 12, + "yellow jacket": 12, + "hammer": 12, + "medium hair": 12, + "ribbon": 12, + "black bikini": 12, + "white flower": 12, + "lace-up boots": 12, + "reindeer antlers": 11, + "deer ears": 11, + "blue bow": 11, + "blue shorts": 11, + "red bow": 11, + "red dress": 11, + "feathers": 11, + "cow tail": 11, + "blue shirt": 11, + "mini hat": 11, + "^_^": 11, + "brown thighhighs": 11, + "stuffed toy": 11, + "holding axe": 11, + "grin": 11, + "china dress": 11, + "holding hammer": 11, + "crocodilian tail": 11, + "dark-skinned male": 11, + "colored skin": 11, + "beanie": 10, + "facing viewer": 10, + "blush": 10, + "blue footwear": 10, + "rose": 10, + "mouse ears": 10, + "neckerchief": 10, + "black capelet": 10, + "lion ears": 10, + "mouth hold": 10, + "breastplate": 10, + "hair intakes": 10, + "one eye closed": 10, + "scar on face": 10, + "clothing cutout": 10, + "thigh boots": 10, + "chinese clothes": 10, + "choker": 10, + "headset": 10, + "sleeveless shirt": 10, + "armband": 10, + "rabbit girl": 10, + "under-rim eyewear": 10, + "submachine gun": 9, + "cabbie hat": 9, + "animal hood": 9, + "blue flower": 9, + "black cloak": 9, + "cleavage": 9, + "mouse tail": 9, + "thigh strap": 9, + "cross-laced footwear": 9, + "lion tail": 9, + "stuffed animal": 9, + "virtual youtuber": 9, + "scar across eye": 9, + "cat boy": 9, + "flag": 9, + "dog boy": 9, + "detached sleeves": 9, + "red flower": 9, + "red scarf": 9, + "sailor collar": 9, + "fur-trimmed boots": 9, + "facial hair": 9, + "multiple tails": 9, + "black one-piece swimsuit": 9, + "frills": 8, + "bell": 8, + ":<": 8, + "tinted eyewear": 8, + "brown jacket": 8, + "gradient hair": 8, + "one side up": 8, + "black umbrella": 8, + "white bikini": 8, + "mouse girl": 8, + "visor (armor)": 8, + "candy": 8, + "red skirt": 8, + "bare arms": 8, + "panda ears": 8, + "blue pants": 8, + "hair ribbon": 8, + "japanese clothes": 8, + "weapon on back": 8, + "cow boy": 8, + "bracelet": 8, + "peaked cap": 8, + "wide sleeves": 8, + "single hair bun": 8, + "round eyewear": 7, + "assault rifle": 7, + "fedora": 7, + "star (symbol)": 7, + "raccoon ears": 7, + "brown headwear": 7, + "turtleneck": 7, + "single sock": 7, + "eyepatch": 7, + "pauldrons": 7, + "lollipop": 7, + "high heel boots": 7, + "body fur": 7, + "teeth": 7, + "mechanical halo": 7, + "chainsaw": 7, + "white cape": 7, + "ascot": 7, + "vial": 7, + "mask around neck": 7, + "furry female": 7, + "anklet": 7, + "pouch": 7, + "colored sclera": 7, + "mouth mask": 7, + "shoulder bag": 7, + "earpiece": 7, + "shoulder armor": 7, + "white shorts": 7, + "crown braid": 7, + "hair bobbles": 7, + "red-framed eyewear": 7, + "military": 7, + "brown gloves": 7, + "star hair ornament": 6, + "red hairband": 6, + "brown skirt": 6, + "animal hands": 6, + "raccoon tail": 6, + "straw hat": 6, + "mole under eye": 6, + "cow girl": 6, + "hooded cloak": 6, + "buttons": 6, + "top hat": 6, + "black eyes": 6, + "blood": 6, + "tiger boy": 6, + "low-tied long hair": 6, + "tank top": 6, + "hand up": 6, + ":3": 6, + "drone": 6, + "brown fur": 6, + "orange fur": 6, + "multicolored fur": 6, + "leggings": 6, + "holding food": 6, + "two-tone fur": 6, + "two side up": 6, + "yellow sclera": 6, + "brown shirt": 6, + "beach umbrella": 6, + "double bun": 6, + "bear girl": 6, + "brown pants": 6, + "snake tail": 6, + "bandaid on face": 6, + "bandaid on nose": 6, + "black vest": 6, + "red socks": 6, + "blue coat": 6, + "sleeves past fingers": 6, + "striped bow": 6, + "sheep horns": 6, + "sheep ears": 6, + "cane": 6, + "demon girl": 6, + "military uniform": 6, + "lanyard": 6, + "weasel ears": 6, + "black choker": 6, + "ring": 6, + "red rose": 6, + "frilled dress": 5, + "bonnet": 5, + "yellow gloves": 5, + "single glove": 5, + "freckles": 5, + "raccoon girl": 5, + "drill hair": 5, + "briefcase": 5, + "sun hat": 5, + "swimsuit cover-up": 5, + "turtleneck sweater": 5, + "short hair with long locks": 5, + "medical eyepatch": 5, + "red cape": 5, + "bowtie": 5, + "bright pupils": 5, + "blue necktie": 5, + "fish": 5, + "skull hair ornament": 5, + "cat": 5, + "dual wielding": 5, + "rabbit": 5, + "on head": 5, + "thighhighs under boots": 5, + "checkered clothes": 5, + "sniper rifle": 5, + "hooded cape": 5, + "fur-trimmed cape": 5, + "white hairband": 5, + "white one-piece swimsuit": 5, + "topknot": 5, + "short twintails": 5, + "mismatched legwear": 5, + "lantern": 5, + "beads": 5, + "green dress": 5, + "monocle": 5, + "beard": 5, + "sheep girl": 5, + "jack-o'-lantern": 5, + "cross": 5, + "torn cape": 5, + "hoodie": 5, + "oni horns": 5, + "bandaid on leg": 5, + "bandaid on knee": 5, + "short dress": 5, + "red neckerchief": 5, + "toeless legwear": 5, + "white sweater": 4, + "maid headdress": 4, + "hair over shoulder": 4, + "hand fan": 4, + "collar": 4, + "stomach": 4, + "white capelet": 4, + "fur-trimmed capelet": 4, + "frilled skirt": 4, + "tactical clothes": 4, + "layered sleeves": 4, + "short over long sleeves": 4, + "garter straps": 4, + "black nails": 4, + "animalization": 4, + "mole": 4, + "camera": 4, + "holding camera": 4, + "hat bow": 4, + "light brown hair": 4, + "blush stickers": 4, + "tongue": 4, + "holding stuffed toy": 4, + "yellow bow": 4, + "black cat": 4, + "skates": 4, + "hands on hips": 4, + "keychain": 4, + "sports bra": 4, + "mechanical arms": 4, + "clothes around waist": 4, + "cleavage cutout": 4, + "knee boots": 4, + "police hat": 4, + "aiming": 4, + "lance": 4, + "holding flag": 4, + "green shirt": 4, + "brown scarf": 4, + "grey gloves": 4, + "fruit": 4, + "fur-trimmed coat": 4, + "sarong": 4, + "tassel": 4, + "trident": 4, + "tassel earrings": 4, + "goggles around neck": 4, + "school uniform": 4, + "candy hair ornament": 4, + "aqua hair": 4, + "black ribbon": 4, + "yellow footwear": 4, + "cage": 4, + "halloween": 4, + "watch": 4, + "white skin": 4, + "fake animal ears": 4, + "witch hat": 4, + "purple skirt": 4, + "earphones": 4, + "earbuds": 4, + "purple pants": 4, + "black-framed eyewear": 4, + "blue hairband": 4, + "kitsune": 4, + "stirrup legwear": 4, + "apron": 3, + "maid": 3, + "own hands together": 3, + "brown dress": 3, + "yellow socks": 3, + "expressionless": 3, + "neck bell": 3, + "off-shoulder sweater": 3, + "green hairband": 3, + "fake antlers": 3, + "cross tie": 3, + "blue rose": 3, + "nail polish": 3, + "legwear under shorts": 3, + "large breasts": 3, + "cup": 3, + "holding cup": 3, + "feather hair ornament": 3, + "blue cloak": 3, + "grey pantyhose": 3, + "grey thighhighs": 3, + "lion girl": 3, + "black bowtie": 3, + "brown cape": 3, + "yellow shirt": 3, + "ear tag": 3, + "vampire": 3, + "vertical stripes": 3, + "tongue out": 3, + ":q": 3, + "red headwear": 3, + "holding bag": 3, + "garrison cap": 3, + "thigh cutout": 3, + "jacket on shoulders": 3, + "headband": 3, + "hachimaki": 3, + "nejiri hachimaki": 3, + "hooded coat": 3, + "pelvic curtain": 3, + "jacket around waist": 3, + "animal on head": 3, + "bikini skirt": 3, + "alternate costume": 3, + "police": 3, + "police uniform": 3, + "blue thighhighs": 3, + "slit pupils": 3, + "no humans": 3, + "ground vehicle": 3, + "scope": 3, + "red ribbon": 3, + "elbow gloves": 3, + "suitcase": 3, + "striped thighhighs": 3, + "monster boy": 3, + "ear covers": 3, + "fur-trimmed sleeves": 3, + "head wreath": 3, + "laurel crown": 3, + "military hat": 3, + "tattoo": 3, + "food-themed hair ornament": 3, + "orange pantyhose": 3, + "frying pan": 3, + "plate": 3, + "holding plate": 3, + "pancake": 3, + "pancake stack": 3, + "open book": 3, + "notched ear": 3, + "mustache": 3, + "clenched hand": 3, + "two tails": 3, + "pink flower": 3, + "pink bikini": 3, + "off-shoulder bikini": 3, + "white sarong": 3, + "birdcage": 3, + "holding cane": 3, + "pale skin": 3, + "bare legs": 3, + "walking": 3, + "casual one-piece swimsuit": 3, + "hair flaps": 3, + "single leg pantyhose": 3, + "apple": 3, + "grey skirt": 3, + "grey socks": 3, + "white scarf": 3, + "habit": 3, + "party hat": 3, + "cosplay": 3, + "animal costume": 3, + "paw shoes": 3, + "grey headwear": 3, + "pumpkin": 3, + "black sailor collar": 3, + "red shorts": 3, + "test tube": 3, + "navel cutout": 3, + "black ascot": 3, + "aqua headwear": 3, + "water gun": 3, + "multiple rings": 3, + "loafers": 3, + "lizard tail": 3, + "pink footwear": 3, + "pink jacket": 3, + "kimono": 3, + "tabi": 3, + "hair rings": 3, + "otter ears": 3, + "white ascot": 3, + "blue feathers": 3, + "camouflage": 3, + "bulletproof vest": 3, + "juliet sleeves": 2, + "white apron": 2, + "candle": 2, + "candlestand": 2, + "folding fan": 2, + "green pantyhose": 2, + "hooded capelet": 2, + "triangle mouth": 2, + "yellow headwear": 2, + "denim": 2, + "skin fang": 2, + "drinking straw": 2, + "bird tail": 2, + "cable knit": 2, + "aran sweater": 2, + "otoko no ko": 2, + "blue neckerchief": 2, + "side ponytail": 2, + "arm up": 2, + "crossed arms": 2, + "nurse cap": 2, + "pink bow": 2, + "tiara": 2, + "high-waist shorts": 2, + "pink shirt": 2, + "planted": 2, + "stuffed bunny": 2, + "rabbit hair ornament": 2, + "angel": 2, + "shopping bag": 2, + "character doll": 2, + "cooler": 2, + "purple bow": 2, + ";)": 2, + "inflatable toy": 2, + "purple cape": 2, + "chain necklace": 2, + "muscular male": 2, + "black tank top": 2, + "dog": 2, + "tail through clothes": 2, + "spikes": 2, + "symbol-shaped pupils": 2, + "grey scarf": 2, + "cat hood": 2, + "animal nose": 2, + "1other": 2, + "bird mask": 2, + "shaved ice": 2, + "extra ears": 2, + "skull": 2, + "high ponytail": 2, + "gas mask": 2, + "showgirl skirt": 2, + "checkered flag": 2, + "black fur": 2, + "checkered skirt": 2, + "hip vent": 2, + "crossed legs": 2, + "tentacles": 2, + "floppy ears": 2, + "rabbit tail": 2, + "animal hat": 2, + "christmas": 2, + "candy cane": 2, + "food in mouth": 2, + "tablet pc": 2, + "cropped jacket": 2, + "scythe": 2, + "holding scythe": 2, + "yellow flower": 2, + "kneeling": 2, + "head fins": 2, + "orange bow": 2, + "twin drills": 2, + "miniskirt": 2, + "red cross": 2, + "short ponytail": 2, + "walkie-talkie": 2, + "bandage on face": 2, + "black sleeves": 2, + "arm tattoo": 2, + "aqua dress": 2, + "green skin": 2, + "leg tattoo": 2, + "holding fan": 2, + "motor vehicle": 2, + "motorcycle": 2, + "male swimwear": 2, + "swim trunks": 2, + "multicolored jacket": 2, + "multiple straps": 2, + "aqua eyes": 2, + "instrument": 2, + "white sailor collar": 2, + "frilled hairband": 2, + "halberd": 2, + "green socks": 2, + "yellow dress": 2, + "orange hairband": 2, + "claws": 2, + "fox": 2, + "grey dress": 2, + "curled horns": 2, + "red umbrella": 2, + "heart": 2, + "blood bag": 2, + "single kneehigh": 2, + "small breasts": 2, + "white tank top": 2, + "baseball bat": 2, + "cross necklace": 2, + "horn ornament": 2, + "covered mouth": 2, + "hands in pockets": 2, + "respirator": 2, + "nun": 2, + "blood on face": 2, + "yellow thighhighs": 2, + "balloon": 2, + "bear costume": 2, + "bear tail": 2, + "owl ears": 2, + "whip": 2, + "puffy pants": 2, + "halloween costume": 2, + "green bow": 2, + "outline": 2, + "brown sweater": 2, + "white mask": 2, + "ninja": 2, + "ninja mask": 2, + "crossed bandaids": 2, + "serafuku": 2, + "antennae": 2, + "leather jacket": 2, + "green gloves": 2, + "planet": 2, + "colored inner hair": 2, + "cigarette": 2, + "loose socks": 2, + "leg warmers": 2, + "braided ponytail": 2, + "microphone": 2, + "microphone stand": 2, + "shaded face": 2, + "eyewear on headwear": 2, + "chest belt": 2, + "bead bracelet": 2, + "yellow necktie": 2, + "shin guards": 2, + "wristwatch": 2, + "syringe": 2, + "stethoscope": 2, + "orange neckerchief": 2, + "torn thighhighs": 2, + "coat on shoulders": 2, + "blue cape": 2, + "scissors": 2, + "holding scissors": 2, + "holding sheath": 2, + "ready to draw": 2, + "blindfold": 2, + "headgear": 2, + "bird ears": 2, + "facial mark": 2, + "forehead mark": 2, + "geta": 2, + "black kimono": 2, + "robot": 2, + "absurdly long hair": 2, + "bandana": 2, + "goatee": 2, + "chest strap": 2, + "tight": 2, + "tight pants": 2, + "red pants": 2, + "crown": 2, + "mini crown": 2, + "white umbrella": 2, + "bandaid on cheek": 2, + "animification": 2, + "white bow": 1, + "monochrome": 1, + "greyscale": 1, + "gift": 1, + "gift box": 1, + "duffel bag": 1, + "brown capelet": 1, + "crab": 1, + "green skirt": 1, + "black collar": 1, + "dagger": 1, + "yellow skirt": 1, + "drinking glass": 1, + "aqua nails": 1, + "crazy straw": 1, + "clothed animal": 1, + "red thighhighs": 1, + "oil-paper umbrella": 1, + "blue socks": 1, + "shawl": 1, + "furrification": 1, + "basket": 1, + "mini top hat": 1, + "holding basket": 1, + "animal ear legwear": 1, + "shotgun": 1, + "bottle": 1, + "hand in pocket": 1, + "plastic bag": 1, + "whistle": 1, + "telescope": 1, + "white pupils": 1, + "diamond (shape)": 1, + "object hug": 1, + "tail wagging": 1, + "puffy short sleeves": 1, + "wrist cuffs": 1, + "bug": 1, + "butterfly": 1, + "blue butterfly": 1, + "spiked bracelet": 1, + "plaid": 1, + "pink nails": 1, + "purple vest": 1, + "burnt clothes": 1, + "formal": 1, + "suit": 1, + "tail ornament": 1, + "animal on shoulder": 1, + "bowl": 1, + "holding bowl": 1, + "black sweater": 1, + "orange jacket": 1, + "clenched teeth": 1, + "arms behind back": 1, + "trigger discipline": 1, + "ice cream": 1, + "ice cream cone": 1, + "strapless bikini": 1, + "from side": 1, + "over shoulder": 1, + "weapon over shoulder": 1, + ";d": 1, + ">:)": 1, + "race queen": 1, + "adjusting headwear": 1, + "one knee": 1, + "green sweater": 1, + "ball": 1, + "holding ball": 1, + "dog tags": 1, + "kemonomimi mode": 1, + "watermelon": 1, + "snowman": 1, + "holly": 1, + "santa hat": 1, + "sack": 1, + "fur-trimmed headwear": 1, + "asymmetrical gloves": 1, + "mismatched gloves": 1, + "plate armor": 1, + "clipboard": 1, + "chaps": 1, + "tiger": 1, + "fish boy": 1, + "looking to the side": 1, + "eyewear strap": 1, + "camisole": 1, + "mug": 1, + "ringlets": 1, + "orange bowtie": 1, + "torn pants": 1, + "artist name": 1, + "shell": 1, + "seashell": 1, + "boxing gloves": 1, + "sandwich": 1, + "bucket": 1, + "rubber duck": 1, + "high-waist skirt": 1, + "hair stick": 1, + "red skin": 1, + "binoculars": 1, + "tooth necklace": 1, + "guitar": 1, + "holding instrument": 1, + "leather": 1, + "surfboard": 1, + "sailor dress": 1, + "see-through dress": 1, + "sleeveless jacket": 1, + "blue ribbon": 1, + "mirror": 1, + "white neckerchief": 1, + "feathered wings": 1, + "bird wings": 1, + "grey coat": 1, + "fang out": 1, + "bandaged arm": 1, + "reading": 1, + "mop": 1, + "broom": 1, + "lolita fashion": 1, + "gothic lolita": 1, + "white cloak": 1, + "headpat": 1, + "petting": 1, + "roller skates": 1, + "turtleneck dress": 1, + "hat feather": 1, + "owl": 1, + "intravenous drip": 1, + "stitches": 1, + "leotard": 1, + "black leotard": 1, + "yellow sweater": 1, + "seiza": 1, + "upper body": 1, + "green pants": 1, + "clothes writing": 1, + "holding baseball bat": 1, + "beach chair": 1, + "wariza": 1, + "torn scarf": 1, + "large tail": 1, + "horn ribbon": 1, + "instrument case": 1, + "guitar case": 1, + "grey capelet": 1, + "phone": 1, + "cellphone": 1, + "holding phone": 1, + "holding balloon": 1, + "planted sword": 1, + "oni mask": 1, + "uneven legwear": 1, + "swept bangs": 1, + "licking lips": 1, + "brown hoodie": 1, + "sticker": 1, + "legs apart": 1, + "orange skirt": 1, + "over-rim eyewear": 1, + "blue hoodie": 1, + "pink choker": 1, + "white sports bra": 1, + "personification": 1, + "carrot": 1, + "halloween bucket": 1, + "star print": 1, + "animal print": 1, + "holding whip": 1, + "disposable cup": 1, + "coffee cup": 1, + "ankle strap": 1, + "holding lantern": 1, + "toeless footwear": 1, + "shuriken": 1, + "eyebrow piercing": 1, + "diamond-shaped pupils": 1, + "running": 1, + "eyes visible through hair": 1, + "goggles on headwear": 1, + "digital media player": 1, + "skateboard": 1, + "brown socks": 1, + "two-sided skirt": 1, + "grenade launcher": 1, + "holding candy": 1, + "holding lollipop": 1, + "crystal ball": 1, + "notebook": 1, + "bubble blowing": 1, + "chewing gum": 1, + "sign": 1, + "road sign": 1, + "card": 1, + "holding card": 1, + "sarashi": 1, + "box": 1, + "cardboard box": 1, + "holding box": 1, + "rapier": 1, + "pocky": 1, + "striped shorts": 1, + "red sleeves": 1, + "holding water gun": 1, + "folded ponytail": 1, + "shoulder strap": 1, + "aqua gloves": 1, + "shorts under dress": 1, + "backless outfit": 1, + "backless dress": 1, + "newspaper": 1, + "holding syringe": 1, + "green footwear": 1, + "scooter": 1, + "off-shoulder jacket": 1, + "thumb ring": 1, + "turret": 1, + "long skirt": 1, + "cannon": 1, + "bird girl": 1, + "elite ii (arknights)": 1, + "eyebrows hidden by hair": 1, + "black sclera": 1, + "clenched hands": 1, + "black wings": 1, + "headpiece": 1, + "torn pantyhose": 1, + "purple gloves": 1, + "naginata": 1, + "white choker": 1, + "bass guitar": 1, + "yo-yo": 1, + "white eyes": 1, + "paper": 1, + "blue sailor collar": 1, + "helmet removed": 1, + "holding helmet": 1, + "carrying under arm": 1, + "back": 1, + "japanese armor": 1, + "jeans": 1, + "bike shorts": 1, + "wolf boy": 1, + "sharp teeth": 1, + "white hoodie": 1, + "backwards hat": 1, + "white cardigan": 1, + "maid apron": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "AKTEST": { + "n_repeats": 1, + "img_count": 1105 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 1105, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"AKTEST\": {\"chibi\": 1105, \"solo\": 1097, \"smile\": 281, \"blue eyes\": 140, \"simple background\": 820, \"shirt\": 373, \"long sleeves\": 561, \"1boy\": 198, \"hat\": 216, \"holding\": 691, \"closed mouth\": 406, \"blue hair\": 83, \"standing\": 958, \"jacket\": 647, \"full body\": 1104, \"weapon\": 461, \"male focus\": 199, \"red hair\": 81, \"multicolored hair\": 182, \"boots\": 500, \"glasses\": 31, \"pants\": 242, \"sword\": 144, \"black footwear\": 701, \"black headwear\": 136, \"transparent background\": 1094, \"goggles\": 32, \"sheath\": 34, \"round eyewear\": 7, \"1girl\": 916, \"brown hair\": 264, \"animal ears\": 603, \"tail\": 529, \"cat ears\": 76, \"from behind\": 345, \"holding weapon\": 346, \"cat tail\": 57, \"gun\": 92, \"holding gun\": 71, \"red gloves\": 14, \"beanie\": 10, \"facing away\": 184, \"assault rifle\": 7, \"submachine gun\": 9, \"ears through headwear\": 43, \"long hair\": 557, \"bangs\": 586, \"thighhighs\": 150, \"white background\": 480, \"very long hair\": 153, \"yellow eyes\": 110, \"white shirt\": 130, \"white hair\": 172, \"open clothes\": 250, \"horns\": 222, \"shorts\": 171, \"dark skin\": 27, \"off shoulder\": 44, \"white thighhighs\": 17, \"open jacket\": 239, \"dark-skinned female\": 16, \"short shorts\": 64, \"black shorts\": 121, \"white jacket\": 139, \"staff\": 98, \"holding staff\": 87, \"goat horns\": 15, \"goat ears\": 16, \"goat girl\": 13, \"socks\": 127, \"sweater\": 16, \"official alternate costume\": 194, \"white footwear\": 100, \"white socks\": 31, \"white sweater\": 4, \"short hair\": 241, \"coat\": 62, \"black jacket\": 325, \"black coat\": 23, \"black hair\": 169, \"gloves\": 485, \"dress\": 182, \"closed eyes\": 24, \"frills\": 8, \"black gloves\": 273, \"puffy sleeves\": 34, \"blunt bangs\": 19, \"apron\": 3, \"black dress\": 71, \"maid\": 3, \"maid headdress\": 4, \"frilled dress\": 5, \"own hands together\": 3, \"juliet sleeves\": 2, \"white apron\": 2, \"facing viewer\": 10, \"antlers\": 21, \"bonnet\": 5, \"reindeer antlers\": 11, \"deer ears\": 11, \"sunglasses\": 38, \"sheathed\": 29, \"grey pants\": 21, \"braid\": 86, \"white gloves\": 58, \"uniform\": 13, \"grey eyes\": 87, \"single braid\": 19, \"brown footwear\": 40, \"black pants\": 133, \"hair over shoulder\": 4, \"baseball cap\": 20, \"knee pads\": 35, \"bow\": 66, \"hair bun\": 17, \"white bow\": 1, \"candle\": 2, \"candlestand\": 2, \"hair between eyes\": 171, \"grey hair\": 253, \"shoes\": 294, \"cat girl\": 36, \"bow (weapon)\": 36, \"white pants\": 23, \"cabbie hat\": 9, \"crossbow\": 45, \"blush\": 10, \":d\": 38, \"parted lips\": 30, \"thick eyebrows\": 27, \"brown dress\": 3, \"katana\": 15, \"hand fan\": 4, \"folding fan\": 2, \"red eyes\": 117, \"animal ear fluff\": 100, \"id card\": 17, \"fedora\": 7, \"yellow gloves\": 5, \"yellow socks\": 3, \"hood\": 130, \"white dress\": 62, \"collar\": 4, \"expressionless\": 3, \"open coat\": 12, \"infection monitor (arknights)\": 47, \"monochrome\": 1, \"greyscale\": 1, \"hair ornament\": 130, \"hairband\": 38, \"hairclip\": 47, \"sleeves past wrists\": 18, \"bell\": 8, \"neck bell\": 3, \"gift\": 1, \"puffy long sleeves\": 39, \"star hair ornament\": 6, \"red hairband\": 6, \"gift box\": 1, \"off-shoulder sweater\": 3, \"green hairband\": 3, \"blue footwear\": 10, \"striped\": 23, \"navel\": 23, \"ponytail\": 173, \"midriff\": 26, \"stomach\": 4, \"bag\": 77, \"scarf\": 36, \"crop top\": 24, \"piercing\": 35, \"ear piercing\": 38, \"black scarf\": 20, \"duffel bag\": 1, \"skirt\": 184, \"capelet\": 19, \"brown skirt\": 6, \"brown capelet\": 1, \"looking at viewer\": 88, \"single glove\": 5, \"crab\": 1, \"bare shoulders\": 49, \"star (symbol)\": 7, \"green skirt\": 1, \"fingerless gloves\": 77, \"arrow (projectile)\": 35, \"quiver\": 29, \"fake antlers\": 3, \"pantyhose\": 127, \"knife\": 24, \"freckles\": 5, \"animal hands\": 6, \"holding knife\": 21, \"raccoon ears\": 7, \"raccoon tail\": 6, \"raccoon girl\": 5, \"black thighhighs\": 78, \"red shirt\": 18, \"collared shirt\": 26, \"green pantyhose\": 2, \"cross tie\": 3, \"see-through\": 13, \"brown eyes\": 119, \"streaked hair\": 82, \"fur trim\": 73, \"hooded jacket\": 43, \"hood up\": 54, \"white pantyhose\": 14, \"animal hood\": 9, \"white capelet\": 4, \"fur-trimmed capelet\": 4, \"hooded capelet\": 2, \"fur-trimmed hood\": 12, \"blonde hair\": 126, \"flower\": 39, \"hair bow\": 47, \"hair flower\": 26, \"blue skirt\": 12, \"parted bangs\": 32, \"black bow\": 35, \"rose\": 10, \"blue bow\": 11, \"drill hair\": 5, \"frilled skirt\": 4, \"blue flower\": 9, \":<\": 8, \"triangle mouth\": 2, \"tactical clothes\": 4, \"holding sword\": 79, \"sandals\": 45, \"brown headwear\": 7, \"straw hat\": 6, \"yellow headwear\": 2, \"fur-trimmed jacket\": 27, \"pleated skirt\": 26, \"white skirt\": 13, \"black cloak\": 9, \"black collar\": 1, \"dagger\": 1, \"yellow skirt\": 1, \"black shirt\": 94, \"rifle\": 14, \"layered sleeves\": 4, \"short over long sleeves\": 4, \"blue rose\": 3, \"purple eyes\": 67, \"black skirt\": 112, \"nail polish\": 3, \"garter straps\": 4, \"x hair ornament\": 12, \"sneakers\": 14, \"black nails\": 4, \"grey shirt\": 20, \"black necktie\": 16, \"legwear under shorts\": 3, \"briefcase\": 5, \"breasts\": 37, \"open mouth\": 54, \"large breasts\": 3, \"cleavage\": 9, \"jewelry\": 67, \"swimsuit\": 42, \"bikini\": 26, \"necklace\": 17, \"twin braids\": 20, \"denim\": 2, \"eyewear on head\": 28, \"skin fang\": 2, \"blue shorts\": 11, \"sun hat\": 5, \"tinted eyewear\": 8, \"swimsuit cover-up\": 5, \"cup\": 3, \"holding cup\": 3, \"drinking glass\": 1, \"drinking straw\": 2, \"aqua nails\": 1, \"crazy straw\": 1, \"ahoge\": 136, \"black pantyhose\": 54, \"backpack\": 40, \"mouse ears\": 10, \"mouse tail\": 9, \"twintails\": 73, \"red bow\": 11, \"mole under eye\": 6, \"red dress\": 11, \"animal\": 25, \"animalization\": 4, \"clothed animal\": 1, \"short sleeves\": 45, \"red thighhighs\": 1, \"orange hair\": 42, \"feathers\": 11, \"brown jacket\": 8, \"bird tail\": 2, \"feather hair\": 19, \"pink eyes\": 16, \"mole\": 4, \"turtleneck\": 7, \"turtleneck sweater\": 5, \"feather hair ornament\": 3, \"cable knit\": 2, \"aran sweater\": 2, \"pink hair\": 50, \"purple hair\": 65, \"sidelocks\": 55, \"neckerchief\": 10, \"gradient hair\": 8, \"beret\": 18, \"umbrella\": 26, \"otoko no ko\": 2, \"cloak\": 15, \"short hair with long locks\": 5, \"blue headwear\": 14, \"holding umbrella\": 15, \"blue gloves\": 22, \"blue neckerchief\": 2, \"closed umbrella\": 13, \"blue cloak\": 3, \"blue dress\": 18, \"necktie\": 42, \"vest\": 15, \"side ponytail\": 2, \"one side up\": 8, \"red necktie\": 13, \"single thighhigh\": 14, \"camera\": 4, \"single sock\": 7, \"holding camera\": 4, \"hair over one eye\": 48, \"eyepatch\": 7, \"medical eyepatch\": 5, \"black umbrella\": 8, \"oil-paper umbrella\": 1, \"hood down\": 32, \"blue jacket\": 29, \"visor cap\": 16, \"cow ears\": 20, \"cow horns\": 21, \"cow girl\": 6, \"cow tail\": 11, \"asymmetrical legwear\": 14, \"sitting\": 19, \"low twintails\": 22, \"black capelet\": 10, \"hooded cloak\": 6, \"high heels\": 45, \"buttons\": 6, \"arm up\": 2, \"v-shaped eyebrows\": 44, \"thigh strap\": 9, \"white headwear\": 38, \"white bikini\": 8, \"orange eyes\": 66, \"blue shirt\": 11, \"grey pantyhose\": 3, \"crossed arms\": 2, \"nurse cap\": 2, \"cross-laced footwear\": 9, \"grey thighhighs\": 3, \"heterochromia\": 13, \"pink bow\": 2, \"lion ears\": 10, \"lion tail\": 9, \"lion girl\": 3, \"armor\": 37, \"gauntlets\": 12, \"shield\": 78, \"holding shield\": 51, \"squirrel ears\": 13, \"squirrel tail\": 13, \"squirrel girl\": 14, \"cape\": 70, \"tiara\": 2, \"red cape\": 5, \"holding bow (weapon)\": 24, \"bowtie\": 5, \"bandages\": 18, \"mini hat\": 11, \"black bowtie\": 3, \"top hat\": 6, \"bandaged leg\": 13, \"mouse girl\": 8, \"blue socks\": 1, \"helmet\": 25, \"pauldrons\": 7, \"visor (armor)\": 8, \"black cape\": 40, \"brown cape\": 3, \"bright pupils\": 5, \"armored boots\": 15, \"high-waist shorts\": 2, \"grey footwear\": 18, \"yellow shirt\": 3, \"ear tag\": 3, \"food\": 25, \"mouth hold\": 10, \"candy\": 8, \"lollipop\": 7, \"book\": 17, \"holding book\": 13, \"white coat\": 23, \"black hairband\": 13, \"shawl\": 1, \"black eyes\": 6, \"furry\": 42, \"furry male\": 35, \"furrification\": 1, \"horse ears\": 56, \"horse girl\": 42, \"horse tail\": 45, \"basket\": 1, \"mini top hat\": 1, \"holding basket\": 1, \"high heel boots\": 7, \"^_^\": 11, \"short eyebrows\": 15, \"brown thighhighs\": 11, \"earrings\": 31, \"body fur\": 7, \"teeth\": 7, \"pointy ears\": 106, \"two-tone hair\": 23, \"blood\": 6, \"belt\": 22, \"pink shirt\": 2, \"breastplate\": 10, \"wings\": 33, \"halo\": 32, \"mechanical halo\": 7, \"detached wings\": 23, \"energy wings\": 17, \"green eyes\": 78, \"handgun\": 23, \"green jacket\": 24, \"vampire\": 3, \"planted\": 2, \"red skirt\": 8, \"chain\": 17, \"stuffed toy\": 11, \"stuffed animal\": 9, \"stuffed bunny\": 2, \"chainsaw\": 7, \"hat bow\": 4, \"rabbit hair ornament\": 2, \"animal ear legwear\": 1, \"blue necktie\": 5, \"angel\": 2, \"shotgun\": 1, \"virtual youtuber\": 9, \"grey jacket\": 14, \"axe\": 16, \"looking away\": 25, \"kneehighs\": 16, \"light brown hair\": 4, \"black socks\": 29, \"vertical stripes\": 3, \"blush stickers\": 4, \"holding axe\": 11, \"hair intakes\": 10, \"tongue\": 4, \"tongue out\": 3, \":q\": 3, \"red headwear\": 3, \"bear ears\": 41, \"barefoot\": 13, \"bottle\": 1, \"bandaid\": 15, \"fish\": 5, \"hand in pocket\": 1, \"holding bag\": 3, \"shopping bag\": 2, \"plastic bag\": 1, \"leopard ears\": 23, \"character doll\": 2, \"hand on hip\": 18, \"whistle\": 1, \"cooler\": 2, \"purple bow\": 2, \"one eye closed\": 10, \";)\": 2, \"telescope\": 1, \"garrison cap\": 3, \"white cape\": 7, \"white pupils\": 1, \"diamond (shape)\": 1, \"scar\": 15, \"tiger ears\": 20, \"white fur\": 16, \"tiger tail\": 18, \"tiger boy\": 6, \"low-tied long hair\": 6, \"inflatable toy\": 2, \"scar on face\": 10, \"scar across eye\": 9, \"fang\": 13, \"purple cape\": 2, \"polearm\": 40, \"dragon horns\": 51, \"spear\": 15, \"dragon tail\": 43, \"holding polearm\": 29, \"object hug\": 1, \"holding stuffed toy\": 4, \"chain necklace\": 2, \"ascot\": 7, \"clothing cutout\": 10, \"thigh cutout\": 3, \"tank top\": 6, \"muscular male\": 2, \"jacket on shoulders\": 3, \"black tank top\": 2, \"medium breasts\": 13, \"fox ears\": 48, \"fox tail\": 44, \"fox girl\": 33, \"thigh boots\": 10, \"dragon girl\": 33, \"brown pantyhose\": 23, \"sleeveless\": 30, \"bare arms\": 8, \"sleeveless dress\": 14, \"dog ears\": 45, \"dog tail\": 32, \"dog girl\": 22, \"vial\": 7, \"dog\": 2, \"tail wagging\": 1, \"yellow bow\": 4, \"puffy short sleeves\": 1, \"wrist cuffs\": 1, \"bug\": 1, \"butterfly\": 1, \"skull hair ornament\": 5, \"blue butterfly\": 1, \"tail through clothes\": 2, \"spikes\": 2, \"spiked bracelet\": 1, \"symbol-shaped pupils\": 2, \"plaid\": 1, \"goggles on head\": 19, \"torn clothes\": 13, \"pink nails\": 1, \"purple vest\": 1, \"burnt clothes\": 1, \"hand up\": 6, \"formal\": 1, \"cat\": 5, \"suit\": 1, \"black cat\": 4, \"cat boy\": 9, \"dual wielding\": 5, \"tail ornament\": 1, \"animal on shoulder\": 1, \"mask\": 26, \"skates\": 4, \"bird\": 17, \"grey scarf\": 2, \":3\": 6, \"headband\": 3, \"hands on hips\": 4, \"flag\": 9, \"hachimaki\": 3, \"keychain\": 4, \"drone\": 6, \"mask around neck\": 7, \"nejiri hachimaki\": 3, \"cat hood\": 2, \"furry female\": 7, \"animal nose\": 2, \"brown fur\": 6, \"tiger girl\": 12, \"orange fur\": 6, \"multicolored fur\": 6, \"1other\": 2, \"hooded coat\": 3, \"bird mask\": 2, \"pelvic curtain\": 3, \"bowl\": 1, \"holding bowl\": 1, \"shaved ice\": 2, \"grin\": 11, \"sports bra\": 4, \"yellow jacket\": 12, \"mechanical arms\": 4, \"clothes around waist\": 4, \"leggings\": 6, \"jacket around waist\": 3, \"panda ears\": 8, \"red jacket\": 23, \"black sweater\": 1, \"orange jacket\": 1, \"chinese clothes\": 10, \"cleavage cutout\": 4, \"clenched teeth\": 1, \"china dress\": 11, \"knee boots\": 4, \"choker\": 10, \"rabbit ears\": 62, \"arms behind back\": 1, \"extra ears\": 2, \"rabbit\": 5, \"on head\": 5, \"animal on head\": 3, \"skull\": 2, \"anklet\": 7, \"high ponytail\": 2, \"tachi-e\": 14, \"trigger discipline\": 1, \"holding food\": 6, \"ice cream\": 1, \"bikini skirt\": 3, \"oripathy lesion (arknights)\": 28, \"ice cream cone\": 1, \"strapless bikini\": 1, \"gas mask\": 2, \"alternate costume\": 3, \"single horn\": 19, \"police\": 3, \"police uniform\": 3, \"two-tone fur\": 6, \"dog boy\": 9, \"police hat\": 4, \"red footwear\": 18, \"from side\": 1, \"two side up\": 6, \"over shoulder\": 1, \"hammer\": 12, \"weapon over shoulder\": 1, \"holding hammer\": 11, \"headphones\": 30, \"headset\": 10, \"aiming\": 4, \"thighhighs under boots\": 5, \"detached sleeves\": 9, \"medium hair\": 12, \"sleeveless shirt\": 10, \"red flower\": 9, \"pouch\": 7, \"blue pants\": 8, \"blue thighhighs\": 3, \"lance\": 4, \"showgirl skirt\": 2, \"holding flag\": 4, \"checkered flag\": 2, \"slit pupils\": 3, \"colored sclera\": 7, \"yellow sclera\": 6, \"black fur\": 2, \"no humans\": 3, \"green shirt\": 4, \"checkered clothes\": 5, \"checkered skirt\": 2, \";d\": 1, \"armband\": 10, \"hip vent\": 2, \">:)\": 1, \"race queen\": 1, \"brown shirt\": 6, \"adjusting headwear\": 1, \"sniper rifle\": 5, \"low ponytail\": 13, \"ground vehicle\": 3, \"scope\": 3, \"head wings\": 14, \"crossed legs\": 2, \"one knee\": 1, \"mouth mask\": 7, \"ribbon\": 12, \"hair ribbon\": 8, \"red ribbon\": 3, \"green sweater\": 1, \"brown scarf\": 4, \"ball\": 1, \"holding ball\": 1, \"japanese clothes\": 8, \"dog tags\": 1, \"hooded cape\": 5, \"tentacles\": 2, \"grey gloves\": 4, \"demon horns\": 33, \"weapon on back\": 8, \"elbow gloves\": 3, \"demon tail\": 19, \"beach umbrella\": 6, \"rabbit boy\": 18, \"floppy ears\": 2, \"kemonomimi mode\": 1, \"suitcase\": 3, \"rabbit tail\": 2, \"striped thighhighs\": 3, \"animal hat\": 2, \"fruit\": 4, \"shoulder bag\": 7, \"watermelon\": 1, \"christmas\": 2, \"snowman\": 1, \"candy cane\": 2, \"holly\": 1, \"santa hat\": 1, \"sack\": 1, \"fur-trimmed headwear\": 1, \"asymmetrical gloves\": 1, \"mismatched gloves\": 1, \"fur-trimmed cape\": 5, \"plate armor\": 1, \"double bun\": 6, \"food in mouth\": 2, \"tablet pc\": 2, \"clipboard\": 1, \"monster boy\": 3, \"cow boy\": 8, \"bear girl\": 6, \"ear covers\": 3, \"earpiece\": 7, \"cropped jacket\": 2, \"chaps\": 1, \"white hairband\": 5, \"fur-trimmed sleeves\": 3, \"fur-trimmed coat\": 4, \"scythe\": 2, \"holding scythe\": 2, \"black bikini\": 12, \"yellow flower\": 2, \"sarong\": 4, \"brown pants\": 6, \"snake tail\": 6, \"tiger\": 1, \"kneeling\": 2, \"head fins\": 2, \"fish boy\": 1, \"looking to the side\": 1, \"eyewear strap\": 1, \"camisole\": 1, \"tassel\": 4, \"mug\": 1, \"orange bow\": 2, \"ringlets\": 1, \"orange bowtie\": 1, \"twin drills\": 2, \"one-piece swimsuit\": 14, \"white flower\": 12, \"white one-piece swimsuit\": 5, \"head wreath\": 3, \"crocodilian tail\": 11, \"torn pants\": 1, \"topknot\": 5, \"miniskirt\": 2, \"artist name\": 1, \"shell\": 1, \"seashell\": 1, \"short twintails\": 5, \"boxing gloves\": 1, \"red cross\": 2, \"bandaid on face\": 6, \"bandaid on nose\": 6, \"bracelet\": 8, \"dark-skinned male\": 11, \"short ponytail\": 2, \"sandwich\": 1, \"trident\": 4, \"shoulder armor\": 7, \"mismatched legwear\": 5, \"horns through headwear\": 16, \"bucket\": 1, \"rubber duck\": 1, \"white shorts\": 7, \"black vest\": 6, \"peaked cap\": 8, \"walkie-talkie\": 2, \"wide sleeves\": 8, \"laurel crown\": 3, \"military hat\": 3, \"high-waist skirt\": 1, \"bandage on face\": 2, \"lantern\": 5, \"black sleeves\": 2, \"green hair\": 15, \"tattoo\": 3, \"colored skin\": 11, \"beads\": 5, \"green dress\": 5, \"arm tattoo\": 2, \"tassel earrings\": 4, \"aqua dress\": 2, \"goggles around neck\": 4, \"green skin\": 2, \"leg tattoo\": 2, \"hair stick\": 1, \"holding fan\": 2, \"red skin\": 1, \"red socks\": 6, \"motor vehicle\": 2, \"motorcycle\": 2, \"binoculars\": 1, \"male swimwear\": 2, \"swim trunks\": 2, \"tooth necklace\": 1, \"lace-up boots\": 12, \"multicolored jacket\": 2, \"multiple straps\": 2, \"aqua eyes\": 2, \"instrument\": 2, \"guitar\": 1, \"holding instrument\": 1, \"leather\": 1, \"red scarf\": 9, \"surfboard\": 1, \"sailor collar\": 9, \"sailor dress\": 1, \"see-through dress\": 1, \"sleeveless jacket\": 1, \"blue coat\": 6, \"fur-trimmed boots\": 9, \"blue ribbon\": 1, \"mirror\": 1, \"school uniform\": 4, \"white sailor collar\": 2, \"food-themed hair ornament\": 3, \"white neckerchief\": 1, \"red pantyhose\": 15, \"candy hair ornament\": 4, \"orange pantyhose\": 3, \"frying pan\": 3, \"plate\": 3, \"holding plate\": 3, \"frilled hairband\": 2, \"monocle\": 5, \"pancake\": 3, \"pancake stack\": 3, \"aqua hair\": 4, \"facial hair\": 9, \"beard\": 5, \"open book\": 3, \"halberd\": 2, \"feathered wings\": 1, \"bird wings\": 1, \"black ribbon\": 4, \"grey coat\": 1, \"notched ear\": 3, \"antenna hair\": 19, \"fang out\": 1, \"mustache\": 3, \"green socks\": 2, \"clenched hand\": 3, \"sleeves past fingers\": 6, \"bandaged arm\": 1, \"reading\": 1, \"striped bow\": 6, \"yellow dress\": 2, \"yellow footwear\": 4, \"orange hairband\": 2, \"multiple tails\": 9, \"claws\": 2, \"two tails\": 3, \"mop\": 1, \"pink flower\": 3, \"pink bikini\": 3, \"sheep horns\": 6, \"sheep ears\": 6, \"sheep girl\": 5, \"off-shoulder bikini\": 3, \"white sarong\": 3, \"broom\": 1, \"fox\": 2, \"lolita fashion\": 1, \"gothic lolita\": 1, \"jack-o'-lantern\": 5, \"cage\": 4, \"birdcage\": 3, \"white cloak\": 1, \"halloween\": 4, \"headpat\": 1, \"petting\": 1, \"grey dress\": 2, \"curled horns\": 2, \"leopard tail\": 22, \"watch\": 4, \"cane\": 6, \"roller skates\": 1, \"holding cane\": 3, \"black one-piece swimsuit\": 9, \"crown braid\": 7, \"turtleneck dress\": 1, \"red umbrella\": 2, \"hat feather\": 1, \"owl\": 1, \"heart\": 2, \"white skin\": 4, \"intravenous drip\": 1, \"blood bag\": 2, \"cross\": 5, \"pale skin\": 3, \"torn cape\": 5, \"stitches\": 1, \"leotard\": 1, \"bare legs\": 3, \"black leotard\": 1, \"walking\": 3, \"casual one-piece swimsuit\": 3, \"hair flaps\": 3, \"single leg pantyhose\": 3, \"single kneehigh\": 2, \"yellow sweater\": 1, \"seiza\": 1, \"upper body\": 1, \"apple\": 3, \"small breasts\": 2, \"green pants\": 1, \"grey skirt\": 3, \"white tank top\": 2, \"grey socks\": 3, \"baseball bat\": 2, \"clothes writing\": 1, \"holding baseball bat\": 1, \"beach chair\": 1, \"wariza\": 1, \"torn scarf\": 1, \"wolf ears\": 33, \"wolf tail\": 28, \"wolf girl\": 27, \"large tail\": 1, \"white scarf\": 3, \"cross necklace\": 2, \"fake animal ears\": 4, \"horn ornament\": 2, \"covered mouth\": 2, \"horn ribbon\": 1, \"hands in pockets\": 2, \"respirator\": 2, \"instrument case\": 1, \"guitar case\": 1, \"habit\": 3, \"nun\": 2, \"grey capelet\": 1, \"blood on face\": 2, \"witch hat\": 4, \"phone\": 1, \"cellphone\": 1, \"holding phone\": 1, \"yellow thighhighs\": 2, \"demon girl\": 6, \"party hat\": 3, \"cosplay\": 3, \"hoodie\": 5, \"animal costume\": 3, \"paw shoes\": 3, \"balloon\": 2, \"holding balloon\": 1, \"single hair bun\": 8, \"oni horns\": 5, \"planted sword\": 1, \"oni mask\": 1, \"hair bobbles\": 7, \"semi-rimless eyewear\": 14, \"red-framed eyewear\": 7, \"uneven legwear\": 1, \"swept bangs\": 1, \"licking lips\": 1, \"bandaid on leg\": 5, \"bandaid on knee\": 5, \"brown hoodie\": 1, \"bear costume\": 2, \"short dress\": 5, \"sticker\": 1, \"bear tail\": 2, \"legs apart\": 1, \"orange skirt\": 1, \"military\": 7, \"military uniform\": 6, \"over-rim eyewear\": 1, \"owl ears\": 2, \"blue hoodie\": 1, \"pink choker\": 1, \"white sports bra\": 1, \"brown gloves\": 7, \"personification\": 1, \"whip\": 2, \"puffy pants\": 2, \"grey headwear\": 3, \"rabbit girl\": 10, \"halloween costume\": 2, \"carrot\": 1, \"pumpkin\": 3, \"halloween bucket\": 1, \"star print\": 1, \"animal print\": 1, \"green bow\": 2, \"outline\": 2, \"lanyard\": 6, \"holding whip\": 1, \"under-rim eyewear\": 10, \"disposable cup\": 1, \"coffee cup\": 1, \"brown sweater\": 2, \"ankle strap\": 1, \"purple skirt\": 4, \"weasel ears\": 6, \"white mask\": 2, \"holding lantern\": 1, \"ninja\": 2, \"toeless footwear\": 1, \"shuriken\": 1, \"eyebrow piercing\": 1, \"ninja mask\": 2, \"diamond-shaped pupils\": 1, \"black choker\": 6, \"black sailor collar\": 3, \"red neckerchief\": 5, \"running\": 1, \"eyes visible through hair\": 1, \"goggles on headwear\": 1, \"earphones\": 4, \"earbuds\": 4, \"crossed bandaids\": 2, \"serafuku\": 2, \"digital media player\": 1, \"skateboard\": 1, \"brown socks\": 1, \"two-sided skirt\": 1, \"purple pants\": 4, \"antennae\": 2, \"grenade launcher\": 1, \"red shorts\": 3, \"leather jacket\": 2, \"holding candy\": 1, \"holding lollipop\": 1, \"crystal ball\": 1, \"notebook\": 1, \"green gloves\": 2, \"bubble blowing\": 1, \"chewing gum\": 1, \"planet\": 2, \"black-framed eyewear\": 4, \"sign\": 1, \"road sign\": 1, \"test tube\": 3, \"card\": 1, \"holding card\": 1, \"sarashi\": 1, \"box\": 1, \"colored inner hair\": 2, \"cardboard box\": 1, \"holding box\": 1, \"rapier\": 1, \"cigarette\": 2, \"loose socks\": 2, \"leg warmers\": 2, \"pocky\": 1, \"braided ponytail\": 2, \"striped shorts\": 1, \"microphone\": 2, \"microphone stand\": 2, \"navel cutout\": 3, \"red sleeves\": 1, \"black ascot\": 3, \"aqua headwear\": 3, \"shaded face\": 2, \"water gun\": 3, \"eyewear on headwear\": 2, \"holding water gun\": 1, \"folded ponytail\": 1, \"chest belt\": 2, \"shoulder strap\": 1, \"bead bracelet\": 2, \"aqua gloves\": 1, \"shorts under dress\": 1, \"yellow necktie\": 2, \"shin guards\": 2, \"backless outfit\": 1, \"backless dress\": 1, \"newspaper\": 1, \"wristwatch\": 2, \"syringe\": 2, \"stethoscope\": 2, \"holding syringe\": 1, \"orange neckerchief\": 2, \"ring\": 6, \"multiple rings\": 3, \"green footwear\": 1, \"loafers\": 3, \"scooter\": 1, \"off-shoulder jacket\": 1, \"thumb ring\": 1, \"torn thighhighs\": 2, \"turret\": 1, \"long skirt\": 1, \"coat on shoulders\": 2, \"cannon\": 1, \"bird girl\": 1, \"blue cape\": 2, \"elite ii (arknights)\": 1, \"eyebrows hidden by hair\": 1, \"black sclera\": 1, \"lizard tail\": 3, \"pink footwear\": 3, \"pink jacket\": 3, \"scissors\": 2, \"holding scissors\": 2, \"holding sheath\": 2, \"ready to draw\": 2, \"blindfold\": 2, \"clenched hands\": 1, \"headgear\": 2, \"black wings\": 1, \"headpiece\": 1, \"torn pantyhose\": 1, \"bird ears\": 2, \"kimono\": 3, \"facial mark\": 2, \"forehead mark\": 2, \"geta\": 2, \"tabi\": 3, \"purple gloves\": 1, \"black kimono\": 2, \"hair rings\": 3, \"blue hairband\": 4, \"kitsune\": 4, \"red rose\": 6, \"toeless legwear\": 5, \"stirrup legwear\": 4, \"robot\": 2, \"naginata\": 1, \"otter ears\": 3, \"white choker\": 1, \"absurdly long hair\": 2, \"bandana\": 2, \"goatee\": 2, \"bass guitar\": 1, \"yo-yo\": 1, \"chest strap\": 2, \"white eyes\": 1, \"tight\": 2, \"white ascot\": 3, \"tight pants\": 2, \"red pants\": 2, \"paper\": 1, \"blue feathers\": 3, \"crown\": 2, \"mini crown\": 2, \"blue sailor collar\": 1, \"white umbrella\": 2, \"helmet removed\": 1, \"bandaid on cheek\": 2, \"holding helmet\": 1, \"carrying under arm\": 1, \"back\": 1, \"japanese armor\": 1, \"jeans\": 1, \"camouflage\": 3, \"bike shorts\": 1, \"wolf boy\": 1, \"animification\": 2, \"sharp teeth\": 1, \"white hoodie\": 1, \"bulletproof vest\": 3, \"backwards hat\": 1, \"white cardigan\": 1, \"maid apron\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 512], \"count\": 1105}}, \"mean_img_ar_error\": 0.0}, \"subsets\": [{\"img_count\": 1105, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"AKTEST\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "9", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0001", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "276", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "5530", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "ec3b346e8d536806183cf2438a08e465f004627a4b5d7d6f597aaf432d8916db", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "553", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "AKTEST", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "7fcf3871", + "ss_sd_scripts_commit_hash": "e13e95f36f91170e144d91444864838ba1bd3f83", + "ss_seed": "42", + "ss_session_id": "801489692", + "ss_text_encoder_lr": "5e-05", + "ss_training_comment": "None", + "ss_training_finished_at": "1679459500.9484537", + "ss_training_started_at": "1679456400.4718633", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "bb2e6082", + "sshs_model_hash": "d93ff091f51c62357db15cbf9d327773408bd99aa8e1ea95abd3df4c3e6ee918" +} \ No newline at end of file diff --git a/Styles/22/arknightschibilora_v1.txt b/Styles/22/arknightschibilora_v1.txt new file mode 100644 index 0000000000000000000000000000000000000000..a4b458b5a9bb067cab8a5bd96c9cd15bbaf70167 --- /dev/null +++ b/Styles/22/arknightschibilora_v1.txt @@ -0,0 +1,462 @@ +Link:https://civitai.com/models/23051/arknights-chibi-lora +Version:v1 +Base Model:SD 1.5 +Keywords:chibi, full body +--------DESCRIPTION--------- + +Disclaimer: Some preview images were obtained at different stages of the training process and will not match your output 1:1. They are here to give you an idea of what this LoRA looks like. + +A dataset of 1105 assembled sprites, each downloaded painstakingly one-by-one and denoised through a batch converter, were used in the making of this LoRA. + +Compatible with other character LoRAs. + +Recommended tags to use to replicate Arknights' sprites: +chibi +full body +cel-shaded +flat colors +arknights-inspired clothing + +Recommended dimension ratio: 1:1 +512x768 produces taller chibis. + +Lower/increase weight as needed. Works at fine at 1. + +Enjoy. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:chibi, full body, standing, fox ears, tail, platinum blonde hair, blue eyes, sweater dress, bottomless, barefoot, indoors, hydroponics, ahoge, disheveled hair, , standing straight + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img2: + Prompt:(masterpiece, best quality:1.2), chibi, platinum blonde hair, blue eyes, sweater dress, full body, bare feet, (flat shading), (anime cel-shaded:1.1), fox ears, large tail, fox tail, fluffy tail + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:anything-v4.5-pruned, Model Hash: +img3: + Prompt:, chibi, full body,standing, kirisame marisa, solo + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img4: + Prompt:(masterpiece, best quality:1.2), chibi, hakurei reimu, torii gate, ofuda + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img5: + Prompt:(masterpiece, best quality:1.2), chibi, remilia scarlet, mansion, full body, (flat shading:1.1) + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img6: + Prompt:, chibi, full body, news room, animal ears, pink hair, black jacket, breastplate, thighhighs, torn thighhighs, boots, + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img7: + Prompt:, akchibi, chibi, , main outfit, animal ears, pink hair, long hair, black jacket, breastplate, thighhighs, torn thighhighs, black boots + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:512x512, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:2, Model:anything-v4.5-pruned, Model Hash: +img8: + Prompt:,, animal ears, leopard ears, grey eyes, white hair, very long hair,turtleneck, black cape, white dress, pelvic curtain, grey thighhighs, hip vent, black boots, fur-trimmed boots, chibi, full body,standing + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img9: + Prompt:(masterpiece, best quality:1.2), chibi, hatsune miku, stage, idol, song note, full body, microphone stand, (flat shading:1.1) + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears + Size:512x512, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:SomethingV2_2, Model Hash: +img10: + Prompt:, akchibi, chibi, full body, lavender hair,long hair, magenta eyes, long white dress, black belt under breasts, wisteria flowers, grass, tombstone, lavender flowers + Negative Prompt:(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), bare shoulders, anil ears + Size:512x512, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:2, Model:anything-v4.5-pruned, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 23051, + "name": "Arknights Chibi LoRA", + "description": "

Disclaimer: Some preview images were obtained at different stages of the training process and will not match your output 1:1. They are here to give you an idea of what this LoRA looks like.

A dataset of 1105 assembled sprites, each downloaded painstakingly one-by-one and denoised through a batch converter, were used in the making of this LoRA.

Compatible with other character LoRAs.

Recommended tags to use to replicate Arknights' sprites:

  • chibi

  • full body

  • cel-shaded

  • flat colors

  • arknights-inspired clothing

Recommended dimension ratio: 1:1

512x768 produces taller chibis.

Lower/increase weight as needed. Works at fine at 1.


Enjoy.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 1522, + "favoriteCount": 395, + "commentCount": 1, + "ratingCount": 7, + "rating": 4.86 + }, + "creator": { + "username": "7ar", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/28e58702-3eb2-4e2e-6f63-b1893ad74f00/width=96/7ar.jpeg" + }, + "tags": [], + "modelVersions": [ + { + "id": 27533, + "modelId": 23051, + "name": "v1", + "createdAt": "2023-03-22T20:32:24.662Z", + "updatedAt": "2023-03-23T09:18:07.857Z", + "trainedWords": [ + "chibi, full body" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "files": [ + { + "name": "arknightsChibiLora_v1.safetensors", + "id": 22760, + "sizeKB": 18589.349609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-22T20:35:40.427Z", + "hashes": { + "AutoV1": "5CD472F0", + "AutoV2": "9CAB09D576", + "SHA256": "9CAB09D57687ABDF6DE48B4ED2807A4133F1D5A591D6F679A424432E4357F04D", + "CRC32": "CAA610EF", + "BLAKE3": "F29865AA39AD2ADBC60F4C35386555F9FCC58E24BB50FE499F1B13A77921B646" + }, + "downloadUrl": "https://civitai.com/api/download/models/27533", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4700378f-f2f3-4402-80d6-62b92a87c400/width=450/303243.jpeg", + "nsfw": false, + "width": 608, + "height": 608, + "hash": "UJJQ[:ELE2-;~qR*_3%M4o%M?b%29a-;xZt7", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2301221950, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": "chibi, full body, standing, fox ears, tail, platinum blonde hair, blue eyes, sweater dress, bottomless, barefoot, indoors, hydroponics, ahoge, disheveled hair, , standing straight", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Hires upscale": "1.2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2491cc16-1557-4b70-e61b-ca46d0885500/width=450/303242.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UIK1Xc_3029G%$IV~Wt6?H4o~Wt64:Rj-:E1", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1753878173, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(masterpiece, best quality:1.2), chibi, platinum blonde hair, blue eyes, sweater dress, full body, bare feet, (flat shading), (anime cel-shaded:1.1), fox ears, large tail, fox tail, fluffy tail", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c73b9864-75c8-4c5a-2ec5-82bafd8f5a00/width=450/303241.jpeg", + "nsfw": false, + "width": 608, + "height": 608, + "hash": "UYJQ_[RiIUoe%2Ip%MWA_NWC-of6WDxZRiog", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1286647471, + "Model": "SomethingV2_2", + "steps": 28, + "prompt": ", chibi, full body,standing, kirisame marisa, solo", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Hires upscale": "1.2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2),", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eda5b504-5d0f-4bf8-8dfa-bc7819303d00/width=450/303240.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UDK,jaE2~q=|?HRO^,%L,Zxv%gRQ=xaw0LD%", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2190015769, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": "(masterpiece, best quality:1.2), chibi, hakurei reimu, torii gate, ofuda", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d9b9d459-a477-48f0-eebf-19016a21ee00/width=450/303239.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "U4G*.?}[000e-ZwI4-F_-$t7~XMyGs%g0000", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1780278998, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": "(masterpiece, best quality:1.2), chibi, remilia scarlet, mansion, full body, (flat shading:1.1)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/116b6a46-31fa-4563-f958-a449ffddbe00/width=450/303238.jpeg", + "nsfw": false, + "width": 608, + "height": 608, + "hash": "UWIOFRR*Nxs:~WkCNHxa_3t7V?t7o|V@%1NG", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1220477443, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": ", chibi, full body, news room, animal ears, pink hair, black jacket, breastplate, thighhighs, torn thighhighs, boots, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gravelArknights_v1", + "type": "lora", + "weight": 1 + } + ], + "Hires upscale": "1.2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/15d39199-b77b-4ca8-9062-cdbb273c9c00/width=450/303237.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UYIO96%ME2WV%2%2E2WB~p%MWBe.x[%Ls:WB", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3184511290, + "Model": "anything-v4.5-pruned", + "steps": 25, + "prompt": ", akchibi, chibi, , main outfit, animal ears, pink hair, long hair, black jacket, breastplate, thighhighs, torn thighhighs, black boots", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ArknightsSpritesV2", + "type": "lora", + "weight": 1 + }, + { + "name": "Gravel", + "type": "lora", + "weight": 1 + } + ], + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7aa4f3a6-7157-4ca7-6a55-f4e6afa2ef00/width=450/303236.jpeg", + "nsfw": false, + "width": 608, + "height": 608, + "hash": "UPLXMeM{%Nxu~q%MIURQWXWBaej@IURjxuxu", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 3533183496, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": ",, animal ears, leopard ears, grey eyes, white hair, very long hair,turtleneck, black cape, white dress, pelvic curtain, grey thighhighs, hip vent, black boots, fur-trimmed boots, chibi, full body,standing", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "pramanixArknights_v2", + "type": "lora", + "weight": 1 + } + ], + "Hires upscale": "1.2", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f00f6fb-01a2-4137-2cce-f4b6f2cf8b00/width=450/303235.jpeg", + "nsfw": false, + "width": 608, + "height": 608, + "hash": "UIE{wvNGMxIAMyR%oMIT~WV@-;M{M{V@x[R*", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 883608688, + "Model": "SomethingV2_2", + "steps": 20, + "prompt": "(masterpiece, best quality:1.2), chibi, hatsune miku, stage, idol, song note, full body, microphone stand, (flat shading:1.1)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [], + "Hires upscale": "1.2", + "Hires upscaler": "Latent", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c0b9ede0-1936-4dd3-1942-d1828ce6a200/width=450/303234.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UMJaZloc8{xtvbRk-oR%?Ea$-=IV$.ahxsog", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2031102590, + "Model": "anything-v4.5-pruned", + "steps": 25, + "prompt": ", akchibi, chibi, full body, lavender hair,long hair, magenta eyes, long white dress, black belt under breasts, wisteria flowers, grass, tombstone, lavender flowers", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "ArknightsSpritesV2", + "type": "lora", + "weight": 1 + } + ], + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), bare shoulders, anil ears" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/27533" + }, + { + "id": 27534, + "modelId": 23051, + "name": "underfit", + "createdAt": "2023-03-22T20:32:24.662Z", + "updatedAt": "2023-03-23T09:18:07.857Z", + "trainedWords": [ + "chibi, full body" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

I found that the first epoch had an adorable style to it so I might as well throw it here.

", + "files": [ + { + "name": "arknightsChibiLora_underfit.safetensors", + "id": 22761, + "sizeKB": 18589.349609375, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-22T20:35:44.441Z", + "hashes": { + "AutoV1": "5CD472F0", + "AutoV2": "ED3DBC6F76", + "SHA256": "ED3DBC6F7671547CC3706A5EC37BC971CB3624F8CA879FFBFDD03D90FA9F6172", + "CRC32": "937EAB84", + "BLAKE3": "E2FC25F727E65C847F70E2CA76FAE0DFA1FF394234343D430D08912FF9BEA0B7" + }, + "downloadUrl": "https://civitai.com/api/download/models/27534", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8a217e9c-34f2-40af-f8a0-55851392dd00/width=450/303244.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UFL4Te_M00NY0MI.00t8tK8|t8%M0f-V?aMy", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2907099341, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(masterpiece, best quality:1.2), chibi, platinum blonde hair, blue eyes, sweater dress, full body, bare feet, (flat shading), (anime cel-shaded:1.1), fox ears, large tail, fox tail, fluffy tail, standing, indoors, tatami mat, kotatsu,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "hash": "530298b52509", + "name": "01", + "type": "lora", + "weight": null + } + ], + "AddNet Enabled": "True", + "AddNet Model 1": "AKTEST-01(530298b52509)", + "negativePrompt": "(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2), animal ears, sitting", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.0", + "AddNet Weight B 1": "1.0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/27534" + } + ] +} +---------------------------- diff --git a/Styles/24/auvere-000020-119372-metadata.json b/Styles/24/auvere-000020-119372-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..60620a3d8a3d52cc88de793f4af62a7e3b2caaef --- /dev/null +++ b/Styles/24/auvere-000020-119372-metadata.json @@ -0,0 +1,873 @@ +{ + "ss_sd_model_name": "foxyansfw_v4.safetensors", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "2", + "ss_num_train_images": "2040", + "ss_tag_frequency": { + "15_auvere style": { + "young": 136, + "mammal": 131, + "anthro": 122, + "cub": 120, + "hair": 117, + "blush": 116, + "solo": 110, + "genitals": 104, + "nude": 96, + "fur": 92, + "nipples": 82, + "female": 81, + "canid": 71, + "canine": 71, + "open_mouth": 71, + "male": 69, + "pussy": 65, + "looking_at_viewer": 60, + "navel": 54, + "canis": 52, + "flat_chested": 51, + "penis": 50, + "clothing": 50, + "balls": 42, + "loli": 42, + "clothed": 40, + "blue_eyes": 39, + "simple_background": 35, + "domestic_dog": 34, + "butt": 33, + "foreskin": 33, + "spreading": 33, + "spread_legs": 32, + "felid": 32, + "feline": 32, + "humanoid_genitalia": 27, + "furniture": 26, + "lying": 25, + "bed": 24, + "letterbox": 24, + "domestic_cat": 24, + "felis": 24, + "duo": 23, + "erection": 23, + "smile": 23, + "tongue": 23, + "humanoid_penis": 23, + "shota": 23, + "biped": 22, + "clitoris": 22, + "black_bars": 21, + "brown_hair": 21, + "flaccid": 20, + "white_body": 20, + "white_fur": 20, + "child": 20, + "bodily_fluids": 19, + "outside": 18, + "wolf": 18, + "eyes_closed": 17, + "pawpads": 17, + "feet": 17, + "plant": 16, + "green_eyes": 16, + "water": 16, + "paws": 16, + "male/female": 15, + "fox": 15, + "countershading": 15, + "eyewear": 15, + "sitting": 15, + "humanoid": 15, + "on_bed": 14, + "glasses": 14, + "genital_fluids": 14, + "bandage": 13, + "bottomwear": 13, + "fingers": 13, + "topwear": 13, + "multicolored_hair": 13, + "rodent": 13, + "animal_humanoid": 13, + "claws": 13, + "sleeping": 12, + "partially_clothed": 12, + "sky": 12, + "lagomorph": 12, + "leporid": 12, + "rabbit": 12, + "depth_of_field": 12, + "tail": 12, + "blue_hair": 12, + "anus": 11, + "tan_body": 11, + "brown_eyes": 11, + "sundae_(kei)": 11, + "plantigrade": 11, + "on_back": 11, + "toes": 11, + "standing": 11, + "girly": 11, + "cum": 11, + "mammal_humanoid": 11, + "hybrid": 11, + "band-aid": 10, + "looking_back": 10, + "kemono": 10, + "tan_fur": 10, + "casual_nudity": 10, + "presenting": 10, + "green_hair": 10, + "bottomless": 10, + "blonde_hair": 10, + "sex": 9, + "horn": 9, + "underwear": 9, + "herding_dog": 9, + "pastoral_dog": 9, + "black_hair": 9, + "murid": 9, + "murine": 9, + "bovid": 9, + "caprine": 9, + "kneeling": 9, + "food": 8, + "grey_body": 8, + "grey_fur": 8, + "shirt": 8, + "multicolored_body": 8, + "multicolored_fur": 8, + "teeth": 8, + "accessory": 8, + "hair_accessory": 8, + "ribbons": 8, + "humanoid_hands": 8, + "red_hair": 8, + "blue_body": 8, + "blue_fur": 8, + "black_body": 8, + "black_fur": 8, + "footwear": 7, + "countershade_face": 7, + "countershade_torso": 7, + "pillow": 7, + "multi_nipple": 7, + "brown_body": 7, + "brown_fur": 7, + "markings": 7, + "white_hair": 7, + "vaginal": 7, + "one_eye_closed": 7, + "beach": 7, + "front_view": 7, + "seaside": 7, + "bovid_humanoid": 7, + "caprine_humanoid": 7, + "goat_humanoid": 7, + "petal_(petal11)": 7, + "cum_inside": 7, + "tongue_out": 7, + "inside": 6, + "socks": 6, + "panties": 6, + "public": 6, + "shorts": 6, + "open_smile": 6, + "penile": 6, + "penetration": 6, + "countershade_tail": 6, + "two_tone_tail": 6, + "mouse": 6, + "animal_genitalia": 6, + "sea": 6, + "red_eyes": 6, + "lynx": 6, + "fubuki_reikon": 6, + "eyebrows": 6, + "big_eyes": 6, + "yellow_body": 6, + "yellow_fur": 6, + "inanimate_object": 6, + "riggles": 6, + "innie_pussy": 6, + "bedroom": 5, + "fennec": 5, + "legwear": 5, + "soccer": 5, + "sport": 5, + "tomboy": 5, + "australian_shepherd": 5, + "sheepdog": 5, + "juno_clark": 5, + "black_nose": 5, + "on_side": 5, + "small_penis": 5, + "wet": 5, + "flower": 5, + "leaf": 5, + "presenting_hindquarters": 5, + "penile_penetration": 5, + "detailed_background": 5, + "age_difference": 5, + "star": 5, + "two_tone_hair": 5, + "hairclip": 5, + "partially_submerged": 5, + "swimwear": 5, + "cum_in_pussy": 5, + "smiling_at_viewer": 5, + "oral": 5, + "all_fours": 5, + "4_toes": 5, + "5_fingers": 5, + "blep": 5, + "happy": 5, + "tuft": 5, + "white_tail": 5, + "plushie": 5, + "underwear_down": 4, + "holding_object": 4, + "grey_background": 4, + "orange_body": 4, + "orange_fur": 4, + "kei_anbie": 4, + "humanoid_feet": 4, + "presenting_pussy": 4, + "rick_softpaw": 4, + "female_penetrated": 4, + "male_penetrating": 4, + "male_penetrating_female": 4, + "penis_in_pussy": 4, + "vaginal_penetration": 4, + "ineffective_censorship": 4, + "legs_up": 4, + "size_difference": 4, + "star_marking": 4, + "public_bath": 4, + "teal_eyes": 4, + "cum_on_body": 4, + "cum_on_face": 4, + "bikini": 4, + "cloud": 4, + "holidays": 4, + "anthro_on_anthro": 4, + "winterwolfy": 4, + "bedding": 4, + "bedding_background": 4, + "black_eyewear": 4, + "black_glasses": 4, + "black_pupils": 4, + "brown_nipples": 4, + "cheek_tuft": 4, + "circle_eyebrows": 4, + "countershade_arms": 4, + "countershade_feet": 4, + "countershade_hands": 4, + "countershade_legs": 4, + "eyewear_only": 4, + "facial_tuft": 4, + "fur_tuft": 4, + "glasses_only": 4, + "high-angle_view": 4, + "hindpaw": 4, + "iris": 4, + "light": 4, + "monotone_hair": 4, + "orange_eyes": 4, + "orange_tongue": 4, + "pink_pawpads": 4, + "prick_ears": 4, + "pupils": 4, + "seductive": 4, + "two_tone_body": 4, + "two_tone_fur": 4, + "white_bedding": 4, + "white_countershading": 4, + "white_eyebrows": 4, + "white_inner_ear": 4, + "yellow_ears": 4, + "yellow_tail": 4, + "welsh_corgi": 4, + "after_sex": 4, + "pose": 4, + "ball": 3, + "bottomwear_down": 3, + "panties_down": 3, + "pants": 3, + "pants_down": 3, + "sweat": 3, + "white_clothing": 3, + "white_panties": 3, + "white_underwear": 3, + "looking_pleasured": 3, + "short_hair": 3, + ":3": 3, + "tree": 3, + "helen_(johnbrittish)": 3, + "bent_legs": 3, + "bent_arm": 3, + "crouching": 3, + "hand_on_leg": 3, + "hand_on_thigh": 3, + "sand": 3, + "butt_from_the_front": 3, + "black_sclera": 3, + "skirt": 3, + "floofy_(character)": 3, + "rear_view": 3, + "cum_on_leg": 3, + "white_background": 3, + "long_hair": 3, + "crossdressing": 3, + "pink_hair": 3, + "pussy_juice": 3, + "sciurid": 3, + "dessert": 3, + "hyena": 3, + "spotted_hyena": 3, + "braided_hair": 3, + "whiskers": 3, + "animal_penis": 3, + "group": 3, + "group_sex": 3, + "threesome": 3, + "trio": 3, + "city": 3, + "city_background": 3, + "walking": 3, + "rat": 3, + "cyprus_(cy)": 3, + "blurred_background": 3, + "arthropod": 3, + "insect": 3, + "umbrella": 3, + "yellow_eyes": 3, + "grass": 3, + "male/male": 3, + "solo_focus": 3, + "cunnilingus": 3, + "mostly_nude": 3, + "cum_string": 3, + "topless": 3, + "canid_humanoid": 3, + "canine_humanoid": 3, + "condom": 2, + "forced": 2, + "rape": 2, + "sexual_barrier_device": 2, + "sleep_sex": 2, + "chelsea_larimore": 2, + "soccer_ball": 2, + "spots": 2, + "spotted_body": 2, + "spotted_fur": 2, + "gaming": 2, + "holding_joystick": 2, + "joystick": 2, + "pizza": 2, + "playing_videogame": 2, + "kai_(influenzza)": 2, + "robby_bunny": 2, + "masturbation": 2, + "scarf": 2, + "anal": 2, + "anal_penetration": 2, + "forest": 2, + "hair_ribbon": 2, + "angry": 2, + "annoyed": 2, + "floppy_ears": 2, + "chromatic_aberration": 2, + "arms_bent": 2, + "barefoot": 2, + "game_boy_console": 2, + "game_console": 2, + "handheld": 2, + "handheld_console": 2, + "lying_on_bed": 2, + "nintendo_console": 2, + "planted_legs": 2, + "goat": 2, + "hand_on_own_leg": 2, + "hand_on_own_thigh": 2, + "holding_leg": 2, + "holding_thigh": 2, + "koji_katsuo": 2, + "bathing": 2, + "bathroom": 2, + "bathtub": 2, + "bubble": 2, + "holding_person": 2, + "innocence": 2, + "raised_arms": 2, + "shampoo": 2, + "thigh_highs": 2, + "thigh_socks": 2, + "cloudscape": 2, + "moon": 2, + "starry_sky": 2, + "husky": 2, + "nordic_sled_dog": 2, + "spitz": 2, + "censor_bar": 2, + "hand_on_hair": 2, + "partially_retracted_foreskin": 2, + "boy_shorts": 2, + "cherry_panties": 2, + "cherry_pattern_panties": 2, + "cherry_pattern_underwear": 2, + "cherry_underwear": 2, + "colored_edge_panties": 2, + "heart_clothing": 2, + "heart_pattern": 2, + "heart_pattern_panties": 2, + "heart_pattern_underwear": 2, + "pattern_bottomwear": 2, + "pattern_clothing": 2, + "pattern_panties": 2, + "pattern_underwear": 2, + "print_clothing": 2, + "clothing_around_one_leg": 2, + "embarrassed": 2, + "panties_around_one_leg": 2, + "underwear_around_one_leg": 2, + "undressing": 2, + "bikini_bottom": 2, + "bikini_top": 2, + "bite": 2, + "biting_lip": 2, + "biting_own_lip": 2, + "self_bite": 2, + "collar": 2, + "jewelry": 2, + "candy": 2, + "fruit": 2, + "pumpkin": 2, + "purple_eyes": 2, + "toe_claws": 2, + "adult_on_child": 2, + "adult_on_cub": 2, + "equine_genitalia": 2, + "equine_penis": 2, + "fellatio": 2, + "older_male": 2, + "young_female": 2, + "younger_female": 2, + "necktie": 2, + "school_uniform": 2, + "uniform": 2, + "mirror": 2, + "blue_sky": 2, + "chevron_(marking)": 2, + "leg_markings": 2, + "midriff": 2, + "socks_(marking)": 2, + "white_penis": 2, + "ailurid": 2, + "red_panda": 2, + "maxwell_ailuri": 2, + "cum_in_ass": 2, + "cum_on_butt": 2, + "beetle": 2, + "cucujoid": 2, + "ladybug": 2, + "cold": 2, + "caninu": 2, + "malt_marzipan": 2, + "mei_marzipan": 2, + "alternate_species": 2, + "mascot": 2, + "linnea_(baraag)": 2, + "young_on_young": 2, + "dragon": 2, + "animal_plushie": 2, + "eye_markings": 2, + "holding_plushie": 2, + "rabbit_plushie": 2, + "star_on_body": 2, + "star_polygon": 2, + "tired": 2, + "t-shirt": 2, + "cum_on_bedding": 2, + "cum_on_glasses": 2, + "cum_on_hand": 2, + "mustelid": 2, + "otter": 2, + "clothing_pull": 2, + "circumcised": 2, + "bear": 2, + "giant_panda": 2, + "fully_clothed": 2, + "grey_eyes": 2, + "grey_hair": 2, + "snow": 2, + "humanoid_pointy_ears": 2, + "not_furry": 2, + "lalafell": 2, + "fox_humanoid": 2, + "andromorph": 2, + "intersex": 2, + "big_head": 2, + "filled_condom": 1, + "wearing_condom": 1, + "cupcake": 1, + "feral": 1, + "humanoid_pussy": 1, + "leg_warmers": 1, + "leg_warmers_only": 1, + "equid": 1, + "equine": 1, + "horse": 1, + "pony": 1, + "unicorn": 1, + "fan_character": 1, + "pastel_drop": 1, + "frilly": 1, + "frilly_clothing": 1, + "frilly_panties": 1, + "frilly_underwear": 1, + "shorts_down": 1, + "kai_(kaibun)": 1, + "ahoge": 1, + "long_sleeves": 1, + "penile_masturbation": 1, + "tears": 1, + "tissue": 1, + "tissue_box": 1, + "anal_masturbation": 1, + "dildo": 1, + "dildo_in_ass": 1, + "dildo_insertion": 1, + "dildo_sitting": 1, + "male_penetrated": 1, + "object_in_ass": 1, + "sex_toy": 1, + "sex_toy_in_ass": 1, + "sex_toy_insertion": 1, + "plump_labia": 1, + "tail_motion": 1, + "tailwag": 1, + "wet_body": 1, + "wet_fur": 1, + "bird_dog": 1, + "cavalier_king_charles_spaniel": 1, + "hunting_dog": 1, + "spaniel": 1, + "toy_dog": 1, + "acacia_(ashcozy)": 1, + "flower_field": 1, + "tasteful_nudity": 1, + "spread_pussy": 1, + "urethra": 1, + "pajamas": 1, + "popsicle": 1, + "swimming_pool": 1, + "breasts": 1, + "cum_on_chest": 1, + "messy": 1, + "hands_on_hips": 1, + "orange_hair": 1, + "stripes": 1, + "cherry_pattern": 1, + "heart_panties": 1, + "heart_underwear": 1, + "print_underwear": 1, + "unretracted_foreskin": 1, + "raised_leg": 1, + "shy": 1, + "soles": 1, + "eiko": 1, + "two_piece_swimsuit": 1, + "bodily_fluids_in_pussy": 1, + "riley_bunny": 1, + "overalls": 1, + "day": 1, + "necklace": 1, + "tribal": 1, + "tribal_jewelry": 1, + "tribal_necklace": 1, + "chipmunk": 1, + "ground_squirrel": 1, + "gavin_alvarez": 1, + "blue_ears": 1, + "white_ears": 1, + "fungus": 1, + "mushroom": 1, + "bath": 1, + "small_nipples": 1, + "chinchillid": 1, + "cherry_print_underwear": 1, + "backsack": 1, + "benjivulpes": 1, + "suspenders": 1, + "ambiguous_gender": 1, + "hairband": 1, + "hot_spring": 1, + "onsen": 1, + "sauna": 1, + "steam": 1, + "stool": 1, + "towel": 1, + "towel_only": 1, + "brown_nose": 1, + "hands_on_legs": 1, + "crop_top": 1, + "hat": 1, + "headgear": 1, + "headwear": 1, + "pink_crop_top": 1, + "sun_hat": 1, + "sunglasses": 1, + "pink_nose": 1, + "toga": 1, + "blurred_foreground": 1, + "book": 1, + "dappled_light": 1, + "hand_on_face": 1, + "kemololi": 1, + "nude_beach": 1, + "on_front": 1, + "parted_lips": 1, + "chest_tuft": 1, + "raining": 1, + "running": 1, + "flip_bunny": 1, + "pink_body": 1, + "pink_fur": 1, + "egg": 1, + "costume": 1, + "jack-o'-lantern": 1, + "night": 1, + "porch": 1, + "trick_or_treat": 1, + "mummy": 1, + "undead": 1, + "bow_(feature)": 1, + "bow_accessory": 1, + "bow_ribbon": 1, + "hair_bow": 1, + "furrification": 1, + "hand_on_head": 1, + "dress": 1, + "no_underwear": 1, + "upskirt": 1, + "after_vaginal": 1, + "after_vaginal_penetration": 1, + "cuddling": 1, + "frottage": 1, + "male_on_bottom": 1, + "male_on_top": 1, + "on_bottom": 1, + "on_top": 1, + "tree_squirrel": 1, + "casual_exposure": 1, + "smaller_penetrated": 1, + "younger_penetrated": 1, + "anthro_penetrated": 1, + "anthro_penetrating": 1, + "anthro_penetrating_anthro": 1, + "bisexual": 1, + "child_on_child": 1, + "footprint": 1, + "interspecies": 1, + "pawprint": 1, + "pawprint_marking": 1, + "penis_in_ass": 1, + "red_body": 1, + "red_fur": 1, + "gregory_(mobkiller)": 1, + "jeffybunny": 1, + "nikki_(mobkiller)": 1, + "crossgender": 1, + "skinny_dipping": 1, + "closed_frown": 1, + "clothing_lift": 1, + "genital_exploration": 1, + "shirt_lift": 1, + "sitting_on_ground": 1, + "butterfly_print": 1, + "creature_print": 1, + "insect_print": 1, + "print_shirt": 1, + "print_t-shirt": 1, + "print_topwear": 1, + "shirt_only": 1, + "t-shirt_only": 1, + "topwear_only": 1, + "butterfly": 1, + "lepidopteran": 1, + "yoga": 1, + "chani_(ajdurai)": 1, + "jenny_(ajdurai)": 1, + "butt_pose": 1, + "sweatdrop": 1, + "poking_out": 1, + "underwear_pull": 1, + "wrists_tied": 1, + "dark": 1, + "feet_together_knees_apart": 1, + "leg_grab": 1, + "legs_over_edge": 1, + "on_furniture": 1, + "over_edge": 1, + "platform_sex": 1, + "sitting_on_bed": 1, + "straight_arms": 1, + "thigh_grab": 1, + "iankeaton": 1, + "sweater": 1, + "gift": 1, + "crossed_arms": 1, + "procyonid": 1, + "raccoon": 1, + "wardrobe_malfunction": 1, + "pantherine": 1, + "snow_leopard": 1, + "foam": 1, + "ripples": 1, + "water_ripple": 1, + "exposure_variation": 1, + "looking_aside": 1, + "boots": 1, + "boots_only": 1, + "footwear_only": 1, + "snow_boots": 1, + "transparent_background": 1, + "hands_behind_back": 1, + "hoodie": 1, + "kiggles": 1, + "brown_background": 1, + "gesture": 1, + "jacket": 1, + "v_sign": 1, + "wink": 1, + "69_position": 1, + "green_body": 1, + "green_fur": 1, + "licking": 1, + "nose_to_anus": 1, + "mephitid": 1, + "skunk": 1, + "diaper": 1, + "disembodied_penis": 1, + "doughnut": 1, + "faceless_character": 1, + "open_diaper": 1, + "toddler": 1, + "donut_(misterdonut)": 1, + "embrace": 1, + "hug": 1, + "sheath": 1, + "izzy_(drgnhybrid)": 1, + "mau_(drgnhybrid)": 1, + "hands_behind_head": 1, + "humanoidized": 1, + "dog_humanoid": 1, + "cum_on_pussy": 1, + "ejaculation": 1, + "orgasm": 1, + "light_body": 1, + "light_skin": 1, + "shrub": 1, + "backpack": 1, + "beverage": 1, + "bow_shirt": 1, + "bow_skirt": 1, + "bracelet": 1, + "container": 1, + "daww": 1, + "bent_over": 1, + "speedo": 1, + "speedo_down": 1, + "underwear_only": 1, + "bottomwear_pull": 1, + "glowing": 1, + "glowing_eyes": 1, + "glowing_genitalia": 1, + "glowing_penis": 1, + "pants_pull": 1, + "public_nudity": 1, + "small_balls": 1, + "leaning": 1, + "leaning_forward": 1, + "human": 1, + "tan_skin": 1, + "after_anal": 1, + "female_focus": 1, + "gaping": 1, + "gaping_anus": 1, + "pyravia": 1 + } + }, + "ss_base_model_version": "sd_v1", + "ss_batch_size_per_device": "3", + "ss_reg_dataset_dirs": {}, + "ss_epoch": "20", + "ss_max_token_length": "None", + "ss_multires_noise_iterations": "10", + "ss_face_crop_aug_range": "None", + "ss_sd_model_hash": "4b4d6004", + "ss_adaptive_noise_scale": "None", + "ss_max_grad_norm": "1.0", + "ss_num_epochs": "20", + "ss_total_batch_size": "3", + "ss_color_aug": "False", + "ss_random_crop": "False", + "ss_multires_noise_discount": "0.1", + "sshs_model_hash": "134113695c9d1f4fc71ea4f198939b928c31ce196751e2094ee1cf64c9aafdd5", + "ss_gradient_checkpointing": "False", + "ss_shuffle_caption": "False", + "ss_min_bucket_reso": "None", + "ss_max_train_steps": "13600", + "ss_training_started_at": "1694186981.7977788", + "ss_caption_dropout_every_n_epochs": "0", + "ss_lr_scheduler": "constant", + "ss_cache_latents": "True", + "ss_bucket_info": "null", + "sshs_legacy_hash": "661be614", + "ss_zero_terminal_snr": "False", + "ss_sd_scripts_commit_hash": "2accb1305979ba62f5077a23aabac23b4c37e935", + "ss_text_encoder_lr": "5e-05", + "ss_full_fp16": "False", + "ss_lr_warmup_steps": "0", + "ss_flip_aug": "False", + "ss_network_args": { + "conv_dim": "32", + "conv_alpha": "1", + "algo": "lora" + }, + "ss_optimizer": "torch.optim.adamw.AdamW", + "ss_max_bucket_reso": "None", + "ss_num_reg_images": "0", + "ss_network_module": "lycoris.kohya", + "ss_caption_tag_dropout_rate": "0.0", + "ss_caption_dropout_rate": "0.0", + "ss_network_dim": "64", + "ss_lowram": "False", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_learning_rate": "0.0001", + "ss_bucket_no_upscale": "False", + "ss_mixed_precision": "bf16", + "ss_unet_lr": "0.0001", + "ss_dataset_dirs": { + "15_auvere style": { + "n_repeats": 15, + "img_count": 136 + } + }, + "ss_v2": "False", + "ss_keep_tokens": "0", + "ss_training_finished_at": "1694195203.2130728", + "ss_steps": "13600", + "ss_session_id": "1531506023", + "ss_network_alpha": "64.0", + "ss_output_name": "auvere", + "ss_noise_offset": "None", + "ss_enable_bucket": "False", + "ss_gradient_accumulation_steps": "1", + "ss_training_comment": "None", + "ss_network_dropout": "None", + "ss_min_snr_gamma": "None", + "ss_new_sd_model_hash": "c4d0b43f9019756cc2fc619e856c3e6b2272e67a45f1c3a8091ad4520aad412f", + "ss_num_batches_per_epoch": "680", + "ss_seed": "1" +} \ No newline at end of file diff --git a/Styles/24/auvere-000020-119372.txt b/Styles/24/auvere-000020-119372.txt new file mode 100644 index 0000000000000000000000000000000000000000..6bea4ec7519ecaeb778923cd8790fae88835d633 --- /dev/null +++ b/Styles/24/auvere-000020-119372.txt @@ -0,0 +1,1382 @@ +Link:https://civitai.com/models/143202?modelVersionId=158906 +Version:v1 epoch 20 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +The style of artist auvere trained for Foxya v3 +The preview image uses the prompt " furry" - the recommended settings are epoch 14-20, strength 0.5-0.8. +Epochs 1-6 pretty much don't do anything so they're zipped. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt: furry + Negative Prompt:EasyNegative, nsfw + Size:512x512, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:foxyansfw_v3, Model Hash:1da18c4a59 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 143202, + "name": "auvere", + "description": "

The style of artist auvere trained for Foxya v3.
The preview image uses the prompt \"<lyco> furry\" - the recommended settings are epoch 14-20, strength 0.5-0.8.
Epochs 1-6 pretty much don't do anything so they're zipped.

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Rent", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 769, + "favoriteCount": 11, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Aonodensetsu", + "image": null + }, + "tags": [ + "style", + "artstyle" + ], + "modelVersions": [ + { + "id": 158906, + "modelId": 143202, + "name": "v1 epoch 20", + "createdAt": "2023-09-10T11:38:34.169Z", + "updatedAt": "2023-09-10T11:39:43.394Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 119, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119372, + "sizeKB": 118248.51171875, + "name": "auvere-000020.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:41:11.857Z", + "hashes": { + "AutoV1": "4ECB30D8", + "AutoV2": "5A09DA859A", + "SHA256": "5A09DA859AD685F125B16A003227684C575BEC3644333CE6DD25BA93B0583778", + "CRC32": "EA2DED35", + "BLAKE3": "3FD641C0C3A5A25C5D484D5C7DD1E82F7ABD5D0D5DF54C6E5EFBCB68B6AE33FF" + }, + "downloadUrl": "https://civitai.com/api/download/models/158906", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0120e148-402c-4d24-92a1-0ddaabd5ca75/width=450/2433755.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UNK-k4$JM{pJ1-Mx={JD03Rj-.Rk?a?aI:r=", + "type": "image", + "metadata": { + "hash": "UNK-k4$JM{pJ1-Mx={JD03Rj-.Rk?a?aI:r=", + "size": 314536, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 807678368, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000020": "134113695c9d\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158906" + }, + { + "id": 158904, + "modelId": 143202, + "name": "v1 epoch 19", + "createdAt": "2023-09-10T11:37:07.066Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 44, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119371, + "sizeKB": 118248.51171875, + "name": "auvere-000019.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:41:04.507Z", + "hashes": { + "AutoV1": "8CBBE7DB", + "AutoV2": "DD9B66D4FE", + "SHA256": "DD9B66D4FEFBA962C2E16FE1C8F47B2D5E80EBB820718EAF7A3C4C2169F98894", + "CRC32": "8532D0B8", + "BLAKE3": "B5557FC2A9188CF6CB660EA182C739A6F136001E75E6F9C806FE855B55B8115B" + }, + "downloadUrl": "https://civitai.com/api/download/models/158904", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/80d3c2c2-f84c-4250-b66f-18f2f3f8f384/width=450/2433737.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UKF=jn^*k9-:EK^*?HxZ00xa?aoe~WIU9GW.", + "type": "image", + "metadata": { + "hash": "UKF=jn^*k9-:EK^*?HxZ00xa?aoe~WIU9GW.", + "size": 295144, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 4275124746, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000019": "a226becf391b\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158904" + }, + { + "id": 158902, + "modelId": 143202, + "name": "v1 epoch 18", + "createdAt": "2023-09-10T11:36:21.106Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 63, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119370, + "sizeKB": 118248.51171875, + "name": "auvere-000018.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:41:06.938Z", + "hashes": { + "AutoV1": "4EC5E0E0", + "AutoV2": "3EC173488F", + "SHA256": "3EC173488F72A7A22738C1F14611BEE0642FB6FD6518FEBCA798A8080ABD2EED", + "CRC32": "93443997", + "BLAKE3": "1B3115F2C4F54661A019C2796902C0B5D8AEB2A02080DEA1645F78119C21F3D9" + }, + "downloadUrl": "https://civitai.com/api/download/models/158902", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/925c0695-9f99-42a4-b96d-bb990f7010ef/width=450/2433715.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UbMZm,?H~VD$r;M|RPnhM|Ip%g%LV@RkWVt7", + "type": "image", + "metadata": { + "hash": "UbMZm,?H~VD$r;M|RPnhM|Ip%g%LV@RkWVt7", + "size": 189834, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 3165242168, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000018": "c2003deb02d7\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158902" + }, + { + "id": 158897, + "modelId": 143202, + "name": "v1 epoch 17", + "createdAt": "2023-09-10T11:35:07.476Z", + "updatedAt": "2023-10-13T17:28:30.148Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 47, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119366, + "sizeKB": 118248.51171875, + "name": "auvere-000017.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:40:42.029Z", + "hashes": { + "AutoV1": "00565FDE", + "AutoV2": "788C17B834", + "SHA256": "788C17B834832AFBAFE28D9BBC7FE19982E93531F38014F86C984505B86408D4", + "CRC32": "EC45B78E", + "BLAKE3": "F82D6020195EC388B0626D96C09A65DB1D47C00774E33AEF3DC36FC5619ED047" + }, + "downloadUrl": "https://civitai.com/api/download/models/158897", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c2ba0fde-bb2a-4396-8315-5f9715f18816/width=450/2930424.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UVJRQ|DiKPt70fnh_NWAVZIUxHof^+IVxFRj", + "type": "image", + "metadata": { + "hash": "UVJRQ|DiKPt70fnh_NWAVZIUxHof^+IVxFRj", + "size": 302047, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1787672963, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000017": "94b7c59cd9c4\"", + "negativePrompt": "EasyNegative", + "Denoising strength": "0.6" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158897" + }, + { + "id": 158894, + "modelId": 143202, + "name": "v1 epoch 16", + "createdAt": "2023-09-10T11:34:15.119Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 58, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119363, + "sizeKB": 118248.51171875, + "name": "auvere-000016.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:36:20.365Z", + "hashes": { + "AutoV1": "5A8451EE", + "AutoV2": "AD749C4036", + "SHA256": "AD749C4036D923C682651AD7323C8387183A84468EF4FF737A67A2FC5ECA675B", + "CRC32": "AFEFBEAC", + "BLAKE3": "288665E7FAF2AFBAEF4207F2142E2AAC996B23C8E469BD86C6953D8A3B3E58F0" + }, + "downloadUrl": "https://civitai.com/api/download/models/158894", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b7c610ea-d621-4943-b42b-c859cd147062/width=450/2433679.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UFKd_60002X-3szmR4lBR6kB^%sDR3JAE2$*", + "type": "image", + "metadata": { + "hash": "UFKd_60002X-3szmR4lBR6kB^%sDR3JAE2$*", + "size": 331200, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 3534411661, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000016": "e130efc28880\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158894" + }, + { + "id": 158893, + "modelId": 143202, + "name": "v1 epoch 15", + "createdAt": "2023-09-10T11:33:36.391Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 54, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119362, + "sizeKB": 118248.51171875, + "name": "auvere-000015.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:36:47.112Z", + "hashes": { + "AutoV1": "C29141B8", + "AutoV2": "01D4130C19", + "SHA256": "01D4130C19B23D65A3506F0E4386D62B52849D2AB4D385F162F8FDA2446B197C", + "CRC32": "60565C33", + "BLAKE3": "C13755673D041416ABB92E95508A48302171DA0A3D262893068D33DC4223FB43" + }, + "downloadUrl": "https://civitai.com/api/download/models/158893", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9893ee7e-3b2a-4744-a2f6-36a6d1d60071/width=450/2433660.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UNG8r}aePUo#_4s:r{R*-pWB?Hs:-nWB?axt", + "type": "image", + "metadata": { + "hash": "UNG8r}aePUo#_4s:r{R*-pWB?Hs:-nWB?axt", + "size": 276218, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 420951347, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000015": "99869e30e42e\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158893" + }, + { + "id": 158891, + "modelId": 143202, + "name": "v1 epoch 14", + "createdAt": "2023-09-10T11:32:51.817Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 53, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119359, + "sizeKB": 118248.51171875, + "name": "auvere-000014.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:36:46.369Z", + "hashes": { + "AutoV1": "6883E1C4", + "AutoV2": "E961D7E11C", + "SHA256": "E961D7E11CF0CFDE33F266E699E985EFDD40F2D70B5EB7D0F898BB162E46FC24", + "CRC32": "B87D3D53", + "BLAKE3": "DC36BBCD2B5B6A7458EEBBF6CA38153F727679778AD0C6568C67B011939F39F9" + }, + "downloadUrl": "https://civitai.com/api/download/models/158891", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0026e5b0-b6f4-460e-a1c0-61f52b08d972/width=450/2433650.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UKLN0,Si0000~Vxa-;WAMxVs?b?b?HxuIBof", + "type": "image", + "metadata": { + "hash": "UKLN0,Si0000~Vxa-;WAMxVs?b?b?HxuIBof", + "size": 262088, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 2494402079, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000014": "6b07e8c782d4\"", + "negativePrompt": "EasyNegative, nsfw" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158891" + }, + { + "id": 158888, + "modelId": 143202, + "name": "v1 epoch 13", + "createdAt": "2023-09-10T11:32:00.844Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 44, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119357, + "sizeKB": 118248.51171875, + "name": "auvere-000013.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:36:27.458Z", + "hashes": { + "AutoV1": "B7ECF2AA", + "AutoV2": "7FFF343C49", + "SHA256": "7FFF343C49DF852042582A9D92C761CFC2F4CAC9A27DCCDBDD4755158C18F82B", + "CRC32": "695B5D5C", + "BLAKE3": "2D906C154D61A6AD538B44805B600A7A07E8C5324CE65339236B97848D31BB4B" + }, + "downloadUrl": "https://civitai.com/api/download/models/158888", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/79234592-53a8-4a6a-b291-e71f9d739ef5/width=450/2433646.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UBJtkv0200$-IjS~~VDm00I._28|^*sFM{9a", + "type": "image", + "metadata": { + "hash": "UBJtkv0200$-IjS~~VDm00I._28|^*sFM{9a", + "size": 354344, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1809604625, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000013": "4e7805940b01\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158888" + }, + { + "id": 158887, + "modelId": 143202, + "name": "v1 epoch 12", + "createdAt": "2023-09-10T11:31:19.759Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 42, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119356, + "sizeKB": 118248.51171875, + "name": "auvere-000012.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:35:54.295Z", + "hashes": { + "AutoV1": "13DA562A", + "AutoV2": "3EE29191D9", + "SHA256": "3EE29191D9F133A66D4595C7ABE975DD1079DEC33EDA2FCC98C08F235F25FD0E", + "CRC32": "846C8448", + "BLAKE3": "544076DBB7B6C5875BA226443286EEB9641B6DA63C1D17C3491097060255A8B8" + }, + "downloadUrl": "https://civitai.com/api/download/models/158887", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9a29a94e-f015-4d33-ae3f-f358cdea188b/width=450/2433635.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UIIOzx%h0057yZ-YN3o}00My~C?b-MIUaI%M", + "type": "image", + "metadata": { + "hash": "UIIOzx%h0057yZ-YN3o}00My~C?b-MIUaI%M", + "size": 292152, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 3850566610, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000012": "adcf51d7615f\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158887" + }, + { + "id": 158885, + "modelId": 143202, + "name": "v1 epoch 11", + "createdAt": "2023-09-10T11:29:40.465Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 41, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119354, + "sizeKB": 118248.51171875, + "name": "auvere-000011.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:35:52.453Z", + "hashes": { + "AutoV1": "20B3EE9B", + "AutoV2": "B8ADCF5AEA", + "SHA256": "B8ADCF5AEA5DB3F9F96CBD5E6E9AB2EAFB055E6767D9648F2F2F2582C0F8D9D6", + "CRC32": "2D290DDD", + "BLAKE3": "6FD2487A233E5913C6C573AECDE6A642175885E200580B84B22051972295336F" + }, + "downloadUrl": "https://civitai.com/api/download/models/158885", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f0237d23-350b-4fb7-b824-c8375dc4c5ab/width=450/2433611.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UKKnVn_13G9GOcv|RqT1009aS%$%=cb^n,xC", + "type": "image", + "metadata": { + "hash": "UKKnVn_13G9GOcv|RqT1009aS%$%=cb^n,xC", + "size": 337301, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1665023888, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000011": "503312fd8457\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158885" + }, + { + "id": 158884, + "modelId": 143202, + "name": "v1 epoch 10", + "createdAt": "2023-09-10T11:28:53.732Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 45, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119352, + "sizeKB": 118248.51171875, + "name": "auvere-000010.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:31:14.217Z", + "hashes": { + "AutoV1": "5A0B6530", + "AutoV2": "8DB6CD8A03", + "SHA256": "8DB6CD8A03D4D666C551D5D98226F509C41C97FCC76CF003A0D982924EDD5B0D", + "CRC32": "AA6EAAE7", + "BLAKE3": "493234307399575B16A37AECD964A4473DEB35FE069603DD59CB1AA88E9B4451" + }, + "downloadUrl": "https://civitai.com/api/download/models/158884", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a667f28f-4260-4c77-931f-60bf9eb0d660/width=450/2433589.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "URHetS+Z?v-;.TQ,Rmx]9GE0VtNdR6IpocRk", + "type": "image", + "metadata": { + "hash": "URHetS+Z?v-;.TQ,Rmx]9GE0VtNdR6IpocRk", + "size": 311203, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 375757684, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000010": "149197cad109\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158884" + }, + { + "id": 158881, + "modelId": 143202, + "name": "v1 epoch 9", + "createdAt": "2023-09-10T11:28:00.421Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 37, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119350, + "sizeKB": 118248.51171875, + "name": "auvere-000009.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:31:09.801Z", + "hashes": { + "AutoV1": "8A822B00", + "AutoV2": "DFE1D62B32", + "SHA256": "DFE1D62B3249C474DD554C360D31020395C61C9E82DA2EFED19FEE8E24BA5AC0", + "CRC32": "E4C7FD7B", + "BLAKE3": "00AFC411E8FCF5446D7D0F86259796404EE2FA5829EFCD5A552CAA56DB5DFCAE" + }, + "downloadUrl": "https://civitai.com/api/download/models/158881", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/870fad8c-bf39-4e98-9a97-72460dd19ad1/width=450/2433571.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "ULHB#r~W9t00~CjaDiIonhi_xu?H.SJANHIo", + "type": "image", + "metadata": { + "hash": "ULHB#r~W9t00~CjaDiIonhi_xu?H.SJANHIo", + "size": 275726, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 2003212174, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000009": "4e6ce27439ae\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0.7" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158881" + }, + { + "id": 158879, + "modelId": 143202, + "name": "v1 epoch 8", + "createdAt": "2023-09-10T11:27:20.812Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 37, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119349, + "sizeKB": 118248.51171875, + "name": "auvere-000008.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:30:41.918Z", + "hashes": { + "AutoV1": "14172824", + "AutoV2": "F1C8C1B6B6", + "SHA256": "F1C8C1B6B6A3ED13F11C1A48589D1A619A551EE68FDBEF24333FF0978AC4F75B", + "CRC32": "646E6F25", + "BLAKE3": "7BEA4DFA68C25B1D915400BD1CBB32E63DFB90F6FE1DE9A88AD3F74C9ED52018" + }, + "downloadUrl": "https://civitai.com/api/download/models/158879", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/471eaa8f-6001-4aec-af87-3bbf893cdb0b/width=450/2433565.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "USH2QR+r%zOtL4Q,V[OtICM_$LxbR4S2I;r=", + "type": "image", + "metadata": { + "hash": "USH2QR+r%zOtL4Q,V[OtICM_$LxbR4S2I;r=", + "size": 344113, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 3900287109, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000008": "b1f367b5d171\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158879" + }, + { + "id": 158878, + "modelId": 143202, + "name": "v1 epoch 7", + "createdAt": "2023-09-10T11:26:35.252Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 39, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119348, + "sizeKB": 118248.51171875, + "name": "auvere-000007.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:30:45.498Z", + "hashes": { + "AutoV1": "AB74F16B", + "AutoV2": "3F4D2F8C00", + "SHA256": "3F4D2F8C0044E33A259D4BE6F7A287BC4AAF3246D92722068E35D3644E1E1984", + "CRC32": "A6E66F38", + "BLAKE3": "94D2F9BC2A590ECD9E820BF224F227ED5DDAB39CB9F6E9FAFAB0E1404ECFEEE7" + }, + "downloadUrl": "https://civitai.com/api/download/models/158878", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eb0f7de8-016d-464d-bb67-97baadffb287/width=450/2433564.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UKH.NYQ,ysL4CTMxt95XveEL-Q$i8_xZNIae", + "type": "image", + "metadata": { + "hash": "UKH.NYQ,ysL4CTMxt95XveEL-Q$i8_xZNIae", + "size": 367067, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 3856544281, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"auvere-000007": "ac813d89456b\"", + "negativePrompt": "EasyNegative, nsfw", + "Denoising strength": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158878" + }, + { + "id": 158874, + "modelId": 143202, + "name": "v1 epochs 6-1", + "createdAt": "2023-09-10T11:23:30.721Z", + "updatedAt": "2023-09-10T11:38:34.169Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 46, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 119345, + "sizeKB": 549422.17578125, + "name": "auvere-1-6.zip", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "Diffusers" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-10T11:26:07.538Z", + "hashes": { + "AutoV1": "FE88E31C", + "AutoV2": "0F1E98313E", + "SHA256": "0F1E98313E4DD219DBAA2B91ED57C18E7B4C457D21D53D2B12345AB3629883EB", + "CRC32": "E8CAEED8", + "BLAKE3": "F25F868FA1232A87F4412CC6B4169DB4E776A8E246E843593385CD11E73E4BD6" + }, + "downloadUrl": "https://civitai.com/api/download/models/158874", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3adf0a4e-41af-404e-951d-08c748f3cc79/width=450/2433475.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UhI=6-%2pGb[~poLs;tkV]M|%2%MMzRjkVjc", + "type": "image", + "metadata": { + "hash": "UhI=6-%2pGb[~poLs;tkV]M|%2%MMzRjkVjc", + "size": 319929, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 2578497272, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.6.0", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "\"auvere-000006": "2d249e399ce9\"", + "negativePrompt": "EasyNegative, nsfw" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/158874" + } + ] +} +---------------------------- diff --git a/Styles/26/b-ern-000015-93101-metadata.json b/Styles/26/b-ern-000015-93101-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..f1b9314bf8cd92420538bd30c118a98dd6d517f7 --- /dev/null +++ b/Styles/26/b-ern-000015-93101-metadata.json @@ -0,0 +1,1128 @@ +{ + "ss_sd_model_name": "foxyansfw_v3.safetensors", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "2", + "ss_num_train_images": "1335", + "ss_tag_frequency": { + "15_b-ern style": { + "anthro": 80, + "mammal": 78, + "genitals": 77, + "young": 72, + "female": 70, + "cub": 66, + "solo": 61, + "nude": 57, + "pussy": 53, + "hair": 49, + "fur": 46, + "nipples": 39, + "loli": 38, + "male": 35, + "penis": 35, + "simple_background": 34, + "rodent": 33, + "sciurid": 32, + "rocketgirl": 32, + "flat_chested": 32, + "tail": 27, + "balls": 26, + "erection": 26, + "butt": 24, + "clitoris": 24, + "looking_at_viewer": 24, + "duo": 23, + "open_mouth": 23, + "tongue": 23, + "canid": 23, + "canine": 23, + "clothing": 23, + "spreading": 22, + "breasts": 21, + "spread_legs": 21, + "bodily_fluids": 21, + "animal_genitalia": 20, + "brown_hair": 20, + "feet": 20, + "sex_toy": 19, + "vaginal": 19, + "transparent_background": 19, + "lying": 19, + "male/female": 18, + "penetration": 18, + "smile": 18, + "animal_penis": 17, + "tan_body": 17, + "genital_fluids": 17, + "sex": 17, + "blue_eyes": 17, + "toes": 17, + "tongue_out": 16, + "navel": 16, + "masturbation": 16, + "standing": 16, + "knot": 15, + "tan_fur": 15, + "anus": 14, + "pawpads": 14, + "clothed": 14, + "penile": 14, + "size_difference": 13, + "canis": 13, + "yellow_eyes": 13, + "sitting": 13, + "felid": 13, + "vaginal_penetration": 13, + "age_difference": 12, + "canine_genitalia": 12, + "canine_penis": 12, + "paws": 12, + "tree_squirrel": 12, + "blush": 12, + "green_eyes": 12, + "lagomorph": 12, + "leporid": 12, + "rabbit": 12, + "dildo": 12, + "collar": 12, + "white_body": 12, + "larger_male": 11, + "presenting": 11, + "male_penetrating": 11, + "vaginal_masturbation": 11, + "short_hair": 11, + "feline": 11, + "white_fur": 11, + "fingers": 11, + "smaller_female": 10, + "biped": 10, + "cum": 10, + "female_penetrated": 10, + "black_body": 10, + "black_fur": 10, + "on_back": 10, + "multicolored_body": 9, + "male_penetrating_female": 9, + "brown_body": 9, + "brown_fur": 9, + "domestic_cat": 9, + "felis": 9, + "wings": 9, + "5_fingers": 9, + "presenting_pussy": 8, + "avian": 8, + "eyes_closed": 8, + "markings": 8, + "dragon": 8, + "hybrid": 8, + "multicolored_fur": 7, + "cum_inside": 7, + "one_eye_closed": 7, + "vibrator": 7, + "eyewear": 7, + "white_background": 7, + "holding_object": 7, + "3_toes": 7, + "bottomless": 7, + "feral": 7, + "domestic_dog": 7, + "topwear": 7, + "looking_back": 7, + "detailed_background": 7, + "penile_penetration": 7, + "pink_nose": 7, + "fox": 7, + "purple_eyes": 7, + "anthro_on_anthro": 6, + "older_male": 6, + "innie_pussy": 6, + "raised_tail": 6, + "pink_body": 6, + "pink_fur": 6, + "small_breasts": 6, + "interspecies": 6, + "hitachi_magic_wand": 6, + "wand_vibrator": 6, + "purple_hair": 6, + "areola": 6, + "outside": 6, + "feathers": 6, + "black_nose": 6, + "long_hair": 6, + "humanoid_genitalia": 6, + "beak": 6, + "penis_in_pussy": 6, + "group": 6, + "kneeling": 6, + "shota": 6, + "sheath": 6, + "teeth": 6, + "younger_female": 5, + "accessory": 5, + "brown_eyes": 5, + "freckles": 5, + "plant": 5, + "ribbons": 5, + "anal": 5, + "smaller_penetrated": 5, + "toddler": 5, + "legs_up": 5, + "mustelid": 5, + "strapless_strapon": 5, + "dripping": 5, + "pink_inner_ear": 5, + "pussy_juice": 5, + "bestiality": 5, + "footwear": 5, + "oral": 5, + "bird": 5, + "bottomwear": 5, + "gloves_(marking)": 5, + "spread_pussy": 5, + "anthro_penetrated": 5, + "grey_body": 5, + "legwear": 5, + "fluffy": 5, + "fluffy_tail": 5, + "clitoral_hood": 5, + "ambiguous_gender": 5, + "group_sex": 5, + "all_fours": 5, + "countershading": 5, + "humanoid_penis": 5, + "plantigrade": 5, + "scalie": 5, + "hair_accessory": 4, + "ponytail": 4, + "two_tone_body": 4, + "pompom_(b-ern)": 4, + "anal_penetration": 4, + "anthro_penetrating": 4, + "inside": 4, + "looking_pleasured": 4, + "human": 4, + "vibrator_on_pussy": 4, + "glasses": 4, + "egyptian": 4, + "ass_up": 4, + "blue_clitoris": 4, + "blue_nipples": 4, + "green_dildo": 4, + "machine": 4, + "metallic_body": 4, + "robot_joints": 4, + "short_tail": 4, + "robot": 4, + "cosmic_bun": 4, + "bow_(feature)": 4, + "bow_ribbon": 4, + "cum_drip": 4, + "female_on_feral": 4, + "purple_body": 4, + "tapering_penis": 4, + "red_hair": 4, + "shirt": 4, + "blue_hair": 4, + "urethra": 4, + "cosplay": 4, + "cum_in_pussy": 4, + "orange_body": 4, + "orange_fur": 4, + "grey_fur": 4, + "looking_at_another": 4, + "panties": 4, + "underwear": 4, + "food": 4, + "pokemon_(species)": 4, + "erect_nipples": 4, + "jewelry": 4, + "penile_masturbation": 4, + "saliva": 4, + "from_behind_position": 4, + "soles": 4, + "marine": 3, + "two_tone_fur": 3, + "alien": 3, + "male_on_human": 3, + "orange_hair": 3, + "otter": 3, + "knotted_dildo": 3, + "scut_tail": 3, + "bow_accessory": 3, + "child": 3, + "cum_in_mouth": 3, + "fellatio": 3, + "hair_bow": 3, + "hair_ribbon": 3, + "penis_grab": 3, + "purple_fur": 3, + "quadruped": 3, + "socks": 3, + "blue_body": 3, + "rito": 3, + "kass_(tloz)": 3, + "barefoot": 3, + "claws": 3, + "pants": 3, + "mephitid": 3, + "skunk": 3, + "leash": 3, + "anthro_on_feral": 3, + "brown_nose": 3, + "clothing_around_one_leg": 3, + "girly": 3, + "partially_clothed": 3, + "stockings": 3, + "goggles": 3, + "on_front": 3, + "heterochromia": 3, + "piercing": 3, + "pose": 3, + "young_on_young": 3, + "mako_(rudragon)": 3, + "furniture": 3, + "countershade_torso": 3, + "precum": 3, + "generation_4_pokemon": 3, + "fruit": 3, + "wolf": 3, + "scales": 3, + "wink": 3, + "raised_leg": 3, + "dildo_insertion": 3, + "sex_toy_insertion": 3, + "mostly_nude": 3, + "side_view": 3, + "holidays": 3, + "digitigrade": 3, + "multicolored_tail": 3, + "toying_self": 3, + "anubian_jackal": 2, + "deity": 2, + "jackal": 2, + "anubis": 2, + "hindpaw": 2, + "swimwear": 2, + "baby": 2, + "changing_table": 2, + "female_on_anthro": 2, + "headgear": 2, + "headwear": 2, + "larger_anthro": 2, + "border": 2, + "egyptian_clothing": 2, + "mask": 2, + "headphones": 2, + "holding_dildo": 2, + "holding_sex_toy": 2, + "pink_hair": 2, + "centered_hair_bow": 2, + "cute_eyes": 2, + "extended_legs": 2, + "human_on_feral": 2, + "penis_nursing": 2, + "sleeping": 2, + "tuft": 2, + "blue_fur": 2, + "blue_tongue": 2, + "butt_from_the_front": 2, + "humanoid_pussy": 2, + "leg_markings": 2, + "socks_(marking)": 2, + "orgasm": 2, + "game_console": 2, + "boots": 2, + "equine_genitalia": 2, + "equine_penis": 2, + "male_on_anthro": 2, + "equid": 2, + "equine": 2, + "horse": 2, + "bench": 2, + "feathered_wings": 2, + "feline_genitalia": 2, + "feline_penis": 2, + "hand_on_head": 2, + "park_bench": 2, + "penile_spines": 2, + "public": 2, + "public_sex": 2, + "table_lotus_position": 2, + "pantherine": 2, + "tiger": 2, + "azukipuddles": 2, + "flashing": 2, + "front_view": 2, + "anthro_penetrating_anthro": 2, + "big_dom_small_sub": 2, + "dominant": 2, + "eye_contact": 2, + "male/male": 2, + "panties_around_one_leg": 2, + "panties_down": 2, + "underwear_around_one_leg": 2, + "underwear_down": 2, + "bent_over": 2, + "heart_pawpads": 2, + "rear_view": 2, + "pink_nipples": 2, + "winged_arms": 2, + "notts_(tloz)": 2, + "no_underwear": 2, + "amber_(mancoin)": 2, + "krystal": 2, + "2_penises": 2, + "horn": 2, + "multi_genitalia": 2, + "multi_penis": 2, + "ru_(rudragon)": 2, + "amber_eyes": 2, + "anal_masturbation": 2, + "fingering": 2, + "etis": 2, + "<3": 2, + "countershade_tail": 2, + "scotty_kat": 2, + "lucario": 2, + "uniform": 2, + "bathing": 2, + "fish": 2, + "shark": 2, + "arched_back": 2, + "elemental_creature": 2, + "flora_fauna": 2, + "food_creature": 2, + "living_fruit": 2, + "dress": 2, + "red_eyes": 2, + "5_toes": 2, + "grey_hair": 2, + "beverage": 2, + "abstract_background": 2, + "pillow": 2, + "casual_nudity": 2, + "countershade_face": 2, + "fin": 2, + "antediluvia": 2, + "container": 2, + "hand_on_back": 2, + "holding_penis": 2, + "looking_at_partner": 2, + "red_body": 2, + "red_fur": 2, + "sweater": 2, + "reptile": 2, + "black_hair": 2, + "ejaculation": 2, + "clenched_teeth": 2, + "smaller_anthro": 2, + "nightdancer_(character)": 2, + "shallow_penetration": 2, + "4_toes": 2, + "membrane_(anatomy)": 2, + "belly": 2, + "cub_penetrated": 2, + "leaking_cum": 2, + "crouching": 2, + "dildo_in_pussy": 2, + "dildo_sitting": 2, + "sex_toy_in_pussy": 2, + "musteline": 2, + "floor": 2, + "tile": 2, + "tile_floor": 2, + "beach": 1, + "on_towel": 1, + "sand": 1, + "seaside": 1, + "towel": 1, + "ambient_arthropod": 1, + "ambient_crustacean": 1, + "ambient_sealife": 1, + "arthropod": 1, + "crab": 1, + "crustacean": 1, + "decapoda": 1, + "malacostracan": 1, + "clothing_aside": 1, + "flower": 1, + "flower_in_hair": 1, + "one-piece_swimsuit": 1, + "swimwear_aside": 1, + "adult_on_baby": 1, + "anthro_penetrating_human": 1, + "blurred_background": 1, + "bonnet": 1, + "cum_in_ass": 1, + "day": 1, + "human_on_anthro": 1, + "human_penetrated": 1, + "older_anthro": 1, + "open_smile": 1, + "smaller_human": 1, + "white_balls": 1, + "window": 1, + "younger_human": 1, + "andromorph": 1, + "auburn_hair": 1, + "eyewear_only": 1, + "glasses_only": 1, + "intersex": 1, + "teeth_showing": 1, + "transparent_border": 1, + "iemier": 1, + "blue_anus": 1, + "pornography": 1, + "pussy_juice_drip": 1, + "avian_feet": 1, + "blue_feathers": 1, + "presenting_penis": 1, + "white_feathers": 1, + "black_sclera": 1, + "butt_pillow": 1, + "chest_tuft": 1, + "cuddling": 1, + "daww": 1, + "gloves": 1, + "handwear": 1, + "head_on_butt": 1, + "side_boob": 1, + "tattoo": 1, + "thick_thighs": 1, + "wide_hips": 1, + "yellow_body": 1, + "yellow_fur": 1, + "digimon_(species)": 1, + "renamon": 1, + "rika_nonaka": 1, + "bedroom_eyes": 1, + "blue_inner_pussy": 1, + "cmyk": 1, + "multicolored_pussy": 1, + "narrowed_eyes": 1, + "seductive": 1, + "star": 1, + "star_marking": 1, + "star_on_body": 1, + "star_polygon": 1, + "two_tone_pussy": 1, + "yellow_pawpads": 1, + "socks_(rainbowskunkbutt)": 1, + "orgasm_face": 1, + "controller": 1, + "game_controller": 1, + "gaming": 1, + "holding_controller": 1, + "playing_videogame": 1, + "brown_spots": 1, + "spots": 1, + "spotted_body": 1, + "spotted_fur": 1, + "dalmatian": 1, + "flena_(darkrusty)": 1, + "balls_on_face": 1, + "equine_anus": 1, + "handjob": 1, + "hooves": 1, + "penis_milking": 1, + "puffy_anus": 1, + "epona_(tloz)": 1, + "raised_clothing": 1, + "raised_shirt": 1, + "raised_topwear": 1, + "clothed_sex": 1, + "crossdressing": 1, + "hoodie": 1, + "leg_warmers": 1, + "male_penetrated": 1, + "male_penetrating_male": 1, + "orange_nose": 1, + "penis_in_ass": 1, + "purple_nose": 1, + "smaller_male": 1, + "younger_male": 1, + "younger_penetrated": 1, + "clock": 1, + "hand_print": 1, + "popsicle": 1, + "presenting_hindquarters": 1, + "spank_marks": 1, + "tippy_toes": 1, + "watch": 1, + "big_tail": 1, + "pink_areola": 1, + "pink_pawpads": 1, + "pink_pussy": 1, + "blue_cum": 1, + "bottomwear_around_one_leg": 1, + "colored_cum": 1, + "ink": 1, + "pants_around_one_leg": 1, + "unusual_bodily_fluids": 1, + "unusual_cum": 1, + "unusual_genital_fluids": 1, + "hat": 1, + "generation_1_pokemon": 1, + "pikachu": 1, + "condom": 1, + "condom_decoration": 1, + "filled_condom": 1, + "monotone_background": 1, + "sexual_barrier_device": 1, + "beak_kiss": 1, + "cum_from_penis": 1, + "female/female": 1, + "harem": 1, + "kissing": 1, + "cree_(tloz)": 1, + "genli_(tloz)": 1, + "kheel_(tloz)": 1, + "kotts_(tloz)": 1, + "assisted_exposure": 1, + "bodysuit": 1, + "dressing": 1, + "loincloth": 1, + "looking_at_another's_breasts": 1, + "looking_at_breasts": 1, + "pubes": 1, + "skinsuit": 1, + "surprise": 1, + "tight_clothing": 1, + "topless": 1, + "tribal": 1, + "action_pose": 1, + "bass_guitar": 1, + "chain": 1, + "chain_leash": 1, + "guitar": 1, + "holding_weapon": 1, + "music": 1, + "musical_instrument": 1, + "navel_piercing": 1, + "non-mammal_breasts": 1, + "plucked_string_instrument": 1, + "punk": 1, + "purple_feathers": 1, + "string_instrument": 1, + "weapon": 1, + "hemipenes": 1, + "anal_fingering": 1, + "chair": 1, + "fingering_self": 1, + "group_masturbation": 1, + "leopardus": 1, + "mastiff": 1, + "molosser": 1, + "ocelot": 1, + "rottweiler": 1, + "eve_(sloss)": 1, + "naki_(havokinthesnow)": 1, + "skynex_(rajak)": 1, + "slinky_(rnixon)": 1, + "tsubaki_(iceerth)": 1, + "unnamed_male_rottweiler_(jah2000)": 1, + "bikini": 1, + "bikini_removed": 1, + "countershade_legs": 1, + "discarded_clothing": 1, + "skateboard": 1, + "suspended_in_midair": 1, + "swimwear_removed": 1, + "triangle_bikini": 1, + "undressed": 1, + "wardrobe_malfunction": 1, + "glans": 1, + "open_bottomwear": 1, + "open_clothing": 1, + "open_pants": 1, + "pink_glans": 1, + "pink_penis": 1, + "pink_tongue": 1, + "cupping_chin": 1, + "hand_on_butt": 1, + "hand_on_own_butt": 1, + "knot_in_sheath": 1, + "small_dom_big_sub": 1, + "submissive": 1, + "submissive_male": 1, + "plump_labia": 1, + "school": 1, + "school_uniform": 1, + "thigh_highs": 1, + "partially_submerged": 1, + "ball_grab": 1, + "cum_in_hair": 1, + "cum_on_face": 1, + "foursome": 1, + "grass": 1, + "licking": 1, + "nipple_fetish": 1, + "nipple_lick": 1, + "nipple_play": 1, + "knot_tugging": 1, + "frizzy_(ern)": 1, + "bloomers": 1, + "fully_clothed": 1, + "toy": 1, + "riolu": 1, + "avalon_a'nnova": 1, + "big_breasts": 1, + "leash_in_mouth": 1, + "object_in_mouth": 1, + "green_body": 1, + "green_scales": 1, + "grey_scales": 1, + "hand_on_hip": 1, + "multicolored_scales": 1, + "red_nipples": 1, + "two_tone_scales": 1, + "amphibian": 1, + "frog": 1, + "choker": 1, + "exposed_breasts": 1, + "garter": 1, + "maid_uniform": 1, + "necklace": 1, + "tea": 1, + "bad_parenting": 1, + "bed": 1, + "bed_sheet": 1, + "bedding": 1, + "gesture": 1, + "on_bed": 1, + "under_covers": 1, + "waving": 1, + "collar_only": 1, + "penis_tip": 1, + "solo_focus": 1, + "unknown_species": 1, + "countershade_feet": 1, + "hands_behind_head": 1, + "raised_arm": 1, + "v-cut": 1, + "ambiguous_penetration": 1, + "bite": 1, + "breast_grab": 1, + "fangs": 1, + "grope": 1, + "hand_on_breast": 1, + "white_hair": 1, + "chani_(ajdurai)": 1, + "sweat": 1, + "blue_nose": 1, + "purple_penis": 1, + "rainbow_body": 1, + "rainbow_fur": 1, + "sparkledog": 1, + "2_tails": 1, + "after_kiss": 1, + "arm_wraps": 1, + "autumn": 1, + "cup": 1, + "dead_tree": 1, + "forest": 1, + "hands_on_shoulders": 1, + "holding_container": 1, + "holding_cup": 1, + "larger_female": 1, + "multi_tail": 1, + "nature": 1, + "older_female": 1, + "raised_heel": 1, + "saliva_string": 1, + "straw": 1, + "tail_fetish": 1, + "tail_masturbation": 1, + "tail_play": 1, + "threesome": 1, + "tree": 1, + "trio": 1, + "wraps": 1, + "mouse": 1, + "murid": 1, + "murine": 1, + "fully_sheathed": 1, + "easter_bunny": 1, + "bath": 1, + "bathtub": 1, + "bubble": 1, + "foam": 1, + "scrubbing": 1, + "water": 1, + "red_fox": 1, + "jess_(ajdurai)": 1, + "book": 1, + "reading": 1, + "porcupine": 1, + "hal_adhil": 1, + "alternate_species": 1, + "bottle": 1, + "clothing_lift": 1, + "costume": 1, + "dress_lift": 1, + "furrification": 1, + "spirit": 1, + "malon": 1, + "backpack": 1, + "midriff": 1, + "pink_clothing": 1, + "pink_panties": 1, + "pink_underwear": 1, + "strawberry": 1, + "husky": 1, + "nordic_sled_dog": 1, + "spitz": 1, + "aisty_(mancoin)": 1, + "braided_hair": 1, + "vaginal_fingering": 1, + "african_golden_wolf": 1, + "ankha_(ajdurai)": 1, + "blonde_hair": 1, + "cougar": 1, + "sierra_(pumapaws)": 1, + "circumcised": 1, + "cumshot": 1, + "tail_tuft": 1, + "gryphon": 1, + "mythological_avian": 1, + "arm_spreader": 1, + "bdsm": 1, + "blood": 1, + "bound": 1, + "breeding_stand": 1, + "claw_marks": 1, + "cuff_(restraint)": 1, + "feral_penetrating": 1, + "feral_penetrating_anthro": 1, + "forced": 1, + "larger_feral": 1, + "leg_spreader": 1, + "lock": 1, + "mounting": 1, + "padlock": 1, + "rape": 1, + "restraints": 1, + "scratches": 1, + "spreader_bar": 1, + "toe_claws": 1, + "wrist_cuffs": 1, + "anthro_penetrating_feral": 1, + "arms_in_front": 1, + "bent_legs": 1, + "body_part_in_pussy": 1, + "feet_together": 1, + "feral_penetrated": 1, + "glistening": 1, + "glistening_genitalia": 1, + "glistening_pawpads": 1, + "glistening_penis": 1, + "hands_on_leg": 1, + "hands_together": 1, + "kneeling_on_one_leg": 1, + "leg_glider_position": 1, + "leg_grab": 1, + "legs_together": 1, + "male_on_feral": 1, + "night": 1, + "scarf": 1, + "wood": 1, + "lynx": 1, + "zaire_(nightdancer)": 1, + "black_penis": 1, + "dipstick_tail": 1, + "genital_piercing": 1, + "membranous_wings": 1, + "penis_piercing": 1, + "prince_albert_piercing": 1, + "red_tail": 1, + "tail_markings": 1, + "two_tone_tail": 1, + "white_tail": 1, + "moogle": 1, + "raike": 1, + "chest_gem": 1, + "hands_behind_back": 1, + "neck_bow": 1, + "on_bottom": 1, + "on_top": 1, + "orange_background": 1, + "purple_bow": 1, + "reverse_cowgirl_position": 1, + "dinnick_a'nnova": 1, + "elie_(din)": 1, + "pigtails": 1, + "being_watched": 1, + "cum_from_pussy": 1, + "duo_focus": 1, + "happy": 1, + "happy_sex": 1, + "looking_at_genitalia": 1, + "looking_at_penis": 1, + "male_penetrating_anthro": 1, + "voyeur": 1, + "lillablu-e": 1, + "grimace": 1, + "hands_on_knees": 1, + "hands_on_legs": 1, + "eye_markings": 1, + "long_tail": 1, + "nintendo_console": 1, + "on_sofa": 1, + "purple_markings": 1, + "sofa": 1, + "domestic_ferret": 1, + "true_musteline": 1, + "weasel": 1, + "alia_(ajdurai)": 1, + "brown_tail": 1, + "pink_dildo": 1, + "gulonine": 1, + "marten": 1, + "pine_marten": 1, + "procyonid": 1, + "raccoon": 1, + "alula_(maou)": 1, + "pubic_mound": 1, + "plug_(sex_toy)": 1, + "vaginal_plug": 1, + "high-angle_view": 1, + "pink_eyes": 1, + "furred_dragon": 1, + "furred_reptilian": 1, + "kin_(kinshiratsuki)": 1, + "autofellatio": 1, + "oral_masturbation": 1, + "raised_hackles": 1, + "spiked_tail": 1, + "spikes": 1, + "spikes_(anatomy)": 1, + "spiky_fur": 1, + "tremble_spikes": 1, + "big_ears": 1, + "ear_piercing": 1, + "easter_egg": 1, + "egg": 1, + "foreskin": 1, + "mane": 1, + "thick_tail": 1, + "yuki_nexus": 1, + "webbed_feet": 1, + "finger_fetish": 1, + "finger_in_mouth": 1, + "finger_play": 1, + "detached_sheath": 1, + "headdress": 1, + "doggystyle": 1, + "filing_cabinet": 1, + "information_board": 1, + "looking_down": 1, + "on_ground": 1, + "slim": 1, + "water_cooler": 1, + "whiteboard": 1 + } + }, + "ss_new_sd_model_hash": "1da18c4a593a2c6293fd4421d7219184f3bee2741d7f5c9a240f7cac85bce4a7", + "sshs_model_hash": "94f70e761cfe2219cb860ac1563cd011869a03edd04d0577580044272aa08cb6", + "ss_num_epochs": "15", + "ss_base_model_version": "sd_v1", + "ss_prior_loss_weight": "1.0", + "ss_multires_noise_discount": "0.3", + "ss_training_comment": "None", + "ss_gradient_accumulation_steps": "1", + "ss_lr_scheduler": "constant", + "ss_v2": "False", + "ss_total_batch_size": "3", + "ss_enable_bucket": "True", + "sshs_legacy_hash": "2d714674", + "ss_noise_offset": "0.08", + "ss_flip_aug": "False", + "ss_sd_scripts_commit_hash": "397bf51a8cd36104e52055358e4ffd066c5858df", + "ss_num_batches_per_epoch": "445", + "ss_caption_tag_dropout_rate": "0.0", + "ss_training_finished_at": "1690469996.8139415", + "ss_num_reg_images": "0", + "ss_seed": "1", + "ss_scale_weight_norms": "None", + "ss_network_args": { + "conv_dim": "50", + "conv_alpha": "50", + "use_cp": "False", + "algo": "loha" + }, + "ss_session_id": "504225298", + "ss_min_snr_gamma": "None", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_adaptive_noise_scale": "None", + "ss_batch_size_per_device": "3", + "ss_training_started_at": "1690442132.0292861", + "ss_mixed_precision": "bf16", + "ss_output_name": "b-ern", + "ss_multires_noise_iterations": "None", + "ss_color_aug": "False", + "ss_sd_model_hash": "c2b53246", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_bucket_no_upscale": "True", + "ss_network_alpha": "50.0", + "ss_max_bucket_reso": "2048", + "ss_epoch": "15", + "ss_max_train_steps": "6675", + "ss_cache_latents": "True", + "ss_shuffle_caption": "True", + "ss_learning_rate": "0.0001", + "ss_unet_lr": "None", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 256, + 640 + ], + "count": 15 + }, + "1": { + "resolution": [ + 256, + 704 + ], + "count": 15 + }, + "2": { + "resolution": [ + 320, + 576 + ], + "count": 15 + }, + "3": { + "resolution": [ + 320, + 640 + ], + "count": 30 + }, + "4": { + "resolution": [ + 320, + 704 + ], + "count": 15 + }, + "5": { + "resolution": [ + 320, + 768 + ], + "count": 15 + }, + "6": { + "resolution": [ + 384, + 512 + ], + "count": 135 + }, + "7": { + "resolution": [ + 384, + 576 + ], + "count": 210 + }, + "8": { + "resolution": [ + 384, + 640 + ], + "count": 60 + }, + "9": { + "resolution": [ + 448, + 448 + ], + "count": 150 + }, + "10": { + "resolution": [ + 448, + 512 + ], + "count": 195 + }, + "11": { + "resolution": [ + 448, + 576 + ], + "count": 30 + }, + "12": { + "resolution": [ + 512, + 384 + ], + "count": 75 + }, + "13": { + "resolution": [ + 512, + 448 + ], + "count": 210 + }, + "14": { + "resolution": [ + 576, + 384 + ], + "count": 30 + }, + "15": { + "resolution": [ + 576, + 448 + ], + "count": 90 + }, + "16": { + "resolution": [ + 640, + 384 + ], + "count": 30 + }, + "17": { + "resolution": [ + 704, + 320 + ], + "count": 15 + } + }, + "mean_img_ar_error": 0.032574232677261436 + }, + "ss_steps": "6675", + "ss_random_crop": "False", + "ss_max_token_length": "None", + "ss_full_fp16": "False", + "ss_lowram": "False", + "ss_min_bucket_reso": "256", + "ss_network_dropout": "0.0", + "ss_caption_dropout_every_n_epochs": "0", + "ss_network_dim": "50", + "ss_face_crop_aug_range": "None", + "ss_gradient_checkpointing": "False", + "ss_text_encoder_lr": "None", + "ss_network_module": "lycoris.kohya", + "ss_caption_dropout_rate": "0.0", + "ss_dataset_dirs": { + "15_b-ern style": { + "n_repeats": 15, + "img_count": 89 + } + }, + "ss_reg_dataset_dirs": {}, + "ss_keep_tokens": "0" +} \ No newline at end of file diff --git a/Styles/26/b-ern-000015-93101.txt b/Styles/26/b-ern-000015-93101.txt new file mode 100644 index 0000000000000000000000000000000000000000..c6a5b1d598ed7ae971b2f2ecf05bbc8723ab5ec9 --- /dev/null +++ b/Styles/26/b-ern-000015-93101.txt @@ -0,0 +1,1224 @@ +Link:https://civitai.com/models/118494?modelVersionId=128579 +Version:v1 epoch 15 +Base Model:Other +Keywords: +--------DESCRIPTION--------- + +The style of artist b-ern trained for Foxya v3 +The preview image uses the prompt " furry" - the recommended settings are epoch 14-15, strength 0.4-0.7. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt: furry + Negative Prompt:EasyNegative + Size:512x512, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:foxyansfw_v3, Model Hash:1da18c4a59 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 118494, + "name": "b-ern", + "description": "

The style of artist b-ern trained for Foxya v3.
The preview image uses the prompt \"<lyco> furry\" - the recommended settings are epoch 14-15, strength 0.4-0.7.

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 165, + "favoriteCount": 4, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Aonodensetsu", + "image": null + }, + "tags": [ + "style", + "furry", + "artstyle" + ], + "modelVersions": [ + { + "id": 128579, + "modelId": 118494, + "name": "v1 epoch 15", + "createdAt": "2023-07-29T12:46:39.638Z", + "updatedAt": "2023-07-29T12:48:19.818Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 29, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93101, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000015.dq1b.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000015.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:51:02.677Z", + "hashes": { + "AutoV1": "E4EFD2DB", + "AutoV2": "124D945227", + "SHA256": "124D945227F680E231F4EB369BC7C88E5ECB4AC133B2A3461D0FE75F861F15D3", + "CRC32": "2036C51A", + "BLAKE3": "AEDEC9E8E40E7339DA67E5282B46DCAC0700CA24D33D33F68D4E69A647126DCA" + }, + "downloadUrl": "https://civitai.com/api/download/models/128579", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/56d7c5ba-f27d-4fe5-bbfa-c29f6c64fe25/width=450/1774768.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UqKd9;x]-:R.~V%M%MWEt6tRR-M{RkRloMjZ", + "meta": { + "Size": "512x512", + "seed": 598924318, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128579" + }, + { + "id": 128570, + "modelId": 118494, + "name": "v1 epoch 14", + "createdAt": "2023-07-29T12:43:44.889Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 11, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93098, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000014.12hm.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000014.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:46:06.714Z", + "hashes": { + "AutoV1": "647A3912", + "AutoV2": "D9A596849A", + "SHA256": "D9A596849AD264A4C85512C52452579CD790F6E2FECED1D19112CC2385E8264D", + "CRC32": "6A23B61D", + "BLAKE3": "47B24C4CEBAE34F944A67DF5703E823AEF34EAA2D3E4F23B23205EBB5436DE66" + }, + "downloadUrl": "https://civitai.com/api/download/models/128570", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a75b5f7a-d230-4702-9ae2-3ac639e33d03/width=450/1774750.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UELq98Mxys.8.TDi-p.9I@.9-prq?GM{9GR*", + "meta": { + "Size": "512x512", + "seed": 3421632240, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128570" + }, + { + "id": 128567, + "modelId": 118494, + "name": "v1 epoch 13", + "createdAt": "2023-07-29T12:41:11.313Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 11, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93094, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000013.sAaa.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000013.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:46:15.012Z", + "hashes": { + "AutoV1": "9E444E2E", + "AutoV2": "2E9C7CA59D", + "SHA256": "2E9C7CA59D2F2CF7527AD862BC6A630D037C2CBEC97E73DA3DA820394DD0E4C6", + "CRC32": "D20494A2", + "BLAKE3": "F7F6E8ECF52306806C11D67D3496F3E7FF0FB10C9EA8C9A19019095A38D582F8" + }, + "downloadUrl": "https://civitai.com/api/download/models/128567", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a359f188-4f1e-403f-84f5-2e79bf63c916/width=450/1774695.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UIIq[lD%?^?b%gM_s:oz%hWBRPxu%2RkNG%M", + "meta": { + "Size": "512x512", + "seed": 3958377397, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128567" + }, + { + "id": 128563, + "modelId": 118494, + "name": "v1 epoch 12", + "createdAt": "2023-07-29T12:39:28.75Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93093, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000012.cWG4.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000012.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:41:32.316Z", + "hashes": { + "AutoV1": "33EB4F2A", + "AutoV2": "59AA24DBEA", + "SHA256": "59AA24DBEAF5F1ACB7CA0F43ACA59D64933BD1721D4882071C033E81521F3351", + "CRC32": "E41C6DE4", + "BLAKE3": "EFB68DC7695D84BE8B163BA57AC6F89A6ED177EAAA18E615747609318E83BA18" + }, + "downloadUrl": "https://civitai.com/api/download/models/128563", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/909f3e8d-c238-40dd-93f6-fa7b2529b53a/width=450/1774657.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UTKKA[~W?^I=0Lnhw^NGXnRPxtxu-UxvX8xZ", + "meta": { + "Size": "512x512", + "seed": 217512277, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128563" + }, + { + "id": 128562, + "modelId": 118494, + "name": "v1 epoch 11", + "createdAt": "2023-07-29T12:38:32.965Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 8, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93092, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000011.zbcy.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000011.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:41:38.163Z", + "hashes": { + "AutoV1": "E66DCAFE", + "AutoV2": "665C9A5788", + "SHA256": "665C9A5788CE9A8E5108DD19571CF72A93C4136D57E84778A311A11D60514494", + "CRC32": "9478BD7A", + "BLAKE3": "AA273E1F103BCA0248C9BE7626F4577D3E15BD929DE8B1F5C2EA413946535FCC" + }, + "downloadUrl": "https://civitai.com/api/download/models/128562", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b1aa6ebb-11c1-44f8-8b3d-9602939725e0/width=450/1774624.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UFI#_kVX00Ej0:sVw|NuEwWAxt^+_4%M4.ni", + "meta": { + "Size": "512x512", + "seed": 1566637645, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128562" + }, + { + "id": 128561, + "modelId": 118494, + "name": "v1 epoch 10", + "createdAt": "2023-07-29T12:37:07.67Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 10, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93091, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000010.fS4D.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000010.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:41:38.163Z", + "hashes": { + "AutoV1": "C936E350", + "AutoV2": "254E623EDC", + "SHA256": "254E623EDC5477131AFC5A71FDF4D36CE57732FA93DCAD33A978E58CD5DAE42A", + "CRC32": "D37608AE", + "BLAKE3": "2E4E92BA939E5B5217D2B6C38C10A337716DB5EE52C7EF3C6D4E14E164B575EF" + }, + "downloadUrl": "https://civitai.com/api/download/models/128561", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5d41c426-c7cb-4e96-affa-6126161eaedb/width=450/1774615.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UZHoXhZ#xrx]%%skWDtSx[S3t7xuxwkCbHRP", + "meta": { + "Size": "512x512", + "seed": 3278047317, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128561" + }, + { + "id": 128558, + "modelId": 118494, + "name": "v1 epoch 9", + "createdAt": "2023-07-29T12:35:55.787Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93089, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000009.ca1I.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000009.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:41:08.818Z", + "hashes": { + "AutoV1": "7D3F84A9", + "AutoV2": "5B35902607", + "SHA256": "5B35902607D6A7736A868C86864BA714BB452CFD6C6958136F0EE297A0D7FF64", + "CRC32": "7D36ED78", + "BLAKE3": "FDE3CAD7104CCE9BE5733189866D6CFDACE2171C81502A58A390EF62C21F384D" + }, + "downloadUrl": "https://civitai.com/api/download/models/128558", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bbc8d0eb-4a83-49c1-811d-63da61ed4310/width=450/1774582.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UeKAyp=^~pskeRxBwuV?$$DixaoJ%M%Mt8og", + "meta": { + "Size": "512x512", + "seed": 666066577, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128558" + }, + { + "id": 128557, + "modelId": 118494, + "name": "v1 epoch 8", + "createdAt": "2023-07-29T12:35:03.172Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 10, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93087, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000008.Ow1A.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000008.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:41:05.149Z", + "hashes": { + "AutoV1": "D6EB9536", + "AutoV2": "CCAED81218", + "SHA256": "CCAED812189D698AC3049BEC4B7EB2615BBF06EBD15ECBAED256A1D5423D12CF", + "CRC32": "25A7AA57", + "BLAKE3": "C6E7FAA15AE8B40890E637F1DF16D1679F4A7932A362CE0B0B8657E9549BFFD9" + }, + "downloadUrl": "https://civitai.com/api/download/models/128557", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/64a3a611-ecd9-4120-abe9-abff9c7f6e0b/width=450/1774573.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UEIN:V01%Mxu~BE19aWB=_4nD%-;ITogxu%L", + "meta": { + "Size": "512x512", + "seed": 1448226941, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128557" + }, + { + "id": 128555, + "modelId": 118494, + "name": "v1 epoch 7", + "createdAt": "2023-07-29T12:31:23.66Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93084, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000007.QTpA.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000007.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:35:48.925Z", + "hashes": { + "AutoV1": "FC3E8D27", + "AutoV2": "A3F2F7A57F", + "SHA256": "A3F2F7A57FC220378902D4104B201ABF146B44A3C8376DC11473937D832549B4", + "CRC32": "6625B1DC", + "BLAKE3": "BAD2E7BBD0C2C7ADAFCAD8D85500C155272026A28DA77D43E813AC09BC50FE58" + }, + "downloadUrl": "https://civitai.com/api/download/models/128555", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a15f4e0b-b42d-43e7-b353-bb648fedacae/width=450/1774560.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UHGIWQ00%g9ZS$D%t7tR~q9F%M%M-pIUNGRj", + "meta": { + "Size": "512x512", + "seed": 3444329072, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128555" + }, + { + "id": 128553, + "modelId": 118494, + "name": "v1 epoch 6", + "createdAt": "2023-07-29T12:28:09.203Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 8, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93081, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000006.pupD.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000006.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:30:42.206Z", + "hashes": { + "AutoV1": "FFB8C7D4", + "AutoV2": "6DF57B3C9F", + "SHA256": "6DF57B3C9F06559C931E320F23AA74D7C5229FF86BF62BD34A3C5FF5FB06004A", + "CRC32": "22266327", + "BLAKE3": "60443F91766C7286F4B8D6D6CB579F3F18361EE24D71ECDD618EED4484D04AE2" + }, + "downloadUrl": "https://civitai.com/api/download/models/128553", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/75b21a76-ab19-4693-b7dd-5aacc1532761/width=450/1774521.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UIKTS+o~HXDi^+Kj-;xuO?9F-;~q%~v~9ZOE", + "meta": { + "Size": "512x512", + "seed": 470667854, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128553" + }, + { + "id": 128549, + "modelId": 118494, + "name": "v1 epoch 5", + "createdAt": "2023-07-29T12:23:21.256Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93078, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000005.lfN0.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000005.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:25:42.191Z", + "hashes": { + "AutoV1": "483138A2", + "AutoV2": "2BA44BE58F", + "SHA256": "2BA44BE58FE53113C8DB91DFFF1B34EC4A6FCD7CF9B256EBB4BC31BD8B4B4F21", + "CRC32": "1D811184", + "BLAKE3": "D1E10B376869A13DEF6FAB72DC2CC598E3D1A55A471EE3E324C314D24912D22B" + }, + "downloadUrl": "https://civitai.com/api/download/models/128549", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/90a0b61d-8375-49d2-8593-fc078d27523d/width=450/1774474.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UPKUA#IAxuM{x]-;Rjof.TR-RkxuD$IUx]Rj", + "meta": { + "Size": "512x512", + "seed": 1877901162, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128549" + }, + { + "id": 128546, + "modelId": 118494, + "name": "v1 epoch 4", + "createdAt": "2023-07-29T12:21:50.328Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 10, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93076, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000004.mNB9.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000004.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:25:37.065Z", + "hashes": { + "AutoV1": "889DB7AB", + "AutoV2": "7D130A7B76", + "SHA256": "7D130A7B76BFB233019613754B8B9EB70DA840926B8AC3AB07B452851BE2FE06", + "CRC32": "B6949DD6", + "BLAKE3": "1AC72E00762A2E6AE9D5BEE7BE221735ACEF923275CACEB7612A828C6390C826" + }, + "downloadUrl": "https://civitai.com/api/download/models/128546", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b42ca99b-9458-4280-84bd-ced13e69ec10/width=450/1774398.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "U7Heq64;RdR3-atQxAng-eIW^-ai07x-be8|", + "meta": { + "Size": "512x512", + "seed": 435924507, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128546" + }, + { + "id": 128543, + "modelId": 118494, + "name": "v1 epoch 3", + "createdAt": "2023-07-29T12:19:37.914Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 9, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93075, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000003.V8nh.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000003.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:20:49.984Z", + "hashes": { + "AutoV1": "A75B67A6", + "AutoV2": "25C95A69F6", + "SHA256": "25C95A69F63429044CAD1592317D003B29FE0DCA226DEADF5371E69FF026F69E", + "CRC32": "791D7431", + "BLAKE3": "6BC4F65178219564E99E5CF3E7A4433F53EB29B8BB411AEE51F1A641A435C754" + }, + "downloadUrl": "https://civitai.com/api/download/models/128543", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ec717f18-c027-4d6a-ba56-172dd2a6ef47/width=450/1774379.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UJIE9E-nwGsp-m~Vt7oM~U%MNaozJCIUxvn$", + "meta": { + "Size": "512x512", + "seed": 2303589361, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128543" + }, + { + "id": 128542, + "modelId": 118494, + "name": "v1 epoch 2", + "createdAt": "2023-07-29T12:18:11.267Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 12, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93074, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000002.SOG5.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000002.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:20:59.025Z", + "hashes": { + "AutoV1": "D4E7CD63", + "AutoV2": "8A96605377", + "SHA256": "8A966053772EC756EF4F847D9EBCDC5AE129DEC54984736B79E38E9485770C64", + "CRC32": "40D299A7", + "BLAKE3": "4D8FE82886A1FA071F35B4660DA213FBF83956EDF220B032912471E6C3DB2FA2" + }, + "downloadUrl": "https://civitai.com/api/download/models/128542", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/88866eb8-07a9-4587-86c1-1339d5b26181/width=450/1774342.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UZHUnMRj~V-o~WE1%MxZn~IoR+s.IVWXRkoL", + "meta": { + "Size": "512x512", + "seed": 1234724658, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128542" + }, + { + "id": 128538, + "modelId": 118494, + "name": "v1 epoch 1", + "createdAt": "2023-07-29T12:10:11.297Z", + "updatedAt": "2023-07-29T12:46:39.638Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 11, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 93069, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/1872696/model/bErn000001.Xb14.safetensors", + "sizeKB": 237892.05078125, + "name": "b-ern-000001.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-29T12:15:55.442Z", + "hashes": { + "AutoV1": "03D549C5", + "AutoV2": "287E27628D", + "SHA256": "287E27628DFD4A53F8FA71EA3975A082DC64EC9EB4C64A737756CA4602284827", + "CRC32": "597B1756", + "BLAKE3": "F10F0F1C5290A12AEFD3ED11FA067CAD2CA82F0B8C7AA51DDC177F4400B4C793" + }, + "downloadUrl": "https://civitai.com/api/download/models/128538", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51509c18-f5a9-431f-b618-d44d12455296/width=450/1774334.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UHG+Bv9G_ND%-;-;W=-;n%R+-pay%MM|M{jF", + "meta": { + "Size": "512x512", + "seed": 1917071152, + "Model": "foxyansfw_v3", + "steps": 30, + "hashes": { + "model": "1da18c4a59" + }, + "prompt": " furry", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "1da18c4a59", + "name": "foxyansfw_v3", + "type": "model" + } + ], + "Model hash": "1da18c4a59", + "\"EasyNegative": "66a7279a88dd\"", + "negativePrompt": "EasyNegative" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/128538" + } + ] +} +---------------------------- diff --git a/Styles/3/32x32-10-160042-metadata.json b/Styles/3/32x32-10-160042-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..2a955f077ad581ce4fde152659f1f27b86a4b698 --- /dev/null +++ b/Styles/3/32x32-10-160042-metadata.json @@ -0,0 +1,64 @@ +{ + "ss_sd_model_name": "sd-v1-5-pruned-noema-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "1000", + "ss_tag_frequency": { + "dataset": { + "32x32": 1000 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 1, + "img_count": 1000 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 1000, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dataset\": {\"32x32\": 1000}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 512], \"count\": 1000}}, \"mean_img_ar_error\": 0.0}, \"subsets\": [{\"img_count\": 1000, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": \"32x32\", \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0005", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "250", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "5000", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "7d8dc5577b85ca48fb12957a1fafee7a59aa380784f0e4f0a3f80f64449c0efa", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "500", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "32x32", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "25d4f007", + "ss_sd_scripts_commit_hash": "9a67e0df390033a89f17e70df5131393692c2a55", + "ss_seed": "42", + "ss_session_id": "3352446192", + "ss_steps": "5000", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1698863623.2605388", + "ss_training_started_at": "1698860406.052207", + "ss_unet_lr": "0.0005", + "ss_v2": "False", + "sshs_legacy_hash": "de2f2560", + "sshs_model_hash": "fbc605cdd74af5778c46f87ba6b34f9ba0bcc651364eec3f06fab01ef1fba22b" +} \ No newline at end of file diff --git a/Styles/3/32x32-10-160042.png b/Styles/3/32x32-10-160042.png new file mode 100644 index 0000000000000000000000000000000000000000..77e729e791318a71b2f77c5c4dc8955eb1a1a7f3 Binary files /dev/null and b/Styles/3/32x32-10-160042.png differ diff --git a/Styles/3/32x32-10-160042.txt b/Styles/3/32x32-10-160042.txt new file mode 100644 index 0000000000000000000000000000000000000000..333cc90cd9c7544d73c944152f51bbdc5b2fafb5 --- /dev/null +++ b/Styles/3/32x32-10-160042.txt @@ -0,0 +1,298 @@ +Link:https://civitai.com/models/185726/8bitdiffuser-32x-or-a-perfect-pixel-art-model +Version:v1.0 +Base Model:SD 1.5 +Keywords:pixel art +--------DESCRIPTION--------- + +This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each +This page is for the 32x model! + +When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via perfect neighbor, but i have had the BEST results when using astropulse's K-centroid downsampling method, it is completely free and can run even on lower end devices. the other method i recommend is the old reliable billinear downsampling +However if you are generating images at a scale HIGHER then 512x, the pixel scale will still stay the same, for example if you generate the image at 1024x with the 64x model, you will need to scale it down to 128x (1024/512=2 , 64*2=128) for the pixel art results. +The 32x model is MUCH better at generating even pixels, at about 30-50 steps it gets hard to tell it isnt just upscaled pixel art, so if you do not wish to downsample images to native size, the 32x model might be the best choice for you! however it fails greatly on resolutions higher then 512x and cannot produce much details + +best settings for this LoRA is: +Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling) +CFG scale: 7-14 +LoRA scale: 0.75-1.5(the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy) +Sampling method: DPM++ 2M SDE karras +Recommended prompt: "pixelart" (Add these to the start every generation, this isn't "required" but I found it gets the best results) +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img3: + Prompt:pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:40, CFG:7, Clip Skip:0, Model:cuteyukimixAdorable_specialchapter, Model Hash:53d7264d1c + +img7: + Prompt:pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:40, CFG:7, Clip Skip:0, Model:cuteyukimixAdorable_specialchapter, Model Hash:53d7264d1c + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185726, + "name": "8bitdiffuser 32x | a perfect pixel art model", + "description": "

This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each

This page is for the 32x model!

When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via perfect neighbor, but i have had the BEST results when using astropulse's K-centroid downsampling method, it is completely free and can run even on lower end devices. the other method i recommend is the old reliable billinear downsampling

However if you are generating images at a scale HIGHER then 512x, the pixel scale will still stay the same, for example if you generate the image at 1024x with the 64x model, you will need to scale it down to 128x (1024/512=2 , 64*2=128) for the pixel art results.

  • The 32x model is MUCH better at generating even pixels, at about 30-50 steps it gets hard to tell it isnt just upscaled pixel art, so if you do not wish to downsample images to native size, the 32x model might be the best choice for you! however it fails greatly on resolutions higher then 512x and cannot produce much details

best settings for this LoRA is:

  • Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling)

  • CFG scale: 7-14

  • LoRA scale: 0.75-1.5 (the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy)

  • Sampling method: DPM++ 2M SDE karras

  • Recommended prompt: \"pixelart\" (Add these to the start every generation, this isn't \"required\" but I found it gets the best results)

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 45, + "favoriteCount": 12, + "commentCount": 0, + "ratingCount": 2, + "rating": 3, + "tippedAmountCount": 57987 + }, + "creator": { + "username": "extraordicord", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca69a7a1-3c2b-42c7-bf40-d5c453df4e31/width=96/extraordicord.jpeg" + }, + "tags": [ + "anime", + "pixel art", + "style", + "pixelart", + "pixel perfect" + ], + "modelVersions": [ + { + "id": 208536, + "modelId": 185726, + "name": "v1.0", + "createdAt": "2023-11-01T21:25:48.373Z", + "updatedAt": "2023-11-01T21:33:24.635Z", + "trainedWords": [ + "pixel art" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 45, + "ratingCount": 2, + "rating": 3 + }, + "files": [ + { + "id": 160042, + "sizeKB": 18543.703125, + "name": "32x32-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T21:35:56.405Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "C6526FC903", + "SHA256": "C6526FC903775850F315FBC7A3FB76127D122BD56B74E05135E03B86301DD047", + "CRC32": "EDE3AF35", + "BLAKE3": "1C7BBF075E35483C046F0561DF212760833752A0CF38DA31AE6097E78B418734" + }, + "downloadUrl": "https://civitai.com/api/download/models/208536", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ccbcd365-4af3-4627-84b0-920b0c02c54e/width=450/3320579.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UlONB^t7_3t7offkxuof~qayIAayt7j[M|WC", + "type": "image", + "metadata": { + "hash": "UlONB^t7_3t7offkxuof~qayIAayt7j[M|WC", + "size": 4434, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d72734b-2d24-422d-abe4-6646a4d224e9/width=450/3320611.jpeg", + "nsfw": "None", + "width": 6400, + "height": 1920, + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "type": "image", + "metadata": { + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "size": 191537, + "width": 6400, + "height": 1920 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1e21c78-b7f2-494a-98a4-8e3e2395dbf3/width=450/3320581.jpeg", + "nsfw": "X", + "width": 512, + "height": 512, + "hash": "UrODLRxu?^oLozj[xuWB%gafr?WBV?ofNGf+", + "type": "image", + "metadata": { + "hash": "UrODLRxu?^oLozj[xuWB%gafr?WBV?ofNGf+", + "size": 148222, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 3594894753, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 40, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "fbc605cdd74a", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "32x32-10(fbc605cdd74a)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b739d430-b2ac-404d-b05f-f0607cb71278/width=450/3320580.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UYM%$S%N?w?G%Mt6nhR+_3V@xtIUniR*Nas:", + "type": "image", + "metadata": { + "hash": "UYM%$S%N?w?G%Mt6nhR+_3V@xtIUniR*Nas:", + "size": 5310, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/56d634a3-0118-46db-adaf-c39cd9ae2862/width=450/3320576.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UrN0}8xu_NoM%Nayk7j@%LWBt7R*R*ofRkoe", + "type": "image", + "metadata": { + "hash": "UrN0}8xu_NoM%Nayk7j@%LWBt7R*R*ofRkoe", + "size": 5303, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c5b49c2d-d3ba-4e1f-b482-c2cf03874cba/width=450/3320577.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UgN^3s?v.T%L-=Rjn$Rj%MRjj?V@o}oeV@s:", + "type": "image", + "metadata": { + "hash": "UgN^3s?v.T%L-=Rjn$Rj%MRjj?V@o}oeV@s:", + "size": 5335, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b709c6b8-7c3e-4175-a023-50303c427f78/width=450/3320578.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "URK1E[-UKjE10LIoMxozKQ%N$%xa~VaJogj]", + "type": "image", + "metadata": { + "hash": "URK1E[-UKjE10LIoMxozKQ%N$%xa~VaJogj]", + "size": 191055, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 3594894752, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 40, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "fbc605cdd74a", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "32x32-10(fbc605cdd74a)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208536" + } + ] +} +---------------------------- diff --git a/Styles/31/botiland-83927-metadata.json b/Styles/31/botiland-83927-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..e11e978e6a0c1ffcb9f72b50193e14d4c1906355 --- /dev/null +++ b/Styles/31/botiland-83927-metadata.json @@ -0,0 +1,527 @@ +{ + "ss_sd_model_name": "animefull-final-pruned-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "414", + "ss_tag_frequency": { + "lonely_island2": { + "botiland": 207, + "blush": 205, + "breasts": 192, + "nipples": 171, + "tan": 163, + "1girl": 158, + "blue eyes": 157, + "long hair": 152, + "open mouth": 151, + "tanlines": 151, + "blonde hair": 146, + "twintails": 146, + "large breasts": 134, + "hetero": 131, + "1boy": 129, + "one-piece tan": 122, + "smile": 96, + "fang": 88, + "solo focus": 82, + "nude": 81, + "black hair": 80, + "dark skin": 77, + "short hair": 76, + "sex": 75, + "penis": 72, + "sweat": 70, + "censored": 70, + "looking at viewer": 69, + "spread legs": 66, + "medium breasts": 64, + "brown hair": 56, + "vaginal": 56, + "full-face blush": 55, + "navel": 54, + "small breasts": 53, + "pussy": 53, + "multiple girls": 53, + "solo": 51, + "underwear": 51, + "mosaic censoring": 51, + "panties": 50, + "skirt": 47, + "ass": 45, + "grabbing": 43, + "breast grab": 41, + "sitting": 39, + "nose blush": 38, + "oppai loli": 38, + "heavy breathing": 38, + "closed eyes": 37, + "pink panties": 34, + "lying": 34, + "hair ornament": 31, + "grin": 31, + "cum": 31, + "dark-skinned female": 29, + "ribbon": 29, + "loli": 28, + "on back": 28, + "indoors": 27, + "hair ribbon": 27, + "cum in pussy": 26, + "faceless": 25, + "cleavage": 25, + "clothes lift": 25, + "hair bobbles": 24, + "short twintails": 24, + "barefoot": 23, + "faceless male": 23, + "bangs": 22, + "completely nude": 22, + "symbol-shaped pupils": 20, + "pov": 20, + "sex from behind": 20, + "3girls": 20, + "shirt": 19, + "clothes pull": 19, + "2girls": 19, + "mole": 18, + "mole under eye": 18, + "shirt lift": 18, + "heart-shaped pupils": 18, + "saliva": 18, + "two side up": 17, + "very long hair": 17, + "doggystyle": 17, + "dutch angle": 16, + "tank top": 16, + "white panties": 16, + "striped": 15, + "strap slip": 15, + "collarbone": 15, + "grabbing from behind": 15, + "looking back": 15, + "bottomless": 15, + "missionary": 15, + "straddling": 15, + "multiple boys": 14, + "camisole": 14, + "pleated skirt": 14, + "ahoge": 13, + ":d": 13, + "desk": 13, + "breath": 13, + "grey hair": 13, + "bare shoulders": 12, + "bag": 12, + "tatami": 12, + "fat": 12, + "purple eyes": 12, + "group sex": 12, + "cowgirl position": 12, + "shorts": 11, + "head out of frame": 11, + "covered nipples": 11, + "chair": 11, + "heart": 11, + "socks": 11, + "ass grab": 11, + "fat man": 11, + "glasses": 11, + "pink hair": 11, + "short shorts": 10, + "hair between eyes": 10, + "bench": 10, + "tongue": 10, + "cleft of venus": 10, + "oral": 10, + "no bra": 9, + "girl on top": 9, + "thighhighs": 9, + "paizuri": 9, + "anus": 9, + "sailor collar": 9, + "nipple slip": 8, + "day": 8, + "swimsuit": 8, + "close-up": 8, + "puffy nipples": 8, + "office chair": 8, + "breast sucking": 8, + "uncensored": 8, + "blue ribbon": 8, + "ponytail": 8, + "miniskirt": 8, + "clothed male nude female": 8, + "pink skirt": 8, + "outdoors": 8, + "all fours": 8, + "squatting": 8, + "denim shorts": 7, + "window": 7, + "wide-eyed": 7, + "sky": 7, + "teeth": 7, + "naughty face": 7, + "pantyshot": 7, + "backpack": 7, + "see-through": 7, + "half-closed eyes": 7, + "black skirt": 7, + "tears": 7, + "blue hair": 7, + "bottle": 6, + "curtains": 6, + "controller": 6, + "game controller": 6, + "ear blush": 6, + "kiss": 6, + "sweater": 6, + "arms behind back": 6, + "black thighhighs": 6, + "standing": 6, + "looking at another": 6, + "erection": 6, + "trembling": 6, + "yuri": 6, + "red hair": 6, + "5girls": 6, + "blue sailor collar": 6, + "cameltoe": 5, + "soles": 5, + "striped shirt": 5, + "closed mouth": 5, + "blue shorts": 5, + "one breast out": 5, + "bikini tan": 5, + "breast focus": 5, + "bed": 5, + "necktie": 5, + "turtleneck": 5, + "ribbed sweater": 5, + "randoseru": 5, + "bar censor": 5, + "handjob": 5, + "on stomach": 5, + "pillow": 5, + "blunt bangs": 5, + "pink footwear": 5, + "microskirt": 5, + "breast press": 5, + "panties around one leg": 5, + "4girls": 5, + "tongue out": 5, + "bent over": 5, + "pregnant": 5, + "denim": 4, + "@_@": 4, + "public indecency": 4, + "cloud": 4, + "sitting on person": 4, + "food": 4, + "electric fan": 4, + "downblouse": 4, + "fangs": 4, + "2boys": 4, + "^_^": 4, + "breast slip": 4, + "one-piece swimsuit": 4, + "one-piece swimsuit pull": 4, + "upper body": 4, + "computer": 4, + "poster (object)": 4, + ":o": 4, + "undressing": 4, + "from behind": 4, + "locker": 4, + "panty pull": 4, + "bulge": 4, + "skirt lift": 4, + "from side": 4, + "torogao": 4, + "midriff": 4, + "table": 4, + "orgasm": 4, + "no panties": 4, + "orgy": 4, + "flat chest": 4, + "mixed bathing": 4, + "constricted pupils": 3, + "gamepad": 3, + "from above": 3, + "striped panties": 3, + "school uniform": 3, + "suspenders": 3, + "monitor": 3, + "lifted by self": 3, + "topless": 3, + "pants": 3, + "blue shirt": 3, + "on floor": 3, + "huge breasts": 3, + "profile": 3, + "erection under clothes": 3, + "towel": 3, + "ejaculation": 3, + "grabbing another's ass": 3, + "wet": 3, + "cunnilingus": 3, + "fellatio": 3, + "cum in mouth": 3, + "bra": 3, + "red eyes": 3, + "6+girls": 3, + "clothing aside": 3, + "panties aside": 3, + "green eyes": 3, + "shoes": 3, + "against wall": 3, + "arms behind head": 3, + "wooden floor": 3, + "happy sex": 3, + "ahegao": 3, + "feet": 2, + "toes": 2, + "surprised": 2, + "sitting on lap": 2, + "playing games": 2, + "holding controller": 2, + "choker": 2, + "bare legs": 2, + "animal ears": 2, + "dress": 2, + "pantyhose": 2, + "coat": 2, + "briefcase": 2, + "hand on another's face": 2, + "keyboard (computer)": 2, + "shorts pull": 2, + "underwear only": 2, + "lactation": 2, + "grabbing own breast": 2, + "white socks": 2, + "on chair": 2, + "plump": 2, + "tissue box": 2, + "sports bra": 2, + "crop top": 2, + "shiny skin": 2, + "breasts out": 2, + "bra lift": 2, + "cum on body": 2, + "cum on breasts": 2, + "top-down bottom-up": 2, + "clenched teeth": 2, + "overflow": 2, + "side ponytail": 2, + "embarrassed": 2, + "wavy mouth": 2, + "knees together feet apart": 2, + "door": 2, + "doorway": 2, + "have to pee": 2, + "purple hair": 2, + "hair over eyes": 2, + "fingering": 2, + "brown eyes": 2, + "blurry": 2, + "blurry background": 2, + "upside-down": 2, + "utility pole": 2, + "pole": 2, + "irrumatio": 2, + "suspended congress": 2, + "yellow eyes": 2, + "back": 2, + "torso grab": 2, + "age difference": 2, + "white hair": 2, + "interlocked fingers": 2, + "drooling": 2, + "clothed sex": 2, + "reverse cowgirl position": 2, + "bra strap": 2, + "reaching towards viewer": 2, + "squatting cowgirl position": 2, + "bathroom": 2, + "outstretched arms": 1, + "wardrobe malfunction": 1, + "sanpaku": 1, + "holding": 1, + "sliding doors": 1, + "panty peek": 1, + "plastic bag": 1, + "upshorts": 1, + "bikini": 1, + "bikini top only": 1, + "flashing": 1, + "assisted exposure": 1, + "shirt pull": 1, + "sparkle": 1, + "pointy ears": 1, + "meme": 1, + "stuffed toy": 1, + "stuffed animal": 1, + "teddy bear": 1, + "gradient hair": 1, + "black pantyhose": 1, + "tail": 1, + "wings": 1, + "bat wings": 1, + "black background": 1, + "demon tail": 1, + "demon wings": 1, + "waving": 1, + "tail wagging": 1, + "turtleneck sweater": 1, + "comic": 1, + "deep skin": 1, + "zettai ryouiki": 1, + "bookshelf": 1, + "nipple tweak": 1, + "indian style": 1, + "hot": 1, + "covering breasts": 1, + "pulled by self": 1, + "backpack removed": 1, + "drunk": 1, + "bow": 1, + "head tilt": 1, + "no shoes": 1, + "can": 1, + "pov hands": 1, + "naked towel": 1, + "red skirt": 1, + "x-ray": 1, + "uterus": 1, + "internal cumshot": 1, + "pillow hug": 1, + "blue skirt": 1, + "on desk": 1, + "penis awe": 1, + "faceless female": 1, + "photo (object)": 1, + ":<": 1, + "looking up": 1, + "white dress": 1, + "bare arms": 1, + "arm support": 1, + "side-tie panties": 1, + "hug from behind": 1, + "shiny": 1, + "threesome": 1, + "ffm threesome": 1, + "teamwork": 1, + "female masturbation": 1, + "hug": 1, + "upright straddle": 1, + "the pose": 1, + "m legs": 1, + "holding another's wrist": 1, + "reach-around": 1, + "female orgasm": 1, + "suit": 1, + "suspender skirt": 1, + "train interior": 1, + "wariza": 1, + "eating": 1, + "brand name imitation": 1, + "food print": 1, + "chips (food)": 1, + "potato chips": 1, + "interracial": 1, + "anger vein": 1, + "road": 1, + "power lines": 1, + "street": 1, + "after sex": 1, + "cumdrip": 1, + "white shirt": 1, + "between breasts": 1, + "exhibitionism": 1, + "public nudity": 1, + "areola slip": 1, + "take your pick": 1, + "dark-skinned male": 1, + "siblings": 1, + "3boys": 1, + "short sleeves": 1, + "kneehighs": 1, + "scrunchie": 1, + "blue pants": 1, + "imminent penetration": 1, + "one eye closed": 1, + "cum on ass": 1, + "sweatdrop": 1, + "hands on own chest": 1, + "underboob": 1, + "halo": 1, + "on side": 1, + "sideboob": 1, + "male pubic hair": 1, + "from below": 1, + "upskirt": 1, + "ass focus": 1, + "swing": 1, + "=_=": 1, + "detached collar": 1, + "breasts squeezed together": 1, + "unmoving pattern": 1, + "kneeling": 1, + "own hands together": 1, + "off shoulder": 1, + "on bed": 1, + "boy on top": 1, + "rolling eyes": 1, + "fucked silly": 1, + "open clothes": 1, + "simple background": 1, + "hanging breasts": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "lonely_island2": { + "n_repeats": 2, + "img_count": 207 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 414, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"lonely_island2\": {\"botiland\": 207, \"1girl\": 158, \"solo\": 51, \"breasts\": 192, \"looking at viewer\": 69, \"blush\": 205, \"short hair\": 76, \"open mouth\": 151, \"blue eyes\": 157, \"large breasts\": 134, \"brown hair\": 56, \"nipples\": 171, \"ahoge\": 13, \"shorts\": 11, \"fang\": 88, \"dark skin\": 77, \"dark-skinned female\": 29, \"short shorts\": 10, \"dutch angle\": 16, \"outstretched arms\": 1, \"denim\": 4, \"tan\": 163, \"tanlines\": 151, \"denim shorts\": 7, \"@_@\": 4, \"nipple slip\": 8, \"one-piece tan\": 122, \"public indecency\": 4, \"wardrobe malfunction\": 1, \"long hair\": 152, \"blonde hair\": 146, \"shirt\": 19, \"black hair\": 80, \"1boy\": 129, \"bare shoulders\": 12, \"twintails\": 146, \"medium breasts\": 64, \"sitting\": 39, \"underwear\": 51, \"panties\": 50, \"hetero\": 131, \"sweat\": 70, \"barefoot\": 23, \"day\": 8, \"striped\": 15, \"cloud\": 4, \"indoors\": 27, \"spread legs\": 66, \"feet\": 2, \"window\": 7, \"toes\": 2, \"cameltoe\": 5, \"soles\": 5, \"bottle\": 6, \"curtains\": 6, \"pink panties\": 34, \"surprised\": 2, \"strap slip\": 15, \"faceless\": 25, \"faceless male\": 23, \"striped shirt\": 5, \"wide-eyed\": 7, \"sitting on person\": 4, \"controller\": 6, \"constricted pupils\": 3, \"sitting on lap\": 2, \"game controller\": 6, \"playing games\": 2, \"sanpaku\": 1, \"holding controller\": 2, \"gamepad\": 3, \"smile\": 96, \"hair ornament\": 31, \"holding\": 1, \"cleavage\": 25, \"hair between eyes\": 10, \"closed mouth\": 5, \"collarbone\": 15, \"sky\": 7, \"choker\": 2, \"bare legs\": 2, \"food\": 4, \"bag\": 12, \"blue shorts\": 5, \"tatami\": 12, \"sliding doors\": 1, \"panty peek\": 1, \"electric fan\": 4, \"plastic bag\": 1, \"upshorts\": 1, \"swimsuit\": 8, \"bikini\": 1, \"clothes pull\": 19, \"bikini top only\": 1, \"head out of frame\": 11, \"one breast out\": 5, \"bikini tan\": 5, \"flashing\": 1, \"breast focus\": 5, \"teeth\": 7, \"grin\": 31, \"covered nipples\": 11, \"two side up\": 17, \"nose blush\": 38, \"tank top\": 16, \"hair bobbles\": 24, \"naughty face\": 7, \"downblouse\": 4, \"no bra\": 9, \"close-up\": 8, \"assisted exposure\": 1, \":d\": 13, \"fangs\": 4, \"from above\": 3, \"puffy nipples\": 8, \"full-face blush\": 55, \"shirt pull\": 1, \"oppai loli\": 38, \"multiple boys\": 14, \"solo focus\": 82, \"2boys\": 4, \"animal ears\": 2, \"closed eyes\": 37, \"sparkle\": 1, \"^_^\": 4, \"breast slip\": 4, \"pointy ears\": 1, \"mole\": 18, \"mole under eye\": 18, \"meme\": 1, \"ear blush\": 6, \"ribbon\": 29, \"very long hair\": 17, \"hair ribbon\": 27, \"bed\": 5, \"stuffed toy\": 1, \"stuffed animal\": 1, \"striped panties\": 3, \"camisole\": 14, \"teddy bear\": 1, \"dress\": 2, \"gradient hair\": 1, \"pantyhose\": 2, \"coat\": 2, \"black pantyhose\": 1, \"short twintails\": 24, \"one-piece swimsuit\": 4, \"grabbing\": 43, \"breast grab\": 41, \"one-piece swimsuit pull\": 4, \"skirt\": 47, \"school uniform\": 3, \"tail\": 1, \"ass\": 45, \"wings\": 1, \"necktie\": 5, \"pantyshot\": 7, \"suspenders\": 3, \"bat wings\": 1, \"black background\": 1, \"demon tail\": 1, \"demon wings\": 1, \"waving\": 1, \"tail wagging\": 1, \"briefcase\": 2, \"grabbing from behind\": 15, \"girl on top\": 9, \"kiss\": 6, \"hand on another's face\": 2, \"upper body\": 4, \"sweater\": 6, \"turtleneck\": 5, \"ribbed sweater\": 5, \"turtleneck sweater\": 1, \"comic\": 1, \"small breasts\": 53, \"chair\": 11, \"arms behind back\": 6, \"desk\": 13, \"computer\": 4, \"monitor\": 3, \"poster (object)\": 4, \"keyboard (computer)\": 2, \"office chair\": 8, \"deep skin\": 1, \"thighhighs\": 9, \"black thighhighs\": 6, \"zettai ryouiki\": 1, \"backpack\": 7, \"bookshelf\": 1, \":o\": 4, \"nipple tweak\": 1, \"breath\": 13, \"heavy breathing\": 38, \"indian style\": 1, \"hot\": 1, \"navel\": 54, \"clothes lift\": 25, \"shirt lift\": 18, \"undressing\": 4, \"lifted by self\": 3, \"randoseru\": 5, \"standing\": 6, \"bangs\": 22, \"nude\": 81, \"looking at another\": 6, \"from behind\": 4, \"loli\": 28, \"topless\": 3, \"covering breasts\": 1, \"pulled by self\": 1, \"shorts pull\": 2, \"locker\": 4, \"backpack removed\": 1, \"underwear only\": 2, \"panty pull\": 4, \"heart\": 11, \"pants\": 3, \"symbol-shaped pupils\": 20, \"heart-shaped pupils\": 18, \"erection\": 6, \"blue shirt\": 3, \"bulge\": 4, \"on floor\": 3, \"drunk\": 1, \"lying\": 34, \"sex\": 75, \"on back\": 28, \"breast sucking\": 8, \"lactation\": 2, \"censored\": 70, \"bar censor\": 5, \"grabbing own breast\": 2, \"bow\": 1, \"pleated skirt\": 14, \"socks\": 11, \"head tilt\": 1, \"see-through\": 7, \"skirt lift\": 4, \"half-closed eyes\": 7, \"white socks\": 2, \"on chair\": 2, \"huge breasts\": 3, \"no shoes\": 1, \"pov\": 20, \"can\": 1, \"bench\": 10, \"pov hands\": 1, \"penis\": 72, \"from side\": 4, \"profile\": 3, \"erection under clothes\": 3, \"towel\": 3, \"plump\": 2, \"naked towel\": 1, \"tongue\": 10, \"torogao\": 4, \"pussy\": 53, \"uncensored\": 8, \"cleft of venus\": 10, \"red skirt\": 1, \"trembling\": 6, \"blue ribbon\": 8, \"handjob\": 5, \"ponytail\": 8, \"cum\": 31, \"mosaic censoring\": 51, \"vaginal\": 56, \"cum in pussy\": 26, \"ejaculation\": 3, \"x-ray\": 1, \"uterus\": 1, \"internal cumshot\": 1, \"multiple girls\": 53, \"looking back\": 15, \"completely nude\": 22, \"on stomach\": 5, \"tissue box\": 2, \"bottomless\": 15, \"missionary\": 15, \"sports bra\": 2, \"pillow\": 5, \"sex from behind\": 20, \"doggystyle\": 17, \"ass grab\": 11, \"fat\": 12, \"pillow hug\": 1, \"fat man\": 11, \"grabbing another's ass\": 3, \"glasses\": 11, \"miniskirt\": 8, \"blue skirt\": 1, \"clothed male nude female\": 8, \"on desk\": 1, \"penis awe\": 1, \"pink skirt\": 8, \"2girls\": 19, \"outdoors\": 8, \"midriff\": 4, \"black skirt\": 7, \"yuri\": 6, \"white panties\": 16, \"faceless female\": 1, \"photo (object)\": 1, \"blunt bangs\": 5, \"crop top\": 2, \"pink footwear\": 5, \"microskirt\": 5, \"wet\": 3, \":<\": 1, \"looking up\": 1, \"oral\": 10, \"cunnilingus\": 3, \"white dress\": 1, \"bare arms\": 1, \"arm support\": 1, \"side-tie panties\": 1, \"hug from behind\": 1, \"fellatio\": 3, \"cum in mouth\": 3, \"shiny\": 1, \"shiny skin\": 2, \"breasts out\": 2, \"purple eyes\": 12, \"bra\": 3, \"group sex\": 12, \"breast press\": 5, \"threesome\": 1, \"bra lift\": 2, \"ffm threesome\": 1, \"teamwork\": 1, \"female masturbation\": 1, \"hug\": 1, \"upright straddle\": 1, \"paizuri\": 9, \"the pose\": 1, \"saliva\": 18, \"cum on body\": 2, \"cum on breasts\": 2, \"m legs\": 1, \"holding another's wrist\": 1, \"tears\": 7, \"panties around one leg\": 5, \"top-down bottom-up\": 2, \"all fours\": 8, \"table\": 4, \"clenched teeth\": 2, \"reach-around\": 1, \"overflow\": 2, \"orgasm\": 4, \"female orgasm\": 1, \"anus\": 9, \"suit\": 1, \"suspender skirt\": 1, \"train interior\": 1, \"blue hair\": 7, \"grey hair\": 13, \"red hair\": 6, \"side ponytail\": 2, \"wariza\": 1, \"eating\": 1, \"5girls\": 6, \"brand name imitation\": 1, \"food print\": 1, \"chips (food)\": 1, \"potato chips\": 1, \"interracial\": 1, \"anger vein\": 1, \"pink hair\": 11, \"no panties\": 4, \"road\": 1, \"power lines\": 1, \"street\": 1, \"4girls\": 5, \"after sex\": 1, \"cumdrip\": 1, \"orgy\": 4, \"flat chest\": 4, \"white shirt\": 1, \"embarrassed\": 2, \"wavy mouth\": 2, \"knees together feet apart\": 2, \"door\": 2, \"doorway\": 2, \"have to pee\": 2, \"red eyes\": 3, \"6+girls\": 3, \"between breasts\": 1, \"exhibitionism\": 1, \"public nudity\": 1, \"3girls\": 20, \"clothing aside\": 3, \"panties aside\": 3, \"areola slip\": 1, \"purple hair\": 2, \"hair over eyes\": 2, \"fingering\": 2, \"squatting\": 8, \"brown eyes\": 2, \"green eyes\": 3, \"take your pick\": 1, \"shoes\": 3, \"blurry\": 2, \"blurry background\": 2, \"upside-down\": 2, \"utility pole\": 2, \"pole\": 2, \"irrumatio\": 2, \"suspended congress\": 2, \"straddling\": 15, \"yellow eyes\": 2, \"sailor collar\": 9, \"tongue out\": 5, \"bent over\": 5, \"back\": 2, \"dark-skinned male\": 1, \"torso grab\": 2, \"siblings\": 1, \"3boys\": 1, \"blue sailor collar\": 6, \"short sleeves\": 1, \"kneehighs\": 1, \"scrunchie\": 1, \"age difference\": 2, \"blue pants\": 1, \"against wall\": 3, \"imminent penetration\": 1, \"white hair\": 2, \"one eye closed\": 1, \"cum on ass\": 1, \"sweatdrop\": 1, \"hands on own chest\": 1, \"underboob\": 1, \"halo\": 1, \"on side\": 1, \"sideboob\": 1, \"male pubic hair\": 1, \"from below\": 1, \"upskirt\": 1, \"ass focus\": 1, \"swing\": 1, \"arms behind head\": 3, \"wooden floor\": 3, \"=_=\": 1, \"detached collar\": 1, \"breasts squeezed together\": 1, \"unmoving pattern\": 1, \"cowgirl position\": 12, \"happy sex\": 3, \"kneeling\": 1, \"own hands together\": 1, \"interlocked fingers\": 2, \"pregnant\": 5, \"off shoulder\": 1, \"drooling\": 2, \"clothed sex\": 2, \"reverse cowgirl position\": 2, \"bra strap\": 2, \"on bed\": 1, \"boy on top\": 1, \"ahegao\": 3, \"rolling eyes\": 1, \"fucked silly\": 1, \"open clothes\": 1, \"reaching towards viewer\": 2, \"squatting cowgirl position\": 2, \"mixed bathing\": 4, \"simple background\": 1, \"bathroom\": 2, \"hanging breasts\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [576, 448], \"count\": 414}}, \"mean_img_ar_error\": 0.1294117647058823}, \"subsets\": [{\"img_count\": 207, \"num_repeats\": 2, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"lonely_island2\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "20", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0001", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "207", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "4140", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "16", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "06bece8e771a9ec16474db4c7d601d2f04fd08d1b1611072e7dd97c18cec3a09", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "207", + "ss_num_epochs": "20", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "lonely_island2", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "0b1893f6", + "ss_sd_scripts_commit_hash": "5050971ac687dca70ba0486a583d283e8ae324e2", + "ss_seed": "42", + "ss_session_id": "3103457902", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1689276786.6126819", + "ss_training_started_at": "1689274345.7293463", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "bdbec579", + "sshs_model_hash": "1f4b65f4ca38c2ee8494d207d2b8441319d8d2ac764b7126112e0d9aea9fac86" +} \ No newline at end of file diff --git a/Styles/31/botiland-83927.txt b/Styles/31/botiland-83927.txt new file mode 100644 index 0000000000000000000000000000000000000000..ccd0b968b0431e20f0f7877310ddf26fc37fe1e2 --- /dev/null +++ b/Styles/31/botiland-83927.txt @@ -0,0 +1,373 @@ +Link:https://civitai.com/models/108990/lonely-island-artstyle-nsfw +Version:v1.0 +Base Model:SD 1.5 +Keywords:botiland +--------DESCRIPTION--------- + +Artstyle of circleartist +Trigger tag is botiland +Works well with AnythingV5, AOM3B1 didn't work well :( +Add censored in UC bc all train images has pixelated censorship + + + +Top tags are +blush (205) +breasts (192) +nipples (171) +tan (163) +1girl (158) +blue eyes (157) +long hair (152) +open mouth (151) +tanlines (151) +blonde hair (146) +twintails (146) +large breasts (134) +hetero (131) +1boy (129) +one-piece tan (122) +smile (96) +fang (88) +solo focus (82) +nude (81) +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:masterpiece, best quality, blond hair, full-face blush, blush, looking at viewer, smug, smile, finger to mouth, , (botiland) + Negative Prompt:lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, (censored) + Size:384x576, Sampler:Euler a, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img2: + Prompt:masterpiece, best quality, blond hair, full-face blush, full body, pink panties, blush, looking at viewer, smug, smile, finger to mouth, , (botiland) + Negative Prompt:lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, (censored) + Size:384x640, Sampler:Euler a, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img3: + Prompt:masterpiece, best quality, blond hair, full-face blush, full body, (((onsen))), ((water)), (partially submerged), (one side up), red flowers (shy), , (botiland) + Negative Prompt:(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),lowres,text,bad anatomy,bad hands,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,((panties)),((nude)),(((nsfw))),blurry, (more than 5 fingers), (less than 5 fingers), (censored) + Size:640x384, Sampler:DPM++ SDE, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img4: + Prompt:masterpiece, best quality, blush, breasts,nipples,tan,1girl,blue eyes,long hair,open mouth,tanlines,blonde hair,twintails,large breasts,hetero,one-piece tan, , (botiland) + Negative Prompt:(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored) + Size:448x640, Sampler:DPM++ SDE, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img6: + Prompt:masterpiece, best quality, ass focus, anus, pussy, close-up, cum, naked, cum in pussy, , (botiland) + Negative Prompt:(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),lowres,text,bad anatomy,bad hands,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,((panties)),((nude)),(((nsfw))),blurry, (more than 5 fingers), (less than 5 fingers), (censored) + Size:640x448, Sampler:DPM++ SDE, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img7: + Prompt:masterpiece, best quality, , (zoe), (orange hair), (long hair), (heterochima, purple eye, blue eye), , (botiland) + Negative Prompt:(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored) + Size:448x640, Sampler:DPM++ SDE, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img8: + Prompt:masterpiece, best quality, jakuzure nonon, black soft hat, holster, black gloves,utility belt,shoulder holster, (hand near face), blush, full body, nipples, breasts, looking at viewer, , (botiland) + Negative Prompt:(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored) + Size:448x640, Sampler:DPM++ SDE, Steps:35, CFG:8, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash: +img10: + Prompt:masterpiece, best quality, , (zoe), (orange hair), (long hair), (heterochima, purple eye, blue eye), , (botiland) + Negative Prompt:lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry + Size:384x576, Sampler:Euler a, Steps:35, CFG:8, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 108990, + "name": "Lonely Island artstyle NSFW ぼっちアイランド (オセロ) ", + "description": "

Artstyle of circle / artist

Trigger tag is botiland
Works well with AnythingV5, AOM3B1 didn't work well :(
Add censored in UC bc all train images has pixelated censorship



Top tags are
blush (205)

breasts (192)

nipples (171)

tan (163)

1girl (158)

blue eyes (157)

long hair (152)

open mouth (151)

tanlines (151)

blonde hair (146)

twintails (146)

large breasts (134)

hetero (131)

1boy (129)

one-piece tan (122)

smile (96)

fang (88)

solo focus (82)

nude (81)

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 180, + "favoriteCount": 42, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "ALEKSEYR554", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c19aba0c-91ff-4be4-e569-343db5f46400/width=96/ALEKSEYR554.jpeg" + }, + "tags": [ + "style", + "nsfw", + "styles" + ], + "modelVersions": [ + { + "id": 117405, + "modelId": 108990, + "name": "v1.0", + "createdAt": "2023-07-14T11:21:48.644Z", + "updatedAt": "2023-07-14T11:30:05.667Z", + "trainedWords": [ + "botiland" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 180, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "botiland.safetensors", + "id": 83927, + "sizeKB": 36993.8134765625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-14T11:25:58.886Z", + "hashes": { + "AutoV1": "281973F3", + "AutoV2": "F9F9C317F8", + "SHA256": "F9F9C317F88DC9AC3F225D968E30262F35C3E7EC392CB35D5071EA531600A438", + "CRC32": "F4097BF7", + "BLAKE3": "1B9CFB6FCCA5CD31180E00CC0990BF63840644E1F2E79EE8952241EBA72918DA" + }, + "downloadUrl": "https://civitai.com/api/download/models/117405", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/26ba7fa4-c760-4823-a4a0-cd7fe9331132/width=450/1551124.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UPOe;Tt79tRk},4:Ipt7ELRRoOIoOERkIq%1", + "meta": { + "Size": "384x576", + "seed": 4277346099, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, blond hair, full-face blush, blush, looking at viewer, smug, smile, finger to mouth, , (botiland)", + "Version": "v1.4.0", + "sampler": "Euler a", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/42c1936e-07fc-4dc2-8d12-a0eb4745359e/width=450/1551123.jpeg", + "nsfw": "X", + "width": 768, + "height": 1280, + "hash": "UGJQcn0L00^jxU9uE2?GxT9a~V-oRi%2xuIn", + "meta": { + "Size": "384x640", + "seed": 4277346099, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, blond hair, full-face blush, full body, pink panties, blush, looking at viewer, smug, smile, finger to mouth, , (botiland)", + "Version": "v1.4.0", + "sampler": "Euler a", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e4288cf2-86fe-4007-9d9c-84ea05561d97/width=450/1551125.jpeg", + "nsfw": "None", + "width": 1280, + "height": 768, + "hash": "U7IXNy0001~V|.02_3+?I9%Mxbb@~W-UDj0z", + "meta": { + "Size": "640x384", + "seed": 3310185533, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, blond hair, full-face blush, full body, (((onsen))), ((water)), (partially submerged), (one side up), red flowers (shy), , (botiland)", + "Version": "v1.4.0", + "sampler": "DPM++ SDE", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),lowres,text,bad anatomy,bad hands,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,((panties)),((nude)),(((nsfw))),blurry, (more than 5 fingers), (less than 5 fingers), (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/407257b6-0559-49ac-8602-b50c843601ed/width=450/1551126.jpeg", + "nsfw": "X", + "width": 896, + "height": 1280, + "hash": "U5NlDD~A00-V32x[3ENa00WD02Ip04M{D4WB", + "meta": { + "Size": "448x640", + "seed": 2415887846, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, blush, breasts,nipples,tan,1girl,blue eyes,long hair,open mouth,tanlines,blonde hair,twintails,large breasts,hetero,one-piece tan, , (botiland)", + "Version": "v1.4.0", + "sampler": "DPM++ SDE", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ad23690e-a858-4ec7-9c47-8761803cd9e5/width=450/1551128.jpeg", + "nsfw": "None", + "width": 896, + "height": 1280, + "hash": "UCJtx8_K00_N7^JQESt,#6~B-W0L0Lf$R$Io", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be3b0530-72f1-42e4-ae13-abc8815b8f03/width=450/1551127.jpeg", + "nsfw": "X", + "width": 1280, + "height": 896, + "hash": "UJP5G-%M00sm.moz9aRj00aKIpV@Mef+r=Rk", + "meta": { + "Size": "640x448", + "seed": 2438520220, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, ass focus, anus, pussy, close-up, cum, naked, cum in pussy, , (botiland)", + "Version": "v1.4.0", + "sampler": "DPM++ SDE", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),lowres,text,bad anatomy,bad hands,missing fingers,extra digit,fewer digits,cropped,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,username,blurry,((panties)),((nude)),(((nsfw))),blurry, (more than 5 fingers), (less than 5 fingers), (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f3df08b8-f937-4730-ac1a-714a6863afcf/width=450/1551134.jpeg", + "nsfw": "None", + "width": 896, + "height": 1280, + "hash": "UGLVg-5700AH|.0zFyo#ISt7KRM_ERxuRP$M", + "meta": { + "Size": "448x640", + "seed": 3792166466, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, , (zoe), (orange hair), (long hair), (heterochima, purple eye, blue eye), , (botiland)", + "Version": "v1.4.0", + "sampler": "DPM++ SDE", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "zoeLeagueOfLegends_v10", + "type": "lora", + "weight": 0.8 + } + ], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b0365efb-b8b5-4829-b561-7e946998efa1/width=450/1551131.jpeg", + "nsfw": "X", + "width": 896, + "height": 1280, + "hash": "U8JQ.iNZ00~C~CkB56sp4nxu-;IU-VWVNts:", + "meta": { + "Size": "448x640", + "seed": 4987018, + "Model": "AnythingV5_v5PrtRE", + "steps": 35, + "prompt": "masterpiece, best quality, jakuzure nonon, black soft hat, holster, black gloves,utility belt,shoulder holster, (hand near face), blush, full body, nipples, breasts, looking at viewer, , (botiland) ", + "Version": "v1.4.0", + "sampler": "DPM++ SDE", + "cfgScale": 8, + "clipSkip": 2, + "resources": [], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(lowres),(cropped),(worst quality),((((low quality)))),(((normal quality))),((jpeg artifacts)),((bad anatomy)),((bad hands)),error,((bad text)),((missing text)),((missing fingers)),((missing anatomy)),((missing hands)),((bad fingers)),(extra digit),(fewer digits),((bad detailed)),((missing hand)),((bad finger)),(((missing finger))),((bad hand)),(bad legs),((missing legs)),((bad anatomy legs)),((bad objects)),((missing objects)),((bad items)),((missing items)),(bad environment),(missing environment),((bad building)),((missing building)),((bad reflection)),((missing reflection)),((bad background)),((missing background)),((missing eyes)),((bad eyes)),(bad geometry),((missing geometry)),((bad line)),((missing line)),(bad light),(missing light),(bad shadows),(missing shadows),(bad wrist),(missing wrist),((bad metal)),((missing metal)),((bad wood)),((missing wood)),(more than 5 fingers), (less than 5 fingers), (censored)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2fbfb1ae-7ef5-4c31-90c2-b3d1386668c5/width=450/1551129.jpeg", + "nsfw": "None", + "width": 896, + "height": 1280, + "hash": "UKK1dVj=64x]K}s94;9u~o-BNLt7t*57x[kW", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/40b99355-0105-443c-a15c-7f6c80de92de/width=450/1551133.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "U9K+_;}[01KO00-V0fEN0#Mx_NI=^4bw=Y%M", + "meta": { + "Size": "384x576", + "seed": 3937834873, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 35, + "prompt": "masterpiece, best quality, , (zoe), (orange hair), (long hair), (heterochima, purple eye, blue eye), , (botiland)", + "Version": "v1.4.0", + "sampler": "Euler a", + "cfgScale": 8, + "clipSkip": 2, + "resources": [ + { + "name": "zoeLeagueOfLegends_v10", + "type": "lora", + "weight": 0.8 + } + ], + "Hires steps": "20", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "lowres, text, bad anatomy, bad hands, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry", + "Denoising strength": "0.45" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/117405" + } + ] +} +---------------------------- diff --git a/Styles/32/chibi-v1-77327-metadata.json b/Styles/32/chibi-v1-77327-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..39ed45e22ad972943cda358c5e3f877a4296695c --- /dev/null +++ b/Styles/32/chibi-v1-77327-metadata.json @@ -0,0 +1,273 @@ +{ + "ss_sd_model_name": "model.safetensors", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "2", + "ss_num_train_images": "192", + "ss_tag_frequency": { + "12_chibi": { + "chibi": 16, + "solo": 16, + "simple background": 16, + "white background": 16, + "bangs": 15, + "full body": 14, + "1girl": 11, + "gloves": 10, + "holding": 10, + "open mouth": 10, + "transparent background": 10, + "hair between eyes": 8, + "smile": 8, + "long hair": 8, + "looking at viewer": 6, + "hair ornament": 6, + "1boy": 5, + "male focus": 5, + "green eyes": 5, + "sitting": 5, + "black gloves": 5, + "multicolored hair": 5, + "blue eyes": 5, + "blue hair": 5, + "grey hair": 4, + "purple eyes": 4, + "flower": 4, + "dress": 4, + ":d": 4, + "boots": 3, + "pants": 3, + "blonde hair": 3, + "red eyes": 3, + "japanese clothes": 3, + "streaked hair": 3, + "ponytail": 3, + "animal ears": 3, + "armor": 3, + "jewelry": 3, + "ahoge": 3, + "long sleeves": 3, + "hat": 3, + "sidelocks": 3, + "detached sleeves": 3, + "aqua eyes": 2, + "closed mouth": 2, + "jacket": 2, + "coat": 2, + "hood": 2, + "fingerless gloves": 2, + "tail": 2, + "white hair": 2, + "pink hair": 2, + "gradient hair": 2, + "bow": 2, + "blunt bangs": 2, + "green hair": 2, + "black hair": 2, + "earrings": 2, + "capelet": 2, + "dark skin": 2, + "red headwear": 2, + "twintails": 2, + "gauntlets": 2, + "short hair": 2, + "albedo (genshin impact)": 1, + "blue shirt": 1, + "black footwear": 1, + "shirt": 1, + "short sleeves": 1, + "white coat": 1, + "hood down": 1, + "kaedehara kazuha": 1, + "red hair": 1, + "leaf print": 1, + "leaf": 1, + "antenna hair": 1, + "crossed bangs": 1, + "food": 1, + "japanese armor": 1, + "dog boy": 1, + "gorou (genshin impact)": 1, + "brown hair": 1, + "dog ears": 1, + "dog tail": 1, + "holding weapon": 1, + "weapon": 1, + "axe": 1, + "dog": 1, + "sangonomiya kokomi": 1, + "bow-shaped hair": 1, + "white gloves": 1, + "frilled sleeves": 1, + "wide sleeves": 1, + "frills": 1, + "thick eyebrows": 1, + "fox boy": 1, + "fox ears": 1, + "yellow flower": 1, + "fox tail": 1, + "animal ear fluff": 1, + "hoodie": 1, + "green capelet": 1, + "single earring": 1, + "black dress": 1, + "dark-skinned male": 1, + "hair over one eye": 1, + "black headwear": 1, + "animal hat": 1, + "bouquet": 1, + "arabian clothes": 1, + "purple flower": 1, + "blue flower": 1, + "heterochromia": 1, + "yellow eyes": 1, + "dark-skinned female": 1, + "eye of horus": 1, + "own hands together": 1, + "hairband": 1, + "short hair with long locks": 1, + "klee (genshin impact)": 1, + "pointy ears": 1, + "low twintails": 1, + "hat feather": 1, + "red dress": 1, + "cabbie hat": 1, + "brown gloves": 1, + "bag": 1, + "backpack": 1, + "jumpy dumpty": 1, + "charm (object)": 1, + "dodoco (genshin impact)": 1, + "jean (genshin impact)": 1, + "hair bow": 1, + "blue capelet": 1, + "white pants": 1, + "black bow": 1, + "noelle (genshin impact)": 1, + "hair flower": 1, + "maid headdress": 1, + "rose": 1, + "red flower": 1, + "braid": 1, + "red rose": 1, + "maid": 1, + "armored boots": 1, + "armored dress": 1, + "apron": 1, + "maid apron": 1, + ":o": 1, + "ganyu (genshin impact)": 1, + "horns": 1, + "holding flower": 1, + "qingxin flower": 1, + "white flower": 1, + "black bodysuit": 1, + "bell": 1, + "goat horns": 1, + "bodysuit": 1, + "keqing (genshin impact)": 1, + "purple hair": 1, + "cone hair bun": 1, + "hair bun": 1, + "blush": 1, + "stuffed toy": 1, + "stuffed animal": 1, + "double bun": 1, + "pantyhose": 1, + "yanfei (genshin impact)": 1, + "antlers": 1, + "yelan (genshin impact)": 1, + "coat on shoulders": 1, + "fur trim": 1, + "diagonal bangs": 1, + "dice": 1, + "jacket on shoulders": 1, + "asymmetrical gloves": 1, + "bob cut": 1, + "fur-trimmed jacket": 1, + "kamisato ayaka": 1, + "hand fan": 1, + "holding fan": 1, + "ribbon": 1, + "hair ribbon": 1, + "light blue hair": 1, + "mole under eye": 1, + "covering mouth": 1, + "mole": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_batch_size_per_device": "1", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 512, + 512 + ], + "count": 192 + } + }, + "mean_img_ar_error": 0.0 + }, + "ss_bucket_no_upscale": "False", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "12_chibi": { + "n_repeats": 12, + "img_count": 16 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "9", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "0", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_bucket_reso": "1024", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "255", + "ss_max_train_steps": "1920", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "32", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "a611cf9c19e8f8011a0912cb064b8b71a542d834422e9da53420eac87db38bd8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "192", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "chibi", + "ss_prior_loss_weight": "1", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "de2f2560", + "ss_sd_scripts_commit_hash": "(unknown)", + "ss_seed": "1337", + "ss_session_id": "2460528798", + "ss_shuffle_caption": "True", + "ss_steps": "1728", + "ss_text_encoder_lr": "1e-05", + "ss_total_batch_size": "1", + "ss_training_comment": "None", + "ss_training_finished_at": "1688389144.7971582", + "ss_training_started_at": "1688388858.753433", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "069551a1", + "sshs_model_hash": "5430e2503a156e108808547d8185e773834ed289f80930db4ec5061be966e9a5" +} \ No newline at end of file diff --git a/Styles/32/chibi-v1-77327.txt b/Styles/32/chibi-v1-77327.txt new file mode 100644 index 0000000000000000000000000000000000000000..6e77da38df076b5be4b063bf17188780230f8ae1 --- /dev/null +++ b/Styles/32/chibi-v1-77327.txt @@ -0,0 +1,191 @@ +Link:https://civitai.com/models/102365/chibiqq +Version:v1.0 +Base Model:SD 1.5 +Keywords:chibi +--------DESCRIPTION--------- + +一个Q版角色的模型，可以将你的角色变成Q版人物，或者直接生成Q版人物，根据权重的不同，Q版程度也会不同，请自行尝试，降低权重可以有更清晰的细节表现并且可以提高泛用性，提高权重会增加图片的风格化程度。 + +不需要提示词，不过你也可以加上chibi来稳定效果。 + +可以用来生成小头像玩玩，请不要用于商业途径！ + +Lora of a chibi character can turn your character into a chibi character, or directly generate a chibi character. Depending on the weight, the degree of chibi will be different. Please try it yourself.  + +It doesn't need a tag, but you can also add chibi to stabilize the effect. + +(Please do not use it for commercial purposes!) + +例图模型/Sample graph modelcetus-Mix-v3.5 +采样方法（Sampler）：DPM++SDE Karras +放大算法（Hires.fix）R-ESRGAN 4x+Anime6B (0.3) +---------------------------- +-----ABOUT THIS VERSION----- + +❤️ +---------------------------- +------PREVIEWS METADATA----- + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 102365, + "name": "chibi/Q版风格/Q版化/头像", + "description": "

一个Q版角色的模型，可以将你的角色变成Q版人物，或者直接生成Q版人物，根据权重的不同，Q版程度也会不同，请自行尝试，降低权重可以有更清晰的细节表现并且可以提高泛用性，提高权重会增加图片的风格化程度。

不需要提示词，不过你也可以加上chibi来稳定效果。

可以用来生成小头像玩玩，请不要用于商业途径！

Lora of a chibi character can turn your character into a chibi character, or directly generate a chibi character. Depending on the weight, the degree of chibi will be different. Please try it yourself. 

It doesn't need a tag, but you can also add chibi to stabilize the effect.

(Please do not use it for commercial purposes!)

例图模型/Sample graph model：cetus-Mix-v3.5
采样方法（Sampler）：DPM++SDE Karras

放大算法（Hires.fix）：R-ESRGAN 4x+Anime6B (0.3)

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 0, + "favoriteCount": 0, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Hayasaka_AI_", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dfe4859f-f4be-4c4b-90a0-df7393aa698b/width=96/Hayasaka_AI_.jpeg" + }, + "tags": [ + "anime", + "style", + "2d", + "chibi" + ], + "modelVersions": [ + { + "id": 109525, + "modelId": 102365, + "name": "v1.0", + "createdAt": "2023-07-03T17:13:55.124Z", + "updatedAt": "2023-07-03T17:20:48.666Z", + "trainedWords": [ + "chibi" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

❤️

", + "stats": { + "downloadCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "chibi-v1.safetensors", + "id": 77327, + "sizeKB": 36979.525390625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-03T17:15:46.013Z", + "hashes": { + "AutoV1": "5C26D4E6", + "AutoV2": "8E0A3C72DF", + "SHA256": "8E0A3C72DF8B895ACA393472560C5773857B95204249B79F29FC2D7946EDC202", + "CRC32": "A1CAA13B", + "BLAKE3": "46FDF13399E98DDD201E89CF75BE95D554445F7B77AAB2B8049D7CD3EBABB5A2" + }, + "downloadUrl": "https://civitai.com/api/download/models/109525", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0e199ea5-62eb-42bd-bedc-261a92436f91/width=450/1391619.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UHN0e-?Ft,Is_OWA4TxHzpS$Vrwcv2R,?bt5", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3458eae1-1151-474e-b5b9-ac06b37e71c9/width=450/1391620.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UWLg^jXmD+k=}tf*RQVYr?%3t6tRIAV@njI:", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0d889686-c9ed-4611-ba7a-a0ae99aece34/width=450/1391621.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UNL;8B.9x^?HAJnzRkNGnOog~pIB%gIU%LIU", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da16fa0b-89ba-42b5-bc09-c73aac352418/width=450/1391622.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UhMZ%ZV@_NxaE#bHnis:IVayx]ofxtoLxZR*", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fec799b2-62bc-4c7d-8b9c-cadf56f99af7/width=450/1391624.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UOLgt%RP01ni}tt74:W=Q9Rjm-soD$bva}oK", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/066351d4-e1a5-4df8-835c-c8bbe70ca5aa/width=450/1391625.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UDNA3ZVE8wvi{NB=Fw-;?_n3L#sl00]g%MQm", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3624b797-c36a-480d-bf62-c8abfc484025/width=450/1391655.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UeM*26s:.mt7$kjGX7bH.8f+=|ofggbHaej[", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd0a9394-56cb-4570-a9e4-1651419f640a/width=450/1391659.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UfNc$#t7_NRjs:WBx]t7%ha|xut6x]kBaeof", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/44935eb8-1853-41bb-a5cb-9fbf782b5688/width=450/1391653.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UmNwf+ae_NtRoMj[kCWB-;axwct7tRoyoLae", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d6c254f4-074b-4f21-851f-8ca4d78ebcfb/width=450/1391626.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UlPi|?oL_NtRjFWBkCof?bj[Rjof%MoyWBWB", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/109525" + } + ] +} +---------------------------- diff --git a/Styles/33/comicfusion-10-98250-metadata.json b/Styles/33/comicfusion-10-98250-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..6ae9f690f4c9bbfb6bd749d2ea44aac781b7e3cf --- /dev/null +++ b/Styles/33/comicfusion-10-98250-metadata.json @@ -0,0 +1,61 @@ +{ + "ss_sd_model_name": "sd-v1-5-pruned-noema-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "400", + "ss_tag_frequency": { + "dataset": { + "comicfusion": 20 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 20, + "img_count": 20 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 400, \"num_reg_images\": 0, \"resolution\": [768, 768], \"enable_bucket\": true, \"min_bucket_reso\": 320, \"max_bucket_reso\": 1280, \"tag_frequency\": {\"dataset\": {\"comicfusion\": 20}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [576, 960], \"count\": 40}, \"1\": {\"resolution\": [576, 1024], \"count\": 40}, \"2\": {\"resolution\": [640, 896], \"count\": 260}, \"3\": {\"resolution\": [704, 832], \"count\": 20}, \"4\": {\"resolution\": [768, 768], \"count\": 20}, \"5\": {\"resolution\": [896, 640], \"count\": 20}}, \"mean_img_ar_error\": 0.029573482730941902}, \"subsets\": [{\"img_count\": 20, \"num_repeats\": 20, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": \"comicfusion\", \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0003", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "100", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "2000", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "f8999e07ed43938dfcfc71498a761c79472999547b045100d201e376715cecfe", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "200", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "comicfusion", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "5386e8fb", + "ss_sd_scripts_commit_hash": "e6ad3cbc66130fdc3bf9ecd1e0272969b1d613f7", + "ss_seed": "42", + "ss_session_id": "3373473054", + "ss_steps": "2000", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1691287646.6187837", + "ss_training_started_at": "1691284729.66159", + "ss_unet_lr": "0.0003", + "ss_v2": "False", + "sshs_legacy_hash": "71bcf886", + "sshs_model_hash": "ab84f86582b509d6842763c5f35ea612417695e8f182f7f279af918af26552f5" +} \ No newline at end of file diff --git a/Styles/33/comicfusion-10-98250.txt b/Styles/33/comicfusion-10-98250.txt new file mode 100644 index 0000000000000000000000000000000000000000..203639b9c41ffdaed0c8757ce29e985cc5a6ce1c --- /dev/null +++ b/Styles/33/comicfusion-10-98250.txt @@ -0,0 +1,650 @@ +Link:https://civitai.com/models/123484/comicfusion +Version:v1.0 +Base Model:SD 1.5 +Keywords:comicfusion +--------DESCRIPTION--------- + +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:Neon-lit alley, rain-slicked pavement reflecting holographic graffiti, a trench-coated figure emerges from the shadows. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img2: + Prompt:Skyline vista, a lone figure stands atop an abandoned tower, silhouetted against a sprawling cityscape of flickering lights and encrypted data. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img3: + Prompt:Hovering police drone, its searchlight cutting through the urban haze, casting a stark, synthetic glow on the crumbling facade. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img4: + Prompt:Skywalk race, cybernetically enhanced competitors hurtling through a grid of luminescent tracks high above the metropolis. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img5: + Prompt:Skyline vista, a lone figure stands atop an abandoned tower, silhouetted against a sprawling cityscape of flickering lights and encrypted data. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img6: + Prompt:Synthetic rainforest, bioluminescent flora casting an otherworldly glow, towering data trees hosting encrypted knowledge. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img7: + Prompt:Virtual reality den, neon-hued cables connecting to headsets, users lost in a realm where data and dreams intertwine. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img8: + Prompt:Subway platform, commuters with implanted interfaces engage in silent conversations, their eyes glowing with digital overlays. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img9: + Prompt:Data heist, a cybernetic thief jacks into a secured mainframe, navigating through an intricate labyrinth of code defenses. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + +img10: + Prompt:Virtual meditation garden, seekers adorned with neural interfaces, communing with digital representations of serene natural landscapes. , comicfusion + Negative Prompt: + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:radiantV3_radiantV3, Model Hash:7964f082b4 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 123484, + "name": "ComicFusion", + "description": null, + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 125, + "favoriteCount": 27, + "commentCount": 0, + "ratingCount": 1, + "rating": 5 + }, + "creator": { + "username": "hk4life", + "image": "https://lh3.googleusercontent.com/a/AEdFTp60zF_y9rmG8dWKfpryxu-jolOOGH4HUDfZjuZO_g=s96-c" + }, + "tags": [ + "art", + "cyberpunk", + "style", + "comic", + "spiritual", + "occult" + ], + "modelVersions": [ + { + "id": 134636, + "modelId": 123484, + "name": "v1.0", + "createdAt": "2023-08-06T02:12:57.021Z", + "updatedAt": "2023-08-06T02:16:27.68Z", + "trainedWords": [ + "comicfusion" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 125, + "ratingCount": 1, + "rating": 5 + }, + "files": [ + { + "id": 98250, + "url": "https://civitai-delivery-worker-prod-2023-08-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/22415/model/comicfusion10.o5Eb.safetensors", + "sizeKB": 36976.3798828125, + "name": "comicfusion-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-08-06T02:15:37.763Z", + "hashes": { + "AutoV1": "9D239ACA", + "AutoV2": "7848347811", + "SHA256": "78483478114A3EE5FAFDB1D047632AC439771CC3A6FAA67AAD328203FBA3CB2A", + "CRC32": "EE58B12A", + "BLAKE3": "BD32E2E6F9F8F27EBD0F63E3FD26801E4A90114ACE2CB43A09E7FBF1FF486C0C" + }, + "downloadUrl": "https://civitai.com/api/download/models/134636", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d4602b23-ba1c-4d35-91b7-34b9e4dcdbd1/width=450/1893814.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UQD+J5}l{Kx=+t-R-.$MXQoLo3s:OESeRlNa", + "type": "image", + "metadata": { + "hash": "UQD+J5}l{Kx=+t-R-.$MXQoLo3s:OESeRlNa", + "size": 2567633, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426134, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Neon-lit alley, rain-slicked pavement reflecting holographic graffiti, a trench-coated figure emerges from the shadows. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d37435c2-dd0a-49d4-9f65-fe2bb618ba58/width=450/1893786.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHE_Kd=_~A={-6%1Rk-U0g%0E3sm~AM|xtNH", + "type": "image", + "metadata": { + "hash": "UHE_Kd=_~A={-6%1Rk-U0g%0E3sm~AM|xtNH", + "size": 2247552, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426132, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Skyline vista, a lone figure stands atop an abandoned tower, silhouetted against a sprawling cityscape of flickering lights and encrypted data. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ff6b18a-78c3-4ebd-b5c3-c17c0d6af1a5/width=450/1893819.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEIN+v^$,H0OV?axM~xa8~-nt5Rk~U-n^#IW", + "type": "image", + "metadata": { + "hash": "UEIN+v^$,H0OV?axM~xa8~-nt5Rk~U-n^#IW", + "size": 1714579, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426136, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Hovering police drone, its searchlight cutting through the urban haze, casting a stark, synthetic glow on the crumbling facade. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ac56345-822d-45ac-b21a-5642bcb0fe7d/width=450/1893812.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UADv.v.8L*H[0vNZ9pMds=M{-tx]D6$lTW%M", + "type": "image", + "metadata": { + "hash": "UADv.v.8L*H[0vNZ9pMds=M{-tx]D6$lTW%M", + "size": 1855499, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426135, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Skywalk race, cybernetically enhanced competitors hurtling through a grid of luminescent tracks high above the metropolis. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c95c46fa-d317-479b-aae2-5bc7dbabdc6d/width=450/1893825.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UMIXpC-n}:%KF{t5IpoexYRkR*RkDkNHOYWB", + "type": "image", + "metadata": { + "hash": "UMIXpC-n}:%KF{t5IpoexYRkR*RkDkNHOYWB", + "size": 1922655, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426137, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Skyline vista, a lone figure stands atop an abandoned tower, silhouetted against a sprawling cityscape of flickering lights and encrypted data. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b3dd6531-6735-4e62-962b-3d454423a04e/width=450/1893839.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UC8jV,iRK.kE4VXO+.j1?~pFI-bW85aLvhbq", + "type": "image", + "metadata": { + "hash": "UC8jV,iRK.kE4VXO+.j1?~pFI-bW85aLvhbq", + "size": 2280134, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426138, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Synthetic rainforest, bioluminescent flora casting an otherworldly glow, towering data trees hosting encrypted knowledge. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/892ce692-327a-4fed-ac8c-15fe48ff61e9/width=450/1893866.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UXFG1,**}8x?uKq|J6k9NFizbdaLXenkxbnj", + "type": "image", + "metadata": { + "hash": "UXFG1,**}8x?uKq|J6k9NFizbdaLXenkxbnj", + "size": 2036981, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426139, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Virtual reality den, neon-hued cables connecting to headsets, users lost in a realm where data and dreams intertwine. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e45c0796-5aec-42fe-bf43-92971d7b3bcf/width=450/1893865.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKFi79~q.SIAo}E1s.-p%Ms.s.bvx]%Mspt7", + "type": "image", + "metadata": { + "hash": "UKFi79~q.SIAo}E1s.-p%Ms.s.bvx]%Mspt7", + "size": 1574572, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 3295426140, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Subway platform, commuters with implanted interfaces engage in silent conversations, their eyes glowing with digital overlays. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b323548b-d2e2-4644-bb80-734fd427d1ca/width=450/1893904.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UTGcxOoy%{t700WCo[ax}_f7i*j]4mk9NGWB", + "type": "image", + "metadata": { + "hash": "UTGcxOoy%{t700WCo[ax}_f7i*j]4mk9NGWB", + "size": 1155309, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 4075308411, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Data heist, a cybernetic thief jacks into a secured mainframe, navigating through an intricate labyrinth of code defenses. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4ee0a10f-a68d-4134-a6cc-2adce96c141e/width=450/1893905.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDEpfgtQzAn$00RkKiW;=@ae_Nt7crt6HsjF", + "type": "image", + "metadata": { + "hash": "UDEpfgtQzAn$00RkKiW;=@ae_Nt7crt6HsjF", + "size": 2524564, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "512x768", + "seed": 4075308412, + "Model": "radiantV3_radiantV3", + "steps": 20, + "hashes": { + "model": "7964f082b4" + }, + "prompt": "Virtual meditation garden, seekers adorned with neural interfaces, communing with digital representations of serene natural landscapes. , comicfusion", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "7964f082b4", + "name": "radiantV3_radiantV3", + "type": "model" + }, + { + "hash": "ab84f86582b5", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "7964f082b4", + "Hires upscale": "2", + "AddNet Enabled": "True", + "AddNet Model 1": "comicfusion-10(ab84f86582b5)", + "Hires upscaler": "4x-UltraSharp", + "AddNet Module 1": "LoRA", + "Wildcard prompt": "\"__cyberpunk__ , comicfusion\"", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1", + "Denoising strength": "0.3" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/134636" + } + ] +} +---------------------------- diff --git a/Styles/34/comiclo-126023-metadata.json b/Styles/34/comiclo-126023-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..1fd4c30c3c32d9dccf85a5f4b731dd2c65ab6ce1 --- /dev/null +++ b/Styles/34/comiclo-126023-metadata.json @@ -0,0 +1,957 @@ +{ + "ss_sd_model_name": "a.ckpt", + "ss_resolution": "(512, 768)", + "ss_clip_skip": "2", + "ss_num_train_images": "2610", + "ss_tag_frequency": { + "10_comiclo": { + "black hair": 250, + "black eyes": 196, + "short hair": 183, + "outdoors": 163, + "smile": 161, + "1girl": 153, + "solo": 143, + "long hair": 125, + "multiple girls": 115, + "day": 111, + "twintails": 103, + "looking at viewer": 92, + "2girls": 88, + "shirt": 87, + "skirt": 87, + "water": 86, + "bag": 86, + "sky": 86, + "sitting": 84, + "open mouth": 82, + "shorts": 75, + "brown hair": 72, + "hair ornament": 68, + "tree": 66, + "child": 62, + "holding": 58, + "cloud": 57, + "standing": 52, + "brown eyes": 51, + "swimsuit": 51, + "flat chest": 48, + "blush": 47, + "shoes": 47, + "bangs": 44, + "barefoot": 44, + "hat": 43, + "ponytail": 40, + "one-piece swimsuit": 38, + ":d": 37, + "hairclip": 36, + "socks": 36, + "sandals": 36, + "jacket": 36, + "closed eyes": 33, + "backpack": 32, + "short sleeves": 31, + "denim": 30, + "long sleeves": 30, + "grin": 30, + "food": 29, + "white shirt": 29, + "beach": 29, + "school swimsuit": 29, + "flower": 28, + "sleeveless": 28, + "bare shoulders": 28, + "striped": 27, + "blue sky": 27, + "sneakers": 27, + "braid": 26, + "walking": 26, + "ocean": 26, + "dress": 25, + "pantyhose": 24, + "coat": 24, + "school uniform": 23, + "hair bobbles": 22, + "hood": 22, + "t-shirt": 22, + "snow": 21, + "short twintails": 21, + "twin braids": 21, + "closed mouth": 21, + "camisole": 21, + "sunlight": 20, + "3girls": 20, + "bikini": 20, + "navel": 20, + "squatting": 19, + "animal": 19, + "eating": 19, + "polka dot": 19, + "from above": 18, + "school bag": 18, + "looking back": 18, + "innertube": 17, + "indoors": 17, + "tank top": 17, + "shadow": 17, + "bob cut": 17, + "scenery": 17, + "nude": 17, + "arm support": 17, + "wading": 17, + "looking up": 16, + "legs": 16, + "winter clothes": 16, + "pants": 16, + "road": 16, + "building": 16, + "umbrella": 15, + "denim shorts": 15, + "female child": 15, + "plaid": 15, + "shade": 15, + "profile": 15, + "small breasts": 15, + "hoodie": 15, + "from behind": 15, + "towel": 15, + "railing": 15, + "dappled sunlight": 15, + "short shorts": 15, + "boots": 14, + "winter": 14, + "running": 14, + "outstretched arms": 14, + "black skirt": 14, + "rock": 14, + "window": 14, + "grass": 14, + "feet": 14, + "arms up": 14, + "scarf": 13, + "looking away": 13, + "nipples": 13, + "sweater": 13, + "breasts": 13, + "arms behind back": 13, + "dog": 12, + "sunset": 12, + "power lines": 12, + "loli": 12, + "cherry blossoms": 12, + "tan": 12, + "sun hat": 12, + "randoseru": 11, + "arm up": 11, + "ground vehicle": 11, + "full body": 11, + "leaf": 11, + "wet": 11, + "hood down": 11, + "upper body": 11, + "white footwear": 11, + "looking at another": 11, + "striped shirt": 11, + "1boy": 11, + "underwear": 11, + "open clothes": 11, + "rain": 10, + "stairs": 10, + "parted lips": 10, + "gloves": 10, + "fruit": 10, + "partially submerged": 10, + "blue shorts": 10, + "black pantyhose": 9, + "armpits": 9, + "leaning forward": 9, + "4girls": 9, + "bare legs": 9, + "autumn": 9, + "cat": 9, + "mountain": 9, + "onsen": 9, + "straw hat": 9, + "panties": 9, + "low twintails": 9, + "^_^": 9, + "from below": 9, + "looking to the side": 8, + "from side": 8, + "competition school swimsuit": 8, + "shoulder bag": 8, + "river": 8, + "completely nude": 8, + "bird": 8, + "black one-piece swimsuit": 8, + "night": 8, + "freckles": 8, + "antenna hair": 8, + "pink footwear": 7, + "plaid skirt": 7, + "plant": 7, + "collarbone": 7, + "baseball cap": 7, + "goggles": 7, + "sand": 7, + "street": 7, + "jeans": 7, + "pleated skirt": 7, + "lying": 7, + "fur trim": 7, + "petals": 7, + "ass": 7, + "gym uniform": 7, + "blunt bangs": 7, + "glasses": 7, + "dutch angle": 7, + "sleeveless shirt": 7, + "white dress": 7, + "looking down": 7, + "hug": 7, + "vest": 7, + "nature": 7, + "kneehighs": 7, + "handbag": 7, + "bare arms": 7, + "rubber boots": 6, + "book": 6, + "beanie": 6, + "motor vehicle": 6, + "blue one-piece swimsuit": 6, + "cloudy sky": 6, + "serafuku": 6, + "autumn leaves": 6, + "tanlines": 6, + "headwear removed": 6, + "hat removed": 6, + "teeth": 6, + "soaking feet": 6, + "blue skirt": 6, + "bike shorts": 6, + "sundress": 6, + "necktie": 6, + "kikuchi makoto": 6, + "solo focus": 6, + "hair flower": 5, + "plaid scarf": 5, + "tankini": 5, + "midriff": 5, + "hair over shoulder": 5, + "puddle": 5, + "leash": 5, + "white socks": 5, + "utility pole": 5, + "spread arms": 5, + "table": 5, + "holding food": 5, + "holding clothes": 5, + "gym shorts": 5, + "black shorts": 5, + "branch": 5, + "pointing": 5, + "bucket": 5, + "closed umbrella": 5, + "watercraft": 5, + "cup": 5, + "city": 5, + "jumping": 5, + "splashing": 5, + "goggles on head": 5, + "pool": 5, + "japanese clothes": 5, + "kimono": 5, + "sleeveless dress": 5, + "bent over": 5, + "chair": 5, + "bowl": 5, + "expressionless": 5, + "white shorts": 5, + "hands on own knees": 5, + "grey shorts": 5, + "sweater vest": 5, + "raglan sleeves": 4, + "lamppost": 4, + "frills": 4, + "hand between legs": 4, + "reflection": 4, + "fish": 4, + "black serafuku": 4, + "happy": 4, + "sign": 4, + "house": 4, + "bridge": 4, + "wagashi": 4, + "popsicle": 4, + "turtleneck": 4, + "on back": 4, + "medium hair": 4, + "standing on one leg": 4, + "print shirt": 4, + "outstretched arm": 4, + "fence": 4, + "mittens": 4, + "basket": 4, + "boat": 4, + "blue eyes": 4, + "yukata": 4, + "collared shirt": 4, + "bra": 4, + "multiple boys": 4, + "legwear under shorts": 4, + "chopsticks": 4, + "blazer": 4, + "summer": 4, + "one eye closed": 4, + "bench": 4, + "snowing": 4, + "toes": 4, + "floral print": 4, + "hand up": 4, + "hooded jacket": 4, + "phone": 4, + "cellphone": 4, + "capri pants": 4, + "holding umbrella": 3, + "sitting on stairs": 3, + "bow": 3, + "taiyaki": 3, + "mouth hold": 3, + "pillow": 3, + "parted bangs": 3, + "between legs": 3, + "casual one-piece swimsuit": 3, + "collar": 3, + "brown footwear": 3, + "white neckerchief": 3, + "neckerchief": 3, + "sailor collar": 3, + "kotatsu": 3, + "earmuffs": 3, + "miniskirt": 3, + "in tree": 3, + "holding hat": 3, + "mandarin orange": 3, + "orange (fruit)": 3, + "hanten (clothes)": 3, + "bathing": 3, + "one-piece tan": 3, + ":o": 3, + "5girls": 3, + "6+girls": 3, + "leg up": 3, + "cityscape": 3, + "thighhighs": 3, + "bath": 3, + "white panties": 3, + "track jacket": 3, + "instrument": 3, + "bath yukata": 3, + "wind": 3, + "lingerie": 3, + "holding bag": 3, + "tree shade": 3, + "swim cap": 3, + "night sky": 3, + "hair bun": 3, + "stream": 3, + "horizon": 3, + "waves": 3, + "holding chopsticks": 3, + "breath": 3, + "cowboy shot": 3, + "sportswear": 3, + "head rest": 3, + "yuri": 3, + "hug from behind": 3, + "back": 3, + "ball": 3, + "christmas": 3, + "hydrangea": 3, + "bicycle": 3, + "smartphone": 3, + "no socks": 3, + "laughing": 3, + "yellow shirt": 3, + "long skirt": 3, + "letterboxed": 3, + "see-through": 3, + "open shirt": 3, + "own hands together": 2, + "frilled bikini": 2, + "bikini skirt": 2, + "hair bow": 2, + "striped bikini": 2, + "field": 2, + "pink dress": 2, + "v arms": 2, + "ribbon": 2, + "polka dot swimsuit": 2, + "white one-piece swimsuit": 2, + "underwater": 2, + "diving mask": 2, + "air bubble": 2, + "bubble": 2, + "snorkel": 2, + "freediving": 2, + "hairband": 2, + "car": 2, + "black footwear": 2, + "on stomach": 2, + "sweat": 2, + "sweatdrop": 2, + "under table": 2, + "under kotatsu": 2, + "fishing rod": 2, + "pink shirt": 2, + "food on face": 2, + "uwabaki": 2, + "holding fruit": 2, + "white sweater": 2, + "cutoffs": 2, + "convenient censoring": 2, + "ripples": 2, + "forehead": 2, + "bottle": 2, + "water bottle": 2, + "red coat": 2, + "black shirt": 2, + "blue shirt": 2, + "clothes writing": 2, + "mountainous horizon": 2, + "sun": 2, + "bug": 2, + "blurry": 2, + "reading": 2, + "open book": 2, + "holding book": 2, + "no panties": 2, + "blue kimono": 2, + "cardigan": 2, + "black socks": 2, + "swing": 2, + "shoes removed": 2, + "hibiscus": 2, + "vending machine": 2, + "lap pillow": 2, + "holding hands": 2, + "single hair bun": 2, + "drink": 2, + "desk": 2, + "camera": 2, + "snowball": 2, + "noodles": 2, + "ramen": 2, + "kneepits": 2, + "skewer": 2, + "single braid": 2, + ";d": 2, + "rabbit": 2, + "drinking straw": 2, + "red scarf": 2, + "loafers": 2, + "grey skirt": 2, + "bed": 2, + "heart": 2, + "ahoge": 2, + "androgynous": 2, + "sleeping": 2, + "buruma": 2, + "black buruma": 2, + "poolside": 2, + "mole": 2, + "feet out of frame": 2, + "skinny": 2, + "blue dress": 2, + "tongue out": 2, + "tongue": 2, + ":p": 2, + "v-shaped eyebrows": 2, + "looking afar": 2, + "christmas tree": 2, + "santa hat": 2, + "santa costume": 2, + "gift": 2, + "soles": 2, + "foreshortening": 2, + "city lights": 2, + "scrunchie": 2, + "white hoodie": 2, + "dock": 2, + "sleeves rolled up": 2, + "animal print": 2, + "pink jacket": 2, + "pink sweater": 2, + "open jacket": 2, + "bicycle basket": 2, + "holding phone": 2, + "hand on own knee": 2, + "winter coat": 2, + "off shoulder": 2, + "forest": 2, + "all fours": 2, + "tatami": 2, + "denim skirt": 2, + "sketch": 2, + "clenched hand": 2, + "holding leash": 2, + "red necktie": 2, + "very short hair": 2, + "train interior": 2, + "lighthouse": 2, + "waving": 2, + "stretching": 2, + "no pants": 2, + "black bikini": 2, + "underwear only": 2, + "flower pot": 1, + "couch": 1, + "hands on lap": 1, + "raincoat": 1, + "blood": 1, + "yellow raincoat": 1, + "white headwear": 1, + "frilled swimsuit": 1, + "pink one-piece swimsuit": 1, + "swimming": 1, + "diving": 1, + "pet": 1, + "holding strap": 1, + "fishing": 1, + "holding fishing rod": 1, + "two side up": 1, + "cherry": 1, + "gym shirt": 1, + "ribbed sweater": 1, + "brown pantyhose": 1, + "maple leaf": 1, + "paw print": 1, + "groin": 1, + "hair over one eye": 1, + "stomach": 1, + "steam": 1, + "upper teeth only": 1, + "shiny": 1, + "mouth mask": 1, + "surgical mask": 1, + "mask": 1, + "holding bottle": 1, + "covered mouth": 1, + "fur-trimmed boots": 1, + "dango": 1, + "pink theme": 1, + "sanshoku dango": 1, + "hanami": 1, + "belt": 1, + "dirty": 1, + "leggings": 1, + "sparkler": 1, + "fireworks": 1, + "lake": 1, + "white tank top": 1, + "hand net": 1, + "butterfly net": 1, + "dragonfly": 1, + "argyle legwear": 1, + "argyle": 1, + "onigiri": 1, + "picnic basket": 1, + "picnic": 1, + "legs up": 1, + "wetsuit": 1, + "diving mask on head": 1, + "pubic hair": 1, + "female pubic hair": 1, + "open kimono": 1, + "white skirt": 1, + "wide shot": 1, + "white scarf": 1, + "green scarf": 1, + "frozen": 1, + "ice": 1, + "bear": 1, + "bus stop": 1, + "alley": 1, + "thermos": 1, + "hands in pockets": 1, + "track suit": 1, + "shallow water": 1, + "music": 1, + "playing instrument": 1, + "recorder": 1, + "flute": 1, + "holding instrument": 1, + "water drop": 1, + "hugging own legs": 1, + "silhouette": 1, + "ikari shinji": 1, + "2boys": 1, + "cliff": 1, + "red sky": 1, + "red theme": 1, + "star (sky)": 1, + "starry sky": 1, + "tanabata": 1, + "watermelon": 1, + "can": 1, + "bikini top only": 1, + "out of frame": 1, + "fubuki (kancolle)": 1, + "kitakami (kancolle)": 1, + "casual": 1, + "no humans": 1, + "monochrome": 1, + "blue theme": 1, + "classroom": 1, + "school desk": 1, + "pantyshot": 1, + "ice skates": 1, + "skates": 1, + "restaurant": 1, + "food stand": 1, + "lantern": 1, + "paper lantern": 1, + "holding animal": 1, + "puppy": 1, + "baseball mitt": 1, + "baseball": 1, + "blue headwear": 1, + "baseball uniform": 1, + "blue socks": 1, + "blurry background": 1, + "stadium": 1, + "on head": 1, + "animal on head": 1, + "hamster": 1, + "drinking": 1, + "clothes around waist": 1, + "jacket around waist": 1, + "blue pantyhose": 1, + "train station": 1, + "pajamas": 1, + "stuffed toy": 1, + "stuffed animal": 1, + "instrument case": 1, + "horse": 1, + "horseback riding": 1, + "riding": 1, + "arrow (projectile)": 1, + "saddle": 1, + "reins": 1, + "bow (weapon)": 1, + "weapon": 1, + "male focus": 1, + "real world location": 1, + "mole under mouth": 1, + "shrine": 1, + "wolf": 1, + "medium breasts": 1, + "hair over eyes": 1, + "ribs": 1, + "facing away": 1, + "potted plant": 1, + "pinafore dress": 1, + "suspender skirt": 1, + "ice cream": 1, + "ice cream cone": 1, + "eyewear on head": 1, + "hose": 1, + "duck": 1, + "surprised": 1, + "hawaiian shirt": 1, + "candy": 1, + "jack-o'-lantern": 1, + "halloween": 1, + "witch hat": 1, + "lollipop": 1, + "pumpkin": 1, + "costume": 1, + "swirl lollipop": 1, + "witch": 1, + "hiding": 1, + "waterfall": 1, + "christmas ornaments": 1, + "bell": 1, + "star (symbol)": 1, + "wreath": 1, + "holly": 1, + "footprints": 1, + "turtle": 1, + "frog": 1, + "rimless eyewear": 1, + "earrings": 1, + "hair scrunchie": 1, + "green shorts": 1, + "hand on own face": 1, + "panty peek": 1, + "crossed arms": 1, + "snail": 1, + "frilled skirt": 1, + "topknot": 1, + "ship": 1, + "polka dot legwear": 1, + "apron": 1, + "strawberry": 1, + "sleeves pushed up": 1, + "cake": 1, + "pastry bag": 1, + "side ponytail": 1, + "cooking": 1, + "head scarf": 1, + "blowing": 1, + "turtleneck sweater": 1, + "pink coat": 1, + "sleeves past wrists": 1, + "swimsuit under clothes": 1, + "white jacket": 1, + "curtains": 1, + "wading pool": 1, + "striped one-piece swimsuit": 1, + "knees up": 1, + "beachball": 1, + "bandaid on knee": 1, + "bandaid on leg": 1, + "bandaid": 1, + "purple skirt": 1, + "landscape": 1, + "black pants": 1, + "object hug": 1, + "black kimono": 1, + "black coat": 1, + "holding bowl": 1, + "shovel": 1, + "open cardigan": 1, + "pussy": 1, + "against tree": 1, + "bottomless": 1, + "goldfish": 1, + "covering mouth": 1, + "leaning": 1, + "balcony": 1, + "food in mouth": 1, + "sunflower": 1, + "heart print": 1, + "striped pantyhose": 1, + "pen": 1, + "pencil": 1, + "scissors": 1, + "holding scissors": 1, + "denim jacket": 1, + "blue jacket": 1, + "meat": 1, + "tomato": 1, + "shrimp": 1, + "vegetable": 1, + "salad": 1, + "polka dot skirt": 1, + "on side": 1, + "hand fan": 1, + "paper fan": 1, + "uchiwa": 1, + "green shirt": 1, + "green sweater": 1, + "holding bucket": 1, + "shore": 1, + "flip-flops": 1, + ":q": 1, + "kicking": 1, + "purple shirt": 1, + "seagull": 1, + "striped dress": 1, + "zipper": 1, + "frown": 1, + "plaid shirt": 1, + "blue pants": 1, + "swept bangs": 1, + "hand on own chin": 1, + "polka dot dress": 1, + "sitting backwards": 1, + "electric fan": 1, + "wariza": 1, + "male swimwear": 1, + "red bikini": 1, + "red one-piece swimsuit": 1, + "between thighs": 1, + "bandana": 1, + "dress shirt": 1, + "crowd": 1, + "hair ribbon": 1, + "apple": 1, + "blue footwear": 1, + "grey pants": 1, + "animal collar": 1, + "toenails": 1, + "hill": 1, + "hair rings": 1, + "bush": 1, + "wing collar": 1, + "wince": 1, + "tomboy": 1, + "racket": 1, + "tennis racket": 1, + "looking outside": 1, + "overalls": 1, + "crossed legs": 1, + "pencil skirt": 1, + "hetero": 1, + "chain-link fence": 1, + "kickboard": 1, + "crow": 1, + "paper bag": 1, + "volleyball": 1, + "holding ball": 1, + "hand on hip": 1, + "shop": 1, + "hand on headwear": 1, + "arm at side": 1, + "snowman": 1, + "shopping bag": 1, + "guard rail": 1, + "spaghetti strap": 1, + "\\o/": 1, + "undressing": 1, + "kitchen": 1, + "palm tree": 1, + "afloat": 1, + "holding shoes": 1, + "sports bikini": 1, + "upside-down": 1, + "too many": 1, + "bikini under clothes": 1, + "wet clothes": 1, + "adjusting hair": 1, + "crab": 1, + "sleeveless hoodie": 1, + "topless": 1, + "mole under eye": 1, + "looking at phone": 1 + } + }, + "ss_batch_size_per_device": "8", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 384, + 1024 + ], + "count": 10 + }, + "1": { + "resolution": [ + 448, + 832 + ], + "count": 10 + }, + "2": { + "resolution": [ + 512, + 704 + ], + "count": 770 + }, + "3": { + "resolution": [ + 512, + 768 + ], + "count": 1660 + }, + "4": { + "resolution": [ + 576, + 576 + ], + "count": 20 + }, + "5": { + "resolution": [ + 576, + 640 + ], + "count": 10 + }, + "6": { + "resolution": [ + 640, + 576 + ], + "count": 30 + }, + "7": { + "resolution": [ + 704, + 512 + ], + "count": 80 + }, + "8": { + "resolution": [ + 768, + 512 + ], + "count": 20 + } + }, + "mean_img_ar_error": 0.018288139697145336 + }, + "ss_bucket_no_upscale": "False", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "10_comiclo": { + "n_repeats": 10, + "img_count": 261 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "15", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "0", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_bucket_reso": "3072", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "4965", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "32.0", + "ss_network_dim": "64", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "331", + "ss_num_epochs": "15", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "comiclo", + "ss_prior_loss_weight": "1.0", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "925997e9", + "ss_sd_scripts_commit_hash": "6d5f847edc7eaf858aa6fe060c68875b8da7392a", + "ss_seed": "31337", + "ss_session_id": "4124848386", + "ss_shuffle_caption": "True", + "ss_text_encoder_lr": "1e-05", + "ss_total_batch_size": "8", + "ss_training_comment": "None", + "ss_training_finished_at": "1695239996.240564", + "ss_training_started_at": "1695234707.883308", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "ea4c49b7", + "sshs_model_hash": "b691c32071a790566a7a5335fc29266fb7ee0b9748affe74fa8f5fcf294e8121" +} \ No newline at end of file diff --git a/Styles/34/comiclo-126023.txt b/Styles/34/comiclo-126023.txt new file mode 100644 index 0000000000000000000000000000000000000000..8225933d29be0413d3a29ca5dd1b22a2713ef60a --- /dev/null +++ b/Styles/34/comiclo-126023.txt @@ -0,0 +1,643 @@ +Link:https://civitai.com/models/149039/c-comic-lo-takamichi-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +有事加群：697080799,188546326 +This is the treasured gem of humanity, the guiding light of the 2D world. +这是人类的至宝，二次元的明灯。 +Recently, for some unknown reason, when my script trains the same model, the hands always tend to be poorly rendered... +最近，不知道什么原因，我的脚本在训练同样的模型时，手部总是容易画崩……A tip: When I'm training the style Lora, I don't consider its style transfer on different checkpoints. I only focus on restoration on the training model. So, please try to use the nai, anything series of models. Though it also works on some realistic models.提示：我训练画风lora的时候，并不会考虑它在不同ckpt上的风格迁移，只考虑在训练模型上进行还原，所以请尽量使用nai,anything系列模型。尽管它在一些写实模型上也有效果。 + +我是不是该把muk改成妹喜画风啊…… +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:masterpiece, best quality,,multiple girls, 3girls, backpack, bag, black hair, hat, hair ornament, ponytail, hairclip, black eyes, bandana, striped, smile, short hair, shorts, long hair, skirt, denim, looking at viewer, hug, shirt + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img2: + Prompt:masterpiece, best quality,,multiple girls, 2girls, swimsuit, innertube, one-piece swimsuit, water, school swimsuit, black hair, afloat, short hair, smile, black eyes, partially submerged, hair ornament, barefoot, hairclip, open mouth, looking at viewer, flat chest + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img3: + Prompt:masterpiece, best quality,,multiple girls, 3girls, fruit, food, watermelon, water, sandals, hat, black hair, hair bobbles, shorts, skirt, river, short hair, dappled sunlight, hairband, smile, outdoors, straw hat, hair ornament, dress, stream, open mouth, nature, rock, wading, sunlight, long hair, twintails, polka dot + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img4: + Prompt:masterpiece, best quality,,1girl, solo, pantyhose, sitting, flower, skirt, twintails, sitting on stairs, from above, black eyes, stairs, black hair, plaid skirt, legs, plaid, long hair, shade, smile, looking at viewer, black pantyhose, brown hair, looking up, own hands together, sunlight, brown eyes, long sleeves, plant, flower pot, book + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:576x832, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img5: + Prompt:masterpiece, best quality,,1girl, solo, shorts, short hair, from below, sky, cloud, denim shorts, black hair, day, denim, black eyes, smile, cutoffs, arms behind back, blue shorts, short shorts, bare shoulders, blue sky + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:576x832, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img6: + Prompt:masterpiece, best quality,,1girl, solo, ground vehicle, bicycle, skirt, hood, sky, long hair, outdoors, cloud, bicycle basket, brown hair, hood down, twintails, braid, sunset, twin braids, hair over shoulder, long sleeves, hoodie, jacket, looking at viewer, coat, brown eyes, standing, city, pleated skirt, closed mouth, building, hooded jacket, motor vehicle, black hair, plaid skirt, plaid, scenery, bangs + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:576x832, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img7: + Prompt:masterpiece, best quality,,1girl, solo, black hair, fruit, black eyes, tree, food, coat, hair ornament, orange (fruit), looking at viewer, upper body, short hair, closed mouth, bangs, fur trim, outdoors, hair bobbles, jacket, hood down, day, leaf, zipper, mandarin orange, winter clothes, frown, twintails, branch, turtleneck, long sleeves, sunlight, expressionless + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img8: + Prompt:masterpiece, best quality,,1girl, solo, flower, school uniform, black hair, bag, squatting, black eyes, jacket, skirt, blazer, school bag, hairclip, smile, hair ornament, socks, short hair, loafers, shoes + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img9: + Prompt:masterpiece, best quality,,1girl, solo, short hair, skirt, sky, standing, outdoors, shirt, black hair, barefoot, arms behind back, brown eyes, white shirt, instrument case, power lines, short sleeves, black eyes, sunset, cloud, bag, scenery, holding, brown hair, looking away, t-shirt + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:576x832, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + +img10: + Prompt:masterpiece, best quality,,multiple girls, swimsuit, 3girls, one-piece swimsuit, school swimsuit, day, water, black hair, outdoors, wading, black eyes, cloud, short hair, sky, smile, black one-piece swimsuit, ocean, flat chest, + Negative Prompt:text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2) + Size:1024x1536, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash:6e430eb514 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 149039, + "name": "C萝画风 comic lo takamichi style", + "description": "

有事加群：697080799,188546326

This is the treasured gem of humanity, the guiding light of the 2D world.

这是人类的至宝，二次元的明灯。

Recently, for some unknown reason, when my script trains the same model, the hands always tend to be poorly rendered...

最近，不知道什么原因，我的脚本在训练同样的模型时，手部总是容易画崩……

A tip: When I'm training the style Lora, I don't consider its style transfer on different checkpoints. I only focus on restoration on the training model. So, please try to use the nai, anything series of models. Though it also works on some realistic models.
提示：我训练画风lora的时候，并不会考虑它在不同ckpt上的风格迁移，只考虑在训练模型上进行还原，所以请尽量使用nai,anything系列模型。尽管它在一些写实模型上也有效果。

我是不是该把muk改成妹喜画风啊……

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 147, + "favoriteCount": 26, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "kozue", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/08339353-58fe-4acf-b9f9-c098de947d00/width=96/kozue.jpeg" + }, + "tags": [ + "style", + "style art" + ], + "modelVersions": [ + { + "id": 166374, + "modelId": 149039, + "name": "v1.0", + "createdAt": "2023-09-21T00:45:15.663Z", + "updatedAt": "2023-09-21T00:49:45.033Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 147, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 126023, + "sizeKB": 73855.47265625, + "name": "comiclo.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-21T00:50:40.715Z", + "hashes": { + "AutoV1": "39CC13A6", + "AutoV2": "86DA5589BC", + "SHA256": "86DA5589BC4C976E3DACAE9638E473AD4DEF45C2F6827B5E1B7FAADE5DFD8B70", + "CRC32": "92DC9CF1", + "BLAKE3": "22D7B0913585ED85717431E0327A0C0B3B3EBC7CC242B0382EF368400C8AE32E" + }, + "downloadUrl": "https://civitai.com/api/download/models/166374", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff551d09-99c7-4682-9411-3fd8ed932670/width=450/2598437.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UEKApR,skZ~W}:ITInIU01EMx[E2.8IA-;aK", + "type": "image", + "metadata": { + "hash": "UEKApR,skZ~W}:ITInIU01EMx[E2.8IA-;aK", + "size": 1994820, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 3711118842, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,multiple girls, 3girls, backpack, bag, black hair, hat, hair ornament, ponytail, hairclip, black eyes, bandana, striped, smile, short hair, shorts, long hair, skirt, denim, looking at viewer, hug, shirt", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/461903f3-0de0-4f61-80b9-dc2bb7eeace5/width=450/2598435.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UVKK.uj].RRQPAo#s:aK.lo}Ipt55So2wcIo", + "type": "image", + "metadata": { + "hash": "UVKK.uj].RRQPAo#s:aK.lo}Ipt55So2wcIo", + "size": 1838719, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 3315911664, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,multiple girls, 2girls, swimsuit, innertube, one-piece swimsuit, water, school swimsuit, black hair, afloat, short hair, smile, black eyes, partially submerged, hair ornament, barefoot, hairclip, open mouth, looking at viewer, flat chest", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fee07a87-1815-4050-b70c-be54740cc577/width=450/2598436.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UEH2T4eSPRRj-,Q:NdS}qAox%Lf}?v4nt7Rn", + "type": "image", + "metadata": { + "hash": "UEH2T4eSPRRj-,Q:NdS}qAox%Lf}?v4nt7Rn", + "size": 2233206, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 3711118842, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,multiple girls, 3girls, fruit, food, watermelon, water, sandals, hat, black hair, hair bobbles, shorts, skirt, river, short hair, dappled sunlight, hairband, smile, outdoors, straw hat, hair ornament, dress, stream, open mouth, nature, rock, wading, sunlight, long hair, twintails, polka dot", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2b4d877-6746-4a6d-81be-06f834db94a1/width=450/2598444.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UBJalx.59s0eQ-V~4oyC?t009Z_300IV~V?a", + "type": "image", + "metadata": { + "hash": "UBJalx.59s0eQ-V~4oyC?t009Z_300IV~V?a", + "size": 2061138, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "576x832", + "seed": 3653208387, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, pantyhose, sitting, flower, skirt, twintails, sitting on stairs, from above, black eyes, stairs, black hair, plaid skirt, legs, plaid, long hair, shade, smile, looking at viewer, black pantyhose, brown hair, looking up, own hands together, sunlight, brown eyes, long sleeves, plant, flower pot, book", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/98a9456a-e580-4d0e-bc9e-dc08deabcc26/width=450/2598441.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UDGbuMA16T5Y5t+X?GXm9~_ND*vfNG.9xFNF", + "type": "image", + "metadata": { + "hash": "UDGbuMA16T5Y5t+X?GXm9~_ND*vfNG.9xFNF", + "size": 1776337, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "576x832", + "seed": 2012057223, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, shorts, short hair, from below, sky, cloud, denim shorts, black hair, day, denim, black eyes, smile, cutoffs, arms behind back, blue shorts, short shorts, bare shoulders, blue sky", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c3fa71ec-edb5-4520-ba59-04e18f488440/width=450/2598439.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UfIX{eOE?aM|?^t6kqt7E+n%NHtQM|M|RPWX", + "type": "image", + "metadata": { + "hash": "UfIX{eOE?aM|?^t6kqt7E+n%NHtQM|M|RPWX", + "size": 1852592, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "576x832", + "seed": 940236467, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, ground vehicle, bicycle, skirt, hood, sky, long hair, outdoors, cloud, bicycle basket, brown hair, hood down, twintails, braid, sunset, twin braids, hair over shoulder, long sleeves, hoodie, jacket, looking at viewer, coat, brown eyes, standing, city, pleated skirt, closed mouth, building, hooded jacket, motor vehicle, black hair, plaid skirt, plaid, scenery, bangs", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aafeb368-b1dd-4e10-a78a-1c2bd6bcbd7e/width=450/2598443.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UHF}_@;29t56JDNtIU$j5Zae~CjF%hv}-AX6", + "type": "image", + "metadata": { + "hash": "UHF}_@;29t56JDNtIU$j5Zae~CjF%hv}-AX6", + "size": 2046648, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 1165675955, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, black hair, fruit, black eyes, tree, food, coat, hair ornament, orange (fruit), looking at viewer, upper body, short hair, closed mouth, bangs, fur trim, outdoors, hair bobbles, jacket, hood down, day, leaf, zipper, mandarin orange, winter clothes, frown, twintails, branch, turtleneck, long sleeves, sunlight, expressionless", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/40fa941f-9c89-4a21-a30c-293f449665c1/width=450/2598438.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UUK,d9~AfhEN^3V@jFWV~Uxt%LofocNHE1R*", + "type": "image", + "metadata": { + "hash": "UUK,d9~AfhEN^3V@jFWV~Uxt%LofocNHE1R*", + "size": 1874550, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 1044382012, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, flower, school uniform, black hair, bag, squatting, black eyes, jacket, skirt, blazer, school bag, hairclip, smile, hair ornament, socks, short hair, loafers, shoes", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63915b00-4d44-4749-8668-93b7dd1e7235/width=450/2598442.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "URH-u@5Z-po#CA$yR*a}0LxBIojE=XRls.oI", + "type": "image", + "metadata": { + "hash": "URH-u@5Z-po#CA$yR*a}0LxBIojE=XRls.oI", + "size": 1515985, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "576x832", + "seed": 1493740039, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,1girl, solo, short hair, skirt, sky, standing, outdoors, shirt, black hair, barefoot, arms behind back, brown eyes, white shirt, instrument case, power lines, short sleeves, black eyes, sunset, cloud, bag, scenery, holding, brown hair, looking away, t-shirt", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07504653-fa61-4c1c-94b7-896cb29573e0/width=450/2598447.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1536, + "hash": "UMF~,b?btmu6ALROn*og9cM{IpD%IUtSs:$y", + "type": "image", + "metadata": { + "hash": "UMF~,b?btmu6ALROn*og9cM{IpD%IUtSs:$y", + "size": 1708062, + "width": 1024, + "height": 1536 + }, + "meta": { + "Size": "1024x1536", + "seed": 2656801908, + "Model": "anything-v4.5-pruned", + "steps": 20, + "hashes": { + "model": "6e430eb514" + }, + "prompt": "masterpiece, best quality,,multiple girls, swimsuit, 3girls, one-piece swimsuit, school swimsuit, day, water, black hair, outdoors, wading, black eyes, cloud, short hair, sky, smile, black one-piece swimsuit, ocean, flat chest,", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "\"comiclo": "b691c32071a7\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "comiclo", + "type": "lora", + "weight": 1 + }, + { + "hash": "6e430eb514", + "name": "anything-v4.5-pruned", + "type": "model" + } + ], + "Model hash": "6e430eb514", + "negativePrompt": "text,username,logo,(low quality, worst quality:1.4), (bad anatomy), (inaccurate limb:1.2), bad composition, inaccurate eyes, extra digit, fewer digits, (extra arms:1.2)", + "Denoising strength": "0.4", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "R-ESRGAN 4x+ Anime6B", + "Ultimate SD upscale mask_blur": "16", + "Ultimate SD upscale tile_width": "576", + "Ultimate SD upscale tile_height": "832" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/166374" + } + ] +} +---------------------------- diff --git a/Styles/35/cps2v2_fp-163174-metadata.json b/Styles/35/cps2v2_fp-163174-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..8b791b114304da56d1fe502105d1b52d0f07fe65 --- /dev/null +++ b/Styles/35/cps2v2_fp-163174-metadata.json @@ -0,0 +1,110 @@ +{ + "ss_sd_model_name": "animefull-final-pruned-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "1510", + "ss_tag_frequency": { + "croped": { + "solo": 680, + "pink background": 637, + "simple background": 586, + "1boy": 500, + "male focus": 491, + "full body": 311, + "boots": 292, + "1girl": 245, + "gloves": 218, + "muscular": 203, + "blonde hair": 183, + "long hair": 153, + "weapon": 125, + "standing": 98, + "fingerless gloves": 98, + "armor": 91, + "hat": 83, + "barefoot": 62, + "fighting stance": 62, + "black hair": 60, + "short hair": 59, + "belt": 59, + "helmet": 58, + "headband": 58, + "holding": 57, + "pants": 56, + "no humans": 54, + "brown hair": 52, + "dougi": 51, + "sword": 47, + "cape": 47, + "shoes": 46, + "muscular male": 46, + "bodysuit": 41, + "clenched hands": 39, + "blue background": 38, + "multiple boys": 38, + "leotard": 38, + "holding weapon": 38, + "purple hair": 2, + "2girls": 1, + "hugging": 1, + "nurse": 1, + "chinese clothes": 1, + "heels": 1, + "colored skin": 1, + "pajamas": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "False", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "croped": { + "n_repeats": 2, + "img_count": 755 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 1, \"num_train_images\": 1510, \"num_reg_images\": 0, \"resolution\": [768, 768], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"croped\": {\"pink background\": 637, \"solo\": 680, \"no humans\": 54, \"clenched hands\": 39, \"1boy\": 500, \"2girls\": 1, \"hugging\": 1, \"long hair\": 153, \"blonde hair\": 183, \"1girl\": 245, \"black hair\": 60, \"muscular\": 203, \"purple hair\": 2, \"nurse\": 1, \"chinese clothes\": 1, \"heels\": 1, \"colored skin\": 1, \"pajamas\": 1, \"barefoot\": 62, \"simple background\": 586, \"blue background\": 38, \"full body\": 311, \"standing\": 98, \"male focus\": 491, \"shoes\": 46, \"brown hair\": 52, \"boots\": 292, \"armor\": 91, \"gloves\": 218, \"helmet\": 58, \"weapon\": 125, \"sword\": 47, \"holding\": 57, \"fighting stance\": 62, \"multiple boys\": 38, \"muscular male\": 46, \"dougi\": 51, \"hat\": 83, \"pants\": 56, \"leotard\": 38, \"short hair\": 59, \"holding weapon\": 38, \"cape\": 47, \"belt\": 59, \"bodysuit\": 41, \"fingerless gloves\": 98, \"headband\": 58}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [448, 1024], \"count\": 6}, \"1\": {\"resolution\": [512, 1024], \"count\": 12}, \"2\": {\"resolution\": [576, 960], \"count\": 48}, \"3\": {\"resolution\": [576, 1024], \"count\": 20}, \"4\": {\"resolution\": [640, 896], \"count\": 92}, \"5\": {\"resolution\": [704, 832], \"count\": 170}, \"6\": {\"resolution\": [768, 768], \"count\": 564}, \"7\": {\"resolution\": [832, 704], \"count\": 128}, \"8\": {\"resolution\": [896, 640], \"count\": 432}, \"9\": {\"resolution\": [960, 576], \"count\": 20}, \"10\": {\"resolution\": [1024, 448], \"count\": 2}, \"11\": {\"resolution\": [1024, 512], \"count\": 6}, \"12\": {\"resolution\": [1024, 576], \"count\": 10}}, \"mean_img_ar_error\": 0.04296908525416213}, \"subsets\": [{\"img_count\": 755, \"num_repeats\": 2, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 0, \"image_dir\": \"croped\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "12", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0003", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "18120", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16.0", + "ss_network_dim": "32", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "06bece8e771a9ec16474db4c7d601d2f04fd08d1b1611072e7dd97c18cec3a09", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "1510", + "ss_num_epochs": "12", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit(weight_decay=0.1,betas=(0.9, 0.99))", + "ss_output_name": "Cps2V2_Fp", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "0b1893f6", + "ss_sd_scripts_commit_hash": "7c38c33ed62fa1becab94f967a52aca18ffaccc0", + "ss_seed": "23", + "ss_session_id": "2615963126", + "ss_steps": "18120", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1698157982.3235896", + "ss_training_started_at": "1698126584.1331193", + "ss_unet_lr": "0.0003", + "ss_v2": "False", + "sshs_legacy_hash": "b1644096", + "sshs_model_hash": "d7d938f411c33cb2d7c23a8332215fc752fac1136bf8930317ac37c0e29375be" +} \ No newline at end of file diff --git a/Styles/35/cps2v2_fp-163174.txt b/Styles/35/cps2v2_fp-163174.txt new file mode 100644 index 0000000000000000000000000000000000000000..3400118edef4b71e1b25ce970800f89728fc4e10 --- /dev/null +++ b/Styles/35/cps2v2_fp-163174.txt @@ -0,0 +1,757 @@ +Link:https://civitai.com/models/189011/capcom-cps2-sprite-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Capcom CPS2 Arcade Sprite Style +I really wanted to do this style +Trained Using Street fighter Alpha, Darkstalkers, Marvel Vs Capcom 2 sprites +Use "simple background, full body" You can add "fighting stance" if you like +Doesn't gen faces very well from my test +From testing you need to use High Res Fix to get the pixel look +I am going to retrain this lora to improve it +Enjoy!, feel free to share your gens and feedback. Shoot me a message on discord or leave a comment if you have a character or style request. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:masterpiece, best quality, solo, 1girl, smile, hatsune miku, , simple background, standing, full body, fighting stance, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img2: + Prompt:masterpiece, best quality, solo, 1boy, smile, , simple background, Naoya, school uniform, grey pants, full body, standing, holding sword, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img3: + Prompt:masterpiece, best quality, solo, 1girl, :d, , simple background, full body, standing, sonomura maki, pendant, hair ribbon, school uniform, skirt, socks, mary janes + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img4: + Prompt:masterpiece, best quality, solo, 1boy, smile, , simple background, full body, , nanjop1, school uniform, blue ascot, glasses, sniper rifle, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img5: + Prompt:masterpiece, best quality, solo, 1boy, smirk, , simple background, full body, standing, , markp1, beanie, school uniform, pants, shirt, pin, backpack + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img6: + Prompt:masterpiece, best quality, solo, 1boy, grin, , simple background, full body, fighting stance, brownp1, school uniform, goggles, goggles on head, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img7: + Prompt:masterpiece, best quality, solo, 1girl, :d, , simple background, full body, standing, , ayasep1, school uniform, necktie, twintails, freckles, arms up, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img8: + Prompt:masterpiece, best quality, solo, 1girl, , simple background, full body, standing, , erikop1, school uniform, ponytail, holding sword, rapier, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img9: + Prompt:masterpiece, best quality, solo, 1girl, , simple background, full body, standing, , yukinop1, school uniform, hair clip, necktie, skirt, arms behind Back + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + +img10: + Prompt:masterpiece, best quality, solo, 1boy, serious, , simple background, full body, standing, , reijip1, school uniform, scar, fingerless gloves, belt, collar, chain, open clothes, + Negative Prompt:(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:seizamix_v2, Model Hash:51a7154418 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 189011, + "name": "Capcom CPS2 Sprite Style", + "description": "

Capcom CPS2 Arcade Sprite Style

I really wanted to do this style

Trained Using Street fighter Alpha, Darkstalkers, Marvel Vs Capcom 2 sprites

Use \"simple background, full body\" You can add \"fighting stance\" if you like

Doesn't gen faces very well from my test

From testing you need to use High Res Fix to get the pixel look

I am going to retrain this lora to improve it

Enjoy!, feel free to share your gens and feedback. Shoot me a message on discord or leave a comment if you have a character or style request.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 308, + "favoriteCount": 98, + "commentCount": 5, + "ratingCount": 4, + "rating": 4.75, + "tippedAmountCount": 2927 + }, + "creator": { + "username": "FP_plus", + "image": "https://cdn.discordapp.com/avatars/1142235915025129593/ab60e85a217b0fd82577258f4f766f78.png" + }, + "tags": [ + "style", + "pixelart", + "capcom", + "videogame" + ], + "modelVersions": [ + { + "id": 212298, + "modelId": 189011, + "name": "v1.0", + "createdAt": "2023-11-04T14:32:34.649Z", + "updatedAt": "2023-11-04T14:40:28.486Z", + "publishedAt": "2023-11-04T21:05:00Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 308, + "ratingCount": 4, + "rating": 4.75 + }, + "files": [ + { + "id": 163174, + "sizeKB": 36978.525390625, + "name": "Cps2V2_Fp.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-04T14:40:09.61Z", + "hashes": { + "AutoV1": "35C5D8A2", + "AutoV2": "02C3B7F3EF", + "SHA256": "02C3B7F3EFD8387FE72390AA42BDED82811E4E97B668FEDA61D09881D8F0528E", + "CRC32": "DC6FF1E2", + "BLAKE3": "6C915A2B61810510EDE79224A8C4B78959DF97C5AD739E7DE9B30E9B0A9CC8F2" + }, + "downloadUrl": "https://civitai.com/api/download/models/212298", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/462ee734-2ce8-4204-9360-b41a7a369ae0/width=450/3383900.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1024, + "hash": "UVPjMst7~qt7W:ayxaj[-;j[IUWB-;j[M{ay", + "type": "image", + "metadata": { + "hash": "UVPjMst7~qt7W:ayxaj[-;j[IUWB-;j[M{ay", + "size": 404459, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 569732081, + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1girl, smile, hatsune miku, , simple background, standing, full body, fighting stance,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3\"", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ea6f0a8-0f96-4277-adf8-b8510f10bfe3/width=450/3383902.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UJNm.+bI~q%Mxus:xuof?bt7D%M{xvRkNGa}", + "type": "image", + "metadata": { + "hash": "UJNm.+bI~q%Mxus:xuof?bt7D%M{xvRkNGa}", + "size": 422996, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 1329123302, + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1boy, smile, , simple background, Naoya, school uniform, grey pants, full body, standing, holding sword,", + "NaoyaV3": "3086f54f2564\"", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "NaoyaV3", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8903ff6c-9f83-444b-93aa-75ffbeea9044/width=450/3383903.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "URO:Frxb~XofS5fkxaj@%MWBIos:-UoLNcWV", + "type": "image", + "metadata": { + "hash": "URO:Frxb~XofS5fkxaj@%MWBIos:-UoLNcWV", + "size": 427133, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 243135790, + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1girl, :d, , simple background, full body, standing, sonomura maki, pendant, hair ribbon, school uniform, skirt, socks, mary janes", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "maki-nvwls-v1-final": "9ea851cc3633\"", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c7cbdc93-bf51-43f9-b2e1-36c2f43a539a/width=450/3383909.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1024, + "hash": "UOM7osxu~qt7xuofxaM{?HofD%ae%2WBRks:", + "type": "image", + "metadata": { + "hash": "UOM7osxu~qt7xuofxaM{?HofD%ae%2WBRks:", + "size": 433661, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 1847126220, + "Model": "seizamix_v2", + "Nanjo": "ae7b6ee84d5d\"", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1boy, smile, , simple background, full body, , nanjop1, school uniform, blue ascot, glasses, sniper rifle,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Nanjo", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9144d604-a85e-47b6-a78f-388e4e37fde8/width=450/3383910.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UUN+YQR*}]-ps.WUofs;$*s:I;R*%2oMR+WV", + "type": "image", + "metadata": { + "hash": "UUN+YQR*}]-ps.WUofs;$*s:I;R*%2oMR+WV", + "size": 454829, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Mark": "04f281e271fa\"", + "Size": "512x512", + "seed": 2741724421, + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1boy, smirk, , simple background, full body, standing, , markp1, beanie, school uniform, pants, shirt, pin, backpack", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Mark", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca2acd27-eb03-4cd0-a1aa-ba972c020f4f/width=450/3383914.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UUO3|Vt7_Nxvt6ae-;kC?bWB9Yof%gj[R*ae", + "type": "image", + "metadata": { + "hash": "UUO3|Vt7_Nxvt6ae-;kC?bWB9Yof%gj[R*ae", + "size": 567198, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 2862149204, + "Brown": "e47934d43e84\"", + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1boy, grin, , simple background, full body, fighting stance, brownp1, school uniform, goggles, goggles on head,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Brown", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fd753f50-56e4-44b9-8dfd-10d4210907d9/width=450/3383916.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UQOfJ%oe~Xs;t6WBxbt8xWWBIobI={odI[bI", + "type": "image", + "metadata": { + "hash": "UQOfJ%oe~Xs;t6WBxbt8xWWBIobI={odI[bI", + "size": 428776, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 745263215, + "Ayase": "afd0b0d7e8ae\"", + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1girl, :d, , simple background, full body, standing, , ayasep1, school uniform, necktie, twintails, freckles, arms up,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Ayase", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ec93b66-ccda-4645-9fb8-dc4783544b96/width=450/3383917.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UAGuk8jI?w%MxvW;V?s:SOaynhof={niJUSO", + "type": "image", + "metadata": { + "hash": "UAGuk8jI?w%MxvW;V?s:SOaynhof={niJUSO", + "size": 402707, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 1907284876, + "Eriko": "9b8fd91566f0\"", + "Model": "seizamix_v2", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1girl, , simple background, full body, standing, , erikop1, school uniform, ponytail, holding sword, rapier,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Eriko", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a1e432ac-3e23-445f-9221-2f0be4f066e5/width=450/3383919.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UJJ8eSfk~q-:%Mj[RjfQ-pofIURjn$ayt8kC", + "type": "image", + "metadata": { + "hash": "UJJ8eSfk~q-:%Mj[RjfQ-pofIURjn$ayt8kC", + "size": 341384, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 870123606, + "Model": "seizamix_v2", + "steps": 30, + "Yukino": "49d68d65bea2\"", + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1girl, , simple background, full body, standing, , yukinop1, school uniform, hair clip, necktie, skirt, arms behind Back", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Yukino", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/778fc0ec-198a-4024-895f-014daf8d3855/width=450/3383993.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UJJa_[M|~q?axujvR*bF-;t6IUM|x[oesooM", + "type": "image", + "metadata": { + "hash": "UJJa_[M|~q?axujvR*bF-;t6IUM|x[oesooM", + "size": 401825, + "width": 1024, + "height": 1024 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "512x512", + "seed": 1489772515, + "Model": "seizamix_v2", + "Reiji": "2908c2161de3\"", + "steps": 30, + "hashes": { + "model": "51a7154418" + }, + "prompt": "masterpiece, best quality, solo, 1boy, serious, , simple background, full body, standing, , reijip1, school uniform, scar, fingerless gloves, belt, collar, chain, open clothes,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 7, + "resources": [ + { + "name": "Cps2V2_Fp", + "type": "lora", + "weight": 1 + }, + { + "name": "Reiji", + "type": "lora", + "weight": 1 + }, + { + "hash": "51a7154418", + "name": "seizamix_v2", + "type": "model" + } + ], + "\"Cps2V2_Fp": "d7d938f411c3", + "Model hash": "51a7154418", + "Hires upscale": "2", + "Hires upscaler": "None", + "negativePrompt": "(worst quality, low quality:1.4), bokeh, lowres, text, signature, sketch, watermark, artist name, speech bubble,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/212298" + } + ] +} +---------------------------- diff --git a/Styles/36/csppixelart_style-20-85922-metadata.json b/Styles/36/csppixelart_style-20-85922-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..fe1611dd6f3478f4081322bebf1d89c5ba454354 --- /dev/null +++ b/Styles/36/csppixelart_style-20-85922-metadata.json @@ -0,0 +1,453 @@ +{ + "ss_sd_model_name": "animefull-final-pruned-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "183", + "ss_tag_frequency": { + "dataset": { + "pixelart": 61, + "pixel": 61, + "pixel style": 61, + "16bit": 61, + "31bit": 61, + "solo": 54, + "full body": 43, + "1girl": 38, + "standing": 28, + "breasts": 25, + "transparent background": 24, + "gloves": 21, + "1boy": 20, + "male focus": 20, + "long hair": 20, + "simple background": 19, + "boots": 19, + "muscular": 17, + "holding": 14, + "blonde hair": 14, + "fingerless gloves": 14, + "belt": 13, + "weapon": 12, + "short hair": 12, + "large breasts": 12, + "cleavage": 12, + "ponytail": 11, + "blue eyes": 10, + "pants": 10, + "navel": 10, + "shorts": 10, + "white background": 9, + "brown hair": 9, + "smile": 8, + "bare shoulders": 8, + "shoes": 8, + "green hair": 7, + "fighting stance": 7, + "holding weapon": 7, + "thighhighs": 7, + "jewelry": 7, + "high heels": 7, + "midriff": 7, + "red eyes": 6, + "green eyes": 6, + "sneakers": 6, + "sword": 6, + "armor": 6, + "skirt": 6, + "hat": 6, + "shirt": 6, + "outdoors": 6, + "hand on hip": 6, + "leotard": 6, + "helmet": 5, + "thigh boots": 5, + "red hair": 5, + "pelvic curtain": 5, + "black hair": 5, + "japanese clothes": 4, + "socks": 4, + "jacket": 4, + "crop top": 4, + "night": 4, + "looking at viewer": 4, + "grey background": 4, + "high heel boots": 4, + "short shorts": 4, + "abs": 4, + "dress": 4, + "sleeveless": 4, + "sky": 4, + "wristband": 4, + "building": 4, + "legs apart": 3, + "underwear": 3, + "panties": 3, + "holding sword": 3, + "toned": 3, + "bangs": 3, + "blue hair": 3, + "braid": 3, + "gun": 3, + "brown eyes": 3, + "school uniform": 3, + "serafuku": 3, + "sailor collar": 3, + "closed mouth": 3, + "swimsuit": 3, + "bikini": 3, + "earrings": 3, + "witch hat": 3, + "staff": 3, + "sandals": 3, + "ribbon": 3, + "multiple boys": 3, + "hair bun": 3, + "tail": 3, + "high ponytail": 3, + "headband": 3, + "muscular female": 3, + "dougi": 3, + "red footwear": 3, + "dark skin": 3, + "no humans": 3, + "scenery": 3, + "choker": 3, + "elbow gloves": 3, + "black gloves": 3, + "topless male": 2, + "fishnets": 2, + "ninja": 2, + "red shirt": 2, + "baggy pants": 2, + "scarf": 2, + "shoulder armor": 2, + "gauntlets": 2, + "full armor": 2, + "hair over one eye": 2, + "strapless": 2, + "cropped jacket": 2, + "chaps": 2, + "twintails": 2, + "tattoo": 2, + "blue background": 2, + "holding gun": 2, + "blue skirt": 2, + "neckerchief": 2, + "blue sailor collar": 2, + "detached sleeves": 2, + "cape": 2, + "purple headwear": 2, + "clenched hands": 2, + "hair ribbon": 2, + "kimono": 2, + "double bun": 2, + "chinese clothes": 2, + "cherry blossoms": 2, + "white shirt": 2, + "clenched hand": 2, + "red jacket": 2, + "bow": 2, + "orange hair": 2, + "animal ears": 2, + "cat ears": 2, + "cat tail": 2, + "portrait": 2, + "open mouth": 2, + "upper body": 2, + "blue footwear": 2, + "wings": 2, + "horns": 2, + "crossed arms": 2, + "pleated skirt": 2, + "red gloves": 2, + "colored skin": 2, + "green leotard": 2, + "bike shorts": 2, + "fire": 2, + "red pants": 2, + "white pants": 2, + "purple hair": 2, + "stairs": 2, + "black footwear": 2, + "bracelet": 2, + "sunglasses": 2, + "day": 2, + "cloud": 2, + "blue sky": 2, + "bird": 2, + "blue shorts": 2, + "dark-skinned female": 2, + "denim": 2, + "pointy ears": 2, + "mask": 1, + "wrestling outfit": 1, + "red panties": 1, + "short sword": 1, + "fishnet bodysuit": 1, + "1other": 1, + "brown background": 1, + "pauldrons": 1, + "breastplate": 1, + "magic": 1, + "knight": 1, + "helm": 1, + "white hair": 1, + "twitter username": 1, + "bra": 1, + "leather": 1, + "leather jacket": 1, + "strapless bra": 1, + "cowboy boots": 1, + "pink eyes": 1, + "character name": 1, + "twin braids": 1, + "rocket launcher": 1, + "bag": 1, + "red neckerchief": 1, + "sitting": 1, + "signature": 1, + "gem": 1, + "holding staff": 1, + "hand on headwear": 1, + "witch": 1, + "purple cape": 1, + "glasses": 1, + "brown footwear": 1, + "baseball cap": 1, + "dual wielding": 1, + "round eyewear": 1, + "brown headwear": 1, + "knee pads": 1, + "brown shorts": 1, + "bubble blowing": 1, + "chewing gum": 1, + "thick eyebrows": 1, + "pectorals": 1, + "tree": 1, + "thick thighs": 1, + "china dress": 1, + "hood": 1, + "hoodie": 1, + "red shorts": 1, + "legs": 1, + "sash": 1, + "obi": 1, + "railing": 1, + "blue kimono": 1, + "short kimono": 1, + "architecture": 1, + "shoulder tattoo": 1, + "bridge": 1, + "east asian architecture": 1, + "yellow sash": 1, + "cat girl": 1, + "claws": 1, + "animal hands": 1, + "white fur": 1, + "big hair": 1, + "fur": 1, + "collarbone": 1, + "vest": 1, + "medium breasts": 1, + "pantyhose": 1, + "black pantyhose": 1, + "moon": 1, + "full moon": 1, + "bodystocking": 1, + "flower": 1, + "lily pad": 1, + "lotus": 1, + "hair bow": 1, + "yellow skirt": 1, + "halterneck": 1, + "teeth": 1, + "chibi": 1, + "black eyes": 1, + "letterboxed": 1, + "spiked hair": 1, + "monster": 1, + "dragon": 1, + "huge breasts": 1, + "aqua hair": 1, + "short sleeves": 1, + "puffy sleeves": 1, + "puffy short sleeves": 1, + "yellow neckerchief": 1, + "6+boys": 1, + "white leotard": 1, + "dancing": 1, + "green skin": 1, + "crowd": 1, + "closed eyes": 1, + "red skirt": 1, + "antenna hair": 1, + "shorts under skirt": 1, + "hair pulled back": 1, + "ringlets": 1, + "red sailor collar": 1, + "2boys": 1, + "water": 1, + "pool": 1, + "hair ornament": 1, + "halo": 1, + "black shorts": 1, + "bikini top only": 1, + "asymmetrical gloves": 1, + "flame print": 1, + "barefoot": 1, + "bald": 1, + "dog tags": 1, + "pyrokinesis": 1, + "purple fire": 1, + "bandages": 1, + "dark-skinned male": 1, + "standing on one leg": 1, + "ankle wrap": 1, + "window": 1, + "plant": 1, + "door": 1, + "house": 1, + "robot": 1, + "candle": 1, + "torch": 1, + "black thighhighs": 1, + "collar": 1, + "crown": 1, + "black leotard": 1, + "spikes": 1, + "armlet": 1, + "strapless leotard": 1, + "spiked bracelet": 1, + "spiked collar": 1, + "super crown": 1, + "spiked armlet": 1, + "cosplay": 1, + "revealing clothes": 1, + "hand fan": 1, + "folding fan": 1, + "mole": 1, + "from above": 1, + "lipstick": 1, + "red headwear": 1, + "red lips": 1, + "tinted eyewear": 1, + "mole above mouth": 1, + "long sleeves": 1, + "small breasts": 1, + "black dress": 1, + "pink background": 1, + "side slit": 1, + "floating": 1, + "curly hair": 1, + "rock": 1, + "telekinesis": 1, + "levitation": 1, + "highleg": 1, + "blue leotard": 1, + "mole under mouth": 1, + "arm cannon": 1, + "power suit (metroid)": 1, + "tank top": 1, + "grey hair": 1, + "eyewear on head": 1, + "denim shorts": 1, + "micro shorts": 1, + "yellow-framed eyewear": 1, + "castle": 1, + "tower": 1, + "arch": 1, + "yellow eyes": 1, + "white dress": 1, + "monster girl": 1, + "snake": 1, + "snake hair": 1, + "very long hair": 1, + "absurdly long hair": 1, + "ass": 1, + "border": 1, + "instrument": 1, + "minigirl": 1, + "bow (weapon)": 1, + "fairy wings": 1, + "riding": 1, + "fairy": 1, + "uniform": 1, + "military": 1, + "military uniform": 1, + "green shorts": 1, + "miniskirt": 1, + "clothing cutout": 1, + "cleavage cutout": 1, + "hair over eyes": 1, + "glowing": 1, + "katana": 1, + "sheath": 1, + "japanese armor": 1, + "samurai": 1, + "kabuto (helmet)": 1, + "polearm": 1, + "spear": 1, + "holding polearm": 1, + "lance": 1, + "gold armor": 1, + "plume": 1, + "sidelocks": 1, + "underboob": 1, + "elf": 1, + "armored boots": 1, + "greaves": 1, + "bikini armor": 1, + "faulds": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 3, + "img_count": 61 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 183, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dataset\": {\"pixelart\": 61, \"pixel\": 61, \"pixel style\": 61, \"16bit\": 61, \"31bit\": 61, \"solo\": 54, \"simple background\": 19, \"red eyes\": 6, \"1boy\": 20, \"standing\": 28, \"full body\": 43, \"male focus\": 20, \"boots\": 19, \"mask\": 1, \"muscular\": 17, \"transparent background\": 24, \"legs apart\": 3, \"topless male\": 2, \"wrestling outfit\": 1, \"1girl\": 38, \"long hair\": 20, \"breasts\": 25, \"white background\": 9, \"holding\": 14, \"underwear\": 3, \"green eyes\": 6, \"panties\": 3, \"ponytail\": 11, \"weapon\": 12, \"japanese clothes\": 4, \"green hair\": 7, \"socks\": 4, \"sneakers\": 6, \"fishnets\": 2, \"ninja\": 2, \"red panties\": 1, \"short sword\": 1, \"fishnet bodysuit\": 1, \"short hair\": 12, \"blue eyes\": 10, \"blonde hair\": 14, \"gloves\": 21, \"jacket\": 4, \"belt\": 13, \"pants\": 10, \"fingerless gloves\": 14, \"crop top\": 4, \"red shirt\": 2, \"fighting stance\": 7, \"baggy pants\": 2, \"sword\": 6, \"scarf\": 2, \"holding weapon\": 7, \"armor\": 6, \"holding sword\": 3, \"helmet\": 5, \"shoulder armor\": 2, \"gauntlets\": 2, \"1other\": 1, \"brown background\": 1, \"pauldrons\": 1, \"breastplate\": 1, \"magic\": 1, \"knight\": 1, \"full armor\": 2, \"helm\": 1, \"large breasts\": 12, \"navel\": 10, \"white hair\": 1, \"twitter username\": 1, \"bra\": 1, \"hair over one eye\": 2, \"strapless\": 2, \"night\": 4, \"cropped jacket\": 2, \"toned\": 3, \"leather\": 1, \"leather jacket\": 1, \"strapless bra\": 1, \"chaps\": 2, \"cowboy boots\": 1, \"smile\": 8, \"bangs\": 3, \"bare shoulders\": 8, \"twintails\": 2, \"blue hair\": 3, \"braid\": 3, \"pink eyes\": 1, \"character name\": 1, \"twin braids\": 1, \"gun\": 3, \"tattoo\": 2, \"blue background\": 2, \"holding gun\": 2, \"rocket launcher\": 1, \"skirt\": 6, \"brown hair\": 9, \"brown eyes\": 3, \"school uniform\": 3, \"serafuku\": 3, \"sailor collar\": 3, \"bag\": 1, \"blue skirt\": 2, \"neckerchief\": 2, \"blue sailor collar\": 2, \"red neckerchief\": 1, \"looking at viewer\": 4, \"thighhighs\": 7, \"hat\": 6, \"cleavage\": 12, \"jewelry\": 7, \"sitting\": 1, \"closed mouth\": 3, \"swimsuit\": 3, \"bikini\": 3, \"earrings\": 3, \"detached sleeves\": 2, \"signature\": 1, \"grey background\": 4, \"cape\": 2, \"high heels\": 7, \"witch hat\": 3, \"thigh boots\": 5, \"staff\": 3, \"gem\": 1, \"high heel boots\": 4, \"holding staff\": 1, \"hand on headwear\": 1, \"witch\": 1, \"purple headwear\": 2, \"purple cape\": 1, \"shirt\": 6, \"shorts\": 10, \"clenched hands\": 2, \"glasses\": 1, \"midriff\": 7, \"short shorts\": 4, \"brown footwear\": 1, \"baseball cap\": 1, \"dual wielding\": 1, \"round eyewear\": 1, \"brown headwear\": 1, \"knee pads\": 1, \"brown shorts\": 1, \"bubble blowing\": 1, \"chewing gum\": 1, \"red hair\": 5, \"abs\": 4, \"sandals\": 3, \"thick eyebrows\": 1, \"pectorals\": 1, \"dress\": 4, \"ribbon\": 3, \"hair ribbon\": 2, \"outdoors\": 6, \"multiple boys\": 3, \"kimono\": 2, \"hair bun\": 3, \"tree\": 1, \"hand on hip\": 6, \"double bun\": 2, \"thick thighs\": 1, \"chinese clothes\": 2, \"cherry blossoms\": 2, \"china dress\": 1, \"pelvic curtain\": 5, \"white shirt\": 2, \"shoes\": 8, \"hood\": 1, \"hoodie\": 1, \"clenched hand\": 2, \"red jacket\": 2, \"red shorts\": 1, \"bow\": 2, \"orange hair\": 2, \"legs\": 1, \"sash\": 1, \"obi\": 1, \"railing\": 1, \"blue kimono\": 1, \"short kimono\": 1, \"architecture\": 1, \"shoulder tattoo\": 1, \"bridge\": 1, \"east asian architecture\": 1, \"yellow sash\": 1, \"animal ears\": 2, \"tail\": 3, \"cat ears\": 2, \"cat tail\": 2, \"cat girl\": 1, \"claws\": 1, \"animal hands\": 1, \"white fur\": 1, \"big hair\": 1, \"fur\": 1, \"collarbone\": 1, \"portrait\": 2, \"open mouth\": 2, \"upper body\": 2, \"sleeveless\": 4, \"vest\": 1, \"high ponytail\": 3, \"blue footwear\": 2, \"black hair\": 5, \"medium breasts\": 1, \"pantyhose\": 1, \"sky\": 4, \"leotard\": 6, \"black pantyhose\": 1, \"moon\": 1, \"full moon\": 1, \"bodystocking\": 1, \"flower\": 1, \"lily pad\": 1, \"lotus\": 1, \"hair bow\": 1, \"yellow skirt\": 1, \"headband\": 3, \"halterneck\": 1, \"muscular female\": 3, \"wings\": 2, \"horns\": 2, \"teeth\": 1, \"chibi\": 1, \"black eyes\": 1, \"crossed arms\": 2, \"letterboxed\": 1, \"spiked hair\": 1, \"wristband\": 4, \"monster\": 1, \"dragon\": 1, \"dougi\": 3, \"huge breasts\": 1, \"aqua hair\": 1, \"short sleeves\": 1, \"pleated skirt\": 2, \"puffy sleeves\": 1, \"puffy short sleeves\": 1, \"red footwear\": 3, \"red gloves\": 2, \"yellow neckerchief\": 1, \"colored skin\": 2, \"6+boys\": 1, \"white leotard\": 1, \"dancing\": 1, \"green skin\": 1, \"crowd\": 1, \"green leotard\": 2, \"closed eyes\": 1, \"red skirt\": 1, \"antenna hair\": 1, \"bike shorts\": 2, \"shorts under skirt\": 1, \"hair pulled back\": 1, \"ringlets\": 1, \"red sailor collar\": 1, \"2boys\": 1, \"water\": 1, \"pool\": 1, \"hair ornament\": 1, \"halo\": 1, \"black shorts\": 1, \"bikini top only\": 1, \"asymmetrical gloves\": 1, \"flame print\": 1, \"barefoot\": 1, \"bald\": 1, \"fire\": 2, \"dog tags\": 1, \"pyrokinesis\": 1, \"purple fire\": 1, \"dark skin\": 3, \"bandages\": 1, \"dark-skinned male\": 1, \"standing on one leg\": 1, \"ankle wrap\": 1, \"red pants\": 2, \"no humans\": 3, \"window\": 1, \"plant\": 1, \"building\": 4, \"scenery\": 3, \"door\": 1, \"house\": 1, \"white pants\": 2, \"purple hair\": 2, \"robot\": 1, \"stairs\": 2, \"candle\": 1, \"torch\": 1, \"black thighhighs\": 1, \"black footwear\": 2, \"collar\": 1, \"bracelet\": 2, \"crown\": 1, \"black leotard\": 1, \"spikes\": 1, \"armlet\": 1, \"strapless leotard\": 1, \"spiked bracelet\": 1, \"spiked collar\": 1, \"super crown\": 1, \"spiked armlet\": 1, \"cosplay\": 1, \"revealing clothes\": 1, \"hand fan\": 1, \"folding fan\": 1, \"choker\": 3, \"mole\": 1, \"from above\": 1, \"sunglasses\": 2, \"lipstick\": 1, \"red headwear\": 1, \"red lips\": 1, \"tinted eyewear\": 1, \"mole above mouth\": 1, \"long sleeves\": 1, \"small breasts\": 1, \"black dress\": 1, \"pink background\": 1, \"side slit\": 1, \"floating\": 1, \"curly hair\": 1, \"rock\": 1, \"telekinesis\": 1, \"levitation\": 1, \"elbow gloves\": 3, \"highleg\": 1, \"blue leotard\": 1, \"day\": 2, \"cloud\": 2, \"blue sky\": 2, \"bird\": 2, \"mole under mouth\": 1, \"blue shorts\": 2, \"arm cannon\": 1, \"power suit (metroid)\": 1, \"black gloves\": 3, \"dark-skinned female\": 2, \"tank top\": 1, \"grey hair\": 1, \"denim\": 2, \"eyewear on head\": 1, \"denim shorts\": 1, \"micro shorts\": 1, \"yellow-framed eyewear\": 1, \"castle\": 1, \"tower\": 1, \"arch\": 1, \"yellow eyes\": 1, \"white dress\": 1, \"monster girl\": 1, \"snake\": 1, \"snake hair\": 1, \"very long hair\": 1, \"absurdly long hair\": 1, \"ass\": 1, \"pointy ears\": 2, \"border\": 1, \"instrument\": 1, \"minigirl\": 1, \"bow (weapon)\": 1, \"fairy wings\": 1, \"riding\": 1, \"fairy\": 1, \"uniform\": 1, \"military\": 1, \"military uniform\": 1, \"green shorts\": 1, \"miniskirt\": 1, \"clothing cutout\": 1, \"cleavage cutout\": 1, \"hair over eyes\": 1, \"glowing\": 1, \"katana\": 1, \"sheath\": 1, \"japanese armor\": 1, \"samurai\": 1, \"kabuto (helmet)\": 1, \"polearm\": 1, \"spear\": 1, \"holding polearm\": 1, \"lance\": 1, \"gold armor\": 1, \"plume\": 1, \"sidelocks\": 1, \"underboob\": 1, \"elf\": 1, \"armored boots\": 1, \"greaves\": 1, \"bikini armor\": 1, \"faulds\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [384, 640], \"count\": 15}, \"1\": {\"resolution\": [448, 576], \"count\": 114}, \"2\": {\"resolution\": [512, 512], \"count\": 42}, \"3\": {\"resolution\": [576, 448], \"count\": 6}, \"4\": {\"resolution\": [640, 384], \"count\": 6}}, \"mean_img_ar_error\": 0.04777782416949694}, \"subsets\": [{\"img_count\": 61, \"num_repeats\": 3, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "20", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0003", + "ss_lowram": "True", + "ss_lr_scheduler": "constant", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "1840", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "32", + "ss_network_dim": "64", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "06bece8e771a9ec16474db4c7d601d2f04fd08d1b1611072e7dd97c18cec3a09", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "92", + "ss_num_epochs": "20", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "CspPixelArt_Style", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "0b1893f6", + "ss_sd_scripts_commit_hash": "e6ad3cbc66130fdc3bf9ecd1e0272969b1d613f7", + "ss_seed": "42", + "ss_session_id": "3121892103", + "ss_steps": "1840", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1689568294.3307602", + "ss_training_started_at": "1689567164.2291677", + "ss_unet_lr": "0.0003", + "ss_v2": "False", + "sshs_legacy_hash": "a023632e", + "sshs_model_hash": "b1e315918dd177f5190150b026738d433e1ce86f23bcbaa287734a4c7daa46fa" +} \ No newline at end of file diff --git a/Styles/36/csppixelart_style-20-85922.txt b/Styles/36/csppixelart_style-20-85922.txt new file mode 100644 index 0000000000000000000000000000000000000000..1d4c30ddf902314eae5d324c39913cd5119e8faa --- /dev/null +++ b/Styles/36/csppixelart_style-20-85922.txt @@ -0,0 +1,288 @@ +Link:https://civitai.com/models/111134/retro-game-cps-ii-pixel-art-style-by-yeiyeiart-comissions-open +Version:v1.0 +Base Model:SD 1.5 +Keywords:PixelArt,pixel,16Bits,31bits +--------DESCRIPTION--------- + +REMEMBER to follow the social networks and ask for your own model. Hello, everyone! This time I bring you something new. It's a unique style that generates amazing images. The style in question is called "Cps2" and it corresponds to the retro aesthetic of games like Street FighterMarvel vs. Capcom, and more. It was commissioned by a client. Use the model with a strength of for the best results. Activate it with the keyword "PixelArt" and accompany it with the following prompts "(Pixel, 16bits, 31bits)" for even better results (optional). Have fun and share your creations with the community. Don't forget to leave a review and inquire about your custom models! :3 +⬇️⬇️⬇️⬇️⬇️⬇️⬇️⬇️ +Don’t forget to check out my other Disney Series Loras on my profile. Currently RapunzelSnow WhiteMeridaCinderellaPocahontasFa MulanElsaAnna, Tianaand Alice in WonderlandArielAuroraJasmineFiona (Sherk), From the Princess Series ;D” Also u have The Bonus Series with: Nani PelekaiLifeguard (lilo & stitch). And Tinker bellJane Porter (Tarzan)Kida (atlantis)ChelJessica Rabbit +Restaurant Series: Ronald McDonaldWendys +Don’t forget to check out my other Disney Series Loras on my profile. YeiYeiArt +Or +THE NEW !! Villain Collection: MaleficentUrsula +⬇️⬇️⬇️⬇️⬇️⬇️⬇️⬇️ +ADVICE“If you want a commission of something in particular, whether it’s a style or a character on request, contact me via emailjeanc.romero.ib@gmail.comor write me by Discord jeangcr +Check my comissions!!: + + +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1girl cheerleader, (PixelArt:1), (blue eyes, skirt, uniform,,makeup, blonde, gloves), curvy, looking at viewer, smile, :D, from below, cute pose, (detailed landscape, school, grass, clouds:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot, (masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2), + Negative Prompt:(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3, + Size:340x512, Sampler:Euler a, Steps:28, CFG:7, Clip Skip:0, Model:control_v11f1p_sd15_depth [cfd03158], Model Hash:5493a0ec49 + +img2: + Prompt:1girl, felicia \(vampire\), cat_paws, blue hair, cat tail,, (PixelArt:1), curvy, looking at viewer, smile, :D, from below, cute pose, (dynamic_angle:1.2), (dynamic_pose:1.2), (masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2), + Negative Prompt:(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3, + Size:512x380, Sampler:Euler a, Steps:28, CFG:7.5, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img3: + Prompt:1girl cheerleader jumping happy, (PixelArt:1), (blue eyes, skirt, uniform,,makeup, blonde, gloves), curvy, looking at viewer, smile, :D, jumping, cute pose, (detailed landscape, school, grass, clouds:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot, (masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2), + Negative Prompt:(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3, + Size:512x512, Sampler:Euler a, Steps:28, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img4: + Prompt:1girl, (PixelArt:1), (blue eyes, mask, domino mask, hat, bodysuit, jester cap, makeup, facepaint, gloves), (makeup), curvy, looking at viewer, evil smile, :D, leaning forward, cute pose, from below, (detailed landscape, festival, lights, paper:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot, (masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2), + Negative Prompt:(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3, + Size:512x512, Sampler:Euler a, Steps:28, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 111134, + "name": "Retro Game (CPS II) Pixel Art -Style- By YeiyeiArt (Comissions Open)", + "description": "

REMEMBER to follow the social networks and ask for your own model. Hello, everyone! This time I bring you something new. It's a unique style that generates amazing images. The style in question is called \"Cps2\" and it corresponds to the retro aesthetic of games like Street Fighter, Marvel vs. Capcom, and more. It was commissioned by a client. Use the model with a strength of <1.0> for the best results. Activate it with the keyword \"PixelArt\" and accompany it with the following prompts \"(Pixel, 16bits, 31bits)\" for even better results (optional). Have fun and share your creations with the community. Don't forget to leave a review and inquire about your custom models! :3

⬇️⬇️⬇️⬇️⬇️⬇️⬇️⬇️

Don’t forget to check out my other Disney Series Loras on my profile. Currently Rapunzel, Snow White, Merida, Cinderella, Pocahontas, Fa Mulan, Elsa, Anna, Tiana and Alice in Wonderland, Ariel, Aurora, Jasmine, Fiona (Sherk), From the Princess Series ;D” Also u have The Bonus Series with: Nani Pelekai, Lifeguard (lilo & stitch). And Tinker bell, Jane Porter (Tarzan), Kida (atlantis), Chel, Jessica Rabbit.

Restaurant Series: Ronald McDonald, Wendys

Don’t forget to check out my other Disney Series Loras on my profile. YeiYeiArt.

Or

THE NEW !! Villain Collection: Maleficent, Ursula.

⬇️⬇️⬇️⬇️⬇️⬇️⬇️⬇️

ADVICE!! “If you want a commission of something in particular, whether it’s a style or a character on request, contact me via email: jeanc.romero.ib@gmail.com or write me by Discord --> jeangcr”

Check my comissions!!:

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 1082, + "favoriteCount": 262, + "commentCount": 6, + "ratingCount": 3, + "rating": 5 + }, + "creator": { + "username": "YeiYeiArt", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a45b8b0f-1d93-4bec-3181-0814e1cb7600/width=96/YeiYeiArt.jpeg" + }, + "tags": [ + "anime", + "sexy", + "female", + "retro", + "style", + "woman", + "furry", + "fantasy", + "game character", + "girls", + "video game", + "characters", + "lora", + "styles" + ], + "modelVersions": [ + { + "id": 119855, + "modelId": 111134, + "name": "v1.0", + "createdAt": "2023-07-17T20:01:17.259Z", + "updatedAt": "2023-07-17T20:03:54.787Z", + "trainedWords": [ + "PixelArt", + "pixel", + "16Bits", + "31bits" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 1082, + "ratingCount": 3, + "rating": 5 + }, + "files": [ + { + "id": 85922, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/131137/model/csppixelartStyle20.tp0A.safetensors", + "sizeKB": 73854.8291015625, + "name": "CspPixelArt_Style-20.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-17T20:05:43.699Z", + "hashes": { + "AutoV1": "93C45AE1", + "AutoV2": "BF25D364E2", + "SHA256": "BF25D364E2E1D535E5D910FC4CB5F3A0F1F56349A29CF4D430D7F100E4F0A88A", + "CRC32": "7C42172A", + "BLAKE3": "EE58E60533B56FCEDD1B8E95A1B9D7CE15BBCD13DE57D9B75F90241E5BFEC0E2" + }, + "downloadUrl": "https://civitai.com/api/download/models/119855", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9697d292-99f3-45eb-b80d-af3889bcd555/width=450/1603044.jpeg", + "nsfw": "None", + "width": 680, + "height": 1024, + "hash": "U8Fh}08wUB2T2?:NIWNi00-:}_sWvkY5o@Qk", + "meta": { + "ENSD": "31337", + "Size": "340x512", + "seed": 1155046478, + "Model": "abyssorangemix3AOM3_aom3a1b", + "model": "control_v11f1p_sd15_depth [cfd03158]", + "steps": 28, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl cheerleader, (PixelArt:1), (blue eyes, skirt, uniform,,makeup, blonde, gloves), curvy, looking at viewer, smile, :D, from below, cute pose, \n(detailed landscape, school, grass, clouds:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot,\n(masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2),\n ", + "weight": "1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "resize mode": "Just Resize", + "control mode": "My prompt is more important", + "\"preprocessor": "depth_zoe", + "Hires upscale": "2", + "pixel perfect": "False", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3,", + "starting/ending": "(0, 0.71)", + "Denoising strength": "0.51", + "preprocessor params": "(512, 64, 64)\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e4640659-884e-4a07-9aa5-066f576cb044/width=450/1603047.jpeg", + "nsfw": "X", + "width": 1024, + "height": 760, + "hash": "UJG*T#_4IQ-20pI_%1D$EfVrR4V?VWJ7XT$f", + "meta": { + "ENSD": "31337", + "Size": "512x380", + "seed": 4213578586, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 28, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, felicia \\(vampire\\), cat_paws, blue hair, cat tail,, (PixelArt:1), curvy, looking at viewer, smile, :D, from below, cute pose, \n (dynamic_angle:1.2), (dynamic_pose:1.2),\n(masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2),\n ", + "sampler": "Euler a", + "cfgScale": 7.5, + "clipSkip": 2, + "resources": [ + { + "name": "feliciaDarkstalkers_feliciaV1", + "type": "lora", + "weight": 0.75 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3,", + "Denoising strength": "0.51" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5cdcc82f-a875-41ae-a60b-4beefae5e923/width=450/1603045.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1024, + "hash": "UTKKWe%gJAb_T0xuNJxu_Mt7t8WBRPoyR+NH", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 852325368, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 28, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl cheerleader jumping happy, (PixelArt:1), (blue eyes, skirt, uniform,,makeup, blonde, gloves), curvy, looking at viewer, smile, :D, jumping, cute pose, \n(detailed landscape, school, grass, clouds:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot,\n(masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2),\n ", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3,", + "Denoising strength": "0.51" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2ee1a4b2-4103-4528-b405-beb0b0739ee9/width=450/1603046.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1024, + "hash": "UIGkRgD,}|oD^sE2%OS74:NHNcM}4p%1RQs:", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 69455910, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 28, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "1girl, (PixelArt:1), (blue eyes, mask, domino mask, hat, bodysuit, jester cap, makeup, facepaint, gloves), (makeup), curvy, looking at viewer, evil smile, :D, leaning forward, cute pose, from below,\n(detailed landscape, festival, lights, paper:1.2), (background:1), (dynamic_angle:1.2), (dynamic_pose:1.2), (rule of third_composition:1.3), (dynamic_perspective:1.2), (dynamic_Line_of_action:1.2), solo, wide shot,\n(masterpiece:1.2), (best quality, highest quality), (ultra detailed), (8k, 4k, intricate),(full-body-shot:1), (Cowboy-shot:1.2), (50mm), (highly detailed:1.2),(detailed face:1.2), detailed_eyes,(gradients),(ambient light:1.3),(cinematic composition:1.3),(HDR:1),Accent Lighting,extremely detailed,original, highres,(perfect_anatomy:1.2),\n ", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality:1.4), (worst quality:1.4), (monochrome:1.1),(bad_prompt_version2:0.8), (bad-hands-5:1.1), badhands1, verybadimagenegative_v1.3,", + "Denoising strength": "0.51" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/119855" + } + ] +} +---------------------------- diff --git a/Styles/369/pumpkinspice-000005-metadata.json b/Styles/369/pumpkinspice-000005-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..756d8cc6d39c1a1122fb1f881108fe34efe1f65a --- /dev/null +++ b/Styles/369/pumpkinspice-000005-metadata.json @@ -0,0 +1,703 @@ +{ + "ss_sd_model_name": "model.ckpt", + "ss_resolution": "(1280, 1280)", + "ss_clip_skip": "2", + "ss_num_train_images": "1472", + "ss_tag_frequency": { + "16_pumpkinspice": { + "hetero": 80, + "loli": 78, + "penis": 76, + "open mouth": 76, + "long hair": 73, + "uncensored": 72, + "blush": 58, + "1girl": 56, + "1boy": 54, + "blonde hair": 51, + "cum": 50, + "pussy": 49, + "nude": 46, + "nipples": 45, + "blue eyes": 44, + "tongue": 44, + "looking at viewer": 40, + "flat chest": 39, + "solo focus": 38, + "white hair": 37, + "group sex": 36, + "lying": 36, + "multiple girls": 36, + "bangs": 36, + "cum in pussy": 35, + "thighhighs": 35, + "navel": 34, + "erection": 33, + "tongue out": 33, + "2girls": 31, + "spread legs": 30, + "symbol-shaped pupils": 30, + "underwear": 28, + "sex": 27, + "on back": 27, + "cum in mouth": 27, + "ass": 26, + "heart": 26, + "le malin \\(azur lane\\)": 26, + "multiple boys": 25, + "facial": 25, + "hair bun": 25, + "+_+": 25, + "vaginal": 24, + "panties": 24, + "animal ears": 23, + "multiple penises": 23, + "heart-shaped pupils": 22, + "cum on body": 21, + "double bun": 20, + "cum on hair": 19, + "cum on tongue": 18, + "fellatio": 18, + "oral": 18, + "striped": 18, + "anus": 18, + "bare shoulders": 17, + "small breasts": 16, + "red eyes": 16, + "after vaginal": 16, + "after sex": 16, + "short hair": 16, + "green eyes": 16, + "smile": 16, + "pantyhose": 16, + "vertical stripes": 16, + "breasts": 15, + "cumdrip": 15, + "bukkake": 15, + "barefoot": 15, + "2boys": 14, + "twintails": 14, + "hat": 14, + "blue hair": 14, + "saliva": 14, + "large penis": 14, + "braid": 14, + "bow": 13, + "threesome": 13, + "hair ornament": 13, + "multicolored hair": 13, + "veiny penis": 13, + "simple background": 13, + "black hair": 12, + "white panties": 12, + "testicles": 12, + "completely nude": 12, + "purple eyes": 12, + "very long hair": 11, + "hair between eyes": 11, + "dress": 11, + "hair bow": 11, + "animal ear fluff": 11, + "gloves": 11, + "multiple views": 11, + "orgy": 11, + "halo": 10, + "collar": 10, + "leotard": 9, + "clothed female nude male": 9, + "flower": 9, + "teeth": 9, + "ribbon": 9, + "swimsuit": 9, + "veins": 9, + "fake animal ears": 8, + "closed eyes": 8, + "thighs": 8, + "dark skin": 8, + "one eye closed": 8, + "bikini": 8, + "hair ribbon": 8, + "torn clothes": 8, + "brown eyes": 8, + "ffm threesome": 8, + "cooperative fellatio": 8, + "licking penis": 8, + "gangbang": 8, + "sitting": 8, + "tutu": 8, + "single hair bun": 8, + "dark-skinned female": 7, + "tiger ears": 7, + ":q": 7, + "4boys": 7, + "licking": 7, + "twin braids": 7, + "standing": 7, + "white gloves": 7, + "horse penis": 7, + "animal penis": 7, + "white background": 7, + "solo": 7, + "clothing aside": 6, + "cum in ass": 6, + "overflow": 6, + "hair flower": 6, + "sidelocks": 6, + "rolling eyes": 6, + "ejaculation": 6, + "censored": 6, + "sweat": 6, + "tears": 6, + "fur trim": 6, + "black thighhighs": 6, + "cat ears": 6, + "cum on penis": 6, + "hairband": 6, + "official alternate costume": 6, + "cum on clothes": 6, + "see-through": 6, + "gaping": 6, + "bestiality": 6, + "white dress": 6, + "pointy ears": 6, + "collarbone": 6, + "rabbit ears": 5, + "3girls": 5, + "pink hair": 5, + "illyasviel von einzbern": 5, + "bra": 5, + "stomach bulge": 5, + "shun \\(blue archive\\)": 5, + "licking lips": 5, + "black panties": 5, + "asphyxiation": 5, + "strangling": 5, + "on side": 5, + "tail": 5, + "micro bikini": 5, + "tiger girl": 5, + "siblings": 5, + "blunt bangs": 5, + "revealing clothes": 5, + "clothes lift": 5, + "brown hair": 5, + "ahegao": 5, + "mmf threesome": 5, + "covered nipples": 5, + "after anal": 5, + "iris \\(pokemon\\)": 5, + "huge penis": 5, + "purple hair": 5, + "soles": 5, + "gradient hair": 5, + "penis on face": 5, + "boots": 5, + "armpits": 5, + "upper body": 5, + "aris \\(blue archive\\)": 4, + "playboy bunny": 4, + "leotard aside": 4, + "anal": 4, + "wrist cuffs": 4, + "grey hair": 4, + "size difference": 4, + "erune": 4, + "twins": 4, + "bell": 4, + "split": 4, + "standing split": 4, + "standing on one leg": 4, + "pussy juice": 4, + "v": 4, + "big hair": 4, + "penis awe": 4, + "bottomless": 4, + "pokephilia": 4, + "horse": 4, + "feet": 4, + "green hair": 4, + "leash": 4, + "yellow eyes": 4, + "bridal garter": 4, + "sun hat": 4, + "hat flower": 4, + "purple bow": 4, + "brown footwear": 4, + "water": 4, + "wet": 4, + "choker": 4, + "striped thighhighs": 4, + "doggystyle": 3, + "cum on stomach": 3, + "missionary": 3, + "3boys": 3, + "masturbation": 3, + "black dress": 3, + "streaked hair": 3, + "pov": 3, + "chinese clothes": 3, + "jacket": 3, + "trembling": 3, + "bed sheet": 3, + "fur collar": 3, + "mash kyrielight \\(dangerous beast\\)": 3, + "mash kyrielight \\(dangerous beast\\) \\(cosplay\\)": 3, + "fur-trimmed gloves": 3, + "fur-trimmed legwear": 3, + "elbow gloves": 3, + "mash kyrielight": 3, + "black gloves": 3, + "jingle bell": 3, + "cosplay": 3, + "lace-trimmed legwear": 3, + "wolf ears": 3, + "hair bell": 3, + "lace trim": 3, + "midori \\(blue archive\\)": 3, + "momoi \\(blue archive\\)": 3, + "headphones": 3, + "animal ear headphones": 3, + "cat ear headphones": 3, + "sisters": 3, + "socks": 3, + "le malin \\(listless lapin\\) \\(azur lane\\)": 3, + "spoken heart": 3, + "back": 3, + "imminent penetration": 3, + "cleft of venus": 3, + "dawn \\(pokemon\\)": 3, + "two side up": 3, + "detached collar": 3, + "finger in another's mouth": 3, + "hair over one eye": 3, + "nahida \\(genshin impact\\)": 3, + "cum in container": 3, + "side ponytail": 3, + "diona \\(genshin impact\\)": 3, + "pince-nez": 3, + "cat girl": 3, + "sunglasses": 3, + "white bikini": 3, + "white headwear": 3, + "elf": 3, + "wading": 3, + "wet clothes": 3, + "jewelry": 3, + "earrings": 3, + "black background": 3, + "covered eyes": 3, + "black leotard": 2, + "bowtie": 2, + "clothed sex": 2, + "miyu edelfelt": 2, + "chloe von einzbern": 2, + "veil": 2, + "white bra": 2, + "hairclip": 2, + "male masturbation": 2, + "mouse ears": 2, + "used condom": 2, + "antenna hair": 2, + "heart hair ornament": 2, + "sheet grab": 2, + "food": 2, + "condom": 2, + "holding": 2, + "white jacket": 2, + "age difference": 2, + "drooling": 2, + "doughnut": 2, + "long sleeves": 2, + "o-ring": 2, + "pink ribbon": 2, + "pink bikini": 2, + "green bikini": 2, + "bikini lift": 2, + "rabbit tail": 2, + "torso grab": 2, + "short sleeves": 2, + "china dress": 2, + "spread pussy": 2, + "arm support": 2, + "mosaic censoring": 2, + "on stomach": 2, + "looking back": 2, + "uniform": 2, + "covered navel": 2, + "leg lift": 2, + "military": 2, + "military uniform": 2, + "flexible": 2, + "imminent vaginal": 2, + "guided penetration": 2, + "panties around one leg": 2, + "female masturbation": 2, + "kissing penis": 2, + "fingering": 2, + "just the tip": 2, + "tan": 2, + "penis grab": 2, + "hair rings": 2, + "dress lift": 2, + "clitoris": 2, + "pokemon \\(creature\\)": 2, + "all fours": 2, + "akagi miria": 2, + "wristband": 2, + "andira \\(granblue fantasy\\)": 2, + "monkey ears": 2, + "monkey tail": 2, + "one-piece swimsuit": 2, + "green one-piece swimsuit": 2, + "precum": 2, + "looking at penis": 2, + "blue background": 2, + "black bra": 2, + "bowl": 2, + "cat tail": 2, + "looking over eyewear": 2, + "side-tie bikini bottom": 2, + "black headwear": 2, + "male pubic hair": 2, + "thighlet": 2, + "pubic hair": 2, + "partially submerged": 2, + "shirt": 2, + "after fellatio": 2, + "from behind": 2, + "ringed eyes": 2, + "sleeveless": 2, + "height difference": 2, + "thigh strap": 2, + "no humans": 2, + "gokkun": 2, + "from side": 2, + "purple headwear": 2, + "bikini top only": 2, + "sex from behind": 1, + "chair": 1, + "black footwear": 1, + "one side up": 1, + "panties aside": 1, + "cum on ass": 1, + "white thighhighs": 1, + "black bikini": 1, + "untied": 1, + "swept bangs": 1, + "hand on another's neck": 1, + "grabbing another's hair": 1, + "motion lines": 1, + "torogao": 1, + "muscular": 1, + "tsurime": 1, + "parted bangs": 1, + "topless": 1, + "vest": 1, + "upper teeth only": 1, + "saliva trail": 1, + "speech bubble": 1, + "eyelashes": 1, + "paw gloves": 1, + "animal hands": 1, + "tiger tail": 1, + "tiger stripes": 1, + "paw shoes": 1, + "hachikuji mayoi": 1, + "green ribbon": 1, + "cum string": 1, + "white hairband": 1, + "panty pull": 1, + "leaning back": 1, + "pulled by self": 1, + "rainbow hair": 1, + "pink footwear": 1, + "marker": 1, + "thigh sex": 1, + "cum on legs": 1, + "swimsuit aside": 1, + "casual one-piece swimsuit": 1, + "bucket": 1, + "bar censor": 1, + "tinted eyewear": 1, + "frilled bikini": 1, + "frills": 1, + "blindfold": 1, + "gag": 1, + "fishnets": 1, + "ball gag": 1, + "yellow sleeves": 1, + "double penetration": 1, + "fishnet thighhighs": 1, + "single thighhigh": 1, + "gagged": 1, + "fur-trimmed sleeves": 1, + "armlet": 1, + "lily pad": 1, + "outdoors": 1, + "wariza": 1, + "looking up": 1, + "close-up": 1, + "lower body": 1, + "stomach": 1, + "holding food": 1, + "walkie-talkie": 1, + "necktie": 1, + "pink eyes": 1, + "blue necktie": 1, + "scrunchie": 1, + "orange eyes": 1, + "white leotard": 1, + "neck bell": 1, + "camisole": 1, + "back focus": 1, + "sleep molestation": 1, + "sleeping": 1, + "virtual youtuber": 1, + "no panties": 1, + "sleeveless dress": 1, + "on bed": 1, + "mouth pull": 1, + "phone": 1, + "head grab": 1, + "black bowtie": 1, + "black bow": 1, + "side braid": 1, + "highleg": 1, + "white flower": 1, + "sex toy": 1, + "vibrator": 1, + "yusa kozue": 1, + "object insertion": 1, + "ahoge": 1, + "pink bow": 1, + "closed mouth": 1, + "spoon": 1, + "dark-skinned male": 1, + "half-closed eyes": 1, + "covering crotch": 1, + "detached sleeves": 1, + "see-through sleeves": 1, + "sailor collar": 1, + "pink collar": 1, + "fang": 1, + "neckerchief": 1, + "anchor symbol": 1, + "yuri": 1, + "bangs pinned back": 1, + "animal collar": 1, + "vertical-striped thighhighs": 1, + "arm up": 1, + "cross-section": 1, + "internal cumshot": 1, + "uterus": 1, + "lifted by self": 1, + "leg up": 1, + "witch hat": 1, + "wedgie": 1, + "toes": 1, + "partially visible vulva": 1, + "ribs": 1, + "spread anus": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_batch_size_per_device": "2", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 832, + 1536 + ], + "count": 16 + }, + "1": { + "resolution": [ + 896, + 1536 + ], + "count": 32 + }, + "2": { + "resolution": [ + 960, + 1536 + ], + "count": 16 + }, + "3": { + "resolution": [ + 1024, + 1536 + ], + "count": 64 + }, + "4": { + "resolution": [ + 1088, + 1472 + ], + "count": 240 + }, + "5": { + "resolution": [ + 1152, + 1408 + ], + "count": 48 + }, + "6": { + "resolution": [ + 1216, + 1344 + ], + "count": 64 + }, + "7": { + "resolution": [ + 1280, + 1280 + ], + "count": 64 + }, + "8": { + "resolution": [ + 1344, + 1216 + ], + "count": 48 + }, + "9": { + "resolution": [ + 1408, + 1152 + ], + "count": 48 + }, + "10": { + "resolution": [ + 1472, + 1088 + ], + "count": 368 + }, + "11": { + "resolution": [ + 1536, + 576 + ], + "count": 16 + }, + "12": { + "resolution": [ + 1536, + 704 + ], + "count": 48 + }, + "13": { + "resolution": [ + 1536, + 768 + ], + "count": 48 + }, + "14": { + "resolution": [ + 1536, + 832 + ], + "count": 32 + }, + "15": { + "resolution": [ + 1536, + 896 + ], + "count": 16 + }, + "16": { + "resolution": [ + 1536, + 960 + ], + "count": 16 + }, + "17": { + "resolution": [ + 1536, + 1024 + ], + "count": 288 + } + }, + "mean_img_ar_error": 0.029644524454581257 + }, + "ss_bucket_no_upscale": "False", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "16_pumpkinspice": { + "n_repeats": 16, + "img_count": 92 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "5", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "0", + "ss_learning_rate": "7e-05", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_bucket_reso": "1536", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "255", + "ss_max_train_steps": "7360", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "5", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "6", + "ss_network_alpha": "8", + "ss_network_args": { + "conv_dim": "4", + "conv_alpha": "1", + "dropout": "0", + "algo": "loha" + }, + "ss_network_dim": "16", + "ss_network_module": "lycoris.kohya", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "736", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "lion_pytorch.lion_pytorch.Lion", + "ss_output_name": "pumpkinspice", + "ss_prior_loss_weight": "1", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "925997e9", + "ss_sd_scripts_commit_hash": "16e5981d3153ba02c34445089b998c5002a60abc", + "ss_seed": "1337", + "ss_session_id": "1424395527", + "ss_shuffle_caption": "True", + "ss_steps": "3680", + "ss_text_encoder_lr": "8e-06", + "ss_total_batch_size": "2", + "ss_training_comment": "None", + "ss_training_finished_at": "1686954104.7546453", + "ss_training_started_at": "1686937594.6649566", + "ss_unet_lr": "7e-05", + "ss_v2": "False", + "sshs_legacy_hash": "91f7657e", + "sshs_model_hash": "c9d3979bfb2f25fb931e4a599c2bfe7f74c661f8319747b3d540f5fc72577fa9" +} \ No newline at end of file diff --git a/Styles/37/dagasi fluffyrock-metadata.json b/Styles/37/dagasi fluffyrock-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..466b796b460a0cfdb4feafc465ee0ff9dec82638 --- /dev/null +++ b/Styles/37/dagasi fluffyrock-metadata.json @@ -0,0 +1,1234 @@ +{ + "ss_sd_model_name": "fluffyrockE17YSMod_v31.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "2925", + "ss_tag_frequency": { + "train_data": { + "dagasi": 195, + "hi res": 195, + "blush": 172, + "bodily fluids": 172, + "mammal": 168, + "female": 160, + "anthro": 151, + "genital fluids": 141, + "male": 133, + "genitals": 130, + "fur": 128, + "young": 103, + "digital media (artwork)": 102, + "sex": 101, + "duo": 99, + "male/female": 99, + "tears": 99, + "cum": 95, + "clothing": 92, + "pussy juice": 88, + "sweat": 88, + "penis": 87, + "cum inside": 86, + "pussy": 84, + "tail": 83, + "looking pleasured": 80, + "penetration": 80, + "nintendo": 77, + "human": 76, + "hair": 74, + "tongue": 73, + "leaking cum": 73, + "solo focus": 69, + "open mouth": 69, + "clothed": 67, + "male penetrating": 67, + "orgasm": 66, + "butt": 65, + "interspecies": 61, + "anus": 61, + "penile": 60, + "cub": 60, + "cum in pussy": 60, + "female penetrated": 58, + "canid": 58, + "canine": 58, + "spreading": 57, + "male penetrating female": 56, + "tongue out": 56, + "vaginal": 55, + "pokemon": 54, + "pokemon (species)": 54, + "cum from pussy": 53, + "first person view": 52, + "loli": 50, + "saliva": 50, + "breasts": 49, + "group": 48, + "spread legs": 48, + "vaginal penetration": 47, + "dripping": 45, + "faceless character": 43, + "penile penetration": 43, + "text": 41, + "anthro penetrated": 41, + "male penetrating anthro": 41, + "cum drip": 41, + "fucked silly": 41, + "<3": 41, + "felid": 40, + "shaking": 40, + "humanoid genitalia": 38, + "erection": 38, + "anal": 37, + "size difference": 37, + "narrowed eyes": 37, + "big penis": 37, + "faceless male": 36, + "balls": 34, + "fingers": 33, + "ambiguous gender": 33, + "humanoid penis": 33, + "brown body": 31, + "oral": 31, + "plump labia": 31, + "trembling": 31, + "lagomorph": 31, + "brown fur": 30, + "looking at viewer": 30, + "underwear": 29, + "anal penetration": 28, + "from behind position": 28, + "feral": 28, + "kemono": 27, + "generation 4 pokemon": 27, + "human penetrating": 27, + "pokephilia": 27, + "ejaculation": 27, + "eyebrows": 27, + "cum in ass": 27, + "drooling": 27, + "crying": 27, + "human penetrating female": 25, + "penis in pussy": 25, + "holding partner": 25, + "black body": 25, + "human on anthro": 24, + "orgasm face": 24, + "long ears": 24, + "cum in mouth": 23, + "female on human": 23, + "forced": 23, + "lying": 23, + "rear view": 23, + "female focus": 23, + "foreskin": 23, + "nude": 22, + "from front position": 22, + "nipple outline": 22, + "partially clothed": 22, + "cum from ass": 22, + "leporid": 22, + "humanoid": 22, + "feline": 21, + "grey body": 21, + "fox": 21, + "biped": 21, + "white body": 21, + "ahegao": 20, + "nipples": 20, + "cum overflow": 20, + "<3 eyes": 20, + "fellatio": 19, + "oral penetration": 19, + "on back": 19, + "shota": 19, + "tears of pleasure": 19, + "balls deep": 19, + "blue eyes": 19, + "cub penetrated": 18, + "cum from mouth": 18, + "cum on face": 18, + "grey fur": 18, + "pantherine": 18, + "male/male": 18, + "livestream": 18, + "english text": 17, + "teeth": 17, + "group sex": 17, + "male pov": 17, + "after sex": 17, + "bottomwear": 17, + "navel": 17, + "panties": 17, + "rabbit": 17, + "eeveelution": 17, + "quadruped": 17, + "generation 9 pokemon": 17, + "black fur": 17, + "blue hair": 16, + "anal juice": 16, + "big balls": 16, + "penis in ass": 16, + "feral girl": 16, + "larger male": 16, + "smaller female": 16, + "machine": 16, + "vein": 16, + "veiny penis": 16, + "age difference": 16, + "tight fit": 16, + "animal crossing": 15, + "domestic cat": 15, + "felis": 15, + "japanese text": 15, + "yellow body": 15, + "human penetrating anthro": 15, + "double penetration": 15, + "stretched pussy": 15, + "thick thighs": 15, + "bestiality": 15, + "human on feral": 15, + "meowscarada": 15, + "robot": 15, + "made in abyss": 15, + "narehate": 15, + "white hair": 15, + "markings": 14, + "small breasts": 14, + "brand new animal": 14, + "michiru kagemori": 14, + "motion lines": 14, + "studio trigger": 14, + "animal genitalia": 14, + "blush lines": 14, + "feral penetrated": 14, + "male humanoid": 14, + "solo": 14, + "sweatdrop": 14, + "nanachi": 14, + "holding object": 13, + "tail markings": 13, + "smile": 13, + "big butt": 13, + "raccoon dog": 13, + "rape": 13, + "tanuki": 13, + "topwear": 13, + "raised tail": 13, + "animal penis": 13, + "seductive": 13, + "changed (video game)": 13, + "goo creature": 13, + "lin (changed)": 13, + "puro (changed)": 13, + "regu": 13, + "ankha (animal crossing)": 12, + "yellow fur": 12, + "pussy ejaculation": 12, + "prostitution": 12, + "looking back": 12, + "disney": 12, + "judy hopps": 12, + "zootopia": 12, + "bent over": 12, + "excessive genital fluids": 12, + "cum splatter": 12, + "big breasts": 12, + "faceless human": 12, + "precum": 12, + "licking": 12, + "bedroom eyes": 12, + "green eyes": 12, + "eyes closed": 12, + "small but hung": 12, + "simple background": 12, + "ring (marking)": 11, + "ringtail": 11, + "time stop": 11, + "fingering": 11, + "missionary position": 11, + "shorts": 11, + "tuft": 11, + "anthro on anthro": 11, + "human penetrating feral": 11, + "white fur": 11, + "partially retracted foreskin": 11, + "cum string": 11, + "lopunny": 10, + "medium breasts": 10, + "orange body": 10, + "under boob": 10, + "countershading": 10, + "through wall": 10, + "torn clothing": 10, + "uniform": 10, + "imminent sex": 10, + "male on feral": 10, + "excessive cum": 10, + "spiral eyes": 10, + "cum while penetrated": 10, + "male penetrated": 10, + "yellow eyes": 10, + "generation 1 pokemon": 10, + "dominant": 10, + "snow leopard": 10, + "yuki (dagasi)": 10, + "sitting": 9, + "momo (dagasi)": 9, + "penetrating pov": 9, + "pink hair": 9, + "spread pussy": 9, + "lucario": 9, + "bikini": 9, + "forced prostitution": 9, + "orange fur": 9, + "swimwear": 9, + "trio": 9, + "inner ear fluff": 9, + "honkai: star rail": 9, + "mihoyo": 9, + "pom-pom (honkai: star rail)": 9, + "television": 9, + "canine genitalia": 9, + "canine penis": 9, + "knot": 9, + "glans": 9, + "questionable consent": 9, + "translation request": 9, + "eyelashes": 9, + "happy": 9, + "anal orgasm": 9, + "larger human": 9, + "smaller feral": 9, + "eye roll": 9, + "glaceon": 9, + "thick penis": 9, + "mask": 9, + "anal fingering": 8, + "cinderace": 8, + "generation 8 pokemon": 8, + "black clothing": 8, + "kohaku (dagasi)": 8, + "sex box": 8, + "tiger": 8, + "detailed background": 8, + "anthro penetrating": 8, + "police officer": 8, + "police uniform": 8, + "policewoman": 8, + "protective gear": 8, + "red eyes": 8, + "pupils": 8, + "doggystyle": 8, + "glistening": 8, + "glistening body": 8, + "animal humanoid": 8, + "cephalopod": 8, + "cephalopod humanoid": 8, + "inkling": 8, + "marine": 8, + "marine humanoid": 8, + "mollusk": 8, + "mollusk humanoid": 8, + "splatoon": 8, + "cum from nose": 8, + "cum in nose": 8, + "outside": 8, + "dominant male": 8, + "sexual abuse": 8, + "sexual harassment": 8, + "older male": 8, + "cum on penis": 8, + "leafeon": 8, + "uncensored": 7, + "deep throat": 7, + "penis in mouth": 7, + "micro bikini": 7, + "bound": 7, + "canis": 7, + "nick wilde": 7, + "red fox": 7, + "anthro penetrating anthro": 7, + "camera": 7, + "monitor": 7, + "screen": 7, + "torn panties": 7, + "torn underwear": 7, + "green body": 7, + "green fur": 7, + "huge penis": 7, + "looking at genitalia": 7, + "looking at penis": 7, + "hand on butt": 7, + "food": 7, + "headgear": 7, + "pink eyes": 7, + "808 (hi-fi rush)": 7, + "half-closed eyes": 7, + "hi-fi rush": 7, + "pawpads": 7, + "amy rose": 7, + "cream the rabbit": 7, + "eulipotyphlan": 7, + "hedgehog": 7, + "miles prower": 7, + "sega": 7, + "sonic the hedgehog (series)": 7, + "clitoris": 7, + "villager (animal crossing)": 7, + "pussy ejaculation while penetrated": 7, + "male penetrating male": 7, + "generation 3 pokemon": 7, + "abuse": 7, + "on top": 7, + "smaller penetrated": 7, + "chat": 7, + "generation 6 pokemon": 7, + "underwear down": 7, + "younger female": 7, + "book": 6, + "dress": 6, + "question mark": 6, + "restrained": 6, + "female/ambiguous": 6, + "flat chested": 6, + "female anthro": 6, + "furniture": 6, + "shirt": 6, + "perineum": 6, + "pivoted ears": 6, + "presenting": 6, + "presenting hindquarters": 6, + "caelus (honkai: star rail)": 6, + "covering": 6, + "bovid": 6, + "caprine": 6, + "cum on body": 6, + "toriel": 6, + "undertale": 6, + "undertale (series)": 6, + "circumcised": 6, + "dessert": 6, + "penis lick": 6, + "hat": 6, + "headwear": 6, + "chai (hi-fi rush)": 6, + "feet": 6, + "plant": 6, + "toes": 6, + "imminent rape": 6, + "cum on leg": 6, + "straddling": 6, + "camel toe": 6, + "feral focus": 6, + "grey clothing": 6, + "grey ears": 6, + "grey hair": 6, + "grey topwear": 6, + "fingering partner": 5, + "saliva string": 5, + "threesome": 5, + "gaping": 5, + "gaping pussy": 5, + "torogao": 5, + "blep": 5, + "pants": 5, + "human pov": 5, + "scared": 5, + "cum on clothing": 5, + "deep penetration": 5, + "ears down": 5, + "cum on butt": 5, + "purple eyes": 5, + "areola": 5, + "bottomless": 5, + "frisk (undertale)": 5, + "fangs": 5, + "holding head": 5, + "squish": 5, + "butt grab": 5, + "gloves": 5, + "handwear": 5, + "legwear": 5, + "after vaginal": 5, + "tagme": 5, + "fish": 5, + "inkling girl": 5, + "salmonid (splatoon)": 5, + "hands-free": 5, + "smaller male": 5, + "countershade torso": 5, + "grass": 5, + "on bottom": 5, + "bed": 5, + "long penis": 5, + "tail grab": 5, + "hoopa": 5, + "legendary pokemon": 5, + "portal amputation": 5, + "portal ring": 5, + "cum on breasts": 5, + "black bottomwear": 5, + "black shorts": 5, + "blue body": 5, + "translated": 4, + "love ball": 4, + "pokeball": 4, + "thumb in ass": 4, + "spitroast": 4, + "collaborative": 4, + "collaborative fellatio": 4, + "collaborative sex": 4, + "hand on head": 4, + "ambiguous penetration": 4, + "front view": 4, + "multicolored body": 4, + "multicolored fur": 4, + "backsack": 4, + "bottomwear down": 4, + "pants down": 4, + "ambiguous pov": 4, + "clenched teeth": 4, + "cunnilingus": 4, + "wolf": 4, + "covering face": 4, + "cum in clothing": 4, + "cum in panties": 4, + "cum in pants": 4, + "cum on panties": 4, + "equid": 4, + "equine": 4, + "equine genitalia": 4, + "equine penis": 4, + "scut tail": 4, + "short tail": 4, + "faceless female": 4, + "leg grab": 4, + "spiral pupils": 4, + "floppy ears": 4, + "horn": 4, + "pasties": 4, + "ice cream": 4, + "bat": 4, + "rouge the bat": 4, + "cute fangs": 4, + "snot": 4, + "younger male": 4, + "after anal": 4, + "prosthetic": 4, + "prosthetic arm": 4, + "prosthetic limb": 4, + "horizontal pupils": 4, + "phone": 4, + "tan body": 4, + "simultaneous orgasms": 4, + "younger penetrated": 4, + "penis base": 4, + "penis grab": 4, + "gardevoir": 4, + "eevee": 4, + "transformation": 4, + "portal": 4, + "simulated amputation": 4, + "thinking with portals": 4, + "hypnosis": 4, + "mind control": 4, + "paws": 4, + "soles": 4, + "undressing": 4, + "looking back at viewer": 4, + "romantic": 4, + "pulling clothing": 4, + "clock": 3, + "holding book": 3, + "stopwatch": 3, + "watch": 3, + "irrumatio": 3, + "arm grab": 3, + "blue bottomwear": 3, + "blue clothing": 3, + "blue shorts": 3, + "clothed/nude": 3, + "clothed female nude male": 3, + "clothing aside": 3, + "gangbang": 3, + "grey penis": 3, + "jacket": 3, + "multicolored clothing": 3, + "nipple fetish": 3, + "nipple play": 3, + "red clothing": 3, + "red jacket": 3, + "red topwear": 3, + "two tone clothing": 3, + "white clothing": 3, + "white shirt": 3, + "white topwear": 3, + "countershade fur": 3, + "domestic dog": 3, + "perro-kun": 3, + "take your pick": 3, + "reverse forced oral": 3, + "puffy anus": 3, + "generation 2 pokemon": 3, + "breast play": 3, + "mature anthro": 3, + "mature female": 3, + "pink areola": 3, + "pink nipples": 3, + "hand on leg": 3, + "bdsm": 3, + "bdsm gear": 3, + "predator penetrating prey": 3, + "penis awe": 3, + "shirt collar": 3, + "2 tails": 3, + "foursome": 3, + "multi tail": 3, + "wide hips": 3, + "streaming": 3, + "after vaginal penetration": 3, + "cum drool": 3, + "after oral": 3, + "child": 3, + "looking at another": 3, + "excessive sweat": 3, + "internal": 3, + "prostate stimulation": 3, + "urethra": 3, + "cum on balls": 3, + "marie itami": 3, + "teenager": 3, + "leaking precum": 3, + "kirlia": 3, + "sandwich position": 3, + "cellphone": 3, + "all fours": 3, + "tan fur": 3, + "cumming together": 3, + "after rape": 3, + "saliva on penis": 3, + "age regression": 3, + "aged down": 3, + "baggy clothing": 3, + "blonde hair": 3, + "pink pussy": 3, + "hand on tail": 3, + "abdominal bulge": 3, + "hoopa (confined)": 3, + "footwear": 3, + "breast squish": 3, + "pink body": 3, + "legs up": 3, + "vaginal fingering": 3, + "rimming": 3, + "on model": 3, + "spread anus": 3, + "male penetrating feral": 3, + "goo transformation": 3, + "precum drip": 3, + "transformation sequence": 3, + "duo focus": 3, + "tight clothing": 3, + "female on top": 3, + "cum on back": 3, + "toe curl": 3, + "cumshot": 3, + "buneary": 2, + "cum inflation": 2, + "inflation": 2, + "athletic": 2, + "athletic anthro": 2, + "athletic female": 2, + "black shirt": 2, + "black topwear": 2, + "bottomwear aside": 2, + "crotch lines": 2, + "mmf threesome": 2, + "motion blur": 2, + "multicolored shirt": 2, + "multicolored topwear": 2, + "nipple pinch": 2, + "panties aside": 2, + "pinch": 2, + "raised clothing": 2, + "raised shirt": 2, + "raised topwear": 2, + "shorts aside": 2, + "two tone body": 2, + "two tone fur": 2, + "two tone shirt": 2, + "two tone topwear": 2, + "underwear aside": 2, + "countershade tail": 2, + "deer": 2, + "eyebrow through hair": 2, + "fluffy": 2, + "fluffy tail": 2, + "hair over eyes": 2, + "sex education": 2, + "translucent": 2, + "translucent hair": 2, + "tongue in pussy": 2, + "holding tail": 2, + "espeon": 2, + "purple body": 2, + "breast suck": 2, + "face fucking": 2, + "head grab": 2, + "sucking": 2, + "claws": 2, + "finger claws": 2, + "oblivious": 2, + "4 fingers": 2, + "contraption concept": 2, + "exclamation point": 2, + "glory box": 2, + "glory hole": 2, + "glory hole station": 2, + "constricted pupils": 2, + "hip grab": 2, + "knotting": 2, + "small pupils": 2, + "breast grab": 2, + "hand on breast": 2, + "petting head": 2, + "arched back": 2, + "restrained arms": 2, + "behind another": 2, + "embarrassed": 2, + "pussy juice on penis": 2, + "skinny": 2, + "small waist": 2, + "kneeling": 2, + "light body": 2, + "pawmi": 2, + "cum on tongue": 2, + "cum on feet": 2, + "assisted exposure": 2, + "humanoid pointy ears": 2, + "bondage": 2, + "machine bondage": 2, + "warning": 2, + "pussy juice string": 2, + "ear blush": 2, + "retracted foreskin": 2, + "mink": 2, + "mustelid": 2, + "musteline": 2, + "true musteline": 2, + "nervous": 2, + "direction lines": 2, + "blackmail": 2, + "holding cellphone": 2, + "holding phone": 2, + "holding smartphone": 2, + "smartphone": 2, + "it'll never fit": 2, + "sleeping": 2, + "sans (undertale)": 2, + "ass up": 2, + "ejaculating while penetrated": 2, + "emanata": 2, + "overstimulation": 2, + "after fellatio": 2, + "sweaty butt": 2, + "grin": 2, + "ralts": 2, + "mostly clothed": 2, + "mostly clothed female": 2, + "braided hair": 2, + "crossdressing": 2, + "inkling boy": 2, + "school uniform": 2, + "anthro focus": 2, + "heart pasties": 2, + "thigh highs": 2, + "drooling tongue": 2, + "hand on hip": 2, + "breasts frottage": 2, + "hypnotic eyes": 2, + "skimpy": 2, + "flareon": 2, + "jolteon": 2, + "red sclera": 2, + "sylveon": 2, + "umbreon": 2, + "vaporeon": 2, + "imminent oral": 2, + "tan glans": 2, + "penis between hands": 2, + "pikachu": 2, + "orange eyes": 2, + "pseudo hair": 2, + "black tail": 2, + "lap dance position": 2, + "restrained legs": 2, + "pillow": 2, + "mating press": 2, + "holding leg": 2, + "male raping female": 2, + "moan": 2, + "spread butt": 2, + "blue fur": 2, + "female rimming male": 2, + "oral sandwich": 2, + "side view": 2, + "black nose": 2, + "dipstick tail": 2, + "floragato": 2, + "sprigatito": 2, + "wet": 2, + "wet clothing": 2, + "cum on head": 2, + "white skin": 2, + "feral on feral": 2, + "feral penetrating": 2, + "feral penetrating feral": 2, + "cum pool": 2, + "cum pooling": 2, + "brown hair": 2, + "bulge": 2, + "human to anthro": 2, + "spandex": 2, + "species transformation": 2, + "tight bottomwear": 2, + "tail motion": 2, + "tailwag": 2, + "cum in hair": 2, + "cum on tail": 2, + "presenting anus": 2, + "big ears": 2, + "eating": 2, + "eating food": 2, + "after kiss": 2, + "disembodied hand": 1, + "throat swabbing": 1, + "pov hands": 1, + "collarbone": 1, + "forced oral": 1, + "on table": 1, + "over table": 1, + "table": 1, + "ventral groove": 1, + "wrist grab": 1, + "ball size difference": 1, + "cervine": 1, + "chalkboard": 1, + "chital": 1, + "girly": 1, + "tail tuft": 1, + "empty eyes": 1, + "imminent orgasm": 1, + "male fingering female": 1, + "cum on belly": 1, + "cum on neck": 1, + "lesser dog": 1, + "thigh grab": 1, + "imminent fellatio": 1, + "male on anthro": 1, + "shaded": 1, + "?!": 1, + "owo": 1, + "restraints": 1, + "sequence": 1, + "x anus": 1, + "anal juice string": 1, + "butt squish": 1, + "hot dogging": 1, + "surprised expression": 1, + "exposed breasts": 1, + "grinding on penis": 1, + "penis between thighs": 1, + "penis on pussy": 1, + "shocked expression": 1, + "cub penetrating": 1, + "tremble spikes": 1, + "3 fingers": 1, + "3 toes": 1, + "air puff": 1, + "belly tuft": 1, + "bite": 1, + "cheek spots": 1, + "diamond (marking)": 1, + "elemental creature": 1, + "facial markings": 1, + "flora fauna": 1, + "flower (anatomy)": 1, + "gloves (marking)": 1, + "head markings": 1, + "light fur": 1, + "neck bite": 1, + "scruff bite": 1, + "steam": 1, + "all three filled": 1, + "medial ring": 1, + "facial blush": 1, + "happy sex": 1, + "anamniotic egg": 1, + "cum on egg": 1, + "egg": 1, + "nude female": 1, + "oviposition": 1, + "looking at partner": 1, + "colored": 1, + "colorful": 1, + "dialogue": 1, + "dialogue box": 1, + "digital drawing (artwork)": 1, + "encasement": 1, + "fucking machine": 1, + "header": 1, + "header box": 1, + "highlighted text": 1, + "key": 1, + "keyring": 1, + "number": 1, + "text box": 1, + "text emphasis": 1, + "tom nook (animal crossing)": 1, + "zero pictured": 1, + "after orgasm": 1, + "half-erect": 1, + "pull out": 1, + "imminent kiss": 1, + "bubble": 1, + "suds": 1, + "vulpix": 1, + "4 toes": 1, + "animated skeleton": 1, + "annoying dog (undertale)": 1, + "bone": 1, + "skeleton": 1, + "undead": 1, + "larger on top": 1, + "leapfrog position": 1, + "light countershading": 1, + "age transformation": 1, + "looking at self": 1, + "shrinking": 1, + "size transformation": 1, + "butt slap": 1, + "looking back at another": 1, + "slap": 1, + "spanking": 1, + "voyeur": 1, + "breath": 1, + "covering crotch": 1, + "ink": 1, + "looking up skirt": 1, + "partially submerged": 1, + "trapped": 1, + "featureless crotch": 1, + "ear pull": 1, + "stockings": 1, + "looking away": 1, + "charizard": 1, + "dragon": 1, + "scalie": 1, + "faceless ambiguous": 1, + "deep anal": 1, + "black bikini": 1, + "black swimwear": 1, + "2:1": 1, + "all nine eeveelutions": 1, + "on bed": 1, + "on side": 1, + "red body": 1, + "big dom small sub": 1, + "grey balls": 1, + "open clothing": 1, + "open jacket": 1, + "open topwear": 1, + "pinned": 1, + "three-quarter view": 1, + "breast lick": 1, + "spank marks": 1, + "bottomless female": 1, + "censor bar": 1, + "censored": 1, + "clothing lift": 1, + "lol comments": 1, + "bouncing breasts": 1, + "frown": 1, + "fully restrained": 1, + "green bottomwear": 1, + "green clothing": 1, + "green shorts": 1, + "multicolored bottomwear": 1, + "multicolored shorts": 1, + "two tone bottomwear": 1, + "two tone shorts": 1, + "detailed food": 1, + "fence": 1, + "ketchup": 1, + "mayonnaise": 1, + "picnic blanket": 1, + "plate": 1, + "sandwich (food)": 1, + "orange hair": 1, + "skirt": 1, + "standing": 1, + "leaking": 1, + "pussy juice leaking": 1, + "landline phone": 1, + "looking at porn": 1, + "pornography": 1, + "ruined reputation": 1, + "tail in mouth": 1, + "clothed anthro": 1, + "clothed female": 1, + "kissing": 1, + "kissing pov": 1, + "holding waist": 1, + "recording": 1, + "hand on shoulders": 1, + "butt focus": 1, + "forced exposure": 1, + "forced undressing": 1, + "livestreaming": 1, + "yellow clothing": 1, + "yellow panties": 1, + "yellow underwear": 1, + "bed sheet": 1, + "bedding": 1, + "bedding background": 1, + "bedroom sex": 1, + "grabbing sheets": 1, + "large penetration": 1, + "vaginal tugging": 1, + "blue skin": 1, + "fin": 1, + "frill (anatomy)": 1, + "head fin": 1, + "membrane (anatomy)": 1, + "membranous frill": 1, + "neck frill": 1, + "tail fin": 1, + "thick tail": 1, + "vaginal orgasm": 1, + "niko (oneshot)": 1, + "oneshot": 1, + "plantigrade": 1, + "cum covered": 1, + "messy": 1, + "condom": 1, + "condom in mouth": 1, + "object in mouth": 1, + "sexual barrier device": 1, + "side boob": 1, + "after transformation": 1, + "expansion": 1, + "genital expansion": 1, + "penis expansion": 1, + "precum squirt": 1, + "ffm": 1, + "ffm threesome": 1, + "slim": 1, + "classroom": 1, + "school": 1, + "armor": 1, + "chick montblanc": 1, + "cyberconnect2": 1, + "fuga: melodies of steel": 1, + "helmet": 1, + "little tail bronx": 1, + "mei marzipan": 1, + "ponytail (hair)": 1, + "scarf": 1, + "shocked face": 1, + "tentacle sex": 1, + "tentacles": 1, + "amputee": 1, + "disability": 1, + "evolutionary family": 1, + "quadruple amputee": 1, + "foreskin pull": 1, + "glistening skin": 1, + "handjob": 1, + "holding penis": 1, + "pink anus": 1, + "pussy juice drip": 1, + "saliva on tongue": 1, + "face in pillow": 1, + "grabbing pillow": 1, + "holding butt": 1, + "on front": 1, + "quadruple amputee portal": 1, + "ejaculation while penetrated": 1, + "forced orgasm": 1, + "mounting": 1, + "male/ambiguous": 1, + "penis on face": 1, + "1 eye": 1, + "cyclops": 1, + "female/female": 1, + "pakkoyan": 1, + "pink fur": 1, + "red hair": 1, + "vueko": 1, + "becoming erect": 1, + "erection under clothing": 1, + "genital outline": 1, + "mid transformation": 1, + "penis outline": 1, + "precum through clothing": 1, + "tenting": 1, + "cowgirl position": 1, + "dominant female": 1, + "nipple lick": 1, + "submissive": 1, + "submissive male": 1, + "aroused": 1, + "paper": 1, + "smiling at viewer": 1, + "frottage": 1, + "penis size difference": 1, + "thigh sex": 1, + "black eyes": 1, + "delayed reaction": 1, + "orgasm delay": 1, + "forced transformation": 1, + "topless": 1, + "topless male": 1, + "white pupils": 1, + "after anal penetration": 1, + "body blush": 1, + "butt blush": 1, + "clitoral hood": 1, + "presenting cream pie": 1, + "presenting pussy": 1, + "tan anus": 1, + "tan pussy": 1, + "yellow anus": 1, + "yellow pussy": 1, + "licking lips": 1, + "parallel sex": 1, + "greyscale": 1, + "informative": 1, + "instructions": 1, + "monochrome": 1, + "phone number": 1, + "sign": 1, + "wheels": 1, + "big knot": 1, + "embrace": 1, + "hug": 1, + "riolu": 1, + "low-angle view": 1, + "worm's-eye view": 1, + "male on bottom": 1, + "alcohol": 1, + "asian clothing": 1, + "beverage": 1, + "boss monster": 1, + "bow (feature)": 1, + "bow in front": 1, + "bow tie": 1, + "costume": 1, + "curvy figure": 1, + "east asian clothing": 1, + "grillby": 1, + "heart maebari": 1, + "japanese clothing": 1, + "maebari": 1, + "reverse bunny costume": 1, + "temmie (undertale)": 1, + "voluptuous": 1, + "wine": 1, + "wine bottle": 1, + "nelle (puzzle and dragons)": 1, + "puzzle and dragons": 1, + "saliva drip": 1, + "saliva on face": 1, + "chest tuft": 1, + "molosser": 1, + "mountain dog": 1, + "saint bernard": 1, + "black ears": 1, + "black sclera": 1, + "fur tuft": 1, + "head tuft": 1, + "thrusting": 1, + "human on humanoid": 1, + "drooling cum": 1, + "panties down": 1, + "cum covered penis": 1, + "human on robot": 1, + "petting": 1, + "bent spoon position": 1, + "dildo": 1, + "lucky pierre": 1, + "object in ass": 1, + "pegging": 1, + "reverse missionary position": 1, + "sex toy": 1, + "sex toy in ass": 1, + "sex toy insertion": 1, + "sex toy penetration": 1, + "strapon": 1, + "toying partner": 1, + "adult male": 1, + "adult on cub": 1, + "female cub": 1, + "rough sex": 1, + "holding arms": 1, + "white countershading": 1, + "star eyes": 1, + "<3 pupils": 1, + "collar": 1, + "masturbation": 1, + "penile masturbation": 1, + "white tail": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "train_data": { + "n_repeats": 15, + "img_count": 195 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 6, \"num_train_images\": 2925, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"train_data\": {\"animal crossing\": 15, \"ankha (animal crossing)\": 12, \"anthro\": 151, \"blue hair\": 16, \"blush\": 172, \"book\": 6, \"clock\": 3, \"clothed\": 67, \"clothing\": 92, \"dagasi\": 195, \"digital media (artwork)\": 102, \"disembodied hand\": 1, \"domestic cat\": 15, \"dress\": 6, \"duo\": 99, \"english text\": 17, \"felid\": 40, \"feline\": 21, \"felis\": 15, \"female\": 160, \"first person view\": 52, \"fur\": 128, \"hair\": 74, \"hi res\": 195, \"holding book\": 3, \"holding object\": 13, \"japanese text\": 15, \"kemono\": 27, \"mammal\": 168, \"markings\": 14, \"nintendo\": 77, \"question mark\": 6, \"ring (marking)\": 11, \"ringtail\": 11, \"sitting\": 9, \"solo focus\": 69, \"stopwatch\": 3, \"tail\": 83, \"tail markings\": 13, \"text\": 41, \"time stop\": 11, \"translated\": 4, \"watch\": 3, \"yellow body\": 15, \"yellow fur\": 12, \"ahegao\": 20, \"anal\": 37, \"anal fingering\": 8, \"anal juice\": 16, \"anal penetration\": 28, \"anthro penetrated\": 41, \"bodily fluids\": 172, \"brown body\": 31, \"brown fur\": 30, \"buneary\": 2, \"butt\": 65, \"cub penetrated\": 18, \"faceless character\": 43, \"faceless male\": 36, \"female penetrated\": 58, \"fingering\": 11, \"fingering partner\": 5, \"generation 4 pokemon\": 27, \"genital fluids\": 141, \"genitals\": 130, \"human\": 76, \"human on anthro\": 24, \"human penetrating\": 27, \"human penetrating anthro\": 15, \"human penetrating female\": 25, \"interspecies\": 61, \"loli\": 50, \"looking pleasured\": 80, \"lopunny\": 10, \"love ball\": 4, \"male\": 133, \"male/female\": 99, \"male penetrating\": 67, \"male penetrating anthro\": 41, \"male penetrating female\": 56, \"open mouth\": 69, \"penetration\": 80, \"penile\": 60, \"penile penetration\": 43, \"penis\": 87, \"penis in pussy\": 25, \"pokeball\": 4, \"pokemon\": 54, \"pokemon (species)\": 54, \"pokephilia\": 27, \"pussy\": 84, \"pussy juice\": 88, \"saliva\": 50, \"saliva string\": 5, \"sex\": 101, \"smile\": 13, \"sweat\": 88, \"teeth\": 17, \"thumb in ass\": 4, \"tongue\": 73, \"tongue out\": 56, \"uncensored\": 7, \"vaginal\": 55, \"vaginal penetration\": 47, \"young\": 103, \"canid\": 58, \"canine\": 58, \"cub\": 60, \"cum\": 95, \"cum from mouth\": 18, \"cum from pussy\": 53, \"cum in mouth\": 23, \"cum in pussy\": 60, \"cum inflation\": 2, \"cum inside\": 86, \"deep throat\": 7, \"double penetration\": 15, \"fellatio\": 19, \"fingers\": 33, \"group\": 48, \"group sex\": 17, \"inflation\": 2, \"irrumatio\": 3, \"leaking cum\": 73, \"male pov\": 17, \"momo (dagasi)\": 9, \"nipples\": 20, \"nude\": 22, \"oral\": 31, \"oral penetration\": 19, \"orgasm\": 66, \"penetrating pov\": 9, \"penis in mouth\": 7, \"pink hair\": 9, \"restrained\": 6, \"spitroast\": 4, \"threesome\": 5, \"throat swabbing\": 1, \"after sex\": 17, \"ambiguous gender\": 33, \"anus\": 61, \"big butt\": 13, \"breasts\": 49, \"cum drip\": 41, \"cum overflow\": 20, \"dripping\": 45, \"ejaculation\": 27, \"female/ambiguous\": 6, \"flat chested\": 6, \"fucked silly\": 41, \"gaping\": 5, \"gaping pussy\": 5, \"holding partner\": 25, \"orgasm face\": 24, \"plump labia\": 31, \"pov hands\": 1, \"pussy ejaculation\": 12, \"shaking\": 40, \"small breasts\": 14, \"spread legs\": 48, \"spread pussy\": 9, \"spreading\": 57, \"stretched pussy\": 15, \"thick thighs\": 15, \"torogao\": 5, \"trembling\": 31, \"cinderace\": 8, \"collaborative\": 4, \"collaborative fellatio\": 4, \"collaborative sex\": 4, \"cum on face\": 18, \"female anthro\": 6, \"female on human\": 23, \"forced\": 23, \"generation 8 pokemon\": 8, \"hand on head\": 4, \"lucario\": 9, \"tears\": 99, \"ambiguous penetration\": 4, \"arm grab\": 3, \"athletic\": 2, \"athletic anthro\": 2, \"athletic female\": 2, \"bikini\": 9, \"black clothing\": 8, \"black shirt\": 2, \"black topwear\": 2, \"blue bottomwear\": 3, \"blue clothing\": 3, \"blue shorts\": 3, \"bottomwear\": 17, \"bottomwear aside\": 2, \"brand new animal\": 14, \"clothed/nude\": 3, \"clothed female nude male\": 3, \"clothing aside\": 3, \"collarbone\": 1, \"crotch lines\": 2, \"forced oral\": 1, \"forced prostitution\": 9, \"from front position\": 22, \"front view\": 4, \"furniture\": 6, \"gangbang\": 3, \"grey body\": 21, \"grey fur\": 18, \"grey penis\": 3, \"jacket\": 3, \"lying\": 23, \"medium breasts\": 10, \"michiru kagemori\": 14, \"micro bikini\": 7, \"missionary position\": 11, \"mmf threesome\": 2, \"motion blur\": 2, \"motion lines\": 14, \"multicolored body\": 4, \"multicolored clothing\": 3, \"multicolored fur\": 4, \"multicolored shirt\": 2, \"multicolored topwear\": 2, \"navel\": 17, \"nipple fetish\": 3, \"nipple outline\": 22, \"nipple pinch\": 2, \"nipple play\": 3, \"on back\": 19, \"on table\": 1, \"orange body\": 10, \"orange fur\": 9, \"over table\": 1, \"panties\": 17, \"panties aside\": 2, \"partially clothed\": 22, \"pinch\": 2, \"prostitution\": 12, \"raccoon dog\": 13, \"raised clothing\": 2, \"raised shirt\": 2, \"raised topwear\": 2, \"rape\": 13, \"red clothing\": 3, \"red jacket\": 3, \"red topwear\": 3, \"shirt\": 6, \"shorts\": 11, \"shorts aside\": 2, \"studio trigger\": 14, \"swimwear\": 9, \"table\": 1, \"tanuki\": 13, \"topwear\": 13, \"trio\": 9, \"two tone body\": 2, \"two tone clothing\": 3, \"two tone fur\": 2, \"two tone shirt\": 2, \"two tone topwear\": 2, \"under boob\": 10, \"underwear\": 29, \"underwear aside\": 2, \"ventral groove\": 1, \"white clothing\": 3, \"white shirt\": 3, \"white topwear\": 3, \"wrist grab\": 1, \"blep\": 5, \"bound\": 7, \"kohaku (dagasi)\": 8, \"pantherine\": 18, \"sex box\": 8, \"tiger\": 8, \"backsack\": 4, \"ball size difference\": 1, \"balls\": 34, \"big balls\": 16, \"bottomwear down\": 4, \"canis\": 7, \"cervine\": 1, \"chalkboard\": 1, \"chital\": 1, \"countershade fur\": 3, \"countershade tail\": 2, \"countershading\": 10, \"deer\": 2, \"detailed background\": 8, \"domestic dog\": 3, \"eyebrow through hair\": 2, \"eyebrows\": 27, \"fluffy\": 2, \"fluffy tail\": 2, \"fox\": 21, \"girly\": 1, \"hair over eyes\": 2, \"humanoid genitalia\": 38, \"inner ear fluff\": 9, \"looking at viewer\": 30, \"looking back\": 12, \"male/male\": 18, \"pants\": 5, \"pants down\": 4, \"perineum\": 6, \"perro-kun\": 3, \"pivoted ears\": 6, \"presenting\": 6, \"presenting hindquarters\": 6, \"raised tail\": 13, \"rear view\": 23, \"sex education\": 2, \"shota\": 19, \"tail tuft\": 1, \"take your pick\": 3, \"translucent\": 2, \"translucent hair\": 2, \"tuft\": 11, \"caelus (honkai: star rail)\": 6, \"cum from ass\": 22, \"cum in ass\": 27, \"honkai: star rail\": 9, \"human pov\": 5, \"mihoyo\": 9, \"penis in ass\": 16, \"pom-pom (honkai: star rail)\": 9, \"ambiguous pov\": 4, \"disney\": 12, \"judy hopps\": 12, \"lagomorph\": 31, \"leporid\": 22, \"long ears\": 24, \"nick wilde\": 7, \"rabbit\": 17, \"red fox\": 7, \"through wall\": 10, \"torn clothing\": 10, \"zootopia\": 12, \"clenched teeth\": 4, \"cunnilingus\": 4, \"empty eyes\": 1, \"imminent orgasm\": 1, \"reverse forced oral\": 3, \"scared\": 5, \"tongue in pussy\": 2, \"wolf\": 4, \"animal genitalia\": 14, \"animal penis\": 13, \"anthro on anthro\": 11, \"anthro penetrating\": 8, \"anthro penetrating anthro\": 7, \"bent over\": 12, \"blush lines\": 14, \"camera\": 7, \"covering\": 6, \"covering face\": 4, \"cum in clothing\": 4, \"cum in panties\": 4, \"cum in pants\": 4, \"cum on clothing\": 5, \"cum on panties\": 4, \"deep penetration\": 5, \"ears down\": 5, \"equid\": 4, \"equine\": 4, \"equine genitalia\": 4, \"equine penis\": 4, \"excessive genital fluids\": 12, \"female focus\": 23, \"from behind position\": 28, \"holding tail\": 2, \"livestream\": 18, \"male fingering female\": 1, \"monitor\": 7, \"police officer\": 8, \"police uniform\": 8, \"policewoman\": 8, \"protective gear\": 8, \"puffy anus\": 3, \"screen\": 7, \"scut tail\": 4, \"short tail\": 4, \"size difference\": 37, \"tears of pleasure\": 19, \"television\": 9, \"torn panties\": 7, \"torn underwear\": 7, \"uniform\": 10, \"bestiality\": 15, \"biped\": 21, \"cum on butt\": 5, \"cum splatter\": 12, \"eeveelution\": 17, \"erection\": 38, \"espeon\": 2, \"feral\": 28, \"feral girl\": 16, \"feral penetrated\": 14, \"generation 2 pokemon\": 3, \"human on feral\": 15, \"human penetrating feral\": 11, \"male humanoid\": 14, \"narrowed eyes\": 37, \"purple body\": 2, \"purple eyes\": 5, \"quadruped\": 17, \"areola\": 5, \"big breasts\": 12, \"bottomless\": 5, \"bovid\": 6, \"breast play\": 3, \"breast suck\": 2, \"canine genitalia\": 9, \"canine penis\": 9, \"caprine\": 6, \"cum on belly\": 1, \"cum on body\": 6, \"cum on neck\": 1, \"face fucking\": 2, \"faceless female\": 4, \"faceless human\": 12, \"frisk (undertale)\": 5, \"head grab\": 2, \"knot\": 9, \"leg grab\": 4, \"lesser dog\": 1, \"mature anthro\": 3, \"mature female\": 3, \"pink areola\": 3, \"pink nipples\": 3, \"sucking\": 2, \"thigh grab\": 1, \"toriel\": 6, \"undertale\": 6, \"undertale (series)\": 6, \"big penis\": 37, \"circumcised\": 6, \"claws\": 2, \"fangs\": 5, \"finger claws\": 2, \"generation 9 pokemon\": 17, \"glans\": 9, \"green body\": 7, \"green fur\": 7, \"hand on leg\": 3, \"holding head\": 5, \"huge penis\": 7, \"humanoid penis\": 33, \"imminent fellatio\": 1, \"larger male\": 16, \"looking at genitalia\": 7, \"looking at penis\": 7, \"male on anthro\": 1, \"meowscarada\": 15, \"oblivious\": 2, \"precum\": 12, \"red eyes\": 8, \"shaded\": 1, \"smaller female\": 16, \"4 fingers\": 2, \"questionable consent\": 9, \"?!\": 1, \"bdsm\": 3, \"bdsm gear\": 3, \"contraption concept\": 2, \"exclamation point\": 2, \"glory box\": 2, \"glory hole\": 2, \"glory hole station\": 2, \"owo\": 1, \"restraints\": 1, \"sequence\": 1, \"solo\": 14, \"translation request\": 9, \"x anus\": 1, \"anal juice string\": 1, \"constricted pupils\": 2, \"drooling\": 27, \"hand on butt\": 7, \"hip grab\": 2, \"knotting\": 2, \"predator penetrating prey\": 3, \"pupils\": 8, \"small pupils\": 2, \"spiral pupils\": 4, \"squish\": 5, \"breast grab\": 2, \"eyelashes\": 9, \"floppy ears\": 4, \"foreskin\": 23, \"hand on breast\": 2, \"horn\": 4, \"pasties\": 4, \"penis awe\": 3, \"shirt collar\": 3, \"white body\": 21, \"white fur\": 11, \"dessert\": 6, \"food\": 7, \"happy\": 9, \"ice cream\": 4, \"licking\": 12, \"penis lick\": 6, \"petting head\": 2, \"hat\": 6, \"headgear\": 7, \"headwear\": 6, \"arched back\": 2, \"restrained arms\": 2, \"butt grab\": 5, \"butt squish\": 1, \"hot dogging\": 1, \"imminent sex\": 10, \"surprised expression\": 1, \"behind another\": 2, \"embarrassed\": 2, \"exposed breasts\": 1, \"grinding on penis\": 1, \"penis between thighs\": 1, \"penis on pussy\": 1, \"pink eyes\": 7, \"pussy juice on penis\": 2, \"shocked expression\": 1, \"808 (hi-fi rush)\": 7, \"<3\": 41, \"black body\": 25, \"chai (hi-fi rush)\": 6, \"half-closed eyes\": 7, \"hi-fi rush\": 7, \"machine\": 16, \"male on feral\": 10, \"pawpads\": 7, \"robot\": 15, \"2 tails\": 3, \"<3 eyes\": 20, \"amy rose\": 7, \"balls deep\": 19, \"bat\": 4, \"bedroom eyes\": 12, \"cream the rabbit\": 7, \"cub penetrating\": 1, \"doggystyle\": 8, \"eulipotyphlan\": 7, \"foursome\": 3, \"gloves\": 5, \"green eyes\": 12, \"handwear\": 5, \"hedgehog\": 7, \"miles prower\": 7, \"multi tail\": 3, \"rouge the bat\": 4, \"seductive\": 13, \"sega\": 7, \"skinny\": 2, \"small waist\": 2, \"sonic the hedgehog (series)\": 7, \"tremble spikes\": 1, \"wide hips\": 3, \"3 fingers\": 1, \"3 toes\": 1, \"air puff\": 1, \"belly tuft\": 1, \"bite\": 1, \"cheek spots\": 1, \"crying\": 27, \"cute fangs\": 4, \"diamond (marking)\": 1, \"elemental creature\": 1, \"eyes closed\": 12, \"facial markings\": 1, \"feet\": 6, \"flora fauna\": 1, \"flower (anatomy)\": 1, \"gloves (marking)\": 1, \"head markings\": 1, \"kneeling\": 2, \"light body\": 2, \"light fur\": 1, \"neck bite\": 1, \"pawmi\": 2, \"plant\": 6, \"scruff bite\": 1, \"steam\": 1, \"sweatdrop\": 14, \"toes\": 6, \"imminent rape\": 6, \"legwear\": 5, \"all three filled\": 1, \"cum on tongue\": 2, \"streaming\": 3, \"after vaginal\": 5, \"after vaginal penetration\": 3, \"cum drool\": 3, \"cum on feet\": 2, \"excessive cum\": 10, \"medial ring\": 1, \"vein\": 16, \"veiny penis\": 16, \"after oral\": 3, \"black fur\": 17, \"blue eyes\": 19, \"changed (video game)\": 13, \"glistening\": 8, \"glistening body\": 8, \"goo creature\": 13, \"lin (changed)\": 13, \"puro (changed)\": 13, \"spiral eyes\": 10, \"tagme\": 5, \"assisted exposure\": 2, \"clitoris\": 7, \"facial blush\": 1, \"villager (animal crossing)\": 7, \"happy sex\": 1, \"pussy ejaculation while penetrated\": 7, \"anamniotic egg\": 1, \"animal humanoid\": 8, \"cephalopod\": 8, \"cephalopod humanoid\": 8, \"child\": 3, \"cum on egg\": 1, \"egg\": 1, \"fish\": 5, \"humanoid\": 22, \"humanoid pointy ears\": 2, \"inkling\": 8, \"inkling girl\": 5, \"marine\": 8, \"marine humanoid\": 8, \"mollusk\": 8, \"mollusk humanoid\": 8, \"nude female\": 1, \"oviposition\": 1, \"salmonid (splatoon)\": 5, \"splatoon\": 8, \"cum from nose\": 8, \"cum in nose\": 8, \"looking at another\": 3, \"looking at partner\": 1, \"snot\": 4, \"bondage\": 2, \"colored\": 1, \"colorful\": 1, \"dialogue\": 1, \"dialogue box\": 1, \"digital drawing (artwork)\": 1, \"encasement\": 1, \"fucking machine\": 1, \"header\": 1, \"header box\": 1, \"highlighted text\": 1, \"key\": 1, \"keyring\": 1, \"machine bondage\": 2, \"number\": 1, \"text box\": 1, \"text emphasis\": 1, \"tom nook (animal crossing)\": 1, \"warning\": 2, \"zero pictured\": 1, \"age difference\": 16, \"anal orgasm\": 9, \"cum while penetrated\": 10, \"excessive sweat\": 3, \"hands-free\": 5, \"internal\": 3, \"male penetrated\": 10, \"male penetrating male\": 7, \"partially retracted foreskin\": 11, \"prostate stimulation\": 3, \"small but hung\": 12, \"smaller male\": 5, \"younger male\": 4, \"pussy juice string\": 2, \"urethra\": 3, \"after anal\": 4, \"after orgasm\": 1, \"cum on balls\": 3, \"cum on leg\": 6, \"ear blush\": 2, \"half-erect\": 1, \"pull out\": 1, \"retracted foreskin\": 2, \"marie itami\": 3, \"mink\": 2, \"mustelid\": 2, \"musteline\": 2, \"teenager\": 3, \"true musteline\": 2, \"larger human\": 9, \"leaking precum\": 3, \"nervous\": 2, \"prosthetic\": 4, \"prosthetic arm\": 4, \"prosthetic limb\": 4, \"smaller feral\": 9, \"countershade torso\": 5, \"horizontal pupils\": 4, \"imminent kiss\": 1, \"made in abyss\": 15, \"nanachi\": 14, \"narehate\": 15, \"regu\": 13, \"white hair\": 15, \"yellow eyes\": 10, \"bubble\": 1, \"generation 3 pokemon\": 7, \"grass\": 5, \"kirlia\": 3, \"outside\": 8, \"suds\": 1, \"cum string\": 11, \"direction lines\": 2, \"eye roll\": 9, \"generation 1 pokemon\": 10, \"glaceon\": 9, \"sandwich position\": 3, \"simple background\": 12, \"straddling\": 6, \"tight fit\": 16, \"vulpix\": 1, \"abuse\": 7, \"blackmail\": 2, \"cellphone\": 3, \"dominant\": 10, \"dominant male\": 8, \"holding cellphone\": 2, \"holding phone\": 2, \"holding smartphone\": 2, \"phone\": 4, \"sexual abuse\": 8, \"sexual harassment\": 8, \"smartphone\": 2, \"snow leopard\": 10, \"yuki (dagasi)\": 10, \"it'll never fit\": 2, \"sleeping\": 2, \"4 toes\": 1, \"all fours\": 3, \"animated skeleton\": 1, \"annoying dog (undertale)\": 1, \"bone\": 1, \"sans (undertale)\": 2, \"skeleton\": 1, \"tan body\": 4, \"tan fur\": 3, \"undead\": 1, \"ass up\": 2, \"cumming together\": 3, \"ejaculating while penetrated\": 2, \"emanata\": 2, \"larger on top\": 1, \"leapfrog position\": 1, \"light countershading\": 1, \"older male\": 8, \"on bottom\": 5, \"on top\": 7, \"simultaneous orgasms\": 4, \"smaller penetrated\": 7, \"younger penetrated\": 4, \"camel toe\": 6, \"overstimulation\": 2, \"bed\": 5, \"after rape\": 3, \"chat\": 7, \"after fellatio\": 2, \"cum on penis\": 8, \"penis base\": 4, \"long penis\": 5, \"penis grab\": 4, \"saliva on penis\": 3, \"thick penis\": 9, \"tail grab\": 5, \"sweaty butt\": 2, \"gardevoir\": 4, \"generation 6 pokemon\": 7, \"grin\": 2, \"hoopa\": 5, \"legendary pokemon\": 5, \"portal amputation\": 5, \"portal ring\": 5, \"ralts\": 2, \"eevee\": 4, \"feral focus\": 6, \"age regression\": 3, \"age transformation\": 1, \"aged down\": 3, \"baggy clothing\": 3, \"looking at self\": 1, \"shrinking\": 1, \"size transformation\": 1, \"transformation\": 4, \"butt slap\": 1, \"looking back at another\": 1, \"mostly clothed\": 2, \"mostly clothed female\": 2, \"slap\": 1, \"spanking\": 1, \"voyeur\": 1, \"blonde hair\": 3, \"braided hair\": 2, \"breath\": 1, \"covering crotch\": 1, \"crossdressing\": 2, \"ink\": 1, \"inkling boy\": 2, \"looking up skirt\": 1, \"partially submerged\": 1, \"school uniform\": 2, \"trapped\": 1, \"featureless crotch\": 1, \"anthro focus\": 2, \"ear pull\": 1, \"pink pussy\": 3, \"cum on breasts\": 5, \"heart pasties\": 2, \"stockings\": 1, \"thigh highs\": 2, \"black bottomwear\": 5, \"black shorts\": 5, \"grey clothing\": 6, \"grey ears\": 6, \"grey hair\": 6, \"grey topwear\": 6, \"hand on tail\": 3, \"looking away\": 1, \"abdominal bulge\": 3, \"charizard\": 1, \"dragon\": 1, \"hoopa (confined)\": 3, \"portal\": 4, \"scalie\": 1, \"simulated amputation\": 4, \"thinking with portals\": 4, \"footwear\": 3, \"faceless ambiguous\": 1, \"deep anal\": 1, \"drooling tongue\": 2, \"hand on hip\": 2, \"black bikini\": 1, \"black swimwear\": 1, \"blue body\": 5, \"breast squish\": 3, \"breasts frottage\": 2, \"hypnosis\": 4, \"hypnotic eyes\": 2, \"mind control\": 4, \"skimpy\": 2, \"2:1\": 1, \"all nine eeveelutions\": 1, \"flareon\": 2, \"jolteon\": 2, \"leafeon\": 8, \"on bed\": 1, \"on side\": 1, \"paws\": 4, \"pink body\": 3, \"red body\": 1, \"red sclera\": 2, \"soles\": 4, \"sylveon\": 2, \"umbreon\": 2, \"vaporeon\": 2, \"big dom small sub\": 1, \"grey balls\": 1, \"imminent oral\": 2, \"open clothing\": 1, \"open jacket\": 1, \"open topwear\": 1, \"pinned\": 1, \"tan glans\": 2, \"three-quarter view\": 1, \"breast lick\": 1, \"spank marks\": 1, \"bottomless female\": 1, \"censor bar\": 1, \"censored\": 1, \"clothing lift\": 1, \"lol comments\": 1, \"undressing\": 4, \"penis between hands\": 2, \"bouncing breasts\": 1, \"frown\": 1, \"fully restrained\": 1, \"green bottomwear\": 1, \"green clothing\": 1, \"green shorts\": 1, \"multicolored bottomwear\": 1, \"multicolored shorts\": 1, \"two tone bottomwear\": 1, \"two tone shorts\": 1, \"detailed food\": 1, \"fence\": 1, \"ketchup\": 1, \"mayonnaise\": 1, \"picnic blanket\": 1, \"pikachu\": 2, \"plate\": 1, \"sandwich (food)\": 1, \"orange hair\": 1, \"skirt\": 1, \"standing\": 1, \"legs up\": 3, \"vaginal fingering\": 3, \"looking back at viewer\": 4, \"leaking\": 1, \"pussy juice leaking\": 1, \"landline phone\": 1, \"looking at porn\": 1, \"pornography\": 1, \"ruined reputation\": 1, \"tail in mouth\": 1, \"rimming\": 3, \"orange eyes\": 2, \"pseudo hair\": 2, \"clothed anthro\": 1, \"clothed female\": 1, \"black tail\": 2, \"lap dance position\": 2, \"romantic\": 4, \"kissing\": 1, \"kissing pov\": 1, \"pulling clothing\": 4, \"restrained legs\": 2, \"underwear down\": 7, \"younger female\": 7, \"holding waist\": 1, \"pillow\": 2, \"recording\": 1, \"hand on shoulders\": 1, \"butt focus\": 1, \"mating press\": 2, \"forced exposure\": 1, \"forced undressing\": 1, \"livestreaming\": 1, \"yellow clothing\": 1, \"yellow panties\": 1, \"yellow underwear\": 1, \"holding leg\": 2, \"male raping female\": 2, \"bed sheet\": 1, \"bedding\": 1, \"bedding background\": 1, \"bedroom sex\": 1, \"grabbing sheets\": 1, \"large penetration\": 1, \"moan\": 2, \"vaginal tugging\": 1, \"blue skin\": 1, \"fin\": 1, \"frill (anatomy)\": 1, \"head fin\": 1, \"membrane (anatomy)\": 1, \"membranous frill\": 1, \"neck frill\": 1, \"on model\": 3, \"spread anus\": 3, \"spread butt\": 2, \"tail fin\": 1, \"thick tail\": 1, \"male penetrating feral\": 3, \"vaginal orgasm\": 1, \"niko (oneshot)\": 1, \"oneshot\": 1, \"plantigrade\": 1, \"cum covered\": 1, \"messy\": 1, \"blue fur\": 2, \"condom\": 1, \"condom in mouth\": 1, \"object in mouth\": 1, \"sexual barrier device\": 1, \"side boob\": 1, \"mask\": 9, \"after transformation\": 1, \"expansion\": 1, \"genital expansion\": 1, \"goo transformation\": 3, \"penis expansion\": 1, \"precum drip\": 3, \"precum squirt\": 1, \"transformation sequence\": 3, \"female rimming male\": 2, \"ffm\": 1, \"ffm threesome\": 1, \"oral sandwich\": 2, \"side view\": 2, \"slim\": 1, \"black nose\": 2, \"classroom\": 1, \"dipstick tail\": 2, \"school\": 1, \"armor\": 1, \"chick montblanc\": 1, \"cyberconnect2\": 1, \"duo focus\": 3, \"fuga: melodies of steel\": 1, \"helmet\": 1, \"little tail bronx\": 1, \"mei marzipan\": 1, \"ponytail (hair)\": 1, \"scarf\": 1, \"shocked face\": 1, \"tentacle sex\": 1, \"tentacles\": 1, \"tight clothing\": 3, \"amputee\": 1, \"disability\": 1, \"evolutionary family\": 1, \"floragato\": 2, \"quadruple amputee\": 1, \"sprigatito\": 2, \"wet\": 2, \"wet clothing\": 2, \"cum on head\": 2, \"female on top\": 3, \"foreskin pull\": 1, \"glistening skin\": 1, \"handjob\": 1, \"holding penis\": 1, \"pink anus\": 1, \"pussy juice drip\": 1, \"saliva on tongue\": 1, \"white skin\": 2, \"cum on back\": 3, \"face in pillow\": 1, \"grabbing pillow\": 1, \"holding butt\": 1, \"on front\": 1, \"feral on feral\": 2, \"feral penetrating\": 2, \"feral penetrating feral\": 2, \"quadruple amputee portal\": 1, \"ejaculation while penetrated\": 1, \"forced orgasm\": 1, \"cum pool\": 2, \"cum pooling\": 2, \"mounting\": 1, \"toe curl\": 3, \"male/ambiguous\": 1, \"penis on face\": 1, \"1 eye\": 1, \"cyclops\": 1, \"female/female\": 1, \"pakkoyan\": 1, \"pink fur\": 1, \"red hair\": 1, \"vueko\": 1, \"becoming erect\": 1, \"brown hair\": 2, \"bulge\": 2, \"erection under clothing\": 1, \"genital outline\": 1, \"human to anthro\": 2, \"mid transformation\": 1, \"penis outline\": 1, \"precum through clothing\": 1, \"spandex\": 2, \"species transformation\": 2, \"tenting\": 1, \"tight bottomwear\": 2, \"cowgirl position\": 1, \"dominant female\": 1, \"nipple lick\": 1, \"submissive\": 1, \"submissive male\": 1, \"aroused\": 1, \"paper\": 1, \"smiling at viewer\": 1, \"frottage\": 1, \"penis size difference\": 1, \"thigh sex\": 1, \"tail motion\": 2, \"tailwag\": 2, \"black eyes\": 1, \"delayed reaction\": 1, \"orgasm delay\": 1, \"forced transformation\": 1, \"topless\": 1, \"topless male\": 1, \"white pupils\": 1, \"after anal penetration\": 1, \"body blush\": 1, \"butt blush\": 1, \"clitoral hood\": 1, \"cum in hair\": 2, \"cum on tail\": 2, \"presenting anus\": 2, \"presenting cream pie\": 1, \"presenting pussy\": 1, \"tan anus\": 1, \"tan pussy\": 1, \"yellow anus\": 1, \"yellow pussy\": 1, \"big ears\": 2, \"eating\": 2, \"eating food\": 2, \"licking lips\": 1, \"after kiss\": 2, \"parallel sex\": 1, \"greyscale\": 1, \"informative\": 1, \"instructions\": 1, \"monochrome\": 1, \"phone number\": 1, \"sign\": 1, \"wheels\": 1, \"big knot\": 1, \"embrace\": 1, \"hug\": 1, \"riolu\": 1, \"cumshot\": 3, \"low-angle view\": 1, \"worm's-eye view\": 1, \"male on bottom\": 1, \"alcohol\": 1, \"asian clothing\": 1, \"beverage\": 1, \"boss monster\": 1, \"bow (feature)\": 1, \"bow in front\": 1, \"bow tie\": 1, \"costume\": 1, \"curvy figure\": 1, \"east asian clothing\": 1, \"grillby\": 1, \"heart maebari\": 1, \"japanese clothing\": 1, \"maebari\": 1, \"reverse bunny costume\": 1, \"temmie (undertale)\": 1, \"voluptuous\": 1, \"wine\": 1, \"wine bottle\": 1, \"nelle (puzzle and dragons)\": 1, \"puzzle and dragons\": 1, \"saliva drip\": 1, \"saliva on face\": 1, \"chest tuft\": 1, \"molosser\": 1, \"mountain dog\": 1, \"saint bernard\": 1, \"black ears\": 1, \"black sclera\": 1, \"fur tuft\": 1, \"head tuft\": 1, \"thrusting\": 1, \"human on humanoid\": 1, \"drooling cum\": 1, \"panties down\": 1, \"cum covered penis\": 1, \"human on robot\": 1, \"petting\": 1, \"bent spoon position\": 1, \"dildo\": 1, \"lucky pierre\": 1, \"object in ass\": 1, \"pegging\": 1, \"reverse missionary position\": 1, \"sex toy\": 1, \"sex toy in ass\": 1, \"sex toy insertion\": 1, \"sex toy penetration\": 1, \"strapon\": 1, \"toying partner\": 1, \"adult male\": 1, \"adult on cub\": 1, \"female cub\": 1, \"rough sex\": 1, \"holding arms\": 1, \"white countershading\": 1, \"star eyes\": 1, \"<3 pupils\": 1, \"collar\": 1, \"masturbation\": 1, \"penile masturbation\": 1, \"white tail\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [448, 576], \"count\": 1920}, \"1\": {\"resolution\": [576, 448], \"count\": 990}, \"2\": {\"resolution\": [704, 320], \"count\": 15}}, \"mean_img_ar_error\": 0.08053849284618508}, \"subsets\": [{\"img_count\": 195, \"num_repeats\": 15, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 0, \"image_dir\": \"train_data\", \"class_tokens\": \"mksks\", \"is_reg\": false}]}]", + "ss_epoch": "2", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0001", + "ss_lowram": "True", + "ss_lr_scheduler": "constant", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "2928", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "16", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "645b99d6db08cc52f1f5a75a70c3ad65dae6cf88946600bcc86b002fa06dd604", + "ss_new_vae_hash": "f921fb3f29891d2a77a6571e56b8b5052420d2884129517a333c60b1b4816cdf", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "488", + "ss_num_epochs": "6", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "dagasi style", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "537a51ea", + "ss_sd_scripts_commit_hash": "1f8fe63ceaac10643268338c1d5ceb24dcf6ea0c", + "ss_seed": "3419607849", + "ss_session_id": "1792226523", + "ss_text_encoder_lr": "5e-05", + "ss_training_comment": "None", + "ss_training_finished_at": "1686188671.1662238", + "ss_training_started_at": "1686187128.5488706", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "ss_vae_hash": "f458b5c6", + "ss_vae_name": "anime.vae.pt", + "sshs_legacy_hash": "c1ee76c5", + "sshs_model_hash": "a2c82c58a3eb697e5e0c7ec870d5c201602b5c4a3abcbc13ff07a809f37b05a6" +} \ No newline at end of file diff --git a/Styles/37/dagasi fluffyrock.txt b/Styles/37/dagasi fluffyrock.txt new file mode 100644 index 0000000000000000000000000000000000000000..1fc38c3c3b36fcb61bab2430967290f8cfcf056c --- /dev/null +++ b/Styles/37/dagasi fluffyrock.txt @@ -0,0 +1,449 @@ +Link:https://civitai.com/models/86448/dagasi-style-lora-for-fluffyrock-based-models +Version:v1.0 +Base Model:SD 1.5 +Keywords:dagasi +--------DESCRIPTION--------- + +This 'DAGASI furry model was specifically trained on Fluffyrock. Produces kemono anime and stylized imagery. Is prone to producing young looking character so use negative prompts to avoid. Style may be too strong at high weight and eyes tend to look strange. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt: dagasi, animal focus, three-quarter view, (anthro), vaporeon, eeveelution, (solo), big eyes, pupils, paws, waterfall, ((symmetrical)), female, anatomically correct, masterpiece, best quality, detailed background, blue eyes, pokemon (species) + Negative Prompt:ugly, human, + Size:512x512, Sampler:Euler a, Steps:26, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img2: + Prompt: dagasi, animal focus, three-quarter view, (feral), eevee, eeveelution, (solo), big shining eyes, pupils, paws, forest, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, brown eyes, pokemon (species), fullbody, + Negative Prompt:ugly, human, (bad quality), blush + Size:760x520, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img3: + Prompt: fox, anthro, male, clothed, dagasi, animal focus, three-quarter view, (vulpine), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, standing, hair tuft, rain jacket, yellow rain boots, raining, + Negative Prompt:ugly, human, (bad quality), bad anatomy, + Size:520x648, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img4: + Prompt: wolf, anthro, male, clothed, dagasi, animal focus, (canine), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, standing, hair tuft,snow, coat, anime, fluffy tail, + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying + Size:520x648, Sampler:Euler a, Steps:32, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img5: + Prompt: pikachu, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, sightly chubby + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, + Size:520x648, Sampler:Euler a, Steps:32, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img6: + Prompt: arcanine, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, sightly chubby + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, + Size:520x648, Sampler:Euler a, Steps:32, CFG:7, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img7: + Prompt: arcanine, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy, open mouth, eating strawberries + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, + Size:520x648, Sampler:Euler a, Steps:29, CFG:10, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img8: + Prompt: scorbunny, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy, + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nsfw + Size:520x648, Sampler:Euler a, Steps:29, CFG:10, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img9: + Prompt: Cinderace, male, dagasi, animal focus, (pokemon), (solo), cute eyes, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy, kicking a ball + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nsfw + Size:520x648, Sampler:Euler a, Steps:29, CFG:10, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + +img10: + Prompt: detailed,anime, zootopia, rabbit, female, dagasi, animal focus, (solo), cute eyes, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, police outfit, judy hopps + Negative Prompt:ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nipples + Size:520x704, Sampler:Euler a, Steps:29, CFG:10, Clip Skip:0, Model:model, Model Hash:c1559cdef8 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 86448, + "name": "DAGASI Style LORA - for Fluffyrock based models", + "description": "

This 'DAGASI' furry model was specifically trained on Fluffyrock. Produces kemono anime and stylized imagery. Is prone to producing young looking character so use negative prompts to avoid. Style may be too strong at high weight and eyes tend to look strange.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Image", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 5, + "favoriteCount": 2, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "1x1zh", + "image": null + }, + "tags": [ + "animals", + "style", + "furry" + ], + "modelVersions": [ + { + "id": 91937, + "modelId": 86448, + "name": "v1.0", + "createdAt": "2023-06-08T19:14:59.026Z", + "updatedAt": "2023-06-08T19:18:55.652Z", + "trainedWords": [ + "dagasi" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 5, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "dagasi fluffyrock.safetensors", + "id": 63367, + "sizeKB": 37023.638671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-08T19:16:09.162Z", + "hashes": { + "AutoV1": "98452205", + "AutoV2": "F341B03AD4", + "SHA256": "F341B03AD4502318ACDBF0B2EE9FB72BC7A2D8235350132FB89AF5461A8BBC5A", + "CRC32": "1488EF1A", + "BLAKE3": "995705A8E730CEB597E1600A0C5711778AD5119EF620421E2BF26D3E7D965878" + }, + "downloadUrl": "https://civitai.com/api/download/models/91937", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6e95bdc3-1579-472f-a720-65875716bd98/width=450/1076722.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UDIY^F0LzTKS@XD*9tIU~VRR?b9F[,Vto#%#", + "meta": { + "Size": "512x512", + "seed": 2882596154, + "Model": "model", + "steps": 26, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " dagasi, animal focus, three-quarter view, (anthro), vaporeon, eeveelution, (solo), big eyes, pupils, paws, waterfall, ((symmetrical)), female, anatomically correct, masterpiece, best quality, detailed background, blue eyes, pokemon (species)", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human,", + "Denoising strength": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/607e4abf-f956-4290-b36e-2ea5f1746dff/width=450/1076727.jpeg", + "nsfw": "None", + "width": 760, + "height": 520, + "hash": "UJI=6o_0.joGT2^7rrtSx_s;=y%2~XNfIYnh", + "meta": { + "Size": "760x520", + "seed": 2926825250, + "Model": "model", + "steps": 20, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " dagasi, animal focus, three-quarter view, (feral), eevee, eeveelution, (solo), big shining eyes, pupils, paws, forest, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, brown eyes, pokemon (species), fullbody,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), blush", + "Denoising strength": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b37f7707-a318-45bf-93a1-eac538b9c4bf/width=450/1076723.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "UKKAc#VW15?F}*-;5qrpXf-:={r;t+wG#Q?a", + "meta": { + "Size": "520x648", + "seed": 360002635, + "Model": "model", + "steps": 20, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " fox, anthro, male, clothed, dagasi, animal focus, three-quarter view, (vulpine), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, standing, hair tuft, rain jacket, yellow rain boots, raining,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/48ea1fe3-dba2-46d6-87b7-d4deae538a35/width=450/1076728.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "UFI}*R00.mSi_1bwDiM{pbRP=yNGDgD*%NtR", + "meta": { + "Size": "520x648", + "seed": 3766038696, + "Model": "model", + "steps": 32, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " wolf, anthro, male, clothed, dagasi, animal focus, (canine), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, standing, hair tuft,snow, coat, anime, fluffy tail,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ef073ef3-7c57-4423-abc3-a90f321d9640/width=450/1076725.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "U9M%Ss0H0G^GD#m-^ba1Ii=X^DEB:h0E-hX8", + "meta": { + "Size": "520x648", + "seed": 271302340, + "Model": "model", + "steps": 32, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " pikachu, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, sightly chubby", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0eacd91b-15b3-4c5b-beed-d9699d0b2169/width=450/1076729.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "UOLDMiEQ0Mo#T}IC4:xGM*%3%2ogT1-;%Ls:", + "meta": { + "Size": "520x648", + "seed": 4011507643, + "Model": "model", + "steps": 32, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " arcanine, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, sightly chubby", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/50804fdc-34e7-4d71-a7a2-f3e61cb4bd60/width=450/1076731.jpeg", + "nsfw": "X", + "width": 520, + "height": 648, + "hash": "UHMPEr0157%|*I01D*o}k:a1%2=_-nVY%LIp", + "meta": { + "Size": "520x648", + "seed": 1904577909, + "Model": "model", + "steps": 29, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " arcanine, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy, open mouth, eating strawberries", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 10, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db2b8d74-b5a0-45ea-b8e4-520fa445cdac/width=450/1076730.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "UELpz70000_MISXT$g#R00x]~qtl=|?u-;Mw", + "meta": { + "Size": "520x648", + "seed": 3071014447, + "Model": "model", + "steps": 29, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " scorbunny, male, dagasi, animal focus, (pokemon), (solo), cute eyes, paws, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 10, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nsfw" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a070c1c7-3fd6-4633-b83b-6a9f26e1416a/width=450/1076732.jpeg", + "nsfw": "None", + "width": 520, + "height": 648, + "hash": "UILNx+181+Djv04p.94oHqIV8waiuPxW-mrq", + "meta": { + "Size": "520x648", + "seed": 1458506570, + "Model": "model", + "steps": 29, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " Cinderace, male, dagasi, animal focus, (pokemon), (solo), cute eyes, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, fluffy, kicking a ball", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 10, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nsfw" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/04190b78-51fe-40a8-88a0-dbbfdfd7c94d/width=450/1076733.jpeg", + "nsfw": "None", + "width": 520, + "height": 704, + "hash": "UJECa]9FaHIp~CM~V|t7E4Ip%2s=nnj^-pjI", + "meta": { + "Size": "520x704", + "seed": 2033812721, + "Model": "model", + "steps": 29, + "hashes": { + "model": "c1559cdef8" + }, + "prompt": " detailed,anime, zootopia, rabbit, female, dagasi, animal focus, (solo), cute eyes, cute smile, ((symmetrical)), anatomically correct, masterpiece, best quality, detailed background, fullbody, kemono, police outfit, judy hopps", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 10, + "resources": [ + { + "hash": "c1559cdef8", + "name": "model", + "type": "model" + } + ], + "Model hash": "c1559cdef8", + "\"dagasi style": "a2c82c58a3eb\"", + "negativePrompt": "ugly, human, (bad quality), bad anatomy, crying, plain, ((bad fingers)), amputee, ((bad drawing)), weird eyes, nipples" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/91937" + } + ] +} +---------------------------- diff --git a/Styles/38/dibuctor-08-115109-metadata.json b/Styles/38/dibuctor-08-115109-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..9b9aeea29e0da1e72c35dd10f8bc4d224a81310d --- /dev/null +++ b/Styles/38/dibuctor-08-115109-metadata.json @@ -0,0 +1,657 @@ +{ + "ss_sd_model_name": "animefull-final-pruned-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "305", + "ss_tag_frequency": { + "dibuctor": { + "dibuctor": 305, + "1girl": 303, + "breasts": 303, + "huge breasts": 273, + "hetero": 265, + "1boy": 259, + "nude": 224, + "dark skin": 200, + "nipples": 193, + "blush": 180, + "dark-skinned male": 176, + "interracial": 170, + "sex": 161, + "black hair": 154, + "penis": 151, + "long hair": 147, + "thighs": 142, + "fat": 136, + "thick thighs": 133, + "short hair": 131, + "censored": 128, + "ass": 126, + "completely nude": 121, + "mosaic censoring": 120, + "vaginal": 101, + "pussy": 99, + "testicles": 89, + "navel": 88, + "brown hair": 88, + "open mouth": 86, + "bald": 83, + "pubic hair": 68, + "sex from behind": 65, + "cum": 64, + "grabbing": 62, + "alternate breast size": 59, + "fat man": 59, + "old man": 56, + "smile": 55, + "breast grab": 55, + "old": 55, + "kiss": 54, + "huge ass": 51, + "leg hair": 51, + "gigantic breasts": 50, + "purple eyes": 49, + "ugly man": 47, + "choker": 45, + "cum in pussy": 44, + "tongue": 44, + "ass grab": 42, + "male pubic hair": 41, + "white background": 41, + "curvy": 40, + "lying": 40, + "shiny skin": 39, + "breast sucking": 39, + "sweat": 38, + "solo": 37, + "multicolored hair": 36, + "wide hips": 35, + "closed eyes": 35, + "blue eyes": 34, + "simple background": 34, + "pink eyes": 34, + "spread legs": 33, + "tongue out": 33, + "anus": 32, + "doggystyle": 31, + "shiny": 31, + "horns": 31, + "ribbon": 31, + "gag": 31, + "bit gag": 31, + "comic": 30, + "socks": 30, + "cleavage": 29, + "thighhighs": 29, + "detached sleeves": 29, + "standing": 29, + "bamboo": 28, + "straddling": 27, + "teeth": 27, + "pink ribbon": 27, + "ahegao": 26, + "looking back": 26, + "red eyes": 26, + "white eyes": 25, + "large breasts": 25, + "solo focus": 25, + "no pupils": 24, + "barefoot": 24, + "plump": 24, + "uncensored": 23, + "brown eyes": 23, + "gagged": 23, + "looking at viewer": 22, + "blue hair": 22, + "fucked silly": 22, + "lactation": 22, + "blonde hair": 21, + "orange hair": 21, + "facial hair": 21, + "shirt": 21, + "underwear": 21, + "deep skin": 21, + "rolling eyes": 21, + "on back": 21, + "girl on top": 20, + "oral": 20, + "japanese clothes": 19, + "panties": 19, + "mature female": 19, + "clenched teeth": 19, + "gloves": 19, + "red hair": 18, + "elbow gloves": 18, + "chest hair": 18, + "hair ribbon": 18, + "kimono": 17, + "erection": 17, + "fellatio": 17, + "age difference": 17, + "pants": 16, + "sunglasses": 15, + "missionary": 15, + "boy on top": 15, + "collar": 15, + "french kiss": 15, + "pink kimono": 15, + "multiple boys": 14, + "mustache": 14, + "rape": 14, + "sash": 14, + "obi": 14, + "checkered sash": 14, + "large penis": 13, + "gradient hair": 13, + "huge penis": 13, + "bangs": 12, + "blunt bangs": 12, + "veins": 12, + "beard": 12, + "hand on another's head": 12, + "mating press": 12, + "armpit hair": 12, + "suspended congress": 12, + "anal": 12, + "cumdrip": 12, + "all fours": 12, + "hat": 12, + "faceless male": 12, + "group sex": 12, + "hug": 12, + "sitting": 12, + "asa no ha (pattern)": 12, + "swimsuit": 11, + "bikini": 11, + "2boys": 11, + "after sex": 11, + "faceless": 11, + "threesome": 11, + "grin": 11, + "pantyhose": 11, + "looking at another": 11, + "topless": 11, + "bent over": 10, + "standing sex": 10, + "forehead protector": 10, + "outdoors": 10, + "on side": 10, + "deep penetration": 10, + "grabbing from behind": 10, + "blush stickers": 10, + "very dark skin": 10, + "dress": 10, + "colored skin": 10, + "two-tone hair": 10, + "belt": 9, + "dark-skinned female": 9, + "on stomach": 9, + "bell": 9, + "shorts": 9, + "torn clothes": 9, + "white shirt": 9, + "bare shoulders": 9, + "pink choker": 9, + "bulge": 9, + "kneehighs": 9, + "arm hair": 9, + "konohagakure symbol": 8, + "height difference": 8, + "paizuri": 8, + "cowgirl position": 8, + "neck bell": 8, + "from behind": 8, + "saliva": 8, + "reverse suspended congress": 8, + "skirt": 8, + "very long hair": 8, + "condom": 8, + "breast press": 8, + "tattoo": 8, + "artist name": 7, + "yellow eyes": 7, + "white hair": 7, + "jewelry": 7, + "earrings": 7, + "overflow": 7, + "cum pool": 7, + "open clothes": 7, + "imminent penetration": 7, + "hairband": 7, + "ponytail": 7, + "gradient": 7, + "quad tails": 6, + "hair over one eye": 6, + "reverse cowgirl position": 6, + "fingering": 6, + "cheating (relationship)": 6, + "leg lock": 6, + "backboob": 6, + "cross-section": 6, + "animal print": 6, + "cow print": 6, + "cowbell": 6, + "cow girl": 6, + "one eye closed": 6, + "mmf threesome": 6, + "hand on hip": 6, + "upright straddle": 6, + "purple hair": 6, + "glasses": 6, + "haori": 6, + "indoors": 5, + "veiny penis": 5, + "ejaculation": 5, + "animal ears": 5, + "cow ears": 5, + "cow horns": 5, + "after ejaculation": 5, + "prone bone": 5, + "bodysuit": 5, + "condom on penis": 5, + "denim": 5, + "erection under clothes": 5, + "borrowed character": 5, + "arms behind back": 5, + "multiple penises": 5, + "slingshot swimsuit": 4, + "lifting person": 4, + "soles": 4, + "impregnation": 4, + "ovum": 4, + "fertilization": 4, + "sperm cell": 4, + "red panties": 4, + "uterus": 4, + "beach": 4, + "after vaginal": 4, + "fishnets": 4, + "flaccid": 4, + "handjob": 4, + "x-ray": 4, + "head back": 4, + "web address": 4, + "folded": 4, + "short shorts": 4, + "clothed male nude female": 4, + "makeup": 4, + "pussy juice": 4, + "tiptoes": 4, + "grabbing another's ass": 4, + "groping": 4, + "double penetration": 4, + "cunnilingus": 4, + "hair between eyes": 4, + "breastfeeding": 4, + "black eyes": 4, + "motion lines": 4, + "black thighhighs": 4, + "boots": 4, + "2girls": 3, + "squatting": 3, + "medium breasts": 3, + "hands on hips": 3, + "bra": 3, + ":>=": 3, + "kneeling": 3, + "internal cumshot": 3, + "excessive cum": 3, + "purple panties": 3, + "clothed female nude male": 3, + "black pantyhose": 3, + "school uniform": 3, + "twintails": 3, + "blood": 3, + "arm warmers": 3, + "saliva trail": 3, + "purple choker": 3, + "white gloves": 3, + "garter straps": 3, + "covered navel": 3, + "impossible clothes": 3, + "grey skin": 3, + "forehead jewel": 3, + "anilingus": 3, + "sandals": 3, + "irrumatio": 3, + "arm grab": 3, + "micro bikini": 3, + "candle": 3, + "gradient background": 3, + "trembling": 3, + "mouth hold": 3, + "interspecies": 3, + "demon girl": 3, + "3boys": 3, + "sidelocks": 3, + "shota": 3, + "blue skin": 3, + "brown footwear": 3, + "armpits": 2, + "arms up": 2, + "arms behind head": 2, + "multiple girls": 2, + "bikini top only": 2, + "pink hair": 2, + "bandana": 2, + "silent comic": 2, + "clothes lift": 2, + "headband": 2, + "netorare": 2, + "feet": 2, + "toes": 2, + "anal fingering": 2, + "hand on another's shoulder": 2, + "jacket": 2, + "fishnet top": 2, + "undressing": 2, + "multiple views": 2, + "torn pantyhose": 2, + "breasts out": 2, + "shiny hair": 2, + "no panties": 2, + "imminent vaginal": 2, + "full nelson": 2, + "shoes": 2, + "off shoulder": 2, + "bob cut": 2, + "jeans": 2, + "surprise kiss": 2, + "assisted exposure": 2, + "bestiality": 2, + "sex toy": 2, + "eye contact": 2, + "hanging breasts": 2, + "holding hands": 2, + "blurry": 2, + "from side": 2, + "blurry background": 2, + "bottomless": 2, + "pleated skirt": 2, + "sleeveless": 2, + "freckles": 2, + "body freckles": 2, + "striped": 2, + "striped panties": 2, + "thigh sex": 2, + "defloration": 2, + "leotard": 2, + "frown": 2, + "expressionless": 2, + "black leotard": 2, + "impossible leotard": 2, + "shoulder tattoo": 2, + "against wall": 2, + "bound": 2, + "bdsm": 2, + "sitting on person": 2, + "sitting on face": 2, + "clitoris": 2, + "cum string": 2, + "meme": 2, + "upper body": 2, + "areola slip": 2, + "skindentation": 2, + "white bikini": 2, + "arm held back": 2, + "single horn": 2, + "christmas": 2, + "christmas tree": 2, + "speech bubble": 2, + "english text": 2, + "black ribbon": 2, + "peaked cap": 2, + "belly": 2, + "fingerless gloves": 2, + "bench": 2, + "onee-shota": 2, + "braid": 2, + "open shirt": 2, + "miniskirt": 2, + "toeless legwear": 2, + "spitroast": 2, + "triple penetration": 2, + "cum in mouth": 2, + "cum in ass": 2, + "pokemon (creature)": 2, + "book": 2, + "green bikini": 1, + "wrestling": 1, + "jumpsuit": 1, + "fang": 1, + "mask": 1, + "skirt lift": 1, + "black bra": 1, + "kissing cheek": 1, + "kissing forehead": 1, + "shirt removed": 1, + "buttjob": 1, + "panties around one leg": 1, + "green hair": 1, + "black bikini": 1, + "red shirt": 1, + "dragon horns": 1, + "dragon girl": 1, + "male swimwear": 1, + "tiles": 1, + "shirt lift": 1, + "lifted by self": 1, + "side ponytail": 1, + "thought bubble": 1, + "imagining": 1, + "sweater": 1, + "one breast out": 1, + "cum on penis": 1, + "ahoge": 1, + "huge ahoge": 1, + "breasts squeezed together": 1, + "licking penis": 1, + "couch": 1, + "long sleeves": 1, + "pink shirt": 1, + "clothes pull": 1, + "pulled by another": 1, + "blue shorts": 1, + "denim shorts": 1, + "pink panties": 1, + "wide-eyed": 1, + "pink gloves": 1, + "pointy ears": 1, + "cervix": 1, + "hairy": 1, + "sharp teeth": 1, + "lipstick": 1, + "standing on one leg": 1, + "split": 1, + "bed sheet": 1, + "tears": 1, + "purple gloves": 1, + "what": 1, + "ass-to-ass": 1, + "white dress": 1, + "ring": 1, + "veil": 1, + "wedding dress": 1, + "wedding ring": 1, + "bridal veil": 1, + "bride": 1, + "wedding": 1, + "pubic tattoo": 1, + "novelty censor": 1, + "muscular": 1, + "abs": 1, + "mushroom": 1, + "symbol-shaped pupils": 1, + "peeing": 1, + "pee": 1, + "purple background": 1, + "no pussy": 1, + "groin": 1, + "surprised": 1, + "constricted pupils": 1, + "hood": 1, + "tatami": 1, + "hands on own chest": 1, + "breast suppress": 1, + "penis awe": 1, + "looking at penis": 1, + "sideboob": 1, + "head grab": 1, + "underboob": 1, + "panty pull": 1, + "from below": 1, + "orgasm": 1, + "female orgasm": 1, + "bondage": 1, + "interlocked fingers": 1, + "slave": 1, + "sagging breasts": 1, + "huge nipples": 1, + "nursing handjob": 1, + "bar censor": 1, + "mole": 1, + "purple dress": 1, + "purple bikini": 1, + "mother and son": 1, + "forehead": 1, + "collarbone": 1, + "close-up": 1, + "head out of frame": 1, + "breast focus": 1, + "sarashi": 1, + "eyepatch bikini": 1, + "imminent rape": 1, + "demon": 1, + "69": 1, + "orc": 1, + "bouncing breasts": 1, + "anger vein": 1, + "angry": 1, + "implied sex": 1, + "sleeping": 1, + "scar on forehead": 1, + "pink bra": 1, + "garter belt": 1, + "4boys": 1, + "gangbang": 1, + "antlers": 1, + "reindeer antlers": 1, + "fake antlers": 1, + "uniform": 1, + "military": 1, + "military uniform": 1, + "salute": 1, + "collared shirt": 1, + "chair": 1, + "skin tight": 1, + "black gloves": 1, + "black dress": 1, + "covered nipples": 1, + "single hair bun": 1, + "long skirt": 1, + "red gloves": 1, + "red thighhighs": 1, + "hoop earrings": 1, + "single braid": 1, + "blue dress": 1, + "hair ornament": 1, + "hairclip": 1, + "belly grab": 1, + "squatting cowgirl position": 1, + "opaque glasses": 1, + "sky": 1, + "day": 1, + "ocean": 1, + "bursting breasts": 1, + "white panties": 1, + "white bra": 1, + "green eyes": 1, + "midriff": 1, + "cape": 1, + "crop top": 1, + "purple skirt": 1, + "high ponytail": 1, + "hair pulled back": 1, + "ass focus": 1, + "pov": 1, + "stirrup legwear": 1, + "penis size difference": 1, + "used condom": 1, + "after anal": 1, + "gaping": 1, + "pointless condom": 1, + "anal hair": 1, + "animal": 1, + "watermark": 1, + "bandages": 1, + "dog": 1, + "bandaged leg": 1, + "animal penis": 1, + "dog penis": 1, + "butt crack": 1, + "furry": 1, + "pokephilia": 1, + "furry with non-furry": 1, + "tree": 1, + "full body": 1, + "pink dress": 1, + "white thighhighs": 1, + "crown": 1, + "very short hair": 1, + "black choker": 1, + "open book": 1, + "reading": 1, + "pencil": 1, + "crossed legs": 1, + "desk": 1, + "teacher": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dibuctor": { + "n_repeats": 1, + "img_count": 305 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 305, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dibuctor\": {\"dibuctor\": 305, \"1girl\": 303, \"solo\": 37, \"breasts\": 303, \"smile\": 55, \"blonde hair\": 21, \"cleavage\": 29, \"nipples\": 193, \"thighs\": 142, \"japanese clothes\": 19, \"kimono\": 17, \"huge breasts\": 273, \"shiny skin\": 39, \"thick thighs\": 133, \"curvy\": 40, \"wide hips\": 35, \"quad tails\": 6, \"open mouth\": 86, \"blue eyes\": 34, \"1boy\": 259, \"ass\": 126, \"hetero\": 265, \"nude\": 224, \"dark skin\": 200, \"sex\": 161, \"completely nude\": 121, \"dark-skinned male\": 176, \"bent over\": 10, \"sex from behind\": 65, \"doggystyle\": 31, \"interracial\": 170, \"standing sex\": 10, \"fat\": 136, \"long hair\": 147, \"looking at viewer\": 22, \"blush\": 180, \"bangs\": 12, \"black hair\": 154, \"navel\": 88, \"swimsuit\": 11, \"bikini\": 11, \"shiny\": 31, \"indoors\": 5, \"blunt bangs\": 12, \"armpits\": 2, \"arms up\": 2, \"arms behind head\": 2, \"alternate breast size\": 59, \"slingshot swimsuit\": 4, \"white eyes\": 25, \"no pupils\": 24, \"gigantic breasts\": 50, \"forehead protector\": 10, \"konohagakure symbol\": 8, \"short hair\": 131, \"multiple girls\": 2, \"2girls\": 3, \"outdoors\": 10, \"censored\": 128, \"barefoot\": 24, \"pussy\": 99, \"spread legs\": 33, \"orange hair\": 21, \"hair over one eye\": 6, \"mosaic censoring\": 120, \"anus\": 32, \"facial hair\": 21, \"squatting\": 3, \"bikini top only\": 2, \"green bikini\": 1, \"lifting person\": 4, \"wrestling\": 1, \"shirt\": 21, \"blue hair\": 22, \"closed eyes\": 35, \"belt\": 9, \"artist name\": 7, \"huge ass\": 51, \"jumpsuit\": 1, \"large breasts\": 25, \"medium breasts\": 3, \"yellow eyes\": 7, \"pink hair\": 2, \"red hair\": 18, \"dark-skinned female\": 9, \"hands on hips\": 3, \"bandana\": 2, \"penis\": 151, \"solo focus\": 25, \"fang\": 1, \"cum\": 64, \"vaginal\": 101, \"pubic hair\": 68, \"cum in pussy\": 44, \"testicles\": 89, \"straddling\": 27, \"girl on top\": 20, \"male pubic hair\": 41, \"reverse cowgirl position\": 6, \"leg hair\": 51, \"kiss\": 54, \"fat man\": 59, \"comic\": 30, \"multiple boys\": 14, \"2boys\": 11, \"mask\": 1, \"ass grab\": 42, \"plump\": 24, \"height difference\": 8, \"silent comic\": 2, \"underwear\": 21, \"panties\": 19, \"clothes lift\": 2, \"skirt lift\": 1, \"pants\": 16, \"bra\": 3, \"headband\": 2, \"erection\": 17, \"black bra\": 1, \"veins\": 12, \"veiny penis\": 5, \"large penis\": 13, \"grabbing\": 62, \"breast grab\": 55, \"fingering\": 6, \"kissing cheek\": 1, \"kissing forehead\": 1, \"white hair\": 7, \"lying\": 40, \"oral\": 20, \"sunglasses\": 15, \"on stomach\": 9, \"fellatio\": 17, \"beard\": 12, \"paizuri\": 8, \"hand on another's head\": 12, \"age difference\": 17, \"mature female\": 19, \"mustache\": 14, \"bald\": 83, \"breast sucking\": 39, \"old\": 55, \"old man\": 56, \":>=\": 3, \"missionary\": 15, \"boy on top\": 15, \"mating press\": 12, \"cheating (relationship)\": 6, \"jewelry\": 7, \"earrings\": 7, \"netorare\": 2, \"armpit hair\": 12, \"leg lock\": 6, \"suspended congress\": 12, \"tongue\": 44, \"tongue out\": 33, \"feet\": 2, \"toes\": 2, \"soles\": 4, \"anal\": 12, \"cowgirl position\": 8, \"ahegao\": 26, \"backboob\": 6, \"anal fingering\": 2, \"on side\": 10, \"deep skin\": 21, \"teeth\": 27, \"clenched teeth\": 19, \"cumdrip\": 12, \"rolling eyes\": 21, \"fucked silly\": 22, \"impregnation\": 4, \"ovum\": 4, \"fertilization\": 4, \"sperm cell\": 4, \"looking back\": 26, \"kneeling\": 3, \"after sex\": 11, \"sweat\": 38, \"all fours\": 12, \"red panties\": 4, \"shirt removed\": 1, \"buttjob\": 1, \"panties around one leg\": 1, \"ejaculation\": 5, \"overflow\": 7, \"cross-section\": 6, \"uterus\": 4, \"internal cumshot\": 3, \"deep penetration\": 10, \"cum pool\": 7, \"brown hair\": 88, \"thighhighs\": 29, \"hat\": 12, \"animal ears\": 5, \"purple eyes\": 49, \"horns\": 31, \"elbow gloves\": 18, \"collar\": 15, \"bell\": 9, \"animal print\": 6, \"neck bell\": 8, \"cow print\": 6, \"cow ears\": 5, \"cow horns\": 5, \"cowbell\": 6, \"cow girl\": 6, \"multicolored hair\": 36, \"green hair\": 1, \"open clothes\": 7, \"shorts\": 9, \"gradient hair\": 13, \"black bikini\": 1, \"beach\": 4, \"red shirt\": 1, \"dragon horns\": 1, \"dragon girl\": 1, \"hand on another's shoulder\": 2, \"male swimwear\": 1, \"imminent penetration\": 7, \"ugly man\": 47, \"after vaginal\": 4, \"excessive cum\": 3, \"tiles\": 1, \"jacket\": 2, \"one eye closed\": 6, \"fishnets\": 4, \"purple panties\": 3, \"fishnet top\": 2, \"shirt lift\": 1, \"undressing\": 2, \"lifted by self\": 1, \"from behind\": 8, \"lactation\": 22, \"detached sleeves\": 29, \"grabbing from behind\": 10, \"gloves\": 19, \"standing\": 29, \"french kiss\": 15, \"saliva\": 8, \"flaccid\": 4, \"after ejaculation\": 5, \"red eyes\": 26, \"faceless\": 11, \"faceless male\": 12, \"side ponytail\": 1, \"multiple views\": 2, \"group sex\": 12, \"threesome\": 11, \"prone bone\": 5, \"grin\": 11, \"handjob\": 4, \"thought bubble\": 1, \"imagining\": 1, \"x-ray\": 4, \"pantyhose\": 11, \"hairband\": 7, \"torn clothes\": 9, \"clothed female nude male\": 3, \"torn pantyhose\": 2, \"huge penis\": 13, \"reverse suspended congress\": 8, \"black pantyhose\": 3, \"sweater\": 1, \"head back\": 4, \"one breast out\": 1, \"breasts out\": 2, \"cum on penis\": 1, \"skirt\": 8, \"very long hair\": 8, \"school uniform\": 3, \"ahoge\": 1, \"socks\": 30, \"shiny hair\": 2, \"uncensored\": 23, \"no panties\": 2, \"huge ahoge\": 1, \"brown eyes\": 23, \"hug\": 12, \"bodysuit\": 5, \"blush stickers\": 10, \"white shirt\": 9, \"breasts squeezed together\": 1, \"licking penis\": 1, \"imminent vaginal\": 2, \"condom on penis\": 5, \"twintails\": 3, \"on back\": 21, \"blood\": 3, \"web address\": 4, \"folded\": 4, \"condom\": 8, \"full nelson\": 2, \"mmf threesome\": 6, \"shoes\": 2, \"couch\": 1, \"very dark skin\": 10, \"simple background\": 34, \"long sleeves\": 1, \"white background\": 41, \"bare shoulders\": 9, \"choker\": 45, \"off shoulder\": 2, \"looking at another\": 11, \"short shorts\": 4, \"bob cut\": 2, \"denim\": 5, \"pink shirt\": 1, \"jeans\": 2, \"pink choker\": 9, \"surprise kiss\": 2, \"dress\": 10, \"clothes pull\": 1, \"assisted exposure\": 2, \"pulled by another\": 1, \"blue shorts\": 1, \"denim shorts\": 1, \"bulge\": 9, \"pink eyes\": 34, \"topless\": 11, \"pink panties\": 1, \"wide-eyed\": 1, \"arm warmers\": 3, \"saliva trail\": 3, \"clothed male nude female\": 4, \"breast press\": 8, \"erection under clothes\": 5, \"kneehighs\": 9, \"chest hair\": 18, \"purple choker\": 3, \"pink gloves\": 1, \"makeup\": 4, \"arm hair\": 9, \"hand on hip\": 6, \"pointy ears\": 1, \"bestiality\": 2, \"cervix\": 1, \"upright straddle\": 6, \"hairy\": 1, \"pussy juice\": 4, \"sex toy\": 2, \"tiptoes\": 4, \"sharp teeth\": 1, \"eye contact\": 2, \"lipstick\": 1, \"grabbing another's ass\": 4, \"standing on one leg\": 1, \"split\": 1, \"bed sheet\": 1, \"tears\": 1, \"purple gloves\": 1, \"hanging breasts\": 2, \"what\": 1, \"ass-to-ass\": 1, \"holding hands\": 2, \"white gloves\": 3, \"white dress\": 1, \"garter straps\": 3, \"ring\": 1, \"veil\": 1, \"wedding dress\": 1, \"wedding ring\": 1, \"bridal veil\": 1, \"bride\": 1, \"wedding\": 1, \"blurry\": 2, \"from side\": 2, \"blurry background\": 2, \"bottomless\": 2, \"pleated skirt\": 2, \"sleeveless\": 2, \"tattoo\": 8, \"freckles\": 2, \"groping\": 4, \"pubic tattoo\": 1, \"body freckles\": 2, \"double penetration\": 4, \"striped\": 2, \"striped panties\": 2, \"cunnilingus\": 4, \"novelty censor\": 1, \"thigh sex\": 2, \"muscular\": 1, \"abs\": 1, \"borrowed character\": 5, \"mushroom\": 1, \"symbol-shaped pupils\": 1, \"hair between eyes\": 4, \"defloration\": 2, \"peeing\": 1, \"pee\": 1, \"purple hair\": 6, \"leotard\": 2, \"covered navel\": 3, \"colored skin\": 10, \"frown\": 2, \"expressionless\": 2, \"black leotard\": 2, \"impossible clothes\": 3, \"grey skin\": 3, \"forehead jewel\": 3, \"impossible leotard\": 2, \"purple background\": 1, \"no pussy\": 1, \"groin\": 1, \"sitting\": 12, \"ponytail\": 7, \"glasses\": 6, \"shoulder tattoo\": 2, \"anilingus\": 3, \"surprised\": 1, \"constricted pupils\": 1, \"hood\": 1, \"tatami\": 1, \"sandals\": 3, \"hands on own chest\": 1, \"breast suppress\": 1, \"penis awe\": 1, \"looking at penis\": 1, \"sideboob\": 1, \"irrumatio\": 3, \"head grab\": 1, \"rape\": 14, \"underboob\": 1, \"breastfeeding\": 4, \"panty pull\": 1, \"against wall\": 2, \"from below\": 1, \"orgasm\": 1, \"female orgasm\": 1, \"bound\": 2, \"bdsm\": 2, \"bondage\": 1, \"interlocked fingers\": 1, \"slave\": 1, \"sagging breasts\": 1, \"huge nipples\": 1, \"nursing handjob\": 1, \"bar censor\": 1, \"sitting on person\": 2, \"sitting on face\": 2, \"mole\": 1, \"arms behind back\": 5, \"clitoris\": 2, \"arm grab\": 3, \"cum string\": 2, \"purple dress\": 1, \"black eyes\": 4, \"micro bikini\": 3, \"purple bikini\": 1, \"mother and son\": 1, \"ribbon\": 31, \"hair ribbon\": 18, \"sash\": 14, \"obi\": 14, \"pink ribbon\": 27, \"gag\": 31, \"gagged\": 23, \"pink kimono\": 15, \"bamboo\": 28, \"bit gag\": 31, \"asa no ha (pattern)\": 12, \"checkered sash\": 14, \"two-tone hair\": 10, \"gradient\": 7, \"meme\": 2, \"candle\": 3, \"haori\": 6, \"gradient background\": 3, \"forehead\": 1, \"collarbone\": 1, \"upper body\": 2, \"close-up\": 1, \"head out of frame\": 1, \"breast focus\": 1, \"trembling\": 3, \"mouth hold\": 3, \"areola slip\": 2, \"sarashi\": 1, \"skindentation\": 2, \"white bikini\": 2, \"eyepatch bikini\": 1, \"imminent rape\": 1, \"demon\": 1, \"69\": 1, \"orc\": 1, \"bouncing breasts\": 1, \"arm held back\": 2, \"motion lines\": 4, \"interspecies\": 3, \"anger vein\": 1, \"angry\": 1, \"single horn\": 2, \"demon girl\": 3, \"implied sex\": 1, \"sleeping\": 1, \"scar on forehead\": 1, \"pink bra\": 1, \"3boys\": 3, \"christmas\": 2, \"multiple penises\": 5, \"garter belt\": 1, \"4boys\": 1, \"gangbang\": 1, \"antlers\": 1, \"christmas tree\": 2, \"reindeer antlers\": 1, \"fake antlers\": 1, \"sidelocks\": 3, \"uniform\": 1, \"speech bubble\": 2, \"english text\": 2, \"military\": 1, \"black ribbon\": 2, \"military uniform\": 1, \"peaked cap\": 2, \"salute\": 1, \"collared shirt\": 1, \"chair\": 1, \"skin tight\": 1, \"belly\": 2, \"black gloves\": 1, \"fingerless gloves\": 2, \"black dress\": 1, \"covered nipples\": 1, \"single hair bun\": 1, \"black thighhighs\": 4, \"long skirt\": 1, \"bench\": 2, \"red gloves\": 1, \"red thighhighs\": 1, \"shota\": 3, \"onee-shota\": 2, \"hoop earrings\": 1, \"braid\": 2, \"single braid\": 1, \"blue dress\": 1, \"hair ornament\": 1, \"hairclip\": 1, \"open shirt\": 2, \"belly grab\": 1, \"squatting cowgirl position\": 1, \"opaque glasses\": 1, \"sky\": 1, \"day\": 1, \"ocean\": 1, \"bursting breasts\": 1, \"white panties\": 1, \"white bra\": 1, \"green eyes\": 1, \"midriff\": 1, \"miniskirt\": 2, \"cape\": 1, \"crop top\": 1, \"purple skirt\": 1, \"high ponytail\": 1, \"blue skin\": 3, \"hair pulled back\": 1, \"ass focus\": 1, \"pov\": 1, \"toeless legwear\": 2, \"stirrup legwear\": 1, \"penis size difference\": 1, \"spitroast\": 2, \"triple penetration\": 2, \"cum in mouth\": 2, \"cum in ass\": 2, \"used condom\": 1, \"after anal\": 1, \"gaping\": 1, \"pointless condom\": 1, \"anal hair\": 1, \"animal\": 1, \"watermark\": 1, \"bandages\": 1, \"dog\": 1, \"bandaged leg\": 1, \"animal penis\": 1, \"dog penis\": 1, \"butt crack\": 1, \"boots\": 4, \"pokemon (creature)\": 2, \"furry\": 1, \"pokephilia\": 1, \"furry with non-furry\": 1, \"brown footwear\": 3, \"tree\": 1, \"full body\": 1, \"pink dress\": 1, \"white thighhighs\": 1, \"crown\": 1, \"very short hair\": 1, \"book\": 2, \"black choker\": 1, \"open book\": 1, \"reading\": 1, \"pencil\": 1, \"crossed legs\": 1, \"desk\": 1, \"teacher\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [448, 576], \"count\": 5}, \"1\": {\"resolution\": [512, 512], \"count\": 300}}, \"mean_img_ar_error\": 0.0011358280243024892}, \"subsets\": [{\"img_count\": 305, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dibuctor\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "8", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0005", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "61", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "1224", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "06bece8e771a9ec16474db4c7d601d2f04fd08d1b1611072e7dd97c18cec3a09", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "153", + "ss_num_epochs": "8", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "dibuctor", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "0b1893f6", + "ss_sd_scripts_commit_hash": "5050971ac687dca70ba0486a583d283e8ae324e2", + "ss_seed": "42", + "ss_session_id": "1298149638", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1692456846.2866616", + "ss_training_started_at": "1692456058.4557621", + "ss_unet_lr": "0.0005", + "ss_v2": "False", + "sshs_legacy_hash": "de2f2560", + "sshs_model_hash": "507e74a9834852fa35d3c8ae10f37e1b1c423366327ed198e20ca38396387dce" +} \ No newline at end of file diff --git a/Styles/38/dibuctor-08-115109.txt b/Styles/38/dibuctor-08-115109.txt new file mode 100644 index 0000000000000000000000000000000000000000..0a5e93f7629f3fffac62342aa610910209eb8240 --- /dev/null +++ b/Styles/38/dibuctor-08-115109.txt @@ -0,0 +1,508 @@ +Link:https://civitai.com/models/139231/dibuctor-hentai-artist-style +Version:v1.0 +Base Model:SD 1.5 +Keywords:dibuctor +--------DESCRIPTION--------- +Tags: Animal focus (more original) or Big tits (more furry) or Bara (more furry), +This arthritis makes for big boobs, a big penis, and the minimalist, somewhat manual drawing style of SHINY colors that you see. +Desc: Make artist style, For this series of parrots it is recommended to see a bit of the work to see what it does and what tags to use + +--> Weight: 1.2 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img2: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img3: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img4: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img5: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img6: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img7: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img8: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img9: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare)) + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: +img10: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy + Negative Prompt:(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human) + Size:512x760, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 139231, + "name": "Dibuctor - Hentai Artist Style", + "description": "
Tags: Animal focus (more original) or Big tits (more furry) or Bara (more furry), \nThis arthritis makes for big boobs, a big penis, and the minimalist, somewhat manual drawing style of SHINY colors that you see.\nDesc: Make artist style, For this series of parrots it is recommended to see a bit of the work to see what it does and what tags to use\n\n--> Weight: 1.2 << Depending on the Checkpoint it may be less, but for now I've only work forcing it
", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 25, + "favoriteCount": 5, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Tomas_Aguilar", + "image": "https://lh3.googleusercontent.com/a/AGNmyxYWsZqFI4NSQhTwGpj6efRqfkoQ0JOc9-y3kPk7=s96-c" + }, + "tags": [ + "art", + "style", + "bigtits", + "hentai", + "bigbutt", + "bigass", + "bigdick" + ], + "modelVersions": [ + { + "id": 154062, + "modelId": 139231, + "name": "v1.0", + "createdAt": "2023-09-03T01:15:16.731Z", + "updatedAt": "2023-09-03T01:18:36.589Z", + "trainedWords": [ + "dibuctor" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 25, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 115109, + "url": "https://civitai-delivery-worker-prod-2023-09-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/model/1201448/dibuctor08.kZRv.safetensors", + "sizeKB": 18566.4404296875, + "name": "dibuctor-08.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-03T01:20:46.412Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "6523E1D925", + "SHA256": "6523E1D925EDD5CDE5BED228D0CF0BA4FF63293197D89BB5C3AC1AAFC602C054", + "CRC32": "6E4A0EB8", + "BLAKE3": "500C1BEE6A8836150F1ED894F1AB69B53859CD59CBBA5C740BC60AA154101289" + }, + "downloadUrl": "https://civitai.com/api/download/models/154062", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/011cf3d0-65e1-4141-9cbe-253c32feae72/width=450/2329094.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "ULK^y$-:?]xC7%tQo#M{cGt7xGaeo%s.-pay", + "type": "image", + "metadata": { + "hash": "ULK^y$-:?]xC7%tQo#M{cGt7xGaeo%s.-pay", + "size": 457797, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082642, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2d86a6a3-01b3-4c8e-8559-85329166f837/width=450/2329092.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 760, + "hash": "UDMG@n?w0K-.07.A-=RjTzx^-oIUD,NLwcae", + "type": "image", + "metadata": { + "hash": "UDMG@n?w0K-.07.A-=RjTzx^-oIUD,NLwcae", + "size": 439501, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082650, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b5be275d-6668-4d19-bc81-081c3f810242/width=450/2329089.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UKO3nNNHACWCCA%M%haeyZM{%3xD^+ax?Gt6", + "type": "image", + "metadata": { + "hash": "UKO3nNNHACWCCA%M%haeyZM{%3xD^+ax?Gt6", + "size": 390665, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082646, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8117ba25-4168-42b2-95ac-415ea890dc7f/width=450/2329088.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 760, + "hash": "UBNASE_45joz0G?b.9IpBY?a?HM_?cM{-6xD", + "type": "image", + "metadata": { + "hash": "UBNASE_45joz0G?b.9IpBY?a?HM_?cM{-6xD", + "size": 424723, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082647, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ac7b9519-fb27-49f6-a378-8c29ff56d133/width=450/2329090.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UNM7P*t8_MR+YRt7NfR*BXxv%Nf7srNHIVxt", + "type": "image", + "metadata": { + "hash": "UNM7P*t8_MR+YRt7NfR*BXxv%Nf7srNHIVxt", + "size": 427107, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082648, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e05c2fe0-e68b-40a0-8a1c-8833145335d4/width=450/2329091.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UPK^:0o~_3NGlVENIqNGTfM}-pRj4;xF%L$*", + "type": "image", + "metadata": { + "hash": "UPK^:0o~_3NGlVENIqNGTfM}-pRj4;xF%L$*", + "size": 540675, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082649, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f3b8412-dcc5-4310-9fab-6dd2ddbc6be1/width=450/2329093.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 760, + "hash": "UWL4Wz%MyXjEpyozItRPOtbb-pV@D+ju-Vsl", + "type": "image", + "metadata": { + "hash": "UWL4Wz%MyXjEpyozItRPOtbb-pV@D+ju-Vsl", + "size": 515376, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082641, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/56affd42-4a6f-4473-926d-65571b016bf3/width=450/2329096.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UKMaIl~AL3kr6DtSI]NK?HNy}@s:_4xa%1%1", + "type": "image", + "metadata": { + "hash": "UKMaIl~AL3kr6DtSI]NK?HNy}@s:_4xa%1%1", + "size": 495968, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082644, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fcb78c90-d908-4121-ba19-afdbdd24f8f4/width=450/2329097.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UKLNrb,..lS$2{?FIq%MF4X5rXtRV}E1MxI;", + "type": "image", + "metadata": { + "hash": "UKLNrb,..lS$2{?FIq%MF4X5rXtRV}E1MxI;", + "size": 477288, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 48082645, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy,micro bikini, ,beach, holding weapon, tattoo, ((netorare))", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/571063ed-7ca4-4aab-91d1-77487ca810c1/width=450/2329098.jpeg", + "nsfw": "X", + "width": 512, + "height": 760, + "hash": "UKIr7tDik~NL?K9FItkW0}Vr-pogNgM^%1t7", + "type": "image", + "metadata": { + "hash": "UKIr7tDik~NL?K9FItkW0}Vr-pogNgM^%1t7", + "size": 504620, + "width": 512, + "height": 760 + }, + "meta": { + "VAE": "any.vae.safetensors", + "Size": "512x760", + "seed": 4023540187, + "Model": "anything-v4.5-pruned", + "steps": 20, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2), dibuctor, ,1girl, breasts,dark skin,huge breasts,thick thighs,curvy", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "\"dibuctor": "507e74a98348\"", + "resources": [ + { + "name": "dibuctor", + "type": "lora", + "weight": 1.2 + } + ], + "negativePrompt": "(((blur))), (EasyNegative:1.2), ng_deepnegative_v1_75t, paintings, sketches, (worst quality:2), (low quality:2), (normal quality:2), lowres, normal quality, ((monochrome)), ((grayscale)), bad anatomy,(long hair:1.4),DeepNegative,(fat:1.2),facing away, looking away,tilted head,lowres,bad anatomy,bad hands, text, error, missing fingers,extra digit, fewer digits, cropped, worstquality, low quality, normal quality,jpegartifacts,signature, watermark, username,blurry,bad feet,cropped,poorly drawn hands,poorly drawn face,mutation,deformed,worst quality,low quality,normal quality,jpeg artifacts,signature,watermark,extra fingers,fewer digits,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,text,error,missing fingers,missing arms,missing legs, (nude), (human)", + "CFG Rescale phi": "0" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/154062" + } + ] +} +---------------------------- diff --git a/Styles/39/diives_style-159693-metadata.json b/Styles/39/diives_style-159693-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..5f759a8960043d5876f6ff2720d557f4a8398cc1 --- /dev/null +++ b/Styles/39/diives_style-159693-metadata.json @@ -0,0 +1,542 @@ +{ + "ss_sd_model_name": "AnyLoRA_noVae_fp16-pruned.ckpt", + "ss_clip_skip": "2", + "ss_num_train_images": "430", + "ss_tag_frequency": { + "Diives_Style": { + "blush": 30, + "1girl": 29, + "tail": 28, + "simple background": 27, + "furry": 27, + "animal ears": 26, + "furry female": 26, + "long hair": 23, + "artist name": 23, + "smile": 22, + "looking at viewer": 21, + "standing": 21, + "open mouth": 21, + "solo": 20, + "white background": 19, + "full body": 18, + "english text": 18, + "thighhighs": 17, + "body fur": 17, + "multiple girls": 16, + "teeth": 16, + "pokemon (creature)": 15, + "ass": 14, + "red eyes": 14, + "animal nose": 14, + "bare shoulders": 14, + "signature": 13, + "heart": 13, + "navel": 13, + "medium breasts": 13, + "2girls": 12, + "underwear": 12, + "rabbit ears": 12, + "blue eyes": 11, + "nipples": 11, + "closed mouth": 11, + "sweat": 10, + "skirt": 10, + "rabbit tail": 10, + "colored skin": 10, + "small breasts": 10, + "colored sclera": 10, + "looking back": 9, + "panties": 9, + "blush stickers": 9, + "happy": 9, + "rabbit girl": 9, + "black hair": 9, + "large breasts": 8, + "from behind": 8, + "shirt": 8, + "dress": 8, + "socks": 8, + "yuri": 8, + "half-closed eyes": 8, + "furry with furry": 8, + "tongue": 8, + "buck teeth": 8, + "leotard": 8, + "blonde hair": 7, + "sitting": 7, + "thighs": 7, + "nude": 7, + "gloves": 7, + "bow": 7, + "interspecies": 7, + "two-tone fur": 7, + "one eye closed": 7, + "ponytail": 6, + "shoes": 6, + "very long hair": 6, + "tongue out": 6, + "sidelocks": 6, + "hand up": 6, + "looking at another": 6, + "talking": 6, + "green eyes": 6, + "pantyhose": 6, + "pussy": 6, + "cleavage": 6, + "thick thighs": 5, + "short sleeves": 5, + "sleeveless": 5, + "white panties": 5, + "sleeveless shirt": 5, + "white fur": 5, + "brown fur": 5, + "brown hair": 5, + "hair ornament": 5, + "lopunny": 5, + "closed eyes": 5, + "wide hips": 5, + "spread legs": 5, + "black eyes": 5, + "leg up": 5, + "topknot": 5, + "twintails": 4, + "white shirt": 4, + "short dress": 4, + "yellow fur": 4, + "pointy ears": 4, + "extra mouth": 4, + "1boy": 4, + "pink hair": 4, + "aqua eyes": 4, + "crop top": 4, + "saliva": 4, + "white pupils": 4, + "flat color": 4, + "cowboy shot": 4, + "orange hair": 4, + "speech bubble": 4, + "multiple views": 4, + "embarrassed": 4, + "cameltoe": 4, + "dog ears": 4, + "dog tail": 4, + "dog girl": 4, + "green hair": 4, + "short hair": 4, + "standing on one leg": 4, + "stomach": 4, + "shiny": 4, + "blue hair": 4, + "miniskirt": 3, + "animal ear fluff": 3, + "fox ears": 3, + "fox tail": 3, + "fox girl": 3, + "snout": 3, + "horns": 3, + "white thighhighs": 3, + "glasses": 3, + "blunt bangs": 3, + "hand on hip": 3, + "sharp teeth": 3, + "chewing gum": 3, + "crossed legs": 3, + "holding": 3, + "hetero": 3, + "boots": 3, + "lying": 3, + "on back": 3, + "nose blush": 3, + "bright pupils": 3, + "yellow shirt": 3, + "femdom": 3, + "patreon logo": 3, + "furry with non-furry": 3, + "animal feet": 3, + "rabbit boy": 3, + "pink fur": 3, + "sylveon": 3, + "collarbone": 3, + "claws": 3, + "orange fur": 3, + "pussy juice": 3, + "underwear only": 3, + "black sclera": 3, + "hair bow": 3, + "bra": 3, + "arrow (symbol)": 3, + "purple eyes": 3, + "3girls": 3, + "6+girls": 3, + "arm up": 3, + "hands up": 3, + "looking down": 3, + "high heels": 3, + "hair tie": 3, + "purple hair": 3, + "uncensored": 3, + "jewelry": 3, + "earrings": 3, + "mask": 2, + "hair pulled back": 2, + "domino mask": 2, + "wrestling ring": 2, + "rainbow mika": 2, + "open clothes": 2, + "no panties": 2, + "alternate color": 2, + "braixen": 2, + "crown": 2, + "demon tail": 2, + "buruma": 2, + "shorts": 2, + "short shorts": 2, + "multicolored skin": 2, + "two-tone skin": 2, + "bubble blowing": 2, + "hairband": 2, + "indoors": 2, + "fangs": 2, + "white footwear": 2, + "girl on top": 2, + "motion lines": 2, + "bow panties": 2, + "sitting on person": 2, + "furry male": 2, + "jaggy lines": 2, + "panties removed": 2, + "holding panties": 2, + "black thighhighs": 2, + "tiger ears": 2, + "tiger tail": 2, + "tiger girl": 2, + "multicolored fur": 2, + "torn clothes": 2, + "topless": 2, + "red fur": 2, + "bandaid": 2, + "kirlia": 2, + "striped tail": 2, + "braid": 2, + "sex toy": 2, + "bowtie": 2, + "fang": 2, + "strapless": 2, + "covered navel": 2, + ":3": 2, + "hand to own mouth": 2, + "green skin": 2, + "comic": 2, + "wide-eyed": 2, + "blue skin": 2, + "glaceon": 2, + "midriff": 2, + "arms up": 2, + "crossed arms": 2, + "fire": 2, + "personification": 2, + "hair between eyes": 2, + "heterochromia": 2, + "yellow background": 2, + "split": 2, + "barefoot": 2, + "leaning forward": 2, + "light blush": 2, + "striped": 2, + "belt": 2, + "clothes lift": 2, + "pubic hair": 2, + "ass visible through thighs": 2, + "female pubic hair": 2, + "piercing": 2, + "skirt lift": 2, + "clitoral hood": 2, + "furrification": 2, + "wrist cuffs": 2, + "playboy bunny": 2, + "ass grab": 2, + "vaginal": 2, + "drooling": 2, + "wet": 1, + "huge ass": 1, + "black dress": 1, + "clothes pull": 1, + "freckles": 1, + "fur collar": 1, + "skirt pull": 1, + "yellow eyes": 1, + ":d": 1, + "demon girl": 1, + "demon horns": 1, + "between legs": 1, + "happy birthday": 1, + "oni horns": 1, + "hand between legs": 1, + "red skin": 1, + "skin-covered horns": 1, + "shadow": 1, + "sunglasses": 1, + "eyewear on head": 1, + "strap slip": 1, + "red-framed eyewear": 1, + "tinted eyewear": 1, + "long tongue": 1, + "red-tinted eyewear": 1, + "vest": 1, + "fingernails": 1, + "no bra": 1, + "makeup": 1, + "red shirt": 1, + "pelvic curtain": 1, + "eyeshadow": 1, + "long fingernails": 1, + "sharp fingernails": 1, + "red vest": 1, + "eyeliner": 1, + "hand on own thigh": 1, + "loincloth": 1, + "open vest": 1, + "red eyeshadow": 1, + "half-closed eye": 1, + "red hair": 1, + "fingering": 1, + "poke ball": 1, + "bandaid on face": 1, + "poke ball (basic)": 1, + "bandaid on nose": 1, + "huge breasts": 1, + "completely nude": 1, + "red background": 1, + "green bow": 1, + "lactation": 1, + "^^^": 1, + "pregnant": 1, + "multi-tied hair": 1, + "twin braids": 1, + "vibrator": 1, + "inverted nipples": 1, + "remote control vibrator": 1, + "black skirt": 1, + "monster girl": 1, + "yellow bow": 1, + "antennae": 1, + "yellow bowtie": 1, + "looking to the side": 1, + "white leotard": 1, + "white eyes": 1, + "spoken blush": 1, + "school uniform": 1, + "bag": 1, + "cup": 1, + "backpack": 1, + "surprised": 1, + "drinking straw": 1, + "drink": 1, + "orange background": 1, + "drinking": 1, + "head fins": 1, + "constricted pupils": 1, + "vaporeon": 1, + "pink eyes": 1, + "character name": 1, + "dated": 1, + "highleg": 1, + "black shorts": 1, + "outstretched arm": 1, + "mouse ears": 1, + "mouse tail": 1, + "split mouth": 1, + "mouse girl": 1, + "grey fur": 1, + "yellow leotard": 1, + "black pantyhose": 1, + "watermark": 1, + "steam": 1, + "patreon username": 1, + "sports bra": 1, + "steaming body": 1, + "torn pantyhose": 1, + "stick": 1, + "white gloves": 1, + "bodysuit": 1, + "cropped legs": 1, + "hairclip": 1, + "pants": 1, + "fingerless gloves": 1, + "thick eyebrows": 1, + "all fours": 1, + ":t": 1, + "pout": 1, + "link": 1, + "princess zelda": 1, + "wings": 1, + "choker": 1, + "elbow gloves": 1, + "thigh boots": 1, + "black choker": 1, + "bat wings": 1, + "black wings": 1, + "anus": 1, + "own hands together": 1, + "dog": 1, + "isabelle (animal crossing)": 1, + "bent over": 1, + "kiss": 1, + "hands on own knees": 1, + "kissing cheek": 1, + "detached sleeves": 1, + "standing split": 1, + "white hair": 1, + "cat ears": 1, + "armpits": 1, + "cat tail": 1, + "cat girl": 1, + "joints": 1, + "doll joints": 1, + "v-shaped eyebrows": 1, + "leaf": 1, + "breath": 1, + "anger vein": 1, + "angry": 1, + "toeless legwear": 1, + "raccoon ears": 1, + "raccoon tail": 1, + "annoyed": 1, + "leaf on head": 1, + "green panties": 1, + "=3": 1, + "green bra": 1, + "no humans": 1, + "arthropod girl": 1, + "shirt lift": 1, + "lifted by another": 1, + "black leotard": 1, + "grabbing own ass": 1, + "blood": 1, + "fake animal ears": 1, + "shiny hair": 1, + "shiny skin": 1, + "skindentation": 1, + "pink bow": 1, + "pink panties": 1, + "white skin": 1, + "blue theme": 1, + "top-down bottom-up": 1, + "string panties": 1, + "jack-o' challenge": 1, + "blue fur": 1, + "blue sclera": 1, + "penis": 1, + "sex": 1, + "erection": 1, + "brown background": 1, + "legs together": 1, + "yellow dress": 1, + "yellow skirt": 1, + "covered nipples": 1, + "clothing cutout": 1, + "blue leotard": 1, + "heart cutout": 1, + "wrestling outfit": 1, + "sweater": 1, + "sideboob": 1, + "turtleneck": 1, + "back": 1, + "ribbed sweater": 1, + "butt crack": 1, + "meme attire": 1, + "backless outfit": 1, + "turtleneck sweater": 1, + "backless dress": 1, + "virgin killer sweater": 1, + "black skin": 1, + "naked sweater": 1, + "yellow skin": 1, + "striped thighhighs": 1, + "object insertion": 1, + "clitoris": 1, + "spaghetti strap": 1, + "vaginal object insertion": 1, + "ribbon": 1, + "pleated skirt": 1, + "collared shirt": 1, + "flat chest": 1, + "orange eyes": 1, + "legs": 1, + "kneehighs": 1, + "outline": 1, + "yellow sclera": 1, + "clothed pokemon": 1, + "black fur": 1, + "grin": 1, + "bracelet": 1, + "blue dress": 1, + "squatting": 1, + "genderswap": 1, + "strapless dress": 1, + "genderswap (mtf)": 1, + "spikes": 1, + "hands on hips": 1, + "blue footwear": 1, + "blue thighhighs": 1, + "spiked bracelet": 1, + "super crown": 1, + "spiked shell": 1, + "princess peach": 1, + "bowsette": 1, + "mario": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "Diives_Style": { + "n_repeats": 10, + "img_count": 43 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 430, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"Diives_Style\": {\"1girl\": 29, \"solo\": 20, \"long hair\": 23, \"looking at viewer\": 21, \"blue eyes\": 11, \"blonde hair\": 7, \"large breasts\": 8, \"thighhighs\": 17, \"twintails\": 4, \"sitting\": 7, \"nipples\": 11, \"ass\": 14, \"thighs\": 7, \"nude\": 7, \"sweat\": 10, \"looking back\": 9, \"from behind\": 8, \"wet\": 1, \"mask\": 2, \"thick thighs\": 5, \"huge ass\": 1, \"hair pulled back\": 2, \"domino mask\": 2, \"wrestling ring\": 2, \"rainbow mika\": 2, \"blush\": 30, \"smile\": 22, \"multiple girls\": 16, \"skirt\": 10, \"simple background\": 27, \"shirt\": 8, \"red eyes\": 14, \"white background\": 19, \"dress\": 8, \"2girls\": 12, \"animal ears\": 26, \"closed mouth\": 11, \"underwear\": 12, \"standing\": 21, \"panties\": 9, \"tail\": 28, \"full body\": 18, \"white shirt\": 4, \"short sleeves\": 5, \"open clothes\": 2, \"sleeveless\": 5, \"socks\": 8, \"artist name\": 23, \"signature\": 13, \"miniskirt\": 3, \"yuri\": 8, \"rabbit ears\": 12, \"white panties\": 5, \"black dress\": 1, \"animal ear fluff\": 3, \"fox ears\": 3, \"pokemon (creature)\": 15, \"sleeveless shirt\": 5, \"no panties\": 2, \"fox tail\": 3, \"blush stickers\": 9, \"clothes pull\": 1, \"short dress\": 4, \"half-closed eyes\": 8, \"happy\": 9, \"fox girl\": 3, \"rabbit tail\": 10, \"furry\": 27, \"freckles\": 1, \"fur collar\": 1, \"rabbit girl\": 9, \"furry female\": 26, \"alternate color\": 2, \"body fur\": 17, \"skirt pull\": 1, \"white fur\": 5, \"animal nose\": 14, \"snout\": 3, \"brown fur\": 5, \"yellow fur\": 4, \"furry with furry\": 8, \"braixen\": 2, \"open mouth\": 21, \"brown hair\": 5, \"yellow eyes\": 1, \"ponytail\": 6, \":d\": 1, \"horns\": 3, \"shoes\": 6, \"pointy ears\": 4, \"white thighhighs\": 3, \"colored skin\": 10, \"demon girl\": 1, \"crown\": 2, \"demon horns\": 1, \"demon tail\": 2, \"between legs\": 1, \"happy birthday\": 1, \"oni horns\": 1, \"buruma\": 2, \"hand between legs\": 1, \"red skin\": 1, \"skin-covered horns\": 1, \"black hair\": 9, \"bare shoulders\": 14, \"very long hair\": 6, \"glasses\": 3, \"shorts\": 2, \"teeth\": 16, \"tongue\": 8, \"blunt bangs\": 3, \"hand on hip\": 3, \"short shorts\": 2, \"shadow\": 1, \"sunglasses\": 1, \"sharp teeth\": 3, \"eyewear on head\": 1, \"strap slip\": 1, \"red-framed eyewear\": 1, \"tinted eyewear\": 1, \"multicolored skin\": 2, \"long tongue\": 1, \"two-tone skin\": 2, \"bubble blowing\": 2, \"chewing gum\": 3, \"red-tinted eyewear\": 1, \"extra mouth\": 4, \"tongue out\": 6, \"crossed legs\": 3, \"gloves\": 7, \"1boy\": 4, \"bow\": 7, \"holding\": 3, \"pink hair\": 4, \"hetero\": 3, \"heart\": 13, \"sidelocks\": 6, \"hairband\": 2, \"small breasts\": 10, \"boots\": 3, \"lying\": 3, \"indoors\": 2, \"hand up\": 6, \"on back\": 3, \"looking at another\": 6, \"aqua eyes\": 4, \"english text\": 18, \"crop top\": 4, \"saliva\": 4, \"nose blush\": 3, \"fangs\": 2, \"white footwear\": 2, \"girl on top\": 2, \"motion lines\": 2, \"bow panties\": 2, \"bright pupils\": 3, \"colored sclera\": 10, \"white pupils\": 4, \"yellow shirt\": 3, \"sitting on person\": 2, \"talking\": 6, \"femdom\": 3, \"furry male\": 2, \"interspecies\": 7, \"jaggy lines\": 2, \"panties removed\": 2, \"flat color\": 4, \"patreon logo\": 3, \"two-tone fur\": 7, \"furry with non-furry\": 3, \"holding panties\": 2, \"animal feet\": 3, \"buck teeth\": 8, \"rabbit boy\": 3, \"pink fur\": 3, \"sylveon\": 3, \"hair ornament\": 5, \"navel\": 13, \"medium breasts\": 13, \"green eyes\": 6, \"collarbone\": 3, \"cowboy shot\": 4, \"black thighhighs\": 2, \"orange hair\": 4, \"vest\": 1, \"fingernails\": 1, \"no bra\": 1, \"makeup\": 1, \"red shirt\": 1, \"claws\": 3, \"pelvic curtain\": 1, \"eyeshadow\": 1, \"long fingernails\": 1, \"sharp fingernails\": 1, \"red vest\": 1, \"eyeliner\": 1, \"tiger ears\": 2, \"hand on own thigh\": 1, \"tiger tail\": 2, \"loincloth\": 1, \"open vest\": 1, \"red eyeshadow\": 1, \"half-closed eye\": 1, \"tiger girl\": 2, \"orange fur\": 3, \"multicolored fur\": 2, \"pantyhose\": 6, \"red hair\": 1, \"torn clothes\": 2, \"pussy juice\": 3, \"topless\": 2, \"underwear only\": 3, \"fingering\": 1, \"black sclera\": 3, \"red fur\": 2, \"lopunny\": 5, \"bandaid\": 2, \"poke ball\": 1, \"bandaid on face\": 1, \"poke ball (basic)\": 1, \"bandaid on nose\": 1, \"kirlia\": 2, \"hair bow\": 3, \"pussy\": 6, \"huge breasts\": 1, \"completely nude\": 1, \"red background\": 1, \"green bow\": 1, \"lactation\": 1, \"striped tail\": 2, \"closed eyes\": 5, \"bra\": 3, \"speech bubble\": 4, \"multiple views\": 4, \"embarrassed\": 4, \"^^^\": 1, \"wide hips\": 5, \"arrow (symbol)\": 3, \"pregnant\": 1, \"multi-tied hair\": 1, \"purple eyes\": 3, \"braid\": 2, \"one eye closed\": 7, \"twin braids\": 1, \"sex toy\": 2, \"vibrator\": 1, \"inverted nipples\": 1, \"remote control vibrator\": 1, \"bowtie\": 2, \"black skirt\": 1, \"monster girl\": 1, \"yellow bow\": 1, \"antennae\": 1, \"yellow bowtie\": 1, \"fang\": 2, \"spread legs\": 5, \"leotard\": 8, \"strapless\": 2, \"covered navel\": 2, \":3\": 2, \"cameltoe\": 4, \"dog ears\": 4, \"dog tail\": 4, \"dog girl\": 4, \"hand to own mouth\": 2, \"green hair\": 4, \"looking to the side\": 1, \"white leotard\": 1, \"green skin\": 2, \"white eyes\": 1, \"spoken blush\": 1, \"3girls\": 3, \"school uniform\": 1, \"comic\": 2, \"bag\": 1, \"cup\": 1, \"backpack\": 1, \"surprised\": 1, \"drinking straw\": 1, \"wide-eyed\": 2, \"drink\": 1, \"blue skin\": 2, \"orange background\": 1, \"drinking\": 1, \"head fins\": 1, \"constricted pupils\": 1, \"vaporeon\": 1, \"pink eyes\": 1, \"6+girls\": 3, \"glaceon\": 2, \"short hair\": 4, \"cleavage\": 6, \"midriff\": 2, \"black eyes\": 5, \"character name\": 1, \"arm up\": 3, \"arms up\": 2, \"dated\": 1, \"hands up\": 3, \"highleg\": 1, \"black shorts\": 1, \"leg up\": 5, \"standing on one leg\": 4, \"outstretched arm\": 1, \"mouse ears\": 1, \"mouse tail\": 1, \"split mouth\": 1, \"topknot\": 5, \"mouse girl\": 1, \"grey fur\": 1, \"yellow leotard\": 1, \"stomach\": 4, \"black pantyhose\": 1, \"watermark\": 1, \"looking down\": 3, \"steam\": 1, \"patreon username\": 1, \"sports bra\": 1, \"steaming body\": 1, \"torn pantyhose\": 1, \"high heels\": 3, \"crossed arms\": 2, \"fire\": 2, \"personification\": 2, \"stick\": 1, \"shiny\": 4, \"white gloves\": 1, \"bodysuit\": 1, \"cropped legs\": 1, \"hair tie\": 3, \"hairclip\": 1, \"pants\": 1, \"fingerless gloves\": 1, \"thick eyebrows\": 1, \"all fours\": 1, \":t\": 1, \"pout\": 1, \"link\": 1, \"princess zelda\": 1, \"wings\": 1, \"choker\": 1, \"elbow gloves\": 1, \"thigh boots\": 1, \"black choker\": 1, \"bat wings\": 1, \"black wings\": 1, \"hair between eyes\": 2, \"blue hair\": 4, \"purple hair\": 3, \"uncensored\": 3, \"anus\": 1, \"heterochromia\": 2, \"yellow background\": 2, \"split\": 2, \"barefoot\": 2, \"own hands together\": 1, \"dog\": 1, \"isabelle (animal crossing)\": 1, \"leaning forward\": 2, \"bent over\": 1, \"kiss\": 1, \"light blush\": 2, \"hands on own knees\": 1, \"kissing cheek\": 1, \"detached sleeves\": 1, \"standing split\": 1, \"white hair\": 1, \"cat ears\": 1, \"armpits\": 1, \"cat tail\": 1, \"cat girl\": 1, \"joints\": 1, \"doll joints\": 1, \"v-shaped eyebrows\": 1, \"leaf\": 1, \"breath\": 1, \"anger vein\": 1, \"angry\": 1, \"toeless legwear\": 1, \"raccoon ears\": 1, \"raccoon tail\": 1, \"annoyed\": 1, \"leaf on head\": 1, \"green panties\": 1, \"=3\": 1, \"green bra\": 1, \"no humans\": 1, \"arthropod girl\": 1, \"jewelry\": 3, \"earrings\": 3, \"striped\": 2, \"belt\": 2, \"clothes lift\": 2, \"pubic hair\": 2, \"ass visible through thighs\": 2, \"female pubic hair\": 2, \"shirt lift\": 1, \"piercing\": 2, \"skirt lift\": 2, \"lifted by another\": 1, \"clitoral hood\": 2, \"furrification\": 2, \"wrist cuffs\": 2, \"playboy bunny\": 2, \"black leotard\": 1, \"ass grab\": 2, \"grabbing own ass\": 1, \"blood\": 1, \"fake animal ears\": 1, \"shiny hair\": 1, \"shiny skin\": 1, \"skindentation\": 1, \"pink bow\": 1, \"pink panties\": 1, \"white skin\": 1, \"blue theme\": 1, \"top-down bottom-up\": 1, \"string panties\": 1, \"jack-o' challenge\": 1, \"blue fur\": 1, \"blue sclera\": 1, \"penis\": 1, \"sex\": 1, \"vaginal\": 2, \"erection\": 1, \"drooling\": 2, \"brown background\": 1, \"legs together\": 1, \"yellow dress\": 1, \"yellow skirt\": 1, \"covered nipples\": 1, \"clothing cutout\": 1, \"blue leotard\": 1, \"heart cutout\": 1, \"wrestling outfit\": 1, \"sweater\": 1, \"sideboob\": 1, \"turtleneck\": 1, \"back\": 1, \"ribbed sweater\": 1, \"butt crack\": 1, \"meme attire\": 1, \"backless outfit\": 1, \"turtleneck sweater\": 1, \"backless dress\": 1, \"virgin killer sweater\": 1, \"black skin\": 1, \"naked sweater\": 1, \"yellow skin\": 1, \"striped thighhighs\": 1, \"object insertion\": 1, \"clitoris\": 1, \"spaghetti strap\": 1, \"vaginal object insertion\": 1, \"ribbon\": 1, \"pleated skirt\": 1, \"collared shirt\": 1, \"flat chest\": 1, \"orange eyes\": 1, \"legs\": 1, \"kneehighs\": 1, \"outline\": 1, \"yellow sclera\": 1, \"clothed pokemon\": 1, \"black fur\": 1, \"grin\": 1, \"bracelet\": 1, \"blue dress\": 1, \"squatting\": 1, \"genderswap\": 1, \"strapless dress\": 1, \"genderswap (mtf)\": 1, \"spikes\": 1, \"hands on hips\": 1, \"blue footwear\": 1, \"blue thighhighs\": 1, \"spiked bracelet\": 1, \"super crown\": 1, \"spiked shell\": 1, \"princess peach\": 1, \"bowsette\": 1, \"mario\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [320, 704], \"count\": 10}, \"1\": {\"resolution\": [384, 640], \"count\": 70}, \"2\": {\"resolution\": [448, 576], \"count\": 130}, \"3\": {\"resolution\": [512, 512], \"count\": 90}, \"4\": {\"resolution\": [576, 448], \"count\": 50}, \"5\": {\"resolution\": [640, 384], \"count\": 70}, \"6\": {\"resolution\": [768, 320], \"count\": 10}}, \"mean_img_ar_error\": 0.06629716380296799}, \"subsets\": [{\"img_count\": 43, \"num_repeats\": 10, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"Diives_Style\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0005", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "107", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "2150", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "b0c91a8a93ab63b8b513046c2e2181a4ce78b83367ee7e26354ba9e018ea102f", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "215", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "Diives_Style", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "66f58dbb", + "ss_sd_scripts_commit_hash": "e6ad3cbc66130fdc3bf9ecd1e0272969b1d613f7", + "ss_seed": "42", + "ss_session_id": "2538447589", + "ss_steps": "2150", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1698337879.5300426", + "ss_training_started_at": "1698336618.9540133", + "ss_unet_lr": "0.0005", + "ss_v2": "False", + "sshs_legacy_hash": "de2f2560", + "sshs_model_hash": "5b0828f67289349b89d47d59aa6cdbd07edb6c2ccacf0f9ed03991243467d54e" +} \ No newline at end of file diff --git a/Styles/39/diives_style-159693.txt b/Styles/39/diives_style-159693.txt new file mode 100644 index 0000000000000000000000000000000000000000..9e1ab4cc7a266e39cc2573b09b4c8600b208be1b --- /dev/null +++ b/Styles/39/diives_style-159693.txt @@ -0,0 +1,753 @@ +Link:https://civitai.com/models/185388/diives-artist-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Suggested weight: 0.8 to 1.0 +I recommend trying with weight 1 and if its too weird lower the weight. +Please support the artist by checking out their pagehttps://twitter.com/diivesart +Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style +Trained on: 50 images +Training Model: AnyLoRA_noVae_fp16-pruned +flip_aug: True +Num of Repeats: 10 +Unit is Epochs or Steps: Epochs +Number of Epochs or Steps: 10 +Training Batch Size: 2 +Network Dim: 16 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:, ((masterpiece,best quality)), absurdres, , aairida, short hair, red hairband, neck ring, collar, strapless shirt, red shirt, bracelet, sash, waist cape, white shorts, bare legs, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, + Negative Prompt:EasyNegativeV2, bad-hands-5, blurry, bad anatomy, long legs, poorly detailed, (worst quality, low quality:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img2: + Prompt:, ((masterpiece,best quality)), absurdres, , serena \(pokemon\), 1girl, long hair, blue eyes, thighhighs, long hair, hat, jewelry, bracelet, black thighhighs, collared shirt, pleated skirt, red skirt, sleeveless, high-waist skirt, sleeveless shirt, eyelashes, pink headwear, black shirt, eyewear on headwear, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img3: + Prompt:, ((masterpiece,best quality)), absurdres, , gloria \(pokemon\), brown hair, solo, backpack, brown eyes, tam o' shanter, grey cardigan, pink dress, short hair, green socks, socks, brown bag, bob cut, bangs, long sleeves, collared dress, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img4: + Prompt:, ((masterpiece,best quality)), absurdres, , hmmarnie, aqua eyes, black choker, red ribbon, pink dress, jewelry, black jacket, open clothes, long sleeves, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img5: + Prompt:, ((masterpiece,best quality)), absurdres, (finely detailed beautiful eyes: 1.2), phyami, yaminor, 1girl, solo, blonde hair, long hair, red eyes, thigh strap, very long hair, detached sleeves, black dress, ,contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img6: + Prompt:, ((masterpiece,best quality)), absurdres, (finely detailed beautiful eyes: 1.2), phyami, yaminor, 1girl, solo, blonde hair, long hair, red eyes, thigh strap, very long hair, detached sleeves, black dress, ,contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img7: + Prompt:, (masterpiece, best quality), 1girl, princess daisy, blue eyes, long hair, orange hair, crown, daisy, dress, flower, gem, gloves, orange dress, puffy short sleeves, puffy sleeves, short sleeves, white gloves, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img8: + Prompt:, ((masterpiece,best quality)), absurdres, , Caulifla_DB, bare shoulders, midriff, purple baggy pants, pink tube top, black bracelets,solo, smiling, smug, looking at viewer, cowboy shot, cinematic composition, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img9: + Prompt:, ((masterpiece,best quality)), absurdres, , Prinz_Eugen_Azur_Lane,thighhighs, , solo, smiling, looking at viewer, cowboy shot, cinematic composition, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img10: + Prompt:, ((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185388, + "name": "Diives (Artist Style)", + "description": "

Suggested weight: 0.8 to 1.0

I recommend trying with weight 1 and if its too weird lower the weight.

Please support the artist by checking out their page🔞: https://twitter.com/diivesart

Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style

Trained on: 50 images

Training Model: AnyLoRA_noVae_fp16-pruned

flip_aug: True

Num of Repeats: 10

Unit is Epochs or Steps: Epochs

Number of Epochs or Steps: 10

Training Batch Size: 2

Network Dim: 16

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Rent", + "allowDerivatives": true, + "allowDifferentLicense": false, + "stats": { + "downloadCount": 0, + "favoriteCount": 0, + "commentCount": 0, + "ratingCount": 0, + "rating": 0, + "tippedAmountCount": 93467 + }, + "creator": { + "username": "CitronLegacy", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb17dc3d-5b4c-4c72-a8a4-bf88b02b2ef7/width=96/CitronLegacy.jpeg" + }, + "tags": [ + "anime", + "style", + "art style", + "styles" + ], + "modelVersions": [ + { + "id": 208130, + "modelId": 185388, + "name": "v1.0", + "createdAt": "2023-11-01T14:30:27.619Z", + "updatedAt": "2023-11-01T14:44:17.803Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 159693, + "sizeKB": 18562.201171875, + "name": "Diives_Style.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T14:35:43.178Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "04C23EF895", + "SHA256": "04C23EF895C52DC4ACFB3F3185D2817E01596808FECB43935FA155E782219668", + "CRC32": "F1F77589", + "BLAKE3": "CD453987FD7356DC9615B7411C57C351E8A70FA3FB3C0C286477C1745101DA97" + }, + "downloadUrl": "https://civitai.com/api/download/models/208130", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9100cd09-9719-42b8-abab-1e6de6057ff6/width=450/3311591.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UNL4B7000y%d?@#kpdVY?wRORpR5ICJA%gn$", + "type": "image", + "metadata": { + "hash": "UNL4B7000y%d?@#kpdVY?wRORpR5ICJA%gn$", + "size": 959839, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 2794095324, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:bad-hands-5": "aa7651be15", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegativeV2": "339cc9210f" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , aairida, short hair, red hairband, neck ring, collar, strapless shirt, red shirt, bracelet, sash, waist cape, white shorts, bare legs, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegativeV2, bad-hands-5, blurry, bad anatomy, long legs, poorly detailed, (worst quality, low quality:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/29c7a309-9810-4f46-b6c8-73d314f49356/width=450/3311593.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "UCHnEMD*0M.600xuHrRPh2%2^*E200adP9Rm", + "type": "image", + "metadata": { + "hash": "UCHnEMD*0M.600xuHrRPh2%2^*E200adP9Rm", + "size": 714899, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 2754799927, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:serena_v1": "8de68afb42", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , serena \\(pokemon\\), 1girl, long hair, blue eyes, thighhighs, long hair, hat, jewelry, bracelet, black thighhighs, collared shirt, pleated skirt, red skirt, sleeveless, high-waist skirt, sleeveless shirt, eyelashes, pink headwear, black shirt, eyewear on headwear, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 1 + }, + { + "name": "serena_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8d1cc3d7-445a-423b-89b3-55e1cf02f888/width=450/3311595.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UjI#M-t8TKtRKjtRkDt7~qR*tRogR:jFt6W:", + "type": "image", + "metadata": { + "hash": "UjI#M-t8TKtRKjtRkDt7~qR*tRogR:jFt6W:", + "size": 1121400, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 1246978132, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , gloria \\(pokemon\\), brown hair, solo, backpack, brown eyes, tam o' shanter, grey cardigan, pink dress, short hair, green socks, socks, brown bag, bob cut, bangs, long sleeves, collared dress, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3bacc0f9-8045-47f3-9791-e52fd193ade6/width=450/3311597.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UKHnpms.F{?a3stP-;sCZ;sAV@OB02%Lawv~", + "type": "image", + "metadata": { + "hash": "UKHnpms.F{?a3stP-;sCZ;sAV@OB02%Lawv~", + "size": 1076786, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 4202152826, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:marnie_v1": "bf82fbe350", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , hmmarnie, aqua eyes, black choker, red ribbon, pink dress, jewelry, black jacket, open clothes, long sleeves, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "name": "marnie_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7171eca8-528e-4048-8421-76f671c68a8b/width=450/3311598.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UBI|?c06DN-T1Fv#0B_0$n~l02Ef0f%J_14=", + "type": "image", + "metadata": { + "hash": "UBI|?c06DN-T1Fv#0B_0$n~l02Ef0f%J_14=", + "size": 773282, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 3081911351, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:yami-v1": "f5cf095668", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, (finely detailed beautiful eyes: 1.2), phyami, yaminor, 1girl, solo, blonde hair, long hair, red eyes, thigh strap, very long hair, detached sleeves, black dress, ,contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a88e6d13-5037-4ddc-925c-51d744240f54/width=450/3311599.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "USK-2gE8_3-j~nsrNLNExtRPE3WTaNRhM}xa", + "type": "image", + "metadata": { + "hash": "USK-2gE8_3-j~nsrNLNExtRPE3WTaNRhM}xa", + "size": 947900, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 2320143657, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:yami-v1": "f5cf095668", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, (finely detailed beautiful eyes: 1.2), phyami, yaminor, 1girl, solo, blonde hair, long hair, red eyes, thigh strap, very long hair, detached sleeves, black dress, ,contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f6631fc4-97d0-4622-b016-6eabf0c940fe/width=450/3311601.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UYIqH2=^YkO[SlbbT2R+$*rVS*NLRQR*IWaK", + "type": "image", + "metadata": { + "hash": "UYIqH2=^YkO[SlbbT2R+$*rVS*NLRQR*IWaK", + "size": 840726, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 1461912869, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "lora:princessdaisy-lora-nochekaiser": "766dd39282" + }, + "prompt": ", (masterpiece, best quality), 1girl, princess daisy, blue eyes, long hair, orange hair, crown, daisy, dress, flower, gem, gloves, orange dress, puffy short sleeves, puffy sleeves, short sleeves, white gloves,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a49d416d-f9a0-4630-ad6a-23eef08d89e1/width=450/3311602.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UEFOp2=|0|K1%J-:t9r=0J-.~Aw4^j-AaJNH", + "type": "image", + "metadata": { + "hash": "UEFOp2=|0|K1%J-:t9r=0J-.~Aw4^j-AaJNH", + "size": 941900, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 915027970, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "lora:Caulifla_DB_v3_Anime": "791554bbd1", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Caulifla_DB, bare shoulders, midriff, purple baggy pants, pink tube top, black bracelets,solo, smiling, smug, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 1 + }, + { + "name": "Caulifla_DB_v3_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3c0592ac-d1f9-4208-bd9b-5ec5cb9b82aa/width=450/3311604.jpeg", + "nsfw": "Mature", + "width": 768, + "height": 1152, + "hash": "UDH^-o4U0d5+^iM{O8D=_L9c9F$x01-;kUoe", + "type": "image", + "metadata": { + "hash": "UDH^-o4U0d5+^iM{O8D=_L9c9F$x01-;kUoe", + "size": 1038230, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 1039287932, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "lora:Prinz_Eugen_Azur_Lane": "b30248d451", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Prinz_Eugen_Azur_Lane,thighhighs, , solo, smiling, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Prinz_Eugen_Azur_Lane", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/af64a576-e98d-4285-81a7-2733800a60a0/width=450/3311607.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "USH_lk^jP;E,GdIU-=tmnpNbn4R79ct6$Pj=", + "type": "image", + "metadata": { + "hash": "USH_lk^jP;E,GdIU-=tmnpNbn4R79ct6$Pj=", + "size": 1056621, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 773052944, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:ahri_v10": "bfd7d14325", + "embed:badhandv4": "5e40d722fc", + "lora:Diives_Style": "04c23ef895", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Diives_Style", + "type": "lora", + "weight": 0.8 + }, + { + "name": "ahri_v10", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208130" + } + ] +} +---------------------------- diff --git a/Styles/4/64x64-10-160106-metadata.json b/Styles/4/64x64-10-160106-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..0b1ffc706c84d9f3ace6c3a60f37dc1ea5f54ea4 --- /dev/null +++ b/Styles/4/64x64-10-160106-metadata.json @@ -0,0 +1,64 @@ +{ + "ss_sd_model_name": "sd-v1-5-pruned-noema-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "1000", + "ss_tag_frequency": { + "dataset": { + "64x64": 1000 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 1, + "img_count": 1000 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 1000, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dataset\": {\"64x64\": 1000}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 512], \"count\": 1000}}, \"mean_img_ar_error\": 0.0}, \"subsets\": [{\"img_count\": 1000, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": \"64x64\", \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0005", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "250", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "5000", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "7d8dc5577b85ca48fb12957a1fafee7a59aa380784f0e4f0a3f80f64449c0efa", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "500", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "64x64", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "25d4f007", + "ss_sd_scripts_commit_hash": "9a67e0df390033a89f17e70df5131393692c2a55", + "ss_seed": "42", + "ss_session_id": "3078804175", + "ss_steps": "5000", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1698860142.6852803", + "ss_training_started_at": "1698856924.924458", + "ss_unet_lr": "0.0005", + "ss_v2": "False", + "sshs_legacy_hash": "de2f2560", + "sshs_model_hash": "4c9cbf5b899204985cbe7a3931109a11a3b9e302fd15b11930d6e56b3c7b3bd1" +} \ No newline at end of file diff --git a/Styles/4/64x64-10-160106.txt b/Styles/4/64x64-10-160106.txt new file mode 100644 index 0000000000000000000000000000000000000000..9ae2db0758f90e13935d12a4c5150be21b3d4942 --- /dev/null +++ b/Styles/4/64x64-10-160106.txt @@ -0,0 +1,429 @@ +Link:https://civitai.com/models/185743/8bitdiffuser-64x-or-a-perfect-pixel-art-model +Version:v1.0 +Base Model:SD 1.5 +Keywords:pixel art +--------DESCRIPTION--------- + +This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each +This page is for the 64x model! + +When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via perfect neighbor, but i have had the BEST results when using astropulse's K-centroid downsampling method, it is completely free and can run even on lower end devices. the other method i recommend is the old reliable billinear downsampling +However if you are generating images at a scale HIGHER then 512x, the pixel scale will still stay the same, for example if you generate the image at 1024x with the 64x model, you will need to scale it down to 128x (1024/512=2 , 64*2=128) for the pixel art results. +the 64x model, while a bit worse at generating 30-50 pixels, still operates greatly when downsampling images to native size. + +best settings for this LoRA is: +Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling) +CFG scale: 7-14 +LoRA scale: 0.75-1.5(the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy) +Sampling method: DPM++ 2M SDE karras +Recommended prompt: "pixelart" (Add these to the start every generation, this isn't "required" but I found it gets the best results) +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img3: + Prompt:pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:40, CFG:7, Clip Skip:0, Model:anyloraCheckpoint_novaeFp16, Model Hash:00bafa0e71 + +img7: + Prompt:pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:40, CFG:7, Clip Skip:0, Model:cuteyukimixAdorable_specialchapter, Model Hash:53d7264d1c + +img8: + Prompt:pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, from below, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:40, CFG:7, Clip Skip:0, Model:anyloraCheckpoint_novaeFp16, Model Hash:00bafa0e71 + +img9: + Prompt:pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body + Negative Prompt: + Size:512x512, Sampler:DPM++ 2M Karras, Steps:22, CFG:7, Clip Skip:0, Model:cuteyukimixAdorable_specialchapter, Model Hash:53d7264d1c + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185743, + "name": "8bitdiffuser 64x | a perfect pixel art model", + "description": "

This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each

This page is for the 64x model!

When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via perfect neighbor, but i have had the BEST results when using astropulse's K-centroid downsampling method, it is completely free and can run even on lower end devices. the other method i recommend is the old reliable billinear downsampling

However if you are generating images at a scale HIGHER then 512x, the pixel scale will still stay the same, for example if you generate the image at 1024x with the 64x model, you will need to scale it down to 128x (1024/512=2 , 64*2=128) for the pixel art results.

  • the 64x model, while a bit worse at generating 30-50 pixels, still operates greatly when downsampling images to native size.

best settings for this LoRA is:

  • Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling)

  • CFG scale: 7-14

  • LoRA scale: 0.75-1.5 (the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy)

  • Sampling method: DPM++ 2M SDE karras

  • Recommended prompt: \"pixelart\" (Add these to the start every generation, this isn't \"required\" but I found it gets the best results)

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 53, + "favoriteCount": 18, + "commentCount": 0, + "ratingCount": 1, + "rating": 1, + "tippedAmountCount": 58676 + }, + "creator": { + "username": "extraordicord", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca69a7a1-3c2b-42c7-bf40-d5c453df4e31/width=96/extraordicord.jpeg" + }, + "tags": [ + "anime", + "sexy", + "pixel", + "style", + "girls", + "pixelart", + "pixel perfect", + "pixels" + ], + "modelVersions": [ + { + "id": 208554, + "modelId": 185743, + "name": "v1.0", + "createdAt": "2023-11-01T21:44:05.017Z", + "updatedAt": "2023-11-01T22:34:26.667Z", + "trainedWords": [ + "pixel art" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 53, + "ratingCount": 1, + "rating": 1 + }, + "files": [ + { + "id": 160106, + "sizeKB": 18543.703125, + "name": "64x64-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T22:58:40.544Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "3285B6979B", + "SHA256": "3285B6979B4690D464CBE27061F9571FA39EFACF483FEEEDDE99375B8D90F29A", + "CRC32": "015FC738", + "BLAKE3": "B2BA65A12E398C2D34C777E7610BFA2E3C3789E96F32F0FDB9D7312D892C2529" + }, + "downloadUrl": "https://civitai.com/api/download/models/208554", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fa9a009e-68d0-4365-9ba9-6fda1b6c9ffb/width=450/3320731.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UHJHR4~q01-p00H?=xD*R:xv?H$%-Vs9IU%M", + "type": "image", + "metadata": { + "hash": "UHJHR4~q01-p00H?=xD*R:xv?H$%-Vs9IU%M", + "size": 13087, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/68a0490d-4ac8-42f8-b86e-f64f9f300213/width=450/3320736.jpeg", + "nsfw": "None", + "width": 6400, + "height": 1920, + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "type": "image", + "metadata": { + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "size": 191537, + "width": 6400, + "height": 1920 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/77a07dbb-d2b3-4940-8f75-10399a6589f4/width=450/3320733.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UtMaCgWV~Wt7yXWVSwofnPj[wJoLt6ayW-n%", + "type": "image", + "metadata": { + "hash": "UtMaCgWV~Wt7yXWVSwofnPj[wJoLt6ayW-n%", + "size": 280822, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 1895353110, + "Model": "anyloraCheckpoint_novaeFp16", + "steps": 40, + "hashes": { + "model": "00bafa0e71" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "00bafa0e71", + "name": "anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + }, + { + "hash": "51389dc686f1", + "name": "HatsuneMiku", + "type": "lora", + "weight": null + } + ], + "Model hash": "00bafa0e71", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Model 2": "HatsuneMiku(51389dc686f1)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight A 2": "0.95", + "AddNet Weight B 1": "1.25", + "AddNet Weight B 2": "0.95" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51b3c4ed-800c-4ae9-880b-165f68f51454/width=450/3320734.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 512, + "hash": "UWL:_%Md_NNf~VD$XAs;s+xZRkM{s:x]jXs;", + "type": "image", + "metadata": { + "hash": "UWL:_%Md_NNf~VD$XAs;s+xZRkM{s:x]jXs;", + "size": 16338, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/76fb9f78-8d21-4ebe-a217-639bad3857fd/width=450/3320735.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "URLD[QxalBt8^*jZ9aWC%~WX~WofIpWX%1s:", + "type": "image", + "metadata": { + "hash": "URLD[QxalBt8^*jZ9aWC%~WX~WofIpWX%1s:", + "size": 14653, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc8485b9-7257-44d0-b4eb-fe3f0758748e/width=450/3320730.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UOGIAi^*019ZD*t7?GR*0KIV%Lxu~VWB4:jZ", + "type": "image", + "metadata": { + "hash": "UOGIAi^*019ZD*t7?GR*0KIV%Lxu~VWB4:jZ", + "size": 12755, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/47583c86-4791-4188-bb7d-185861babaa4/width=450/3320728.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UUPi|?x]_NxH?uofS2WU%hRjaJoyVsWBWBWC", + "type": "image", + "metadata": { + "hash": "UUPi|?x]_NxH?uofS2WU%hRjaJoyVsWBWBWC", + "size": 242537, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 2735777651, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 40, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53821b86-91eb-4e45-8900-579a612c60af/width=450/3320729.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UKNwH4tR?GxaUGRj.Sjvk?s:=KbY~Coyzpen", + "type": "image", + "metadata": { + "hash": "UKNwH4tR?GxaUGRj.Sjvk?s:=KbY~Coyzpen", + "size": 300963, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 1828856850, + "Model": "anyloraCheckpoint_novaeFp16", + "steps": 40, + "hashes": { + "model": "00bafa0e71" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, from below, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "00bafa0e71", + "name": "anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + }, + { + "hash": "51389dc686f1", + "name": "HatsuneMiku", + "type": "lora", + "weight": null + } + ], + "Model hash": "00bafa0e71", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Model 2": "HatsuneMiku(51389dc686f1)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight A 2": "0.9", + "AddNet Weight B 1": "1.25", + "AddNet Weight B 2": "0.9" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a77c3cd-2fd4-4cc5-a480-3055d72e2e77/width=450/3320732.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UtPsbdof?]t7-;WUM{s:XRjsnia}kUaysqj]", + "type": "image", + "metadata": { + "hash": "UtPsbdof?]t7-;WUM{s:XRjsnia}kUaysqj]", + "size": 203430, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 654289543, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 22, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208554" + } + ] +} +---------------------------- diff --git a/Styles/40/disgaea-nai-lycoris-88964-metadata.json b/Styles/40/disgaea-nai-lycoris-88964-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/Styles/40/disgaea-nai-lycoris-88964.txt b/Styles/40/disgaea-nai-lycoris-88964.txt new file mode 100644 index 0000000000000000000000000000000000000000..84a82040e047e13662043b87e016f3c4fa3a33c2 --- /dev/null +++ b/Styles/40/disgaea-nai-lycoris-88964.txt @@ -0,0 +1,516 @@ +Link:https://civitai.com/models/114233/disgaea-style +Version:v1.0 +Base Model:Other +Keywords: +--------DESCRIPTION--------- + +This is the LyCORIS version of the previously released LoRA version. While using the same dataset it generally performs better yielding higher quality output while being more flexible with outfits. +How to use +Just prompt away. The dataset is based on official character art with "simple background" and "white background" so use those tags if you want to strengthen the style further. You can also add standard tag for Disgaea (Senkai Makai Disgaea) to further change the style from the softer official character art towards the more "pointy" version provided the model has data on it. +Other things to try for AOM2 is using "3D" and "realistic" as negative tags though that shouldn't be necessary normally. +For more prompt suggestions see the sample images or the zip of training tags. +Note also that the end results depend on the sampler used, some producing more clean and polished results and others more close to drawings, experiment to see what works best with your model and goals. + +While it's possible to prompt some characters from the game through tags, especially if you use their name too, there are now specialized LoRAs here on CivitAI for most of them if you want the best accuracy 😊 +Don't forget to review and upload your own images, it's always fun to see what you're creating! +Misc +Trained on NAI at 512 with 165 images at 512 resolution. Sample images from AOM2_NSFW +All images are untouched txt2img upscaled, no inpainting or helper embeddings used for quality transparence, e.g. - things should look even better if you do. + +---------------------------- +-----ABOUT THIS VERSION----- + +Initial release +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt: 1girl, solo, facing viewer, praying, very long blonde hair, pointy ears, taut black dress, side_slit, cuffs, metal_collar, chains, closed eyes, facing viewer, red background, thorns, rose petals + Negative Prompt:(worst quality, low quality:1.0) + Size:2560x2048, Sampler:DPM++ 2M Karras, Steps:20, CFG:6, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img2: + Prompt: 1girl, solo, ninja, red eyes, breasts, ponytail, mask, cleavage, black hair, crossed arms, bandages, mouth mask, long hair, medium breasts, midriff, large breasts + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img3: + Prompt: solo, 1boy, male focus, red hair, necktie, gloves, ahoge, elbow gloves, black background, smile, black eyes, hand on hip, red necktie, pants, simple background, full body, sleeveless + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img4: + Prompt: 1girl, solo, tail, thighhighs, red hair, wings, red eyes, flat chest, gloves, jewelry, twintails, demon tail, demon girl, pointy ears, elbow gloves, earrings, bat wings, skirt, boots, belt, smile, simple background, choker, navel, miniskirt, black background, black thighhighs, looking at viewer + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img5: + Prompt: 1girl, solo, thighhighs, blue eyes, pointy ears, drill hair, arms behind back, blonde hair, bare shoulders, white background, simple background, detached sleeves, full body, flat chest, white thighhighs, twin drills, blush, standing, zipper, boots, belt, long hair + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img6: + Prompt: 1boy, male focus, weapon, sword, blue hair, solo, red eyes, scarf, shorts, pointy ears, topless male, antenna hair, black background, jewelry, belt, red shorts, bracelet, full body, holding sword, holding weapon, simple background, holding + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img7: + Prompt: 1girl, solo, drill hair, blue eyes, blonde hair, pointy ears, twintails, dress, bare shoulders, twin drills, long hair, detached sleeves, smile, pantyhose, full body, simple background, white background, belt + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img8: + Prompt: 1girl, solo, thighhighs, green shirt, shirt, breasts, short hair, full body, standing, impossible clothes, blue eyes, large breasts, pointy ears, simple background, hand on hip, grey background, jewelry, black thighhighs, looking at viewer, long sleeves, white footwear, pelvic curtain, impossible shirt, boots, belt, ascot, earrings, frills, hands on hips, brooch, orange hair, loincloth, :o, leotard, legs apart + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img9: + Prompt: 1girl, solo, standing, arms_behind_head, beltbra, smile, bike_short, beltskirt, headband, short green hair, pointy ears, flat chest, belt, armored boots, midriff + Negative Prompt:(worst quality, low quality:1.0) + Size:2048x2560, Sampler:DPM++ 2M Karras, Steps:20, CFG:6, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img10: + Prompt: 1girl, solo, long hair, blonde hair, blue eyes, wings, ribbon,detached sleeves, black background, bow, shoes, bloomers, simple background + Negative Prompt:(worst quality, low quality:1.0), simple background + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 114233, + "name": "Disgaea Style / 魔界戦記ディスガイア", + "description": "

This is the LyCORIS version of the previously released LoRA version. While using the same dataset it generally performs better yielding higher quality output while being more flexible with outfits.

How to use
Just prompt away. The dataset is based on official character art with \"simple background\" and \"white background\" so use those tags if you want to strengthen the style further. You can also add standard tag for Disgaea (Senkai Makai Disgaea) to further change the style from the softer official character art towards the more \"pointy\" version provided the model has data on it.
Other things to try for AOM2 is using \"3D\" and \"realistic\" as negative tags though that shouldn't be necessary normally.
For more prompt suggestions see the sample images or the zip of training tags.

Note also that the end results depend on the sampler used, some producing more clean and polished results and others more close to drawings, experiment to see what works best with your model and goals.

While it's possible to prompt some characters from the game through tags, especially if you use their name too, there are now specialized LoRAs here on CivitAI for most of them if you want the best accuracy 😊

Don't forget to review and upload your own images, it's always fun to see what you're creating!

Misc
Trained on NAI at 512 with 165 images at 512 resolution. Sample images from AOM2_NSFW
All images are untouched txt2img upscaled, no inpainting or helper embeddings used for quality transparence, e.g. - things should look even better if you do.

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 127, + "favoriteCount": 40, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "AnyKey", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/59ca0d85-87f6-4d2a-9b22-7a423a5c2b02/width=96/AnyKey.jpeg" + }, + "tags": [ + "atlus", + "style", + "disgaea" + ], + "modelVersions": [ + { + "id": 123460, + "modelId": 114233, + "name": "v1.0", + "createdAt": "2023-07-22T19:04:25.046Z", + "updatedAt": "2023-07-22T19:27:15.014Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Initial release

", + "vaeId": null, + "stats": { + "downloadCount": 127, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 88963, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/92813/default/disgaea20style.28Dh.zip", + "sizeKB": 54.0908203125, + "name": "Disgaea Style Autotags.zip", + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-22T19:09:18.734Z", + "hashes": { + "AutoV2": "1B3F37CE37", + "SHA256": "1B3F37CE3736503B79905294BAB24179B20343D500D285EDB3EB382DA8B773F1", + "CRC32": "E73DAF51", + "BLAKE3": "F75F1358408040272AFF1DF3866B91429D50C372D4B8F9734FE20BA7F40B2B2D" + }, + "downloadUrl": "https://civitai.com/api/download/models/123460?type=Training%20Data" + }, + { + "id": 88964, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/92813/model/disgaeaNAILycoris.EOIu.safetensors", + "sizeKB": 25427.55078125, + "name": "Disgaea-NAI-LyCORIS.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-22T19:09:39.092Z", + "hashes": { + "AutoV1": "92CC456A", + "AutoV2": "8DB017A8B5", + "SHA256": "8DB017A8B532942824218EA1A1FDB793C71378F04698E6758338E69A3B0F0EE5", + "CRC32": "1C682BE3", + "BLAKE3": "B282265289F708DEECB304DD7E2A01618978ECC895252D98BC5EB65B28C65979" + }, + "downloadUrl": "https://civitai.com/api/download/models/123460", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1f585b3b-5480-4376-82a1-93de754526dc/width=450/1674547.jpeg", + "nsfw": "None", + "width": 2560, + "height": 2048, + "hash": "UCH^bU9t4VE2.R?u020L00~Ven4o9a9a_2s:", + "meta": { + "Size": "2560x2048", + "seed": 2604754543, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n 1girl, solo, facing viewer, praying, very long blonde hair, pointy ears, taut black dress, side_slit, cuffs, metal_collar, chains, closed eyes, facing viewer, red background, thorns, rose petals", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0)", + "Denoising strength": "0.1", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x_foolhardy_Remacri", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6d9a76a9-547b-4922-aa5e-491affca23e8/width=450/1674492.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 960, + "hash": "UNE.*3~q?v.7?bxt-;-;E0Rjxat8%Mxuofjs", + "meta": { + "Size": "512x640", + "seed": 3258845053, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, ninja, red eyes, breasts, ponytail, mask, cleavage, black hair, crossed arms, bandages, mouth mask, long hair, medium breasts, midriff, large breasts", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0), simple background", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/026741c3-2113-4d37-bd2a-417833d120b2/width=450/1674496.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "U9Du}Z}[FxEh00ni0K56~qS#Ezkp8^V@%hXS", + "meta": { + "Size": "512x640", + "seed": 2910171335, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\nsolo, 1boy, male focus, red hair, necktie, gloves, ahoge, elbow gloves, black background, smile, black eyes, hand on hip, red necktie, pants, simple background, full body, sleeveless", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0)", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8288bab0-ef81-4250-b5a8-a7f1be87ddcf/width=450/1674488.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UCD8nK5700~V:kb^F_VYVFNa.7sA,=R+Ez%1", + "meta": { + "Size": "512x640", + "seed": 2230134533, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, tail, thighhighs, red hair, wings, red eyes, flat chest, gloves, jewelry, twintails, demon tail, demon girl, pointy ears, elbow gloves, earrings, bat wings, skirt, boots, belt, smile, simple background, choker, navel, miniskirt, black background, black thighhighs, looking at viewer", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e2efd438-9f60-4ca4-a774-bf792f60552f/width=450/1674490.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "UDFF{M%L0fo#|Es90ztR^hRkEQxt%LI;E2$%", + "meta": { + "Size": "512x640", + "seed": 2169086414, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, thighhighs, blue eyes, pointy ears, drill hair, arms behind back, blonde hair, bare shoulders, white background, simple background, detached sleeves, full body, flat chest, white thighhighs, twin drills, blush, standing, zipper, boots, belt, long hair", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0), simple background", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1b4a8e6f-df25-476d-8867-df53979026fd/width=450/1674494.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "U4C6ot?c0fK0x^e-McIU0zE1}r=yESo~^+-o", + "meta": { + "Size": "512x640", + "seed": 2478079020, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1boy, male focus, weapon, sword, blue hair, solo, red eyes, scarf, shorts, pointy ears, topless male, antenna hair, black background, jewelry, belt, red shorts, bracelet, full body, holding sword, holding weapon, simple background, holding", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0)", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/acdd7851-54cc-49b7-aa39-638b08eec7c1/width=450/1674491.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "UEDSXZR*00%2}?of9vV@8_kC.8V@R-RkjYxa", + "meta": { + "Size": "512x640", + "seed": 1504261309, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, drill hair, blue eyes, blonde hair, pointy ears, twintails, dress, bare shoulders, twin drills, long hair, detached sleeves, smile, pantyhose, full body, simple background, white background, belt", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0), simple background", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/45e01c91-7769-4e16-a8cd-1b2aa8e140ae/width=450/1674489.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "UGGl6XNLX-^j~pRkD*%1M{t7t7M{MwW=o#s8", + "meta": { + "Size": "512x640", + "seed": 2315461098, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, thighhighs, green shirt, shirt, breasts, short hair, full body, standing, impossible clothes, blue eyes, large breasts, pointy ears, simple background, hand on hip, grey background, jewelry, black thighhighs, looking at viewer, long sleeves, white footwear, pelvic curtain, impossible shirt, boots, belt, ascot, earrings, frills, hands on hips, brooch, orange hair, loincloth, :o, leotard, legs apart", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0), simple background", + "Denoising strength": "0.1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe9a08e1-c5ef-48d1-98dc-64d1f5c80b96/width=450/1674493.jpeg", + "nsfw": "None", + "width": 2048, + "height": 2560, + "hash": "UNGHk_~Vsmn3~9xtbbspSeR*ofxaocbFbIs;", + "meta": { + "Size": "2048x2560", + "seed": 1492352447, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, standing, arms_behind_head, beltbra, smile, bike_short, beltskirt, headband, short green hair, pointy ears, flat chest, belt, armored boots, midriff", + "Version": "v1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0)", + "Denoising strength": "0.1", + "Ultimate SD upscale padding": "32", + "Ultimate SD upscale upscaler": "4x_foolhardy_Remacri", + "Ultimate SD upscale mask_blur": "8", + "Ultimate SD upscale tile_width": "512", + "Ultimate SD upscale tile_height": "512" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f9d45e8c-0a10-4a6c-9a77-abf555224051/width=450/1674497.jpeg", + "nsfw": "None", + "width": 768, + "height": 960, + "hash": "ULH_Jc_N00IAITWAozIU00D+JDWYOHxaw]$$", + "meta": { + "Size": "512x640", + "seed": 2199675648, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, solo, long hair, blonde hair, blue eyes, wings, ribbon,detached sleeves, black background, bow, shoes, bloomers, simple background", + "Version": "v1.4.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.0), simple background", + "Denoising strength": "0.1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/123460" + } + ] +} +---------------------------- diff --git a/Styles/41/disgaeastyle_v10smol-metadata.json b/Styles/41/disgaeastyle_v10smol-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/Styles/41/disgaeastyle_v10smol.txt b/Styles/41/disgaeastyle_v10smol.txt new file mode 100644 index 0000000000000000000000000000000000000000..32f629fc64c227c07c38726698acb19506bc1ae6 --- /dev/null +++ b/Styles/41/disgaeastyle_v10smol.txt @@ -0,0 +1,476 @@ +Link:https://civitai.com/models/38277?modelVersionId=44230 +Version:v1.0-Smol +Base Model:Other +Keywords: +--------DESCRIPTION--------- + +Makes characters in the style of the Disgaea games. +How to use +Just prompt away. The dataset is based on official character art with "simple background" and "white background" so use those tags if you want to strengthen the style further. You can also add standard tag for Disgaea to further change the style provided the model has data on it, see sample image for how this works on AOM2. +Don't forget to review and upload your own images, it's always fun to see what you're creating! +Like my LoRAs and want more? Please consider a small tip towards my electricity bill and further training > +Misc +512 resolution trained on NAI. Sample images from AOM2_NSFW and NAI. +All images are untouched raw txt2imgs, no inpainting done, for quality transparency. +---------------------------- +-----ABOUT THIS VERSION----- + +This is an alternative smaller pruned LoRA version, it trades a bit of accuracy for a bit of flexibility. Neither is better or worse, it's just a matter of preference. +---------------------------- +------PREVIEWS METADATA----- + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 38277, + "name": "Disgaea Style / 魔界戦記ディスガイア", + "description": "

Makes characters in the style of the Disgaea games.

How to use
Just prompt away. The dataset is based on official character art with \"simple background\" and \"white background\" so use those tags if you want to strengthen the style further. You can also add standard tag for Disgaea to further change the style provided the model has data on it, see sample image for how this works on AOM2.

Don't forget to review and upload your own images, it's always fun to see what you're creating!
Like my LoRAs and want more? Please consider a small tip towards my electricity bill and further training >.<

Misc
512 resolution trained on NAI. Sample images from AOM2_NSFW and NAI.
All images are untouched raw txt2imgs, no inpainting done, for quality transparency.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 295, + "favoriteCount": 80, + "commentCount": 0, + "ratingCount": 1, + "rating": 5 + }, + "creator": { + "username": "AnyKey", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9fb96a94-1561-4d50-677f-0d1e18381300/width=96/AnyKey.jpeg" + }, + "tags": [], + "modelVersions": [ + { + "id": 44230, + "modelId": 38277, + "name": "v1.0", + "createdAt": "2023-04-13T02:39:37.873Z", + "updatedAt": "2023-04-13T03:05:46.049Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Initial Release

", + "files": [ + { + "name": "disgaeaStyle_v10.safetensors", + "id": 33428, + "sizeKB": 147577.623046875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T02:45:39.845Z", + "hashes": { + "AutoV1": "1F24BF15", + "AutoV2": "EDDF9C8953", + "SHA256": "EDDF9C8953CC7D9177E35385713D362DDFDD6314855FE5565D1FE31D852D9DED", + "CRC32": "18CF240C", + "BLAKE3": "9BAB047167BAA87E2B1C8C727A19269A935AC70CEAA34B8717EAAB39D91D79F6" + }, + "downloadUrl": "https://civitai.com/api/download/models/44230", + "primary": true + }, + { + "name": "disgaeaStyle_v10_trainingData.zip", + "id": 33427, + "sizeKB": 23.7705078125, + "type": "Training Data", + "metadata": { + "fp": null, + "size": null, + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T02:45:38.869Z", + "hashes": { + "AutoV2": "F07E581DA2", + "SHA256": "F07E581DA24CBB581F791C890BFBEFD677622A5C282E16FF4E044A02F595849A", + "CRC32": "561B198E", + "BLAKE3": "09E07A4CE55294C7E025A2FE27A75D62E277516649AE0A67D5FF70990C7042CF" + }, + "downloadUrl": "https://civitai.com/api/download/models/44230?type=Training%20Data" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cc189fcf-3c2b-4ee7-f511-cc503a3d5a00/width=450/482462.jpeg", + "nsfw": false, + "width": 512, + "height": 640, + "hash": "UDHB-.I900Wt~UxVR:E100%LRRWC0LtRjEIU", + "meta": { + "Size": "512x640", + "seed": 2536988809, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\nblonde hair, twin drills, priest robe, halo, angel wings, holding scythe", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb095c0d-8b0b-4c88-440a-27dbe0f92300/width=450/482465.jpeg", + "nsfw": true, + "width": 640, + "height": 512, + "hash": "UNJ7^0~q%$?bXT%N%K%1D*-:t6t8RjM{t7Rj", + "meta": { + "Size": "640x512", + "seed": 1303271038, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, makai senki disgaea", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2a6d3671-978a-4853-1627-99ae551ebd00/width=450/482556.jpeg", + "nsfw": false, + "width": 896, + "height": 2001, + "hash": "U?NmsQ~q%gaKxuayjaj[ofWBaxofofj[ayof", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/594d3d5a-5121-46b7-c2f1-2c837b849000/width=450/482461.jpeg", + "nsfw": true, + "width": 512, + "height": 640, + "hash": "UPJ*h;%OGwt-0hNZtlRPM*I[-=R5xcXAR:jZ", + "meta": { + "Size": "512x640", + "seed": 1797939494, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, makai senki disgaea", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/553b4019-f123-43ab-26e5-3e76ff90cf00/width=450/482468.jpeg", + "nsfw": true, + "width": 512, + "height": 640, + "hash": "UFOpSxoI.9$ezmVsR5D$-mt7Rp?b%0tSyZMd", + "meta": { + "Size": "512x640", + "seed": 3464780806, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\nwearing crop top, short shorts, thigh boots, elbow gloves, blonde hair, twin drills", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/97223059-e684-4501-a8ec-6be35b7d4000/width=450/482463.jpeg", + "nsfw": false, + "width": 512, + "height": 640, + "hash": "UFG]Q+C4XD-nB0#CHs%hNWw@-:J}|R,_?uEf", + "meta": { + "Size": "512x640", + "seed": 2795105712, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "(Makai Senki Disgaea)\n(white background)\n(upper body)\n(solo)\n(1girl)(facing viewer)\n(goat_horns girl) cleric", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0),greyscale,monochrome" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/123bd625-50e1-43fa-6464-d99829c19c00/width=450/482455.jpeg", + "nsfw": false, + "width": 512, + "height": 640, + "hash": "UCJQyVD*LN-nx,NGVvx]t*Mw-pNM$iR%_N^+", + "meta": { + "Size": "512x640", + "seed": 2186281179, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\n(goat_horns girl) fighter", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),greyscale,monochrome" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3fbb8092-5bb9-46ec-d0b4-81a56c6fa200/width=450/482452.jpeg", + "nsfw": true, + "width": 512, + "height": 640, + "hash": "UNLW0DxtR5NG%PogxukCcr$*TJIUP;o~WFR*", + "meta": { + "Size": "512x640", + "seed": 3983187470, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "(Makai Senki Disgaea)\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\n(bunny girl) druid", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),greyscale,monochrome" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dfef7011-d1ca-412b-12c4-7c4b1c443f00/width=450/482457.jpeg", + "nsfw": false, + "width": 512, + "height": 640, + "hash": "UFHV*nGYyB-;yGTyJ6IqBzIBmQrEqFi_#liv", + "meta": { + "Size": "512x640", + "seed": 3983187474, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "(Makai Senki Disgaea)\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\n(cat_ears girl) druid", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),greyscale,monochrome" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ea6ea6c5-269a-4e6c-b646-a835ed1aaa00/width=450/482469.jpeg", + "nsfw": false, + "width": 640, + "height": 512, + "hash": "U9JQGtgh00H=04wg9vklD|M}^lyC9BXO~K#T", + "meta": { + "Size": "640x512", + "seed": 2474802305, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "(Makai Senki Disgaea)\n(white background)\n(full body)\n(solo)\n(1girl)(facing viewer)\n(goat_horns girl) sorcerer", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "Disgaea", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),greyscale,monochrome" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/44230" + }, + { + "id": 44251, + "modelId": 38277, + "name": "v1.0-Smol", + "createdAt": "2023-04-13T03:04:44.417Z", + "updatedAt": "2023-04-13T03:05:46.049Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

This is an alternative smaller pruned LoRA version, it trades a bit of accuracy for a bit of flexibility. Neither is better or worse, it's just a matter of preference.

", + "files": [ + { + "name": "disgaeaStyle_v10Smol.safetensors", + "id": 33443, + "sizeKB": 54138.4638671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-13T03:15:43.438Z", + "hashes": { + "AutoV1": "D81B13DC", + "AutoV2": "8F18379FBC", + "SHA256": "8F18379FBC6FDB23DD011868A699FA7EA0E63665CDBAD67E2A21377E455842F9", + "CRC32": "8494B26E", + "BLAKE3": "74FCB455A2DBFAD8628CFC91F3DC7250BAF4950C98CD4328E01460A6F69D2901" + }, + "downloadUrl": "https://civitai.com/api/download/models/44251", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32ad4ccf-bfa1-46fd-209a-1e1accfa9f00/width=450/482660.jpeg", + "nsfw": true, + "width": 896, + "height": 2001, + "hash": "U=NmsQ~q%gV@xuayf6j[ofWBayofofj[WVoe", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/44251" + } + ] +} +---------------------------- diff --git a/Styles/42/dongfang-115361-metadata.json b/Styles/42/dongfang-115361-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..ba264910ff95caea9e22464103981d778dd957f5 --- /dev/null +++ b/Styles/42/dongfang-115361-metadata.json @@ -0,0 +1,353 @@ +{ + "ss_sd_model_name": "anything-v5-PrtRE.safetensors", + "ss_resolution": "(512, 768)", + "ss_clip_skip": "2", + "ss_num_train_images": "420", + "ss_tag_frequency": { + "14_dongfang": { + "1girl": 30, + "solo": 29, + "full_body": 24, + "skirt": 12, + "dress": 11, + "short_hair": 11, + "long_sleeves": 10, + "long_hair": 10, + "hat": 9, + "looking_at_viewer": 9, + "bow": 8, + "frills": 8, + "pixel_art": 8, + "red_eyes": 8, + "smile": 8, + "blue_eyes": 7, + "blonde_hair": 7, + "transparent_background": 7, + "blue_hair": 6, + "green_eyes": 6, + "hair_ornament": 5, + "simple_background": 5, + "green_hair": 5, + "wide_sleeves": 5, + "socks": 4, + "shoes": 4, + "japanese_clothes": 4, + "boots": 3, + "blue_dress": 3, + "white_legwear": 3, + "red_hair": 3, + "tail": 3, + "weapon": 3, + "green_skirt": 3, + "third_eye": 3, + "detached_sleeves": 3, + "geta": 3, + "capelet": 2, + "hairband": 2, + "sash": 2, + "hair_bobbles": 2, + "two_side_up": 2, + "kaenbyou_rin": 2, + "animal_ears": 2, + "braid": 2, + "twin_braids": 2, + "chain": 2, + "cuffs": 2, + "wings": 2, + "cape": 2, + "kimono": 2, + "pom_pom_\\(clothes\\)": 2, + "ribbon_trim": 2, + "ribbon-trimmed_sleeves": 2, + "white_background": 2, + "black_hair": 2, + "scarf": 2, + "short_sleeves": 2, + "tate_eboshi": 2, + "horns": 2, + "standing": 2, + "oekaki": 2, + "eyeball": 2, + "heart": 2, + "komeiji_koishi": 2, + "komeiji_satori": 2, + "heart_of_string": 2, + "frilled_sleeves": 2, + "blouse": 2, + "yellow_shirt": 2, + "frilled_shirt_collar": 2, + "rose_print": 2, + "shirt": 2, + "string": 2, + "alice_margatroid": 1, + "shanghai_doll": 1, + "kawashiro_nitori": 1, + "backpack": 1, + "bag": 1, + "key": 1, + "pocket": 1, + "blue_footwear": 1, + "skirt_set": 1, + "green_headwear": 1, + "kurodani_yamame": 1, + "brown_dress": 1, + "tachi-e": 1, + "red_skirt": 1, + "yellow_eyes": 1, + "cat_ears": 1, + "multiple_tails": 1, + "cat_tail": 1, + "two_tails": 1, + ":3": 1, + "black_footwear": 1, + "black_bow": 1, + "kaku_seiga": 1, + "shawl": 1, + "hair_stick": 1, + "hair_rings": 1, + "vest": 1, + "white_vest": 1, + "belt": 1, + "kagiyama_hina": 1, + "ribbon": 1, + "hair_ribbon": 1, + "front_ponytail": 1, + "skirt_hold": 1, + "underwear": 1, + "reiuji_utsuho": 1, + "green_bow": 1, + "hair_bow": 1, + "arm_cannon": 1, + "black_wings": 1, + "asymmetrical_footwear": 1, + "bird_wings": 1, + "mismatched_footwear": 1, + "hand_on_hip": 1, + "maid": 1, + "apron": 1, + "maid_headdress": 1, + "yumeko_\\(touhou\\)": 1, + "enmaided": 1, + "maid_apron": 1, + "white_apron": 1, + "frilled_apron": 1, + "pantyhose": 1, + "tabard": 1, + "matara_okina": 1, + "chair": 1, + "aura": 1, + "fur_trim": 1, + "jacket_on_shoulders": 1, + "kisume": 1, + "bucket": 1, + "in_container": 1, + "wooden_bucket": 1, + "in_bucket": 1, + "twintails": 1, + "tokin_hat": 1, + "wolf_ears": 1, + "inubashiri_momiji": 1, + "shield": 1, + "wolf_tail": 1, + "sword": 1, + "tengu-geta": 1, + "red_headwear": 1, + "yatadera_narumi": 1, + "ajirogasa": 1, + "red_legwear": 1, + "pointy_ears": 1, + "mizuhashi_parsee": 1, + "arm_warmers": 1, + "mary_janes": 1, + "white_scarf": 1, + "bobby_socks": 1, + "soga_no_tojiko": 1, + "green_dress": 1, + "ghost_tail": 1, + "blush": 1, + "barefoot": 1, + "mononobe_no_futo": 1, + "ponytail": 1, + "grey_hair": 1, + "blue_skirt": 1, + "onozuka_komachi": 1, + "scythe": 1, + "puffy_short_sleeves": 1, + "single_horn": 1, + "hoshiguma_yuugi": 1, + "cup": 1, + "cleavage": 1, + "breasts": 1, + "blue_kimono": 1, + "sakazuki": 1, + "kochiya_sanae": 1, + "frog_hair_ornament": 1, + "gohei": 1, + "hair_tubes": 1, + "snake_hair_ornament": 1, + "miko": 1, + "nontraditional_miko": 1, + "kumoi_ichirin": 1, + "hood": 1, + "jewelry": 1, + "heterochromia": 1, + "holding_umbrella": 1, + "karakasa_obake": 1, + "oil-paper_umbrella": 1, + "umbrella": 1, + "tatara_kogasa": 1, + "purple_umbrella": 1, + "tongue": 1, + "blue_umbrella": 1, + "red_umbrella": 1, + "tongue_out": 1, + "shared_umbrella": 1, + "puffy_sleeves": 1, + "alphes_\\(style\\)": 1, + ":p": 1, + "parasol": 1, + "checkered": 1, + "futatsuiwa_mamizou": 1, + "glasses": 1, + "leaf": 1, + "leaf_on_head": 1, + "raccoon_ears": 1, + "raccoon_tail": 1, + "checkered_scarf": 1, + "brown_hair": 1, + "checkered_background": 1, + "brown_eyes": 1, + "pince-nez": 1, + "leaf_hair_ornament": 1, + "kiseru": 1, + "sandals": 1, + "houjuu_nue": 1, + "thighhighs": 1, + "asymmetrical_wings": 1, + "snake": 1, + "polearm": 1, + "trident": 1, + "black_legwear": 1, + "zettai_ryouiki": 1, + "black_dress": 1, + "red_wings": 1, + "red_bowtie": 1, + "blue_wings": 1, + "short_dress": 1, + "jaggy_line": 1, + "red_bow": 1, + "bowtie": 1, + "star_\\(symbol\\)": 1, + "star_hat_ornament": 1, + "miyako_yoshika": 1, + "hat_ornament": 1, + "outstretched_arms": 1, + "ofuda": 1, + "zombie_pose": 1, + "open_mouth": 1, + "jiangshi": 1, + "heart_hair_ornament": 1, + "pink_hair": 1, + "pink_skirt": 1, + "blue_blouse": 1, + "slippers": 1, + "pink_eyes": 1, + "ribbon-trimmed_collar": 1, + "blue_shirt": 1, + "black_headwear": 1, + "hat_ribbon": 1, + "yellow_blouse": 1, + "yellow_bow": 1, + "yellow_ribbon": 1, + "floral_print": 1, + "hat_bow": 1 + } + }, + "ss_total_batch_size": "6", + "ss_network_alpha": "64", + "sshs_model_hash": "4a4ed4c0594d2fa2aa2f1c95c5b0fa0c269314972dc586005b9e427a19e5314c", + "ss_caption_dropout_rate": "0.0", + "ss_keep_tokens": "0", + "ss_new_sd_model_hash": "7f96a1a9ca9b3a3242a9ae95d19284f0d2da8d5282b42d2d974398bf7663a252", + "ss_output_name": "dongfang", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "modelspec.date": "2023-09-02T22:34:10", + "modelspec.implementation": "diffusers", + "ss_full_fp16": "False", + "ss_training_finished_at": "1693665250.856613", + "ss_shuffle_caption": "True", + "ss_multires_noise_discount": "0.3", + "modelspec.title": "dongfang", + "ss_enable_bucket": "True", + "ss_bucket_no_upscale": "False", + "ss_noise_offset": "None", + "ss_zero_terminal_snr": "False", + "ss_gradient_checkpointing": "False", + "ss_prior_loss_weight": "1", + "ss_sd_model_hash": "893e49b9", + "ss_lr_warmup_steps": "0", + "ss_max_train_steps": "1120", + "ss_sd_scripts_commit_hash": "(unknown)", + "modelspec.architecture": "stable-diffusion-v1/lora", + "ss_learning_rate": "0.0001", + "ss_caption_dropout_every_n_epochs": "0", + "sshs_legacy_hash": "c733e34f", + "ss_training_comment": "None", + "ss_random_crop": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_batch_size_per_device": "6", + "ss_cache_latents": "True", + "ss_flip_aug": "False", + "ss_training_started_at": "1693663924.6194823", + "ss_max_token_length": "255", + "ss_max_bucket_reso": "1024", + "ss_num_batches_per_epoch": "70", + "ss_num_epochs": "16", + "ss_gradient_accumulation_steps": "1", + "ss_adaptive_noise_scale": "None", + "ss_network_dropout": "None", + "ss_face_crop_aug_range": "None", + "ss_min_snr_gamma": "None", + "ss_min_bucket_reso": "256", + "ss_reg_dataset_dirs": {}, + "ss_num_reg_images": "0", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 512, + 768 + ], + "count": 420 + } + }, + "mean_img_ar_error": 0.0 + }, + "ss_network_dim": "64", + "ss_epoch": "16", + "modelspec.prediction_type": "epsilon", + "modelspec.encoder_layer": "2", + "ss_seed": "1337", + "ss_max_grad_norm": "1.0", + "ss_dataset_dirs": { + "14_dongfang": { + "n_repeats": 14, + "img_count": 30 + } + }, + "ss_color_aug": "False", + "modelspec.sai_model_spec": "1.0.0", + "ss_session_id": "225476375", + "ss_scale_weight_norms": "None", + "ss_unet_lr": "0.0001", + "ss_text_encoder_lr": "1e-05", + "ss_base_model_version": "sd_v1", + "ss_caption_tag_dropout_rate": "0.0", + "ss_steps": "1120", + "ss_lowram": "False", + "modelspec.resolution": "512x768", + "ss_v2": "False", + "ss_network_module": "networks.lora", + "ss_mixed_precision": "fp16", + "ss_multires_noise_iterations": "None" +} \ No newline at end of file diff --git a/Styles/42/dongfang-115361.txt b/Styles/42/dongfang-115361.txt new file mode 100644 index 0000000000000000000000000000000000000000..5fdf899969cdc41082aa0bd7e880cf7bf9883c3e --- /dev/null +++ b/Styles/42/dongfang-115361.txt @@ -0,0 +1,404 @@ +Link:https://civitai.com/models/139350 +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +使用东方夜雀食堂立绘训练 +无触发词，1girl即可使用 +（建议加上solo和full body以达到类似立绘的效果） +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:masterpiece,best quality,1girl, ,solo, full body, red eyes,hakurei reimu, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + +img2: + Prompt:masterpiece,best quality,1girl, ,solo, full body, red eyes, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + +img3: + Prompt:masterpiece,best quality,1girl, ,solo, full body, red eyes, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + +img4: + Prompt:masterpiece,best quality,1girl, ,solo, full body, red eyes, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + +img5: + Prompt:masterpiece,best quality,1girl, ,solo, full body,hat, white hair, red eyes, cat ears, china dress, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + +img6: + Prompt:masterpiece,best quality,1girl, ,solo, full body,green eyes, orange hair, + Negative Prompt:EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error, + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:anything-v5-PrtRE, Model Hash:7f96a1a9ca + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 139350, + "name": "东方夜雀食堂立绘画风", + "description": "

使用东方夜雀食堂立绘训练

无触发词，1girl即可使用

（建议加上solo和full body以达到类似立绘的效果）

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 108, + "favoriteCount": 23, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "wenaka", + "image": "https://lh3.googleusercontent.com/a/AGNmyxbvq3orxi-KAx9XcbVAjPIiJpf74pjC-AfrbMb8=s96-c" + }, + "tags": [ + "anime", + "female", + "style", + "woman", + "game character", + "girls" + ], + "modelVersions": [ + { + "id": 154330, + "modelId": 139350, + "name": "v1.0", + "createdAt": "2023-09-03T07:00:58.755Z", + "updatedAt": "2023-09-03T07:04:50.602Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 108, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 115361, + "url": "https://civitai-delivery-worker-prod-2023-09-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/model/674388/dongfang.VFz7.safetensors", + "sizeKB": 73845.3828125, + "name": "dongfang.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-03T07:05:56.351Z", + "hashes": { + "AutoV1": "C054490C", + "AutoV2": "2DA613D051", + "SHA256": "2DA613D051B20D1C51BE92239636094AFFBA9780A446099B81BFFB86082A65AD", + "CRC32": "559EB655", + "BLAKE3": "417071CFCCE2DA67EEFF24DE41EF2915415432FB2FE3F5AC3D87DA771A07B145" + }, + "downloadUrl": "https://civitai.com/api/download/models/154330", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6539a2ef-9462-4fbe-a6cf-f7f5e4d68045/width=450/2333650.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UHK,,D?bQ7%#0,V}pJxuTc%O$fxE4UMzInoy", + "type": "image", + "metadata": { + "hash": "UHK,,D?bQ7%#0,V}pJxuTc%O$fxE4UMzInoy", + "size": 591737, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1580989637, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body, red eyes,hakurei reimu,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/149f1d0d-8fa3-4af6-8f81-4d5c9a01b51b/width=450/2333646.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UHIha8DNTaS_0NoG%KI._L%L$_x]9b%KD%t6", + "type": "image", + "metadata": { + "hash": "UHIha8DNTaS_0NoG%KI._L%L$_x]9b%KD%t6", + "size": 629870, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2748576494, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body, red eyes,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5f8304d6-da99-407a-8a7d-ca3925b46c4a/width=450/2333645.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UPH1oZ~U_2x]Ng-:xtxu?a-:%1s.E3WEX9bb", + "type": "image", + "metadata": { + "hash": "UPH1oZ~U_2x]Ng-:xtxu?a-:%1s.E3WEX9bb", + "size": 616616, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2748576493, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body, red eyes,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/55f3949f-dd5a-4a07-b41b-61f7a9810f55/width=450/2333647.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "ULKUZvDPuPaJ0OM|?ID*^*S$%1IqETf%9ZNG", + "type": "image", + "metadata": { + "hash": "ULKUZvDPuPaJ0OM|?ID*^*S$%1IqETf%9ZNG", + "size": 619246, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2748576496, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body, red eyes,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1c67d73-c198-4491-a7e6-3a5c0088933c/width=450/2333651.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "UDKKWuL#5q4-1nI8Oaa0IpZ~xux[01?GDjIU", + "type": "image", + "metadata": { + "hash": "UDKKWuL#5q4-1nI8Oaa0IpZ~xux[01?GDjIU", + "size": 608061, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2719757406, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body,hat, white hair, red eyes, cat ears, china dress,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7aff1122-1037-40ed-95f0-2dc87139969e/width=450/2333910.jpeg", + "nsfw": "None", + "width": 512, + "height": 768, + "hash": "U:MQS1V@xut7xaRjRjay_NR*bHkBR*jZj@jY", + "type": "image", + "metadata": { + "hash": "U:MQS1V@xut7xaRjRjay_NR*bHkBR*jZj@jY", + "size": 510619, + "width": 512, + "height": 768 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2239659701, + "Model": "anything-v5-PrtRE", + "steps": 30, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "masterpiece,best quality,1girl, ,solo, full body,green eyes, orange hair,", + "Version": "v1.5.1", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "\"dongfang": "4a4ed4c0594d\"", + "resources": [ + { + "name": "dongfang", + "type": "lora", + "weight": 1 + }, + { + "hash": "7f96a1a9ca", + "name": "anything-v5-PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "\"EasyNegative": "c74b4e810b03\"", + "negativePrompt": "EasyNegative, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, bad feet, thighhighs, EasyNegative,badhandv4,ng_deepnegative_v1_75t,(worst quality:2), (low quality:2), (normal quality:2), lowres, ((monochrome)), ((grayscale)), bad anatomy,DeepNegative, skin spots, acnes, skin blemishes,(fat:1.2),facing away, looking away,tilted head, lowres,bad anatomy,bad hands, missing fingers,extra digit, fewer digits,bad feet,poorly drawn hands,poorly drawn face,mutation,deformed,extra fingers,extra limbs,extra arms,extra legs,malformed limbs,fused fingers,too many fingers,long neck,cross-eyed,mutated hands,polar lowres,bad body,bad proportions,gross proportions,missing arms,missing legs,extra digit, extra arms, extra leg, extra foot,teethcroppe,signature, watermark, username,blurry,cropped,jpeg artifacts,text,error," + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/154330" + } + ] +} +---------------------------- diff --git a/Styles/43/dross_style_v1-115078-metadata.json b/Styles/43/dross_style_v1-115078-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..ae5ecc5c47f82a1b005fc9928faa5bf1f5bbf691 --- /dev/null +++ b/Styles/43/dross_style_v1-115078-metadata.json @@ -0,0 +1,213 @@ +{ + "ss_sd_model_name": "AnythingV5_v5PrtRE.safetensors", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "None", + "ss_num_train_images": "12700", + "ss_tag_frequency": { + "100_Dross_Stlye sexy femboy orc green_skin elf_ears sexy": { + "dross_stlye sexy femboy orc green_skin elf_ears sexy": 9 + }, + "100_Dross_Stlye sexy femboy orc green_skin elf_ears sexy, anal_sex from_side": { + "dross_stlye sexy femboy orc green_skin elf_ears sexy": 3, + "anal_sex from_side": 3 + }, + "100_Dross_Style femboy penis Caleb blonde sexy": { + "dross_style femboy penis caleb blonde sexy": 15 + }, + "100_Dross_Style femboy penis Caleb sexy ass": { + "dross_style femboy penis caleb sexy ass": 3 + }, + "100_Dross_Style femboy penis Caleb sexy nude": { + "dross_style femboy penis caleb sexy nude": 3 + }, + "100_Dross_Style femboy penis Caleb sexy sex nude missionary anal pov": { + "dross_style femboy penis caleb sexy sex nude missionary anal pov": 6 + }, + "100_Dross_Style femboy penis sexy Ash": { + "dross_style femboy penis sexy ash": 9 + }, + "100_Dross_Style femboy penis sexy Ash ass": { + "dross_style femboy penis sexy ash ass": 9 + }, + "100_Dross_Style femboy penis sexy Ash fellatio pov": { + "dross_style femboy penis sexy ash fellatio pov": 3 + }, + "100_Dross_Style femboy penis sexy Ash full_nelson sex anal": { + "dross_style femboy penis sexy ash full_nelson sex anal": 3 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair": { + "dross_style femboy penis sexy cody ashblonde_hair": 15 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair nude": { + "dross_style femboy penis sexy cody ashblonde_hair nude": 6 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair nude sex anal": { + "dross_style femboy penis sexy cody ashblonde_hair nude sex anal": 8 + }, + "100_Dross_Style femboy penis sexy Jade": { + "dross_style femboy penis sexy jade": 9 + }, + "100_Dross_Style femboy penis sexy Jade ass": { + "dross_style femboy penis sexy jade ass": 12 + }, + "100_Dross_Style femboy penis sexy pov fellatio blowjob Jade": { + "dross_style femboy penis sexy pov fellatio blowjob jade": 3 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy from_behind": { + "dross_style femboy penis taylor pink_hair sexy from_behind": 3 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy from_behind ass": { + "dross_style femboy penis taylor pink_hair sexy from_behind ass": 5 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy nude": { + "dross_style femboy penis taylor pink_hair sexy nude": 3 + } + }, + "ss_new_sd_model_hash": "7f96a1a9ca9b3a3242a9ae95d19284f0d2da8d5282b42d2d974398bf7663a252", + "modelspec.title": "Dross_Style_v1", + "ss_output_name": "Dross_Style_v1", + "ss_epoch": "2", + "ss_noise_offset": "0.0", + "modelspec.resolution": "512x512", + "ss_training_comment": "None", + "sshs_legacy_hash": "243c0a7e", + "ss_max_token_length": "None", + "ss_gradient_checkpointing": "False", + "ss_caption_tag_dropout_rate": "0.0", + "ss_unet_lr": "0.0001", + "ss_flip_aug": "False", + "modelspec.sai_model_spec": "1.0.0", + "ss_sd_scripts_commit_hash": "2853f4cec850557e83882a4072cfe416cb9c57d7", + "ss_cache_latents": "True", + "ss_min_snr_gamma": "None", + "ss_reg_dataset_dirs": {}, + "ss_bucket_info": "null", + "ss_v2": "False", + "ss_full_fp16": "False", + "ss_num_batches_per_epoch": "12700", + "ss_color_aug": "False", + "ss_face_crop_aug_range": "None", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_batch_size_per_device": "1", + "ss_multires_noise_discount": "0.3", + "modelspec.prediction_type": "epsilon", + "ss_session_id": "423459053", + "ss_network_alpha": "1.0", + "ss_max_grad_norm": "1.0", + "ss_random_crop": "False", + "ss_caption_dropout_every_n_epochs": "0", + "ss_total_batch_size": "1", + "ss_num_epochs": "2", + "modelspec.implementation": "diffusers", + "ss_bucket_no_upscale": "False", + "ss_seed": "2973179195", + "ss_scale_weight_norms": "None", + "ss_lr_warmup_steps": "1270", + "ss_steps": "25400", + "ss_keep_tokens": "0", + "ss_text_encoder_lr": "5e-05", + "ss_lowram": "False", + "sshs_model_hash": "92a634b95cb01e49905210b4ac7774340bf75dfd0c3bf3b7109eadc4cefe5b9e", + "ss_enable_bucket": "False", + "ss_sd_model_hash": "893e49b9", + "modelspec.architecture": "stable-diffusion-v1/lora", + "ss_dataset_dirs": { + "100_Dross_Stlye sexy femboy orc green_skin elf_ears sexy": { + "n_repeats": 100, + "img_count": 9 + }, + "100_Dross_Stlye sexy femboy orc green_skin elf_ears sexy, anal_sex from_side": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis Caleb blonde sexy": { + "n_repeats": 100, + "img_count": 15 + }, + "100_Dross_Style femboy penis Caleb sexy ass": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis Caleb sexy nude": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis Caleb sexy sex nude missionary anal pov": { + "n_repeats": 100, + "img_count": 6 + }, + "100_Dross_Style femboy penis sexy Ash": { + "n_repeats": 100, + "img_count": 9 + }, + "100_Dross_Style femboy penis sexy Ash ass": { + "n_repeats": 100, + "img_count": 9 + }, + "100_Dross_Style femboy penis sexy Ash fellatio pov": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis sexy Ash full_nelson sex anal": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair": { + "n_repeats": 100, + "img_count": 15 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair nude": { + "n_repeats": 100, + "img_count": 6 + }, + "100_Dross_Style femboy penis sexy Cody ashblonde_hair nude sex anal": { + "n_repeats": 100, + "img_count": 8 + }, + "100_Dross_Style femboy penis sexy Jade": { + "n_repeats": 100, + "img_count": 9 + }, + "100_Dross_Style femboy penis sexy Jade ass": { + "n_repeats": 100, + "img_count": 12 + }, + "100_Dross_Style femboy penis sexy pov fellatio blowjob Jade": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy from_behind": { + "n_repeats": 100, + "img_count": 3 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy from_behind ass": { + "n_repeats": 100, + "img_count": 5 + }, + "100_Dross_Style femboy penis Taylor pink_hair sexy nude": { + "n_repeats": 100, + "img_count": 3 + } + }, + "ss_num_reg_images": "0", + "ss_gradient_accumulation_steps": "1", + "ss_caption_dropout_rate": "0.0", + "ss_training_finished_at": "1693688169.8768392", + "ss_adaptive_noise_scale": "None", + "ss_max_train_steps": "25400", + "modelspec.date": "2023-09-02T22:56:09", + "ss_shuffle_caption": "False", + "ss_min_bucket_reso": "None", + "ss_learning_rate": "0.0001", + "ss_mixed_precision": "bf16", + "ss_prior_loss_weight": "1.0", + "ss_zero_terminal_snr": "False", + "ss_network_module": "networks.lora", + "ss_lr_scheduler": "cosine", + "ss_training_started_at": "1693681207.2882724", + "ss_network_dim": "8", + "ss_base_model_version": "sd_v1", + "ss_multires_noise_iterations": "None", + "ss_network_dropout": "None", + "ss_max_bucket_reso": "None" +} \ No newline at end of file diff --git a/Styles/43/dross_style_v1-115078.txt b/Styles/43/dross_style_v1-115078.txt new file mode 100644 index 0000000000000000000000000000000000000000..2c355d02e24f1d73c9524412b3e54c1055b290ce --- /dev/null +++ b/Styles/43/dross_style_v1-115078.txt @@ -0,0 +1,785 @@ +Link:https://civitai.com/models/139199/dross-artist-style-lora +Version:v1.0 +Base Model:SD 1.5 +Keywords:dross_style,femboy,sexy,sex,anal,missionary,caleb,taylor,ash,ork,cody,ashblonde_hair,pink_hair,penis,pov,fellatio,blowjob,from_behind,jade,elf_ears,nude,blonde,ass +--------DESCRIPTION--------- + +LoRA for recreating the artstyle of Dross + +You can trigger certain concepts/characters by using the given trigger words. +Almost all poses and acts in my samples are 100% created without additional LoRAs. + +Trained on AnythingV5. Samples created with mistoonAnime_v10 and AnythingV5. + +Recommended weight is 0.75 - 0.9 + +All characters depicted in samples are at least 18 years old. + +All my work and possible future commission work is 100% free to download and use. +But if you want to support me by buying a coffee you can do so at Kofi +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, lying on bed, penis, nude, croptop, from behind, presenting ass, + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img2: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, orange hair, fellatio, pov, blowjob, penis, nude, + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img3: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, nude, penis, anal, sex, smiling, muscular, closed eyes, abs, (caleb, blonde:1.4), pov, missionary, in corn field, arms above head, open mouth, panting, sweaty, cum, ejaculation, cum on body, erection, looking at viewer, projectile cum + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img4: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, caleb, blonde, femboy, dungarees, smiling, + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2, sex + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:AnythingV5_v5PrtRE, Model Hash:7f96a1a9ca + +img5: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, long red hair, standing, white dress + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img6: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, blue undercut, standing, denim hotpants + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img7: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, mankini, standing at beach, (cody, ashblonde_hair:1.4) + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img8: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, (long ashblonde_hair:1.3), standing in gym, leggins, croptop, from behind, presenting ass, (cody:1.4) + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img9: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, penis, ((pixie cut)), standing, white dress + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + +img10: + Prompt:(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, orc, red skin, demon boy, devil tail, elf_ears, (muscular) penis, sitting in cave, + Negative Prompt:By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2 + Size:512x680, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:mistoonAnime_v10, Model Hash:a49140c6c5 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 139199, + "name": "Dross - Artist Style LoRA", + "description": "

LoRA for recreating the artstyle of Dross.

You can trigger certain concepts/characters by using the given trigger words.

Almost all poses and acts in my samples are 100% created without additional LoRAs.

Trained on AnythingV5. Samples created with mistoonAnime_v10 and AnythingV5.

Recommended weight is 0.75 - 0.9


All characters depicted in samples are at least 18 years old.

All my work and possible future commission work is 100% free to download and use.

But if you want to support me by buying a coffee you can do so at Kofi.

", + "type": "LORA", + "poi": false, + "nsfw": true, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 38, + "favoriteCount": 4, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "StableFocus", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6af3fe45-b4a4-4421-b750-59ac404844e0/width=96/StableFocus.jpeg" + }, + "tags": [ + "anime", + "trap", + "style", + "yaoi", + "hentai" + ], + "modelVersions": [ + { + "id": 154029, + "modelId": 139199, + "name": "v1.0", + "createdAt": "2023-09-02T23:30:07.236Z", + "updatedAt": "2023-09-03T01:37:48.273Z", + "trainedWords": [ + "dross_style", + "femboy", + "sexy", + "sex", + "anal", + "missionary", + "caleb", + "taylor", + "ash", + "ork", + "cody", + "ashblonde_hair", + "pink_hair", + "penis", + "pov", + "fellatio", + "blowjob", + "from_behind", + "jade", + "elf_ears", + "nude", + "blonde", + "ass" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 38, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 115078, + "url": "https://civitai-delivery-worker-prod-2023-09-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/model/2013849/drossStyleV1.M2xn.safetensors", + "sizeKB": 9331.25, + "name": "Dross_Style_v1.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-02T23:36:00.541Z", + "hashes": { + "AutoV1": "FD6D1F50", + "AutoV2": "517876D903", + "SHA256": "517876D9033411AB6CCB03309FE71ECBCCCCD7795DCFE4750D36CEFA22D905C6", + "CRC32": "ABC07671", + "BLAKE3": "602DC28E809BB7162CCDBD272876AB89770AAFFC8B7A1FF31A0016B1D6B5CB57" + }, + "downloadUrl": "https://civitai.com/api/download/models/154029", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a078764-1e0a-449d-abd8-01694d62d37d/width=450/2328792.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UNHBYz%MITRO01j]-Toc}?n$-;oz=vj?OrtR", + "type": "image", + "metadata": { + "hash": "UNHBYz%MITRO01j]-Toc}?n$-;oz=vj?OrtR", + "size": 1343794, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 4136535243, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, lying on bed, penis, nude, croptop, from behind, presenting ass,", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bb737573-4249-48c0-8fbc-bcdf6cd9b2e6/width=450/2328820.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UGK]cS~B0MS500Rj1KNdE1X7%Ms:_2xtR-sT", + "type": "image", + "metadata": { + "hash": "UGK]cS~B0MS500Rj1KNdE1X7%Ms:_2xtR-sT", + "size": 1517386, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 767981489, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, orange hair, fellatio, pov, blowjob, penis, nude,", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d24237f8-e621-4d8d-a2c5-28a73e4463bc/width=450/2329115.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UEJ@LBI:01t700M|E2aeaKxa~Cs:-oNGRRW.", + "type": "image", + "metadata": { + "hash": "UEJ@LBI:01t700M|E2aeaKxa~Cs:-oNGRRW.", + "size": 1478971, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 2649161856, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, nude, penis, anal, sex, smiling, muscular, closed eyes, abs, (caleb, blonde:1.4), pov, missionary, in corn field, arms above head, open mouth, panting, sweaty, cum, ejaculation, cum on body, erection, looking at viewer, projectile cum", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "name": "projectile_cum_v0.2", + "type": "lora", + "weight": 0.85 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "projectile_cum_v0.2": "adf72edbd3d1\"", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0747c594-f083-4be6-8387-ec4de027be2b/width=450/2329788.jpeg", + "nsfw": "None", + "width": 512, + "height": 680, + "hash": "UfL:=g+Z~B={%3--E2n~m,OFNIRjs,r?kWxZ", + "type": "image", + "metadata": { + "hash": "UfL:=g+Z~B={%3--E2n~m,OFNIRjs,r?kWxZ", + "size": 475817, + "width": 512, + "height": 680 + }, + "meta": { + "Size": "512x680", + "seed": 268812961, + "Model": "AnythingV5_v5PrtRE", + "steps": 20, + "hashes": { + "model": "7f96a1a9ca" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, caleb, blonde, femboy, dungarees, smiling,", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "7f96a1a9ca", + "name": "AnythingV5_v5PrtRE", + "type": "model" + } + ], + "Model hash": "7f96a1a9ca", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "FastNegativeV2": "a7465e7cc2a2\"", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2, sex", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1da029ee-20c3-43c5-8ba9-c84294ca2194/width=450/2328634.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1360, + "hash": "UJHd~s~B00bE00jF.8f*4-NG%gR+xvWCRPjZ", + "type": "image", + "metadata": { + "hash": "UJHd~s~B00bE00jF.8f*4-NG%gR+xvWCRPjZ", + "size": 1421112, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 966519500, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, long red hair, standing, white dress", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/11968619-6f0f-4266-8027-5cd341202e1e/width=450/2328648.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1360, + "hash": "U7Bf;MjG0JE1rBbb5RI:0#$*,.$*00NG~Wt8", + "type": "image", + "metadata": { + "hash": "U7Bf;MjG0JE1rBbb5RI:0#$*,.$*00NG~Wt8", + "size": 1357443, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 966519500, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, blue undercut, standing, denim hotpants", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e9088539-736b-42de-a8ed-dd200bd94540/width=450/2329004.jpeg", + "nsfw": "None", + "width": 512, + "height": 680, + "hash": "UKKw:}%L1ixZOvX8-pj]G^bc#nbb3ZS~IqR+", + "type": "image", + "metadata": { + "hash": "UKKw:}%L1ixZOvX8-pj]G^bc#nbb3ZS~IqR+", + "size": 534638, + "width": 512, + "height": 680 + }, + "meta": { + "Size": "512x680", + "seed": 3847450712, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, mankini, standing at beach, (cody, ashblonde_hair:1.4)", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "FastNegativeV2": "a7465e7cc2a2\"", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/22d0d72f-15b3-4064-9859-28f0eee1af15/width=450/2328734.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UIHn$-xbXRD%~pr?0fM_00%0M}WX4noz-oJB", + "type": "image", + "metadata": { + "hash": "UIHn$-xbXRD%~pr?0fM_00%0M}WX4noz-oJB", + "size": 1357153, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 1487316652, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, (long ashblonde_hair:1.3), standing in gym, leggins, croptop, from behind, presenting ass, (cody:1.4)", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1cfbfcd3-90aa-4f6b-857b-1373514dba5c/width=450/2328565.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UJM7DV004-9Z~U9G_2bb00-px]%2%#IV$$jF", + "type": "image", + "metadata": { + "hash": "UJM7DV004-9Z~U9G_2bb00-px]%2%#IV$$jF", + "size": 1170597, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 566481137, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, penis, ((pixie cut)), standing, white dress", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d242e8fa-dcf1-4e1e-a84e-76013d35fce8/width=450/2329071.jpeg", + "nsfw": "X", + "width": 1024, + "height": 1360, + "hash": "UCE2IaMc0gRi0}X7,axaJ+nisVS2~CROEhs9", + "type": "image", + "metadata": { + "hash": "UCE2IaMc0gRi0}X7,axaJ+nisVS2~CROEhs9", + "size": 1439356, + "width": 1024, + "height": 1360 + }, + "meta": { + "Size": "512x680", + "seed": 3592401503, + "Model": "mistoonAnime_v10", + "steps": 20, + "hashes": { + "model": "a49140c6c5" + }, + "prompt": "(8k, RAW photo, best quality, masterpiece:1.2),ultra-detailed, (high detailed skin:1.2), 8k uhd, dslr, soft lighting, high quality, dross_style, sexy, femboy, orc, red skin, demon boy, devil tail, elf_ears, (muscular) penis, sitting in cave,", + "Version": "v1.5.1", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Dross_Style_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "a49140c6c5", + "name": "mistoonAnime_v10", + "type": "model" + } + ], + "Model hash": "a49140c6c5", + "Hires steps": "25", + "bad-hands-5": "aa7651be154c", + "easynegative": "c74b4e810b03", + "Hires upscale": "2", + "FastNegativeV2": "a7465e7cc2a2\"", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "By bad artist -neg,bad-hands-5 easynegative, low quality, missing limbs, bad quality, blurred, greyed out, discoloured, bad-picture-chill-75v, FastNegativeV2", + "\"Dross_Style_v1": "92a634b95cb0\"", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.7.11", + "Denoising strength": "0.19", + "\"By bad artist -neg": "2d356134903e", + "ADetailer mask blur": "14", + "ADetailer confidence": "0.3", + "bad-picture-chill-75v": "7d9cc5f549d7", + "ADetailer dilate/erode": "32", + "Style Selector Enabled": "True", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/154029" + } + ] +} +---------------------------- diff --git a/Styles/434/yukinominato_v1-metadata.json b/Styles/434/yukinominato_v1-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..7ca6ca92f6c2706f6a90fffeccfa7993e3b3d0ea --- /dev/null +++ b/Styles/434/yukinominato_v1-metadata.json @@ -0,0 +1,2148 @@ +{ + "ss_sd_model_name": "anyhentai_19.safetensors", + "ss_resolution": "(640, 640)", + "ss_clip_skip": "2", + "ss_num_train_images": "1565", + "ss_tag_frequency": { + "5_yukinominato": { + "yukino minato": 313, + "blush": 313, + "1girl": 283, + "open_mouth": 257, + "looking_at_viewer": 231, + "loli": 226, + "short_hair": 194, + "smile": 191, + "solo": 188, + "brown_hair": 173, + "long_hair": 169, + "flat_chest": 161, + "navel": 138, + "nipples": 137, + "bangs": 135, + "breasts": 115, + "small_breasts": 114, + ":d": 114, + "cum": 110, + "pussy": 110, + "censored": 105, + "spread_legs": 105, + "collarbone": 105, + "1boy": 103, + "nude": 101, + "brown_eyes": 95, + "hetero": 91, + "sitting": 90, + "hair_ornament": 88, + "red_eyes": 88, + "cum_in_pussy": 85, + "underwear": 85, + "black_hair": 84, + "panties": 84, + "shirt": 84, + "solo_focus": 83, + "penis": 81, + "cum_on_body": 80, + "lying": 80, + "thighhighs": 80, + "indoors": 77, + "eyebrows_visible_through_hair": 74, + "tears": 71, + "bow": 68, + "blue_eyes": 67, + "skirt": 67, + "twintails": 66, + "on_back": 65, + "sweat": 65, + "cover": 64, + "ribbon": 61, + "green_eyes": 61, + "outdoors": 61, + "sex": 60, + "cover_page": 60, + "vaginal": 59, + "sky": 59, + "bare_shoulders": 58, + "holding": 58, + "blonde_hair": 57, + "hair_between_eyes": 57, + "barefoot": 57, + "after_sex": 56, + "facial": 56, + "dress": 54, + "clothes_lift": 54, + "fang": 53, + "doujin_cover": 53, + "purple_eyes": 53, + "cum_on_clothes": 52, + "mosaic_censoring": 52, + "signature": 52, + "bed_sheet": 51, + "ejaculation": 51, + "long_sleeves": 50, + "cum_on_hair": 48, + "tan": 48, + "heart": 48, + "white_panties": 47, + "tree": 46, + "cum_on_breasts": 45, + "cumdrip": 45, + "ass": 43, + "two_side_up": 43, + "bottomless": 42, + "pillow": 42, + "bukkake": 41, + "day": 41, + "cloud": 40, + "bed": 40, + "dark_skin": 40, + "tanlines": 40, + "white_shirt": 39, + "wet": 39, + "cum_on_stomach": 38, + "window": 38, + "bag": 38, + "multiple_boys": 37, + "flower": 37, + "dark-skinned_female": 37, + "multiple_girls": 37, + "groin": 37, + "swimsuit": 37, + "no_panties": 36, + "parted_bangs": 36, + "water": 36, + "standing": 35, + "dutch_angle": 35, + "school_uniform": 35, + "socks": 34, + "one-piece_tan": 34, + "black_legwear": 34, + "bar_censor": 33, + "hair_ribbon": 33, + "japanese_clothes": 33, + "low_twintails": 33, + "cum_on_ass": 32, + "looking_back": 32, + "open_clothes": 31, + "off_shoulder": 31, + "very_long_hair": 31, + "girl_on_top": 31, + "on_bed": 30, + "tail": 30, + "night": 29, + "animal_ears": 29, + "gloves": 29, + "2boys": 28, + "cum_in_mouth": 28, + "ponytail": 28, + "straddling": 28, + "yellow_eyes": 27, + "sleeveless": 27, + "pink_panties": 27, + "erection": 26, + "closed_mouth": 26, + "multiple_penises": 26, + "blue_sky": 26, + "content_rating": 26, + "jacket": 25, + "hat": 25, + "pov": 25, + "kimono": 25, + "feet": 25, + "pleated_skirt": 25, + "hairband": 25, + "white_legwear": 25, + "one_side_up": 24, + "striped": 24, + "after_vaginal": 23, + "lifted_by_self": 23, + "2girls": 23, + "teeth": 22, + "ahoge": 22, + "cum_on_boy": 22, + ":o": 22, + "towel": 22, + "male_pubic_hair": 22, + "convenient_censoring": 22, + "frills": 22, + "hairclip": 22, + "group_sex": 21, + "thighs": 21, + "completely_nude": 21, + "suggestive_fluid": 21, + "pink_eyes": 21, + "shirt_lift": 21, + "plant": 21, + "panty_pull": 21, + "speech_bubble": 20, + "uncensored": 20, + "curtains": 20, + "steam": 20, + "sleeveless_dress": 20, + "hood": 20, + "pink_hair": 20, + "hair_bow": 20, + "hair_bobbles": 20, + "one-piece_swimsuit": 20, + "school_swimsuit": 20, + "panties_around_one_leg": 20, + "backpack": 20, + "randoseru": 20, + "hair_flower": 19, + "night_sky": 19, + "plaid": 19, + "petite": 19, + "cameltoe": 19, + "sleeves_past_wrists": 19, + "symbol-shaped_pupils": 19, + "ass_visible_through_thighs": 19, + "kneehighs": 19, + "wide_sleeves": 19, + "polka_dot": 19, + "purple_hair": 19, + "dress_lift": 18, + "cloudy_sky": 18, + "bare_arms": 18, + "food": 18, + "heart-shaped_pupils": 18, + "black_thighhighs": 18, + "shorts": 18, + "rape": 17, + "pointless_condom": 17, + "testicles": 17, + "cowgirl_position": 17, + "red_bow": 17, + "clothes_pull": 17, + "condom": 17, + "jewelry": 16, + "full_body": 16, + "onsen": 16, + "blue_hair": 16, + "multiple_views": 16, + "short_sleeves": 16, + "bush": 16, + "missionary": 16, + "topless": 16, + "cum_on_tongue": 16, + "skirt_lift": 16, + "cum_string": 15, + "from_behind": 15, + "trembling": 15, + "star_\\(symbol\\)": 15, + "soaking_feet": 15, + "nature": 15, + "pubic_hair": 15, + "male_focus": 15, + "bath": 15, + "arm_support": 15, + "bikini": 15, + "shoes": 15, + "tile_floor": 15, + "moon": 14, + "star_\\(sky\\)": 14, + "red_hair": 14, + "one_eye_closed": 14, + "grass": 14, + "arms_up": 14, + "blue_skirt": 14, + "letterboxed": 14, + "threesome": 14, + "bowtie": 14, + "one-piece_swimsuit_pull": 14, + "dakimakura_\\(medium\\)": 14, + "on_side": 14, + "pink_flower": 14, + "condom_wrapper": 14, + "tiles": 14, + "white_thighhighs": 14, + "3boys": 13, + "obi": 13, + "sash": 13, + "forehead": 13, + "desk": 13, + "hoodie": 13, + "upper_teeth_only": 13, + "black_skirt": 13, + "pantyshot": 13, + "braid": 13, + "white_dress": 13, + "plaid_skirt": 13, + "boots": 13, + "white_gloves": 13, + "armpits": 13, + "arm_up": 13, + "polka_dot_panties": 13, + "starry_sky": 12, + "head_tilt": 12, + "snow": 12, + "cleft_of_venus": 12, + "see-through": 12, + "heart_censor": 12, + "branch": 12, + "sundress": 12, + "horns": 12, + "petals": 12, + "swimsuit_pull": 12, + "black_socks": 12, + "tile_wall": 12, + "bathroom": 12, + "red_ribbon": 11, + "restrained": 11, + "twitching_penis": 11, + "cum_in_ass": 11, + "on_floor": 11, + "full_moon": 11, + "i-401_\\(kancolle\\)": 11, + "camisole": 11, + "soles": 11, + "toes": 11, + "forest": 11, + "potted_plant": 11, + "fake_animal_ears": 11, + "serafuku": 11, + "glasses": 11, + "school_bag": 11, + "otoko_no_ko": 11, + "cat_ears": 11, + "wariza": 11, + "scrunchie": 11, + "cowboy_shot": 11, + "saliva": 11, + "from_below": 11, + "ceiling": 11, + "covered_nipples": 11, + "competition_school_swimsuit": 11, + "fence": 11, + "used_condom": 11, + "floral_print": 11, + "soap_bubbles": 11, + "blue_swimsuit": 11, + "elbow_gloves": 11, + "sex_from_behind": 11, + "handjob": 10, + "cum_on_pussy": 10, + "strap_slip": 10, + "snowing": 10, + "starry_background": 10, + "parted_lips": 10, + "stuffed_animal": 10, + "stuffed_toy": 10, + "teddy_bear": 10, + "clothed_female_nude_male": 10, + "detached_sleeves": 10, + "projectile_cum": 10, + "happy_sex": 10, + "rock": 10, + "book": 10, + "stairs": 10, + "twin_braids": 10, + "cape": 10, + "clothing_aside": 10, + "bell": 10, + "collar": 10, + "old_school_swimsuit": 10, + "wet_clothes": 10, + "sample_watermark": 10, + "cum_pool": 10, + "pointless_censoring": 10, + "bow_panties": 10, + "side_ponytail": 10, + "tissue": 10, + "used_tissue": 10, + "kneeling": 10, + "veins": 9, + "open_jacket": 9, + "clothed_sex": 9, + "no_pants": 9, + "chain": 9, + "body_writing": 9, + "tally": 9, + "television": 9, + "leaf": 9, + "palm_tree": 9, + "overflow": 9, + "mmf_threesome": 9, + "anal": 9, + "siblings": 9, + "cat_tail": 9, + "underwear_only": 9, + "hood_down": 9, + "building": 9, + "open_shirt": 9, + "frilled_pillow": 9, + "pillow_grab": 9, + "sheet_grab": 9, + "nipple_slip": 9, + "covering": 9, + "cum_on_self": 9, + "chain-link_fence": 9, + "hands_up": 9, + "cherry_blossoms": 9, + "sample": 9, + "no_shoes": 9, + "tongue": 9, + "condom_packet_strip": 9, + "panties_removed": 9, + "capelet": 9, + "white_background": 9, + "apron": 9, + "choker": 8, + "weapon": 8, + "bdsm": 8, + "bondage": 8, + "bound": 8, + "cuffs": 8, + "motion_lines": 8, + "crescent_moon": 8, + "4girls": 8, + "black_shirt": 8, + "outstretched_arm": 8, + "classroom": 8, + "against_tree": 8, + "bamboo": 8, + "cardigan": 8, + "cellphone": 8, + "closed_eyes": 8, + "yaoi": 8, + "sisters": 8, + "out-of-frame_censoring": 8, + "mountain": 8, + "midriff": 8, + "bra": 8, + "bare_tree": 8, + "short_shorts": 8, + "animal_ear_fluff": 8, + "holding_hands": 8, + "covered_navel": 8, + "pulled_by_self": 8, + "cup": 8, + "swimsuit_aside": 8, + "torii": 8, + "pointy_ears": 8, + "star_print": 8, + "wrist_cuffs": 8, + "money": 8, + "bathing": 8, + "bathtub": 8, + "fur_trim": 8, + "toilet": 8, + "pink_shirt": 8, + "sexually_suggestive": 8, + "short_kimono": 8, + "heart_print": 8, + "pussy_juice": 8, + "futon": 8, + "tissue_box": 8, + "cream": 8, + "scarf": 8, + "spoken_squiggle": 8, + "veiny_penis": 7, + "earrings": 7, + "gangbang": 7, + "bound_wrists": 7, + "food_on_body": 7, + "new_year": 7, + "calendar_\\(medium\\)": 7, + "yukata": 7, + "dog_ears": 7, + "fireworks": 7, + "shooting_star": 7, + "space": 7, + "tanzaku": 7, + "floral_background": 7, + "school_desk": 7, + "on_desk": 7, + "open_kimono": 7, + "christmas_tree": 7, + "anus": 7, + "phone": 7, + "smartphone": 7, + "sleeves_past_fingers": 7, + "comic": 7, + "collared_shirt": 7, + "pregnant": 7, + "age_difference": 7, + "after_ejaculation": 7, + "legs": 7, + "child": 7, + "grey_hair": 7, + "excessive_cum": 7, + "pool": 7, + "oni_horns": 7, + "faceless": 7, + "headband": 7, + "striped_legwear": 7, + "cum_in_clothes": 7, + "white_skirt": 7, + "heart_pillow": 7, + "rose": 7, + "red_dress": 7, + "tongue_out": 7, + "black_bow": 7, + "sex_toy": 7, + "print_panties": 7, + "print_kimono": 7, + "detached_collar": 7, + "drawstring": 7, + "orange_eyes": 7, + "torn_clothes": 7, + "after_rape": 7, + "shoulder_bag": 7, + "food_print": 7, + "multicolored_hair": 7, + "short_twintails": 7, + "leash": 7, + "zettai_ryouiki": 7, + "spoken_heart": 7, + "pink_dress": 6, + "...": 6, + "shackles": 6, + "clenched_teeth": 6, + "moonlight": 6, + "gradient_background": 6, + "aerial_fireworks": 6, + "aurora": 6, + "earth_\\(planet\\)": 6, + "galaxy": 6, + "light_particles": 6, + "milky_way": 6, + "planet": 6, + "starry_sky_print": 6, + "tanabata": 6, + "5girls": 6, + "pink_kimono": 6, + "all_fours": 6, + "red_gloves": 6, + "clothes_writing": 6, + "ball": 6, + "sitting_on_bed": 6, + "tree_shade": 6, + "sailor_collar": 6, + "pantyhose": 6, + "sunset": 6, + "oral": 6, + "bucket": 6, + "holding_towel": 6, + "candy": 6, + "chocolate": 6, + "red_bowtie": 6, + "pillarboxed": 6, + "hair_over_one_eye": 6, + "hair_scrunchie": 6, + "torso_grab": 6, + "english_text": 6, + "upshorts": 6, + "blunt_bangs": 6, + "legs_up": 6, + "after_paizuri": 6, + "poolside": 6, + "oni": 6, + "faceless_male": 6, + "v": 6, + "backpack_removed": 6, + "umbrella": 6, + "elf": 6, + ";d": 6, + "pants": 6, + "red_flower": 6, + "outstretched_arms": 6, + "spring_\\(season\\)": 6, + "vibrator": 6, + "showering": 6, + "soap": 6, + "soap_censor": 6, + "undressing": 6, + "towel_on_head": 6, + "box": 6, + "fur-trimmed_gloves": 6, + "rooftop": 6, + "sack": 6, + "grin": 6, + "black_panties": 6, + "witch_hat": 6, + "leaning_forward": 6, + "suspender_skirt": 6, + "simple_background": 6, + "animal": 6, + "from_above": 6, + "upper_body": 6, + "blue_dress": 6, + "strapless": 6, + "brick_wall": 6, + "rabbit_ears": 6, + "plaid_scarf": 6, + "holding_condom": 6, + "impregnation": 6, + "squiggle": 6, + "sweater": 6, + "masturbation": 5, + "fundoshi": 5, + "yamakasa": 5, + "handcuffs": 5, + "pubic_tattoo": 5, + "outstretched_hand": 5, + "overalls": 5, + "city_lights": 5, + "constellation": 5, + "fireflies": 5, + "skyline": 5, + "plaid_dress": 5, + "unmoving_pattern": 5, + "orange_hair": 5, + "necklace": 5, + "chair": 5, + "tatami": 5, + "necktie": 5, + "charm_\\(object\\)": 5, + "blood": 5, + "defloration": 5, + "fellatio": 5, + "pink_bow": 5, + "grinding": 5, + "wooden_bucket": 5, + "mouth_hold": 5, + "kemonomimi_mode": 5, + "black_border": 5, + "bedroom": 5, + "red_skirt": 5, + "stomach_bulge": 5, + "black_eyes": 5, + "table": 5, + "blazer": 5, + "suspenders": 5, + "blue_ribbon": 5, + "belt": 5, + "striped_panties": 5, + "denim_shorts": 5, + "rainbow": 5, + "fangs": 5, + "jingle_bell": 5, + "after_fellatio": 5, + "blue_one-piece_swimsuit": 5, + "sakazuki": 5, + "revealing_clothes": 5, + "animal_print": 5, + "skirt_removed": 5, + "foreskin": 5, + "imminent_penetration": 5, + "short_dress": 5, + "pov_hands": 5, + "blue_flower": 5, + "purple_flower": 5, + "rain": 5, + "pillow_hug": 5, + "starfish": 5, + "white_footwear": 5, + "couch": 5, + "red_rose": 5, + "on_stomach": 5, + "rose_petals": 5, + "anal_beads": 5, + "egg_vibrator": 5, + "remote_control_vibrator": 5, + "shower_\\(place\\)": 5, + "shower_head": 5, + "spread_pussy": 5, + "bandaid": 5, + "antlers": 5, + "bobblehat": 5, + "carrying_over_shoulder": 5, + "chimney": 5, + "christmas": 5, + "christmas_ornaments": 5, + "fake_facial_hair": 5, + "fake_mustache": 5, + "fireplace": 5, + "fur-trimmed_capelet": 5, + "fur-trimmed_dress": 5, + "fur-trimmed_headwear": 5, + "fur-trimmed_skirt": 5, + "gift": 5, + "gift_bag": 5, + "gift_box": 5, + "holding_sack": 5, + "holly": 5, + "merry_christmas": 5, + "pom_pom_\\(clothes\\)": 5, + "red_headwear": 5, + "reindeer_antlers": 5, + "reindeer_costume": 5, + "santa_bikini": 5, + "santa_boots": 5, + "santa_costume": 5, + "santa_dress": 5, + "santa_gloves": 5, + "santa_hat": 5, + "white_bow": 5, + "asymmetrical_legwear": 5, + "uneven_legwear": 5, + "hat_bow": 5, + "oversized_object": 5, + "horse_ears": 5, + "horse_girl": 5, + "toilet_paper": 5, + "chinese_zodiac": 5, + "crime_prevention_buzzer": 5, + "strawberry_panties": 5, + "ground_vehicle": 5, + "beach": 5, + "object_hug": 5, + "antenna_hair": 5, + "leotard": 5, + "stone_floor": 5, + "hand_up": 5, + "crossdressing": 5, + "x-ray": 5, + "red_scarf": 5, + "yes-no_pillow": 5, + "beads": 5, + "hair_beads": 5, + "kanna_kamui": 5, + "light_purple_hair": 5, + "white_kimono": 5, + "feather_hair_ornament": 5, + "feathers": 5, + "wand": 5, + "silver_hair": 5, + "moaning": 5, + "fertilization": 5, + "ovum": 5, + "takagi-san": 5, + "shota": 5, + "maid_headdress": 5, + "waist_apron": 5, + "white_apron": 5, + "card": 5, + "shiny": 4, + "aqua_eyes": 4, + "shrine": 4, + "tabi": 4, + "spoken_ellipsis": 4, + "2018": 4, + "tattoo": 4, + "blue_kimono": 4, + "red_kimono": 4, + "dog_girl": 4, + "dog_tail": 4, + "gradient": 4, + "naked_overalls": 4, + "ocean": 4, + "sitting_on_desk": 4, + "monitor": 4, + "knee_up": 4, + "bamboo_forest": 4, + "field": 4, + "jungle": 4, + "on_grass": 4, + "palm_leaf": 4, + "cosplay": 4, + "cum_on_penis": 4, + "neckerchief": 4, + "black_sailor_collar": 4, + "holding_phone": 4, + "iphone": 4, + "train_interior": 4, + "double_penetration": 4, + "twins": 4, + "sitting_on_person": 4, + "ffm_threesome": 4, + "wooden_fence": 4, + "valentine": 4, + "covered_mouth": 4, + "sandals": 4, + "waterfall": 4, + "miniskirt": 4, + "sleeveless_shirt": 4, + "holding_food": 4, + "phone_screen": 4, + "white_bikini": 4, + "leaning_back": 4, + "piercing": 4, + "oversized_clothes": 4, + "bookshelf": 4, + "dress_shirt": 4, + "big_belly": 4, + "alcohol": 4, + "male_masturbation": 4, + "staff": 4, + "tentacles": 4, + "m_legs": 4, + "polka_dot_dress": 4, + "partially_visible_vulva": 4, + "green_jacket": 4, + "medium_breasts": 4, + "dated": 4, + "sidelocks": 4, + "crying": 4, + "neck_ribbon": 4, + "after_anal": 4, + "precum": 4, + "hand_on_own_stomach": 4, + "oil-paper_umbrella": 4, + "wet_dress": 4, + "house": 4, + "dark_elf": 4, + "buruma": 4, + "gym_uniform": 4, + "saint_quartz_\\(fate\\)": 4, + "star_hair_ornament": 4, + "star_pasties": 4, + "red_footwear": 4, + "side-tie_panties": 4, + "confetti": 4, + "falling_petals": 4, + "hanami": 4, + "dildo": 4, + "yellow_skirt": 4, + "kimono_lift": 4, + "imminent_vaginal": 4, + "locker": 4, + "locker_room": 4, + "swimsuit_under_clothes": 4, + "ro-500_\\(kancolle\\)": 4, + "fur-trimmed_legwear": 4, + "holding_bag": 4, + "red_capelet": 4, + "black_headwear": 4, + "mary_janes": 4, + "white_ribbon": 4, + "halloween": 4, + "jack-o'-lantern": 4, + "pumpkin": 4, + "torn_legwear": 4, + "restroom": 4, + "wading": 4, + "partially_submerged": 4, + "denim": 4, + "panty_peek": 4, + "blue_shorts": 4, + "no_bra": 4, + "naked_hoodie": 4, + "pink_hoodie": 4, + "tail_raised": 4, + "pink_jacket": 4, + "strawberry_print": 4, + "motor_vehicle": 4, + "bag_charm": 4, + "nude_cover": 4, + "reverse_cowgirl_position": 4, + "black_gloves": 4, + "mask": 4, + "brick": 4, + "brick_floor": 4, + "stone_wall": 4, + "wall": 4, + "blue_rose": 4, + "purple_rose": 4, + "cum_on_pectorals": 4, + "lotion": 4, + "messy": 4, + "^_^": 4, + "honeycomb_\\(pattern\\)": 4, + "honeycomb_background": 4, + "coat": 4, + "winter_clothes": 4, + "snowflakes": 4, + "snowman": 4, + "egasumi": 4, + "wooden_floor": 4, + "watermark": 4, + "looking_away": 4, + "hakama": 4, + "hakama_skirt": 4, + "striped_shirt": 4, + "illyasviel_von_einzbern": 4, + "magical_girl": 4, + "candy_apple": 4, + "summer_festival": 4, + "lantern": 4, + "slave": 4, + "white_socks": 4, + "low_ponytail": 4, + "out_of_frame": 4, + "condom_in_mouth": 4, + "spoken_object": 4, + "child_on_child": 4, + "wings": 4, + "striped_thighhighs": 4, + "prostitution": 4, + "lolita_hairband": 4, + "frilled_hairband": 4, + "print_legwear": 4, + "holding_card": 4, + "playing_card": 4, + "tablet_pc": 4, + "winter": 4, + "pokemon_\\(creature\\)": 3, + "rope": 3, + "sword": 3, + "uniform": 3, + "happy_new_year": 3, + "marker": 3, + "reaching": 3, + "astronaut": 3, + "desert": 3, + "dust": 3, + "red_moon": 3, + "telescope": 3, + "plaid_shirt": 3, + "profile": 3, + "brown_shirt": 3, + "pink_camisole": 3, + "shiny_hair": 3, + "wince": 3, + "chalkboard": 3, + "bare_legs": 3, + "animal_costume": 3, + "animal_hood": 3, + "on_ground": 3, + "under_tree": 3, + "blush_stickers": 3, + "ikazuchi_\\(kancolle\\)": 3, + "looking_at_phone": 3, + "red_neckerchief": 3, + "selfie": 3, + "sleeping": 3, + "red_necktie": 3, + "penises_touching": 3, + "frottage": 3, + "naked_ribbon": 3, + "covering_mouth": 3, + "chocolate_on_body": 3, + "anal_tail": 3, + "popsicle": 3, + "upskirt": 3, + "white_bra": 3, + "oversized_shirt": 3, + "photo_\\(object\\)": 3, + "bottle": 3, + "can": 3, + "large_penis": 3, + "4boys": 3, + "black_ribbon": 3, + "frilled_sleeves": 3, + "red_shirt": 3, + "hinatsuru_ai": 3, + "checkered": 3, + "polka_dot_background": 3, + "hand_on_own_chest": 3, + "grabbing": 3, + "breast_grab": 3, + "name_tag": 3, + "vest": 3, + "single_braid": 3, + "blue_jacket": 3, + "on_table": 3, + "hand_fan": 3, + "handheld_game_console": 3, + "black_umbrella": 3, + "blue_umbrella": 3, + "bus_stop": 3, + "holding_umbrella": 3, + "hydrangea": 3, + "leaf_umbrella": 3, + "morning_glory": 3, + "parasol": 3, + "pink_umbrella": 3, + "puddle": 3, + "raincoat": 3, + "red_umbrella": 3, + "rubber_boots": 3, + "shared_umbrella": 3, + "snail": 3, + "teruterubouzu": 3, + "transparent": 3, + "transparent_umbrella": 3, + "water_drop": 3, + "white_umbrella": 3, + "yellow_footwear": 3, + "cum_on_glasses": 3, + "recording": 3, + "akagi_miria": 3, + "crop_top": 3, + "frilled_skirt": 3, + "monochrome": 3, + "sakurai_momoka": 3, + "high_heels": 3, + "internal_cumshot": 3, + "petals_on_liquid": 3, + "double_handjob": 3, + "hitachi_magic_wand": 3, + "multiple_condoms": 3, + "heavy_breathing": 3, + "argyle": 3, + "argyle_background": 3, + "side-tie_bikini": 3, + "dark-skinned_male": 3, + "covering_breasts": 3, + "just_the_tip": 3, + "sparkle": 3, + "bandeau": 3, + "footjob": 3, + "key": 3, + "keyhole": 3, + "orange_bow": 3, + "polka_dot_bow": 3, + "single_thighhigh": 3, + "abigail_williams_\\(fate\\)": 3, + "black_footwear": 3, + "glowing": 3, + "sunlight": 3, + "bat": 3, + "cross": 3, + "halloween_bucket": 3, + "halloween_costume": 3, + "pumpkin_hat": 3, + "trick_or_treat": 3, + "cloak": 3, + "hand_on_own_head": 3, + "doggystyle": 3, + "fat": 3, + "handbag": 3, + "buruma_pull": 3, + "white_hairband": 3, + "bent_over": 3, + "bike_shorts": 3, + "waving": 3, + "bandaid_on_knee": 3, + "car": 3, + "paw_print": 3, + "paw_print_background": 3, + "paw_pose": 3, + "ripples": 3, + "anal_object_insertion": 3, + "butt_plug": 3, + "object_insertion": 3, + "goggles": 3, + "licking_penis": 3, + "pink_scrunchie": 3, + "lamp": 3, + "bound_arms": 3, + "knee_boots": 3, + "pink_skirt": 3, + "bandaid_on_pussy": 3, + "thigh_grab": 3, + "hooded_jacket": 3, + "pavement": 3, + "pink_footwear": 3, + "white_flower": 3, + "rice_shower_\\(umamusume\\)": 3, + "cum_on_hands": 3, + "milk": 3, + "rose_print": 3, + "uterus": 3, + "breath": 3, + "duffel_coat": 3, + "wet_shirt": 3, + "yes": 3, + "twitter_username": 3, + "tail_wagging": 3, + "orange_scarf": 3, + "copyright_name": 3, + "light_brown_hair": 3, + "pouch": 3, + "chained": 3, + "holding_weapon": 3, + "lowleg": 3, + "hexagon": 3, + "nishizumi_miho": 3, + "mixed_bathing": 3, + "stomach": 3, + "dirty": 3, + "fruit": 3, + "miko": 3, + "plum_blossoms": 3, + "red_hakama": 3, + "uwabaki": 3, + "pink_rose": 3, + "white_rose": 3, + "yellow_rose": 3, + "raglan_sleeves": 3, + "holding_panties": 3, + "nose_blush": 3, + "bat_wings": 3, + "black_cape": 3, + "reaching_out": 3, + "fleur_de_lapin_uniform": 3, + "tray": 3, + "kirima_sharo": 3, + "black_hairband": 3, + "teacup": 3, + "underbust": 3, + "kirima_syaro": 3, + "waitress": 3, + "bowl": 3, + "pink_background": 3, + "two-tone_background": 3, + "sperm_cell": 3, + "letter": 3, + "love_letter": 3, + "white_headwear": 3, + "checkered_scarf": 3, + "fringe_trim": 3, + "interlocked_fingers": 3, + "green_shirt": 3, + "viewfinder": 3, + "puffy_sleeves": 3, + "black_jacket": 2, + "medium_hair": 2, + "gloria_\\(pokemon\\)": 2, + "tanya_degurechaff": 2, + "military": 2, + "military_uniform": 2, + "angry": 2, + "barcode": 2, + "half-closed_eyes": 2, + "public_use": 2, + "2012": 2, + "year_of_the_dog": 2, + "overall_shorts": 2, + "honma_meiko": 2, + "bodysuit": 2, + "hand_on_hip": 2, + "skin_tight": 2, + "pendant": 2, + "foliage": 2, + "garden": 2, + "log": 2, + "moss": 2, + "mushroom": 2, + "path": 2, + "pond": 2, + "tent": 2, + "tree_stump": 2, + "wheat": 2, + "eevee": 2, + "hood_up": 2, + "anger_vein": 2, + "black_serafuku": 2, + "earphones": 2, + "sleeping_upright": 2, + "school_briefcase": 2, + "blue_shirt": 2, + "black-framed_eyewear": 2, + "back": 2, + "steam_censor": 2, + "chocolate_on_breasts": 2, + "heart-shaped_chocolate": 2, + "white_one-piece_swimsuit": 2, + "ear_piercing": 2, + "shirasaka_koume": 2, + "mirror": 2, + "door": 2, + "holding_book": 2, + "naked_shirt": 2, + "reverse_upright_straddle": 2, + "flaccid": 2, + "microphone": 2, + "holding_microphone": 2, + "implied_sex": 2, + "karaoke": 2, + "halftone": 2, + "halftone_background": 2, + "panties_aside": 2, + "polka_dot_bra": 2, + "polka_dot_shirt": 2, + "squatting": 2, + "demon_tail": 2, + "net": 2, + "sake": 2, + "skin-covered_horns": 2, + "shuten_douji_\\(fate\\)": 2, + "leg_ribbon": 2, + "ankle_ribbon": 2, + "hat_removed": 2, + "headwear_removed": 2, + "moriya_suwako": 2, + "purple_skirt": 2, + "brown_headwear": 2, + "frog_print": 2, + "turtleneck": 2, + "purple_vest": 2, + "leg_grab": 2, + "disembodied_penis": 2, + "futasub": 2, + "handsfree_ejaculation": 2, + "imminent_rape": 2, + "looking_at_penis": 2, + "penis_awe": 2, + "phimosis": 2, + "foreshortening": 2, + "fox_ears": 2, + "front-tie_top": 2, + "tied_shirt": 2, + "w": 2, + "paper_fan": 2, + "donation_box": 2, + "nintendo_switch": 2, + "tank_top": 2, + "frilled_dress": 2, + "bench": 2, + "bulge": 2, + "double_v": 2, + "track_jacket": 2, + "pants_pull": 2, + "layered_skirt": 2, + "polka_dot_skirt": 2, + "pink_ribbon": 2, + "ribbon_choker": 2, + "greyscale": 2, + "red_panties": 2, + "red_hairband": 2, + "untied": 2, + "untied_panties": 2, + "beer_can": 2, + "picnic": 2, + "chips_\\(food\\)": 2, + "potato_chips": 2, + "hand_on_another's_head": 2, + "underboob": 2, + "condom_on_penis": 2, + "bubble": 2, + "sponge": 2, + "wet_hair": 2, + "interracial": 2, + "circlet": 2, + "manya_\\(dq4\\)": 2, + "bracelet": 2, + "dress_pull": 2, + "large_breasts": 2, + "sparkle_background": 2, + "mismatched_legwear": 2, + "\\\\o/": 2, + "femdom": 2, + "horse_tail": 2, + "spread_arms": 2, + "yellow_shirt": 2, + "flower_field": 2, + "holding_flower": 2, + "summer": 2, + "sunflower": 2, + "yellow_flower": 2, + "torn_dress": 2, + "3girls": 2, + "beachball": 2, + "kickboard": 2, + "adjusting_swimsuit": 2, + "polka_dot_legwear": 2, + "incest": 2, + "train_station": 2, + "over_shoulder": 2, + "blue_buruma": 2, + "public_indecency": 2, + "exhibitionism": 2, + "gym_shirt": 2, + "christmas_lights": 2, + "fur-trimmed_sleeves": 2, + "reindeer": 2, + "inflatable_raft": 2, + "black_shorts": 2, + "food-themed_hair_ornament": 2, + "claw_pose": 2, + "gao": 2, + "tiger_ears": 2, + "tiger_tail": 2, + "unzipped": 2, + "striped_tail": 2, + "tiger_girl": 2, + "bear_panties": 2, + "print_dress": 2, + "bandaid_on_leg": 2, + "car_interior": 2, + "cat_girl": 2, + "dappled_sunlight": 2, + "stone_lantern": 2, + "feet_out_of_frame": 2, + "hair_censor": 2, + "hair_over_breasts": 2, + "fake_tail": 2, + "horizon": 2, + "pov_crotch": 2, + "closed_umbrella": 2, + "clothed_male_nude_female": 2, + "ahegao": 2, + "torn_leotard": 2, + "torn_pants": 2, + "torn_sleeves": 2, + "pasties": 2, + "^^^": 2, + "frog": 2, + "artist_name": 2, + "blurry": 2, + "depth_of_field": 2, + "foam": 2, + "white_day": 2, + "hug": 2, + "cherry_blossom_print": 2, + "purple_kimono": 2, + "alternate_costume": 2, + "mount_fuji": 2, + "penis_grab": 2, + "nengajou": 2, + "bow_bra": 2, + "dakimakura_\\(object\\)": 2, + "head_on_pillow": 2, + "holding_pillow": 2, + "under_covers": 2, + "brothers": 2, + "twilight": 2, + "pinafore_dress": 2, + "red_neckwear": 2, + "ayanami_rei": 2, + "tokyo-3_middle_school_uniform": 2, + "character_name": 2, + "vertical_stripes": 2, + "thigh_boots": 2, + "prisma_illya": 2, + "ascot": 2, + "wavy_mouth": 2, + "orange_ascot": 2, + "holding_ball": 2, + "festival": 2, + "holding_sword": 2, + "glint": 2, + "silhouette": 2, + "babydoll": 2, + "library": 2, + "arrow_\\(symbol\\)": 2, + "faucet": 2, + "crying_with_eyes_open": 2, + "forehead_jewel": 2, + "wide-eyed": 2, + "dirty_clothes": 2, + "colored_skin": 2, + "strawberry": 2, + "against_wall": 2, + "floor": 2, + "sailor_moon_redraw_challenge": 2, + "silk": 2, + "spider_web": 2, + "thigh_strap": 2, + "animal_collar": 2, + "ball_and_chain_restraint": 2, + "bound_ankles": 2, + "broken_chain": 2, + "red_collar": 2, + "viewer_holding_leash": 2, + "leonardo_da_vinci_\\(fate\\)": 2, + "+++": 2, + "beans": 2, + "club_\\(weapon\\)": 2, + "kanabou": 2, + "makizushi": 2, + "mamemaki": 2, + "masu": 2, + "setsubun": 2, + "spiked_club": 2, + "sushi": 2, + "tiger_print": 2, + "tiger_stripes": 2, + "lum": 2, + "head_scarf": 2, + "cross-section": 2, + "toilet_use": 2, + ":3": 2, + "red_coat": 2, + "head_wings": 2, + "thorns": 2, + "vampire": 2, + "vampy": 2, + "coffee": 2, + "licking": 2, + "injury": 2, + "skirt_hold": 2, + "cat_hair_ornament": 2, + "chocolate_making": 2, + "food_on_face": 2, + "mixing_bowl": 2, + "whisk": 2, + "spill": 2, + "spatula": 2, + "looking_to_the_side": 2, + "hair_over_shoulder": 2, + "dice": 2, + "envelope": 2, + "gameplay_mechanics": 2, + "paper_airplane": 2, + "playboy_bunny": 2, + "rabbit_tail": 2, + "shikigami": 2, + "tarot": 2, + "enmaided": 2, + "frilled_apron": 2, + "maid": 2, + "maid_apron": 2, + "black_dress": 2, + "black_scarf": 2, + "blue_scarf": 2, + "brown_scarf": 2, + "enpera": 2, + "green_scarf": 2, + "grey_scarf": 2, + "naked_scarf": 2, + "pink_scarf": 2, + "plaid_background": 2, + "purple_scarf": 2, + "shared_scarf": 2, + "striped_scarf": 2, + "white_scarf": 2, + "yellow_scarf": 2, + "shared_clothes": 2, + "black_bikini": 2, + "breastplate": 2, + "hair_stick": 2, + "hairpin": 2, + "stomach_tattoo": 2, + "chloe_von_einzbern": 2, + "broom": 2, + "happy_halloween": 2, + "pumpkin_hair_ornament": 2, + "witch": 2, + "black_cloak": 2, + "cellphone_picture": 2, + "nintendo_3ds": 2, + "taking_picture": 2, + "cum_while_penetrated": 2, + "year_of_the_ox": 2, + "cow": 2, + "holding_animal": 2, + "fox_mask": 2, + "mask_on_head": 2, + "tengu_mask": 2, + "eating": 2, + "hair_bun": 2, + "hand_on_own_knee": 2, + "kinomoto_sakura": 2, + "asymmetrical_bangs": 1, + "asymmetrical_hair": 1, + "black_choker": 1, + "black_nails": 1, + "furry_with_non-furry": 1, + "marnie_\\(pokemon\\)": 1, + "morpeko": 1, + "nail_polish": 1, + "shiny_skin": 1, + "undercut": 1, + "leg_up": 1, + "standing_on_one_leg": 1, + "bodypaint": 1, + "calligraphy_brush": 1, + "facepaint": 1, + "hagoita": 1, + "hanetsuki": 1, + "leg_tattoo": 1, + "paddle": 1, + "paintbrush": 1, + "2013": 1, + "2016": 1, + "2015": 1, + "2014": 1, + "beckoning": 1, + "reaching_towards_viewer": 1, + "brown_kimono": 1, + "watercraft": 1, + "giant": 1, + "giantess": 1, + "island": 1, + "black_bodysuit": 1, + "pilot_suit": 1, + "upper_teeth": 1, + "grey_shirt": 1, + "toenails": 1, + "thigh_gap": 1, + "blue_sleeves": 1, + "totooria_helmold": 1, + "shoulder_blades": 1, + "blue_sailor_collar": 1, + "spitroast": 1, + "cirno": 1, + "teamwork": 1, + "fountain": 1, + "pencil": 1, + "flying_sweatdrops": 1, + "toothbrush": 1, + "scissors": 1, + "unbuttoned": 1, + "belly_grab": 1, + "sake_bottle": 1, + "autumn": 1, + "autumn_leaves": 1, + "falling_leaves": 1, + "ginkgo_leaf": 1, + "holding_leaf": 1, + "leaf_background": 1, + "leaf_hair_ornament": 1, + "leaf_on_head": 1, + "maple_leaf": 1, + "pink_legwear": 1, + "sweet_potato": 1, + "aki_shizuha": 1, + "pink_socks": 1, + "suspender_shorts": 1, + "colored_eyelashes": 1, + "monster": 1, + "slime_\\(substance\\)": 1, + "slime_\\(dragon_quest\\)": 1, + "naked_cape": 1, + "purple_cape": 1, + "6+girls": 1, + "konjiki_no_yami": 1, + "yuuki_mikan": 1, + "momo_velia_deviluke": 1, + "lala_satalin_deviluke": 1, + "racket": 1, + "grey_eyes": 1, + "wedding_band": 1, + "syringe": 1, + ">_<": 1, + "dark_penis": 1, + "identity_censor": 1, + "loose_socks": 1, + "no_testicles": 1, + "urethral_insertion": 1, + "fire": 1, + "fake_screenshot": 1, + "torch": 1, + "alice_margatroid": 1, + "ring": 1, + "long_pointy_ears": 1, + "track_suit": 1, + "track_pants": 1, + "bangle": 1, + "cheerleader": 1, + "fingernails": 1, + "pom_pom_\\(cheerleading\\)": 1, + "star_earrings": 1, + "print_skirt": 1, + "bags_under_eyes": 1, + "wavy_hair": 1, + "ice_cream": 1, + "ice_cream_cone": 1, + "kagamihara_nadeshiko": 1, + "sideboob": 1, + "candy_wrapper": 1, + "lube": 1, + "checkered_background": 1, + "checkered_floor": 1, + "kimono_pull": 1, + "blue_bikini": 1, + "sweatdrop": 1, + "thought_bubble": 1, + "sasaki_chie": 1, + "side-tie_bikini_bottom": 1, + "rabbit_hair_ornament": 1, + "+_+": 1, + "two-footed_footjob": 1, + "belt_buckle": 1, + "buckle": 1, + "white_shorts": 1, + "dog_tags": 1, + "ear_ribbon": 1, + "mayano_top_gun_\\(umamusume\\)": 1, + "brown_thighhighs": 1, + "green_belt": 1, + "bat_hair_ornament": 1, + "blanket": 1, + "canopy_bed": 1, + "crescent": 1, + "curtain_grab": 1, + "ghost": 1, + "ghost_costume": 1, + "graveyard": 1, + "nun": 1, + "purple_sky": 1, + "tombstone": 1, + "torn_cape": 1, + "bat_\\(animal\\)": 1, + "purple_bow": 1, + "purple_panties": 1, + "sign": 1, + "hose": 1, + "lily_pad": 1, + "new_school_swimsuit": 1, + "mole": 1, + "izumi_konata": 1, + "adjusting_clothes": 1, + "hand_net": 1, + "butterfly_net": 1, + "swept_bangs": 1, + "satou_shin": 1, + "thick_eyebrows": 1, + "fat_man": 1, + "looking_at_another": 1, + "flashing": 1, + "panties_under_buruma": 1, + "pussy_peek": 1, + "holding_strap": 1, + "orange_background": 1, + "carrot_hair_ornament": 1, + "border": 1, + "circle_cut": 1, + "grey_border": 1, + "shikishi": 1, + "bear_print": 1, + "ivy": 1, + "pine_tree": 1, + "shade": 1, + "school_chair": 1, + "yellow_ribbon": 1, + "manga_cover": 1, + "tail_through_clothes": 1, + "white_swimsuit": 1, + "hill": 1, + "lake": 1, + "shore": 1, + "straw_hat": 1, + "sun_hat": 1, + "hands_on_headwear": 1, + "android": 1, + "gradient_hair": 1, + "headphones": 1, + "headphones_around_neck": 1, + "joints": 1, + "mechanical_parts": 1, + "jibril_\\(no_game_no_life\\)": 1, + "blue_scrunchie": 1, + "polka_dot_scrunchie": 1, + "river": 1, + "torn_bike_shorts": 1, + "torn_bodysuit": 1, + "torn_gloves": 1, + "torn_swimsuit": 1, + "nipple_tweak": 1, + "flat_chest_grab": 1, + "brother_and_sister": 1, + "bandaids_on_nipples": 1, + "barcode_tattoo": 1, + "character_censor": 1, + "facial_tattoo": 1, + "heart_tattoo": 1, + "novelty_censor": 1, + "fingerless_gloves": 1, + "chestnut_mouth": 1, + "open_hoodie": 1, + "sneakers": 1, + "grey_skirt": 1, + "over-kneehighs": 1, + "beach_umbrella": 1, + "purple_umbrella": 1, + "green_dress": 1, + "blurry_background": 1, + "knife": 1, + "sheath": 1, + "off-shoulder_dress": 1, + "hat_flower": 1, + "dagger": 1, + "tilted_headwear": 1, + "purple_dress": 1, + "blue_headwear": 1, + "sheathed": 1, + "cream_on_face": 1, + "sunscreen": 1, + "rubber_duck": 1, + "mountainous_horizon": 1, + "stone_stairs": 1, + "haru_urara_\\(umamusume\\)": 1, + "facing_viewer": 1, + "penis_on_face": 1, + "elio_\\(pokemon\\)": 1, + "lana_\\(pokemon\\)": 1, + "candy_cane": 1, + "deer_ears": 1, + "fake_antlers": 1, + "fur-trimmed_boots": 1, + "holding_gift": 1, + "ornament": 1, + "red_sleeves": 1, + "wreath": 1, + "red_bikini": 1, + "green_hair": 1, + "black_kimono": 1, + "v-shaped_eyebrows": 1, + "frilled_kimono": 1, + "anklet": 1, + ">:\\)": 1, + "brown_footwear": 1, + "brown_gloves": 1, + "single_pantsleg": 1, + "torn_scarf": 1, + "asymmetrical_clothes": 1, + "tube_top": 1, + "evening": 1, + "hakama_short_skirt": 1, + "orange_sky": 1, + "red_sky": 1, + "tasuki": 1, + "holding_wand": 1, + "pink_sleeves": 1, + "magical_ruby": 1, + "yellow_ascot": 1, + "holding_poke_ball": 1, + "kinchaku": 1, + "orb": 1, + "paper_lantern": 1, + "poke_ball": 1, + "poke_ball_\\(basic\\)": 1, + "temari_ball": 1, + "yin_yang": 1, + "fish": 1, + "goldfish": 1, + "bagged_fish": 1, + "multitasking": 1, + "open_book": 1, + "reading": 1, + "orange_shirt": 1, + "scowl": 1, + "maebari": 1, + "hands_on_own_stomach": 1, + "bath_stool": 1, + "crack": 1, + "shouji": 1, + "sliding_doors": 1, + "volleyball": 1, + "no_mask": 1, + "head_wreath": 1, + "zouri": 1, + "skyscraper": 1, + "skirt_around_one_leg": 1, + "hand_on_another's_shoulder": 1, + "ankle_cuffs": 1, + "black_collar": 1, + "spreader_bar": 1, + "vibrator_in_thighhighs": 1, + "vibrator_on_nipple": 1, + "vibrator_under_clothes": 1, + "side_braid": 1, + "eraser": 1, + "armband": 1, + "green_necktie": 1, + "pencil_skirt": 1, + "police": 1, + "police_uniform": 1, + "policewoman": 1, + "salute": 1, + "train": 1, + "folded_ponytail": 1, + "kuga_natsuki": 1, + "green_ribbon": 1, + "roll_\\(mega_man\\)": 1, + "shop": 1, + "lollipop": 1, + "honey": 1, + "green_skirt": 1, + "arms_behind_back": 1, + "blue_butterfly": 1, + "bug": 1, + "butterfly": 1, + "white_butterfly": 1, + "yellow_butterfly": 1, + "blue_panties": 1, + "holding_clothes": 1, + "arm_grab": 1, + "arm_held_back": 1, + "bra_removed": 1, + "holding_another's_wrist": 1, + "izumi_sagiri": 1, + "female_masturbation": 1, + "vaginal_object_insertion": 1, + "animal_on_head": 1, + "monkey_tail": 1, + "on_head": 1, + "tail_ornament": 1, + "toeless_legwear": 1, + "virtual_youtuber": 1, + "andira_\\(granblue_fantasy\\)": 1, + "blue_bow": 1, + "open_fly": 1, + "erune": 1, + "tail_ribbon": 1, + "tail_bell": 1, + "monkey": 1, + "monkey_ears": 1, + "open_shorts": 1, + "black_flower": 1, + "black_rose": 1, + "bouquet": 1, + "flower_ornament": 1, + "green_flower": 1, + "holding_bouquet": 1, + "vase": 1, + "dragon_girl": 1, + "dragon_horns": 1, + "striped_socks": 1, + "crossed_arms": 1, + "naked_apron": 1, + "orange_dress": 1, + "kitchen": 1, + "empty_eyes": 1, + "torn_panties": 1, + "blue_skin": 1, + "cervix": 1, + "knees_up": 1, + "bra_visible_through_clothes": 1, + "shoes_removed": 1, + "holding_shoes": 1, + "pajamas": 1, + "pink_pajamas": 1, + "thermometer": 1, + "american_flag": 1, + "black_leotard": 1, + "club_\\(shape\\)": 1, + "diamond_\\(shape\\)": 1, + "holding_sign": 1, + "leg_garter": 1, + "magician": 1, + "poker_chip": 1, + "spade_\\(shape\\)": 1, + "spoken_exclamation_mark": 1, + "ufo": 1, + "censored_nipples": 1, + "kneepits": 1, + "lactation": 1, + "rolling_eyes": 1, + "ice_cube": 1, + "partially_colored": 1, + "mikasa_ackerman": 1, + "skirt_set": 1, + "covering_crotch": 1, + "between_legs": 1, + "flipped_hair": 1, + "acerola_\\(pokemon\\)": 1, + "armor": 1, + "red_cape": 1, + "waist_cape": 1, + "black_bra": 1, + "drooling": 1, + "asphyxiation": 1, + "strangling": 1, + "paizuri": 1, + "neck_bell": 1, + "sink": 1, + "east_asian_architecture": 1, + "hachimaki": 1, + "instrument": 1, + "uchiwa": 1, + "camcorder": 1, + "camera": 1, + "camera_phone": 1, + "health_bar": 1, + "id_card": 1, + "mahjong_tile": 1, + "milk_carton": 1, + "micro_bikini": 1, + "bikini_top_only": 1, + "androgynous": 1, + "keychain": 1, + "mars_symbol": 1, + "messenger_bag": 1, + "penis_in_panties": 1, + "pink_bra": 1, + "bra_lift": 1, + "training_bra": 1, + "bridge": 1, + "cityscape": 1, + "heart_pasties": 1, + "mochi": 1, + "purple_legwear": 1, + "purple_leotard": 1, + "miyu_edelfelt": 1, + "highleg": 1, + "highleg_leotard": 1, + "purple_thighhighs": 1, + "white_cape": 1, + "tentacle_sex": 1, + "leotard_aside": 1, + "x_hair_ornament": 1, + "book_stack": 1, + "purple_sleeves": 1, + "condensation_trail": 1, + "dandelion": 1, + "skirt_basket": 1, + "print_bra": 1, + "yellow_hoodie": 1, + "sakura_kyouko": 1, + "consensual_tentacles": 1, + "pink_thighhighs": 1, + "pink_gloves": 1, + "opaque_glasses": 1, + "game_boy": 1, + "playstation_portable": 1, + "remote_control": 1, + "cold": 1, + "scarf_over_mouth": 1, + "white_sweater": 1, + "hand_in_pocket": 1, + "narita_taishin_\\(umamusume\\)": 1, + "white_jacket": 1, + "puffy_long_sleeves": 1, + "apple": 1, + "banana": 1, + "berry": 1, + "blueberry": 1, + "cake": 1, + "cherry": 1, + "food-themed_clothes": 1, + "fruit_on_head": 1, + "grapes": 1, + "holding_fruit": 1, + "in_food": 1, + "melon": 1, + "minigirl": 1, + "orange_\\(fruit\\)": 1, + "parfait": 1, + "peach": 1, + "red_apple": 1, + "strawberry_hair_ornament": 1, + "strawberry_shortcake": 1, + "tomato": 1, + "watermelon": 1, + "whipped_cream": 1, + "blue_theme": 1, + "brown_pants": 1, + "off-shoulder_shirt": 1, + "t-shirt": 1, + "baseball_cap": 1, + "green_headwear": 1, + "open_door": 1, + "mug": 1, + "beard": 1, + "facial_hair": 1, + "ugly_man": 1, + "size_difference": 1, + "striped_bow": 1, + "striped_bowtie": 1, + "alice_cartelet": 1, + "open_cardigan": 1, + "single_hair_bun": 1, + "park": 1, + ";o": 1, + ";q": 1, + "finger_to_mouth": 1, + "hand_to_head": 1, + "rubbing_eyes": 1, + "bikini_bottom_only": 1, + "finger_in_own_mouth": 1, + "green_kimono": 1, + "genderswap": 1, + "futanari": 1, + "futa_with_male": 1, + "penis_size_difference": 1, + "poster_\\(object\\)": 1, + "homurahara_academy_uniform": 1, + "puffy_short_sleeves": 1, + "homurahara_academy_school_uniform": 1, + "from_side": 1, + "road": 1, + "frilled_bikini": 1, + "purple_bikini": 1, + "sand": 1, + "innertube": 1, + "crab": 1, + "vaulting_horse": 1, + "black_hoodie": 1, + "grey_hoodie": 1, + "sleeveless_hoodie": 1, + "railing": 1, + "checkered_skirt": 1, + "hands_on_own_knees": 1, + "sitting_on_face": 1, + "cunnilingus": 1, + "snowflake_print": 1, + "snowflake_hair_ornament": 1, + "holding_cup": 1, + "short_eyebrows": 1, + "balloon": 1, + "card_\\(medium\\)": 1, + "card_parody": 1, + "cd": 1, + "origami": 1, + "party_popper": 1, + "seashell": 1, + "kirby": 1, + "criss-cross_halter": 1, + "halterneck": 1, + "sarashi": 1, + "robe": 1, + "lowleg_panties": 1, + "ass_grab": 1, + "grabbing_another's_ass": 1, + "hand_on_another's_ass": 1, + "abuse": 1, + "bruise": 1, + "cuts": 1, + "spoken_blush": 1, + "talking": 1, + "ranguage": 1, + "engrish_text": 1, + "finger_in_another's_mouth": 1, + "transparent_background": 1, + "anchor": 1, + "flail": 1, + "gold_chain": 1, + "holding_leash": 1, + "leash_pull": 1, + "metal_collar": 1, + "prison": 1, + "prison_clothes": 1, + "lock": 1, + "tomoeda_elementary_school_uniform": 1, + "pink_headwear": 1, + "fuuin_no_tsue": 1 + } + }, + "ss_batch_size_per_device": "6", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 320, + 960 + ], + "count": 10 + }, + "1": { + "resolution": [ + 384, + 576 + ], + "count": 10 + }, + "2": { + "resolution": [ + 448, + 768 + ], + "count": 10 + }, + "3": { + "resolution": [ + 448, + 832 + ], + "count": 5 + }, + "4": { + "resolution": [ + 512, + 704 + ], + "count": 1200 + }, + "5": { + "resolution": [ + 512, + 768 + ], + "count": 155 + }, + "6": { + "resolution": [ + 576, + 576 + ], + "count": 35 + }, + "7": { + "resolution": [ + 576, + 640 + ], + "count": 35 + }, + "8": { + "resolution": [ + 640, + 512 + ], + "count": 15 + }, + "9": { + "resolution": [ + 640, + 576 + ], + "count": 45 + }, + "10": { + "resolution": [ + 704, + 448 + ], + "count": 5 + }, + "11": { + "resolution": [ + 704, + 512 + ], + "count": 35 + }, + "12": { + "resolution": [ + 768, + 384 + ], + "count": 5 + } + }, + "mean_img_ar_error": 0.020645673750061461 + }, + "ss_bucket_no_upscale": "True", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "5_yukinominato": { + "n_repeats": 5, + "img_count": 313 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "2", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "1", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "constant", + "ss_lr_warmup_steps": "0", + "ss_max_bucket_reso": "1024", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "2609", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "1.0", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "011cdb0b184fc66910401011fbcf9dab399f9d3e2d6a06812cb840e2a8cf5d83", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "264", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "yukinominato_v2", + "ss_prior_loss_weight": "1.0", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "fe1e0ff6", + "ss_sd_scripts_commit_hash": "8320ac6acac3b8bd8a74020767f81efa201987b4", + "ss_seed": "2062065288", + "ss_session_id": "4144619860", + "ss_shuffle_caption": "True", + "ss_text_encoder_lr": "5e-05", + "ss_total_batch_size": "6", + "ss_training_comment": "None", + "ss_training_finished_at": "1682907652.0704758", + "ss_training_started_at": "1682906537.7889266", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "0661ef0e", + "sshs_model_hash": "595e9c09397cab4c159c8cab08488d7f01eab800397ed0a4d4283949b9d604dc" +} \ No newline at end of file diff --git a/Styles/434/yukinominato_v1.txt b/Styles/434/yukinominato_v1.txt new file mode 100644 index 0000000000000000000000000000000000000000..7ad33150e5981d1a601c860697427e95026f0e5f --- /dev/null +++ b/Styles/434/yukinominato_v1.txt @@ -0,0 +1,237 @@ +Link:https://civitai.com/models/55060/yukino-minato-style +Version:v1.0 +Base Model:SD 1.5 +Keywords:yukino minato +--------DESCRIPTION--------- + +This model was created using some color illustrations of this artist, Has a side effect which works as a 'Lolification Beam', but in general, it has a very similar style in anime-based models like anything. + +Disclaimer: +For personal use only. Sale or distribution of any content generated with this is prohibited. Please support artists if you have the means. +---------------------------- +-----ABOUT THIS VERSION----- + +I recommend using it with a strength of 1 +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:yukino minato, masterpiece, full body, fire, annie \(league of legends\), league of legends, 1girl, puffy sleeves, short sleeves, pleated skirt, animal ears, backpack, bag, bangs, fake animal ears, flat chest, green eyes, looking at viewer, standing, pink hair, mary janes,, + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:150, CFG:7, Clip Skip:2, Model:, Model Hash: +img2: + Prompt:yukino minato, masterpiece, full body, , chartotori, dress,, bare legs, bare shoulders, blush, collarbone, strapless, hat, frills, flat chest,back bow,blue sleeves, solo, detached sleeves + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:150, CFG:7, Clip Skip:2, Model:, Model Hash: +img3: + Prompt:yukino minato, masterpiece, full body , , gloria1, gloria \(pokemon\), + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:150, CFG:7, Clip Skip:2, Model:, Model Hash: +img4: + Prompt:yukino minato, masterpiece, full body , gotou1, gotou hitori, pink sweater, + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:150, CFG:7, Clip Skip:2, Model:, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 55060, + "name": "Yukino Minato Style", + "description": "

This model was created using some color illustrations of this artist, Has a side effect which works as a 'Lolification Beam', but in general, it has a very similar style in anime-based models like anything.

Disclaimer:

For personal use only. Sale or distribution of any content generated with this is prohibited. Please support artists if you have the means.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 509, + "favoriteCount": 85, + "commentCount": 1, + "ratingCount": 2, + "rating": 5 + }, + "creator": { + "username": "Konoko", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ed215914-4927-4549-d207-b3af16c5cb00/width=96/Konoko.jpeg" + }, + "tags": [ + { + "name": "anime" + }, + { + "name": "style" + }, + { + "name": "yukino minato" + } + ], + "modelVersions": [ + { + "id": 59451, + "modelId": 55060, + "name": "v1.0", + "createdAt": "2023-05-01T04:22:52.997Z", + "updatedAt": "2023-05-01T04:27:37.038Z", + "trainedWords": [ + "yukino minato" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": "

I recommend using it with a strength of 1

", + "stats": { + "downloadCount": 509, + "ratingCount": 2, + "rating": 5 + }, + "files": [ + { + "name": "yukinominato_v1.safetensors", + "id": 42209, + "sizeKB": 37015.443359375, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-01T04:25:54.719Z", + "hashes": { + "AutoV1": "CE835BCE", + "AutoV2": "02F23EC502", + "SHA256": "02F23EC502AE40A0D8FFCD8C34859593CC8B8E780CAD4AEB7AEDB91CEE9B8DE6", + "CRC32": "8A325C9D", + "BLAKE3": "2A29000BC253D493AD51ED4188BAE47D165AB59AF2E7EB0EB3B6A12F0B9700C4" + }, + "downloadUrl": "https://civitai.com/api/download/models/59451", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9c41040-4b98-4b8d-1fcd-604983f63f00/width=450/648616.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "UGIg7eB:9Erc16I@5=~C:+OsyDRoJDSi-oIo", + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 217044150, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body, fire, annie \\(league of legends\\), league of legends, 1girl, puffy sleeves, short sleeves, pleated skirt, animal ears, backpack, bag, bangs, fake animal ears, flat chest, green eyes, looking at viewer, standing, pink hair, mary janes,, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "annieFromLeagueOf_annieV1", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73a47314-22c8-447a-4c2c-5505e7b5ee00/width=450/648621.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "USI}kU_MG,x[O@x]xJXlEfohsEW?rfV}b]xa", + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 3084226209, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body, , chartotori, dress,, bare legs, bare shoulders, blush, collarbone, strapless, hat, frills, flat chest,back bow,blue sleeves, solo, detached sleeves", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "atelierTotoriTotooriaHelmold_v1a", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ede8561-a505-4744-f2ed-0f2c5ba97e00/width=450/648622.jpeg", + "nsfw": "Soft", + "width": 664, + "height": 856, + "hash": "UIHVO[NE2Y~UaJ$+r?F^AC%L#nE2$%NaNb-:", + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 4053658586, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body , , gloria1, gloria \\(pokemon\\),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gloriaPokemon_v10", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f78ddf4-7f07-4b82-49ec-875636320f00/width=450/648623.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "UOH^|y~X1F56TLbxELIU.Skra1r=Nf%MxutP", + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 391110613, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body , gotou1, gotou hitori, pink sweater,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gotohHitoriBocchiThe_v10", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/59451" + } + ] +} +---------------------------- diff --git a/Styles/435/yukino_minato_style_v2-152777-metadata.json b/Styles/435/yukino_minato_style_v2-152777-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..848c4b6959180e7843c7fcdcee3d0dd17d0556b3 --- /dev/null +++ b/Styles/435/yukino_minato_style_v2-152777-metadata.json @@ -0,0 +1,407 @@ +{ + "ss_sd_model_name": "nai.ckpt", + "ss_resolution": "(768, 768)", + "ss_clip_skip": "2", + "ss_num_train_images": "1077", + "ss_tag_frequency": { + "3_yukino": { + "yukino": 359 + } + }, + "ss_full_fp16": "False", + "ss_num_batches_per_epoch": "553", + "modelspec.title": "yukino_minato_style_v2", + "ss_max_token_length": "150", + "ss_optimizer": "torch.optim.adamw.AdamW", + "ss_max_grad_norm": "1.0", + "ss_face_crop_aug_range": "None", + "ss_scale_weight_norms": "1.0", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 246, + 768 + ], + "count": 6 + }, + "1": { + "resolution": [ + 253, + 768 + ], + "count": 3 + }, + "2": { + "resolution": [ + 300, + 768 + ], + "count": 6 + }, + "3": { + "resolution": [ + 330, + 768 + ], + "count": 3 + }, + "4": { + "resolution": [ + 353, + 768 + ], + "count": 3 + }, + "5": { + "resolution": [ + 376, + 768 + ], + "count": 3 + }, + "6": { + "resolution": [ + 392, + 768 + ], + "count": 3 + }, + "7": { + "resolution": [ + 407, + 768 + ], + "count": 3 + }, + "8": { + "resolution": [ + 415, + 768 + ], + "count": 6 + }, + "9": { + "resolution": [ + 422, + 768 + ], + "count": 3 + }, + "10": { + "resolution": [ + 430, + 768 + ], + "count": 6 + }, + "11": { + "resolution": [ + 438, + 768 + ], + "count": 3 + }, + "12": { + "resolution": [ + 445, + 768 + ], + "count": 3 + }, + "13": { + "resolution": [ + 461, + 768 + ], + "count": 9 + }, + "14": { + "resolution": [ + 468, + 768 + ], + "count": 3 + }, + "15": { + "resolution": [ + 476, + 768 + ], + "count": 3 + }, + "16": { + "resolution": [ + 484, + 768 + ], + "count": 6 + }, + "17": { + "resolution": [ + 492, + 768 + ], + "count": 3 + }, + "18": { + "resolution": [ + 499, + 768 + ], + "count": 6 + }, + "19": { + "resolution": [ + 507, + 768 + ], + "count": 6 + }, + "20": { + "resolution": [ + 515, + 768 + ], + "count": 6 + }, + "21": { + "resolution": [ + 522, + 768 + ], + "count": 30 + }, + "22": { + "resolution": [ + 530, + 768 + ], + "count": 75 + }, + "23": { + "resolution": [ + 538, + 768 + ], + "count": 51 + }, + "24": { + "resolution": [ + 545, + 768 + ], + "count": 651 + }, + "25": { + "resolution": [ + 553, + 768 + ], + "count": 54 + }, + "26": { + "resolution": [ + 561, + 768 + ], + "count": 18 + }, + "27": { + "resolution": [ + 568, + 768 + ], + "count": 12 + }, + "28": { + "resolution": [ + 576, + 768 + ], + "count": 3 + }, + "29": { + "resolution": [ + 584, + 768 + ], + "count": 3 + }, + "30": { + "resolution": [ + 630, + 768 + ], + "count": 3 + }, + "31": { + "resolution": [ + 645, + 768 + ], + "count": 3 + }, + "32": { + "resolution": [ + 676, + 768 + ], + "count": 3 + }, + "33": { + "resolution": [ + 684, + 768 + ], + "count": 9 + }, + "34": { + "resolution": [ + 691, + 768 + ], + "count": 9 + }, + "35": { + "resolution": [ + 714, + 768 + ], + "count": 3 + }, + "36": { + "resolution": [ + 722, + 768 + ], + "count": 3 + }, + "37": { + "resolution": [ + 730, + 768 + ], + "count": 6 + }, + "38": { + "resolution": [ + 760, + 768 + ], + "count": 12 + }, + "39": { + "resolution": [ + 768, + 369 + ], + "count": 3 + }, + "40": { + "resolution": [ + 768, + 545 + ], + "count": 18 + }, + "41": { + "resolution": [ + 768, + 586 + ], + "count": 9 + }, + "42": { + "resolution": [ + 768, + 746 + ], + "count": 3 + }, + "43": { + "resolution": [ + 768, + 768 + ], + "count": 3 + } + }, + "mean_img_ar_error": 0.0 + }, + "ss_network_args": { + "conv_dim": "8", + "conv_alpha": "4", + "use_cp": "True", + "algo": "loha", + "dropout": 0.0 + }, + "ss_multires_noise_discount": "0.2", + "modelspec.resolution": "768x768", + "ss_color_aug": "False", + "ss_min_snr_gamma": "10.0", + "ss_network_module": "lycoris.kohya", + "modelspec.sai_model_spec": "1.0.0", + "ss_flip_aug": "False", + "ss_dataset_dirs": { + "3_yukino": { + "n_repeats": 3, + "img_count": 359 + } + }, + "ss_prior_loss_weight": "1.0", + "ss_batch_size_per_device": "2", + "ss_min_bucket_reso": "256", + "ss_total_batch_size": "8", + "ss_caption_dropout_rate": "0.0", + "ss_bucket_no_upscale": "True", + "ss_enable_bucket": "True", + "ss_text_encoder_lr": "0.0001", + "ss_session_id": "3121250491", + "ss_lr_scheduler": "cosine", + "ss_multires_noise_iterations": "8", + "ss_training_started_at": "1698194995.4667602", + "ss_training_comment": "None", + "ss_steps": "973", + "ss_mixed_precision": "bf16", + "ss_cache_latents": "True", + "modelspec.encoder_layer": "2", + "ss_lr_warmup_steps": "0", + "ss_gradient_accumulation_steps": "4", + "ss_max_train_steps": "1347", + "ss_epoch": "7", + "ss_caption_tag_dropout_rate": "0.0", + "ss_network_dim": "32", + "ss_random_crop": "False", + "ss_training_finished_at": "1698197484.0846066", + "ss_gradient_checkpointing": "False", + "ss_shuffle_caption": "False", + "ss_num_epochs": "10", + "ss_max_bucket_reso": "2048", + "ss_noise_offset": "None", + "modelspec.date": "2023-10-24T19:31:24", + "ss_keep_tokens": "0", + "ss_adaptive_noise_scale": "None", + "modelspec.prediction_type": "epsilon", + "ss_base_model_version": "sd_v1", + "ss_reg_dataset_dirs": {}, + "sshs_legacy_hash": "d6d25c76", + "ss_learning_rate": "0.0001", + "ss_v2": "False", + "ss_seed": "3931113199", + "ss_zero_terminal_snr": "False", + "ss_num_reg_images": "0", + "ss_caption_dropout_every_n_epochs": "0", + "ss_ip_noise_gamma": "None", + "modelspec.implementation": "diffusers", + "sshs_model_hash": "46ba424a8e6026102c36349001b3b3797db50deda1ebbc9285c1f4c19133a383", + "modelspec.architecture": "stable-diffusion-v1/lora", + "ss_sd_scripts_commit_hash": "15dd0a638af86f89dd0c457428e165598d4884a2", + "ss_network_dropout": "0.0", + "ss_sd_model_hash": "925997e9", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_lowram": "False", + "ss_output_name": "yukino_minato_style_v2", + "ss_network_alpha": "16.0", + "ss_unet_lr": "0.0001" +} \ No newline at end of file diff --git a/Styles/435/yukino_minato_style_v2-152777.txt b/Styles/435/yukino_minato_style_v2-152777.txt new file mode 100644 index 0000000000000000000000000000000000000000..3bfdb73f1e84bb76af572cf911b0e0f3370cde18 --- /dev/null +++ b/Styles/435/yukino_minato_style_v2-152777.txt @@ -0,0 +1,720 @@ +Link:https://civitai.com/models/55060/yukino-minato-style +Version:v2.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +This model was created using some color illustrations of this artist, Has a side effect which works as a 'Lolification Beam', but in general, it has a very similar style in anime-based models like anything. +Version 2 +This version is a Loha, and it really shines vs the lora versions that I tried. +Some images has a specia control of block weight that I found tryng to remove the intrusion of the train data (u know what I mean) keeping the style, and gives much more flexibility using it with other loras or models. + +You need the LoRA Block Weight extension to use it. + +Disclaimer: +For personal use only. Sale or distribution of any content generated with this is prohibited. Please support artists if you have the means. The use of this Lora is the sole responsibility of the user, and any actions taken based on its output are at the user's discretion. +---------------------------- +-----ABOUT THIS VERSION----- + +Is a Lycorys loha now +Removed trigger word +Updated training set and used a 768,768 set +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:A girl studying in a restaurant, from side, sitting, , brown hair, short hair, hair between eyes, round glasses, , multiple boys, + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img2: + Prompt:full body, from above, looking at viewer, standing, , raphtalia, tail, long sleeves, gloves, thigh boots, belt, hair flower, + Negative Prompt:(worst quality, low quality:1.4), nsfw, naked, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img3: + Prompt:dutch angle, A girl smiling at viewer, full body, , cardcaptor sakura, red dress + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, wings, + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img4: + Prompt:A girl (angry:1.1) with the viewer, dutch angle, sitting, crossed arms, , , mona (genshin impact), twintails, long hair, witch hat, pantyhose,gloves, black hair, choker, jewelry, cape, gold trim, blue leotard,earrings, detached sleeves, star (symbol), hat ornament, green eyes, fur collar, parkle print,, + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img5: + Prompt:A woman smiling at viewer, wedding dress, pov, sitting, ,(hatsune miku:1.2), church, flowers, twintails, + Negative Prompt:(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img6: + Prompt:a girl in a public park, standing, dutch angle, , onna_shinkan, long hair, hat, long sleeves, dress, white headwear, thighhighs, very long hair, thigh boots, wide sleeves, white thighhighs, hair between eyes, staff, holding staff, + Negative Prompt:(worst quality, low quality:1.4), nsfw, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, + Size:512x664, Sampler:DPM++ 2M Karras, Steps:30, CFG:7, Clip Skip:0, Model:, Model Hash: +img7: + Prompt:a girl on a skyscraper, from above, , (hatsune miku:1.2), twintails, cyan hair + Negative Prompt:(worst quality, low quality:1.4), nsfw, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, + Size:768x512, Sampler:DPM++ 2M Karras, Steps:30, CFG:9, Clip Skip:0, Model:, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 55060, + "name": "Yukino Minato Style", + "description": "

This model was created using some color illustrations of this artist, Has a side effect which works as a 'Lolification Beam', but in general, it has a very similar style in anime-based models like anything.

Version 2

This version is a Loha, and it really shines vs the lora versions that I tried.

Some images has a specia control of block weight that I found tryng to remove the intrusion of the train data (u know what I mean) keeping the style, and gives much more flexibility using it with other loras or models.

<lora:yukino_minato_style_v2:1:1:lbw=.45,1.2,1.5,-1,-1,1,1,1,1,1,1,1,1,1,2,2,1.5,1,2,2,2,1,1,1,1,1>

You need the LoRA Block Weight extension to use it.

Disclaimer:

For personal use only. Sale or distribution of any content generated with this is prohibited. Please support artists if you have the means. The use of this Lora is the sole responsibility of the user, and any actions taken based on its output are at the user's discretion.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 1912, + "favoriteCount": 237, + "commentCount": 2, + "ratingCount": 3, + "rating": 5, + "tippedAmountCount": 11932 + }, + "creator": { + "username": "Konoko", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ed215914-4927-4549-d207-b3af16c5cb00/width=96/Konoko.jpeg" + }, + "tags": [ + "anime", + "style", + "yukino minato" + ], + "modelVersions": [ + { + "id": 199514, + "modelId": 55060, + "name": "v2.0", + "createdAt": "2023-10-26T07:04:29.463Z", + "updatedAt": "2023-10-26T09:42:58.108Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": "

  • Is a Lycorys loha now

  • Removed trigger word

  • Updated training set and used a 768,768 set

", + "vaeId": null, + "stats": { + "downloadCount": 342, + "ratingCount": 1, + "rating": 5 + }, + "files": [ + { + "id": 152777, + "sizeKB": 88153.91015625, + "name": "yukino_minato_style_v2.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-10-26T09:10:44.549Z", + "hashes": { + "AutoV1": "2D19C3C9", + "AutoV2": "ABAA30906F", + "SHA256": "ABAA30906F55F9DADC986AC6BB6B62771A041F9840A509A1590BFE5C7DE6F07B", + "CRC32": "112BD2FA", + "BLAKE3": "61FD3E3B12B2BE8E0A6567E0B6DEC8EC67B83904B7C20A8B374337017C4BD1A3" + }, + "downloadUrl": "https://civitai.com/api/download/models/199514", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7719ca81-0deb-48a8-9890-e16d0725d83f/width=450/3174915.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1328, + "hash": "UNINaH~UIn%2?A-o^*R*--obocNG~Bxuxuay", + "type": "image", + "metadata": { + "hash": "UNINaH~UIn%2?A-o^*R*--obocNG~Bxuxuay", + "size": 1726324, + "width": 1024, + "height": 1328 + }, + "meta": { + "Size": "512x664", + "seed": 2051405937, + "steps": 30, + "LLuL x": "128", + "LLuL y": "166", + "prompt": "A girl studying in a restaurant, from side, sitting, , brown hair, short hair, hair between eyes, round glasses, , multiple boys,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "yukino_minato_style_v2", + "type": "lora", + "weight": 1 + } + ], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "0cdb03a8ac", + "Hires steps": "50", + "LLuL Layers": "['OUT']", + "LLuL Weight": "0.15", + "LLuL Enabled": "True", + "Hires upscale": "2", + "LLuL Apply to": "['out']", + "LLuL Multiply": "2", + "LLuL Upscaler": "bilinear", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "LLuL Max steps": "30", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4,", + "ADetailer model": "face_yolov8n.pt", + "LLuL Downscaler": "bilinear", + "LLuL Start steps": "5", + "ADetailer version": "23.9.3", + "Denoising strength": "0.6", + "LLuL Interpolation": "lerp", + "ADetailer mask blur": "4", + "ADetailer model 2nd": "hand_yolov8n.pt", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "roundglasses_v3-000008": "e6279f0af926\"", + "\"yukino_minato_style_v2": "73577acf1e0b", + "ADetailer mask blur 2nd": "4", + "ADetailer confidence 2nd": "0.3", + "ADetailer inpaint padding": "32", + "ADetailer dilate/erode 2nd": "4", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True", + "ADetailer inpaint padding 2nd": "32", + "ADetailer denoising strength 2nd": "0.4", + "ADetailer inpaint only masked 2nd": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c62d277d-c61c-4732-9228-ad124b6e8a08/width=450/3174651.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1656, + "hash": "UJHTy^~AI:NH-o-oI;S45QkB={S30fR*flxG", + "type": "image", + "metadata": { + "hash": "UJHTy^~AI:NH-o-oI;S45QkB={S30fR*flxG", + "size": 3014155, + "width": 1280, + "height": 1656 + }, + "meta": { + "Size": "512x664", + "seed": 3135221112, + "steps": 30, + "prompt": "full body, from above, looking at viewer, standing, , raphtalia, tail, long sleeves, gloves, thigh boots, belt, hair flower,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "yukino_minato_style_v2", + "type": "lora", + "weight": 1 + }, + { + "name": "shieldhero_raphtalia", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "d124fc18f0", + "Hires steps": "50", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4), nsfw, naked, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.5", + "shieldhero_raphtalia": "7d870de7a056\"", + "\"yukino_minato_style_v2": "73577acf1e0b" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/db3f21f7-4ca0-4031-b526-41a1aeb33dff/width=450/3174484.jpeg", + "nsfw": "None", + "width": 1280, + "height": 1920, + "hash": "UFHL0srDKj5R@Exv$jShy?%$}X-Cw5Q-%Ms;", + "type": "image", + "metadata": { + "hash": "UFHL0srDKj5R@Exv$jShy?%$}X-Cw5Q-%Ms;", + "size": 3215986, + "width": 1280, + "height": 1920 + }, + "meta": { + "Size": "512x768", + "seed": 2264195670, + "steps": 30, + "prompt": "dutch angle, A girl smiling at viewer, full body, , cardcaptor sakura, red dress", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "yukino_minato_style_v2", + "type": "lora", + "weight": 1 + } + ], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "858ec47484", + "Hires steps": "50", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4, wings,", + "Denoising strength": "0.65", + "\"yukino_minato_style_v2": "73577acf1e0b\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/305d5dc0-4c7b-4086-bedf-41afeb4ab73e/width=450/3174786.jpeg", + "nsfw": "Mature", + "width": 1280, + "height": 1656, + "hash": "UADvK5sq.m%hM{?b9aWB009FH=IUx]H?-px]", + "type": "image", + "metadata": { + "hash": "UADvK5sq.m%hM{?b9aWB009FH=IUx]H?-px]", + "size": 2613125, + "width": 1280, + "height": 1656 + }, + "meta": { + "Size": "512x664", + "mona": "28a12d16e1bf\"", + "seed": 1310111400, + "steps": 30, + "prompt": "A girl (angry:1.1) with the viewer, dutch angle, sitting, crossed arms, , , mona (genshin impact), twintails, long hair, witch hat, pantyhose,gloves, black hair, choker, jewelry, cape, gold trim, blue leotard,earrings, detached sleeves, star (symbol), hat ornament, green eyes, fur collar, parkle print,,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "mona", + "type": "lora", + "weight": 0.6 + } + ], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "7bca87139a", + "Hires steps": "50", + "Hires upscale": "2.5", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4,", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.9.3", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer model 2nd": "Eyes.pt", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "\"yukino_minato_style_v2": "73577acf1e0b", + "ADetailer mask blur 2nd": "4", + "ADetailer confidence 2nd": "0.3", + "ADetailer inpaint padding": "32", + "ADetailer dilate/erode 2nd": "4", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True", + "ADetailer inpaint padding 2nd": "32", + "ADetailer denoising strength 2nd": "0.4", + "ADetailer inpaint only masked 2nd": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0babe4af-170e-4976-a962-84c7da6d8c80/width=450/3175314.jpeg", + "nsfw": "Soft", + "width": 1280, + "height": 1656, + "hash": "UBIXNz0000-p0Jf,jE0f00~V%gR5PCRO-oay", + "type": "image", + "metadata": { + "hash": "UBIXNz0000-p0Jf,jE0f00~V%gR5PCRO-oay", + "size": 2949752, + "width": 1280, + "height": 1656 + }, + "meta": { + "Size": "512x664", + "seed": 2684006856, + "steps": 30, + "LLuL x": "192", + "LLuL y": "249", + "prompt": "A woman smiling at viewer, wedding dress, pov, sitting, ,(hatsune miku:1.2), church, flowers, twintails,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "yukino_minato_style_v2", + "type": "lora", + "weight": 0.9 + } + ], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "858ec47484", + "Hires steps": "50", + "LLuL Layers": "['OUT']", + "LLuL Weight": "0.15", + "LLuL Enabled": "True", + "Hires upscale": "2.5", + "LLuL Apply to": "['out']", + "LLuL Multiply": "4", + "LLuL Upscaler": "bilinear", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "LLuL Max steps": "30", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4,", + "ADetailer model": "face_yolov8n.pt", + "LLuL Downscaler": "bilinear", + "LLuL Start steps": "5", + "ADetailer version": "23.9.3", + "Denoising strength": "0.5", + "LLuL Interpolation": "lerp", + "ADetailer mask blur": "4", + "ADetailer model 2nd": "Eyes.pt", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "\"yukino_minato_style_v2": "73577acf1e0b\"", + "ADetailer mask blur 2nd": "4", + "ADetailer confidence 2nd": "0.3", + "ADetailer inpaint padding": "32", + "ADetailer dilate/erode 2nd": "4", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True", + "ADetailer inpaint padding 2nd": "32", + "ADetailer denoising strength 2nd": "0.4", + "ADetailer inpaint only masked 2nd": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fa663fdf-a2bd-4097-9b60-f1b79f3cb37b/width=450/3175393.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1328, + "hash": "UDG[QP={009G?F~W9Z029tWXx]9ax]NKxDs:", + "type": "image", + "metadata": { + "hash": "UDG[QP={009G?F~W9Z029tWXx]9ax]NKxDs:", + "size": 1718317, + "width": 1024, + "height": 1328 + }, + "meta": { + "Size": "512x664", + "seed": 2219757837, + "steps": 30, + "LLuL x": "192", + "LLuL y": "249", + "prompt": "a girl in a public park, standing, dutch angle, , onna_shinkan, long hair, hat, long sleeves, dress, white headwear, thighhighs, very long hair, thigh boots, wide sleeves, white thighhighs, hair between eyes, staff, holding staff,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "onna_shinkan", + "type": "lora", + "weight": 0.8 + } + ], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "f23d96c149", + "Hires steps": "50", + "LLuL Layers": "['OUT']", + "LLuL Weight": "0.15", + "LLuL Enabled": "True", + "onna_shinkan": "75785a5b4c25\"", + "Hires upscale": "2", + "LLuL Apply to": "['out']", + "LLuL Multiply": "4", + "LLuL Upscaler": "bilinear", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "LLuL Max steps": "30", + "negativePrompt": "(worst quality, low quality:1.4), nsfw, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4,", + "LLuL Downscaler": "bilinear", + "LLuL Start steps": "5", + "Denoising strength": "0.5", + "LLuL Interpolation": "lerp", + "\"yukino_minato_style_v2": "73577acf1e0b" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/edadb5fb-41b3-48cd-b659-fd54c1e430c3/width=450/3175556.jpeg", + "nsfw": "None", + "width": 1536, + "height": 1024, + "hash": "UNC6}sRj4oR*_NWBMxWBTKWB%1jsxwWBX4jr", + "type": "image", + "metadata": { + "hash": "UNC6}sRj4oR*_NWBMxWBTKWB%1jsxwWBX4jr", + "size": 2281267, + "width": 1536, + "height": 1024 + }, + "meta": { + "Size": "768x512", + "seed": 4240820614, + "steps": 30, + "LLuL x": "288", + "LLuL y": "192", + "prompt": "a girl on a skyscraper, from above, , (hatsune miku:1.2), twintails, cyan hair", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "235745af8d", + "cfgScale": 9, + "clipSkip": 2, + "resources": [], + "\"badhandv4": "5e40d722fc3d\"", + "Model hash": "58f37f4736", + "Hires steps": "50", + "LLuL Layers": "['OUT']", + "LLuL Weight": "0.15", + "LLuL Enabled": "True", + "Hires upscale": "2", + "LLuL Apply to": "['out']", + "LLuL Multiply": "4", + "LLuL Upscaler": "bilinear", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "LLuL Max steps": "30", + "negativePrompt": "(worst quality, low quality:1.4), nsfw, bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,badhandv4,", + "ADetailer model": "face_yolov8s.pt", + "LLuL Downscaler": "bilinear", + "LLuL Start steps": "5", + "ADetailer version": "23.9.3", + "Denoising strength": "0.5", + "LLuL Interpolation": "lerp", + "ADetailer mask blur": "4", + "ADetailer model 2nd": "hand_yolov8n.pt", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "\"yukino_minato_style_v2": "73577acf1e0b\"", + "ADetailer mask blur 2nd": "6", + "ADetailer confidence 2nd": "0.3", + "ADetailer inpaint padding": "32", + "ADetailer dilate/erode 2nd": "4", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True", + "ADetailer inpaint padding 2nd": "32", + "ADetailer denoising strength 2nd": "0.4", + "ADetailer inpaint only masked 2nd": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/199514" + }, + { + "id": 59451, + "modelId": 55060, + "name": "v1.0", + "createdAt": "2023-05-01T04:22:52.997Z", + "updatedAt": "2023-10-26T07:04:29.463Z", + "trainedWords": [ + "yukino minato" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": "Standard", + "earlyAccessTimeFrame": 0, + "description": "

I recommend using it with a strength of 1

", + "vaeId": null, + "stats": { + "downloadCount": 1570, + "ratingCount": 2, + "rating": 5 + }, + "files": [ + { + "id": 42209, + "sizeKB": 37015.443359375, + "name": "yukinominato_v1.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-05-01T04:25:54.719Z", + "hashes": { + "AutoV1": "CE835BCE", + "AutoV2": "02F23EC502", + "SHA256": "02F23EC502AE40A0D8FFCD8C34859593CC8B8E780CAD4AEB7AEDB91CEE9B8DE6", + "CRC32": "8A325C9D", + "BLAKE3": "2A29000BC253D493AD51ED4188BAE47D165AB59AF2E7EB0EB3B6A12F0B9700C4" + }, + "downloadUrl": "https://civitai.com/api/download/models/59451", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b9c41040-4b98-4b8d-1fcd-604983f63f00/width=450/648616.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "UGIg7eB:9Erc16I@5=~C:+OsyDRoJDSi-oIo", + "type": "image", + "metadata": { + "hash": "UGIg7eB:9Erc16I@5=~C:+OsyDRoJDSi-oIo", + "width": 664, + "height": 856 + }, + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 217044150, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body, fire, annie \\(league of legends\\), league of legends, 1girl, puffy sleeves, short sleeves, pleated skirt, animal ears, backpack, bag, bangs, fake animal ears, flat chest, green eyes, looking at viewer, standing, pink hair, mary janes,, ", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "annieFromLeagueOf_annieV1", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73a47314-22c8-447a-4c2c-5505e7b5ee00/width=450/648621.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "USI}kU_MG,x[O@x]xJXlEfohsEW?rfV}b]xa", + "type": "image", + "metadata": { + "hash": "USI}kU_MG,x[O@x]xJXlEfohsEW?rfV}b]xa", + "width": 664, + "height": 856 + }, + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 3084226209, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body, , chartotori, dress,, bare legs, bare shoulders, blush, collarbone, strapless, hat, frills, flat chest,back bow,blue sleeves, solo, detached sleeves", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "atelierTotoriTotooriaHelmold_v1a", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ede8561-a505-4744-f2ed-0f2c5ba97e00/width=450/648622.jpeg", + "nsfw": "Soft", + "width": 664, + "height": 856, + "hash": "UIHVO[NE2Y~UaJ$+r?F^AC%L#nE2$%NaNb-:", + "type": "image", + "metadata": { + "hash": "UIHVO[NE2Y~UaJ$+r?F^AC%L#nE2$%NaNb-:", + "width": 664, + "height": 856 + }, + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 4053658586, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body , , gloria1, gloria \\(pokemon\\),", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gloriaPokemon_v10", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4f78ddf4-7f07-4b82-49ec-875636320f00/width=450/648623.jpeg", + "nsfw": "None", + "width": 664, + "height": 856, + "hash": "UOH^|y~X1F56TLbxELIU.Skra1r=Nf%MxutP", + "type": "image", + "metadata": { + "hash": "UOH^|y~X1F56TLbxELIU.Skra1r=Nf%MxutP", + "width": 664, + "height": 856 + }, + "meta": { + "ENSD": "31337", + "Size": "512x664", + "seed": 391110613, + "steps": 150, + "prompt": "yukino minato, masterpiece, full body , gotou1, gotou hitori, pink sweater,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "gotohHitoriBocchiThe_v10", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d1e459f9f", + "Hires upscale": "1.3", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality:1.4), bad anatomy, extra ears, fewer digits, text, signature, watermark, username, artist name, bad proportions, greyscale, monocrome, multiple views, lowres, blurry, simple background,", + "Denoising strength": "0.55" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/59451" + } + ] +} +---------------------------- diff --git a/Styles/436/zankuro_anylora_dim32-159860-metadata.json b/Styles/436/zankuro_anylora_dim32-159860-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..7452abee4e2c77b5222e1b1b0428c2010668d03b --- /dev/null +++ b/Styles/436/zankuro_anylora_dim32-159860-metadata.json @@ -0,0 +1,317 @@ +{ + "ss_sd_model_name": "AnyLoRA_noVae_fp16-pruned.ckpt", + "ss_clip_skip": "2", + "ss_num_train_images": "270", + "ss_tag_frequency": { + "Zankuro_AnyLora_Dim32": { + "1girl": 27, + "solo": 25, + "blush": 24, + "long hair": 21, + "looking at viewer": 19, + "smile": 18, + "nipples": 17, + "pointy ears": 16, + "open mouth": 15, + "large breasts": 15, + "sweat": 13, + "simple background": 11, + "inverted nipples": 11, + "red eyes": 10, + "gloves": 10, + "animal ears": 9, + "pink hair": 9, + "ass": 9, + "huge breasts": 8, + "underwear": 8, + "panties": 8, + "bow": 8, + "purple eyes": 8, + "purple hair": 7, + "navel": 7, + "white background": 7, + "looking back": 7, + "nude": 7, + "closed mouth": 6, + "thighhighs": 6, + ":d": 6, + "white panties": 6, + "twintails": 6, + "heart": 6, + "short hair": 6, + "swimsuit": 5, + "cat ears": 5, + "extra ears": 5, + "blue eyes": 5, + "from behind": 5, + "blunt bangs": 5, + "wet": 5, + "maid headdress": 5, + "very long hair": 5, + "bikini": 4, + "wings": 4, + "hair bow": 4, + "upper body": 4, + "barefoot": 4, + "feet": 4, + "soles": 4, + "choker": 4, + "wrist cuffs": 4, + "blush stickers": 3, + "necktie": 3, + "detached collar": 3, + "puffy nipples": 3, + "skull": 3, + "sitting": 3, + "underwear only": 3, + "red bow": 3, + "hair between eyes": 3, + "blue hair": 3, + "cowboy shot": 3, + "water": 3, + "loli": 3, + "black hair": 3, + "thighs": 3, + "thick thighs": 3, + "breasts squeezed together": 3, + "fake animal ears": 3, + "jewelry": 2, + "earrings": 2, + "striped": 2, + "white gloves": 2, + "animal ear fluff": 2, + "lactation": 2, + "bikini lift": 2, + "cleavage": 2, + "dark skin": 2, + "dark-skinned female": 2, + "aqua hair": 2, + "clothes lift": 2, + "panty pull": 2, + "bow panties": 2, + "hair ornament": 2, + "fingerless gloves": 2, + "skull hair ornament": 2, + "breast suppress": 2, + "horns": 2, + "medium breasts": 2, + "pussy": 2, + "white thighhighs": 2, + "skindentation": 2, + "flat chest": 2, + "topless": 2, + "black thighhighs": 2, + "kneeling": 2, + "thong": 2, + "butt crack": 2, + "closed eyes": 2, + "tongue": 2, + "tongue out": 2, + "1boy": 2, + "hetero": 2, + "penis": 2, + "solo focus": 2, + "lying": 2, + "shiny": 2, + "shiny skin": 2, + "red background": 2, + "pink eyes": 2, + "plump": 2, + "oppai loli": 2, + "rabbit ears": 2, + "brown hair": 2, + "black gloves": 2, + "2girls": 1, + ":3": 1, + "fur collar": 1, + "striped bikini": 1, + "breast rest": 1, + "green hair": 1, + "head wings": 1, + "school uniform": 1, + "serafuku": 1, + "no bra": 1, + "shirt lift": 1, + "no pants": 1, + "kiyosumi school uniform": 1, + "mouth hold": 1, + "naughty face": 1, + "full body": 1, + "white hair": 1, + "colored sclera": 1, + "black sclera": 1, + "spread legs": 1, + "bra": 1, + "lingerie": 1, + "striped panties": 1, + "bandages": 1, + "naked bandage": 1, + "standing": 1, + "black bow": 1, + "half-closed eyes": 1, + "wading": 1, + "white choker": 1, + "skirt": 1, + "tail": 1, + "boots": 1, + "elbow gloves": 1, + "miniskirt": 1, + "collar": 1, + "cat tail": 1, + "zoom layer": 1, + "lowleg": 1, + "lowleg panties": 1, + "toes": 1, + "black bikini": 1, + "bottomless": 1, + "seiza": 1, + "untied": 1, + "sex": 1, + "vaginal": 1, + "bent over": 1, + "sex from behind": 1, + "bouncing breasts": 1, + "arm grab": 1, + "arm held back": 1, + "holding": 1, + "food": 1, + "fruit": 1, + "on side": 1, + "holding food": 1, + "headdress": 1, + "holding fruit": 1, + "orange (fruit)": 1, + "mandarin orange": 1, + "ponytail": 1, + "shorts": 1, + "short shorts": 1, + "black background": 1, + "outline": 1, + "borrowed character": 1, + "censored": 1, + "parted lips": 1, + "medium hair": 1, + "bar censor": 1, + "dress": 1, + "ribbon": 1, + "hair ribbon": 1, + "blue ribbon": 1, + "rei no himo": 1, + "on stomach": 1, + ":p": 1, + "feet up": 1, + "the pose": 1, + "shirt": 1, + "short sleeves": 1, + "red hair": 1, + "one eye closed": 1, + "shoes": 1, + "socks": 1, + "covered nipples": 1, + "see-through": 1, + ";d": 1, + "wet clothes": 1, + "spoken heart": 1, + "gym uniform": 1, + "buruma": 1, + "wet shirt": 1, + "fang": 1, + "demon girl": 1, + "demon horns": 1, + "skin fang": 1, + "demon wings": 1, + "purple background": 1, + "frown": 1, + "curvy": 1, + "wide hips": 1, + "red bikini": 1, + "alternate breast size": 1, + "bare shoulders": 1, + "pantyhose": 1, + "teeth": 1, + "bowtie": 1, + "grey background": 1, + "leotard": 1, + "black pantyhose": 1, + "strapless": 1, + "covered navel": 1, + "upper teeth only": 1, + "playboy bunny": 1, + "red bowtie": 1, + "black leotard": 1, + "strapless leotard": 1, + "green eyes": 1, + "all fours": 1, + "steam": 1, + "partially submerged": 1, + "hands on own chest": 1, + "brown eyes": 1, + "cum": 1, + "pov": 1, + "erection": 1, + "pink background": 1, + "handjob": 1, + "gloved handjob": 1, + "hairband": 1, + "armpits": 1, + "arms up": 1, + "one-piece swimsuit": 1, + "symbol-shaped pupils": 1, + "heart-shaped pupils": 1, + "black one-piece swimsuit": 1, + "slingshot swimsuit": 1, + "bunny pose": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "Zankuro_AnyLora_Dim32": { + "n_repeats": 10, + "img_count": 27 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 270, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"Zankuro_AnyLora_Dim32\": {\"1girl\": 27, \"solo\": 25, \"long hair\": 21, \"looking at viewer\": 19, \"blush\": 24, \"smile\": 18, \"simple background\": 11, \"red eyes\": 10, \"gloves\": 10, \"2girls\": 1, \"animal ears\": 9, \"jewelry\": 2, \"closed mouth\": 6, \"nipples\": 17, \"swimsuit\": 5, \"purple hair\": 7, \"bikini\": 4, \"sweat\": 13, \"earrings\": 2, \"pointy ears\": 16, \"striped\": 2, \"cat ears\": 5, \"white gloves\": 2, \"huge breasts\": 8, \"animal ear fluff\": 2, \":3\": 1, \"blush stickers\": 3, \"extra ears\": 5, \"fur collar\": 1, \"striped bikini\": 1, \"lactation\": 2, \"inverted nipples\": 11, \"breast rest\": 1, \"bikini lift\": 2, \"open mouth\": 15, \"large breasts\": 15, \"thighhighs\": 6, \"navel\": 7, \"cleavage\": 2, \"underwear\": 8, \"panties\": 8, \":d\": 6, \"green hair\": 1, \"wings\": 4, \"necktie\": 3, \"dark skin\": 2, \"white panties\": 6, \"dark-skinned female\": 2, \"aqua hair\": 2, \"detached collar\": 3, \"head wings\": 1, \"blue eyes\": 5, \"bow\": 8, \"twintails\": 6, \"school uniform\": 1, \"pink hair\": 9, \"hair bow\": 4, \"serafuku\": 1, \"clothes lift\": 2, \"no bra\": 1, \"shirt lift\": 1, \"panty pull\": 2, \"no pants\": 1, \"bow panties\": 2, \"puffy nipples\": 3, \"kiyosumi school uniform\": 1, \"hair ornament\": 2, \"upper body\": 4, \"fingerless gloves\": 2, \"mouth hold\": 1, \"naughty face\": 1, \"skull\": 3, \"skull hair ornament\": 2, \"breast suppress\": 2, \"white background\": 7, \"sitting\": 3, \"full body\": 1, \"ass\": 9, \"white hair\": 1, \"horns\": 2, \"barefoot\": 4, \"looking back\": 7, \"from behind\": 5, \"feet\": 4, \"soles\": 4, \"colored sclera\": 1, \"black sclera\": 1, \"medium breasts\": 2, \"pussy\": 2, \"spread legs\": 1, \"bra\": 1, \"white thighhighs\": 2, \"underwear only\": 3, \"lingerie\": 1, \"striped panties\": 1, \"purple eyes\": 8, \"heart\": 6, \"blunt bangs\": 5, \"red bow\": 3, \"wet\": 5, \"maid headdress\": 5, \"skindentation\": 2, \"bandages\": 1, \"naked bandage\": 1, \"hair between eyes\": 3, \"very long hair\": 5, \"blue hair\": 3, \"standing\": 1, \"cowboy shot\": 3, \"choker\": 4, \"water\": 3, \"flat chest\": 2, \"wrist cuffs\": 4, \"loli\": 3, \"black bow\": 1, \"topless\": 2, \"half-closed eyes\": 1, \"wading\": 1, \"white choker\": 1, \"short hair\": 6, \"skirt\": 1, \"tail\": 1, \"boots\": 1, \"elbow gloves\": 1, \"black thighhighs\": 2, \"miniskirt\": 1, \"collar\": 1, \"cat tail\": 1, \"kneeling\": 2, \"thong\": 2, \"butt crack\": 2, \"zoom layer\": 1, \"lowleg\": 1, \"lowleg panties\": 1, \"nude\": 7, \"black hair\": 3, \"toes\": 1, \"black bikini\": 1, \"bottomless\": 1, \"seiza\": 1, \"untied\": 1, \"closed eyes\": 2, \"tongue\": 2, \"tongue out\": 2, \"1boy\": 2, \"hetero\": 2, \"penis\": 2, \"solo focus\": 2, \"sex\": 1, \"vaginal\": 1, \"bent over\": 1, \"sex from behind\": 1, \"bouncing breasts\": 1, \"arm grab\": 1, \"arm held back\": 1, \"holding\": 1, \"lying\": 2, \"food\": 1, \"shiny\": 2, \"shiny skin\": 2, \"fruit\": 1, \"on side\": 1, \"holding food\": 1, \"red background\": 2, \"headdress\": 1, \"holding fruit\": 1, \"orange (fruit)\": 1, \"mandarin orange\": 1, \"ponytail\": 1, \"thighs\": 3, \"shorts\": 1, \"short shorts\": 1, \"thick thighs\": 3, \"black background\": 1, \"outline\": 1, \"borrowed character\": 1, \"censored\": 1, \"parted lips\": 1, \"medium hair\": 1, \"pink eyes\": 2, \"bar censor\": 1, \"plump\": 2, \"dress\": 1, \"ribbon\": 1, \"hair ribbon\": 1, \"blue ribbon\": 1, \"rei no himo\": 1, \"on stomach\": 1, \":p\": 1, \"feet up\": 1, \"the pose\": 1, \"shirt\": 1, \"short sleeves\": 1, \"red hair\": 1, \"one eye closed\": 1, \"shoes\": 1, \"socks\": 1, \"covered nipples\": 1, \"see-through\": 1, \";d\": 1, \"wet clothes\": 1, \"spoken heart\": 1, \"gym uniform\": 1, \"buruma\": 1, \"breasts squeezed together\": 3, \"wet shirt\": 1, \"fang\": 1, \"demon girl\": 1, \"demon horns\": 1, \"skin fang\": 1, \"demon wings\": 1, \"purple background\": 1, \"frown\": 1, \"curvy\": 1, \"wide hips\": 1, \"red bikini\": 1, \"alternate breast size\": 1, \"oppai loli\": 2, \"bare shoulders\": 1, \"pantyhose\": 1, \"teeth\": 1, \"bowtie\": 1, \"grey background\": 1, \"rabbit ears\": 2, \"leotard\": 1, \"black pantyhose\": 1, \"strapless\": 1, \"covered navel\": 1, \"fake animal ears\": 3, \"upper teeth only\": 1, \"playboy bunny\": 1, \"red bowtie\": 1, \"black leotard\": 1, \"strapless leotard\": 1, \"brown hair\": 2, \"green eyes\": 1, \"black gloves\": 2, \"all fours\": 1, \"steam\": 1, \"partially submerged\": 1, \"hands on own chest\": 1, \"brown eyes\": 1, \"cum\": 1, \"pov\": 1, \"erection\": 1, \"pink background\": 1, \"handjob\": 1, \"gloved handjob\": 1, \"hairband\": 1, \"armpits\": 1, \"arms up\": 1, \"one-piece swimsuit\": 1, \"symbol-shaped pupils\": 1, \"heart-shaped pupils\": 1, \"black one-piece swimsuit\": 1, \"slingshot swimsuit\": 1, \"bunny pose\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [448, 576], \"count\": 190}, \"1\": {\"resolution\": [512, 512], \"count\": 10}, \"2\": {\"resolution\": [576, 448], \"count\": 60}, \"3\": {\"resolution\": [640, 384], \"count\": 10}}, \"mean_img_ar_error\": 0.06644797989680275}, \"subsets\": [{\"img_count\": 27, \"num_repeats\": 10, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"Zankuro_AnyLora_Dim32\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0005", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "67", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "1350", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16", + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "b0c91a8a93ab63b8b513046c2e2181a4ce78b83367ee7e26354ba9e018ea102f", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "135", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "Zankuro_AnyLora_Dim32", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "66f58dbb", + "ss_sd_scripts_commit_hash": "e6ad3cbc66130fdc3bf9ecd1e0272969b1d613f7", + "ss_seed": "42", + "ss_session_id": "4129611501", + "ss_steps": "1350", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1697904182.6438189", + "ss_training_started_at": "1697903261.354922", + "ss_unet_lr": "0.0005", + "ss_v2": "False", + "sshs_legacy_hash": "4b007d82", + "sshs_model_hash": "2490a4256342c9ba1546e8bbe06d2a8c8e64fba2bf6a0f1da4395c194d9dab36" +} \ No newline at end of file diff --git a/Styles/436/zankuro_anylora_dim32-159860.txt b/Styles/436/zankuro_anylora_dim32-159860.txt new file mode 100644 index 0000000000000000000000000000000000000000..0116bf5980094e2e967471b6839ed2974da514e1 --- /dev/null +++ b/Styles/436/zankuro_anylora_dim32-159860.txt @@ -0,0 +1,765 @@ +Link:https://civitai.com/models/185558/zankuro-artist-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Suggested weight: 0.8 to 1.0 +I recommend trying with weight 1 and if its too weird lower the weight. +Please support the artist by checking out their pagehttps://www.pixiv.net/en/users/7964 +Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style +Trained on: 27 images +Training Model: AnyLoRA_noVae_fp16-pruned +flip_aug: True +Num of Repeats: 10 +Unit is Epochs or Steps: Epochs +Number of Epochs or Steps: 10 +Training Batch Size: 2 +Network Dim: 32 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:, ((masterpiece,best quality)), absurdres, , Boosette_Mario, 1girl, long hair, white hair, long white dress, ballroom dress, white gloves, solo, smiling, blushing, looking at viewer, cowboy shot, cinematic composition, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img2: + Prompt:, ((masterpiece,best quality)), absurdres, , hmdmg1, wizard hat, blush, blush stickers, cleavage, bare shoulders, dress, off shoulder, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img3: + Prompt:, ((masterpiece,best quality)), absurdres, , Misty_Pokemon, yellow crop top, suspenders, side ponytail, orange hair, denim shorts, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, tropical beach, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img4: + Prompt:, ((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img5: + Prompt:, (masterpiece, best quality), 1girl, princess daisy, blue eyes, long hair, orange hair, crown, daisy, dress, flower, gem, gloves, orange dress, puffy short sleeves, puffy sleeves, short sleeves, white gloves, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img6: + Prompt:, ((masterpiece,best quality)), absurdres, , Solise_AFK, solo, smiling, looking at viewer, cowboy shot, forest in background, cinematic composition, , + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img7: + Prompt:, ((masterpiece,best quality)), absurdres, , Irisviel_von_Einzbern, red shirt, white skirt, solo, smiling, looking at viewer, cowboy shot, cinematic composition, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img8: + Prompt:, ((masterpiece,best quality)), absurdres, , Caulifla_DB, bare shoulders, midriff, purple baggy pants, pink tube top, black bracelets,solo, smiling, smug, looking at viewer, cowboy shot, cinematic composition, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img9: + Prompt:, ((masterpiece,best quality)), absurdres, , Anubis_Citron_OC, (dark skin), black hair, yellow eyes, pelvic curtain, crop top, thighhighs, , solo, smiling, looking at viewer, cowboy shot, cinematic composition, , contrapposto, + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img10: + Prompt:, ((masterpiece,best quality)), absurdres, , Gruntilda, green skin, long black hair, black dress, red eyes, busty, smug,, witch hat, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto + Negative Prompt:EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t + Size:512x768, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185558, + "name": "Zankuro (Artist Style)", + "description": "

Suggested weight: 0.8 to 1.0

I recommend trying with weight 1 and if its too weird lower the weight.

Please support the artist by checking out their page🔞: https://www.pixiv.net/en/users/7964

Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style

Trained on: 27 images

Training Model: AnyLoRA_noVae_fp16-pruned

flip_aug: True

Num of Repeats: 10

Unit is Epochs or Steps: Epochs

Number of Epochs or Steps: 10

Training Batch Size: 2

Network Dim: 32

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Rent", + "allowDerivatives": true, + "allowDifferentLicense": false, + "stats": { + "downloadCount": 62, + "favoriteCount": 11, + "commentCount": 0, + "ratingCount": 0, + "rating": 0, + "tippedAmountCount": 86441 + }, + "creator": { + "username": "CitronLegacy", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb17dc3d-5b4c-4c72-a8a4-bf88b02b2ef7/width=96/CitronLegacy.jpeg" + }, + "tags": [ + "anime", + "style", + "art style" + ], + "modelVersions": [ + { + "id": 208324, + "modelId": 185558, + "name": "v1.0", + "createdAt": "2023-11-01T17:47:54.317Z", + "updatedAt": "2023-11-01T17:54:34.297Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 68, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 159860, + "sizeKB": 36985.78125, + "name": "Zankuro_AnyLora_Dim32.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T17:51:07.774Z", + "hashes": { + "AutoV1": "B2F7BC4F", + "AutoV2": "E645962F91", + "SHA256": "E645962F9177FAE608E54379BDFD75A999CC6C19F176CEE0FE520E5A4132ACA7", + "CRC32": "B50C8B87", + "BLAKE3": "141CFE20807F2C999455C9463543527C8B212D53966A873B6DEC845C31AEF39E" + }, + "downloadUrl": "https://civitai.com/api/download/models/208324", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/147db89c-d213-41ce-99ad-075699b8da40/width=450/3315826.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UNJ@U,~X0dE200V@4.In-pM{aORnNGxt%Lof", + "type": "image", + "metadata": { + "hash": "UNJ@U,~X0dE200V@4.In-pM{aORnNGxt%Lof", + "size": 1052223, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 276973485, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Boosette_Mario_Anime": "20254a208f", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Boosette_Mario, 1girl, long hair, white hair, long white dress, ballroom dress, white gloves, solo, smiling, blushing, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Boosette_Mario_Anime", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c3402a8-46a1-42f3-817e-0f974381d9b8/width=450/3315828.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UEIXBhRP0d8|00J800^+-ojEx]IB58?H~ANx", + "type": "image", + "metadata": { + "hash": "UEIXBhRP0d8|00J800^+-ojEx]IB58?H~ANx", + "size": 1188003, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 127640552, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:dark_magician_girl_v1": "3532f38c76", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , hmdmg1, wizard hat, blush, blush stickers, cleavage, bare shoulders, dress, off shoulder, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "dark_magician_girl_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27c1d953-4bd3-4f04-8e36-9b66396b994e/width=450/3315827.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UAKK1iPU48}r-#?[-U8{DQvz5R-UMyZ%1OBB", + "type": "image", + "metadata": { + "hash": "UAKK1iPU48}r-#?[-U8{DQvz5R-UMyZ%1OBB", + "size": 1210347, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 729660882, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Misty_Pokemon_v2_Anime": "11b0377a52", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Misty_Pokemon, yellow crop top, suspenders, side ponytail, orange hair, denim shorts, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, tropical beach,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 1 + }, + { + "name": "Misty_Pokemon_v2_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/906184a6-a22a-45e8-bd18-3fab7aa064be/width=450/3315830.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UCIg$T^*C*aJLwnB+@S$tco%D}Rjl99}={-T", + "type": "image", + "metadata": { + "hash": "UCIg$T^*C*aJLwnB+@S$tco%D}Rjl99}={-T", + "size": 1142567, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 3722962716, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:ahri_v10": "bfd7d14325", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "ahri_v10", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da7f7bdd-ee00-4cb7-95b6-35f33a22a078/width=450/3315829.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UAI;9g~U11N00Q58OY%18w-o-:Vs*0OZkXRi", + "type": "image", + "metadata": { + "hash": "UAI;9g~U11N00Q58OY%18w-o-:Vs*0OZkXRi", + "size": 1176272, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 2715964951, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "lora:princessdaisy-lora-nochekaiser": "766dd39282" + }, + "prompt": ", (masterpiece, best quality), 1girl, princess daisy, blue eyes, long hair, orange hair, crown, daisy, dress, flower, gem, gloves, orange dress, puffy short sleeves, puffy sleeves, short sleeves, white gloves,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/11920405-b4ba-4f8a-b9d4-ab805eee3a27/width=450/3315831.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UDF5?g$T00^+?[In01?GH=IAImRjBURj$SRR", + "type": "image", + "metadata": { + "hash": "UDF5?g$T00^+?[In01?GH=IAImRjBURj$SRR", + "size": 1314823, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 2778427056, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Solise_AFK": "4fc875e5e7", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Solise_AFK, solo, smiling, looking at viewer, cowboy shot, forest in background, cinematic composition, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 1 + }, + { + "name": "Solise_AFK", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9eaa75bd-4281-4d98-8718-05db687a4ba3/width=450/3315833.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UJIqQ8_300xCJ5-:$+t7?]r?8_S6D%o|%LMd", + "type": "image", + "metadata": { + "hash": "UJIqQ8_300xCJ5-:$+t7?]r?8_S6D%o|%LMd", + "size": 1148587, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 4046415327, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "lora:Irisviel_von_Einzbern_Combined": "5fb4ce6284" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Irisviel_von_Einzbern, red shirt, white skirt, solo, smiling, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Irisviel_von_Einzbern_Combined", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d86c5c8d-eeff-4af8-91be-65af364182de/width=450/3315832.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UHGuC2RP_4t-w@s+$%jD0e$|%MkU-Cv~iv-o", + "type": "image", + "metadata": { + "hash": "UHGuC2RP_4t-w@s+$%jD0e$|%MkU-Cv~iv-o", + "size": 1078522, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 417994075, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Caulifla_DB_v3_Anime": "791554bbd1", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Caulifla_DB, bare shoulders, midriff, purple baggy pants, pink tube top, black bracelets,solo, smiling, smug, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Caulifla_DB_v3_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe412e2f-5366-498f-90f5-978c9bffec14/width=450/3315834.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UNGa?}kC.7pI*JOY?Gx]PVNexatRtmRjEgNe", + "type": "image", + "metadata": { + "hash": "UNGa?}kC.7pI*JOY?Gx]PVNexatRtmRjEgNe", + "size": 1281198, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 3026399581, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Anubis_Citron_OC_Anime": "1d13def507", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Anubis_Citron_OC, (dark skin), black hair, yellow eyes, pelvic curtain, crop top, thighhighs, , solo, smiling, looking at viewer, cowboy shot, cinematic composition, , contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Anubis_Citron_OC_Anime", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ea6f26b-e804-4697-9029-17ecf2c70eb9/width=450/3315865.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "USEMj~jX%jW@EooLtlozIUj]Dja#RQRP%Kt5", + "type": "image", + "metadata": { + "hash": "USEMj~jX%jW@EooLtlozIUj]Dja#RQRP%Kt5", + "size": 990363, + "width": 768, + "height": 1152 + }, + "meta": { + "Size": "512x768", + "seed": 3488484097, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Gruntilda_Anime": "a042c57f56", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Gruntilda, green skin, long black hair, black dress, red eyes, busty, smug,, witch hat, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Gruntilda_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208324" + } + ] +} +---------------------------- diff --git a/Styles/437/zankuro_style16-85559-metadata.json b/Styles/437/zankuro_style16-85559-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..0b22c2d09c70f05292ec76b9b3e64bd965871920 --- /dev/null +++ b/Styles/437/zankuro_style16-85559-metadata.json @@ -0,0 +1,833 @@ +{ + "ss_sd_model_name": "nsfw.ckpt", + "ss_clip_skip": "2", + "ss_num_train_images": "357", + "ss_tag_frequency": { + "Zankuro": { + "1girl": 342, + "solo": 327, + "looking at viewer": 239, + "blush": 232, + "long hair": 217, + "breasts": 216, + "smile": 201, + "simple background": 171, + "pointy ears": 152, + "large breasts": 150, + "open mouth": 131, + "gloves": 130, + "sweat": 126, + "navel": 116, + "ass": 116, + "white background": 108, + "red eyes": 105, + "pink hair": 101, + "swimsuit": 92, + "underwear": 91, + "panties": 90, + "twintails": 89, + "animal ears": 88, + "nipples": 84, + "heart": 83, + "closed mouth": 81, + "short hair": 74, + "looking back": 74, + "bow": 72, + "bikini": 72, + "blue eyes": 70, + "very long hair": 63, + "white panties": 61, + "thighhighs": 61, + "purple hair": 60, + "nude": 55, + "bangs": 54, + "full body": 53, + "barefoot": 53, + "hair ornament": 52, + "from behind": 52, + "loli": 51, + "hair bow": 50, + ":d": 49, + "blue hair": 48, + "huge breasts": 48, + "skull hair ornament": 48, + "boots": 47, + "flat chest": 46, + "black gloves": 45, + "pussy": 44, + "pink eyes": 44, + "sitting": 42, + "censored": 40, + "blush stickers": 40, + "lying": 39, + "black bikini": 36, + "hair between eyes": 35, + "purple eyes": 35, + "standing": 35, + "brown hair": 35, + "choker": 34, + "wrist cuffs": 33, + "black hair": 33, + "maid headdress": 32, + "wings": 31, + "white gloves": 31, + "cat ears": 28, + "extra ears": 28, + "tail": 27, + "holding": 27, + "hat": 27, + "cleavage": 26, + "covered nipples": 25, + "bare shoulders": 25, + "dress": 24, + "blonde hair": 24, + "black bow": 23, + "aqua hair": 23, + "spread legs": 23, + "inverted nipples": 23, + "mosaic censoring": 23, + "wet": 22, + "on back": 21, + "green eyes": 21, + "lactation": 21, + "cowboy shot": 20, + "panty pull": 19, + "black thighhighs": 19, + "skirt": 19, + "squatting": 18, + "black footwear": 17, + "upper body": 17, + "elbow gloves": 17, + "parted lips": 17, + "yellow eyes": 16, + "white bra": 15, + "micro bikini": 15, + "multiple girls": 15, + "on stomach": 15, + "soles": 15, + "bra": 14, + "pantyhose": 14, + "necktie": 14, + "long sleeves": 14, + "black background": 14, + "one-piece swimsuit": 14, + "hands up": 13, + "collar": 13, + "jewelry": 13, + "green hair": 13, + "horns": 13, + "yellow gloves": 13, + "black choker": 13, + "fang": 13, + "feet": 12, + "2girls": 12, + "red bow": 12, + "earrings": 12, + "ponytail": 12, + "pink background": 12, + "oppai loli": 12, + "toes": 11, + "leotard": 11, + "side-tie bikini bottom": 11, + "bow panties": 11, + "maid": 11, + "plump": 11, + "thighs": 11, + "bodysuit": 11, + "medium hair": 11, + "see-through": 11, + "fake animal ears": 11, + "bell": 11, + "blunt bangs": 11, + "areola slip": 10, + "kneeling": 10, + "underwear only": 10, + "blue background": 10, + "striped": 10, + "red hair": 10, + "ahoge": 10, + "weapon": 10, + "breasts squeezed together": 10, + "food": 10, + "bottomless": 10, + "fingerless gloves": 10, + "breast suppress": 10, + "rabbit ears": 10, + "blue headwear": 10, + "hairband": 10, + "armpits": 10, + "heart censor": 9, + "bed sheet": 9, + "red background": 9, + "covered navel": 9, + "grabbing own ass": 9, + "white thighhighs": 9, + "closed eyes": 9, + "deep skin": 9, + "topless": 9, + "tongue": 9, + "tongue out": 9, + "black panties": 9, + "outline": 9, + "white bikini": 9, + "dark skin": 8, + "dark-skinned female": 8, + "grey background": 8, + "socks": 8, + "multiple views": 8, + "hand on hip": 8, + "detached sleeves": 8, + "milking machine": 8, + "black eyes": 8, + "anus": 8, + "grin": 8, + "partially visible vulva": 8, + "one eye closed": 8, + "pussy juice": 7, + "scarf": 7, + "shoes": 7, + "from below": 7, + "thigh boots": 7, + "brown eyes": 7, + "cameltoe": 7, + "wet clothes": 7, + "playboy bunny": 7, + "tentacles": 7, + "orange bodysuit": 7, + "animal ear fluff": 7, + "arms up": 7, + "spoken heart": 7, + "neck bell": 7, + "school swimsuit": 7, + "colored skin": 7, + "slingshot swimsuit": 7, + "demon girl": 6, + "high heels": 6, + "shiny": 6, + "thong": 6, + "towel": 6, + "pillow": 6, + "symbol-shaped pupils": 6, + "ribbon": 6, + "shiny skin": 6, + "clothes lift": 6, + "lifted by self": 6, + "yellow footwear": 6, + "tabard": 6, + "red bikini": 6, + "standing on one leg": 6, + "purple background": 6, + "blue skin": 6, + "alternate breast size": 6, + "masturbation": 6, + "water": 6, + "dakimakura (medium)": 5, + "animal print": 5, + "red necktie": 5, + "black dress": 5, + "black pantyhose": 5, + "belly": 5, + "holding weapon": 5, + "ass grab": 5, + "heart-shaped pupils": 5, + "cat tail": 5, + "tray": 5, + "white dress": 5, + "naughty face": 5, + "half-closed eyes": 5, + "legs up": 5, + "armor": 5, + "microskirt": 5, + "medium breasts": 5, + "detached collar": 5, + "wariza": 5, + "side-tie panties": 5, + "white outline": 5, + "wristband": 5, + "wading": 5, + "untied": 5, + "ball": 4, + "head wings": 4, + "red footwear": 4, + "thick thighs": 4, + "orange hair": 4, + "cleft of venus": 4, + "garter straps": 4, + "completely nude": 4, + "bar censor": 4, + "santa hat": 4, + "skull": 4, + "sword": 4, + "rabbit tail": 4, + "mitre": 4, + "orange eyes": 4, + "white hair": 4, + "black headwear": 4, + "orange gloves": 4, + "staff": 4, + "monster girl": 4, + "black skirt": 4, + "bowtie": 4, + "shorts": 4, + "hair ribbon": 4, + "japanese clothes": 4, + "mouth hold": 4, + "white camisole": 4, + "female masturbation": 4, + "underboob": 4, + "thong bikini": 4, + "hands on hips": 4, + "ass visible through thighs": 4, + "bandages": 3, + "censored nipples": 3, + "red leotard": 3, + "hair over one eye": 3, + "small breasts": 3, + "hood": 3, + "holding panties": 3, + "holding underwear": 3, + "holding clothes": 3, + "striped panties": 3, + "panties removed": 3, + "red dress": 3, + "on bed": 3, + "condom": 3, + "condom wrapper": 3, + "bent over": 3, + "tan": 3, + "tanlines": 3, + "arm up": 3, + "shadow": 3, + "cropped legs": 3, + "christmas": 3, + "puffy sleeves": 3, + "holding tray": 3, + "short dress": 3, + "clothing cutout": 3, + "shirt lift": 3, + "black socks": 3, + "cat": 3, + "thigh gap": 3, + "sleeves past wrists": 3, + "green background": 3, + "hose": 3, + "teeth": 3, + "red scarf": 3, + "speech bubble": 3, + "aqua eyes": 3, + "saliva": 3, + "pasties": 3, + "heterochromia": 3, + "covering": 3, + ";d": 3, + "jingle bell": 3, + "black leotard": 3, + "tail ornament": 3, + "multicolored hair": 3, + "two-tone hair": 3, + "black ribbon": 3, + "ghost": 3, + "triangular headpiece": 3, + "kimono": 3, + "camisole": 3, + "from side": 3, + "bouncing breasts": 3, + "arms behind head": 3, + "all fours": 3, + "cup": 3, + "red panties": 3, + "skindentation": 3, + "gradient background": 3, + "seiza": 3, + "braid": 3, + "winged helmet": 3, + "helmet": 3, + "hand up": 3, + "shirt": 3, + "red one-piece swimsuit": 3, + "torn clothes": 3, + "naked bandage": 2, + "striped bikini": 2, + "beachball": 2, + "wolf tail": 2, + "wolf ears": 2, + "sex toy": 2, + "vibrator": 2, + "lilith aensland": 2, + "bat print": 2, + "print legwear": 2, + "bat wings": 2, + "bridal gauntlets": 2, + "animal hood": 2, + "eyepatch": 2, + "claws": 2, + "yellow bow": 2, + "drill hair": 2, + "striped thighhighs": 2, + "black necktie": 2, + "twin drills": 2, + "midriff": 2, + "crop top": 2, + "crotchless": 2, + "bottle": 2, + "towel on head": 2, + "pointing": 2, + "short sleeves": 2, + "outstretched arm": 2, + "knife": 2, + "skin tight": 2, + "big hair": 2, + "fangs": 2, + "knees together feet apart": 2, + "white footwear": 2, + "highleg bikini": 2, + "groin": 2, + "one-piece tan": 2, + "pleated skirt": 2, + "santa costume": 2, + "juliet sleeves": 2, + "cleavage cutout": 2, + "glasses": 2, + "hands on own chest": 2, + "school uniform": 2, + "orange neckerchief": 2, + "wide sleeves": 2, + "green panties": 2, + "peaked cap": 2, + "sideboob": 2, + "animal hands": 2, + "eyes visible through hair": 2, + "single horn": 2, + "bikini lift": 2, + "strapless leotard": 2, + "tail bow": 2, + "against glass": 2, + "yuri": 2, + "grabbing": 2, + "cow print": 2, + "colored inner hair": 2, + "elf": 2, + "profile": 2, + "fishnets": 2, + "fruit": 2, + "on side": 2, + "holding food": 2, + "slime girl": 2, + "outdoors": 2, + "butt crack": 2, + "sandals": 2, + "shaved ice": 2, + ":p": 2, + "bikini armor": 2, + "bikini top only": 2, + "shield": 2, + "maid bikini": 2, + "frills": 2, + "bath": 2, + "scylla": 2, + "big belly": 2, + "pregnant": 2, + "jacket": 2, + "fur trim": 2, + "bright pupils": 2, + "fur-trimmed sleeves": 2, + "earmuffs": 2, + "hair bobbles": 2, + "pants": 2, + "chinese clothes": 2, + "uniform": 2, + "claw pose": 2, + "dress lift": 2, + "octopus": 2, + "suction cups": 2, + "soap bubbles": 2, + "sneakers": 2, + "cirno": 2, + "black one-piece swimsuit": 2, + "pelvic curtain": 2, + "covering nipples": 2, + "teacup": 2, + "orange background": 2, + "back": 2, + "colored sclera": 2, + "black sclera": 2, + "slime (dragon quest)": 2, + "bow bra": 2, + "sleeveless dress": 2, + "star (symbol)": 2, + "puffy nipples": 2, + "untied bikini": 2, + "front-tie bikini top": 2, + "yellow bikini": 2, + "front-tie top": 2, + "sheet grab": 2, + "headphones": 2, + "white choker": 2, + "revealing clothes": 2, + "buruma": 2, + "gym uniform": 2, + "crossed legs": 2, + "the pose": 2, + "halo": 2, + "demon horns": 2, + "demon wings": 2, + "curtains": 2, + "dragon horns": 2, + "dragon girl": 2, + "candy": 2, + "lollipop": 2, + "clothes pull": 2, + "gradient": 2, + "partially submerged": 2, + "fairy wings": 1, + "fairy": 1, + "wet panties": 1, + "cat hood": 1, + "brown background": 1, + "alena (dq4)": 1, + "cape": 1, + "yellow skirt": 1, + "curly hair": 1, + "belt": 1, + "3girls": 1, + "huge ass": 1, + "toenails": 1, + "whip": 1, + "holding whip": 1, + "breast press": 1, + "zoom layer": 1, + "grey hair": 1, + "kneehighs": 1, + "basket": 1, + "pointing at viewer": 1, + "copyright name": 1, + "pink bodysuit": 1, + "holding knife": 1, + "holding dagger": 1, + "dagger": 1, + "furry female": 1, + "furry": 1, + "pink skin": 1, + "cat girl": 1, + "character doll": 1, + "zettai ryouiki": 1, + "doll": 1, + "fox ears": 1, + "green bow": 1, + "gun": 1, + "holding gun": 1, + "hood up": 1, + "highleg": 1, + "ibuki suika": 1, + "chain": 1, + "gourd": 1, + "horn ornament": 1, + "headgear": 1, + "popsicle": 1, + "naked towel": 1, + "ass focus": 1, + "black jacket": 1, + "crotch seam": 1, + "mythra (xenoblade)": 1, + "swept bangs": 1, + "chest jewel": 1, + "tiara": 1, + "black-framed eyewear": 1, + "semi-rimless eyewear": 1, + "under-rim eyewear": 1, + "bra lift": 1, + "wedgie": 1, + "school bag": 1, + "dressing": 1, + "bag": 1, + "broom": 1, + "orange hairband": 1, + "neckerchief": 1, + "holding broom": 1, + "restrained": 1, + "mace": 1, + "white tail": 1, + "impossible clothes": 1, + "sharp teeth": 1, + "cross": 1, + "pink wings": 1, + "solo focus": 1, + "naked sheet": 1, + "foot focus": 1, + "out-of-frame censoring": 1, + "black border": 1, + "border": 1, + "lamia": 1, + "forked tongue": 1, + "long tongue": 1, + "nipple slip": 1, + "head out of frame": 1, + "breast focus": 1, + "nude cover": 1, + "4girls": 1, + "paw gloves": 1, + "body blush": 1, + "breast rest": 1, + "fur collar": 1, + ":3": 1, + "brown thighhighs": 1, + "head-mounted display": 1, + "paw pose": 1, + "hairclip": 1, + "pulled by self": 1, + "breast grab": 1, + "licking": 1, + "mini wings": 1, + "ear tag": 1, + "cow ears": 1, + "official alternate costume": 1, + "cow horns": 1, + "cow girl": 1, + "fishnet pantyhose": 1, + "mandarin orange": 1, + "holding fruit": 1, + "grass": 1, + "lotion": 1, + "borrowed character": 1, + "short shorts": 1, + "uncensored": 1, + "fat mons": 1, + "beach": 1, + "cowbell": 1, + "plant": 1, + "vines": 1, + "rabbit": 1, + "dog ears": 1, + "kirin (armor)": 1, + "monster hunter (character)": 1, + "lalafell": 1, + "bathtub": 1, + "hitodama": 1, + "large areolae": 1, + "pink footwear": 1, + "cherry": 1, + "indian style": 1, + "black bra": 1, + "garter belt": 1, + "thick eyebrows": 1, + "short eyebrows": 1, + "yellow jacket": 1, + "fur-trimmed jacket": 1, + "white scarf": 1, + "white leotard": 1, + "grabbing own breast": 1, + "open jacket": 1, + "open clothes": 1, + "mecha musume": 1, + "close-up": 1, + "snake": 1, + "lei lei": 1, + "jiangshi": 1, + "ofuda": 1, + "qing guanmao": 1, + "flipped hair": 1, + "headdress": 1, + "milk": 1, + "body writing": 1, + "spread ass": 1, + "armband": 1, + "kicking": 1, + "flying sweatdrops": 1, + "crown": 1, + "consensual tentacles": 1, + "capelet": 1, + "sky": 1, + "cloud": 1, + "crotchless panties": 1, + "black scarf": 1, + "cross-section": 1, + "fishnet thighhighs": 1, + "fellatio gesture": 1, + "fishnet gloves": 1, + "mushroom": 1, + "motion lines": 1, + "maebari": 1, + "brown pantyhose": 1, + "heart background": 1, + "hestia (danmachi)": 1, + "rei no himo": 1, + "blue ribbon": 1, + "heart earrings": 1, + "kotatsu": 1, + "chopsticks": 1, + "table": 1, + "ice wings": 1, + "blue bow": 1, + "aged up": 1, + "slime (creature)": 1, + "black wings": 1, + "sleeveless": 1, + "frilled hairband": 1, + "manya (dq4)": 1, + "circlet": 1, + "bracelet": 1, + "loincloth": 1, + "anklet": 1, + "bike shorts": 1, + "blue gloves": 1, + "unaligned breasts": 1, + "shorts under skirt": 1, + "white skirt": 1, + "object hug": 1, + "spanked": 1, + "panties around one leg": 1, + "bed": 1, + "wind chime": 1, + "calendar (object)": 1, + "bare legs": 1, + "uraraka ochako": 1, + "black bodysuit": 1, + "minigirl": 1, + "multi-tied hair": 1, + "legwear under shorts": 1, + "dog": 1, + "bathing": 1, + "convenient censoring": 1, + "striped socks": 1, + "shiny hair": 1, + "no shoes": 1, + "holding staff": 1, + "breast sucking": 1, + "hot": 1, + "peeing": 1, + "yokozuwari": 1, + "holding shield": 1, + "holding sword": 1, + "shoulder armor": 1, + "rubbing eyes": 1, + "striped sleeves": 1, + "eyewear removed": 1, + "stairs": 1, + "ribbon choker": 1, + "bra pull": 1, + "stocking (psg)": 1, + "heart pasties": 1, + "facing away": 1, + "nun": 1, + "habit": 1, + "wet shirt": 1, + "?": 1, + "police": 1, + "police uniform": 1, + "knee pads": 1, + ":<": 1, + "spoon": 1, + "cake": 1, + "can": 1, + "fundoshi": 1, + "goggles": 1, + "goggles on head": 1, + "short twintails": 1, + "feet up": 1, + "bunny pose": 1, + "salute": 1, + "v": 1, + "double v": 1, + "skin fang": 1, + "indoors": 1, + ":o": 1, + "dutch angle": 1, + "clothing aside": 1, + "fingering": 1, + "white headwear": 1, + "sun hat": 1, + "frown": 1, + "red headwear": 1, + "red gloves": 1, + "hands on own ass": 1, + "miniskirt": 1, + "bikini pull": 1, + "neck ribbon": 1, + "purple dress": 1, + "bulma": 1, + "red bowtie": 1, + "strapless": 1, + "white one-piece swimsuit": 1, + "nekomusume": 1, + "nekomusume (gegege no kitarou 6)": 1, + "red choker": 1, + "white shirt": 1, + "sex": 1, + "ankle cuffs": 1, + "jitome": 1, + "leg up": 1, + "winged arms": 1, + "feathered wings": 1, + "stomach": 1, + "arm support": 1, + "looking down": 1, + "book": 1, + "clothes in mouth": 1, + "slit pupils": 1, + "pillar": 1, + "monster": 1, + "between breasts": 1, + "teapot": 1, + "mary janes": 1, + "apron": 1, + "musical note": 1, + "stool": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "Zankuro": { + "n_repeats": 1, + "img_count": 357 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 1, \"num_train_images\": 357, \"num_reg_images\": 0, \"resolution\": [768, 768], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"Zankuro\": {\"1girl\": 342, \"breasts\": 216, \"solo\": 327, \"pointy ears\": 152, \"smile\": 201, \"white background\": 108, \"pink hair\": 101, \"navel\": 116, \"blue eyes\": 70, \"looking at viewer\": 239, \"bandages\": 3, \"covered nipples\": 25, \"large breasts\": 150, \"simple background\": 171, \"hands up\": 13, \"areola slip\": 10, \"wings\": 31, \"blush\": 232, \"naked bandage\": 2, \"open mouth\": 131, \"full body\": 53, \"short hair\": 74, \"kneeling\": 10, \"fairy wings\": 1, \"bangs\": 54, \"fairy\": 1, \":d\": 49, \"heart censor\": 9, \"heart\": 83, \"panties\": 90, \"long hair\": 217, \"on back\": 21, \"censored\": 40, \"panty pull\": 19, \"underwear\": 91, \"black bow\": 23, \"lying\": 39, \"very long hair\": 63, \"white panties\": 61, \"hair bow\": 50, \"bow\": 72, \"loli\": 51, \"barefoot\": 53, \"hair between eyes\": 35, \"red eyes\": 105, \"bed sheet\": 9, \"sweat\": 126, \"bra\": 14, \"white bra\": 15, \"dakimakura (medium)\": 5, \"wrist cuffs\": 33, \"censored nipples\": 3, \"underwear only\": 10, \"aqua hair\": 23, \"swimsuit\": 92, \"animal ears\": 88, \"tail\": 27, \"bikini\": 72, \"ball\": 4, \"blue hair\": 48, \"collar\": 13, \"striped bikini\": 2, \"beachball\": 2, \"blue background\": 10, \"wolf tail\": 2, \"striped\": 10, \"wolf ears\": 2, \"micro bikini\": 15, \"holding\": 27, \"twintails\": 89, \"ass\": 116, \"looking back\": 74, \"feet\": 12, \"hair ornament\": 52, \"sex toy\": 2, \"wet panties\": 1, \"pussy juice\": 7, \"choker\": 34, \"vibrator\": 2, \"toes\": 11, \"lilith aensland\": 2, \"animal print\": 5, \"bat print\": 2, \"pantyhose\": 14, \"head wings\": 4, \"leotard\": 11, \"print legwear\": 2, \"purple hair\": 60, \"demon girl\": 6, \"red leotard\": 3, \"bat wings\": 2, \"bridal gauntlets\": 2, \"high heels\": 6, \"bare shoulders\": 25, \"red footwear\": 4, \"shiny\": 6, \"from behind\": 52, \"thick thighs\": 4, \"boots\": 47, \"gloves\": 130, \"hair over one eye\": 3, \"small breasts\": 3, \"black gloves\": 45, \"black hair\": 33, \"black footwear\": 17, \"side-tie bikini bottom\": 11, \"black bikini\": 36, \"orange hair\": 4, \"hood\": 3, \"cat hood\": 1, \"sitting\": 42, \"animal hood\": 2, \"blush stickers\": 40, \"scarf\": 7, \"multiple girls\": 15, \"2girls\": 12, \"maid headdress\": 32, \"red bow\": 12, \"necktie\": 14, \"holding panties\": 3, \"brown background\": 1, \"pussy\": 44, \"bow panties\": 11, \"maid\": 11, \"holding underwear\": 3, \"holding clothes\": 3, \"long sleeves\": 14, \"red necktie\": 5, \"striped panties\": 3, \"plump\": 11, \"panties removed\": 3, \"black dress\": 5, \"cleft of venus\": 4, \"eyepatch\": 2, \"alena (dq4)\": 1, \"hat\": 27, \"cape\": 1, \"jewelry\": 13, \"earrings\": 12, \"yellow skirt\": 1, \"dress\": 24, \"claws\": 2, \"curly hair\": 1, \"red background\": 9, \"black pantyhose\": 5, \"belt\": 1, \"blonde hair\": 24, \"thighhighs\": 61, \"yellow eyes\": 16, \"black thighhighs\": 19, \"spread legs\": 23, \"3girls\": 1, \"dark skin\": 8, \"dark-skinned female\": 8, \"red hair\": 10, \"purple eyes\": 35, \"huge ass\": 1, \"thong\": 6, \"huge breasts\": 48, \"green hair\": 13, \"yellow bow\": 2, \"grey background\": 8, \"thighs\": 11, \"on stomach\": 15, \"skull hair ornament\": 48, \"white gloves\": 31, \"toenails\": 1, \"drill hair\": 2, \"striped thighhighs\": 2, \"whip\": 1, \"black necktie\": 2, \"ahoge\": 10, \"twin drills\": 2, \"midriff\": 2, \"holding whip\": 1, \"crop top\": 2, \"standing\": 35, \"shoes\": 7, \"skirt\": 19, \"squatting\": 18, \"closed mouth\": 81, \"flat chest\": 46, \"crotchless\": 2, \"bottle\": 2, \"towel\": 6, \"towel on head\": 2, \"belly\": 5, \"nipples\": 84, \"breast press\": 1, \"pointing\": 2, \"brown hair\": 35, \"zoom layer\": 1, \"grey hair\": 1, \"red dress\": 3, \"kneehighs\": 1, \"socks\": 8, \"green eyes\": 21, \"short sleeves\": 2, \"outstretched arm\": 2, \"basket\": 1, \"pointing at viewer\": 1, \"copyright name\": 1, \"inverted nipples\": 23, \"nude\": 55, \"mosaic censoring\": 23, \"pillow\": 6, \"on bed\": 3, \"pink bodysuit\": 1, \"bodysuit\": 11, \"knife\": 2, \"holding knife\": 1, \"weapon\": 10, \"holding dagger\": 1, \"ponytail\": 12, \"covered navel\": 9, \"skin tight\": 2, \"dagger\": 1, \"big hair\": 2, \"holding weapon\": 5, \"cleavage\": 26, \"grabbing own ass\": 9, \"ass grab\": 5, \"symbol-shaped pupils\": 6, \"heart-shaped pupils\": 5, \"furry female\": 1, \"furry\": 1, \"multiple views\": 8, \"cat ears\": 28, \"pink skin\": 1, \"cat tail\": 5, \"cat girl\": 1, \"fangs\": 2, \"from below\": 7, \"hand on hip\": 8, \"character doll\": 1, \"zettai ryouiki\": 1, \"doll\": 1, \"fox ears\": 1, \"thigh boots\": 7, \"garter straps\": 4, \"detached sleeves\": 8, \"knees together feet apart\": 2, \"condom\": 3, \"condom wrapper\": 3, \"pink eyes\": 44, \"black background\": 14, \"breasts squeezed together\": 10, \"upper body\": 17, \"green bow\": 1, \"wet\": 22, \"brown eyes\": 7, \"bent over\": 3, \"completely nude\": 4, \"tan\": 3, \"tanlines\": 3, \"white footwear\": 2, \"gun\": 1, \"holding gun\": 1, \"hood up\": 1, \"highleg\": 1, \"arm up\": 3, \"highleg bikini\": 2, \"groin\": 2, \"shadow\": 3, \"one-piece tan\": 2, \"ibuki suika\": 1, \"chain\": 1, \"horns\": 13, \"gourd\": 1, \"ribbon\": 6, \"horn ornament\": 1, \"lactation\": 21, \"headgear\": 1, \"pleated skirt\": 2, \"food\": 10, \"popsicle\": 1, \"naked towel\": 1, \"bar censor\": 4, \"cropped legs\": 3, \"milking machine\": 8, \"santa costume\": 2, \"christmas\": 3, \"santa hat\": 4, \"juliet sleeves\": 2, \"puffy sleeves\": 3, \"ass focus\": 1, \"white thighhighs\": 9, \"black jacket\": 1, \"cameltoe\": 7, \"crotch seam\": 1, \"shiny skin\": 6, \"tray\": 5, \"holding tray\": 3, \"cowboy shot\": 20, \"medium hair\": 11, \"bottomless\": 10, \"mythra (xenoblade)\": 1, \"short dress\": 3, \"cleavage cutout\": 2, \"elbow gloves\": 17, \"white dress\": 5, \"swept bangs\": 1, \"clothing cutout\": 3, \"chest jewel\": 1, \"tiara\": 1, \"glasses\": 2, \"black-framed eyewear\": 1, \"semi-rimless eyewear\": 1, \"under-rim eyewear\": 1, \"see-through\": 11, \"clothes lift\": 6, \"naughty face\": 5, \"lifted by self\": 6, \"bra lift\": 1, \"shirt lift\": 3, \"black socks\": 3, \"half-closed eyes\": 5, \"cat\": 3, \"fingerless gloves\": 10, \"wedgie\": 1, \"parted lips\": 17, \"breast suppress\": 10, \"hands on own chest\": 2, \"extra ears\": 28, \"thigh gap\": 3, \"school bag\": 1, \"wet clothes\": 7, \"dressing\": 1, \"legs up\": 5, \"school uniform\": 2, \"bag\": 1, \"broom\": 1, \"skull\": 4, \"orange neckerchief\": 2, \"black eyes\": 8, \"orange hairband\": 1, \"sleeves past wrists\": 3, \"neckerchief\": 1, \"wide sleeves\": 2, \"holding broom\": 1, \"yellow gloves\": 13, \"anus\": 8, \"green panties\": 2, \"yellow footwear\": 6, \"green background\": 3, \"grin\": 8, \"hose\": 3, \"pink background\": 12, \"teeth\": 3, \"sword\": 4, \"armor\": 5, \"rabbit ears\": 10, \"rabbit tail\": 4, \"playboy bunny\": 7, \"fake animal ears\": 11, \"black choker\": 13, \"tentacles\": 7, \"closed eyes\": 9, \"deep skin\": 9, \"restrained\": 1, \"orange bodysuit\": 7, \"tabard\": 6, \"blue headwear\": 10, \"mitre\": 4, \"mace\": 1, \"microskirt\": 5, \"animal ear fluff\": 7, \"peaked cap\": 2, \"white tail\": 1, \"orange eyes\": 4, \"white hair\": 4, \"topless\": 9, \"fang\": 13, \"black headwear\": 4, \"arms up\": 7, \"orange gloves\": 4, \"impossible clothes\": 1, \"red scarf\": 3, \"sharp teeth\": 1, \"sideboob\": 2, \"red bikini\": 6, \"animal hands\": 2, \"spoken heart\": 7, \"staff\": 4, \"cross\": 1, \"hairband\": 10, \"pink wings\": 1, \"partially visible vulva\": 8, \"solo focus\": 1, \"soles\": 15, \"naked sheet\": 1, \"foot focus\": 1, \"speech bubble\": 3, \"out-of-frame censoring\": 1, \"black border\": 1, \"border\": 1, \"aqua eyes\": 3, \"monster girl\": 4, \"lamia\": 1, \"tongue\": 9, \"tongue out\": 9, \"forked tongue\": 1, \"long tongue\": 1, \"black skirt\": 4, \"eyes visible through hair\": 2, \"saliva\": 3, \"pasties\": 3, \"single horn\": 2, \"medium breasts\": 5, \"heterochromia\": 3, \"nipple slip\": 1, \"head out of frame\": 1, \"breast focus\": 1, \"nude cover\": 1, \"covering\": 3, \"4girls\": 1, \"one eye closed\": 8, \"paw gloves\": 1, \"bell\": 11, \"neck bell\": 7, \";d\": 3, \"jingle bell\": 3, \"body blush\": 1, \"breast rest\": 1, \"fur collar\": 1, \"bikini lift\": 2, \":3\": 1, \"black leotard\": 3, \"bowtie\": 4, \"detached collar\": 5, \"brown thighhighs\": 1, \"strapless leotard\": 2, \"head-mounted display\": 1, \"tail ornament\": 3, \"paw pose\": 1, \"standing on one leg\": 6, \"hairclip\": 1, \"tail bow\": 2, \"against glass\": 2, \"school swimsuit\": 7, \"one-piece swimsuit\": 14, \"pulled by self\": 1, \"yuri\": 2, \"grabbing\": 2, \"breast grab\": 1, \"licking\": 1, \"purple background\": 6, \"mini wings\": 1, \"ear tag\": 1, \"cow print\": 2, \"cow ears\": 1, \"multicolored hair\": 3, \"official alternate costume\": 1, \"cow horns\": 1, \"two-tone hair\": 3, \"cow girl\": 1, \"colored inner hair\": 2, \"elf\": 2, \"profile\": 2, \"fishnets\": 2, \"fishnet pantyhose\": 1, \"fruit\": 2, \"on side\": 2, \"holding food\": 2, \"blunt bangs\": 11, \"mandarin orange\": 1, \"holding fruit\": 1, \"slime girl\": 2, \"colored skin\": 7, \"outdoors\": 2, \"grass\": 1, \"blue skin\": 6, \"lotion\": 1, \"borrowed character\": 1, \"shorts\": 4, \"short shorts\": 1, \"butt crack\": 2, \"uncensored\": 1, \"fat mons\": 1, \"sandals\": 2, \"shaved ice\": 2, \"beach\": 1, \"cowbell\": 1, \":p\": 2, \"bikini armor\": 2, \"plant\": 1, \"vines\": 1, \"bikini top only\": 2, \"shield\": 2, \"rabbit\": 1, \"dog ears\": 1, \"kirin (armor)\": 1, \"monster hunter (character)\": 1, \"lalafell\": 1, \"hair ribbon\": 4, \"oppai loli\": 12, \"maid bikini\": 2, \"black ribbon\": 3, \"frills\": 2, \"bath\": 2, \"bathtub\": 1, \"wariza\": 5, \"ghost\": 3, \"triangular headpiece\": 3, \"hitodama\": 1, \"japanese clothes\": 4, \"kimono\": 3, \"black panties\": 9, \"large areolae\": 1, \"scylla\": 2, \"pink footwear\": 1, \"cherry\": 1, \"mouth hold\": 4, \"side-tie panties\": 5, \"indian style\": 1, \"outline\": 9, \"big belly\": 2, \"pregnant\": 2, \"black bra\": 1, \"white outline\": 5, \"garter belt\": 1, \"thick eyebrows\": 1, \"short eyebrows\": 1, \"alternate breast size\": 6, \"jacket\": 2, \"yellow jacket\": 1, \"fur trim\": 2, \"bright pupils\": 2, \"fur-trimmed jacket\": 1, \"fur-trimmed sleeves\": 2, \"earmuffs\": 2, \"white scarf\": 1, \"white leotard\": 1, \"grabbing own breast\": 1, \"open jacket\": 1, \"open clothes\": 1, \"mecha musume\": 1, \"close-up\": 1, \"hair bobbles\": 2, \"pants\": 2, \"camisole\": 3, \"white camisole\": 4, \"snake\": 1, \"slingshot swimsuit\": 7, \"wristband\": 5, \"lei lei\": 1, \"jiangshi\": 1, \"ofuda\": 1, \"chinese clothes\": 2, \"qing guanmao\": 1, \"flipped hair\": 1, \"from side\": 3, \"headdress\": 1, \"milk\": 1, \"body writing\": 1, \"spread ass\": 1, \"uniform\": 2, \"armband\": 1, \"wading\": 5, \"white bikini\": 9, \"claw pose\": 2, \"kicking\": 1, \"flying sweatdrops\": 1, \"dress lift\": 2, \"octopus\": 2, \"crown\": 1, \"suction cups\": 2, \"consensual tentacles\": 1, \"capelet\": 1, \"female masturbation\": 4, \"masturbation\": 6, \"soap bubbles\": 2, \"underboob\": 4, \"sky\": 1, \"cloud\": 1, \"crotchless panties\": 1, \"black scarf\": 1, \"sneakers\": 2, \"water\": 6, \"cirno\": 2, \"cross-section\": 1, \"fishnet thighhighs\": 1, \"fellatio gesture\": 1, \"fishnet gloves\": 1, \"armpits\": 10, \"thong bikini\": 4, \"mushroom\": 1, \"bouncing breasts\": 3, \"black one-piece swimsuit\": 2, \"arms behind head\": 3, \"motion lines\": 1, \"all fours\": 3, \"pelvic curtain\": 2, \"maebari\": 1, \"brown pantyhose\": 1, \"covering nipples\": 2, \"heart background\": 1, \"hestia (danmachi)\": 1, \"rei no himo\": 1, \"blue ribbon\": 1, \"cup\": 3, \"teacup\": 2, \"orange background\": 2, \"hands on hips\": 4, \"red panties\": 3, \"skindentation\": 3, \"gradient background\": 3, \"heart earrings\": 1, \"kotatsu\": 1, \"chopsticks\": 1, \"table\": 1, \"back\": 2, \"colored sclera\": 2, \"black sclera\": 2, \"ice wings\": 1, \"blue bow\": 1, \"aged up\": 1, \"slime (creature)\": 1, \"slime (dragon quest)\": 2, \"bow bra\": 2, \"black wings\": 1, \"sleeveless\": 1, \"sleeveless dress\": 2, \"seiza\": 3, \"untied\": 5, \"star (symbol)\": 2, \"frilled hairband\": 1, \"puffy nipples\": 2, \"manya (dq4)\": 1, \"circlet\": 1, \"bracelet\": 1, \"loincloth\": 1, \"anklet\": 1, \"untied bikini\": 2, \"front-tie bikini top\": 2, \"yellow bikini\": 2, \"front-tie top\": 2, \"bike shorts\": 1, \"blue gloves\": 1, \"unaligned breasts\": 1, \"shorts under skirt\": 1, \"white skirt\": 1, \"braid\": 3, \"winged helmet\": 3, \"helmet\": 3, \"object hug\": 1, \"spanked\": 1, \"panties around one leg\": 1, \"bed\": 1, \"wind chime\": 1, \"calendar (object)\": 1, \"bare legs\": 1, \"uraraka ochako\": 1, \"black bodysuit\": 1, \"sheet grab\": 2, \"minigirl\": 1, \"multi-tied hair\": 1, \"legwear under shorts\": 1, \"dog\": 1, \"bathing\": 1, \"convenient censoring\": 1, \"striped socks\": 1, \"shiny hair\": 1, \"no shoes\": 1, \"headphones\": 2, \"holding staff\": 1, \"breast sucking\": 1, \"hot\": 1, \"peeing\": 1, \"yokozuwari\": 1, \"hand up\": 3, \"holding shield\": 1, \"holding sword\": 1, \"shoulder armor\": 1, \"rubbing eyes\": 1, \"striped sleeves\": 1, \"eyewear removed\": 1, \"stairs\": 1, \"ribbon choker\": 1, \"bra pull\": 1, \"stocking (psg)\": 1, \"heart pasties\": 1, \"facing away\": 1, \"ass visible through thighs\": 4, \"nun\": 1, \"habit\": 1, \"white choker\": 2, \"revealing clothes\": 2, \"buruma\": 2, \"gym uniform\": 2, \"wet shirt\": 1, \"shirt\": 3, \"?\": 1, \"police\": 1, \"police uniform\": 1, \"knee pads\": 1, \":<\": 1, \"crossed legs\": 2, \"spoon\": 1, \"cake\": 1, \"can\": 1, \"fundoshi\": 1, \"goggles\": 1, \"goggles on head\": 1, \"short twintails\": 1, \"the pose\": 2, \"feet up\": 1, \"bunny pose\": 1, \"halo\": 2, \"red one-piece swimsuit\": 3, \"salute\": 1, \"v\": 1, \"double v\": 1, \"demon horns\": 2, \"demon wings\": 2, \"skin fang\": 1, \"curtains\": 2, \"indoors\": 1, \":o\": 1, \"dutch angle\": 1, \"clothing aside\": 1, \"fingering\": 1, \"white headwear\": 1, \"sun hat\": 1, \"frown\": 1, \"dragon horns\": 2, \"dragon girl\": 2, \"torn clothes\": 3, \"red headwear\": 1, \"red gloves\": 1, \"hands on own ass\": 1, \"miniskirt\": 1, \"candy\": 2, \"lollipop\": 2, \"clothes pull\": 2, \"bikini pull\": 1, \"gradient\": 2, \"neck ribbon\": 1, \"purple dress\": 1, \"bulma\": 1, \"red bowtie\": 1, \"strapless\": 1, \"white one-piece swimsuit\": 1, \"nekomusume\": 1, \"nekomusume (gegege no kitarou 6)\": 1, \"red choker\": 1, \"white shirt\": 1, \"sex\": 1, \"ankle cuffs\": 1, \"jitome\": 1, \"partially submerged\": 2, \"leg up\": 1, \"winged arms\": 1, \"feathered wings\": 1, \"stomach\": 1, \"arm support\": 1, \"looking down\": 1, \"book\": 1, \"clothes in mouth\": 1, \"slit pupils\": 1, \"pillar\": 1, \"monster\": 1, \"between breasts\": 1, \"teapot\": 1, \"mary janes\": 1, \"apron\": 1, \"musical note\": 1, \"stool\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [256, 512], \"count\": 1}, \"1\": {\"resolution\": [384, 320], \"count\": 1}, \"2\": {\"resolution\": [384, 576], \"count\": 1}, \"3\": {\"resolution\": [384, 1280], \"count\": 2}, \"4\": {\"resolution\": [448, 640], \"count\": 2}, \"5\": {\"resolution\": [448, 1280], \"count\": 3}, \"6\": {\"resolution\": [512, 704], \"count\": 2}, \"7\": {\"resolution\": [512, 768], \"count\": 4}, \"8\": {\"resolution\": [576, 576], \"count\": 1}, \"9\": {\"resolution\": [576, 704], \"count\": 1}, \"10\": {\"resolution\": [576, 768], \"count\": 6}, \"11\": {\"resolution\": [576, 832], \"count\": 6}, \"12\": {\"resolution\": [576, 896], \"count\": 10}, \"13\": {\"resolution\": [576, 960], \"count\": 2}, \"14\": {\"resolution\": [576, 1024], \"count\": 1}, \"15\": {\"resolution\": [640, 512], \"count\": 1}, \"16\": {\"resolution\": [640, 576], \"count\": 1}, \"17\": {\"resolution\": [640, 768], \"count\": 16}, \"18\": {\"resolution\": [640, 832], \"count\": 45}, \"19\": {\"resolution\": [640, 896], \"count\": 115}, \"20\": {\"resolution\": [704, 704], \"count\": 16}, \"21\": {\"resolution\": [704, 768], \"count\": 19}, \"22\": {\"resolution\": [704, 832], \"count\": 1}, \"23\": {\"resolution\": [768, 512], \"count\": 1}, \"24\": {\"resolution\": [768, 576], \"count\": 5}, \"25\": {\"resolution\": [768, 640], \"count\": 8}, \"26\": {\"resolution\": [768, 704], \"count\": 14}, \"27\": {\"resolution\": [768, 768], \"count\": 17}, \"28\": {\"resolution\": [832, 576], \"count\": 8}, \"29\": {\"resolution\": [832, 640], \"count\": 10}, \"30\": {\"resolution\": [896, 576], \"count\": 1}, \"31\": {\"resolution\": [896, 640], \"count\": 21}, \"32\": {\"resolution\": [960, 576], \"count\": 1}, \"33\": {\"resolution\": [1024, 512], \"count\": 1}, \"34\": {\"resolution\": [1024, 576], \"count\": 13}}, \"mean_img_ar_error\": 0.013551653152327214}, \"subsets\": [{\"img_count\": 357, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 0, \"image_dir\": \"Zankuro\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "16", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "357", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "7140", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "bf16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16.0", + "ss_network_args": { + "conv_dim": "16", + "conv_alpha": "8.0" + }, + "ss_network_dim": "32", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "357", + "ss_num_epochs": "20", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit(weight_decay=0.1,betas=(0.9, 0.99))", + "ss_output_name": "ZANKURO_STYLE", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "925997e9", + "ss_sd_scripts_commit_hash": "c924c47f374ac1b6e33e71f82948eb1853e2243f", + "ss_seed": "727", + "ss_session_id": "885289302", + "ss_steps": "5712", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1689315558.3948143", + "ss_training_started_at": "1689312830.346651", + "ss_unet_lr": "0.0002", + "ss_v2": "False", + "sshs_legacy_hash": "44b3616e", + "sshs_model_hash": "bef74d9f56da21650f6473b1bd0e27f56c82dc7eaf694f608c518416cfb0eb8e" +} \ No newline at end of file diff --git a/Styles/437/zankuro_style16-85559.txt b/Styles/437/zankuro_style16-85559.txt new file mode 100644 index 0000000000000000000000000000000000000000..0fb46c954a4255bf0795079e77634b45742232a1 --- /dev/null +++ b/Styles/437/zankuro_style16-85559.txt @@ -0,0 +1,557 @@ +Link:https://civitai.com/models/110739/zankuro-style-locon +Version:v1.0 +Base Model:Other +Keywords: +--------DESCRIPTION--------- + +Style from Zankuro consider supporting them. + +I like to use it with nadenadesitai model. + +Samples at 0.9~1 strength but its up to you, I rarely use styles at 1 strength(but did for samples). + +Issues: hands, and it makes weird things on the neck area, idk how to fix that. + +Enjoy :D +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:768x1152, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img2: + Prompt:1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img3: + Prompt:1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:768x1152, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img4: + Prompt:1girl, , large breasts, bikini, cleavage, squatting, cameltoe, open mouth, tongue out, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img5: + Prompt:1girl, , large breasts, bikini, cleavage, squatting, cameltoe, open mouth, tongue out, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img6: + Prompt:1girl, , large breasts, leotard, from behind, ass, thong, looking at viewer, grin, ass grab, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img7: + Prompt:1girl, , large breasts, nude, straddling, spread legs, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img8: + Prompt:1girl, , large breasts, nude, straddling, spread legs, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img9: + Prompt:1girl, , large breasts, nude, standing, grin, arms behind head, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + +img10: + Prompt:1girl, , large breasts, nude, standing, grin, arms behind head, + Negative Prompt:(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through, + Size:512x768, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:anything-v4.5-pruned-fp16, Model Hash:f773383dbc + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 110739, + "name": "Zankuro Style LoCon", + "description": "

Style from Zankuro consider supporting them.

I like to use it with nadenadesitai model.

Samples at 0.9~1 strength but its up to you, I rarely use styles at 1 strength(but did for samples).

Issues: hands, and it makes weird things on the neck area, idk how to fix that.

Enjoy :D

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Rent", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 607, + "favoriteCount": 163, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Mooseful", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3beb0d48-f9b1-4e8d-8cf2-4f3bb986ed00/width=96/Mooseful.jpeg" + }, + "tags": [ + "anime", + "style", + "styles" + ], + "modelVersions": [ + { + "id": 119402, + "modelId": 110739, + "name": "v1.0", + "createdAt": "2023-07-17T06:31:30.102Z", + "updatedAt": "2023-07-17T06:32:56.448Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 607, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "ZANKURO_STYLE16.safetensors", + "id": 85559, + "sizeKB": 59219.0126953125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-07-17T06:35:56.993Z", + "hashes": { + "AutoV1": "1CF4C20A", + "AutoV2": "3AB47AD84E", + "SHA256": "3AB47AD84E5F1CD6BBFA40BDBBC64280F661A5F09E7C27BA906EC490210A3F81", + "CRC32": "0F221081", + "BLAKE3": "585FEEEFDF5FAF5AEDBFF67646BF1B1BD7979E201CE39FE11BEA094205C9D39C" + }, + "downloadUrl": "https://civitai.com/api/download/models/119402", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b3dabd2-bbf9-4c6e-915f-f0030fdc2821/width=450/1594239.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UJJj_54n^*wcE0xZ~WD%?as8D%RjIobG%2%2", + "meta": { + "ENSD": "31337", + "Size": "768x1152", + "seed": 2642996081, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "Mask blur": "4", + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.97" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/012213d1-9f9c-441b-9ca0-864d24911b17/width=450/1594240.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UBIEhP4n0cs;?]9F~Vt7x[RO_3NG_N9F~Cxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2717019560, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c76b9838-4818-4a37-906c-40816d765423/width=450/1594241.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "URL481~W_2%1.8?b?bE2Eex[xuR%~WRjD*NG", + "meta": { + "ENSD": "31337", + "Size": "768x1152", + "seed": 2815083705, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, close-up, red eyes, black hair, smile, office lady, white shirt, tight miniskirt, standing, sleeveless,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "Mask blur": "4", + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.43" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/52aa01b1-b440-4095-b162-739a89ba0834/width=450/1594246.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "U9M6MB,@LNS$0fS1yY-p~B%1~WfR%L0z57S4", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 4080789976, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, bikini, cleavage, squatting, cameltoe, open mouth, tongue out,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f2cc9ce9-99d4-4b2a-a686-c26918561367/width=450/1594242.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UAKKA|-V80-;0PjEXBW=5SjE}ZRj}[WBIAV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3835354391, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, bikini, cleavage, squatting, cameltoe, open mouth, tongue out,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6ae4b9df-4bc4-4e80-801b-6a1829ccd6cc/width=450/1594248.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UGL3u^_3GZ002atS^k4.~CM|M{xFWUS3soxa", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1615996221, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, leotard, from behind, ass, thong, looking at viewer, grin, ass grab,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e812170d-9a8a-49ec-a09c-1cd0e1597a7c/width=450/1594243.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UNK^51xatlJ:Kj4:%MT09[Vs~Bt7#,9tWBV@", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2423118214, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, nude, straddling, spread legs,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/816f2829-5c2b-45a3-a2df-c7f3a28ceaf6/width=450/1594244.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UFLf~|Dj7er^01D%?v%1I]k7~C9Z9ZJ756Rj", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2423118215, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, nude, straddling, spread legs,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f3754c05-84df-42d8-a1d1-fa4cf10f0570/width=450/1594247.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UELW#9%g3?-;03$%%MIVE+9ubu={It-p9aEL", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3005216286, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, nude, standing, grin, arms behind head,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d8743c51-a356-4a15-9a32-9ce0facb08d8/width=450/1594245.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UBKS-Q5800tQ00$*~Vr?9tIotRxZE2%L9uEM", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 711452939, + "Model": "anything-v4.5-pruned-fp16", + "steps": 20, + "hashes": { + "model": "f773383dbc" + }, + "prompt": "1girl, , large breasts, nude, standing, grin, arms behind head,", + "Version": "v1.3.2", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "ZANKURO_STYLE16", + "type": "lora", + "weight": 1 + }, + { + "hash": "f773383dbc", + "name": "anything-v4.5-pruned-fp16", + "type": "model" + } + ], + "Model hash": "f773383dbc", + "Hires steps": "10", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality:1.4), (low quality:1.4), text, watermark, (muscular), extra digits, see-through,", + "\"ZANKURO_STYLE16": "bef74d9f56da\"", + "Denoising strength": "0.57" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/119402" + } + ] +} +---------------------------- diff --git a/Styles/438/zankuro_style_v4-276106.txt b/Styles/438/zankuro_style_v4-276106.txt new file mode 100644 index 0000000000000000000000000000000000000000..443d1a897b8ea2eb0a8bdb51ef283b5b3004161a --- /dev/null +++ b/Styles/438/zankuro_style_v4-276106.txt @@ -0,0 +1,1447 @@ +Link:https://civitai.com/models/185558/zankuro-artist-style +Version:v4 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Please support the artist by checking out their pagehttps://www.pixiv.net/en/users/7964 +Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style +I really like the way Zankuro draws pointy ears. +Update v4 (02/17/2024) - New version is more style accurate and has more interesting poses. +Warning! 🔞 This Lora is very naughty because it matches Zankuro's style. Please use this Lora with caution. +Please experiment with the weight. Some images look nice with 1.0 weight while others look better with 0.7 weight. +Trained on: 881 images +Training Model: AnyLoRA_noVae_fp16-pruned +flip_aug: False +Num of Repeats: 1 +Unit is Epochs or Steps: Epochs +Number of Epochs or Steps: 10 +Training Batch Size: 4 +Total Steps: 2202 +Resolution: 512 +Network Dim: Dim 32 and Alpha 16 +Lora Creation Process took: 00:43:21 +Old v1 stuff +Suggested weight: 0.8 to 1.0 +I recommend trying with weight 1 and if its too weird lower the weight. +Trained on: 27 images +Training Model: AnyLoRA_noVae_fp16-pruned +flip_aug: True +Num of Repeats: 10 +Unit is Epochs or Steps: Epochs +Number of Epochs or Steps: 10 +Training Batch Size: 2 +Network Dim: 32 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:,((masterpiece,best quality)), aazelda, long hair, crown braid, hairclip, pointy ears, blue shirt, long sleeves, fingerless gloves, black gloves, black pants, tight pants, , smile, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img2: + Prompt:, medium breasts, smile, smug, ((masterpiece,best quality)), absurdres, deathlock-san, 1girl, short hair, pink hair, pointy ears, black shirt, upper body, hearts, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img3: + Prompt:, medium breasts, smile, smug, ((masterpiece,best quality)), absurdres, ishtar-san, medium breasts, long_hair, looking_at_viewer, pointy_ears, purple_hair, red_eyes, solo, cowboy shot, standing, black dress, curvy, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img4: + Prompt:, medium breasts, smile, smug, ((masterpiece,best quality)), absurdres, 1girl, brown hair, twintails, long hair, bunny suit, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img5: + Prompt:,((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img6: + Prompt:, medium breasts, smile, smug, ((masterpiece,best quality)), absurdres, 1girl, short hair, pink hair, pointy ears, black shirt, black pants, upper body, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img7: + Prompt:, medium breasts, ((masterpiece,best quality)), absurdres, , Fiery_Hair, 1girl, hand on hip, contrapposto, long hair, large breasts, cleavage, bare shoulders, very long hair, blue fire, blue fire hair, upper body, outdoors, sky, pointy ears, from side, tree, profile, night, floating hair, colored skin, colored sclera, yellow sclera, looking at viewer, smile, smug, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img8: + Prompt:, medium breasts, , (rouge_the_bat_(cosplay):1), white elbow gloves, bare shoulders, bat wings, white thighboots,((masterpiece,best quality)), aalillie, long hair, braid, , smile, cowboy shot + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img9: + Prompt:,((masterpiece,best quality)), bbasuna, long hair, blue hair, blue eyes, pointy ears, white dress, detached sleeves, blue thighhighs, , cowboy shot + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + +img10: + Prompt:,((masterpiece,best quality)), aahex, hex maniac \(pokemon\), smile, long hair, ahoge, purple hairband, purple eyes, @_@, large breasts, long dress, black dress, long sleeves, , arms behind back, outdoors, full moon, + Negative Prompt:negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2 + Size:512x768, Sampler:DPM++ 2M Karras, Steps:25, CFG:7, Clip Skip:0, Model:1_anyloraCheckpoint_bakedvaeFtmseFp16NOT, Model Hash:8a952cafe9 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185558, + "name": "Zankuro (Artist Style)", + "description": "

Please support the artist by checking out their page🔞: https://www.pixiv.net/en/users/7964

Check out all the Art styles I’ve made: https://civitai.com/user/CitronLegacy/models?tag=style

I really like the way Zankuro draws pointy ears.

Update v4 (02/17/2024) - New version is more style accurate and has more interesting poses.

🔞 Warning! 🔞 This Lora is very naughty because it matches Zankuro's style. Please use this Lora with caution.

Please experiment with the weight. Some images look nice with 1.0 weight while others look better with 0.7 weight.

Trained on: 881 images

Training Model: AnyLoRA_noVae_fp16-pruned

flip_aug: False

Num of Repeats: 1

Unit is Epochs or Steps: Epochs

Number of Epochs or Steps: 10

Training Batch Size: 4

Total Steps: 2202

Resolution: 512

Network Dim: Dim 32 and Alpha 16

Lora Creation Process took: 00:43:21

Old v1 stuff

Suggested weight: 0.8 to 1.0

I recommend trying with weight 1 and if its too weird lower the weight.

Trained on: 27 images

Training Model: AnyLoRA_noVae_fp16-pruned

flip_aug: True

Num of Repeats: 10

Unit is Epochs or Steps: Epochs

Number of Epochs or Steps: 10

Training Batch Size: 2

Network Dim: 32

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Rent", + "allowDerivatives": true, + "allowDifferentLicense": false, + "stats": { + "downloadCount": 1280, + "favoriteCount": 238, + "commentCount": 6, + "ratingCount": 5, + "rating": 5, + "tippedAmountCount": 8512 + }, + "creator": { + "username": "CitronLegacy", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cb17dc3d-5b4c-4c72-a8a4-bf88b02b2ef7/width=96/CitronLegacy.jpeg" + }, + "tags": [ + "anime", + "style", + "art style", + "zankuro" + ], + "modelVersions": [ + { + "id": 346951, + "modelId": 185558, + "name": "v4", + "createdAt": "2024-02-17T01:48:41.733Z", + "updatedAt": "2024-02-17T02:06:33.733Z", + "status": "Published", + "publishedAt": "2024-02-17T05:59:00Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 297, + "ratingCount": 2, + "rating": 5 + }, + "files": [ + { + "id": 276106, + "sizeKB": 37060.7109375, + "name": "Zankuro_Style_v4.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2024-02-17T01:56:02.122Z", + "hashes": { + "AutoV1": "3446E930", + "AutoV2": "55E9A871BB", + "SHA256": "55E9A871BBC98907ED6FC2DC3A4557DF1F38B0B797513851A4888FB278022CE6", + "CRC32": "E3C302E6", + "BLAKE3": "AC0C3D392720B777D7691B2F303A272FC44DE3E62CA3C17D85979D0F70886B99", + "AutoV3": "77A04A510A4ED15F00370BAB684E7D80C6F479115E660BCAC876431EA315D69E" + }, + "downloadUrl": "https://civitai.com/api/download/models/346951", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fdbc8cff-c81c-4dc5-977b-2add3438f485/width=450/6731495.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UDEf{3GH4SWX^7Rn02#RP4RkPp$y-pogE4R%", + "type": "image", + "metadata": { + "hash": "UDEf{3GH4SWX^7Rn02#RP4RkPp$y-pogE4R%", + "size": 1015886, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 2677820435, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "lora:zelda_1": "deac8901d5", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",((masterpiece,best quality)), aazelda, long hair, crown braid, hairclip, pointy ears, blue shirt, long sleeves, fingerless gloves, black gloves, black pants, tight pants, , smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.6 + }, + { + "name": "zelda_1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0c217c72-591d-4917-aa27-4facb05fda7e/width=450/6731494.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UaKmeTV@%~of~CaeI.R*J6RjM{RjyDj[w|bH", + "type": "image", + "metadata": { + "hash": "UaKmeTV@%~of~CaeI.R*J6RjM{RjyDj[w|bH", + "size": 876454, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 3929827851, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts, smile, smug, \n((masterpiece,best quality)), absurdres, deathlock-san, 1girl, short hair, pink hair, pointy ears, black shirt, upper body, hearts,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ba3a1c44-415a-4160-887d-6add69373ae6/width=450/6731492.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "URG+T$-WuUEK57EKIp-pXg$+xtNFE1sX$*R*", + "type": "image", + "metadata": { + "hash": "URG+T$-WuUEK57EKIp-pXg$+xtNFE1sX$*R*", + "size": 1049974, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 1162044648, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts, smile, smug,\n((masterpiece,best quality)), absurdres, \nishtar-san, medium breasts, long_hair, looking_at_viewer, pointy_ears, purple_hair, red_eyes, solo, cowboy shot, standing, black dress, curvy,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e45faefc-7f85-4ca7-9656-cd0e2213e338/width=450/6731496.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UMG[yvJB8JtlT}rZx_SwRWAHxw=ZtnxbRpkW", + "type": "image", + "metadata": { + "hash": "UMG[yvJB8JtlT}rZx_SwRWAHxw=ZtnxbRpkW", + "size": 940236, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 27525197, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts, smile, smug,\n((masterpiece,best quality)), absurdres,\n1girl, brown hair, twintails, long hair, bunny suit,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9217c30a-61b8-4331-a625-a67236411a1e/width=450/6731493.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "U8HV3Y+h470f00Em^c=|{cR7*yNd4Tv-ZMIB", + "type": "image", + "metadata": { + "hash": "U8HV3Y+h470f00Em^c=|{cR7*yNd4Tv-ZMIB", + "size": 1073595, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 4110575815, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "lora:ahri_v10": "bfd7d14325", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.7 + }, + { + "name": "ahri_v10", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/82363279-8888-4396-859a-711b5be96580/width=450/6731497.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UZKS-is;Nursm-aet7xa%2V[M{M{}axaxut7", + "type": "image", + "metadata": { + "hash": "UZKS-is;Nursm-aet7xa%2V[M{M{}axaxut7", + "size": 965408, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 2879724524, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts, smile, smug, \n((masterpiece,best quality)), absurdres, 1girl, short hair, pink hair, pointy ears, black shirt, black pants, upper body,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bff6f119-8e9b-4366-a7b5-8a6f7d504418/width=450/6731499.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UFC7+^KN3q?^68,pqZAD9tR5quZhInOr-At6", + "type": "image", + "metadata": { + "hash": "UFC7+^KN3q?^68,pqZAD9tR5quZhInOr-At6", + "size": 1022382, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 2240081165, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "lora:Fiery_Hair": "ac478e1e34", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts,\n((masterpiece,best quality)), absurdres, , Fiery_Hair, 1girl, hand on hip, contrapposto, long hair, large breasts, cleavage, bare shoulders, very long hair, blue fire, blue fire hair, upper body, outdoors, sky, pointy ears, from side, tree, profile, night, floating hair, colored skin, colored sclera, yellow sclera, looking at viewer, smile, smug,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 1 + }, + { + "name": "Fiery_Hair", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da608fe8-57d0-4c0e-88bf-d7d2361ff886/width=450/6731500.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UHH-17-q0LE2}-WA0Ne?9rxDD-NGtRWU?I%M", + "type": "image", + "metadata": { + "hash": "UHH-17-q0LE2}-WA0Ne?9rxDD-NGtRWU?I%M", + "size": 862793, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 3353229931, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "lora:Rouge_the_Bat_Cosplay": "1e528087cd", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",\nmedium breasts,\n, (rouge_the_bat_(cosplay):1), white elbow gloves, bare shoulders, bat wings, white thighboots,((masterpiece,best quality)), aalillie, long hair, braid, , smile, cowboy shot", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Rouge_the_Bat_Cosplay", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d3c8fff-c102-43a5-a8d9-c280aa5a1fbd/width=450/6731498.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "U9GuzfPB4Tvf00~qMJ00^%PV={~BE+E1%2v|", + "type": "image", + "metadata": { + "hash": "U9GuzfPB4Tvf00~qMJ00^%PV={~BE+E1%2v|", + "size": 1064924, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 1315726544, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",((masterpiece,best quality)), bbasuna, long hair, blue hair, blue eyes, pointy ears, white dress, detached sleeves, blue thighhighs, , cowboy shot", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.6 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/933d8c0f-9c3f-404d-aa80-cbf17d7167d4/width=450/6731502.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UtG+OJt8_NtR-qRPs:xu%Ma#WUt7%Moft7t7", + "type": "image", + "metadata": { + "hash": "UtG+OJt8_NtR-qRPs:xu%Ma#WUt7%Moft7t7", + "size": 833283, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 1672312599, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 25, + "hashes": { + "model": "8a952cafe9", + "lora:hex_maniac_v1": "03d30ff61c", + "embed:EasyNegativeV2": "339cc9210f", + "embed:negative_hand-neg": "73b524a2da", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "embed:verybadimagenegative_v1.3": "d70463f870" + }, + "prompt": ",((masterpiece,best quality)), aahex, hex maniac \\(pokemon\\), smile, long hair, ahoge, purple hairband, purple eyes, @_@, large breasts, long dress, black dress, long sleeves, , arms behind back, outdoors, full moon,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_Style_v4", + "type": "lora", + "weight": 0.8 + }, + { + "name": "hex_maniac_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "negative_hand-neg, ng_deepnegative_v1_75t, verybadimagenegative_v1.3, EasyNegativeV2", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/346951" + }, + { + "id": 208324, + "modelId": 185558, + "name": "v1.0", + "createdAt": "2023-11-01T17:47:54.317Z", + "updatedAt": "2024-02-17T01:48:41.733Z", + "status": "Published", + "publishedAt": "2023-11-01T17:54:34.296Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 983, + "ratingCount": 3, + "rating": 5 + }, + "files": [ + { + "id": 159860, + "sizeKB": 36985.78125, + "name": "Zankuro_AnyLora_Dim32.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T17:51:07.774Z", + "hashes": { + "AutoV1": "B2F7BC4F", + "AutoV2": "E645962F91", + "SHA256": "E645962F9177FAE608E54379BDFD75A999CC6C19F176CEE0FE520E5A4132ACA7", + "CRC32": "B50C8B87", + "BLAKE3": "141CFE20807F2C999455C9463543527C8B212D53966A873B6DEC845C31AEF39E" + }, + "downloadUrl": "https://civitai.com/api/download/models/208324", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/147db89c-d213-41ce-99ad-075699b8da40/width=450/3315826.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UNJ@U,~X0dE200V@4.In-pM{aORnNGxt%Lof", + "type": "image", + "metadata": { + "hash": "UNJ@U,~X0dE200V@4.In-pM{aORnNGxt%Lof", + "size": 1052223, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 276973485, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Boosette_Mario_Anime": "20254a208f", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Boosette_Mario, 1girl, long hair, white hair, long white dress, ballroom dress, white gloves, solo, smiling, blushing, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Boosette_Mario_Anime", + "type": "lora", + "weight": 0.9 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1c3402a8-46a1-42f3-817e-0f974381d9b8/width=450/3315828.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UEIXBhRP0d8|00J800^+-ojEx]IB58?H~ANx", + "type": "image", + "metadata": { + "hash": "UEIXBhRP0d8|00J800^+-ojEx]IB58?H~ANx", + "size": 1188003, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 127640552, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:dark_magician_girl_v1": "3532f38c76", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , hmdmg1, wizard hat, blush, blush stickers, cleavage, bare shoulders, dress, off shoulder, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "dark_magician_girl_v1", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27c1d953-4bd3-4f04-8e36-9b66396b994e/width=450/3315827.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UAKK1iPU48}r-#?[-U8{DQvz5R-UMyZ%1OBB", + "type": "image", + "metadata": { + "hash": "UAKK1iPU48}r-#?[-U8{DQvz5R-UMyZ%1OBB", + "size": 1210347, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 729660882, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Misty_Pokemon_v2_Anime": "11b0377a52", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Misty_Pokemon, yellow crop top, suspenders, side ponytail, orange hair, denim shorts, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto, tropical beach,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 1 + }, + { + "name": "Misty_Pokemon_v2_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/906184a6-a22a-45e8-bd18-3fab7aa064be/width=450/3315830.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UCIg$T^*C*aJLwnB+@S$tco%D}Rjl99}={-T", + "type": "image", + "metadata": { + "hash": "UCIg$T^*C*aJLwnB+@S$tco%D}Rjl99}={-T", + "size": 1142567, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 3722962716, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "lora:ahri_v10": "bfd7d14325", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, ah1, facial mark, multiple tails, fox tails, korean clothes, cleavage, bare shoulders, detached sleeves, , outdoors, standing, cowboy shot, smile, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "ahri_v10", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da7f7bdd-ee00-4cb7-95b6-35f33a22a078/width=450/3315829.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UAI;9g~U11N00Q58OY%18w-o-:Vs*0OZkXRi", + "type": "image", + "metadata": { + "hash": "UAI;9g~U11N00Q58OY%18w-o-:Vs*0OZkXRi", + "size": 1176272, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 2715964951, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "lora:princessdaisy-lora-nochekaiser": "766dd39282" + }, + "prompt": ", (masterpiece, best quality), 1girl, princess daisy, blue eyes, long hair, orange hair, crown, daisy, dress, flower, gem, gloves, orange dress, puffy short sleeves, puffy sleeves, short sleeves, white gloves,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/11920405-b4ba-4f8a-b9d4-ab805eee3a27/width=450/3315831.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UDF5?g$T00^+?[In01?GH=IAImRjBURj$SRR", + "type": "image", + "metadata": { + "hash": "UDF5?g$T00^+?[In01?GH=IAImRjBURj$SRR", + "size": 1314823, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 2778427056, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "lora:Solise_AFK": "4fc875e5e7", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Solise_AFK, solo, smiling, looking at viewer, cowboy shot, forest in background, cinematic composition, ,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 1 + }, + { + "name": "Solise_AFK", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9eaa75bd-4281-4d98-8718-05db687a4ba3/width=450/3315833.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UJIqQ8_300xCJ5-:$+t7?]r?8_S6D%o|%LMd", + "type": "image", + "metadata": { + "hash": "UJIqQ8_300xCJ5-:$+t7?]r?8_S6D%o|%LMd", + "size": 1148587, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 4046415327, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d", + "lora:Irisviel_von_Einzbern_Combined": "5fb4ce6284" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Irisviel_von_Einzbern, red shirt, white skirt, solo, smiling, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Irisviel_von_Einzbern_Combined", + "type": "lora", + "weight": 0.7 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d86c5c8d-eeff-4af8-91be-65af364182de/width=450/3315832.jpeg", + "nsfw": "Soft", + "width": 768, + "height": 1152, + "hash": "UHGuC2RP_4t-w@s+$%jD0e$|%MkU-Cv~iv-o", + "type": "image", + "metadata": { + "hash": "UHGuC2RP_4t-w@s+$%jD0e$|%MkU-Cv~iv-o", + "size": 1078522, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 417994075, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Caulifla_DB_v3_Anime": "791554bbd1", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Caulifla_DB, bare shoulders, midriff, purple baggy pants, pink tube top, black bracelets,solo, smiling, smug, looking at viewer, cowboy shot, cinematic composition,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Caulifla_DB_v3_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fe412e2f-5366-498f-90f5-978c9bffec14/width=450/3315834.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "UNGa?}kC.7pI*JOY?Gx]PVNexatRtmRjEgNe", + "type": "image", + "metadata": { + "hash": "UNGa?}kC.7pI*JOY?Gx]PVNexatRtmRjEgNe", + "size": 1281198, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 3026399581, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Anubis_Citron_OC_Anime": "1d13def507", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Anubis_Citron_OC, (dark skin), black hair, yellow eyes, pelvic curtain, crop top, thighhighs, , solo, smiling, looking at viewer, cowboy shot, cinematic composition, , contrapposto,", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Anubis_Citron_OC_Anime", + "type": "lora", + "weight": 1 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ea6f26b-e804-4697-9029-17ecf2c70eb9/width=450/3315865.jpeg", + "nsfw": "X", + "width": 768, + "height": 1152, + "hash": "USEMj~jX%jW@EooLtlozIUj]Dja#RQRP%Kt5", + "type": "image", + "metadata": { + "hash": "USEMj~jX%jW@EooLtlozIUj]Dja#RQRP%Kt5", + "size": 990363, + "width": 768, + "height": 1152 + }, + "availability": "Public", + "meta": { + "Size": "512x768", + "seed": 3488484097, + "Model": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "steps": 20, + "hashes": { + "model": "8a952cafe9", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "lora:Gruntilda_Anime": "a042c57f56", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": ", ((masterpiece,best quality)), absurdres, , Gruntilda, green skin, long black hair, black dress, red eyes, busty, smug,, witch hat, solo, smiling, looking at viewer, cowboy shot, cinematic composition, contrapposto", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "Zankuro_AnyLora_Dim32", + "type": "lora", + "weight": 0.8 + }, + { + "name": "Gruntilda_Anime", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "8a952cafe9", + "name": "1_anyloraCheckpoint_bakedvaeFtmseFp16NOT", + "type": "model" + } + ], + "Model hash": "8a952cafe9", + "Hires upscale": "1.5", + "Hires upscaler": "4x-AnimeSharp", + "negativePrompt": "EasyNegative, (worst quality, low quality:1.0), badhandv4, ng_deepnegative_v1_75t", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.8.1", + "Denoising strength": "0.5", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208324" + } + ] +} +---------------------------- diff --git a/Styles/44/enkyo-94855-metadata.json b/Styles/44/enkyo-94855-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..0132f7d892665e0dca671f52714287b5d659a029 --- /dev/null +++ b/Styles/44/enkyo-94855-metadata.json @@ -0,0 +1,1518 @@ +{ + "ss_sd_model_name": "pruned.ckpt", + "ss_resolution": "(768, 768)", + "ss_clip_skip": "2", + "ss_num_train_images": "1605", + "ss_tag_frequency": { + "5_a": { + "1girl": 320, + "simple background": 314, + "solo": 279, + "looking at viewer": 275, + "full body": 260, + "breasts": 248, + "long hair": 218, + "bangs": 198, + "long sleeves": 192, + "white background": 189, + "closed mouth": 189, + "standing": 178, + "gloves": 174, + "smile": 163, + "medium breasts": 150, + "thighhighs": 145, + "cleavage": 127, + "boots": 124, + "weapon": 121, + "holding": 115, + "hair between eyes": 106, + "skirt": 99, + "black gloves": 97, + "grey background": 94, + "black footwear": 92, + "blue eyes": 92, + "short hair": 85, + "white hair": 85, + "jacket": 83, + "navel": 82, + "underwear": 82, + "holding weapon": 81, + "shoes": 80, + "black legwear": 79, + "very long hair": 78, + "red eyes": 75, + "bare shoulders": 75, + "blonde hair": 74, + "large breasts": 72, + "shirt": 70, + "dress": 70, + "braid": 69, + "high heels": 68, + "hair ornament": 68, + "purple eyes": 67, + "thigh strap": 66, + "brown hair": 66, + "pink eyes": 66, + "horns": 64, + "open mouth": 62, + "panties": 61, + "eyebrows visible through hair": 58, + "pleated skirt": 58, + "frills": 57, + "multicolored hair": 56, + "ribbon": 54, + "green eyes": 54, + "open clothes": 53, + "white shirt": 52, + "belt": 52, + "miniskirt": 50, + "flower": 50, + "white legwear": 48, + "hat": 47, + "tail": 47, + "sword": 47, + "hood": 46, + "black skirt": 46, + "hand on hip": 44, + "ass": 44, + "bow": 43, + "white gloves": 42, + "virtual youtuber": 42, + "pointy ears": 42, + "multiple views": 41, + "kneehighs": 40, + "blue hair": 40, + "parted lips": 39, + "sleeves past wrists": 39, + "holster": 37, + "demon horns": 37, + "brown footwear": 37, + "silver hair": 36, + "midriff": 36, + "socks": 36, + "school uniform": 36, + "hood down": 35, + "demon tail": 35, + "demon girl": 35, + "open jacket": 34, + "parted bangs": 34, + "black neckwear": 33, + "swimsuit": 33, + "streaked hair": 32, + "black panties": 32, + "pink hair": 32, + "striped": 32, + "bikini": 32, + "twintails": 32, + "knife": 32, + "bra": 31, + "collarbone": 31, + "choker": 31, + "leotard": 31, + "thigh boots": 31, + "yellow eyes": 30, + "wings": 30, + "jewelry": 30, + "wide sleeves": 30, + "small breasts": 30, + "holding sword": 30, + "from behind": 29, + "white footwear": 29, + "black hair": 29, + ":d": 29, + "elbow gloves": 29, + "fingerless gloves": 29, + "ahoge": 28, + "cape": 28, + "striped legwear": 28, + "cowboy shot": 28, + "high heel boots": 27, + "off shoulder": 27, + "asymmetrical legwear": 26, + "gun": 26, + "shorts": 26, + "rose": 26, + "sheath": 26, + "hooded jacket": 25, + "corset": 25, + "vertical stripes": 25, + "watermark": 25, + "hair ribbon": 24, + "white dress": 24, + "necktie": 24, + "pantyhose": 24, + "sidelocks": 24, + "single thighhigh": 23, + "capelet": 23, + "vertical-striped legwear": 23, + "sitting": 23, + "pouch": 22, + "puffy sleeves": 22, + "headphones": 22, + "hair flower": 22, + "white jacket": 22, + "hoodie": 22, + "black bra": 21, + "character sheet": 21, + "twin braids": 21, + "teeth": 21, + "loafers": 21, + "short shorts": 21, + "collared shirt": 21, + "ponytail": 21, + "nail polish": 21, + "grey hair": 20, + "thigh holster": 20, + "cropped legs": 20, + "black bikini": 20, + "uneven legwear": 19, + "black ribbon": 19, + "handgun": 19, + "neck ribbon": 19, + "demon wings": 19, + "green hair": 19, + "looking back": 19, + "hair over one eye": 19, + "crop top": 19, + "japanese clothes": 19, + "short sleeves": 19, + "glasses": 18, + "curled horns": 18, + "garter straps": 18, + "covered navel": 17, + "headgear": 17, + "flat color": 17, + "thighs": 17, + "blush": 17, + "sheathed": 17, + "sneakers": 17, + "cropped jacket": 16, + "detached sleeves": 16, + "black choker": 16, + "scarf": 16, + "yellow background": 16, + "sandals": 16, + "blunt bangs": 16, + "armor": 16, + "zettai ryouiki": 16, + "two-tone hair": 15, + "french braid": 15, + "frilled skirt": 15, + "purple hair": 15, + "buttons": 15, + "white skirt": 15, + "dual wielding": 15, + "sailor collar": 15, + "heterochromia": 15, + "low wings": 15, + "brown eyes": 15, + "highleg": 15, + "mask": 14, + "turnaround": 14, + "polearm": 14, + "black headwear": 14, + "standing on one leg": 14, + "red legwear": 14, + "medium hair": 14, + "barefoot": 14, + "dark skin": 14, + "orange eyes": 14, + "staff": 14, + "katana": 14, + "black jacket": 13, + "short dress": 13, + "grin": 13, + "dark-skinned female": 13, + "sleeveless": 13, + "sweater": 13, + "kimono": 13, + "hand up": 13, + "mecha musume": 12, + "ascot": 12, + "orange legwear": 12, + "black shorts": 12, + "fur trim": 12, + "clothing cutout": 12, + "dagger": 12, + "profile": 12, + "purple flower": 12, + "torn clothes": 12, + "sash": 12, + "bracelet": 12, + "pants": 11, + "white flower": 11, + "bodysuit": 11, + "pistol": 11, + "brown gloves": 11, + "black leotard": 11, + "skindentation": 11, + "multicolored": 11, + "chaps": 11, + "hair bun": 11, + "mole": 11, + "stomach": 11, + "frilled sleeves": 10, + "strapless": 10, + "ass visible through thighs": 10, + "pink legwear": 10, + ":o": 10, + "spear": 10, + "bikini top": 10, + "black dress": 10, + "hair bow": 10, + "red skirt": 10, + "o-ring": 10, + "serafuku": 10, + "sweater dress": 10, + "side ponytail": 10, + "fire": 10, + "twitter username": 10, + "bow (weapon)": 9, + "red hair": 9, + "brown jacket": 9, + "witch hat": 9, + "sideboob": 9, + "knee boots": 9, + "top hat": 9, + "red scarf": 9, + "antenna hair": 9, + "no bra": 9, + "white sailor collar": 9, + "arms at sides": 9, + "holding gun": 9, + "hat flower": 9, + "maid headdress": 9, + "blazer": 9, + ":3": 9, + "purple legwear": 9, + "off-shoulder sweater": 9, + "white sweater": 9, + "scabbard": 9, + "hairband": 9, + "highleg leotard": 9, + "bowtie": 9, + "holding bow (weapon)": 8, + "halberd": 8, + "white neckwear": 8, + "grey jacket": 8, + "snake": 8, + "earrings": 8, + "animal": 8, + "red ribbon": 8, + "gradient hair": 8, + "hood up": 8, + "red flower": 8, + "brown legwear": 8, + "white panties": 8, + "orange background": 8, + "double-breasted": 8, + "headset": 8, + "halterneck": 8, + "neckerchief": 8, + "open shirt": 8, + "obi": 8, + "shoulder armor": 8, + "outstretched arm": 8, + "puffy short sleeves": 8, + "upper body": 8, + "outstretched arms": 8, + "one eye closed": 8, + "holding staff": 8, + "white bow": 8, + "green legwear": 8, + "arrow (projectile)": 7, + "personification": 7, + "heart": 7, + "mini hat": 7, + "vest": 7, + "red neckwear": 7, + "holstered weapon": 7, + "holding knife": 7, + "cross-laced footwear": 7, + "thigh gap": 7, + "revealing clothes": 7, + "cowboy hat": 7, + "apron": 7, + "fingernails": 7, + "sleeveless shirt": 7, + "puffy long sleeves": 7, + "mismatched legwear": 7, + "orange gloves": 7, + "purple rose": 7, + "axe": 7, + "snake hair": 7, + "bare legs": 7, + "arms up": 7, + "mechanical arms": 7, + "manakete": 7, + "looking to the side": 7, + "cloak": 7, + "torn legwear": 7, + "gauntlets": 7, + "gas mask": 6, + "goggles around neck": 6, + "goggles": 6, + "knee pads": 6, + "center frills": 6, + "strapless dress": 6, + "arm up": 6, + "tiara": 6, + "suitcase": 6, + "red dress": 6, + "helmet": 6, + "unzipped": 6, + "multicolored eyes": 6, + "red rose": 6, + "leg up": 6, + "waist apron": 6, + "grey skirt": 6, + "sweat": 6, + "hands up": 6, + "one side up": 6, + "bike shorts": 6, + "blue fire": 6, + "dress shirt": 6, + "wariza": 6, + "white snake": 6, + "mole under eye": 6, + "cleavage cutout": 6, + "half gloves": 6, + "hairclip": 6, + "side bun": 6, + "upper teeth": 6, + "red leotard": 6, + "pink dress": 6, + "bikini armor": 6, + "jumping": 6, + "detached collar": 6, + "red gloves": 5, + "respirator": 5, + "layered skirt": 5, + "partially fingerless gloves": 5, + "pantyshot": 5, + "yellow legwear": 5, + "witch": 5, + "blue legwear": 5, + "uniform": 5, + "magic": 5, + "mini top hat": 5, + "tilted headwear": 5, + "green headwear": 5, + "red footwear": 5, + "red headwear": 5, + "animal hood": 5, + "blue jacket": 5, + "garter belt": 5, + "white headwear": 5, + "covered nipples": 5, + "crossed legs": 5, + "babydoll": 5, + "white rose": 5, + "broken horn": 5, + "maid": 5, + "single kneehigh": 5, + "cardigan": 5, + "blue ribbon": 5, + "colored skin": 5, + "soles": 5, + "feet": 5, + "toes": 5, + "from side": 5, + "low twintails": 5, + "cropped torso": 5, + "wing collar": 5, + "chain": 5, + "armpits": 5, + "skull": 5, + "bob cut": 5, + "petals": 5, + "forehead": 5, + "blue bow": 5, + "stone": 5, + "shrug (clothing)": 5, + "purple gloves": 5, + "pirate hat": 5, + "toeless footwear": 5, + "crown": 4, + "skin tight": 4, + "semi-rimless eyewear": 4, + "quiver": 4, + "book": 4, + "garreg mach monastery uniform": 4, + "open book": 4, + "floating object": 4, + "bird": 4, + "micro shorts": 4, + "revolver": 4, + "santa hat": 4, + "santa costume": 4, + "christmas": 4, + "fur-trimmed boots": 4, + "pom pom (clothes)": 4, + "elf": 4, + "bridal gauntlets": 4, + "grey shirt": 4, + "blue nails": 4, + "lace-up boots": 4, + "arm support": 4, + "denim shorts": 4, + "denim": 4, + "blue wings": 4, + "cutoffs": 4, + "broom": 4, + "mary janes": 4, + "black bow": 4, + "short necktie": 4, + "fang": 4, + "microskirt": 4, + "collar": 4, + "purple background": 4, + "own hands together": 4, + "nipples": 4, + "hammer": 4, + "horn flower": 4, + "high ponytail": 4, + "red-framed eyewear": 4, + "wedding dress": 4, + "bouquet": 4, + "veil": 4, + "bride": 4, + "bridal veil": 4, + "halloween": 4, + "eyepatch": 4, + "fur-trimmed jacket": 4, + "grey legwear": 4, + "underwear only": 4, + "drill hair": 4, + "pinstripe pattern": 4, + "blue shirt": 4, + "groin": 4, + "grey dress": 4, + "brooch": 4, + "white leotard": 4, + "toeless legwear": 4, + "skates": 4, + "hooded cloak": 4, + "underbust": 4, + "toenails": 4, + "short twintails": 4, + "bag": 4, + "fox mask": 4, + "necklace": 4, + "single glove": 4, + "shield": 4, + "short kimono": 4, + ":<": 3, + "two side up": 3, + "black capelet": 3, + "crossbow": 3, + "floating": 3, + "holding book": 3, + "scythe": 3, + "holding scythe": 3, + "sleeves past fingers": 3, + "fur-trimmed sleeves": 3, + "fairy wings": 3, + "fur-trimmed dress": 3, + "fairy": 3, + "butterfly wings": 3, + "green footwear": 3, + "curly hair": 3, + "biker clothes": 3, + "bikesuit": 3, + "rapier": 3, + "can": 3, + "spray can": 3, + "aqua nails": 3, + "steampunk": 3, + "chair": 3, + "antlers": 3, + "ankle ribbon": 3, + "braided bangs": 3, + "yellow bow": 3, + "ground vehicle": 3, + "motor vehicle": 3, + "motorcycle": 3, + "white hoodie": 3, + "invisible chair": 3, + "white apron": 3, + "maid apron": 3, + "frilled apron": 3, + "mop": 3, + "red bikini": 3, + "wavy mouth": 3, + "pink neckwear": 3, + "watson cross": 3, + "concept art": 3, + "single horn": 3, + "cabbie hat": 3, + "leg warmers": 3, + "sparkle": 3, + "headband": 3, + "pelvic curtain": 3, + "claws": 3, + "butt crack": 3, + "pink nails": 3, + "o-ring bottom": 3, + "food": 3, + "fruit": 3, + "grenade": 3, + "explosive": 3, + "skull earrings": 3, + "sickle": 3, + "criss-cross halter": 3, + "pale skin": 3, + "bare arms": 3, + "android": 3, + "pauldrons": 3, + "star (symbol)": 3, + "spread arms": 3, + "flat chest": 3, + "striped gloves": 3, + "vertical-striped gloves": 3, + "mole under mouth": 3, + "japanese armor": 3, + "sode": 3, + "blue dress": 3, + "twin drills": 3, + "ankle boots": 3, + "brown scarf": 3, + "ribbon choker": 3, + "hitodama": 3, + "ghost": 3, + "green nails": 3, + "smoke": 3, + "black-framed eyewear": 3, + "welrod mk2": 3, + "pinstripe vest": 3, + "vertical-striped vest": 3, + "striped vest": 3, + "toenail polish": 3, + "underboob": 3, + "mouth mask": 3, + "strapless leotard": 3, + "mini crown": 3, + "electricity": 3, + "white pants": 3, + "holding axe": 3, + "double bun": 3, + "round eyewear": 3, + "orange hair": 3, + "mask on head": 3, + "sharp fingernails": 3, + "purple skirt": 3, + "side slit": 3, + "pink background": 3, + "red background": 3, + "bow panties": 3, + "compound bow": 2, + "mask around neck": 2, + "white sleeves": 2, + "poke ball": 2, + "camouflage": 2, + "yellow gloves": 2, + "owl": 2, + "feathers": 2, + "armband": 2, + "leaning forward": 2, + "green vest": 2, + "snowman": 2, + "hair bobbles": 2, + "fur-trimmed headwear": 2, + "holding helmet": 2, + "helmet removed": 2, + "headwear removed": 2, + "center opening": 2, + "holding dagger": 2, + "heart hair ornament": 2, + "blue flower": 2, + "holding can": 2, + "brown background": 2, + "cowboy western": 2, + "off-shoulder shirt": 2, + "holding polearm": 2, + "dragon girl": 2, + "musical note": 2, + "eighth note": 2, + "beamed eighth notes": 2, + "treble clef": 2, + "quarter note": 2, + "beamed sixteenth notes": 2, + "hand in hair": 2, + "blue shorts": 2, + "holding broom": 2, + "frilled dress": 2, + "dougi": 2, + "karate gi": 2, + "green background": 2, + "red bra": 2, + "downblouse": 2, + "zipper": 2, + "black sleeves": 2, + "v": 2, + "double v": 2, + "single sock": 2, + "syringe": 2, + "blue gloves": 2, + "black nails": 2, + "fringe trim": 2, + "cum": 2, + "cum on body": 2, + "cum on breasts": 2, + "facial": 2, + "symbol-shaped pupils": 2, + "heart-shaped pupils": 2, + "tail masturbation": 2, + "war hammer": 2, + "from above": 2, + "red nails": 2, + "cup": 2, + "stretch": 2, + "mug": 2, + "closed eyes": 2, + "artist name": 2, + "holding bouquet": 2, + "long dress": 2, + "german clothes": 2, + "dirndl": 2, + "halloween costume": 2, + "contrapposto": 2, + "yellow skirt": 2, + "under-rim eyewear": 2, + "o-ring bikini": 2, + "purple leotard": 2, + "orb": 2, + "frown": 2, + "goggles on head": 2, + "company name": 2, + "orange nails": 2, + "yellow nails": 2, + "single mechanical arm": 2, + "prosthesis": 2, + "prosthetic arm": 2, + "kunai": 2, + "halter top": 2, + "black flower": 2, + "skull hair ornament": 2, + "brown skirt": 2, + "bed sheet": 2, + "circlet": 2, + "facial mark": 2, + "sweatdrop": 2, + "huge weapon": 2, + "purple skin": 2, + "joints": 2, + "red bow": 2, + "black hairband": 2, + "high-waist skirt": 2, + "epaulettes": 2, + "nude": 2, + "chibi": 2, + "shadow": 2, + "glowing": 2, + "animal ears": 2, + "cat ears": 2, + "camisole": 2, + "hair rings": 2, + "white shorts": 2, + "colored inner hair": 2, + "roller skates": 2, + "inline skates": 2, + "floral print": 2, + "back": 2, + "thong": 2, + "transparent background": 2, + ";d": 2, + "red capelet": 2, + "signature": 2, + "brown headwear": 2, + "thick eyebrows": 2, + "tabi": 2, + "back cutout": 2, + "white kimono": 2, + "shoes removed": 2, + "single shoe": 2, + "hands on own chest": 2, + "white cape": 2, + "open fly": 2, + "microphone": 2, + "coat": 2, + "jacket on shoulders": 2, + "looking away": 2, + "trigger discipline": 2, + "hoop earrings": 2, + "dutch angle": 2, + "between breasts": 2, + "greaves": 2, + "cow tail": 2, + "armored boots": 2, + "scar": 2, + "stitches": 2, + "rifle": 2, + "oni horns": 2, + "oni": 2, + "white cardigan": 2, + "hand on headwear": 2, + "submachine gun": 2, + "bell": 2, + "facing viewer": 2, + "sleeveless dress": 2, + "torn dress": 2, + "ninja": 2, + "polka dot": 2, + "scrunchie": 2, + "no shoes": 2, + "portrait": 2, + "monocle": 2, + "blue footwear": 2, + "hand on headphones": 2, + "long fingernails": 2, + "one eye covered": 2, + "head wings": 2, + "black cape": 2, + "orange panties": 2, + "strap slip": 2, + "cross": 2, + "see-through": 2, + "clenched hands": 2, + "feathered wings": 2, + "white wings": 2, + "holding shield": 2, + "angel wings": 2, + "yellow neckwear": 2, + "hat feather": 2, + "winged footwear": 2, + "hip vent": 2, + "short sword": 2, + "red shirt": 2, + "box": 2, + "tongue": 2, + "tongue out": 2, + "bomb": 2, + "bullet": 2, + ":q": 2, + "holding arrow": 2, + "armlet": 2, + "pirate": 2, + "green hairband": 2, + "muneate": 2, + "tasuki": 2, + "ribbed sweater": 2, + "playstation 5": 2, + "bow bra": 2, + "green shirt": 2, + "vines": 1, + "camouflage jacket": 1, + "heart earrings": 1, + "purple jacket": 1, + "red wings": 1, + "green shorts": 1, + "freckles": 1, + "thumbs up": 1, + "bandaid on forehead": 1, + "motorcycle helmet": 1, + "bandaid": 1, + "black bodysuit": 1, + "v-shaped eyebrows": 1, + "headphones around neck": 1, + "gatling gun": 1, + "from below": 1, + "minigun": 1, + "head rest": 1, + "whip": 1, + "armchair": 1, + "throne": 1, + "green dress": 1, + "basket": 1, + "yokozuwari": 1, + "sixteenth note": 1, + "mechanical tail": 1, + "adjusting clothes": 1, + "knee up": 1, + "sketch": 1, + "unsheathing": 1, + "juliet sleeves": 1, + "page number": 1, + "frilled bikini": 1, + "innertube": 1, + "holding syringe": 1, + "leg ribbon": 1, + "telescope": 1, + "tripod": 1, + "stargazing": 1, + "camera": 1, + "breath": 1, + "knees up": 1, + "argyle": 1, + "bra pull": 1, + "clothes pull": 1, + "breasts outside": 1, + "pussy juice": 1, + "tail between legs": 1, + "leaf": 1, + "dragon tail": 1, + "extra arms": 1, + "white bikini": 1, + "gourd": 1, + "fighting stance": 1, + "chinese clothes": 1, + "indoors": 1, + "office chair": 1, + "monitor": 1, + "multicolored legwear": 1, + "multicolored clothes": 1, + "desk": 1, + "window": 1, + "computer": 1, + "office": 1, + "tissue box": 1, + "keyboard (computer)": 1, + "coffee mug": 1, + "umbrella": 1, + "bloomers": 1, + "holding umbrella": 1, + "parasol": 1, + "aqua eyes": 1, + "copyright": 1, + "partially unzipped": 1, + "o-ring top": 1, + "ladle": 1, + "x hair ornament": 1, + "chef hat": 1, + "chef uniform": 1, + "carrot": 1, + "green ribbon": 1, + "broccoli": 1, + "holding ladle": 1, + "white border": 1, + "swept bangs": 1, + "mechanical wings": 1, + "binoculars": 1, + "geta": 1, + "floating weapon": 1, + "sharp teeth": 1, + "lolita hairband": 1, + "white skin": 1, + "breast pocket": 1, + "pocket": 1, + "lying": 1, + "on back": 1, + "topless": 1, + "side-tie panties": 1, + "broom riding": 1, + ">_<": 1, + "wince": 1, + "holding hammer": 1, + "lolita fashion": 1, + "gothic lolita": 1, + "black feathers": 1, + "robot joints": 1, + "science fiction": 1, + "green cape": 1, + "striped shirt": 1, + "vertical-striped shirt": 1, + "pinstripe shirt": 1, + "cropped shirt": 1, + "lowleg": 1, + "pussy": 1, + "completely nude": 1, + "uncensored": 1, + "standing split": 1, + "split": 1, + "orange-framed eyewear": 1, + "blue neckwear": 1, + "index finger raised": 1, + "1other": 1, + "black sailor collar": 1, + "red hairband": 1, + "hair intakes": 1, + "puffy pants": 1, + "impossible leotard": 1, + "ass cutout": 1, + "cat tail": 1, + "cat ear headphones": 1, + "fake animal ears": 1, + "variations": 1, + "symmetry": 1, + "orange jacket": 1, + "black camisole": 1, + "spaghetti strap": 1, + "off-shoulder jacket": 1, + "green neckwear": 1, + "tattoo": 1, + "hand in pocket": 1, + "facial tattoo": 1, + "2girls": 1, + "multiple girls": 1, + "detached pants": 1, + "brown panties": 1, + "brown belt": 1, + "flight deck": 1, + "yellow ribbon": 1, + "nightgown": 1, + "anchor symbol": 1, + "wrist cuffs": 1, + "anchor": 1, + "anchor print": 1, + "all fours": 1, + "spine": 1, + "mechanical parts": 1, + "red hood": 1, + "hooded capelet": 1, + "pleated dress": 1, + "facing away": 1, + "panty peek": 1, + "kneepits": 1, + "ice skates": 1, + "sarashi": 1, + "ootachi": 1, + "briefcase": 1, + "backless outfit": 1, + "frilled choker": 1, + "mechanical halo": 1, + "yellow bikini": 1, + "mecha": 1, + "microphone stand": 1, + "haori": 1, + "whip sword": 1, + "tri braids": 1, + "white belt": 1, + "mechanical legs": 1, + "pink hoodie": 1, + "purple nails": 1, + "blue skirt": 1, + "black coat": 1, + "red panties": 1, + "highleg panties": 1, + "eyes visible through hair": 1, + "sports bra": 1, + "tank top": 1, + "pipe": 1, + "kiseru": 1, + "holding pipe": 1, + "brown kimono": 1, + "clenched teeth": 1, + "lace-trimmed bra": 1, + "micro bikini": 1, + "single braid": 1, + "hair over shoulder": 1, + "dragon wings": 1, + "beer mug": 1, + "alcohol": 1, + "holding cup": 1, + "beer": 1, + "waitress": 1, + "navel piercing": 1, + "cow horns": 1, + "gold armor": 1, + "low-tied long hair": 1, + "blindfold": 1, + "covered eyes": 1, + "eye mask": 1, + "shark": 1, + "hand on own chest": 1, + "paintbrush": 1, + "hagoita": 1, + "paddle": 1, + "hanetsuki": 1, + "calligraphy brush": 1, + "zipper pull tab": 1, + "green camisole": 1, + "polka dot camisole": 1, + "slippers": 1, + "pink jacket": 1, + "hair scrunchie": 1, + "pink shorts": 1, + "pink scrunchie": 1, + "waving": 1, + "flower necklace": 1, + "loungewear": 1, + "broken armor": 1, + "brown dress": 1, + "sleeves rolled up": 1, + "visor": 1, + "pink gloves": 1, + "pink footwear": 1, + "pink bodysuit": 1, + "green-tinted eyewear": 1, + "impossible clothes": 1, + "wrist scrunchie": 1, + "multicolored nails": 1, + "copyright name": 1, + "on motorcycle": 1, + "belt pouch": 1, + "lantern": 1, + "cage": 1, + "wand": 1, + "bat": 1, + "holding lantern": 1, + "holding wand": 1, + "buckle": 1, + "jack-o'-lantern": 1, + "black cloak": 1, + "birdcage": 1, + "torpedo": 1, + "remodel (kantai collection)": 1, + "holding torpedo": 1, + "white scarf": 1, + "turret": 1, + "torpedo tubes": 1, + "machinery": 1, + "beret": 1, + "pinafore dress": 1, + "mac-10": 1, + "machine pistol": 1, + "hand on hilt": 1, + "faulds": 1, + "reverse grip": 1, + "purple dress": 1, + "short hair with long locks": 1, + "bunny hood": 1, + "grey footwear": 1, + "eyewear on head": 1, + "front-tie top": 1, + "front-tie bikini": 1, + "bikini skirt": 1, + "patchwork skin": 1, + "zombie": 1, + "sunglasses": 1, + "messy hair": 1, + "one-piece swimsuit": 1, + "school swimsuit": 1, + "blue swimsuit": 1, + "orange neckwear": 1, + "backpack": 1, + "pith helmet": 1, + "holding strap": 1, + "legwear under shorts": 1, + "wavy hair": 1, + "hair cones": 1, + "platform footwear": 1, + "red belt": 1, + "black shirt": 1, + "gift": 1, + "candy cane": 1, + "candy": 1, + "gift box": 1, + "fur-trimmed gloves": 1, + "fur-trimmed capelet": 1, + "hair bell": 1, + "apple": 1, + "sack": 1, + "christmas ornaments": 1, + "green bow": 1, + "christmas tree": 1, + "dog": 1, + "floating book": 1, + "torn skirt": 1, + "broken eyewear": 1, + "yellow panties": 1, + "no pants": 1, + "orange scarf": 1, + "dynamite": 1, + "black kimono": 1, + "blood": 1, + "bandages": 1, + "bandaged leg": 1, + "bandaged neck": 1, + "blood on bandages": 1, + "pink kimono": 1, + "breast lift": 1, + "between legs": 1, + "breast hold": 1, + "masturbation": 1, + "vision (genshin impact)": 1, + "brown shorts": 1, + "crossed bangs": 1, + "aiming": 1, + "drawing bow": 1, + "bucket": 1, + "forehead jewel": 1, + "maid bikini": 1, + "battle axe": 1, + "phone": 1, + "cellphone": 1, + "holding phone": 1, + "smartphone": 1, + "animal skull": 1, + "skull on head": 1, + "tribal": 1, + "snowboard": 1, + "beanie": 1, + "skateboard": 1, + "button badge": 1, + "badge": 1, + "orange flower": 1, + "walking": 1, + "saber (weapon)": 1, + "scimitar": 1, + "face": 1, + "off-shoulder dress": 1, + "anklet": 1, + "staff (music)": 1, + "penguin": 1, + "green flower": 1, + "green gloves": 1, + "head wreath": 1, + "light purple hair": 1, + "shaded face": 1, + "spray paint": 1, + "white mittens": 1, + "mittens": 1, + "red sleeves": 1, + "yellow hairband": 1, + "hibiscus": 1, + "hands in pockets": 1, + "ball": 1, + "drone": 1, + "suspenders": 1, + "suspender skirt": 1, + "animal hat": 1, + "aran sweater": 1, + "cat hat": 1, + "turtleneck sweater": 1, + "animal ear fluff": 1, + "turtleneck": 1, + "chakram": 1, + "purple neckwear": 1, + "tantou": 1, + "white bra": 1, + "arm garter": 1, + "crop top overhang": 1, + "torn shirt": 1, + "tassel": 1, + "clenched hand": 1, + "green bra": 1, + "gem": 1, + "green pants": 1, + "pink flower": 1, + "red jacket": 1, + "o-ring panties": 1, + "shoe soles": 1, + "branch": 1, + "crossed arms": 1, + "feet out of frame": 1, + "arms under breasts": 1, + "black pants": 1, + "pencil skirt": 1, + "green jacket": 1, + "leg garter": 1, + "green skirt": 1, + "suit": 1, + "formal": 1, + "skirt suit": 1, + "office lady": 1, + "side braid": 1, + "on head": 1, + "animal on head": 1, + "cake": 1, + "bird on head": 1, + "plate": 1, + "blush stickers": 1, + "birthday cake": 1, + "dated": 1, + "holding plate": 1, + "happy birthday": 1, + "strawberry": 1, + "anniversary": 1, + "single leg pantyhose": 1, + "single pantsleg": 1, + "orange skirt": 1, + "sandogasa": 1, + "vambraces": 1, + "arm guards": 1, + "kote": 1, + "character name": 1, + "pokedex number": 1 + } + }, + "ss_batch_size_per_device": "1", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 448, + 896 + ], + "count": 5 + }, + "1": { + "resolution": [ + 448, + 960 + ], + "count": 10 + }, + "2": { + "resolution": [ + 448, + 1024 + ], + "count": 10 + }, + "3": { + "resolution": [ + 448, + 1088 + ], + "count": 5 + }, + "4": { + "resolution": [ + 448, + 1152 + ], + "count": 10 + }, + "5": { + "resolution": [ + 512, + 896 + ], + "count": 35 + }, + "6": { + "resolution": [ + 512, + 960 + ], + "count": 45 + }, + "7": { + "resolution": [ + 512, + 1024 + ], + "count": 35 + }, + "8": { + "resolution": [ + 512, + 1088 + ], + "count": 30 + }, + "9": { + "resolution": [ + 576, + 704 + ], + "count": 10 + }, + "10": { + "resolution": [ + 576, + 832 + ], + "count": 30 + }, + "11": { + "resolution": [ + 576, + 896 + ], + "count": 80 + }, + "12": { + "resolution": [ + 576, + 960 + ], + "count": 125 + }, + "13": { + "resolution": [ + 640, + 640 + ], + "count": 5 + }, + "14": { + "resolution": [ + 640, + 768 + ], + "count": 100 + }, + "15": { + "resolution": [ + 640, + 832 + ], + "count": 155 + }, + "16": { + "resolution": [ + 640, + 896 + ], + "count": 185 + }, + "17": { + "resolution": [ + 704, + 704 + ], + "count": 85 + }, + "18": { + "resolution": [ + 704, + 768 + ], + "count": 185 + }, + "19": { + "resolution": [ + 704, + 832 + ], + "count": 25 + }, + "20": { + "resolution": [ + 768, + 640 + ], + "count": 10 + }, + "21": { + "resolution": [ + 768, + 704 + ], + "count": 135 + }, + "22": { + "resolution": [ + 768, + 768 + ], + "count": 20 + }, + "23": { + "resolution": [ + 832, + 576 + ], + "count": 45 + }, + "24": { + "resolution": [ + 832, + 640 + ], + "count": 70 + }, + "25": { + "resolution": [ + 832, + 704 + ], + "count": 40 + }, + "26": { + "resolution": [ + 896, + 512 + ], + "count": 5 + }, + "27": { + "resolution": [ + 896, + 576 + ], + "count": 15 + }, + "28": { + "resolution": [ + 896, + 640 + ], + "count": 50 + }, + "29": { + "resolution": [ + 960, + 576 + ], + "count": 10 + }, + "30": { + "resolution": [ + 1024, + 576 + ], + "count": 35 + } + }, + "mean_img_ar_error": 0.018259776167906666 + }, + "ss_bucket_no_upscale": "True", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "5_a": { + "n_repeats": 5, + "img_count": 321 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "6", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "0", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine", + "ss_lr_warmup_steps": "963", + "ss_max_bucket_reso": "1024", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "9630", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "6", + "ss_network_alpha": "32.0", + "ss_network_args": { + "conv_dim": "1", + "conv_alpha": "1", + "algo": "lora" + }, + "ss_network_dim": "32", + "ss_network_module": "lycoris.kohya", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "1605", + "ss_num_epochs": "6", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "last", + "ss_prior_loss_weight": "1.0", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "925997e9", + "ss_sd_scripts_commit_hash": "(unknown)", + "ss_seed": "1337", + "ss_session_id": "1607155318", + "ss_shuffle_caption": "False", + "ss_steps": "9630", + "ss_text_encoder_lr": "7e-05", + "ss_total_batch_size": "1", + "ss_training_comment": "None", + "ss_training_finished_at": "1689286916.2377546", + "ss_training_started_at": "1689263784.9545681", + "ss_unet_lr": "0.0002", + "ss_v2": "False", + "sshs_legacy_hash": "2b0f5ba0", + "sshs_model_hash": "19d136f17d412186a13d84527dfeb079e657167eda2083432c2f79162cb47067" +} \ No newline at end of file diff --git a/Styles/44/enkyo-94855.txt b/Styles/44/enkyo-94855.txt new file mode 100644 index 0000000000000000000000000000000000000000..7b81836dc15ea15486671e4f5d9bfa14f85462e5 --- /dev/null +++ b/Styles/44/enkyo-94855.txt @@ -0,0 +1,444 @@ +Link:https://civitai.com/models/120235 +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +This model training by enkyo, recommended weight is 1.0 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:,1girl, hat, long hair, solo, shorts, plant, jewelry, long sleeves, sitting, white shorts, earrings, white headwear, witch hat, food, choker, shirt, feet out of frame, holding, leaf, cup, looking at viewer, tray, white hair, aqua eyes, blue eyes + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img2: + Prompt:, 1girl, solo, shorts, jacket, thighhighs, twintails, ribbon, navel, camisole, smile, blush, fang, bangs, collarbone, breasts, underwear, :d, panties, + +, midriff, standing, sidelocks, blonde hair, hair ribbon, open clothes, black ribbon, black jacket, open jacket, bare shoulders, virtual youtuber, short shorts, blue eyes, long sleeves, off shoulder, open mouth, black background, black thighhighs, simple background, black shorts, brown shorts, looking at viewer, open fly, open shorts, small breasts, black camisole, white camisole, long hair, hand in pocket, v-shaped eyebrows, black panties, puffy long sleeves, outstretched arm, puffy sleeves, strap slip, hair between eyes + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img3: + Prompt:, trnyteal, keyhole, 1girl, swimsuit, bikini, forehead, breasts, tentacles, bangs, bow, navel, sidelocks, collarbone, hat, thighs, creature, multiple bows, long hair, double bun, orange bow, white hair, colored skin, hair bun, small breasts, third eye, black bow, bare shoulders, very long hair, parted bangs, white skin, black bikini, red eyes, looking at viewer, polka dot bow, pink eyes + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img4: + Prompt:, 1girl, red panties, underwear, panties, bra removed, cat, solo, slippers, washing machine, barefoot, indoors, brown hair, bra, side-tie panties, profile, toothbrush, sink, ponytail, breasts, wide shot, standing, leaning forward, mirror, red bra, tiles, tile wall, plant, loaded interior, hairband, underwear only, bare legs, towel, window, basket, brushing teeth, laundry, bathroom + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img5: + Prompt:, 1girl, solo, braid, smile, leaf, hat, socks, dress, sweater, plaid, ;d, blush, beret, earrings, bangs, jewelry, scarf, hairclip, ribbon, shirt, breasts, turtleneck, one eye closed, brown hair, open mouth, twin braids, white background, long hair, brown footwear, long sleeves, simple background, yellow sweater, yellow shirt, hair ornament, full body, plaid scarf, looking at viewer, red socks, brown eyes, autumn leaves, yellow eyes, maple leaf, high heels, black dress + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img7: + Prompt:,jewelry, solo, earrings, flower, 1girl, holding, branch, hanfu, 1boy, hair ornament, long hair, hand fan, chinese clothes, holding fan, upper body, long sleeves, blue eyes, black hair, white background, brown hair, hair flower, purple dress, looking down, male focus + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 120235, + "name": "enkyo Artist Style", + "description": "

This model training by enkyo, recommended weight is 1.0.

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 366, + "favoriteCount": 75, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Keruchi", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89664be1-50f7-480a-8bc8-74569eb2b560/width=96/Keruchi.jpeg" + }, + "tags": [ + "anime", + "style", + "enkyo style", + "enkyo" + ], + "modelVersions": [ + { + "id": 130740, + "modelId": 120235, + "name": "v1.0", + "createdAt": "2023-08-01T04:09:02.993Z", + "updatedAt": "2023-08-02T01:03:00.06Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": 121355, + "stats": { + "downloadCount": 366, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 94855, + "url": "https://civitai-delivery-worker-prod-2023-08-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/160689/model/enkyo.FCBq.safetensors", + "sizeKB": 43275.326171875, + "name": "enkyo.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-08-01T04:10:37.647Z", + "hashes": { + "AutoV1": "8906EC64", + "AutoV2": "EADC45CE06", + "SHA256": "EADC45CE06556AFF7539F7E33FC1B5D6866DEEA3BC043BFD01CCE9A2104F4476", + "CRC32": "8249BCD3", + "BLAKE3": "CBE88E09A53C64F10C8AB44ECE09980BE02036306F553A8DAB5C610D2812B939" + }, + "downloadUrl": "https://civitai.com/api/download/models/130740", + "primary": true + }, + { + "id": 87234, + "url": "https://5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/civitai-prod-settled/1/training-images/anythingV30Vae.KAQO.pt", + "sizeKB": 803518.3623046875, + "name": "Anything-V3.0.vae.pt", + "type": "VAE", + "metadata": { + "format": "Other", + "modelFileId": 1468, + "vaeMigration": true, + "modelFileHash": "F921FB3F29891D2A77A6571E56B8B5052420D2884129517A333C60B1B4816CDF" + }, + "pickleScanResult": "Danger", + "pickleScanMessage": "**Detected Pickle imports (5)**\n*Dangerous import detected*\n```\n*pytorch_lightning.callbacks.model_checkpoint.ModelCheckpoint*\ntorch.LongStorage\ntorch.FloatStorage\ncollections.OrderedDict\ntorch._utils._rebuild_tensor_v2\n```", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2022-12-18T09:38:06.503Z", + "modelVersionId": 121355, + "hashes": { + "AutoV1": "F458B5C6", + "AutoV2": "F921FB3F29", + "SHA256": "F921FB3F29891D2A77A6571E56B8B5052420D2884129517A333C60B1B4816CDF", + "CRC32": "65AEACBA", + "BLAKE3": "2E175004F953D6DC373A9DD18BF8A1845983EB6E1B3D6EA0C76A81D344244F18" + }, + "downloadUrl": "https://civitai.com/api/download/models/130740?type=VAE&format=Other" + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/484f9c0e-d8c4-493a-a5d4-69f811f4842b/width=450/1832301.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UPJ[I}IH00M{*0ISXAs=KkoaxuIp]%J3n6NH", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1197199835, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ",1girl, hat, long hair, solo, shorts, plant, jewelry, long sleeves, sitting, white shorts, earrings, white headwear, witch hat, food, choker, shirt, feet out of frame, holding, leaf, cup, looking at viewer, tray, white hair, aqua eyes, blue eyes", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/66888f8c-813b-465e-b473-a42f51892efe/width=450/1818925.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UDIXdR^%009b~A-oNL9a_1kB9aV{0eM{xvxv", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 3785643211, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ", 1girl, solo, shorts, jacket, thighhighs, twintails, ribbon, navel, camisole, smile, blush, fang, bangs, collarbone, breasts, underwear, :d, panties, + +, midriff, standing, sidelocks, blonde hair, hair ribbon, open clothes, black ribbon, black jacket, open jacket, bare shoulders, virtual youtuber, short shorts, blue eyes, long sleeves, off shoulder, open mouth, black background, black thighhighs, simple background, black shorts, brown shorts, looking at viewer, open fly, open shorts, small breasts, black camisole, white camisole, long hair, hand in pocket, v-shaped eyebrows, black panties, puffy long sleeves, outstretched arm, puffy sleeves, strap slip, hair between eyes", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/18eead0d-a948-4479-9cb1-2e6c0a9ccf2a/width=450/1818170.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UIJuf$rY00Or2lbbRQsV8btltTNGy?I:$,WC", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2405269893, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ", trnyteal, keyhole, 1girl, swimsuit, bikini, forehead, breasts, tentacles, bangs, bow, navel, sidelocks, collarbone, hat, thighs, creature, multiple bows, long hair, double bun, orange bow, white hair, colored skin, hair bun, small breasts, third eye, black bow, bare shoulders, very long hair, parted bangs, white skin, black bikini, red eyes, looking at viewer, polka dot bow, pink eyes", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8e2feb5b-0f44-4986-8aa4-1720d0faa26a/width=450/1818928.jpeg", + "nsfw": "Soft", + "width": 1024, + "height": 1536, + "hash": "UIMQJ8~DGaESx--.-=$%I-t6-;s%9@X9$%NH", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2388373333, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ", 1girl, red panties, underwear, panties, bra removed, cat, solo, slippers, washing machine, barefoot, indoors, brown hair, bra, side-tie panties, profile, toothbrush, sink, ponytail, breasts, wide shot, standing, leaning forward, mirror, red bra, tiles, tile wall, plant, loaded interior, hairband, underwear only, bare legs, towel, window, basket, brushing teeth, laundry, bathroom", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dd10dca6-4eeb-4b7c-9a82-846dd8f115ec/width=450/1818930.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "URRo$]t6?w%MDiMx-;%gXAoe%1t7-;j[oyoe", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 536932539, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ", 1girl, solo, braid, smile, leaf, hat, socks, dress, sweater, plaid, ;d, blush, beret, earrings, bangs, jewelry, scarf, hairclip, ribbon, shirt, breasts, turtleneck, one eye closed, brown hair, open mouth, twin braids, white background, long hair, brown footwear, long sleeves, simple background, yellow sweater, yellow shirt, hair ornament, full body, plaid scarf, looking at viewer, red socks, brown eyes, autumn leaves, yellow eyes, maple leaf, high heels, black dress", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/993ba0da-6b9f-4661-baa3-fd7311361dd1/width=450/1818931.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UkR37$t6_MxvI.WBxbxab[WBspt7xtaxa$jb", + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a366c2dd-0144-4b18-9f2c-eddf114e4907/width=450/1832302.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UjM@G=_2_ND*_MtRodn$W?M{j]ocxtjFn+W=", + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1694840915, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": ",jewelry, solo, earrings, flower, 1girl, holding, branch, hanfu, 1boy, hair ornament, long hair, hand fan, chinese clothes, holding fan, upper body, long sleeves, blue eyes, black hair, white background, brown hair, hair flower, purple dress, looking down, male focus", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "enkyo", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/130740" + } + ] +} +---------------------------- diff --git a/Styles/440/zoirun-97700-metadata.json b/Styles/440/zoirun-97700-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..5d3710cfabf6c7792f6d30148399720b18bcf73a --- /dev/null +++ b/Styles/440/zoirun-97700-metadata.json @@ -0,0 +1,720 @@ +{ + "ss_sd_model_name": "pruned.ckpt", + "ss_resolution": "(768, 768)", + "ss_clip_skip": "2", + "ss_num_train_images": "295", + "ss_tag_frequency": { + "5_a": { + "1girl": 58, + "bangs": 58, + "solo": 57, + "blush": 55, + "looking at viewer": 55, + "eyebrows visible through hair": 53, + "long hair": 45, + "blue eyes": 37, + "long sleeves": 35, + "shirt": 34, + "simple background": 34, + "white background": 32, + "white shirt": 30, + "closed mouth": 29, + "dress": 28, + "ribbon": 28, + "upper body": 27, + "very long hair": 27, + "bow": 26, + "smile": 26, + "blonde hair": 22, + "collared shirt": 22, + "sleeveless": 21, + "hair ornament": 21, + "flower": 20, + "hand up": 20, + "holding": 19, + "hands up": 19, + "hair ribbon": 19, + "hairband": 18, + "bare shoulders": 18, + "wings": 17, + "grey background": 16, + "frills": 16, + "parted lips": 15, + "sleeveless dress": 15, + "breasts": 15, + "skirt": 15, + "brown hair": 15, + "hair between eyes": 15, + "halo": 14, + "hair bow": 14, + "red eyes": 14, + "jacket": 13, + "open mouth": 13, + "collarbone": 13, + "feathered wings": 13, + "white wings": 13, + "white dress": 12, + "white ribbon": 12, + "white hairband": 12, + "angel wings": 12, + ":o": 12, + "short hair": 12, + "hair flower": 11, + "black skirt": 11, + ":d": 11, + "jewelry": 10, + "white bow": 10, + "blunt bangs": 10, + "grey hair": 10, + "black bow": 10, + "silver hair": 10, + "pantyhose": 10, + "black dress": 9, + "blue flower": 9, + "petals": 9, + "cowboy shot": 9, + "pleated skirt": 9, + "animal ears": 9, + "blurry": 9, + "black neckwear": 9, + "red hair": 8, + "blue bow": 8, + "white flower": 8, + "standing": 8, + "rose": 8, + "star (symbol)": 8, + "off shoulder": 8, + "virtual youtuber": 8, + "sitting": 8, + "blue neckwear": 8, + "bare arms": 8, + "red neckwear": 8, + "polka dot": 7, + "cropped torso": 7, + "bowtie": 7, + "full body": 7, + "light brown hair": 7, + "white legwear": 7, + "blue dress": 7, + "outdoors": 7, + "open clothes": 7, + "neck ribbon": 7, + "nail polish": 7, + "depth of field": 7, + "sparkle": 7, + "sailor collar": 7, + "school uniform": 7, + "black jacket": 7, + "earrings": 6, + "short sleeves": 6, + "puffy sleeves": 6, + "shoes": 6, + "black footwear": 6, + "sky": 6, + "pink hair": 6, + "arm up": 6, + "own hands together": 6, + "cloud": 6, + "open jacket": 6, + "braid": 5, + "hat": 5, + "multicolored hair": 5, + "black legwear": 5, + "floral background": 5, + "blue hair": 5, + "book": 5, + "holding book": 5, + "apron": 5, + "frilled dress": 5, + "tail": 5, + "animal ear fluff": 5, + "necktie": 5, + "choker": 5, + "black choker": 5, + "red ribbon": 5, + "medium breasts": 5, + "red flower": 5, + "day": 5, + "mini wings": 5, + "serafuku": 5, + "dress shirt": 5, + "gloves": 5, + "black ribbon": 4, + "small breasts": 4, + "blue rose": 4, + "black hairband": 4, + "twintails": 4, + "twitter username": 4, + "mary janes": 4, + "white apron": 4, + "frilled apron": 4, + "tree": 4, + "feet out of frame": 4, + "pinafore dress": 4, + "blue ribbon": 4, + "pink nails": 4, + "clock": 4, + "white sailor collar": 4, + "head wings": 4, + "red bow": 4, + "purple eyes": 4, + "blurry background": 4, + "portrait": 4, + "black hair": 4, + "white jacket": 3, + "wide sleeves": 3, + "ahoge": 3, + "open book": 3, + "star hair ornament": 3, + "off-shoulder dress": 3, + "watch": 3, + "pocket watch": 3, + "low twintails": 3, + "navel": 3, + "bag": 3, + "yellow eyes": 3, + "polka dot legwear": 3, + "blue skirt": 3, + "hairclip": 3, + "plaid": 3, + "plaid skirt": 3, + "autumn leaves": 3, + "leaf": 3, + "ginkgo leaf": 3, + "cat ears": 3, + "cat tail": 3, + "socks": 3, + "v": 3, + "cat girl": 3, + "hair bun": 3, + "alternate hairstyle": 3, + "looking back": 3, + "headphones": 3, + "heart": 3, + "brown eyes": 3, + "steepled fingers": 3, + "roman numeral": 3, + "bracelet": 3, + "ocean": 3, + "blue sky": 3, + "sunlight": 3, + "demon wings": 3, + "red nails": 3, + "maid": 3, + "maid apron": 3, + "angel": 3, + "pink flower": 3, + "red rose": 3, + "black shirt": 3, + "tail raised": 3, + "black sailor collar": 3, + "from behind": 3, + "white gloves": 3, + "sleeveless shirt": 3, + "one side up": 3, + "hood": 2, + "ponytail": 2, + "holding flower": 2, + "lily (flower)": 2, + "hair over one eye": 2, + "white headwear": 2, + "beret": 2, + "collared dress": 2, + "white neckwear": 2, + "sandals": 2, + "white footwear": 2, + "swimsuit": 2, + "bikini": 2, + "frilled bikini": 2, + "skirt hold": 2, + "frilled skirt": 2, + "sweater": 2, + "breath": 2, + "grey skirt": 2, + "knees up": 2, + "profile": 2, + "striped": 2, + "nintendo switch": 2, + "cat ear headphones": 2, + "fingernails": 2, + "lying": 2, + "on back": 2, + "pink ribbon": 2, + "strap slip": 2, + "hand on own chest": 2, + "paper": 2, + "scrunchie": 2, + "wrist scrunchie": 2, + "side bun": 2, + "purple flower": 2, + "white capelet": 2, + "capelet": 2, + "alternate hair length": 2, + "horizon": 2, + "water": 2, + "bat wings": 2, + "maid headdress": 2, + "juliet sleeves": 2, + "picture frame": 2, + "waist apron": 2, + "cloudy sky": 2, + "yellow flower": 2, + "bug": 2, + "butterfly": 2, + "blue butterfly": 2, + "black headwear": 2, + "index finger raised": 2, + "v-shaped eyebrows": 2, + "blue headwear": 2, + "sketch": 2, + "fox ears": 2, + "white hair": 2, + "pink rose": 2, + "streaked hair": 2, + "thigh strap": 2, + "two-tone background": 2, + "animal": 2, + "single glove": 2, + "neckerchief": 2, + "demon tail": 2, + "scarf": 2, + "sig sauer": 2, + "shirt tucked in": 2, + "upper teeth": 2, + "teeth": 2, + "holding pencil": 2, + "sketchbook": 2, + "branch": 2, + "autumn": 2, + "armband": 2, + "high-waist skirt": 2, + "bow hairband": 2, + "envelope": 1, + "forehead": 1, + "parted bangs": 1, + "hood down": 1, + "holding envelope": 1, + "covered mouth": 1, + "flower over mouth": 1, + "eyebrows behind hair": 1, + "black background": 1, + "ascot": 1, + "purple neckwear": 1, + "two-tone hair": 1, + ":3": 1, + "head tilt": 1, + "brown dress": 1, + "eyewear on head": 1, + "sunglasses": 1, + "suitcase": 1, + "white bikini": 1, + "luggage": 1, + "ribbon-trimmed swimsuit": 1, + "cooler": 1, + "rolling suitcase": 1, + "constellation": 1, + "starry background": 1, + "musical note": 1, + "constellation print": 1, + "beamed eighth notes": 1, + "night": 1, + "star (sky)": 1, + "telescope": 1, + "starry sky": 1, + "night sky": 1, + "white sweater": 1, + "turtleneck": 1, + "turtleneck sweater": 1, + "fur trim": 1, + "coat": 1, + "tripod": 1, + "ribbed sweater": 1, + "railing": 1, + "camera": 1, + "brown legwear": 1, + "snowing": 1, + "open coat": 1, + "boots": 1, + "cross-laced footwear": 1, + "lace-up boots": 1, + "hair intakes": 1, + "blue background": 1, + "w": 1, + "japanese clothes": 1, + "kimono": 1, + "yukata": 1, + "from side": 1, + "blue kimono": 1, + "white border": 1, + "double bun": 1, + "striped kimono": 1, + "border": 1, + "handheld game console": 1, + "green eyes": 1, + "holding handheld game console": 1, + ":<": 1, + "hooded jacket": 1, + "green bow": 1, + "heart earrings": 1, + "brown background": 1, + "pink dress": 1, + "pink shirt": 1, + "medium hair": 1, + "gradient hair": 1, + "black scrunchie": 1, + "sailor dress": 1, + "blue scrunchie": 1, + "polka dot scrunchie": 1, + "food": 1, + "popsicle": 1, + "innertube": 1, + "black bikini": 1, + "cleavage": 1, + "bikini skirt": 1, + "holding food": 1, + "hibiscus": 1, + "stomach": 1, + "eating": 1, + "halterneck": 1, + "bead bracelet": 1, + "pink bow": 1, + "light rays": 1, + "food in mouth": 1, + "ribbon trim": 1, + "chair": 1, + "indoors": 1, + "interlocked fingers": 1, + "on chair": 1, + "chromatic aberration": 1, + "vase": 1, + "potted plant": 1, + "drawer": 1, + "plant": 1, + "pink eyes": 1, + "wooden floor": 1, + "sunset": 1, + "nude": 1, + "glint": 1, + "pokemon (creature)": 1, + "shorts": 1, + "red headwear": 1, + "white shorts": 1, + "pokemon on lap": 1, + "short shorts": 1, + "sunflower": 1, + "sun hat": 1, + "sundress": 1, + "hand on headwear": 1, + "condensation trail": 1, + ">:)": 1, + "finger to mouth": 1, + "detached sleeves": 1, + "fox girl": 1, + "ears down": 1, + "puffy long sleeves": 1, + "key": 1, + "window": 1, + "phone": 1, + "holding phone": 1, + "cellphone": 1, + "midriff": 1, + "black serafuku": 1, + "belt": 1, + "facial mark": 1, + "black belt": 1, + "crop top": 1, + "whisker markings": 1, + "blurry foreground": 1, + "bell": 1, + "collar": 1, + "neck bell": 1, + "bat hair ornament": 1, + "jingle bell": 1, + "paw pose": 1, + "red collar": 1, + "sleeves past wrists": 1, + "paw print": 1, + "paw print background": 1, + "kemonomimi mode": 1, + "brown skirt": 1, + "holding hair": 1, + "white pupils": 1, + "bright pupils": 1, + "bird": 1, + "feathers": 1, + "facing away": 1, + "wind": 1, + "white feathers": 1, + "cardigan": 1, + "pink cardigan": 1, + "pink sweater": 1, + "black wings": 1, + "green gloves": 1, + "blue scarf": 1, + "cross hair ornament": 1, + "school bag": 1, + "aqua scarf": 1, + "blazer": 1, + "shoulder bag": 1, + "polka dot background": 1, + "pink background": 1, + "fake animal ears": 1, + "sidelocks": 1, + "holding stylus": 1, + "multiple girls": 1, + "2girls": 1, + "closed eyes": 1, + "^_^": 1, + "blue jacket": 1, + "flying sweatdrops": 1, + "id card": 1, + "can": 1, + "headgear": 1, + "back-to-back": 1, + "fingerless gloves": 1, + "black gloves": 1, + "fox shadow puppet": 1, + "wariza": 1, + "arms up": 1, + "head wreath": 1, + "armpits": 1, + "flower wreath": 1, + "barefoot": 1, + "pleated dress": 1, + "sneakers": 1, + "headband": 1, + "nurse cap": 1, + "two side up": 1, + "bunny hair ornament": 1, + "pink apron": 1, + "pink headwear": 1, + "fang": 1, + "bandages": 1, + "puffy short sleeves": 1, + "bandaged arm": 1, + ">_<": 1, + "fang out": 1, + "skin fang": 1, + "clipboard": 1, + "pen": 1, + "center frills": 1, + "pegasus": 1, + "armor": 1, + "signature": 1, + "pegasus knight uniform (fire emblem)": 1, + "breastplate": 1, + "arm behind back": 1, + "frilled shirt collar": 1, + "notepad": 1, + "pencil": 1, + "notebook": 1, + "fangs": 1, + "blue nails": 1, + "v over eye": 1, + "notice lines": 1, + "striped bow": 1, + "elbow gloves": 1, + "french braid": 1, + "broom": 1, + "holding broom": 1, + "kneehighs": 1, + "standing on one leg": 1, + "dark blue hair": 1, + "hand in hair": 1, + "looking away": 1, + "cropped legs": 1, + "demon girl": 1, + "corset": 1, + "palette (object)": 1, + "paintbrush": 1, + "rainbow": 1, + "holding paintbrush": 1, + "green dress": 1, + "outline": 1, + "expressionless": 1, + "horse ears": 1, + "tilted headwear": 1, + "hat flower": 1, + "fur collar": 1, + "red sleeves": 1, + "horse girl": 1 + } + }, + "ss_batch_size_per_device": "1", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 512, + 896 + ], + "count": 5 + }, + "1": { + "resolution": [ + 512, + 960 + ], + "count": 5 + }, + "2": { + "resolution": [ + 576, + 832 + ], + "count": 35 + }, + "3": { + "resolution": [ + 576, + 896 + ], + "count": 40 + }, + "4": { + "resolution": [ + 576, + 960 + ], + "count": 55 + }, + "5": { + "resolution": [ + 640, + 768 + ], + "count": 25 + }, + "6": { + "resolution": [ + 640, + 832 + ], + "count": 25 + }, + "7": { + "resolution": [ + 640, + 896 + ], + "count": 40 + }, + "8": { + "resolution": [ + 704, + 768 + ], + "count": 25 + }, + "9": { + "resolution": [ + 704, + 832 + ], + "count": 5 + }, + "10": { + "resolution": [ + 768, + 640 + ], + "count": 5 + }, + "11": { + "resolution": [ + 768, + 704 + ], + "count": 10 + }, + "12": { + "resolution": [ + 832, + 640 + ], + "count": 10 + }, + "13": { + "resolution": [ + 896, + 576 + ], + "count": 5 + }, + "14": { + "resolution": [ + 896, + 640 + ], + "count": 5 + } + }, + "mean_img_ar_error": 0.013180177455315394 + }, + "ss_bucket_no_upscale": "True", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "5_a": { + "n_repeats": 5, + "img_count": 59 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "6", + "ss_face_crop_aug_range": "None", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "0", + "ss_learning_rate": "0.0001", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine", + "ss_lr_warmup_steps": "177", + "ss_max_bucket_reso": "1024", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "1770", + "ss_min_bucket_reso": "256", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "6", + "ss_network_alpha": "32.0", + "ss_network_args": { + "conv_dim": "1", + "conv_alpha": "1", + "algo": "lora" + }, + "ss_network_dim": "32", + "ss_network_module": "lycoris.kohya", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "295", + "ss_num_epochs": "6", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "last", + "ss_prior_loss_weight": "1.0", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "925997e9", + "ss_sd_scripts_commit_hash": "(unknown)", + "ss_seed": "1337", + "ss_session_id": "1794241593", + "ss_shuffle_caption": "False", + "ss_steps": "1770", + "ss_text_encoder_lr": "7e-05", + "ss_total_batch_size": "1", + "ss_training_comment": "None", + "ss_training_finished_at": "1689041653.1467292", + "ss_training_started_at": "1689038437.007665", + "ss_unet_lr": "0.0002", + "ss_v2": "False", + "sshs_legacy_hash": "9598b168", + "sshs_model_hash": "aa465619b3f430d68873c7938f9cf4c9958858e52c683da2b90ecafafbc2e16a" +} \ No newline at end of file diff --git a/Styles/440/zoirun-97700.txt b/Styles/440/zoirun-97700.txt new file mode 100644 index 0000000000000000000000000000000000000000..862e37a1e583f618e9b045bdba37038c63c13fff --- /dev/null +++ b/Styles/440/zoirun-97700.txt @@ -0,0 +1,522 @@ +Link:https://civitai.com/models/122945/zoirun-artist-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1girl, long hair, bow, dress, stuffed toy, blonde hair, stuffed animal, teddy bear, blue eyes, orange bow, black dress, hair bow, hat, black bow, polka dot, polka dot bow, parted bangs, bangs, bug, black headwear, butterfly, solo, sleeves past wrists, long sleeves, shoes, very long hair, black footwear, sleeves past fingers, forehead, headwear removed, smile, underwear, white bloomers, red background, bloomers, looking at viewer, hat removed, closed mouth, mary janes, multiple bows, object hug, shadow, multiple hair bows, holding, standing, full body, eyebrows visible through hair, holding stuffed toy + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img2: + Prompt:1girl, solo, apron, smile, twintails, kimono, :d, frills, bangs, blush, fang, virtual youtuber, blonde hair, white apron, sleeves past wrists, japanese clothes, blue eyes, frilled apron, white background, long sleeves, wide sleeves, open mouth, pink kimono, maid headdress, simple background, looking at viewer, red kimono, wa maid, floral print, sleeves past fingers, print kimono, pinching sleeves, head tilt, waist apron, long hair + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img3: + Prompt:1girl, choker, hairclip, dress, sitting, border, sketch, animal ears, black choker, cat ears, multiple views, long hair, red hair, looking at viewer, white dress, closed mouth, pink eyes, long sleeves, hair ornament, hands on hips, extra ears, off shoulder, brown hair + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img4: + Prompt:1girl, solo, indoors, desk, shirt, bow, curtains, blush, bangs, classroom, bowtie, window, sitting, chair, sweater, eraser, striped, pencil, holding, wind, blurry, day, notebook, sunlight, chalkboard, cardigan, pen, brown hair, looking at viewer, brown eyes, long sleeves, school uniform, collared shirt, sleeves past wrists, school desk, red bow, white shirt, pencil case, closed mouth, head rest, red bowtie, school chair, blue sweater, striped bow, floating hair, holding pencil, medium hair, depth of field, upper body, striped bowtie, diagonal stripes + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img5: + Prompt:1girl, skirt, flower, solo, wading, smile, bird, sky, outdoors, day, serafuku, water, neckerchief, cloud, shirt, :d, ocean, seagull, blush, teeth, hibiscus, standing, wet, bangs, sunlight, hair ornament, hair flower, school uniform, long hair, open mouth, pleated skirt, short sleeves, brown eyes, looking at viewer, white shirt, blue sky, sailor collar, blue skirt, brown hair, water drop, red neckerchief, lens flare, cowboy shot, upper teeth, skirt hold, red flower, wringing clothes + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img7: + Prompt:1girl, picnic, solo, sitting, smile, shirt, outdoors, petals, food, striped, omelet, bento, collarbone, yokozuwari, holding, blush, day, bangs, ribbon, overalls, hanami, :d, suspenders, ponytail, choker, bow, tree, feeding, open mouth, cherry blossoms, looking at viewer, striped shirt, long hair, polka dot, blonde hair, off shoulder, polka dot bow, overall shorts, purple eyes, blue eyes, bare shoulders, off-shoulder shirt, incoming food, hair bow + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + +img8: + Prompt:1boy, male focus, solo, bag, shirt, brown eyes, backpack, smile, open mouth, pants, shoes, white shirt, looking at viewer, from above, leaf, brown hair, collared shirt, short sleeves, belt, :d, full body, sneakers, standing, black pants, school uniform, grey footwear, twitter username, sunlight, looking up, green bag, holding strap, bangs, short hair, branch + Negative Prompt:(worst quality, low quality, extra digits:1.4), + Size:512x768, Sampler:DPM++ 2M Karras, Steps:30, CFG:6, Clip Skip:0, Model:starlake-4.0, Model Hash:70ba76a999 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 122945, + "name": "zoirun Artist Style", + "description": null, + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 127, + "favoriteCount": 24, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Keruchi", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/89664be1-50f7-480a-8bc8-74569eb2b560/width=96/Keruchi.jpeg" + }, + "tags": [ + "anime", + "style" + ], + "modelVersions": [ + { + "id": 133965, + "modelId": 122945, + "name": "v1.0", + "createdAt": "2023-08-05T03:58:38.166Z", + "updatedAt": "2023-08-05T04:01:15.879Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 127, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 97700, + "url": "https://civitai-delivery-worker-prod-2023-08-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/160689/model/zoirun.VmQv.safetensors", + "sizeKB": 43260.95703125, + "name": "zoirun.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-08-05T04:00:42.122Z", + "hashes": { + "AutoV1": "E5CA36B8", + "AutoV2": "636CC1D67A", + "SHA256": "636CC1D67A1E141D576963E71F2B1F402091606023866F51BF1AE82ED24F28F2", + "CRC32": "A1DBE65F", + "BLAKE3": "311695F17F471F90D9158759DB9EB71EB0C3D8FDE7D9D2A9EAC85E0FF7260464" + }, + "downloadUrl": "https://civitai.com/api/download/models/133965", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ff27eec0-bdfb-4089-8303-aaf733625e6c/width=450/1879272.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UKNcKS%M}]Dj~Vr?N2t8%OayNeog0fSe?aa{", + "type": "image", + "metadata": { + "hash": "UKNcKS%M}]Dj~Vr?N2t8%OayNeog0fSe?aa{", + "size": 977732, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2792001203, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, long hair, bow, dress, stuffed toy, blonde hair, stuffed animal, teddy bear, blue eyes, orange bow, black dress, hair bow, hat, black bow, polka dot, polka dot bow, parted bangs, bangs, bug, black headwear, butterfly, solo, sleeves past wrists, long sleeves, shoes, very long hair, black footwear, sleeves past fingers, forehead, headwear removed, smile, underwear, white bloomers, red background, bloomers, looking at viewer, hat removed, closed mouth, mary janes, multiple bows, object hug, shadow, multiple hair bows, holding, standing, full body, eyebrows visible through hair, holding stuffed toy", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d98e48d9-5ad7-4cfe-9043-5e02aa08b3b1/width=450/1879255.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UUQc6k?F%#kE_MNG.9bcWXoeMxf8sqaen$oe", + "type": "image", + "metadata": { + "hash": "UUQc6k?F%#kE_MNG.9bcWXoeMxf8sqaen$oe", + "size": 964481, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 292599955, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, solo, apron, smile, twintails, kimono, :d, frills, bangs, blush, fang, virtual youtuber, blonde hair, white apron, sleeves past wrists, japanese clothes, blue eyes, frilled apron, white background, long sleeves, wide sleeves, open mouth, pink kimono, maid headdress, simple background, looking at viewer, red kimono, wa maid, floral print, sleeves past fingers, print kimono, pinching sleeves, head tilt, waist apron, long hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/05411521-eaa6-4559-b33a-bdede6dec686/width=450/1879257.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UGOyq*ml.S~ororc?ux[Xl8{xatQ%$MxMx.R", + "type": "image", + "metadata": { + "hash": "UGOyq*ml.S~ororc?ux[Xl8{xatQ%$MxMx.R", + "size": 1271373, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1741608986, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, choker, hairclip, dress, sitting, border, sketch, animal ears, black choker, cat ears, multiple views, long hair, red hair, looking at viewer, white dress, closed mouth, pink eyes, long sleeves, hair ornament, hands on hips, extra ears, off shoulder, brown hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0a7620f2-9605-4fa8-9e86-58d2eb25c1ad/width=450/1879260.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UbK-2#9Ftlaf~pMxRkR+S~RiM{R*%2WBM{WB", + "type": "image", + "metadata": { + "hash": "UbK-2#9Ftlaf~pMxRkR+S~RiM{R*%2WBM{WB", + "size": 1202680, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 1864162519, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, solo, indoors, desk, shirt, bow, curtains, blush, bangs, classroom, bowtie, window, sitting, chair, sweater, eraser, striped, pencil, holding, wind, blurry, day, notebook, sunlight, chalkboard, cardigan, pen, brown hair, looking at viewer, brown eyes, long sleeves, school uniform, collared shirt, sleeves past wrists, school desk, red bow, white shirt, pencil case, closed mouth, head rest, red bowtie, school chair, blue sweater, striped bow, floating hair, holding pencil, medium hair, depth of field, upper body, striped bowtie, diagonal stripes", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/35c661b2-053d-49a9-86d5-73f9947daa2c/width=450/1879261.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UWIOV7xbu69vM|R-IpM}IAn*i_jFa#o#-oWB", + "type": "image", + "metadata": { + "hash": "UWIOV7xbu69vM|R-IpM}IAn*i_jFa#o#-oWB", + "size": 1483148, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 2446728872, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, skirt, flower, solo, wading, smile, bird, sky, outdoors, day, serafuku, water, neckerchief, cloud, shirt, :d, ocean, seagull, blush, teeth, hibiscus, standing, wet, bangs, sunlight, hair ornament, hair flower, school uniform, long hair, open mouth, pleated skirt, short sleeves, brown eyes, looking at viewer, white shirt, blue sky, sailor collar, blue skirt, brown hair, water drop, red neckerchief, lens flare, cowboy shot, upper teeth, skirt hold, red flower, wringing clothes", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a33e9529-7515-4def-a7f1-6314b8535624/width=450/1879262.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UWQl8}?Gt9aP-:NHt8of.lS3WFkWNLs-WTni", + "type": "image", + "metadata": { + "hash": "UWQl8}?Gt9aP-:NHt8of.lS3WFkWNLs-WTni", + "size": 1292725, + "width": 920, + "height": 1376 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/09f36747-e669-46ea-9a48-88982a7ea27a/width=450/1879265.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UGN0SZE39IIA~q0LX:sPVZ.7rrRP8~In+[x]", + "type": "image", + "metadata": { + "hash": "UGN0SZE39IIA~q0LX:sPVZ.7rrRP8~In+[x]", + "size": 1552693, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 115271907, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1girl, picnic, solo, sitting, smile, shirt, outdoors, petals, food, striped, omelet, bento, collarbone, yokozuwari, holding, blush, day, bangs, ribbon, overalls, hanami, :d, suspenders, ponytail, choker, bow, tree, feeding, open mouth, cherry blossoms, looking at viewer, striped shirt, long hair, polka dot, blonde hair, off shoulder, polka dot bow, overall shorts, purple eyes, blue eyes, bare shoulders, off-shoulder shirt, incoming food, hair bow", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33cec6c8-7f58-45bb-8a64-1faf1b840fbc/width=450/1879271.jpeg", + "nsfw": "None", + "width": 920, + "height": 1376, + "hash": "UBK1RI4o-i-p_L-U4:Si00WS00%M$_56ohsr", + "type": "image", + "metadata": { + "hash": "UBK1RI4o-i-p_L-U4:Si00WS00%M$_56ohsr", + "size": 1453912, + "width": 920, + "height": 1376 + }, + "meta": { + "ENSD": "31337", + "Size": "512x768", + "seed": 299264293, + "Model": "starlake-4.0", + "steps": 30, + "hashes": { + "model": "70ba76a999" + }, + "prompt": "1boy, male focus, solo, bag, shirt, brown eyes, backpack, smile, open mouth, pants, shoes, white shirt, looking at viewer, from above, leaf, brown hair, collared shirt, short sleeves, belt, :d, full body, sneakers, standing, black pants, school uniform, grey footwear, twitter username, sunlight, looking up, green bag, holding strap, bangs, short hair, branch", + "sampler": "DPM++ 2M Karras", + "cfgScale": 6, + "clipSkip": 2, + "resources": [ + { + "name": "zoirun", + "type": "lora", + "weight": 1 + }, + { + "hash": "70ba76a999", + "name": "starlake-4.0", + "type": "model" + } + ], + "Model hash": "70ba76a999", + "Hires steps": "10", + "Hires upscale": "1.8", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "(worst quality, low quality, extra digits:1.4),", + "ADetailer model": "face_yolov8n.pt", + "ADetailer version": "23.6.2", + "Denoising strength": "0.55", + "ADetailer mask blur": "4", + "ADetailer confidence": "0.3", + "ADetailer dilate/erode": "4", + "ADetailer inpaint padding": "32", + "ADetailer denoising strength": "0.4", + "ADetailer inpaint only masked": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/133965" + } + ] +} +---------------------------- diff --git "a/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601-metadata.json" "b/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601-metadata.json" new file mode 100644 index 0000000000000000000000000000000000000000..df59059ac873ca6fbeecc9021458b57a0fd5debf --- /dev/null +++ "b/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601-metadata.json" @@ -0,0 +1,955 @@ +{ + "ss_sd_model_name": "AnythingV5_v5RE.ckpt", + "ss_resolution": "(1024, 1024)", + "ss_clip_skip": "None", + "ss_num_train_images": "3596", + "ss_tag_frequency": { + "2_higurashi_no_naku_koro_ni style": { + "long hair": 1355, + "1girl": 967, + "solo": 898, + "purple eyes": 882, + "furude rika": 879, + "blue hair": 860, + "multiple girls": 709, + "short hair": 648, + "open mouth": 590, + "purple hair": 568, + "outdoors": 559, + "dress": 533, + "hanyuu": 511, + "blonde hair": 509, + "parody": 506, + "smile": 494, + "anime coloring": 487, + "2girls": 478, + "houjou satoko": 449, + "tree": 428, + "brown hair": 407, + "bangs": 402, + "horns": 383, + "green hair": 379, + "1boy": 374, + "closed eyes": 357, + "shirt": 340, + "sonozaki mion": 308, + "day": 295, + "maebara keiichi": 290, + "skirt": 289, + "sky": 278, + "hairband": 269, + "looking at viewer": 265, + "blunt bangs": 255, + "green eyes": 253, + "bow": 244, + "school uniform": 243, + "hat": 230, + "nature": 227, + "ponytail": 226, + "blush": 208, + "close-up": 208, + "ryuuguu rena": 205, + "sleeveless": 196, + "sonozaki shion": 193, + "blue eyes": 183, + "blush stickers": 168, + "grass": 167, + "cloud": 167, + "white shirt": 157, + "indoors": 156, + "forest": 153, + "green dress": 149, + "closed mouth": 148, + "sundress": 146, + "bare shoulders": 145, + "short sleeves": 142, + "3girls": 132, + "animal ears": 128, + "hair bun": 127, + "upper body": 126, + "ribbon": 120, + "siblings": 120, + "sisters": 118, + "japanese clothes": 117, + "cat ears": 114, + "orange hair": 110, + "sitting": 107, + "male focus": 103, + "twins": 101, + "sun hat": 100, + "miko": 98, + "pink dress": 93, + "from behind": 89, + "double bun": 88, + "collarbone": 86, + "scenery": 84, + "pink bow": 84, + "black hairband": 79, + "suspenders": 79, + "pantyhose": 78, + "necktie": 77, + "window": 77, + "no humans": 76, + "profile": 75, + "classroom": 73, + "collared shirt": 73, + "sunset": 72, + ":d": 70, + "portrait": 68, + "thighhighs": 67, + "water": 66, + "hakama": 65, + "hakama skirt": 65, + "blue sky": 64, + "house": 64, + "half updo": 62, + "white headwear": 62, + "alternate hairstyle": 62, + "red hakama": 61, + "desk": 60, + "vest": 59, + "breasts": 59, + "pants": 56, + "looking at another": 54, + "holding": 54, + "magical girl": 54, + "bowtie": 53, + "wand": 53, + "standing": 52, + "hair ribbon": 51, + "wings": 51, + "4girls": 49, + "shorts": 48, + "sailor collar": 48, + "green skirt": 48, + "detached sleeves": 48, + "tears": 47, + "yellow shirt": 47, + "belt": 46, + "bag": 45, + "mountain": 45, + "^_^": 44, + "pink shirt": 44, + "nude": 44, + "chair": 43, + "sleeveless dress": 42, + "dark": 41, + "multiple boys": 40, + "school desk": 40, + "serafuku": 39, + "puffy sleeves": 39, + "6+girls": 38, + "beret": 37, + "sleeveless shirt": 37, + "brown eyes": 36, + "frown": 34, + "sweatdrop": 33, + "fang": 33, + "one eye closed": 33, + "sandals": 33, + "2boys": 32, + "blurry": 32, + "stairs": 32, + "lying": 31, + "5girls": 31, + "shrine": 31, + "hug": 31, + "turtleneck": 31, + "fake animal ears": 31, + "pillow": 30, + "white background": 30, + "puffy short sleeves": 29, + "glasses": 28, + "yellow ribbon": 27, + "head out of frame": 27, + "arms behind back": 25, + "teeth": 25, + ":o": 25, + "simple background": 25, + "sleeping": 24, + "bed": 24, + "purple bow": 23, + "style parody": 23, + "braid": 23, + "sailor dress": 23, + "black thighhighs": 23, + "pleated skirt": 22, + "torii": 21, + "clothes around waist": 21, + "weapon": 21, + "onsen": 21, + "cleavage": 21, + "food": 20, + "building": 20, + "large breasts": 20, + "wavy mouth": 20, + "on back": 19, + "hair between eyes": 19, + "chalkboard": 19, + "solo focus": 18, + "towel": 18, + "child": 18, + "yellow vest": 17, + "clenched hands": 17, + "sweater": 17, + "river": 17, + "rock": 17, + "barefoot": 17, + "hands on own face": 17, + "road": 17, + "sunlight": 17, + "covering mouth": 17, + "socks": 16, + "shoes": 16, + "flower": 16, + "stone lantern": 16, + "architecture": 16, + "east asian architecture": 16, + "sweat": 16, + "curtains": 16, + "hat ribbon": 16, + "yuri": 16, + "door": 15, + "labcoat": 15, + "hands on own cheeks": 15, + "gun": 15, + "rain": 15, + "hetero": 14, + "tank top": 14, + "under covers": 14, + "leotard": 14, + "partially submerged": 14, + "black hair": 14, + "bathing": 14, + "blue skirt": 13, + "boots": 13, + "naked towel": 13, + "television": 13, + "red eyes": 13, + "single hair bun": 13, + "facing viewer": 13, + "white dress": 13, + "night": 13, + "backpack": 13, + "mask": 13, + "tile wall": 13, + "crossover": 12, + "holding hands": 12, + "out of frame": 12, + "parted lips": 12, + "jacket around waist": 12, + "underwear": 12, + "shaded face": 12, + "detached collar": 12, + "pajamas": 12, + "suspender skirt": 12, + "antennae": 12, + "bathtub": 12, + "eye contact": 11, + "school chair": 11, + "from side": 11, + "bush": 11, + "clenched teeth": 11, + "facing away": 11, + "nurse": 11, + "grey hair": 11, + "red sky": 11, + "cosplay": 11, + "rope": 10, + "eye focus": 10, + "shoulder holster": 10, + "futon": 10, + "nurse cap": 10, + "wet": 10, + "arms up": 10, + "medium breasts": 10, + "tiles": 10, + "hair bow": 10, + "staff": 10, + "sparkle": 10, + "shiny hair": 9, + "book": 9, + "green shorts": 9, + "neckerchief": 9, + "arms behind head": 9, + "baseball bat": 9, + "bandages": 9, + "mouth hold": 9, + "rabbit ears": 9, + "ass": 9, + "path": 9, + "ribbon-trimmed sleeves": 9, + "squatting": 8, + "red shirt": 8, + "blindfold": 8, + "pointing": 8, + "denim": 8, + "holster": 8, + "outstretched arms": 8, + "white sweater": 8, + "purple bowtie": 8, + "crossdressing": 8, + "heart": 8, + "running": 8, + "walking": 8, + "grin": 8, + "nata (tool)": 8, + "sleeveless sweater": 8, + "handgun": 8, + "landscape": 8, + "white sailor collar": 8, + "bath": 8, + "statue": 7, + "official style": 7, + "green pants": 7, + "armpits": 7, + "headband": 7, + "crossed arms": 7, + "brown footwear": 7, + "tatami": 7, + "calendar (object)": 7, + "playboy bunny": 7, + "panties": 7, + "looking outside": 7, + "choker": 7, + "turtleneck sweater": 7, + "holding gun": 7, + "red skirt": 7, + "waitress": 7, + ">_<": 7, + "minigirl": 7, + "bathroom": 7, + "steam": 7, + "instrument": 7, + "crying": 6, + "striped bow": 6, + "couple": 6, + "eating": 6, + "long sleeves": 6, + "card": 6, + "yellow neckerchief": 6, + "table": 6, + "shide": 6, + "apron": 6, + "fence": 6, + "wrist cuffs": 6, + "box": 6, + "hands on hips": 6, + "legs": 6, + "looking back": 6, + "holding weapon": 6, + "ribbed sweater": 6, + "phone": 6, + "purple sky": 6, + "own hands together": 6, + "school": 6, + "jacket": 6, + "jewelry": 6, + "black background": 6, + "red footwear": 6, + "black skirt": 6, + "purple background": 6, + "sad": 6, + "black pantyhose": 6, + "strapless": 6, + "bento": 5, + "shimenawa": 5, + "jeans": 5, + "fire": 5, + "lower body": 5, + "nightgown": 5, + "monitor": 5, + "hat bow": 5, + "bandaid": 5, + ":3": 5, + "index finger raised": 5, + "plant": 5, + "clenched hand": 5, + "ribbon trim": 5, + "long skirt": 5, + "bookshelf": 5, + "braided bun": 5, + "autumn": 5, + "red bow": 5, + "bound": 5, + "bondage": 5, + "bdsm": 5, + "frills": 5, + "fairy": 5, + "glowing": 5, + "kneehighs": 5, + "between breasts": 5, + "recorder": 5, + "striped": 4, + "bench": 4, + "onigiri": 4, + "green necktie": 4, + "holding card": 4, + "shiny": 4, + "playing card": 4, + ":<": 4, + "denim shorts": 4, + "looking up": 4, + "wall": 4, + "3boys": 4, + "blue shorts": 4, + "yellow necktie": 4, + "maid": 4, + "hand on own chin": 4, + "waterfall": 4, + "bloomers": 4, + "umbrella": 4, + "male playboy bunny": 4, + "photo background": 4, + "field": 4, + "carrying": 4, + "light rays": 4, + "rifle": 4, + "cloudy sky": 4, + "microphone": 4, + "black bow": 4, + "soaking feet": 4, + "blurry background": 4, + "lap pillow": 4, + "talking on phone": 4, + "orange sky": 4, + "black pants": 4, + "watch": 4, + "on side": 4, + "grey eyes": 4, + "randoseru": 4, + "character doll": 4, + "doll": 4, + "fruit": 4, + "pov": 4, + "peeking out": 4, + "chopsticks": 4, + "locker": 4, + "hair ornament": 4, + "bubble": 4, + "striped bowtie": 3, + "school bag": 3, + "reading": 3, + "indian style": 3, + "lamppost": 3, + "v-shaped eyebrows": 3, + "blue sailor collar": 3, + "no eyes": 3, + "looking down": 3, + "light purple hair": 3, + "angry": 3, + "thumbs up": 3, + "holding baseball bat": 3, + "opaque glasses": 3, + "bare arms": 3, + "alice margatroid": 3, + "emphasis lines": 3, + "maid headdress": 3, + "kyon": 3, + "blanket": 3, + "strap slip": 3, + "from below": 3, + "sliding doors": 3, + "tail": 3, + "rabbit tail": 3, + "twintails": 3, + "power lines": 3, + "hill": 3, + "hands on own knees": 3, + "hood": 3, + "sun": 3, + "lens flare": 3, + "assault rifle": 3, + "very long hair": 3, + "blurry foreground": 3, + "hand on hip": 3, + "own hands clasped": 3, + "cellphone": 3, + "against glass": 3, + "wooden wall": 3, + "kimono": 3, + "female child": 3, + "purple theme": 3, + "cityscape": 3, + "red theme": 3, + "back bow": 3, + "old": 3, + "old man": 3, + "facial hair": 3, + "wristwatch": 3, + "necklace": 3, + "frilled pillow": 3, + "nishizumi miho": 3, + "blue bow": 3, + "sexually suggestive": 3, + "ass focus": 3, + "orange (fruit)": 3, + "bracelet": 3, + "explosion": 3, + "moon": 3, + "blue background": 3, + "blue leotard": 3, + "star (symbol)": 3, + "upside-down": 3, + "red bowtie": 3, + "yellow thighhighs": 3, + "yellow eyes": 3, + "ground vehicle": 3, + "sign": 3, + "street": 3, + "wet hair": 3, + "veil": 3, + "rice": 2, + "holding food": 2, + "laughing": 2, + "pillar": 2, + "ruins": 2, + "column lineup": 2, + "sunglasses": 2, + "wristband": 2, + "covering": 2, + "candy": 2, + "chibi": 2, + "tatara kogasa": 2, + "mob cap": 2, + "white bloomers": 2, + "sink": 2, + "sponge": 2, + "broom": 2, + "cabinet": 2, + "yellow bow": 2, + "railroad tracks": 2, + "tearing up": 2, + "dog tags": 2, + "sitting on stairs": 2, + "princess carry": 2, + "leaf": 2, + "kafuu chino": 2, + "topless male": 2, + "sleeveless turtleneck": 2, + "aiming": 2, + "aiming at viewer": 2, + "veranda": 2, + "open vest": 2, + "on stomach": 2, + "pink skirt": 2, + "expressionless": 2, + "looking away": 2, + "map": 2, + "yellow sweater": 2, + "cardboard box": 2, + "holding phone": 2, + "summer uniform": 2, + "corded phone": 2, + "evil smile": 2, + "happy": 2, + "donation box": 2, + "twilight": 2, + "city": 2, + "yellow background": 2, + "lipstick": 2, + "makeup": 2, + "open clothes": 2, + "red background": 2, + "gradient": 2, + "gradient background": 2, + "serious": 2, + "computer": 2, + "saliva": 2, + "kneeling": 2, + "back-to-back": 2, + "injury": 2, + "blood": 2, + "white headband": 2, + "name tag": 2, + "pink bowtie": 2, + "white kimono": 2, + "wooden floor": 2, + "torn clothes": 2, + "red necktie": 2, + "pov hands": 2, + "camera": 2, + "fog": 2, + "sand": 2, + "faucet": 2, + "hip vent": 2, + "heart brooch": 2, + "fake screenshot": 2, + "blue dress": 2, + "from above": 2, + "zettai ryouiki": 2, + "hair flower": 2, + "fishnets": 2, + "all fours": 2, + "red leotard": 2, + "fur trim": 2, + "flute": 2, + "motion blur": 2, + "=_=": 2, + "black eyes": 2, + "paper": 2, + "pen": 2, + "pencil": 2, + "motor vehicle": 2, + "against tree": 2, + "holding sign": 2, + "hair bobbles": 2, + "uwabaki": 2, + "shopping bag": 2, + "bus stop": 2, + "suit": 2, + "formal": 2, + "police": 1, + "police uniform": 1, + "uniform": 1, + "police hat": 1, + "blue necktie": 1, + "loafers": 1, + "arm behind head": 1, + "food on face": 1, + "rice on face": 1, + "cookie": 1, + "yellow sky": 1, + "undershirt": 1, + ":>": 1, + "hair over eyes": 1, + "isobe noriko": 1, + "naoetsu high school uniform": 1, + "music": 1, + ";d": 1, + "helmet": 1, + "baseball mitt": 1, + "baseball uniform": 1, + "baseball": 1, + "sportswear": 1, + "higurashi_no_naku_koro_ni style": 1, + "sleeves rolled up": 1, + "kallen stadtfeld": 1, + "green shirt": 1, + "white thighhighs": 1, + "covering crotch": 1, + "pointing at viewer": 1, + "special week (umamusume)": 1, + "horse ears": 1, + "two-tone hair": 1, + "multicolored hair": 1, + "horse girl": 1, + "chocolate": 1, + "box of chocolates": 1, + "heart-shaped chocolate": 1, + "valentine": 1, + "still life": 1, + "heart-shaped box": 1, + "food focus": 1, + "watermark": 1, + "tongue": 1, + "akanbe": 1, + ":p": 1, + "tongue out": 1, + "stream": 1, + "camisole": 1, + "closed umbrella": 1, + "seiza": 1, + "cushion": 1, + "watching television": 1, + "inaba tewi": 1, + "black leotard": 1, + "black footwear": 1, + "hands on headwear": 1, + "spread arms": 1, + "fish": 1, + "mahjong": 1, + "otoko no ko": 1, + "dutch angle": 1, + "mother and daughter": 1, + "baby": 1, + "on bed": 1, + "stone": 1, + "handbag": 1, + "hiiragi tsukasa": 1, + "hands on lap": 1, + "hoodie": 1, + "green theme": 1, + "dappled sunlight": 1, + "overalls": 1, + "back": 1, + "sideboob": 1, + "hugging own legs": 1, + "kagari atsuko": 1, + "suspended congress": 1, + "pants rolled up": 1, + "hime cut": 1, + "kawashiro nitori": 1, + "wide sleeves": 1, + "tombstone": 1, + "hands up": 1, + "thinking": 1, + "stroking own chin": 1, + "multiple views": 1, + "sunbeam": 1, + "piggyback": 1, + "flip phone": 1, + "ganyu (genshin impact)": 1, + "evil grin": 1, + "scared": 1, + "shooting star": 1, + "star (sky)": 1, + "backlighting": 1, + "houraisan kaguya": 1, + "bulletin board": 1, + "track suit": 1, + "red pants": 1, + "red jacket": 1, + "ceiling light": 1, + "gradient sky": 1, + "dusk": 1, + "juice box": 1, + "autumn leaves": 1, + "remilia scarlet": 1, + "hawaiian shirt": 1, + "open shirt": 1, + "cigarette": 1, + "off shoulder": 1, + "outstretched arm": 1, + "bound wrists": 1, + "ribbon choker": 1, + "scissors": 1, + "smirk": 1, + "nail polish": 1, + "red nails": 1, + ";o": 1, + "izayoi liko": 1, + "flat chest": 1, + "kirisame marisa": 1, + "white panties": 1, + "loli": 1, + "full body": 1, + "letterboxed": 1, + "popsicle": 1, + "plaid skirt": 1, + "blue bowtie": 1, + "hug from behind": 1, + "black panties": 1, + "cameltoe": 1, + "frederica bernkastel": 1, + "nosebleed": 1, + "adjusting eyewear": 1, + "looking to the side": 1, + "hospital bed": 1, + "strawberry": 1, + "swimsuit": 1, + "school swimsuit": 1, + "cream": 1, + "wheelchair": 1, + "on floor": 1, + "covering breasts": 1, + "tattoo": 1, + "gym uniform": 1, + "revolver": 1, + "triangle mouth": 1, + "jitome": 1, + "bandaid on face": 1, + "asashio (kancolle)": 1, + "comic": 1, + "faceless": 1, + "hakurei reimu": 1, + "thick eyebrows": 1, + "glowing eyes": 1, + "kitchen": 1, + "stove": 1, + "kettle": 1, + "white socks": 1, + "knee pads": 1, + "depth of field": 1, + "mouth mask": 1, + "surgical mask": 1, + "fangs": 1, + "holding clothes": 1, + "frilled dress": 1, + "beam": 1, + "water gun": 1, + "dual wielding": 1, + "holding water gun": 1, + "one-piece swimsuit": 1, + "arm up": 1, + "henshin": 1, + "crescent moon": 1, + "sonic the hedgehog": 1, + "furry male": 1, + "furry": 1, + "hishikawa rikka": 1, + "pink background": 1, + "bucket": 1, + "torch": 1, + "holding wand": 1, + "midriff": 1, + "sleeveless kimono": 1, + "red sleeves": 1, + "wet clothes": 1, + "see-through": 1, + "stone stairs": 1, + "black shirt": 1, + "straitjacket": 1, + "mecha": 1, + "robot": 1, + "pink hair": 1, + "alternate costume": 1, + "high heels": 1, + "bed sheet": 1, + "fishnet thighhighs": 1, + "meme": 1, + "fairy wings": 1, + "pokemon (creature)": 1, + "arm cannon": 1, + "yellow panties": 1, + "pantyshot": 1, + "upskirt": 1, + "yellow skirt": 1, + "oomori yuuko": 1, + "magic circle": 1, + "eyes visible through hair": 1, + "fur-trimmed dress": 1, + "banana": 1, + "white hair": 1, + "red choker": 1, + "scarf": 1, + "striped scarf": 1, + "hatsune miku": 1, + "spoon": 1, + "shirt tucked in": 1, + "writing": 1, + "hand in pocket": 1, + "train interior": 1, + "car": 1, + "object hug": 1, + "couch": 1, + "motorcycle": 1, + "headpat": 1, + "bruise": 1, + "knee boots": 1, + "brick wall": 1, + "patchouli knowledge": 1, + "surprised": 1, + "wide-eyed": 1, + "pink eyes": 1, + "upper teeth only": 1, + "plastic bag": 1, + "utility pole": 1, + "covering face": 1, + "bicycle": 1, + "ice cream": 1, + "wing collar": 1, + "pencil skirt": 1, + "feeding": 1, + "head wreath": 1, + "hand on another's shoulder": 1, + "hands on another's shoulders": 1, + "convenient censoring": 1, + "night sky": 1, + "flashlight": 1, + "star print": 1, + "clothes hanger": 1, + "striped dress": 1, + "riding": 1, + "horseback riding": 1, + "horse": 1, + "bouquet": 1, + "bridal veil": 1, + "wedding dress": 1, + "stuffed toy": 1, + "notebook": 1 + } + }, + "ss_network_module": "lycoris.kohya", + "ss_flip_aug": "False", + "ss_max_bucket_reso": "2048", + "ss_epoch": "6", + "ss_network_dropout": "0.0", + "ss_num_epochs": "6", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_bucket_no_upscale": "True", + "modelspec.sai_model_spec": "1.0.0", + "ss_network_args": { + "conv_dim": "32", + "conv_alpha": "1", + "use_cp": "False", + "algo": "loha" + }, + "ss_gradient_checkpointing": "True", + "ss_training_comment": "None", + "ss_new_sd_model_hash": "e06702b2747b3efa38373df813850bb0f444cb82794de2fbba69a71ffdd9136d", + "ss_num_batches_per_epoch": "1798", + "modelspec.date": "2023-09-30T16:56:56", + "ss_noise_offset": "0.0", + "ss_output_name": "ひぐらしのなく頃に_煌_LoHA", + "ss_min_snr_gamma": "None", + "sshs_legacy_hash": "84ab119a", + "ss_multires_noise_discount": "0.3", + "ss_v2": "False", + "ss_caption_dropout_every_n_epochs": "0", + "ss_sd_model_hash": "2986849f", + "modelspec.implementation": "diffusers", + "ss_face_crop_aug_range": "None", + "modelspec.resolution": "1024x1024", + "ss_caption_tag_dropout_rate": "0.0", + "modelspec.prediction_type": "epsilon", + "sshs_model_hash": "698e73fed2d0a26c3a0b3297c61ce818c8b732223d98b6c558b9ecfe2c4e1f38", + "modelspec.architecture": "stable-diffusion-v1/lora", + "ss_num_reg_images": "0", + "ss_max_train_steps": "10788", + "ss_scale_weight_norms": "None", + "ss_enable_bucket": "True", + "ss_multires_noise_iterations": "None", + "ss_keep_tokens": "0", + "modelspec.title": "ひぐらしのなく頃に_煌_LoHA", + "ss_base_model_version": "sd_v1", + "ss_max_grad_norm": "1.0", + "ss_prior_loss_weight": "1.0", + "ss_full_fp16": "False", + "ss_lowram": "False", + "ss_text_encoder_lr": "4e-05", + "ss_caption_dropout_rate": "0.0", + "ss_unet_lr": "0.0001", + "ss_batch_size_per_device": "2", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 1344, + 768 + ], + "count": 3596 + } + }, + "mean_img_ar_error": 0.027777777777777679 + }, + "ss_training_finished_at": "1696060616.550202", + "ss_total_batch_size": "2", + "ss_learning_rate": "0.0001", + "ss_network_dim": "64", + "ss_shuffle_caption": "True", + "ss_lr_warmup_steps": "1079", + "ss_sd_scripts_commit_hash": "c883fac332f75eeaaaa4764c0edea94215ecf4d6", + "ss_session_id": "3773985190", + "ss_random_crop": "False", + "ss_dataset_dirs": { + "2_higurashi_no_naku_koro_ni style": { + "n_repeats": 2, + "img_count": 1798 + } + }, + "ss_color_aug": "False", + "ss_gradient_accumulation_steps": "1", + "ss_cache_latents": "True", + "ss_adaptive_noise_scale": "None", + "ss_zero_terminal_snr": "False", + "ss_training_started_at": "1696041548.1437228", + "ss_mixed_precision": "fp16", + "ss_steps": "10788", + "ss_min_bucket_reso": "256", + "ss_max_token_length": "225", + "ss_network_alpha": "32.0", + "ss_seed": "519098825", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_reg_dataset_dirs": {} +} \ No newline at end of file diff --git "a/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601.txt" "b/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601.txt" new file mode 100644 index 0000000000000000000000000000000000000000..4b628c13b12d260770bfa22a86d608c6a082604e --- /dev/null +++ "b/Styles/443/\343\201\262\343\201\220\343\202\211\343\201\227\343\201\256\343\201\252\343\201\217\351\240\203\343\201\253_\347\205\214_loha-131601.txt" @@ -0,0 +1,465 @@ +Link:https://civitai.com/models/154232/higurashi-no-naku-koro-ni-kira-style-loha +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- +It is recommended that the weights be about 1.0 +I've noticed that some characters don't work, in which case you might want to use ControlNet. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,child,purple eyes,long hair,blue hair,dress,blush,bangs,looking at viewer,simple background,sundress,blunt bangs,full body,green dress,collarbone,bare shoulders + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Karras, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + +img2: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,houjou satoko, 1girl, solo, blonde hair, pantyhose, hairband, sailor dress, short hair, school uniform, dress, transparent background, smile, purple eyes + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Karras, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + +img3: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,maebara keiichi, 1boy, male focus, solo, brown hair, open mouth, shirt, indoors, looking at viewer, school uniform, desk, purple eyes, white shirt, collared shirt, upper body, teeth, collarbone + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Karras, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + +img4: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,blue hair,purple eyes,long hair,animal ears,rabbit ears,skirt,white background,blush,simple background,jacket,black skirt,looking at viewer,breasts,ahoge,small breasts,fake animal ears,off shoulder,bangs,very long hair,collarbone,long sleeves,embarrassed,bare shoulders,pleated skirt,blue jacket,miniskirt,wavy mouth,camisole + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Exponential, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + +img5: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,lollipop,solo,furude rika,blue hair,purple eyes,long hair,blunt bangs,bangs,food,candy,looking at viewer,holding,white background,simple background,white shirt,shirt,long sleeves,holding food,suspenders,from behind,looking back,cat hood,animal hood,skirt,blush,hood,black skirt,wide sleeves,holding candy,animal ears,tail,very long hair,high-waist skirt,holding lollipop,hood up,cowboy shot,fake animal ears,ass,suspender skirt,cat ears + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Exponential, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + +img6: + Prompt:(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,blue hair,purple eyes,long hair,blunt bangs,bangs,skirt,fang,shirt,bell,smile,boots,open mouth,red background,v,high heels,heart,crossdressing,frills,looking at viewer,two side up,black skirt,blush,long sleeves,bow,half-closed eyes,belt,jirai kei,black footwear + Negative Prompt:(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5) + Size:480x640, Sampler:DPM++ 3M SDE Exponential, Steps:30, CFG:30, Clip Skip:0, Model:AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01, Model Hash:4556c8bdbf + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 154232, + "name": "Higurashi no Naku Koro ni Kira Style LoHA", + "description": "

It is recommended that the weights be about 1.0

I've noticed that some characters don't work, in which case you might want to use ControlNet.

", + "type": "LoCon", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 178, + "favoriteCount": 27, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "munsy0227", + "image": "https://lh3.googleusercontent.com/a/AGNmyxaZylUhS8HAUM2PtBl8FhKyMTmRr2Omq6Rr0DkVMA=s96-c" + }, + "tags": [ + "anime", + "style", + "studio deen", + "higurashi", + "styles", + "higurashi when they cry", + "higurashi no naku koro ni kira" + ], + "modelVersions": [ + { + "id": 172810, + "modelId": 154232, + "name": "v1.0", + "createdAt": "2023-09-30T08:45:01.255Z", + "updatedAt": "2023-09-30T08:53:33.116Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 178, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 131601, + "sizeKB": 236426.86328125, + "name": "ひぐらしのなく頃に_煌_LoHA.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-09-30T09:01:12.034Z", + "hashes": { + "AutoV1": "485F2022", + "AutoV2": "5A297FCEE2", + "SHA256": "5A297FCEE2CFD5358A4ABC9AB50C9E2A37DBFF88E350A3A6DF3804DE73FEE8A6", + "CRC32": "F7C74EE8", + "BLAKE3": "C32F3F3EF1BF424A70F87BA51B76664732FFD101381511F4D97776B3DF9C069A" + }, + "downloadUrl": "https://civitai.com/api/download/models/172810", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/934eed62-fbd3-445e-a435-632fd391224a/width=450/2725976.jpeg", + "nsfw": "None", + "width": 960, + "height": 1280, + "hash": "U7Gl6NIo00n44VV[yWtQ4UxGYOSzCkSg{yaK", + "type": "image", + "metadata": { + "hash": "U7Gl6NIo00n44VV[yWtQ4UxGYOSzCkSg{yaK", + "size": 1933268, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 3115808002, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,child,purple eyes,long hair,blue hair,dress,blush,bangs,looking at viewer,simple background,sundress,blunt bangs,full body,green dress,collarbone,bare shoulders", + "Version": "v1.6.0-127-g102b6617", + "sampler": "DPM++ 3M SDE Karras", + "CFG mode": "Half Cosine Up", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Mimic mode": "Half Cosine Down", + "Model hash": "4556c8bdbf", + "Hires steps": "15", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Interpolate Phi": "0.65", + "CFG scale minimum": "5", + "Denoising strength": "0.45", + "Scaling Startpoint": "MEAN", + "Mimic scale minimum": "5", + "Variability Measure": "AD", + "Threshold percentile": "99", + "\"r0P00W0n0j0O0\u0003k0_Lq_LoHA": "698e73fed2d0\"", + "Separate Feature Channels": "True", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7148f01b-1ebc-40fb-8829-b842edd6851e/width=450/2725980.jpeg", + "nsfw": "None", + "width": 960, + "height": 1280, + "hash": "UPFPd5R4B;X9~UV?57NIMwadRlRkt7s.xvoz", + "type": "image", + "metadata": { + "hash": "UPFPd5R4B;X9~UV?57NIMwadRlRkt7s.xvoz", + "size": 2260690, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 461978472, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,houjou satoko, 1girl, solo, blonde hair, pantyhose, hairband, sailor dress, short hair, school uniform, dress, transparent background, smile, purple eyes", + "Version": "v1.6.0-127-g102b6617", + "sampler": "DPM++ 3M SDE Karras", + "CFG mode": "Half Cosine Up", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Mimic mode": "Half Cosine Down", + "Model hash": "4556c8bdbf", + "Hires steps": "15", + "Mimic scale": "7", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Interpolate Phi": "0.65", + "CFG scale minimum": "5", + "Denoising strength": "0.45", + "Scaling Startpoint": "MEAN", + "Mimic scale minimum": "5", + "Variability Measure": "AD", + "Threshold percentile": "99", + "\"r0P00W0n0j0O0\u0003k0_Lq_LoHA": "698e73fed2d0\"", + "Separate Feature Channels": "True", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/306cf53b-bf30-44d0-b8fc-c425ea23df12/width=450/2725988.jpeg", + "nsfw": "None", + "width": 960, + "height": 1280, + "hash": "UHI4*1DPbpVuZ|R6tPRl$*N[%1oz~WEL%2NG", + "type": "image", + "metadata": { + "hash": "UHI4*1DPbpVuZ|R6tPRl$*N[%1oz~WEL%2NG", + "size": 978472, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 2621010550, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,maebara keiichi, 1boy, male focus, solo, brown hair, open mouth, shirt, indoors, looking at viewer, school uniform, desk, purple eyes, white shirt, collared shirt, upper body, teeth, collarbone", + "\"Module": "reference_only", + "sampler": "DPM++ 3M SDE Karras", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Model hash": "4556c8bdbf", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Denoising strength": "0.45" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/041fb1c4-1bdd-4eb6-95d3-b3d7560c4735/width=450/2730671.jpeg", + "nsfw": "None", + "width": 960, + "height": 1280, + "hash": "UDHd{#GH5rx]018wF{rX_ME1+aE2+HVs?bR,", + "type": "image", + "metadata": { + "hash": "UDHd{#GH5rx]018wF{rX_ME1+aE2+HVs?bR,", + "size": 2160686, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 735499403, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,blue hair,purple eyes,long hair,animal ears,rabbit ears,skirt,white background,blush,simple background,jacket,black skirt,looking at viewer,breasts,ahoge,small breasts,fake animal ears,off shoulder,bangs,very long hair,collarbone,long sleeves,embarrassed,bare shoulders,pleated skirt,blue jacket,miniskirt,wavy mouth,camisole", + "Version": "v1.6.0-127-g102b6617", + "sampler": "DPM++ 3M SDE Exponential", + "CFG mode": "Half Cosine Up", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Mimic mode": "Half Cosine Down", + "Model hash": "4556c8bdbf", + "Hires steps": "15", + "Mimic scale": "8.5", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Interpolate Phi": "0.65", + "CFG scale minimum": "5", + "Denoising strength": "0.45", + "Scaling Startpoint": "MEAN", + "Mimic scale minimum": "5", + "Variability Measure": "AD", + "Threshold percentile": "99", + "\"r0P00W0n0j0O0\u0003k0_Lq_LoHA": "698e73fed2d0\"", + "Separate Feature Channels": "True", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4efae40-ef07-4698-a49d-bfbd3afe580f/width=450/2730673.jpeg", + "nsfw": "Mature", + "width": 960, + "height": 1280, + "hash": "UTI67hInqD%M5Qaxxra#s9xuX9Rj4.RP%Maf", + "type": "image", + "metadata": { + "hash": "UTI67hInqD%M5Qaxxra#s9xuX9Rj4.RP%Maf", + "size": 1827320, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 1891250209, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,lollipop,solo,furude rika,blue hair,purple eyes,long hair,blunt bangs,bangs,food,candy,looking at viewer,holding,white background,simple background,white shirt,shirt,long sleeves,holding food,suspenders,from behind,looking back,cat hood,animal hood,skirt,blush,hood,black skirt,wide sleeves,holding candy,animal ears,tail,very long hair,high-waist skirt,holding lollipop,hood up,cowboy shot,fake animal ears,ass,suspender skirt,cat ears", + "Version": "v1.6.0-127-g102b6617", + "sampler": "DPM++ 3M SDE Exponential", + "CFG mode": "Half Cosine Up", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Mimic mode": "Half Cosine Down", + "Model hash": "4556c8bdbf", + "Hires steps": "15", + "Mimic scale": "8.5", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Interpolate Phi": "0.65", + "CFG scale minimum": "5", + "Denoising strength": "0.45", + "Scaling Startpoint": "MEAN", + "Mimic scale minimum": "5", + "Variability Measure": "AD", + "Threshold percentile": "99", + "\"r0P00W0n0j0O0\u0003k0_Lq_LoHA": "698e73fed2d0\"", + "Separate Feature Channels": "True", + "Dynamic thresholding enabled": "True" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/04d667c2-894c-44a8-a48d-3a7d23acb830/width=450/2730672.jpeg", + "nsfw": "None", + "width": 960, + "height": 1280, + "hash": "UEHK^U00Kh9F9a_ND$WB0xoz#mof%NWA^kE1", + "type": "image", + "metadata": { + "hash": "UEHK^U00Kh9F9a_ND$WB0xoz#mof%NWA^kE1", + "size": 1982912, + "width": 960, + "height": 1280 + }, + "meta": { + "VAE": "vae-ft-mse-840000-ema-pruned.safetensors", + "Size": "480x640", + "seed": 4112007047, + "Model": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "steps": 30, + "hashes": { + "vae": "735e4c3a44", + "model": "4556c8bdbf", + "embed:badhandv4": "5e40d722fc", + "embed:EasyNegative": "c74b4e810b", + "embed:ng_deepnegative_v1_75t": "54e7e4826d" + }, + "prompt": "(masterpiece,best quality,high resolution,high quality,hyper detail,best anatomy,illustration:1.3),,1girl,solo,furude rika,blue hair,purple eyes,long hair,blunt bangs,bangs,skirt,fang,shirt,bell,smile,boots,open mouth,red background,v,high heels,heart,crossdressing,frills,looking at viewer,two side up,black skirt,blush,long sleeves,bow,half-closed eyes,belt,jirai kei,black footwear", + "Version": "v1.6.0-127-g102b6617", + "sampler": "DPM++ 3M SDE Exponential", + "CFG mode": "Half Cosine Up", + "VAE hash": "735e4c3a44", + "cfgScale": 30, + "resources": [ + { + "hash": "4556c8bdbf", + "name": "AOM3A1B_orangemixsx0.6+HazyAbyssx0.35+disneyPixarCartoon_v10x0.05x0.99+DreamShaper_8_prunedx0.01", + "type": "model" + } + ], + "Mimic mode": "Half Cosine Down", + "Model hash": "4556c8bdbf", + "Hires steps": "15", + "Mimic scale": "8.5", + "Hires upscale": "2", + "Hires upscaler": "R-ESRGAN 4x+", + "negativePrompt": "(EasyNegative:1.3),(badhandv4, ng_deepnegative_v1_75t:1.2),(worst quality, bad quality, mutated quality, low quality, normal quality, bad anatomy, worst anatomy, mutated anatomy, worst quality hands, mutated fingers, mutated pupil, mutated nipples, big nipples, mutated pussy, mature, milf, otoko_no_ko:1.4),(censored, mosaic censoring, bar censor:1.5)", + "Interpolate Phi": "0.65", + "CFG scale minimum": "5", + "Denoising strength": "0.45", + "Scaling Startpoint": "MEAN", + "Mimic scale minimum": "5", + "Variability Measure": "AD", + "Threshold percentile": "99", + "\"r0P00W0n0j0O0\u0003k0_Lq_LoHA": "698e73fed2d0\"", + "Separate Feature Channels": "True", + "Dynamic thresholding enabled": "True" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/172810" + } + ] +} +---------------------------- diff --git "a/Styles/444/\351\251\254\350\265\233\345\205\213-metadata.json" "b/Styles/444/\351\251\254\350\265\233\345\205\213-metadata.json" new file mode 100644 index 0000000000000000000000000000000000000000..1ffa4872da4c1e4fb38d490fc1b560b221d20f65 --- /dev/null +++ "b/Styles/444/\351\251\254\350\265\233\345\205\213-metadata.json" @@ -0,0 +1,86 @@ +{ + "ss_sd_model_name": "炉子一号fp16.ckpt", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "2", + "ss_num_train_images": "500", + "ss_tag_frequency": { + "500_test": { + "test": 1 + } + }, + "ss_enable_bucket": "True", + "ss_max_train_steps": "1750", + "ss_noise_offset": "None", + "ss_shuffle_caption": "True", + "ss_steps": "1750", + "ss_keep_tokens": "0", + "ss_unet_lr": "0.0001", + "ss_gradient_checkpointing": "False", + "ss_training_started_at": "1685941526.0201414", + "ss_text_encoder_lr": "1e-05", + "ss_cache_latents": "True", + "ss_num_batches_per_epoch": "250", + "ss_training_comment": "None", + "ss_num_reg_images": "0", + "ss_max_bucket_reso": "1024", + "ss_session_id": "974399338", + "ss_output_name": "马赛克", + "ss_max_token_length": "255", + "ss_seed": "3278468811", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 512, + 512 + ], + "count": 500 + } + }, + "mean_img_ar_error": 0.0 + }, + "ss_training_finished_at": "1685942238.1405609", + "ss_network_alpha": "32", + "ss_adaptive_noise_scale": "None", + "ss_dataset_dirs": { + "500_test": { + "n_repeats": 500, + "img_count": 1 + } + }, + "ss_caption_dropout_rate": "0.0", + "ss_v2": "False", + "ss_lr_warmup_steps": "500", + "ss_flip_aug": "False", + "ss_network_dim": "64", + "ss_mixed_precision": "fp16", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_lowram": "False", + "ss_reg_dataset_dirs": {}, + "ss_epoch": "7", + "ss_prior_loss_weight": "1", + "ss_num_epochs": "7", + "ss_min_bucket_reso": "256", + "ss_new_sd_model_hash": "5ae02e347a0f80cea8571e3442483f2183c7695cb80b7981288c72c7344a8e41", + "sshs_model_hash": "093742bcf6e406956895423f8c0e80ed9f598cb9f8e6f74bbe7231bc21bd753d", + "ss_sd_scripts_commit_hash": "(unknown)", + "ss_caption_dropout_every_n_epochs": "0", + "ss_sd_model_hash": "1e3a65e3", + "ss_multires_noise_discount": "0.3", + "ss_learning_rate": "0.0001", + "ss_random_crop": "False", + "ss_full_fp16": "False", + "sshs_legacy_hash": "aa9c7568", + "ss_batch_size_per_device": "2", + "ss_network_module": "networks.lora", + "ss_caption_tag_dropout_rate": "0.0", + "ss_total_batch_size": "2", + "ss_face_crop_aug_range": "None", + "ss_color_aug": "False", + "ss_lr_scheduler": "constant_with_warmup", + "ss_multires_noise_iterations": "None", + "ss_max_grad_norm": "1.0", + "ss_bucket_no_upscale": "False", + "ss_gradient_accumulation_steps": "1", + "ss_min_snr_gamma": "None" +} \ No newline at end of file diff --git "a/Styles/444/\351\251\254\350\265\233\345\205\213.txt" "b/Styles/444/\351\251\254\350\265\233\345\205\213.txt" new file mode 100644 index 0000000000000000000000000000000000000000..6643aa2b95059bc6074c766d84fe8aba3146aa12 --- /dev/null +++ "b/Styles/444/\351\251\254\350\265\233\345\205\213.txt" @@ -0,0 +1,150 @@ +Link:https://civitai.com/models/84307/pixel +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- +Recommended weight： 马赛克:1.5 +取到2的话会发生一些微妙的事情 +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1 girl,angle,halo + Negative Prompt:nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark + Size:, Sampler:DPM++ 2S a Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img2: + Prompt:1 girl,flower,petal + Negative Prompt:nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark + Size:, Sampler:DPM++ 2S a Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img3: + Prompt:1 girl,bikini,pool + Negative Prompt:nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark + Size:, Sampler:DPM++ 2S a Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 84307, + "name": "像素（pixel）", + "description": "

Recommended weight： <lora:马赛克:1.5>

取到2的话会发生一些微妙的事情

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 128, + "favoriteCount": 21, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Cinsdia", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/413ee08a-0537-47b8-a230-df633466fecd/width=96/Cinsdia.jpeg" + }, + "tags": [ + "anime", + "pixel", + "style" + ], + "modelVersions": [ + { + "id": 89619, + "modelId": 84307, + "name": "v1.0", + "createdAt": "2023-06-05T07:57:16.03Z", + "updatedAt": "2023-06-05T08:09:24.198Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 128, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "马赛克.safetensors", + "id": 61601, + "sizeKB": 73840.13671875, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-06-05T08:10:28.22Z", + "hashes": { + "AutoV1": "D6B42BA4", + "AutoV2": "47C773BBB9", + "SHA256": "47C773BBB95BB335602033B86E2F4B510073964ECC0C88244ED1D1BF24FE45FC", + "CRC32": "664A03C1", + "BLAKE3": "C10450F49B8F4B112C6E1DF0752CFA60C536FC5181142F5E978F12FC608C11E6" + }, + "downloadUrl": "https://civitai.com/api/download/models/89619", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/829d6c3b-68d8-4545-92ba-ed5e3a7e31fb/width=450/1037158.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UKL|ZOt7?vE10LVs~pt7xtx]D%of-;xuxaxa", + "meta": { + "seed": 3504288991, + "steps": 20, + "prompt": "1 girl,angle,halo", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "negativePrompt": "nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9baf138f-9a8e-4316-a5de-843056434d32/width=450/1037159.jpeg", + "nsfw": "None", + "width": 1024, + "height": 1536, + "hash": "UIL4HH?aO7jX_MX8.7EL^+?ZIV-:og-:-V-:", + "meta": { + "seed": 4277747247, + "steps": 20, + "prompt": "1 girl,flower,petal", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "negativePrompt": "nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bff9e181-7242-4fb9-9ed7-4c2156ea1569/width=450/1037180.jpeg", + "nsfw": "Mature", + "width": 1024, + "height": 1536, + "hash": "UeMQu0?HysMytRNd-:axtQt7xaRjrXs:$NR*", + "meta": { + "seed": 2532567101, + "steps": 20, + "prompt": "1 girl,bikini,pool", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "negativePrompt": "nsfw, (worst quality, low quality:1.4), (bad_prompt_version2:0.8), EasyNegative, badhandv4, text, name, letters, watermark" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/89619" + } + ] +} +---------------------------- diff --git a/Styles/45/etrianv2.1-metadata.json b/Styles/45/etrianv2.1-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/Styles/45/etrianv2.1.txt b/Styles/45/etrianv2.1.txt new file mode 100644 index 0000000000000000000000000000000000000000..827db999c29f2f29b95494ff8d7b5c6132d21c86 --- /dev/null +++ b/Styles/45/etrianv2.1.txt @@ -0,0 +1,1246 @@ +Link:https://civitai.com/models/18500/etrian-odyssey-himukai-yuuji-style +Version:v2.1 +Base Model:Other +Keywords: +--------DESCRIPTION--------- + +Trained on official art from the game and artist this LoRA was blessed by RNGJesus to reliably output some really high quality artwork. It works both as a style for the game and as a general one. +How to use +Just prompt (1boy) or (1girl) and then fantasy tags like "armor", "pointy ears" and so on to trigger the style. You can further refined it using fantasy type characters tags from the Etrian Odyssey game. See the sample images for prompts. I also uploaded the training tags as a separate file you can use as a template to modify. + +AUTOMATIC1111 users can utilize the wildcard prompt below to randomly prompt classes and races from the game.. I recommend using "3d" and "realistic" in negatives on AOM2 and other models with mixed in realism. "Chibi" also seems to work fine for more chubby little adventurers. + +({full|upper} body) +(solo) +(1girl)(facing viewer) +({human|elf|bunny_ear|goat_horns|horse_ears|cat_ears|demon|angel} girl) +in ({barbarian|bard|cleric|druid|fighter|monk|paladin|ranger|rogue|sorcerer|warlock|wizard|artificer} outfit) + +Don't forget to review and upload your own images, it's always fun to see what you're creating! +Like my LoRAs and want more? Please consider a small tip towards my electricity bill and further training > +---------------------------- +-----ABOUT THIS VERSION----- + +Retrained to cut down on filesize. Pruned three images that wasn't 100% on style. +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt: 1girl, solo, twintails, blonde hair, jewelry, dark-skinned female, yellow eyes, dark skin, earrings, navel, open mouth, smile, weapon, simple background, white background, harem outfit, dancer, long hair, armpits, sword, harem pants, armlet, midriff, pants, feathers, bikini, swimsuit, arm up, :d + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img2: + Prompt: a female knight wearing oversized armor + Negative Prompt:(worst quality, low quality:1.0), 3d, realistic + Size:512x640, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img3: + Prompt: 1girl, solo, blue eyes, blonde hair, gloves, smile, open mouth, white background, overalls, goggles, ponytail, goggles on head, simple background, cropped legs, :d, wrench, belt, hammer, bandeau, looking at viewer, blush, bare shoulders, strapless, shorts, white gloves, cowboy shot + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img4: + Prompt: 1girl, solo, holding, white background, long hair, open mouth, simple background, weapon, dress, holding weapon, purple eyes, high heels, gloves, breasts, boots, elbow gloves, aqua hair, frills, blue hair, black footwear, high heel boots, smile, looking at viewer, bright pupils, white pupils, black gloves, scythe, frilled dress, teeth + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img5: + Prompt: 1girl, dark-skinned female, pointy ears, taut white dress, glasses, earrings, hand on hips, gold trim, upper body, navel cutout + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img6: + Prompt: a cat_girl maid doing the paw pose trying to be cute :3 + Negative Prompt:(worst quality, low quality:1.0), 3d, realistic + Size:512x640, Sampler:DPM++ 2M Karras, Steps:20, CFG:7, Clip Skip:2, Model:AbyssOrangeMix2_nsfw-fixed, Model Hash:b0d8210b03 + +img7: + Prompt: solo, 1boy, brown eyes, male focus, labcoat, simple background, white background, syringe, instrument, purple hair, full body, pants + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img8: + Prompt: male focus, 1boy, solo, weapon, mace, shield, white background, purple hair, armor, simple background, grin, smile, full body, yellow eyes, teeth + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img9: + Prompt: 1girl, blonde hair, blue eyes, armored dress, holding gun + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + +img10: + Prompt: 1girl, bunny girl, short shorts, thigh boots, belt, crop top, goggles on head + Negative Prompt:(worst quality, low quality:1.0) + Size:512x640, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:2, Model:NAI-animefull-final-pruned-fixed, Model Hash:e0d8a216df + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 18500, + "name": "Etrian Odyssey / Himukai Yuuji Style", + "description": "

Trained on official art from the game and artist this LoRA was blessed by RNGJesus to reliably output some really high quality artwork. It works both as a style for the game and as a general one.

How to use
Just prompt (1boy) or (1girl) and then fantasy tags like \"armor\", \"pointy ears\" and so on to trigger the style. You can further refined it using fantasy type characters tags from the Etrian Odyssey game. See the sample images for prompts. I also uploaded the training tags as a separate file you can use as a template to modify.

AUTOMATIC1111 users can utilize the wildcard prompt below to randomly prompt classes and races from the game.. I recommend using \"3d\" and \"realistic\" in negatives on AOM2 and other models with mixed in realism. \"Chibi\" also seems to work fine for more chubby little adventurers.

<lora:EtrianV2:1>
({full|upper} body)
(solo)
(1girl)(facing viewer)
({human|elf|bunny_ear|goat_horns|horse_ears|cat_ears|demon|angel} girl)
in ({barbarian|bard|cleric|druid|fighter|monk|paladin|ranger|rogue|sorcerer|warlock|wizard|artificer} outfit)

Don't forget to review and upload your own images, it's always fun to see what you're creating!
Like my LoRAs and want more? Please consider a small tip towards my electricity bill and further training >.<

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": false, + "allowCommercialUse": "None", + "allowDerivatives": false, + "allowDifferentLicense": false, + "stats": { + "downloadCount": 1891, + "favoriteCount": 309, + "commentCount": 5, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "AnyKey", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9fb96a94-1561-4d50-677f-0d1e18381300/width=96/AnyKey.jpeg" + }, + "tags": [ + { + "name": "anime" + }, + { + "name": "game art" + }, + { + "name": "style" + }, + { + "name": "art style" + } + ], + "modelVersions": [ + { + "id": 70819, + "modelId": 18500, + "name": "v2.1", + "createdAt": "2023-05-14T20:08:12.446Z", + "updatedAt": "2023-05-14T20:25:36.221Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Retrained to cut down on filesize. Pruned three images that wasn't 100% on style.

", + "stats": { + "downloadCount": 650, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "EtrianV2.1.safetensors", + "id": 49360, + "sizeKB": 36980.830078125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-14T20:21:05.811Z", + "hashes": { + "AutoV1": "5731107D", + "AutoV2": "9DD54D0FB3", + "SHA256": "9DD54D0FB3DC5939DD1D8895419CD4F7EB6ADC8196158245BE2981B2A1F66D65", + "CRC32": "73C24E99", + "BLAKE3": "F9B562696A8019D7031068C4E032F00FBB075B0AC6A7725DBED253B3F709590E" + }, + "downloadUrl": "https://civitai.com/api/download/models/70819", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fbc2da86-7103-4aad-af70-589adaac4db8/width=450/791169.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UdKT;|IpysOEI8ni4oNGIpxDiws,%LkDIqof", + "meta": { + "Size": "512x640", + "seed": 3701553185, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, solo, twintails, blonde hair, jewelry, dark-skinned female, yellow eyes, dark skin, earrings, navel, open mouth, smile, weapon, simple background, white background, harem outfit, dancer, long hair, armpits, sword, harem pants, armlet, midriff, pants, feathers, bikini, swimsuit, arm up, :d", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e3f7b57d-6deb-4b29-866a-b77f95db526d/width=450/791173.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UJHBl2~p%$NHH=Mx01R+?HsmyDt7M{kDRPog", + "meta": { + "Size": "512x640", + "seed": 1995050305, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na female knight wearing oversized armor", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3ac8d491-519f-4c1a-93f9-c6f8551aec3d/width=450/791174.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UyP6%7t7_4xu%LWBt7ofxtf6WCRjE1ofxaWA", + "meta": { + "Size": "512x640", + "seed": 2042849811, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, solo, blue eyes, blonde hair, gloves, smile, open mouth, white background, overalls, goggles, ponytail, goggles on head, simple background, cropped legs, :d, wrench, belt, hammer, bandeau, looking at viewer, blush, bare shoulders, strapless, shorts, white gloves, cowboy shot", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31062028-af09-456f-8f94-8eb6a1f17949/width=450/791178.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UlMQu1xu?bx[R%R*og%M~pxuIUs;M|WCk8M{", + "meta": { + "Size": "512x640", + "seed": 3142717949, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, solo, holding, white background, long hair, open mouth, simple background, weapon, dress, holding weapon, purple eyes, high heels, gloves, breasts, boots, elbow gloves, aqua hair, frills, blue hair, black footwear, high heel boots, smile, looking at viewer, bright pupils, white pupils, black gloves, scythe, frilled dress, teeth", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/35dc1e72-f189-422d-a55e-2fede834d990/width=450/791184.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UFGugz_N9uwb00M{?v%g9bM_ITDj%gj]xDt7", + "meta": { + "Size": "512x640", + "seed": 1395358967, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, dark-skinned female, pointy ears, taut white dress, glasses, earrings, hand on hips, gold trim, upper body, navel cutout", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d0b3ea2-ec1a-49bc-8b6e-262722dc68e2/width=450/791170.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UEHnmT~A019bMJ-T-;JAn4xZS~ELEOIpM{%M", + "meta": { + "Size": "512x640", + "seed": 1312690713, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na cat_girl maid doing the paw pose trying to be cute :3", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aff253b1-90ee-438e-91ac-36f97e59fb27/width=450/791172.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "U7G[$gM}00-:MeIotk^*00xt?GD*_NofVs9G", + "meta": { + "Size": "512x640", + "seed": 2722394664, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\nsolo, 1boy, brown eyes, male focus, labcoat, simple background, white background, syringe, instrument, purple hair, full body, pants", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3e679371-56fb-492c-9c10-94a97e8c695b/width=450/791171.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "U%LE4$Rk.7WA_N%MxukDt7WBkCaeRjRjRjWU", + "meta": { + "Size": "512x640", + "seed": 3229028864, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\nmale focus, 1boy, solo, weapon, mace, shield, white background, purple hair, armor, simple background, grin, smile, full body, yellow eyes, teeth", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ba5b8c96-f82b-4eb7-95af-c855aaad198e/width=450/791175.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UbKnoBDN.9x^.8~VRoR:.8s+kDkEx]ozWCog", + "meta": { + "Size": "512x640", + "seed": 2785656181, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, blonde hair, blue eyes, armored dress, holding gun", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/afe71329-8ca7-4f5e-9c58-435fab0f89d9/width=450/791179.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UfJRR9t7yZxvoLt8ofRiXARPxat7xvV@R*WV", + "meta": { + "Size": "512x640", + "seed": 2112926842, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "hashes": { + "model": "e0d8a216df" + }, + "prompt": "\n1girl, bunny girl, short shorts, thigh boots, belt, crop top, goggles on head", + "sampler": "Euler a", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2.1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/70819" + }, + { + "id": 69755, + "modelId": 18500, + "name": "v2.0", + "createdAt": "2023-05-13T16:00:43.094Z", + "updatedAt": "2023-05-14T20:25:58.505Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

Retrained with up-to-date methods. This version should work even better on AOM2.

", + "stats": { + "downloadCount": 594, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "EtrianV2.safetensors", + "id": 48712, + "sizeKB": 147574.548828125, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-05-13T16:11:05.457Z", + "hashes": { + "AutoV1": "D3D4220D", + "AutoV2": "E3DA7F559D", + "SHA256": "E3DA7F559DDA1839EE3334072C5C5DA3F85891622AA6A63F716E0444DAEDC583", + "CRC32": "3B9E8D6A", + "BLAKE3": "4F553460D0A0051F8FB929440C8EE970769E4B3EEA16F006CA705C8AC271FBD5" + }, + "downloadUrl": "https://civitai.com/api/download/models/69755", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/327899dc-72b3-4c44-ba78-6f9af93fb05b/width=450/778828.jpeg", + "nsfw": "Soft", + "width": 640, + "height": 512, + "hash": "UUIE%%IW5Prs~oM|E1n-ouNGROog-pM_slb0", + "meta": { + "Size": "640x512", + "seed": 3464637433, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n1girl, Alice, standing, blonde hair, blue eyes, blue armored dress, white apron, red hairband, arms crossed, smiling smugly, outdoors", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e608438b-09da-429c-a312-38bdd07a5297/width=450/778853.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 640, + "hash": "USJ7H-={5k%}~qxa%K?u?bWrWX?Ho#s;WCS4", + "meta": { + "Size": "512x640", + "seed": 4207438311, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na barbarian girl admiring her new leather armor", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/879a4a9a-1094-4c3f-9ca6-e0b0db8d4dbf/width=450/778862.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 640, + "hash": "UqKA.?M{%#t7~qR*%gt7I;t7oIR*j[R*RPoK", + "meta": { + "Size": "512x640", + "seed": 3843863439, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na draph girl with uselessly huge breasts that barely fits inside her tight armored dress", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5e64ffe9-5299-4393-972f-a0d4ea7988b6/width=450/778850.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 640, + "hash": "UHKA=^%LG^NL00e.9FNGyEV@wbxu01js%2RP", + "meta": { + "Size": "512x640", + "seed": 3372692220, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n(full body)\n(solo)\n(1girl)(facing viewer)\n(bunny_ear girl)\nin \n(wizard outfit)", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f5d62b80-b001-48b7-866f-1dde03c2ec48/width=450/778859.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UTHnToRO~TIU9bE3WXNG4:f+jIbbxst5t6s.", + "meta": { + "Size": "512x640", + "seed": 1414153265, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na goat_horned girl peeking around corner doing the :3 face", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8e4d25b-aac9-45af-9ca5-804cd3e2d73f/width=450/778847.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UKJs?~.81M~Bt+-;t9_2_M?H?Gt74U%1x]s:", + "meta": { + "Size": "512x640", + "seed": 3741916496, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\nan elf in a pajamas yawning sleepily at the kitchen table", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a517ce50-0273-4381-9f41-e8348ab9fdc1/width=450/778846.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UeHB#PDkS|oy_LMzbbSd.7WTs;kV.7Sdjcxt", + "meta": { + "Size": "512x640", + "seed": 3784910610, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na paladin girl sleeping on a grassy knoll", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/553bb490-0336-4ec3-868d-12e37b0062da/width=450/778851.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UKI4njjb_3oL?uj@NeR*~ps:a}of%Mayn%WC", + "meta": { + "Size": "512x640", + "seed": 2810004185, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n(full body)\n(solo)\n(1girl)(facing viewer)\n(demon girl)\nin \n(veteran outfit)", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f17cdfb6-8198-46ab-a7ca-48e3f57ee253/width=450/778856.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 640, + "hash": "UXJ7?kRj%#Na?as:kXoz_Ni^?bkDt7Nd$*%1", + "meta": { + "Size": "512x640", + "seed": 3894645729, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\na female elf hunting wild boars", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bd842673-d105-44b3-bbfa-a676a0e91731/width=450/778838.jpeg", + "nsfw": "None", + "width": 640, + "height": 512, + "hash": "UAJG.r00L1=^59tR0gxY00%f9G%M56-O~UIB", + "meta": { + "Size": "640x512", + "seed": 2687289762, + "Model": "AbyssOrangeMix2_nsfw-fixed", + "steps": 20, + "hashes": { + "model": "b0d8210b03" + }, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)\n(horse_ears girl)\nin \n(wizard outfit)", + "sampler": "Euler a", + "cfgScale": 6, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianV2", + "type": "lora", + "weight": 1 + }, + { + "hash": "b0d8210b03", + "name": "AbyssOrangeMix2_nsfw-fixed", + "type": "model" + } + ], + "Model hash": "b0d8210b03", + "negativePrompt": "(worst quality, low quality:1.0), 3d, realistic" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/69755" + }, + { + "id": 21948, + "modelId": 18500, + "name": "v1.0", + "createdAt": "2023-03-12T05:52:11.831Z", + "updatedAt": "2023-05-14T20:08:12.446Z", + "trainedWords": [], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

1.0 - Initial release

", + "stats": { + "downloadCount": 647, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "EtrianOdyssey.safetensors", + "id": 18293, + "sizeKB": 55413.9033203125, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-03-12T05:56:35.157Z", + "hashes": { + "AutoV1": "0FBE62B5", + "AutoV2": "5B2FCCEB20", + "SHA256": "5B2FCCEB20F524233B92BFAF1E90D8402AF3CF5A55BE834F7E4FB0D92BE012EF", + "CRC32": "0F886F72", + "BLAKE3": "A253B4673C8D59C109982CAFCA70780B7B0503A25C75F809488B1AB069ABB28E" + }, + "downloadUrl": "https://civitai.com/api/download/models/21948", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/606e2a60-4643-4a27-e810-0424dbaaab00/width=450/234634.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UDG[iz-:00MyzUaeAcIqwsk9?akC*JR-m8nO", + "meta": { + "Size": "512x640", + "seed": 1152486772, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)(smile)(:D)\n(human girl)\nin \n(alchemist outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d270fc85-3069-49ec-4d83-b30fb50b5e00/width=450/234653.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UEF=,S-UP;vz.8.8x]-o00xs=^bu4;-TwHSz", + "meta": { + "Size": "512x640", + "seed": 1847914310, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "\n(upper body)\n(solo)\n(1boy)(facing viewer)\n(human boy)\nin \n(protector outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3b459667-d480-44f5-d7dc-a40910c31b00/width=450/234652.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UFIhHUD+00W.}+E2S5%L01%1R+t60gWC-nWE", + "meta": { + "Size": "512x640", + "seed": 1152348888, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "(chibi)\n(upper body)\n(solo)\n(1girl)(facing viewer)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/59ab6c63-7314-4783-7f0b-1ecef331f600/width=450/234651.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "U8GudtR%00IV4nIns=WAbcax~pbHDiIT^+Ri", + "meta": { + "Size": "512x640", + "seed": 669544850, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)(smile)(:D)\n(bunny girl)\nin \n(alchemist outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/39ebbbc3-2c53-401b-8464-a709af3ee700/width=450/234650.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "U8FFd8_40000DjE1R*WVO@?aiwD%D*9FM_?b", + "meta": { + "Size": "512x640", + "seed": 3105235803, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4bca5ca0-2384-4ebf-e4bb-dc0e63a04600/width=450/234649.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 640, + "hash": "UJG+gm00Ey+v*JIAI:VY.lRQt5IA-;bwxZaK", + "meta": { + "Size": "512x640", + "seed": 1380024005, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)(smile)\n(bunny girl)\nin \n(bra, bike shorts, (), puffy short sleeves, socks, underwear)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/da600303-2f24-40bb-6bad-d3a4a3137800/width=450/234648.jpeg", + "nsfw": "None", + "width": 640, + "height": 512, + "hash": "UFHUte~0=:5v.8n0D%KT9vM|RjRj%gs+%2$%", + "meta": { + "Size": "640x512", + "seed": 718314427, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)(smile)(:D)\n(human girl)\nin \n(troubadour outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2ce923b9-0ea8-4d3a-f1e8-77e59886b900/width=450/234647.jpeg", + "nsfw": "None", + "width": 640, + "height": 512, + "hash": "URIqZ6.6oyIW~BxuIoIoNZaeMzRQS0j?r@V[", + "meta": { + "Size": "640x512", + "seed": 2437248985, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "(chibi)\n(upper body)\n(solo)\n(1girl)(facing viewer)\n(elf girl)\nin \n(protector outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4e73a2c9-801f-45c1-a086-7190cb0e0f00/width=450/234646.jpeg", + "nsfw": "None", + "width": 640, + "height": 512, + "hash": "UKKS3TO?.nrD|HsoNusA$NwJoKbvNHRjSeOD", + "meta": { + "Size": "640x512", + "seed": 3464124080, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 20, + "prompt": "\n(upper body)\n(solo)\n(1girl)(facing viewer)(smile)(raised hand, raised index finger)\n(bunny girl)\nin \n(dark hunter outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6e85ac6a-a0f4-45bf-8cbf-e6b65b15fc00/width=450/234645.jpeg", + "nsfw": "None", + "width": 512, + "height": 640, + "hash": "UAH24Z%M9yR-~Tn~9cM~IUoexvNH9dWX-ls.", + "meta": { + "Size": "512x640", + "seed": 1165518979, + "Model": "NAI-animefull-final-pruned-fixed", + "steps": 30, + "prompt": "(chibi)\n(full body)\n(solo)\n(1girl)(facing viewer)\n(bunny girl)\nin \n(hexer outfit)", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "Clip skip": "2", + "resources": [ + { + "name": "EtrianOdyssey", + "type": "lora", + "weight": 1 + }, + { + "hash": "e0d8a216df", + "name": "NAI-animefull-final-pruned-fixed", + "type": "model" + } + ], + "Model hash": "e0d8a216df", + "negativePrompt": "(worst quality, low quality:1.0),simple background" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/21948" + } + ] +} +---------------------------- diff --git a/Styles/46/extracted_apostlestyle_10_dim16-metadata.json b/Styles/46/extracted_apostlestyle_10_dim16-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..03b31ce9abe3938ca13bac86997745fd5656767a --- /dev/null +++ b/Styles/46/extracted_apostlestyle_10_dim16-metadata.json @@ -0,0 +1,6 @@ +{ + "ss_network_alpha": "16", + "ss_network_dim": "16", + "sshs_legacy_hash": "07d341f8", + "sshs_model_hash": "6173f3feff38cc40942c8dd10f90a8f3d8c1850b084288196daa5d81d9dd7ca9" +} \ No newline at end of file diff --git a/Styles/46/extracted_apostlestyle_10_dim16.txt b/Styles/46/extracted_apostlestyle_10_dim16.txt new file mode 100644 index 0000000000000000000000000000000000000000..7c5d23775ad9acd1bdcc22b26891561883ac3112 --- /dev/null +++ b/Styles/46/extracted_apostlestyle_10_dim16.txt @@ -0,0 +1,398 @@ +NOTES: this is the -info.txt from the original dreambooth model from which this lora was extracted from! +-------------------------- +Link:https://civitai.com/models/6272/apostle-style +Version:1.0 +Base Model:SD 1.5 +Keywords:art by apstle +--------DESCRIPTION--------- + +This model was trained with 400 images of Apostle's art available at Nozomi. +to force the style the prompt art by apstle must be used. +training was performed in 12000 steps with a learning rate of 2e-6. +The text encoder was not trained. No regularization images were used. +the base model was Anything V4 +all training was done in Google Colab for free with a Tesla T4 and took about 2 hours. +the notebook used was the one from TheLastBen. +Typical negative prompts: +Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:art by apstle, misty, xmas clothes + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x768, Sampler:Euler a, Steps:35, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img2: + Prompt:cat_girl, neko, kitty, furry, cat_ear, tail, whiskers, cat_paws, nekomimi, playful + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img3: + Prompt:art by apstle, blonde_hair, blue_eyes, barefoot, swimwear, ocean, beach, bikini, tan, sand, sun + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:10, Clip Skip:0, Model:apstle, Model Hash: +img4: + Prompt:art by apstle, teacher, classroom, lesson, lecture, knowledge, education, instruct, mentor, academic, knowledgeable + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:568x728, Sampler:Euler a, Steps:35, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img5: + Prompt:art by apstle, school_uniform, skirt, ponytail, socks, classroom, teacher, lesson, lecture, student, knowledge + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x768, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img6: + Prompt:art by apstle,yuri, lesbian, girls_love, kiss, romance, love, affection, emotional, sensual, relationship + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img7: + Prompt:art by apstle, lingerie, stockings, garter_belt, high_heels, seductive, alluring, sexual, intimate, provocative, tempting + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:576x512, Sampler:Euler a, Steps:50, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img8: + Prompt:art by (((apstle))), anime, cosplay, costume, superhero, fantasy, roleplay, costume_play, adventurous, thrilling + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:35, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img9: + Prompt:art by apstle, dragon_girl, dragon, scales, fire_breath, mythical, powerful + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:720x512, Sampler:Euler a, Steps:35, CFG:7, Clip Skip:0, Model:apstle, Model Hash: +img10: + Prompt:art by apstle, misty, orange hair, having sex + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x768, Sampler:Euler a, Steps:35, CFG:7, Clip Skip:0, Model:apstle, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 6272, + "name": "Apostle Style", + "description": "

This model was trained with 400 images of Apostle's art available at Nozomi.

to force the style the prompt art by apstle must be used.

training was performed in 12000 steps with a learning rate of 2e-6.

The text encoder was not trained. No regularization images were used.

the base model was Anything V4.

all training was done in Google Colab for free with a Tesla T4 and took about 2 hours.

the notebook used was the one from TheLastBen.

Typical negative prompts:

Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))

", + "type": "Checkpoint", + "poi": false, + "nsfw": true, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 200, + "favoriteCount": 39, + "commentCount": 0, + "ratingCount": 1, + "rating": 5 + }, + "creator": { + "username": "Nektarine", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07fc2e87-eeb6-4cd2-0c3a-18093334fc00/width=96/Nektarine.jpeg" + }, + "tags": [ + { + "name": "anime" + }, + { + "name": "style" + } + ], + "modelVersions": [ + { + "id": 7353, + "modelId": 6272, + "name": "1.0", + "createdAt": "2023-02-02T05:16:51.507Z", + "updatedAt": "2023-02-02T05:16:51.507Z", + "trainedWords": [ + "art by apstle" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 204, + "ratingCount": 1, + "rating": 5 + }, + "files": [ + { + "name": "apostleStyle_10.ckpt", + "id": 7433, + "sizeKB": 2082861.063476562, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "PickleTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-02T05:39:44.399Z", + "hashes": { + "AutoV1": "68DF4953", + "AutoV2": "110016AE2A", + "SHA256": "110016AE2A1125100A099B6060D6F957E68B186C25D06EC46459F30B55CC85C5", + "CRC32": "8C954039", + "BLAKE3": "21BA188E15658036530E94B42F1E864D641D19B8D780967E7038AF38D674C3BD" + }, + "downloadUrl": "https://civitai.com/api/download/models/7353", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8af4050d-bbf5-4674-4362-9aceaa3d1a00/width=450/68338.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UGI|]?%#2Q}+9s~8S$x@~pa6IATJ4UNZyC=|", + "meta": { + "Size": "512x768", + "seed": 1322550587, + "Model": "apstle", + "steps": 35, + "prompt": "art by apstle, misty, xmas clothes", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/46227cf9-e5b3-494c-3017-fca15c259900/width=450/68352.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UEJaltM,Bd?b~TRhEMb@_1soD,%10|tRxwxa", + "meta": { + "Size": "512x512", + "seed": 1726533170, + "Model": "apstle", + "steps": 40, + "prompt": "cat_girl, neko, kitty, furry, cat_ear, tail, whiskers, cat_paws, nekomimi, playful", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/9ca2d291-1fc4-40d0-f042-2e1fb27b7600/width=450/68351.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UKK^{l4v3ZV#CAniIDoy%It6=sgMx_bbJoWE", + "meta": { + "Size": "512x512", + "seed": 3970629785, + "Model": "apstle", + "steps": 40, + "prompt": "art by apstle, blonde_hair, blue_eyes, barefoot, swimwear, ocean, beach, bikini, tan, sand, sun", + "sampler": "Euler a", + "cfgScale": 10, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/497cceb9-0a23-4486-d5a8-3dfb70197800/width=450/68350.jpeg", + "nsfw": false, + "width": 568, + "height": 728, + "hash": "UCIqlr02?[%N_LE2Os-U=_D*9Z?akqt7%MM{", + "meta": { + "Size": "568x728", + "seed": 2003004481, + "Model": "apstle", + "steps": 35, + "prompt": "art by apstle, teacher, classroom, lesson, lecture, knowledge, education, instruct, mentor, academic, knowledgeable", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1cef31ec-3542-4bdb-7ca6-fc5edcb72900/width=450/68349.jpeg", + "nsfw": false, + "width": 512, + "height": 768, + "hash": "UJJHjrIU~V-o?v9a-;Rk-pIV4oM{D%t8?GjZ", + "meta": { + "Size": "512x768", + "seed": 3334297774, + "Model": "apstle", + "steps": 40, + "prompt": "art by apstle, school_uniform, skirt, ponytail, socks, classroom, teacher, lesson, lecture, student, knowledge", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/31d3be8f-87f0-47e8-3f47-7d804fcdc400/width=450/68348.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "U9JG?100R:?[00.6$MIB15yCyDD*-T4pX9?u", + "meta": { + "Size": "512x512", + "seed": 4068089449, + "Model": "apstle", + "steps": 40, + "prompt": "art by apstle,yuri, lesbian, girls_love, kiss, romance, love, affection, emotional, sensual, relationship", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e56f5448-99c0-4df8-a2a7-d403ed23d000/width=450/68347.jpeg", + "nsfw": true, + "width": 576, + "height": 512, + "hash": "U8HAnu009GV[00rr_2J600_L-Brs?uoz0Lt6", + "meta": { + "Size": "576x512", + "seed": 1802891363, + "Model": "apstle", + "steps": 50, + "prompt": "art by apstle, lingerie, stockings, garter_belt, high_heels, seductive, alluring, sexual, intimate, provocative, tempting", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6101a793-4343-4bce-8982-f4e120edab00/width=450/68346.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UTHxc|DkcEV[?w57%3xH?bo#I[IUtRS4WVof", + "meta": { + "Size": "512x512", + "seed": 2169760386, + "Model": "apstle", + "steps": 35, + "prompt": "art by (((apstle))), anime, cosplay, costume, superhero, fantasy, roleplay, costume_play, adventurous, thrilling", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/63379a75-54ea-4987-6ced-962464336100/width=450/68345.jpeg", + "nsfw": false, + "width": 720, + "height": 512, + "hash": "UXHwcx{I?F-:%ii_WTg4IVjKkXIUnOofozjF", + "meta": { + "Size": "720x512", + "seed": 2263864659, + "Model": "apstle", + "steps": 35, + "prompt": "art by apstle, dragon_girl, dragon, scales, fire_breath, mythical, powerful", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6bf1406a-5b2c-41e6-d4bf-739ed8af4900/width=450/68344.jpeg", + "nsfw": true, + "width": 512, + "height": 768, + "hash": "UCHK@HQS2nx_1wI99tIv}]D#-=kD?vs75qS%", + "meta": { + "Size": "512x768", + "seed": 827257906, + "Model": "apstle", + "steps": 35, + "prompt": "art by apstle, misty, orange hair, having sex", + "sampler": "Euler a", + "cfgScale": 7, + "resources": [ + { + "hash": "110016ae2a", + "name": "apstle", + "type": "model" + } + ], + "Model hash": "110016ae2a", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/7353" + } + ] +} +---------------------------- diff --git a/Styles/47/extracted_diivesstyle_10_dim16-metadata.json b/Styles/47/extracted_diivesstyle_10_dim16-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..eec4c182e376da90f6aa6ad7f71b440f973e7143 --- /dev/null +++ b/Styles/47/extracted_diivesstyle_10_dim16-metadata.json @@ -0,0 +1,6 @@ +{ + "ss_network_alpha": "16", + "ss_network_dim": "16", + "sshs_legacy_hash": "07d341f8", + "sshs_model_hash": "867c60145ea9f4be59ae4d8366530895ca0cdd09b54d08ff1cc6465d9be248b9" +} \ No newline at end of file diff --git a/Styles/47/extracted_diivesstyle_10_dim16.txt b/Styles/47/extracted_diivesstyle_10_dim16.txt new file mode 100644 index 0000000000000000000000000000000000000000..a30c42fcf11583b919ecb3cbe4e6b8f6b1e907e8 --- /dev/null +++ b/Styles/47/extracted_diivesstyle_10_dim16.txt @@ -0,0 +1,351 @@ +NOTES: this is the -info.txt from the original dreambooth model from which this lora was extracted from! +-------------------------- +Link:https://civitai.com/models/5136/diives-style +Version:1.0 +Base Model:Other +Keywords:diives,diives art,by diives,art by diives,in the style of diives,diives style,cartoon,drawing +--------DESCRIPTION--------- + +This model was trained with the Diives art available at Gelbooru. +to force the style you must use the prompt diives, diives art, by diives, art by diives, in the style of diives, diives style, cartoon, drawing +training was done in 6000 steps with a learning rate 2e-6. +The text encoder was not trained. No regularization images were used. +the base model was Anything V4 with 512 x 512 images +all training was done on Google Colab free with a Tesla T4 and took about 1 hour. +the notebook used was the one from TheLastBen +just in case I attach the VAE of Anything V4. I'm not sure yet if it improves the results much, but you don't lose anything by using it. +Typical negative prompts: +Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:art by diives, girl in the beach, white bikini + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img3: + Prompt:art by diives, 1girl, casual pose, green skirt, white panties + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img4: + Prompt:art by diives, girl in sports clothes, doing yoga + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img5: + Prompt:art by diives, girl in sports clothes training, yoga + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img6: + Prompt:art by diives, curvy hatsune miku, sport bra, sexy pose + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img7: + Prompt:art by diives, girl in denim shorts, golden hair + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img8: + Prompt:flat art by (((diives))), 1boy, 1girl, beach, bikini, bikini_aside, blush, breasts, clothed_sex, clothing_aside, day, eyebrows_visible_through_hair, green_bikini, green_bra, green_eyes, green_hair, green_panties, green_shirt, green_skirt, hetero, medium_breasts, navel, open_mouth, outdoors, panties_aside, penis, pussy, pussy_juice, sex, short_hair, skirt, solo_focus, spread_legs, swimsuit, uncensored, vaginal + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img9: + Prompt:art by diives, 1girl, provocative pose, blue skirt, white panties + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:diives, Model Hash: +img10: + Prompt:art by diives, 1girl, :d, bangle, bracelet, colored_skin, jewelry, long_hair, open_mouth, pink_hair, simple_background, smile, solo, white_background, wristband + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:diives, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 5136, + "name": "Diives Style", + "description": "

This model was trained with the Diives art available at Gelbooru.

to force the style you must use the prompt diives, diives art, by diives, art by diives, in the style of diives, diives style, cartoon, drawing

training was done in 6000 steps with a learning rate 2e-6.

The text encoder was not trained. No regularization images were used.

the base model was Anything V4 with 512 x 512 images

all training was done on Google Colab free with a Tesla T4 and took about 1 hour.

the notebook used was the one from TheLastBen.

just in case I attach the VAE of Anything V4. I'm not sure yet if it improves the results much, but you don't lose anything by using it.

Typical negative prompts:

Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))

", + "type": "Checkpoint", + "poi": false, + "nsfw": true, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 477, + "favoriteCount": 89, + "commentCount": 2, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Nektarine", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07fc2e87-eeb6-4cd2-0c3a-18093334fc00/width=96/Nektarine.jpeg" + }, + "tags": [ + { + "name": "draw style" + }, + { + "name": "diives style" + }, + { + "name": "diives" + }, + { + "name": "artstyle" + } + ], + "modelVersions": [ + { + "id": 5951, + "modelId": 5136, + "name": "1.0", + "createdAt": "2023-01-24T04:03:11.557Z", + "updatedAt": "2023-01-24T04:03:11.557Z", + "trainedWords": [ + "diives", + "diives art", + "by diives", + "art by diives", + "in the style of diives", + "diives style", + "cartoon", + "drawing" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 477, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "diivesStyle_10.ckpt", + "id": 6201, + "sizeKB": 2082861.063476562, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "PickleTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "**Detected Pickle imports (3)**\n```\ntorch.HalfStorage\ntorch._utils._rebuild_tensor_v2\ncollections.OrderedDict\n```", + "virusScanResult": "Success", + "scannedAt": "2023-01-24T04:11:30.565Z", + "hashes": { + "AutoV1": "68DF4953", + "AutoV2": "8B0B2386DF", + "SHA256": "8B0B2386DF3D2818585A5DE2BE2835B030653DBA71F538C688869BD8B7714FA2", + "CRC32": "759512D5", + "BLAKE3": "10962CFA17847C11A7766E819F6F6808C9F8BA6FF518C326B1C65474230013A1" + }, + "downloadUrl": "https://civitai.com/api/download/models/5951", + "primary": true + }, + { + "name": "anything-v4.0.vae.pt", + "id": 6202, + "sizeKB": 803518.3623046875, + "type": "VAE", + "metadata": { + "format": "Other" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "**Detected Pickle imports (5)**\n*Dangerous import detected*\n```\n*pytorch_lightning.callbacks.model_checkpoint.ModelCheckpoint*\npytorch_lightning.callbacks.model_checkpoint.ModelCheckpoint\ntorch._utils._rebuild_tensor_v2\ncollections.OrderedDict\ntorch.LongStorage\n```", + "virusScanResult": "Success", + "scannedAt": "2023-01-24T04:15:41.913Z", + "hashes": { + "AutoV1": "F458B5C6", + "AutoV2": "F921FB3F29", + "SHA256": "F921FB3F29891D2A77A6571E56B8B5052420D2884129517A333C60B1B4816CDF", + "CRC32": "65AEACBA", + "BLAKE3": "2E175004F953D6DC373A9DD18BF8A1845983EB6E1B3D6EA0C76A81D344244F18" + }, + "downloadUrl": "https://civitai.com/api/download/models/5951?type=VAE&format=Other" + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/cfddc96d-e517-4842-a922-1690e3098e00/width=450/50514.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UIM$-}L#CT^J00MwEp$^q9YMi{xZ0~NEDjrc", + "meta": { + "Size": "512x512", + "seed": 2946243565, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, girl in the beach, white bikini", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f7bc12d3-ce34-48bf-7e7f-ca9e94f00700/width=450/50524.jpeg", + "nsfw": false, + "width": 509, + "height": 511, + "hash": "UPL4TvuJ,A-T0MB{xTax49ZexTr==d=WKJkq", + "meta": null + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5d758f20-12c8-4e78-3f20-7a6bba957e00/width=450/50523.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UfO3p[K|$,we_-P7aLv-NXImNFwOP8+%$+Om", + "meta": { + "Size": "512x512", + "seed": 3893958443, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, 1girl, casual pose, green skirt, white panties", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/be95af75-6c23-4344-8fa7-8d979b273900/width=450/50522.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UIMGx9*L?sN1K*L#-=xu?dIRT1%e4n-:jwNH", + "meta": { + "Size": "512x512", + "seed": 554547136, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, girl in sports clothes, doing yoga", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/815f2d03-2379-48e6-b8eb-478da010c400/width=450/50521.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UeJ96}tmysRkt,-:N|r;$voe-8$%W8WFxZnj", + "meta": { + "Size": "512x512", + "seed": 435335347, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, girl in sports clothes training, yoga", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0923e518-10a0-4a3a-8b43-d48b77918900/width=450/50520.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UXMP|Nr];BJ7}csq+foezroMwcsoQ:NZx[Na", + "meta": { + "Size": "512x512", + "seed": 1486497810, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, curvy hatsune miku, sport bra, sexy pose", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0a9a0d8c-62df-4503-2a8f-860df4d9a800/width=450/50519.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "URI=PxnixBTLS=w@WUWs?@t1oIRoFekRocR;", + "meta": { + "Size": "512x512", + "seed": 3302896345, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, girl in denim shorts, golden hair", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7bc4fd6b-ce42-4436-ddde-d99592764000/width=450/50518.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UKKLv]L9EV5^8Fj8$^%N9p-yR$rq_IOr%3?F", + "meta": { + "Size": "512x512", + "seed": 829054891, + "Model": "diives", + "steps": 20, + "prompt": "flat art by (((diives))), 1boy, 1girl, beach, bikini, bikini_aside, blush, breasts, clothed_sex, clothing_aside, day, eyebrows_visible_through_hair, green_bikini, green_bra, green_eyes, green_hair, green_panties, green_shirt, green_skirt, hetero, medium_breasts, navel, open_mouth, outdoors, panties_aside, penis, pussy, pussy_juice, sex, short_hair, skirt, solo_focus, spread_legs, swimsuit, uncensored, vaginal", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "Variation seed": "3662837613", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))", + "Variation seed strength": "0.42" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5521ac41-f4ae-4875-209b-9fee4803fa00/width=450/50517.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UUKw-O@qxtK7D=zV}oAd-6tRICrrRpv~M{xC", + "meta": { + "Size": "512x512", + "seed": 3492276660, + "Model": "diives", + "steps": 20, + "prompt": "art by diives, 1girl, provocative pose, blue skirt, white panties", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6fe6a068-3263-44ce-ddb3-ca988744df00/width=450/50516.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UgRT21xu-Hwh$-V@o@aztQoeRSa|xHW-ofn,", + "meta": { + "Size": "512x512", + "seed": 3655147030, + "Model": "diives", + "steps": 40, + "prompt": "art by diives, 1girl, :d, bangle, bracelet, colored_skin, jewelry, long_hair, open_mouth, pink_hair, simple_background, smile, solo, white_background, wristband", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "8b0b2386df", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, (((signature))), (((watermark))), (((username))), (((text))), blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/5951" + } + ] +} +---------------------------- diff --git a/Styles/48/extracted_reithentaistyle_10_dim16-metadata.json b/Styles/48/extracted_reithentaistyle_10_dim16-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..76363a2204b15f353e37cc9ec8d0db5a638dc93a --- /dev/null +++ b/Styles/48/extracted_reithentaistyle_10_dim16-metadata.json @@ -0,0 +1,6 @@ +{ + "ss_network_alpha": "16", + "ss_network_dim": "16", + "sshs_legacy_hash": "07d341f8", + "sshs_model_hash": "b6d78a8732589a2195f81496ea934dafa289c2e6d254c1ccb1141a860cd5307c" +} \ No newline at end of file diff --git a/Styles/48/extracted_reithentaistyle_10_dim16.txt b/Styles/48/extracted_reithentaistyle_10_dim16.txt new file mode 100644 index 0000000000000000000000000000000000000000..aeaeb5879a0a67f30d18c533f81984e869a8dae3 --- /dev/null +++ b/Styles/48/extracted_reithentaistyle_10_dim16.txt @@ -0,0 +1,256 @@ +NOTES: this is the -info.txt from the original dreambooth model from which this lora was extracted from! +-------------------------- +Link:https://civitai.com/models/4923/reit-hentai-style +Version:1.0 +Base Model:Other +Keywords:reithentai,reithentai art,reithentai style,art by reithentai +--------DESCRIPTION--------- + +This model was trained with the Reit Hentai art available at Gelbooru. +364 images were used, and the training was done in 6500 steps with a learning rate 2e-6. +the base model was Anything V4. +The text encoder was not trained. More than 3000 regularization images from the dataset waifu-regularization-3.3k were used +all training was done on Google Colab free with a Tesla T4 and took about 1 hour and a quarter. +the notebook used was the one from TheLastBen + +you can accentuate / force the Reit style by adding reithentai, reithentai art, reithentai style or art by reithentai at the prompt. + +Typical negative prompts: + +Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + +---------------------------- +-----ABOUT THIS VERSION----- + +initial test version (and probably the only one) +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:hatsune miku in the beach, cyan bikini + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:model, Model Hash: +img2: + Prompt:princess peach with gym clothes + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:model, Model Hash: +img3: + Prompt:1girl, :d, bangle, bracelet, colored_skin, jewelry, long_hair, open_mouth, pink_hair, simple_background, smile, solo, white_background, wristband + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:model, Model Hash: +img4: + Prompt:busty girl having sex in a red bikini + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:model, Model Hash: +img5: + Prompt:furry foxy girl with a cute expression having hard sex + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:20, CFG:7, Clip Skip:0, Model:model, Model Hash: +img6: + Prompt:megpoid gumi, green bikini, having sex + Negative Prompt:Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck))) + Size:512x512, Sampler:Euler a, Steps:40, CFG:7, Clip Skip:0, Model:model, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 4923, + "name": "Reit Hentai Style", + "description": "

This model was trained with the Reit Hentai art available at Gelbooru.

364 images were used, and the training was done in 6500 steps with a learning rate 2e-6.

the base model was Anything V4.

The text encoder was not trained. More than 3000 regularization images from the dataset waifu-regularization-3.3k were used

all training was done on Google Colab free with a Tesla T4 and took about 1 hour and a quarter.

the notebook used was the one from TheLastBen.

you can accentuate / force the Reit style by adding reithentai, reithentai art, reithentai style or art by reithentai at the prompt.

Typical negative prompts:

Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry, ((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))

", + "type": "Checkpoint", + "poi": false, + "nsfw": true, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 637, + "favoriteCount": 92, + "commentCount": 8, + "ratingCount": 1, + "rating": 4 + }, + "creator": { + "username": "Nektarine", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/07fc2e87-eeb6-4cd2-0c3a-18093334fc00/width=96/Nektarine.jpeg" + }, + "tags": [ + { + "name": "anime" + }, + { + "name": "reithentai" + }, + { + "name": "reit" + }, + { + "name": "art style" + } + ], + "modelVersions": [ + { + "id": 5672, + "modelId": 4923, + "name": "1.0", + "createdAt": "2023-01-21T02:09:00.191Z", + "updatedAt": "2023-01-21T02:09:00.191Z", + "trainedWords": [ + "reithentai", + "reithentai art", + "reithentai style", + "art by reithentai" + ], + "baseModel": "Other", + "earlyAccessTimeFrame": 0, + "description": "

initial test version (and probably the only one)

", + "stats": { + "downloadCount": 637, + "ratingCount": 1, + "rating": 4 + }, + "files": [ + { + "name": "reitHentaiStyle_10.ckpt", + "id": 5885, + "sizeKB": 2082871.739257812, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "PickleTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "**Detected Pickle imports (3)**\n```\ncollections.OrderedDict\ntorch.HalfStorage\ntorch._utils._rebuild_tensor_v2\n```", + "virusScanResult": "Success", + "scannedAt": "2023-01-21T02:16:32.339Z", + "hashes": { + "AutoV1": "791386B2", + "AutoV2": "69AE6595E4", + "SHA256": "69AE6595E42C3CAD737C5B336BB68BB818134472E98E97DD42EE34AAF4C2C79E", + "CRC32": "CBF116AF", + "BLAKE3": "E71A71FE801862C93A10676261B06E8F10F5FEE28D7EDC263058E23CB7BC90EE" + }, + "downloadUrl": "https://civitai.com/api/download/models/5672", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b4fca41a-8ad4-4f6c-220d-77b31d4b6600/width=450/46199.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UGJSqQ~VL0M#%fEl;fIpGI9$RlAH5@BpNHxG", + "meta": { + "Size": "512x512", + "seed": 177939135, + "Model": "model", + "steps": 40, + "prompt": "hatsune miku in the beach, cyan bikini", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d340aab5-a3c8-4537-558c-7708ef808a00/width=450/46204.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UWLp:j9$Os$fpyI^V|xBD,IVo#S0ohnNaKo{", + "meta": { + "Size": "512x512", + "seed": 2376310422, + "Model": "model", + "steps": 40, + "prompt": "princess peach with gym clothes", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/65f7fe61-bf6e-4010-146c-2c136b1d6800/width=450/46203.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UWO:In?].mR4ixx]WAV@%MRjWXVtxuRjoyaL", + "meta": { + "Size": "512x512", + "seed": 2155088853, + "Model": "model", + "steps": 20, + "prompt": "1girl, :d, bangle, bracelet, colored_skin, jewelry, long_hair, open_mouth, pink_hair, simple_background, smile, solo, white_background, wristband", + "sampler": "Euler a", + "cfgScale": 7, + "Mask blur": "4", + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))", + "Denoising strength": "1" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2283bb26-922a-4e8c-3172-d44517f62100/width=450/46202.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UHK^dBjK2[tl0LRSI.X9ClV_PUSi?wRngNWY", + "meta": { + "Size": "512x512", + "seed": 4219178718, + "Model": "model", + "steps": 40, + "prompt": "busty girl having sex in a red bikini", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/7de4b8ab-b556-4364-8d77-0beb04d2f100/width=450/46201.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "UGKvy^IUJ6M~~o-:a%e:o{^k-VE1~p4:D%IU", + "meta": { + "Size": "512x512", + "seed": 749130502, + "Model": "model", + "steps": 20, + "prompt": "furry foxy girl with a cute expression having hard sex", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/73841458-7121-4917-94c3-584424d92100/width=450/46200.jpeg", + "nsfw": true, + "width": 512, + "height": 512, + "hash": "U9KUcl000200%|_4Q,=C10xWH?.R?G0fv}tR", + "meta": { + "Size": "512x512", + "seed": 803145732, + "Model": "model", + "steps": 40, + "prompt": "megpoid gumi, green bikini, having sex", + "sampler": "Euler a", + "cfgScale": 7, + "Model hash": "69ae6595e4", + "negativePrompt": "Disfigured, bad art, amateur, poorly drawn, ugly, flat, deformed, poorly drawn, extra limbs, close up, b&w, weird colors, lowres, bad anatomy, bad hands, (((text))), error, missing fingers, extra digit, fewer digits , cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username, blurry\n((((ugly)))), (((duplicate))), ((morbid)), ((mutilated)), out of frame, extra fingers, mutated hands, ((poorly drawn hands)), (( poorly drawn face)), (((mutation))), (((deformed))), ((ugly)), blurry, ((bad anatomy)), (((bad proportions))), ((extra limbs )), cloned face, (((disfigured))), out of frame, ugly, extra limbs, (bad anatomy), gross proportions, (malformed limbs), ((missing arms)), ((missing legs)), (((extra arms))), (((extra legs))), mutated hands, (fused fingers), (too many fingers), (((long neck)))" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/5672" + } + ] +} +---------------------------- diff --git a/Styles/5/64x64v2-1-09-166955-metadata.json b/Styles/5/64x64v2-1-09-166955-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..ef59b97341c71c6b88ecbc584b764e58022e6b1d --- /dev/null +++ b/Styles/5/64x64v2-1-09-166955-metadata.json @@ -0,0 +1,68 @@ +{ + "ss_sd_model_name": "sd-v1-5-pruned-noema-fp16.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "5000", + "ss_tag_frequency": { + "dataset": { + "64x64v3": 5000 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 1, + "img_count": 5000 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 4, \"num_train_images\": 5000, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dataset\": {\"64x64v3\": 5000}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 512], \"count\": 5000}}, \"mean_img_ar_error\": 0.0}, \"subsets\": [{\"img_count\": 5000, \"num_repeats\": 1, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": \"64x64v3\", \"is_reg\": false}]}]", + "ss_epoch": "9", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0002", + "ss_lowram": "True", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "625", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "12500", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16", + "ss_network_args": { + "conv_dim": "16", + "conv_alpha": "8" + }, + "ss_network_dim": "32", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "7d8dc5577b85ca48fb12957a1fafee7a59aa380784f0e4f0a3f80f64449c0efa", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "1250", + "ss_num_epochs": "10", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "64x64v3", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "25d4f007", + "ss_sd_scripts_commit_hash": "9a67e0df390033a89f17e70df5131393692c2a55", + "ss_seed": "42", + "ss_session_id": "1468776081", + "ss_steps": "11250", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1699374152.6289444", + "ss_training_started_at": "1699360372.157996", + "ss_unet_lr": "0.0002", + "ss_v2": "False", + "sshs_legacy_hash": "989a27f9", + "sshs_model_hash": "469a1eb067dd4e90a7283efa732246a5c1026a86f550937eb3d497c15d2d6918" +} \ No newline at end of file diff --git a/Styles/5/64x64v2-1-09-166955.txt b/Styles/5/64x64v2-1-09-166955.txt new file mode 100644 index 0000000000000000000000000000000000000000..a61f5d104495373c053430f595b8efc9467ce175 --- /dev/null +++ b/Styles/5/64x64v2-1-09-166955.txt @@ -0,0 +1,1484 @@ +Link:https://civitai.com/models/185743?modelVersionId=216899 +Version:v2.1 +Base Model:SD 1.5 +Keywords:Pixel art,Isometric +--------DESCRIPTION--------- + +This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each +Update! for versions v2 and above they are trained on 5000 images! + +This page is for the 64x model! +PLEASE when using this model, use one of the AnyLoRA forks, CuteYukiMix or Animekawa. it works best with these models, while it can work on many other models, it might not produce the "pixel perfect" results +When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via billinear, but i have had the BEST results when using astropulse's Pixelize plugin for A1111, it is completely free and can run even on lower end devices. +For the 64x model, make sure to use an 8X downscale factor, and for the 32x model use a 16X downscale factor +the 64x model, while a bit worse at generating even pixels, still operates greatly when downsampling images to native size, it also works much better at full body character portraits, however much like the 32x model, it has issues when using at high resolutions, i recommend not going above 756x756 + +best settings for this LoRA is: +Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling) +CFG scale: 7-14 +LoRA scale: 0.75-1.5(the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy) +Sampling method: DPM++ 2M SDE karras +Recommended prompt: "pixelart" (Add these to the start every generation, this isn't "required" but I found it gets the best results) +---------------------------- +-----ABOUT THIS VERSION----- + +Changed from Lora training to LoCon training. +Same data size. +Now works SIGNIFICANTLY better for full body portraits and on higher resolutions, this is trained with a slightly higher batch size then usual, next version will be more heavily trained +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img2: + Prompt:Pixel art, 1girl, cute, bed, lying, large breasts, large thighs, stockings, paizuri, happy, + Negative Prompt:character out of frame, out of frame + Size:756x756, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img3: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img4: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img5: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img6: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img7: + Prompt:Pixel art, 1girl, cute, bed, sleeping, medium breasts, large thighss + Negative Prompt:character out of frame, out of frame + Size:756x756, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img8: + Prompt:Pixel art, 1girl, cute, bed, sleeping, blanket + Negative Prompt:character out of frame, out of frame + Size:756x756, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img9: + Prompt:Pixel art, 1girl, cute, bed, sleeping, medium breasts, sweater, long sweater + Negative Prompt:character out of frame, out of frame + Size:756x756, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + +img10: + Prompt:Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi + Negative Prompt:character out of frame, out of frame + Size:512x512, Sampler:DPM++ 2M SDE Karras, Steps:50, CFG:7, Clip Skip:0, Model:AnimeKawa_animekawa_v10, Model Hash:d4c1719023 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 185743, + "name": "8bitdiffuser 64x | a perfect pixel art model", + "description": "

This is 8bitdiffuser! At the moment 2 models trained an 1000 respective images each

Update! for versions v2 and above they are trained on 5000 images!

This page is for the 64x model!

PLEASE when using this model, use one of the AnyLoRA forks, CuteYukiMix or Animekawa. it works best with these models, while it can work on many other models, it might not produce the \"pixel perfect\" results

When generating images at a scale of 512x512, scaling them down to the respective model's trained size (aka the one in the name) will produce pixel perfect results! you can downscale them via billinear, but i have had the BEST results when using astropulse's Pixelize plugin for A1111, it is completely free and can run even on lower end devices.

For the 64x model, make sure to use an 8X downscale factor, and for the 32x model use a 16X downscale factor

  • the 64x model, while a bit worse at generating even pixels, still operates greatly when downsampling images to native size, it also works much better at full body character portraits, however much like the 32x model, it has issues when using at high resolutions, i recommend not going above 756x756

best settings for this LoRA is:

  • Steps: 20-40 (On lower step counts, pixels will look very noisy, however if you downsample this to native pixel size this issue is resolved, increase step count if you want a great generation without downsampling)

  • CFG scale: 7-14

  • LoRA scale: 0.75-1.5 (the lower you will set the scale, the more it will look like traditional art and the pixels will become uneven, but the higher the scale is it will appear much noisy)

  • Sampling method: DPM++ 2M SDE karras

  • Recommended prompt: \"pixelart\" (Add these to the start every generation, this isn't \"required\" but I found it gets the best results)

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 1040, + "favoriteCount": 213, + "commentCount": 12, + "ratingCount": 7, + "rating": 5, + "tippedAmountCount": 1348 + }, + "creator": { + "username": "extraordicord", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/ca69a7a1-3c2b-42c7-bf40-d5c453df4e31/width=96/extraordicord.jpeg" + }, + "tags": [ + "anime", + "sexy", + "pixel", + "style", + "girls", + "pixelart", + "pixel perfect", + "pixels" + ], + "modelVersions": [ + { + "id": 216899, + "modelId": 185743, + "name": "v2.1", + "createdAt": "2023-11-07T21:31:41.768Z", + "updatedAt": "2023-11-07T21:40:42.578Z", + "publishedAt": "2023-11-07T21:40:42.575Z", + "trainedWords": [ + "Pixel art", + "Isometric" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": "

Changed from Lora training to LoCon training.

Same data size.

Now works SIGNIFICANTLY better for full body portraits and on higher resolutions, this is trained with a slightly higher batch size then usual, next version will be more heavily trained

", + "vaeId": null, + "stats": { + "downloadCount": 66, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 166955, + "sizeKB": 59187.9580078125, + "name": "64x64v2-1-09.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-07T21:35:41.409Z", + "hashes": { + "AutoV1": "48ABEE6E", + "AutoV2": "FA7E88DCB6", + "SHA256": "FA7E88DCB659BCA1DAC1F42950F6A05504CE9838B6F22156244BE0E1CD03D3BD", + "CRC32": "B00F8279", + "BLAKE3": "7402530511E9B590F7EE9AB7C89531EA97EFB83313E808E6A50D1A0D4BCF9B30" + }, + "downloadUrl": "https://civitai.com/api/download/models/216899", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/27a63b1a-d40d-4d7b-a751-2e1ca72c208c/width=450/3466007.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "URN03fV@bxxa~oofyDa#b_j[x]a}?bWBW=oy", + "type": "image", + "metadata": { + "hash": "URN03fV@bxxa~oofyDa#b_j[x]a}?bWBW=oy", + "size": 289841, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752208, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d68a8701-3990-4c28-95d1-be2fb31f126a/width=450/3465998.jpeg", + "nsfw": "Mature", + "width": 2256, + "height": 904, + "hash": "UUKwndo~Rkj^-;spofRj_Nt6Rj%L_2NGocM{", + "type": "image", + "metadata": { + "hash": "UUKwndo~Rkj^-;spofRj_Nt6Rj%L_2NGocM{", + "size": 1788335, + "width": 2256, + "height": 904 + }, + "meta": { + "Size": "756x756", + "seed": 123812, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "Script": "X/Y/Z plot", + "X Type": "AddNet Model 1", + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, bed, lying, large breasts, large thighs, stockings, paizuri, happy,", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "X Values": "\"64x64-10(4c9cbf5b8992),64x64v2-10(5c7b5f7a4df1),64x64v3-09(469a1eb067dd)\"", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b7d777cb-77b8-4106-b8c4-bbdf21dea85d/width=450/3466002.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UrKnVlx]~qofWWayoeof-;WUxuWB%Ms:NGRk", + "type": "image", + "metadata": { + "hash": "UrKnVlx]~qofWWayoeof-;WUxuWB%Ms:NGRk", + "size": 242732, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752206, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/eca6d55b-262b-4480-a07b-76ee2dc6a70f/width=450/3466008.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UrL4Noof_NogI;azaKjtx]fRxuj[?bj@t7j[", + "type": "image", + "metadata": { + "hash": "UrL4Noof_NogI;azaKjtx]fRxuj[?bj@t7j[", + "size": 265432, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752204, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/1d8e2cea-5f4a-49a6-bd86-0ffdccb6e0c3/width=450/3466004.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UfJkQQof_Mog?bj[-:ofozj[s:j@-:j[R+j?", + "type": "image", + "metadata": { + "hash": "UfJkQQof_Mog?bj[-:ofozj[s:j@-:j[R+j?", + "size": 261547, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752202, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b1adddfc-4b68-4ce3-bd63-b4808731e028/width=450/3466003.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UqNm+uof~qofo#azn~j@_3fkM{t7%MofM|Rk", + "type": "image", + "metadata": { + "hash": "UqNm+uof~qofo#azn~j@_3fkM{t7%MofM|Rk", + "size": 166198, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752201, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/90b0a6e4-513a-4350-88cc-59b366516f62/width=450/3466024.jpeg", + "nsfw": "None", + "width": 752, + "height": 752, + "hash": "UdMGVkw5xttR?IH@xuo|_Mt7RjX5R%R*oet6", + "type": "image", + "metadata": { + "hash": "UdMGVkw5xttR?IH@xuo|_Mt7RjX5R%R*oet6", + "size": 595493, + "width": 752, + "height": 752 + }, + "meta": { + "Size": "756x756", + "seed": 2861773166, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, bed, sleeping, medium breasts, large thighss", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c080d1e6-5571-4bec-a914-8cda4aa290d5/width=450/3466016.jpeg", + "nsfw": "None", + "width": 752, + "height": 752, + "hash": "USK,?J~po}oM-p%NIrt8=pIAxvNFH?M}D%Rj", + "type": "image", + "metadata": { + "hash": "USK,?J~po}oM-p%NIrt8=pIAxvNFH?M}D%Rj", + "size": 443235, + "width": 752, + "height": 752 + }, + "meta": { + "Size": "756x756", + "seed": 4203856320, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, bed, sleeping, blanket", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f12f148-3c62-4b7d-a145-fc1010587df4/width=450/3466023.jpeg", + "nsfw": "None", + "width": 752, + "height": 752, + "hash": "UPL:Wc~VIUM~VGaJ-UsS^kohxbk8^kxWIVIU", + "type": "image", + "metadata": { + "hash": "UPL:Wc~VIUM~VGaJ-UsS^kohxbk8^kxWIVIU", + "size": 606961, + "width": 752, + "height": 752 + }, + "meta": { + "Size": "756x756", + "seed": 2679957503, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, bed, sleeping, medium breasts, sweater, long sweater", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/29d8746d-8536-4afa-8272-1585c3c4adf5/width=450/3466015.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UUIhQ-jZ.8s;.Say~Wt6~qoft7j[~WofIVay", + "type": "image", + "metadata": { + "hash": "UUIhQ-jZ.8s;.Say~Wt6~qoft7j[~WofIVay", + "size": 236250, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 1684752210, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "Pixel art, 1girl, cute, portrait, bust up, upper body, transparent background, chibi", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M SDE Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "469a1eb067dd", + "name": "09", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v3-09(469a1eb067dd)", + "negativePrompt": "character out of frame, out of frame", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/216899" + }, + { + "id": 210996, + "modelId": 185743, + "name": "v2.0", + "createdAt": "2023-11-03T17:37:15.667Z", + "updatedAt": "2023-11-07T21:31:41.768Z", + "publishedAt": "2023-11-03T17:41:44.37Z", + "trainedWords": [ + "pixel art" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": "

a LOT more training data on this version, also works much better with lower LoRA scale, this version was trained on 5000 images instead of 1000.

", + "vaeId": null, + "stats": { + "downloadCount": 675, + "ratingCount": 5, + "rating": 5 + }, + "files": [ + { + "id": 162128, + "sizeKB": 18543.7109375, + "name": "64x64v2-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-03T17:41:33.812Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "474A6CB9F5", + "SHA256": "474A6CB9F597C32B35DEE6706473FDEADFAD85B9540D2387BA3E51454078D34F", + "CRC32": "95A32299", + "BLAKE3": "02DE4E80756E2FF2E913A18B50589405F8F2E5F6FB3BBA6525103EC95342CA89" + }, + "downloadUrl": "https://civitai.com/api/download/models/210996", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/e2abea19-3a52-4b71-af56-72d743c29e51/width=450/3361877.jpeg", + "nsfw": "None", + "width": 512, + "height": 752, + "hash": "URJbT-$,_34n~px@?J%N%h%gxYjFs=M{R$In", + "type": "image", + "metadata": { + "hash": "URJbT-$,_34n~px@?J%N%h%gxYjFs=M{R$In", + "size": 411562, + "width": 512, + "height": 752 + }, + "meta": { + "Size": "512x756", + "seed": 4201871996, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "pixel art, 1girl, cute, bust up, light smile, hoodie", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a25db332-8dd2-4e0a-8635-96be73210271/width=450/3361833.jpeg", + "nsfw": "None", + "width": 448, + "height": 319, + "hash": "UPLNrj?a.7?a~pRjM{Rj_2RjM|Rj?bWBafae", + "type": "image", + "metadata": { + "hash": "UPLNrj?a.7?a~pRjM{Rj_2RjM|Rj?bWBafae", + "size": 182289, + "width": 448, + "height": 319 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aa2f0adb-6085-448b-a3fa-161326609542/width=450/3361863.jpeg", + "nsfw": "None", + "width": 752, + "height": 512, + "hash": "UNM%WWIqlV_2%2V@M{IV4.Rjs.s.^%IVE2xa", + "type": "image", + "metadata": { + "hash": "UNM%WWIqlV_2%2V@M{IV4.Rjs.s.^%IVE2xa", + "size": 312382, + "width": 752, + "height": 512 + }, + "meta": { + "Size": "756x512", + "seed": 2232011916, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 50, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, cute, close up, close up of face", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/95abe39f-132a-4d29-a11e-43ff509f1d3d/width=450/3361864.jpeg", + "nsfw": "None", + "width": 752, + "height": 512, + "hash": "UXOUo3V_9HnlV[S2x@RjnPoMR*t6~BWCRQoe", + "type": "image", + "metadata": { + "hash": "UXOUo3V_9HnlV[S2x@RjnPoMR*t6~BWCRQoe", + "size": 387232, + "width": 752, + "height": 512 + }, + "meta": { + "Size": "756x512", + "seed": 1490686660, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 50, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, cute, sexy, close up, close up of face", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/21081aa1-1d94-496f-9914-e5b6c0bdbfab/width=450/3361872.jpeg", + "nsfw": "None", + "width": 512, + "height": 752, + "hash": "UFHx{C-C-?4.0vNbR7%M*Cx[9sx]0xIV?GM{", + "type": "image", + "metadata": { + "hash": "UFHx{C-C-?4.0vNbR7%M*Cx[9sx]0xIV?GM{", + "size": 438943, + "width": 512, + "height": 752 + }, + "meta": { + "Size": "512x756", + "seed": 267538719, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "pixel art, 1girl, cute, bust up, light smile, hoodie", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a326ca1b-7dfa-4ce2-bb39-5dbdc005f5e8/width=450/3361866.jpeg", + "nsfw": "None", + "width": 752, + "height": 512, + "hash": "UZJtJK}[~VenxGtRodtR%LS$ENRjM}aKV@WD", + "type": "image", + "metadata": { + "hash": "UZJtJK}[~VenxGtRodtR%LS$ENRjM}aKV@WD", + "size": 411478, + "width": 752, + "height": 512 + }, + "meta": { + "Size": "756x512", + "seed": 922667657, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 50, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, cute, sexy, bust up, light smile, hoodie", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6c8a4e6b-ff42-45d0-a2e9-f0a88f692368/width=450/3361876.jpeg", + "nsfw": "None", + "width": 512, + "height": 752, + "hash": "UGL|ih[VMc=|?DvgPWnN_MaJE2bHX-SzVrSO", + "type": "image", + "metadata": { + "hash": "UGL|ih[VMc=|?DvgPWnN_MaJE2bHX-SzVrSO", + "size": 440982, + "width": 512, + "height": 752 + }, + "meta": { + "Size": "512x756", + "seed": 267538721, + "Model": "AnimeKawa_animekawa_v10", + "steps": 50, + "hashes": { + "model": "d4c1719023" + }, + "prompt": "pixel art, 1girl, cute, bust up, light smile, hoodie", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "d4c1719023", + "name": "AnimeKawa_animekawa_v10", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "d4c1719023", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d1358598-bc29-4970-8fb4-21f6f43c81fb/width=450/3361865.jpeg", + "nsfw": "Soft", + "width": 752, + "height": 512, + "hash": "ULJtPG5qE3}@-TI=i_xt_N-:s:IoR,xtM{Wr", + "type": "image", + "metadata": { + "hash": "ULJtPG5qE3}@-TI=i_xt_N-:s:IoR,xtM{Wr", + "size": 379944, + "width": 752, + "height": 512 + }, + "meta": { + "Size": "756x512", + "seed": 3671628247, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 50, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, cute, sexy, upper body", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/39e8ced7-9681-47b9-9d81-1abcb0979d59/width=450/3361861.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 512, + "hash": "UgIYwOt7paoHTObcxvni-;W=SQni%JWEoyfh", + "type": "image", + "metadata": { + "hash": "UgIYwOt7paoHTObcxvni-;W=SQni%JWEoyfh", + "size": 295574, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 408573503, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 40, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, cute, sexy, meadow, hill, grass, blue t-shirt, shorts, light smile, long hair, wind,", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/626b9af3-f674-4d9e-935a-e1d567e804f7/width=450/3361860.jpeg", + "nsfw": "Soft", + "width": 512, + "height": 512, + "hash": "UBF=wH_4l.oel7?b-rbEVYyD9]xv02-U^PSi", + "type": "image", + "metadata": { + "hash": "UBF=wH_4l.oel7?b-rbEVYyD9]xv02-U^PSi", + "size": 347172, + "width": 512, + "height": 512 + }, + "meta": { + "Size": "512x512", + "seed": 2071053747, + "Model": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "steps": 50, + "hashes": { + "model": "ad1150a839" + }, + "prompt": "pixel art, 1girl, upper body, umbrella, wet clothes, t-shirt, hoodie, skirt, street", + "Version": "## 1.4.1", + "sampler": "DPM++ 2M Karras", + "cfgScale": 7, + "resources": [ + { + "hash": "ad1150a839", + "name": "AnyLoRA_-_Checkpoint_anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "5c7b5f7a4df1", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "ad1150a839", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64v2-10(5c7b5f7a4df1)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1", + "AddNet Weight B 1": "1" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/210996" + }, + { + "id": 208554, + "modelId": 185743, + "name": "v1.0", + "createdAt": "2023-11-01T21:44:05.017Z", + "updatedAt": "2023-11-07T21:31:41.768Z", + "publishedAt": "2023-11-01T21:46:10.577Z", + "trainedWords": [ + "pixel art" + ], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 299, + "ratingCount": 2, + "rating": 5 + }, + "files": [ + { + "id": 160106, + "sizeKB": 18543.703125, + "name": "64x64-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-11-01T22:58:40.544Z", + "hashes": { + "AutoV1": "DE2F2560", + "AutoV2": "3285B6979B", + "SHA256": "3285B6979B4690D464CBE27061F9571FA39EFACF483FEEEDDE99375B8D90F29A", + "CRC32": "015FC738", + "BLAKE3": "B2BA65A12E398C2D34C777E7610BFA2E3C3789E96F32F0FDB9D7312D892C2529" + }, + "downloadUrl": "https://civitai.com/api/download/models/208554", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fa9a009e-68d0-4365-9ba9-6fda1b6c9ffb/width=450/3320731.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UHJHR4~q01-p00H?=xD*R:xv?H$%-Vs9IU%M", + "type": "image", + "metadata": { + "hash": "UHJHR4~q01-p00H?=xD*R:xv?H$%-Vs9IU%M", + "size": 13087, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/68a0490d-4ac8-42f8-b86e-f64f9f300213/width=450/3320736.jpeg", + "nsfw": "None", + "width": 6400, + "height": 1920, + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "type": "image", + "metadata": { + "hash": "UwM@iyxutQxu~qRjV@WB-;WVWBWB%Mofj[fk", + "size": 191537, + "width": 6400, + "height": 1920 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/77a07dbb-d2b3-4940-8f75-10399a6589f4/width=450/3320733.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UtMaCgWV~Wt7yXWVSwofnPj[wJoLt6ayW-n%", + "type": "image", + "metadata": { + "hash": "UtMaCgWV~Wt7yXWVSwofnPj[wJoLt6ayW-n%", + "size": 280822, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 1895353110, + "Model": "anyloraCheckpoint_novaeFp16", + "steps": 40, + "hashes": { + "model": "00bafa0e71" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "00bafa0e71", + "name": "anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + }, + { + "hash": "51389dc686f1", + "name": "HatsuneMiku", + "type": "lora", + "weight": null + } + ], + "Model hash": "00bafa0e71", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Model 2": "HatsuneMiku(51389dc686f1)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight A 2": "0.95", + "AddNet Weight B 1": "1.25", + "AddNet Weight B 2": "0.95" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/51b3c4ed-800c-4ae9-880b-165f68f51454/width=450/3320734.jpeg", + "nsfw": "Mature", + "width": 512, + "height": 512, + "hash": "UWL:_%Md_NNf~VD$XAs;s+xZRkM{s:x]jXs;", + "type": "image", + "metadata": { + "hash": "UWL:_%Md_NNf~VD$XAs;s+xZRkM{s:x]jXs;", + "size": 16338, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/76fb9f78-8d21-4ebe-a217-639bad3857fd/width=450/3320735.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "URLD[QxalBt8^*jZ9aWC%~WX~WofIpWX%1s:", + "type": "image", + "metadata": { + "hash": "URLD[QxalBt8^*jZ9aWC%~WX~WofIpWX%1s:", + "size": 14653, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/dc8485b9-7257-44d0-b4eb-fe3f0758748e/width=450/3320730.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UOGIAi^*019ZD*t7?GR*0KIV%Lxu~VWB4:jZ", + "type": "image", + "metadata": { + "hash": "UOGIAi^*019ZD*t7?GR*0KIV%Lxu~VWB4:jZ", + "size": 12755, + "width": 512, + "height": 512 + }, + "meta": null + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/47583c86-4791-4188-bb7d-185861babaa4/width=450/3320728.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UUPi|?x]_NxH?uofS2WU%hRjaJoyVsWBWBWC", + "type": "image", + "metadata": { + "hash": "UUPi|?x]_NxH?uofS2WU%hRjaJoyVsWBWBWC", + "size": 242537, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 2735777651, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 40, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body, huge breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/53821b86-91eb-4e45-8900-579a612c60af/width=450/3320729.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UKNwH4tR?GxaUGRj.Sjvk?s:=KbY~Coyzpen", + "type": "image", + "metadata": { + "hash": "UKNwH4tR?GxaUGRj.Sjvk?s:=KbY~Coyzpen", + "size": 300963, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 1828856850, + "Model": "anyloraCheckpoint_novaeFp16", + "steps": 40, + "hashes": { + "model": "00bafa0e71" + }, + "prompt": "pixel art, 1girl, cute, sexy, transparent background, light smile, upper body, from below, Hatsune Miku,pink hair, pink eyes, aqua hair, aqua eyes, multicolored hair, gradient hair, large breasts", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "00bafa0e71", + "name": "anyloraCheckpoint_novaeFp16", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + }, + { + "hash": "51389dc686f1", + "name": "HatsuneMiku", + "type": "lora", + "weight": null + } + ], + "Model hash": "00bafa0e71", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Model 2": "HatsuneMiku(51389dc686f1)", + "AddNet Module 1": "LoRA", + "AddNet Module 2": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight A 2": "0.9", + "AddNet Weight B 1": "1.25", + "AddNet Weight B 2": "0.9" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5a77c3cd-2fd4-4cc5-a480-3055d72e2e77/width=450/3320732.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UtPsbdof?]t7-;WUM{s:XRjsnia}kUaysqj]", + "type": "image", + "metadata": { + "hash": "UtPsbdof?]t7-;WUM{s:XRjsnia}kUaysqj]", + "size": 203430, + "width": 512, + "height": 512 + }, + "meta": { + "VAE": "cleanvae_v10.safetensors", + "Size": "512x512", + "seed": 654289543, + "Model": "cuteyukimixAdorable_specialchapter", + "steps": 22, + "hashes": { + "model": "53d7264d1c" + }, + "prompt": "pixel art, pixelart, 1girl, cute, sexy, transparent background, light smile, upper body", + "Version": "v1.6.0", + "sampler": "DPM++ 2M Karras", + "VAE hash": "42100bcdd1", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "53d7264d1c", + "name": "cuteyukimixAdorable_specialchapter", + "type": "model" + }, + { + "hash": "4c9cbf5b8992", + "name": "10", + "type": "lora", + "weight": null + } + ], + "Model hash": "53d7264d1c", + "AddNet Enabled": "True", + "AddNet Model 1": "64x64-10(4c9cbf5b8992)", + "AddNet Module 1": "LoRA", + "AddNet Weight A 1": "1.25", + "AddNet Weight B 1": "1.25" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/208554" + } + ] +} +---------------------------- diff --git a/Styles/52/gerph-10-94683-metadata.json b/Styles/52/gerph-10-94683-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..6b2afb64fbd8e85949b399fe53dc21480210ef2a --- /dev/null +++ b/Styles/52/gerph-10-94683-metadata.json @@ -0,0 +1,756 @@ +{ + "ss_sd_model_name": "AnyLoRA_noVae_fp16-pruned.ckpt", + "ss_clip_skip": "2", + "ss_num_train_images": "500", + "ss_tag_frequency": { + "dataset": { + "gerph": 100, + "1girl": 97, + "breasts": 97, + "solo": 96, + "simple background": 70, + "large breasts": 65, + "blush": 60, + "smile": 59, + "looking at viewer": 57, + "white background": 53, + "short hair": 50, + "navel": 47, + "cleavage": 45, + "huge breasts": 41, + "long hair": 39, + "swimsuit": 32, + "gloves": 31, + "red hair": 28, + "open mouth": 27, + "teeth": 26, + "thighhighs": 25, + "jewelry": 24, + "blue eyes": 23, + "shirt": 21, + "bikini": 20, + "full body": 20, + "bangs": 20, + "earrings": 19, + "yellow eyes": 19, + "underwear": 19, + "thighs": 18, + "holding": 18, + "orange hair": 17, + "shorts": 16, + "panties": 16, + "blue hair": 16, + "blonde hair": 15, + "hair over one eye": 15, + "ponytail": 15, + "tongue": 15, + "tongue out": 15, + "upper body": 14, + "makeup": 14, + "black thighhighs": 14, + "black eyes": 14, + "cowboy shot": 14, + "grin": 14, + "high heels": 13, + "hair ornament": 13, + "sharp teeth": 13, + "hat": 13, + "brown hair": 12, + "symbol-shaped pupils": 12, + "standing": 12, + "dress": 12, + "sweat": 12, + "elbow gloves": 12, + "black gloves": 12, + "midriff": 12, + "fingerless gloves": 12, + "skirt": 12, + "nipples": 11, + "red eyes": 11, + "green eyes": 11, + "one-piece swimsuit": 11, + "crop top": 11, + "heart": 10, + "short shorts": 10, + "freckles": 10, + "ass": 10, + "curvy": 10, + "covered nipples": 10, + "v": 10, + "underboob": 10, + "ahoge": 10, + "heart-shaped pupils": 9, + "very long hair": 9, + "hand on hip": 9, + "slingshot swimsuit": 9, + "boots": 9, + "medium breasts": 9, + "shoes": 9, + "lipstick": 8, + "red footwear": 8, + "misty (pokemon)": 8, + "collar": 8, + "side ponytail": 8, + "hood": 8, + "arms up": 8, + "purple hair": 8, + "nail polish": 8, + "choker": 8, + "tank top": 8, + "sitting": 7, + "suspenders": 7, + "pink hair": 7, + "thick thighs": 7, + "black hair": 7, + "double v": 7, + "jacket": 7, + "black footwear": 6, + "glasses": 6, + "spread legs": 6, + "areola slip": 6, + "red bikini": 6, + "hair between eyes": 6, + "striped": 6, + "micro bikini": 6, + "collarbone": 6, + "poke ball (basic)": 6, + "poke ball": 6, + "denim shorts": 6, + "denim": 6, + "blush stickers": 6, + "green hair": 6, + "multicolored hair": 6, + "nude": 6, + "white shirt": 6, + "collared shirt": 6, + "parted lips": 6, + "hoodie": 6, + "looking back": 6, + "short sleeves": 6, + "aqua eyes": 6, + "brown eyes": 6, + "pussy": 5, + "red dress": 5, + "thigh gap": 5, + "strap gap": 5, + "bow": 5, + "weapon": 5, + "large areolae": 5, + "lips": 5, + "black panties": 5, + "sunglasses": 5, + "bright pupils": 5, + "barefoot": 5, + "holding poke ball": 5, + "bare shoulders": 5, + "long sleeves": 5, + "red gloves": 5, + "outline": 5, + "socks": 5, + "grey background": 4, + "grey eyes": 4, + "ear piercing": 4, + "piercing": 4, + "leotard": 4, + "white thighhighs": 4, + "dark skin": 4, + "orange eyes": 4, + "dark-skinned female": 4, + "armpits": 4, + "arms behind head": 4, + "leg up": 4, + "hairband": 4, + "bandaid": 4, + "braid": 4, + "bottomless": 4, + "pink background": 4, + "blue nails": 4, + "one eye closed": 4, + "mask": 4, + "short dress": 4, + "toes": 4, + "from behind": 4, + "sweater": 4, + "ribbon": 4, + "miniskirt": 4, + "pleated skirt": 4, + "black skirt": 4, + "cynthia (pokemon)": 3, + "topless": 3, + "eyeshadow": 3, + "drooling": 3, + "grey hair": 3, + "saliva": 3, + "cup": 3, + "hairclip": 3, + "blue shorts": 3, + "animal ears": 3, + "holding weapon": 3, + "condom": 3, + "two-tone hair": 3, + "fur trim": 3, + "pantyhose": 3, + "aqua hair": 3, + "yellow background": 3, + "necklace": 3, + "school uniform": 3, + "purple eyes": 3, + "red nails": 3, + "eyewear on head": 3, + "pink bikini": 3, + "shiny": 3, + "ahegao": 3, + "belt": 3, + "standing on one leg": 3, + "bike shorts": 3, + "black socks": 3, + "hands up": 3, + "sidelocks": 3, + "twintails": 3, + "closed eyes": 3, + "skull hair ornament": 3, + "white panties": 3, + "impossible clothes": 3, + "feet": 3, + "white outline": 3, + "medium hair": 3, + "blue background": 3, + "bag": 3, + "hair over eyes": 3, + "sideboob": 3, + "hair ribbon": 3, + "clothing cutout": 3, + "black choker": 3, + "bandaid on face": 3, + "bandaid on nose": 3, + "covered navel": 3, + "bent over": 3, + "black dress": 3, + "highleg": 3, + "ringed eyes": 3, + "bob cut": 3, + "green headwear": 3, + "tam o' shanter": 3, + "jessie (pokemon)": 3, + "highleg panties": 3, + "long tongue": 3, + "princess daisy": 2, + "flower earrings": 2, + "crown": 2, + "upper teeth only": 2, + "green background": 2, + "side-tie bikini bottom": 2, + "arm up": 2, + "inverted nipples": 2, + "anus": 2, + "no panties": 2, + "thigh strap": 2, + "o-ring": 2, + "red-framed eyewear": 2, + "bracelet": 2, + "white hair": 2, + "drinking glass": 2, + "striped bikini": 2, + "striped thighhighs": 2, + "multiple girls": 2, + "2girls": 2, + "rabbit ears": 2, + "striped panties": 2, + "bowtie": 2, + "ass visible through thighs": 2, + "weapon over shoulder": 2, + "over shoulder": 2, + "hood up": 2, + "shiny skin": 2, + "pubic hair": 2, + "streaked hair": 2, + "female pubic hair": 2, + "detached collar": 2, + "pubic hair peek": 2, + "necktie": 2, + "wide hips": 2, + "gigantic breasts": 2, + "embarrassed": 2, + "ball": 2, + "clenched teeth": 2, + "pointy ears": 2, + "1boy": 2, + "bra": 2, + "tinted eyewear": 2, + "purple background": 2, + "single braid": 2, + "black bikini": 2, + "bikini top only": 2, + "completely nude": 2, + "white pupils": 2, + "black bodysuit": 2, + "bodysuit": 2, + "black shorts": 2, + "stomach": 2, + "v-shaped eyebrows": 2, + "food": 2, + "skindentation": 2, + "genderswap (mtf)": 2, + "genderswap": 2, + "zipper": 2, + "track jacket": 2, + "pantyshot": 2, + "garter straps": 2, + "bandages": 2, + "androgynous": 2, + "orange background": 2, + "print shirt": 2, + "mole": 2, + "sonia (pokemon)": 2, + "heart hair ornament": 2, + "coat": 2, + "handbag": 2, + "meme attire": 2, + "turtleneck sweater": 2, + "ribbed sweater": 2, + "turtleneck": 2, + "red background": 2, + "box": 2, + "zettai ryouiki": 2, + "top-down bottom-up": 2, + "green jacket": 2, + "open clothes": 2, + ":d": 2, + "no pants": 2, + "green nails": 2, + "microdress": 2, + "tan": 2, + "tanlines": 2, + ":p": 2, + "may (pokemon)": 2, + "bandana": 2, + "hanging breasts": 2, + "leaning forward": 2, + "cosplay": 2, + "thigh boots": 2, + "tattoo": 2, + "green one-piece swimsuit": 2, + "sleeveless": 2, + "no bra": 2, + "@_@": 2, + "competition swimsuit": 2, + "red one-piece swimsuit": 2, + "spiked hair": 2, + "pink eyes": 2, + "closed mouth": 2, + "white gloves": 2, + "strapless": 2, + "red headwear": 2, + "high heel boots": 2, + "off shoulder": 2, + "gloria (pokemon)": 2, + "hair slicked back": 2, + "hood down": 2, + "clothes lift": 2, + "lifted by self": 2, + "team rocket": 2, + "team rocket uniform": 2, + "maid headdress": 2, + "orange bikini": 1, + "fur collar": 1, + "cameltoe": 1, + "black nails": 1, + "drunk": 1, + "bar (place)": 1, + "futanari": 1, + "trembling": 1, + "bottle": 1, + "nose blush": 1, + "alcohol": 1, + "goggles on head": 1, + "goggles": 1, + "white bikini": 1, + "arm behind head": 1, + "looking down": 1, + "wardrobe malfunction": 1, + "mushroom": 1, + "blunt bangs": 1, + "teacup": 1, + "alice (alice in wonderland)": 1, + "black leotard": 1, + "rabbit": 1, + "top hat": 1, + "hair bow": 1, + "playboy bunny": 1, + "teapot": 1, + "animal hood": 1, + "rabbit hood": 1, + "fake animal ears": 1, + "sword": 1, + "condom packet strip": 1, + "holding sword": 1, + "orange necktie": 1, + "plump": 1, + "wavy mouth": 1, + "hair pulled back": 1, + "matoi ryuuko": 1, + "beachball": 1, + "breasts apart": 1, + "senketsu": 1, + "holding ball": 1, + "princess zelda": 1, + "puffy nipples": 1, + "detached sleeves": 1, + "blue gloves": 1, + "facial mark": 1, + "cat ears": 1, + "bald": 1, + "dark-skinned male": 1, + "faceless male": 1, + "faceless": 1, + "whisker markings": 1, + "hetero": 1, + "jirou kyouka": 1, + "headphones": 1, + "red necktie": 1, + "u.a. school uniform": 1, + "loose necktie": 1, + "cloak": 1, + "hooded cloak": 1, + "multiple boys": 1, + "brown gloves": 1, + "2boys": 1, + "breasts out": 1, + "solo focus": 1, + "cigarette": 1, + "couch": 1, + "orange-tinted eyewear": 1, + "pole dancing": 1, + "gradient": 1, + "stripper pole": 1, + "gradient background": 1, + "pole": 1, + "bare arms": 1, + "ranma-chan": 1, + "braided ponytail": 1, + "squatting": 1, + "loose belt": 1, + "halo": 1, + "black lips": 1, + "standing split": 1, + "split": 1, + "leg lift": 1, + "hair stick": 1, + "yamato (one piece)": 1, + "oni": 1, + "horns": 1, + "multicolored horns": 1, + "red horns": 1, + "club (weapon)": 1, + "bikini bottom only": 1, + "kanabou": 1, + "fundoshi": 1, + "colored pubic hair": 1, + "curled horns": 1, + "groin": 1, + "cropped legs": 1, + "high ponytail": 1, + "japanese clothes": 1, + "spiked club": 1, + "burger": 1, + "striped gloves": 1, + "musical note": 1, + "holding food": 1, + "convenient censoring": 1, + "eighth note": 1, + "blue bow": 1, + "hug": 1, + "hug from behind": 1, + "yuri": 1, + "sandals": 1, + "strap slip": 1, + "naked hoodie": 1, + "red hood": 1, + "impossible dress": 1, + "covered mouth": 1, + "torn clothes": 1, + "huge ass": 1, + "dawn (pokemon)": 1, + "beanie": 1, + "w": 1, + "white headwear": 1, + "tiara": 1, + "purple eyeshadow": 1, + "bea (pokemon)": 1, + "bodysuit under clothes": 1, + "single glove": 1, + "knee pads": 1, + "black hairband": 1, + "print shorts": 1, + "fighting stance": 1, + "book": 1, + "fire": 1, + "holding book": 1, + "red lips": 1, + "open book": 1, + "blue shirt": 1, + "aqua background": 1, + "aqua shirt": 1, + "yellow jacket": 1, + "glint": 1, + "split ponytail": 1, + "low twintails": 1, + "virgin killer sweater": 1, + "backless outfit": 1, + "naked sweater": 1, + "butt crack": 1, + "bare back": 1, + "backless dress": 1, + "sweater dress": 1, + "black one-piece swimsuit": 1, + "labcoat": 1, + "doctor": 1, + "chair": 1, + "white coat": 1, + "name tag": 1, + "office chair": 1, + "pink lips": 1, + "pink shirt": 1, + "red jacket": 1, + "waving": 1, + "jack-o' challenge": 1, + "sports bra": 1, + "sneakers": 1, + "orange sweater": 1, + "wind lift": 1, + "magnifying glass": 1, + "wind": 1, + "black-framed eyewear": 1, + "red skirt": 1, + "orange shirt": 1, + "skirt flip": 1, + "bow panties": 1, + "pink panties": 1, + "cropped shirt": 1, + "feet out of frame": 1, + "purple panties": 1, + "taut clothes": 1, + "body freckles": 1, + "open shirt": 1, + "brown headwear": 1, + "highleg bikini": 1, + "green lips": 1, + "baseball mitt": 1, + "baseball cap": 1, + "white footwear": 1, + "green skirt": 1, + "fang": 1, + "orange gloves": 1, + "mole under mouth": 1, + "argyle": 1, + "armor": 1, + "glowing": 1, + "argyle legwear": 1, + "polearm": 1, + "red bandana": 1, + "+_+": 1, + "nami (one piece)": 1, + "suspender shorts": 1, + "aqua nails": 1, + "ribbed shirt": 1, + "soles": 1, + "yellow gloves": 1, + "anus peek": 1, + "cleavage cutout": 1, + "looking to the side": 1, + "brown pantyhose": 1, + "male focus": 1, + "meme": 1, + "happy": 1, + "portrait": 1, + "scar": 1, + "low ponytail": 1, + "shiny hair": 1, + "hair intakes": 1, + "scar on face": 1, + "semi-rimless eyewear": 1, + "see-through": 1, + "under-rim eyewear": 1, + "lowleg": 1, + "lowleg panties": 1, + "print panties": 1, + "green ribbon": 1, + "mature female": 1, + "hex maniac (pokemon)": 1, + "purple hairband": 1, + "messy hair": 1, + "black background": 1, + "all fours": 1, + "underwear only": 1, + "wet": 1, + "whistle around neck": 1, + "whistle": 1, + "highleg swimsuit": 1, + "lying": 1, + "wine glass": 1, + "pasties": 1, + "crossed legs": 1, + "in container": 1, + "party hat": 1, + "holding cup": 1, + "blue footwear": 1, + "in box": 1, + "pink gloves": 1, + "sweatdrop": 1, + "covering": 1, + "covering crotch": 1, + "white tank top": 1, + "headband": 1, + "twin braids": 1, + "used condom": 1, + "multiple condoms": 1, + ":t": 1, + "crossed arms": 1, + "single thighhigh": 1, + "blood": 1, + "sparkle": 1, + "asymmetrical legwear": 1, + "pout": 1, + "super crown": 1, + "chain": 1, + "shackles": 1, + "cuffs": 1, + "broken chain": 1, + "broken": 1, + "bell": 1, + "santa hat": 1, + "red panties": 1, + "christmas": 1, + "neck bell": 1, + "knee boots": 1, + "brown thighhighs": 1, + "side-tie panties": 1, + "jingle bell": 1, + "humanization": 1, + "middle finger": 1, + "black jacket": 1, + "arms behind back": 1, + ":<": 1, + "antlers": 1, + "red shirt": 1, + "controller": 1, + "fake antlers": 1, + "game controller": 1, + "tied shirt": 1, + "halftone": 1, + ";d": 1, + "nurse": 1, + "nurse cap": 1, + "alternate costume": 1, + "adjusting gloves": 1, + "ok sign": 1, + "green thighhighs": 1, + "blue hoodie": 1, + "hoodie lift": 1, + "narrow waist": 1, + "steaming body": 1, + "yoko littner": 1, + "flame print": 1, + "gun": 1, + "rifle": 1, + "anti-materiel rifle": 1, + "scarf": 1, + "studded belt": 1, + "sniper rifle": 1, + "holding eyewear": 1, + "eyewear removed": 1, + "asymmetrical gloves": 1, + "bursting breasts": 1, + "white skirt": 1, + "thong": 1, + "microskirt": 1, + "shirt lift": 1, + "undressing": 1, + "reverse trap": 1, + "surcoat": 1, + "turban": 1, + "scythe": 1, + "holding scythe": 1, + "leg tattoo": 1, + "pubic tattoo": 1, + "skull": 1, + "backpack": 1, + "plaid": 1, + "watch": 1, + "pink bow": 1, + "covered eyes": 1, + "plaid skirt": 1, + "black pantyhose": 1, + "blue skirt": 1, + "pink bowtie": 1, + "strapless swimsuit": 1, + "one eye covered": 1, + "seiza": 1, + "colored tongue": 1, + "blue tongue": 1, + "borrowed design": 1, + "revealing clothes": 1, + "holding clothes": 1, + "red hoodie": 1, + "ankle boots": 1, + "thick eyebrows": 1, + "green bikini": 1, + "axe": 1, + "clothes around waist": 1, + "pants": 1, + "brown footwear": 1, + "blue pants": 1 + } + }, + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "dataset": { + "n_repeats": 5, + "img_count": 100 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 2, \"num_train_images\": 500, \"num_reg_images\": 0, \"resolution\": [512, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"dataset\": {\"gerph\": 100, \"princess daisy\": 2, \"1girl\": 97, \"flower earrings\": 2, \"breasts\": 97, \"brown hair\": 12, \"crown\": 2, \"solo\": 96, \"swimsuit\": 32, \"bikini\": 20, \"symbol-shaped pupils\": 12, \"heart-shaped pupils\": 9, \"earrings\": 19, \"jewelry\": 24, \"heart\": 10, \"open mouth\": 27, \"huge breasts\": 41, \"blue eyes\": 23, \"smile\": 59, \"teeth\": 26, \"blush\": 60, \"orange bikini\": 1, \"upper teeth only\": 2, \"cleavage\": 45, \"green background\": 2, \"simple background\": 70, \"navel\": 47, \"long hair\": 39, \"upper body\": 14, \"side-tie bikini bottom\": 2, \"arm up\": 2, \"cynthia (pokemon)\": 3, \"nipples\": 11, \"blonde hair\": 15, \"inverted nipples\": 2, \"high heels\": 13, \"hair over one eye\": 15, \"topless\": 3, \"hair ornament\": 13, \"full body\": 20, \"makeup\": 14, \"very long hair\": 9, \"large breasts\": 65, \"fur collar\": 1, \"cameltoe\": 1, \"grey background\": 4, \"black nails\": 1, \"standing\": 12, \"grey eyes\": 4, \"eyeshadow\": 3, \"lipstick\": 8, \"looking at viewer\": 57, \"black footwear\": 6, \"drunk\": 1, \"bar (place)\": 1, \"dress\": 12, \"pussy\": 5, \"futanari\": 1, \"glasses\": 6, \"spread legs\": 6, \"anus\": 2, \"red footwear\": 8, \"drooling\": 3, \"short hair\": 50, \"no panties\": 2, \"red dress\": 5, \"thigh strap\": 2, \"o-ring\": 2, \"sitting\": 7, \"red-framed eyewear\": 2, \"sweat\": 12, \"bracelet\": 2, \"red eyes\": 11, \"trembling\": 1, \"bottle\": 1, \"white hair\": 2, \"nose blush\": 1, \"grey hair\": 3, \"saliva\": 3, \"cup\": 3, \"drinking glass\": 2, \"alcohol\": 1, \"shorts\": 16, \"gloves\": 31, \"green eyes\": 11, \"suspenders\": 7, \"elbow gloves\": 12, \"thighhighs\": 25, \"black gloves\": 12, \"orange hair\": 17, \"red hair\": 28, \"ponytail\": 15, \"misty (pokemon)\": 8, \"short shorts\": 10, \"black thighhighs\": 14, \"white background\": 53, \"areola slip\": 6, \"collar\": 8, \"thigh gap\": 5, \"tongue\": 15, \"pink hair\": 7, \"goggles on head\": 1, \"goggles\": 1, \"red bikini\": 6, \"tongue out\": 15, \"yellow eyes\": 19, \"thighs\": 18, \"hair between eyes\": 6, \"striped\": 6, \"striped bikini\": 2, \"striped thighhighs\": 2, \"black eyes\": 14, \"freckles\": 10, \"shirt\": 21, \"sharp teeth\": 13, \"underwear\": 19, \"hairclip\": 3, \"ear piercing\": 4, \"piercing\": 4, \"micro bikini\": 6, \"white bikini\": 1, \"collarbone\": 6, \"strap gap\": 5, \"side ponytail\": 8, \"poke ball (basic)\": 6, \"poke ball\": 6, \"denim shorts\": 6, \"denim\": 6, \"blue shorts\": 3, \"cowboy shot\": 14, \"arm behind head\": 1, \"midriff\": 12, \"looking down\": 1, \"wardrobe malfunction\": 1, \"multiple girls\": 2, \"mushroom\": 1, \"2girls\": 2, \"animal ears\": 3, \"rabbit ears\": 2, \"ass\": 10, \"bow\": 5, \"panties\": 16, \"thick thighs\": 7, \"blush stickers\": 6, \"bangs\": 20, \"striped panties\": 2, \"blunt bangs\": 1, \"teacup\": 1, \"blue hair\": 16, \"alice (alice in wonderland)\": 1, \"hat\": 13, \"leotard\": 4, \"black leotard\": 1, \"rabbit\": 1, \"top hat\": 1, \"bowtie\": 2, \"hair bow\": 1, \"playboy bunny\": 1, \"teapot\": 1, \"weapon\": 5, \"holding weapon\": 3, \"holding\": 18, \"hood\": 8, \"condom\": 3, \"animal hood\": 1, \"ass visible through thighs\": 2, \"white thighhighs\": 4, \"rabbit hood\": 1, \"weapon over shoulder\": 2, \"hand on hip\": 9, \"slingshot swimsuit\": 9, \"over shoulder\": 2, \"hood up\": 2, \"shiny skin\": 2, \"fake animal ears\": 1, \"sword\": 1, \"curvy\": 10, \"condom packet strip\": 1, \"large areolae\": 5, \"holding sword\": 1, \"pubic hair\": 2, \"streaked hair\": 2, \"female pubic hair\": 2, \"green hair\": 6, \"multicolored hair\": 6, \"black hair\": 7, \"dark skin\": 4, \"detached collar\": 2, \"orange eyes\": 4, \"orange necktie\": 1, \"dark-skinned female\": 4, \"pubic hair peek\": 2, \"necktie\": 2, \"wide hips\": 2, \"plump\": 1, \"wavy mouth\": 1, \"gigantic breasts\": 2, \"embarrassed\": 2, \"covered nipples\": 10, \"hair pulled back\": 1, \"one-piece swimsuit\": 11, \"matoi ryuuko\": 1, \"beachball\": 1, \"ball\": 2, \"clenched teeth\": 2, \"two-tone hair\": 3, \"breasts apart\": 1, \"senketsu\": 1, \"holding ball\": 1, \"princess zelda\": 1, \"pointy ears\": 2, \"nude\": 6, \"fingerless gloves\": 12, \"puffy nipples\": 1, \"lips\": 5, \"detached sleeves\": 1, \"blue gloves\": 1, \"fur trim\": 3, \"armpits\": 4, \"arms behind head\": 4, \"arms up\": 8, \"v\": 10, \"skirt\": 12, \"double v\": 7, \"pantyhose\": 3, \"facial mark\": 1, \"1boy\": 2, \"cat ears\": 1, \"bald\": 1, \"white shirt\": 6, \"collared shirt\": 6, \"aqua hair\": 3, \"dark-skinned male\": 1, \"faceless male\": 1, \"faceless\": 1, \"whisker markings\": 1, \"hetero\": 1, \"jirou kyouka\": 1, \"headphones\": 1, \"red necktie\": 1, \"purple hair\": 8, \"yellow background\": 3, \"necklace\": 3, \"school uniform\": 3, \"purple eyes\": 3, \"u.a. school uniform\": 1, \"nail polish\": 8, \"choker\": 8, \"loose necktie\": 1, \"red nails\": 3, \"cloak\": 1, \"hooded cloak\": 1, \"bra\": 2, \"multiple boys\": 1, \"brown gloves\": 1, \"black panties\": 5, \"boots\": 9, \"2boys\": 1, \"leg up\": 4, \"breasts out\": 1, \"solo focus\": 1, \"cigarette\": 1, \"couch\": 1, \"eyewear on head\": 3, \"orange-tinted eyewear\": 1, \"sunglasses\": 5, \"tinted eyewear\": 2, \"pole dancing\": 1, \"hairband\": 4, \"grin\": 14, \"gradient\": 1, \"stripper pole\": 1, \"gradient background\": 1, \"pole\": 1, \"pink bikini\": 3, \"underboob\": 10, \"purple background\": 2, \"shiny\": 3, \"medium breasts\": 9, \"bandaid\": 4, \"crop top\": 11, \"tank top\": 8, \"bare arms\": 1, \"ranma-chan\": 1, \"braid\": 4, \"braided ponytail\": 1, \"single braid\": 2, \"black bikini\": 2, \"bikini top only\": 2, \"bottomless\": 4, \"parted lips\": 6, \"squatting\": 1, \"bright pupils\": 5, \"completely nude\": 2, \"white pupils\": 2, \"ahegao\": 3, \"barefoot\": 5, \"black bodysuit\": 2, \"holding poke ball\": 5, \"bodysuit\": 2, \"belt\": 3, \"ahoge\": 10, \"loose belt\": 1, \"halo\": 1, \"bare shoulders\": 5, \"black lips\": 1, \"standing split\": 1, \"standing on one leg\": 3, \"split\": 1, \"shoes\": 9, \"black shorts\": 2, \"long sleeves\": 5, \"hoodie\": 6, \"leg lift\": 1, \"pink background\": 4, \"bike shorts\": 3, \"blue nails\": 4, \"black socks\": 3, \"hair stick\": 1, \"yamato (one piece)\": 1, \"stomach\": 2, \"oni\": 1, \"horns\": 1, \"multicolored horns\": 1, \"red horns\": 1, \"club (weapon)\": 1, \"bikini bottom only\": 1, \"hands up\": 3, \"kanabou\": 1, \"fundoshi\": 1, \"colored pubic hair\": 1, \"curled horns\": 1, \"groin\": 1, \"v-shaped eyebrows\": 2, \"sidelocks\": 3, \"cropped legs\": 1, \"high ponytail\": 1, \"japanese clothes\": 1, \"spiked club\": 1, \"burger\": 1, \"food\": 2, \"striped gloves\": 1, \"musical note\": 1, \"twintails\": 3, \"holding food\": 1, \"skindentation\": 2, \"convenient censoring\": 1, \"eighth note\": 1, \"blue bow\": 1, \"hug\": 1, \"genderswap (mtf)\": 2, \"hug from behind\": 1, \"genderswap\": 2, \"one eye closed\": 4, \"yuri\": 1, \"sandals\": 1, \"strap slip\": 1, \"zipper\": 2, \"closed eyes\": 3, \"skull hair ornament\": 3, \"jacket\": 7, \"track jacket\": 2, \"naked hoodie\": 1, \"pantyshot\": 2, \"mask\": 4, \"white panties\": 3, \"garter straps\": 2, \"red hood\": 1, \"red gloves\": 5, \"short dress\": 4, \"impossible dress\": 1, \"impossible clothes\": 3, \"covered mouth\": 1, \"bandages\": 2, \"torn clothes\": 1, \"looking back\": 6, \"androgynous\": 2, \"huge ass\": 1, \"dawn (pokemon)\": 1, \"beanie\": 1, \"w\": 1, \"white headwear\": 1, \"tiara\": 1, \"purple eyeshadow\": 1, \"bea (pokemon)\": 1, \"bodysuit under clothes\": 1, \"orange background\": 2, \"single glove\": 1, \"short sleeves\": 6, \"knee pads\": 1, \"outline\": 5, \"toes\": 4, \"print shirt\": 2, \"black hairband\": 1, \"print shorts\": 1, \"feet\": 3, \"fighting stance\": 1, \"white outline\": 3, \"book\": 1, \"fire\": 1, \"holding book\": 1, \"red lips\": 1, \"mole\": 2, \"open book\": 1, \"blue shirt\": 1, \"medium hair\": 3, \"aqua background\": 1, \"blue background\": 3, \"sonia (pokemon)\": 2, \"heart hair ornament\": 2, \"coat\": 2, \"bag\": 3, \"aqua eyes\": 6, \"handbag\": 2, \"aqua shirt\": 1, \"yellow jacket\": 1, \"glint\": 1, \"hair over eyes\": 3, \"from behind\": 4, \"split ponytail\": 1, \"low twintails\": 1, \"virgin killer sweater\": 1, \"sideboob\": 3, \"meme attire\": 2, \"sweater\": 4, \"backless outfit\": 1, \"naked sweater\": 1, \"butt crack\": 1, \"bare back\": 1, \"backless dress\": 1, \"ribbon\": 4, \"turtleneck sweater\": 2, \"hair ribbon\": 3, \"sweater dress\": 1, \"ribbed sweater\": 2, \"turtleneck\": 2, \"black one-piece swimsuit\": 1, \"labcoat\": 1, \"doctor\": 1, \"brown eyes\": 6, \"chair\": 1, \"white coat\": 1, \"name tag\": 1, \"red background\": 2, \"office chair\": 1, \"pink lips\": 1, \"pink shirt\": 1, \"box\": 2, \"zettai ryouiki\": 2, \"red jacket\": 1, \"clothing cutout\": 3, \"black choker\": 3, \"waving\": 1, \"jack-o' challenge\": 1, \"top-down bottom-up\": 2, \"socks\": 5, \"sports bra\": 1, \"sneakers\": 1, \"orange sweater\": 1, \"wind lift\": 1, \"magnifying glass\": 1, \"wind\": 1, \"black-framed eyewear\": 1, \"red skirt\": 1, \"orange shirt\": 1, \"miniskirt\": 4, \"pleated skirt\": 4, \"skirt flip\": 1, \"bow panties\": 1, \"pink panties\": 1, \"green jacket\": 2, \"black skirt\": 4, \"cropped shirt\": 1, \"feet out of frame\": 1, \"open clothes\": 2, \":d\": 2, \"no pants\": 2, \"purple panties\": 1, \"taut clothes\": 1, \"body freckles\": 1, \"open shirt\": 1, \"brown headwear\": 1, \"highleg bikini\": 1, \"green lips\": 1, \"green nails\": 2, \"microdress\": 2, \"tan\": 2, \"bandaid on face\": 3, \"tanlines\": 2, \"baseball mitt\": 1, \"baseball cap\": 1, \"bandaid on nose\": 3, \"white footwear\": 1, \"green skirt\": 1, \":p\": 2, \"fang\": 1, \"orange gloves\": 1, \"mole under mouth\": 1, \"covered navel\": 3, \"argyle\": 1, \"armor\": 1, \"glowing\": 1, \"argyle legwear\": 1, \"polearm\": 1, \"may (pokemon)\": 2, \"bandana\": 2, \"hanging breasts\": 2, \"red bandana\": 1, \"bent over\": 3, \"leaning forward\": 2, \"cosplay\": 2, \"thigh boots\": 2, \"+_+\": 1, \"nami (one piece)\": 1, \"tattoo\": 2, \"green one-piece swimsuit\": 2, \"suspender shorts\": 1, \"sleeveless\": 2, \"aqua nails\": 1, \"ribbed shirt\": 1, \"soles\": 1, \"yellow gloves\": 1, \"anus peek\": 1, \"cleavage cutout\": 1, \"looking to the side\": 1, \"black dress\": 3, \"brown pantyhose\": 1, \"male focus\": 1, \"meme\": 1, \"happy\": 1, \"portrait\": 1, \"scar\": 1, \"low ponytail\": 1, \"shiny hair\": 1, \"hair intakes\": 1, \"scar on face\": 1, \"semi-rimless eyewear\": 1, \"see-through\": 1, \"under-rim eyewear\": 1, \"lowleg\": 1, \"lowleg panties\": 1, \"print panties\": 1, \"no bra\": 2, \"green ribbon\": 1, \"mature female\": 1, \"hex maniac (pokemon)\": 1, \"@_@\": 2, \"purple hairband\": 1, \"messy hair\": 1, \"black background\": 1, \"all fours\": 1, \"underwear only\": 1, \"wet\": 1, \"competition swimsuit\": 2, \"red one-piece swimsuit\": 2, \"whistle around neck\": 1, \"highleg\": 3, \"whistle\": 1, \"highleg swimsuit\": 1, \"lying\": 1, \"wine glass\": 1, \"pasties\": 1, \"crossed legs\": 1, \"in container\": 1, \"party hat\": 1, \"holding cup\": 1, \"blue footwear\": 1, \"in box\": 1, \"ringed eyes\": 3, \"pink gloves\": 1, \"spiked hair\": 2, \"sweatdrop\": 1, \"covering\": 1, \"covering crotch\": 1, \"white tank top\": 1, \"headband\": 1, \"twin braids\": 1, \"used condom\": 1, \"multiple condoms\": 1, \":t\": 1, \"crossed arms\": 1, \"single thighhigh\": 1, \"blood\": 1, \"sparkle\": 1, \"asymmetrical legwear\": 1, \"pink eyes\": 2, \"pout\": 1, \"closed mouth\": 2, \"super crown\": 1, \"white gloves\": 2, \"chain\": 1, \"shackles\": 1, \"cuffs\": 1, \"broken chain\": 1, \"broken\": 1, \"bob cut\": 3, \"strapless\": 2, \"bell\": 1, \"santa hat\": 1, \"red panties\": 1, \"christmas\": 1, \"neck bell\": 1, \"knee boots\": 1, \"brown thighhighs\": 1, \"red headwear\": 2, \"high heel boots\": 2, \"side-tie panties\": 1, \"jingle bell\": 1, \"humanization\": 1, \"middle finger\": 1, \"off shoulder\": 2, \"black jacket\": 1, \"arms behind back\": 1, \":<\": 1, \"antlers\": 1, \"red shirt\": 1, \"controller\": 1, \"fake antlers\": 1, \"game controller\": 1, \"tied shirt\": 1, \"halftone\": 1, \";d\": 1, \"nurse\": 1, \"nurse cap\": 1, \"alternate costume\": 1, \"adjusting gloves\": 1, \"ok sign\": 1, \"gloria (pokemon)\": 2, \"green headwear\": 3, \"tam o' shanter\": 3, \"jessie (pokemon)\": 3, \"green thighhighs\": 1, \"hair slicked back\": 2, \"hood down\": 2, \"blue hoodie\": 1, \"hoodie lift\": 1, \"clothes lift\": 2, \"highleg panties\": 3, \"lifted by self\": 2, \"narrow waist\": 1, \"steaming body\": 1, \"yoko littner\": 1, \"flame print\": 1, \"gun\": 1, \"rifle\": 1, \"anti-materiel rifle\": 1, \"scarf\": 1, \"studded belt\": 1, \"sniper rifle\": 1, \"holding eyewear\": 1, \"eyewear removed\": 1, \"asymmetrical gloves\": 1, \"team rocket\": 2, \"team rocket uniform\": 2, \"bursting breasts\": 1, \"white skirt\": 1, \"thong\": 1, \"microskirt\": 1, \"shirt lift\": 1, \"undressing\": 1, \"reverse trap\": 1, \"surcoat\": 1, \"turban\": 1, \"scythe\": 1, \"holding scythe\": 1, \"leg tattoo\": 1, \"pubic tattoo\": 1, \"skull\": 1, \"backpack\": 1, \"plaid\": 1, \"watch\": 1, \"pink bow\": 1, \"covered eyes\": 1, \"plaid skirt\": 1, \"black pantyhose\": 1, \"blue skirt\": 1, \"pink bowtie\": 1, \"long tongue\": 3, \"strapless swimsuit\": 1, \"one eye covered\": 1, \"seiza\": 1, \"colored tongue\": 1, \"blue tongue\": 1, \"borrowed design\": 1, \"maid headdress\": 2, \"revealing clothes\": 1, \"holding clothes\": 1, \"red hoodie\": 1, \"ankle boots\": 1, \"thick eyebrows\": 1, \"green bikini\": 1, \"axe\": 1, \"clothes around waist\": 1, \"pants\": 1, \"brown footwear\": 1, \"blue pants\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [320, 704], \"count\": 15}, \"1\": {\"resolution\": [384, 640], \"count\": 100}, \"2\": {\"resolution\": [448, 576], \"count\": 175}, \"3\": {\"resolution\": [512, 512], \"count\": 195}, \"4\": {\"resolution\": [576, 448], \"count\": 10}, \"5\": {\"resolution\": [640, 384], \"count\": 5}}, \"mean_img_ar_error\": 0.026507790468227675}, \"subsets\": [{\"img_count\": 100, \"num_repeats\": 5, \"color_aug\": false, \"flip_aug\": false, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"dataset\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "10", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "0.0001", + "ss_lowram": "True", + "ss_lr_scheduler": "constant", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "3780", + "ss_min_snr_gamma": "5.0", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "8", + "ss_network_dim": "16", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "b0c91a8a93ab63b8b513046c2e2181a4ce78b83367ee7e26354ba9e018ea102f", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "252", + "ss_num_epochs": "15", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit", + "ss_output_name": "gerph", + "ss_prior_loss_weight": "1.0", + "ss_sd_model_hash": "66f58dbb", + "ss_sd_scripts_commit_hash": "e6ad3cbc66130fdc3bf9ecd1e0272969b1d613f7", + "ss_seed": "42", + "ss_session_id": "1628510923", + "ss_steps": "2520", + "ss_text_encoder_lr": "0", + "ss_training_comment": "None", + "ss_training_finished_at": "1690749759.631684", + "ss_training_started_at": "1690748362.1310456", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "015fe32a", + "sshs_model_hash": "63139c790eb4f9023eb18114e0a712536e63571b3df63e99b33c66f53934f416" +} \ No newline at end of file diff --git a/Styles/52/gerph-10-94683.txt b/Styles/52/gerph-10-94683.txt new file mode 100644 index 0000000000000000000000000000000000000000..eaf7037b910ae0606111c3a84853c69a31f07e83 --- /dev/null +++ b/Styles/52/gerph-10-94683.txt @@ -0,0 +1,325 @@ +Link:https://civitai.com/models/120068/gerph-artstyle +Version:v1.0 +Base Model:SD 1.5 +Keywords:gerph +--------DESCRIPTION--------- + +Lora imitating the style of the artist Gerph + +best prompts: 1girl, solo, breasts, outline + +Work better with AOM (AbyssOrangeMix) models or merge, but can do fine with any anime model +Letting the weight of the model at 1 can work if you don't have hands on the images, else it may give some strange results. Thats why I suggest you set the weigth at 0.9 or 0.8, and if it still give bad hands, try to describe the position of the hands in the prompts (clenched hands, v sign, ...) +If you want to add a loras or embeddings in the prompt, try to lower their weight (especially for embeddings) +Like all my other style models, faces can also turn out a little strange, so you will need to do some inpainting (with the parameter "only masked") to have the best result. +If you manage to have some great results or if you want to suggest some improvement for the model, you can send me reviews or feedbacks in the comment + +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:(masterpiece, official art), gerph, normpika, 1girl, blush, smile, open mouth, v sign, park, looking at viewer, full body, outline, , + Negative Prompt:bad-anime, easynegative, badhandsv5-neg, watermark, logo, + Size:512x768, Sampler:Euler a, Steps:25, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img2: + Prompt:(masterpiece, official art), gerph, 1girl, blush, (red hair), ponytail, smile, v sign, sport bra, park, sunlight, looking at viewer, upper body, outline, + Negative Prompt:easynegative, badhandsv5-neg, (watermark, logo:1.2) + Size:512x512, Sampler:Euler a, Steps:25, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img3: + Prompt:masterpiece, official art, gerph, 1girl, solo blush, breasts, black hair, short hair, ponytail, headband, frown, focus, martial art, karate, white kimono, cleavage, black belt, fighting pose, standing, full body, mountain, rocks, outline, + Negative Prompt:easynegative, (badhandsv5-neg), (watermark, logo) + Size:512x512, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img4: + Prompt:(masterpiece, official art), 1girl, solo, breasts, sharp teeth, yellow eyes, hood, large breasts, hoodie, blue hair, hair over one eye, solo, cleavage, teeth, gloves, shorts, hand on hip, smile, short hair, collar, grin, short shorts, high heels, ankle boots, hood down, choker, black gloves, purple hair, boots, bike shorts, standing, full body, outline, + Negative Prompt:bad-anime, easynegative, badhandsv5-neg, watermark, logo, + Size:512x768, Sampler:DPM++ 2S a Karras, Steps:30, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img5: + Prompt:(masterpiece, official art), gerph, 1girl, solo, blush, huge breasts, nun, bedroom eyes, smile, long dress, standing, indoor, church, outline, + Negative Prompt:bad-anime, easynegative, badhandsv5-neg, (watermark, logo), + Size:512x512, Sampler:DPM++ 2S a Karras, Steps:35, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + +img6: + Prompt:masterpiece, official art, gerph, 1girl, nude, solo, blush, huge breasts, blond hair, long hair, choked, eyes wide opened, open mouth, covering breasts, standing, beach, outline, + Negative Prompt:bad-anime, easynegative, badhandsv5-neg, (watermark, logo), + Size:512x768, Sampler:Euler a, Steps:30, CFG:7, Clip Skip:0, Model:abyssorangemix3AOM3_aom3a1b, Model Hash:5493a0ec49 + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 120068, + "name": "Gerph Artstyle", + "description": "

Lora imitating the style of the artist Gerph

best prompts: 1girl, solo, breasts, outline

Work better with AOM (AbyssOrangeMix) models or merge, but can do fine with any anime model.

Letting the weight of the model at 1 can work if you don't have hands on the images, else it may give some strange results. Thats why I suggest you set the weigth at 0.9 or 0.8, and if it still give bad hands, try to describe the position of the hands in the prompts (clenched hands, v sign, ...)

If you want to add a loras or embeddings in the prompt, try to lower their weight (especially for embeddings)

Like all my other style models, faces can also turn out a little strange, so you will need to do some inpainting (with the parameter \"only masked\") to have the best result.

If you manage to have some great results or if you want to suggest some improvement for the model, you can send me reviews or feedbacks in the comment.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 0, + "favoriteCount": 0, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "Zolilio", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/5469aaf6-be33-4b6a-8f6b-a097ab7da35b/width=96/Zolilio.jpeg" + }, + "tags": [ + "anime", + "style", + "artstyle" + ], + "modelVersions": [ + { + "id": 130543, + "modelId": 120068, + "name": "v1.0", + "createdAt": "2023-07-31T20:50:28.568Z", + "updatedAt": "2023-07-31T20:57:32.241Z", + "trainedWords": [ + "gerph" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 94683, + "url": "https://civitai-delivery-worker-prod-2023-07-01.5ac0637cfd0766c97916cefa3764fbdf.r2.cloudflarestorage.com/97792/model/gerph10.qPJk.safetensors", + "sizeKB": 13358.943359375, + "name": "gerph-10.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-07-31T21:00:49.281Z", + "hashes": { + "AutoV1": "167A9755", + "AutoV2": "1D5677AF05", + "SHA256": "1D5677AF05E4ED302E0DF94A833EBFBD2C7F6DFD4C63D3DF722DE296C7B32734", + "CRC32": "C249DF02", + "BLAKE3": "63D43F1DF8D66BC0B4C92C0672BE515DA09D935E88420290454FD6FC1DA20F99" + }, + "downloadUrl": "https://civitai.com/api/download/models/130543", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/78860030-cb6b-47b4-8171-c9d86b4fb0c7/width=450/1813650.jpeg", + "nsfw": "None", + "width": 768, + "height": 1152, + "hash": "UIJHs+_19a-P3GERM|jX?bbw$~r=4q%1VrE2", + "meta": { + "Size": "512x768", + "seed": 781531580, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 25, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(masterpiece, official art), gerph, normpika, 1girl, blush, smile, open mouth, v sign, park, looking at viewer, full body, outline, ,", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "amanoPikameeLocon_v1", + "type": "lora", + "weight": 0.8 + }, + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "bad-anime, easynegative, badhandsv5-neg, watermark, logo, ", + "Denoising strength": "0.6" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c0e20b29-271c-40b8-8912-f7b15788b176/width=450/1813644.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UKLNSx#HTuc[wf8}KKE.8_I9xsNz?bw@-oo~", + "meta": { + "Size": "512x512", + "seed": 781531581, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 25, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(masterpiece, official art), gerph, 1girl, blush, (red hair), ponytail, smile, v sign, sport bra, park, sunlight, looking at viewer, upper body, outline, ", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "negativePrompt": "easynegative, badhandsv5-neg, (watermark, logo:1.2)" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0693c095-ffbd-4991-af68-6c155781c0d3/width=450/1813649.jpeg", + "nsfw": "None", + "width": 768, + "height": 768, + "hash": "U7Gb*NQq01n50M03_19b9r58^iXm%LE3~BS~", + "meta": { + "Size": "512x512", + "seed": 781531581, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 30, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "masterpiece, official art, gerph, 1girl, solo blush, breasts, black hair, short hair, ponytail, headband, frown, focus, martial art, karate, white kimono, cleavage, black belt, fighting pose, standing, full body, mountain, rocks, outline, ", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "1.5", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "easynegative, (badhandsv5-neg), (watermark, logo)", + "Denoising strength": "0.7" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/6d25c761-b887-473b-b4b9-ca0c927a6857/width=450/1813642.jpeg", + "nsfw": "None", + "width": 608, + "height": 920, + "hash": "U6I}9J-.IQ%1x_ax-Mj^02WA^jxu~Bs:9tWB", + "meta": { + "Size": "512x768", + "seed": 781531581, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 30, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(masterpiece, official art), 1girl, solo, breasts, sharp teeth, yellow eyes, hood, large breasts, hoodie, blue hair, hair over one eye, solo, cleavage, teeth, gloves, shorts, hand on hip, smile, short hair, collar, grin, short shorts, high heels, ankle boots, hood down, choker, black gloves, purple hair, boots, bike shorts, standing, full body, outline, ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "Hires upscale": "1.2", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "bad-anime, easynegative, badhandsv5-neg, watermark, logo, ", + "Denoising strength": "0.75" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a0edcbe5-b936-4430-98ca-ba29a81f90ca/width=450/1813648.jpeg", + "nsfw": "None", + "width": 512, + "height": 512, + "hash": "UOGH^~NH00M{~UIVE2%1M^NG%gWCxZRkt7s.", + "meta": { + "Size": "512x512", + "seed": 3488530593, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 35, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "(masterpiece, official art), gerph, 1girl, solo, blush, huge breasts, nun, bedroom eyes, smile, long dress, standing, indoor, church, outline, ", + "sampler": "DPM++ 2S a Karras", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "negativePrompt": "bad-anime, easynegative, badhandsv5-neg, (watermark, logo), " + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c38397a5-ab78-48e7-aae8-f5f93387f013/width=450/1813646.jpeg", + "nsfw": "X", + "width": 512, + "height": 768, + "hash": "UDMs$Y?J2]}p245E0qVE179vIZ^*9Hnmh}Fd", + "meta": { + "Size": "512x768", + "seed": 3488530593, + "Model": "abyssorangemix3AOM3_aom3a1b", + "steps": 30, + "hashes": { + "model": "5493a0ec49" + }, + "prompt": "masterpiece, official art, gerph, 1girl, nude, solo, blush, huge breasts, blond hair, long hair, choked, eyes wide opened, open mouth, covering breasts, standing, beach, outline, ", + "sampler": "Euler a", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "hash": "5493a0ec49", + "name": "abyssorangemix3AOM3_aom3a1b", + "type": "model" + } + ], + "Model hash": "5493a0ec49", + "negativePrompt": "bad-anime, easynegative, badhandsv5-neg, (watermark, logo), " + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/130543" + } + ] +} +---------------------------- diff --git a/Styles/53/ghibli_v4.txt b/Styles/53/ghibli_v4.txt new file mode 100644 index 0000000000000000000000000000000000000000..b12e100d7d2f90a5e55e96c30603148d1a361a20 --- /dev/null +++ b/Styles/53/ghibli_v4.txt @@ -0,0 +1,233 @@ +Link:https://civitai.com/models/54233/ghiblibackground +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +The beautiful Ghibli scene has a powerful expression for both architecture and landscape +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,clear,rational construction,cartoon style,brick_wall, building, bush, day, door, fence, field, flower, flower_field, garden, grass, house, nature, no_humans, outdoors, path, pink_flower, plant, potted_plant, road, scenery, sunflower, tree, tree_stump + Negative Prompt:paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative + Size:584x400, Sampler:DPM++ SDE Karras, Steps:40, CFG:7, Clip Skip:0, Model:concept_scene_B, Model Hash:a074b8864e + +img2: + Prompt:panorama,landscape,(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,building, album_cover, architecture, balcony, blue_sky, bridge, brown_hair, building, car, chimney, city, cityscape, cloud, cloudy_sky, day, east_asian_architecture, house, mountain, outdoors, pagoda, power_lines, railing, real_world_location, road, rooftop, scenery, sky, skyline, skyscraper, stairs, street, tokyo_\(city\), tower, town, tree + Negative Prompt:paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative + Size:584x400, Sampler:DPM++ SDE Karras, Steps:40, CFG:7, Clip Skip:0, Model:concept_scene_B, Model Hash:a074b8864e + +img3: + Prompt:panorama,landscape,(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,antlers, bare_tree, branch, cherry_blossoms, fantasy, fence, forest, in_tree, lake, landscape, letterboxed, moon, mountain, mountainous_horizon, nature, night, night_sky, no_humans, outdoors, pine_tree, scenery, shooting_star, sky, snow, star_\(sky\), starry_sky, sunset, torn_clothes, tree, wintern + Negative Prompt:paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative + Size:584x400, Sampler:DPM++ SDE Karras, Steps:40, CFG:7, Clip Skip:0, Model:concept_scene_B, Model Hash:a074b8864e + + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 54233, + "name": "GHIBLI_Background", + "description": "

The beautiful Ghibli scene has a powerful expression for both architecture and landscape

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 448, + "favoriteCount": 118, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "mccc", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/fd142637-3be3-4fda-778c-f1cc58917400/width=96/mccc.jpeg" + }, + "tags": [ + { + "name": "ghibli" + }, + { + "name": "scenery" + }, + { + "name": "background" + } + ], + "modelVersions": [ + { + "id": 58596, + "modelId": 54233, + "name": "v1.0", + "createdAt": "2023-04-30T03:45:48.093Z", + "updatedAt": "2023-04-30T03:49:31.469Z", + "trainedWords": [], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "stats": { + "downloadCount": 448, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "name": "Ghibli_v4.safetensors", + "id": 41643, + "sizeKB": 73838.03515625, + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-04-30T03:50:42.223Z", + "hashes": { + "AutoV1": "6806EE29", + "AutoV2": "DF7098D16D", + "SHA256": "DF7098D16DF3533F3F8E49377146BE132EB81AB494544CBE7C26444CB0A8C99A", + "CRC32": "98E8475A", + "BLAKE3": "D3577BCFBEB8EC717A1504C1E6B060620706555028890045D2D9FD8629712431" + }, + "downloadUrl": "https://civitai.com/api/download/models/58596", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2de63efb-8604-46c1-acb4-ef8a75b3eb00/width=450/638284.jpeg", + "nsfw": "None", + "width": 1168, + "height": 800, + "hash": "UGFiPV}@8{jKTMnhrpx@.8M|D$%2kZodRNRk", + "meta": { + "Size": "584x400", + "seed": 3256590904, + "Model": "concept_scene_B", + "steps": 40, + "hashes": { + "model": "a074b8864e" + }, + "prompt": "(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,clear,rational construction,cartoon style,brick_wall, building, bush, day, door, fence, field, flower, flower_field, garden, grass, house, nature, no_humans, outdoors, path, pink_flower, plant, potted_plant, road, scenery, sunflower, tree, tree_stump ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ghibli_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "concept_scene_B", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b994c8db-02ff-4198-cda3-65054bed5400/width=450/638285.jpeg", + "nsfw": "None", + "width": 1168, + "height": 800, + "hash": "UUIF6%Z~D%adyZMxxCRi_Nf4IUjYxabHWCxa", + "meta": { + "Size": "584x400", + "seed": 3256590905, + "Model": "concept_scene_B", + "steps": 40, + "hashes": { + "model": "a074b8864e" + }, + "prompt": "panorama,landscape,(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,building, album_cover, architecture, balcony, blue_sky, bridge, brown_hair, building, car, chimney, city, cityscape, cloud, cloudy_sky, day, east_asian_architecture, house, mountain, outdoors, pagoda, power_lines, railing, real_world_location, road, rooftop, scenery, sky, skyline, skyscraper, stairs, street, tokyo_\\(city\\), tower, town, tree", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ghibli_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "concept_scene_B", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/4d106057-d2a5-4f38-193e-30ef5202ae00/width=450/638286.jpeg", + "nsfw": "None", + "width": 1168, + "height": 800, + "hash": "UTH-yBs,9atR~qxCMyoz?vt6V[ofb_oJxaWC", + "meta": { + "Size": "584x400", + "seed": 3256590904, + "Model": "concept_scene_B", + "steps": 40, + "hashes": { + "model": "a074b8864e" + }, + "prompt": "panorama,landscape,(((high quality))),highly_detailed,extremely_detailed_CG_unity_8k_wallpaper,illustration,highres,absurdres,High saturation,antlers, bare_tree, branch, cherry_blossoms, fantasy, fence, forest, in_tree, lake, landscape, letterboxed, moon, mountain, mountainous_horizon, nature, night, night_sky, no_humans, outdoors, pine_tree, scenery, shooting_star, sky, snow, star_\\(sky\\), starry_sky, sunset, torn_clothes, tree, wintern ", + "sampler": "DPM++ SDE Karras", + "cfgScale": 7, + "resources": [ + { + "name": "Ghibli_v4", + "type": "lora", + "weight": 1 + }, + { + "hash": "a074b8864e", + "name": "concept_scene_B", + "type": "model" + } + ], + "Model hash": "a074b8864e", + "Hires steps": "30", + "Hires upscale": "2", + "Hires upscaler": "Latent", + "negativePrompt": "paintings, sketches, (worst quality:1), (low quality1), (normal quality:1), lowres, normal quality, ((monochrome)), ((grayscale)), skin spots, acnes, skin blemishes, age spot, glan,nsfw, lowres, bad anatomy, text, error, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, username,Wrong structure,easynegative", + "Denoising strength": "0.7" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/3f62644b-a3d6-4ae7-6f3b-46cd82f87d00/width=450/638288.jpeg", + "nsfw": "None", + "width": 1168, + "height": 800, + "hash": "UMEfJ}I[R4xsK-NKMxWX%hxVV?kD~UNGIpog", + "meta": null + } + ], + "downloadUrl": "https://civitai.com/api/download/models/58596" + } + ] +} +---------------------------- diff --git a/Styles/54/guardiantalessalchibi_v10-metadata.json b/Styles/54/guardiantalessalchibi_v10-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..a0d822e7c17887c3c19bce3e2f5eedb84309eded --- /dev/null +++ b/Styles/54/guardiantalessalchibi_v10-metadata.json @@ -0,0 +1,417 @@ +{ + "ss_sd_model_name": "final-pruned.ckpt", + "ss_resolution": "(512, 512)", + "ss_clip_skip": "2", + "ss_num_train_images": "260", + "ss_tag_frequency": { + "5_GTChibi": { + " long hair": 31, + " bangs": 29, + " holding": 28, + " smile": 27, + " blush": 23, + " gloves": 21, + " closed mouth": 21, + " dress": 18, + " weapon": 16, + " open mouth": 14, + " holding weapon": 13, + " short hair": 12, + "blonde hair": 12, + " hair ornament": 12, + " flower": 12, + " long sleeves": 12, + " ahoge": 12, + " red eyes": 9, + " horns": 9, + " hair flower": 9, + " tail": 9, + " white hair": 9, + " pants": 8, + " sword": 8, + " holding sword": 8, + " bow": 8, + " hair between eyes": 8, + " blue eyes": 8, + " shirt": 7, + " purple eyes": 7, + " hat": 7, + " yellow eyes": 6, + " pointy ears": 6, + " boots": 6, + " blonde hair": 6, + " skirt": 6, + " thighhighs": 6, + " jacket": 6, + " animal ears": 6, + " wings": 6, + " very long hair": 6, + " standing": 6, + " cape": 5, + " breasts": 5, + " brown hair": 5, + " grey hair": 4, + " red hair": 4, + " white shirt": 4, + "animal ears": 4, + " gun": 4, + " hood": 4, + "blue eyes": 4, + " staff": 4, + " :d": 4, + " jewelry": 4, + " multiple tails": 4, + " fox ears": 4, + " fox tail": 4, + " black footwear": 4, + " braid": 4, + " sitting": 4, + " white dress": 4, + "green eyes": 4, + " teeth": 4, + " brown footwear": 4, + " black hair": 4, + " v-shaped eyebrows": 4, + " pink eyes": 3, + " elbow gloves": 3, + " purple dress": 3, + " hood up": 3, + " tiger ears": 3, + " male focus": 3, + " ponytail": 3, + "weapon": 3, + " blue hair": 3, + " ribbon": 3, + " armor": 3, + " eyes visible through hair": 3, + " holding shield": 3, + " white gloves": 3, + " shoes": 3, + " fang": 3, + "pink hair": 3, + " black gloves": 3, + " frills": 3, + " black jacket": 3, + " fox girl": 3, + "hat": 2, + " cane": 2, + " denim": 2, + " jeans": 2, + " cleavage": 2, + " torn clothes": 2, + " torn pants": 2, + " rabbit ears": 2, + " hair bow": 2, + "red hair": 2, + " grin": 2, + " sunglasses": 2, + " holding gun": 2, + " handgun": 2, + " basket": 2, + " red bow": 2, + " apron": 2, + " holding staff": 2, + " tiger tail": 2, + " red footwear": 2, + " cloak": 2, + " swimsuit": 2, + " white headwear": 2, + " demon girl": 2, + " demon horns": 2, + " demon tail": 2, + " japanese clothes": 2, + " 1boy": 2, + "red eyes": 2, + " chinese clothes": 2, + " hair bun": 2, + " pantyhose": 2, + " green eyes": 2, + " red flower": 2, + " shield": 2, + " hairband": 2, + " shoulder armor": 2, + " white pants": 2, + " chair": 2, + " coat": 2, + " fur trim": 2, + " upper teeth only": 2, + " bow (weapon)": 2, + " holding bow (weapon)": 2, + " arrow (projectile)": 2, + " black dress": 2, + " motor vehicle": 2, + " ground vehicle": 2, + " motorcycle": 2, + " black pants": 2, + " dark skin": 2, + " food": 2, + " sparkle": 2, + " animal hands": 2, + " paw gloves": 2, + " orange hair": 2, + " hanbok": 2, + " white footwear": 2, + " sharp teeth": 2, + " multicolored hair": 2, + " navel": 2, + " umbrella": 2, + " holding umbrella": 2, + " chain": 2, + " top hat": 1, + " card": 1, + " holding cane": 1, + " thigh boots": 1, + " fingerless gloves": 1, + " cowboy hat": 1, + " bell": 1, + " jingle bell": 1, + " orange bow": 1, + " holding basket": 1, + " tiger girl": 1, + " hooded cape": 1, + "blue one-piece swimsuit": 1, + " one-piece swimsuit": 1, + " open clothes": 1, + " open jacket": 1, + " white jacket": 1, + " red wings": 1, + " baseball cap": 1, + " demon wings": 1, + " bat wings": 1, + " barefoot": 1, + " horns through headwear": 1, + " kimono": 1, + " parted lips": 1, + " monster girl": 1, + " slit pupils": 1, + "green hair": 1, + " black thighhighs": 1, + " :<": 1, + " mecha musume": 1, + " leotard": 1, + " headgear": 1, + "purple eyes": 1, + " cup": 1, + " twintails": 1, + " double bun": 1, + " alcohol": 1, + " looking back": 1, + " wheelchair": 1, + " blue ribbon": 1, + " neck ribbon": 1, + " instrument": 1, + " harp": 1, + " heart": 1, + " holding instrument": 1, + " white thighhighs": 1, + " polearm": 1, + " scarf": 1, + " spear": 1, + " black hairband": 1, + " lux (league of legends)": 1, + " eyepatch": 1, + " crossed legs": 1, + " peaked cap": 1, + " military hat": 1, + " military uniform": 1, + "1boy": 1, + " blue hairband": 1, + " outstretched arms": 1, + " standing on one leg": 1, + " floral print": 1, + "yellow eyes": 1, + " red headwear": 1, + " star (symbol)": 1, + " star hair ornament": 1, + " halo": 1, + " angel": 1, + " bare shoulders": 1, + " white wings": 1, + " feathered wings": 1, + " angel wings": 1, + "twintails": 1, + " purple footwear": 1, + " short sleeves": 1, + " puffy sleeves": 1, + " puffy short sleeves": 1, + " on motorcycle": 1, + " virtual youtuber": 1, + "hair ornament": 1, + " ninja": 1, + " seele vollerei": 1, + " china dress": 1, + "long hair": 1, + " facial hair": 1, + " mustache": 1, + " beard": 1, + " blue wings": 1, + " plaid": 1, + " multiple girls": 1, + " 2girls": 1, + " white bow": 1, + " fruit": 1, + " back-to-back": 1, + " plaid skirt": 1, + "robot": 1, + " mecha": 1, + " no humans": 1, + " clenched hand": 1, + " science fiction": 1, + " looking ahead": 1, + " open hand": 1, + "shield": 1, + "shirt": 1, + " book": 1, + " suspenders": 1, + " holding book": 1, + " necktie": 1, + " cat tail": 1, + " crown": 1, + " cat ears": 1, + " red skirt": 1, + " princess peach": 1, + " frilled skirt": 1, + " paw print": 1, + " one eye closed": 1, + " antenna hair": 1, + " korean clothes": 1, + " magical girl": 1, + " wand": 1, + " red hood": 1, + " red cloak": 1, + " red cape": 1, + " hair over one eye": 1, + " shaded face": 1, + " torn cape": 1, + " red dress": 1, + " head wings": 1, + " red gloves": 1, + " fire": 1, + " bikini": 1, + " eyewear on head": 1, + " crossed arms": 1, + " thigh strap": 1, + " sandals": 1, + " official alternate costume": 1, + "brown hair": 1, + " brown eyes": 1, + " wide sleeves": 1, + " parasol": 1, + "horns": 1, + " earrings": 1, + " medium breasts": 1, + " floating": 1, + " hair behind ear": 1, + " hand on hip": 1, + "blue hair": 1, + " scythe": 1, + " socks": 1, + " holding scythe": 1, + " anchor": 1, + " closed eyes": 1, + " leaf": 1, + " orange eyes": 1, + " blush stickers": 1, + " facial mark": 1, + " wolf": 1, + "sunglasses": 1, + " riding": 1, + " blue pants": 1, + " torn jeans": 1, + "korean clothes": 1, + " :3": 1, + " bonnet": 1, + " striped": 1, + " closed umbrella": 1, + " striped bow": 1, + " animal ear fluff": 1 + } + }, + "ss_batch_size_per_device": "2", + "ss_bucket_info": { + "buckets": { + "0": { + "resolution": [ + 384, + 640 + ], + "count": 5 + }, + "1": { + "resolution": [ + 448, + 576 + ], + "count": 100 + }, + "2": { + "resolution": [ + 512, + 512 + ], + "count": 140 + }, + "3": { + "resolution": [ + 576, + 448 + ], + "count": 15 + } + }, + "mean_img_ar_error": 0.0538294917918091 + }, + "ss_cache_latents": "True", + "ss_color_aug": "False", + "ss_dataset_dirs": { + "5_GTChibi": { + "n_repeats": 5, + "img_count": 52 + }, + "GTChibi_out": { + "n_repeats": 0, + "img_count": 0 + }, + "jsonconfigfol": { + "n_repeats": 0, + "img_count": 0 + } + }, + "ss_enable_bucket": "True", + "ss_epoch": "19", + "ss_flip_aug": "False", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_keep_tokens": "None", + "ss_learning_rate": "0.0001", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_bucket_reso": "960", + "ss_max_token_length": "150", + "ss_max_train_steps": "3325", + "ss_min_bucket_reso": "320", + "ss_mixed_precision": "fp16", + "ss_network_alpha": "4.0", + "ss_network_dim": "8", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "89d59c3dde4c56c6d5c41da34cc55ce479d93b4007046980934b14db71bdb2a8", + "ss_num_batches_per_epoch": "133", + "ss_num_epochs": "25", + "ss_num_reg_images": "0", + "ss_output_name": "GTChibi", + "ss_random_crop": "False", + "ss_reg_dataset_dirs": {}, + "ss_sd_model_hash": "925997e9", + "ss_seed": "23", + "ss_session_id": "3243420043", + "ss_shuffle_caption": "False", + "ss_text_encoder_lr": "None", + "ss_total_batch_size": "2", + "ss_training_comment": "None", + "ss_training_started_at": "1677602889.0127442", + "ss_unet_lr": "None", + "ss_v2": "False", + "sshs_legacy_hash": "5383692c", + "sshs_model_hash": "35b4d37f12995aaaaffed516c8dd1db37569a9990ebf87e0123869581855e992" +} \ No newline at end of file diff --git a/Styles/54/guardiantalessalchibi_v10.txt b/Styles/54/guardiantalessalchibi_v10.txt new file mode 100644 index 0000000000000000000000000000000000000000..ffeed9bfa4ff2fcdb0d8068d0fbb3a8c3ee6ac7c --- /dev/null +++ b/Styles/54/guardiantalessalchibi_v10.txt @@ -0,0 +1,343 @@ +Link:https://civitai.com/models/14274/Guardian%20Tales%20%E4%B8%89%E4%B8%83-SAL-%E7%8B%AC%E8%BD%AE%E8%BD%A6%20%7C%20Chibi%20Style%20Lora%2052 +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Lora trained on 52 images 三七-SAL-独轮车 I think? +Trained on NAI gen'd on AOM2 +May look baked on other models. +WARNING: Transparent Dataset will not generate backgrounds. +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:, korean clothes, flower, tail, hair ornament, :3, fox tail, braid, orange hair, hanbok, holding, multiple tails, fox ears, hair flower, animal ears, long hair, ahoge, bangs, smile, blue eyes, closed mouth, long sleeves, fox girl + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: +img2: + Prompt:, hat, cane, long hair, cape, top hat, card, gloves, smile, holding cane, pink eyes, thigh boots, grey hair + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: +img3: + Prompt:, animal ears, tail, food, fox tail, long hair, fox ears, smile, multiple tails, fang, white hair, long sleeves, yellow eyes, holding, white shirt, shirt, black pants, pants, open mouth, bangs, animal ear fluff, fox girl + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: +img4: + Prompt:, blonde hair, weapon, horns, holding weapon, purple eyes, eyes visible through hair, holding, wings, smile, sword, long hair, open mouth, holding sword, fang, hand on hip, :d, navel, tail, thighhighs + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:final-pruned, Model Hash: +img5: + Prompt:, robot, mecha, weapon, holding, no humans, holding weapon, sword, shield, holding sword, clenched hand, science fiction, standing, holding shield, looking ahead, open hand + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: +img6: + Prompt:, blonde hair, blue eyes, tail, animal hands, animal ears, smile, paw gloves, cat tail, crown, open mouth, cat ears, gloves, skirt, jewelry, red skirt, princess peach, holding, tiger ears, frilled skirt, paw print + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: +img7: + Prompt:, hair ornament, red eyes, bangs, long hair, ninja, thighhighs, closed mouth, flower, seele vollerei, hair flower, black hair, red flower, red hair, horns, chinese clothes, gloves, dress, china dress, brown hair + Negative Prompt:lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet, + Size:512x512, Sampler:DPM++ 2M Karras, Steps:28, CFG:8, Clip Skip:2, Model:AbyssOrangeMix2_nsfw, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 14274, + "name": "Guardian Tales 三七-SAL-独轮车 | Chibi Style Lora 52", + "description": "

Lora trained on 52 images 三七-SAL-独轮车 I think?

Trained on NAI gen'd on AOM2

May look baked on other models.

WARNING: Transparent Dataset will not generate backgrounds.

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "None", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 1141, + "favoriteCount": 262, + "commentCount": 0, + "ratingCount": 2, + "rating": 5 + }, + "creator": { + "username": "Numeratic", + "image": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/b1ae93ee-0583-4a51-ee10-d97d34ca9f00/width=96/Numeratic.jpeg" + }, + "tags": [ + { + "name": "anime" + }, + { + "name": "character" + }, + { + "name": "girl" + }, + { + "name": "style" + }, + { + "name": "woman" + }, + { + "name": "chibi" + } + ], + "modelVersions": [ + { + "id": 16792, + "modelId": 14274, + "name": "v1.0", + "createdAt": "2023-02-28T18:12:42.125Z", + "updatedAt": "2023-02-28T18:12:42.125Z", + "trainedWords": [ + "" + ], + "baseModel": "SD 1.5", + "earlyAccessTimeFrame": 0, + "description": null, + "files": [ + { + "name": "guardianTalesSALChibi_v10.safetensors", + "id": 14144, + "sizeKB": 9331.9921875, + "type": "Model", + "metadata": { + "fp": "fp16", + "size": "full", + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "scannedAt": "2023-02-28T18:16:02.726Z", + "hashes": { + "AutoV1": "9CB72DE1", + "AutoV2": "A2AF10D8CD", + "SHA256": "A2AF10D8CD90FC8CB72D4AEC38A5E5F3115DB32808736C8E27FB4B4BD0F28060", + "CRC32": "5CBBB14D", + "BLAKE3": "02B7AD23FF7AC837BEEECB50FDE9F8B6C325664E67F9DA1C58DE6F57880378EC" + }, + "downloadUrl": "https://civitai.com/api/download/models/16792", + "primary": true + } + ], + "images": [ + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2da080b6-4b0a-49da-64cb-886c1f3c0a00/width=450/169594.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "U9NSsU00.m~8$==_00Rj0r^fpfyE00pKr;8{", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1975307887, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", korean clothes, flower, tail, hair ornament, :3, fox tail, braid, orange hair, hanbok, holding, multiple tails, fox ears, hair flower, animal ears, long hair, ahoge, bangs, smile, blue eyes, closed mouth, long sleeves, fox girl", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a0e9c28e-d341-4742-1db2-e97f21146400/width=450/169600.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "U6J7:s00YN%$I;Rjad%g00_4$*RPMwx].8D$", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 687977467, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", hat, cane, long hair, cape, top hat, card, gloves, smile, holding cane, pink eyes, thigh boots, grey hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/32b1e189-dacc-41b4-6cbf-cfb6c1430c00/width=450/169599.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "USM7cOt8O=xX?]D%9Z-p4.%LbEohxakVxujZ", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2289570198, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", animal ears, tail, food, fox tail, long hair, fox ears, smile, multiple tails, fang, white hair, long sleeves, yellow eyes, holding, white shirt, shirt, black pants, pants, open mouth, bangs, animal ear fluff, fox girl", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet,", + "Denoising strength": "0.65" + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d09a09a4-ebfb-4033-875d-2b0e17b4c100/width=450/169598.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UAJ%%^%K0b9h~nxs9c9a00M_?9xb05E4.4--", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 56947781, + "Model": "final-pruned", + "steps": 28, + "prompt": ", blonde hair, weapon, horns, holding weapon, purple eyes, eyes visible through hair, holding, wings, smile, sword, long hair, open mouth, holding sword, fang, hand on hip, :d, navel, tail, thighhighs", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Batch pos": "4", + "Clip skip": "2", + "resources": [ + { + "hash": "89d59c3dde", + "name": "final-pruned", + "type": "model" + } + ], + "Batch size": "6", + "Model hash": "89d59c3dde", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/0f18af00-8fd2-4481-16dc-627fdcc94e00/width=450/169597.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UYKK$n%M~ps-x]ozV@jZ?bRPM{WXs.WAX9kC", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 2893392585, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", robot, mecha, weapon, holding, no humans, holding weapon, sword, shield, holding sword, clenched hand, science fiction, standing, holding shield, looking ahead, open hand", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Batch pos": "3", + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Batch size": "6", + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bf49c9e2-9476-443b-2c2a-8ba61ff89800/width=450/169596.jpeg", + "nsfw": false, + "width": 512, + "height": 512, + "hash": "UUL;1|~qAIg5%exVj0E29et5xut8M#Is-.t7", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 464317535, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", blonde hair, blue eyes, tail, animal hands, animal ears, smile, paw gloves, cat tail, crown, open mouth, cat ears, gloves, skirt, jewelry, red skirt, princess peach, holding, tiger ears, frilled skirt, paw print", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Batch pos": "0", + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Batch size": "6", + "Model hash": "0873291ac5", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet," + } + }, + { + "url": "https://imagecache.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/80b2783b-75a8-4a0d-528e-ce208023b700/width=450/169595.jpeg", + "nsfw": false, + "width": 1024, + "height": 1024, + "hash": "UXMQChTL.7NJMcI;s:WX_NjERkoeMxt6E2of", + "meta": { + "ENSD": "31337", + "Size": "512x512", + "seed": 1352637625, + "Model": "AbyssOrangeMix2_nsfw", + "steps": 28, + "prompt": ", hair ornament, red eyes, bangs, long hair, ninja, thighhighs, closed mouth, flower, seele vollerei, hair flower, black hair, red flower, red hair, horns, chinese clothes, gloves, dress, china dress, brown hair", + "sampler": "DPM++ 2M Karras", + "cfgScale": 8, + "Clip skip": "2", + "resources": [ + { + "hash": "0873291ac5", + "name": "AbyssOrangeMix2_nsfw", + "type": "model" + } + ], + "Model hash": "0873291ac5", + "Hires upscale": "2", + "Hires upscaler": "4x_foolhardy_Remacri", + "negativePrompt": "lowres, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, worst quality, low quality, normal quality, jpeg artifacts, signature, watermark, child, username, blurry, out of focus, censorship, tentacle hair, grey skin, monochrome, no pussy, worst quality, low quality, medium quality, deleted, lowres, comic, bad anatomy, bad hands, text, error, missing fingers, extra digit, fewer digits, cropped, censored, spoken heart, spoken question mark, signature, speech bubble, amputee, multiple girls, (worst quality, low quality:1.3), (depth of field, blurry:1.2), (greyscale, monochrome:1.1), 3D face, nose, cropped, lowres, text, jpeg artifacts, signature, watermark, username, blurry, artist name, trademark, watermark, title, (muscular, loli, petite, child, infant, toddlers, chibi, sd character:1.1), multiple view, Reference sheet,", + "Denoising strength": "0.65" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/16792" + } + ] +} +---------------------------- diff --git a/Styles/56/homebrew_close_as_neighbors-000006-139632-metadata.json b/Styles/56/homebrew_close_as_neighbors-000006-139632-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..be47e4a480314ef5297c545d718c1e07fa791494 --- /dev/null +++ b/Styles/56/homebrew_close_as_neighbors-000006-139632-metadata.json @@ -0,0 +1,1058 @@ +{ + "ss_sd_model_name": "everydayartEDA_v5.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "2200", + "ss_tag_frequency": { + "tagged": { + "comic": 585, + "speech_bubble": 565, + "long_hair": 524, + "english_text": 486, + "multiple_girls": 478, + "1girl": 477, + "blush": 414, + "solo": 327, + "1boy": 310, + "open_mouth": 289, + "2girls": 257, + "black_hair": 250, + "korean_text": 248, + "shirt": 218, + "breasts": 206, + "bangs": 192, + "monochrome": 184, + "eyebrows_visible_through_hair": 151, + "brown_hair": 137, + "collarbone": 129, + "sweat": 127, + "nude": 125, + "letterboxed": 113, + "1koma": 106, + "smile": 106, + "blonde_hair": 106, + "thought_bubble": 105, + "short_hair": 104, + "greyscale": 99, + "closed_eyes": 96, + "close-up": 90, + "head_out_of_frame": 86, + "sweatdrop": 78, + "white_shirt": 75, + "yuri": 71, + "bare_shoulders": 70, + "nipples": 69, + "nose_blush": 64, + "male_focus": 63, + "spoken_blush": 62, + "looking_at_viewer": 60, + "black_border": 59, + "hair_between_eyes": 56, + "sitting": 55, + "hetero": 54, + "white_background": 52, + "green_eyes": 52, + "collared_shirt": 48, + "large_breasts": 48, + "talking": 47, + "left-to-right_manga": 45, + "medium_breasts": 44, + "upper_body": 42, + "lying": 42, + "blurry": 41, + "simple_background": 40, + ":d": 39, + "ass": 39, + "censored": 39, + "emphasis_lines": 38, + "hat": 38, + "depth_of_field": 35, + "short_sleeves": 34, + "barefoot": 30, + "cleavage": 29, + "sex": 29, + "transparent_background": 29, + "sky": 28, + "cup": 28, + "purple_eyes": 28, + "ponytail": 28, + "navel": 28, + "penis": 28, + "underwear": 28, + "on_back": 27, + "indoors": 27, + "brown_eyes": 27, + "blue_hair": 26, + "black_eyes": 26, + "tiles": 26, + "from_behind": 26, + "pillarboxed": 26, + "blurry_foreground": 25, + "pants": 24, + "shorts": 23, + "tile_wall": 23, + "building": 22, + "jewelry": 22, + "face": 22, + "blurry_background": 22, + "skirt": 22, + "phone_screen": 22, + "motion_blur": 22, + "cloud": 21, + "bag": 21, + "hair_bun": 21, + "twintails": 21, + "full-face_blush": 21, + "blank_speech_bubble": 21, + "t-shirt": 21, + "braid": 20, + "bed": 20, + "closed_mouth": 20, + "multiple_boys": 20, + "holding": 20, + "spoken_heart": 20, + "jacket": 20, + "pillow": 19, + "tile_floor": 19, + "faceless": 19, + "spoken_squiggle": 19, + "facing_away": 19, + "panties": 19, + "motion_lines": 19, + "necktie": 19, + "outdoors": 18, + "chair": 18, + "profile": 17, + "mole": 17, + "border": 17, + "tears": 17, + "gradient": 17, + "tongue": 17, + "yellow_eyes": 17, + "profanity": 17, + "day": 16, + "necklace": 16, + "on_bed": 16, + "bathroom": 16, + "blunt_bangs": 16, + "table": 15, + "brick_wall": 15, + "tongue_out": 15, + "speed_lines": 15, + "sunset": 14, + "solo_focus": 14, + "choker": 14, + "blue_sky": 13, + "city": 13, + "food": 13, + "gradient_background": 13, + "wet": 13, + "spoken_sweatdrop": 13, + "bathing": 13, + "saliva": 13, + "ranguage": 13, + "feet": 13, + "cum": 13, + "2boys": 13, + "sidelocks": 12, + "bed_sheet": 12, + "@_@": 12, + "spoken_anger_vein": 12, + "bathtub": 12, + "2koma": 12, + "back": 12, + "facial_hair": 12, + "dress": 12, + "school_uniform": 12, + "cloudy_sky": 11, + "scenery": 11, + "off_shoulder": 11, + "house": 11, + "white_border": 11, + "pink_eyes": 11, + "cellphone": 11, + "holding_phone": 11, + "phone": 11, + "pov": 11, + "black_shirt": 11, + "shoes": 11, + "ahoge": 11, + "stubble": 11, + "vaginal": 11, + "spread_legs": 11, + "hands": 11, + "^_^": 11, + "from_side": 10, + "admiral_\\(kancolle\\)": 10, + "faceless_male": 10, + "smartphone": 10, + "alcohol": 10, + "anger_vein": 10, + "bath": 10, + "desk": 10, + "they_had_lots_of_sex_afterwards": 10, + "heart": 10, + "bra": 10, + "pink_hair": 10, + "door": 10, + "teeth": 9, + "hair_over_eyes": 9, + "chain-link_fence": 9, + "pink_shirt": 9, + "embarrassed": 9, + "tank_top": 9, + "cityscape": 9, + "water": 9, + "shaded_face": 9, + "engrish_text": 9, + "black_choker": 9, + "thai_text": 9, + "parody": 9, + "drinking_glass": 9, + "no_eyes": 9, + "black_necktie": 9, + "low_ponytail": 9, + "long_sleeves": 9, + "bottle": 8, + "ear_blush": 8, + "moon": 8, + "purple_hair": 8, + "looking_at_another": 8, + "drunk": 8, + "shower_\\(place\\)": 8, + "toilet": 8, + "rain": 8, + "wide-eyed": 8, + "cover": 8, + "pussy": 8, + "no_humans": 8, + "sleeping": 8, + "earrings": 8, + "soles": 8, + "toes": 8, + "bar_censor": 8, + "trembling": 8, + "mug": 8, + "window": 7, + "crying": 7, + "red_background": 7, + "brick_floor": 7, + "restroom": 7, + "stone_wall": 7, + "oral": 7, + "fence": 7, + "skyscraper": 7, + "tree": 7, + "showering": 7, + "...": 7, + "spoken_ellipsis": 7, + "steam": 7, + "circle_cut": 7, + "implied_sex": 7, + "black_background": 7, + "parted_lips": 6, + "parted_bangs": 6, + "sleeveless": 6, + "hand_on_own_chest": 6, + "towel": 6, + "looking_at_phone": 6, + "selfie": 6, + "beer": 6, + "beer_mug": 6, + "ceiling": 6, + "honeycomb_\\(pattern\\)": 6, + "honeycomb_background": 6, + "meme": 6, + "stone_floor": 6, + "wall": 6, + "holding_cup": 6, + "erection": 6, + "hair_over_shoulder": 6, + "pectorals": 6, + "clothes_lift": 6, + "^^^": 6, + "mosaic_censoring": 6, + "breast_focus": 6, + "fang": 6, + "curtains": 6, + "small_breasts": 6, + "drooling": 6, + "red_hair": 6, + "spoken_musical_note": 6, + "waving": 6, + "white_panties": 6, + "shoulder_blades": 6, + "backpack": 6, + "sweating_profusely": 6, + "armpits": 6, + "takeda_harumi_\\(shiromanta\\)": 6, + "suspenders": 6, + "night": 5, + "star_\\(sky\\)": 5, + "ground_vehicle": 5, + "motor_vehicle": 5, + "bedroom": 5, + "covering": 5, + "cellphone_picture": 5, + "taking_picture": 5, + "couch": 5, + "brick": 5, + "toilet_use": 5, + "low_twintails": 5, + "shoulder_bag": 5, + "wavy_mouth": 5, + "cover_page": 5, + "architecture": 5, + "bookshelf": 5, + "shower_head": 5, + "classroom": 5, + "photo_background": 5, + "bowl": 5, + "plate": 5, + "school_bag": 5, + "fake_screenshot": 5, + "orange_hair": 5, + "spoken_question_mark": 5, + "tray": 5, + "cum_in_pussy": 5, + "umbrella": 5, + "flandre_scarlet": 5, + "buttons": 5, + "partially_submerged": 5, + "goatee": 5, + "eyes_visible_through_hair": 5, + "drink": 5, + "drinking_straw": 5, + "hand_on_own_cheek": 5, + "fellatio": 5, + "red_shirt": 5, + "pencil_skirt": 5, + "belt": 5, + "pointing": 5, + "beach": 5, + "night_sky": 4, + "horizon": 4, + "ocean": 4, + "full_moon": 4, + "space": 4, + "starry_sky": 4, + "book": 4, + "car": 4, + "blanket": 4, + "futon": 4, + "covering_breasts": 4, + "iphone": 4, + "v": 4, + "hand_on_hip": 4, + "cracked_wall": 4, + "on_floor": 4, + "through_wall": 4, + "groin": 4, + "out_of_frame": 4, + "disposable_cup": 4, + "hoodie": 4, + "breast_grab": 4, + "clothed_male_nude_female": 4, + "muscular": 4, + "east_asian_architecture": 4, + "rooftop": 4, + "bath_stool": 4, + "sailor_collar": 4, + "brown_jacket": 4, + "kiss": 4, + "bouncing_breasts": 4, + "fur_trim": 4, + "index_finger_raised": 4, + "commander_\\(girls'_frontline\\)": 4, + "glasses": 4, + "nape": 4, + "underwear_only": 4, + "blue_shirt": 4, + "mole_under_eye": 4, + "double_bun": 4, + "anime_coloring": 4, + "artoria_pendragon_\\(fate\\)": 4, + "german_text": 4, + "?": 4, + "coffee": 4, + "sideboob": 4, + "hand_on_own_face": 4, + "missionary": 4, + "popsicle": 4, + ">_<": 4, + "cigarette": 4, + "formal": 4, + "crying_with_eyes_open": 4, + "producer_\\(idolmaster_cinderella_girls_anime\\)": 4, + "yellow_shirt": 4, + "red_eyes": 4, + "snowflakes": 4, + "shirt_lift": 4, + "tanabata": 4, + "palm_tree": 4, + "condensation_trail": 3, + "mountain": 3, + "street": 3, + "zzz": 3, + "under_covers": 3, + "forehead": 3, + "grey_eyes": 3, + "looking_away": 3, + "naked_towel": 3, + "completely_nude": 3, + "fubuki_\\(kancolle\\)": 3, + "crack": 3, + "hexagon": 3, + "kitchen": 3, + "midriff": 3, + "silk": 3, + "spider_web": 3, + "hood": 3, + "hair_ornament": 3, + "hair_scrunchie": 3, + "dress_shirt": 3, + "sleeves_rolled_up": 3, + "short_shorts": 3, + "clothes_writing": 3, + "facing_viewer": 3, + "bara": 3, + "thick_eyebrows": 3, + "doujin_cover": 3, + "skyline": 3, + "tower": 3, + "3girls": 3, + "floor": 3, + "pavement": 3, + "sailor_moon_redraw_challenge": 3, + "shared_bathing": 3, + "soap": 3, + "soap_bubbles": 3, + "stool": 3, + "areolae": 3, + "school_desk": 3, + "brown_shirt": 3, + "eye_focus": 3, + "self_fondle": 3, + "on_side": 3, + "grabbing": 3, + "signature": 3, + "dark_skin": 3, + "legs": 3, + "pussy_juice": 3, + "testicles": 3, + "hanging_breasts": 3, + "one_eye_closed": 3, + "alice_margatroid": 3, + "bow": 3, + "office_lady": 3, + "own_hands_together": 3, + "drinking": 3, + "pendant": 3, + "swimsuit": 3, + "nishizumi_miho": 3, + "thighhighs": 3, + "lips": 3, + "heavy_breathing": 3, + "bubble_tea": 3, + "television": 3, + "glass": 3, + "ice": 3, + "ice_cube": 3, + "covering_mouth": 3, + "producer_\\(idolmaster\\)": 3, + "collar": 3, + "photo_\\(medium\\)": 3, + "military": 3, + "suit": 3, + "socks": 3, + "muscular_male": 3, + "romaji_text": 3, + "arm_up": 3, + "pov_hands": 3, + "grin": 3, + "smoking": 3, + "focused": 3, + "grey_background": 3, + "serafuku": 3, + "floral_background": 3, + "snowflake_background": 3, + "frills": 3, + "shadow": 3, + "vest": 3, + "faceless_female": 3, + "lens_flare": 3, + "bamboo": 3, + "palm_leaf": 3, + "plant": 3, + "potted_plant": 3, + "tanzaku": 3, + "sunrise": 2, + "aurora": 2, + "balcony": 2, + "city_lights": 2, + "constellation": 2, + "crescent_moon": 2, + "fireworks": 2, + "galaxy": 2, + "lamppost": 2, + "milky_way": 2, + "moonlight": 2, + "shooting_star": 2, + "snowing": 2, + "starry_sky_print": 2, + "telescope": 2, + "road": 2, + "alarm_clock": 2, + "clock": 2, + "lamp": 2, + "character_name": 2, + "topless": 2, + "braided_ponytail": 2, + "noshiro_\\(kancolle\\)": 2, + "twin_braids": 2, + "cellphone_charm": 2, + "mouth_hold": 2, + "chopsticks": 2, + "denim": 2, + "stuck": 2, + "stomach": 2, + "crossed_legs": 2, + "hood_down": 2, + "handjob": 2, + "stairs": 2, + "bracelet": 2, + "handbag": 2, + "bare_arms": 2, + "partially_unbuttoned": 2, + "library": 2, + "real_world_location": 2, + "town": 2, + "argyle": 2, + "argyle_background": 2, + "bathhouse": 2, + "locker": 2, + "locker_room": 2, + "map": 2, + "net": 2, + "pink_panties": 2, + "pool": 2, + "reflective_floor": 2, + "sink": 2, + "toilet_paper": 2, + "!": 2, + "!!": 2, + "!?": 2, + "pantyhose": 2, + "ear_piercing": 2, + "piercing": 2, + "stud_earrings": 2, + "breast_hold": 2, + "on_stomach": 2, + "spoken_exclamation_mark": 2, + "saliva_trail": 2, + "polka_dot": 2, + "deep_skin": 2, + "foot_focus": 2, + "grabbing_own_breast": 2, + "fur-trimmed_jacket": 2, + "shiny": 2, + "shiny_skin": 2, + "finger_to_mouth": 2, + "russian_text": 2, + "short_twintails": 2, + "subtitled": 2, + "hand_to_own_mouth": 2, + "own_hands_clasped": 2, + "convenient_censoring": 2, + "covering_face": 2, + "scrunchie": 2, + "striped": 2, + "off-shoulder_shirt": 2, + "nero_claudius_\\(fate\\)": 2, + "heart-shaped_pupils": 2, + "symbol-shaped_pupils": 2, + "oil-paper_umbrella": 2, + "hug": 2, + "hug_from_behind": 2, + "angry": 2, + "onsen": 2, + "checkered": 2, + "mirror": 2, + "mixed_bathing": 2, + "=3": 2, + "breath": 2, + "french_kiss": 2, + "ejaculation": 2, + "bubble_tea_challenge": 2, + "igarashi_futaba_\\(shiromanta\\)": 2, + "spoken_object": 2, + "fire": 2, + "randoseru": 2, + "shared_umbrella": 2, + "elf": 2, + "pointy_ears": 2, + "phallic_symbol": 2, + "sexually_suggestive": 2, + "couple": 2, + "thighs": 2, + "ice_cream": 2, + "earth_\\(planet\\)": 2, + "planet": 2, + "towel_around_neck": 2, + "nail_polish": 2, + "tsushima_yoshiko": 2, + "reaching_out": 2, + "holding_cigarette": 2, + "pantylines": 2, + "licking": 2, + "truth": 2, + "black_shorts": 2, + "red_jacket": 2, + "french_braid": 2, + "military_uniform": 2, + "uniform": 2, + "white_dress": 2, + "silhouette": 2, + "sun": 2, + "holding_tray": 2, + "waiter": 2, + "waitress": 2, + "sandals": 2, + "mountainous_horizon": 2, + "chibi": 2, + "crossed_arms": 2, + "thinking": 2, + "black_footwear": 2, + "boots": 2, + "pantyshot": 2, + "sparkle": 2, + "sparkle_background": 2, + "3d": 2, + "blur_censor": 2, + "bokeh": 2, + "camera": 2, + "chromatic_aberration": 2, + "concert": 2, + "cosplay_photo": 2, + "figure": 2, + "film_grain": 2, + "hickey": 2, + "messy_hair": 2, + "photo_inset": 2, + "reference_inset": 2, + "stadium": 2, + "unconventional_media": 2, + "used_condom": 2, + "white_flower": 2, + "coconut": 2, + "leaf": 2, + "sunflower": 2, + "bow_panties": 2, + "topless_male": 2, + "bare_tree": 2, + "branch": 2, + "imminent_kiss": 1, + "lantern": 1, + "mole_under_mouth": 1, + "covered_mouth": 1, + "takagi-san": 1, + "artist_name": 1, + "all_fours": 1, + "camera_phone": 1, + "card": 1, + "chat_log": 1, + "female_pov": 1, + "flip_phone": 1, + "game_boy": 1, + "holding_card": 1, + "holding_handheld_game_console": 1, + "looking_at_object": 1, + "nintendo_3ds": 1, + "nintendo_ds": 1, + "nintendo_switch": 1, + "rotom_phone": 1, + "arm_behind_head": 1, + "ass_grab": 1, + "grabbing_another's_ass": 1, + "grabbing_own_ass": 1, + "hand_on_another's_thigh": 1, + "hand_on_ass": 1, + "hand_on_own_ass": 1, + "hand_in_pocket": 1, + "casual": 1, + "denim_shorts": 1, + "bench": 1, + "kitashirakawa_tamako": 1, + "pocky_day": 1, + "red_moon": 1, + "red_theme": 1, + "no_nose": 1, + "constricted_pupils": 1, + "white_tank_top": 1, + "clothes_grab": 1, + "lifted_by_self": 1, + "sheet_grab": 1, + "breast_press": 1, + "text_focus": 1, + "title": 1, + "chimney": 1, + "clock_tower": 1, + "ceiling_light": 1, + "faucet": 1, + "graffiti": 1, + "soap_bottle": 1, + "standing": 1, + "washing_machine": 1, + "mole_on_breast": 1, + "clenched_teeth": 1, + "surprised": 1, + "wooden_floor": 1, + "clothed_female_nude_female": 1, + "crescent_earrings": 1, + "flower_earrings": 1, + "heart_earrings": 1, + "hoop_earrings": 1, + "single_earring": 1, + "star_earrings": 1, + "hair_up": 1, + "black_panties": 1, + "viewfinder": 1, + "licking_lips": 1, + "nervous": 1, + "halftone": 1, + "halftone_background": 1, + "breast_lift": 1, + "covering_nipples": 1, + "grabbing_from_behind": 1, + "groping": 1, + "nipple_tweak": 1, + "holding_bowl": 1, + "watch": 1, + "bloomers": 1, + "coat": 1, + "caught": 1, + "shushing": 1, + "futa_with_female": 1, + "anus": 1, + "large_areolae": 1, + "shigure_\\(kancolle\\)": 1, + "single_braid": 1, + "hair_bow": 1, + "clenched_hand": 1, + "in_the_face": 1, + "punching": 1, + "striped_background": 1, + "cowboy_shot": 1, + "blouse": 1, + "frilled_shirt": 1, + "girl_on_top": 1, + "nero_claudius_\\(fate/extra\\)": 1, + "saber": 1, + "lillie_\\(pokemon\\)": 1, + "cucumber": 1, + "akebono_\\(kancolle\\)": 1, + "red_umbrella": 1, + "brothers": 1, + "siblings": 1, + "breast_envy": 1, + "tattoo": 1, + "plaid": 1, + "plaid_skirt": 1, + "against_wall": 1, + "backboob": 1, + "barbed_wire": 1, + "bare_back": 1, + "blue_swimsuit": 1, + "board_game": 1, + "checkered_background": 1, + "kabedon": 1, + "plaid_background": 1, + "poolside": 1, + "reflection": 1, + "volleyball": 1, + "squiggle": 1, + "lipstick": 1, + "makeup": 1, + "bikini": 1, + "sonoda_umi": 1, + "3boys": 1, + "fishnets": 1, + "green_jacket": 1, + "yaoi": 1, + "computer": 1, + "ahegao": 1, + "cervix": 1, + "cross-section": 1, + "deep_penetration": 1, + "female_orgasm": 1, + "fertilization": 1, + "impregnation": 1, + "internal_cumshot": 1, + "orgasm": 1, + "ovum": 1, + "projectile_cum": 1, + "sperm_cell": 1, + "uterus": 1, + "x-ray": 1, + "demon_tail": 1, + "head_rest": 1, + "juice": 1, + "kazami_yuuka": 1, + "beer_can": 1, + "can": 1, + "soap_censor": 1, + "steam_censor": 1, + "wet_hair": 1, + "champagne_flute": 1, + "shirt_tucked_in": 1, + "whiskey": 1, + "spit_take": 1, + "brown_bag": 1, + "holding_strap": 1, + "red_bag": 1, + "erica_hartmann": 1, + "gertrud_barkhorn": 1, + "large_penis": 1, + "looking_at_penis": 1, + "penis_awe": 1, + "special_feeling_\\(meme\\)": 1, + "cat_tail": 1, + "tail": 1, + "white_shorts": 1, + "puffy_sleeves": 1, + "miyamoto_frederica": 1, + "makaino_ririmu": 1, + "bowl_cut": 1, + "bulge": 1, + "male_underwear": 1, + "basket": 1, + "fruit": 1, + "low-tied_long_hair": 1, + "explosion": 1, + "older": 1, + "??": 1, + "ball": 1, + "eating": 1, + "food_in_mouth": 1, + "hime_cut": 1, + "melting": 1, + "shared_food": 1, + "pubic_hair": 1, + "fork": 1, + "fujimaru_ritsuka_\\(female\\)": 1, + "mordred_\\(fate\\)": 1, + "mordred_\\(fate/apocrypha\\)": 1, + "grey_hoodie": 1, + "bridge": 1, + "panty_pull": 1, + "miki_sayaka": 1, + "fur_collar": 1, + "arm_support": 1, + "bra_strap": 1, + "breasts_apart": 1, + "takao_\\(kancolle\\)": 1, + "smoke": 1, + "salaryman": 1, + "ass_focus": 1, + "floral_print": 1, + "licking_penis": 1, + "carrying": 1, + "slippers": 1, + ":i": 1, + ":t": 1, + "pout": 1, + "morino_rinze": 1, + "komi_shouko": 1, + "interlocked_fingers": 1, + ":o": 1, + "p-head_producer": 1, + ":>=": 1, + "paizuri": 1, + "curry": 1, + "food_focus": 1, + "rice": 1, + "holding_bottle": 1, + "tied_hair": 1, + "pointing_at_viewer": 1, + "wing_collar": 1, + "knees_up": 1, + "jeans": 1, + "glowing": 1, + "glowing_eyes": 1, + "epaulettes": 1, + "rosehip_\\(girls_und_panzer\\)": 1, + "st._gloriana's_military_uniform": 1, + "multicolored_hair": 1, + "streaked_hair": 1, + "footjob": 1, + "tickling": 1, + "toe_scrunch": 1, + "toenails": 1, + "orange_background": 1, + "shared_speech_bubble": 1, + "sweater_lift": 1, + "white_bra": 1, + "large_pectorals": 1, + "holding_book": 1, + "springfield_\\(girls'_frontline\\)": 1, + "blood": 1, + "nude_cover": 1, + "bursting_breasts": 1, + "cleavage_cutout": 1, + "clothing_cutout": 1, + "meme_attire": 1, + "open-chest_sweater": 1, + "hair_over_one_eye": 1, + "restaurant": 1, + "dark-skinned_female": 1, + "hairclip": 1, + "alternate_costume": 1, + "counter": 1, + "sepia": 1, + "4girls": 1, + "jitome": 1, + "o_o": 1, + "arashi_\\(kancolle\\)": 1, + "pinafore_dress": 1, + "medium_hair": 1, + "naval_uniform": 1, + "heterochromia": 1, + "breast_rest": 1, + "kicking": 1, + "ripples": 1, + "soaking_feet": 1, + "splashing": 1, + "fingernails": 1, + "graf_zeppelin_\\(kancolle\\)": 1, + "aircraft": 1, + "airplane": 1, + "flying": 1, + "hill": 1, + "island": 1, + "landscape": 1, + "lighthouse": 1, + "hands_on_own_cheeks": 1, + "hands_on_own_face": 1, + "nishizumi_maho": 1, + "arms_under_breasts": 1, + "cum_on_body": 1, + "full_body": 1, + "kawashima_momo": 1, + "facepalm": 1, + "frown": 1, + "kneeling": 1, + "cropped_shoulders": 1, + "brown_footwear": 1, + "white_legwear": 1, + "gloves": 1, + "cross-laced_footwear": 1, + "lace-up_boots": 1, + "shoelaces": 1, + "sneakers": 1, + "black_sailor_collar": 1, + "happy_birthday": 1, + "half-closed_eyes": 1, + "black_skirt": 1, + "sex_from_behind": 1, + "between_legs": 1, + "hand_between_legs": 1, + "white_footwear": 1, + "ogata_hyakunosuke": 1, + "scar": 1, + "scar_on_cheek": 1, + "scar_on_face": 1, + "miniskirt": 1, + "diffraction_spikes": 1, + "ankle_boots": 1, + "puffy_short_sleeves": 1, + "space_craft": 1, + "star_\\(symbol\\)": 1, + "pajamas": 1, + "holding_clothes": 1, + "holding_panties": 1, + "holding_underwear": 1, + "panties_removed": 1, + "striped_panties": 1, + "hinata_hajime": 1, + "black_jacket": 1, + "leaning_forward": 1, + "detached_sleeves": 1, + "black_pants": 1, + "cherry_blossoms": 1, + "pink_background": 1, + "wet_clothes": 1, + "dakimakura_\\(object\\)": 1, + "head_on_pillow": 1, + "pillow_hug": 1, + "yes": 1, + "cactus": 1, + "abs": 1, + "straddling": 1, + "light_censor": 1, + "paradis_military_uniform": 1, + "teacup": 1, + "fujimaru_ritsuka_\\(male\\)": 1, + "tamura_yuri": 1, + "pillow_grab": 1, + "heart_of_string": 1, + "komeiji_koishi": 1, + "komeiji_satori": 1, + "third_eye": 1, + "hong_meiling": 1, + "wings": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "tagged": { + "n_repeats": 2, + "img_count": 1100 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 1, \"num_train_images\": 2200, \"num_reg_images\": 0, \"resolution\": [704, 512], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"tagged\": {\"2girls\": 257, \"bottle\": 8, \"comic\": 585, \"english_text\": 486, \"multiple_girls\": 478, \"speech_bubble\": 565, \"sunset\": 14, \"night\": 5, \"night_sky\": 4, \"sky\": 28, \"star_\\\\(sky\\\\)\": 5, \"long_hair\": 524, \"blue_sky\": 13, \"cloud\": 21, \"cloudy_sky\": 11, \"condensation_trail\": 3, \"day\": 16, \"horizon\": 4, \"mountain\": 3, \"ocean\": 4, \"outdoors\": 18, \"scenery\": 11, \"sunrise\": 2, \"1girl\": 477, \"bangs\": 192, \"blush\": 414, \"close-up\": 90, \"closed_eyes\": 96, \"ear_blush\": 8, \"eyebrows_visible_through_hair\": 151, \"imminent_kiss\": 1, \"nose_blush\": 64, \"parted_lips\": 6, \"profile\": 17, \"sweat\": 127, \"yuri\": 71, \"blue_hair\": 26, \"korean_text\": 248, \"solo\": 327, \"white_background\": 52, \"bare_shoulders\": 70, \"braid\": 20, \"brown_hair\": 137, \"off_shoulder\": 11, \"sidelocks\": 12, \"upper_body\": 42, \"aurora\": 2, \"balcony\": 2, \"building\": 22, \"city_lights\": 2, \"constellation\": 2, \"crescent_moon\": 2, \"fireworks\": 2, \"full_moon\": 4, \"galaxy\": 2, \"house\": 11, \"lamppost\": 2, \"lantern\": 1, \"milky_way\": 2, \"moon\": 8, \"moonlight\": 2, \"shooting_star\": 2, \"snowing\": 2, \"space\": 4, \"starry_sky\": 4, \"starry_sky_print\": 2, \"telescope\": 2, \"window\": 7, \"monochrome\": 184, \"book\": 4, \"cup\": 28, \"city\": 13, \"car\": 4, \"ground_vehicle\": 5, \"motor_vehicle\": 5, \"road\": 2, \"street\": 3, \"open_mouth\": 289, \"purple_hair\": 8, \"breasts\": 206, \"collarbone\": 129, \"head_out_of_frame\": 86, \"jewelry\": 22, \"mole\": 17, \"mole_under_mouth\": 1, \"necklace\": 16, \"shirt\": 218, \"zzz\": 3, \"greyscale\": 99, \"alarm_clock\": 2, \"bed\": 20, \"bed_sheet\": 12, \"bedroom\": 5, \"black_hair\": 250, \"blanket\": 4, \"clock\": 2, \"futon\": 4, \"lamp\": 2, \"lying\": 42, \"on_back\": 27, \"on_bed\": 16, \"pillow\": 19, \"under_covers\": 3, \"closed_mouth\": 20, \"covered_mouth\": 1, \"forehead\": 3, \"grey_eyes\": 3, \"parted_bangs\": 6, \"takagi-san\": 1, \"cleavage\": 29, \"hair_between_eyes\": 56, \"looking_at_viewer\": 60, \"teeth\": 9, \"multiple_boys\": 20, \"1boy\": 310, \"1koma\": 106, \"black_eyes\": 26, \"collared_shirt\": 48, \"male_focus\": 63, \"short_hair\": 104, \"smile\": 106, \"sweatdrop\": 78, \"white_shirt\": 75, \"white_border\": 11, \"border\": 17, \"character_name\": 2, \"covering\": 5, \"covering_breasts\": 4, \"nude\": 125, \"topless\": 2, \"face\": 22, \"blurry\": 41, \"blurry_background\": 22, \"depth_of_field\": 35, \"braided_ponytail\": 2, \"from_side\": 10, \"noshiro_\\\\(kancolle\\\\)\": 2, \"simple_background\": 40, \"sleeveless\": 6, \"twin_braids\": 2, \":d\": 39, \"food\": 13, \"holding\": 20, \"spoken_blush\": 62, \"artist_name\": 1, \"crying\": 7, \"looking_away\": 3, \"tears\": 17, \"red_background\": 7, \"@_@\": 12, \"looking_at_another\": 8, \"pink_eyes\": 11, \"purple_eyes\": 28, \"admiral_\\\\(kancolle\\\\)\": 10, \"indoors\": 27, \"talking\": 47, \"thought_bubble\": 105, \"bathroom\": 16, \"blonde_hair\": 106, \"green_eyes\": 52, \"hand_on_own_chest\": 6, \"naked_towel\": 3, \"shorts\": 23, \"tile_floor\": 19, \"tile_wall\": 23, \"tiles\": 26, \"towel\": 6, \"gradient\": 17, \"gradient_background\": 13, \"barefoot\": 30, \"faceless\": 19, \"faceless_male\": 10, \"all_fours\": 1, \"ass\": 39, \"completely_nude\": 3, \"sex\": 29, \"camera_phone\": 1, \"card\": 1, \"cellphone\": 11, \"cellphone_charm\": 2, \"cellphone_picture\": 5, \"chat_log\": 1, \"female_pov\": 1, \"flip_phone\": 1, \"game_boy\": 1, \"holding_card\": 1, \"holding_handheld_game_console\": 1, \"holding_phone\": 11, \"iphone\": 4, \"looking_at_object\": 1, \"looking_at_phone\": 6, \"nintendo_3ds\": 1, \"nintendo_ds\": 1, \"nintendo_switch\": 1, \"phone\": 11, \"pov\": 11, \"rotom_phone\": 1, \"selfie\": 6, \"smartphone\": 10, \"taking_picture\": 5, \"v\": 4, \"medium_breasts\": 44, \"nipples\": 69, \"chair\": 18, \"couch\": 5, \"short_sleeves\": 34, \"sitting\": 55, \"skirt\": 22, \"table\": 15, \"arm_behind_head\": 1, \"solo_focus\": 14, \"spoken_anger_vein\": 12, \"spoken_squiggle\": 19, \"alcohol\": 10, \"beer\": 6, \"beer_mug\": 6, \"drunk\": 8, \"ass_grab\": 1, \"brown_eyes\": 27, \"grabbing_another's_ass\": 1, \"grabbing_own_ass\": 1, \"hand_on_another's_thigh\": 1, \"hand_on_ass\": 1, \"hand_on_own_ass\": 1, \"mouth_hold\": 2, \"black_shirt\": 11, \"chopsticks\": 2, \"ponytail\": 28, \"facing_away\": 19, \"fubuki_\\\\(kancolle\\\\)\": 3, \"hair_over_eyes\": 9, \"hand_in_pocket\": 1, \"hand_on_hip\": 4, \"pants\": 24, \"bathtub\": 12, \"brick\": 5, \"brick_floor\": 7, \"brick_wall\": 15, \"casual\": 1, \"ceiling\": 6, \"chain-link_fence\": 9, \"crack\": 3, \"cracked_wall\": 4, \"denim\": 2, \"denim_shorts\": 1, \"from_behind\": 26, \"hexagon\": 3, \"honeycomb_\\\\(pattern\\\\)\": 6, \"honeycomb_background\": 6, \"kitchen\": 3, \"meme\": 6, \"midriff\": 3, \"on_floor\": 4, \"restroom\": 7, \"shower_\\\\(place\\\\)\": 8, \"silk\": 3, \"spider_web\": 3, \"stone_floor\": 6, \"stone_wall\": 7, \"stuck\": 2, \"through_wall\": 4, \"toilet\": 8, \"toilet_use\": 5, \"wall\": 6, \"groin\": 4, \"navel\": 28, \"out_of_frame\": 4, \"stomach\": 2, \"wet\": 13, \"blurry_foreground\": 25, \"bag\": 21, \"bench\": 1, \"crossed_legs\": 2, \"disposable_cup\": 4, \"holding_cup\": 6, \"hood\": 3, \"hood_down\": 2, \"hoodie\": 4, \"large_breasts\": 48, \"breast_grab\": 4, \"censored\": 39, \"clothed_male_nude_female\": 4, \"erection\": 6, \"handjob\": 2, \"hetero\": 54, \"penis\": 28, \"hair_bun\": 21, \"emphasis_lines\": 38, \"rain\": 8, \"hair_ornament\": 3, \"hair_over_shoulder\": 6, \"hair_scrunchie\": 3, \"kitashirakawa_tamako\": 1, \"low_twintails\": 5, \"twintails\": 21, \"shoes\": 11, \"stairs\": 2, \"dress_shirt\": 3, \"sleeves_rolled_up\": 3, \"anger_vein\": 10, \"pink_shirt\": 9, \"pocky_day\": 1, \"red_moon\": 1, \"red_theme\": 1, \"bracelet\": 2, \"handbag\": 2, \"short_shorts\": 3, \"shoulder_bag\": 5, \"embarrassed\": 9, \"full-face_blush\": 21, \"no_nose\": 1, \"wavy_mouth\": 5, \"2koma\": 12, \"ahoge\": 11, \"constricted_pupils\": 1, \"wide-eyed\": 8, \"blank_speech_bubble\": 21, \"oral\": 7, \"spoken_heart\": 20, \"spoken_sweatdrop\": 13, \"tongue\": 17, \"tongue_out\": 15, \"hat\": 38, \"bare_arms\": 2, \"clothes_writing\": 3, \"facing_viewer\": 3, \"tank_top\": 9, \"white_tank_top\": 1, \"cover\": 8, \"bara\": 3, \"muscular\": 4, \"partially_unbuttoned\": 2, \"pectorals\": 6, \"stubble\": 11, \"thick_eyebrows\": 3, \"clothes_grab\": 1, \"clothes_lift\": 6, \"lifted_by_self\": 1, \"sheet_grab\": 1, \"^^^\": 6, \"breast_press\": 1, \"cover_page\": 5, \"doujin_cover\": 3, \"text_focus\": 1, \"title\": 1, \"mosaic_censoring\": 6, \"pussy\": 8, \"architecture\": 5, \"bookshelf\": 5, \"chimney\": 1, \"cityscape\": 9, \"clock_tower\": 1, \"east_asian_architecture\": 4, \"fence\": 7, \"library\": 2, \"no_humans\": 8, \"real_world_location\": 2, \"rooftop\": 4, \"skyline\": 3, \"skyscraper\": 7, \"tower\": 3, \"town\": 2, \"tree\": 7, \"3girls\": 3, \"argyle\": 2, \"argyle_background\": 2, \"back\": 12, \"bath\": 10, \"bath_stool\": 4, \"bathhouse\": 2, \"bathing\": 13, \"ceiling_light\": 1, \"faucet\": 1, \"floor\": 3, \"graffiti\": 1, \"locker\": 2, \"locker_room\": 2, \"map\": 2, \"net\": 2, \"panties\": 19, \"pavement\": 3, \"pink_panties\": 2, \"pool\": 2, \"reflective_floor\": 2, \"sailor_moon_redraw_challenge\": 3, \"shared_bathing\": 3, \"shower_head\": 5, \"showering\": 7, \"sink\": 2, \"soap\": 3, \"soap_bottle\": 1, \"soap_bubbles\": 3, \"standing\": 1, \"stool\": 3, \"toilet_paper\": 2, \"underwear\": 28, \"washing_machine\": 1, \"water\": 9, \"areolae\": 3, \"breast_focus\": 6, \"mole_on_breast\": 1, \"choker\": 14, \"sleeping\": 8, \"clenched_teeth\": 1, \"!\": 2, \"!!\": 2, \"!?\": 2, \"surprised\": 1, \"fang\": 6, \"sailor_collar\": 4, \"left-to-right_manga\": 45, \"pantyhose\": 2, \"...\": 7, \"spoken_ellipsis\": 7, \"steam\": 7, \"wooden_floor\": 1, \"clothed_female_nude_female\": 1, \"classroom\": 5, \"desk\": 10, \"school_desk\": 3, \"black_border\": 59, \"brown_jacket\": 4, \"brown_shirt\": 3, \"crescent_earrings\": 1, \"ear_piercing\": 2, \"earrings\": 8, \"flower_earrings\": 1, \"heart_earrings\": 1, \"hoop_earrings\": 1, \"jacket\": 20, \"letterboxed\": 113, \"phone_screen\": 22, \"photo_background\": 5, \"piercing\": 2, \"pillarboxed\": 26, \"single_earring\": 1, \"star_earrings\": 1, \"stud_earrings\": 2, \"they_had_lots_of_sex_afterwards\": 10, \"eye_focus\": 3, \"shaded_face\": 9, \"bowl\": 5, \"plate\": 5, \"curtains\": 6, \"hair_up\": 1, \"breast_hold\": 2, \"self_fondle\": 3, \"black_panties\": 1, \"on_side\": 3, \"on_stomach\": 2, \"small_breasts\": 6, \"school_bag\": 5, \"circle_cut\": 7, \"fake_screenshot\": 5, \"spoken_exclamation_mark\": 2, \"viewfinder\": 1, \"orange_hair\": 5, \"motion_blur\": 22, \"motion_lines\": 19, \"speed_lines\": 15, \"t-shirt\": 21, \"drooling\": 6, \"licking_lips\": 1, \"saliva\": 13, \"saliva_trail\": 2, \"blunt_bangs\": 16, \"red_hair\": 6, \"nervous\": 1, \"yellow_eyes\": 17, \"heart\": 10, \"kiss\": 4, \"spoken_musical_note\": 6, \"spoken_question_mark\": 5, \"halftone\": 1, \"halftone_background\": 1, \"polka_dot\": 2, \"facial_hair\": 12, \"engrish_text\": 9, \"ranguage\": 13, \"breast_lift\": 1, \"covering_nipples\": 1, \"deep_skin\": 2, \"feet\": 13, \"foot_focus\": 2, \"grabbing\": 3, \"grabbing_from_behind\": 1, \"grabbing_own_breast\": 2, \"groping\": 1, \"nipple_tweak\": 1, \"soles\": 8, \"toes\": 8, \"signature\": 3, \"holding_bowl\": 1, \"tray\": 5, \"bar_censor\": 8, \"bouncing_breasts\": 4, \"vaginal\": 11, \"profanity\": 17, \"watch\": 1, \"bloomers\": 1, \"coat\": 1, \"fur-trimmed_jacket\": 2, \"fur_trim\": 4, \"waving\": 6, \"shiny\": 2, \"shiny_skin\": 2, \"black_choker\": 9, \"white_panties\": 6, \"caught\": 1, \"dark_skin\": 3, \"dress\": 12, \"transparent_background\": 29, \"finger_to_mouth\": 2, \"index_finger_raised\": 4, \"shushing\": 1, \"commander_\\\\(girls'_frontline\\\\)\": 4, \"legs\": 3, \"glasses\": 4, \"futa_with_female\": 1, \"anus\": 1, \"cum\": 13, \"cum_in_pussy\": 5, \"pussy_juice\": 3, \"spread_legs\": 11, \"testicles\": 3, \"russian_text\": 2, \"large_areolae\": 1, \"hanging_breasts\": 3, \"bra\": 10, \"nape\": 4, \"short_twintails\": 2, \"shoulder_blades\": 6, \"underwear_only\": 4, \"blue_shirt\": 4, \"shigure_\\\\(kancolle\\\\)\": 1, \"single_braid\": 1, \"thai_text\": 9, \"hands\": 11, \"trembling\": 8, \"implied_sex\": 7, \"mole_under_eye\": 4, \"double_bun\": 4, \"anime_coloring\": 4, \"black_background\": 7, \"parody\": 9, \"subtitled\": 2, \"hand_to_own_mouth\": 2, \"one_eye_closed\": 3, \"umbrella\": 5, \"alice_margatroid\": 3, \"bow\": 3, \"flandre_scarlet\": 5, \"hair_bow\": 1, \"office_lady\": 3, \"own_hands_clasped\": 2, \"own_hands_together\": 3, \"2boys\": 13, \"convenient_censoring\": 2, \"clenched_hand\": 1, \"covering_face\": 2, \"drinking\": 3, \"in_the_face\": 1, \"punching\": 1, \"scrunchie\": 2, \"backpack\": 6, \"buttons\": 5, \"striped\": 2, \"striped_background\": 1, \"cowboy_shot\": 1, \"blouse\": 1, \"frilled_shirt\": 1, \"off-shoulder_shirt\": 2, \"pendant\": 3, \"^_^\": 11, \"girl_on_top\": 1, \"swimsuit\": 3, \"artoria_pendragon_\\\\(fate\\\\)\": 4, \"nero_claudius_\\\\(fate\\\\)\": 2, \"nero_claudius_\\\\(fate/extra\\\\)\": 1, \"partially_submerged\": 5, \"saber\": 1, \"german_text\": 4, \"?\": 4, \"nishizumi_miho\": 3, \"heart-shaped_pupils\": 2, \"symbol-shaped_pupils\": 2, \"lillie_\\\\(pokemon\\\\)\": 1, \"cucumber\": 1, \"goatee\": 5, \"thighhighs\": 3, \"akebono_\\\\(kancolle\\\\)\": 1, \"oil-paper_umbrella\": 2, \"red_umbrella\": 1, \"lips\": 3, \"brothers\": 1, \"hug\": 2, \"hug_from_behind\": 2, \"siblings\": 1, \"angry\": 2, \"breast_envy\": 1, \"onsen\": 2, \"tattoo\": 1, \"coffee\": 4, \"mug\": 8, \"plaid\": 1, \"plaid_skirt\": 1, \"eyes_visible_through_hair\": 5, \"against_wall\": 1, \"backboob\": 1, \"barbed_wire\": 1, \"bare_back\": 1, \"blue_swimsuit\": 1, \"board_game\": 1, \"checkered\": 2, \"checkered_background\": 1, \"kabedon\": 1, \"mirror\": 2, \"mixed_bathing\": 2, \"plaid_background\": 1, \"poolside\": 1, \"reflection\": 1, \"volleyball\": 1, \"sideboob\": 4, \"sweating_profusely\": 6, \"pink_hair\": 10, \"drinking_glass\": 9, \"=3\": 2, \"breath\": 2, \"heavy_breathing\": 3, \"no_eyes\": 9, \"squiggle\": 1, \"lipstick\": 1, \"makeup\": 1, \"bikini\": 1, \"black_necktie\": 9, \"necktie\": 19, \"sonoda_umi\": 1, \"door\": 10, \"bubble_tea\": 3, \"drink\": 5, \"drinking_straw\": 5, \"armpits\": 6, \"3boys\": 1, \"fishnets\": 1, \"green_jacket\": 1, \"yaoi\": 1, \"computer\": 1, \"television\": 3, \"french_kiss\": 2, \"ahegao\": 1, \"cervix\": 1, \"cross-section\": 1, \"deep_penetration\": 1, \"ejaculation\": 2, \"female_orgasm\": 1, \"fertilization\": 1, \"impregnation\": 1, \"internal_cumshot\": 1, \"orgasm\": 1, \"ovum\": 1, \"projectile_cum\": 1, \"sperm_cell\": 1, \"uterus\": 1, \"x-ray\": 1, \"demon_tail\": 1, \"hand_on_own_cheek\": 5, \"hand_on_own_face\": 4, \"head_rest\": 1, \"low_ponytail\": 9, \"bubble_tea_challenge\": 2, \"glass\": 3, \"ice\": 3, \"ice_cube\": 3, \"juice\": 1, \"kazami_yuuka\": 1, \"igarashi_futaba_\\\\(shiromanta\\\\)\": 2, \"takeda_harumi_\\\\(shiromanta\\\\)\": 6, \"covering_mouth\": 3, \"missionary\": 4, \"spoken_object\": 2, \"beer_can\": 1, \"can\": 1, \"soap_censor\": 1, \"steam_censor\": 1, \"wet_hair\": 1, \"champagne_flute\": 1, \"fire\": 2, \"shirt_tucked_in\": 1, \"whiskey\": 1, \"spit_take\": 1, \"brown_bag\": 1, \"holding_strap\": 1, \"randoseru\": 2, \"red_bag\": 1, \"school_uniform\": 12, \"producer_\\\\(idolmaster\\\\)\": 3, \"erica_hartmann\": 1, \"gertrud_barkhorn\": 1, \"large_penis\": 1, \"looking_at_penis\": 1, \"penis_awe\": 1, \"shared_umbrella\": 2, \"special_feeling_\\\\(meme\\\\)\": 1, \"cat_tail\": 1, \"tail\": 1, \"white_shorts\": 1, \"puffy_sleeves\": 1, \"collar\": 3, \"miyamoto_frederica\": 1, \"elf\": 2, \"makaino_ririmu\": 1, \"pointy_ears\": 2, \"phallic_symbol\": 2, \"popsicle\": 4, \"sexually_suggestive\": 2, \"bowl_cut\": 1, \"bulge\": 1, \"couple\": 2, \"male_underwear\": 1, \"thighs\": 2, \"basket\": 1, \"fruit\": 1, \"low-tied_long_hair\": 1, \"photo_\\\\(medium\\\\)\": 3, \"military\": 3, \"explosion\": 1, \"older\": 1, \"??\": 1, \"ball\": 1, \"eating\": 1, \"fellatio\": 5, \"food_in_mouth\": 1, \"hime_cut\": 1, \"ice_cream\": 2, \"melting\": 1, \"shared_food\": 1, \"pubic_hair\": 1, \"fork\": 1, \">_<\": 4, \"cigarette\": 4, \"formal\": 4, \"suit\": 3, \"socks\": 3, \"fujimaru_ritsuka_\\\\(female\\\\)\": 1, \"mordred_\\\\(fate\\\\)\": 1, \"mordred_\\\\(fate/apocrypha\\\\)\": 1, \"crying_with_eyes_open\": 4, \"earth_\\\\(planet\\\\)\": 2, \"planet\": 2, \"muscular_male\": 3, \"grey_hoodie\": 1, \"bridge\": 1, \"panty_pull\": 1, \"producer_\\\\(idolmaster_cinderella_girls_anime\\\\)\": 4, \"miki_sayaka\": 1, \"romaji_text\": 3, \"yellow_shirt\": 4, \"suspenders\": 6, \"fur_collar\": 1, \"towel_around_neck\": 2, \"nail_polish\": 2, \"tsushima_yoshiko\": 2, \"arm_support\": 1, \"bra_strap\": 1, \"arm_up\": 3, \"reaching_out\": 2, \"long_sleeves\": 9, \"pov_hands\": 3, \"breasts_apart\": 1, \"takao_\\\\(kancolle\\\\)\": 1, \"grin\": 3, \"holding_cigarette\": 2, \"red_shirt\": 5, \"smoke\": 1, \"smoking\": 3, \"pantylines\": 2, \"pencil_skirt\": 5, \"salaryman\": 1, \"ass_focus\": 1, \"floral_print\": 1, \"licking\": 2, \"licking_penis\": 1, \"carrying\": 1, \"slippers\": 1, \":i\": 1, \":t\": 1, \"pout\": 1, \"morino_rinze\": 1, \"red_eyes\": 4, \"truth\": 2, \"snowflakes\": 4, \"belt\": 5, \"focused\": 3, \"komi_shouko\": 1, \"grey_background\": 3, \"interlocked_fingers\": 1, \":o\": 1, \"p-head_producer\": 1, \"serafuku\": 3, \"shirt_lift\": 4, \":>=\": 1, \"floral_background\": 3, \"paizuri\": 1, \"snowflake_background\": 3, \"black_shorts\": 2, \"curry\": 1, \"food_focus\": 1, \"rice\": 1, \"holding_bottle\": 1, \"red_jacket\": 2, \"tied_hair\": 1, \"pointing\": 5, \"pointing_at_viewer\": 1, \"french_braid\": 2, \"wing_collar\": 1, \"knees_up\": 1, \"jeans\": 1, \"glowing\": 1, \"glowing_eyes\": 1, \"epaulettes\": 1, \"military_uniform\": 2, \"rosehip_\\\\(girls_und_panzer\\\\)\": 1, \"st._gloriana's_military_uniform\": 1, \"uniform\": 2, \"multicolored_hair\": 1, \"streaked_hair\": 1, \"footjob\": 1, \"tickling\": 1, \"toe_scrunch\": 1, \"toenails\": 1, \"orange_background\": 1, \"shared_speech_bubble\": 1, \"frills\": 3, \"white_dress\": 2, \"sweater_lift\": 1, \"white_bra\": 1, \"large_pectorals\": 1, \"holding_book\": 1, \"springfield_\\\\(girls'_frontline\\\\)\": 1, \"blood\": 1, \"nude_cover\": 1, \"bursting_breasts\": 1, \"cleavage_cutout\": 1, \"clothing_cutout\": 1, \"meme_attire\": 1, \"open-chest_sweater\": 1, \"beach\": 5, \"shadow\": 3, \"hair_over_one_eye\": 1, \"restaurant\": 1, \"dark-skinned_female\": 1, \"hairclip\": 1, \"alternate_costume\": 1, \"counter\": 1, \"silhouette\": 2, \"sun\": 2, \"sepia\": 1, \"4girls\": 1, \"jitome\": 1, \"o_o\": 1, \"arashi_\\\\(kancolle\\\\)\": 1, \"holding_tray\": 2, \"waiter\": 2, \"waitress\": 2, \"pinafore_dress\": 1, \"vest\": 3, \"medium_hair\": 1, \"naval_uniform\": 1, \"faceless_female\": 3, \"heterochromia\": 1, \"breast_rest\": 1, \"kicking\": 1, \"ripples\": 1, \"soaking_feet\": 1, \"splashing\": 1, \"sandals\": 2, \"fingernails\": 1, \"graf_zeppelin_\\\\(kancolle\\\\)\": 1, \"aircraft\": 1, \"airplane\": 1, \"flying\": 1, \"hill\": 1, \"island\": 1, \"landscape\": 1, \"lighthouse\": 1, \"mountainous_horizon\": 2, \"hands_on_own_cheeks\": 1, \"hands_on_own_face\": 1, \"nishizumi_maho\": 1, \"chibi\": 2, \"arms_under_breasts\": 1, \"crossed_arms\": 2, \"cum_on_body\": 1, \"full_body\": 1, \"kawashima_momo\": 1, \"facepalm\": 1, \"thinking\": 2, \"frown\": 1, \"kneeling\": 1, \"cropped_shoulders\": 1, \"black_footwear\": 2, \"brown_footwear\": 1, \"white_legwear\": 1, \"gloves\": 1, \"boots\": 2, \"cross-laced_footwear\": 1, \"lace-up_boots\": 1, \"shoelaces\": 1, \"sneakers\": 1, \"black_sailor_collar\": 1, \"happy_birthday\": 1, \"half-closed_eyes\": 1, \"black_skirt\": 1, \"pantyshot\": 2, \"sex_from_behind\": 1, \"between_legs\": 1, \"hand_between_legs\": 1, \"white_footwear\": 1, \"ogata_hyakunosuke\": 1, \"scar\": 1, \"scar_on_cheek\": 1, \"scar_on_face\": 1, \"miniskirt\": 1, \"diffraction_spikes\": 1, \"lens_flare\": 3, \"sparkle\": 2, \"sparkle_background\": 2, \"ankle_boots\": 1, \"puffy_short_sleeves\": 1, \"space_craft\": 1, \"star_\\\\(symbol\\\\)\": 1, \"tanabata\": 4, \"3d\": 2, \"blur_censor\": 2, \"bokeh\": 2, \"camera\": 2, \"chromatic_aberration\": 2, \"concert\": 2, \"cosplay_photo\": 2, \"figure\": 2, \"film_grain\": 2, \"hickey\": 2, \"messy_hair\": 2, \"photo_inset\": 2, \"reference_inset\": 2, \"stadium\": 2, \"unconventional_media\": 2, \"used_condom\": 2, \"white_flower\": 2, \"pajamas\": 1, \"bamboo\": 3, \"coconut\": 2, \"leaf\": 2, \"palm_leaf\": 3, \"palm_tree\": 4, \"plant\": 3, \"potted_plant\": 3, \"sunflower\": 2, \"tanzaku\": 3, \"bow_panties\": 2, \"holding_clothes\": 1, \"holding_panties\": 1, \"holding_underwear\": 1, \"panties_removed\": 1, \"striped_panties\": 1, \"hinata_hajime\": 1, \"black_jacket\": 1, \"leaning_forward\": 1, \"topless_male\": 2, \"detached_sleeves\": 1, \"black_pants\": 1, \"cherry_blossoms\": 1, \"pink_background\": 1, \"wet_clothes\": 1, \"dakimakura_\\\\(object\\\\)\": 1, \"head_on_pillow\": 1, \"pillow_hug\": 1, \"yes\": 1, \"bare_tree\": 2, \"branch\": 2, \"cactus\": 1, \"abs\": 1, \"straddling\": 1, \"light_censor\": 1, \"paradis_military_uniform\": 1, \"teacup\": 1, \"fujimaru_ritsuka_\\\\(male\\\\)\": 1, \"tamura_yuri\": 1, \"pillow_grab\": 1, \"heart_of_string\": 1, \"komeiji_koishi\": 1, \"komeiji_satori\": 1, \"third_eye\": 1, \"hong_meiling\": 1, \"wings\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 704], \"count\": 4}, \"1\": {\"resolution\": [576, 576], \"count\": 2096}, \"2\": {\"resolution\": [640, 512], \"count\": 4}, \"3\": {\"resolution\": [704, 512], \"count\": 82}, \"4\": {\"resolution\": [768, 448], \"count\": 4}, \"5\": {\"resolution\": [832, 384], \"count\": 2}, \"6\": {\"resolution\": [960, 320], \"count\": 2}, \"7\": {\"resolution\": [1024, 256], \"count\": 6}}, \"mean_img_ar_error\": 0.08232736654639948}, \"subsets\": [{\"img_count\": 1100, \"num_repeats\": 2, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"tagged\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "6", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "1e-05", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "26400", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16.0", + "ss_network_dim": "32", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "1d9847b29a24a31630f096b5f1862c5c819c35806038d03caa94abe151c67f88", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "2200", + "ss_num_epochs": "12", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit(weight_decay=0.1,betas=(0.9, 0.99))", + "ss_output_name": "homebrew_close_as_neighbors", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "ca450e49", + "ss_sd_scripts_commit_hash": "7c38c33ed62fa1becab94f967a52aca18ffaccc0", + "ss_seed": "23", + "ss_session_id": "509443425", + "ss_steps": "13200", + "ss_text_encoder_lr": "0.0001", + "ss_training_comment": "None", + "ss_training_finished_at": "1697226072.757531", + "ss_training_started_at": "1697222340.3514762", + "ss_unet_lr": "0.00015", + "ss_v2": "False", + "sshs_legacy_hash": "22dff448", + "sshs_model_hash": "5d6af4e4a918f3d477eef38d3825a993c06d206e4e7ebfd3313815497ce33f57" +} \ No newline at end of file diff --git a/Styles/56/homebrew_close_as_neighbors-000006-139632.txt b/Styles/56/homebrew_close_as_neighbors-000006-139632.txt new file mode 100644 index 0000000000000000000000000000000000000000..770cfe494ac3f51070762929369e235e75ed5f16 --- /dev/null +++ b/Styles/56/homebrew_close_as_neighbors-000006-139632.txt @@ -0,0 +1,253 @@ +Link:https://civitai.com/models/161674/close-as-neighbors-manhwa-style +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Gonna try a v2 shortly +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1girl, hime_cut, blunted_bangs, upper_body, ponytail, collarbone, solo, simple_background, arms_behind_back, side-tie bikini, highres, masterpiece, 1girl, eye contact, stare, open_mouth, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic, , + Negative Prompt:(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white, + Size:512x704, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img2: + Prompt:1girl, hime_cut, blunted_bangs, upper_body, midriff, ponytail, collarbone, solo, simple_background, arms_behind_back, crop top, jean shorts, highres, masterpiece, 1girl, eye contact, smile, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic, , + Negative Prompt:(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white, + Size:512x704, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img3: + Prompt:1girl, hime_cut, blunted_bangs, cowboy_shot, groin, midriff, ponytail, collarbone, solo, simple_background, arms_behind_back, crop top, panties, highres, masterpiece, 1girl, eye contact, blush, nose blush, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic, , + Negative Prompt:(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white, + Size:512x704, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img4: + Prompt:1girl, hime_cut, blunted_bangs, face_focus, ponytail, collarbone, solo, simple_background, arms_behind_back, dress, highres, masterpiece, 1girl, eye contact, blush, nose blush, gradient eyes, simple background, shiny_skin, panel, comic, , + Negative Prompt:(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white, + Size:512x704, Sampler:DPM++ SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 161674, + "name": "Close as neighbors manhwa style", + "description": "

Gonna try a v2 shortly

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 40, + "favoriteCount": 3, + "commentCount": 0, + "ratingCount": 0, + "rating": 0 + }, + "creator": { + "username": "bobbysmithy55555426", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aa80bab4-c088-48ac-a62d-3045184405a5/width=96/bobbysmithy55555426.jpeg" + }, + "tags": [ + "style" + ], + "modelVersions": [ + { + "id": 181981, + "modelId": 161674, + "name": "v1.0", + "createdAt": "2023-10-13T20:49:36.945Z", + "updatedAt": "2023-10-14T04:58:47.205Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 40, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 139632, + "sizeKB": 37015.0283203125, + "name": "homebrew_close_as_neighbors-000006.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-10-13T20:50:49.443Z", + "hashes": { + "AutoV1": "3A5DDC47", + "AutoV2": "B5B421E1AF", + "SHA256": "B5B421E1AFC250AD5A7B2041E3633FE8433EB099F5057E2140F8AC36C07A8B0A", + "CRC32": "DAC0E9B8", + "BLAKE3": "8E10EFEEDB2F60CD8F1B6015E30F399E117BF8930EB7BE3D2F5D0E5459D33E86" + }, + "downloadUrl": "https://civitai.com/api/download/models/181981", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/d77ba93f-643f-4e1f-b1b9-2f349c808515/width=450/2933411.jpeg", + "nsfw": "Mature", + "width": 712, + "height": 984, + "hash": "ULL|o%9Z9u~pt-Mw~WxuFL9G%2?G?bNG%1oM", + "type": "image", + "metadata": { + "hash": "ULL|o%9Z9u~pt-Mw~WxuFL9G%2?G?bNG%1oM", + "size": 668055, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 3721749109, + "steps": 20, + "prompt": "1girl, hime_cut, blunted_bangs, upper_body, ponytail, collarbone, solo, simple_background, arms_behind_back, side-tie bikini, \nhighres, masterpiece, 1girl, eye contact, stare, open_mouth, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic, \n ,", + "Version": "v1.6.0", + "sampler": "DPM++ SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "homebrew_close_as_neighbors", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white,", + "Denoising strength": "0.4", + "\"homebrew_close_as_neighbors": "5d6af4e4a918\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/18a02da6-b4b9-4590-8b0e-3b3de3137b41/width=450/2933412.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "USOf.Dxu_Mof-;t7-;R*4.WB?Hof-;ayaKs:", + "type": "image", + "metadata": { + "hash": "USOf.Dxu_Mof-;t7-;R*4.WB?Hof-;ayaKs:", + "size": 477568, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 2827924485, + "steps": 20, + "prompt": "1girl, hime_cut, blunted_bangs, upper_body, midriff, ponytail, collarbone, solo, simple_background, arms_behind_back, crop top, jean shorts, \nhighres, masterpiece, 1girl, eye contact, smile, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic, \n ,", + "Version": "v1.6.0", + "sampler": "DPM++ SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "homebrew_close_as_neighbors", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white,", + "Denoising strength": "0.4", + "\"homebrew_close_as_neighbors": "5d6af4e4a918\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2b5fbfbe-07b8-4b37-9131-2a3d1801dbae/width=450/2933410.jpeg", + "nsfw": "Mature", + "width": 712, + "height": 984, + "hash": "UAMGn$-o0YtT4oxuE1Io0NV[^iW.~nR%9Ij^", + "type": "image", + "metadata": { + "hash": "UAMGn$-o0YtT4oxuE1Io0NV[^iW.~nR%9Ij^", + "size": 518971, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 4189542255, + "steps": 20, + "prompt": "1girl, hime_cut, blunted_bangs, cowboy_shot, groin, midriff, ponytail, collarbone, solo, simple_background, arms_behind_back, crop top, panties,\nhighres, masterpiece, 1girl, eye contact, blush, nose blush, happy, fang, gradient eyes, simple background, shiny_skin, panel, comic,\n,", + "Version": "v1.6.0", + "sampler": "DPM++ SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "resources": [], + "Model hash": "1d9847b29a", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white,", + "Denoising strength": "0.4", + "\"homebrew_close_as_neighbors-000006": "5d6af4e4a918\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/33cf6ec3-6831-4fe3-b4b8-9bb002de55a3/width=450/2933413.jpeg", + "nsfw": "None", + "width": 712, + "height": 984, + "hash": "UKLDu$KjTJ-:9a~V?aRj9^%1-:NG?bE2$zxa", + "type": "image", + "metadata": { + "hash": "UKLDu$KjTJ-:9a~V?aRj9^%1-:NG?bE2$zxa", + "size": 639597, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 1491763505, + "steps": 20, + "prompt": "1girl, hime_cut, blunted_bangs, face_focus, ponytail, collarbone, solo, simple_background, arms_behind_back, dress, \nhighres, masterpiece, 1girl, eye contact, blush, nose blush, gradient eyes, simple background, shiny_skin, panel, comic,\n,", + "Version": "v1.6.0", + "sampler": "DPM++ SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [], + "Model hash": "1d9847b29a", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(worst quality, low quality, bad hands, gloves, futanari:1.2), tattoo, badhandv4, monochrome, black and white,", + "Denoising strength": "0.4", + "\"homebrew_close_as_neighbors-000006": "5d6af4e4a918\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/181981" + } + ] +} +---------------------------- diff --git a/Styles/57/homebrew_omaru_gyuunyuu-141777-metadata.json b/Styles/57/homebrew_omaru_gyuunyuu-141777-metadata.json new file mode 100644 index 0000000000000000000000000000000000000000..7d5d7ecf45a9648e2307d9175843736e8cb778f3 --- /dev/null +++ b/Styles/57/homebrew_omaru_gyuunyuu-141777-metadata.json @@ -0,0 +1,1320 @@ +{ + "ss_sd_model_name": "everydayartEDA_v5.safetensors", + "ss_clip_skip": "2", + "ss_num_train_images": "992", + "ss_tag_frequency": { + "tagged": { + "1girl": 238, + "solo": 214, + "looking_at_viewer": 195, + "blush": 193, + "breasts": 160, + "smile": 139, + "long_hair": 137, + "simple_background": 89, + "collarbone": 87, + "bangs": 86, + "medium_breasts": 85, + "white_background": 84, + "brown_hair": 80, + "eyebrows_visible_through_hair": 80, + "jewelry": 76, + "brown_eyes": 75, + "hair_ornament": 66, + "shirt": 66, + "blonde_hair": 65, + "sitting": 62, + "short_hair": 62, + "letterboxed": 59, + "blue_eyes": 57, + "navel": 57, + "cleavage": 51, + "bare_shoulders": 49, + "skirt": 46, + "heart": 45, + "underwear": 40, + "barefoot": 39, + "panties": 39, + "necklace": 38, + "closed_mouth": 38, + "earrings": 38, + "open_mouth": 34, + "bow": 34, + "green_eyes": 33, + "upper_body": 32, + "long_sleeves": 32, + "black_hair": 31, + "ponytail": 31, + "large_breasts": 29, + "tongue": 25, + "tongue_out": 25, + "nipples": 25, + "sweat": 25, + "one_eye_closed": 25, + "wavy_hair": 25, + "cowboy_shot": 25, + "hair_between_eyes": 24, + "nude": 23, + "scrunchie": 23, + "shorts": 23, + "clothes_lift": 22, + "swimsuit": 22, + "ass": 22, + "dress": 22, + "1boy": 21, + "bikini": 21, + "small_breasts": 21, + "hair_scrunchie": 20, + "nose_blush": 20, + "nail_polish": 20, + "grey_background": 20, + "off_shoulder": 19, + "thighhighs": 19, + "ohtsuki_yui": 19, + "pleated_skirt": 19, + "white_shirt": 19, + "ribbon": 19, + "hetero": 18, + "bed_sheet": 18, + "heart-shaped_pupils": 18, + "lifted_by_self": 18, + "school_uniform": 18, + "hair_bow": 17, + "ahoge": 17, + "pink_hair": 17, + "hairclip": 17, + "parted_lips": 17, + "character_name": 17, + "on_bed": 16, + "symbol-shaped_pupils": 16, + "black_border": 16, + "standing": 16, + "solo_focus": 15, + "pillarboxed": 15, + "hair_over_one_eye": 14, + "grin": 14, + "twintails": 14, + "feet": 14, + "panty_pull": 14, + "glasses": 14, + "plaid": 14, + "black_legwear": 14, + "border": 14, + "hat": 14, + "twitter_username": 14, + "blurry": 13, + "hairband": 13, + "sweater": 13, + "sidelocks": 13, + "jacket": 13, + "holding": 13, + "heart_necklace": 13, + "purple_eyes": 13, + "very_long_hair": 12, + "hair_ribbon": 12, + "short_sleeves": 12, + "black_panties": 12, + "lying": 12, + "striped": 12, + "penis": 12, + "hood": 12, + "depth_of_field": 11, + "bed": 11, + "shirt_lift": 11, + "bracelet": 11, + "censored": 11, + "pink_nails": 10, + "open_clothes": 10, + "plaid_skirt": 10, + "food": 10, + "flower": 10, + "sleeveless": 10, + "multicolored_hair": 10, + "blurry_background": 10, + "star_\\(symbol\\)": 10, + "pendant": 9, + "bare_legs": 9, + "fur_trim": 9, + "yellow_eyes": 9, + "looking_back": 9, + "underboob": 9, + "phone_screen": 9, + "outside_border": 9, + "red_eyes": 9, + "2girls": 9, + "multiple_girls": 9, + "fellatio": 9, + "oral": 9, + "gloves": 8, + "v": 8, + "bottomless": 8, + "black_eyes": 8, + "cardigan": 8, + "white_border": 8, + "armpits": 8, + "hori_yuko": 8, + "gradient": 8, + "heart_earrings": 8, + "sex": 7, + "braid": 7, + ":q": 7, + "blue_scrunchie": 7, + "pink_scrunchie": 7, + "blue_skirt": 7, + "grey_hair": 7, + "pink_bow": 7, + "two-tone_background": 7, + "white_panties": 7, + "animal_ears": 7, + "wariza": 7, + "blue_nails": 7, + "pantyhose": 7, + "gradient_background": 7, + "blue_hair": 7, + "two-tone_hair": 7, + "clothes_writing": 7, + "miyamoto_frederica": 7, + "pillow": 7, + "drill_hair": 7, + "hair_bun": 7, + "abe_nana": 6, + "closed_eyes": 6, + "kneeling": 6, + "pink_shirt": 6, + "black_bikini": 6, + "red_nails": 6, + "side-tie_bikini": 6, + "t-shirt": 6, + "coat": 6, + "shiomi_syuko": 6, + "jougasaki_mika": 6, + "pink_background": 6, + "necktie": 6, + "pink_panties": 6, + "white_bikini": 6, + "eyelashes": 6, + "tank_top": 6, + "fingernails": 6, + "hair_flower": 6, + "pink_eyes": 6, + "fur-trimmed_jacket": 6, + "bar_censor": 6, + "licking": 6, + "sailor_collar": 6, + "fur-trimmed_sleeves": 6, + "kotobuki_tsumugi": 6, + "sakuma_mayu": 6, + "pubic_hair": 6, + "purple_hair": 6, + "hoodie": 6, + "denim": 6, + "trembling": 5, + "horns": 5, + "pointy_ears": 5, + "naughty_face": 5, + "no_bra": 5, + "undressing": 5, + "orange_nails": 5, + "yellow_nails": 5, + "from_behind": 5, + "indian_style": 5, + "semi-rimless_eyewear": 5, + "bag": 5, + "morikubo_nono": 5, + "side-tie_panties": 5, + "spoken_heart": 5, + "pink_dress": 5, + "arms_up": 5, + "blue_bow": 5, + ":3": 5, + "purple_nails": 5, + "pasties": 5, + "fur-trimmed_coat": 5, + "fur_collar": 5, + "heavy_breathing": 5, + "steam": 5, + "licking_penis": 5, + "blurry_foreground": 5, + "on_back": 5, + "dark-skinned_female": 5, + "dark_skin": 5, + "natalia_\\(idolmaster\\)": 5, + "eyebrows": 5, + "thick_eyebrows": 5, + ":d": 5, + "two_side_up": 5, + "black_nails": 5, + "curtains": 5, + "water": 5, + "hand_on_hip": 5, + "back": 5, + "female_pubic_hair": 5, + "parted_bangs": 5, + "ninomiya_asuka": 5, + "transparent_background": 5, + "bra": 5, + "circle_cut": 5, + "collar": 5, + "teeth": 5, + "piercing": 5, + "cup": 5, + "draph": 4, + "light_purple_hair": 4, + "narmaya_\\(granblue_fantasy\\)": 4, + "pov": 4, + "totoki_airi": 4, + "all_fours": 4, + "areolae": 4, + "pink_cardigan": 4, + "curly_hair": 4, + "forehead": 4, + "aqua_eyes": 4, + "front-tie_top": 4, + "licking_lips": 4, + "micro_bikini": 4, + "silver_hair": 4, + "greyscale": 4, + "monochrome": 4, + "floral_print": 4, + "speech_bubble": 4, + "tachibana_arisu": 4, + "bowtie": 4, + "candy": 4, + "lollipop": 4, + "black_bow": 4, + "multicolored_nails": 4, + "nail_art": 4, + "covered_nipples": 4, + "heart_pasties": 4, + "red_bow": 4, + "scarf": 4, + "side_ponytail": 4, + "breath": 4, + "steaming_body": 4, + "ichinose_shiki": 4, + "on_stomach": 4, + "striped_shirt": 4, + "red-framed_eyewear": 4, + "cloud": 4, + "sky": 4, + "polka_dot_scrunchie": 4, + "squatting": 4, + "black_shirt": 4, + "horizon": 4, + "ocean": 4, + "see-through": 4, + "dated": 4, + "happy_birthday": 4, + "bangle": 4, + "cum": 4, + "polka_dot": 4, + "stuffed_animal": 4, + "stuffed_toy": 4, + "short_shorts": 4, + "towel": 4, + "day": 4, + "himekawa_yuki": 4, + "leaning_forward": 4, + "torn_clothes": 4, + "serafuku": 4, + "pants": 4, + "orange_hair": 4, + "ear_piercing": 4, + "green_hair": 4, + "soles": 4, + "dress_lift": 4, + "denim_shorts": 4, + "ribbed_sweater": 3, + "black_gloves": 3, + "fingerless_gloves": 3, + "full_body": 3, + "selfie": 3, + "beads": 3, + "from_side": 3, + "camisole": 3, + "green_jacket": 3, + "messy_hair": 3, + "track_jacket": 3, + "collared_shirt": 3, + "gyaru": 3, + "clothes_pull": 3, + "low_twintails": 3, + "military": 3, + "uniform": 3, + "front-tie_bikini": 3, + "string_bikini": 3, + "tattoo": 3, + "cat_ears": 3, + "hamakaze_\\(kancolle\\)": 3, + "breast_hold": 3, + "japanese_clothes": 3, + "striped_bow": 3, + "tears": 3, + "thought_bubble": 3, + "aqua_nails": 3, + "demon_tail": 3, + "tail": 3, + ";\\)": 3, + "toenail_polish": 3, + "boots": 3, + "double_bun": 3, + "fur_coat": 3, + "arms_behind_back": 3, + "english_text": 3, + "shoes": 3, + "masturbation": 3, + "atago_\\(kancolle\\)": 3, + "beach": 3, + "beret": 3, + "sand": 3, + "girl_on_top": 3, + "hugging_own_legs": 3, + "holding_food": 3, + "fur-trimmed_hood": 3, + "covering": 3, + "covering_breasts": 3, + "finger_to_mouth": 3, + "outdoors": 3, + "weapon": 3, + "twin_drills": 3, + "straddling": 3, + "frills": 3, + "long_fingernails": 3, + "handbag": 3, + "star_print": 3, + "yokoyama_nao": 3, + "tied_shirt": 3, + "wet": 3, + "star_necklace": 3, + "jougasaki_rika": 3, + "ring": 3, + "heart_censor": 3, + "pussy": 3, + "cum_on_body": 3, + "choker": 3, + "topless": 3, + "underwear_only": 3, + "black_headwear": 3, + "orange_bow": 3, + "witch_hat": 3, + "bow_panties": 3, + "under-rim_eyewear": 3, + "blunt_bangs": 3, + "arm_support": 3, + "toes": 3, + "red_ribbon": 3, + "male_pubic_hair": 3, + "pink_bikini": 3, + "fire": 3, + "thong": 3, + "blue_dress": 3, + "ringlets": 3, + "motion_blur": 3, + "hood_down": 3, + "strap_slip": 3, + "bike_shorts": 3, + "crop_top": 3, + "midriff": 3, + "head_rest": 3, + "skirt_lift": 3, + "book": 2, + "holding_book": 2, + "off-shoulder_sweater": 2, + "sagisawa_fumika": 2, + "shawl": 2, + "french_kiss": 2, + "kiss": 2, + "upright_straddle": 2, + "from_above": 2, + "yellow_ribbon": 2, + "signature": 2, + "o-ring": 2, + "o-ring_bikini": 2, + "o-ring_top": 2, + "black_dress": 2, + "fur": 2, + "kohinata_miho": 2, + "blue_necktie": 2, + "shoulder_bag": 2, + "sleeves_past_wrists": 2, + "striped_necktie": 2, + "stud_earrings": 2, + "cellphone": 2, + "phone": 2, + "bikini_pull": 2, + "bikini_top": 2, + "looking_away": 2, + "sweatdrop": 2, + "military_uniform": 2, + "white_gloves": 2, + "heart_tattoo": 2, + "pubic_tattoo": 2, + "stomach": 2, + "eyes_visible_through_hair": 2, + "katagiri_sanae": 2, + "pink_jacket": 2, + "blue_shirt": 2, + "sasaki_chie": 2, + "...": 2, + "spoken_ellipsis": 2, + "kimono": 2, + "obi": 2, + "print_kimono": 2, + "sash": 2, + "wide_sleeves": 2, + "talking": 2, + ";p": 2, + "pink_sweater": 2, + "suzuhara_lulu": 2, + "virtual_youtuber": 2, + "bandaid": 2, + "crossed_legs": 2, + "close-up": 2, + "fur-trimmed_cape": 2, + "green_background": 2, + "purple_scrunchie": 2, + "pill_earrings": 2, + "yumemi_riamu": 2, + "handjob": 2, + "pointless_censoring": 2, + "blue_headwear": 2, + "lips": 2, + "doughnut": 2, + "eyewear_removed": 2, + "holding_eyewear": 2, + "index_finger_raised": 2, + "spikes": 2, + "red_scrunchie": 2, + "yellow_scrunchie": 2, + "akagi_miria": 2, + "frilled_skirt": 2, + "red_skirt": 2, + "hino_akane_\\(idolmaster\\)": 2, + "cum_in_mouth": 2, + "moroboshi_kirari": 2, + "star_hair_ornament": 2, + "pool": 2, + "poolside": 2, + "arm_up": 2, + "w": 2, + "green_skirt": 2, + "white_legwear": 2, + "bullet": 2, + "firing": 2, + "gun": 2, + "holding_gun": 2, + "loafers": 2, + "muzzle_flash": 2, + "rifle": 2, + "shell_casing": 2, + "double_v": 2, + "hayami_kanade": 2, + "out-of-frame_censoring": 2, + "garter_straps": 2, + "abigail_williams_\\(fate\\)": 2, + "hat_bow": 2, + "keyhole": 2, + "multiple_bows": 2, + "polka_dot_bow": 2, + "revealing_clothes": 2, + "yellow_shirt": 2, + "blue_border": 2, + "grey_border": 2, + "koshimizu_sachiko": 2, + "red_border": 2, + "white_dress": 2, + "ball_and_chain_restraint": 2, + "bdsm": 2, + "bondage": 2, + "bound": 2, + "bound_ankles": 2, + "bound_wrists": 2, + "chain": 2, + "chained": 2, + "clenched_teeth": 2, + "cuffs": 2, + "handcuffs": 2, + "restrained": 2, + "shackles": 2, + "hood_up": 2, + "heart_ahoge": 2, + "heart_background": 2, + "satou_shin": 2, + "red_hair": 2, + "pink_bra": 2, + "kamiya_nao": 2, + "no_shoes": 2, + "=3": 2, + "otokura_yuuki": 2, + ";d": 2, + "honda_mio": 2, + "yellow_bow": 2, + "shadow": 2, + "hand_on_own_face": 2, + "red_bowtie": 2, + "yuri": 2, + "bodysuit": 2, + "cowgirl_position": 2, + "mosaic_censoring": 2, + "unmoving_pattern": 2, + "vaginal": 2, + "explosion": 2, + "headphones": 2, + "profile": 2, + "red_flower": 2, + "red_rose": 2, + "rose": 2, + "sakurai_momoka": 2, + "headgear": 2, + "belt": 2, + "between_breasts": 2, + "turtleneck": 2, + "blue_scarf": 2, + "indoors": 2, + "mole": 2, + "highleg": 2, + "round_eyewear": 2, + "animal_hood": 2, + "hooded_jacket": 2, + "open_hoodie": 2, + "open_jacket": 2, + "fingering": 2, + "spread_legs": 2, + "bespectacled": 2, + "tan": 2, + "tanlines": 2, + "panties_around_one_leg": 2, + "sheet_grab": 2, + "blue_sky": 2, + "cloudy_sky": 2, + "pom_pom_\\(clothes\\)": 2, + "red_headwear": 2, + "black_skirt": 2, + "miniskirt": 2, + "plate": 2, + "tray": 2, + "window": 2, + "souryuu_asuka_langley": 2, + "brown_background": 2, + "sleeveless_dress": 2, + "yokozuwari": 2, + "motion_lines": 2, + "twitching_penis": 2, + "full-face_blush": 2, + "bendy_straw": 2, + "drink": 2, + "drinking_glass": 2, + "drinking_straw": 2, + "mug": 2, + "cum_on_hair": 2, + "facial": 2, + "shibuya_rin": 2, + "outline": 2, + "red_background": 2, + "white_outline": 2, + "hand_up": 2, + "ryuuzaki_kaoru": 2, + "orange_background": 2, + "medium_hair": 2, + "blue_shorts": 2, + "elbow_gloves": 2, + "areola_slip": 2, + "plaid_bow": 2, + "pantyshot": 2, + "watch": 2, + "wrist_scrunchie": 2, + "futaba_anzu": 2, + "stuffed_bunny": 2, + "table": 2, + "blur_censor": 2, + "photo_\\(medium\\)": 2, + "the_pose": 2, + "plaid_shirt": 2, + "black-framed_eyewear": 2, + "orange_shirt": 2, + "bookshelf": 1, + "open_book": 1, + "plant": 1, + "potted_plant": 1, + "grey_eyes": 1, + "hoshi_syoko": 1, + "side_braid": 1, + "cropped_torso": 1, + "foreshortening": 1, + "outstretched_arm": 1, + "reaching_out": 1, + "bag_charm": 1, + "flying_sweatdrops": 1, + "kogal": 1, + "one_side_up": 1, + "school_bag": 1, + "sonoda_chiyoko": 1, + "covering_mouth": 1, + "fake_screenshot": 1, + "holding_phone": 1, + "smartphone": 1, + "taking_picture": 1, + "pink_camisole": 1, + "embarrassed": 1, + "hair_pulled_back": 1, + "anchor_hair_ornament": 1, + "iron_cross": 1, + "military_hat": 1, + "peaked_cap": 1, + "prinz_eugen_\\(kancolle\\)": 1, + "bare_arms": 1, + "breast_tattoo": 1, + "swept_bangs": 1, + "white_ribbon": 1, + "paw_pose": 1, + "arm_under_breasts": 1, + "crossed_arms": 1, + "cherry_hair_ornament": 1, + "food-themed_hair_ornament": 1, + "heart_hair_ornament": 1, + "kindergarten_uniform": 1, + "name_tag": 1, + "strawberry_hair_ornament": 1, + "hair_down": 1, + "pocky": 1, + "low_ponytail": 1, + "striped_kimono": 1, + "vertical_stripes": 1, + "yukata": 1, + "claw_pose": 1, + "green_nails": 1, + "x_hair_ornament": 1, + "bandaids_on_nipples": 1, + "momo_velia_deviluke": 1, + "white_flower": 1, + "chair": 1, + "toenails": 1, + "brown_footwear": 1, + "orange_scarf": 1, + "pink_scarf": 1, + "red_scarf": 1, + "sendai_\\(kancolle\\)": 1, + "white_scarf": 1, + "feather_boa": 1, + "head_out_of_frame": 1, + "leggings": 1, + "legwear_under_shorts": 1, + "red_footwear": 1, + "sneakers": 1, + "smell": 1, + "open_shirt": 1, + "aqua_hair": 1, + "dildo": 1, + "naked_shirt": 1, + "lotion": 1, + "sailor_dress": 1, + "sailor_hat": 1, + "z1_leberecht_maass_\\(kancolle\\)": 1, + "z3_max_schultz_\\(kancolle\\)": 1, + "black_shorts": 1, + "off-shoulder_shirt": 1, + "striped_sweater": 1, + "face": 1, + "floating_hair": 1, + "portrait": 1, + "eating": 1, + "pajamas": 1, + "fur-trimmed_gloves": 1, + "green_coat": 1, + "mouth_hold": 1, + "parka": 1, + "animal": 1, + "armor": 1, + "bird": 1, + "black_armor": 1, + "black_feathers": 1, + "cloak": 1, + "crow": 1, + "dove": 1, + "feathers": 1, + "glowing": 1, + "glowing_eyes": 1, + "king_hassan_\\(fate\\)": 1, + "male_focus": 1, + "seagull": 1, + "skull": 1, + "skull_mask": 1, + "white_feathers": 1, + "hojo_karen": 1, + "bead_necklace": 1, + "completely_nude": 1, + "hug": 1, + "print_shirt": 1, + "apron": 1, + "white_scrunchie": 1, + "bikini_bottom": 1, + "caustics": 1, + "wading": 1, + "waves": 1, + "wet_clothes": 1, + "wet_hair": 1, + "wet_shirt": 1, + "milestone_celebration": 1, + "thank_you": 1, + "flower_bracelet": 1, + "layered_skirt": 1, + "v_arms": 1, + "butt_crack": 1, + "halterneck": 1, + "purple_bikini": 1, + "no_panties": 1, + "open_coat": 1, + "pink_coat": 1, + "winter_coat": 1, + "aiming": 1, + "ak-47": 1, + "anti-materiel_rifle": 1, + "ar-15": 1, + "assault_rifle": 1, + "battle_rifle": 1, + "beretta_92": 1, + "bullpup": 1, + "cartridge": 1, + "casing_ejection": 1, + "finger_on_trigger": 1, + "grenade_launcher": 1, + "h&k_hk416": 1, + "h&k_ump": 1, + "handgun": 1, + "heckler_&_koch": 1, + "holding_weapon": 1, + "holster": 1, + "kalashnikov_rifle": 1, + "load_bearing_vest": 1, + "m1911": 1, + "m4_carbine": 1, + "machine_gun": 1, + "magazine_\\(weapon\\)": 1, + "one_knee": 1, + "p90": 1, + "pistol": 1, + "scope": 1, + "shotgun": 1, + "sig_sauer": 1, + "sling": 1, + "sniper_rifle": 1, + "submachine_gun": 1, + "suppressor": 1, + "thigh_holster": 1, + "trigger_discipline": 1, + "walther": 1, + "sisters": 1, + "sparkle": 1, + "sparkle_background": 1, + "black_tank_top": 1, + "cum_on_stomach": 1, + "cumdrip": 1, + "hand_on_own_stomach": 1, + "kanzaki_ranko": 1, + "lolita_fashion": 1, + "striped_dress": 1, + "lace": 1, + "lace-trimmed_panties": 1, + "lace_panties": 1, + "lace_trim": 1, + "shimamura_uzuki": 1, + "food_print": 1, + "oosaki_amana": 1, + "oosaki_tenka": 1, + "polka_dot_panties": 1, + "strawberry_print": 1, + "toilet": 1, + "toilet_paper": 1, + "toilet_use": 1, + "galaxy": 1, + "key": 1, + "light_particles": 1, + "night_sky": 1, + "shooting_star": 1, + "space": 1, + "star_\\(sky\\)": 1, + "starry_sky": 1, + "starry_sky_print": 1, + "teddy_bear": 1, + "tentacles": 1, + "hair_flaps": 1, + "pink_border": 1, + "angel": 1, + "angel_wings": 1, + "bug": 1, + "detached_wings": 1, + "fairy_wings": 1, + "fake_wings": 1, + "feathered_wings": 1, + "halo": 1, + "looking_to_the_side": 1, + "mini_wings": 1, + "white_wings": 1, + "wings": 1, + "sandals": 1, + "anchor": 1, + "angry": 1, + "animal_collar": 1, + "animal_hands": 1, + "belt_collar": 1, + "black_collar": 1, + "blue_collar": 1, + "broken": 1, + "broken_chain": 1, + "chain_necklace": 1, + "flail": 1, + "gold_chain": 1, + "hook": 1, + "leash": 1, + "leash_pull": 1, + "lock": 1, + "metal_collar": 1, + "padlock": 1, + "pink_collar": 1, + "pocket_watch": 1, + "police": 1, + "police_uniform": 1, + "prison": 1, + "prison_clothes": 1, + "sickle": 1, + "slave": 1, + "spiked_collar": 1, + "studded_collar": 1, + "swing": 1, + "viewer_holding_leash": 1, + "wolf_ears": 1, + "short_twintails": 1, + "bow_bra": 1, + "braided_bun": 1, + "diagonal_stripes": 1, + "kneehighs": 1, + "socks": 1, + "dolphin_shorts": 1, + "hooded_track_jacket": 1, + "yellow_skirt": 1, + "blue_sailor_collar": 1, + "dark_blue_hair": 1, + "fish_hair_ornament": 1, + "clothes_around_waist": 1, + "peace_symbol": 1, + "smiley_face": 1, + "sweater_around_waist": 1, + "otoko_no_ko": 1, + "shorts_pull": 1, + "wing_collar": 1, + "yellow_jacket": 1, + "yellow_raincoat": 1, + "evil_smile": 1, + "glowing_eye": 1, + "print_bow": 1, + "sharp_teeth": 1, + "skull_print": 1, + "third_eye": 1, + "breast_rest": 1, + "convenient_leg": 1, + "miyamizu_mitsuha": 1, + "akiyama_mio": 1, + "breast_grab": 1, + "deep_skin": 1, + "grabbing": 1, + "grabbing_from_behind": 1, + "groping": 1, + "self_fondle": 1, + "arm_hair": 1, + "body_hair": 1, + "chain-link_fence": 1, + "chest_hair": 1, + "clothed_sex": 1, + "fence": 1, + "fishnet_bodysuit": 1, + "fishnet_gloves": 1, + "fishnet_legwear": 1, + "fishnets": 1, + "forehead_protector": 1, + "hairy": 1, + "honeycomb_\\(pattern\\)": 1, + "leg_hair": 1, + "net": 1, + "ninja": 1, + "plaid_legwear": 1, + "pussy_juice": 1, + "racket": 1, + "squatting_cowgirl_position": 1, + "taimanin_suit": 1, + "tennis_racket": 1, + "carrying": 1, + "princess_carry": 1, + "saliva": 1, + "embers": 1, + "machinery": 1, + "smoke": 1, + "turret": 1, + "low-tied_long_hair": 1, + "holding_hands": 1, + "interlocked_fingers": 1, + "kagamine_rin": 1, + "tainaka_ritsu": 1, + "badge": 1, + "bunny": 1, + "hair_bobbles": 1, + "sazanami_\\(kancolle\\)": 1, + "soaking_feet": 1, + "object_hug": 1, + "pillow_hug": 1, + "eye_contact": 1, + "looking_at_another": 1, + "warspite_\\(kancolle\\)": 1, + "burnt_clothes": 1, + "damaged": 1, + "detached_sleeves": 1, + "kongou_\\(kancolle\\)": 1, + "nontraditional_miko": 1, + "red_sky": 1, + "sunset": 1, + "thigh_boots": 1, + "torn_skirt": 1, + "photo_background": 1, + "strap_between_breasts": 1, + "turtleneck_sweater": 1, + "clenched_hands": 1, + "groin": 1, + "naked_scarf": 1, + "striped_scarf": 1, + "sweater_vest": 1, + "purple_skirt": 1, + "shiny_hair": 1, + "torn_legwear": 1, + "thigh_strap": 1, + "uneven_gloves": 1, + "arm_behind_head": 1, + "highleg_bikini": 1, + "black_choker": 1, + "animal_costume": 1, + "bunny_hood": 1, + "ichihara_nina": 1, + "kigurumi": 1, + "futanari": 1, + "holding_towel": 1, + "black_scarf": 1, + "enpera": 1, + "naked_towel": 1, + "sigh": 1, + "black_hoodie": 1, + "nana_asta_deviluke": 1, + "chocolate": 1, + "chocolate_on_breasts": 1, + "happy_valentine": 1, + "heart-shaped_chocolate": 1, + "naked_ribbon": 1, + "valentine": 1, + "no_pants": 1, + "orange_panties": 1, + "yellow_panties": 1, + "yellow_sweater": 1, + "side_drill": 1, + "sitting_on_bed": 1, + "condensation_trail": 1, + "mountain": 1, + "mountainous_horizon": 1, + "couch": 1, + "orange_bikini": 1, + "bell": 1, + "bobblehat": 1, + "christmas": 1, + "christmas_tree": 1, + "fur-trimmed_capelet": 1, + "fur-trimmed_dress": 1, + "fur-trimmed_headwear": 1, + "fur-trimmed_skirt": 1, + "hands_on_feet": 1, + "merry_christmas": 1, + "sack": 1, + "santa_bikini": 1, + "santa_boots": 1, + "santa_costume": 1, + "santa_dress": 1, + "santa_gloves": 1, + "santa_hat": 1, + ":p": 1, + "anchovy_\\(girls_und_panzer\\)": 1, + "anzio_school_uniform": 1, + "black_belt": 1, + "black_cape": 1, + "black_necktie": 1, + "black_ribbon": 1, + "cape": 1, + "dress_shirt": 1, + "emblem": 1, + "riding_crop": 1, + "smirk": 1, + "art_brush": 1, + "blood": 1, + "canvas_\\(object\\)": 1, + "hatsune_miku": 1, + "holding_tray": 1, + "painting": 1, + "palette_\\(object\\)": 1, + "nitta_minami": 1, + "polo_shirt": 1, + "igarashi_kyoko": 1, + "beach_umbrella": 1, + "black_umbrella": 1, + "blue_umbrella": 1, + "bokeh": 1, + "frog": 1, + "holding_umbrella": 1, + "hydrangea": 1, + "leaf_umbrella": 1, + "lens_flare": 1, + "lily_pad": 1, + "oil-paper_umbrella": 1, + "parasol": 1, + "pink_umbrella": 1, + "puddle": 1, + "purple_umbrella": 1, + "rain": 1, + "rainbow": 1, + "red_umbrella": 1, + "ripples": 1, + "rubber_boots": 1, + "shared_umbrella": 1, + "snail": 1, + "teruterubouzu": 1, + "transparent": 1, + "transparent_umbrella": 1, + "umbrella": 1, + "water_drop": 1, + "white_umbrella": 1, + "half_updo": 1, + "hand_on_own_thigh": 1, + "breasts_outside": 1, + "cum_on_penis": 1, + "erection": 1, + "hand_in_panties": 1, + "sound_effects": 1, + "testicles": 1, + "mash_kyrielight": 1, + "comic": 1, + "p-head_producer": 1, + "producer_\\(idolmaster\\)": 1, + "glass": 1, + "bukkake": 1, + "cum_on_breasts": 1, + "cum_on_clothes": 1, + "half-closed_eyes": 1, + "okumura_haru": 1, + "sleeves_rolled_up": 1, + "covered_navel": 1, + "g-string": 1, + "alpha_signature": 1, + "purple_scarf": 1, + "red_shirt": 1, + "white_shorts": 1, + "akeome": 1, + "happy_new_year": 1, + "holding_cup": 1, + "new_year": 1, + "nishizumi_miho": 1, + "starfish": 1, + "starry_background": 1, + "upper_teeth": 1, + "waving": 1, + "jeans": 1, + "takebe_saori": 1, + "headphones_around_neck": 1, + "tada_riina": 1, + "ankle_cuffs": 1, + "bound_arms": 1, + "spreader_bar": 1, + "kiriya_aoi": 1, + "burning": 1, + "cake": 1, + "candle": 1, + "flame": 1, + "garter_belt": 1, + "halloween": 1, + "happy_halloween": 1, + "holding_plate": 1, + "jack-o'-lantern": 1, + "pumpkin": 1, + "teacup": 1, + "trick_or_treat": 1, + "witch": 1, + "animal_print": 1, + "leopard_print": 1, + "matoba_risa": 1, + "drawstring": 1, + "v_over_eye": 1, + "yellow_hoodie": 1, + "beanie": 1, + "green_shorts": 1, + "on_lap": 1, + "pikachu": 1, + "pokemon_\\(creature\\)": 1, + "selene_\\(pokemon\\)": 1, + "z-ring": 1, + "crop_top_overhang": 1, + "hoop_earrings": 1, + "one_breast_out": 1, + "red_legwear": 1, + "cover": 1, + "cover_page": 1, + "doujin_cover": 1, + "gran_\\(granblue_fantasy\\)": 1, + "green_neckwear": 1, + "green_ribbon": 1, + "hair_censor": 1, + "hair_over_breasts": 1, + "lala_satalin_deviluke": 1, + "fang": 1, + "plaid_bowtie": 1, + "frilled_bikini": 1, + "shirasaka_koume": 1, + "naked_coat": 1, + "highleg_panties": 1, + "lipstick_mark": 1, + "paw_print": 1, + "print_dress": 1, + "print_skirt": 1, + "wristband": 1, + "wristwatch": 1, + "artist_name": 1, + "sleeveless_shirt": 1, + "bush": 1, + "cafe": 1, + "pov_across_table": 1, + "tree": 1, + "cross": 1, + "cross_necklace": 1, + "grey_shirt": 1, + "black_background": 1, + "dotted_line": 1, + "have_to_pee": 1, + "struggling": 1, + "twitching": 1, + "eyepatch": 1, + "hayasaka_mirei": 1, + "streaked_hair": 1, + "yellow_shorts": 1, + "facing_viewer": 1, + "hands_in_pockets": 1, + "high_ponytail": 1, + "missionary": 1, + "viewfinder": 1, + "downblouse": 1, + "sajo_yukimi": 1, + "cum_on_tongue": 1, + "ejaculation": 1, + "anus": 1, + "black_pubic_hair": 1, + "chromatic_aberration": 1, + "doggystyle": 1, + "facing_away": 1, + "sex_from_behind": 1, + "top-down_bottom-up": 1, + "hand_in_pocket": 1, + "aran_sweater": 1, + "maekawa_miku": 1, + "sweater_dress": 1, + "multiple_earrings": 1, + "white_bra": 1, + "bikini_tan": 1, + "diagonal_bangs": 1, + "lipstick": 1, + "tanaka_mamimi": 1, + "condom": 1, + "condom_wrapper": 1, + "tsukioka_kogane": 1, + "goggles": 1, + "sunglasses": 1, + "hand_on_own_cheek": 1, + "ascot": 1, + "multicolored_background": 1, + "bracer": 1, + "interface_headset": 1, + "pilot_suit": 1, + "plugsuit": 1, + "red_bodysuit": 1, + "i-401_\\(kancolle\\)": 1, + "orange_leotard": 1, + "orange_ribbon": 1, + "zipper": 1, + "light_brown_hair": 1, + "buttons": 1, + "on_side": 1, + "pink_hairband": 1, + "untied_panties": 1, + "untying": 1, + "holding_candy": 1, + "can": 1, + "checkered": 1, + "coffee": 1, + "coffee_mug": 1, + "drinking": 1, + "orange_jacket": 1, + "plaid_dress": 1, + "plaid_jacket": 1, + "plaid_necktie": 1, + "plaid_panties": 1, + "plaid_ribbon": 1, + "plaid_scarf": 1, + "towel_around_neck": 1, + "blue_background": 1, + "skirt_hold": 1 + } + }, + "ss_adaptive_noise_scale": "None", + "ss_cache_latents": "True", + "ss_caption_dropout_every_n_epochs": "0", + "ss_caption_dropout_rate": "0.0", + "ss_caption_tag_dropout_rate": "0.0", + "ss_dataset_dirs": { + "tagged": { + "n_repeats": 4, + "img_count": 248 + } + }, + "ss_datasets": "[{\"is_dreambooth\": true, \"batch_size_per_device\": 1, \"num_train_images\": 992, \"num_reg_images\": 0, \"resolution\": [512, 704], \"enable_bucket\": true, \"min_bucket_reso\": 256, \"max_bucket_reso\": 1024, \"tag_frequency\": {\"tagged\": {\"1girl\": 238, \"bangs\": 86, \"bare_shoulders\": 49, \"black_hair\": 31, \"blue_eyes\": 57, \"blurry\": 13, \"blush\": 193, \"book\": 2, \"bookshelf\": 1, \"breasts\": 160, \"cleavage\": 51, \"depth_of_field\": 11, \"hairband\": 13, \"holding_book\": 2, \"jewelry\": 76, \"letterboxed\": 59, \"long_hair\": 137, \"looking_at_viewer\": 195, \"necklace\": 38, \"off-shoulder_sweater\": 2, \"off_shoulder\": 19, \"open_book\": 1, \"pendant\": 9, \"plant\": 1, \"potted_plant\": 1, \"ribbed_sweater\": 3, \"sagisawa_fumika\": 2, \"shawl\": 2, \"sitting\": 62, \"solo\": 214, \"sweater\": 13, \"1boy\": 21, \"abe_nana\": 6, \"brown_hair\": 80, \"closed_eyes\": 6, \"collarbone\": 87, \"french_kiss\": 2, \"hair_bow\": 17, \"hetero\": 18, \"kiss\": 2, \"nude\": 23, \"open_mouth\": 34, \"sex\": 7, \"trembling\": 5, \"upright_straddle\": 2, \"black_gloves\": 3, \"braid\": 7, \"draph\": 4, \"fingerless_gloves\": 3, \"from_above\": 2, \"gloves\": 8, \"hair_ornament\": 66, \"hair_over_one_eye\": 14, \"horns\": 5, \"large_breasts\": 29, \"light_purple_hair\": 4, \"narmaya_\\\\(granblue_fantasy\\\\)\": 4, \"pointy_ears\": 5, \"pov\": 4, \"smile\": 139, \"solo_focus\": 15, \"thighhighs\": 19, \":q\": 7, \"barefoot\": 39, \"bed\": 11, \"bed_sheet\": 18, \"blonde_hair\": 65, \"blue_scrunchie\": 7, \"closed_mouth\": 38, \"clothes_lift\": 22, \"eyebrows_visible_through_hair\": 80, \"hair_scrunchie\": 20, \"heart\": 45, \"heart-shaped_pupils\": 18, \"kneeling\": 6, \"lifted_by_self\": 18, \"medium_breasts\": 85, \"naughty_face\": 5, \"navel\": 57, \"no_bra\": 5, \"nose_blush\": 20, \"ohtsuki_yui\": 19, \"on_bed\": 16, \"pink_scrunchie\": 7, \"scrunchie\": 23, \"shirt\": 66, \"shirt_lift\": 11, \"shorts\": 23, \"symbol-shaped_pupils\": 16, \"tongue\": 25, \"tongue_out\": 25, \"ahoge\": 17, \"bare_legs\": 9, \"blue_skirt\": 7, \"full_body\": 3, \"grey_eyes\": 1, \"grey_hair\": 7, \"grin\": 14, \"hair_between_eyes\": 24, \"hoshi_syoko\": 1, \"pleated_skirt\": 19, \"side_braid\": 1, \"simple_background\": 89, \"skirt\": 46, \"very_long_hair\": 12, \"white_background\": 84, \"white_shirt\": 19, \"brown_eyes\": 75, \"cropped_torso\": 1, \"hair_ribbon\": 12, \"nipples\": 25, \"pink_shirt\": 6, \"ribbon\": 19, \"sweat\": 25, \"totoki_airi\": 4, \"twintails\": 14, \"undressing\": 5, \"upper_body\": 32, \"yellow_ribbon\": 2, \"bikini\": 21, \"black_bikini\": 6, \"foreshortening\": 1, \"nail_polish\": 20, \"one_eye_closed\": 25, \"orange_nails\": 5, \"outstretched_arm\": 1, \"pink_nails\": 10, \"reaching_out\": 1, \"red_nails\": 6, \"selfie\": 3, \"signature\": 2, \"swimsuit\": 22, \"v\": 8, \"wavy_hair\": 25, \"yellow_nails\": 5, \"all_fours\": 4, \"beads\": 3, \"bracelet\": 11, \"o-ring\": 2, \"o-ring_bikini\": 2, \"o-ring_top\": 2, \"ponytail\": 31, \"side-tie_bikini\": 6, \"ass\": 22, \"bottomless\": 8, \"from_side\": 3, \"short_sleeves\": 12, \"sidelocks\": 13, \"t-shirt\": 6, \"black_dress\": 2, \"black_eyes\": 8, \"coat\": 6, \"dress\": 22, \"earrings\": 38, \"feet\": 14, \"jacket\": 13, \"open_clothes\": 10, \"shiomi_syuko\": 6, \"short_hair\": 62, \"fur\": 2, \"fur_trim\": 9, \"jougasaki_mika\": 6, \"pink_hair\": 17, \"yellow_eyes\": 9, \"black_panties\": 12, \"camisole\": 3, \"from_behind\": 5, \"kohinata_miho\": 2, \"looking_back\": 9, \"panties\": 39, \"panty_pull\": 14, \"pink_background\": 6, \"underwear\": 40, \"glasses\": 14, \"green_jacket\": 3, \"indian_style\": 5, \"messy_hair\": 3, \"semi-rimless_eyewear\": 5, \"track_jacket\": 3, \"bag\": 5, \"bag_charm\": 1, \"blue_necktie\": 2, \"cardigan\": 8, \"collared_shirt\": 3, \"cowboy_shot\": 25, \"flying_sweatdrops\": 1, \"gyaru\": 3, \"hairclip\": 17, \"kogal\": 1, \"morikubo_nono\": 5, \"necktie\": 6, \"one_side_up\": 1, \"plaid\": 14, \"plaid_skirt\": 10, \"school_bag\": 1, \"school_uniform\": 18, \"shoulder_bag\": 2, \"sleeves_past_wrists\": 2, \"striped_necktie\": 2, \"stud_earrings\": 2, \"areolae\": 4, \"long_sleeves\": 32, \"parted_lips\": 17, \"sonoda_chiyoko\": 1, \"underboob\": 9, \"black_border\": 16, \"black_legwear\": 14, \"bow\": 34, \"cellphone\": 2, \"covering_mouth\": 1, \"fake_screenshot\": 1, \"holding\": 13, \"holding_phone\": 1, \"phone\": 2, \"phone_screen\": 9, \"pillarboxed\": 15, \"pink_bow\": 7, \"pink_cardigan\": 4, \"pink_panties\": 6, \"side-tie_panties\": 5, \"smartphone\": 1, \"taking_picture\": 1, \"pink_camisole\": 1, \"standing\": 16, \"bikini_pull\": 2, \"bikini_top\": 2, \"border\": 14, \"clothes_pull\": 3, \"curly_hair\": 4, \"embarrassed\": 1, \"forehead\": 4, \"grey_background\": 20, \"hair_pulled_back\": 1, \"looking_away\": 2, \"outside_border\": 9, \"red_eyes\": 9, \"small_breasts\": 21, \"sweatdrop\": 2, \"two-tone_background\": 7, \"white_bikini\": 6, \"white_border\": 8, \"anchor_hair_ornament\": 1, \"aqua_eyes\": 4, \"hat\": 14, \"iron_cross\": 1, \"low_twintails\": 3, \"lying\": 12, \"military\": 3, \"military_hat\": 1, \"military_uniform\": 2, \"peaked_cap\": 1, \"prinz_eugen_\\\\(kancolle\\\\)\": 1, \"uniform\": 3, \"white_gloves\": 2, \"white_panties\": 7, \"bare_arms\": 1, \"breast_tattoo\": 1, \"front-tie_bikini\": 3, \"front-tie_top\": 4, \"heart_tattoo\": 2, \"licking_lips\": 4, \"micro_bikini\": 4, \"pubic_tattoo\": 2, \"spoken_heart\": 5, \"stomach\": 2, \"string_bikini\": 3, \"swept_bangs\": 1, \"tattoo\": 3, \"white_ribbon\": 1, \"animal_ears\": 7, \"cat_ears\": 3, \"eyes_visible_through_hair\": 2, \"hamakaze_\\\\(kancolle\\\\)\": 3, \"paw_pose\": 1, \"silver_hair\": 4, \"arm_under_breasts\": 1, \"breast_hold\": 3, \"crossed_arms\": 1, \"heart_necklace\": 13, \"katagiri_sanae\": 2, \"pink_dress\": 5, \"pink_jacket\": 2, \"armpits\": 8, \"arms_up\": 5, \"character_name\": 17, \"greyscale\": 4, \"monochrome\": 4, \"blue_shirt\": 2, \"cherry_hair_ornament\": 1, \"food-themed_hair_ornament\": 1, \"heart_hair_ornament\": 1, \"kindergarten_uniform\": 1, \"name_tag\": 1, \"sasaki_chie\": 2, \"strawberry_hair_ornament\": 1, \"wariza\": 7, \"...\": 2, \"eyelashes\": 6, \"hair_down\": 1, \"pocky\": 1, \"spoken_ellipsis\": 2, \"striped\": 12, \"floral_print\": 4, \"japanese_clothes\": 3, \"kimono\": 2, \"low_ponytail\": 1, \"obi\": 2, \"print_kimono\": 2, \"sash\": 2, \"striped_bow\": 3, \"striped_kimono\": 1, \"twitter_username\": 14, \"vertical_stripes\": 1, \"wide_sleeves\": 2, \"yukata\": 1, \"blue_bow\": 5, \"speech_bubble\": 4, \"tachibana_arisu\": 4, \"talking\": 2, \"tears\": 3, \"thought_bubble\": 3, \";p\": 2, \"tank_top\": 6, \"bowtie\": 4, \"candy\": 4, \"food\": 10, \"lollipop\": 4, \"pink_sweater\": 2, \":3\": 5, \"aqua_nails\": 3, \"black_bow\": 4, \"blue_nails\": 7, \"claw_pose\": 1, \"fingernails\": 6, \"green_nails\": 1, \"multicolored_nails\": 4, \"nail_art\": 4, \"purple_nails\": 5, \"suzuhara_lulu\": 2, \"virtual_youtuber\": 2, \"x_hair_ornament\": 1, \"bandaid\": 2, \"bandaids_on_nipples\": 1, \"covered_nipples\": 4, \"demon_tail\": 3, \"flower\": 10, \"hair_flower\": 6, \"heart_pasties\": 4, \"momo_velia_deviluke\": 1, \"pasties\": 5, \"pink_eyes\": 6, \"tail\": 3, \"white_flower\": 1, \";\\\\)\": 3, \"chair\": 1, \"crossed_legs\": 2, \"hori_yuko\": 8, \"red_bow\": 4, \"sleeveless\": 10, \"toenail_polish\": 3, \"toenails\": 1, \"2girls\": 9, \"boots\": 3, \"brown_footwear\": 1, \"double_bun\": 3, \"multiple_girls\": 9, \"orange_scarf\": 1, \"pink_scarf\": 1, \"red_scarf\": 1, \"scarf\": 4, \"sendai_\\\\(kancolle\\\\)\": 1, \"white_scarf\": 1, \"close-up\": 2, \"feather_boa\": 1, \"fur-trimmed_cape\": 2, \"fur-trimmed_coat\": 5, \"fur-trimmed_jacket\": 6, \"fur_coat\": 3, \"fur_collar\": 5, \"head_out_of_frame\": 1, \"arms_behind_back\": 3, \"english_text\": 3, \"green_background\": 2, \"leggings\": 1, \"legwear_under_shorts\": 1, \"pantyhose\": 7, \"purple_scrunchie\": 2, \"red_footwear\": 1, \"shoes\": 3, \"side_ponytail\": 4, \"sneakers\": 1, \"breath\": 4, \"heavy_breathing\": 5, \"smell\": 1, \"steam\": 5, \"steaming_body\": 4, \"gradient\": 8, \"gradient_background\": 7, \"ichinose_shiki\": 4, \"open_shirt\": 1, \"aqua_hair\": 1, \"blue_hair\": 7, \"dildo\": 1, \"masturbation\": 3, \"multicolored_hair\": 10, \"naked_shirt\": 1, \"pill_earrings\": 2, \"two-tone_hair\": 7, \"yumemi_riamu\": 2, \"bar_censor\": 6, \"censored\": 11, \"fellatio\": 9, \"green_eyes\": 33, \"handjob\": 2, \"licking\": 6, \"licking_penis\": 5, \"on_stomach\": 4, \"oral\": 9, \"penis\": 12, \"pointless_censoring\": 2, \"atago_\\\\(kancolle\\\\)\": 3, \"beach\": 3, \"beret\": 3, \"blue_headwear\": 2, \"blurry_background\": 10, \"blurry_foreground\": 5, \"lotion\": 1, \"sand\": 3, \"clothes_writing\": 7, \"girl_on_top\": 3, \"on_back\": 5, \"sailor_collar\": 6, \"sailor_dress\": 1, \"sailor_hat\": 1, \"z1_leberecht_maass_\\\\(kancolle\\\\)\": 1, \"z3_max_schultz_\\\\(kancolle\\\\)\": 1, \"black_shorts\": 1, \"miyamoto_frederica\": 7, \"off-shoulder_shirt\": 1, \"striped_shirt\": 4, \"striped_sweater\": 1, \"hugging_own_legs\": 3, \"pillow\": 7, \"face\": 1, \"floating_hair\": 1, \"lips\": 2, \"portrait\": 1, \"doughnut\": 2, \"eating\": 1, \"holding_food\": 3, \"pajamas\": 1, \"dark-skinned_female\": 5, \"dark_skin\": 5, \"eyewear_removed\": 2, \"fur-trimmed_gloves\": 1, \"fur-trimmed_hood\": 3, \"fur-trimmed_sleeves\": 6, \"green_coat\": 1, \"holding_eyewear\": 2, \"mouth_hold\": 1, \"natalia_\\\\(idolmaster\\\\)\": 5, \"parka\": 1, \"purple_eyes\": 13, \"red-framed_eyewear\": 4, \"star_\\\\(symbol\\\\)\": 10, \"covering\": 3, \"covering_breasts\": 3, \"eyebrows\": 5, \"finger_to_mouth\": 3, \"index_finger_raised\": 2, \"kotobuki_tsumugi\": 6, \"thick_eyebrows\": 5, \"animal\": 1, \"armor\": 1, \"bird\": 1, \"black_armor\": 1, \"black_feathers\": 1, \"cloak\": 1, \"cloud\": 4, \"crow\": 1, \"dove\": 1, \"feathers\": 1, \"glowing\": 1, \"glowing_eyes\": 1, \"king_hassan_\\\\(fate\\\\)\": 1, \"male_focus\": 1, \"outdoors\": 3, \"seagull\": 1, \"skull\": 1, \"skull_mask\": 1, \"sky\": 4, \"spikes\": 2, \"weapon\": 3, \"white_feathers\": 1, \"drill_hair\": 7, \"hojo_karen\": 1, \"twin_drills\": 3, \"bead_necklace\": 1, \"polka_dot_scrunchie\": 4, \"red_scrunchie\": 2, \"squatting\": 4, \"yellow_scrunchie\": 2, \"completely_nude\": 1, \"hug\": 1, \"straddling\": 3, \":d\": 5, \"akagi_miria\": 2, \"frilled_skirt\": 2, \"frills\": 3, \"print_shirt\": 1, \"red_skirt\": 2, \"two_side_up\": 5, \"black_nails\": 5, \"long_fingernails\": 3, \"hino_akane_\\\\(idolmaster\\\\)\": 2, \"apron\": 1, \"cum_in_mouth\": 2, \"white_scrunchie\": 1, \"handbag\": 3, \"moroboshi_kirari\": 2, \"star_hair_ornament\": 2, \"black_shirt\": 4, \"curtains\": 5, \"star_print\": 3, \"yokoyama_nao\": 3, \"bikini_bottom\": 1, \"caustics\": 1, \"horizon\": 4, \"ocean\": 4, \"pool\": 2, \"poolside\": 2, \"see-through\": 4, \"tied_shirt\": 3, \"wading\": 1, \"water\": 5, \"waves\": 1, \"wet\": 3, \"wet_clothes\": 1, \"wet_hair\": 1, \"wet_shirt\": 1, \"arm_up\": 2, \"dated\": 4, \"happy_birthday\": 4, \"milestone_celebration\": 1, \"star_necklace\": 3, \"thank_you\": 1, \"w\": 2, \"bangle\": 4, \"flower_bracelet\": 1, \"hand_on_hip\": 5, \"jougasaki_rika\": 3, \"green_skirt\": 2, \"layered_skirt\": 1, \"heart_earrings\": 8, \"sakuma_mayu\": 6, \"v_arms\": 1, \"white_legwear\": 2, \"back\": 5, \"butt_crack\": 1, \"halterneck\": 1, \"purple_bikini\": 1, \"ring\": 3, \"female_pubic_hair\": 5, \"heart_censor\": 3, \"no_panties\": 1, \"open_coat\": 1, \"pink_coat\": 1, \"pubic_hair\": 6, \"pussy\": 3, \"winter_coat\": 1, \"aiming\": 1, \"ak-47\": 1, \"anti-materiel_rifle\": 1, \"ar-15\": 1, \"assault_rifle\": 1, \"battle_rifle\": 1, \"beretta_92\": 1, \"bullet\": 2, \"bullpup\": 1, \"cartridge\": 1, \"casing_ejection\": 1, \"finger_on_trigger\": 1, \"firing\": 2, \"grenade_launcher\": 1, \"gun\": 2, \"h&k_hk416\": 1, \"h&k_ump\": 1, \"handgun\": 1, \"heckler_&_koch\": 1, \"holding_gun\": 2, \"holding_weapon\": 1, \"holster\": 1, \"kalashnikov_rifle\": 1, \"load_bearing_vest\": 1, \"loafers\": 2, \"m1911\": 1, \"m4_carbine\": 1, \"machine_gun\": 1, \"magazine_\\\\(weapon\\\\)\": 1, \"muzzle_flash\": 2, \"one_knee\": 1, \"p90\": 1, \"pistol\": 1, \"rifle\": 2, \"scope\": 1, \"shell_casing\": 2, \"shotgun\": 1, \"sig_sauer\": 1, \"sling\": 1, \"sniper_rifle\": 1, \"submachine_gun\": 1, \"suppressor\": 1, \"thigh_holster\": 1, \"trigger_discipline\": 1, \"walther\": 1, \"double_v\": 2, \"sisters\": 1, \"sparkle\": 1, \"sparkle_background\": 1, \"black_tank_top\": 1, \"hayami_kanade\": 2, \"parted_bangs\": 5, \"cum\": 4, \"cum_on_body\": 3, \"cum_on_stomach\": 1, \"cumdrip\": 1, \"hand_on_own_stomach\": 1, \"out-of-frame_censoring\": 2, \"garter_straps\": 2, \"ninomiya_asuka\": 5, \"transparent_background\": 5, \"choker\": 3, \"kanzaki_ranko\": 1, \"lolita_fashion\": 1, \"striped_dress\": 1, \"bra\": 5, \"lace\": 1, \"lace-trimmed_panties\": 1, \"lace_panties\": 1, \"lace_trim\": 1, \"shimamura_uzuki\": 1, \"topless\": 3, \"underwear_only\": 3, \"food_print\": 1, \"oosaki_amana\": 1, \"oosaki_tenka\": 1, \"polka_dot\": 4, \"polka_dot_panties\": 1, \"strawberry_print\": 1, \"toilet\": 1, \"toilet_paper\": 1, \"toilet_use\": 1, \"abigail_williams_\\\\(fate\\\\)\": 2, \"black_headwear\": 3, \"galaxy\": 1, \"hat_bow\": 2, \"key\": 1, \"keyhole\": 2, \"light_particles\": 1, \"multiple_bows\": 2, \"night_sky\": 1, \"orange_bow\": 3, \"polka_dot_bow\": 2, \"revealing_clothes\": 2, \"shooting_star\": 1, \"space\": 1, \"star_\\\\(sky\\\\)\": 1, \"starry_sky\": 1, \"starry_sky_print\": 1, \"stuffed_animal\": 4, \"stuffed_toy\": 4, \"teddy_bear\": 1, \"tentacles\": 1, \"witch_hat\": 3, \"bow_panties\": 3, \"yellow_shirt\": 2, \"blue_border\": 2, \"circle_cut\": 5, \"grey_border\": 2, \"hair_flaps\": 1, \"koshimizu_sachiko\": 2, \"pink_border\": 1, \"purple_hair\": 6, \"red_border\": 2, \"angel\": 1, \"angel_wings\": 1, \"bug\": 1, \"detached_wings\": 1, \"fairy_wings\": 1, \"fake_wings\": 1, \"feathered_wings\": 1, \"halo\": 1, \"looking_to_the_side\": 1, \"mini_wings\": 1, \"white_dress\": 2, \"white_wings\": 1, \"wings\": 1, \"sandals\": 1, \"under-rim_eyewear\": 3, \"anchor\": 1, \"angry\": 1, \"animal_collar\": 1, \"animal_hands\": 1, \"ball_and_chain_restraint\": 2, \"bdsm\": 2, \"belt_collar\": 1, \"black_collar\": 1, \"blue_collar\": 1, \"bondage\": 2, \"bound\": 2, \"bound_ankles\": 2, \"bound_wrists\": 2, \"broken\": 1, \"broken_chain\": 1, \"chain\": 2, \"chain_necklace\": 1, \"chained\": 2, \"clenched_teeth\": 2, \"collar\": 5, \"cuffs\": 2, \"flail\": 1, \"gold_chain\": 1, \"handcuffs\": 2, \"hook\": 1, \"leash\": 1, \"leash_pull\": 1, \"lock\": 1, \"metal_collar\": 1, \"padlock\": 1, \"pink_collar\": 1, \"pocket_watch\": 1, \"police\": 1, \"police_uniform\": 1, \"prison\": 1, \"prison_clothes\": 1, \"restrained\": 2, \"shackles\": 2, \"sickle\": 1, \"slave\": 1, \"spiked_collar\": 1, \"studded_collar\": 1, \"swing\": 1, \"teeth\": 5, \"viewer_holding_leash\": 1, \"wolf_ears\": 1, \"hood\": 12, \"hood_up\": 2, \"hoodie\": 6, \"heart_ahoge\": 2, \"heart_background\": 2, \"satou_shin\": 2, \"red_hair\": 2, \"short_twintails\": 1, \"bow_bra\": 1, \"pink_bra\": 2, \"blunt_bangs\": 3, \"braided_bun\": 1, \"diagonal_stripes\": 1, \"hair_bun\": 7, \"kamiya_nao\": 2, \"kneehighs\": 1, \"no_shoes\": 2, \"socks\": 1, \"=3\": 2, \"dolphin_shorts\": 1, \"otokura_yuuki\": 2, \"short_shorts\": 4, \"towel\": 4, \";d\": 2, \"honda_mio\": 2, \"hooded_track_jacket\": 1, \"yellow_bow\": 2, \"yellow_skirt\": 1, \"blue_sailor_collar\": 1, \"dark_blue_hair\": 1, \"day\": 4, \"fish_hair_ornament\": 1, \"clothes_around_waist\": 1, \"peace_symbol\": 1, \"smiley_face\": 1, \"sweater_around_waist\": 1, \"himekawa_yuki\": 4, \"leaning_forward\": 4, \"otoko_no_ko\": 1, \"shorts_pull\": 1, \"wing_collar\": 1, \"yellow_jacket\": 1, \"yellow_raincoat\": 1, \"evil_smile\": 1, \"glowing_eye\": 1, \"print_bow\": 1, \"sharp_teeth\": 1, \"skull_print\": 1, \"third_eye\": 1, \"breast_rest\": 1, \"arm_support\": 3, \"convenient_leg\": 1, \"shadow\": 2, \"toes\": 3, \"hand_on_own_face\": 2, \"miyamizu_mitsuha\": 1, \"red_bowtie\": 2, \"red_ribbon\": 3, \"akiyama_mio\": 1, \"breast_grab\": 1, \"deep_skin\": 1, \"grabbing\": 1, \"grabbing_from_behind\": 1, \"groping\": 1, \"self_fondle\": 1, \"yuri\": 2, \"arm_hair\": 1, \"body_hair\": 1, \"bodysuit\": 2, \"chain-link_fence\": 1, \"chest_hair\": 1, \"clothed_sex\": 1, \"cowgirl_position\": 2, \"fence\": 1, \"fishnet_bodysuit\": 1, \"fishnet_gloves\": 1, \"fishnet_legwear\": 1, \"fishnets\": 1, \"forehead_protector\": 1, \"hairy\": 1, \"honeycomb_\\\\(pattern\\\\)\": 1, \"leg_hair\": 1, \"male_pubic_hair\": 3, \"mosaic_censoring\": 2, \"net\": 1, \"ninja\": 1, \"plaid_legwear\": 1, \"pussy_juice\": 1, \"racket\": 1, \"squatting_cowgirl_position\": 1, \"taimanin_suit\": 1, \"tennis_racket\": 1, \"torn_clothes\": 4, \"unmoving_pattern\": 2, \"vaginal\": 2, \"pink_bikini\": 3, \"carrying\": 1, \"princess_carry\": 1, \"saliva\": 1, \"embers\": 1, \"explosion\": 2, \"fire\": 3, \"machinery\": 1, \"serafuku\": 4, \"smoke\": 1, \"turret\": 1, \"low-tied_long_hair\": 1, \"thong\": 3, \"blue_dress\": 3, \"ringlets\": 3, \"headphones\": 2, \"holding_hands\": 1, \"interlocked_fingers\": 1, \"kagamine_rin\": 1, \"tainaka_ritsu\": 1, \"badge\": 1, \"bunny\": 1, \"hair_bobbles\": 1, \"sazanami_\\\\(kancolle\\\\)\": 1, \"soaking_feet\": 1, \"object_hug\": 1, \"pillow_hug\": 1, \"eye_contact\": 1, \"looking_at_another\": 1, \"profile\": 2, \"red_flower\": 2, \"red_rose\": 2, \"rose\": 2, \"sakurai_momoka\": 2, \"warspite_\\\\(kancolle\\\\)\": 1, \"burnt_clothes\": 1, \"damaged\": 1, \"detached_sleeves\": 1, \"headgear\": 2, \"kongou_\\\\(kancolle\\\\)\": 1, \"nontraditional_miko\": 1, \"red_sky\": 1, \"sunset\": 1, \"thigh_boots\": 1, \"torn_skirt\": 1, \"belt\": 2, \"between_breasts\": 2, \"motion_blur\": 3, \"pants\": 4, \"photo_background\": 1, \"strap_between_breasts\": 1, \"turtleneck\": 2, \"turtleneck_sweater\": 1, \"clenched_hands\": 1, \"blue_scarf\": 2, \"groin\": 1, \"naked_scarf\": 1, \"striped_scarf\": 1, \"indoors\": 2, \"mole\": 2, \"sweater_vest\": 1, \"orange_hair\": 4, \"purple_skirt\": 1, \"shiny_hair\": 1, \"torn_legwear\": 1, \"thigh_strap\": 1, \"uneven_gloves\": 1, \"arm_behind_head\": 1, \"highleg\": 2, \"highleg_bikini\": 1, \"piercing\": 5, \"black_choker\": 1, \"ear_piercing\": 4, \"round_eyewear\": 2, \"animal_costume\": 1, \"animal_hood\": 2, \"bunny_hood\": 1, \"hooded_jacket\": 2, \"ichihara_nina\": 1, \"kigurumi\": 1, \"open_hoodie\": 2, \"futanari\": 1, \"holding_towel\": 1, \"black_scarf\": 1, \"enpera\": 1, \"open_jacket\": 2, \"naked_towel\": 1, \"sigh\": 1, \"black_hoodie\": 1, \"fingering\": 2, \"hood_down\": 3, \"spread_legs\": 2, \"nana_asta_deviluke\": 1, \"chocolate\": 1, \"chocolate_on_breasts\": 1, \"happy_valentine\": 1, \"heart-shaped_chocolate\": 1, \"naked_ribbon\": 1, \"valentine\": 1, \"bespectacled\": 2, \"tan\": 2, \"tanlines\": 2, \"no_pants\": 1, \"orange_panties\": 1, \"yellow_panties\": 1, \"yellow_sweater\": 1, \"panties_around_one_leg\": 2, \"side_drill\": 1, \"strap_slip\": 3, \"sheet_grab\": 2, \"sitting_on_bed\": 1, \"blue_sky\": 2, \"cloudy_sky\": 2, \"condensation_trail\": 1, \"mountain\": 1, \"mountainous_horizon\": 1, \"couch\": 1, \"orange_bikini\": 1, \"bell\": 1, \"bike_shorts\": 3, \"bobblehat\": 1, \"christmas\": 1, \"christmas_tree\": 1, \"crop_top\": 3, \"fur-trimmed_capelet\": 1, \"fur-trimmed_dress\": 1, \"fur-trimmed_headwear\": 1, \"fur-trimmed_skirt\": 1, \"hands_on_feet\": 1, \"merry_christmas\": 1, \"midriff\": 3, \"pom_pom_\\\\(clothes\\\\)\": 2, \"red_headwear\": 2, \"sack\": 1, \"santa_bikini\": 1, \"santa_boots\": 1, \"santa_costume\": 1, \"santa_dress\": 1, \"santa_gloves\": 1, \"santa_hat\": 1, \":p\": 1, \"anchovy_\\\\(girls_und_panzer\\\\)\": 1, \"anzio_school_uniform\": 1, \"black_belt\": 1, \"black_cape\": 1, \"black_necktie\": 1, \"black_ribbon\": 1, \"black_skirt\": 2, \"cape\": 1, \"dress_shirt\": 1, \"emblem\": 1, \"green_hair\": 4, \"miniskirt\": 2, \"riding_crop\": 1, \"smirk\": 1, \"art_brush\": 1, \"blood\": 1, \"canvas_\\\\(object\\\\)\": 1, \"hatsune_miku\": 1, \"holding_tray\": 1, \"painting\": 1, \"palette_\\\\(object\\\\)\": 1, \"plate\": 2, \"tray\": 2, \"window\": 2, \"souryuu_asuka_langley\": 2, \"nitta_minami\": 1, \"polo_shirt\": 1, \"soles\": 4, \"igarashi_kyoko\": 1, \"beach_umbrella\": 1, \"black_umbrella\": 1, \"blue_umbrella\": 1, \"bokeh\": 1, \"frog\": 1, \"holding_umbrella\": 1, \"hydrangea\": 1, \"leaf_umbrella\": 1, \"lens_flare\": 1, \"lily_pad\": 1, \"oil-paper_umbrella\": 1, \"parasol\": 1, \"pink_umbrella\": 1, \"puddle\": 1, \"purple_umbrella\": 1, \"rain\": 1, \"rainbow\": 1, \"red_umbrella\": 1, \"ripples\": 1, \"rubber_boots\": 1, \"shared_umbrella\": 1, \"snail\": 1, \"teruterubouzu\": 1, \"transparent\": 1, \"transparent_umbrella\": 1, \"umbrella\": 1, \"water_drop\": 1, \"white_umbrella\": 1, \"brown_background\": 2, \"half_updo\": 1, \"hand_on_own_thigh\": 1, \"sleeveless_dress\": 2, \"yokozuwari\": 2, \"breasts_outside\": 1, \"cum_on_penis\": 1, \"erection\": 1, \"hand_in_panties\": 1, \"motion_lines\": 2, \"sound_effects\": 1, \"testicles\": 1, \"twitching_penis\": 2, \"dress_lift\": 4, \"full-face_blush\": 2, \"mash_kyrielight\": 1, \"comic\": 1, \"p-head_producer\": 1, \"producer_\\\\(idolmaster\\\\)\": 1, \"bendy_straw\": 2, \"cup\": 5, \"drink\": 2, \"drinking_glass\": 2, \"drinking_straw\": 2, \"glass\": 1, \"head_rest\": 3, \"mug\": 2, \"bukkake\": 1, \"cum_on_breasts\": 1, \"cum_on_clothes\": 1, \"cum_on_hair\": 2, \"facial\": 2, \"half-closed_eyes\": 1, \"okumura_haru\": 1, \"denim\": 6, \"denim_shorts\": 4, \"shibuya_rin\": 2, \"sleeves_rolled_up\": 1, \"covered_navel\": 1, \"g-string\": 1, \"skirt_lift\": 3, \"alpha_signature\": 1, \"purple_scarf\": 1, \"red_shirt\": 1, \"white_shorts\": 1, \"akeome\": 1, \"happy_new_year\": 1, \"holding_cup\": 1, \"new_year\": 1, \"nishizumi_miho\": 1, \"outline\": 2, \"red_background\": 2, \"white_outline\": 2, \"hand_up\": 2, \"ryuuzaki_kaoru\": 2, \"starfish\": 1, \"starry_background\": 1, \"upper_teeth\": 1, \"waving\": 1, \"jeans\": 1, \"takebe_saori\": 1, \"headphones_around_neck\": 1, \"tada_riina\": 1, \"ankle_cuffs\": 1, \"bound_arms\": 1, \"spreader_bar\": 1, \"kiriya_aoi\": 1, \"burning\": 1, \"cake\": 1, \"candle\": 1, \"flame\": 1, \"garter_belt\": 1, \"halloween\": 1, \"happy_halloween\": 1, \"holding_plate\": 1, \"jack-o'-lantern\": 1, \"orange_background\": 2, \"pumpkin\": 1, \"teacup\": 1, \"trick_or_treat\": 1, \"witch\": 1, \"medium_hair\": 2, \"animal_print\": 1, \"leopard_print\": 1, \"matoba_risa\": 1, \"blue_shorts\": 2, \"drawstring\": 1, \"v_over_eye\": 1, \"yellow_hoodie\": 1, \"beanie\": 1, \"green_shorts\": 1, \"on_lap\": 1, \"pikachu\": 1, \"pokemon_\\\\(creature\\\\)\": 1, \"selene_\\\\(pokemon\\\\)\": 1, \"z-ring\": 1, \"crop_top_overhang\": 1, \"hoop_earrings\": 1, \"one_breast_out\": 1, \"red_legwear\": 1, \"cover\": 1, \"cover_page\": 1, \"doujin_cover\": 1, \"elbow_gloves\": 2, \"gran_\\\\(granblue_fantasy\\\\)\": 1, \"green_neckwear\": 1, \"green_ribbon\": 1, \"areola_slip\": 2, \"hair_censor\": 1, \"hair_over_breasts\": 1, \"lala_satalin_deviluke\": 1, \"fang\": 1, \"plaid_bow\": 2, \"plaid_bowtie\": 1, \"pantyshot\": 2, \"frilled_bikini\": 1, \"shirasaka_koume\": 1, \"naked_coat\": 1, \"highleg_panties\": 1, \"lipstick_mark\": 1, \"paw_print\": 1, \"print_dress\": 1, \"print_skirt\": 1, \"watch\": 2, \"wrist_scrunchie\": 2, \"wristband\": 1, \"wristwatch\": 1, \"artist_name\": 1, \"futaba_anzu\": 2, \"stuffed_bunny\": 2, \"sleeveless_shirt\": 1, \"bush\": 1, \"cafe\": 1, \"pov_across_table\": 1, \"table\": 2, \"tree\": 1, \"cross\": 1, \"cross_necklace\": 1, \"grey_shirt\": 1, \"black_background\": 1, \"dotted_line\": 1, \"have_to_pee\": 1, \"struggling\": 1, \"twitching\": 1, \"eyepatch\": 1, \"hayasaka_mirei\": 1, \"streaked_hair\": 1, \"yellow_shorts\": 1, \"facing_viewer\": 1, \"hands_in_pockets\": 1, \"high_ponytail\": 1, \"blur_censor\": 2, \"missionary\": 1, \"photo_\\\\(medium\\\\)\": 2, \"viewfinder\": 1, \"downblouse\": 1, \"sajo_yukimi\": 1, \"the_pose\": 2, \"cum_on_tongue\": 1, \"ejaculation\": 1, \"anus\": 1, \"black_pubic_hair\": 1, \"chromatic_aberration\": 1, \"doggystyle\": 1, \"facing_away\": 1, \"sex_from_behind\": 1, \"top-down_bottom-up\": 1, \"hand_in_pocket\": 1, \"plaid_shirt\": 2, \"aran_sweater\": 1, \"maekawa_miku\": 1, \"sweater_dress\": 1, \"multiple_earrings\": 1, \"white_bra\": 1, \"bikini_tan\": 1, \"black-framed_eyewear\": 2, \"diagonal_bangs\": 1, \"lipstick\": 1, \"tanaka_mamimi\": 1, \"condom\": 1, \"condom_wrapper\": 1, \"tsukioka_kogane\": 1, \"goggles\": 1, \"sunglasses\": 1, \"hand_on_own_cheek\": 1, \"ascot\": 1, \"multicolored_background\": 1, \"bracer\": 1, \"interface_headset\": 1, \"pilot_suit\": 1, \"plugsuit\": 1, \"red_bodysuit\": 1, \"i-401_\\\\(kancolle\\\\)\": 1, \"orange_leotard\": 1, \"orange_ribbon\": 1, \"orange_shirt\": 2, \"zipper\": 1, \"light_brown_hair\": 1, \"buttons\": 1, \"on_side\": 1, \"pink_hairband\": 1, \"untied_panties\": 1, \"untying\": 1, \"holding_candy\": 1, \"can\": 1, \"checkered\": 1, \"coffee\": 1, \"coffee_mug\": 1, \"drinking\": 1, \"orange_jacket\": 1, \"plaid_dress\": 1, \"plaid_jacket\": 1, \"plaid_necktie\": 1, \"plaid_panties\": 1, \"plaid_ribbon\": 1, \"plaid_scarf\": 1, \"towel_around_neck\": 1, \"blue_background\": 1, \"skirt_hold\": 1}}, \"bucket_info\": {\"buckets\": {\"0\": {\"resolution\": [512, 704], \"count\": 992}}, \"mean_img_ar_error\": 0.05762987012987019}, \"subsets\": [{\"img_count\": 248, \"num_repeats\": 4, \"color_aug\": false, \"flip_aug\": true, \"random_crop\": false, \"shuffle_caption\": true, \"keep_tokens\": 1, \"image_dir\": \"tagged\", \"class_tokens\": null, \"is_reg\": false}]}]", + "ss_epoch": "12", + "ss_face_crop_aug_range": "None", + "ss_full_fp16": "False", + "ss_gradient_accumulation_steps": "1", + "ss_gradient_checkpointing": "False", + "ss_learning_rate": "1e-05", + "ss_lowram": "False", + "ss_lr_scheduler": "cosine_with_restarts", + "ss_lr_warmup_steps": "0", + "ss_max_grad_norm": "1.0", + "ss_max_token_length": "225", + "ss_max_train_steps": "11904", + "ss_min_snr_gamma": "None", + "ss_mixed_precision": "fp16", + "ss_multires_noise_discount": "0.3", + "ss_multires_noise_iterations": "None", + "ss_network_alpha": "16.0", + "ss_network_dim": "32", + "ss_network_dropout": "None", + "ss_network_module": "networks.lora", + "ss_new_sd_model_hash": "1d9847b29a24a31630f096b5f1862c5c819c35806038d03caa94abe151c67f88", + "ss_noise_offset": "None", + "ss_num_batches_per_epoch": "992", + "ss_num_epochs": "12", + "ss_num_reg_images": "0", + "ss_optimizer": "bitsandbytes.optim.adamw.AdamW8bit(weight_decay=0.1,betas=(0.9, 0.99))", + "ss_output_name": "homebrew_omaru_gyuunyuu", + "ss_prior_loss_weight": "1.0", + "ss_scale_weight_norms": "None", + "ss_sd_model_hash": "ca450e49", + "ss_sd_scripts_commit_hash": "7c38c33ed62fa1becab94f967a52aca18ffaccc0", + "ss_seed": "23", + "ss_session_id": "3888556586", + "ss_steps": "11904", + "ss_text_encoder_lr": "1e-05", + "ss_training_comment": "None", + "ss_training_finished_at": "1692041664.812933", + "ss_training_started_at": "1692038403.674333", + "ss_unet_lr": "0.0001", + "ss_v2": "False", + "sshs_legacy_hash": "bdc4861d", + "sshs_model_hash": "d39d35de36c86c44e54ad9715d0a17414606dbaedeb036a559cc4258bfa1957c" +} \ No newline at end of file diff --git a/Styles/57/homebrew_omaru_gyuunyuu-141777.txt b/Styles/57/homebrew_omaru_gyuunyuu-141777.txt new file mode 100644 index 0000000000000000000000000000000000000000..d60356fbb88ae047111ab6d561e3e9c41ea9616d --- /dev/null +++ b/Styles/57/homebrew_omaru_gyuunyuu-141777.txt @@ -0,0 +1,458 @@ +Link:https://civitai.com/models/164036/omarugyuunyuu-syle +Version:v1.0 +Base Model:SD 1.5 +Keywords: +--------DESCRIPTION--------- + +Old model I never updated. Let me know if it sucks and you are interested in a version that doesn't suck. +Style is kinda cute+webtoony+strong outlines +---------------------------- +-----ABOUT THIS VERSION----- + +---------------------------- +------PREVIEWS METADATA----- +img1: + Prompt:1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, silver_hair, solo, simple_background, :o, + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img2: + Prompt:1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, silver_hair, solo, simple_background, :o, + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img3: + Prompt:1girl, jeans, crop top, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, arms_behind_back, long hair, silver_hair, solo, simple_background, laughing, happy, , + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img4: + Prompt:1girl, hoodie, shorts, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, long hair, midriff, sleeveless, silver_hair, solo, simple_background, laughing, happy, , + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img5: + Prompt:1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, silver_hair, solo, simple_background, :o, busty, + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img6: + Prompt:1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, silver_hair, solo, simple_background, :o, + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img7: + Prompt:1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, silver_hair, solo, simple_background, :o, + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: +img8: + Prompt:1girl, side-tie bikini, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, arms_behind_back, long hair, midriff, purple_hair, solo, simple_background, :o, , + Negative Prompt:(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white, + Size:512x704, Sampler:DPM++ 2M SDE Karras, Steps:20, CFG:7, Clip Skip:0, Model:, Model Hash: + +---------------------------- + + +------ENTIRE LINK JSON------ +{ + "id": 164036, + "name": "Omaru_gyuunyuu syle", + "description": "

Old model I never updated. Let me know if it sucks and you are interested in a version that doesn't suck.

Style is kinda cute+webtoony+strong outlines

", + "type": "LORA", + "poi": false, + "nsfw": false, + "allowNoCredit": true, + "allowCommercialUse": "Sell", + "allowDerivatives": true, + "allowDifferentLicense": true, + "stats": { + "downloadCount": 172, + "favoriteCount": 35, + "commentCount": 1, + "ratingCount": 0, + "rating": 0, + "tippedAmountCount": 73539 + }, + "creator": { + "username": "bobbysmithy55555426", + "image": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/aa80bab4-c088-48ac-a62d-3045184405a5/width=96/bobbysmithy55555426.jpeg" + }, + "tags": [ + "anime", + "style", + "woman" + ], + "modelVersions": [ + { + "id": 184792, + "modelId": 164036, + "name": "v1.0", + "createdAt": "2023-10-17T00:34:19.555Z", + "updatedAt": "2023-10-17T00:36:22.245Z", + "trainedWords": [], + "trainingStatus": null, + "trainingDetails": null, + "baseModel": "SD 1.5", + "baseModelType": null, + "earlyAccessTimeFrame": 0, + "description": null, + "vaeId": null, + "stats": { + "downloadCount": 172, + "ratingCount": 0, + "rating": 0 + }, + "files": [ + { + "id": 141777, + "sizeKB": 37025.4951171875, + "name": "homebrew_omaru_gyuunyuu.safetensors", + "type": "Model", + "metadata": { + "fp": null, + "size": null, + "format": "SafeTensor" + }, + "pickleScanResult": "Success", + "pickleScanMessage": "No Pickle imports", + "virusScanResult": "Success", + "virusScanMessage": null, + "scannedAt": "2023-10-17T00:35:56.777Z", + "hashes": { + "AutoV1": "457A6FF4", + "AutoV2": "EE2CE4F70D", + "SHA256": "EE2CE4F70D5C86152785AFBD8140722583C005F4899F2327AED28305E7A821CA", + "CRC32": "8E8F632A", + "BLAKE3": "8B0630EEF732A6311E5AB5EC2C5C09B54F2830E30653E62776A305E89B9EFA35" + }, + "downloadUrl": "https://civitai.com/api/download/models/184792", + "primary": true + } + ], + "images": [ + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2244baf7-9d0a-4a37-a016-2dbb73d0545d/width=450/2987427.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "UjI~-{v~L1PB^+bbaKe.~CbGwdxGxaR*xaxa", + "type": "image", + "metadata": { + "hash": "UjI~-{v~L1PB^+bbaKe.~CbGwdxGxaR*xaxa", + "size": 411082, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 3373357828, + "steps": 20, + "prompt": "1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, \nsilver_hair, solo, simple_background, :o, \n", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/f1f5674c-1f56-4f32-bfe3-6ca3b3e93b8e/width=450/2987428.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "UJKdufof.8t7~qof9ZWB?bof4.WB4.WB?Hof", + "type": "image", + "metadata": { + "hash": "UJKdufof.8t7~qof9ZWB?bof4.WB4.WB?Hof", + "size": 538502, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 3304849959, + "steps": 20, + "prompt": "1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, \nsilver_hair, solo, simple_background, :o, \n", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/747cd44a-c990-4c15-8236-39ac519e77d3/width=450/2987650.jpeg", + "nsfw": "None", + "width": 712, + "height": 984, + "hash": "UKJ*Yg%L9ss=~qIo9Z-p9aM{-ptR%MoJIoNH", + "type": "image", + "metadata": { + "hash": "UKJ*Yg%L9ss=~qIo9Z-p9aM{-ptR%MoJIoNH", + "size": 563892, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 1464861701, + "steps": 20, + "prompt": "1girl, jeans, crop top, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, arms_behind_back, long hair, \nsilver_hair, solo, simple_background, laughing, happy, \n,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/c9b39d37-d034-4790-acb1-1ff23a3964f6/width=450/2987651.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "U6Gl0LwN00%zyZkqH=Dj[8nO14o}0d?bai00", + "type": "image", + "metadata": { + "hash": "U6Gl0LwN00%zyZkqH=Dj[8nO14o}0d?bai00", + "size": 514551, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 729636589, + "steps": 20, + "prompt": "1girl, hoodie, shorts, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, long hair, midriff, sleeveless, \nsilver_hair, solo, simple_background, laughing, happy, \n,", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/2343d796-61f2-4bd0-a2d3-34a6d317a2ad/width=450/2987430.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "UiM@QAM{?v-;~qofxuj[?Hs:E1WVW=oft6Rj", + "type": "image", + "metadata": { + "hash": "UiM@QAM{?v-;~qofxuj[?Hs:E1WVW=oft6Rj", + "size": 487575, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 2352781751, + "steps": 20, + "prompt": "1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, \nsilver_hair, solo, simple_background, :o, busty, \n", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "badhandv4": "5e40d722fc3d\"", + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "bad-artist": "2d356134903e", + "Hires steps": "12", + "\"easynegative": "c74b4e810b03", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/8bef5c36-cda4-45a1-ae16-7ee28a5606ad/width=450/2987426.jpeg", + "nsfw": "None", + "width": 712, + "height": 984, + "hash": "USL4mOM|0Mn$-;D%M_jb.9M{~WRk?ajZIURj", + "type": "image", + "metadata": { + "hash": "USL4mOM|0Mn$-;D%M_jb.9M{~WRk?ajZIURj", + "size": 516357, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 3708058623, + "steps": 20, + "prompt": "1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, \nsilver_hair, solo, simple_background, :o, \n", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/a8482f4a-893e-42ad-a27c-c09d127af951/width=450/2987431.jpeg", + "nsfw": "Soft", + "width": 712, + "height": 984, + "hash": "UJF~UA^,InIU?HWB4nM{~pk9D%og4nIURiag", + "type": "image", + "metadata": { + "hash": "UJF~UA^,InIU?HWB4nM{~pk9D%og4nIURiag", + "size": 450649, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 774229944, + "steps": 20, + "prompt": "1girl, loose long sleeve shirt, v neck, jean shorts, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, cashmere sweater, arms_behind_back, long hair, \nsilver_hair, solo, simple_background, :o, \n", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8\"" + } + }, + { + "url": "https://image.civitai.com/xG1nkqKTMzGDvpLrqFT7WA/bf031195-590e-4a7c-880e-117d78d5ed1f/width=450/2987429.jpeg", + "nsfw": "Mature", + "width": 712, + "height": 984, + "hash": "UJLzs:4:pc~V9b%M-:Io%M-;xuD*t8V@IURj", + "type": "image", + "metadata": { + "hash": "UJLzs:4:pc~V9b%M-:Io%M-;xuD*t8V@IURj", + "size": 493906, + "width": 712, + "height": 984 + }, + "meta": { + "Size": "512x704", + "seed": 2618242915, + "steps": 20, + "prompt": "1girl, side-tie bikini, bored, neutral_expression, from_front, straight-on, looking_at_viewer, shiny_skin, skindentation, hips, arms_behind_back, ahoge, standing, straight-on, arms_behind_back, long hair, midriff, \npurple_hair, solo, simple_background, :o, \n, ", + "Version": "v1.6.0", + "sampler": "DPM++ 2M SDE Karras", + "VAE hash": "f921fb3f29", + "cfgScale": 7, + "clipSkip": 2, + "Pad conds": "True", + "resources": [ + { + "name": "homebrew_omaru_gyuunyuu", + "type": "lora", + "weight": 0.8 + }, + { + "name": "chara_Jigokuraku_Yuzuriha_v1", + "type": "lora", + "weight": 0.6 + } + ], + "Model hash": "1d9847b29a", + "Hires steps": "12", + "Hires upscale": "1.4", + "Hires upscaler": "R-ESRGAN 4x+ Anime6B", + "negativePrompt": "(low quality, worst quality:1.2), EasyNegative, bad-artist, badhandv4, nipples, fat, greyscale, black and white,", + "Denoising strength": "0.45", + "\"homebrew_omaru_gyuunyuu": "d39d35de36c8", + "chara_Jigokuraku_Yuzuriha_v1": "4a1a12a01546\"" + } + } + ], + "downloadUrl": "https://civitai.com/api/download/models/184792" + } + ] +} +----------------------------