Add files using upload-large-folder tool

.gitattributes

@@ -361,3 +361,11 @@ tuning-competition-baseline/.venv/lib/python3.11/site-packages/nvidia/cudnn/lib/
 .venv/lib/python3.11/site-packages/numpy/random/_mt19937.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
 .venv/lib/python3.11/site-packages/numpy/random/_generator.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
 .venv/lib/python3.11/site-packages/numpy/random/bit_generator.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/_philox.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/_bounded_integers.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/_pcg64.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/_common.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/tests/__pycache__/test_generator_mt19937.cpython-311.pyc filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/tests/__pycache__/test_random.cpython-311.pyc filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/mtrand.cpython-311-x86_64-linux-gnu.so filter=lfs diff=lfs merge=lfs -text
+.venv/lib/python3.11/site-packages/numpy/random/tests/__pycache__/test_randomstate.cpython-311.pyc filter=lfs diff=lfs merge=lfs -text

.venv/lib/python3.11/site-packages/numpy/core/__init__.py

@@ -0,0 +1,180 @@
+"""
+Contains the core of NumPy: ndarray, ufuncs, dtypes, etc.
+
+Please note that this module is private.  All functions and objects
+are available in the main ``numpy`` namespace - use that instead.
+
+"""
+
+import os
+import warnings
+
+from numpy.version import version as __version__
+
+
+# disables OpenBLAS affinity setting of the main thread that limits
+# python threads or processes to one core
+env_added = []
+for envkey in ['OPENBLAS_MAIN_FREE', 'GOTOBLAS_MAIN_FREE']:
+    if envkey not in os.environ:
+        os.environ[envkey] = '1'
+        env_added.append(envkey)
+
+try:
+    from . import multiarray
+except ImportError as exc:
+    import sys
+    msg = """
+
+IMPORTANT: PLEASE READ THIS FOR ADVICE ON HOW TO SOLVE THIS ISSUE!
+
+Importing the numpy C-extensions failed. This error can happen for
+many reasons, often due to issues with your setup or how NumPy was
+installed.
+
+We have compiled some common reasons and troubleshooting tips at:
+
+    https://numpy.org/devdocs/user/troubleshooting-importerror.html
+
+Please note and check the following:
+
+  * The Python version is: Python%d.%d from "%s"
+  * The NumPy version is: "%s"
+
+and make sure that they are the versions you expect.
+Please carefully study the documentation linked above for further help.
+
+Original error was: %s
+""" % (sys.version_info[0], sys.version_info[1], sys.executable,
+        __version__, exc)
+    raise ImportError(msg)
+finally:
+    for envkey in env_added:
+        del os.environ[envkey]
+del envkey
+del env_added
+del os
+
+from . import umath
+
+# Check that multiarray,umath are pure python modules wrapping
+# _multiarray_umath and not either of the old c-extension modules
+if not (hasattr(multiarray, '_multiarray_umath') and
+        hasattr(umath, '_multiarray_umath')):
+    import sys
+    path = sys.modules['numpy'].__path__
+    msg = ("Something is wrong with the numpy installation. "
+        "While importing we detected an older version of "
+        "numpy in {}. One method of fixing this is to repeatedly uninstall "
+        "numpy until none is found, then reinstall this version.")
+    raise ImportError(msg.format(path))
+
+from . import numerictypes as nt
+multiarray.set_typeDict(nt.sctypeDict)
+from . import numeric
+from .numeric import *
+from . import fromnumeric
+from .fromnumeric import *
+from . import defchararray as char
+from . import records
+from . import records as rec
+from .records import record, recarray, format_parser
+# Note: module name memmap is overwritten by a class with same name
+from .memmap import *
+from .defchararray import chararray
+from . import function_base
+from .function_base import *
+from . import _machar
+from . import getlimits
+from .getlimits import *
+from . import shape_base
+from .shape_base import *
+from . import einsumfunc
+from .einsumfunc import *
+del nt
+
+from .numeric import absolute as abs
+
+# do this after everything else, to minimize the chance of this misleadingly
+# appearing in an import-time traceback
+from . import _add_newdocs
+from . import _add_newdocs_scalars
+# add these for module-freeze analysis (like PyInstaller)
+from . import _dtype_ctypes
+from . import _internal
+from . import _dtype
+from . import _methods
+
+__all__ = ['char', 'rec', 'memmap']
+__all__ += numeric.__all__
+__all__ += ['record', 'recarray', 'format_parser']
+__all__ += ['chararray']
+__all__ += function_base.__all__
+__all__ += getlimits.__all__
+__all__ += shape_base.__all__
+__all__ += einsumfunc.__all__
+
+# We used to use `np.core._ufunc_reconstruct` to unpickle. This is unnecessary,
+# but old pickles saved before 1.20 will be using it, and there is no reason
+# to break loading them.
+def _ufunc_reconstruct(module, name):
+    # The `fromlist` kwarg is required to ensure that `mod` points to the
+    # inner-most module rather than the parent package when module name is
+    # nested. This makes it possible to pickle non-toplevel ufuncs such as
+    # scipy.special.expit for instance.
+    mod = __import__(module, fromlist=[name])
+    return getattr(mod, name)
+
+
+def _ufunc_reduce(func):
+    # Report the `__name__`. pickle will try to find the module. Note that
+    # pickle supports for this `__name__` to be a `__qualname__`. It may
+    # make sense to add a `__qualname__` to ufuncs, to allow this more
+    # explicitly (Numba has ufuncs as attributes).
+    # See also: https://github.com/dask/distributed/issues/3450
+    return func.__name__
+
+
+def _DType_reconstruct(scalar_type):
+    # This is a work-around to pickle type(np.dtype(np.float64)), etc.
+    # and it should eventually be replaced with a better solution, e.g. when
+    # DTypes become HeapTypes.
+    return type(dtype(scalar_type))
+
+
+def _DType_reduce(DType):
+    # As types/classes, most DTypes can simply be pickled by their name:
+    if not DType._legacy or DType.__module__ == "numpy.dtypes":
+        return DType.__name__
+
+    # However, user defined legacy dtypes (like rational) do not end up in
+    # `numpy.dtypes` as module and do not have a public class at all.
+    # For these, we pickle them by reconstructing them from the scalar type:
+    scalar_type = DType.type
+    return _DType_reconstruct, (scalar_type,)
+
+
+def __getattr__(name):
+    # Deprecated 2022-11-22, NumPy 1.25.
+    if name == "MachAr":
+        warnings.warn(
+            "The `np.core.MachAr` is considered private API (NumPy 1.24)",
+            DeprecationWarning, stacklevel=2,
+        )
+        return _machar.MachAr
+    raise AttributeError(f"Module {__name__!r} has no attribute {name!r}")
+
+
+import copyreg
+
+copyreg.pickle(ufunc, _ufunc_reduce)
+copyreg.pickle(type(dtype), _DType_reduce, _DType_reconstruct)
+
+# Unclutter namespace (must keep _*_reconstruct for unpickling)
+del copyreg
+del _ufunc_reduce
+del _DType_reduce
+
+from numpy._pytesttester import PytestTester
+test = PytestTester(__name__)
+del PytestTester

.venv/lib/python3.11/site-packages/numpy/core/__init__.pyi

@@ -0,0 +1,2 @@
+# NOTE: The `np.core` namespace is deliberately kept empty due to it
+# being private (despite the lack of leading underscore)

.venv/lib/python3.11/site-packages/numpy/core/_add_newdocs_scalars.py

@@ -0,0 +1,372 @@
+"""
+This file is separate from ``_add_newdocs.py`` so that it can be mocked out by
+our sphinx ``conf.py`` during doc builds, where we want to avoid showing
+platform-dependent information.
+"""
+import sys
+import os
+from numpy.core import dtype
+from numpy.core import numerictypes as _numerictypes
+from numpy.core.function_base import add_newdoc
+
+##############################################################################
+#
+# Documentation for concrete scalar classes
+#
+##############################################################################
+
+def numeric_type_aliases(aliases):
+    def type_aliases_gen():
+        for alias, doc in aliases:
+            try:
+                alias_type = getattr(_numerictypes, alias)
+            except AttributeError:
+                # The set of aliases that actually exist varies between platforms
+                pass
+            else:
+                yield (alias_type, alias, doc)
+    return list(type_aliases_gen())
+
+
+possible_aliases = numeric_type_aliases([
+    ('int8', '8-bit signed integer (``-128`` to ``127``)'),
+    ('int16', '16-bit signed integer (``-32_768`` to ``32_767``)'),
+    ('int32', '32-bit signed integer (``-2_147_483_648`` to ``2_147_483_647``)'),
+    ('int64', '64-bit signed integer (``-9_223_372_036_854_775_808`` to ``9_223_372_036_854_775_807``)'),
+    ('intp', 'Signed integer large enough to fit pointer, compatible with C ``intptr_t``'),
+    ('uint8', '8-bit unsigned integer (``0`` to ``255``)'),
+    ('uint16', '16-bit unsigned integer (``0`` to ``65_535``)'),
+    ('uint32', '32-bit unsigned integer (``0`` to ``4_294_967_295``)'),
+    ('uint64', '64-bit unsigned integer (``0`` to ``18_446_744_073_709_551_615``)'),
+    ('uintp', 'Unsigned integer large enough to fit pointer, compatible with C ``uintptr_t``'),
+    ('float16', '16-bit-precision floating-point number type: sign bit, 5 bits exponent, 10 bits mantissa'),
+    ('float32', '32-bit-precision floating-point number type: sign bit, 8 bits exponent, 23 bits mantissa'),
+    ('float64', '64-bit precision floating-point number type: sign bit, 11 bits exponent, 52 bits mantissa'),
+    ('float96', '96-bit extended-precision floating-point number type'),
+    ('float128', '128-bit extended-precision floating-point number type'),
+    ('complex64', 'Complex number type composed of 2 32-bit-precision floating-point numbers'),
+    ('complex128', 'Complex number type composed of 2 64-bit-precision floating-point numbers'),
+    ('complex192', 'Complex number type composed of 2 96-bit extended-precision floating-point numbers'),
+    ('complex256', 'Complex number type composed of 2 128-bit extended-precision floating-point numbers'),
+    ])
+
+
+def _get_platform_and_machine():
+    try:
+        system, _, _, _, machine = os.uname()
+    except AttributeError:
+        system = sys.platform
+        if system == 'win32':
+            machine = os.environ.get('PROCESSOR_ARCHITEW6432', '') \
+                    or os.environ.get('PROCESSOR_ARCHITECTURE', '')
+        else:
+            machine = 'unknown'
+    return system, machine
+
+
+_system, _machine = _get_platform_and_machine()
+_doc_alias_string = f":Alias on this platform ({_system} {_machine}):"
+
+
+def add_newdoc_for_scalar_type(obj, fixed_aliases, doc):
+    # note: `:field: value` is rST syntax which renders as field lists.
+    o = getattr(_numerictypes, obj)
+
+    character_code = dtype(o).char
+    canonical_name_doc = "" if obj == o.__name__ else \
+                        f":Canonical name: `numpy.{obj}`\n    "
+    if fixed_aliases:
+        alias_doc = ''.join(f":Alias: `numpy.{alias}`\n    "
+                            for alias in fixed_aliases)
+    else:
+        alias_doc = ''
+    alias_doc += ''.join(f"{_doc_alias_string} `numpy.{alias}`: {doc}.\n    "
+                         for (alias_type, alias, doc) in possible_aliases if alias_type is o)
+
+    docstring = f"""
+    {doc.strip()}
+
+    :Character code: ``'{character_code}'``
+    {canonical_name_doc}{alias_doc}
+    """
+
+    add_newdoc('numpy.core.numerictypes', obj, docstring)
+
+
+add_newdoc_for_scalar_type('bool_', [],
+    """
+    Boolean type (True or False), stored as a byte.
+
+    .. warning::
+
+       The :class:`bool_` type is not a subclass of the :class:`int_` type
+       (the :class:`bool_` is not even a number type). This is different
+       than Python's default implementation of :class:`bool` as a
+       sub-class of :class:`int`.
+    """)
+
+add_newdoc_for_scalar_type('byte', [],
+    """
+    Signed integer type, compatible with C ``char``.
+    """)
+
+add_newdoc_for_scalar_type('short', [],
+    """
+    Signed integer type, compatible with C ``short``.
+    """)
+
+add_newdoc_for_scalar_type('intc', [],
+    """
+    Signed integer type, compatible with C ``int``.
+    """)
+
+add_newdoc_for_scalar_type('int_', [],
+    """
+    Signed integer type, compatible with Python `int` and C ``long``.
+    """)
+
+add_newdoc_for_scalar_type('longlong', [],
+    """
+    Signed integer type, compatible with C ``long long``.
+    """)
+
+add_newdoc_for_scalar_type('ubyte', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned char``.
+    """)
+
+add_newdoc_for_scalar_type('ushort', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned short``.
+    """)
+
+add_newdoc_for_scalar_type('uintc', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned int``.
+    """)
+
+add_newdoc_for_scalar_type('uint', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned long``.
+    """)
+
+add_newdoc_for_scalar_type('ulonglong', [],
+    """
+    Signed integer type, compatible with C ``unsigned long long``.
+    """)
+
+add_newdoc_for_scalar_type('half', [],
+    """
+    Half-precision floating-point number type.
+    """)
+
+add_newdoc_for_scalar_type('single', [],
+    """
+    Single-precision floating-point number type, compatible with C ``float``.
+    """)
+
+add_newdoc_for_scalar_type('double', ['float_'],
+    """
+    Double-precision floating-point number type, compatible with Python `float`
+    and C ``double``.
+    """)
+
+add_newdoc_for_scalar_type('longdouble', ['longfloat'],
+    """
+    Extended-precision floating-point number type, compatible with C
+    ``long double`` but not necessarily with IEEE 754 quadruple-precision.
+    """)
+
+add_newdoc_for_scalar_type('csingle', ['singlecomplex'],
+    """
+    Complex number type composed of two single-precision floating-point
+    numbers.
+    """)
+
+add_newdoc_for_scalar_type('cdouble', ['cfloat', 'complex_'],
+    """
+    Complex number type composed of two double-precision floating-point
+    numbers, compatible with Python `complex`.
+    """)
+
+add_newdoc_for_scalar_type('clongdouble', ['clongfloat', 'longcomplex'],
+    """
+    Complex number type composed of two extended-precision floating-point
+    numbers.
+    """)
+
+add_newdoc_for_scalar_type('object_', [],
+    """
+    Any Python object.
+    """)
+
+add_newdoc_for_scalar_type('str_', ['unicode_'],
+    r"""
+    A unicode string.
+
+    This type strips trailing null codepoints.
+
+    >>> s = np.str_("abc\x00")
+    >>> s
+    'abc'
+
+    Unlike the builtin `str`, this supports the :ref:`python:bufferobjects`, exposing its
+    contents as UCS4:
+
+    >>> m = memoryview(np.str_("abc"))
+    >>> m.format
+    '3w'
+    >>> m.tobytes()
+    b'a\x00\x00\x00b\x00\x00\x00c\x00\x00\x00'
+    """)
+
+add_newdoc_for_scalar_type('bytes_', ['string_'],
+    r"""
+    A byte string.
+
+    When used in arrays, this type strips trailing null bytes.
+    """)
+
+add_newdoc_for_scalar_type('void', [],
+    r"""
+    np.void(length_or_data, /, dtype=None)
+
+    Create a new structured or unstructured void scalar.
+
+    Parameters
+    ----------
+    length_or_data : int, array-like, bytes-like, object
+       One of multiple meanings (see notes).  The length or
+       bytes data of an unstructured void.  Or alternatively,
+       the data to be stored in the new scalar when `dtype`
+       is provided.
+       This can be an array-like, in which case an array may
+       be returned.
+    dtype : dtype, optional
+        If provided the dtype of the new scalar.  This dtype must
+        be "void" dtype (i.e. a structured or unstructured void,
+        see also :ref:`defining-structured-types`).
+
+       ..versionadded:: 1.24
+
+    Notes
+    -----
+    For historical reasons and because void scalars can represent both
+    arbitrary byte data and structured dtypes, the void constructor
+    has three calling conventions:
+
+    1. ``np.void(5)`` creates a ``dtype="V5"`` scalar filled with five
+       ``\0`` bytes.  The 5 can be a Python or NumPy integer.
+    2. ``np.void(b"bytes-like")`` creates a void scalar from the byte string.
+       The dtype itemsize will match the byte string length, here ``"V10"``.
+    3. When a ``dtype=`` is passed the call is roughly the same as an
+       array creation.  However, a void scalar rather than array is returned.
+
+    Please see the examples which show all three different conventions.
+
+    Examples
+    --------
+    >>> np.void(5)
+    void(b'\x00\x00\x00\x00\x00')
+    >>> np.void(b'abcd')
+    void(b'\x61\x62\x63\x64')
+    >>> np.void((5, 3.2, "eggs"), dtype="i,d,S5")
+    (5, 3.2, b'eggs')  # looks like a tuple, but is `np.void`
+    >>> np.void(3, dtype=[('x', np.int8), ('y', np.int8)])
+    (3, 3)  # looks like a tuple, but is `np.void`
+
+    """)
+
+add_newdoc_for_scalar_type('datetime64', [],
+    """
+    If created from a 64-bit integer, it represents an offset from
+    ``1970-01-01T00:00:00``.
+    If created from string, the string can be in ISO 8601 date
+    or datetime format.
+
+    >>> np.datetime64(10, 'Y')
+    numpy.datetime64('1980')
+    >>> np.datetime64('1980', 'Y')
+    numpy.datetime64('1980')
+    >>> np.datetime64(10, 'D')
+    numpy.datetime64('1970-01-11')
+
+    See :ref:`arrays.datetime` for more information.
+    """)
+
+add_newdoc_for_scalar_type('timedelta64', [],
+    """
+    A timedelta stored as a 64-bit integer.
+
+    See :ref:`arrays.datetime` for more information.
+    """)
+
+add_newdoc('numpy.core.numerictypes', "integer", ('is_integer',
+    """
+    integer.is_integer() -> bool
+
+    Return ``True`` if the number is finite with integral value.
+
+    .. versionadded:: 1.22
+
+    Examples
+    --------
+    >>> np.int64(-2).is_integer()
+    True
+    >>> np.uint32(5).is_integer()
+    True
+    """))
+
+# TODO: work out how to put this on the base class, np.floating
+for float_name in ('half', 'single', 'double', 'longdouble'):
+    add_newdoc('numpy.core.numerictypes', float_name, ('as_integer_ratio',
+        """
+        {ftype}.as_integer_ratio() -> (int, int)
+
+        Return a pair of integers, whose ratio is exactly equal to the original
+        floating point number, and with a positive denominator.
+        Raise `OverflowError` on infinities and a `ValueError` on NaNs.
+
+        >>> np.{ftype}(10.0).as_integer_ratio()
+        (10, 1)
+        >>> np.{ftype}(0.0).as_integer_ratio()
+        (0, 1)
+        >>> np.{ftype}(-.25).as_integer_ratio()
+        (-1, 4)
+        """.format(ftype=float_name)))
+
+    add_newdoc('numpy.core.numerictypes', float_name, ('is_integer',
+        f"""
+        {float_name}.is_integer() -> bool
+
+        Return ``True`` if the floating point number is finite with integral
+        value, and ``False`` otherwise.
+
+        .. versionadded:: 1.22
+
+        Examples
+        --------
+        >>> np.{float_name}(-2.0).is_integer()
+        True
+        >>> np.{float_name}(3.2).is_integer()
+        False
+        """))
+
+for int_name in ('int8', 'uint8', 'int16', 'uint16', 'int32', 'uint32',
+        'int64', 'uint64', 'int64', 'uint64', 'int64', 'uint64'):
+    # Add negative examples for signed cases by checking typecode
+    add_newdoc('numpy.core.numerictypes', int_name, ('bit_count',
+        f"""
+        {int_name}.bit_count() -> int
+
+        Computes the number of 1-bits in the absolute value of the input.
+        Analogous to the builtin `int.bit_count` or ``popcount`` in C++.
+
+        Examples
+        --------
+        >>> np.{int_name}(127).bit_count()
+        7""" +
+        (f"""
+        >>> np.{int_name}(-127).bit_count()
+        7
+        """ if dtype(int_name).char.islower() else "")))

.venv/lib/python3.11/site-packages/numpy/core/_asarray.py

@@ -0,0 +1,134 @@
+"""
+Functions in the ``as*array`` family that promote array-likes into arrays.
+
+`require` fits this category despite its name not matching this pattern.
+"""
+from .overrides import (
+    array_function_dispatch,
+    set_array_function_like_doc,
+    set_module,
+)
+from .multiarray import array, asanyarray
+
+
+__all__ = ["require"]
+
+
+POSSIBLE_FLAGS = {
+    'C': 'C', 'C_CONTIGUOUS': 'C', 'CONTIGUOUS': 'C',
+    'F': 'F', 'F_CONTIGUOUS': 'F', 'FORTRAN': 'F',
+    'A': 'A', 'ALIGNED': 'A',
+    'W': 'W', 'WRITEABLE': 'W',
+    'O': 'O', 'OWNDATA': 'O',
+    'E': 'E', 'ENSUREARRAY': 'E'
+}
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def require(a, dtype=None, requirements=None, *, like=None):
+    """
+    Return an ndarray of the provided type that satisfies requirements.
+
+    This function is useful to be sure that an array with the correct flags
+    is returned for passing to compiled code (perhaps through ctypes).
+
+    Parameters
+    ----------
+    a : array_like
+       The object to be converted to a type-and-requirement-satisfying array.
+    dtype : data-type
+       The required data-type. If None preserve the current dtype. If your
+       application requires the data to be in native byteorder, include
+       a byteorder specification as a part of the dtype specification.
+    requirements : str or sequence of str
+       The requirements list can be any of the following
+
+       * 'F_CONTIGUOUS' ('F') - ensure a Fortran-contiguous array
+       * 'C_CONTIGUOUS' ('C') - ensure a C-contiguous array
+       * 'ALIGNED' ('A')      - ensure a data-type aligned array
+       * 'WRITEABLE' ('W')    - ensure a writable array
+       * 'OWNDATA' ('O')      - ensure an array that owns its own data
+       * 'ENSUREARRAY', ('E') - ensure a base array, instead of a subclass
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    out : ndarray
+        Array with specified requirements and type if given.
+
+    See Also
+    --------
+    asarray : Convert input to an ndarray.
+    asanyarray : Convert to an ndarray, but pass through ndarray subclasses.
+    ascontiguousarray : Convert input to a contiguous array.
+    asfortranarray : Convert input to an ndarray with column-major
+                     memory order.
+    ndarray.flags : Information about the memory layout of the array.
+
+    Notes
+    -----
+    The returned array will be guaranteed to have the listed requirements
+    by making a copy if needed.
+
+    Examples
+    --------
+    >>> x = np.arange(6).reshape(2,3)
+    >>> x.flags
+      C_CONTIGUOUS : True
+      F_CONTIGUOUS : False
+      OWNDATA : False
+      WRITEABLE : True
+      ALIGNED : True
+      WRITEBACKIFCOPY : False
+
+    >>> y = np.require(x, dtype=np.float32, requirements=['A', 'O', 'W', 'F'])
+    >>> y.flags
+      C_CONTIGUOUS : False
+      F_CONTIGUOUS : True
+      OWNDATA : True
+      WRITEABLE : True
+      ALIGNED : True
+      WRITEBACKIFCOPY : False
+
+    """
+    if like is not None:
+        return _require_with_like(
+            like,
+            a,
+            dtype=dtype,
+            requirements=requirements,
+        )
+
+    if not requirements:
+        return asanyarray(a, dtype=dtype)
+
+    requirements = {POSSIBLE_FLAGS[x.upper()] for x in requirements}
+
+    if 'E' in requirements:
+        requirements.remove('E')
+        subok = False
+    else:
+        subok = True
+
+    order = 'A'
+    if requirements >= {'C', 'F'}:
+        raise ValueError('Cannot specify both "C" and "F" order')
+    elif 'F' in requirements:
+        order = 'F'
+        requirements.remove('F')
+    elif 'C' in requirements:
+        order = 'C'
+        requirements.remove('C')
+
+    arr = array(a, dtype=dtype, order=order, copy=False, subok=subok)
+
+    for prop in requirements:
+        if not arr.flags[prop]:
+            return arr.copy(order)
+    return arr
+
+
+_require_with_like = array_function_dispatch()(require)

.venv/lib/python3.11/site-packages/numpy/core/_asarray.pyi

@@ -0,0 +1,42 @@
+from collections.abc import Iterable
+from typing import Any, TypeVar, Union, overload, Literal
+
+from numpy import ndarray
+from numpy._typing import DTypeLike, _SupportsArrayFunc
+
+_ArrayType = TypeVar("_ArrayType", bound=ndarray[Any, Any])
+
+_Requirements = Literal[
+    "C", "C_CONTIGUOUS", "CONTIGUOUS",
+    "F", "F_CONTIGUOUS", "FORTRAN",
+    "A", "ALIGNED",
+    "W", "WRITEABLE",
+    "O", "OWNDATA"
+]
+_E = Literal["E", "ENSUREARRAY"]
+_RequirementsWithE = Union[_Requirements, _E]
+
+@overload
+def require(
+    a: _ArrayType,
+    dtype: None = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> _ArrayType: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: _E | Iterable[_RequirementsWithE] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> ndarray[Any, Any]: ...
+@overload
+def require(
+    a: object,
+    dtype: DTypeLike = ...,
+    requirements: None | _Requirements | Iterable[_Requirements] = ...,
+    *,
+    like: _SupportsArrayFunc = ...
+) -> ndarray[Any, Any]: ...

.venv/lib/python3.11/site-packages/numpy/core/_dtype.py

@@ -0,0 +1,369 @@
+"""
+A place for code to be called from the implementation of np.dtype
+
+String handling is much easier to do correctly in python.
+"""
+import numpy as np
+
+
+_kind_to_stem = {
+    'u': 'uint',
+    'i': 'int',
+    'c': 'complex',
+    'f': 'float',
+    'b': 'bool',
+    'V': 'void',
+    'O': 'object',
+    'M': 'datetime',
+    'm': 'timedelta',
+    'S': 'bytes',
+    'U': 'str',
+}
+
+
+def _kind_name(dtype):
+    try:
+        return _kind_to_stem[dtype.kind]
+    except KeyError as e:
+        raise RuntimeError(
+            "internal dtype error, unknown kind {!r}"
+            .format(dtype.kind)
+        ) from None
+
+
+def __str__(dtype):
+    if dtype.fields is not None:
+        return _struct_str(dtype, include_align=True)
+    elif dtype.subdtype:
+        return _subarray_str(dtype)
+    elif issubclass(dtype.type, np.flexible) or not dtype.isnative:
+        return dtype.str
+    else:
+        return dtype.name
+
+
+def __repr__(dtype):
+    arg_str = _construction_repr(dtype, include_align=False)
+    if dtype.isalignedstruct:
+        arg_str = arg_str + ", align=True"
+    return "dtype({})".format(arg_str)
+
+
+def _unpack_field(dtype, offset, title=None):
+    """
+    Helper function to normalize the items in dtype.fields.
+
+    Call as:
+
+    dtype, offset, title = _unpack_field(*dtype.fields[name])
+    """
+    return dtype, offset, title
+
+
+def _isunsized(dtype):
+    # PyDataType_ISUNSIZED
+    return dtype.itemsize == 0
+
+
+def _construction_repr(dtype, include_align=False, short=False):
+    """
+    Creates a string repr of the dtype, excluding the 'dtype()' part
+    surrounding the object. This object may be a string, a list, or
+    a dict depending on the nature of the dtype. This
+    is the object passed as the first parameter to the dtype
+    constructor, and if no additional constructor parameters are
+    given, will reproduce the exact memory layout.
+
+    Parameters
+    ----------
+    short : bool
+        If true, this creates a shorter repr using 'kind' and 'itemsize', instead
+        of the longer type name.
+
+    include_align : bool
+        If true, this includes the 'align=True' parameter
+        inside the struct dtype construction dict when needed. Use this flag
+        if you want a proper repr string without the 'dtype()' part around it.
+
+        If false, this does not preserve the
+        'align=True' parameter or sticky NPY_ALIGNED_STRUCT flag for
+        struct arrays like the regular repr does, because the 'align'
+        flag is not part of first dtype constructor parameter. This
+        mode is intended for a full 'repr', where the 'align=True' is
+        provided as the second parameter.
+    """
+    if dtype.fields is not None:
+        return _struct_str(dtype, include_align=include_align)
+    elif dtype.subdtype:
+        return _subarray_str(dtype)
+    else:
+        return _scalar_str(dtype, short=short)
+
+
+def _scalar_str(dtype, short):
+    byteorder = _byte_order_str(dtype)
+
+    if dtype.type == np.bool_:
+        if short:
+            return "'?'"
+        else:
+            return "'bool'"
+
+    elif dtype.type == np.object_:
+        # The object reference may be different sizes on different
+        # platforms, so it should never include the itemsize here.
+        return "'O'"
+
+    elif dtype.type == np.bytes_:
+        if _isunsized(dtype):
+            return "'S'"
+        else:
+            return "'S%d'" % dtype.itemsize
+
+    elif dtype.type == np.str_:
+        if _isunsized(dtype):
+            return "'%sU'" % byteorder
+        else:
+            return "'%sU%d'" % (byteorder, dtype.itemsize / 4)
+
+    # unlike the other types, subclasses of void are preserved - but
+    # historically the repr does not actually reveal the subclass
+    elif issubclass(dtype.type, np.void):
+        if _isunsized(dtype):
+            return "'V'"
+        else:
+            return "'V%d'" % dtype.itemsize
+
+    elif dtype.type == np.datetime64:
+        return "'%sM8%s'" % (byteorder, _datetime_metadata_str(dtype))
+
+    elif dtype.type == np.timedelta64:
+        return "'%sm8%s'" % (byteorder, _datetime_metadata_str(dtype))
+
+    elif np.issubdtype(dtype, np.number):
+        # Short repr with endianness, like '<f8'
+        if short or dtype.byteorder not in ('=', '|'):
+            return "'%s%c%d'" % (byteorder, dtype.kind, dtype.itemsize)
+
+        # Longer repr, like 'float64'
+        else:
+            return "'%s%d'" % (_kind_name(dtype), 8*dtype.itemsize)
+
+    elif dtype.isbuiltin == 2:
+        return dtype.type.__name__
+
+    else:
+        raise RuntimeError(
+            "Internal error: NumPy dtype unrecognized type number")
+
+
+def _byte_order_str(dtype):
+    """ Normalize byteorder to '<' or '>' """
+    # hack to obtain the native and swapped byte order characters
+    swapped = np.dtype(int).newbyteorder('S')
+    native = swapped.newbyteorder('S')
+
+    byteorder = dtype.byteorder
+    if byteorder == '=':
+        return native.byteorder
+    if byteorder == 'S':
+        # TODO: this path can never be reached
+        return swapped.byteorder
+    elif byteorder == '|':
+        return ''
+    else:
+        return byteorder
+
+
+def _datetime_metadata_str(dtype):
+    # TODO: this duplicates the C metastr_to_unicode functionality
+    unit, count = np.datetime_data(dtype)
+    if unit == 'generic':
+        return ''
+    elif count == 1:
+        return '[{}]'.format(unit)
+    else:
+        return '[{}{}]'.format(count, unit)
+
+
+def _struct_dict_str(dtype, includealignedflag):
+    # unpack the fields dictionary into ls
+    names = dtype.names
+    fld_dtypes = []
+    offsets = []
+    titles = []
+    for name in names:
+        fld_dtype, offset, title = _unpack_field(*dtype.fields[name])
+        fld_dtypes.append(fld_dtype)
+        offsets.append(offset)
+        titles.append(title)
+
+    # Build up a string to make the dictionary
+
+    if np.core.arrayprint._get_legacy_print_mode() <= 121:
+        colon = ":"
+        fieldsep = ","
+    else:
+        colon = ": "
+        fieldsep = ", "
+
+    # First, the names
+    ret = "{'names'%s[" % colon
+    ret += fieldsep.join(repr(name) for name in names)
+
+    # Second, the formats
+    ret += "], 'formats'%s[" % colon
+    ret += fieldsep.join(
+        _construction_repr(fld_dtype, short=True) for fld_dtype in fld_dtypes)
+
+    # Third, the offsets
+    ret += "], 'offsets'%s[" % colon
+    ret += fieldsep.join("%d" % offset for offset in offsets)
+
+    # Fourth, the titles
+    if any(title is not None for title in titles):
+        ret += "], 'titles'%s[" % colon
+        ret += fieldsep.join(repr(title) for title in titles)
+
+    # Fifth, the itemsize
+    ret += "], 'itemsize'%s%d" % (colon, dtype.itemsize)
+
+    if (includealignedflag and dtype.isalignedstruct):
+        # Finally, the aligned flag
+        ret += ", 'aligned'%sTrue}" % colon
+    else:
+        ret += "}"
+
+    return ret
+
+
+def _aligned_offset(offset, alignment):
+    # round up offset:
+    return - (-offset // alignment) * alignment
+
+
+def _is_packed(dtype):
+    """
+    Checks whether the structured data type in 'dtype'
+    has a simple layout, where all the fields are in order,
+    and follow each other with no alignment padding.
+
+    When this returns true, the dtype can be reconstructed
+    from a list of the field names and dtypes with no additional
+    dtype parameters.
+
+    Duplicates the C `is_dtype_struct_simple_unaligned_layout` function.
+    """
+    align = dtype.isalignedstruct
+    max_alignment = 1
+    total_offset = 0
+    for name in dtype.names:
+        fld_dtype, fld_offset, title = _unpack_field(*dtype.fields[name])
+
+        if align:
+            total_offset = _aligned_offset(total_offset, fld_dtype.alignment)
+            max_alignment = max(max_alignment, fld_dtype.alignment)
+
+        if fld_offset != total_offset:
+            return False
+        total_offset += fld_dtype.itemsize
+
+    if align:
+        total_offset = _aligned_offset(total_offset, max_alignment)
+
+    if total_offset != dtype.itemsize:
+        return False
+    return True
+
+
+def _struct_list_str(dtype):
+    items = []
+    for name in dtype.names:
+        fld_dtype, fld_offset, title = _unpack_field(*dtype.fields[name])
+
+        item = "("
+        if title is not None:
+            item += "({!r}, {!r}), ".format(title, name)
+        else:
+            item += "{!r}, ".format(name)
+        # Special case subarray handling here
+        if fld_dtype.subdtype is not None:
+            base, shape = fld_dtype.subdtype
+            item += "{}, {}".format(
+                _construction_repr(base, short=True),
+                shape
+            )
+        else:
+            item += _construction_repr(fld_dtype, short=True)
+
+        item += ")"
+        items.append(item)
+
+    return "[" + ", ".join(items) + "]"
+
+
+def _struct_str(dtype, include_align):
+    # The list str representation can't include the 'align=' flag,
+    # so if it is requested and the struct has the aligned flag set,
+    # we must use the dict str instead.
+    if not (include_align and dtype.isalignedstruct) and _is_packed(dtype):
+        sub = _struct_list_str(dtype)
+
+    else:
+        sub = _struct_dict_str(dtype, include_align)
+
+    # If the data type isn't the default, void, show it
+    if dtype.type != np.void:
+        return "({t.__module__}.{t.__name__}, {f})".format(t=dtype.type, f=sub)
+    else:
+        return sub
+
+
+def _subarray_str(dtype):
+    base, shape = dtype.subdtype
+    return "({}, {})".format(
+        _construction_repr(base, short=True),
+        shape
+    )
+
+
+def _name_includes_bit_suffix(dtype):
+    if dtype.type == np.object_:
+        # pointer size varies by system, best to omit it
+        return False
+    elif dtype.type == np.bool_:
+        # implied
+        return False
+    elif dtype.type is None:
+        return True
+    elif np.issubdtype(dtype, np.flexible) and _isunsized(dtype):
+        # unspecified
+        return False
+    else:
+        return True
+
+
+def _name_get(dtype):
+    # provides dtype.name.__get__, documented as returning a "bit name"
+
+    if dtype.isbuiltin == 2:
+        # user dtypes don't promise to do anything special
+        return dtype.type.__name__
+
+    if dtype.kind == '\x00':
+        name = type(dtype).__name__
+    elif issubclass(dtype.type, np.void):
+        # historically, void subclasses preserve their name, eg `record64`
+        name = dtype.type.__name__
+    else:
+        name = _kind_name(dtype)
+
+    # append bit counts
+    if _name_includes_bit_suffix(dtype):
+        name += "{}".format(dtype.itemsize * 8)
+
+    # append metadata to datetimes
+    if dtype.type in (np.datetime64, np.timedelta64):
+        name += _datetime_metadata_str(dtype)
+
+    return name

.venv/lib/python3.11/site-packages/numpy/core/_dtype_ctypes.py

@@ -0,0 +1,117 @@
+"""
+Conversion from ctypes to dtype.
+
+In an ideal world, we could achieve this through the PEP3118 buffer protocol,
+something like::
+
+    def dtype_from_ctypes_type(t):
+        # needed to ensure that the shape of `t` is within memoryview.format
+        class DummyStruct(ctypes.Structure):
+            _fields_ = [('a', t)]
+
+        # empty to avoid memory allocation
+        ctype_0 = (DummyStruct * 0)()
+        mv = memoryview(ctype_0)
+
+        # convert the struct, and slice back out the field
+        return _dtype_from_pep3118(mv.format)['a']
+
+Unfortunately, this fails because:
+
+* ctypes cannot handle length-0 arrays with PEP3118 (bpo-32782)
+* PEP3118 cannot represent unions, but both numpy and ctypes can
+* ctypes cannot handle big-endian structs with PEP3118 (bpo-32780)
+"""
+
+# We delay-import ctypes for distributions that do not include it.
+# While this module is not used unless the user passes in ctypes
+# members, it is eagerly imported from numpy/core/__init__.py.
+import numpy as np
+
+
+def _from_ctypes_array(t):
+    return np.dtype((dtype_from_ctypes_type(t._type_), (t._length_,)))
+
+
+def _from_ctypes_structure(t):
+    for item in t._fields_:
+        if len(item) > 2:
+            raise TypeError(
+                "ctypes bitfields have no dtype equivalent")
+
+    if hasattr(t, "_pack_"):
+        import ctypes
+        formats = []
+        offsets = []
+        names = []
+        current_offset = 0
+        for fname, ftyp in t._fields_:
+            names.append(fname)
+            formats.append(dtype_from_ctypes_type(ftyp))
+            # Each type has a default offset, this is platform dependent for some types.
+            effective_pack = min(t._pack_, ctypes.alignment(ftyp))
+            current_offset = ((current_offset + effective_pack - 1) // effective_pack) * effective_pack
+            offsets.append(current_offset)
+            current_offset += ctypes.sizeof(ftyp)
+
+        return np.dtype(dict(
+            formats=formats,
+            offsets=offsets,
+            names=names,
+            itemsize=ctypes.sizeof(t)))
+    else:
+        fields = []
+        for fname, ftyp in t._fields_:
+            fields.append((fname, dtype_from_ctypes_type(ftyp)))
+
+        # by default, ctypes structs are aligned
+        return np.dtype(fields, align=True)
+
+
+def _from_ctypes_scalar(t):
+    """
+    Return the dtype type with endianness included if it's the case
+    """
+    if getattr(t, '__ctype_be__', None) is t:
+        return np.dtype('>' + t._type_)
+    elif getattr(t, '__ctype_le__', None) is t:
+        return np.dtype('<' + t._type_)
+    else:
+        return np.dtype(t._type_)
+
+
+def _from_ctypes_union(t):
+    import ctypes
+    formats = []
+    offsets = []
+    names = []
+    for fname, ftyp in t._fields_:
+        names.append(fname)
+        formats.append(dtype_from_ctypes_type(ftyp))
+        offsets.append(0)  # Union fields are offset to 0
+
+    return np.dtype(dict(
+        formats=formats,
+        offsets=offsets,
+        names=names,
+        itemsize=ctypes.sizeof(t)))
+
+
+def dtype_from_ctypes_type(t):
+    """
+    Construct a dtype object from a ctypes type
+    """
+    import _ctypes
+    if issubclass(t, _ctypes.Array):
+        return _from_ctypes_array(t)
+    elif issubclass(t, _ctypes._Pointer):
+        raise TypeError("ctypes pointers have no dtype equivalent")
+    elif issubclass(t, _ctypes.Structure):
+        return _from_ctypes_structure(t)
+    elif issubclass(t, _ctypes.Union):
+        return _from_ctypes_union(t)
+    elif isinstance(getattr(t, '_type_', None), str):
+        return _from_ctypes_scalar(t)
+    else:
+        raise NotImplementedError(
+            "Unknown ctypes type {}".format(t.__name__))

.venv/lib/python3.11/site-packages/numpy/core/_exceptions.py

@@ -0,0 +1,172 @@
+"""
+Various richly-typed exceptions, that also help us deal with string formatting
+in python where it's easier.
+
+By putting the formatting in `__str__`, we also avoid paying the cost for
+users who silence the exceptions.
+"""
+from .._utils import set_module
+
+def _unpack_tuple(tup):
+    if len(tup) == 1:
+        return tup[0]
+    else:
+        return tup
+
+
+def _display_as_base(cls):
+    """
+    A decorator that makes an exception class look like its base.
+
+    We use this to hide subclasses that are implementation details - the user
+    should catch the base type, which is what the traceback will show them.
+
+    Classes decorated with this decorator are subject to removal without a
+    deprecation warning.
+    """
+    assert issubclass(cls, Exception)
+    cls.__name__ = cls.__base__.__name__
+    return cls
+
+
+class UFuncTypeError(TypeError):
+    """ Base class for all ufunc exceptions """
+    def __init__(self, ufunc):
+        self.ufunc = ufunc
+
+
+@_display_as_base
+class _UFuncNoLoopError(UFuncTypeError):
+    """ Thrown when a ufunc loop cannot be found """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc)
+        self.dtypes = tuple(dtypes)
+
+    def __str__(self):
+        return (
+            "ufunc {!r} did not contain a loop with signature matching types "
+            "{!r} -> {!r}"
+        ).format(
+            self.ufunc.__name__,
+            _unpack_tuple(self.dtypes[:self.ufunc.nin]),
+            _unpack_tuple(self.dtypes[self.ufunc.nin:])
+        )
+
+
+@_display_as_base
+class _UFuncBinaryResolutionError(_UFuncNoLoopError):
+    """ Thrown when a binary resolution fails """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc, dtypes)
+        assert len(self.dtypes) == 2
+
+    def __str__(self):
+        return (
+            "ufunc {!r} cannot use operands with types {!r} and {!r}"
+        ).format(
+            self.ufunc.__name__, *self.dtypes
+        )
+
+
+@_display_as_base
+class _UFuncCastingError(UFuncTypeError):
+    def __init__(self, ufunc, casting, from_, to):
+        super().__init__(ufunc)
+        self.casting = casting
+        self.from_ = from_
+        self.to = to
+
+
+@_display_as_base
+class _UFuncInputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc input cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.in_i = i
+
+    def __str__(self):
+        # only show the number if more than one input exists
+        i_str = "{} ".format(self.in_i) if self.ufunc.nin != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} input {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _UFuncOutputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc output cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.out_i = i
+
+    def __str__(self):
+        # only show the number if more than one output exists
+        i_str = "{} ".format(self.out_i) if self.ufunc.nout != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} output {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _ArrayMemoryError(MemoryError):
+    """ Thrown when an array cannot be allocated"""
+    def __init__(self, shape, dtype):
+        self.shape = shape
+        self.dtype = dtype
+
+    @property
+    def _total_size(self):
+        num_bytes = self.dtype.itemsize
+        for dim in self.shape:
+            num_bytes *= dim
+        return num_bytes
+
+    @staticmethod
+    def _size_to_string(num_bytes):
+        """ Convert a number of bytes into a binary size string """
+
+        # https://en.wikipedia.org/wiki/Binary_prefix
+        LOG2_STEP = 10
+        STEP = 1024
+        units = ['bytes', 'KiB', 'MiB', 'GiB', 'TiB', 'PiB', 'EiB']
+
+        unit_i = max(num_bytes.bit_length() - 1, 1) // LOG2_STEP
+        unit_val = 1 << (unit_i * LOG2_STEP)
+        n_units = num_bytes / unit_val
+        del unit_val
+
+        # ensure we pick a unit that is correct after rounding
+        if round(n_units) == STEP:
+            unit_i += 1
+            n_units /= STEP
+
+        # deal with sizes so large that we don't have units for them
+        if unit_i >= len(units):
+            new_unit_i = len(units) - 1
+            n_units *= 1 << ((unit_i - new_unit_i) * LOG2_STEP)
+            unit_i = new_unit_i
+
+        unit_name = units[unit_i]
+        # format with a sensible number of digits
+        if unit_i == 0:
+            # no decimal point on bytes
+            return '{:.0f} {}'.format(n_units, unit_name)
+        elif round(n_units) < 1000:
+            # 3 significant figures, if none are dropped to the left of the .
+            return '{:#.3g} {}'.format(n_units, unit_name)
+        else:
+            # just give all the digits otherwise
+            return '{:#.0f} {}'.format(n_units, unit_name)
+
+    def __str__(self):
+        size_str = self._size_to_string(self._total_size)
+        return (
+            "Unable to allocate {} for an array with shape {} and data type {}"
+            .format(size_str, self.shape, self.dtype)
+        )

.venv/lib/python3.11/site-packages/numpy/core/_internal.pyi

@@ -0,0 +1,30 @@
+from typing import Any, TypeVar, overload, Generic
+import ctypes as ct
+
+from numpy import ndarray
+from numpy.ctypeslib import c_intp
+
+_CastT = TypeVar("_CastT", bound=ct._CanCastTo)  # Copied from `ctypes.cast`
+_CT = TypeVar("_CT", bound=ct._CData)
+_PT = TypeVar("_PT", bound=None | int)
+
+# TODO: Let the likes of `shape_as` and `strides_as` return `None`
+# for 0D arrays once we've got shape-support
+
+class _ctypes(Generic[_PT]):
+    @overload
+    def __new__(cls, array: ndarray[Any, Any], ptr: None = ...) -> _ctypes[None]: ...
+    @overload
+    def __new__(cls, array: ndarray[Any, Any], ptr: _PT) -> _ctypes[_PT]: ...
+    @property
+    def data(self) -> _PT: ...
+    @property
+    def shape(self) -> ct.Array[c_intp]: ...
+    @property
+    def strides(self) -> ct.Array[c_intp]: ...
+    @property
+    def _as_parameter_(self) -> ct.c_void_p: ...
+
+    def data_as(self, obj: type[_CastT]) -> _CastT: ...
+    def shape_as(self, obj: type[_CT]) -> ct.Array[_CT]: ...
+    def strides_as(self, obj: type[_CT]) -> ct.Array[_CT]: ...

.venv/lib/python3.11/site-packages/numpy/core/_machar.py

@@ -0,0 +1,356 @@
+"""
+Machine arithmetic - determine the parameters of the
+floating-point arithmetic system
+
+Author: Pearu Peterson, September 2003
+
+"""
+__all__ = ['MachAr']
+
+from .fromnumeric import any
+from ._ufunc_config import errstate
+from .._utils import set_module
+
+# Need to speed this up...especially for longfloat
+
+# Deprecated 2021-10-20, NumPy 1.22
+class MachAr:
+    """
+    Diagnosing machine parameters.
+
+    Attributes
+    ----------
+    ibeta : int
+        Radix in which numbers are represented.
+    it : int
+        Number of base-`ibeta` digits in the floating point mantissa M.
+    machep : int
+        Exponent of the smallest (most negative) power of `ibeta` that,
+        added to 1.0, gives something different from 1.0
+    eps : float
+        Floating-point number ``beta**machep`` (floating point precision)
+    negep : int
+        Exponent of the smallest power of `ibeta` that, subtracted
+        from 1.0, gives something different from 1.0.
+    epsneg : float
+        Floating-point number ``beta**negep``.
+    iexp : int
+        Number of bits in the exponent (including its sign and bias).
+    minexp : int
+        Smallest (most negative) power of `ibeta` consistent with there
+        being no leading zeros in the mantissa.
+    xmin : float
+        Floating-point number ``beta**minexp`` (the smallest [in
+        magnitude] positive floating point number with full precision).
+    maxexp : int
+        Smallest (positive) power of `ibeta` that causes overflow.
+    xmax : float
+        ``(1-epsneg) * beta**maxexp`` (the largest [in magnitude]
+        usable floating value).
+    irnd : int
+        In ``range(6)``, information on what kind of rounding is done
+        in addition, and on how underflow is handled.
+    ngrd : int
+        Number of 'guard digits' used when truncating the product
+        of two mantissas to fit the representation.
+    epsilon : float
+        Same as `eps`.
+    tiny : float
+        An alias for `smallest_normal`, kept for backwards compatibility.
+    huge : float
+        Same as `xmax`.
+    precision : float
+        ``- int(-log10(eps))``
+    resolution : float
+        ``- 10**(-precision)``
+    smallest_normal : float
+        The smallest positive floating point number with 1 as leading bit in
+        the mantissa following IEEE-754. Same as `xmin`.
+    smallest_subnormal : float
+        The smallest positive floating point number with 0 as leading bit in
+        the mantissa following IEEE-754.
+
+    Parameters
+    ----------
+    float_conv : function, optional
+        Function that converts an integer or integer array to a float
+        or float array. Default is `float`.
+    int_conv : function, optional
+        Function that converts a float or float array to an integer or
+        integer array. Default is `int`.
+    float_to_float : function, optional
+        Function that converts a float array to float. Default is `float`.
+        Note that this does not seem to do anything useful in the current
+        implementation.
+    float_to_str : function, optional
+        Function that converts a single float to a string. Default is
+        ``lambda v:'%24.16e' %v``.
+    title : str, optional
+        Title that is printed in the string representation of `MachAr`.
+
+    See Also
+    --------
+    finfo : Machine limits for floating point types.
+    iinfo : Machine limits for integer types.
+
+    References
+    ----------
+    .. [1] Press, Teukolsky, Vetterling and Flannery,
+           "Numerical Recipes in C++," 2nd ed,
+           Cambridge University Press, 2002, p. 31.
+
+    """
+
+    def __init__(self, float_conv=float,int_conv=int,
+                 float_to_float=float,
+                 float_to_str=lambda v:'%24.16e' % v,
+                 title='Python floating point number'):
+        """
+
+        float_conv - convert integer to float (array)
+        int_conv   - convert float (array) to integer
+        float_to_float - convert float array to float
+        float_to_str - convert array float to str
+        title        - description of used floating point numbers
+
+        """
+        # We ignore all errors here because we are purposely triggering
+        # underflow to detect the properties of the runninng arch.
+        with errstate(under='ignore'):
+            self._do_init(float_conv, int_conv, float_to_float, float_to_str, title)
+
+    def _do_init(self, float_conv, int_conv, float_to_float, float_to_str, title):
+        max_iterN = 10000
+        msg = "Did not converge after %d tries with %s"
+        one = float_conv(1)
+        two = one + one
+        zero = one - one
+
+        # Do we really need to do this?  Aren't they 2 and 2.0?
+        # Determine ibeta and beta
+        a = one
+        for _ in range(max_iterN):
+            a = a + a
+            temp = a + one
+            temp1 = temp - a
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        b = one
+        for _ in range(max_iterN):
+            b = b + b
+            temp = a + b
+            itemp = int_conv(temp-a)
+            if any(itemp != 0):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        ibeta = itemp
+        beta = float_conv(ibeta)
+
+        # Determine it and irnd
+        it = -1
+        b = one
+        for _ in range(max_iterN):
+            it = it + 1
+            b = b * beta
+            temp = b + one
+            temp1 = temp - b
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+
+        betah = beta / two
+        a = one
+        for _ in range(max_iterN):
+            a = a + a
+            temp = a + one
+            temp1 = temp - a
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        temp = a + betah
+        irnd = 0
+        if any(temp-a != zero):
+            irnd = 1
+        tempa = a + beta
+        temp = tempa + betah
+        if irnd == 0 and any(temp-tempa != zero):
+            irnd = 2
+
+        # Determine negep and epsneg
+        negep = it + 3
+        betain = one / beta
+        a = one
+        for i in range(negep):
+            a = a * betain
+        b = a
+        for _ in range(max_iterN):
+            temp = one - a
+            if any(temp-one != zero):
+                break
+            a = a * beta
+            negep = negep - 1
+            # Prevent infinite loop on PPC with gcc 4.0:
+            if negep < 0:
+                raise RuntimeError("could not determine machine tolerance "
+                                   "for 'negep', locals() -> %s" % (locals()))
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        negep = -negep
+        epsneg = a
+
+        # Determine machep and eps
+        machep = - it - 3
+        a = b
+
+        for _ in range(max_iterN):
+            temp = one + a
+            if any(temp-one != zero):
+                break
+            a = a * beta
+            machep = machep + 1
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        eps = a
+
+        # Determine ngrd
+        ngrd = 0
+        temp = one + eps
+        if irnd == 0 and any(temp*one - one != zero):
+            ngrd = 1
+
+        # Determine iexp
+        i = 0
+        k = 1
+        z = betain
+        t = one + eps
+        nxres = 0
+        for _ in range(max_iterN):
+            y = z
+            z = y*y
+            a = z*one  # Check here for underflow
+            temp = z*t
+            if any(a+a == zero) or any(abs(z) >= y):
+                break
+            temp1 = temp * betain
+            if any(temp1*beta == z):
+                break
+            i = i + 1
+            k = k + k
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        if ibeta != 10:
+            iexp = i + 1
+            mx = k + k
+        else:
+            iexp = 2
+            iz = ibeta
+            while k >= iz:
+                iz = iz * ibeta
+                iexp = iexp + 1
+            mx = iz + iz - 1
+
+        # Determine minexp and xmin
+        for _ in range(max_iterN):
+            xmin = y
+            y = y * betain
+            a = y * one
+            temp = y * t
+            if any((a + a) != zero) and any(abs(y) < xmin):
+                k = k + 1
+                temp1 = temp * betain
+                if any(temp1*beta == y) and any(temp != y):
+                    nxres = 3
+                    xmin = y
+                    break
+            else:
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        minexp = -k
+
+        # Determine maxexp, xmax
+        if mx <= k + k - 3 and ibeta != 10:
+            mx = mx + mx
+            iexp = iexp + 1
+        maxexp = mx + minexp
+        irnd = irnd + nxres
+        if irnd >= 2:
+            maxexp = maxexp - 2
+        i = maxexp + minexp
+        if ibeta == 2 and not i:
+            maxexp = maxexp - 1
+        if i > 20:
+            maxexp = maxexp - 1
+        if any(a != y):
+            maxexp = maxexp - 2
+        xmax = one - epsneg
+        if any(xmax*one != xmax):
+            xmax = one - beta*epsneg
+        xmax = xmax / (xmin*beta*beta*beta)
+        i = maxexp + minexp + 3
+        for j in range(i):
+            if ibeta == 2:
+                xmax = xmax + xmax
+            else:
+                xmax = xmax * beta
+
+        smallest_subnormal = abs(xmin / beta ** (it))
+
+        self.ibeta = ibeta
+        self.it = it
+        self.negep = negep
+        self.epsneg = float_to_float(epsneg)
+        self._str_epsneg = float_to_str(epsneg)
+        self.machep = machep
+        self.eps = float_to_float(eps)
+        self._str_eps = float_to_str(eps)
+        self.ngrd = ngrd
+        self.iexp = iexp
+        self.minexp = minexp
+        self.xmin = float_to_float(xmin)
+        self._str_xmin = float_to_str(xmin)
+        self.maxexp = maxexp
+        self.xmax = float_to_float(xmax)
+        self._str_xmax = float_to_str(xmax)
+        self.irnd = irnd
+
+        self.title = title
+        # Commonly used parameters
+        self.epsilon = self.eps
+        self.tiny = self.xmin
+        self.huge = self.xmax
+        self.smallest_normal = self.xmin
+        self._str_smallest_normal = float_to_str(self.xmin)
+        self.smallest_subnormal = float_to_float(smallest_subnormal)
+        self._str_smallest_subnormal = float_to_str(smallest_subnormal)
+
+        import math
+        self.precision = int(-math.log10(float_to_float(self.eps)))
+        ten = two + two + two + two + two
+        resolution = ten ** (-self.precision)
+        self.resolution = float_to_float(resolution)
+        self._str_resolution = float_to_str(resolution)
+
+    def __str__(self):
+        fmt = (
+           'Machine parameters for %(title)s\n'
+           '---------------------------------------------------------------------\n'
+           'ibeta=%(ibeta)s it=%(it)s iexp=%(iexp)s ngrd=%(ngrd)s irnd=%(irnd)s\n'
+           'machep=%(machep)s     eps=%(_str_eps)s (beta**machep == epsilon)\n'
+           'negep =%(negep)s  epsneg=%(_str_epsneg)s (beta**epsneg)\n'
+           'minexp=%(minexp)s   xmin=%(_str_xmin)s (beta**minexp == tiny)\n'
+           'maxexp=%(maxexp)s    xmax=%(_str_xmax)s ((1-epsneg)*beta**maxexp == huge)\n'
+           'smallest_normal=%(smallest_normal)s    '
+           'smallest_subnormal=%(smallest_subnormal)s\n'
+           '---------------------------------------------------------------------\n'
+           )
+        return fmt % self.__dict__
+
+
+if __name__ == '__main__':
+    print(MachAr())

.venv/lib/python3.11/site-packages/numpy/core/_methods.py

@@ -0,0 +1,234 @@
+"""
+Array methods which are called by both the C-code for the method
+and the Python code for the NumPy-namespace function
+
+"""
+import warnings
+from contextlib import nullcontext
+
+from numpy.core import multiarray as mu
+from numpy.core import umath as um
+from numpy.core.multiarray import asanyarray
+from numpy.core import numerictypes as nt
+from numpy.core import _exceptions
+from numpy.core._ufunc_config import _no_nep50_warning
+from numpy._globals import _NoValue
+from numpy.compat import pickle, os_fspath
+
+# save those O(100) nanoseconds!
+umr_maximum = um.maximum.reduce
+umr_minimum = um.minimum.reduce
+umr_sum = um.add.reduce
+umr_prod = um.multiply.reduce
+umr_any = um.logical_or.reduce
+umr_all = um.logical_and.reduce
+
+# Complex types to -> (2,)float view for fast-path computation in _var()
+_complex_to_float = {
+    nt.dtype(nt.csingle) : nt.dtype(nt.single),
+    nt.dtype(nt.cdouble) : nt.dtype(nt.double),
+}
+# Special case for windows: ensure double takes precedence
+if nt.dtype(nt.longdouble) != nt.dtype(nt.double):
+    _complex_to_float.update({
+        nt.dtype(nt.clongdouble) : nt.dtype(nt.longdouble),
+    })
+
+# avoid keyword arguments to speed up parsing, saves about 15%-20% for very
+# small reductions
+def _amax(a, axis=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_maximum(a, axis, None, out, keepdims, initial, where)
+
+def _amin(a, axis=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_minimum(a, axis, None, out, keepdims, initial, where)
+
+def _sum(a, axis=None, dtype=None, out=None, keepdims=False,
+         initial=_NoValue, where=True):
+    return umr_sum(a, axis, dtype, out, keepdims, initial, where)
+
+def _prod(a, axis=None, dtype=None, out=None, keepdims=False,
+          initial=_NoValue, where=True):
+    return umr_prod(a, axis, dtype, out, keepdims, initial, where)
+
+def _any(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    # Parsing keyword arguments is currently fairly slow, so avoid it for now
+    if where is True:
+        return umr_any(a, axis, dtype, out, keepdims)
+    return umr_any(a, axis, dtype, out, keepdims, where=where)
+
+def _all(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    # Parsing keyword arguments is currently fairly slow, so avoid it for now
+    if where is True:
+        return umr_all(a, axis, dtype, out, keepdims)
+    return umr_all(a, axis, dtype, out, keepdims, where=where)
+
+def _count_reduce_items(arr, axis, keepdims=False, where=True):
+    # fast-path for the default case
+    if where is True:
+        # no boolean mask given, calculate items according to axis
+        if axis is None:
+            axis = tuple(range(arr.ndim))
+        elif not isinstance(axis, tuple):
+            axis = (axis,)
+        items = 1
+        for ax in axis:
+            items *= arr.shape[mu.normalize_axis_index(ax, arr.ndim)]
+        items = nt.intp(items)
+    else:
+        # TODO: Optimize case when `where` is broadcast along a non-reduction
+        # axis and full sum is more excessive than needed.
+
+        # guarded to protect circular imports
+        from numpy.lib.stride_tricks import broadcast_to
+        # count True values in (potentially broadcasted) boolean mask
+        items = umr_sum(broadcast_to(where, arr.shape), axis, nt.intp, None,
+                        keepdims)
+    return items
+
+def _clip(a, min=None, max=None, out=None, **kwargs):
+    if min is None and max is None:
+        raise ValueError("One of max or min must be given")
+
+    if min is None:
+        return um.minimum(a, max, out=out, **kwargs)
+    elif max is None:
+        return um.maximum(a, min, out=out, **kwargs)
+    else:
+        return um.clip(a, min, max, out=out, **kwargs)
+
+def _mean(a, axis=None, dtype=None, out=None, keepdims=False, *, where=True):
+    arr = asanyarray(a)
+
+    is_float16_result = False
+
+    rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where)
+    if rcount == 0 if where is True else umr_any(rcount == 0, axis=None):
+        warnings.warn("Mean of empty slice.", RuntimeWarning, stacklevel=2)
+
+    # Cast bool, unsigned int, and int to float64 by default
+    if dtype is None:
+        if issubclass(arr.dtype.type, (nt.integer, nt.bool_)):
+            dtype = mu.dtype('f8')
+        elif issubclass(arr.dtype.type, nt.float16):
+            dtype = mu.dtype('f4')
+            is_float16_result = True
+
+    ret = umr_sum(arr, axis, dtype, out, keepdims, where=where)
+    if isinstance(ret, mu.ndarray):
+        with _no_nep50_warning():
+            ret = um.true_divide(
+                    ret, rcount, out=ret, casting='unsafe', subok=False)
+        if is_float16_result and out is None:
+            ret = arr.dtype.type(ret)
+    elif hasattr(ret, 'dtype'):
+        if is_float16_result:
+            ret = arr.dtype.type(ret / rcount)
+        else:
+            ret = ret.dtype.type(ret / rcount)
+    else:
+        ret = ret / rcount
+
+    return ret
+
+def _var(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *,
+         where=True):
+    arr = asanyarray(a)
+
+    rcount = _count_reduce_items(arr, axis, keepdims=keepdims, where=where)
+    # Make this warning show up on top.
+    if ddof >= rcount if where is True else umr_any(ddof >= rcount, axis=None):
+        warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning,
+                      stacklevel=2)
+
+    # Cast bool, unsigned int, and int to float64 by default
+    if dtype is None and issubclass(arr.dtype.type, (nt.integer, nt.bool_)):
+        dtype = mu.dtype('f8')
+
+    # Compute the mean.
+    # Note that if dtype is not of inexact type then arraymean will
+    # not be either.
+    arrmean = umr_sum(arr, axis, dtype, keepdims=True, where=where)
+    # The shape of rcount has to match arrmean to not change the shape of out
+    # in broadcasting. Otherwise, it cannot be stored back to arrmean.
+    if rcount.ndim == 0:
+        # fast-path for default case when where is True
+        div = rcount
+    else:
+        # matching rcount to arrmean when where is specified as array
+        div = rcount.reshape(arrmean.shape)
+    if isinstance(arrmean, mu.ndarray):
+        with _no_nep50_warning():
+            arrmean = um.true_divide(arrmean, div, out=arrmean,
+                                     casting='unsafe', subok=False)
+    elif hasattr(arrmean, "dtype"):
+        arrmean = arrmean.dtype.type(arrmean / rcount)
+    else:
+        arrmean = arrmean / rcount
+
+    # Compute sum of squared deviations from mean
+    # Note that x may not be inexact and that we need it to be an array,
+    # not a scalar.
+    x = asanyarray(arr - arrmean)
+
+    if issubclass(arr.dtype.type, (nt.floating, nt.integer)):
+        x = um.multiply(x, x, out=x)
+    # Fast-paths for built-in complex types
+    elif x.dtype in _complex_to_float:
+        xv = x.view(dtype=(_complex_to_float[x.dtype], (2,)))
+        um.multiply(xv, xv, out=xv)
+        x = um.add(xv[..., 0], xv[..., 1], out=x.real).real
+    # Most general case; includes handling object arrays containing imaginary
+    # numbers and complex types with non-native byteorder
+    else:
+        x = um.multiply(x, um.conjugate(x), out=x).real
+
+    ret = umr_sum(x, axis, dtype, out, keepdims=keepdims, where=where)
+
+    # Compute degrees of freedom and make sure it is not negative.
+    rcount = um.maximum(rcount - ddof, 0)
+
+    # divide by degrees of freedom
+    if isinstance(ret, mu.ndarray):
+        with _no_nep50_warning():
+            ret = um.true_divide(
+                    ret, rcount, out=ret, casting='unsafe', subok=False)
+    elif hasattr(ret, 'dtype'):
+        ret = ret.dtype.type(ret / rcount)
+    else:
+        ret = ret / rcount
+
+    return ret
+
+def _std(a, axis=None, dtype=None, out=None, ddof=0, keepdims=False, *,
+         where=True):
+    ret = _var(a, axis=axis, dtype=dtype, out=out, ddof=ddof,
+               keepdims=keepdims, where=where)
+
+    if isinstance(ret, mu.ndarray):
+        ret = um.sqrt(ret, out=ret)
+    elif hasattr(ret, 'dtype'):
+        ret = ret.dtype.type(um.sqrt(ret))
+    else:
+        ret = um.sqrt(ret)
+
+    return ret
+
+def _ptp(a, axis=None, out=None, keepdims=False):
+    return um.subtract(
+        umr_maximum(a, axis, None, out, keepdims),
+        umr_minimum(a, axis, None, None, keepdims),
+        out
+    )
+
+def _dump(self, file, protocol=2):
+    if hasattr(file, 'write'):
+        ctx = nullcontext(file)
+    else:
+        ctx = open(os_fspath(file), "wb")
+    with ctx as f:
+        pickle.dump(self, f, protocol=protocol)
+
+def _dumps(self, protocol=2):
+    return pickle.dumps(self, protocol=protocol)

.venv/lib/python3.11/site-packages/numpy/core/_string_helpers.py

@@ -0,0 +1,100 @@
+"""
+String-handling utilities to avoid locale-dependence.
+
+Used primarily to generate type name aliases.
+"""
+# "import string" is costly to import!
+# Construct the translation tables directly
+#   "A" = chr(65), "a" = chr(97)
+_all_chars = tuple(map(chr, range(256)))
+_ascii_upper = _all_chars[65:65+26]
+_ascii_lower = _all_chars[97:97+26]
+LOWER_TABLE = "".join(_all_chars[:65] + _ascii_lower + _all_chars[65+26:])
+UPPER_TABLE = "".join(_all_chars[:97] + _ascii_upper + _all_chars[97+26:])
+
+
+def english_lower(s):
+    """ Apply English case rules to convert ASCII strings to all lower case.
+
+    This is an internal utility function to replace calls to str.lower() such
+    that we can avoid changing behavior with changing locales. In particular,
+    Turkish has distinct dotted and dotless variants of the Latin letter "I" in
+    both lowercase and uppercase. Thus, "I".lower() != "i" in a "tr" locale.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    lowered : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_lower
+    >>> english_lower('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_')
+    'abcdefghijklmnopqrstuvwxyzabcdefghijklmnopqrstuvwxyz0123456789_'
+    >>> english_lower('')
+    ''
+    """
+    lowered = s.translate(LOWER_TABLE)
+    return lowered
+
+
+def english_upper(s):
+    """ Apply English case rules to convert ASCII strings to all upper case.
+
+    This is an internal utility function to replace calls to str.upper() such
+    that we can avoid changing behavior with changing locales. In particular,
+    Turkish has distinct dotted and dotless variants of the Latin letter "I" in
+    both lowercase and uppercase. Thus, "i".upper() != "I" in a "tr" locale.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    uppered : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_upper
+    >>> english_upper('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_')
+    'ABCDEFGHIJKLMNOPQRSTUVWXYZABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789_'
+    >>> english_upper('')
+    ''
+    """
+    uppered = s.translate(UPPER_TABLE)
+    return uppered
+
+
+def english_capitalize(s):
+    """ Apply English case rules to convert the first character of an ASCII
+    string to upper case.
+
+    This is an internal utility function to replace calls to str.capitalize()
+    such that we can avoid changing behavior with changing locales.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    capitalized : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_capitalize
+    >>> english_capitalize('int8')
+    'Int8'
+    >>> english_capitalize('Int8')
+    'Int8'
+    >>> english_capitalize('')
+    ''
+    """
+    if s:
+        return english_upper(s[0]) + s[1:]
+    else:
+        return s

.venv/lib/python3.11/site-packages/numpy/core/_type_aliases.py

@@ -0,0 +1,245 @@
+"""
+Due to compatibility, numpy has a very large number of different naming
+conventions for the scalar types (those subclassing from `numpy.generic`).
+This file produces a convoluted set of dictionaries mapping names to types,
+and sometimes other mappings too.
+
+.. data:: allTypes
+    A dictionary of names to types that will be exposed as attributes through
+    ``np.core.numerictypes.*``
+
+.. data:: sctypeDict
+    Similar to `allTypes`, but maps a broader set of aliases to their types.
+
+.. data:: sctypes
+    A dictionary keyed by a "type group" string, providing a list of types
+    under that group.
+
+"""
+
+from numpy.compat import unicode
+from numpy.core._string_helpers import english_lower
+from numpy.core.multiarray import typeinfo, dtype
+from numpy.core._dtype import _kind_name
+
+
+sctypeDict = {}      # Contains all leaf-node scalar types with aliases
+allTypes = {}            # Collect the types we will add to the module
+
+
+# separate the actual type info from the abstract base classes
+_abstract_types = {}
+_concrete_typeinfo = {}
+for k, v in typeinfo.items():
+    # make all the keys lowercase too
+    k = english_lower(k)
+    if isinstance(v, type):
+        _abstract_types[k] = v
+    else:
+        _concrete_typeinfo[k] = v
+
+_concrete_types = {v.type for k, v in _concrete_typeinfo.items()}
+
+
+def _bits_of(obj):
+    try:
+        info = next(v for v in _concrete_typeinfo.values() if v.type is obj)
+    except StopIteration:
+        if obj in _abstract_types.values():
+            msg = "Cannot count the bits of an abstract type"
+            raise ValueError(msg) from None
+
+        # some third-party type - make a best-guess
+        return dtype(obj).itemsize * 8
+    else:
+        return info.bits
+
+
+def bitname(obj):
+    """Return a bit-width name for a given type object"""
+    bits = _bits_of(obj)
+    dt = dtype(obj)
+    char = dt.kind
+    base = _kind_name(dt)
+
+    if base == 'object':
+        bits = 0
+
+    if bits != 0:
+        char = "%s%d" % (char, bits // 8)
+
+    return base, bits, char
+
+
+def _add_types():
+    for name, info in _concrete_typeinfo.items():
+        # define C-name and insert typenum and typechar references also
+        allTypes[name] = info.type
+        sctypeDict[name] = info.type
+        sctypeDict[info.char] = info.type
+        sctypeDict[info.num] = info.type
+
+    for name, cls in _abstract_types.items():
+        allTypes[name] = cls
+_add_types()
+
+# This is the priority order used to assign the bit-sized NPY_INTxx names, which
+# must match the order in npy_common.h in order for NPY_INTxx and np.intxx to be
+# consistent.
+# If two C types have the same size, then the earliest one in this list is used
+# as the sized name.
+_int_ctypes = ['long', 'longlong', 'int', 'short', 'byte']
+_uint_ctypes = list('u' + t for t in _int_ctypes)
+
+def _add_aliases():
+    for name, info in _concrete_typeinfo.items():
+        # these are handled by _add_integer_aliases
+        if name in _int_ctypes or name in _uint_ctypes:
+            continue
+
+        # insert bit-width version for this class (if relevant)
+        base, bit, char = bitname(info.type)
+
+        myname = "%s%d" % (base, bit)
+
+        # ensure that (c)longdouble does not overwrite the aliases assigned to
+        # (c)double
+        if name in ('longdouble', 'clongdouble') and myname in allTypes:
+            continue
+
+        # Add to the main namespace if desired:
+        if bit != 0 and base != "bool":
+            allTypes[myname] = info.type
+
+        # add forward, reverse, and string mapping to numarray
+        sctypeDict[char] = info.type
+
+        # add mapping for both the bit name
+        sctypeDict[myname] = info.type
+
+
+_add_aliases()
+
+def _add_integer_aliases():
+    seen_bits = set()
+    for i_ctype, u_ctype in zip(_int_ctypes, _uint_ctypes):
+        i_info = _concrete_typeinfo[i_ctype]
+        u_info = _concrete_typeinfo[u_ctype]
+        bits = i_info.bits  # same for both
+
+        for info, charname, intname in [
+                (i_info,'i%d' % (bits//8,), 'int%d' % bits),
+                (u_info,'u%d' % (bits//8,), 'uint%d' % bits)]:
+            if bits not in seen_bits:
+                # sometimes two different types have the same number of bits
+                # if so, the one iterated over first takes precedence
+                allTypes[intname] = info.type
+                sctypeDict[intname] = info.type
+                sctypeDict[charname] = info.type
+
+        seen_bits.add(bits)
+
+_add_integer_aliases()
+
+# We use these later
+void = allTypes['void']
+
+#
+# Rework the Python names (so that float and complex and int are consistent
+#                            with Python usage)
+#
+def _set_up_aliases():
+    type_pairs = [('complex_', 'cdouble'),
+                  ('single', 'float'),
+                  ('csingle', 'cfloat'),
+                  ('singlecomplex', 'cfloat'),
+                  ('float_', 'double'),
+                  ('intc', 'int'),
+                  ('uintc', 'uint'),
+                  ('int_', 'long'),
+                  ('uint', 'ulong'),
+                  ('cfloat', 'cdouble'),
+                  ('longfloat', 'longdouble'),
+                  ('clongfloat', 'clongdouble'),
+                  ('longcomplex', 'clongdouble'),
+                  ('bool_', 'bool'),
+                  ('bytes_', 'string'),
+                  ('string_', 'string'),
+                  ('str_', 'unicode'),
+                  ('unicode_', 'unicode'),
+                  ('object_', 'object')]
+    for alias, t in type_pairs:
+        allTypes[alias] = allTypes[t]
+        sctypeDict[alias] = sctypeDict[t]
+    # Remove aliases overriding python types and modules
+    to_remove = ['object', 'int', 'float',
+                 'complex', 'bool', 'string', 'datetime', 'timedelta',
+                 'bytes', 'str']
+
+    for t in to_remove:
+        try:
+            del allTypes[t]
+            del sctypeDict[t]
+        except KeyError:
+            pass
+
+    # Additional aliases in sctypeDict that should not be exposed as attributes
+    attrs_to_remove = ['ulong']
+
+    for t in attrs_to_remove:
+        try:
+            del allTypes[t]
+        except KeyError:
+            pass
+_set_up_aliases()
+
+
+sctypes = {'int': [],
+           'uint':[],
+           'float':[],
+           'complex':[],
+           'others':[bool, object, bytes, unicode, void]}
+
+def _add_array_type(typename, bits):
+    try:
+        t = allTypes['%s%d' % (typename, bits)]
+    except KeyError:
+        pass
+    else:
+        sctypes[typename].append(t)
+
+def _set_array_types():
+    ibytes = [1, 2, 4, 8, 16, 32, 64]
+    fbytes = [2, 4, 8, 10, 12, 16, 32, 64]
+    for bytes in ibytes:
+        bits = 8*bytes
+        _add_array_type('int', bits)
+        _add_array_type('uint', bits)
+    for bytes in fbytes:
+        bits = 8*bytes
+        _add_array_type('float', bits)
+        _add_array_type('complex', 2*bits)
+    _gi = dtype('p')
+    if _gi.type not in sctypes['int']:
+        indx = 0
+        sz = _gi.itemsize
+        _lst = sctypes['int']
+        while (indx < len(_lst) and sz >= _lst[indx](0).itemsize):
+            indx += 1
+        sctypes['int'].insert(indx, _gi.type)
+        sctypes['uint'].insert(indx, dtype('P').type)
+_set_array_types()
+
+
+# Add additional strings to the sctypeDict
+_toadd = ['int', 'float', 'complex', 'bool', 'object',
+          'str', 'bytes', ('a', 'bytes_'),
+          ('int0', 'intp'), ('uint0', 'uintp')]
+
+for name in _toadd:
+    if isinstance(name, tuple):
+        sctypeDict[name[0]] = allTypes[name[1]]
+    else:
+        sctypeDict[name] = allTypes['%s_' % name]
+
+del _toadd, name

.venv/lib/python3.11/site-packages/numpy/core/_ufunc_config.py

@@ -0,0 +1,466 @@
+"""
+Functions for changing global ufunc configuration
+
+This provides helpers which wrap `umath.geterrobj` and `umath.seterrobj`
+"""
+import collections.abc
+import contextlib
+import contextvars
+
+from .._utils import set_module
+from .umath import (
+    UFUNC_BUFSIZE_DEFAULT,
+    ERR_IGNORE, ERR_WARN, ERR_RAISE, ERR_CALL, ERR_PRINT, ERR_LOG, ERR_DEFAULT,
+    SHIFT_DIVIDEBYZERO, SHIFT_OVERFLOW, SHIFT_UNDERFLOW, SHIFT_INVALID,
+)
+from . import umath
+
+__all__ = [
+    "seterr", "geterr", "setbufsize", "getbufsize", "seterrcall", "geterrcall",
+    "errstate", '_no_nep50_warning'
+]
+
+_errdict = {"ignore": ERR_IGNORE,
+            "warn": ERR_WARN,
+            "raise": ERR_RAISE,
+            "call": ERR_CALL,
+            "print": ERR_PRINT,
+            "log": ERR_LOG}
+
+_errdict_rev = {value: key for key, value in _errdict.items()}
+
+
+@set_module('numpy')
+def seterr(all=None, divide=None, over=None, under=None, invalid=None):
+    """
+    Set how floating-point errors are handled.
+
+    Note that operations on integer scalar types (such as `int16`) are
+    handled like floating point, and are affected by these settings.
+
+    Parameters
+    ----------
+    all : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Set treatment for all types of floating-point errors at once:
+
+        - ignore: Take no action when the exception occurs.
+        - warn: Print a `RuntimeWarning` (via the Python `warnings` module).
+        - raise: Raise a `FloatingPointError`.
+        - call: Call a function specified using the `seterrcall` function.
+        - print: Print a warning directly to ``stdout``.
+        - log: Record error in a Log object specified by `seterrcall`.
+
+        The default is not to change the current behavior.
+    divide : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for division by zero.
+    over : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point overflow.
+    under : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for floating-point underflow.
+    invalid : {'ignore', 'warn', 'raise', 'call', 'print', 'log'}, optional
+        Treatment for invalid floating-point operation.
+
+    Returns
+    -------
+    old_settings : dict
+        Dictionary containing the old settings.
+
+    See also
+    --------
+    seterrcall : Set a callback function for the 'call' mode.
+    geterr, geterrcall, errstate
+
+    Notes
+    -----
+    The floating-point exceptions are defined in the IEEE 754 standard [1]_:
+
+    - Division by zero: infinite result obtained from finite numbers.
+    - Overflow: result too large to be expressed.
+    - Underflow: result so close to zero that some precision
+      was lost.
+    - Invalid operation: result is not an expressible number, typically
+      indicates that a NaN was produced.
+
+    .. [1] https://en.wikipedia.org/wiki/IEEE_754
+
+    Examples
+    --------
+    >>> old_settings = np.seterr(all='ignore')  #seterr to known value
+    >>> np.seterr(over='raise')
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+    >>> np.seterr(**old_settings)  # reset to default
+    {'divide': 'ignore', 'over': 'raise', 'under': 'ignore', 'invalid': 'ignore'}
+
+    >>> np.int16(32000) * np.int16(3)
+    30464
+    >>> old_settings = np.seterr(all='warn', over='raise')
+    >>> np.int16(32000) * np.int16(3)
+    Traceback (most recent call last):
+      File "<stdin>", line 1, in <module>
+    FloatingPointError: overflow encountered in scalar multiply
+
+    >>> old_settings = np.seterr(all='print')
+    >>> np.geterr()
+    {'divide': 'print', 'over': 'print', 'under': 'print', 'invalid': 'print'}
+    >>> np.int16(32000) * np.int16(3)
+    30464
+
+    """
+
+    pyvals = umath.geterrobj()
+    old = geterr()
+
+    if divide is None:
+        divide = all or old['divide']
+    if over is None:
+        over = all or old['over']
+    if under is None:
+        under = all or old['under']
+    if invalid is None:
+        invalid = all or old['invalid']
+
+    maskvalue = ((_errdict[divide] << SHIFT_DIVIDEBYZERO) +
+                 (_errdict[over] << SHIFT_OVERFLOW) +
+                 (_errdict[under] << SHIFT_UNDERFLOW) +
+                 (_errdict[invalid] << SHIFT_INVALID))
+
+    pyvals[1] = maskvalue
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def geterr():
+    """
+    Get the current way of handling floating-point errors.
+
+    Returns
+    -------
+    res : dict
+        A dictionary with keys "divide", "over", "under", and "invalid",
+        whose values are from the strings "ignore", "print", "log", "warn",
+        "raise", and "call". The keys represent possible floating-point
+        exceptions, and the values define how these exceptions are handled.
+
+    See Also
+    --------
+    geterrcall, seterr, seterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'warn', 'under': 'ignore', 'invalid': 'warn'}
+    >>> np.arange(3.) / np.arange(3.)
+    array([nan,  1.,  1.])
+
+    >>> oldsettings = np.seterr(all='warn', over='raise')
+    >>> np.geterr()
+    {'divide': 'warn', 'over': 'raise', 'under': 'warn', 'invalid': 'warn'}
+    >>> np.arange(3.) / np.arange(3.)
+    array([nan,  1.,  1.])
+
+    """
+    maskvalue = umath.geterrobj()[1]
+    mask = 7
+    res = {}
+    val = (maskvalue >> SHIFT_DIVIDEBYZERO) & mask
+    res['divide'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_OVERFLOW) & mask
+    res['over'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_UNDERFLOW) & mask
+    res['under'] = _errdict_rev[val]
+    val = (maskvalue >> SHIFT_INVALID) & mask
+    res['invalid'] = _errdict_rev[val]
+    return res
+
+
+@set_module('numpy')
+def setbufsize(size):
+    """
+    Set the size of the buffer used in ufuncs.
+
+    Parameters
+    ----------
+    size : int
+        Size of buffer.
+
+    """
+    if size > 10e6:
+        raise ValueError("Buffer size, %s, is too big." % size)
+    if size < 5:
+        raise ValueError("Buffer size, %s, is too small." % size)
+    if size % 16 != 0:
+        raise ValueError("Buffer size, %s, is not a multiple of 16." % size)
+
+    pyvals = umath.geterrobj()
+    old = getbufsize()
+    pyvals[0] = size
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def getbufsize():
+    """
+    Return the size of the buffer used in ufuncs.
+
+    Returns
+    -------
+    getbufsize : int
+        Size of ufunc buffer in bytes.
+
+    """
+    return umath.geterrobj()[0]
+
+
+@set_module('numpy')
+def seterrcall(func):
+    """
+    Set the floating-point error callback function or log object.
+
+    There are two ways to capture floating-point error messages.  The first
+    is to set the error-handler to 'call', using `seterr`.  Then, set
+    the function to call using this function.
+
+    The second is to set the error-handler to 'log', using `seterr`.
+    Floating-point errors then trigger a call to the 'write' method of
+    the provided object.
+
+    Parameters
+    ----------
+    func : callable f(err, flag) or object with write method
+        Function to call upon floating-point errors ('call'-mode) or
+        object whose 'write' method is used to log such message ('log'-mode).
+
+        The call function takes two arguments. The first is a string describing
+        the type of error (such as "divide by zero", "overflow", "underflow",
+        or "invalid value"), and the second is the status flag.  The flag is a
+        byte, whose four least-significant bits indicate the type of error, one
+        of "divide", "over", "under", "invalid"::
+
+          [0 0 0 0 divide over under invalid]
+
+        In other words, ``flags = divide + 2*over + 4*under + 8*invalid``.
+
+        If an object is provided, its write method should take one argument,
+        a string.
+
+    Returns
+    -------
+    h : callable, log instance or None
+        The old error handler.
+
+    See Also
+    --------
+    seterr, geterr, geterrcall
+
+    Examples
+    --------
+    Callback upon error:
+
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    ...
+
+    >>> saved_handler = np.seterrcall(err_handler)
+    >>> save_err = np.seterr(all='call')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(saved_handler)
+    <function err_handler at 0x...>
+    >>> np.seterr(**save_err)
+    {'divide': 'call', 'over': 'call', 'under': 'call', 'invalid': 'call'}
+
+    Log error message:
+
+    >>> class Log:
+    ...     def write(self, msg):
+    ...         print("LOG: %s" % msg)
+    ...
+
+    >>> log = Log()
+    >>> saved_handler = np.seterrcall(log)
+    >>> save_err = np.seterr(all='log')
+
+    >>> np.array([1, 2, 3]) / 0.0
+    LOG: Warning: divide by zero encountered in divide
+    array([inf, inf, inf])
+
+    >>> np.seterrcall(saved_handler)
+    <numpy.core.numeric.Log object at 0x...>
+    >>> np.seterr(**save_err)
+    {'divide': 'log', 'over': 'log', 'under': 'log', 'invalid': 'log'}
+
+    """
+    if func is not None and not isinstance(func, collections.abc.Callable):
+        if (not hasattr(func, 'write') or
+                not isinstance(func.write, collections.abc.Callable)):
+            raise ValueError("Only callable can be used as callback")
+    pyvals = umath.geterrobj()
+    old = geterrcall()
+    pyvals[2] = func
+    umath.seterrobj(pyvals)
+    return old
+
+
+@set_module('numpy')
+def geterrcall():
+    """
+    Return the current callback function used on floating-point errors.
+
+    When the error handling for a floating-point error (one of "divide",
+    "over", "under", or "invalid") is set to 'call' or 'log', the function
+    that is called or the log instance that is written to is returned by
+    `geterrcall`. This function or log instance has been set with
+    `seterrcall`.
+
+    Returns
+    -------
+    errobj : callable, log instance or None
+        The current error handler. If no handler was set through `seterrcall`,
+        ``None`` is returned.
+
+    See Also
+    --------
+    seterrcall, seterr, geterr
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> np.geterrcall()  # we did not yet set a handler, returns None
+
+    >>> oldsettings = np.seterr(all='call')
+    >>> def err_handler(type, flag):
+    ...     print("Floating point error (%s), with flag %s" % (type, flag))
+    >>> oldhandler = np.seterrcall(err_handler)
+    >>> np.array([1, 2, 3]) / 0.0
+    Floating point error (divide by zero), with flag 1
+    array([inf, inf, inf])
+
+    >>> cur_handler = np.geterrcall()
+    >>> cur_handler is err_handler
+    True
+
+    """
+    return umath.geterrobj()[2]
+
+
+class _unspecified:
+    pass
+
+
+_Unspecified = _unspecified()
+
+
+@set_module('numpy')
+class errstate(contextlib.ContextDecorator):
+    """
+    errstate(**kwargs)
+
+    Context manager for floating-point error handling.
+
+    Using an instance of `errstate` as a context manager allows statements in
+    that context to execute with a known error handling behavior. Upon entering
+    the context the error handling is set with `seterr` and `seterrcall`, and
+    upon exiting it is reset to what it was before.
+
+    ..  versionchanged:: 1.17.0
+        `errstate` is also usable as a function decorator, saving
+        a level of indentation if an entire function is wrapped.
+        See :py:class:`contextlib.ContextDecorator` for more information.
+
+    Parameters
+    ----------
+    kwargs : {divide, over, under, invalid}
+        Keyword arguments. The valid keywords are the possible floating-point
+        exceptions. Each keyword should have a string value that defines the
+        treatment for the particular error. Possible values are
+        {'ignore', 'warn', 'raise', 'call', 'print', 'log'}.
+
+    See Also
+    --------
+    seterr, geterr, seterrcall, geterrcall
+
+    Notes
+    -----
+    For complete documentation of the types of floating-point exceptions and
+    treatment options, see `seterr`.
+
+    Examples
+    --------
+    >>> olderr = np.seterr(all='ignore')  # Set error handling to known state.
+
+    >>> np.arange(3) / 0.
+    array([nan, inf, inf])
+    >>> with np.errstate(divide='warn'):
+    ...     np.arange(3) / 0.
+    array([nan, inf, inf])
+
+    >>> np.sqrt(-1)
+    nan
+    >>> with np.errstate(invalid='raise'):
+    ...     np.sqrt(-1)
+    Traceback (most recent call last):
+      File "<stdin>", line 2, in <module>
+    FloatingPointError: invalid value encountered in sqrt
+
+    Outside the context the error handling behavior has not changed:
+
+    >>> np.geterr()
+    {'divide': 'ignore', 'over': 'ignore', 'under': 'ignore', 'invalid': 'ignore'}
+
+    """
+
+    def __init__(self, *, call=_Unspecified, **kwargs):
+        self.call = call
+        self.kwargs = kwargs
+
+    def __enter__(self):
+        self.oldstate = seterr(**self.kwargs)
+        if self.call is not _Unspecified:
+            self.oldcall = seterrcall(self.call)
+
+    def __exit__(self, *exc_info):
+        seterr(**self.oldstate)
+        if self.call is not _Unspecified:
+            seterrcall(self.oldcall)
+
+
+def _setdef():
+    defval = [UFUNC_BUFSIZE_DEFAULT, ERR_DEFAULT, None]
+    umath.seterrobj(defval)
+
+
+# set the default values
+_setdef()
+
+
+NO_NEP50_WARNING = contextvars.ContextVar("_no_nep50_warning", default=False)
+
+@set_module('numpy')
+@contextlib.contextmanager
+def _no_nep50_warning():
+    """
+    Context manager to disable NEP 50 warnings.  This context manager is
+    only relevant if the NEP 50 warnings are enabled globally (which is not
+    thread/context safe).
+
+    This warning context manager itself is fully safe, however.
+    """
+    token = NO_NEP50_WARNING.set(True)
+    try:
+        yield
+    finally:
+        NO_NEP50_WARNING.reset(token)

.venv/lib/python3.11/site-packages/numpy/core/_ufunc_config.pyi

@@ -0,0 +1,37 @@
+from collections.abc import Callable
+from typing import Any, Literal, TypedDict
+
+from numpy import _SupportsWrite
+
+_ErrKind = Literal["ignore", "warn", "raise", "call", "print", "log"]
+_ErrFunc = Callable[[str, int], Any]
+
+class _ErrDict(TypedDict):
+    divide: _ErrKind
+    over: _ErrKind
+    under: _ErrKind
+    invalid: _ErrKind
+
+class _ErrDictOptional(TypedDict, total=False):
+    all: None | _ErrKind
+    divide: None | _ErrKind
+    over: None | _ErrKind
+    under: None | _ErrKind
+    invalid: None | _ErrKind
+
+def seterr(
+    all: None | _ErrKind = ...,
+    divide: None | _ErrKind = ...,
+    over: None | _ErrKind = ...,
+    under: None | _ErrKind = ...,
+    invalid: None | _ErrKind = ...,
+) -> _ErrDict: ...
+def geterr() -> _ErrDict: ...
+def setbufsize(size: int) -> int: ...
+def getbufsize() -> int: ...
+def seterrcall(
+    func: None | _ErrFunc | _SupportsWrite[str]
+) -> None | _ErrFunc | _SupportsWrite[str]: ...
+def geterrcall() -> None | _ErrFunc | _SupportsWrite[str]: ...
+
+# See `numpy/__init__.pyi` for the `errstate` class and `no_nep5_warnings`

.venv/lib/python3.11/site-packages/numpy/core/arrayprint.py

@@ -0,0 +1,1725 @@
+"""Array printing function
+
+$Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $
+
+"""
+__all__ = ["array2string", "array_str", "array_repr", "set_string_function",
+           "set_printoptions", "get_printoptions", "printoptions",
+           "format_float_positional", "format_float_scientific"]
+__docformat__ = 'restructuredtext'
+
+#
+# Written by Konrad Hinsen <hinsenk@ere.umontreal.ca>
+# last revision: 1996-3-13
+# modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details)
+# and by Perry Greenfield 2000-4-1 for numarray
+# and by Travis Oliphant  2005-8-22 for numpy
+
+
+# Note: Both scalartypes.c.src and arrayprint.py implement strs for numpy
+# scalars but for different purposes. scalartypes.c.src has str/reprs for when
+# the scalar is printed on its own, while arrayprint.py has strs for when
+# scalars are printed inside an ndarray. Only the latter strs are currently
+# user-customizable.
+
+import functools
+import numbers
+import sys
+try:
+    from _thread import get_ident
+except ImportError:
+    from _dummy_thread import get_ident
+
+import numpy as np
+from . import numerictypes as _nt
+from .umath import absolute, isinf, isfinite, isnat
+from . import multiarray
+from .multiarray import (array, dragon4_positional, dragon4_scientific,
+                         datetime_as_string, datetime_data, ndarray,
+                         set_legacy_print_mode)
+from .fromnumeric import any
+from .numeric import concatenate, asarray, errstate
+from .numerictypes import (longlong, intc, int_, float_, complex_, bool_,
+                           flexible)
+from .overrides import array_function_dispatch, set_module
+import operator
+import warnings
+import contextlib
+
+_format_options = {
+    'edgeitems': 3,  # repr N leading and trailing items of each dimension
+    'threshold': 1000,  # total items > triggers array summarization
+    'floatmode': 'maxprec',
+    'precision': 8,  # precision of floating point representations
+    'suppress': False,  # suppress printing small floating values in exp format
+    'linewidth': 75,
+    'nanstr': 'nan',
+    'infstr': 'inf',
+    'sign': '-',
+    'formatter': None,
+    # Internally stored as an int to simplify comparisons; converted from/to
+    # str/False on the way in/out.
+    'legacy': sys.maxsize}
+
+def _make_options_dict(precision=None, threshold=None, edgeitems=None,
+                       linewidth=None, suppress=None, nanstr=None, infstr=None,
+                       sign=None, formatter=None, floatmode=None, legacy=None):
+    """
+    Make a dictionary out of the non-None arguments, plus conversion of
+    *legacy* and sanity checks.
+    """
+
+    options = {k: v for k, v in locals().items() if v is not None}
+
+    if suppress is not None:
+        options['suppress'] = bool(suppress)
+
+    modes = ['fixed', 'unique', 'maxprec', 'maxprec_equal']
+    if floatmode not in modes + [None]:
+        raise ValueError("floatmode option must be one of " +
+                         ", ".join('"{}"'.format(m) for m in modes))
+
+    if sign not in [None, '-', '+', ' ']:
+        raise ValueError("sign option must be one of ' ', '+', or '-'")
+
+    if legacy == False:
+        options['legacy'] = sys.maxsize
+    elif legacy == '1.13':
+        options['legacy'] = 113
+    elif legacy == '1.21':
+        options['legacy'] = 121
+    elif legacy is None:
+        pass  # OK, do nothing.
+    else:
+        warnings.warn(
+            "legacy printing option can currently only be '1.13', '1.21', or "
+            "`False`", stacklevel=3)
+
+    if threshold is not None:
+        # forbid the bad threshold arg suggested by stack overflow, gh-12351
+        if not isinstance(threshold, numbers.Number):
+            raise TypeError("threshold must be numeric")
+        if np.isnan(threshold):
+            raise ValueError("threshold must be non-NAN, try "
+                             "sys.maxsize for untruncated representation")
+
+    if precision is not None:
+        # forbid the bad precision arg as suggested by issue #18254
+        try:
+            options['precision'] = operator.index(precision)
+        except TypeError as e:
+            raise TypeError('precision must be an integer') from e
+
+    return options
+
+
+@set_module('numpy')
+def set_printoptions(precision=None, threshold=None, edgeitems=None,
+                     linewidth=None, suppress=None, nanstr=None, infstr=None,
+                     formatter=None, sign=None, floatmode=None, *, legacy=None):
+    """
+    Set printing options.
+
+    These options determine the way floating point numbers, arrays and
+    other NumPy objects are displayed.
+
+    Parameters
+    ----------
+    precision : int or None, optional
+        Number of digits of precision for floating point output (default 8).
+        May be None if `floatmode` is not `fixed`, to print as many digits as
+        necessary to uniquely specify the value.
+    threshold : int, optional
+        Total number of array elements which trigger summarization
+        rather than full repr (default 1000).
+        To always use the full repr without summarization, pass `sys.maxsize`.
+    edgeitems : int, optional
+        Number of array items in summary at beginning and end of
+        each dimension (default 3).
+    linewidth : int, optional
+        The number of characters per line for the purpose of inserting
+        line breaks (default 75).
+    suppress : bool, optional
+        If True, always print floating point numbers using fixed point
+        notation, in which case numbers equal to zero in the current precision
+        will print as zero.  If False, then scientific notation is used when
+        absolute value of the smallest number is < 1e-4 or the ratio of the
+        maximum absolute value to the minimum is > 1e3. The default is False.
+    nanstr : str, optional
+        String representation of floating point not-a-number (default nan).
+    infstr : str, optional
+        String representation of floating point infinity (default inf).
+    sign : string, either '-', '+', or ' ', optional
+        Controls printing of the sign of floating-point types. If '+', always
+        print the sign of positive values. If ' ', always prints a space
+        (whitespace character) in the sign position of positive values.  If
+        '-', omit the sign character of positive values. (default '-')
+    formatter : dict of callables, optional
+        If not None, the keys should indicate the type(s) that the respective
+        formatting function applies to.  Callables should return a string.
+        Types that are not specified (by their corresponding keys) are handled
+        by the default formatters.  Individual types for which a formatter
+        can be set are:
+
+        - 'bool'
+        - 'int'
+        - 'timedelta' : a `numpy.timedelta64`
+        - 'datetime' : a `numpy.datetime64`
+        - 'float'
+        - 'longfloat' : 128-bit floats
+        - 'complexfloat'
+        - 'longcomplexfloat' : composed of two 128-bit floats
+        - 'numpystr' : types `numpy.bytes_` and `numpy.str_`
+        - 'object' : `np.object_` arrays
+
+        Other keys that can be used to set a group of types at once are:
+
+        - 'all' : sets all types
+        - 'int_kind' : sets 'int'
+        - 'float_kind' : sets 'float' and 'longfloat'
+        - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat'
+        - 'str_kind' : sets 'numpystr'
+    floatmode : str, optional
+        Controls the interpretation of the `precision` option for
+        floating-point types. Can take the following values
+        (default maxprec_equal):
+
+        * 'fixed': Always print exactly `precision` fractional digits,
+                even if this would print more or fewer digits than
+                necessary to specify the value uniquely.
+        * 'unique': Print the minimum number of fractional digits necessary
+                to represent each value uniquely. Different elements may
+                have a different number of digits. The value of the
+                `precision` option is ignored.
+        * 'maxprec': Print at most `precision` fractional digits, but if
+                an element can be uniquely represented with fewer digits
+                only print it with that many.
+        * 'maxprec_equal': Print at most `precision` fractional digits,
+                but if every element in the array can be uniquely
+                represented with an equal number of fewer digits, use that
+                many digits for all elements.
+    legacy : string or `False`, optional
+        If set to the string `'1.13'` enables 1.13 legacy printing mode. This
+        approximates numpy 1.13 print output by including a space in the sign
+        position of floats and different behavior for 0d arrays. This also
+        enables 1.21 legacy printing mode (described below).
+
+        If set to the string `'1.21'` enables 1.21 legacy printing mode. This
+        approximates numpy 1.21 print output of complex structured dtypes
+        by not inserting spaces after commas that separate fields and after
+        colons.
+
+        If set to `False`, disables legacy mode.
+
+        Unrecognized strings will be ignored with a warning for forward
+        compatibility.
+
+        .. versionadded:: 1.14.0
+        .. versionchanged:: 1.22.0
+
+    See Also
+    --------
+    get_printoptions, printoptions, set_string_function, array2string
+
+    Notes
+    -----
+    `formatter` is always reset with a call to `set_printoptions`.
+
+    Use `printoptions` as a context manager to set the values temporarily.
+
+    Examples
+    --------
+    Floating point precision can be set:
+
+    >>> np.set_printoptions(precision=4)
+    >>> np.array([1.123456789])
+    [1.1235]
+
+    Long arrays can be summarised:
+
+    >>> np.set_printoptions(threshold=5)
+    >>> np.arange(10)
+    array([0, 1, 2, ..., 7, 8, 9])
+
+    Small results can be suppressed:
+
+    >>> eps = np.finfo(float).eps
+    >>> x = np.arange(4.)
+    >>> x**2 - (x + eps)**2
+    array([-4.9304e-32, -4.4409e-16,  0.0000e+00,  0.0000e+00])
+    >>> np.set_printoptions(suppress=True)
+    >>> x**2 - (x + eps)**2
+    array([-0., -0.,  0.,  0.])
+
+    A custom formatter can be used to display array elements as desired:
+
+    >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)})
+    >>> x = np.arange(3)
+    >>> x
+    array([int: 0, int: -1, int: -2])
+    >>> np.set_printoptions()  # formatter gets reset
+    >>> x
+    array([0, 1, 2])
+
+    To put back the default options, you can use:
+
+    >>> np.set_printoptions(edgeitems=3, infstr='inf',
+    ... linewidth=75, nanstr='nan', precision=8,
+    ... suppress=False, threshold=1000, formatter=None)
+
+    Also to temporarily override options, use `printoptions` as a context manager:
+
+    >>> with np.printoptions(precision=2, suppress=True, threshold=5):
+    ...     np.linspace(0, 10, 10)
+    array([ 0.  ,  1.11,  2.22, ...,  7.78,  8.89, 10.  ])
+
+    """
+    opt = _make_options_dict(precision, threshold, edgeitems, linewidth,
+                             suppress, nanstr, infstr, sign, formatter,
+                             floatmode, legacy)
+    # formatter is always reset
+    opt['formatter'] = formatter
+    _format_options.update(opt)
+
+    # set the C variable for legacy mode
+    if _format_options['legacy'] == 113:
+        set_legacy_print_mode(113)
+        # reset the sign option in legacy mode to avoid confusion
+        _format_options['sign'] = '-'
+    elif _format_options['legacy'] == 121:
+        set_legacy_print_mode(121)
+    elif _format_options['legacy'] == sys.maxsize:
+        set_legacy_print_mode(0)
+
+
+@set_module('numpy')
+def get_printoptions():
+    """
+    Return the current print options.
+
+    Returns
+    -------
+    print_opts : dict
+        Dictionary of current print options with keys
+
+          - precision : int
+          - threshold : int
+          - edgeitems : int
+          - linewidth : int
+          - suppress : bool
+          - nanstr : str
+          - infstr : str
+          - formatter : dict of callables
+          - sign : str
+
+        For a full description of these options, see `set_printoptions`.
+
+    See Also
+    --------
+    set_printoptions, printoptions, set_string_function
+
+    """
+    opts = _format_options.copy()
+    opts['legacy'] = {
+        113: '1.13', 121: '1.21', sys.maxsize: False,
+    }[opts['legacy']]
+    return opts
+
+
+def _get_legacy_print_mode():
+    """Return the legacy print mode as an int."""
+    return _format_options['legacy']
+
+
+@set_module('numpy')
+@contextlib.contextmanager
+def printoptions(*args, **kwargs):
+    """Context manager for setting print options.
+
+    Set print options for the scope of the `with` block, and restore the old
+    options at the end. See `set_printoptions` for the full description of
+    available options.
+
+    Examples
+    --------
+
+    >>> from numpy.testing import assert_equal
+    >>> with np.printoptions(precision=2):
+    ...     np.array([2.0]) / 3
+    array([0.67])
+
+    The `as`-clause of the `with`-statement gives the current print options:
+
+    >>> with np.printoptions(precision=2) as opts:
+    ...      assert_equal(opts, np.get_printoptions())
+
+    See Also
+    --------
+    set_printoptions, get_printoptions
+
+    """
+    opts = np.get_printoptions()
+    try:
+        np.set_printoptions(*args, **kwargs)
+        yield np.get_printoptions()
+    finally:
+        np.set_printoptions(**opts)
+
+
+def _leading_trailing(a, edgeitems, index=()):
+    """
+    Keep only the N-D corners (leading and trailing edges) of an array.
+
+    Should be passed a base-class ndarray, since it makes no guarantees about
+    preserving subclasses.
+    """
+    axis = len(index)
+    if axis == a.ndim:
+        return a[index]
+
+    if a.shape[axis] > 2*edgeitems:
+        return concatenate((
+            _leading_trailing(a, edgeitems, index + np.index_exp[ :edgeitems]),
+            _leading_trailing(a, edgeitems, index + np.index_exp[-edgeitems:])
+        ), axis=axis)
+    else:
+        return _leading_trailing(a, edgeitems, index + np.index_exp[:])
+
+
+def _object_format(o):
+    """ Object arrays containing lists should be printed unambiguously """
+    if type(o) is list:
+        fmt = 'list({!r})'
+    else:
+        fmt = '{!r}'
+    return fmt.format(o)
+
+def repr_format(x):
+    return repr(x)
+
+def str_format(x):
+    return str(x)
+
+def _get_formatdict(data, *, precision, floatmode, suppress, sign, legacy,
+                    formatter, **kwargs):
+    # note: extra arguments in kwargs are ignored
+
+    # wrapped in lambdas to avoid taking a code path with the wrong type of data
+    formatdict = {
+        'bool': lambda: BoolFormat(data),
+        'int': lambda: IntegerFormat(data),
+        'float': lambda: FloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'longfloat': lambda: FloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'complexfloat': lambda: ComplexFloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'longcomplexfloat': lambda: ComplexFloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'datetime': lambda: DatetimeFormat(data, legacy=legacy),
+        'timedelta': lambda: TimedeltaFormat(data),
+        'object': lambda: _object_format,
+        'void': lambda: str_format,
+        'numpystr': lambda: repr_format}
+
+    # we need to wrap values in `formatter` in a lambda, so that the interface
+    # is the same as the above values.
+    def indirect(x):
+        return lambda: x
+
+    if formatter is not None:
+        fkeys = [k for k in formatter.keys() if formatter[k] is not None]
+        if 'all' in fkeys:
+            for key in formatdict.keys():
+                formatdict[key] = indirect(formatter['all'])
+        if 'int_kind' in fkeys:
+            for key in ['int']:
+                formatdict[key] = indirect(formatter['int_kind'])
+        if 'float_kind' in fkeys:
+            for key in ['float', 'longfloat']:
+                formatdict[key] = indirect(formatter['float_kind'])
+        if 'complex_kind' in fkeys:
+            for key in ['complexfloat', 'longcomplexfloat']:
+                formatdict[key] = indirect(formatter['complex_kind'])
+        if 'str_kind' in fkeys:
+            formatdict['numpystr'] = indirect(formatter['str_kind'])
+        for key in formatdict.keys():
+            if key in fkeys:
+                formatdict[key] = indirect(formatter[key])
+
+    return formatdict
+
+def _get_format_function(data, **options):
+    """
+    find the right formatting function for the dtype_
+    """
+    dtype_ = data.dtype
+    dtypeobj = dtype_.type
+    formatdict = _get_formatdict(data, **options)
+    if dtypeobj is None:
+        return formatdict["numpystr"]()
+    elif issubclass(dtypeobj, _nt.bool_):
+        return formatdict['bool']()
+    elif issubclass(dtypeobj, _nt.integer):
+        if issubclass(dtypeobj, _nt.timedelta64):
+            return formatdict['timedelta']()
+        else:
+            return formatdict['int']()
+    elif issubclass(dtypeobj, _nt.floating):
+        if issubclass(dtypeobj, _nt.longfloat):
+            return formatdict['longfloat']()
+        else:
+            return formatdict['float']()
+    elif issubclass(dtypeobj, _nt.complexfloating):
+        if issubclass(dtypeobj, _nt.clongfloat):
+            return formatdict['longcomplexfloat']()
+        else:
+            return formatdict['complexfloat']()
+    elif issubclass(dtypeobj, (_nt.str_, _nt.bytes_)):
+        return formatdict['numpystr']()
+    elif issubclass(dtypeobj, _nt.datetime64):
+        return formatdict['datetime']()
+    elif issubclass(dtypeobj, _nt.object_):
+        return formatdict['object']()
+    elif issubclass(dtypeobj, _nt.void):
+        if dtype_.names is not None:
+            return StructuredVoidFormat.from_data(data, **options)
+        else:
+            return formatdict['void']()
+    else:
+        return formatdict['numpystr']()
+
+
+def _recursive_guard(fillvalue='...'):
+    """
+    Like the python 3.2 reprlib.recursive_repr, but forwards *args and **kwargs
+
+    Decorates a function such that if it calls itself with the same first
+    argument, it returns `fillvalue` instead of recursing.
+
+    Largely copied from reprlib.recursive_repr
+    """
+
+    def decorating_function(f):
+        repr_running = set()
+
+        @functools.wraps(f)
+        def wrapper(self, *args, **kwargs):
+            key = id(self), get_ident()
+            if key in repr_running:
+                return fillvalue
+            repr_running.add(key)
+            try:
+                return f(self, *args, **kwargs)
+            finally:
+                repr_running.discard(key)
+
+        return wrapper
+
+    return decorating_function
+
+
+# gracefully handle recursive calls, when object arrays contain themselves
+@_recursive_guard()
+def _array2string(a, options, separator=' ', prefix=""):
+    # The formatter __init__s in _get_format_function cannot deal with
+    # subclasses yet, and we also need to avoid recursion issues in
+    # _formatArray with subclasses which return 0d arrays in place of scalars
+    data = asarray(a)
+    if a.shape == ():
+        a = data
+
+    if a.size > options['threshold']:
+        summary_insert = "..."
+        data = _leading_trailing(data, options['edgeitems'])
+    else:
+        summary_insert = ""
+
+    # find the right formatting function for the array
+    format_function = _get_format_function(data, **options)
+
+    # skip over "["
+    next_line_prefix = " "
+    # skip over array(
+    next_line_prefix += " "*len(prefix)
+
+    lst = _formatArray(a, format_function, options['linewidth'],
+                       next_line_prefix, separator, options['edgeitems'],
+                       summary_insert, options['legacy'])
+    return lst
+
+
+def _array2string_dispatcher(
+        a, max_line_width=None, precision=None,
+        suppress_small=None, separator=None, prefix=None,
+        style=None, formatter=None, threshold=None,
+        edgeitems=None, sign=None, floatmode=None, suffix=None,
+        *, legacy=None):
+    return (a,)
+
+
+@array_function_dispatch(_array2string_dispatcher, module='numpy')
+def array2string(a, max_line_width=None, precision=None,
+                 suppress_small=None, separator=' ', prefix="",
+                 style=np._NoValue, formatter=None, threshold=None,
+                 edgeitems=None, sign=None, floatmode=None, suffix="",
+                 *, legacy=None):
+    """
+    Return a string representation of an array.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int or None, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+    separator : str, optional
+        Inserted between elements.
+    prefix : str, optional
+    suffix : str, optional
+        The length of the prefix and suffix strings are used to respectively
+        align and wrap the output. An array is typically printed as::
+
+          prefix + array2string(a) + suffix
+
+        The output is left-padded by the length of the prefix string, and
+        wrapping is forced at the column ``max_line_width - len(suffix)``.
+        It should be noted that the content of prefix and suffix strings are
+        not included in the output.
+    style : _NoValue, optional
+        Has no effect, do not use.
+
+        .. deprecated:: 1.14.0
+    formatter : dict of callables, optional
+        If not None, the keys should indicate the type(s) that the respective
+        formatting function applies to.  Callables should return a string.
+        Types that are not specified (by their corresponding keys) are handled
+        by the default formatters.  Individual types for which a formatter
+        can be set are:
+
+        - 'bool'
+        - 'int'
+        - 'timedelta' : a `numpy.timedelta64`
+        - 'datetime' : a `numpy.datetime64`
+        - 'float'
+        - 'longfloat' : 128-bit floats
+        - 'complexfloat'
+        - 'longcomplexfloat' : composed of two 128-bit floats
+        - 'void' : type `numpy.void`
+        - 'numpystr' : types `numpy.bytes_` and `numpy.str_`
+
+        Other keys that can be used to set a group of types at once are:
+
+        - 'all' : sets all types
+        - 'int_kind' : sets 'int'
+        - 'float_kind' : sets 'float' and 'longfloat'
+        - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat'
+        - 'str_kind' : sets 'numpystr'
+    threshold : int, optional
+        Total number of array elements which trigger summarization
+        rather than full repr.
+        Defaults to ``numpy.get_printoptions()['threshold']``.
+    edgeitems : int, optional
+        Number of array items in summary at beginning and end of
+        each dimension.
+        Defaults to ``numpy.get_printoptions()['edgeitems']``.
+    sign : string, either '-', '+', or ' ', optional
+        Controls printing of the sign of floating-point types. If '+', always
+        print the sign of positive values. If ' ', always prints a space
+        (whitespace character) in the sign position of positive values.  If
+        '-', omit the sign character of positive values.
+        Defaults to ``numpy.get_printoptions()['sign']``.
+    floatmode : str, optional
+        Controls the interpretation of the `precision` option for
+        floating-point types.
+        Defaults to ``numpy.get_printoptions()['floatmode']``.
+        Can take the following values:
+
+        - 'fixed': Always print exactly `precision` fractional digits,
+          even if this would print more or fewer digits than
+          necessary to specify the value uniquely.
+        - 'unique': Print the minimum number of fractional digits necessary
+          to represent each value uniquely. Different elements may
+          have a different number of digits.  The value of the
+          `precision` option is ignored.
+        - 'maxprec': Print at most `precision` fractional digits, but if
+          an element can be uniquely represented with fewer digits
+          only print it with that many.
+        - 'maxprec_equal': Print at most `precision` fractional digits,
+          but if every element in the array can be uniquely
+          represented with an equal number of fewer digits, use that
+          many digits for all elements.
+    legacy : string or `False`, optional
+        If set to the string `'1.13'` enables 1.13 legacy printing mode. This
+        approximates numpy 1.13 print output by including a space in the sign
+        position of floats and different behavior for 0d arrays. If set to
+        `False`, disables legacy mode. Unrecognized strings will be ignored
+        with a warning for forward compatibility.
+
+        .. versionadded:: 1.14.0
+
+    Returns
+    -------
+    array_str : str
+        String representation of the array.
+
+    Raises
+    ------
+    TypeError
+        if a callable in `formatter` does not return a string.
+
+    See Also
+    --------
+    array_str, array_repr, set_printoptions, get_printoptions
+
+    Notes
+    -----
+    If a formatter is specified for a certain type, the `precision` keyword is
+    ignored for that type.
+
+    This is a very flexible function; `array_repr` and `array_str` are using
+    `array2string` internally so keywords with the same name should work
+    identically in all three functions.
+
+    Examples
+    --------
+    >>> x = np.array([1e-16,1,2,3])
+    >>> np.array2string(x, precision=2, separator=',',
+    ...                       suppress_small=True)
+    '[0.,1.,2.,3.]'
+
+    >>> x  = np.arange(3.)
+    >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x})
+    '[0.00 1.00 2.00]'
+
+    >>> x  = np.arange(3)
+    >>> np.array2string(x, formatter={'int':lambda x: hex(x)})
+    '[0x0 0x1 0x2]'
+
+    """
+
+    overrides = _make_options_dict(precision, threshold, edgeitems,
+                                   max_line_width, suppress_small, None, None,
+                                   sign, formatter, floatmode, legacy)
+    options = _format_options.copy()
+    options.update(overrides)
+
+    if options['legacy'] <= 113:
+        if style is np._NoValue:
+            style = repr
+
+        if a.shape == () and a.dtype.names is None:
+            return style(a.item())
+    elif style is not np._NoValue:
+        # Deprecation 11-9-2017  v1.14
+        warnings.warn("'style' argument is deprecated and no longer functional"
+                      " except in 1.13 'legacy' mode",
+                      DeprecationWarning, stacklevel=2)
+
+    if options['legacy'] > 113:
+        options['linewidth'] -= len(suffix)
+
+    # treat as a null array if any of shape elements == 0
+    if a.size == 0:
+        return "[]"
+
+    return _array2string(a, options, separator, prefix)
+
+
+def _extendLine(s, line, word, line_width, next_line_prefix, legacy):
+    needs_wrap = len(line) + len(word) > line_width
+    if legacy > 113:
+        # don't wrap lines if it won't help
+        if len(line) <= len(next_line_prefix):
+            needs_wrap = False
+
+    if needs_wrap:
+        s += line.rstrip() + "\n"
+        line = next_line_prefix
+    line += word
+    return s, line
+
+
+def _extendLine_pretty(s, line, word, line_width, next_line_prefix, legacy):
+    """
+    Extends line with nicely formatted (possibly multi-line) string ``word``.
+    """
+    words = word.splitlines()
+    if len(words) == 1 or legacy <= 113:
+        return _extendLine(s, line, word, line_width, next_line_prefix, legacy)
+
+    max_word_length = max(len(word) for word in words)
+    if (len(line) + max_word_length > line_width and
+            len(line) > len(next_line_prefix)):
+        s += line.rstrip() + '\n'
+        line = next_line_prefix + words[0]
+        indent = next_line_prefix
+    else:
+        indent = len(line)*' '
+        line += words[0]
+
+    for word in words[1::]:
+        s += line.rstrip() + '\n'
+        line = indent + word
+
+    suffix_length = max_word_length - len(words[-1])
+    line += suffix_length*' '
+
+    return s, line
+
+def _formatArray(a, format_function, line_width, next_line_prefix,
+                 separator, edge_items, summary_insert, legacy):
+    """formatArray is designed for two modes of operation:
+
+    1. Full output
+
+    2. Summarized output
+
+    """
+    def recurser(index, hanging_indent, curr_width):
+        """
+        By using this local function, we don't need to recurse with all the
+        arguments. Since this function is not created recursively, the cost is
+        not significant
+        """
+        axis = len(index)
+        axes_left = a.ndim - axis
+
+        if axes_left == 0:
+            return format_function(a[index])
+
+        # when recursing, add a space to align with the [ added, and reduce the
+        # length of the line by 1
+        next_hanging_indent = hanging_indent + ' '
+        if legacy <= 113:
+            next_width = curr_width
+        else:
+            next_width = curr_width - len(']')
+
+        a_len = a.shape[axis]
+        show_summary = summary_insert and 2*edge_items < a_len
+        if show_summary:
+            leading_items = edge_items
+            trailing_items = edge_items
+        else:
+            leading_items = 0
+            trailing_items = a_len
+
+        # stringify the array with the hanging indent on the first line too
+        s = ''
+
+        # last axis (rows) - wrap elements if they would not fit on one line
+        if axes_left == 1:
+            # the length up until the beginning of the separator / bracket
+            if legacy <= 113:
+                elem_width = curr_width - len(separator.rstrip())
+            else:
+                elem_width = curr_width - max(len(separator.rstrip()), len(']'))
+
+            line = hanging_indent
+            for i in range(leading_items):
+                word = recurser(index + (i,), next_hanging_indent, next_width)
+                s, line = _extendLine_pretty(
+                    s, line, word, elem_width, hanging_indent, legacy)
+                line += separator
+
+            if show_summary:
+                s, line = _extendLine(
+                    s, line, summary_insert, elem_width, hanging_indent, legacy)
+                if legacy <= 113:
+                    line += ", "
+                else:
+                    line += separator
+
+            for i in range(trailing_items, 1, -1):
+                word = recurser(index + (-i,), next_hanging_indent, next_width)
+                s, line = _extendLine_pretty(
+                    s, line, word, elem_width, hanging_indent, legacy)
+                line += separator
+
+            if legacy <= 113:
+                # width of the separator is not considered on 1.13
+                elem_width = curr_width
+            word = recurser(index + (-1,), next_hanging_indent, next_width)
+            s, line = _extendLine_pretty(
+                s, line, word, elem_width, hanging_indent, legacy)
+
+            s += line
+
+        # other axes - insert newlines between rows
+        else:
+            s = ''
+            line_sep = separator.rstrip() + '\n'*(axes_left - 1)
+
+            for i in range(leading_items):
+                nested = recurser(index + (i,), next_hanging_indent, next_width)
+                s += hanging_indent + nested + line_sep
+
+            if show_summary:
+                if legacy <= 113:
+                    # trailing space, fixed nbr of newlines, and fixed separator
+                    s += hanging_indent + summary_insert + ", \n"
+                else:
+                    s += hanging_indent + summary_insert + line_sep
+
+            for i in range(trailing_items, 1, -1):
+                nested = recurser(index + (-i,), next_hanging_indent,
+                                  next_width)
+                s += hanging_indent + nested + line_sep
+
+            nested = recurser(index + (-1,), next_hanging_indent, next_width)
+            s += hanging_indent + nested
+
+        # remove the hanging indent, and wrap in []
+        s = '[' + s[len(hanging_indent):] + ']'
+        return s
+
+    try:
+        # invoke the recursive part with an initial index and prefix
+        return recurser(index=(),
+                        hanging_indent=next_line_prefix,
+                        curr_width=line_width)
+    finally:
+        # recursive closures have a cyclic reference to themselves, which
+        # requires gc to collect (gh-10620). To avoid this problem, for
+        # performance and PyPy friendliness, we break the cycle:
+        recurser = None
+
+def _none_or_positive_arg(x, name):
+    if x is None:
+        return -1
+    if x < 0:
+        raise ValueError("{} must be >= 0".format(name))
+    return x
+
+class FloatingFormat:
+    """ Formatter for subtypes of np.floating """
+    def __init__(self, data, precision, floatmode, suppress_small, sign=False,
+                 *, legacy=None):
+        # for backcompatibility, accept bools
+        if isinstance(sign, bool):
+            sign = '+' if sign else '-'
+
+        self._legacy = legacy
+        if self._legacy <= 113:
+            # when not 0d, legacy does not support '-'
+            if data.shape != () and sign == '-':
+                sign = ' '
+
+        self.floatmode = floatmode
+        if floatmode == 'unique':
+            self.precision = None
+        else:
+            self.precision = precision
+
+        self.precision = _none_or_positive_arg(self.precision, 'precision')
+
+        self.suppress_small = suppress_small
+        self.sign = sign
+        self.exp_format = False
+        self.large_exponent = False
+
+        self.fillFormat(data)
+
+    def fillFormat(self, data):
+        # only the finite values are used to compute the number of digits
+        finite_vals = data[isfinite(data)]
+
+        # choose exponential mode based on the non-zero finite values:
+        abs_non_zero = absolute(finite_vals[finite_vals != 0])
+        if len(abs_non_zero) != 0:
+            max_val = np.max(abs_non_zero)
+            min_val = np.min(abs_non_zero)
+            with errstate(over='ignore'):  # division can overflow
+                if max_val >= 1.e8 or (not self.suppress_small and
+                        (min_val < 0.0001 or max_val/min_val > 1000.)):
+                    self.exp_format = True
+
+        # do a first pass of printing all the numbers, to determine sizes
+        if len(finite_vals) == 0:
+            self.pad_left = 0
+            self.pad_right = 0
+            self.trim = '.'
+            self.exp_size = -1
+            self.unique = True
+            self.min_digits = None
+        elif self.exp_format:
+            trim, unique = '.', True
+            if self.floatmode == 'fixed' or self._legacy <= 113:
+                trim, unique = 'k', False
+            strs = (dragon4_scientific(x, precision=self.precision,
+                               unique=unique, trim=trim, sign=self.sign == '+')
+                    for x in finite_vals)
+            frac_strs, _, exp_strs = zip(*(s.partition('e') for s in strs))
+            int_part, frac_part = zip(*(s.split('.') for s in frac_strs))
+            self.exp_size = max(len(s) for s in exp_strs) - 1
+
+            self.trim = 'k'
+            self.precision = max(len(s) for s in frac_part)
+            self.min_digits = self.precision
+            self.unique = unique
+
+            # for back-compat with np 1.13, use 2 spaces & sign and full prec
+            if self._legacy <= 113:
+                self.pad_left = 3
+            else:
+                # this should be only 1 or 2. Can be calculated from sign.
+                self.pad_left = max(len(s) for s in int_part)
+            # pad_right is only needed for nan length calculation
+            self.pad_right = self.exp_size + 2 + self.precision
+        else:
+            trim, unique = '.', True
+            if self.floatmode == 'fixed':
+                trim, unique = 'k', False
+            strs = (dragon4_positional(x, precision=self.precision,
+                                       fractional=True,
+                                       unique=unique, trim=trim,
+                                       sign=self.sign == '+')
+                    for x in finite_vals)
+            int_part, frac_part = zip(*(s.split('.') for s in strs))
+            if self._legacy <= 113:
+                self.pad_left = 1 + max(len(s.lstrip('-+')) for s in int_part)
+            else:
+                self.pad_left = max(len(s) for s in int_part)
+            self.pad_right = max(len(s) for s in frac_part)
+            self.exp_size = -1
+            self.unique = unique
+
+            if self.floatmode in ['fixed', 'maxprec_equal']:
+                self.precision = self.min_digits = self.pad_right
+                self.trim = 'k'
+            else:
+                self.trim = '.'
+                self.min_digits = 0
+
+        if self._legacy > 113:
+            # account for sign = ' ' by adding one to pad_left
+            if self.sign == ' ' and not any(np.signbit(finite_vals)):
+                self.pad_left += 1
+
+        # if there are non-finite values, may need to increase pad_left
+        if data.size != finite_vals.size:
+            neginf = self.sign != '-' or any(data[isinf(data)] < 0)
+            nanlen = len(_format_options['nanstr'])
+            inflen = len(_format_options['infstr']) + neginf
+            offset = self.pad_right + 1  # +1 for decimal pt
+            self.pad_left = max(self.pad_left, nanlen - offset, inflen - offset)
+
+    def __call__(self, x):
+        if not np.isfinite(x):
+            with errstate(invalid='ignore'):
+                if np.isnan(x):
+                    sign = '+' if self.sign == '+' else ''
+                    ret = sign + _format_options['nanstr']
+                else:  # isinf
+                    sign = '-' if x < 0 else '+' if self.sign == '+' else ''
+                    ret = sign + _format_options['infstr']
+                return ' '*(self.pad_left + self.pad_right + 1 - len(ret)) + ret
+
+        if self.exp_format:
+            return dragon4_scientific(x,
+                                      precision=self.precision,
+                                      min_digits=self.min_digits,
+                                      unique=self.unique,
+                                      trim=self.trim,
+                                      sign=self.sign == '+',
+                                      pad_left=self.pad_left,
+                                      exp_digits=self.exp_size)
+        else:
+            return dragon4_positional(x,
+                                      precision=self.precision,
+                                      min_digits=self.min_digits,
+                                      unique=self.unique,
+                                      fractional=True,
+                                      trim=self.trim,
+                                      sign=self.sign == '+',
+                                      pad_left=self.pad_left,
+                                      pad_right=self.pad_right)
+
+
+@set_module('numpy')
+def format_float_scientific(x, precision=None, unique=True, trim='k',
+                            sign=False, pad_left=None, exp_digits=None,
+                            min_digits=None):
+    """
+    Format a floating-point scalar as a decimal string in scientific notation.
+
+    Provides control over rounding, trimming and padding. Uses and assumes
+    IEEE unbiased rounding. Uses the "Dragon4" algorithm.
+
+    Parameters
+    ----------
+    x : python float or numpy floating scalar
+        Value to format.
+    precision : non-negative integer or None, optional
+        Maximum number of digits to print. May be None if `unique` is
+        `True`, but must be an integer if unique is `False`.
+    unique : boolean, optional
+        If `True`, use a digit-generation strategy which gives the shortest
+        representation which uniquely identifies the floating-point number from
+        other values of the same type, by judicious rounding. If `precision`
+        is given fewer digits than necessary can be printed. If `min_digits`
+        is given more can be printed, in which cases the last digit is rounded
+        with unbiased rounding.
+        If `False`, digits are generated as if printing an infinite-precision
+        value and stopping after `precision` digits, rounding the remaining
+        value with unbiased rounding
+    trim : one of 'k', '.', '0', '-', optional
+        Controls post-processing trimming of trailing digits, as follows:
+
+        * 'k' : keep trailing zeros, keep decimal point (no trimming)
+        * '.' : trim all trailing zeros, leave decimal point
+        * '0' : trim all but the zero before the decimal point. Insert the
+          zero if it is missing.
+        * '-' : trim trailing zeros and any trailing decimal point
+    sign : boolean, optional
+        Whether to show the sign for positive values.
+    pad_left : non-negative integer, optional
+        Pad the left side of the string with whitespace until at least that
+        many characters are to the left of the decimal point.
+    exp_digits : non-negative integer, optional
+        Pad the exponent with zeros until it contains at least this many digits.
+        If omitted, the exponent will be at least 2 digits.
+    min_digits : non-negative integer or None, optional
+        Minimum number of digits to print. This only has an effect for
+        `unique=True`. In that case more digits than necessary to uniquely
+        identify the value may be printed and rounded unbiased.
+
+        -- versionadded:: 1.21.0
+
+    Returns
+    -------
+    rep : string
+        The string representation of the floating point value
+
+    See Also
+    --------
+    format_float_positional
+
+    Examples
+    --------
+    >>> np.format_float_scientific(np.float32(np.pi))
+    '3.1415927e+00'
+    >>> s = np.float32(1.23e24)
+    >>> np.format_float_scientific(s, unique=False, precision=15)
+    '1.230000071797338e+24'
+    >>> np.format_float_scientific(s, exp_digits=4)
+    '1.23e+0024'
+    """
+    precision = _none_or_positive_arg(precision, 'precision')
+    pad_left = _none_or_positive_arg(pad_left, 'pad_left')
+    exp_digits = _none_or_positive_arg(exp_digits, 'exp_digits')
+    min_digits = _none_or_positive_arg(min_digits, 'min_digits')
+    if min_digits > 0 and precision > 0 and min_digits > precision:
+        raise ValueError("min_digits must be less than or equal to precision")
+    return dragon4_scientific(x, precision=precision, unique=unique,
+                              trim=trim, sign=sign, pad_left=pad_left,
+                              exp_digits=exp_digits, min_digits=min_digits)
+
+
+@set_module('numpy')
+def format_float_positional(x, precision=None, unique=True,
+                            fractional=True, trim='k', sign=False,
+                            pad_left=None, pad_right=None, min_digits=None):
+    """
+    Format a floating-point scalar as a decimal string in positional notation.
+
+    Provides control over rounding, trimming and padding. Uses and assumes
+    IEEE unbiased rounding. Uses the "Dragon4" algorithm.
+
+    Parameters
+    ----------
+    x : python float or numpy floating scalar
+        Value to format.
+    precision : non-negative integer or None, optional
+        Maximum number of digits to print. May be None if `unique` is
+        `True`, but must be an integer if unique is `False`.
+    unique : boolean, optional
+        If `True`, use a digit-generation strategy which gives the shortest
+        representation which uniquely identifies the floating-point number from
+        other values of the same type, by judicious rounding. If `precision`
+        is given fewer digits than necessary can be printed, or if `min_digits`
+        is given more can be printed, in which cases the last digit is rounded
+        with unbiased rounding.
+        If `False`, digits are generated as if printing an infinite-precision
+        value and stopping after `precision` digits, rounding the remaining
+        value with unbiased rounding
+    fractional : boolean, optional
+        If `True`, the cutoffs of `precision` and `min_digits` refer to the
+        total number of digits after the decimal point, including leading
+        zeros.
+        If `False`, `precision` and `min_digits` refer to the total number of
+        significant digits, before or after the decimal point, ignoring leading
+        zeros.
+    trim : one of 'k', '.', '0', '-', optional
+        Controls post-processing trimming of trailing digits, as follows:
+
+        * 'k' : keep trailing zeros, keep decimal point (no trimming)
+        * '.' : trim all trailing zeros, leave decimal point
+        * '0' : trim all but the zero before the decimal point. Insert the
+          zero if it is missing.
+        * '-' : trim trailing zeros and any trailing decimal point
+    sign : boolean, optional
+        Whether to show the sign for positive values.
+    pad_left : non-negative integer, optional
+        Pad the left side of the string with whitespace until at least that
+        many characters are to the left of the decimal point.
+    pad_right : non-negative integer, optional
+        Pad the right side of the string with whitespace until at least that
+        many characters are to the right of the decimal point.
+    min_digits : non-negative integer or None, optional
+        Minimum number of digits to print. Only has an effect if `unique=True`
+        in which case additional digits past those necessary to uniquely
+        identify the value may be printed, rounding the last additional digit.
+
+        -- versionadded:: 1.21.0
+
+    Returns
+    -------
+    rep : string
+        The string representation of the floating point value
+
+    See Also
+    --------
+    format_float_scientific
+
+    Examples
+    --------
+    >>> np.format_float_positional(np.float32(np.pi))
+    '3.1415927'
+    >>> np.format_float_positional(np.float16(np.pi))
+    '3.14'
+    >>> np.format_float_positional(np.float16(0.3))
+    '0.3'
+    >>> np.format_float_positional(np.float16(0.3), unique=False, precision=10)
+    '0.3000488281'
+    """
+    precision = _none_or_positive_arg(precision, 'precision')
+    pad_left = _none_or_positive_arg(pad_left, 'pad_left')
+    pad_right = _none_or_positive_arg(pad_right, 'pad_right')
+    min_digits = _none_or_positive_arg(min_digits, 'min_digits')
+    if not fractional and precision == 0:
+        raise ValueError("precision must be greater than 0 if "
+                         "fractional=False")
+    if min_digits > 0 and precision > 0 and min_digits > precision:
+        raise ValueError("min_digits must be less than or equal to precision")
+    return dragon4_positional(x, precision=precision, unique=unique,
+                              fractional=fractional, trim=trim,
+                              sign=sign, pad_left=pad_left,
+                              pad_right=pad_right, min_digits=min_digits)
+
+
+class IntegerFormat:
+    def __init__(self, data):
+        if data.size > 0:
+            max_str_len = max(len(str(np.max(data))),
+                              len(str(np.min(data))))
+        else:
+            max_str_len = 0
+        self.format = '%{}d'.format(max_str_len)
+
+    def __call__(self, x):
+        return self.format % x
+
+
+class BoolFormat:
+    def __init__(self, data, **kwargs):
+        # add an extra space so " True" and "False" have the same length and
+        # array elements align nicely when printed, except in 0d arrays
+        self.truestr = ' True' if data.shape != () else 'True'
+
+    def __call__(self, x):
+        return self.truestr if x else "False"
+
+
+class ComplexFloatingFormat:
+    """ Formatter for subtypes of np.complexfloating """
+    def __init__(self, x, precision, floatmode, suppress_small,
+                 sign=False, *, legacy=None):
+        # for backcompatibility, accept bools
+        if isinstance(sign, bool):
+            sign = '+' if sign else '-'
+
+        floatmode_real = floatmode_imag = floatmode
+        if legacy <= 113:
+            floatmode_real = 'maxprec_equal'
+            floatmode_imag = 'maxprec'
+
+        self.real_format = FloatingFormat(
+            x.real, precision, floatmode_real, suppress_small,
+            sign=sign, legacy=legacy
+        )
+        self.imag_format = FloatingFormat(
+            x.imag, precision, floatmode_imag, suppress_small,
+            sign='+', legacy=legacy
+        )
+
+    def __call__(self, x):
+        r = self.real_format(x.real)
+        i = self.imag_format(x.imag)
+
+        # add the 'j' before the terminal whitespace in i
+        sp = len(i.rstrip())
+        i = i[:sp] + 'j' + i[sp:]
+
+        return r + i
+
+
+class _TimelikeFormat:
+    def __init__(self, data):
+        non_nat = data[~isnat(data)]
+        if len(non_nat) > 0:
+            # Max str length of non-NaT elements
+            max_str_len = max(len(self._format_non_nat(np.max(non_nat))),
+                              len(self._format_non_nat(np.min(non_nat))))
+        else:
+            max_str_len = 0
+        if len(non_nat) < data.size:
+            # data contains a NaT
+            max_str_len = max(max_str_len, 5)
+        self._format = '%{}s'.format(max_str_len)
+        self._nat = "'NaT'".rjust(max_str_len)
+
+    def _format_non_nat(self, x):
+        # override in subclass
+        raise NotImplementedError
+
+    def __call__(self, x):
+        if isnat(x):
+            return self._nat
+        else:
+            return self._format % self._format_non_nat(x)
+
+
+class DatetimeFormat(_TimelikeFormat):
+    def __init__(self, x, unit=None, timezone=None, casting='same_kind',
+                 legacy=False):
+        # Get the unit from the dtype
+        if unit is None:
+            if x.dtype.kind == 'M':
+                unit = datetime_data(x.dtype)[0]
+            else:
+                unit = 's'
+
+        if timezone is None:
+            timezone = 'naive'
+        self.timezone = timezone
+        self.unit = unit
+        self.casting = casting
+        self.legacy = legacy
+
+        # must be called after the above are configured
+        super().__init__(x)
+
+    def __call__(self, x):
+        if self.legacy <= 113:
+            return self._format_non_nat(x)
+        return super().__call__(x)
+
+    def _format_non_nat(self, x):
+        return "'%s'" % datetime_as_string(x,
+                                    unit=self.unit,
+                                    timezone=self.timezone,
+                                    casting=self.casting)
+
+
+class TimedeltaFormat(_TimelikeFormat):
+    def _format_non_nat(self, x):
+        return str(x.astype('i8'))
+
+
+class SubArrayFormat:
+    def __init__(self, format_function, **options):
+        self.format_function = format_function
+        self.threshold = options['threshold']
+        self.edge_items = options['edgeitems']
+
+    def __call__(self, a):
+        self.summary_insert = "..." if a.size > self.threshold else ""
+        return self.format_array(a)
+
+    def format_array(self, a):
+        if np.ndim(a) == 0:
+            return self.format_function(a)
+
+        if self.summary_insert and a.shape[0] > 2*self.edge_items:
+            formatted = (
+                [self.format_array(a_) for a_ in a[:self.edge_items]]
+                + [self.summary_insert]
+                + [self.format_array(a_) for a_ in a[-self.edge_items:]]
+            )
+        else:
+            formatted = [self.format_array(a_) for a_ in a]
+
+        return "[" + ", ".join(formatted) + "]"
+
+
+class StructuredVoidFormat:
+    """
+    Formatter for structured np.void objects.
+
+    This does not work on structured alias types like np.dtype(('i4', 'i2,i2')),
+    as alias scalars lose their field information, and the implementation
+    relies upon np.void.__getitem__.
+    """
+    def __init__(self, format_functions):
+        self.format_functions = format_functions
+
+    @classmethod
+    def from_data(cls, data, **options):
+        """
+        This is a second way to initialize StructuredVoidFormat, using the raw data
+        as input. Added to avoid changing the signature of __init__.
+        """
+        format_functions = []
+        for field_name in data.dtype.names:
+            format_function = _get_format_function(data[field_name], **options)
+            if data.dtype[field_name].shape != ():
+                format_function = SubArrayFormat(format_function, **options)
+            format_functions.append(format_function)
+        return cls(format_functions)
+
+    def __call__(self, x):
+        str_fields = [
+            format_function(field)
+            for field, format_function in zip(x, self.format_functions)
+        ]
+        if len(str_fields) == 1:
+            return "({},)".format(str_fields[0])
+        else:
+            return "({})".format(", ".join(str_fields))
+
+
+def _void_scalar_repr(x):
+    """
+    Implements the repr for structured-void scalars. It is called from the
+    scalartypes.c.src code, and is placed here because it uses the elementwise
+    formatters defined above.
+    """
+    return StructuredVoidFormat.from_data(array(x), **_format_options)(x)
+
+
+_typelessdata = [int_, float_, complex_, bool_]
+
+
+def dtype_is_implied(dtype):
+    """
+    Determine if the given dtype is implied by the representation of its values.
+
+    Parameters
+    ----------
+    dtype : dtype
+        Data type
+
+    Returns
+    -------
+    implied : bool
+        True if the dtype is implied by the representation of its values.
+
+    Examples
+    --------
+    >>> np.core.arrayprint.dtype_is_implied(int)
+    True
+    >>> np.array([1, 2, 3], int)
+    array([1, 2, 3])
+    >>> np.core.arrayprint.dtype_is_implied(np.int8)
+    False
+    >>> np.array([1, 2, 3], np.int8)
+    array([1, 2, 3], dtype=int8)
+    """
+    dtype = np.dtype(dtype)
+    if _format_options['legacy'] <= 113 and dtype.type == bool_:
+        return False
+
+    # not just void types can be structured, and names are not part of the repr
+    if dtype.names is not None:
+        return False
+
+    # should care about endianness *unless size is 1* (e.g., int8, bool)
+    if not dtype.isnative:
+        return False
+
+    return dtype.type in _typelessdata
+
+
+def dtype_short_repr(dtype):
+    """
+    Convert a dtype to a short form which evaluates to the same dtype.
+
+    The intent is roughly that the following holds
+
+    >>> from numpy import *
+    >>> dt = np.int64([1, 2]).dtype
+    >>> assert eval(dtype_short_repr(dt)) == dt
+    """
+    if type(dtype).__repr__ != np.dtype.__repr__:
+        # TODO: Custom repr for user DTypes, logic should likely move.
+        return repr(dtype)
+    if dtype.names is not None:
+        # structured dtypes give a list or tuple repr
+        return str(dtype)
+    elif issubclass(dtype.type, flexible):
+        # handle these separately so they don't give garbage like str256
+        return "'%s'" % str(dtype)
+
+    typename = dtype.name
+    if not dtype.isnative:
+        # deal with cases like dtype('<u2') that are identical to an
+        # established dtype (in this case uint16)
+        # except that they have a different endianness.
+        return "'%s'" % str(dtype)
+    # quote typenames which can't be represented as python variable names
+    if typename and not (typename[0].isalpha() and typename.isalnum()):
+        typename = repr(typename)
+    return typename
+
+
+def _array_repr_implementation(
+        arr, max_line_width=None, precision=None, suppress_small=None,
+        array2string=array2string):
+    """Internal version of array_repr() that allows overriding array2string."""
+    if max_line_width is None:
+        max_line_width = _format_options['linewidth']
+
+    if type(arr) is not ndarray:
+        class_name = type(arr).__name__
+    else:
+        class_name = "array"
+
+    skipdtype = dtype_is_implied(arr.dtype) and arr.size > 0
+
+    prefix = class_name + "("
+    suffix = ")" if skipdtype else ","
+
+    if (_format_options['legacy'] <= 113 and
+            arr.shape == () and not arr.dtype.names):
+        lst = repr(arr.item())
+    elif arr.size > 0 or arr.shape == (0,):
+        lst = array2string(arr, max_line_width, precision, suppress_small,
+                           ', ', prefix, suffix=suffix)
+    else:  # show zero-length shape unless it is (0,)
+        lst = "[], shape=%s" % (repr(arr.shape),)
+
+    arr_str = prefix + lst + suffix
+
+    if skipdtype:
+        return arr_str
+
+    dtype_str = "dtype={})".format(dtype_short_repr(arr.dtype))
+
+    # compute whether we should put dtype on a new line: Do so if adding the
+    # dtype would extend the last line past max_line_width.
+    # Note: This line gives the correct result even when rfind returns -1.
+    last_line_len = len(arr_str) - (arr_str.rfind('\n') + 1)
+    spacer = " "
+    if _format_options['legacy'] <= 113:
+        if issubclass(arr.dtype.type, flexible):
+            spacer = '\n' + ' '*len(class_name + "(")
+    elif last_line_len + len(dtype_str) + 1 > max_line_width:
+        spacer = '\n' + ' '*len(class_name + "(")
+
+    return arr_str + spacer + dtype_str
+
+
+def _array_repr_dispatcher(
+        arr, max_line_width=None, precision=None, suppress_small=None):
+    return (arr,)
+
+
+@array_function_dispatch(_array_repr_dispatcher, module='numpy')
+def array_repr(arr, max_line_width=None, precision=None, suppress_small=None):
+    """
+    Return the string representation of an array.
+
+    Parameters
+    ----------
+    arr : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+
+    Returns
+    -------
+    string : str
+      The string representation of an array.
+
+    See Also
+    --------
+    array_str, array2string, set_printoptions
+
+    Examples
+    --------
+    >>> np.array_repr(np.array([1,2]))
+    'array([1, 2])'
+    >>> np.array_repr(np.ma.array([0.]))
+    'MaskedArray([0.])'
+    >>> np.array_repr(np.array([], np.int32))
+    'array([], dtype=int32)'
+
+    >>> x = np.array([1e-6, 4e-7, 2, 3])
+    >>> np.array_repr(x, precision=6, suppress_small=True)
+    'array([0.000001,  0.      ,  2.      ,  3.      ])'
+
+    """
+    return _array_repr_implementation(
+        arr, max_line_width, precision, suppress_small)
+
+
+@_recursive_guard()
+def _guarded_repr_or_str(v):
+    if isinstance(v, bytes):
+        return repr(v)
+    return str(v)
+
+
+def _array_str_implementation(
+        a, max_line_width=None, precision=None, suppress_small=None,
+        array2string=array2string):
+    """Internal version of array_str() that allows overriding array2string."""
+    if (_format_options['legacy'] <= 113 and
+            a.shape == () and not a.dtype.names):
+        return str(a.item())
+
+    # the str of 0d arrays is a special case: It should appear like a scalar,
+    # so floats are not truncated by `precision`, and strings are not wrapped
+    # in quotes. So we return the str of the scalar value.
+    if a.shape == ():
+        # obtain a scalar and call str on it, avoiding problems for subclasses
+        # for which indexing with () returns a 0d instead of a scalar by using
+        # ndarray's getindex. Also guard against recursive 0d object arrays.
+        return _guarded_repr_or_str(np.ndarray.__getitem__(a, ()))
+
+    return array2string(a, max_line_width, precision, suppress_small, ' ', "")
+
+
+def _array_str_dispatcher(
+        a, max_line_width=None, precision=None, suppress_small=None):
+    return (a,)
+
+
+@array_function_dispatch(_array_str_dispatcher, module='numpy')
+def array_str(a, max_line_width=None, precision=None, suppress_small=None):
+    """
+    Return a string representation of the data in an array.
+
+    The data in the array is returned as a single string.  This function is
+    similar to `array_repr`, the difference being that `array_repr` also
+    returns information on the kind of array and its data type.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+
+    See Also
+    --------
+    array2string, array_repr, set_printoptions
+
+    Examples
+    --------
+    >>> np.array_str(np.arange(3))
+    '[0 1 2]'
+
+    """
+    return _array_str_implementation(
+        a, max_line_width, precision, suppress_small)
+
+
+# needed if __array_function__ is disabled
+_array2string_impl = getattr(array2string, '__wrapped__', array2string)
+_default_array_str = functools.partial(_array_str_implementation,
+                                       array2string=_array2string_impl)
+_default_array_repr = functools.partial(_array_repr_implementation,
+                                        array2string=_array2string_impl)
+
+
+def set_string_function(f, repr=True):
+    """
+    Set a Python function to be used when pretty printing arrays.
+
+    Parameters
+    ----------
+    f : function or None
+        Function to be used to pretty print arrays. The function should expect
+        a single array argument and return a string of the representation of
+        the array. If None, the function is reset to the default NumPy function
+        to print arrays.
+    repr : bool, optional
+        If True (default), the function for pretty printing (``__repr__``)
+        is set, if False the function that returns the default string
+        representation (``__str__``) is set.
+
+    See Also
+    --------
+    set_printoptions, get_printoptions
+
+    Examples
+    --------
+    >>> def pprint(arr):
+    ...     return 'HA! - What are you going to do now?'
+    ...
+    >>> np.set_string_function(pprint)
+    >>> a = np.arange(10)
+    >>> a
+    HA! - What are you going to do now?
+    >>> _ = a
+    >>> # [0 1 2 3 4 5 6 7 8 9]
+
+    We can reset the function to the default:
+
+    >>> np.set_string_function(None)
+    >>> a
+    array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9])
+
+    `repr` affects either pretty printing or normal string representation.
+    Note that ``__repr__`` is still affected by setting ``__str__``
+    because the width of each array element in the returned string becomes
+    equal to the length of the result of ``__str__()``.
+
+    >>> x = np.arange(4)
+    >>> np.set_string_function(lambda x:'random', repr=False)
+    >>> x.__str__()
+    'random'
+    >>> x.__repr__()
+    'array([0, 1, 2, 3])'
+
+    """
+    if f is None:
+        if repr:
+            return multiarray.set_string_function(_default_array_repr, 1)
+        else:
+            return multiarray.set_string_function(_default_array_str, 0)
+    else:
+        return multiarray.set_string_function(f, repr)

.venv/lib/python3.11/site-packages/numpy/core/arrayprint.pyi

@@ -0,0 +1,142 @@
+from types import TracebackType
+from collections.abc import Callable
+from typing import Any, Literal, TypedDict, SupportsIndex
+
+# Using a private class is by no means ideal, but it is simply a consequence
+# of a `contextlib.context` returning an instance of aforementioned class
+from contextlib import _GeneratorContextManager
+
+from numpy import (
+    ndarray,
+    generic,
+    bool_,
+    integer,
+    timedelta64,
+    datetime64,
+    floating,
+    complexfloating,
+    void,
+    str_,
+    bytes_,
+    longdouble,
+    clongdouble,
+)
+from numpy._typing import ArrayLike, _CharLike_co, _FloatLike_co
+
+_FloatMode = Literal["fixed", "unique", "maxprec", "maxprec_equal"]
+
+class _FormatDict(TypedDict, total=False):
+    bool: Callable[[bool_], str]
+    int: Callable[[integer[Any]], str]
+    timedelta: Callable[[timedelta64], str]
+    datetime: Callable[[datetime64], str]
+    float: Callable[[floating[Any]], str]
+    longfloat: Callable[[longdouble], str]
+    complexfloat: Callable[[complexfloating[Any, Any]], str]
+    longcomplexfloat: Callable[[clongdouble], str]
+    void: Callable[[void], str]
+    numpystr: Callable[[_CharLike_co], str]
+    object: Callable[[object], str]
+    all: Callable[[object], str]
+    int_kind: Callable[[integer[Any]], str]
+    float_kind: Callable[[floating[Any]], str]
+    complex_kind: Callable[[complexfloating[Any, Any]], str]
+    str_kind: Callable[[_CharLike_co], str]
+
+class _FormatOptions(TypedDict):
+    precision: int
+    threshold: int
+    edgeitems: int
+    linewidth: int
+    suppress: bool
+    nanstr: str
+    infstr: str
+    formatter: None | _FormatDict
+    sign: Literal["-", "+", " "]
+    floatmode: _FloatMode
+    legacy: Literal[False, "1.13", "1.21"]
+
+def set_printoptions(
+    precision: None | SupportsIndex = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    linewidth: None | int = ...,
+    suppress: None | bool = ...,
+    nanstr: None | str = ...,
+    infstr: None | str = ...,
+    formatter: None | _FormatDict = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    *,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...
+) -> None: ...
+def get_printoptions() -> _FormatOptions: ...
+def array2string(
+    a: ndarray[Any, Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+    separator: str = ...,
+    prefix: str = ...,
+    # NOTE: With the `style` argument being deprecated,
+    # all arguments between `formatter` and `suffix` are de facto
+    # keyworld-only arguments
+    *,
+    formatter: None | _FormatDict = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    suffix: str = ...,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...,
+) -> str: ...
+def format_float_scientific(
+    x: _FloatLike_co,
+    precision: None | int = ...,
+    unique: bool = ...,
+    trim: Literal["k", ".", "0", "-"] = ...,
+    sign: bool = ...,
+    pad_left: None | int = ...,
+    exp_digits: None | int = ...,
+    min_digits: None | int = ...,
+) -> str: ...
+def format_float_positional(
+    x: _FloatLike_co,
+    precision: None | int = ...,
+    unique: bool = ...,
+    fractional: bool = ...,
+    trim: Literal["k", ".", "0", "-"] = ...,
+    sign: bool = ...,
+    pad_left: None | int = ...,
+    pad_right: None | int = ...,
+    min_digits: None | int = ...,
+) -> str: ...
+def array_repr(
+    arr: ndarray[Any, Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+) -> str: ...
+def array_str(
+    a: ndarray[Any, Any],
+    max_line_width: None | int = ...,
+    precision: None | SupportsIndex = ...,
+    suppress_small: None | bool = ...,
+) -> str: ...
+def set_string_function(
+    f: None | Callable[[ndarray[Any, Any]], str], repr: bool = ...
+) -> None: ...
+def printoptions(
+    precision: None | SupportsIndex = ...,
+    threshold: None | int = ...,
+    edgeitems: None | int = ...,
+    linewidth: None | int = ...,
+    suppress: None | bool = ...,
+    nanstr: None | str = ...,
+    infstr: None | str = ...,
+    formatter: None | _FormatDict = ...,
+    sign: Literal[None, "-", "+", " "] = ...,
+    floatmode: None | _FloatMode = ...,
+    *,
+    legacy: Literal[None, False, "1.13", "1.21"] = ...
+) -> _GeneratorContextManager[_FormatOptions]: ...

.venv/lib/python3.11/site-packages/numpy/core/defchararray.py

@@ -0,0 +1,2914 @@
+"""
+This module contains a set of functions for vectorized string
+operations and methods.
+
+.. note::
+   The `chararray` class exists for backwards compatibility with
+   Numarray, it is not recommended for new development. Starting from numpy
+   1.4, if one needs arrays of strings, it is recommended to use arrays of
+   `dtype` `object_`, `bytes_` or `str_`, and use the free functions
+   in the `numpy.char` module for fast vectorized string operations.
+
+Some methods will only be available if the corresponding string method is
+available in your version of Python.
+
+The preferred alias for `defchararray` is `numpy.char`.
+
+"""
+import functools
+
+from .._utils import set_module
+from .numerictypes import (
+    bytes_, str_, integer, int_, object_, bool_, character)
+from .numeric import ndarray, compare_chararrays
+from .numeric import array as narray
+from numpy.core.multiarray import _vec_string
+from numpy.core import overrides
+from numpy.compat import asbytes
+import numpy
+
+__all__ = [
+    'equal', 'not_equal', 'greater_equal', 'less_equal',
+    'greater', 'less', 'str_len', 'add', 'multiply', 'mod', 'capitalize',
+    'center', 'count', 'decode', 'encode', 'endswith', 'expandtabs',
+    'find', 'index', 'isalnum', 'isalpha', 'isdigit', 'islower', 'isspace',
+    'istitle', 'isupper', 'join', 'ljust', 'lower', 'lstrip', 'partition',
+    'replace', 'rfind', 'rindex', 'rjust', 'rpartition', 'rsplit',
+    'rstrip', 'split', 'splitlines', 'startswith', 'strip', 'swapcase',
+    'title', 'translate', 'upper', 'zfill', 'isnumeric', 'isdecimal',
+    'array', 'asarray'
+    ]
+
+
+_globalvar = 0
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy.char')
+
+
+def _is_unicode(arr):
+    """Returns True if arr is a string or a string array with a dtype that
+    represents a unicode string, otherwise returns False.
+
+    """
+    if (isinstance(arr, str) or
+            issubclass(numpy.asarray(arr).dtype.type, str)):
+        return True
+    return False
+
+
+def _to_bytes_or_str_array(result, output_dtype_like=None):
+    """
+    Helper function to cast a result back into an array
+    with the appropriate dtype if an object array must be used
+    as an intermediary.
+    """
+    ret = numpy.asarray(result.tolist())
+    dtype = getattr(output_dtype_like, 'dtype', None)
+    if dtype is not None:
+        return ret.astype(type(dtype)(_get_num_chars(ret)), copy=False)
+    return ret
+
+
+def _clean_args(*args):
+    """
+    Helper function for delegating arguments to Python string
+    functions.
+
+    Many of the Python string operations that have optional arguments
+    do not use 'None' to indicate a default value.  In these cases,
+    we need to remove all None arguments, and those following them.
+    """
+    newargs = []
+    for chk in args:
+        if chk is None:
+            break
+        newargs.append(chk)
+    return newargs
+
+def _get_num_chars(a):
+    """
+    Helper function that returns the number of characters per field in
+    a string or unicode array.  This is to abstract out the fact that
+    for a unicode array this is itemsize / 4.
+    """
+    if issubclass(a.dtype.type, str_):
+        return a.itemsize // 4
+    return a.itemsize
+
+
+def _binary_op_dispatcher(x1, x2):
+    return (x1, x2)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def equal(x1, x2):
+    """
+    Return (x1 == x2) element-wise.
+
+    Unlike `numpy.equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    not_equal, greater_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '==', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def not_equal(x1, x2):
+    """
+    Return (x1 != x2) element-wise.
+
+    Unlike `numpy.not_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, greater_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '!=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater_equal(x1, x2):
+    """
+    Return (x1 >= x2) element-wise.
+
+    Unlike `numpy.greater_equal`, this comparison is performed by
+    first stripping whitespace characters from the end of the string.
+    This behavior is provided for backward-compatibility with
+    numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, less_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '>=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less_equal(x1, x2):
+    """
+    Return (x1 <= x2) element-wise.
+
+    Unlike `numpy.less_equal`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, greater, less
+    """
+    return compare_chararrays(x1, x2, '<=', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def greater(x1, x2):
+    """
+    Return (x1 > x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, less
+    """
+    return compare_chararrays(x1, x2, '>', True)
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def less(x1, x2):
+    """
+    Return (x1 < x2) element-wise.
+
+    Unlike `numpy.greater`, this comparison is performed by first
+    stripping whitespace characters from the end of the string.  This
+    behavior is provided for backward-compatibility with numarray.
+
+    Parameters
+    ----------
+    x1, x2 : array_like of str or unicode
+        Input arrays of the same shape.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools.
+
+    See Also
+    --------
+    equal, not_equal, greater_equal, less_equal, greater
+    """
+    return compare_chararrays(x1, x2, '<', True)
+
+
+def _unary_op_dispatcher(a):
+    return (a,)
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def str_len(a):
+    """
+    Return len(a) element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of integers
+
+    See Also
+    --------
+    len
+
+    Examples
+    --------
+    >>> a = np.array(['Grace Hopper Conference', 'Open Source Day'])
+    >>> np.char.str_len(a)
+    array([23, 15])
+    >>> a = np.array([u'\u0420', u'\u043e'])
+    >>> np.char.str_len(a)
+    array([1, 1])
+    >>> a = np.array([['hello', 'world'], [u'\u0420', u'\u043e']])
+    >>> np.char.str_len(a)
+    array([[5, 5], [1, 1]])
+    """
+    # Note: __len__, etc. currently return ints, which are not C-integers.
+    # Generally intp would be expected for lengths, although int is sufficient
+    # due to the dtype itemsize limitation.
+    return _vec_string(a, int_, '__len__')
+
+
+@array_function_dispatch(_binary_op_dispatcher)
+def add(x1, x2):
+    """
+    Return element-wise string concatenation for two arrays of str or unicode.
+
+    Arrays `x1` and `x2` must have the same shape.
+
+    Parameters
+    ----------
+    x1 : array_like of str or unicode
+        Input array.
+    x2 : array_like of str or unicode
+        Input array.
+
+    Returns
+    -------
+    add : ndarray
+        Output array of `bytes_` or `str_`, depending on input types
+        of the same shape as `x1` and `x2`.
+
+    """
+    arr1 = numpy.asarray(x1)
+    arr2 = numpy.asarray(x2)
+    out_size = _get_num_chars(arr1) + _get_num_chars(arr2)
+
+    if type(arr1.dtype) != type(arr2.dtype):
+        # Enforce this for now.  The solution to it will be implement add
+        # as a ufunc.  It never worked right on Python 3: bytes + unicode gave
+        # nonsense unicode + bytes errored, and unicode + object used the
+        # object dtype itemsize as num chars (worked on short strings).
+        # bytes + void worked but promoting void->bytes is dubious also.
+        raise TypeError(
+            "np.char.add() requires both arrays of the same dtype kind, but "
+            f"got dtypes: '{arr1.dtype}' and '{arr2.dtype}' (the few cases "
+            "where this used to work often lead to incorrect results).")
+
+    return _vec_string(arr1, type(arr1.dtype)(out_size), '__add__', (arr2,))
+
+def _multiply_dispatcher(a, i):
+    return (a,)
+
+
+@array_function_dispatch(_multiply_dispatcher)
+def multiply(a, i):
+    """
+    Return (a * i), that is string multiple concatenation,
+    element-wise.
+
+    Values in `i` of less than 0 are treated as 0 (which yields an
+    empty string).
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    i : array_like of ints
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+    
+    Examples
+    --------
+    >>> a = np.array(["a", "b", "c"])
+    >>> np.char.multiply(x, 3)
+    array(['aaa', 'bbb', 'ccc'], dtype='<U3')
+    >>> i = np.array([1, 2, 3])
+    >>> np.char.multiply(a, i)
+    array(['a', 'bb', 'ccc'], dtype='<U3')
+    >>> np.char.multiply(np.array(['a']), i)
+    array(['a', 'aa', 'aaa'], dtype='<U3')
+    >>> a = np.array(['a', 'b', 'c', 'd', 'e', 'f']).reshape((2, 3))
+    >>> np.char.multiply(a, 3)
+    array([['aaa', 'bbb', 'ccc'],
+           ['ddd', 'eee', 'fff']], dtype='<U3')
+    >>> np.char.multiply(a, i)
+    array([['a', 'bb', 'ccc'],
+           ['d', 'ee', 'fff']], dtype='<U3')
+    """
+    a_arr = numpy.asarray(a)
+    i_arr = numpy.asarray(i)
+    if not issubclass(i_arr.dtype.type, integer):
+        raise ValueError("Can only multiply by integers")
+    out_size = _get_num_chars(a_arr) * max(int(i_arr.max()), 0)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(out_size), '__mul__', (i_arr,))
+
+
+def _mod_dispatcher(a, values):
+    return (a, values)
+
+
+@array_function_dispatch(_mod_dispatcher)
+def mod(a, values):
+    """
+    Return (a % i), that is pre-Python 2.6 string formatting
+    (interpolation), element-wise for a pair of array_likes of str
+    or unicode.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    values : array_like of values
+       These values will be element-wise interpolated into the string.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+
+    See Also
+    --------
+    str.__mod__
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, '__mod__', (values,)), a)
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def capitalize(a):
+    """
+    Return a copy of `a` with only the first character of each element
+    capitalized.
+
+    Calls `str.capitalize` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array of strings to capitalize.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input
+        types
+
+    See Also
+    --------
+    str.capitalize
+
+    Examples
+    --------
+    >>> c = np.array(['a1b2','1b2a','b2a1','2a1b'],'S4'); c
+    array(['a1b2', '1b2a', 'b2a1', '2a1b'],
+        dtype='|S4')
+    >>> np.char.capitalize(c)
+    array(['A1b2', '1b2a', 'B2a1', '2a1b'],
+        dtype='|S4')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'capitalize')
+
+
+def _center_dispatcher(a, width, fillchar=None):
+    return (a,)
+
+
+@array_function_dispatch(_center_dispatcher)
+def center(a, width, fillchar=' '):
+    """
+    Return a copy of `a` with its elements centered in a string of
+    length `width`.
+
+    Calls `str.center` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The padding character to use (default is space).
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input
+        types
+
+    See Also
+    --------
+    str.center
+    
+    Notes
+    -----
+    This function is intended to work with arrays of strings.  The
+    fill character is not applied to numeric types.
+
+    Examples
+    --------
+    >>> c = np.array(['a1b2','1b2a','b2a1','2a1b']); c
+    array(['a1b2', '1b2a', 'b2a1', '2a1b'], dtype='<U4')
+    >>> np.char.center(c, width=9)
+    array(['   a1b2  ', '   1b2a  ', '   b2a1  ', '   2a1b  '], dtype='<U9')
+    >>> np.char.center(c, width=9, fillchar='*')
+    array(['***a1b2**', '***1b2a**', '***b2a1**', '***2a1b**'], dtype='<U9')
+    >>> np.char.center(c, width=1)
+    array(['a', '1', 'b', '2'], dtype='<U1')
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'center', (width_arr, fillchar))
+
+
+def _count_dispatcher(a, sub, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_count_dispatcher)
+def count(a, sub, start=0, end=None):
+    """
+    Returns an array with the number of non-overlapping occurrences of
+    substring `sub` in the range [`start`, `end`].
+
+    Calls `str.count` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+       The substring to search for.
+
+    start, end : int, optional
+       Optional arguments `start` and `end` are interpreted as slice
+       notation to specify the range in which to count.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ints.
+
+    See Also
+    --------
+    str.count
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> np.char.count(c, 'A')
+    array([3, 1, 1])
+    >>> np.char.count(c, 'aA')
+    array([3, 1, 0])
+    >>> np.char.count(c, 'A', start=1, end=4)
+    array([2, 1, 1])
+    >>> np.char.count(c, 'A', start=1, end=3)
+    array([1, 0, 0])
+
+    """
+    return _vec_string(a, int_, 'count', [sub, start] + _clean_args(end))
+
+
+def _code_dispatcher(a, encoding=None, errors=None):
+    return (a,)
+
+
+@array_function_dispatch(_code_dispatcher)
+def decode(a, encoding=None, errors=None):
+    r"""
+    Calls ``bytes.decode`` element-wise.
+
+    The set of available codecs comes from the Python standard library,
+    and may be extended at runtime.  For more information, see the
+    :mod:`codecs` module.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    encoding : str, optional
+       The name of an encoding
+
+    errors : str, optional
+       Specifies how to handle encoding errors
+
+    Returns
+    -------
+    out : ndarray
+
+    See Also
+    --------
+    :py:meth:`bytes.decode`
+
+    Notes
+    -----
+    The type of the result will depend on the encoding specified.
+
+    Examples
+    --------
+    >>> c = np.array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@',
+    ...               b'\x81\x82\xc2\xc1\xc2\x82\x81'])
+    >>> c
+    array([b'\x81\xc1\x81\xc1\x81\xc1', b'@@\x81\xc1@@',
+    ...    b'\x81\x82\xc2\xc1\xc2\x82\x81'], dtype='|S7')
+    >>> np.char.decode(c, encoding='cp037')
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'decode', _clean_args(encoding, errors)))
+
+
+@array_function_dispatch(_code_dispatcher)
+def encode(a, encoding=None, errors=None):
+    """
+    Calls `str.encode` element-wise.
+
+    The set of available codecs comes from the Python standard library,
+    and may be extended at runtime. For more information, see the codecs
+    module.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    encoding : str, optional
+       The name of an encoding
+
+    errors : str, optional
+       Specifies how to handle encoding errors
+
+    Returns
+    -------
+    out : ndarray
+
+    See Also
+    --------
+    str.encode
+
+    Notes
+    -----
+    The type of the result will depend on the encoding specified.
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'encode', _clean_args(encoding, errors)))
+
+
+def _endswith_dispatcher(a, suffix, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_endswith_dispatcher)
+def endswith(a, suffix, start=0, end=None):
+    """
+    Returns a boolean array which is `True` where the string element
+    in `a` ends with `suffix`, otherwise `False`.
+
+    Calls `str.endswith` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    suffix : str
+
+    start, end : int, optional
+        With optional `start`, test beginning at that position. With
+        optional `end`, stop comparing at that position.
+
+    Returns
+    -------
+    out : ndarray
+        Outputs an array of bools.
+
+    See Also
+    --------
+    str.endswith
+
+    Examples
+    --------
+    >>> s = np.array(['foo', 'bar'])
+    >>> s[0] = 'foo'
+    >>> s[1] = 'bar'
+    >>> s
+    array(['foo', 'bar'], dtype='<U3')
+    >>> np.char.endswith(s, 'ar')
+    array([False,  True])
+    >>> np.char.endswith(s, 'a', start=1, end=2)
+    array([False,  True])
+
+    """
+    return _vec_string(
+        a, bool_, 'endswith', [suffix, start] + _clean_args(end))
+
+
+def _expandtabs_dispatcher(a, tabsize=None):
+    return (a,)
+
+
+@array_function_dispatch(_expandtabs_dispatcher)
+def expandtabs(a, tabsize=8):
+    """
+    Return a copy of each string element where all tab characters are
+    replaced by one or more spaces.
+
+    Calls `str.expandtabs` element-wise.
+
+    Return a copy of each string element where all tab characters are
+    replaced by one or more spaces, depending on the current column
+    and the given `tabsize`. The column number is reset to zero after
+    each newline occurring in the string. This doesn't understand other
+    non-printing characters or escape sequences.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array
+    tabsize : int, optional
+        Replace tabs with `tabsize` number of spaces.  If not given defaults
+        to 8 spaces.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.expandtabs
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'expandtabs', (tabsize,)), a)
+
+
+@array_function_dispatch(_count_dispatcher)
+def find(a, sub, start=0, end=None):
+    """
+    For each element, return the lowest index in the string where
+    substring `sub` is found.
+
+    Calls `str.find` element-wise.
+
+    For each element, return the lowest index in the string where
+    substring `sub` is found, such that `sub` is contained in the
+    range [`start`, `end`].
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+        Optional arguments `start` and `end` are interpreted as in
+        slice notation.
+
+    Returns
+    -------
+    out : ndarray or int
+        Output array of ints.  Returns -1 if `sub` is not found.
+
+    See Also
+    --------
+    str.find
+
+    Examples
+    --------
+    >>> a = np.array(["NumPy is a Python library"])
+    >>> np.char.find(a, "Python", start=0, end=None)
+    array([11])
+
+    """
+    return _vec_string(
+        a, int_, 'find', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_count_dispatcher)
+def index(a, sub, start=0, end=None):
+    """
+    Like `find`, but raises `ValueError` when the substring is not found.
+
+    Calls `str.index` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+
+    Returns
+    -------
+    out : ndarray
+        Output array of ints.  Returns -1 if `sub` is not found.
+
+    See Also
+    --------
+    find, str.find
+
+    Examples
+    --------
+    >>> a = np.array(["Computer Science"])
+    >>> np.char.index(a, "Science", start=0, end=None)
+    array([9])
+
+    """
+    return _vec_string(
+        a, int_, 'index', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isalnum(a):
+    """
+    Returns true for each element if all characters in the string are
+    alphanumeric and there is at least one character, false otherwise.
+
+    Calls `str.isalnum` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.isalnum
+    """
+    return _vec_string(a, bool_, 'isalnum')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isalpha(a):
+    """
+    Returns true for each element if all characters in the string are
+    alphabetic and there is at least one character, false otherwise.
+
+    Calls `str.isalpha` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isalpha
+    """
+    return _vec_string(a, bool_, 'isalpha')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isdigit(a):
+    """
+    Returns true for each element if all characters in the string are
+    digits and there is at least one character, false otherwise.
+
+    Calls `str.isdigit` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isdigit
+
+    Examples
+    --------
+    >>> a = np.array(['a', 'b', '0'])
+    >>> np.char.isdigit(a)
+    array([False, False,  True])
+    >>> a = np.array([['a', 'b', '0'], ['c', '1', '2']])
+    >>> np.char.isdigit(a)
+    array([[False, False,  True], [False,  True,  True]])
+    """
+    return _vec_string(a, bool_, 'isdigit')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def islower(a):
+    """
+    Returns true for each element if all cased characters in the
+    string are lowercase and there is at least one cased character,
+    false otherwise.
+
+    Calls `str.islower` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.islower
+    """
+    return _vec_string(a, bool_, 'islower')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isspace(a):
+    """
+    Returns true for each element if there are only whitespace
+    characters in the string and there is at least one character,
+    false otherwise.
+
+    Calls `str.isspace` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isspace
+    """
+    return _vec_string(a, bool_, 'isspace')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def istitle(a):
+    """
+    Returns true for each element if the element is a titlecased
+    string and there is at least one character, false otherwise.
+
+    Call `str.istitle` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.istitle
+    """
+    return _vec_string(a, bool_, 'istitle')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isupper(a):
+    """
+    Return true for each element if all cased characters in the
+    string are uppercase and there is at least one character, false
+    otherwise.
+
+    Call `str.isupper` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of bools
+
+    See Also
+    --------
+    str.isupper
+
+    Examples
+    --------
+    >>> str = "GHC"
+    >>> np.char.isupper(str)
+    array(True)     
+    >>> a = np.array(["hello", "HELLO", "Hello"])
+    >>> np.char.isupper(a)
+    array([False,  True, False]) 
+
+    """
+    return _vec_string(a, bool_, 'isupper')
+
+
+def _join_dispatcher(sep, seq):
+    return (sep, seq)
+
+
+@array_function_dispatch(_join_dispatcher)
+def join(sep, seq):
+    """
+    Return a string which is the concatenation of the strings in the
+    sequence `seq`.
+
+    Calls `str.join` element-wise.
+
+    Parameters
+    ----------
+    sep : array_like of str or unicode
+    seq : array_like of str or unicode
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input types
+
+    See Also
+    --------
+    str.join
+
+    Examples
+    --------
+    >>> np.char.join('-', 'osd')
+    array('o-s-d', dtype='<U5')
+
+    >>> np.char.join(['-', '.'], ['ghc', 'osd'])
+    array(['g-h-c', 'o.s.d'], dtype='<U5')
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(sep, object_, 'join', (seq,)), seq)
+
+
+
+def _just_dispatcher(a, width, fillchar=None):
+    return (a,)
+
+
+@array_function_dispatch(_just_dispatcher)
+def ljust(a, width, fillchar=' '):
+    """
+    Return an array with the elements of `a` left-justified in a
+    string of length `width`.
+
+    Calls `str.ljust` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The character to use for padding
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.ljust
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'ljust', (width_arr, fillchar))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def lower(a):
+    """
+    Return an array with the elements converted to lowercase.
+
+    Call `str.lower` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.lower
+
+    Examples
+    --------
+    >>> c = np.array(['A1B C', '1BCA', 'BCA1']); c
+    array(['A1B C', '1BCA', 'BCA1'], dtype='<U5')
+    >>> np.char.lower(c)
+    array(['a1b c', '1bca', 'bca1'], dtype='<U5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'lower')
+
+
+def _strip_dispatcher(a, chars=None):
+    return (a,)
+
+
+@array_function_dispatch(_strip_dispatcher)
+def lstrip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the leading characters
+    removed.
+
+    Calls `str.lstrip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like, {str, unicode}
+        Input array.
+
+    chars : {str, unicode}, optional
+        The `chars` argument is a string specifying the set of
+        characters to be removed. If omitted or None, the `chars`
+        argument defaults to removing whitespace. The `chars` argument
+        is not a prefix; rather, all combinations of its values are
+        stripped.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.lstrip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+
+    The 'a' variable is unstripped from c[1] because whitespace leading.
+
+    >>> np.char.lstrip(c, 'a')
+    array(['AaAaA', '  aA  ', 'bBABba'], dtype='<U7')
+
+
+    >>> np.char.lstrip(c, 'A') # leaves c unchanged
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, '')).all()
+    ... # XXX: is this a regression? This used to return True
+    ... # np.char.lstrip(c,'') does not modify c at all.
+    False
+    >>> (np.char.lstrip(c, ' ') == np.char.lstrip(c, None)).all()
+    True
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'lstrip', (chars,))
+
+
+def _partition_dispatcher(a, sep):
+    return (a,)
+
+
+@array_function_dispatch(_partition_dispatcher)
+def partition(a, sep):
+    """
+    Partition each element in `a` around `sep`.
+
+    Calls `str.partition` element-wise.
+
+    For each element in `a`, split the element as the first
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array
+    sep : {str, unicode}
+        Separator to split each string element in `a`.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type.
+        The output array will have an extra dimension with 3
+        elements per input element.
+
+    See Also
+    --------
+    str.partition
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'partition', (sep,)), a)
+
+
+def _replace_dispatcher(a, old, new, count=None):
+    return (a,)
+
+
+@array_function_dispatch(_replace_dispatcher)
+def replace(a, old, new, count=None):
+    """
+    For each element in `a`, return a copy of the string with all
+    occurrences of substring `old` replaced by `new`.
+
+    Calls `str.replace` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    old, new : str or unicode
+
+    count : int, optional
+        If the optional argument `count` is given, only the first
+        `count` occurrences are replaced.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.replace
+    
+    Examples
+    --------
+    >>> a = np.array(["That is a mango", "Monkeys eat mangos"])
+    >>> np.char.replace(a, 'mango', 'banana')
+    array(['That is a banana', 'Monkeys eat bananas'], dtype='<U19')
+
+    >>> a = np.array(["The dish is fresh", "This is it"])
+    >>> np.char.replace(a, 'is', 'was')
+    array(['The dwash was fresh', 'Thwas was it'], dtype='<U19')
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'replace', [old, new] + _clean_args(count)), a)
+
+
+@array_function_dispatch(_count_dispatcher)
+def rfind(a, sub, start=0, end=None):
+    """
+    For each element in `a`, return the highest index in the string
+    where substring `sub` is found, such that `sub` is contained
+    within [`start`, `end`].
+
+    Calls `str.rfind` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+        Optional arguments `start` and `end` are interpreted as in
+        slice notation.
+
+    Returns
+    -------
+    out : ndarray
+       Output array of ints.  Return -1 on failure.
+
+    See Also
+    --------
+    str.rfind
+
+    """
+    return _vec_string(
+        a, int_, 'rfind', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_count_dispatcher)
+def rindex(a, sub, start=0, end=None):
+    """
+    Like `rfind`, but raises `ValueError` when the substring `sub` is
+    not found.
+
+    Calls `str.rindex` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    sub : str or unicode
+
+    start, end : int, optional
+
+    Returns
+    -------
+    out : ndarray
+       Output array of ints.
+
+    See Also
+    --------
+    rfind, str.rindex
+
+    """
+    return _vec_string(
+        a, int_, 'rindex', [sub, start] + _clean_args(end))
+
+
+@array_function_dispatch(_just_dispatcher)
+def rjust(a, width, fillchar=' '):
+    """
+    Return an array with the elements of `a` right-justified in a
+    string of length `width`.
+
+    Calls `str.rjust` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    width : int
+        The length of the resulting strings
+    fillchar : str or unicode, optional
+        The character to use for padding
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.rjust
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    if numpy.issubdtype(a_arr.dtype, numpy.bytes_):
+        fillchar = asbytes(fillchar)
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'rjust', (width_arr, fillchar))
+
+
+@array_function_dispatch(_partition_dispatcher)
+def rpartition(a, sep):
+    """
+    Partition (split) each element around the right-most separator.
+
+    Calls `str.rpartition` element-wise.
+
+    For each element in `a`, split the element as the last
+    occurrence of `sep`, and return 3 strings containing the part
+    before the separator, the separator itself, and the part after
+    the separator. If the separator is not found, return 3 strings
+    containing the string itself, followed by two empty strings.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+        Input array
+    sep : str or unicode
+        Right-most separator to split each element in array.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of string or unicode, depending on input
+        type.  The output array will have an extra dimension with
+        3 elements per input element.
+
+    See Also
+    --------
+    str.rpartition
+
+    """
+    return _to_bytes_or_str_array(
+        _vec_string(a, object_, 'rpartition', (sep,)), a)
+
+
+def _split_dispatcher(a, sep=None, maxsplit=None):
+    return (a,)
+
+
+@array_function_dispatch(_split_dispatcher)
+def rsplit(a, sep=None, maxsplit=None):
+    """
+    For each element in `a`, return a list of the words in the
+    string, using `sep` as the delimiter string.
+
+    Calls `str.rsplit` element-wise.
+
+    Except for splitting from the right, `rsplit`
+    behaves like `split`.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sep : str or unicode, optional
+        If `sep` is not specified or None, any whitespace string
+        is a separator.
+    maxsplit : int, optional
+        If `maxsplit` is given, at most `maxsplit` splits are done,
+        the rightmost ones.
+
+    Returns
+    -------
+    out : ndarray
+       Array of list objects
+
+    See Also
+    --------
+    str.rsplit, split
+
+    """
+    # This will return an array of lists of different sizes, so we
+    # leave it as an object array
+    return _vec_string(
+        a, object_, 'rsplit', [sep] + _clean_args(maxsplit))
+
+
+def _strip_dispatcher(a, chars=None):
+    return (a,)
+
+
+@array_function_dispatch(_strip_dispatcher)
+def rstrip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the trailing
+    characters removed.
+
+    Calls `str.rstrip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    chars : str or unicode, optional
+       The `chars` argument is a string specifying the set of
+       characters to be removed. If omitted or None, the `chars`
+       argument defaults to removing whitespace. The `chars` argument
+       is not a suffix; rather, all combinations of its values are
+       stripped.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.rstrip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', 'abBABba'], dtype='S7'); c
+    array(['aAaAaA', 'abBABba'],
+        dtype='|S7')
+    >>> np.char.rstrip(c, b'a')
+    array(['aAaAaA', 'abBABb'],
+        dtype='|S7')
+    >>> np.char.rstrip(c, b'A')
+    array(['aAaAa', 'abBABba'],
+        dtype='|S7')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'rstrip', (chars,))
+
+
+@array_function_dispatch(_split_dispatcher)
+def split(a, sep=None, maxsplit=None):
+    """
+    For each element in `a`, return a list of the words in the
+    string, using `sep` as the delimiter string.
+
+    Calls `str.split` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    sep : str or unicode, optional
+       If `sep` is not specified or None, any whitespace string is a
+       separator.
+
+    maxsplit : int, optional
+        If `maxsplit` is given, at most `maxsplit` splits are done.
+
+    Returns
+    -------
+    out : ndarray
+        Array of list objects
+
+    See Also
+    --------
+    str.split, rsplit
+
+    """
+    # This will return an array of lists of different sizes, so we
+    # leave it as an object array
+    return _vec_string(
+        a, object_, 'split', [sep] + _clean_args(maxsplit))
+
+
+def _splitlines_dispatcher(a, keepends=None):
+    return (a,)
+
+
+@array_function_dispatch(_splitlines_dispatcher)
+def splitlines(a, keepends=None):
+    """
+    For each element in `a`, return a list of the lines in the
+    element, breaking at line boundaries.
+
+    Calls `str.splitlines` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    keepends : bool, optional
+        Line breaks are not included in the resulting list unless
+        keepends is given and true.
+
+    Returns
+    -------
+    out : ndarray
+        Array of list objects
+
+    See Also
+    --------
+    str.splitlines
+
+    """
+    return _vec_string(
+        a, object_, 'splitlines', _clean_args(keepends))
+
+
+def _startswith_dispatcher(a, prefix, start=None, end=None):
+    return (a,)
+
+
+@array_function_dispatch(_startswith_dispatcher)
+def startswith(a, prefix, start=0, end=None):
+    """
+    Returns a boolean array which is `True` where the string element
+    in `a` starts with `prefix`, otherwise `False`.
+
+    Calls `str.startswith` element-wise.
+
+    Parameters
+    ----------
+    a : array_like of str or unicode
+
+    prefix : str
+
+    start, end : int, optional
+        With optional `start`, test beginning at that position. With
+        optional `end`, stop comparing at that position.
+
+    Returns
+    -------
+    out : ndarray
+        Array of booleans
+
+    See Also
+    --------
+    str.startswith
+
+    """
+    return _vec_string(
+        a, bool_, 'startswith', [prefix, start] + _clean_args(end))
+
+
+@array_function_dispatch(_strip_dispatcher)
+def strip(a, chars=None):
+    """
+    For each element in `a`, return a copy with the leading and
+    trailing characters removed.
+
+    Calls `str.strip` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    chars : str or unicode, optional
+       The `chars` argument is a string specifying the set of
+       characters to be removed. If omitted or None, the `chars`
+       argument defaults to removing whitespace. The `chars` argument
+       is not a prefix or suffix; rather, all combinations of its
+       values are stripped.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.strip
+
+    Examples
+    --------
+    >>> c = np.array(['aAaAaA', '  aA  ', 'abBABba'])
+    >>> c
+    array(['aAaAaA', '  aA  ', 'abBABba'], dtype='<U7')
+    >>> np.char.strip(c)
+    array(['aAaAaA', 'aA', 'abBABba'], dtype='<U7')
+    >>> np.char.strip(c, 'a') # 'a' unstripped from c[1] because whitespace leads
+    array(['AaAaA', '  aA  ', 'bBABb'], dtype='<U7')
+    >>> np.char.strip(c, 'A') # 'A' unstripped from c[1] because (unprinted) ws trails
+    array(['aAaAa', '  aA  ', 'abBABba'], dtype='<U7')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'strip', _clean_args(chars))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def swapcase(a):
+    """
+    Return element-wise a copy of the string with
+    uppercase characters converted to lowercase and vice versa.
+
+    Calls `str.swapcase` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.swapcase
+
+    Examples
+    --------
+    >>> c=np.array(['a1B c','1b Ca','b Ca1','cA1b'],'S5'); c
+    array(['a1B c', '1b Ca', 'b Ca1', 'cA1b'],
+        dtype='|S5')
+    >>> np.char.swapcase(c)
+    array(['A1b C', '1B cA', 'B cA1', 'Ca1B'],
+        dtype='|S5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'swapcase')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def title(a):
+    """
+    Return element-wise title cased version of string or unicode.
+
+    Title case words start with uppercase characters, all remaining cased
+    characters are lowercase.
+
+    Calls `str.title` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.title
+
+    Examples
+    --------
+    >>> c=np.array(['a1b c','1b ca','b ca1','ca1b'],'S5'); c
+    array(['a1b c', '1b ca', 'b ca1', 'ca1b'],
+        dtype='|S5')
+    >>> np.char.title(c)
+    array(['A1B C', '1B Ca', 'B Ca1', 'Ca1B'],
+        dtype='|S5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'title')
+
+
+def _translate_dispatcher(a, table, deletechars=None):
+    return (a,)
+
+
+@array_function_dispatch(_translate_dispatcher)
+def translate(a, table, deletechars=None):
+    """
+    For each element in `a`, return a copy of the string where all
+    characters occurring in the optional argument `deletechars` are
+    removed, and the remaining characters have been mapped through the
+    given translation table.
+
+    Calls `str.translate` element-wise.
+
+    Parameters
+    ----------
+    a : array-like of str or unicode
+
+    table : str of length 256
+
+    deletechars : str
+
+    Returns
+    -------
+    out : ndarray
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.translate
+
+    """
+    a_arr = numpy.asarray(a)
+    if issubclass(a_arr.dtype.type, str_):
+        return _vec_string(
+            a_arr, a_arr.dtype, 'translate', (table,))
+    else:
+        return _vec_string(
+            a_arr, a_arr.dtype, 'translate', [table] + _clean_args(deletechars))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def upper(a):
+    """
+    Return an array with the elements converted to uppercase.
+
+    Calls `str.upper` element-wise.
+
+    For 8-bit strings, this method is locale-dependent.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.upper
+
+    Examples
+    --------
+    >>> c = np.array(['a1b c', '1bca', 'bca1']); c
+    array(['a1b c', '1bca', 'bca1'], dtype='<U5')
+    >>> np.char.upper(c)
+    array(['A1B C', '1BCA', 'BCA1'], dtype='<U5')
+
+    """
+    a_arr = numpy.asarray(a)
+    return _vec_string(a_arr, a_arr.dtype, 'upper')
+
+
+def _zfill_dispatcher(a, width):
+    return (a,)
+
+
+@array_function_dispatch(_zfill_dispatcher)
+def zfill(a, width):
+    """
+    Return the numeric string left-filled with zeros
+
+    Calls `str.zfill` element-wise.
+
+    Parameters
+    ----------
+    a : array_like, {str, unicode}
+        Input array.
+    width : int
+        Width of string to left-fill elements in `a`.
+
+    Returns
+    -------
+    out : ndarray, {str, unicode}
+        Output array of str or unicode, depending on input type
+
+    See Also
+    --------
+    str.zfill
+
+    """
+    a_arr = numpy.asarray(a)
+    width_arr = numpy.asarray(width)
+    size = int(numpy.max(width_arr.flat))
+    return _vec_string(
+        a_arr, type(a_arr.dtype)(size), 'zfill', (width_arr,))
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isnumeric(a):
+    """
+    For each element, return True if there are only numeric
+    characters in the element.
+
+    Calls `str.isnumeric` element-wise.
+
+    Numeric characters include digit characters, and all characters
+    that have the Unicode numeric value property, e.g. ``U+2155,
+    VULGAR FRACTION ONE FIFTH``.
+
+    Parameters
+    ----------
+    a : array_like, unicode
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, bool
+        Array of booleans of same shape as `a`.
+
+    See Also
+    --------
+    str.isnumeric
+
+    Examples
+    --------
+    >>> np.char.isnumeric(['123', '123abc', '9.0', '1/4', 'VIII'])
+    array([ True, False, False, False, False])
+
+    """
+    if not _is_unicode(a):
+        raise TypeError("isnumeric is only available for Unicode strings and arrays")
+    return _vec_string(a, bool_, 'isnumeric')
+
+
+@array_function_dispatch(_unary_op_dispatcher)
+def isdecimal(a):
+    """
+    For each element, return True if there are only decimal
+    characters in the element.
+
+    Calls `str.isdecimal` element-wise.
+
+    Decimal characters include digit characters, and all characters
+    that can be used to form decimal-radix numbers,
+    e.g. ``U+0660, ARABIC-INDIC DIGIT ZERO``.
+
+    Parameters
+    ----------
+    a : array_like, unicode
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, bool
+        Array of booleans identical in shape to `a`.
+
+    See Also
+    --------
+    str.isdecimal
+
+    Examples
+    --------
+    >>> np.char.isdecimal(['12345', '4.99', '123ABC', ''])
+    array([ True, False, False, False])
+
+    """ 
+    if not _is_unicode(a):
+        raise TypeError(
+            "isdecimal is only available for Unicode strings and arrays")
+    return _vec_string(a, bool_, 'isdecimal')
+
+
+@set_module('numpy')
+class chararray(ndarray):
+    """
+    chararray(shape, itemsize=1, unicode=False, buffer=None, offset=0,
+              strides=None, order=None)
+
+    Provides a convenient view on arrays of string and unicode values.
+
+    .. note::
+       The `chararray` class exists for backwards compatibility with
+       Numarray, it is not recommended for new development. Starting from numpy
+       1.4, if one needs arrays of strings, it is recommended to use arrays of
+       `dtype` `object_`, `bytes_` or `str_`, and use the free functions
+       in the `numpy.char` module for fast vectorized string operations.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `.endswith`) and infix operators (e.g. ``"+", "*", "%"``)
+
+    chararrays should be created using `numpy.char.array` or
+    `numpy.char.asarray`, rather than this constructor directly.
+
+    This constructor creates the array, using `buffer` (with `offset`
+    and `strides`) if it is not ``None``. If `buffer` is ``None``, then
+    constructs a new array with `strides` in "C order", unless both
+    ``len(shape) >= 2`` and ``order='F'``, in which case `strides`
+    is in "Fortran order".
+
+    Methods
+    -------
+    astype
+    argsort
+    copy
+    count
+    decode
+    dump
+    dumps
+    encode
+    endswith
+    expandtabs
+    fill
+    find
+    flatten
+    getfield
+    index
+    isalnum
+    isalpha
+    isdecimal
+    isdigit
+    islower
+    isnumeric
+    isspace
+    istitle
+    isupper
+    item
+    join
+    ljust
+    lower
+    lstrip
+    nonzero
+    put
+    ravel
+    repeat
+    replace
+    reshape
+    resize
+    rfind
+    rindex
+    rjust
+    rsplit
+    rstrip
+    searchsorted
+    setfield
+    setflags
+    sort
+    split
+    splitlines
+    squeeze
+    startswith
+    strip
+    swapaxes
+    swapcase
+    take
+    title
+    tofile
+    tolist
+    tostring
+    translate
+    transpose
+    upper
+    view
+    zfill
+
+    Parameters
+    ----------
+    shape : tuple
+        Shape of the array.
+    itemsize : int, optional
+        Length of each array element, in number of characters. Default is 1.
+    unicode : bool, optional
+        Are the array elements of type unicode (True) or string (False).
+        Default is False.
+    buffer : object exposing the buffer interface or str, optional
+        Memory address of the start of the array data.  Default is None,
+        in which case a new array is created.
+    offset : int, optional
+        Fixed stride displacement from the beginning of an axis?
+        Default is 0. Needs to be >=0.
+    strides : array_like of ints, optional
+        Strides for the array (see `ndarray.strides` for full description).
+        Default is None.
+    order : {'C', 'F'}, optional
+        The order in which the array data is stored in memory: 'C' ->
+        "row major" order (the default), 'F' -> "column major"
+        (Fortran) order.
+
+    Examples
+    --------
+    >>> charar = np.chararray((3, 3))
+    >>> charar[:] = 'a'
+    >>> charar
+    chararray([[b'a', b'a', b'a'],
+               [b'a', b'a', b'a'],
+               [b'a', b'a', b'a']], dtype='|S1')
+
+    >>> charar = np.chararray(charar.shape, itemsize=5)
+    >>> charar[:] = 'abc'
+    >>> charar
+    chararray([[b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc'],
+               [b'abc', b'abc', b'abc']], dtype='|S5')
+
+    """
+    def __new__(subtype, shape, itemsize=1, unicode=False, buffer=None,
+                offset=0, strides=None, order='C'):
+        global _globalvar
+
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        # force itemsize to be a Python int, since using NumPy integer
+        # types results in itemsize.itemsize being used as the size of
+        # strings in the new array.
+        itemsize = int(itemsize)
+
+        if isinstance(buffer, str):
+            # unicode objects do not have the buffer interface
+            filler = buffer
+            buffer = None
+        else:
+            filler = None
+
+        _globalvar = 1
+        if buffer is None:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   order=order)
+        else:
+            self = ndarray.__new__(subtype, shape, (dtype, itemsize),
+                                   buffer=buffer,
+                                   offset=offset, strides=strides,
+                                   order=order)
+        if filler is not None:
+            self[...] = filler
+        _globalvar = 0
+        return self
+
+    def __array_finalize__(self, obj):
+        # The b is a special case because it is used for reconstructing.
+        if not _globalvar and self.dtype.char not in 'SUbc':
+            raise ValueError("Can only create a chararray from string data.")
+
+    def __getitem__(self, obj):
+        val = ndarray.__getitem__(self, obj)
+
+        if isinstance(val, character):
+            temp = val.rstrip()
+            if len(temp) == 0:
+                val = ''
+            else:
+                val = temp
+
+        return val
+
+    # IMPLEMENTATION NOTE: Most of the methods of this class are
+    # direct delegations to the free functions in this module.
+    # However, those that return an array of strings should instead
+    # return a chararray, so some extra wrapping is required.
+
+    def __eq__(self, other):
+        """
+        Return (self == other) element-wise.
+
+        See Also
+        --------
+        equal
+        """
+        return equal(self, other)
+
+    def __ne__(self, other):
+        """
+        Return (self != other) element-wise.
+
+        See Also
+        --------
+        not_equal
+        """
+        return not_equal(self, other)
+
+    def __ge__(self, other):
+        """
+        Return (self >= other) element-wise.
+
+        See Also
+        --------
+        greater_equal
+        """
+        return greater_equal(self, other)
+
+    def __le__(self, other):
+        """
+        Return (self <= other) element-wise.
+
+        See Also
+        --------
+        less_equal
+        """
+        return less_equal(self, other)
+
+    def __gt__(self, other):
+        """
+        Return (self > other) element-wise.
+
+        See Also
+        --------
+        greater
+        """
+        return greater(self, other)
+
+    def __lt__(self, other):
+        """
+        Return (self < other) element-wise.
+
+        See Also
+        --------
+        less
+        """
+        return less(self, other)
+
+    def __add__(self, other):
+        """
+        Return (self + other), that is string concatenation,
+        element-wise for a pair of array_likes of str or unicode.
+
+        See Also
+        --------
+        add
+        """
+        return asarray(add(self, other))
+
+    def __radd__(self, other):
+        """
+        Return (other + self), that is string concatenation,
+        element-wise for a pair of array_likes of `bytes_` or `str_`.
+
+        See Also
+        --------
+        add
+        """
+        return asarray(add(numpy.asarray(other), self))
+
+    def __mul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __rmul__(self, i):
+        """
+        Return (self * i), that is string multiple concatenation,
+        element-wise.
+
+        See Also
+        --------
+        multiply
+        """
+        return asarray(multiply(self, i))
+
+    def __mod__(self, i):
+        """
+        Return (self % i), that is pre-Python 2.6 string formatting
+        (interpolation), element-wise for a pair of array_likes of `bytes_`
+        or `str_`.
+
+        See Also
+        --------
+        mod
+        """
+        return asarray(mod(self, i))
+
+    def __rmod__(self, other):
+        return NotImplemented
+
+    def argsort(self, axis=-1, kind=None, order=None):
+        """
+        Return the indices that sort the array lexicographically.
+
+        For full documentation see `numpy.argsort`, for which this method is
+        in fact merely a "thin wrapper."
+
+        Examples
+        --------
+        >>> c = np.array(['a1b c', '1b ca', 'b ca1', 'Ca1b'], 'S5')
+        >>> c = c.view(np.chararray); c
+        chararray(['a1b c', '1b ca', 'b ca1', 'Ca1b'],
+              dtype='|S5')
+        >>> c[c.argsort()]
+        chararray(['1b ca', 'Ca1b', 'a1b c', 'b ca1'],
+              dtype='|S5')
+
+        """
+        return self.__array__().argsort(axis, kind, order)
+    argsort.__doc__ = ndarray.argsort.__doc__
+
+    def capitalize(self):
+        """
+        Return a copy of `self` with only the first character of each element
+        capitalized.
+
+        See Also
+        --------
+        char.capitalize
+
+        """
+        return asarray(capitalize(self))
+
+    def center(self, width, fillchar=' '):
+        """
+        Return a copy of `self` with its elements centered in a
+        string of length `width`.
+
+        See Also
+        --------
+        center
+        """
+        return asarray(center(self, width, fillchar))
+
+    def count(self, sub, start=0, end=None):
+        """
+        Returns an array with the number of non-overlapping occurrences of
+        substring `sub` in the range [`start`, `end`].
+
+        See Also
+        --------
+        char.count
+
+        """
+        return count(self, sub, start, end)
+
+    def decode(self, encoding=None, errors=None):
+        """
+        Calls ``bytes.decode`` element-wise.
+
+        See Also
+        --------
+        char.decode
+
+        """
+        return decode(self, encoding, errors)
+
+    def encode(self, encoding=None, errors=None):
+        """
+        Calls `str.encode` element-wise.
+
+        See Also
+        --------
+        char.encode
+
+        """
+        return encode(self, encoding, errors)
+
+    def endswith(self, suffix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` ends with `suffix`, otherwise `False`.
+
+        See Also
+        --------
+        char.endswith
+
+        """
+        return endswith(self, suffix, start, end)
+
+    def expandtabs(self, tabsize=8):
+        """
+        Return a copy of each string element where all tab characters are
+        replaced by one or more spaces.
+
+        See Also
+        --------
+        char.expandtabs
+
+        """
+        return asarray(expandtabs(self, tabsize))
+
+    def find(self, sub, start=0, end=None):
+        """
+        For each element, return the lowest index in the string where
+        substring `sub` is found.
+
+        See Also
+        --------
+        char.find
+
+        """
+        return find(self, sub, start, end)
+
+    def index(self, sub, start=0, end=None):
+        """
+        Like `find`, but raises `ValueError` when the substring is not found.
+
+        See Also
+        --------
+        char.index
+
+        """
+        return index(self, sub, start, end)
+
+    def isalnum(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphanumeric and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalnum
+
+        """
+        return isalnum(self)
+
+    def isalpha(self):
+        """
+        Returns true for each element if all characters in the string
+        are alphabetic and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isalpha
+
+        """
+        return isalpha(self)
+
+    def isdigit(self):
+        """
+        Returns true for each element if all characters in the string are
+        digits and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.isdigit
+
+        """
+        return isdigit(self)
+
+    def islower(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are lowercase and there is at least one cased character,
+        false otherwise.
+
+        See Also
+        --------
+        char.islower
+
+        """
+        return islower(self)
+
+    def isspace(self):
+        """
+        Returns true for each element if there are only whitespace
+        characters in the string and there is at least one character,
+        false otherwise.
+
+        See Also
+        --------
+        char.isspace
+
+        """
+        return isspace(self)
+
+    def istitle(self):
+        """
+        Returns true for each element if the element is a titlecased
+        string and there is at least one character, false otherwise.
+
+        See Also
+        --------
+        char.istitle
+
+        """
+        return istitle(self)
+
+    def isupper(self):
+        """
+        Returns true for each element if all cased characters in the
+        string are uppercase and there is at least one character, false
+        otherwise.
+
+        See Also
+        --------
+        char.isupper
+
+        """
+        return isupper(self)
+
+    def join(self, seq):
+        """
+        Return a string which is the concatenation of the strings in the
+        sequence `seq`.
+
+        See Also
+        --------
+        char.join
+
+        """
+        return join(self, seq)
+
+    def ljust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self` left-justified in a
+        string of length `width`.
+
+        See Also
+        --------
+        char.ljust
+
+        """
+        return asarray(ljust(self, width, fillchar))
+
+    def lower(self):
+        """
+        Return an array with the elements of `self` converted to
+        lowercase.
+
+        See Also
+        --------
+        char.lower
+
+        """
+        return asarray(lower(self))
+
+    def lstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading characters
+        removed.
+
+        See Also
+        --------
+        char.lstrip
+
+        """
+        return asarray(lstrip(self, chars))
+
+    def partition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        partition
+        """
+        return asarray(partition(self, sep))
+
+    def replace(self, old, new, count=None):
+        """
+        For each element in `self`, return a copy of the string with all
+        occurrences of substring `old` replaced by `new`.
+
+        See Also
+        --------
+        char.replace
+
+        """
+        return asarray(replace(self, old, new, count))
+
+    def rfind(self, sub, start=0, end=None):
+        """
+        For each element in `self`, return the highest index in the string
+        where substring `sub` is found, such that `sub` is contained
+        within [`start`, `end`].
+
+        See Also
+        --------
+        char.rfind
+
+        """
+        return rfind(self, sub, start, end)
+
+    def rindex(self, sub, start=0, end=None):
+        """
+        Like `rfind`, but raises `ValueError` when the substring `sub` is
+        not found.
+
+        See Also
+        --------
+        char.rindex
+
+        """
+        return rindex(self, sub, start, end)
+
+    def rjust(self, width, fillchar=' '):
+        """
+        Return an array with the elements of `self`
+        right-justified in a string of length `width`.
+
+        See Also
+        --------
+        char.rjust
+
+        """
+        return asarray(rjust(self, width, fillchar))
+
+    def rpartition(self, sep):
+        """
+        Partition each element in `self` around `sep`.
+
+        See Also
+        --------
+        rpartition
+        """
+        return asarray(rpartition(self, sep))
+
+    def rsplit(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in
+        the string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.rsplit
+
+        """
+        return rsplit(self, sep, maxsplit)
+
+    def rstrip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the trailing
+        characters removed.
+
+        See Also
+        --------
+        char.rstrip
+
+        """
+        return asarray(rstrip(self, chars))
+
+    def split(self, sep=None, maxsplit=None):
+        """
+        For each element in `self`, return a list of the words in the
+        string, using `sep` as the delimiter string.
+
+        See Also
+        --------
+        char.split
+
+        """
+        return split(self, sep, maxsplit)
+
+    def splitlines(self, keepends=None):
+        """
+        For each element in `self`, return a list of the lines in the
+        element, breaking at line boundaries.
+
+        See Also
+        --------
+        char.splitlines
+
+        """
+        return splitlines(self, keepends)
+
+    def startswith(self, prefix, start=0, end=None):
+        """
+        Returns a boolean array which is `True` where the string element
+        in `self` starts with `prefix`, otherwise `False`.
+
+        See Also
+        --------
+        char.startswith
+
+        """
+        return startswith(self, prefix, start, end)
+
+    def strip(self, chars=None):
+        """
+        For each element in `self`, return a copy with the leading and
+        trailing characters removed.
+
+        See Also
+        --------
+        char.strip
+
+        """
+        return asarray(strip(self, chars))
+
+    def swapcase(self):
+        """
+        For each element in `self`, return a copy of the string with
+        uppercase characters converted to lowercase and vice versa.
+
+        See Also
+        --------
+        char.swapcase
+
+        """
+        return asarray(swapcase(self))
+
+    def title(self):
+        """
+        For each element in `self`, return a titlecased version of the
+        string: words start with uppercase characters, all remaining cased
+        characters are lowercase.
+
+        See Also
+        --------
+        char.title
+
+        """
+        return asarray(title(self))
+
+    def translate(self, table, deletechars=None):
+        """
+        For each element in `self`, return a copy of the string where
+        all characters occurring in the optional argument
+        `deletechars` are removed, and the remaining characters have
+        been mapped through the given translation table.
+
+        See Also
+        --------
+        char.translate
+
+        """
+        return asarray(translate(self, table, deletechars))
+
+    def upper(self):
+        """
+        Return an array with the elements of `self` converted to
+        uppercase.
+
+        See Also
+        --------
+        char.upper
+
+        """
+        return asarray(upper(self))
+
+    def zfill(self, width):
+        """
+        Return the numeric string left-filled with zeros in a string of
+        length `width`.
+
+        See Also
+        --------
+        char.zfill
+
+        """
+        return asarray(zfill(self, width))
+
+    def isnumeric(self):
+        """
+        For each element in `self`, return True if there are only
+        numeric characters in the element.
+
+        See Also
+        --------
+        char.isnumeric
+
+        """
+        return isnumeric(self)
+
+    def isdecimal(self):
+        """
+        For each element in `self`, return True if there are only
+        decimal characters in the element.
+
+        See Also
+        --------
+        char.isdecimal
+
+        """
+        return isdecimal(self)
+
+
+@set_module("numpy.char")
+def array(obj, itemsize=None, copy=True, unicode=None, order=None):
+    """
+    Create a `chararray`.
+
+    .. note::
+       This class is provided for numarray backward-compatibility.
+       New code (not concerned with numarray compatibility) should use
+       arrays of type `bytes_` or `str_` and use the free functions
+       in :mod:`numpy.char <numpy.core.defchararray>` for fast
+       vectorized string operations instead.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `str.endswith`) and infix operators (e.g. ``+, *, %``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    copy : bool, optional
+        If true (default), then the object is copied.  Otherwise, a copy
+        will only be made if __array__ returns a copy, if obj is a
+        nested sequence, or if a copy is needed to satisfy any of the other
+        requirements (`itemsize`, unicode, `order`, etc.).
+
+    unicode : bool, optional
+        When true, the resulting `chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+          - a `chararray`,
+          - an ndarray of type `str` or `unicode`
+          - a Python str or unicode object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F', 'A'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).  If order is 'A', then the returned array may
+        be in any order (either C-, Fortran-contiguous, or even
+        discontiguous).
+    """
+    if isinstance(obj, (bytes, str)):
+        if unicode is None:
+            if isinstance(obj, str):
+                unicode = True
+            else:
+                unicode = False
+
+        if itemsize is None:
+            itemsize = len(obj)
+        shape = len(obj) // itemsize
+
+        return chararray(shape, itemsize=itemsize, unicode=unicode,
+                         buffer=obj, order=order)
+
+    if isinstance(obj, (list, tuple)):
+        obj = numpy.asarray(obj)
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, character):
+        # If we just have a vanilla chararray, create a chararray
+        # view around it.
+        if not isinstance(obj, chararray):
+            obj = obj.view(chararray)
+
+        if itemsize is None:
+            itemsize = obj.itemsize
+            # itemsize is in 8-bit chars, so for Unicode, we need
+            # to divide by the size of a single Unicode character,
+            # which for NumPy is always 4
+            if issubclass(obj.dtype.type, str_):
+                itemsize //= 4
+
+        if unicode is None:
+            if issubclass(obj.dtype.type, str_):
+                unicode = True
+            else:
+                unicode = False
+
+        if unicode:
+            dtype = str_
+        else:
+            dtype = bytes_
+
+        if order is not None:
+            obj = numpy.asarray(obj, order=order)
+        if (copy or
+                (itemsize != obj.itemsize) or
+                (not unicode and isinstance(obj, str_)) or
+                (unicode and isinstance(obj, bytes_))):
+            obj = obj.astype((dtype, int(itemsize)))
+        return obj
+
+    if isinstance(obj, ndarray) and issubclass(obj.dtype.type, object):
+        if itemsize is None:
+            # Since no itemsize was specified, convert the input array to
+            # a list so the ndarray constructor will automatically
+            # determine the itemsize for us.
+            obj = obj.tolist()
+            # Fall through to the default case
+
+    if unicode:
+        dtype = str_
+    else:
+        dtype = bytes_
+
+    if itemsize is None:
+        val = narray(obj, dtype=dtype, order=order, subok=True)
+    else:
+        val = narray(obj, dtype=(dtype, itemsize), order=order, subok=True)
+    return val.view(chararray)
+
+
+@set_module("numpy.char")
+def asarray(obj, itemsize=None, unicode=None, order=None):
+    """
+    Convert the input to a `chararray`, copying the data only if
+    necessary.
+
+    Versus a regular NumPy array of type `str` or `unicode`, this
+    class adds the following functionality:
+
+      1) values automatically have whitespace removed from the end
+         when indexed
+
+      2) comparison operators automatically remove whitespace from the
+         end when comparing values
+
+      3) vectorized string operations are provided as methods
+         (e.g. `str.endswith`) and infix operators (e.g. ``+``, ``*``,``%``)
+
+    Parameters
+    ----------
+    obj : array of str or unicode-like
+
+    itemsize : int, optional
+        `itemsize` is the number of characters per scalar in the
+        resulting array.  If `itemsize` is None, and `obj` is an
+        object array or a Python list, the `itemsize` will be
+        automatically determined.  If `itemsize` is provided and `obj`
+        is of type str or unicode, then the `obj` string will be
+        chunked into `itemsize` pieces.
+
+    unicode : bool, optional
+        When true, the resulting `chararray` can contain Unicode
+        characters, when false only 8-bit characters.  If unicode is
+        None and `obj` is one of the following:
+
+          - a `chararray`,
+          - an ndarray of type `str` or 'unicode`
+          - a Python str or unicode object,
+
+        then the unicode setting of the output array will be
+        automatically determined.
+
+    order : {'C', 'F'}, optional
+        Specify the order of the array.  If order is 'C' (default), then the
+        array will be in C-contiguous order (last-index varies the
+        fastest).  If order is 'F', then the returned array
+        will be in Fortran-contiguous order (first-index varies the
+        fastest).
+    """
+    return array(obj, itemsize, copy=False,
+                 unicode=unicode, order=order)

.venv/lib/python3.11/site-packages/numpy/core/defchararray.pyi

@@ -0,0 +1,421 @@
+from typing import (
+    Literal as L,
+    overload,
+    TypeVar,
+    Any,
+)
+
+from numpy import (
+    chararray as chararray,
+    dtype,
+    str_,
+    bytes_,
+    int_,
+    bool_,
+    object_,
+    _OrderKACF,
+)
+
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeStr_co as U_co,
+    _ArrayLikeBytes_co as S_co,
+    _ArrayLikeInt_co as i_co,
+    _ArrayLikeBool_co as b_co,
+)
+
+from numpy.core.multiarray import compare_chararrays as compare_chararrays
+
+_SCT = TypeVar("_SCT", str_, bytes_)
+_CharArray = chararray[Any, dtype[_SCT]]
+
+__all__: list[str]
+
+# Comparison
+@overload
+def equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def not_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def not_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def greater_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def greater_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def less_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def less_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def greater(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def greater(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def less(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def less(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+# String operations
+@overload
+def add(x1: U_co, x2: U_co) -> NDArray[str_]: ...
+@overload
+def add(x1: S_co, x2: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def multiply(a: U_co, i: i_co) -> NDArray[str_]: ...
+@overload
+def multiply(a: S_co, i: i_co) -> NDArray[bytes_]: ...
+
+@overload
+def mod(a: U_co, value: Any) -> NDArray[str_]: ...
+@overload
+def mod(a: S_co, value: Any) -> NDArray[bytes_]: ...
+
+@overload
+def capitalize(a: U_co) -> NDArray[str_]: ...
+@overload
+def capitalize(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+
+def decode(
+    a: S_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[str_]: ...
+
+def encode(
+    a: U_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[str_]: ...
+@overload
+def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def join(sep: U_co, seq: U_co) -> NDArray[str_]: ...
+@overload
+def join(sep: S_co, seq: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def lower(a: U_co) -> NDArray[str_]: ...
+@overload
+def lower(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def partition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def partition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def replace(
+    a: U_co,
+    old: U_co,
+    new: U_co,
+    count: None | i_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def replace(
+    a: S_co,
+    old: S_co,
+    new: S_co,
+    count: None | i_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def rjust(
+    a: U_co,
+    width: i_co,
+    fillchar: U_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def rjust(
+    a: S_co,
+    width: i_co,
+    fillchar: S_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def rpartition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def rpartition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def rsplit(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def rsplit(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def rstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def rstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def split(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def split(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def splitlines(a: U_co, keepends: None | b_co = ...) -> NDArray[object_]: ...
+@overload
+def splitlines(a: S_co, keepends: None | b_co = ...) -> NDArray[object_]: ...
+
+@overload
+def strip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def strip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def swapcase(a: U_co) -> NDArray[str_]: ...
+@overload
+def swapcase(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def title(a: U_co) -> NDArray[str_]: ...
+@overload
+def title(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def translate(
+    a: U_co,
+    table: U_co,
+    deletechars: None | U_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def translate(
+    a: S_co,
+    table: S_co,
+    deletechars: None | S_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def upper(a: U_co) -> NDArray[str_]: ...
+@overload
+def upper(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def zfill(a: U_co, width: i_co) -> NDArray[str_]: ...
+@overload
+def zfill(a: S_co, width: i_co) -> NDArray[bytes_]: ...
+
+# String information
+@overload
+def count(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def count(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def endswith(
+    a: U_co,
+    suffix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+@overload
+def endswith(
+    a: S_co,
+    suffix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+
+@overload
+def find(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def find(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def index(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def index(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+def isalpha(a: U_co | S_co) -> NDArray[bool_]: ...
+def isalnum(a: U_co | S_co) -> NDArray[bool_]: ...
+def isdecimal(a: U_co | S_co) -> NDArray[bool_]: ...
+def isdigit(a: U_co | S_co) -> NDArray[bool_]: ...
+def islower(a: U_co | S_co) -> NDArray[bool_]: ...
+def isnumeric(a: U_co | S_co) -> NDArray[bool_]: ...
+def isspace(a: U_co | S_co) -> NDArray[bool_]: ...
+def istitle(a: U_co | S_co) -> NDArray[bool_]: ...
+def isupper(a: U_co | S_co) -> NDArray[bool_]: ...
+
+@overload
+def rfind(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rfind(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def rindex(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rindex(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def startswith(
+    a: U_co,
+    prefix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+@overload
+def startswith(
+    a: S_co,
+    prefix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+
+def str_len(A: U_co | S_co) -> NDArray[int_]: ...
+
+# Overload 1 and 2: str- or bytes-based array-likes
+# overload 3: arbitrary object with unicode=False  (-> bytes_)
+# overload 4: arbitrary object with unicode=True  (-> str_)
+@overload
+def array(
+    obj: U_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def array(
+    obj: S_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+
+@overload
+def asarray(
+    obj: U_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def asarray(
+    obj: S_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...

.venv/lib/python3.11/site-packages/numpy/core/einsumfunc.py

@@ -0,0 +1,1443 @@
+"""
+Implementation of optimized einsum.
+
+"""
+import itertools
+import operator
+
+from numpy.core.multiarray import c_einsum
+from numpy.core.numeric import asanyarray, tensordot
+from numpy.core.overrides import array_function_dispatch
+
+__all__ = ['einsum', 'einsum_path']
+
+einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ'
+einsum_symbols_set = set(einsum_symbols)
+
+
+def _flop_count(idx_contraction, inner, num_terms, size_dictionary):
+    """
+    Computes the number of FLOPS in the contraction.
+
+    Parameters
+    ----------
+    idx_contraction : iterable
+        The indices involved in the contraction
+    inner : bool
+        Does this contraction require an inner product?
+    num_terms : int
+        The number of terms in a contraction
+    size_dictionary : dict
+        The size of each of the indices in idx_contraction
+
+    Returns
+    -------
+    flop_count : int
+        The total number of FLOPS required for the contraction.
+
+    Examples
+    --------
+
+    >>> _flop_count('abc', False, 1, {'a': 2, 'b':3, 'c':5})
+    30
+
+    >>> _flop_count('abc', True, 2, {'a': 2, 'b':3, 'c':5})
+    60
+
+    """
+
+    overall_size = _compute_size_by_dict(idx_contraction, size_dictionary)
+    op_factor = max(1, num_terms - 1)
+    if inner:
+        op_factor += 1
+
+    return overall_size * op_factor
+
+def _compute_size_by_dict(indices, idx_dict):
+    """
+    Computes the product of the elements in indices based on the dictionary
+    idx_dict.
+
+    Parameters
+    ----------
+    indices : iterable
+        Indices to base the product on.
+    idx_dict : dictionary
+        Dictionary of index sizes
+
+    Returns
+    -------
+    ret : int
+        The resulting product.
+
+    Examples
+    --------
+    >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5})
+    90
+
+    """
+    ret = 1
+    for i in indices:
+        ret *= idx_dict[i]
+    return ret
+
+
+def _find_contraction(positions, input_sets, output_set):
+    """
+    Finds the contraction for a given set of input and output sets.
+
+    Parameters
+    ----------
+    positions : iterable
+        Integer positions of terms used in the contraction.
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+
+    Returns
+    -------
+    new_result : set
+        The indices of the resulting contraction
+    remaining : list
+        List of sets that have not been contracted, the new set is appended to
+        the end of this list
+    idx_removed : set
+        Indices removed from the entire contraction
+    idx_contraction : set
+        The indices used in the current contraction
+
+    Examples
+    --------
+
+    # A simple dot product test case
+    >>> pos = (0, 1)
+    >>> isets = [set('ab'), set('bc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'})
+
+    # A more complex case with additional terms in the contraction
+    >>> pos = (0, 2)
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'})
+    """
+
+    idx_contract = set()
+    idx_remain = output_set.copy()
+    remaining = []
+    for ind, value in enumerate(input_sets):
+        if ind in positions:
+            idx_contract |= value
+        else:
+            remaining.append(value)
+            idx_remain |= value
+
+    new_result = idx_remain & idx_contract
+    idx_removed = (idx_contract - new_result)
+    remaining.append(new_result)
+
+    return (new_result, remaining, idx_removed, idx_contract)
+
+
+def _optimal_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Computes all possible pair contractions, sieves the results based
+    on ``memory_limit`` and returns the lowest cost path. This algorithm
+    scales factorial with respect to the elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The optimal contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _optimal_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    full_results = [(0, [], input_sets)]
+    for iteration in range(len(input_sets) - 1):
+        iter_results = []
+
+        # Compute all unique pairs
+        for curr in full_results:
+            cost, positions, remaining = curr
+            for con in itertools.combinations(range(len(input_sets) - iteration), 2):
+
+                # Find the contraction
+                cont = _find_contraction(con, remaining, output_set)
+                new_result, new_input_sets, idx_removed, idx_contract = cont
+
+                # Sieve the results based on memory_limit
+                new_size = _compute_size_by_dict(new_result, idx_dict)
+                if new_size > memory_limit:
+                    continue
+
+                # Build (total_cost, positions, indices_remaining)
+                total_cost =  cost + _flop_count(idx_contract, idx_removed, len(con), idx_dict)
+                new_pos = positions + [con]
+                iter_results.append((total_cost, new_pos, new_input_sets))
+
+        # Update combinatorial list, if we did not find anything return best
+        # path + remaining contractions
+        if iter_results:
+            full_results = iter_results
+        else:
+            path = min(full_results, key=lambda x: x[0])[1]
+            path += [tuple(range(len(input_sets) - iteration))]
+            return path
+
+    # If we have not found anything return single einsum contraction
+    if len(full_results) == 0:
+        return [tuple(range(len(input_sets)))]
+
+    path = min(full_results, key=lambda x: x[0])[1]
+    return path
+
+def _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost, naive_cost):
+    """Compute the cost (removed size + flops) and resultant indices for
+    performing the contraction specified by ``positions``.
+
+    Parameters
+    ----------
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    input_sets : list of sets
+        The indices found on each tensors.
+    output_set : set
+        The output indices of the expression.
+    idx_dict : dict
+        Mapping of each index to its size.
+    memory_limit : int
+        The total allowed size for an intermediary tensor.
+    path_cost : int
+        The contraction cost so far.
+    naive_cost : int
+        The cost of the unoptimized expression.
+
+    Returns
+    -------
+    cost : (int, int)
+        A tuple containing the size of any indices removed, and the flop cost.
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    new_input_sets : list of sets
+        The resulting new list of indices if this proposed contraction is performed.
+
+    """
+
+    # Find the contraction
+    contract = _find_contraction(positions, input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+
+    # Sieve the results based on memory_limit
+    new_size = _compute_size_by_dict(idx_result, idx_dict)
+    if new_size > memory_limit:
+        return None
+
+    # Build sort tuple
+    old_sizes = (_compute_size_by_dict(input_sets[p], idx_dict) for p in positions)
+    removed_size = sum(old_sizes) - new_size
+
+    # NB: removed_size used to be just the size of any removed indices i.e.:
+    #     helpers.compute_size_by_dict(idx_removed, idx_dict)
+    cost = _flop_count(idx_contract, idx_removed, len(positions), idx_dict)
+    sort = (-removed_size, cost)
+
+    # Sieve based on total cost as well
+    if (path_cost + cost) > naive_cost:
+        return None
+
+    # Add contraction to possible choices
+    return [sort, positions, new_input_sets]
+
+
+def _update_other_results(results, best):
+    """Update the positions and provisional input_sets of ``results`` based on
+    performing the contraction result ``best``. Remove any involving the tensors
+    contracted.
+
+    Parameters
+    ----------
+    results : list
+        List of contraction results produced by ``_parse_possible_contraction``.
+    best : list
+        The best contraction of ``results`` i.e. the one that will be performed.
+
+    Returns
+    -------
+    mod_results : list
+        The list of modified results, updated with outcome of ``best`` contraction.
+    """
+
+    best_con = best[1]
+    bx, by = best_con
+    mod_results = []
+
+    for cost, (x, y), con_sets in results:
+
+        # Ignore results involving tensors just contracted
+        if x in best_con or y in best_con:
+            continue
+
+        # Update the input_sets
+        del con_sets[by - int(by > x) - int(by > y)]
+        del con_sets[bx - int(bx > x) - int(bx > y)]
+        con_sets.insert(-1, best[2][-1])
+
+        # Update the position indices
+        mod_con = x - int(x > bx) - int(x > by), y - int(y > bx) - int(y > by)
+        mod_results.append((cost, mod_con, con_sets))
+
+    return mod_results
+
+def _greedy_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Finds the path by contracting the best pair until the input list is
+    exhausted. The best pair is found by minimizing the tuple
+    ``(-prod(indices_removed), cost)``.  What this amounts to is prioritizing
+    matrix multiplication or inner product operations, then Hadamard like
+    operations, and finally outer operations. Outer products are limited by
+    ``memory_limit``. This algorithm scales cubically with respect to the
+    number of elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The greedy contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _greedy_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    # Handle trivial cases that leaked through
+    if len(input_sets) == 1:
+        return [(0,)]
+    elif len(input_sets) == 2:
+        return [(0, 1)]
+
+    # Build up a naive cost
+    contract = _find_contraction(range(len(input_sets)), input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+    naive_cost = _flop_count(idx_contract, idx_removed, len(input_sets), idx_dict)
+
+    # Initially iterate over all pairs
+    comb_iter = itertools.combinations(range(len(input_sets)), 2)
+    known_contractions = []
+
+    path_cost = 0
+    path = []
+
+    for iteration in range(len(input_sets) - 1):
+
+        # Iterate over all pairs on first step, only previously found pairs on subsequent steps
+        for positions in comb_iter:
+
+            # Always initially ignore outer products
+            if input_sets[positions[0]].isdisjoint(input_sets[positions[1]]):
+                continue
+
+            result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost,
+                                                 naive_cost)
+            if result is not None:
+                known_contractions.append(result)
+
+        # If we do not have a inner contraction, rescan pairs including outer products
+        if len(known_contractions) == 0:
+
+            # Then check the outer products
+            for positions in itertools.combinations(range(len(input_sets)), 2):
+                result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit,
+                                                     path_cost, naive_cost)
+                if result is not None:
+                    known_contractions.append(result)
+
+            # If we still did not find any remaining contractions, default back to einsum like behavior
+            if len(known_contractions) == 0:
+                path.append(tuple(range(len(input_sets))))
+                break
+
+        # Sort based on first index
+        best = min(known_contractions, key=lambda x: x[0])
+
+        # Now propagate as many unused contractions as possible to next iteration
+        known_contractions = _update_other_results(known_contractions, best)
+
+        # Next iteration only compute contractions with the new tensor
+        # All other contractions have been accounted for
+        input_sets = best[2]
+        new_tensor_pos = len(input_sets) - 1
+        comb_iter = ((i, new_tensor_pos) for i in range(new_tensor_pos))
+
+        # Update path and total cost
+        path.append(best[1])
+        path_cost += best[0][1]
+
+    return path
+
+
+def _can_dot(inputs, result, idx_removed):
+    """
+    Checks if we can use BLAS (np.tensordot) call and its beneficial to do so.
+
+    Parameters
+    ----------
+    inputs : list of str
+        Specifies the subscripts for summation.
+    result : str
+        Resulting summation.
+    idx_removed : set
+        Indices that are removed in the summation
+
+
+    Returns
+    -------
+    type : bool
+        Returns true if BLAS should and can be used, else False
+
+    Notes
+    -----
+    If the operations is BLAS level 1 or 2 and is not already aligned
+    we default back to einsum as the memory movement to copy is more
+    costly than the operation itself.
+
+
+    Examples
+    --------
+
+    # Standard GEMM operation
+    >>> _can_dot(['ij', 'jk'], 'ik', set('j'))
+    True
+
+    # Can use the standard BLAS, but requires odd data movement
+    >>> _can_dot(['ijj', 'jk'], 'ik', set('j'))
+    False
+
+    # DDOT where the memory is not aligned
+    >>> _can_dot(['ijk', 'ikj'], '', set('ijk'))
+    False
+
+    """
+
+    # All `dot` calls remove indices
+    if len(idx_removed) == 0:
+        return False
+
+    # BLAS can only handle two operands
+    if len(inputs) != 2:
+        return False
+
+    input_left, input_right = inputs
+
+    for c in set(input_left + input_right):
+        # can't deal with repeated indices on same input or more than 2 total
+        nl, nr = input_left.count(c), input_right.count(c)
+        if (nl > 1) or (nr > 1) or (nl + nr > 2):
+            return False
+
+        # can't do implicit summation or dimension collapse e.g.
+        #     "ab,bc->c" (implicitly sum over 'a')
+        #     "ab,ca->ca" (take diagonal of 'a')
+        if nl + nr - 1 == int(c in result):
+            return False
+
+    # Build a few temporaries
+    set_left = set(input_left)
+    set_right = set(input_right)
+    keep_left = set_left - idx_removed
+    keep_right = set_right - idx_removed
+    rs = len(idx_removed)
+
+    # At this point we are a DOT, GEMV, or GEMM operation
+
+    # Handle inner products
+
+    # DDOT with aligned data
+    if input_left == input_right:
+        return True
+
+    # DDOT without aligned data (better to use einsum)
+    if set_left == set_right:
+        return False
+
+    # Handle the 4 possible (aligned) GEMV or GEMM cases
+
+    # GEMM or GEMV no transpose
+    if input_left[-rs:] == input_right[:rs]:
+        return True
+
+    # GEMM or GEMV transpose both
+    if input_left[:rs] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose right
+    if input_left[-rs:] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose left
+    if input_left[:rs] == input_right[:rs]:
+        return True
+
+    # Einsum is faster than GEMV if we have to copy data
+    if not keep_left or not keep_right:
+        return False
+
+    # We are a matrix-matrix product, but we need to copy data
+    return True
+
+
+def _parse_einsum_input(operands):
+    """
+    A reproduction of einsum c side einsum parsing in python.
+
+    Returns
+    -------
+    input_strings : str
+        Parsed input strings
+    output_string : str
+        Parsed output string
+    operands : list of array_like
+        The operands to use in the numpy contraction
+
+    Examples
+    --------
+    The operand list is simplified to reduce printing:
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(4, 4)
+    >>> b = np.random.rand(4, 4, 4)
+    >>> _parse_einsum_input(('...a,...a->...', a, b))
+    ('za,xza', 'xz', [a, b]) # may vary
+
+    >>> _parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0]))
+    ('za,xza', 'xz', [a, b]) # may vary
+    """
+
+    if len(operands) == 0:
+        raise ValueError("No input operands")
+
+    if isinstance(operands[0], str):
+        subscripts = operands[0].replace(" ", "")
+        operands = [asanyarray(v) for v in operands[1:]]
+
+        # Ensure all characters are valid
+        for s in subscripts:
+            if s in '.,->':
+                continue
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+
+    else:
+        tmp_operands = list(operands)
+        operand_list = []
+        subscript_list = []
+        for p in range(len(operands) // 2):
+            operand_list.append(tmp_operands.pop(0))
+            subscript_list.append(tmp_operands.pop(0))
+
+        output_list = tmp_operands[-1] if len(tmp_operands) else None
+        operands = [asanyarray(v) for v in operand_list]
+        subscripts = ""
+        last = len(subscript_list) - 1
+        for num, sub in enumerate(subscript_list):
+            for s in sub:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+            if num != last:
+                subscripts += ","
+
+        if output_list is not None:
+            subscripts += "->"
+            for s in output_list:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+    # Check for proper "->"
+    if ("-" in subscripts) or (">" in subscripts):
+        invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1)
+        if invalid or (subscripts.count("->") != 1):
+            raise ValueError("Subscripts can only contain one '->'.")
+
+    # Parse ellipses
+    if "." in subscripts:
+        used = subscripts.replace(".", "").replace(",", "").replace("->", "")
+        unused = list(einsum_symbols_set - set(used))
+        ellipse_inds = "".join(unused)
+        longest = 0
+
+        if "->" in subscripts:
+            input_tmp, output_sub = subscripts.split("->")
+            split_subscripts = input_tmp.split(",")
+            out_sub = True
+        else:
+            split_subscripts = subscripts.split(',')
+            out_sub = False
+
+        for num, sub in enumerate(split_subscripts):
+            if "." in sub:
+                if (sub.count(".") != 3) or (sub.count("...") != 1):
+                    raise ValueError("Invalid Ellipses.")
+
+                # Take into account numerical values
+                if operands[num].shape == ():
+                    ellipse_count = 0
+                else:
+                    ellipse_count = max(operands[num].ndim, 1)
+                    ellipse_count -= (len(sub) - 3)
+
+                if ellipse_count > longest:
+                    longest = ellipse_count
+
+                if ellipse_count < 0:
+                    raise ValueError("Ellipses lengths do not match.")
+                elif ellipse_count == 0:
+                    split_subscripts[num] = sub.replace('...', '')
+                else:
+                    rep_inds = ellipse_inds[-ellipse_count:]
+                    split_subscripts[num] = sub.replace('...', rep_inds)
+
+        subscripts = ",".join(split_subscripts)
+        if longest == 0:
+            out_ellipse = ""
+        else:
+            out_ellipse = ellipse_inds[-longest:]
+
+        if out_sub:
+            subscripts += "->" + output_sub.replace("...", out_ellipse)
+        else:
+            # Special care for outputless ellipses
+            output_subscript = ""
+            tmp_subscripts = subscripts.replace(",", "")
+            for s in sorted(set(tmp_subscripts)):
+                if s not in (einsum_symbols):
+                    raise ValueError("Character %s is not a valid symbol." % s)
+                if tmp_subscripts.count(s) == 1:
+                    output_subscript += s
+            normal_inds = ''.join(sorted(set(output_subscript) -
+                                         set(out_ellipse)))
+
+            subscripts += "->" + out_ellipse + normal_inds
+
+    # Build output string if does not exist
+    if "->" in subscripts:
+        input_subscripts, output_subscript = subscripts.split("->")
+    else:
+        input_subscripts = subscripts
+        # Build output subscripts
+        tmp_subscripts = subscripts.replace(",", "")
+        output_subscript = ""
+        for s in sorted(set(tmp_subscripts)):
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+            if tmp_subscripts.count(s) == 1:
+                output_subscript += s
+
+    # Make sure output subscripts are in the input
+    for char in output_subscript:
+        if char not in input_subscripts:
+            raise ValueError("Output character %s did not appear in the input"
+                             % char)
+
+    # Make sure number operands is equivalent to the number of terms
+    if len(input_subscripts.split(',')) != len(operands):
+        raise ValueError("Number of einsum subscripts must be equal to the "
+                         "number of operands.")
+
+    return (input_subscripts, output_subscript, operands)
+
+
+def _einsum_path_dispatcher(*operands, optimize=None, einsum_call=None):
+    # NOTE: technically, we should only dispatch on array-like arguments, not
+    # subscripts (given as strings). But separating operands into
+    # arrays/subscripts is a little tricky/slow (given einsum's two supported
+    # signatures), so as a practical shortcut we dispatch on everything.
+    # Strings will be ignored for dispatching since they don't define
+    # __array_function__.
+    return operands
+
+
+@array_function_dispatch(_einsum_path_dispatcher, module='numpy')
+def einsum_path(*operands, optimize='greedy', einsum_call=False):
+    """
+    einsum_path(subscripts, *operands, optimize='greedy')
+
+    Evaluates the lowest cost contraction order for an einsum expression by
+    considering the creation of intermediate arrays.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation.
+    *operands : list of array_like
+        These are the arrays for the operation.
+    optimize : {bool, list, tuple, 'greedy', 'optimal'}
+        Choose the type of path. If a tuple is provided, the second argument is
+        assumed to be the maximum intermediate size created. If only a single
+        argument is provided the largest input or output array size is used
+        as a maximum intermediate size.
+
+        * if a list is given that starts with ``einsum_path``, uses this as the
+          contraction path
+        * if False no optimization is taken
+        * if True defaults to the 'greedy' algorithm
+        * 'optimal' An algorithm that combinatorially explores all possible
+          ways of contracting the listed tensors and chooses the least costly
+          path. Scales exponentially with the number of terms in the
+          contraction.
+        * 'greedy' An algorithm that chooses the best pair contraction
+          at each step. Effectively, this algorithm searches the largest inner,
+          Hadamard, and then outer products at each step. Scales cubically with
+          the number of terms in the contraction. Equivalent to the 'optimal'
+          path for most contractions.
+
+        Default is 'greedy'.
+
+    Returns
+    -------
+    path : list of tuples
+        A list representation of the einsum path.
+    string_repr : str
+        A printable representation of the einsum path.
+
+    Notes
+    -----
+    The resulting path indicates which terms of the input contraction should be
+    contracted first, the result of this contraction is then appended to the
+    end of the contraction list. This list can then be iterated over until all
+    intermediate contractions are complete.
+
+    See Also
+    --------
+    einsum, linalg.multi_dot
+
+    Examples
+    --------
+
+    We can begin with a chain dot example. In this case, it is optimal to
+    contract the ``b`` and ``c`` tensors first as represented by the first
+    element of the path ``(1, 2)``. The resulting tensor is added to the end
+    of the contraction and the remaining contraction ``(0, 1)`` is then
+    completed.
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(2, 2)
+    >>> b = np.random.rand(2, 5)
+    >>> c = np.random.rand(5, 2)
+    >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy')
+    >>> print(path_info[0])
+    ['einsum_path', (1, 2), (0, 1)]
+    >>> print(path_info[1])
+      Complete contraction:  ij,jk,kl->il # may vary
+             Naive scaling:  4
+         Optimized scaling:  3
+          Naive FLOP count:  1.600e+02
+      Optimized FLOP count:  5.600e+01
+       Theoretical speedup:  2.857
+      Largest intermediate:  4.000e+00 elements
+    -------------------------------------------------------------------------
+    scaling                  current                                remaining
+    -------------------------------------------------------------------------
+       3                   kl,jk->jl                                ij,jl->il
+       3                   jl,ij->il                                   il->il
+
+
+    A more complex index transformation example.
+
+    >>> I = np.random.rand(10, 10, 10, 10)
+    >>> C = np.random.rand(10, 10)
+    >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C,
+    ...                            optimize='greedy')
+
+    >>> print(path_info[0])
+    ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)]
+    >>> print(path_info[1]) 
+      Complete contraction:  ea,fb,abcd,gc,hd->efgh # may vary
+             Naive scaling:  8
+         Optimized scaling:  5
+          Naive FLOP count:  8.000e+08
+      Optimized FLOP count:  8.000e+05
+       Theoretical speedup:  1000.000
+      Largest intermediate:  1.000e+04 elements
+    --------------------------------------------------------------------------
+    scaling                  current                                remaining
+    --------------------------------------------------------------------------
+       5               abcd,ea->bcde                      fb,gc,hd,bcde->efgh
+       5               bcde,fb->cdef                         gc,hd,cdef->efgh
+       5               cdef,gc->defg                            hd,defg->efgh
+       5               defg,hd->efgh                               efgh->efgh
+    """
+
+    # Figure out what the path really is
+    path_type = optimize
+    if path_type is True:
+        path_type = 'greedy'
+    if path_type is None:
+        path_type = False
+
+    explicit_einsum_path = False
+    memory_limit = None
+
+    # No optimization or a named path algorithm
+    if (path_type is False) or isinstance(path_type, str):
+        pass
+
+    # Given an explicit path
+    elif len(path_type) and (path_type[0] == 'einsum_path'):
+        explicit_einsum_path = True
+
+    # Path tuple with memory limit
+    elif ((len(path_type) == 2) and isinstance(path_type[0], str) and
+            isinstance(path_type[1], (int, float))):
+        memory_limit = int(path_type[1])
+        path_type = path_type[0]
+
+    else:
+        raise TypeError("Did not understand the path: %s" % str(path_type))
+
+    # Hidden option, only einsum should call this
+    einsum_call_arg = einsum_call
+
+    # Python side parsing
+    input_subscripts, output_subscript, operands = _parse_einsum_input(operands)
+
+    # Build a few useful list and sets
+    input_list = input_subscripts.split(',')
+    input_sets = [set(x) for x in input_list]
+    output_set = set(output_subscript)
+    indices = set(input_subscripts.replace(',', ''))
+
+    # Get length of each unique dimension and ensure all dimensions are correct
+    dimension_dict = {}
+    broadcast_indices = [[] for x in range(len(input_list))]
+    for tnum, term in enumerate(input_list):
+        sh = operands[tnum].shape
+        if len(sh) != len(term):
+            raise ValueError("Einstein sum subscript %s does not contain the "
+                             "correct number of indices for operand %d."
+                             % (input_subscripts[tnum], tnum))
+        for cnum, char in enumerate(term):
+            dim = sh[cnum]
+
+            # Build out broadcast indices
+            if dim == 1:
+                broadcast_indices[tnum].append(char)
+
+            if char in dimension_dict.keys():
+                # For broadcasting cases we always want the largest dim size
+                if dimension_dict[char] == 1:
+                    dimension_dict[char] = dim
+                elif dim not in (1, dimension_dict[char]):
+                    raise ValueError("Size of label '%s' for operand %d (%d) "
+                                     "does not match previous terms (%d)."
+                                     % (char, tnum, dimension_dict[char], dim))
+            else:
+                dimension_dict[char] = dim
+
+    # Convert broadcast inds to sets
+    broadcast_indices = [set(x) for x in broadcast_indices]
+
+    # Compute size of each input array plus the output array
+    size_list = [_compute_size_by_dict(term, dimension_dict)
+                 for term in input_list + [output_subscript]]
+    max_size = max(size_list)
+
+    if memory_limit is None:
+        memory_arg = max_size
+    else:
+        memory_arg = memory_limit
+
+    # Compute naive cost
+    # This isn't quite right, need to look into exactly how einsum does this
+    inner_product = (sum(len(x) for x in input_sets) - len(indices)) > 0
+    naive_cost = _flop_count(indices, inner_product, len(input_list), dimension_dict)
+
+    # Compute the path
+    if explicit_einsum_path:
+        path = path_type[1:]
+    elif (
+        (path_type is False)
+        or (len(input_list) in [1, 2])
+        or (indices == output_set)
+    ):
+        # Nothing to be optimized, leave it to einsum
+        path = [tuple(range(len(input_list)))]
+    elif path_type == "greedy":
+        path = _greedy_path(input_sets, output_set, dimension_dict, memory_arg)
+    elif path_type == "optimal":
+        path = _optimal_path(input_sets, output_set, dimension_dict, memory_arg)
+    else:
+        raise KeyError("Path name %s not found", path_type)
+
+    cost_list, scale_list, size_list, contraction_list = [], [], [], []
+
+    # Build contraction tuple (positions, gemm, einsum_str, remaining)
+    for cnum, contract_inds in enumerate(path):
+        # Make sure we remove inds from right to left
+        contract_inds = tuple(sorted(list(contract_inds), reverse=True))
+
+        contract = _find_contraction(contract_inds, input_sets, output_set)
+        out_inds, input_sets, idx_removed, idx_contract = contract
+
+        cost = _flop_count(idx_contract, idx_removed, len(contract_inds), dimension_dict)
+        cost_list.append(cost)
+        scale_list.append(len(idx_contract))
+        size_list.append(_compute_size_by_dict(out_inds, dimension_dict))
+
+        bcast = set()
+        tmp_inputs = []
+        for x in contract_inds:
+            tmp_inputs.append(input_list.pop(x))
+            bcast |= broadcast_indices.pop(x)
+
+        new_bcast_inds = bcast - idx_removed
+
+        # If we're broadcasting, nix blas
+        if not len(idx_removed & bcast):
+            do_blas = _can_dot(tmp_inputs, out_inds, idx_removed)
+        else:
+            do_blas = False
+
+        # Last contraction
+        if (cnum - len(path)) == -1:
+            idx_result = output_subscript
+        else:
+            sort_result = [(dimension_dict[ind], ind) for ind in out_inds]
+            idx_result = "".join([x[1] for x in sorted(sort_result)])
+
+        input_list.append(idx_result)
+        broadcast_indices.append(new_bcast_inds)
+        einsum_str = ",".join(tmp_inputs) + "->" + idx_result
+
+        contraction = (contract_inds, idx_removed, einsum_str, input_list[:], do_blas)
+        contraction_list.append(contraction)
+
+    opt_cost = sum(cost_list) + 1
+
+    if len(input_list) != 1:
+        # Explicit "einsum_path" is usually trusted, but we detect this kind of
+        # mistake in order to prevent from returning an intermediate value.
+        raise RuntimeError(
+            "Invalid einsum_path is specified: {} more operands has to be "
+            "contracted.".format(len(input_list) - 1))
+
+    if einsum_call_arg:
+        return (operands, contraction_list)
+
+    # Return the path along with a nice string representation
+    overall_contraction = input_subscripts + "->" + output_subscript
+    header = ("scaling", "current", "remaining")
+
+    speedup = naive_cost / opt_cost
+    max_i = max(size_list)
+
+    path_print  = "  Complete contraction:  %s\n" % overall_contraction
+    path_print += "         Naive scaling:  %d\n" % len(indices)
+    path_print += "     Optimized scaling:  %d\n" % max(scale_list)
+    path_print += "      Naive FLOP count:  %.3e\n" % naive_cost
+    path_print += "  Optimized FLOP count:  %.3e\n" % opt_cost
+    path_print += "   Theoretical speedup:  %3.3f\n" % speedup
+    path_print += "  Largest intermediate:  %.3e elements\n" % max_i
+    path_print += "-" * 74 + "\n"
+    path_print += "%6s %24s %40s\n" % header
+    path_print += "-" * 74
+
+    for n, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        remaining_str = ",".join(remaining) + "->" + output_subscript
+        path_run = (scale_list[n], einsum_str, remaining_str)
+        path_print += "\n%4d    %24s %40s" % path_run
+
+    path = ['einsum_path'] + path
+    return (path, path_print)
+
+
+def _einsum_dispatcher(*operands, out=None, optimize=None, **kwargs):
+    # Arguably we dispatch on more arguments than we really should; see note in
+    # _einsum_path_dispatcher for why.
+    yield from operands
+    yield out
+
+
+# Rewrite einsum to handle different cases
+@array_function_dispatch(_einsum_dispatcher, module='numpy')
+def einsum(*operands, out=None, optimize=False, **kwargs):
+    """
+    einsum(subscripts, *operands, out=None, dtype=None, order='K',
+           casting='safe', optimize=False)
+
+    Evaluates the Einstein summation convention on the operands.
+
+    Using the Einstein summation convention, many common multi-dimensional,
+    linear algebraic array operations can be represented in a simple fashion.
+    In *implicit* mode `einsum` computes these values.
+
+    In *explicit* mode, `einsum` provides further flexibility to compute
+    other array operations that might not be considered classical Einstein
+    summation operations, by disabling, or forcing summation over specified
+    subscript labels.
+
+    See the notes and examples for clarification.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation as comma separated list of
+        subscript labels. An implicit (classical Einstein summation)
+        calculation is performed unless the explicit indicator '->' is
+        included as well as subscript labels of the precise output form.
+    operands : list of array_like
+        These are the arrays for the operation.
+    out : ndarray, optional
+        If provided, the calculation is done into this array.
+    dtype : {data-type, None}, optional
+        If provided, forces the calculation to use the data type specified.
+        Note that you may have to also give a more liberal `casting`
+        parameter to allow the conversions. Default is None.
+    order : {'C', 'F', 'A', 'K'}, optional
+        Controls the memory layout of the output. 'C' means it should
+        be C contiguous. 'F' means it should be Fortran contiguous,
+        'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise.
+        'K' means it should be as close to the layout as the inputs as
+        is possible, including arbitrarily permuted axes.
+        Default is 'K'.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur.  Setting this to
+        'unsafe' is not recommended, as it can adversely affect accumulations.
+
+          * 'no' means the data types should not be cast at all.
+          * 'equiv' means only byte-order changes are allowed.
+          * 'safe' means only casts which can preserve values are allowed.
+          * 'same_kind' means only safe casts or casts within a kind,
+            like float64 to float32, are allowed.
+          * 'unsafe' means any data conversions may be done.
+
+        Default is 'safe'.
+    optimize : {False, True, 'greedy', 'optimal'}, optional
+        Controls if intermediate optimization should occur. No optimization
+        will occur if False and True will default to the 'greedy' algorithm.
+        Also accepts an explicit contraction list from the ``np.einsum_path``
+        function. See ``np.einsum_path`` for more details. Defaults to False.
+
+    Returns
+    -------
+    output : ndarray
+        The calculation based on the Einstein summation convention.
+
+    See Also
+    --------
+    einsum_path, dot, inner, outer, tensordot, linalg.multi_dot
+    einops :
+        similar verbose interface is provided by
+        `einops <https://github.com/arogozhnikov/einops>`_ package to cover
+        additional operations: transpose, reshape/flatten, repeat/tile,
+        squeeze/unsqueeze and reductions.
+    opt_einsum :
+        `opt_einsum <https://optimized-einsum.readthedocs.io/en/stable/>`_
+        optimizes contraction order for einsum-like expressions
+        in backend-agnostic manner.
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    The Einstein summation convention can be used to compute
+    many multi-dimensional, linear algebraic array operations. `einsum`
+    provides a succinct way of representing these.
+
+    A non-exhaustive list of these operations,
+    which can be computed by `einsum`, is shown below along with examples:
+
+    * Trace of an array, :py:func:`numpy.trace`.
+    * Return a diagonal, :py:func:`numpy.diag`.
+    * Array axis summations, :py:func:`numpy.sum`.
+    * Transpositions and permutations, :py:func:`numpy.transpose`.
+    * Matrix multiplication and dot product, :py:func:`numpy.matmul` :py:func:`numpy.dot`.
+    * Vector inner and outer products, :py:func:`numpy.inner` :py:func:`numpy.outer`.
+    * Broadcasting, element-wise and scalar multiplication, :py:func:`numpy.multiply`.
+    * Tensor contractions, :py:func:`numpy.tensordot`.
+    * Chained array operations, in efficient calculation order, :py:func:`numpy.einsum_path`.
+
+    The subscripts string is a comma-separated list of subscript labels,
+    where each label refers to a dimension of the corresponding operand.
+    Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)``
+    is equivalent to :py:func:`np.inner(a,b) <numpy.inner>`. If a label
+    appears only once, it is not summed, so ``np.einsum('i', a)`` produces a
+    view of ``a`` with no changes. A further example ``np.einsum('ij,jk', a, b)``
+    describes traditional matrix multiplication and is equivalent to
+    :py:func:`np.matmul(a,b) <numpy.matmul>`. Repeated subscript labels in one
+    operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent
+    to :py:func:`np.trace(a) <numpy.trace>`.
+
+    In *implicit mode*, the chosen subscripts are important
+    since the axes of the output are reordered alphabetically.  This
+    means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while
+    ``np.einsum('ji', a)`` takes its transpose. Additionally,
+    ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while,
+    ``np.einsum('ij,jh', a, b)`` returns the transpose of the
+    multiplication since subscript 'h' precedes subscript 'i'.
+
+    In *explicit mode* the output can be directly controlled by
+    specifying output subscript labels.  This requires the
+    identifier '->' as well as the list of output subscript labels.
+    This feature increases the flexibility of the function since
+    summing can be disabled or forced when required. The call
+    ``np.einsum('i->', a)`` is like :py:func:`np.sum(a, axis=-1) <numpy.sum>`,
+    and ``np.einsum('ii->i', a)`` is like :py:func:`np.diag(a) <numpy.diag>`.
+    The difference is that `einsum` does not allow broadcasting by default.
+    Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the
+    order of the output subscript labels and therefore returns matrix
+    multiplication, unlike the example above in implicit mode.
+
+    To enable and control broadcasting, use an ellipsis.  Default
+    NumPy-style broadcasting is done by adding an ellipsis
+    to the left of each term, like ``np.einsum('...ii->...i', a)``.
+    To take the trace along the first and last axes,
+    you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix
+    product with the left-most indices instead of rightmost, one can do
+    ``np.einsum('ij...,jk...->ik...', a, b)``.
+
+    When there is only one operand, no axes are summed, and no output
+    parameter is provided, a view into the operand is returned instead
+    of a new array.  Thus, taking the diagonal as ``np.einsum('ii->i', a)``
+    produces a view (changed in version 1.10.0).
+
+    `einsum` also provides an alternative way to provide the subscripts
+    and operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``.
+    If the output shape is not provided in this format `einsum` will be
+    calculated in implicit mode, otherwise it will be performed explicitly.
+    The examples below have corresponding `einsum` calls with the two
+    parameter methods.
+
+    .. versionadded:: 1.10.0
+
+    Views returned from einsum are now writeable whenever the input array
+    is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now
+    have the same effect as :py:func:`np.swapaxes(a, 0, 2) <numpy.swapaxes>`
+    and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal
+    of a 2D array.
+
+    .. versionadded:: 1.12.0
+
+    Added the ``optimize`` argument which will optimize the contraction order
+    of an einsum expression. For a contraction with three or more operands this
+    can greatly increase the computational efficiency at the cost of a larger
+    memory footprint during computation.
+
+    Typically a 'greedy' algorithm is applied which empirical tests have shown
+    returns the optimal path in the majority of cases. In some cases 'optimal'
+    will return the superlative path through a more expensive, exhaustive search.
+    For iterative calculations it may be advisable to calculate the optimal path
+    once and reuse that path by supplying it as an argument. An example is given
+    below.
+
+    See :py:func:`numpy.einsum_path` for more details.
+
+    Examples
+    --------
+    >>> a = np.arange(25).reshape(5,5)
+    >>> b = np.arange(5)
+    >>> c = np.arange(6).reshape(2,3)
+
+    Trace of a matrix:
+
+    >>> np.einsum('ii', a)
+    60
+    >>> np.einsum(a, [0,0])
+    60
+    >>> np.trace(a)
+    60
+
+    Extract the diagonal (requires explicit form):
+
+    >>> np.einsum('ii->i', a)
+    array([ 0,  6, 12, 18, 24])
+    >>> np.einsum(a, [0,0], [0])
+    array([ 0,  6, 12, 18, 24])
+    >>> np.diag(a)
+    array([ 0,  6, 12, 18, 24])
+
+    Sum over an axis (requires explicit form):
+
+    >>> np.einsum('ij->i', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [0,1], [0])
+    array([ 10,  35,  60,  85, 110])
+    >>> np.sum(a, axis=1)
+    array([ 10,  35,  60,  85, 110])
+
+    For higher dimensional arrays summing a single axis can be done with ellipsis:
+
+    >>> np.einsum('...j->...', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [Ellipsis,1], [Ellipsis])
+    array([ 10,  35,  60,  85, 110])
+
+    Compute a matrix transpose, or reorder any number of axes:
+
+    >>> np.einsum('ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum('ij->ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum(c, [1,0])
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.transpose(c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+
+    Vector inner products:
+
+    >>> np.einsum('i,i', b, b)
+    30
+    >>> np.einsum(b, [0], b, [0])
+    30
+    >>> np.inner(b,b)
+    30
+
+    Matrix vector multiplication:
+
+    >>> np.einsum('ij,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum(a, [0,1], b, [1])
+    array([ 30,  80, 130, 180, 230])
+    >>> np.dot(a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum('...j,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+
+    Broadcasting and scalar multiplication:
+
+    >>> np.einsum('..., ...', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(',ij', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(3, [Ellipsis], c, [Ellipsis])
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.multiply(3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+
+    Vector outer product:
+
+    >>> np.einsum('i,j', np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.einsum(np.arange(2)+1, [0], b, [1])
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.outer(np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+
+    Tensor contraction:
+
+    >>> a = np.arange(60.).reshape(3,4,5)
+    >>> b = np.arange(24.).reshape(4,3,2)
+    >>> np.einsum('ijk,jil->kl', a, b)
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3])
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.tensordot(a,b, axes=([1,0],[0,1]))
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+
+    Writeable returned arrays (since version 1.10.0):
+
+    >>> a = np.zeros((3, 3))
+    >>> np.einsum('ii->i', a)[:] = 1
+    >>> a
+    array([[1., 0., 0.],
+           [0., 1., 0.],
+           [0., 0., 1.]])
+
+    Example of ellipsis use:
+
+    >>> a = np.arange(6).reshape((3,2))
+    >>> b = np.arange(12).reshape((4,3))
+    >>> np.einsum('ki,jk->ij', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('ki,...k->i...', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('k...,jk', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+
+    Chained array operations. For more complicated contractions, speed ups
+    might be achieved by repeatedly computing a 'greedy' path or pre-computing the
+    'optimal' path and repeatedly applying it, using an
+    `einsum_path` insertion (since version 1.12.0). Performance improvements can be
+    particularly significant with larger arrays:
+
+    >>> a = np.ones(64).reshape(2,4,8)
+
+    Basic `einsum`: ~1520ms  (benchmarked on 3.1GHz Intel i5.)
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a)
+
+    Sub-optimal `einsum` (due to repeated path calculation time): ~330ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')
+
+    Greedy `einsum` (faster optimal path approximation): ~160ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='greedy')
+
+    Optimal `einsum` (best usage pattern in some use cases): ~110ms
+
+    >>> path = np.einsum_path('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')[0]
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize=path)
+
+    """
+    # Special handling if out is specified
+    specified_out = out is not None
+
+    # If no optimization, run pure einsum
+    if optimize is False:
+        if specified_out:
+            kwargs['out'] = out
+        return c_einsum(*operands, **kwargs)
+
+    # Check the kwargs to avoid a more cryptic error later, without having to
+    # repeat default values here
+    valid_einsum_kwargs = ['dtype', 'order', 'casting']
+    unknown_kwargs = [k for (k, v) in kwargs.items() if
+                      k not in valid_einsum_kwargs]
+    if len(unknown_kwargs):
+        raise TypeError("Did not understand the following kwargs: %s"
+                        % unknown_kwargs)
+
+    # Build the contraction list and operand
+    operands, contraction_list = einsum_path(*operands, optimize=optimize,
+                                             einsum_call=True)
+
+    # Handle order kwarg for output array, c_einsum allows mixed case
+    output_order = kwargs.pop('order', 'K')
+    if output_order.upper() == 'A':
+        if all(arr.flags.f_contiguous for arr in operands):
+            output_order = 'F'
+        else:
+            output_order = 'C'
+
+    # Start contraction loop
+    for num, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        tmp_operands = [operands.pop(x) for x in inds]
+
+        # Do we need to deal with the output?
+        handle_out = specified_out and ((num + 1) == len(contraction_list))
+
+        # Call tensordot if still possible
+        if blas:
+            # Checks have already been handled
+            input_str, results_index = einsum_str.split('->')
+            input_left, input_right = input_str.split(',')
+
+            tensor_result = input_left + input_right
+            for s in idx_rm:
+                tensor_result = tensor_result.replace(s, "")
+
+            # Find indices to contract over
+            left_pos, right_pos = [], []
+            for s in sorted(idx_rm):
+                left_pos.append(input_left.find(s))
+                right_pos.append(input_right.find(s))
+
+            # Contract!
+            new_view = tensordot(*tmp_operands, axes=(tuple(left_pos), tuple(right_pos)))
+
+            # Build a new view if needed
+            if (tensor_result != results_index) or handle_out:
+                if handle_out:
+                    kwargs["out"] = out
+                new_view = c_einsum(tensor_result + '->' + results_index, new_view, **kwargs)
+
+        # Call einsum
+        else:
+            # If out was specified
+            if handle_out:
+                kwargs["out"] = out
+
+            # Do the contraction
+            new_view = c_einsum(einsum_str, *tmp_operands, **kwargs)
+
+        # Append new items and dereference what we can
+        operands.append(new_view)
+        del tmp_operands, new_view
+
+    if specified_out:
+        return out
+    else:
+        return asanyarray(operands[0], order=output_order)

.venv/lib/python3.11/site-packages/numpy/core/einsumfunc.pyi

@@ -0,0 +1,187 @@
+from collections.abc import Sequence
+from typing import TypeVar, Any, overload, Union, Literal
+
+from numpy import (
+    ndarray,
+    dtype,
+    bool_,
+    number,
+    _OrderKACF,
+)
+from numpy._typing import (
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _DTypeLikeBool,
+    _DTypeLikeUInt,
+    _DTypeLikeInt,
+    _DTypeLikeFloat,
+    _DTypeLikeComplex,
+    _DTypeLikeComplex_co,
+    _DTypeLikeObject,
+)
+
+_ArrayType = TypeVar(
+    "_ArrayType",
+    bound=ndarray[Any, dtype[Union[bool_, number[Any]]]],
+)
+
+_OptimizeKind = None | bool | Literal["greedy", "optimal"] | Sequence[Any]
+_CastingSafe = Literal["no", "equiv", "safe", "same_kind"]
+_CastingUnsafe = Literal["unsafe"]
+
+__all__: list[str]
+
+# TODO: Properly handle the `casting`-based combinatorics
+# TODO: We need to evaluate the content `__subscripts` in order
+# to identify whether or an array or scalar is returned. At a cursory
+# glance this seems like something that can quite easily be done with
+# a mypy plugin.
+# Something like `is_scalar = bool(__subscripts.partition("->")[-1])`
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeBool_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeBool = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeUInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeUInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeInt_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeInt = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeFloat_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeFloat = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeComplex = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeComplex_co = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: None = ...,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    out: None = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> Any: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeObject_co,
+    out: _ArrayType,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    casting: _CastingSafe = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+@overload
+def einsum(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: Any,
+    out: _ArrayType,
+    casting: _CastingUnsafe,
+    dtype: None | _DTypeLikeObject = ...,
+    order: _OrderKACF = ...,
+    optimize: _OptimizeKind = ...,
+) -> _ArrayType: ...
+
+# NOTE: `einsum_call` is a hidden kwarg unavailable for public use.
+# It is therefore excluded from the signatures below.
+# NOTE: In practice the list consists of a `str` (first element)
+# and a variable number of integer tuples.
+def einsum_path(
+    subscripts: str | _ArrayLikeInt_co,
+    /,
+    *operands: _ArrayLikeComplex_co | _DTypeLikeObject,
+    optimize: _OptimizeKind = ...,
+) -> tuple[list[Any], str]: ...

.venv/lib/python3.11/site-packages/numpy/core/fromnumeric.pyi

@@ -0,0 +1,1060 @@
+import datetime as dt
+from collections.abc import Sequence
+from typing import Union, Any, overload, TypeVar, Literal, SupportsIndex
+
+from numpy import (
+    ndarray,
+    number,
+    uint64,
+    int_,
+    int64,
+    intp,
+    float16,
+    bool_,
+    floating,
+    complexfloating,
+    object_,
+    generic,
+    _OrderKACF,
+    _OrderACF,
+    _ModeKind,
+    _PartitionKind,
+    _SortKind,
+    _SortSide,
+    _CastingKind,
+)
+from numpy._typing import (
+    DTypeLike,
+    _DTypeLike,
+    ArrayLike,
+    _ArrayLike,
+    NDArray,
+    _ShapeLike,
+    _Shape,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+    _IntLike_co,
+    _BoolLike_co,
+    _ComplexLike_co,
+    _NumberLike_co,
+    _ScalarLike_co,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+_SCT_uifcO = TypeVar("_SCT_uifcO", bound=number[Any] | object_)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+__all__: list[str]
+
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _IntLike_co,
+    axis: None = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> _SCT: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _IntLike_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def take(
+    a: _ArrayLike[_SCT],
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def take(
+    a: ArrayLike,
+    indices: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def reshape(
+    a: _ArrayLike[_SCT],
+    newshape: _ShapeLike,
+    order: _OrderACF = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def reshape(
+    a: ArrayLike,
+    newshape: _ShapeLike,
+    order: _OrderACF = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def choose(
+    a: _IntLike_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> Any: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: _ArrayLike[_SCT],
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: None = ...,
+    mode: _ModeKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def choose(
+    a: _ArrayLikeInt_co,
+    choices: ArrayLike,
+    out: _ArrayType = ...,
+    mode: _ModeKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def repeat(
+    a: _ArrayLike[_SCT],
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def repeat(
+    a: ArrayLike,
+    repeats: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+def put(
+    a: NDArray[Any],
+    ind: _ArrayLikeInt_co,
+    v: ArrayLike,
+    mode: _ModeKind = ...,
+) -> None: ...
+
+@overload
+def swapaxes(
+    a: _ArrayLike[_SCT],
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[_SCT]: ...
+@overload
+def swapaxes(
+    a: ArrayLike,
+    axis1: SupportsIndex,
+    axis2: SupportsIndex,
+) -> NDArray[Any]: ...
+
+@overload
+def transpose(
+    a: _ArrayLike[_SCT],
+    axes: None | _ShapeLike = ...
+) -> NDArray[_SCT]: ...
+@overload
+def transpose(
+    a: ArrayLike,
+    axes: None | _ShapeLike = ...
+) -> NDArray[Any]: ...
+
+@overload
+def partition(
+    a: _ArrayLike[_SCT],
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def partition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[Any]: ...
+
+def argpartition(
+    a: ArrayLike,
+    kth: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    kind: _PartitionKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def sort(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def sort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[Any]: ...
+
+def argsort(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    kind: None | _SortKind = ...,
+    order: None | str | Sequence[str] = ...,
+) -> NDArray[intp]: ...
+
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmax(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> intp: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def argmin(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: _ScalarLike_co,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> intp: ...
+@overload
+def searchsorted(
+    a: ArrayLike,
+    v: ArrayLike,
+    side: _SortSide = ...,
+    sorter: None | _ArrayLikeInt_co = ...,  # 1D int array
+) -> NDArray[intp]: ...
+
+@overload
+def resize(
+    a: _ArrayLike[_SCT],
+    new_shape: _ShapeLike,
+) -> NDArray[_SCT]: ...
+@overload
+def resize(
+    a: ArrayLike,
+    new_shape: _ShapeLike,
+) -> NDArray[Any]: ...
+
+@overload
+def squeeze(
+    a: _SCT,
+    axis: None | _ShapeLike = ...,
+) -> _SCT: ...
+@overload
+def squeeze(
+    a: _ArrayLike[_SCT],
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def squeeze(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def diagonal(
+    a: _ArrayLike[_SCT],
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[_SCT]: ...
+@overload
+def diagonal(
+    a: ArrayLike,
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,  # >= 2D array
+) -> NDArray[Any]: ...
+
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def trace(
+    a: ArrayLike,  # >= 2D array
+    offset: SupportsIndex = ...,
+    axis1: SupportsIndex = ...,
+    axis2: SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def ravel(a: _ArrayLike[_SCT], order: _OrderKACF = ...) -> NDArray[_SCT]: ...
+@overload
+def ravel(a: ArrayLike, order: _OrderKACF = ...) -> NDArray[Any]: ...
+
+def nonzero(a: ArrayLike) -> tuple[NDArray[intp], ...]: ...
+
+def shape(a: ArrayLike) -> _Shape: ...
+
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def compress(
+    condition: _ArrayLikeBool_co,  # 1D bool array
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def clip(
+    a: _SCT,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> _SCT: ...
+@overload
+def clip(
+    a: _ScalarLike_co,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: _ArrayLike[_SCT],
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> NDArray[Any]: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> Any: ...
+@overload
+def clip(
+    a: ArrayLike,
+    a_min: None | ArrayLike,
+    a_max: None | ArrayLike,
+    out: _ArrayType,
+    *,
+    dtype: DTypeLike = ...,
+    where: None | _ArrayLikeBool_co = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    signature: str | tuple[None | str, ...] = ...,
+    extobj: list[Any] = ...,
+    casting: _CastingKind = ...,
+) -> _ArrayType: ...
+
+@overload
+def sum(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    dtype: None = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def sum(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType  = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def all(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> bool_: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def all(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def any(
+    a: ArrayLike,
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> bool_: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def any(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumsum(
+    a: _ArrayLike[_SCT],
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumsum(
+    a: ArrayLike,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def ptp(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+) -> _SCT: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def ptp(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+@overload
+def amax(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amax(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def amin(
+    a: _ArrayLike[_SCT],
+    axis: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def amin(
+    a: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+# TODO: `np.prod()``: For object arrays `initial` does not necessarily
+# have to be a numerical scalar.
+# The only requirement is that it is compatible
+# with the `.__mul__()` method(s) of the passed array's elements.
+
+# Note that the same situation holds for all wrappers around
+# `np.ufunc.reduce`, e.g. `np.sum()` (`.__add__()`).
+@overload
+def prod(
+    a: _ArrayLikeBool_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int_: ...
+@overload
+def prod(
+    a: _ArrayLikeUInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> uint64: ...
+@overload
+def prod(
+    a: _ArrayLikeInt_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> int64: ...
+@overload
+def prod(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def prod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None | DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    initial: _NumberLike_co = ...,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def cumprod(
+    a: _ArrayLikeBool_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeUInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[uint64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[int64]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeFloat_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: None = ...,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def cumprod(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | SupportsIndex = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+def ndim(a: ArrayLike) -> int: ...
+
+def size(a: ArrayLike, axis: None | int = ...) -> int: ...
+
+@overload
+def around(
+    a: _BoolLike_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> float16: ...
+@overload
+def around(
+    a: _SCT_uifcO,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> _SCT_uifcO: ...
+@overload
+def around(
+    a: _ComplexLike_co | object_,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> Any: ...
+@overload
+def around(
+    a: _ArrayLikeBool_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[float16]: ...
+@overload
+def around(
+    a: _ArrayLike[_SCT_uifcO],
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[_SCT_uifcO]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def around(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    decimals: SupportsIndex = ...,
+    out: _ArrayType = ...,
+) -> _ArrayType: ...
+
+@overload
+def mean(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def mean(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def std(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def std(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+@overload
+def var(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> floating[Any]: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: None = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: Literal[False] = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _SCT: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: None = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> Any: ...
+@overload
+def var(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    dtype: DTypeLike = ...,
+    out: _ArrayType = ...,
+    ddof: float = ...,
+    keepdims: bool = ...,
+    *,
+    where: _ArrayLikeBool_co = ...,
+) -> _ArrayType: ...
+
+max = amax
+min = amin
+round = around

.venv/lib/python3.11/site-packages/numpy/core/function_base.py

@@ -0,0 +1,551 @@
+import functools
+import warnings
+import operator
+import types
+
+import numpy as np
+from . import numeric as _nx
+from .numeric import result_type, NaN, asanyarray, ndim
+from numpy.core.multiarray import add_docstring
+from numpy.core import overrides
+
+__all__ = ['logspace', 'linspace', 'geomspace']
+
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+def _linspace_dispatcher(start, stop, num=None, endpoint=None, retstep=None,
+                         dtype=None, axis=None):
+    return (start, stop)
+
+
+@array_function_dispatch(_linspace_dispatcher)
+def linspace(start, stop, num=50, endpoint=True, retstep=False, dtype=None,
+             axis=0):
+    """
+    Return evenly spaced numbers over a specified interval.
+
+    Returns `num` evenly spaced samples, calculated over the
+    interval [`start`, `stop`].
+
+    The endpoint of the interval can optionally be excluded.
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    .. versionchanged:: 1.20.0
+        Values are rounded towards ``-inf`` instead of ``0`` when an
+        integer ``dtype`` is specified. The old behavior can
+        still be obtained with ``np.linspace(start, stop, num).astype(int)``
+
+    Parameters
+    ----------
+    start : array_like
+        The starting value of the sequence.
+    stop : array_like
+        The end value of the sequence, unless `endpoint` is set to False.
+        In that case, the sequence consists of all but the last of ``num + 1``
+        evenly spaced samples, so that `stop` is excluded.  Note that the step
+        size changes when `endpoint` is False.
+    num : int, optional
+        Number of samples to generate. Default is 50. Must be non-negative.
+    endpoint : bool, optional
+        If True, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    retstep : bool, optional
+        If True, return (`samples`, `step`), where `step` is the spacing
+        between samples.
+    dtype : dtype, optional
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred dtype will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+
+        .. versionadded:: 1.9.0
+
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start
+        or stop are array-like.  By default (0), the samples will be along a
+        new axis inserted at the beginning. Use -1 to get an axis at the end.
+
+        .. versionadded:: 1.16.0
+
+    Returns
+    -------
+    samples : ndarray
+        There are `num` equally spaced samples in the closed interval
+        ``[start, stop]`` or the half-open interval ``[start, stop)``
+        (depending on whether `endpoint` is True or False).
+    step : float, optional
+        Only returned if `retstep` is True
+
+        Size of spacing between samples.
+
+
+    See Also
+    --------
+    arange : Similar to `linspace`, but uses a step size (instead of the
+             number of samples).
+    geomspace : Similar to `linspace`, but with numbers spaced evenly on a log
+                scale (a geometric progression).
+    logspace : Similar to `geomspace`, but with the end points specified as
+               logarithms.
+    :ref:`how-to-partition`
+
+    Examples
+    --------
+    >>> np.linspace(2.0, 3.0, num=5)
+    array([2.  , 2.25, 2.5 , 2.75, 3.  ])
+    >>> np.linspace(2.0, 3.0, num=5, endpoint=False)
+    array([2. ,  2.2,  2.4,  2.6,  2.8])
+    >>> np.linspace(2.0, 3.0, num=5, retstep=True)
+    (array([2.  ,  2.25,  2.5 ,  2.75,  3.  ]), 0.25)
+
+    Graphical illustration:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 8
+    >>> y = np.zeros(N)
+    >>> x1 = np.linspace(0, 10, N, endpoint=True)
+    >>> x2 = np.linspace(0, 10, N, endpoint=False)
+    >>> plt.plot(x1, y, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.plot(x2, y + 0.5, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.ylim([-0.5, 1])
+    (-0.5, 1)
+    >>> plt.show()
+
+    """
+    num = operator.index(num)
+    if num < 0:
+        raise ValueError("Number of samples, %s, must be non-negative." % num)
+    div = (num - 1) if endpoint else num
+
+    # Convert float/complex array scalars to float, gh-3504
+    # and make sure one can use variables that have an __array_interface__, gh-6634
+    start = asanyarray(start) * 1.0
+    stop  = asanyarray(stop)  * 1.0
+
+    dt = result_type(start, stop, float(num))
+    if dtype is None:
+        dtype = dt
+        integer_dtype = False
+    else:
+        integer_dtype = _nx.issubdtype(dtype, _nx.integer)
+
+    delta = stop - start
+    y = _nx.arange(0, num, dtype=dt).reshape((-1,) + (1,) * ndim(delta))
+    # In-place multiplication y *= delta/div is faster, but prevents the multiplicant
+    # from overriding what class is produced, and thus prevents, e.g. use of Quantities,
+    # see gh-7142. Hence, we multiply in place only for standard scalar types.
+    if div > 0:
+        _mult_inplace = _nx.isscalar(delta)
+        step = delta / div
+        any_step_zero = (
+            step == 0 if _mult_inplace else _nx.asanyarray(step == 0).any())
+        if any_step_zero:
+            # Special handling for denormal numbers, gh-5437
+            y /= div
+            if _mult_inplace:
+                y *= delta
+            else:
+                y = y * delta
+        else:
+            if _mult_inplace:
+                y *= step
+            else:
+                y = y * step
+    else:
+        # sequences with 0 items or 1 item with endpoint=True (i.e. div <= 0)
+        # have an undefined step
+        step = NaN
+        # Multiply with delta to allow possible override of output class.
+        y = y * delta
+
+    y += start
+
+    if endpoint and num > 1:
+        y[-1, ...] = stop
+
+    if axis != 0:
+        y = _nx.moveaxis(y, 0, axis)
+
+    if integer_dtype:
+        _nx.floor(y, out=y)
+
+    if retstep:
+        return y.astype(dtype, copy=False), step
+    else:
+        return y.astype(dtype, copy=False)
+
+
+def _logspace_dispatcher(start, stop, num=None, endpoint=None, base=None,
+                         dtype=None, axis=None):
+    return (start, stop, base)
+
+
+@array_function_dispatch(_logspace_dispatcher)
+def logspace(start, stop, num=50, endpoint=True, base=10.0, dtype=None,
+             axis=0):
+    """
+    Return numbers spaced evenly on a log scale.
+
+    In linear space, the sequence starts at ``base ** start``
+    (`base` to the power of `start`) and ends with ``base ** stop``
+    (see `endpoint` below).
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    .. versionchanged:: 1.25.0
+        Non-scalar 'base` is now supported
+
+    Parameters
+    ----------
+    start : array_like
+        ``base ** start`` is the starting value of the sequence.
+    stop : array_like
+        ``base ** stop`` is the final value of the sequence, unless `endpoint`
+        is False.  In that case, ``num + 1`` values are spaced over the
+        interval in log-space, of which all but the last (a sequence of
+        length `num`) are returned.
+    num : integer, optional
+        Number of samples to generate.  Default is 50.
+    endpoint : boolean, optional
+        If true, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    base : array_like, optional
+        The base of the log space. The step size between the elements in
+        ``ln(samples) / ln(base)`` (or ``log_base(samples)``) is uniform.
+        Default is 10.0.
+    dtype : dtype
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred type will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start,
+        stop, or base are array-like.  By default (0), the samples will be
+        along a new axis inserted at the beginning. Use -1 to get an axis at
+        the end.
+
+        .. versionadded:: 1.16.0
+
+
+    Returns
+    -------
+    samples : ndarray
+        `num` samples, equally spaced on a log scale.
+
+    See Also
+    --------
+    arange : Similar to linspace, with the step size specified instead of the
+             number of samples. Note that, when used with a float endpoint, the
+             endpoint may or may not be included.
+    linspace : Similar to logspace, but with the samples uniformly distributed
+               in linear space, instead of log space.
+    geomspace : Similar to logspace, but with endpoints specified directly.
+    :ref:`how-to-partition`
+
+    Notes
+    -----
+    If base is a scalar, logspace is equivalent to the code
+
+    >>> y = np.linspace(start, stop, num=num, endpoint=endpoint)
+    ... # doctest: +SKIP
+    >>> power(base, y).astype(dtype)
+    ... # doctest: +SKIP
+
+    Examples
+    --------
+    >>> np.logspace(2.0, 3.0, num=4)
+    array([ 100.        ,  215.443469  ,  464.15888336, 1000.        ])
+    >>> np.logspace(2.0, 3.0, num=4, endpoint=False)
+    array([100.        ,  177.827941  ,  316.22776602,  562.34132519])
+    >>> np.logspace(2.0, 3.0, num=4, base=2.0)
+    array([4.        ,  5.0396842 ,  6.34960421,  8.        ])
+    >>> np.logspace(2.0, 3.0, num=4, base=[2.0, 3.0], axis=-1)
+    array([[ 4.        ,  5.0396842 ,  6.34960421,  8.        ],
+           [ 9.        , 12.98024613, 18.72075441, 27.        ]])
+
+    Graphical illustration:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 10
+    >>> x1 = np.logspace(0.1, 1, N, endpoint=True)
+    >>> x2 = np.logspace(0.1, 1, N, endpoint=False)
+    >>> y = np.zeros(N)
+    >>> plt.plot(x1, y, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.plot(x2, y + 0.5, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.ylim([-0.5, 1])
+    (-0.5, 1)
+    >>> plt.show()
+
+    """
+    ndmax = np.broadcast(start, stop, base).ndim
+    start, stop, base = (
+        np.array(a, copy=False, subok=True, ndmin=ndmax)
+        for a in (start, stop, base)
+    )
+    y = linspace(start, stop, num=num, endpoint=endpoint, axis=axis)
+    base = np.expand_dims(base, axis=axis)
+    if dtype is None:
+        return _nx.power(base, y)
+    return _nx.power(base, y).astype(dtype, copy=False)
+
+
+def _geomspace_dispatcher(start, stop, num=None, endpoint=None, dtype=None,
+                          axis=None):
+    return (start, stop)
+
+
+@array_function_dispatch(_geomspace_dispatcher)
+def geomspace(start, stop, num=50, endpoint=True, dtype=None, axis=0):
+    """
+    Return numbers spaced evenly on a log scale (a geometric progression).
+
+    This is similar to `logspace`, but with endpoints specified directly.
+    Each output sample is a constant multiple of the previous.
+
+    .. versionchanged:: 1.16.0
+        Non-scalar `start` and `stop` are now supported.
+
+    Parameters
+    ----------
+    start : array_like
+        The starting value of the sequence.
+    stop : array_like
+        The final value of the sequence, unless `endpoint` is False.
+        In that case, ``num + 1`` values are spaced over the
+        interval in log-space, of which all but the last (a sequence of
+        length `num`) are returned.
+    num : integer, optional
+        Number of samples to generate.  Default is 50.
+    endpoint : boolean, optional
+        If true, `stop` is the last sample. Otherwise, it is not included.
+        Default is True.
+    dtype : dtype
+        The type of the output array.  If `dtype` is not given, the data type
+        is inferred from `start` and `stop`. The inferred dtype will never be
+        an integer; `float` is chosen even if the arguments would produce an
+        array of integers.
+    axis : int, optional
+        The axis in the result to store the samples.  Relevant only if start
+        or stop are array-like.  By default (0), the samples will be along a
+        new axis inserted at the beginning. Use -1 to get an axis at the end.
+
+        .. versionadded:: 1.16.0
+
+    Returns
+    -------
+    samples : ndarray
+        `num` samples, equally spaced on a log scale.
+
+    See Also
+    --------
+    logspace : Similar to geomspace, but with endpoints specified using log
+               and base.
+    linspace : Similar to geomspace, but with arithmetic instead of geometric
+               progression.
+    arange : Similar to linspace, with the step size specified instead of the
+             number of samples.
+    :ref:`how-to-partition`
+
+    Notes
+    -----
+    If the inputs or dtype are complex, the output will follow a logarithmic
+    spiral in the complex plane.  (There are an infinite number of spirals
+    passing through two points; the output will follow the shortest such path.)
+
+    Examples
+    --------
+    >>> np.geomspace(1, 1000, num=4)
+    array([    1.,    10.,   100.,  1000.])
+    >>> np.geomspace(1, 1000, num=3, endpoint=False)
+    array([   1.,   10.,  100.])
+    >>> np.geomspace(1, 1000, num=4, endpoint=False)
+    array([   1.        ,    5.62341325,   31.6227766 ,  177.827941  ])
+    >>> np.geomspace(1, 256, num=9)
+    array([   1.,    2.,    4.,    8.,   16.,   32.,   64.,  128.,  256.])
+
+    Note that the above may not produce exact integers:
+
+    >>> np.geomspace(1, 256, num=9, dtype=int)
+    array([  1,   2,   4,   7,  16,  32,  63, 127, 256])
+    >>> np.around(np.geomspace(1, 256, num=9)).astype(int)
+    array([  1,   2,   4,   8,  16,  32,  64, 128, 256])
+
+    Negative, decreasing, and complex inputs are allowed:
+
+    >>> np.geomspace(1000, 1, num=4)
+    array([1000.,  100.,   10.,    1.])
+    >>> np.geomspace(-1000, -1, num=4)
+    array([-1000.,  -100.,   -10.,    -1.])
+    >>> np.geomspace(1j, 1000j, num=4)  # Straight line
+    array([0.   +1.j, 0.  +10.j, 0. +100.j, 0.+1000.j])
+    >>> np.geomspace(-1+0j, 1+0j, num=5)  # Circle
+    array([-1.00000000e+00+1.22464680e-16j, -7.07106781e-01+7.07106781e-01j,
+            6.12323400e-17+1.00000000e+00j,  7.07106781e-01+7.07106781e-01j,
+            1.00000000e+00+0.00000000e+00j])
+
+    Graphical illustration of `endpoint` parameter:
+
+    >>> import matplotlib.pyplot as plt
+    >>> N = 10
+    >>> y = np.zeros(N)
+    >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=True), y + 1, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.semilogx(np.geomspace(1, 1000, N, endpoint=False), y + 2, 'o')
+    [<matplotlib.lines.Line2D object at 0x...>]
+    >>> plt.axis([0.5, 2000, 0, 3])
+    [0.5, 2000, 0, 3]
+    >>> plt.grid(True, color='0.7', linestyle='-', which='both', axis='both')
+    >>> plt.show()
+
+    """
+    start = asanyarray(start)
+    stop = asanyarray(stop)
+    if _nx.any(start == 0) or _nx.any(stop == 0):
+        raise ValueError('Geometric sequence cannot include zero')
+
+    dt = result_type(start, stop, float(num), _nx.zeros((), dtype))
+    if dtype is None:
+        dtype = dt
+    else:
+        # complex to dtype('complex128'), for instance
+        dtype = _nx.dtype(dtype)
+
+    # Promote both arguments to the same dtype in case, for instance, one is
+    # complex and another is negative and log would produce NaN otherwise.
+    # Copy since we may change things in-place further down.
+    start = start.astype(dt, copy=True)
+    stop = stop.astype(dt, copy=True)
+
+    out_sign = _nx.ones(_nx.broadcast(start, stop).shape, dt)
+    # Avoid negligible real or imaginary parts in output by rotating to
+    # positive real, calculating, then undoing rotation
+    if _nx.issubdtype(dt, _nx.complexfloating):
+        all_imag = (start.real == 0.) & (stop.real == 0.)
+        if _nx.any(all_imag):
+            start[all_imag] = start[all_imag].imag
+            stop[all_imag] = stop[all_imag].imag
+            out_sign[all_imag] = 1j
+
+    both_negative = (_nx.sign(start) == -1) & (_nx.sign(stop) == -1)
+    if _nx.any(both_negative):
+        _nx.negative(start, out=start, where=both_negative)
+        _nx.negative(stop, out=stop, where=both_negative)
+        _nx.negative(out_sign, out=out_sign, where=both_negative)
+
+    log_start = _nx.log10(start)
+    log_stop = _nx.log10(stop)
+    result = logspace(log_start, log_stop, num=num,
+                      endpoint=endpoint, base=10.0, dtype=dtype)
+
+    # Make sure the endpoints match the start and stop arguments. This is
+    # necessary because np.exp(np.log(x)) is not necessarily equal to x.
+    if num > 0:
+        result[0] = start
+        if num > 1 and endpoint:
+            result[-1] = stop
+
+    result = out_sign * result
+
+    if axis != 0:
+        result = _nx.moveaxis(result, 0, axis)
+
+    return result.astype(dtype, copy=False)
+
+
+def _needs_add_docstring(obj):
+    """
+    Returns true if the only way to set the docstring of `obj` from python is
+    via add_docstring.
+
+    This function errs on the side of being overly conservative.
+    """
+    Py_TPFLAGS_HEAPTYPE = 1 << 9
+
+    if isinstance(obj, (types.FunctionType, types.MethodType, property)):
+        return False
+
+    if isinstance(obj, type) and obj.__flags__ & Py_TPFLAGS_HEAPTYPE:
+        return False
+
+    return True
+
+
+def _add_docstring(obj, doc, warn_on_python):
+    if warn_on_python and not _needs_add_docstring(obj):
+        warnings.warn(
+            "add_newdoc was used on a pure-python object {}. "
+            "Prefer to attach it directly to the source."
+            .format(obj),
+            UserWarning,
+            stacklevel=3)
+    try:
+        add_docstring(obj, doc)
+    except Exception:
+        pass
+
+
+def add_newdoc(place, obj, doc, warn_on_python=True):
+    """
+    Add documentation to an existing object, typically one defined in C
+
+    The purpose is to allow easier editing of the docstrings without requiring
+    a re-compile. This exists primarily for internal use within numpy itself.
+
+    Parameters
+    ----------
+    place : str
+        The absolute name of the module to import from
+    obj : str
+        The name of the object to add documentation to, typically a class or
+        function name
+    doc : {str, Tuple[str, str], List[Tuple[str, str]]}
+        If a string, the documentation to apply to `obj`
+
+        If a tuple, then the first element is interpreted as an attribute of
+        `obj` and the second as the docstring to apply - ``(method, docstring)``
+
+        If a list, then each element of the list should be a tuple of length
+        two - ``[(method1, docstring1), (method2, docstring2), ...]``
+    warn_on_python : bool
+        If True, the default, emit `UserWarning` if this is used to attach
+        documentation to a pure-python object.
+
+    Notes
+    -----
+    This routine never raises an error if the docstring can't be written, but
+    will raise an error if the object being documented does not exist.
+
+    This routine cannot modify read-only docstrings, as appear
+    in new-style classes or built-in functions. Because this
+    routine never raises an error the caller must check manually
+    that the docstrings were changed.
+
+    Since this function grabs the ``char *`` from a c-level str object and puts
+    it into the ``tp_doc`` slot of the type of `obj`, it violates a number of
+    C-API best-practices, by:
+
+    - modifying a `PyTypeObject` after calling `PyType_Ready`
+    - calling `Py_INCREF` on the str and losing the reference, so the str
+      will never be released
+
+    If possible it should be avoided.
+    """
+    new = getattr(__import__(place, globals(), {}, [obj]), obj)
+    if isinstance(doc, str):
+        _add_docstring(new, doc.strip(), warn_on_python)
+    elif isinstance(doc, tuple):
+        attr, docstring = doc
+        _add_docstring(getattr(new, attr), docstring.strip(), warn_on_python)
+    elif isinstance(doc, list):
+        for attr, docstring in doc:
+            _add_docstring(getattr(new, attr), docstring.strip(), warn_on_python)

.venv/lib/python3.11/site-packages/numpy/core/function_base.pyi

@@ -0,0 +1,187 @@
+from typing import (
+    Literal as L,
+    overload,
+    Any,
+    SupportsIndex,
+    TypeVar,
+)
+
+from numpy import floating, complexfloating, generic
+from numpy._typing import (
+    NDArray,
+    DTypeLike,
+    _DTypeLike,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+__all__: list[str]
+
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[False] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+@overload
+def linspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[floating[Any]], floating[Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[complexfloating[Any, Any]], complexfloating[Any, Any]]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[_SCT], _SCT]: ...
+@overload
+def linspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    retstep: L[True] = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> tuple[NDArray[Any], Any]: ...
+
+@overload
+def logspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeFloat_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def logspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    base: _ArrayLikeComplex_co = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def geomspace(
+    start: _ArrayLikeFloat_co,
+    stop: _ArrayLikeFloat_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: None = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: _DTypeLike[_SCT] = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def geomspace(
+    start: _ArrayLikeComplex_co,
+    stop: _ArrayLikeComplex_co,
+    num: SupportsIndex = ...,
+    endpoint: bool = ...,
+    dtype: DTypeLike = ...,
+    axis: SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+# Re-exported to `np.lib.function_base`
+def add_newdoc(
+    place: str,
+    obj: str,
+    doc: str | tuple[str, str] | list[tuple[str, str]],
+    warn_on_python: bool = ...,
+) -> None: ...

.venv/lib/python3.11/site-packages/numpy/core/getlimits.py

@@ -0,0 +1,735 @@
+"""Machine limits for Float32 and Float64 and (long double) if available...
+
+"""
+__all__ = ['finfo', 'iinfo']
+
+import warnings
+
+from .._utils import set_module
+from ._machar import MachAr
+from . import numeric
+from . import numerictypes as ntypes
+from .numeric import array, inf, NaN
+from .umath import log10, exp2, nextafter, isnan
+
+
+def _fr0(a):
+    """fix rank-0 --> rank-1"""
+    if a.ndim == 0:
+        a = a.copy()
+        a.shape = (1,)
+    return a
+
+
+def _fr1(a):
+    """fix rank > 0 --> rank-0"""
+    if a.size == 1:
+        a = a.copy()
+        a.shape = ()
+    return a
+
+
+class MachArLike:
+    """ Object to simulate MachAr instance """
+    def __init__(self, ftype, *, eps, epsneg, huge, tiny,
+                 ibeta, smallest_subnormal=None, **kwargs):
+        self.params = _MACHAR_PARAMS[ftype]
+        self.ftype = ftype
+        self.title = self.params['title']
+        # Parameter types same as for discovered MachAr object.
+        if not smallest_subnormal:
+            self._smallest_subnormal = nextafter(
+                self.ftype(0), self.ftype(1), dtype=self.ftype)
+        else:
+            self._smallest_subnormal = smallest_subnormal
+        self.epsilon = self.eps = self._float_to_float(eps)
+        self.epsneg = self._float_to_float(epsneg)
+        self.xmax = self.huge = self._float_to_float(huge)
+        self.xmin = self._float_to_float(tiny)
+        self.smallest_normal = self.tiny = self._float_to_float(tiny)
+        self.ibeta = self.params['itype'](ibeta)
+        self.__dict__.update(kwargs)
+        self.precision = int(-log10(self.eps))
+        self.resolution = self._float_to_float(
+            self._float_conv(10) ** (-self.precision))
+        self._str_eps = self._float_to_str(self.eps)
+        self._str_epsneg = self._float_to_str(self.epsneg)
+        self._str_xmin = self._float_to_str(self.xmin)
+        self._str_xmax = self._float_to_str(self.xmax)
+        self._str_resolution = self._float_to_str(self.resolution)
+        self._str_smallest_normal = self._float_to_str(self.xmin)
+
+    @property
+    def smallest_subnormal(self):
+        """Return the value for the smallest subnormal.
+
+        Returns
+        -------
+        smallest_subnormal : float
+            value for the smallest subnormal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest subnormal is zero.
+        """
+        # Check that the calculated value is not zero, in case it raises a
+        # warning.
+        value = self._smallest_subnormal
+        if self.ftype(0) == value:
+            warnings.warn(
+                'The value of the smallest subnormal for {} type '
+                'is zero.'.format(self.ftype), UserWarning, stacklevel=2)
+
+        return self._float_to_float(value)
+
+    @property
+    def _str_smallest_subnormal(self):
+        """Return the string representation of the smallest subnormal."""
+        return self._float_to_str(self.smallest_subnormal)
+
+    def _float_to_float(self, value):
+        """Converts float to float.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return _fr1(self._float_conv(value))
+
+    def _float_conv(self, value):
+        """Converts float to conv.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return array([value], self.ftype)
+
+    def _float_to_str(self, value):
+        """Converts float to str.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return self.params['fmt'] % array(_fr0(value)[0], self.ftype)
+
+
+_convert_to_float = {
+    ntypes.csingle: ntypes.single,
+    ntypes.complex_: ntypes.float_,
+    ntypes.clongfloat: ntypes.longfloat
+    }
+
+# Parameters for creating MachAr / MachAr-like objects
+_title_fmt = 'numpy {} precision floating point number'
+_MACHAR_PARAMS = {
+    ntypes.double: dict(
+        itype = ntypes.int64,
+        fmt = '%24.16e',
+        title = _title_fmt.format('double')),
+    ntypes.single: dict(
+        itype = ntypes.int32,
+        fmt = '%15.7e',
+        title = _title_fmt.format('single')),
+    ntypes.longdouble: dict(
+        itype = ntypes.longlong,
+        fmt = '%s',
+        title = _title_fmt.format('long double')),
+    ntypes.half: dict(
+        itype = ntypes.int16,
+        fmt = '%12.5e',
+        title = _title_fmt.format('half'))}
+
+# Key to identify the floating point type.  Key is result of
+# ftype('-0.1').newbyteorder('<').tobytes()
+#
+# 20230201 - use (ftype(-1.0) / ftype(10.0)).newbyteorder('<').tobytes()
+#            instead because stold may have deficiencies on some platforms.
+# See:
+# https://perl5.git.perl.org/perl.git/blob/3118d7d684b56cbeb702af874f4326683c45f045:/Configure
+
+_KNOWN_TYPES = {}
+def _register_type(machar, bytepat):
+    _KNOWN_TYPES[bytepat] = machar
+_float_ma = {}
+
+
+def _register_known_types():
+    # Known parameters for float16
+    # See docstring of MachAr class for description of parameters.
+    f16 = ntypes.float16
+    float16_ma = MachArLike(f16,
+                            machep=-10,
+                            negep=-11,
+                            minexp=-14,
+                            maxexp=16,
+                            it=10,
+                            iexp=5,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f16(-10)),
+                            epsneg=exp2(f16(-11)),
+                            huge=f16(65504),
+                            tiny=f16(2 ** -14))
+    _register_type(float16_ma, b'f\xae')
+    _float_ma[16] = float16_ma
+
+    # Known parameters for float32
+    f32 = ntypes.float32
+    float32_ma = MachArLike(f32,
+                            machep=-23,
+                            negep=-24,
+                            minexp=-126,
+                            maxexp=128,
+                            it=23,
+                            iexp=8,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f32(-23)),
+                            epsneg=exp2(f32(-24)),
+                            huge=f32((1 - 2 ** -24) * 2**128),
+                            tiny=exp2(f32(-126)))
+    _register_type(float32_ma, b'\xcd\xcc\xcc\xbd')
+    _float_ma[32] = float32_ma
+
+    # Known parameters for float64
+    f64 = ntypes.float64
+    epsneg_f64 = 2.0 ** -53.0
+    tiny_f64 = 2.0 ** -1022.0
+    float64_ma = MachArLike(f64,
+                            machep=-52,
+                            negep=-53,
+                            minexp=-1022,
+                            maxexp=1024,
+                            it=52,
+                            iexp=11,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=2.0 ** -52.0,
+                            epsneg=epsneg_f64,
+                            huge=(1.0 - epsneg_f64) / tiny_f64 * f64(4),
+                            tiny=tiny_f64)
+    _register_type(float64_ma, b'\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    _float_ma[64] = float64_ma
+
+    # Known parameters for IEEE 754 128-bit binary float
+    ld = ntypes.longdouble
+    epsneg_f128 = exp2(ld(-113))
+    tiny_f128 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f128
+    with numeric.errstate(all='ignore'):
+        huge_f128 = (ld(1) - epsneg_f128) / tiny_f128 * ld(4)
+    float128_ma = MachArLike(ld,
+                             machep=-112,
+                             negep=-113,
+                             minexp=-16382,
+                             maxexp=16384,
+                             it=112,
+                             iexp=15,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-112)),
+                             epsneg=epsneg_f128,
+                             huge=huge_f128,
+                             tiny=tiny_f128)
+    # IEEE 754 128-bit binary float
+    _register_type(float128_ma,
+        b'\x9a\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\xfb\xbf')
+    _float_ma[128] = float128_ma
+
+    # Known parameters for float80 (Intel 80-bit extended precision)
+    epsneg_f80 = exp2(ld(-64))
+    tiny_f80 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f80
+    with numeric.errstate(all='ignore'):
+        huge_f80 = (ld(1) - epsneg_f80) / tiny_f80 * ld(4)
+    float80_ma = MachArLike(ld,
+                            machep=-63,
+                            negep=-64,
+                            minexp=-16382,
+                            maxexp=16384,
+                            it=63,
+                            iexp=15,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(ld(-63)),
+                            epsneg=epsneg_f80,
+                            huge=huge_f80,
+                            tiny=tiny_f80)
+    # float80, first 10 bytes containing actual storage
+    _register_type(float80_ma, b'\xcd\xcc\xcc\xcc\xcc\xcc\xcc\xcc\xfb\xbf')
+    _float_ma[80] = float80_ma
+
+    # Guessed / known parameters for double double; see:
+    # https://en.wikipedia.org/wiki/Quadruple-precision_floating-point_format#Double-double_arithmetic
+    # These numbers have the same exponent range as float64, but extended number of
+    # digits in the significand.
+    huge_dd = nextafter(ld(inf), ld(0), dtype=ld)
+    # As the smallest_normal in double double is so hard to calculate we set
+    # it to NaN.
+    smallest_normal_dd = NaN
+    # Leave the same value for the smallest subnormal as double
+    smallest_subnormal_dd = ld(nextafter(0., 1.))
+    float_dd_ma = MachArLike(ld,
+                             machep=-105,
+                             negep=-106,
+                             minexp=-1022,
+                             maxexp=1024,
+                             it=105,
+                             iexp=11,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-105)),
+                             epsneg=exp2(ld(-106)),
+                             huge=huge_dd,
+                             tiny=smallest_normal_dd,
+                             smallest_subnormal=smallest_subnormal_dd)
+    # double double; low, high order (e.g. PPC 64)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99Y<\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    # double double; high, low order (e.g. PPC 64 le)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99\xb9\xbf\x9a\x99\x99\x99\x99\x99Y<')
+    _float_ma['dd'] = float_dd_ma
+
+
+def _get_machar(ftype):
+    """ Get MachAr instance or MachAr-like instance
+
+    Get parameters for floating point type, by first trying signatures of
+    various known floating point types, then, if none match, attempting to
+    identify parameters by analysis.
+
+    Parameters
+    ----------
+    ftype : class
+        Numpy floating point type class (e.g. ``np.float64``)
+
+    Returns
+    -------
+    ma_like : instance of :class:`MachAr` or :class:`MachArLike`
+        Object giving floating point parameters for `ftype`.
+
+    Warns
+    -----
+    UserWarning
+        If the binary signature of the float type is not in the dictionary of
+        known float types.
+    """
+    params = _MACHAR_PARAMS.get(ftype)
+    if params is None:
+        raise ValueError(repr(ftype))
+    # Detect known / suspected types
+    # ftype(-1.0) / ftype(10.0) is better than ftype('-0.1') because stold
+    # may be deficient
+    key = (ftype(-1.0) / ftype(10.)).newbyteorder('<').tobytes()
+    ma_like = None
+    if ftype == ntypes.longdouble:
+        # Could be 80 bit == 10 byte extended precision, where last bytes can
+        # be random garbage.
+        # Comparing first 10 bytes to pattern first to avoid branching on the
+        # random garbage.
+        ma_like = _KNOWN_TYPES.get(key[:10])
+    if ma_like is None:
+        # see if the full key is known.
+        ma_like = _KNOWN_TYPES.get(key)
+    if ma_like is None and len(key) == 16:
+        # machine limits could be f80 masquerading as np.float128,
+        # find all keys with length 16 and make new dict, but make the keys
+        # only 10 bytes long, the last bytes can be random garbage
+        _kt = {k[:10]: v for k, v in _KNOWN_TYPES.items() if len(k) == 16}
+        ma_like = _kt.get(key[:10])
+    if ma_like is not None:
+        return ma_like
+    # Fall back to parameter discovery
+    warnings.warn(
+        f'Signature {key} for {ftype} does not match any known type: '
+        'falling back to type probe function.\n'
+        'This warnings indicates broken support for the dtype!',
+        UserWarning, stacklevel=2)
+    return _discovered_machar(ftype)
+
+
+def _discovered_machar(ftype):
+    """ Create MachAr instance with found information on float types
+
+    TODO: MachAr should be retired completely ideally.  We currently only
+          ever use it system with broken longdouble (valgrind, WSL).
+    """
+    params = _MACHAR_PARAMS[ftype]
+    return MachAr(lambda v: array([v], ftype),
+                  lambda v:_fr0(v.astype(params['itype']))[0],
+                  lambda v:array(_fr0(v)[0], ftype),
+                  lambda v: params['fmt'] % array(_fr0(v)[0], ftype),
+                  params['title'])
+
+
+@set_module('numpy')
+class finfo:
+    """
+    finfo(dtype)
+
+    Machine limits for floating point types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `finfo` returns information. For complex
+        input, the returned dtype is the associated ``float*`` dtype for its
+        real and complex components.
+    eps : float
+        The difference between 1.0 and the next smallest representable float
+        larger than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``eps = 2**-52``, approximately 2.22e-16.
+    epsneg : float
+        The difference between 1.0 and the next smallest representable float
+        less than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``epsneg = 2**-53``, approximately 1.11e-16.
+    iexp : int
+        The number of bits in the exponent portion of the floating point
+        representation.
+    machep : int
+        The exponent that yields `eps`.
+    max : floating point number of the appropriate type
+        The largest representable number.
+    maxexp : int
+        The smallest positive power of the base (2) that causes overflow.
+    min : floating point number of the appropriate type
+        The smallest representable number, typically ``-max``.
+    minexp : int
+        The most negative power of the base (2) consistent with there
+        being no leading 0's in the mantissa.
+    negep : int
+        The exponent that yields `epsneg`.
+    nexp : int
+        The number of bits in the exponent including its sign and bias.
+    nmant : int
+        The number of bits in the mantissa.
+    precision : int
+        The approximate number of decimal digits to which this kind of
+        float is precise.
+    resolution : floating point number of the appropriate type
+        The approximate decimal resolution of this type, i.e.,
+        ``10**-precision``.
+    tiny : float
+        An alias for `smallest_normal`, kept for backwards compatibility.
+    smallest_normal : float
+        The smallest positive floating point number with 1 as leading bit in
+        the mantissa following IEEE-754 (see Notes).
+    smallest_subnormal : float
+        The smallest positive floating point number with 0 as leading bit in
+        the mantissa following IEEE-754.
+
+    Parameters
+    ----------
+    dtype : float, dtype, or instance
+        Kind of floating point or complex floating point
+        data-type about which to get information.
+
+    See Also
+    --------
+    iinfo : The equivalent for integer data types.
+    spacing : The distance between a value and the nearest adjacent number
+    nextafter : The next floating point value after x1 towards x2
+
+    Notes
+    -----
+    For developers of NumPy: do not instantiate this at the module level.
+    The initial calculation of these parameters is expensive and negatively
+    impacts import times.  These objects are cached, so calling ``finfo()``
+    repeatedly inside your functions is not a problem.
+
+    Note that ``smallest_normal`` is not actually the smallest positive
+    representable value in a NumPy floating point type. As in the IEEE-754
+    standard [1]_, NumPy floating point types make use of subnormal numbers to
+    fill the gap between 0 and ``smallest_normal``. However, subnormal numbers
+    may have significantly reduced precision [2]_.
+
+    This function can also be used for complex data types as well. If used,
+    the output will be the same as the corresponding real float type
+    (e.g. numpy.finfo(numpy.csingle) is the same as numpy.finfo(numpy.single)).
+    However, the output is true for the real and imaginary components.
+
+    References
+    ----------
+    .. [1] IEEE Standard for Floating-Point Arithmetic, IEEE Std 754-2008,
+           pp.1-70, 2008, http://www.doi.org/10.1109/IEEESTD.2008.4610935
+    .. [2] Wikipedia, "Denormal Numbers",
+           https://en.wikipedia.org/wiki/Denormal_number
+
+    Examples
+    --------
+    >>> np.finfo(np.float64).dtype
+    dtype('float64')
+    >>> np.finfo(np.complex64).dtype
+    dtype('float32')
+
+    """
+
+    _finfo_cache = {}
+
+    def __new__(cls, dtype):
+        try:
+            obj = cls._finfo_cache.get(dtype)  # most common path
+            if obj is not None:
+                return obj
+        except TypeError:
+            pass
+
+        if dtype is None:
+            # Deprecated in NumPy 1.25, 2023-01-16
+            warnings.warn(
+                "finfo() dtype cannot be None. This behavior will "
+                "raise an error in the future. (Deprecated in NumPy 1.25)",
+                DeprecationWarning,
+                stacklevel=2
+            )
+
+        try:
+            dtype = numeric.dtype(dtype)
+        except TypeError:
+            # In case a float instance was given
+            dtype = numeric.dtype(type(dtype))
+
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        dtypes = [dtype]
+        newdtype = numeric.obj2sctype(dtype)
+        if newdtype is not dtype:
+            dtypes.append(newdtype)
+            dtype = newdtype
+        if not issubclass(dtype, numeric.inexact):
+            raise ValueError("data type %r not inexact" % (dtype))
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        if not issubclass(dtype, numeric.floating):
+            newdtype = _convert_to_float[dtype]
+            if newdtype is not dtype:
+                # dtype changed, for example from complex128 to float64
+                dtypes.append(newdtype)
+                dtype = newdtype
+
+                obj = cls._finfo_cache.get(dtype, None)
+                if obj is not None:
+                    # the original dtype was not in the cache, but the new
+                    # dtype is in the cache. we add the original dtypes to
+                    # the cache and return the result
+                    for dt in dtypes:
+                        cls._finfo_cache[dt] = obj
+                    return obj
+        obj = object.__new__(cls)._init(dtype)
+        for dt in dtypes:
+            cls._finfo_cache[dt] = obj
+        return obj
+
+    def _init(self, dtype):
+        self.dtype = numeric.dtype(dtype)
+        machar = _get_machar(dtype)
+
+        for word in ['precision', 'iexp',
+                     'maxexp', 'minexp', 'negep',
+                     'machep']:
+            setattr(self, word, getattr(machar, word))
+        for word in ['resolution', 'epsneg', 'smallest_subnormal']:
+            setattr(self, word, getattr(machar, word).flat[0])
+        self.bits = self.dtype.itemsize * 8
+        self.max = machar.huge.flat[0]
+        self.min = -self.max
+        self.eps = machar.eps.flat[0]
+        self.nexp = machar.iexp
+        self.nmant = machar.it
+        self._machar = machar
+        self._str_tiny = machar._str_xmin.strip()
+        self._str_max = machar._str_xmax.strip()
+        self._str_epsneg = machar._str_epsneg.strip()
+        self._str_eps = machar._str_eps.strip()
+        self._str_resolution = machar._str_resolution.strip()
+        self._str_smallest_normal = machar._str_smallest_normal.strip()
+        self._str_smallest_subnormal = machar._str_smallest_subnormal.strip()
+        return self
+
+    def __str__(self):
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'precision = %(precision)3s   resolution = %(_str_resolution)s\n'
+            'machep = %(machep)6s   eps =        %(_str_eps)s\n'
+            'negep =  %(negep)6s   epsneg =     %(_str_epsneg)s\n'
+            'minexp = %(minexp)6s   tiny =       %(_str_tiny)s\n'
+            'maxexp = %(maxexp)6s   max =        %(_str_max)s\n'
+            'nexp =   %(nexp)6s   min =        -max\n'
+            'smallest_normal = %(_str_smallest_normal)s   '
+            'smallest_subnormal = %(_str_smallest_subnormal)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % self.__dict__
+
+    def __repr__(self):
+        c = self.__class__.__name__
+        d = self.__dict__.copy()
+        d['klass'] = c
+        return (("%(klass)s(resolution=%(resolution)s, min=-%(_str_max)s,"
+                 " max=%(_str_max)s, dtype=%(dtype)s)") % d)
+
+    @property
+    def smallest_normal(self):
+        """Return the value for the smallest normal.
+
+        Returns
+        -------
+        smallest_normal : float
+            Value for the smallest normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        # This check is necessary because the value for smallest_normal is
+        # platform dependent for longdouble types.
+        if isnan(self._machar.smallest_normal.flat[0]):
+            warnings.warn(
+                'The value of smallest normal is undefined for double double',
+                UserWarning, stacklevel=2)
+        return self._machar.smallest_normal.flat[0]
+
+    @property
+    def tiny(self):
+        """Return the value for tiny, alias of smallest_normal.
+
+        Returns
+        -------
+        tiny : float
+            Value for the smallest normal, alias of smallest_normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        return self.smallest_normal
+
+
+@set_module('numpy')
+class iinfo:
+    """
+    iinfo(type)
+
+    Machine limits for integer types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `iinfo` returns information.
+    min : int
+        The smallest integer expressible by the type.
+    max : int
+        The largest integer expressible by the type.
+
+    Parameters
+    ----------
+    int_type : integer type, dtype, or instance
+        The kind of integer data type to get information about.
+
+    See Also
+    --------
+    finfo : The equivalent for floating point data types.
+
+    Examples
+    --------
+    With types:
+
+    >>> ii16 = np.iinfo(np.int16)
+    >>> ii16.min
+    -32768
+    >>> ii16.max
+    32767
+    >>> ii32 = np.iinfo(np.int32)
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    With instances:
+
+    >>> ii32 = np.iinfo(np.int32(10))
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    """
+
+    _min_vals = {}
+    _max_vals = {}
+
+    def __init__(self, int_type):
+        try:
+            self.dtype = numeric.dtype(int_type)
+        except TypeError:
+            self.dtype = numeric.dtype(type(int_type))
+        self.kind = self.dtype.kind
+        self.bits = self.dtype.itemsize * 8
+        self.key = "%s%d" % (self.kind, self.bits)
+        if self.kind not in 'iu':
+            raise ValueError("Invalid integer data type %r." % (self.kind,))
+
+    @property
+    def min(self):
+        """Minimum value of given dtype."""
+        if self.kind == 'u':
+            return 0
+        else:
+            try:
+                val = iinfo._min_vals[self.key]
+            except KeyError:
+                val = int(-(1 << (self.bits-1)))
+                iinfo._min_vals[self.key] = val
+            return val
+
+    @property
+    def max(self):
+        """Maximum value of given dtype."""
+        try:
+            val = iinfo._max_vals[self.key]
+        except KeyError:
+            if self.kind == 'u':
+                val = int((1 << self.bits) - 1)
+            else:
+                val = int((1 << (self.bits-1)) - 1)
+            iinfo._max_vals[self.key] = val
+        return val
+
+    def __str__(self):
+        """String representation."""
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'min = %(min)s\n'
+            'max = %(max)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % {'dtype': self.dtype, 'min': self.min, 'max': self.max}
+
+    def __repr__(self):
+        return "%s(min=%s, max=%s, dtype=%s)" % (self.__class__.__name__,
+                                    self.min, self.max, self.dtype)

.venv/lib/python3.11/site-packages/numpy/core/getlimits.pyi

@@ -0,0 +1,6 @@
+from numpy import (
+    finfo as finfo,
+    iinfo as iinfo,
+)
+
+__all__: list[str]

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/__multiarray_api.c

@@ -0,0 +1,314 @@
+
+/* These pointers will be stored in the C-object for use in other
+    extension modules
+*/
+
+void *PyArray_API[] = {
+        (void *) PyArray_GetNDArrayCVersion,
+        (void *) &PyBigArray_Type,
+        (void *) &PyArray_Type,
+        (void *) &PyArrayDescr_Type,
+        (void *) &PyArrayFlags_Type,
+        (void *) &PyArrayIter_Type,
+        (void *) &PyArrayMultiIter_Type,
+        (int *) &NPY_NUMUSERTYPES,
+        (void *) &PyBoolArrType_Type,
+        (void *) &_PyArrayScalar_BoolValues,
+        (void *) &PyGenericArrType_Type,
+        (void *) &PyNumberArrType_Type,
+        (void *) &PyIntegerArrType_Type,
+        (void *) &PySignedIntegerArrType_Type,
+        (void *) &PyUnsignedIntegerArrType_Type,
+        (void *) &PyInexactArrType_Type,
+        (void *) &PyFloatingArrType_Type,
+        (void *) &PyComplexFloatingArrType_Type,
+        (void *) &PyFlexibleArrType_Type,
+        (void *) &PyCharacterArrType_Type,
+        (void *) &PyByteArrType_Type,
+        (void *) &PyShortArrType_Type,
+        (void *) &PyIntArrType_Type,
+        (void *) &PyLongArrType_Type,
+        (void *) &PyLongLongArrType_Type,
+        (void *) &PyUByteArrType_Type,
+        (void *) &PyUShortArrType_Type,
+        (void *) &PyUIntArrType_Type,
+        (void *) &PyULongArrType_Type,
+        (void *) &PyULongLongArrType_Type,
+        (void *) &PyFloatArrType_Type,
+        (void *) &PyDoubleArrType_Type,
+        (void *) &PyLongDoubleArrType_Type,
+        (void *) &PyCFloatArrType_Type,
+        (void *) &PyCDoubleArrType_Type,
+        (void *) &PyCLongDoubleArrType_Type,
+        (void *) &PyObjectArrType_Type,
+        (void *) &PyStringArrType_Type,
+        (void *) &PyUnicodeArrType_Type,
+        (void *) &PyVoidArrType_Type,
+        (void *) PyArray_SetNumericOps,
+        (void *) PyArray_GetNumericOps,
+        (void *) PyArray_INCREF,
+        (void *) PyArray_XDECREF,
+        (void *) PyArray_SetStringFunction,
+        (void *) PyArray_DescrFromType,
+        (void *) PyArray_TypeObjectFromType,
+        (void *) PyArray_Zero,
+        (void *) PyArray_One,
+        (void *) PyArray_CastToType,
+        (void *) PyArray_CastTo,
+        (void *) PyArray_CastAnyTo,
+        (void *) PyArray_CanCastSafely,
+        (void *) PyArray_CanCastTo,
+        (void *) PyArray_ObjectType,
+        (void *) PyArray_DescrFromObject,
+        (void *) PyArray_ConvertToCommonType,
+        (void *) PyArray_DescrFromScalar,
+        (void *) PyArray_DescrFromTypeObject,
+        (void *) PyArray_Size,
+        (void *) PyArray_Scalar,
+        (void *) PyArray_FromScalar,
+        (void *) PyArray_ScalarAsCtype,
+        (void *) PyArray_CastScalarToCtype,
+        (void *) PyArray_CastScalarDirect,
+        (void *) PyArray_ScalarFromObject,
+        (void *) PyArray_GetCastFunc,
+        (void *) PyArray_FromDims,
+        (void *) PyArray_FromDimsAndDataAndDescr,
+        (void *) PyArray_FromAny,
+        (void *) PyArray_EnsureArray,
+        (void *) PyArray_EnsureAnyArray,
+        (void *) PyArray_FromFile,
+        (void *) PyArray_FromString,
+        (void *) PyArray_FromBuffer,
+        (void *) PyArray_FromIter,
+        (void *) PyArray_Return,
+        (void *) PyArray_GetField,
+        (void *) PyArray_SetField,
+        (void *) PyArray_Byteswap,
+        (void *) PyArray_Resize,
+        (void *) PyArray_MoveInto,
+        (void *) PyArray_CopyInto,
+        (void *) PyArray_CopyAnyInto,
+        (void *) PyArray_CopyObject,
+        (void *) PyArray_NewCopy,
+        (void *) PyArray_ToList,
+        (void *) PyArray_ToString,
+        (void *) PyArray_ToFile,
+        (void *) PyArray_Dump,
+        (void *) PyArray_Dumps,
+        (void *) PyArray_ValidType,
+        (void *) PyArray_UpdateFlags,
+        (void *) PyArray_New,
+        (void *) PyArray_NewFromDescr,
+        (void *) PyArray_DescrNew,
+        (void *) PyArray_DescrNewFromType,
+        (void *) PyArray_GetPriority,
+        (void *) PyArray_IterNew,
+        (void *) PyArray_MultiIterNew,
+        (void *) PyArray_PyIntAsInt,
+        (void *) PyArray_PyIntAsIntp,
+        (void *) PyArray_Broadcast,
+        (void *) PyArray_FillObjectArray,
+        (void *) PyArray_FillWithScalar,
+        (void *) PyArray_CheckStrides,
+        (void *) PyArray_DescrNewByteorder,
+        (void *) PyArray_IterAllButAxis,
+        (void *) PyArray_CheckFromAny,
+        (void *) PyArray_FromArray,
+        (void *) PyArray_FromInterface,
+        (void *) PyArray_FromStructInterface,
+        (void *) PyArray_FromArrayAttr,
+        (void *) PyArray_ScalarKind,
+        (void *) PyArray_CanCoerceScalar,
+        (void *) PyArray_NewFlagsObject,
+        (void *) PyArray_CanCastScalar,
+        (void *) PyArray_CompareUCS4,
+        (void *) PyArray_RemoveSmallest,
+        (void *) PyArray_ElementStrides,
+        (void *) PyArray_Item_INCREF,
+        (void *) PyArray_Item_XDECREF,
+        (void *) PyArray_FieldNames,
+        (void *) PyArray_Transpose,
+        (void *) PyArray_TakeFrom,
+        (void *) PyArray_PutTo,
+        (void *) PyArray_PutMask,
+        (void *) PyArray_Repeat,
+        (void *) PyArray_Choose,
+        (void *) PyArray_Sort,
+        (void *) PyArray_ArgSort,
+        (void *) PyArray_SearchSorted,
+        (void *) PyArray_ArgMax,
+        (void *) PyArray_ArgMin,
+        (void *) PyArray_Reshape,
+        (void *) PyArray_Newshape,
+        (void *) PyArray_Squeeze,
+        (void *) PyArray_View,
+        (void *) PyArray_SwapAxes,
+        (void *) PyArray_Max,
+        (void *) PyArray_Min,
+        (void *) PyArray_Ptp,
+        (void *) PyArray_Mean,
+        (void *) PyArray_Trace,
+        (void *) PyArray_Diagonal,
+        (void *) PyArray_Clip,
+        (void *) PyArray_Conjugate,
+        (void *) PyArray_Nonzero,
+        (void *) PyArray_Std,
+        (void *) PyArray_Sum,
+        (void *) PyArray_CumSum,
+        (void *) PyArray_Prod,
+        (void *) PyArray_CumProd,
+        (void *) PyArray_All,
+        (void *) PyArray_Any,
+        (void *) PyArray_Compress,
+        (void *) PyArray_Flatten,
+        (void *) PyArray_Ravel,
+        (void *) PyArray_MultiplyList,
+        (void *) PyArray_MultiplyIntList,
+        (void *) PyArray_GetPtr,
+        (void *) PyArray_CompareLists,
+        (void *) PyArray_AsCArray,
+        (void *) PyArray_As1D,
+        (void *) PyArray_As2D,
+        (void *) PyArray_Free,
+        (void *) PyArray_Converter,
+        (void *) PyArray_IntpFromSequence,
+        (void *) PyArray_Concatenate,
+        (void *) PyArray_InnerProduct,
+        (void *) PyArray_MatrixProduct,
+        (void *) PyArray_CopyAndTranspose,
+        (void *) PyArray_Correlate,
+        (void *) PyArray_TypestrConvert,
+        (void *) PyArray_DescrConverter,
+        (void *) PyArray_DescrConverter2,
+        (void *) PyArray_IntpConverter,
+        (void *) PyArray_BufferConverter,
+        (void *) PyArray_AxisConverter,
+        (void *) PyArray_BoolConverter,
+        (void *) PyArray_ByteorderConverter,
+        (void *) PyArray_OrderConverter,
+        (void *) PyArray_EquivTypes,
+        (void *) PyArray_Zeros,
+        (void *) PyArray_Empty,
+        (void *) PyArray_Where,
+        (void *) PyArray_Arange,
+        (void *) PyArray_ArangeObj,
+        (void *) PyArray_SortkindConverter,
+        (void *) PyArray_LexSort,
+        (void *) PyArray_Round,
+        (void *) PyArray_EquivTypenums,
+        (void *) PyArray_RegisterDataType,
+        (void *) PyArray_RegisterCastFunc,
+        (void *) PyArray_RegisterCanCast,
+        (void *) PyArray_InitArrFuncs,
+        (void *) PyArray_IntTupleFromIntp,
+        (void *) PyArray_TypeNumFromName,
+        (void *) PyArray_ClipmodeConverter,
+        (void *) PyArray_OutputConverter,
+        (void *) PyArray_BroadcastToShape,
+        (void *) _PyArray_SigintHandler,
+        (void *) _PyArray_GetSigintBuf,
+        (void *) PyArray_DescrAlignConverter,
+        (void *) PyArray_DescrAlignConverter2,
+        (void *) PyArray_SearchsideConverter,
+        (void *) PyArray_CheckAxis,
+        (void *) PyArray_OverflowMultiplyList,
+        (void *) PyArray_CompareString,
+        (void *) PyArray_MultiIterFromObjects,
+        (void *) PyArray_GetEndianness,
+        (void *) PyArray_GetNDArrayCFeatureVersion,
+        (void *) PyArray_Correlate2,
+        (void *) PyArray_NeighborhoodIterNew,
+        (void *) &PyTimeIntegerArrType_Type,
+        (void *) &PyDatetimeArrType_Type,
+        (void *) &PyTimedeltaArrType_Type,
+        (void *) &PyHalfArrType_Type,
+        (void *) &NpyIter_Type,
+        (void *) PyArray_SetDatetimeParseFunction,
+        (void *) PyArray_DatetimeToDatetimeStruct,
+        (void *) PyArray_TimedeltaToTimedeltaStruct,
+        (void *) PyArray_DatetimeStructToDatetime,
+        (void *) PyArray_TimedeltaStructToTimedelta,
+        (void *) NpyIter_New,
+        (void *) NpyIter_MultiNew,
+        (void *) NpyIter_AdvancedNew,
+        (void *) NpyIter_Copy,
+        (void *) NpyIter_Deallocate,
+        (void *) NpyIter_HasDelayedBufAlloc,
+        (void *) NpyIter_HasExternalLoop,
+        (void *) NpyIter_EnableExternalLoop,
+        (void *) NpyIter_GetInnerStrideArray,
+        (void *) NpyIter_GetInnerLoopSizePtr,
+        (void *) NpyIter_Reset,
+        (void *) NpyIter_ResetBasePointers,
+        (void *) NpyIter_ResetToIterIndexRange,
+        (void *) NpyIter_GetNDim,
+        (void *) NpyIter_GetNOp,
+        (void *) NpyIter_GetIterNext,
+        (void *) NpyIter_GetIterSize,
+        (void *) NpyIter_GetIterIndexRange,
+        (void *) NpyIter_GetIterIndex,
+        (void *) NpyIter_GotoIterIndex,
+        (void *) NpyIter_HasMultiIndex,
+        (void *) NpyIter_GetShape,
+        (void *) NpyIter_GetGetMultiIndex,
+        (void *) NpyIter_GotoMultiIndex,
+        (void *) NpyIter_RemoveMultiIndex,
+        (void *) NpyIter_HasIndex,
+        (void *) NpyIter_IsBuffered,
+        (void *) NpyIter_IsGrowInner,
+        (void *) NpyIter_GetBufferSize,
+        (void *) NpyIter_GetIndexPtr,
+        (void *) NpyIter_GotoIndex,
+        (void *) NpyIter_GetDataPtrArray,
+        (void *) NpyIter_GetDescrArray,
+        (void *) NpyIter_GetOperandArray,
+        (void *) NpyIter_GetIterView,
+        (void *) NpyIter_GetReadFlags,
+        (void *) NpyIter_GetWriteFlags,
+        (void *) NpyIter_DebugPrint,
+        (void *) NpyIter_IterationNeedsAPI,
+        (void *) NpyIter_GetInnerFixedStrideArray,
+        (void *) NpyIter_RemoveAxis,
+        (void *) NpyIter_GetAxisStrideArray,
+        (void *) NpyIter_RequiresBuffering,
+        (void *) NpyIter_GetInitialDataPtrArray,
+        (void *) NpyIter_CreateCompatibleStrides,
+        (void *) PyArray_CastingConverter,
+        (void *) PyArray_CountNonzero,
+        (void *) PyArray_PromoteTypes,
+        (void *) PyArray_MinScalarType,
+        (void *) PyArray_ResultType,
+        (void *) PyArray_CanCastArrayTo,
+        (void *) PyArray_CanCastTypeTo,
+        (void *) PyArray_EinsteinSum,
+        (void *) PyArray_NewLikeArray,
+        (void *) PyArray_GetArrayParamsFromObject,
+        (void *) PyArray_ConvertClipmodeSequence,
+        (void *) PyArray_MatrixProduct2,
+        (void *) NpyIter_IsFirstVisit,
+        (void *) PyArray_SetBaseObject,
+        (void *) PyArray_CreateSortedStridePerm,
+        (void *) PyArray_RemoveAxesInPlace,
+        (void *) PyArray_DebugPrint,
+        (void *) PyArray_FailUnlessWriteable,
+        (void *) PyArray_SetUpdateIfCopyBase,
+        (void *) PyDataMem_NEW,
+        (void *) PyDataMem_FREE,
+        (void *) PyDataMem_RENEW,
+        (void *) PyDataMem_SetEventHook,
+        (NPY_CASTING *) &NPY_DEFAULT_ASSIGN_CASTING,
+        (void *) PyArray_MapIterSwapAxes,
+        (void *) PyArray_MapIterArray,
+        (void *) PyArray_MapIterNext,
+        (void *) PyArray_Partition,
+        (void *) PyArray_ArgPartition,
+        (void *) PyArray_SelectkindConverter,
+        (void *) PyDataMem_NEW_ZEROED,
+        (void *) PyArray_CheckAnyScalarExact,
+        (void *) PyArray_MapIterArrayCopyIfOverlap,
+        (void *) PyArray_ResolveWritebackIfCopy,
+        (void *) PyArray_SetWritebackIfCopyBase,
+        (void *) PyDataMem_SetHandler,
+        (void *) PyDataMem_GetHandler,
+        (PyObject* *) &PyDataMem_DefaultHandler
+};

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/__multiarray_api.h

@@ -0,0 +1,1566 @@
+
+#if defined(_MULTIARRAYMODULE) || defined(WITH_CPYCHECKER_STEALS_REFERENCE_TO_ARG_ATTRIBUTE)
+
+typedef struct {
+        PyObject_HEAD
+        npy_bool obval;
+} PyBoolScalarObject;
+
+extern NPY_NO_EXPORT PyTypeObject PyArrayMapIter_Type;
+extern NPY_NO_EXPORT PyTypeObject PyArrayNeighborhoodIter_Type;
+extern NPY_NO_EXPORT PyBoolScalarObject _PyArrayScalar_BoolValues[2];
+
+NPY_NO_EXPORT  unsigned int PyArray_GetNDArrayCVersion \
+       (void);
+extern NPY_NO_EXPORT PyTypeObject PyBigArray_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyArray_Type;
+
+extern NPY_NO_EXPORT PyArray_DTypeMeta PyArrayDescr_TypeFull;
+#define PyArrayDescr_Type (*(PyTypeObject *)(&PyArrayDescr_TypeFull))
+
+extern NPY_NO_EXPORT PyTypeObject PyArrayFlags_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyArrayIter_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyArrayMultiIter_Type;
+
+extern NPY_NO_EXPORT int NPY_NUMUSERTYPES;
+
+extern NPY_NO_EXPORT PyTypeObject PyBoolArrType_Type;
+
+extern NPY_NO_EXPORT PyBoolScalarObject _PyArrayScalar_BoolValues[2];
+
+extern NPY_NO_EXPORT PyTypeObject PyGenericArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyNumberArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyIntegerArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PySignedIntegerArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUnsignedIntegerArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyInexactArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyFloatingArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyComplexFloatingArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyFlexibleArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyCharacterArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyByteArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyShortArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyIntArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyLongArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyLongLongArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUByteArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUShortArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUIntArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyULongArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyULongLongArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyFloatArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyDoubleArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyLongDoubleArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyCFloatArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyCDoubleArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyCLongDoubleArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyObjectArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyStringArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUnicodeArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyVoidArrType_Type;
+
+NPY_NO_EXPORT  int PyArray_SetNumericOps \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_GetNumericOps \
+       (void);
+NPY_NO_EXPORT  int PyArray_INCREF \
+       (PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_XDECREF \
+       (PyArrayObject *);
+NPY_NO_EXPORT  void PyArray_SetStringFunction \
+       (PyObject *, int);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrFromType \
+       (int);
+NPY_NO_EXPORT  PyObject * PyArray_TypeObjectFromType \
+       (int);
+NPY_NO_EXPORT  char * PyArray_Zero \
+       (PyArrayObject *);
+NPY_NO_EXPORT  char * PyArray_One \
+       (PyArrayObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_CastToType \
+       (PyArrayObject *, PyArray_Descr *, int);
+NPY_NO_EXPORT  int PyArray_CastTo \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_CastAnyTo \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_CanCastSafely \
+       (int, int);
+NPY_NO_EXPORT  npy_bool PyArray_CanCastTo \
+       (PyArray_Descr *, PyArray_Descr *);
+NPY_NO_EXPORT  int PyArray_ObjectType \
+       (PyObject *, int);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrFromObject \
+       (PyObject *, PyArray_Descr *);
+NPY_NO_EXPORT  PyArrayObject ** PyArray_ConvertToCommonType \
+       (PyObject *, int *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrFromScalar \
+       (PyObject *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrFromTypeObject \
+       (PyObject *);
+NPY_NO_EXPORT  npy_intp PyArray_Size \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Scalar \
+       (void *, PyArray_Descr *, PyObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_FromScalar \
+       (PyObject *, PyArray_Descr *);
+NPY_NO_EXPORT  void PyArray_ScalarAsCtype \
+       (PyObject *, void *);
+NPY_NO_EXPORT  int PyArray_CastScalarToCtype \
+       (PyObject *, void *, PyArray_Descr *);
+NPY_NO_EXPORT  int PyArray_CastScalarDirect \
+       (PyObject *, PyArray_Descr *, void *, int);
+NPY_NO_EXPORT  PyObject * PyArray_ScalarFromObject \
+       (PyObject *);
+NPY_NO_EXPORT  PyArray_VectorUnaryFunc * PyArray_GetCastFunc \
+       (PyArray_Descr *, int);
+NPY_NO_EXPORT  PyObject * PyArray_FromDims \
+       (int NPY_UNUSED(nd), int *NPY_UNUSED(d), int NPY_UNUSED(type));
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(3) PyObject * PyArray_FromDimsAndDataAndDescr \
+       (int NPY_UNUSED(nd), int *NPY_UNUSED(d), PyArray_Descr *, char *NPY_UNUSED(data));
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_FromAny \
+       (PyObject *, PyArray_Descr *, int, int, int, PyObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(1) PyObject * PyArray_EnsureArray \
+       (PyObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(1) PyObject * PyArray_EnsureAnyArray \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_FromFile \
+       (FILE *, PyArray_Descr *, npy_intp, char *);
+NPY_NO_EXPORT  PyObject * PyArray_FromString \
+       (char *, npy_intp, PyArray_Descr *, npy_intp, char *);
+NPY_NO_EXPORT  PyObject * PyArray_FromBuffer \
+       (PyObject *, PyArray_Descr *, npy_intp, npy_intp);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_FromIter \
+       (PyObject *, PyArray_Descr *, npy_intp);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(1) PyObject * PyArray_Return \
+       (PyArrayObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_GetField \
+       (PyArrayObject *, PyArray_Descr *, int);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) int PyArray_SetField \
+       (PyArrayObject *, PyArray_Descr *, int, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Byteswap \
+       (PyArrayObject *, npy_bool);
+NPY_NO_EXPORT  PyObject * PyArray_Resize \
+       (PyArrayObject *, PyArray_Dims *, int, NPY_ORDER NPY_UNUSED(order));
+NPY_NO_EXPORT  int PyArray_MoveInto \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_CopyInto \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_CopyAnyInto \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_CopyObject \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_NewCopy \
+       (PyArrayObject *, NPY_ORDER);
+NPY_NO_EXPORT  PyObject * PyArray_ToList \
+       (PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_ToString \
+       (PyArrayObject *, NPY_ORDER);
+NPY_NO_EXPORT  int PyArray_ToFile \
+       (PyArrayObject *, FILE *, char *, char *);
+NPY_NO_EXPORT  int PyArray_Dump \
+       (PyObject *, PyObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Dumps \
+       (PyObject *, int);
+NPY_NO_EXPORT  int PyArray_ValidType \
+       (int);
+NPY_NO_EXPORT  void PyArray_UpdateFlags \
+       (PyArrayObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_New \
+       (PyTypeObject *, int, npy_intp const *, int, npy_intp const *, void *, int, int, PyObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_NewFromDescr \
+       (PyTypeObject *, PyArray_Descr *, int, npy_intp const *, npy_intp const *, void *, int, PyObject *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrNew \
+       (PyArray_Descr *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrNewFromType \
+       (int);
+NPY_NO_EXPORT  double PyArray_GetPriority \
+       (PyObject *, double);
+NPY_NO_EXPORT  PyObject * PyArray_IterNew \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject* PyArray_MultiIterNew \
+       (int, ...);
+NPY_NO_EXPORT  int PyArray_PyIntAsInt \
+       (PyObject *);
+NPY_NO_EXPORT  npy_intp PyArray_PyIntAsIntp \
+       (PyObject *);
+NPY_NO_EXPORT  int PyArray_Broadcast \
+       (PyArrayMultiIterObject *);
+NPY_NO_EXPORT  void PyArray_FillObjectArray \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  int PyArray_FillWithScalar \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  npy_bool PyArray_CheckStrides \
+       (int, int, npy_intp, npy_intp, npy_intp const *, npy_intp const *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_DescrNewByteorder \
+       (PyArray_Descr *, char);
+NPY_NO_EXPORT  PyObject * PyArray_IterAllButAxis \
+       (PyObject *, int *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_CheckFromAny \
+       (PyObject *, PyArray_Descr *, int, int, int, PyObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_FromArray \
+       (PyArrayObject *, PyArray_Descr *, int);
+NPY_NO_EXPORT  PyObject * PyArray_FromInterface \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_FromStructInterface \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_FromArrayAttr \
+       (PyObject *, PyArray_Descr *, PyObject *);
+NPY_NO_EXPORT  NPY_SCALARKIND PyArray_ScalarKind \
+       (int, PyArrayObject **);
+NPY_NO_EXPORT  int PyArray_CanCoerceScalar \
+       (int, int, NPY_SCALARKIND);
+NPY_NO_EXPORT  PyObject * PyArray_NewFlagsObject \
+       (PyObject *);
+NPY_NO_EXPORT  npy_bool PyArray_CanCastScalar \
+       (PyTypeObject *, PyTypeObject *);
+NPY_NO_EXPORT  int PyArray_CompareUCS4 \
+       (npy_ucs4 const *, npy_ucs4 const *, size_t);
+NPY_NO_EXPORT  int PyArray_RemoveSmallest \
+       (PyArrayMultiIterObject *);
+NPY_NO_EXPORT  int PyArray_ElementStrides \
+       (PyObject *);
+NPY_NO_EXPORT  void PyArray_Item_INCREF \
+       (char *, PyArray_Descr *);
+NPY_NO_EXPORT  void PyArray_Item_XDECREF \
+       (char *, PyArray_Descr *);
+NPY_NO_EXPORT  PyObject * PyArray_FieldNames \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Transpose \
+       (PyArrayObject *, PyArray_Dims *);
+NPY_NO_EXPORT  PyObject * PyArray_TakeFrom \
+       (PyArrayObject *, PyObject *, int, PyArrayObject *, NPY_CLIPMODE);
+NPY_NO_EXPORT  PyObject * PyArray_PutTo \
+       (PyArrayObject *, PyObject*, PyObject *, NPY_CLIPMODE);
+NPY_NO_EXPORT  PyObject * PyArray_PutMask \
+       (PyArrayObject *, PyObject*, PyObject*);
+NPY_NO_EXPORT  PyObject * PyArray_Repeat \
+       (PyArrayObject *, PyObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Choose \
+       (PyArrayObject *, PyObject *, PyArrayObject *, NPY_CLIPMODE);
+NPY_NO_EXPORT  int PyArray_Sort \
+       (PyArrayObject *, int, NPY_SORTKIND);
+NPY_NO_EXPORT  PyObject * PyArray_ArgSort \
+       (PyArrayObject *, int, NPY_SORTKIND);
+NPY_NO_EXPORT  PyObject * PyArray_SearchSorted \
+       (PyArrayObject *, PyObject *, NPY_SEARCHSIDE, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_ArgMax \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_ArgMin \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Reshape \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Newshape \
+       (PyArrayObject *, PyArray_Dims *, NPY_ORDER);
+NPY_NO_EXPORT  PyObject * PyArray_Squeeze \
+       (PyArrayObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) PyObject * PyArray_View \
+       (PyArrayObject *, PyArray_Descr *, PyTypeObject *);
+NPY_NO_EXPORT  PyObject * PyArray_SwapAxes \
+       (PyArrayObject *, int, int);
+NPY_NO_EXPORT  PyObject * PyArray_Max \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Min \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Ptp \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Mean \
+       (PyArrayObject *, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Trace \
+       (PyArrayObject *, int, int, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Diagonal \
+       (PyArrayObject *, int, int, int);
+NPY_NO_EXPORT  PyObject * PyArray_Clip \
+       (PyArrayObject *, PyObject *, PyObject *, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Conjugate \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Nonzero \
+       (PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Std \
+       (PyArrayObject *, int, int, PyArrayObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Sum \
+       (PyArrayObject *, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_CumSum \
+       (PyArrayObject *, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Prod \
+       (PyArrayObject *, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_CumProd \
+       (PyArrayObject *, int, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_All \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Any \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Compress \
+       (PyArrayObject *, PyObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Flatten \
+       (PyArrayObject *, NPY_ORDER);
+NPY_NO_EXPORT  PyObject * PyArray_Ravel \
+       (PyArrayObject *, NPY_ORDER);
+NPY_NO_EXPORT  npy_intp PyArray_MultiplyList \
+       (npy_intp const *, int);
+NPY_NO_EXPORT  int PyArray_MultiplyIntList \
+       (int const *, int);
+NPY_NO_EXPORT  void * PyArray_GetPtr \
+       (PyArrayObject *, npy_intp const*);
+NPY_NO_EXPORT  int PyArray_CompareLists \
+       (npy_intp const *, npy_intp const *, int);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(5) int PyArray_AsCArray \
+       (PyObject **, void *, npy_intp *, int, PyArray_Descr*);
+NPY_NO_EXPORT  int PyArray_As1D \
+       (PyObject **NPY_UNUSED(op), char **NPY_UNUSED(ptr), int *NPY_UNUSED(d1), int NPY_UNUSED(typecode));
+NPY_NO_EXPORT  int PyArray_As2D \
+       (PyObject **NPY_UNUSED(op), char ***NPY_UNUSED(ptr), int *NPY_UNUSED(d1), int *NPY_UNUSED(d2), int NPY_UNUSED(typecode));
+NPY_NO_EXPORT  int PyArray_Free \
+       (PyObject *, void *);
+NPY_NO_EXPORT  int PyArray_Converter \
+       (PyObject *, PyObject **);
+NPY_NO_EXPORT  int PyArray_IntpFromSequence \
+       (PyObject *, npy_intp *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Concatenate \
+       (PyObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_InnerProduct \
+       (PyObject *, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_MatrixProduct \
+       (PyObject *, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_CopyAndTranspose \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Correlate \
+       (PyObject *, PyObject *, int);
+NPY_NO_EXPORT  int PyArray_TypestrConvert \
+       (int, int);
+NPY_NO_EXPORT  int PyArray_DescrConverter \
+       (PyObject *, PyArray_Descr **);
+NPY_NO_EXPORT  int PyArray_DescrConverter2 \
+       (PyObject *, PyArray_Descr **);
+NPY_NO_EXPORT  int PyArray_IntpConverter \
+       (PyObject *, PyArray_Dims *);
+NPY_NO_EXPORT  int PyArray_BufferConverter \
+       (PyObject *, PyArray_Chunk *);
+NPY_NO_EXPORT  int PyArray_AxisConverter \
+       (PyObject *, int *);
+NPY_NO_EXPORT  int PyArray_BoolConverter \
+       (PyObject *, npy_bool *);
+NPY_NO_EXPORT  int PyArray_ByteorderConverter \
+       (PyObject *, char *);
+NPY_NO_EXPORT  int PyArray_OrderConverter \
+       (PyObject *, NPY_ORDER *);
+NPY_NO_EXPORT  unsigned char PyArray_EquivTypes \
+       (PyArray_Descr *, PyArray_Descr *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(3) PyObject * PyArray_Zeros \
+       (int, npy_intp const *, PyArray_Descr *, int);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(3) PyObject * PyArray_Empty \
+       (int, npy_intp const *, PyArray_Descr *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Where \
+       (PyObject *, PyObject *, PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_Arange \
+       (double, double, double, int);
+NPY_NO_EXPORT  PyObject * PyArray_ArangeObj \
+       (PyObject *, PyObject *, PyObject *, PyArray_Descr *);
+NPY_NO_EXPORT  int PyArray_SortkindConverter \
+       (PyObject *, NPY_SORTKIND *);
+NPY_NO_EXPORT  PyObject * PyArray_LexSort \
+       (PyObject *, int);
+NPY_NO_EXPORT  PyObject * PyArray_Round \
+       (PyArrayObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  unsigned char PyArray_EquivTypenums \
+       (int, int);
+NPY_NO_EXPORT  int PyArray_RegisterDataType \
+       (PyArray_Descr *);
+NPY_NO_EXPORT  int PyArray_RegisterCastFunc \
+       (PyArray_Descr *, int, PyArray_VectorUnaryFunc *);
+NPY_NO_EXPORT  int PyArray_RegisterCanCast \
+       (PyArray_Descr *, int, NPY_SCALARKIND);
+NPY_NO_EXPORT  void PyArray_InitArrFuncs \
+       (PyArray_ArrFuncs *);
+NPY_NO_EXPORT  PyObject * PyArray_IntTupleFromIntp \
+       (int, npy_intp const *);
+NPY_NO_EXPORT  int PyArray_TypeNumFromName \
+       (char const *);
+NPY_NO_EXPORT  int PyArray_ClipmodeConverter \
+       (PyObject *, NPY_CLIPMODE *);
+NPY_NO_EXPORT  int PyArray_OutputConverter \
+       (PyObject *, PyArrayObject **);
+NPY_NO_EXPORT  PyObject * PyArray_BroadcastToShape \
+       (PyObject *, npy_intp *, int);
+NPY_NO_EXPORT  void _PyArray_SigintHandler \
+       (int);
+NPY_NO_EXPORT  void* _PyArray_GetSigintBuf \
+       (void);
+NPY_NO_EXPORT  int PyArray_DescrAlignConverter \
+       (PyObject *, PyArray_Descr **);
+NPY_NO_EXPORT  int PyArray_DescrAlignConverter2 \
+       (PyObject *, PyArray_Descr **);
+NPY_NO_EXPORT  int PyArray_SearchsideConverter \
+       (PyObject *, void *);
+NPY_NO_EXPORT  PyObject * PyArray_CheckAxis \
+       (PyArrayObject *, int *, int);
+NPY_NO_EXPORT  npy_intp PyArray_OverflowMultiplyList \
+       (npy_intp const *, int);
+NPY_NO_EXPORT  int PyArray_CompareString \
+       (const char *, const char *, size_t);
+NPY_NO_EXPORT  PyObject* PyArray_MultiIterFromObjects \
+       (PyObject **, int, int, ...);
+NPY_NO_EXPORT  int PyArray_GetEndianness \
+       (void);
+NPY_NO_EXPORT  unsigned int PyArray_GetNDArrayCFeatureVersion \
+       (void);
+NPY_NO_EXPORT  PyObject * PyArray_Correlate2 \
+       (PyObject *, PyObject *, int);
+NPY_NO_EXPORT  PyObject* PyArray_NeighborhoodIterNew \
+       (PyArrayIterObject *, const npy_intp *, int, PyArrayObject*);
+extern NPY_NO_EXPORT PyTypeObject PyTimeIntegerArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyDatetimeArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyTimedeltaArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyHalfArrType_Type;
+
+extern NPY_NO_EXPORT PyTypeObject NpyIter_Type;
+
+NPY_NO_EXPORT  void PyArray_SetDatetimeParseFunction \
+       (PyObject *NPY_UNUSED(op));
+NPY_NO_EXPORT  void PyArray_DatetimeToDatetimeStruct \
+       (npy_datetime NPY_UNUSED(val), NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_datetimestruct *);
+NPY_NO_EXPORT  void PyArray_TimedeltaToTimedeltaStruct \
+       (npy_timedelta NPY_UNUSED(val), NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_timedeltastruct *);
+NPY_NO_EXPORT  npy_datetime PyArray_DatetimeStructToDatetime \
+       (NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_datetimestruct *NPY_UNUSED(d));
+NPY_NO_EXPORT  npy_datetime PyArray_TimedeltaStructToTimedelta \
+       (NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_timedeltastruct *NPY_UNUSED(d));
+NPY_NO_EXPORT  NpyIter * NpyIter_New \
+       (PyArrayObject *, npy_uint32, NPY_ORDER, NPY_CASTING, PyArray_Descr*);
+NPY_NO_EXPORT  NpyIter * NpyIter_MultiNew \
+       (int, PyArrayObject **, npy_uint32, NPY_ORDER, NPY_CASTING, npy_uint32 *, PyArray_Descr **);
+NPY_NO_EXPORT  NpyIter * NpyIter_AdvancedNew \
+       (int, PyArrayObject **, npy_uint32, NPY_ORDER, NPY_CASTING, npy_uint32 *, PyArray_Descr **, int, int **, npy_intp *, npy_intp);
+NPY_NO_EXPORT  NpyIter * NpyIter_Copy \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_Deallocate \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_HasDelayedBufAlloc \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_HasExternalLoop \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_EnableExternalLoop \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_intp * NpyIter_GetInnerStrideArray \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_intp * NpyIter_GetInnerLoopSizePtr \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_Reset \
+       (NpyIter *, char **);
+NPY_NO_EXPORT  int NpyIter_ResetBasePointers \
+       (NpyIter *, char **, char **);
+NPY_NO_EXPORT  int NpyIter_ResetToIterIndexRange \
+       (NpyIter *, npy_intp, npy_intp, char **);
+NPY_NO_EXPORT  int NpyIter_GetNDim \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_GetNOp \
+       (NpyIter *);
+NPY_NO_EXPORT  NpyIter_IterNextFunc * NpyIter_GetIterNext \
+       (NpyIter *, char **);
+NPY_NO_EXPORT  npy_intp NpyIter_GetIterSize \
+       (NpyIter *);
+NPY_NO_EXPORT  void NpyIter_GetIterIndexRange \
+       (NpyIter *, npy_intp *, npy_intp *);
+NPY_NO_EXPORT  npy_intp NpyIter_GetIterIndex \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_GotoIterIndex \
+       (NpyIter *, npy_intp);
+NPY_NO_EXPORT  npy_bool NpyIter_HasMultiIndex \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_GetShape \
+       (NpyIter *, npy_intp *);
+NPY_NO_EXPORT  NpyIter_GetMultiIndexFunc * NpyIter_GetGetMultiIndex \
+       (NpyIter *, char **);
+NPY_NO_EXPORT  int NpyIter_GotoMultiIndex \
+       (NpyIter *, npy_intp const *);
+NPY_NO_EXPORT  int NpyIter_RemoveMultiIndex \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_HasIndex \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_IsBuffered \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_IsGrowInner \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_intp NpyIter_GetBufferSize \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_intp * NpyIter_GetIndexPtr \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_GotoIndex \
+       (NpyIter *, npy_intp);
+NPY_NO_EXPORT  char ** NpyIter_GetDataPtrArray \
+       (NpyIter *);
+NPY_NO_EXPORT  PyArray_Descr ** NpyIter_GetDescrArray \
+       (NpyIter *);
+NPY_NO_EXPORT  PyArrayObject ** NpyIter_GetOperandArray \
+       (NpyIter *);
+NPY_NO_EXPORT  PyArrayObject * NpyIter_GetIterView \
+       (NpyIter *, npy_intp);
+NPY_NO_EXPORT  void NpyIter_GetReadFlags \
+       (NpyIter *, char *);
+NPY_NO_EXPORT  void NpyIter_GetWriteFlags \
+       (NpyIter *, char *);
+NPY_NO_EXPORT  void NpyIter_DebugPrint \
+       (NpyIter *);
+NPY_NO_EXPORT  npy_bool NpyIter_IterationNeedsAPI \
+       (NpyIter *);
+NPY_NO_EXPORT  void NpyIter_GetInnerFixedStrideArray \
+       (NpyIter *, npy_intp *);
+NPY_NO_EXPORT  int NpyIter_RemoveAxis \
+       (NpyIter *, int);
+NPY_NO_EXPORT  npy_intp * NpyIter_GetAxisStrideArray \
+       (NpyIter *, int);
+NPY_NO_EXPORT  npy_bool NpyIter_RequiresBuffering \
+       (NpyIter *);
+NPY_NO_EXPORT  char ** NpyIter_GetInitialDataPtrArray \
+       (NpyIter *);
+NPY_NO_EXPORT  int NpyIter_CreateCompatibleStrides \
+       (NpyIter *, npy_intp, npy_intp *);
+NPY_NO_EXPORT  int PyArray_CastingConverter \
+       (PyObject *, NPY_CASTING *);
+NPY_NO_EXPORT  npy_intp PyArray_CountNonzero \
+       (PyArrayObject *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_PromoteTypes \
+       (PyArray_Descr *, PyArray_Descr *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_MinScalarType \
+       (PyArrayObject *);
+NPY_NO_EXPORT  PyArray_Descr * PyArray_ResultType \
+       (npy_intp, PyArrayObject *arrs[], npy_intp, PyArray_Descr *descrs[]);
+NPY_NO_EXPORT  npy_bool PyArray_CanCastArrayTo \
+       (PyArrayObject *, PyArray_Descr *, NPY_CASTING);
+NPY_NO_EXPORT  npy_bool PyArray_CanCastTypeTo \
+       (PyArray_Descr *, PyArray_Descr *, NPY_CASTING);
+NPY_NO_EXPORT  PyArrayObject * PyArray_EinsteinSum \
+       (char *, npy_intp, PyArrayObject **, PyArray_Descr *, NPY_ORDER, NPY_CASTING, PyArrayObject *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(3) PyObject * PyArray_NewLikeArray \
+       (PyArrayObject *, NPY_ORDER, PyArray_Descr *, int);
+NPY_NO_EXPORT  int PyArray_GetArrayParamsFromObject \
+       (PyObject *NPY_UNUSED(op), PyArray_Descr *NPY_UNUSED(requested_dtype), npy_bool NPY_UNUSED(writeable), PyArray_Descr **NPY_UNUSED(out_dtype), int *NPY_UNUSED(out_ndim), npy_intp *NPY_UNUSED(out_dims), PyArrayObject **NPY_UNUSED(out_arr), PyObject *NPY_UNUSED(context));
+NPY_NO_EXPORT  int PyArray_ConvertClipmodeSequence \
+       (PyObject *, NPY_CLIPMODE *, int);
+NPY_NO_EXPORT  PyObject * PyArray_MatrixProduct2 \
+       (PyObject *, PyObject *, PyArrayObject*);
+NPY_NO_EXPORT  npy_bool NpyIter_IsFirstVisit \
+       (NpyIter *, int);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) int PyArray_SetBaseObject \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  void PyArray_CreateSortedStridePerm \
+       (int, npy_intp const *, npy_stride_sort_item *);
+NPY_NO_EXPORT  void PyArray_RemoveAxesInPlace \
+       (PyArrayObject *, const npy_bool *);
+NPY_NO_EXPORT  void PyArray_DebugPrint \
+       (PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_FailUnlessWriteable \
+       (PyArrayObject *, const char *);
+NPY_NO_EXPORT NPY_STEALS_REF_TO_ARG(2) int PyArray_SetUpdateIfCopyBase \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  void * PyDataMem_NEW \
+       (size_t);
+NPY_NO_EXPORT  void PyDataMem_FREE \
+       (void *);
+NPY_NO_EXPORT  void * PyDataMem_RENEW \
+       (void *, size_t);
+NPY_NO_EXPORT  PyDataMem_EventHookFunc * PyDataMem_SetEventHook \
+       (PyDataMem_EventHookFunc *, void *, void **);
+extern NPY_NO_EXPORT NPY_CASTING NPY_DEFAULT_ASSIGN_CASTING;
+
+NPY_NO_EXPORT  void PyArray_MapIterSwapAxes \
+       (PyArrayMapIterObject *, PyArrayObject **, int);
+NPY_NO_EXPORT  PyObject * PyArray_MapIterArray \
+       (PyArrayObject *, PyObject *);
+NPY_NO_EXPORT  void PyArray_MapIterNext \
+       (PyArrayMapIterObject *);
+NPY_NO_EXPORT  int PyArray_Partition \
+       (PyArrayObject *, PyArrayObject *, int, NPY_SELECTKIND);
+NPY_NO_EXPORT  PyObject * PyArray_ArgPartition \
+       (PyArrayObject *, PyArrayObject *, int, NPY_SELECTKIND);
+NPY_NO_EXPORT  int PyArray_SelectkindConverter \
+       (PyObject *, NPY_SELECTKIND *);
+NPY_NO_EXPORT  void * PyDataMem_NEW_ZEROED \
+       (size_t, size_t);
+NPY_NO_EXPORT  int PyArray_CheckAnyScalarExact \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyArray_MapIterArrayCopyIfOverlap \
+       (PyArrayObject *, PyObject *, int, PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_ResolveWritebackIfCopy \
+       (PyArrayObject *);
+NPY_NO_EXPORT  int PyArray_SetWritebackIfCopyBase \
+       (PyArrayObject *, PyArrayObject *);
+NPY_NO_EXPORT  PyObject * PyDataMem_SetHandler \
+       (PyObject *);
+NPY_NO_EXPORT  PyObject * PyDataMem_GetHandler \
+       (void);
+extern NPY_NO_EXPORT PyObject* PyDataMem_DefaultHandler;
+
+
+#else
+
+#if defined(PY_ARRAY_UNIQUE_SYMBOL)
+#define PyArray_API PY_ARRAY_UNIQUE_SYMBOL
+#endif
+
+#if defined(NO_IMPORT) || defined(NO_IMPORT_ARRAY)
+extern void **PyArray_API;
+#else
+#if defined(PY_ARRAY_UNIQUE_SYMBOL)
+void **PyArray_API;
+#else
+static void **PyArray_API=NULL;
+#endif
+#endif
+
+#define PyArray_GetNDArrayCVersion \
+        (*(unsigned int (*)(void)) \
+    PyArray_API[0])
+#define PyBigArray_Type (*(PyTypeObject *)PyArray_API[1])
+#define PyArray_Type (*(PyTypeObject *)PyArray_API[2])
+#define PyArrayDescr_Type (*(PyTypeObject *)PyArray_API[3])
+#define PyArrayFlags_Type (*(PyTypeObject *)PyArray_API[4])
+#define PyArrayIter_Type (*(PyTypeObject *)PyArray_API[5])
+#define PyArrayMultiIter_Type (*(PyTypeObject *)PyArray_API[6])
+#define NPY_NUMUSERTYPES (*(int *)PyArray_API[7])
+#define PyBoolArrType_Type (*(PyTypeObject *)PyArray_API[8])
+#define _PyArrayScalar_BoolValues ((PyBoolScalarObject *)PyArray_API[9])
+#define PyGenericArrType_Type (*(PyTypeObject *)PyArray_API[10])
+#define PyNumberArrType_Type (*(PyTypeObject *)PyArray_API[11])
+#define PyIntegerArrType_Type (*(PyTypeObject *)PyArray_API[12])
+#define PySignedIntegerArrType_Type (*(PyTypeObject *)PyArray_API[13])
+#define PyUnsignedIntegerArrType_Type (*(PyTypeObject *)PyArray_API[14])
+#define PyInexactArrType_Type (*(PyTypeObject *)PyArray_API[15])
+#define PyFloatingArrType_Type (*(PyTypeObject *)PyArray_API[16])
+#define PyComplexFloatingArrType_Type (*(PyTypeObject *)PyArray_API[17])
+#define PyFlexibleArrType_Type (*(PyTypeObject *)PyArray_API[18])
+#define PyCharacterArrType_Type (*(PyTypeObject *)PyArray_API[19])
+#define PyByteArrType_Type (*(PyTypeObject *)PyArray_API[20])
+#define PyShortArrType_Type (*(PyTypeObject *)PyArray_API[21])
+#define PyIntArrType_Type (*(PyTypeObject *)PyArray_API[22])
+#define PyLongArrType_Type (*(PyTypeObject *)PyArray_API[23])
+#define PyLongLongArrType_Type (*(PyTypeObject *)PyArray_API[24])
+#define PyUByteArrType_Type (*(PyTypeObject *)PyArray_API[25])
+#define PyUShortArrType_Type (*(PyTypeObject *)PyArray_API[26])
+#define PyUIntArrType_Type (*(PyTypeObject *)PyArray_API[27])
+#define PyULongArrType_Type (*(PyTypeObject *)PyArray_API[28])
+#define PyULongLongArrType_Type (*(PyTypeObject *)PyArray_API[29])
+#define PyFloatArrType_Type (*(PyTypeObject *)PyArray_API[30])
+#define PyDoubleArrType_Type (*(PyTypeObject *)PyArray_API[31])
+#define PyLongDoubleArrType_Type (*(PyTypeObject *)PyArray_API[32])
+#define PyCFloatArrType_Type (*(PyTypeObject *)PyArray_API[33])
+#define PyCDoubleArrType_Type (*(PyTypeObject *)PyArray_API[34])
+#define PyCLongDoubleArrType_Type (*(PyTypeObject *)PyArray_API[35])
+#define PyObjectArrType_Type (*(PyTypeObject *)PyArray_API[36])
+#define PyStringArrType_Type (*(PyTypeObject *)PyArray_API[37])
+#define PyUnicodeArrType_Type (*(PyTypeObject *)PyArray_API[38])
+#define PyVoidArrType_Type (*(PyTypeObject *)PyArray_API[39])
+#define PyArray_SetNumericOps \
+        (*(int (*)(PyObject *)) \
+    PyArray_API[40])
+#define PyArray_GetNumericOps \
+        (*(PyObject * (*)(void)) \
+    PyArray_API[41])
+#define PyArray_INCREF \
+        (*(int (*)(PyArrayObject *)) \
+    PyArray_API[42])
+#define PyArray_XDECREF \
+        (*(int (*)(PyArrayObject *)) \
+    PyArray_API[43])
+#define PyArray_SetStringFunction \
+        (*(void (*)(PyObject *, int)) \
+    PyArray_API[44])
+#define PyArray_DescrFromType \
+        (*(PyArray_Descr * (*)(int)) \
+    PyArray_API[45])
+#define PyArray_TypeObjectFromType \
+        (*(PyObject * (*)(int)) \
+    PyArray_API[46])
+#define PyArray_Zero \
+        (*(char * (*)(PyArrayObject *)) \
+    PyArray_API[47])
+#define PyArray_One \
+        (*(char * (*)(PyArrayObject *)) \
+    PyArray_API[48])
+#define PyArray_CastToType \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Descr *, int)) \
+    PyArray_API[49])
+#define PyArray_CastTo \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[50])
+#define PyArray_CastAnyTo \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[51])
+#define PyArray_CanCastSafely \
+        (*(int (*)(int, int)) \
+    PyArray_API[52])
+#define PyArray_CanCastTo \
+        (*(npy_bool (*)(PyArray_Descr *, PyArray_Descr *)) \
+    PyArray_API[53])
+#define PyArray_ObjectType \
+        (*(int (*)(PyObject *, int)) \
+    PyArray_API[54])
+#define PyArray_DescrFromObject \
+        (*(PyArray_Descr * (*)(PyObject *, PyArray_Descr *)) \
+    PyArray_API[55])
+#define PyArray_ConvertToCommonType \
+        (*(PyArrayObject ** (*)(PyObject *, int *)) \
+    PyArray_API[56])
+#define PyArray_DescrFromScalar \
+        (*(PyArray_Descr * (*)(PyObject *)) \
+    PyArray_API[57])
+#define PyArray_DescrFromTypeObject \
+        (*(PyArray_Descr * (*)(PyObject *)) \
+    PyArray_API[58])
+#define PyArray_Size \
+        (*(npy_intp (*)(PyObject *)) \
+    PyArray_API[59])
+#define PyArray_Scalar \
+        (*(PyObject * (*)(void *, PyArray_Descr *, PyObject *)) \
+    PyArray_API[60])
+#define PyArray_FromScalar \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *)) \
+    PyArray_API[61])
+#define PyArray_ScalarAsCtype \
+        (*(void (*)(PyObject *, void *)) \
+    PyArray_API[62])
+#define PyArray_CastScalarToCtype \
+        (*(int (*)(PyObject *, void *, PyArray_Descr *)) \
+    PyArray_API[63])
+#define PyArray_CastScalarDirect \
+        (*(int (*)(PyObject *, PyArray_Descr *, void *, int)) \
+    PyArray_API[64])
+#define PyArray_ScalarFromObject \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[65])
+#define PyArray_GetCastFunc \
+        (*(PyArray_VectorUnaryFunc * (*)(PyArray_Descr *, int)) \
+    PyArray_API[66])
+#define PyArray_FromDims \
+        (*(PyObject * (*)(int NPY_UNUSED(nd), int *NPY_UNUSED(d), int NPY_UNUSED(type))) \
+    PyArray_API[67])
+#define PyArray_FromDimsAndDataAndDescr \
+        (*(PyObject * (*)(int NPY_UNUSED(nd), int *NPY_UNUSED(d), PyArray_Descr *, char *NPY_UNUSED(data))) \
+    PyArray_API[68])
+#define PyArray_FromAny \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *, int, int, int, PyObject *)) \
+    PyArray_API[69])
+#define PyArray_EnsureArray \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[70])
+#define PyArray_EnsureAnyArray \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[71])
+#define PyArray_FromFile \
+        (*(PyObject * (*)(FILE *, PyArray_Descr *, npy_intp, char *)) \
+    PyArray_API[72])
+#define PyArray_FromString \
+        (*(PyObject * (*)(char *, npy_intp, PyArray_Descr *, npy_intp, char *)) \
+    PyArray_API[73])
+#define PyArray_FromBuffer \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *, npy_intp, npy_intp)) \
+    PyArray_API[74])
+#define PyArray_FromIter \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *, npy_intp)) \
+    PyArray_API[75])
+#define PyArray_Return \
+        (*(PyObject * (*)(PyArrayObject *)) \
+    PyArray_API[76])
+#define PyArray_GetField \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Descr *, int)) \
+    PyArray_API[77])
+#define PyArray_SetField \
+        (*(int (*)(PyArrayObject *, PyArray_Descr *, int, PyObject *)) \
+    PyArray_API[78])
+#define PyArray_Byteswap \
+        (*(PyObject * (*)(PyArrayObject *, npy_bool)) \
+    PyArray_API[79])
+#define PyArray_Resize \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Dims *, int, NPY_ORDER NPY_UNUSED(order))) \
+    PyArray_API[80])
+#define PyArray_MoveInto \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[81])
+#define PyArray_CopyInto \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[82])
+#define PyArray_CopyAnyInto \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[83])
+#define PyArray_CopyObject \
+        (*(int (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[84])
+#define PyArray_NewCopy \
+        (*(PyObject * (*)(PyArrayObject *, NPY_ORDER)) \
+    PyArray_API[85])
+#define PyArray_ToList \
+        (*(PyObject * (*)(PyArrayObject *)) \
+    PyArray_API[86])
+#define PyArray_ToString \
+        (*(PyObject * (*)(PyArrayObject *, NPY_ORDER)) \
+    PyArray_API[87])
+#define PyArray_ToFile \
+        (*(int (*)(PyArrayObject *, FILE *, char *, char *)) \
+    PyArray_API[88])
+#define PyArray_Dump \
+        (*(int (*)(PyObject *, PyObject *, int)) \
+    PyArray_API[89])
+#define PyArray_Dumps \
+        (*(PyObject * (*)(PyObject *, int)) \
+    PyArray_API[90])
+#define PyArray_ValidType \
+        (*(int (*)(int)) \
+    PyArray_API[91])
+#define PyArray_UpdateFlags \
+        (*(void (*)(PyArrayObject *, int)) \
+    PyArray_API[92])
+#define PyArray_New \
+        (*(PyObject * (*)(PyTypeObject *, int, npy_intp const *, int, npy_intp const *, void *, int, int, PyObject *)) \
+    PyArray_API[93])
+#define PyArray_NewFromDescr \
+        (*(PyObject * (*)(PyTypeObject *, PyArray_Descr *, int, npy_intp const *, npy_intp const *, void *, int, PyObject *)) \
+    PyArray_API[94])
+#define PyArray_DescrNew \
+        (*(PyArray_Descr * (*)(PyArray_Descr *)) \
+    PyArray_API[95])
+#define PyArray_DescrNewFromType \
+        (*(PyArray_Descr * (*)(int)) \
+    PyArray_API[96])
+#define PyArray_GetPriority \
+        (*(double (*)(PyObject *, double)) \
+    PyArray_API[97])
+#define PyArray_IterNew \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[98])
+#define PyArray_MultiIterNew \
+        (*(PyObject* (*)(int, ...)) \
+    PyArray_API[99])
+#define PyArray_PyIntAsInt \
+        (*(int (*)(PyObject *)) \
+    PyArray_API[100])
+#define PyArray_PyIntAsIntp \
+        (*(npy_intp (*)(PyObject *)) \
+    PyArray_API[101])
+#define PyArray_Broadcast \
+        (*(int (*)(PyArrayMultiIterObject *)) \
+    PyArray_API[102])
+#define PyArray_FillObjectArray \
+        (*(void (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[103])
+#define PyArray_FillWithScalar \
+        (*(int (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[104])
+#define PyArray_CheckStrides \
+        (*(npy_bool (*)(int, int, npy_intp, npy_intp, npy_intp const *, npy_intp const *)) \
+    PyArray_API[105])
+#define PyArray_DescrNewByteorder \
+        (*(PyArray_Descr * (*)(PyArray_Descr *, char)) \
+    PyArray_API[106])
+#define PyArray_IterAllButAxis \
+        (*(PyObject * (*)(PyObject *, int *)) \
+    PyArray_API[107])
+#define PyArray_CheckFromAny \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *, int, int, int, PyObject *)) \
+    PyArray_API[108])
+#define PyArray_FromArray \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Descr *, int)) \
+    PyArray_API[109])
+#define PyArray_FromInterface \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[110])
+#define PyArray_FromStructInterface \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[111])
+#define PyArray_FromArrayAttr \
+        (*(PyObject * (*)(PyObject *, PyArray_Descr *, PyObject *)) \
+    PyArray_API[112])
+#define PyArray_ScalarKind \
+        (*(NPY_SCALARKIND (*)(int, PyArrayObject **)) \
+    PyArray_API[113])
+#define PyArray_CanCoerceScalar \
+        (*(int (*)(int, int, NPY_SCALARKIND)) \
+    PyArray_API[114])
+#define PyArray_NewFlagsObject \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[115])
+#define PyArray_CanCastScalar \
+        (*(npy_bool (*)(PyTypeObject *, PyTypeObject *)) \
+    PyArray_API[116])
+#define PyArray_CompareUCS4 \
+        (*(int (*)(npy_ucs4 const *, npy_ucs4 const *, size_t)) \
+    PyArray_API[117])
+#define PyArray_RemoveSmallest \
+        (*(int (*)(PyArrayMultiIterObject *)) \
+    PyArray_API[118])
+#define PyArray_ElementStrides \
+        (*(int (*)(PyObject *)) \
+    PyArray_API[119])
+#define PyArray_Item_INCREF \
+        (*(void (*)(char *, PyArray_Descr *)) \
+    PyArray_API[120])
+#define PyArray_Item_XDECREF \
+        (*(void (*)(char *, PyArray_Descr *)) \
+    PyArray_API[121])
+#define PyArray_FieldNames \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[122])
+#define PyArray_Transpose \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Dims *)) \
+    PyArray_API[123])
+#define PyArray_TakeFrom \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, int, PyArrayObject *, NPY_CLIPMODE)) \
+    PyArray_API[124])
+#define PyArray_PutTo \
+        (*(PyObject * (*)(PyArrayObject *, PyObject*, PyObject *, NPY_CLIPMODE)) \
+    PyArray_API[125])
+#define PyArray_PutMask \
+        (*(PyObject * (*)(PyArrayObject *, PyObject*, PyObject*)) \
+    PyArray_API[126])
+#define PyArray_Repeat \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, int)) \
+    PyArray_API[127])
+#define PyArray_Choose \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, PyArrayObject *, NPY_CLIPMODE)) \
+    PyArray_API[128])
+#define PyArray_Sort \
+        (*(int (*)(PyArrayObject *, int, NPY_SORTKIND)) \
+    PyArray_API[129])
+#define PyArray_ArgSort \
+        (*(PyObject * (*)(PyArrayObject *, int, NPY_SORTKIND)) \
+    PyArray_API[130])
+#define PyArray_SearchSorted \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, NPY_SEARCHSIDE, PyObject *)) \
+    PyArray_API[131])
+#define PyArray_ArgMax \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[132])
+#define PyArray_ArgMin \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[133])
+#define PyArray_Reshape \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[134])
+#define PyArray_Newshape \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Dims *, NPY_ORDER)) \
+    PyArray_API[135])
+#define PyArray_Squeeze \
+        (*(PyObject * (*)(PyArrayObject *)) \
+    PyArray_API[136])
+#define PyArray_View \
+        (*(PyObject * (*)(PyArrayObject *, PyArray_Descr *, PyTypeObject *)) \
+    PyArray_API[137])
+#define PyArray_SwapAxes \
+        (*(PyObject * (*)(PyArrayObject *, int, int)) \
+    PyArray_API[138])
+#define PyArray_Max \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[139])
+#define PyArray_Min \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[140])
+#define PyArray_Ptp \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[141])
+#define PyArray_Mean \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *)) \
+    PyArray_API[142])
+#define PyArray_Trace \
+        (*(PyObject * (*)(PyArrayObject *, int, int, int, int, PyArrayObject *)) \
+    PyArray_API[143])
+#define PyArray_Diagonal \
+        (*(PyObject * (*)(PyArrayObject *, int, int, int)) \
+    PyArray_API[144])
+#define PyArray_Clip \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, PyObject *, PyArrayObject *)) \
+    PyArray_API[145])
+#define PyArray_Conjugate \
+        (*(PyObject * (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[146])
+#define PyArray_Nonzero \
+        (*(PyObject * (*)(PyArrayObject *)) \
+    PyArray_API[147])
+#define PyArray_Std \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *, int)) \
+    PyArray_API[148])
+#define PyArray_Sum \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *)) \
+    PyArray_API[149])
+#define PyArray_CumSum \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *)) \
+    PyArray_API[150])
+#define PyArray_Prod \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *)) \
+    PyArray_API[151])
+#define PyArray_CumProd \
+        (*(PyObject * (*)(PyArrayObject *, int, int, PyArrayObject *)) \
+    PyArray_API[152])
+#define PyArray_All \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[153])
+#define PyArray_Any \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[154])
+#define PyArray_Compress \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, int, PyArrayObject *)) \
+    PyArray_API[155])
+#define PyArray_Flatten \
+        (*(PyObject * (*)(PyArrayObject *, NPY_ORDER)) \
+    PyArray_API[156])
+#define PyArray_Ravel \
+        (*(PyObject * (*)(PyArrayObject *, NPY_ORDER)) \
+    PyArray_API[157])
+#define PyArray_MultiplyList \
+        (*(npy_intp (*)(npy_intp const *, int)) \
+    PyArray_API[158])
+#define PyArray_MultiplyIntList \
+        (*(int (*)(int const *, int)) \
+    PyArray_API[159])
+#define PyArray_GetPtr \
+        (*(void * (*)(PyArrayObject *, npy_intp const*)) \
+    PyArray_API[160])
+#define PyArray_CompareLists \
+        (*(int (*)(npy_intp const *, npy_intp const *, int)) \
+    PyArray_API[161])
+#define PyArray_AsCArray \
+        (*(int (*)(PyObject **, void *, npy_intp *, int, PyArray_Descr*)) \
+    PyArray_API[162])
+#define PyArray_As1D \
+        (*(int (*)(PyObject **NPY_UNUSED(op), char **NPY_UNUSED(ptr), int *NPY_UNUSED(d1), int NPY_UNUSED(typecode))) \
+    PyArray_API[163])
+#define PyArray_As2D \
+        (*(int (*)(PyObject **NPY_UNUSED(op), char ***NPY_UNUSED(ptr), int *NPY_UNUSED(d1), int *NPY_UNUSED(d2), int NPY_UNUSED(typecode))) \
+    PyArray_API[164])
+#define PyArray_Free \
+        (*(int (*)(PyObject *, void *)) \
+    PyArray_API[165])
+#define PyArray_Converter \
+        (*(int (*)(PyObject *, PyObject **)) \
+    PyArray_API[166])
+#define PyArray_IntpFromSequence \
+        (*(int (*)(PyObject *, npy_intp *, int)) \
+    PyArray_API[167])
+#define PyArray_Concatenate \
+        (*(PyObject * (*)(PyObject *, int)) \
+    PyArray_API[168])
+#define PyArray_InnerProduct \
+        (*(PyObject * (*)(PyObject *, PyObject *)) \
+    PyArray_API[169])
+#define PyArray_MatrixProduct \
+        (*(PyObject * (*)(PyObject *, PyObject *)) \
+    PyArray_API[170])
+#define PyArray_CopyAndTranspose \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[171])
+#define PyArray_Correlate \
+        (*(PyObject * (*)(PyObject *, PyObject *, int)) \
+    PyArray_API[172])
+#define PyArray_TypestrConvert \
+        (*(int (*)(int, int)) \
+    PyArray_API[173])
+#define PyArray_DescrConverter \
+        (*(int (*)(PyObject *, PyArray_Descr **)) \
+    PyArray_API[174])
+#define PyArray_DescrConverter2 \
+        (*(int (*)(PyObject *, PyArray_Descr **)) \
+    PyArray_API[175])
+#define PyArray_IntpConverter \
+        (*(int (*)(PyObject *, PyArray_Dims *)) \
+    PyArray_API[176])
+#define PyArray_BufferConverter \
+        (*(int (*)(PyObject *, PyArray_Chunk *)) \
+    PyArray_API[177])
+#define PyArray_AxisConverter \
+        (*(int (*)(PyObject *, int *)) \
+    PyArray_API[178])
+#define PyArray_BoolConverter \
+        (*(int (*)(PyObject *, npy_bool *)) \
+    PyArray_API[179])
+#define PyArray_ByteorderConverter \
+        (*(int (*)(PyObject *, char *)) \
+    PyArray_API[180])
+#define PyArray_OrderConverter \
+        (*(int (*)(PyObject *, NPY_ORDER *)) \
+    PyArray_API[181])
+#define PyArray_EquivTypes \
+        (*(unsigned char (*)(PyArray_Descr *, PyArray_Descr *)) \
+    PyArray_API[182])
+#define PyArray_Zeros \
+        (*(PyObject * (*)(int, npy_intp const *, PyArray_Descr *, int)) \
+    PyArray_API[183])
+#define PyArray_Empty \
+        (*(PyObject * (*)(int, npy_intp const *, PyArray_Descr *, int)) \
+    PyArray_API[184])
+#define PyArray_Where \
+        (*(PyObject * (*)(PyObject *, PyObject *, PyObject *)) \
+    PyArray_API[185])
+#define PyArray_Arange \
+        (*(PyObject * (*)(double, double, double, int)) \
+    PyArray_API[186])
+#define PyArray_ArangeObj \
+        (*(PyObject * (*)(PyObject *, PyObject *, PyObject *, PyArray_Descr *)) \
+    PyArray_API[187])
+#define PyArray_SortkindConverter \
+        (*(int (*)(PyObject *, NPY_SORTKIND *)) \
+    PyArray_API[188])
+#define PyArray_LexSort \
+        (*(PyObject * (*)(PyObject *, int)) \
+    PyArray_API[189])
+#define PyArray_Round \
+        (*(PyObject * (*)(PyArrayObject *, int, PyArrayObject *)) \
+    PyArray_API[190])
+#define PyArray_EquivTypenums \
+        (*(unsigned char (*)(int, int)) \
+    PyArray_API[191])
+#define PyArray_RegisterDataType \
+        (*(int (*)(PyArray_Descr *)) \
+    PyArray_API[192])
+#define PyArray_RegisterCastFunc \
+        (*(int (*)(PyArray_Descr *, int, PyArray_VectorUnaryFunc *)) \
+    PyArray_API[193])
+#define PyArray_RegisterCanCast \
+        (*(int (*)(PyArray_Descr *, int, NPY_SCALARKIND)) \
+    PyArray_API[194])
+#define PyArray_InitArrFuncs \
+        (*(void (*)(PyArray_ArrFuncs *)) \
+    PyArray_API[195])
+#define PyArray_IntTupleFromIntp \
+        (*(PyObject * (*)(int, npy_intp const *)) \
+    PyArray_API[196])
+#define PyArray_TypeNumFromName \
+        (*(int (*)(char const *)) \
+    PyArray_API[197])
+#define PyArray_ClipmodeConverter \
+        (*(int (*)(PyObject *, NPY_CLIPMODE *)) \
+    PyArray_API[198])
+#define PyArray_OutputConverter \
+        (*(int (*)(PyObject *, PyArrayObject **)) \
+    PyArray_API[199])
+#define PyArray_BroadcastToShape \
+        (*(PyObject * (*)(PyObject *, npy_intp *, int)) \
+    PyArray_API[200])
+#define _PyArray_SigintHandler \
+        (*(void (*)(int)) \
+    PyArray_API[201])
+#define _PyArray_GetSigintBuf \
+        (*(void* (*)(void)) \
+    PyArray_API[202])
+#define PyArray_DescrAlignConverter \
+        (*(int (*)(PyObject *, PyArray_Descr **)) \
+    PyArray_API[203])
+#define PyArray_DescrAlignConverter2 \
+        (*(int (*)(PyObject *, PyArray_Descr **)) \
+    PyArray_API[204])
+#define PyArray_SearchsideConverter \
+        (*(int (*)(PyObject *, void *)) \
+    PyArray_API[205])
+#define PyArray_CheckAxis \
+        (*(PyObject * (*)(PyArrayObject *, int *, int)) \
+    PyArray_API[206])
+#define PyArray_OverflowMultiplyList \
+        (*(npy_intp (*)(npy_intp const *, int)) \
+    PyArray_API[207])
+#define PyArray_CompareString \
+        (*(int (*)(const char *, const char *, size_t)) \
+    PyArray_API[208])
+#define PyArray_MultiIterFromObjects \
+        (*(PyObject* (*)(PyObject **, int, int, ...)) \
+    PyArray_API[209])
+#define PyArray_GetEndianness \
+        (*(int (*)(void)) \
+    PyArray_API[210])
+#define PyArray_GetNDArrayCFeatureVersion \
+        (*(unsigned int (*)(void)) \
+    PyArray_API[211])
+#define PyArray_Correlate2 \
+        (*(PyObject * (*)(PyObject *, PyObject *, int)) \
+    PyArray_API[212])
+#define PyArray_NeighborhoodIterNew \
+        (*(PyObject* (*)(PyArrayIterObject *, const npy_intp *, int, PyArrayObject*)) \
+    PyArray_API[213])
+#define PyTimeIntegerArrType_Type (*(PyTypeObject *)PyArray_API[214])
+#define PyDatetimeArrType_Type (*(PyTypeObject *)PyArray_API[215])
+#define PyTimedeltaArrType_Type (*(PyTypeObject *)PyArray_API[216])
+#define PyHalfArrType_Type (*(PyTypeObject *)PyArray_API[217])
+#define NpyIter_Type (*(PyTypeObject *)PyArray_API[218])
+#define PyArray_SetDatetimeParseFunction \
+        (*(void (*)(PyObject *NPY_UNUSED(op))) \
+    PyArray_API[219])
+#define PyArray_DatetimeToDatetimeStruct \
+        (*(void (*)(npy_datetime NPY_UNUSED(val), NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_datetimestruct *)) \
+    PyArray_API[220])
+#define PyArray_TimedeltaToTimedeltaStruct \
+        (*(void (*)(npy_timedelta NPY_UNUSED(val), NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_timedeltastruct *)) \
+    PyArray_API[221])
+#define PyArray_DatetimeStructToDatetime \
+        (*(npy_datetime (*)(NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_datetimestruct *NPY_UNUSED(d))) \
+    PyArray_API[222])
+#define PyArray_TimedeltaStructToTimedelta \
+        (*(npy_datetime (*)(NPY_DATETIMEUNIT NPY_UNUSED(fr), npy_timedeltastruct *NPY_UNUSED(d))) \
+    PyArray_API[223])
+#define NpyIter_New \
+        (*(NpyIter * (*)(PyArrayObject *, npy_uint32, NPY_ORDER, NPY_CASTING, PyArray_Descr*)) \
+    PyArray_API[224])
+#define NpyIter_MultiNew \
+        (*(NpyIter * (*)(int, PyArrayObject **, npy_uint32, NPY_ORDER, NPY_CASTING, npy_uint32 *, PyArray_Descr **)) \
+    PyArray_API[225])
+#define NpyIter_AdvancedNew \
+        (*(NpyIter * (*)(int, PyArrayObject **, npy_uint32, NPY_ORDER, NPY_CASTING, npy_uint32 *, PyArray_Descr **, int, int **, npy_intp *, npy_intp)) \
+    PyArray_API[226])
+#define NpyIter_Copy \
+        (*(NpyIter * (*)(NpyIter *)) \
+    PyArray_API[227])
+#define NpyIter_Deallocate \
+        (*(int (*)(NpyIter *)) \
+    PyArray_API[228])
+#define NpyIter_HasDelayedBufAlloc \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[229])
+#define NpyIter_HasExternalLoop \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[230])
+#define NpyIter_EnableExternalLoop \
+        (*(int (*)(NpyIter *)) \
+    PyArray_API[231])
+#define NpyIter_GetInnerStrideArray \
+        (*(npy_intp * (*)(NpyIter *)) \
+    PyArray_API[232])
+#define NpyIter_GetInnerLoopSizePtr \
+        (*(npy_intp * (*)(NpyIter *)) \
+    PyArray_API[233])
+#define NpyIter_Reset \
+        (*(int (*)(NpyIter *, char **)) \
+    PyArray_API[234])
+#define NpyIter_ResetBasePointers \
+        (*(int (*)(NpyIter *, char **, char **)) \
+    PyArray_API[235])
+#define NpyIter_ResetToIterIndexRange \
+        (*(int (*)(NpyIter *, npy_intp, npy_intp, char **)) \
+    PyArray_API[236])
+#define NpyIter_GetNDim \
+        (*(int (*)(NpyIter *)) \
+    PyArray_API[237])
+#define NpyIter_GetNOp \
+        (*(int (*)(NpyIter *)) \
+    PyArray_API[238])
+#define NpyIter_GetIterNext \
+        (*(NpyIter_IterNextFunc * (*)(NpyIter *, char **)) \
+    PyArray_API[239])
+#define NpyIter_GetIterSize \
+        (*(npy_intp (*)(NpyIter *)) \
+    PyArray_API[240])
+#define NpyIter_GetIterIndexRange \
+        (*(void (*)(NpyIter *, npy_intp *, npy_intp *)) \
+    PyArray_API[241])
+#define NpyIter_GetIterIndex \
+        (*(npy_intp (*)(NpyIter *)) \
+    PyArray_API[242])
+#define NpyIter_GotoIterIndex \
+        (*(int (*)(NpyIter *, npy_intp)) \
+    PyArray_API[243])
+#define NpyIter_HasMultiIndex \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[244])
+#define NpyIter_GetShape \
+        (*(int (*)(NpyIter *, npy_intp *)) \
+    PyArray_API[245])
+#define NpyIter_GetGetMultiIndex \
+        (*(NpyIter_GetMultiIndexFunc * (*)(NpyIter *, char **)) \
+    PyArray_API[246])
+#define NpyIter_GotoMultiIndex \
+        (*(int (*)(NpyIter *, npy_intp const *)) \
+    PyArray_API[247])
+#define NpyIter_RemoveMultiIndex \
+        (*(int (*)(NpyIter *)) \
+    PyArray_API[248])
+#define NpyIter_HasIndex \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[249])
+#define NpyIter_IsBuffered \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[250])
+#define NpyIter_IsGrowInner \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[251])
+#define NpyIter_GetBufferSize \
+        (*(npy_intp (*)(NpyIter *)) \
+    PyArray_API[252])
+#define NpyIter_GetIndexPtr \
+        (*(npy_intp * (*)(NpyIter *)) \
+    PyArray_API[253])
+#define NpyIter_GotoIndex \
+        (*(int (*)(NpyIter *, npy_intp)) \
+    PyArray_API[254])
+#define NpyIter_GetDataPtrArray \
+        (*(char ** (*)(NpyIter *)) \
+    PyArray_API[255])
+#define NpyIter_GetDescrArray \
+        (*(PyArray_Descr ** (*)(NpyIter *)) \
+    PyArray_API[256])
+#define NpyIter_GetOperandArray \
+        (*(PyArrayObject ** (*)(NpyIter *)) \
+    PyArray_API[257])
+#define NpyIter_GetIterView \
+        (*(PyArrayObject * (*)(NpyIter *, npy_intp)) \
+    PyArray_API[258])
+#define NpyIter_GetReadFlags \
+        (*(void (*)(NpyIter *, char *)) \
+    PyArray_API[259])
+#define NpyIter_GetWriteFlags \
+        (*(void (*)(NpyIter *, char *)) \
+    PyArray_API[260])
+#define NpyIter_DebugPrint \
+        (*(void (*)(NpyIter *)) \
+    PyArray_API[261])
+#define NpyIter_IterationNeedsAPI \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[262])
+#define NpyIter_GetInnerFixedStrideArray \
+        (*(void (*)(NpyIter *, npy_intp *)) \
+    PyArray_API[263])
+#define NpyIter_RemoveAxis \
+        (*(int (*)(NpyIter *, int)) \
+    PyArray_API[264])
+#define NpyIter_GetAxisStrideArray \
+        (*(npy_intp * (*)(NpyIter *, int)) \
+    PyArray_API[265])
+#define NpyIter_RequiresBuffering \
+        (*(npy_bool (*)(NpyIter *)) \
+    PyArray_API[266])
+#define NpyIter_GetInitialDataPtrArray \
+        (*(char ** (*)(NpyIter *)) \
+    PyArray_API[267])
+#define NpyIter_CreateCompatibleStrides \
+        (*(int (*)(NpyIter *, npy_intp, npy_intp *)) \
+    PyArray_API[268])
+#define PyArray_CastingConverter \
+        (*(int (*)(PyObject *, NPY_CASTING *)) \
+    PyArray_API[269])
+#define PyArray_CountNonzero \
+        (*(npy_intp (*)(PyArrayObject *)) \
+    PyArray_API[270])
+#define PyArray_PromoteTypes \
+        (*(PyArray_Descr * (*)(PyArray_Descr *, PyArray_Descr *)) \
+    PyArray_API[271])
+#define PyArray_MinScalarType \
+        (*(PyArray_Descr * (*)(PyArrayObject *)) \
+    PyArray_API[272])
+#define PyArray_ResultType \
+        (*(PyArray_Descr * (*)(npy_intp, PyArrayObject *arrs[], npy_intp, PyArray_Descr *descrs[])) \
+    PyArray_API[273])
+#define PyArray_CanCastArrayTo \
+        (*(npy_bool (*)(PyArrayObject *, PyArray_Descr *, NPY_CASTING)) \
+    PyArray_API[274])
+#define PyArray_CanCastTypeTo \
+        (*(npy_bool (*)(PyArray_Descr *, PyArray_Descr *, NPY_CASTING)) \
+    PyArray_API[275])
+#define PyArray_EinsteinSum \
+        (*(PyArrayObject * (*)(char *, npy_intp, PyArrayObject **, PyArray_Descr *, NPY_ORDER, NPY_CASTING, PyArrayObject *)) \
+    PyArray_API[276])
+#define PyArray_NewLikeArray \
+        (*(PyObject * (*)(PyArrayObject *, NPY_ORDER, PyArray_Descr *, int)) \
+    PyArray_API[277])
+#define PyArray_GetArrayParamsFromObject \
+        (*(int (*)(PyObject *NPY_UNUSED(op), PyArray_Descr *NPY_UNUSED(requested_dtype), npy_bool NPY_UNUSED(writeable), PyArray_Descr **NPY_UNUSED(out_dtype), int *NPY_UNUSED(out_ndim), npy_intp *NPY_UNUSED(out_dims), PyArrayObject **NPY_UNUSED(out_arr), PyObject *NPY_UNUSED(context))) \
+    PyArray_API[278])
+#define PyArray_ConvertClipmodeSequence \
+        (*(int (*)(PyObject *, NPY_CLIPMODE *, int)) \
+    PyArray_API[279])
+#define PyArray_MatrixProduct2 \
+        (*(PyObject * (*)(PyObject *, PyObject *, PyArrayObject*)) \
+    PyArray_API[280])
+#define NpyIter_IsFirstVisit \
+        (*(npy_bool (*)(NpyIter *, int)) \
+    PyArray_API[281])
+#define PyArray_SetBaseObject \
+        (*(int (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[282])
+#define PyArray_CreateSortedStridePerm \
+        (*(void (*)(int, npy_intp const *, npy_stride_sort_item *)) \
+    PyArray_API[283])
+#define PyArray_RemoveAxesInPlace \
+        (*(void (*)(PyArrayObject *, const npy_bool *)) \
+    PyArray_API[284])
+#define PyArray_DebugPrint \
+        (*(void (*)(PyArrayObject *)) \
+    PyArray_API[285])
+#define PyArray_FailUnlessWriteable \
+        (*(int (*)(PyArrayObject *, const char *)) \
+    PyArray_API[286])
+#define PyArray_SetUpdateIfCopyBase \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[287])
+#define PyDataMem_NEW \
+        (*(void * (*)(size_t)) \
+    PyArray_API[288])
+#define PyDataMem_FREE \
+        (*(void (*)(void *)) \
+    PyArray_API[289])
+#define PyDataMem_RENEW \
+        (*(void * (*)(void *, size_t)) \
+    PyArray_API[290])
+#define PyDataMem_SetEventHook \
+        (*(PyDataMem_EventHookFunc * (*)(PyDataMem_EventHookFunc *, void *, void **)) \
+    PyArray_API[291])
+#define NPY_DEFAULT_ASSIGN_CASTING (*(NPY_CASTING *)PyArray_API[292])
+#define PyArray_MapIterSwapAxes \
+        (*(void (*)(PyArrayMapIterObject *, PyArrayObject **, int)) \
+    PyArray_API[293])
+#define PyArray_MapIterArray \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *)) \
+    PyArray_API[294])
+#define PyArray_MapIterNext \
+        (*(void (*)(PyArrayMapIterObject *)) \
+    PyArray_API[295])
+#define PyArray_Partition \
+        (*(int (*)(PyArrayObject *, PyArrayObject *, int, NPY_SELECTKIND)) \
+    PyArray_API[296])
+#define PyArray_ArgPartition \
+        (*(PyObject * (*)(PyArrayObject *, PyArrayObject *, int, NPY_SELECTKIND)) \
+    PyArray_API[297])
+#define PyArray_SelectkindConverter \
+        (*(int (*)(PyObject *, NPY_SELECTKIND *)) \
+    PyArray_API[298])
+#define PyDataMem_NEW_ZEROED \
+        (*(void * (*)(size_t, size_t)) \
+    PyArray_API[299])
+#define PyArray_CheckAnyScalarExact \
+        (*(int (*)(PyObject *)) \
+    PyArray_API[300])
+#define PyArray_MapIterArrayCopyIfOverlap \
+        (*(PyObject * (*)(PyArrayObject *, PyObject *, int, PyArrayObject *)) \
+    PyArray_API[301])
+#define PyArray_ResolveWritebackIfCopy \
+        (*(int (*)(PyArrayObject *)) \
+    PyArray_API[302])
+#define PyArray_SetWritebackIfCopyBase \
+        (*(int (*)(PyArrayObject *, PyArrayObject *)) \
+    PyArray_API[303])
+
+#if NPY_FEATURE_VERSION >= NPY_1_22_API_VERSION
+#define PyDataMem_SetHandler \
+        (*(PyObject * (*)(PyObject *)) \
+    PyArray_API[304])
+#endif
+
+#if NPY_FEATURE_VERSION >= NPY_1_22_API_VERSION
+#define PyDataMem_GetHandler \
+        (*(PyObject * (*)(void)) \
+    PyArray_API[305])
+#endif
+#define PyDataMem_DefaultHandler (*(PyObject* *)PyArray_API[306])
+
+#if !defined(NO_IMPORT_ARRAY) && !defined(NO_IMPORT)
+static int
+_import_array(void)
+{
+  int st;
+  PyObject *numpy = PyImport_ImportModule("numpy.core._multiarray_umath");
+  PyObject *c_api = NULL;
+
+  if (numpy == NULL) {
+      return -1;
+  }
+  c_api = PyObject_GetAttrString(numpy, "_ARRAY_API");
+  Py_DECREF(numpy);
+  if (c_api == NULL) {
+      return -1;
+  }
+
+  if (!PyCapsule_CheckExact(c_api)) {
+      PyErr_SetString(PyExc_RuntimeError, "_ARRAY_API is not PyCapsule object");
+      Py_DECREF(c_api);
+      return -1;
+  }
+  PyArray_API = (void **)PyCapsule_GetPointer(c_api, NULL);
+  Py_DECREF(c_api);
+  if (PyArray_API == NULL) {
+      PyErr_SetString(PyExc_RuntimeError, "_ARRAY_API is NULL pointer");
+      return -1;
+  }
+
+  /* Perform runtime check of C API version */
+  if (NPY_VERSION != PyArray_GetNDArrayCVersion()) {
+      PyErr_Format(PyExc_RuntimeError, "module compiled against "\
+             "ABI version 0x%x but this version of numpy is 0x%x", \
+             (int) NPY_VERSION, (int) PyArray_GetNDArrayCVersion());
+      return -1;
+  }
+  if (NPY_FEATURE_VERSION > PyArray_GetNDArrayCFeatureVersion()) {
+      PyErr_Format(PyExc_RuntimeError, "module compiled against "\
+             "API version 0x%x but this version of numpy is 0x%x . "\
+             "Check the section C-API incompatibility at the "\
+             "Troubleshooting ImportError section at "\
+             "https://numpy.org/devdocs/user/troubleshooting-importerror.html"\
+             "#c-api-incompatibility "\
+              "for indications on how to solve this problem .", \
+             (int) NPY_FEATURE_VERSION, (int) PyArray_GetNDArrayCFeatureVersion());
+      return -1;
+  }
+
+  /*
+   * Perform runtime check of endianness and check it matches the one set by
+   * the headers (npy_endian.h) as a safeguard
+   */
+  st = PyArray_GetEndianness();
+  if (st == NPY_CPU_UNKNOWN_ENDIAN) {
+      PyErr_SetString(PyExc_RuntimeError,
+                      "FATAL: module compiled as unknown endian");
+      return -1;
+  }
+#if NPY_BYTE_ORDER == NPY_BIG_ENDIAN
+  if (st != NPY_CPU_BIG) {
+      PyErr_SetString(PyExc_RuntimeError,
+                      "FATAL: module compiled as big endian, but "
+                      "detected different endianness at runtime");
+      return -1;
+  }
+#elif NPY_BYTE_ORDER == NPY_LITTLE_ENDIAN
+  if (st != NPY_CPU_LITTLE) {
+      PyErr_SetString(PyExc_RuntimeError,
+                      "FATAL: module compiled as little endian, but "
+                      "detected different endianness at runtime");
+      return -1;
+  }
+#endif
+
+  return 0;
+}
+
+#define import_array() {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, "numpy.core.multiarray failed to import"); return NULL; } }
+
+#define import_array1(ret) {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, "numpy.core.multiarray failed to import"); return ret; } }
+
+#define import_array2(msg, ret) {if (_import_array() < 0) {PyErr_Print(); PyErr_SetString(PyExc_ImportError, msg); return ret; } }
+
+#endif
+
+#endif

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/__ufunc_api.c

@@ -0,0 +1,50 @@
+
+/* These pointers will be stored in the C-object for use in other
+    extension modules
+*/
+
+void *PyUFunc_API[] = {
+        (void *) &PyUFunc_Type,
+        (void *) PyUFunc_FromFuncAndData,
+        (void *) PyUFunc_RegisterLoopForType,
+        (void *) PyUFunc_GenericFunction,
+        (void *) PyUFunc_f_f_As_d_d,
+        (void *) PyUFunc_d_d,
+        (void *) PyUFunc_f_f,
+        (void *) PyUFunc_g_g,
+        (void *) PyUFunc_F_F_As_D_D,
+        (void *) PyUFunc_F_F,
+        (void *) PyUFunc_D_D,
+        (void *) PyUFunc_G_G,
+        (void *) PyUFunc_O_O,
+        (void *) PyUFunc_ff_f_As_dd_d,
+        (void *) PyUFunc_ff_f,
+        (void *) PyUFunc_dd_d,
+        (void *) PyUFunc_gg_g,
+        (void *) PyUFunc_FF_F_As_DD_D,
+        (void *) PyUFunc_DD_D,
+        (void *) PyUFunc_FF_F,
+        (void *) PyUFunc_GG_G,
+        (void *) PyUFunc_OO_O,
+        (void *) PyUFunc_O_O_method,
+        (void *) PyUFunc_OO_O_method,
+        (void *) PyUFunc_On_Om,
+        (void *) PyUFunc_GetPyValues,
+        (void *) PyUFunc_checkfperr,
+        (void *) PyUFunc_clearfperr,
+        (void *) PyUFunc_getfperr,
+        (void *) PyUFunc_handlefperr,
+        (void *) PyUFunc_ReplaceLoopBySignature,
+        (void *) PyUFunc_FromFuncAndDataAndSignature,
+        (void *) PyUFunc_SetUsesArraysAsData,
+        (void *) PyUFunc_e_e,
+        (void *) PyUFunc_e_e_As_f_f,
+        (void *) PyUFunc_e_e_As_d_d,
+        (void *) PyUFunc_ee_e,
+        (void *) PyUFunc_ee_e_As_ff_f,
+        (void *) PyUFunc_ee_e_As_dd_d,
+        (void *) PyUFunc_DefaultTypeResolver,
+        (void *) PyUFunc_ValidateCasting,
+        (void *) PyUFunc_RegisterLoopForDescr,
+        (void *) PyUFunc_FromFuncAndDataAndSignatureAndIdentity
+};

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/__ufunc_api.h

@@ -0,0 +1,314 @@
+
+#ifdef _UMATHMODULE
+
+extern NPY_NO_EXPORT PyTypeObject PyUFunc_Type;
+
+extern NPY_NO_EXPORT PyTypeObject PyUFunc_Type;
+
+NPY_NO_EXPORT  PyObject * PyUFunc_FromFuncAndData \
+       (PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, int);
+NPY_NO_EXPORT  int PyUFunc_RegisterLoopForType \
+       (PyUFuncObject *, int, PyUFuncGenericFunction, const int *, void *);
+NPY_NO_EXPORT  int PyUFunc_GenericFunction \
+       (PyUFuncObject *NPY_UNUSED(ufunc), PyObject *NPY_UNUSED(args), PyObject *NPY_UNUSED(kwds), PyArrayObject **NPY_UNUSED(op));
+NPY_NO_EXPORT  void PyUFunc_f_f_As_d_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_d_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_f_f \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_g_g \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_F_F_As_D_D \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_F_F \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_D_D \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_G_G \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_O_O \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_ff_f_As_dd_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_ff_f \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_dd_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_gg_g \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_FF_F_As_DD_D \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_DD_D \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_FF_F \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_GG_G \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_OO_O \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_O_O_method \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_OO_O_method \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_On_Om \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  int PyUFunc_GetPyValues \
+       (char *, int *, int *, PyObject **);
+NPY_NO_EXPORT  int PyUFunc_checkfperr \
+       (int, PyObject *, int *);
+NPY_NO_EXPORT  void PyUFunc_clearfperr \
+       (void);
+NPY_NO_EXPORT  int PyUFunc_getfperr \
+       (void);
+NPY_NO_EXPORT  int PyUFunc_handlefperr \
+       (int, PyObject *, int, int *);
+NPY_NO_EXPORT  int PyUFunc_ReplaceLoopBySignature \
+       (PyUFuncObject *, PyUFuncGenericFunction, const int *, PyUFuncGenericFunction *);
+NPY_NO_EXPORT  PyObject * PyUFunc_FromFuncAndDataAndSignature \
+       (PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, int, const char *);
+NPY_NO_EXPORT  int PyUFunc_SetUsesArraysAsData \
+       (void **NPY_UNUSED(data), size_t NPY_UNUSED(i));
+NPY_NO_EXPORT  void PyUFunc_e_e \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_e_e_As_f_f \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_e_e_As_d_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_ee_e \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_ee_e_As_ff_f \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  void PyUFunc_ee_e_As_dd_d \
+       (char **, npy_intp const *, npy_intp const *, void *);
+NPY_NO_EXPORT  int PyUFunc_DefaultTypeResolver \
+       (PyUFuncObject *, NPY_CASTING, PyArrayObject **, PyObject *, PyArray_Descr **);
+NPY_NO_EXPORT  int PyUFunc_ValidateCasting \
+       (PyUFuncObject *, NPY_CASTING, PyArrayObject **, PyArray_Descr **);
+NPY_NO_EXPORT  int PyUFunc_RegisterLoopForDescr \
+       (PyUFuncObject *, PyArray_Descr *, PyUFuncGenericFunction, PyArray_Descr **, void *);
+NPY_NO_EXPORT  PyObject * PyUFunc_FromFuncAndDataAndSignatureAndIdentity \
+       (PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, const int, const char *, PyObject *);
+
+#else
+
+#if defined(PY_UFUNC_UNIQUE_SYMBOL)
+#define PyUFunc_API PY_UFUNC_UNIQUE_SYMBOL
+#endif
+
+#if defined(NO_IMPORT) || defined(NO_IMPORT_UFUNC)
+extern void **PyUFunc_API;
+#else
+#if defined(PY_UFUNC_UNIQUE_SYMBOL)
+void **PyUFunc_API;
+#else
+static void **PyUFunc_API=NULL;
+#endif
+#endif
+
+#define PyUFunc_Type (*(PyTypeObject *)PyUFunc_API[0])
+#define PyUFunc_FromFuncAndData \
+        (*(PyObject * (*)(PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, int)) \
+    PyUFunc_API[1])
+#define PyUFunc_RegisterLoopForType \
+        (*(int (*)(PyUFuncObject *, int, PyUFuncGenericFunction, const int *, void *)) \
+    PyUFunc_API[2])
+#define PyUFunc_GenericFunction \
+        (*(int (*)(PyUFuncObject *NPY_UNUSED(ufunc), PyObject *NPY_UNUSED(args), PyObject *NPY_UNUSED(kwds), PyArrayObject **NPY_UNUSED(op))) \
+    PyUFunc_API[3])
+#define PyUFunc_f_f_As_d_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[4])
+#define PyUFunc_d_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[5])
+#define PyUFunc_f_f \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[6])
+#define PyUFunc_g_g \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[7])
+#define PyUFunc_F_F_As_D_D \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[8])
+#define PyUFunc_F_F \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[9])
+#define PyUFunc_D_D \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[10])
+#define PyUFunc_G_G \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[11])
+#define PyUFunc_O_O \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[12])
+#define PyUFunc_ff_f_As_dd_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[13])
+#define PyUFunc_ff_f \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[14])
+#define PyUFunc_dd_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[15])
+#define PyUFunc_gg_g \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[16])
+#define PyUFunc_FF_F_As_DD_D \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[17])
+#define PyUFunc_DD_D \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[18])
+#define PyUFunc_FF_F \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[19])
+#define PyUFunc_GG_G \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[20])
+#define PyUFunc_OO_O \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[21])
+#define PyUFunc_O_O_method \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[22])
+#define PyUFunc_OO_O_method \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[23])
+#define PyUFunc_On_Om \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[24])
+#define PyUFunc_GetPyValues \
+        (*(int (*)(char *, int *, int *, PyObject **)) \
+    PyUFunc_API[25])
+#define PyUFunc_checkfperr \
+        (*(int (*)(int, PyObject *, int *)) \
+    PyUFunc_API[26])
+#define PyUFunc_clearfperr \
+        (*(void (*)(void)) \
+    PyUFunc_API[27])
+#define PyUFunc_getfperr \
+        (*(int (*)(void)) \
+    PyUFunc_API[28])
+#define PyUFunc_handlefperr \
+        (*(int (*)(int, PyObject *, int, int *)) \
+    PyUFunc_API[29])
+#define PyUFunc_ReplaceLoopBySignature \
+        (*(int (*)(PyUFuncObject *, PyUFuncGenericFunction, const int *, PyUFuncGenericFunction *)) \
+    PyUFunc_API[30])
+#define PyUFunc_FromFuncAndDataAndSignature \
+        (*(PyObject * (*)(PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, int, const char *)) \
+    PyUFunc_API[31])
+#define PyUFunc_SetUsesArraysAsData \
+        (*(int (*)(void **NPY_UNUSED(data), size_t NPY_UNUSED(i))) \
+    PyUFunc_API[32])
+#define PyUFunc_e_e \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[33])
+#define PyUFunc_e_e_As_f_f \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[34])
+#define PyUFunc_e_e_As_d_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[35])
+#define PyUFunc_ee_e \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[36])
+#define PyUFunc_ee_e_As_ff_f \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[37])
+#define PyUFunc_ee_e_As_dd_d \
+        (*(void (*)(char **, npy_intp const *, npy_intp const *, void *)) \
+    PyUFunc_API[38])
+#define PyUFunc_DefaultTypeResolver \
+        (*(int (*)(PyUFuncObject *, NPY_CASTING, PyArrayObject **, PyObject *, PyArray_Descr **)) \
+    PyUFunc_API[39])
+#define PyUFunc_ValidateCasting \
+        (*(int (*)(PyUFuncObject *, NPY_CASTING, PyArrayObject **, PyArray_Descr **)) \
+    PyUFunc_API[40])
+#define PyUFunc_RegisterLoopForDescr \
+        (*(int (*)(PyUFuncObject *, PyArray_Descr *, PyUFuncGenericFunction, PyArray_Descr **, void *)) \
+    PyUFunc_API[41])
+
+#if NPY_FEATURE_VERSION >= NPY_1_16_API_VERSION
+#define PyUFunc_FromFuncAndDataAndSignatureAndIdentity \
+        (*(PyObject * (*)(PyUFuncGenericFunction *, void **, char *, int, int, int, int, const char *, const char *, const int, const char *, PyObject *)) \
+    PyUFunc_API[42])
+#endif
+
+static inline int
+_import_umath(void)
+{
+  PyObject *numpy = PyImport_ImportModule("numpy.core._multiarray_umath");
+  PyObject *c_api = NULL;
+
+  if (numpy == NULL) {
+      PyErr_SetString(PyExc_ImportError,
+                      "numpy.core._multiarray_umath failed to import");
+      return -1;
+  }
+  c_api = PyObject_GetAttrString(numpy, "_UFUNC_API");
+  Py_DECREF(numpy);
+  if (c_api == NULL) {
+      PyErr_SetString(PyExc_AttributeError, "_UFUNC_API not found");
+      return -1;
+  }
+
+  if (!PyCapsule_CheckExact(c_api)) {
+      PyErr_SetString(PyExc_RuntimeError, "_UFUNC_API is not PyCapsule object");
+      Py_DECREF(c_api);
+      return -1;
+  }
+  PyUFunc_API = (void **)PyCapsule_GetPointer(c_api, NULL);
+  Py_DECREF(c_api);
+  if (PyUFunc_API == NULL) {
+      PyErr_SetString(PyExc_RuntimeError, "_UFUNC_API is NULL pointer");
+      return -1;
+  }
+  return 0;
+}
+
+#define import_umath() \
+    do {\
+        UFUNC_NOFPE\
+        if (_import_umath() < 0) {\
+            PyErr_Print();\
+            PyErr_SetString(PyExc_ImportError,\
+                    "numpy.core.umath failed to import");\
+            return NULL;\
+        }\
+    } while(0)
+
+#define import_umath1(ret) \
+    do {\
+        UFUNC_NOFPE\
+        if (_import_umath() < 0) {\
+            PyErr_Print();\
+            PyErr_SetString(PyExc_ImportError,\
+                    "numpy.core.umath failed to import");\
+            return ret;\
+        }\
+    } while(0)
+
+#define import_umath2(ret, msg) \
+    do {\
+        UFUNC_NOFPE\
+        if (_import_umath() < 0) {\
+            PyErr_Print();\
+            PyErr_SetString(PyExc_ImportError, msg);\
+            return ret;\
+        }\
+    } while(0)
+
+#define import_ufunc() \
+    do {\
+        UFUNC_NOFPE\
+        if (_import_umath() < 0) {\
+            PyErr_Print();\
+            PyErr_SetString(PyExc_ImportError,\
+                    "numpy.core.umath failed to import");\
+        }\
+    } while(0)
+
+#endif

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/_dtype_api.h

@@ -0,0 +1,408 @@
+/*
+ * DType related API shared by the (experimental) public API And internal API.
+ */
+
+#ifndef NUMPY_CORE_INCLUDE_NUMPY___DTYPE_API_H_
+#define NUMPY_CORE_INCLUDE_NUMPY___DTYPE_API_H_
+
+#define __EXPERIMENTAL_DTYPE_API_VERSION 11
+
+struct PyArrayMethodObject_tag;
+
+/*
+ * Largely opaque struct for DType classes (i.e. metaclass instances).
+ * The internal definition is currently in `ndarraytypes.h` (export is a bit
+ * more complex because `PyArray_Descr` is a DTypeMeta internally but not
+ * externally).
+ */
+#if !(defined(NPY_INTERNAL_BUILD) && NPY_INTERNAL_BUILD)
+
+    typedef struct PyArray_DTypeMeta_tag {
+        PyHeapTypeObject super;
+
+        /*
+        * Most DTypes will have a singleton default instance, for the
+        * parametric legacy DTypes (bytes, string, void, datetime) this
+        * may be a pointer to the *prototype* instance?
+        */
+        PyArray_Descr *singleton;
+        /* Copy of the legacy DTypes type number, usually invalid. */
+        int type_num;
+
+        /* The type object of the scalar instances (may be NULL?) */
+        PyTypeObject *scalar_type;
+        /*
+        * DType flags to signal legacy, parametric, or
+        * abstract.  But plenty of space for additional information/flags.
+        */
+        npy_uint64 flags;
+
+        /*
+        * Use indirection in order to allow a fixed size for this struct.
+        * A stable ABI size makes creating a static DType less painful
+        * while also ensuring flexibility for all opaque API (with one
+        * indirection due the pointer lookup).
+        */
+        void *dt_slots;
+        /* Allow growing (at the moment also beyond this) */
+        void *reserved[3];
+    } PyArray_DTypeMeta;
+
+#endif  /* not internal build */
+
+/*
+ * ******************************************************
+ *         ArrayMethod API (Casting and UFuncs)
+ * ******************************************************
+ */
+/*
+ * NOTE: Expected changes:
+ *       * probably split runtime and general flags into two
+ *       * should possibly not use an enum for typedef for more stable ABI?
+ */
+typedef enum {
+    /* Flag for whether the GIL is required */
+    NPY_METH_REQUIRES_PYAPI = 1 << 0,
+    /*
+     * Some functions cannot set floating point error flags, this flag
+     * gives us the option (not requirement) to skip floating point error
+     * setup/check. No function should set error flags and ignore them
+     * since it would interfere with chaining operations (e.g. casting).
+     */
+    NPY_METH_NO_FLOATINGPOINT_ERRORS = 1 << 1,
+    /* Whether the method supports unaligned access (not runtime) */
+    NPY_METH_SUPPORTS_UNALIGNED = 1 << 2,
+    /*
+     * Used for reductions to allow reordering the operation.  At this point
+     * assume that if set, it also applies to normal operations though!
+     */
+    NPY_METH_IS_REORDERABLE = 1 << 3,
+    /*
+     * Private flag for now for *logic* functions.  The logical functions
+     * `logical_or` and `logical_and` can always cast the inputs to booleans
+     * "safely" (because that is how the cast to bool is defined).
+     * @seberg: I am not sure this is the best way to handle this, so its
+     * private for now (also it is very limited anyway).
+     * There is one "exception". NA aware dtypes cannot cast to bool
+     * (hopefully), so the `??->?` loop should error even with this flag.
+     * But a second NA fallback loop will be necessary.
+     */
+    _NPY_METH_FORCE_CAST_INPUTS = 1 << 17,
+
+    /* All flags which can change at runtime */
+    NPY_METH_RUNTIME_FLAGS = (
+            NPY_METH_REQUIRES_PYAPI |
+            NPY_METH_NO_FLOATINGPOINT_ERRORS),
+} NPY_ARRAYMETHOD_FLAGS;
+
+
+typedef struct PyArrayMethod_Context_tag {
+    /* The caller, which is typically the original ufunc.  May be NULL */
+    PyObject *caller;
+    /* The method "self".  Publically currentl an opaque object. */
+    struct PyArrayMethodObject_tag *method;
+
+    /* Operand descriptors, filled in by resolve_descriptors */
+    PyArray_Descr **descriptors;
+    /* Structure may grow (this is harmless for DType authors) */
+} PyArrayMethod_Context;
+
+
+/*
+ * The main object for creating a new ArrayMethod. We use the typical `slots`
+ * mechanism used by the Python limited API (see below for the slot defs).
+ */
+typedef struct {
+    const char *name;
+    int nin, nout;
+    NPY_CASTING casting;
+    NPY_ARRAYMETHOD_FLAGS flags;
+    PyArray_DTypeMeta **dtypes;
+    PyType_Slot *slots;
+} PyArrayMethod_Spec;
+
+
+/*
+ * ArrayMethod slots
+ * -----------------
+ *
+ * SLOTS IDs For the ArrayMethod creation, once fully public, IDs are fixed
+ * but can be deprecated and arbitrarily extended.
+ */
+#define NPY_METH_resolve_descriptors 1
+/* We may want to adapt the `get_loop` signature a bit: */
+#define _NPY_METH_get_loop 2
+#define NPY_METH_get_reduction_initial 3
+/* specific loops for constructions/default get_loop: */
+#define NPY_METH_strided_loop 4
+#define NPY_METH_contiguous_loop 5
+#define NPY_METH_unaligned_strided_loop 6
+#define NPY_METH_unaligned_contiguous_loop 7
+#define NPY_METH_contiguous_indexed_loop 8
+
+/*
+ * The resolve descriptors function, must be able to handle NULL values for
+ * all output (but not input) `given_descrs` and fill `loop_descrs`.
+ * Return -1 on error or 0 if the operation is not possible without an error
+ * set.  (This may still be in flux.)
+ * Otherwise must return the "casting safety", for normal functions, this is
+ * almost always "safe" (or even "equivalent"?).
+ *
+ * `resolve_descriptors` is optional if all output DTypes are non-parametric.
+ */
+typedef NPY_CASTING (resolve_descriptors_function)(
+        /* "method" is currently opaque (necessary e.g. to wrap Python) */
+        struct PyArrayMethodObject_tag *method,
+        /* DTypes the method was created for */
+        PyArray_DTypeMeta **dtypes,
+        /* Input descriptors (instances).  Outputs may be NULL. */
+        PyArray_Descr **given_descrs,
+        /* Exact loop descriptors to use, must not hold references on error */
+        PyArray_Descr **loop_descrs,
+        npy_intp *view_offset);
+
+
+typedef int (PyArrayMethod_StridedLoop)(PyArrayMethod_Context *context,
+        char *const *data, const npy_intp *dimensions, const npy_intp *strides,
+        NpyAuxData *transferdata);
+
+
+typedef int (get_loop_function)(
+        PyArrayMethod_Context *context,
+        int aligned, int move_references,
+        const npy_intp *strides,
+        PyArrayMethod_StridedLoop **out_loop,
+        NpyAuxData **out_transferdata,
+        NPY_ARRAYMETHOD_FLAGS *flags);
+
+/**
+ * Query an ArrayMethod for the initial value for use in reduction.
+ *
+ * @param context The arraymethod context, mainly to access the descriptors.
+ * @param reduction_is_empty Whether the reduction is empty. When it is, the
+ *     value returned may differ.  In this case it is a "default" value that
+ *     may differ from the "identity" value normally used.  For example:
+ *     - `0.0` is the default for `sum([])`.  But `-0.0` is the correct
+ *       identity otherwise as it preserves the sign for `sum([-0.0])`.
+ *     - We use no identity for object, but return the default of `0` and `1`
+ *       for the empty `sum([], dtype=object)` and `prod([], dtype=object)`.
+ *       This allows `np.sum(np.array(["a", "b"], dtype=object))` to work.
+ *     - `-inf` or `INT_MIN` for `max` is an identity, but at least `INT_MIN`
+ *       not a good *default* when there are no items.
+ * @param initial Pointer to initial data to be filled (if possible)
+ *
+ * @returns -1, 0, or 1 indicating error, no initial value, and initial being
+ *     successfully filled.  Errors must not be given where 0 is correct, NumPy
+ *     may call this even when not strictly necessary.
+ */
+typedef int (get_reduction_initial_function)(
+        PyArrayMethod_Context *context, npy_bool reduction_is_empty,
+        char *initial);
+
+/*
+ * The following functions are only used by the wrapping array method defined
+ * in umath/wrapping_array_method.c
+ */
+
+/*
+ * The function to convert the given descriptors (passed in to
+ * `resolve_descriptors`) and translates them for the wrapped loop.
+ * The new descriptors MUST be viewable with the old ones, `NULL` must be
+ * supported (for outputs) and should normally be forwarded.
+ *
+ * The function must clean up on error.
+ *
+ * NOTE: We currently assume that this translation gives "viewable" results.
+ *       I.e. there is no additional casting related to the wrapping process.
+ *       In principle that could be supported, but not sure it is useful.
+ *       This currently also means that e.g. alignment must apply identically
+ *       to the new dtypes.
+ *
+ * TODO: Due to the fact that `resolve_descriptors` is also used for `can_cast`
+ *       there is no way to "pass out" the result of this function.  This means
+ *       it will be called twice for every ufunc call.
+ *       (I am considering including `auxdata` as an "optional" parameter to
+ *       `resolve_descriptors`, so that it can be filled there if not NULL.)
+ */
+typedef int translate_given_descrs_func(int nin, int nout,
+        PyArray_DTypeMeta *wrapped_dtypes[],
+        PyArray_Descr *given_descrs[], PyArray_Descr *new_descrs[]);
+
+/**
+ * The function to convert the actual loop descriptors (as returned by the
+ * original `resolve_descriptors` function) to the ones the output array
+ * should use.
+ * This function must return "viewable" types, it must not mutate them in any
+ * form that would break the inner-loop logic.  Does not need to support NULL.
+ *
+ * The function must clean up on error.
+ *
+ * @param nargs Number of arguments
+ * @param new_dtypes The DTypes of the output (usually probably not needed)
+ * @param given_descrs Original given_descrs to the resolver, necessary to
+ *        fetch any information related to the new dtypes from the original.
+ * @param original_descrs The `loop_descrs` returned by the wrapped loop.
+ * @param loop_descrs The output descriptors, compatible to `original_descrs`.
+ *
+ * @returns 0 on success, -1 on failure.
+ */
+typedef int translate_loop_descrs_func(int nin, int nout,
+        PyArray_DTypeMeta *new_dtypes[], PyArray_Descr *given_descrs[],
+        PyArray_Descr *original_descrs[], PyArray_Descr *loop_descrs[]);
+
+
+/*
+ * A traverse loop working on a single array. This is similar to the general
+ * strided-loop function. This is designed for loops that need to visit every
+ * element of a single array.
+ *
+ * Currently this is used for array clearing, via the NPY_DT_get_clear_loop
+ * API hook, and zero-filling, via the NPY_DT_get_fill_zero_loop API hook.
+ * These are most useful for handling arrays storing embedded references to
+ * python objects or heap-allocated data.
+ *
+ * The `void *traverse_context` is passed in because we may need to pass in
+ * Intepreter state or similar in the future, but we don't want to pass in
+ * a full context (with pointers to dtypes, method, caller which all make
+ * no sense for a traverse function).
+ *
+ * We assume for now that this context can be just passed through in the
+ * the future (for structured dtypes).
+ *
+ */
+typedef int (traverse_loop_function)(
+        void *traverse_context, PyArray_Descr *descr, char *data,
+        npy_intp size, npy_intp stride, NpyAuxData *auxdata);
+
+
+/*
+ * Simplified get_loop function specific to dtype traversal
+ *
+ * It should set the flags needed for the traversal loop and set out_loop to the
+ * loop function, which must be a valid traverse_loop_function
+ * pointer. Currently this is used for zero-filling and clearing arrays storing
+ * embedded references.
+ *
+ */
+typedef int (get_traverse_loop_function)(
+        void *traverse_context, PyArray_Descr *descr,
+        int aligned, npy_intp fixed_stride,
+        traverse_loop_function **out_loop, NpyAuxData **out_auxdata,
+        NPY_ARRAYMETHOD_FLAGS *flags);
+
+
+/*
+ * ****************************
+ *          DTYPE API
+ * ****************************
+ */
+
+#define NPY_DT_ABSTRACT 1 << 1
+#define NPY_DT_PARAMETRIC 1 << 2
+#define NPY_DT_NUMERIC 1 << 3
+
+/*
+ * These correspond to slots in the NPY_DType_Slots struct and must
+ * be in the same order as the members of that struct. If new slots
+ * get added or old slots get removed NPY_NUM_DTYPE_SLOTS must also
+ * be updated
+ */
+
+#define NPY_DT_discover_descr_from_pyobject 1
+// this slot is considered private because its API hasn't beed decided
+#define _NPY_DT_is_known_scalar_type 2
+#define NPY_DT_default_descr 3
+#define NPY_DT_common_dtype 4
+#define NPY_DT_common_instance 5
+#define NPY_DT_ensure_canonical 6
+#define NPY_DT_setitem 7
+#define NPY_DT_getitem 8
+#define NPY_DT_get_clear_loop 9
+#define NPY_DT_get_fill_zero_loop 10
+
+// These PyArray_ArrFunc slots will be deprecated and replaced eventually
+// getitem and setitem can be defined as a performance optimization;
+// by default the user dtypes call `legacy_getitem_using_DType` and
+// `legacy_setitem_using_DType`, respectively. This functionality is
+// only supported for basic NumPy DTypes.
+
+
+// used to separate dtype slots from arrfuncs slots
+// intended only for internal use but defined here for clarity
+#define _NPY_DT_ARRFUNCS_OFFSET (1 << 10)
+
+// Cast is disabled
+// #define NPY_DT_PyArray_ArrFuncs_cast 0 + _NPY_DT_ARRFUNCS_OFFSET
+
+#define NPY_DT_PyArray_ArrFuncs_getitem 1 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_setitem 2 + _NPY_DT_ARRFUNCS_OFFSET
+
+#define NPY_DT_PyArray_ArrFuncs_copyswapn 3 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_copyswap 4 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_compare 5 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_argmax 6 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_dotfunc 7 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_scanfunc 8 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_fromstr 9 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_nonzero 10 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_fill 11 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_fillwithscalar 12 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_sort 13 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_argsort 14 + _NPY_DT_ARRFUNCS_OFFSET
+
+// Casting related slots are disabled. See
+// https://github.com/numpy/numpy/pull/23173#discussion_r1101098163
+// #define NPY_DT_PyArray_ArrFuncs_castdict 15 + _NPY_DT_ARRFUNCS_OFFSET
+// #define NPY_DT_PyArray_ArrFuncs_scalarkind 16 + _NPY_DT_ARRFUNCS_OFFSET
+// #define NPY_DT_PyArray_ArrFuncs_cancastscalarkindto 17 + _NPY_DT_ARRFUNCS_OFFSET
+// #define NPY_DT_PyArray_ArrFuncs_cancastto 18 + _NPY_DT_ARRFUNCS_OFFSET
+
+// These are deprecated in NumPy 1.19, so are disabled here.
+// #define NPY_DT_PyArray_ArrFuncs_fastclip 19 + _NPY_DT_ARRFUNCS_OFFSET
+// #define NPY_DT_PyArray_ArrFuncs_fastputmask 20 + _NPY_DT_ARRFUNCS_OFFSET
+// #define NPY_DT_PyArray_ArrFuncs_fasttake 21 + _NPY_DT_ARRFUNCS_OFFSET
+#define NPY_DT_PyArray_ArrFuncs_argmin 22 + _NPY_DT_ARRFUNCS_OFFSET
+
+// TODO: These slots probably still need some thought, and/or a way to "grow"?
+typedef struct {
+    PyTypeObject *typeobj;    /* type of python scalar or NULL */
+    int flags;                /* flags, including parametric and abstract */
+    /* NULL terminated cast definitions. Use NULL for the newly created DType */
+    PyArrayMethod_Spec **casts;
+    PyType_Slot *slots;
+    /* Baseclass or NULL (will always subclass `np.dtype`) */
+    PyTypeObject *baseclass;
+} PyArrayDTypeMeta_Spec;
+
+
+typedef PyArray_Descr *(discover_descr_from_pyobject_function)(
+        PyArray_DTypeMeta *cls, PyObject *obj);
+
+/*
+ * Before making this public, we should decide whether it should pass
+ * the type, or allow looking at the object. A possible use-case:
+ * `np.array(np.array([0]), dtype=np.ndarray)`
+ * Could consider arrays that are not `dtype=ndarray` "scalars".
+ */
+typedef int (is_known_scalar_type_function)(
+        PyArray_DTypeMeta *cls, PyTypeObject *obj);
+
+typedef PyArray_Descr *(default_descr_function)(PyArray_DTypeMeta *cls);
+typedef PyArray_DTypeMeta *(common_dtype_function)(
+        PyArray_DTypeMeta *dtype1, PyArray_DTypeMeta *dtype2);
+typedef PyArray_Descr *(common_instance_function)(
+        PyArray_Descr *dtype1, PyArray_Descr *dtype2);
+typedef PyArray_Descr *(ensure_canonical_function)(PyArray_Descr *dtype);
+
+/*
+ * TODO: These two functions are currently only used for experimental DType
+ *       API support.  Their relation should be "reversed": NumPy should
+ *       always use them internally.
+ *       There are open points about "casting safety" though, e.g. setting
+ *       elements is currently always unsafe.
+ */
+typedef int(setitemfunction)(PyArray_Descr *, PyObject *, char *);
+typedef PyObject *(getitemfunction)(PyArray_Descr *, char *);
+
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY___DTYPE_API_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/_neighborhood_iterator_imp.h

@@ -0,0 +1,90 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY__NEIGHBORHOOD_IMP_H_
+#error You should not include this header directly
+#endif
+/*
+ * Private API (here for inline)
+ */
+static inline int
+_PyArrayNeighborhoodIter_IncrCoord(PyArrayNeighborhoodIterObject* iter);
+
+/*
+ * Update to next item of the iterator
+ *
+ * Note: this simply increment the coordinates vector, last dimension
+ * incremented first , i.e, for dimension 3
+ * ...
+ * -1, -1, -1
+ * -1, -1,  0
+ * -1, -1,  1
+ *  ....
+ * -1,  0, -1
+ * -1,  0,  0
+ *  ....
+ * 0,  -1, -1
+ * 0,  -1,  0
+ *  ....
+ */
+#define _UPDATE_COORD_ITER(c) \
+    wb = iter->coordinates[c] < iter->bounds[c][1]; \
+    if (wb) { \
+        iter->coordinates[c] += 1; \
+        return 0; \
+    } \
+    else { \
+        iter->coordinates[c] = iter->bounds[c][0]; \
+    }
+
+static inline int
+_PyArrayNeighborhoodIter_IncrCoord(PyArrayNeighborhoodIterObject* iter)
+{
+    npy_intp i, wb;
+
+    for (i = iter->nd - 1; i >= 0; --i) {
+        _UPDATE_COORD_ITER(i)
+    }
+
+    return 0;
+}
+
+/*
+ * Version optimized for 2d arrays, manual loop unrolling
+ */
+static inline int
+_PyArrayNeighborhoodIter_IncrCoord2D(PyArrayNeighborhoodIterObject* iter)
+{
+    npy_intp wb;
+
+    _UPDATE_COORD_ITER(1)
+    _UPDATE_COORD_ITER(0)
+
+    return 0;
+}
+#undef _UPDATE_COORD_ITER
+
+/*
+ * Advance to the next neighbour
+ */
+static inline int
+PyArrayNeighborhoodIter_Next(PyArrayNeighborhoodIterObject* iter)
+{
+    _PyArrayNeighborhoodIter_IncrCoord (iter);
+    iter->dataptr = iter->translate((PyArrayIterObject*)iter, iter->coordinates);
+
+    return 0;
+}
+
+/*
+ * Reset functions
+ */
+static inline int
+PyArrayNeighborhoodIter_Reset(PyArrayNeighborhoodIterObject* iter)
+{
+    npy_intp i;
+
+    for (i = 0; i < iter->nd; ++i) {
+        iter->coordinates[i] = iter->bounds[i][0];
+    }
+    iter->dataptr = iter->translate((PyArrayIterObject*)iter, iter->coordinates);
+
+    return 0;
+}

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/_numpyconfig.h

@@ -0,0 +1,32 @@
+#define NPY_HAVE_ENDIAN_H 1
+
+#define NPY_SIZEOF_SHORT 2
+#define NPY_SIZEOF_INT 4
+#define NPY_SIZEOF_LONG 8
+#define NPY_SIZEOF_FLOAT 4
+#define NPY_SIZEOF_COMPLEX_FLOAT 8
+#define NPY_SIZEOF_DOUBLE 8
+#define NPY_SIZEOF_COMPLEX_DOUBLE 16
+#define NPY_SIZEOF_LONGDOUBLE 16
+#define NPY_SIZEOF_COMPLEX_LONGDOUBLE 32
+#define NPY_SIZEOF_PY_INTPTR_T 8
+#define NPY_SIZEOF_OFF_T 8
+#define NPY_SIZEOF_PY_LONG_LONG 8
+#define NPY_SIZEOF_LONGLONG 8
+
+#define NPY_USE_C99_COMPLEX 1
+#define NPY_HAVE_COMPLEX_DOUBLE 1
+#define NPY_HAVE_COMPLEX_FLOAT 1
+#define NPY_HAVE_COMPLEX_LONG_DOUBLE 1
+#define NPY_USE_C99_FORMATS 1
+
+/* #undef NPY_NO_SIGNAL */
+#define NPY_NO_SMP 0
+
+#define NPY_VISIBILITY_HIDDEN __attribute__((visibility("hidden")))
+#define NPY_ABI_VERSION 0x01000009
+#define NPY_API_VERSION 0x00000011
+
+#ifndef __STDC_FORMAT_MACROS
+#define __STDC_FORMAT_MACROS 1
+#endif

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/arrayobject.h

@@ -0,0 +1,12 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_ARRAYOBJECT_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_ARRAYOBJECT_H_
+#define Py_ARRAYOBJECT_H
+
+#include "ndarrayobject.h"
+#include "npy_interrupt.h"
+
+#ifdef NPY_NO_PREFIX
+#include "noprefix.h"
+#endif
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_ARRAYOBJECT_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/arrayscalars.h

@@ -0,0 +1,186 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_ARRAYSCALARS_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_ARRAYSCALARS_H_
+
+#ifndef _MULTIARRAYMODULE
+typedef struct {
+        PyObject_HEAD
+        npy_bool obval;
+} PyBoolScalarObject;
+#endif
+
+
+typedef struct {
+        PyObject_HEAD
+        signed char obval;
+} PyByteScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        short obval;
+} PyShortScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        int obval;
+} PyIntScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        long obval;
+} PyLongScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_longlong obval;
+} PyLongLongScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        unsigned char obval;
+} PyUByteScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        unsigned short obval;
+} PyUShortScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        unsigned int obval;
+} PyUIntScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        unsigned long obval;
+} PyULongScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_ulonglong obval;
+} PyULongLongScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_half obval;
+} PyHalfScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        float obval;
+} PyFloatScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        double obval;
+} PyDoubleScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_longdouble obval;
+} PyLongDoubleScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_cfloat obval;
+} PyCFloatScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_cdouble obval;
+} PyCDoubleScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        npy_clongdouble obval;
+} PyCLongDoubleScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        PyObject * obval;
+} PyObjectScalarObject;
+
+typedef struct {
+        PyObject_HEAD
+        npy_datetime obval;
+        PyArray_DatetimeMetaData obmeta;
+} PyDatetimeScalarObject;
+
+typedef struct {
+        PyObject_HEAD
+        npy_timedelta obval;
+        PyArray_DatetimeMetaData obmeta;
+} PyTimedeltaScalarObject;
+
+
+typedef struct {
+        PyObject_HEAD
+        char obval;
+} PyScalarObject;
+
+#define PyStringScalarObject PyBytesObject
+typedef struct {
+        /* note that the PyObject_HEAD macro lives right here */
+        PyUnicodeObject base;
+        Py_UCS4 *obval;
+    #if NPY_FEATURE_VERSION >= NPY_1_20_API_VERSION
+        char *buffer_fmt;
+    #endif
+} PyUnicodeScalarObject;
+
+
+typedef struct {
+        PyObject_VAR_HEAD
+        char *obval;
+        PyArray_Descr *descr;
+        int flags;
+        PyObject *base;
+    #if NPY_FEATURE_VERSION >= NPY_1_20_API_VERSION
+        void *_buffer_info;  /* private buffer info, tagged to allow warning */
+    #endif
+} PyVoidScalarObject;
+
+/* Macros
+     Py<Cls><bitsize>ScalarObject
+     Py<Cls><bitsize>ArrType_Type
+   are defined in ndarrayobject.h
+*/
+
+#define PyArrayScalar_False ((PyObject *)(&(_PyArrayScalar_BoolValues[0])))
+#define PyArrayScalar_True ((PyObject *)(&(_PyArrayScalar_BoolValues[1])))
+#define PyArrayScalar_FromLong(i) \
+        ((PyObject *)(&(_PyArrayScalar_BoolValues[((i)!=0)])))
+#define PyArrayScalar_RETURN_BOOL_FROM_LONG(i)                  \
+        return Py_INCREF(PyArrayScalar_FromLong(i)), \
+                PyArrayScalar_FromLong(i)
+#define PyArrayScalar_RETURN_FALSE              \
+        return Py_INCREF(PyArrayScalar_False),  \
+                PyArrayScalar_False
+#define PyArrayScalar_RETURN_TRUE               \
+        return Py_INCREF(PyArrayScalar_True),   \
+                PyArrayScalar_True
+
+#define PyArrayScalar_New(cls) \
+        Py##cls##ArrType_Type.tp_alloc(&Py##cls##ArrType_Type, 0)
+#define PyArrayScalar_VAL(obj, cls)             \
+        ((Py##cls##ScalarObject *)obj)->obval
+#define PyArrayScalar_ASSIGN(obj, cls, val) \
+        PyArrayScalar_VAL(obj, cls) = val
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_ARRAYSCALARS_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/experimental_dtype_api.h

@@ -0,0 +1,365 @@
+/*
+ * This header exports the new experimental DType API as proposed in
+ * NEPs 41 to 43.  For background, please check these NEPs.  Otherwise,
+ * this header also serves as documentation for the time being.
+ *
+ * The header includes `_dtype_api.h` which holds most definition while this
+ * header mainly wraps functions for public consumption.
+ *
+ * Please do not hesitate to contact @seberg with questions.  This is
+ * developed together with https://github.com/seberg/experimental_user_dtypes
+ * and those interested in experimenting are encouraged to contribute there.
+ *
+ * To use the functions defined in the header, call::
+ *
+ *     if (import_experimental_dtype_api(version) < 0) {
+ *         return NULL;
+ *     }
+ *
+ * in your module init.  (A version mismatch will be reported, just update
+ * to the correct one, this will alert you of possible changes.)
+ *
+ * The following lists the main symbols currently exported.  Please do not
+ * hesitate to ask for help or clarification:
+ *
+ * - PyUFunc_AddLoopFromSpec:
+ *
+ *     Register a new loop for a ufunc.  This uses the `PyArrayMethod_Spec`
+ *     which must be filled in (see in-line comments).
+ *
+ * - PyUFunc_AddWrappingLoop:
+ *
+ *     Register a new loop which reuses an existing one, but modifies the
+ *     result dtypes.  Please search the internal NumPy docs for more info
+ *     at this point.  (Used for physical units dtype.)
+ *
+ * - PyUFunc_AddPromoter:
+ *
+ *     Register a new promoter for a ufunc.  A promoter is a function stored
+ *     in a PyCapsule (see in-line comments).  It is passed the operation and
+ *     requested DType signatures and can mutate it to attempt a new search
+ *     for a matching loop/promoter.
+ *     I.e. for Numba a promoter could even add the desired loop.
+ *
+ * - PyArrayInitDTypeMeta_FromSpec:
+ *
+ *     Initialize a new DType.  It must currently be a static Python C type
+ *     that is declared as `PyArray_DTypeMeta` and not `PyTypeObject`.
+ *     Further, it must subclass `np.dtype` and set its type to
+ *     `PyArrayDTypeMeta_Type` (before calling `PyType_Read()`).
+ *
+ * - PyArray_CommonDType:
+ *
+ *     Find the common-dtype ("promotion") for two DType classes.  Similar
+ *     to `np.result_type`, but works on the classes and not instances.
+ *
+ * - PyArray_PromoteDTypeSequence:
+ *
+ *     Same as CommonDType, but works with an arbitrary number of DTypes.
+ *     This function is smarter and can often return successful and unambiguous
+ *     results when `common_dtype(common_dtype(dt1, dt2), dt3)` would
+ *     depend on the operation order or fail.  Nevertheless, DTypes should
+ *     aim to ensure that their common-dtype implementation is associative
+ *     and commutative!  (Mainly, unsigned and signed integers are not.)
+ *
+ *     For guaranteed consistent results DTypes must implement common-Dtype
+ *     "transitively".  If A promotes B and B promotes C, than A must generally
+ *     also promote C; where "promotes" means implements the promotion.
+ *     (There are some exceptions for abstract DTypes)
+ *
+ * - PyArray_GetDefaultDescr:
+ *
+ *     Given a DType class, returns the default instance (descriptor).
+ *     This is an inline function checking for `singleton` first and only
+ *     calls the `default_descr` function if necessary.
+ *
+ * - PyArray_DoubleDType, etc.:
+ *
+ *     Aliases to the DType classes for the builtin NumPy DTypes.
+ *
+ * WARNING
+ * =======
+ *
+ * By using this header, you understand that this is a fully experimental
+ * exposure.  Details are expected to change, and some options may have no
+ * effect.  (Please contact @seberg if you have questions!)
+ * If the exposure stops working, please file a bug report with NumPy.
+ * Further, a DType created using this API/header should still be expected
+ * to be incompatible with some functionality inside and outside of NumPy.
+ * In this case crashes must be expected.  Please report any such problems
+ * so that they can be fixed before final exposure.
+ * Furthermore, expect missing checks for programming errors which the final
+ * API is expected to have.
+ *
+ * Symbols with a leading underscore are likely to not be included in the
+ * first public version, if these are central to your use-case, please let
+ * us know, so that we can reconsider.
+ *
+ * "Array-like" consumer API not yet under considerations
+ * ======================================================
+ *
+ * The new DType API is designed in a way to make it potentially useful for
+ * alternative "array-like" implementations.  This will require careful
+ * exposure of details and functions and is not part of this experimental API.
+ *
+ * Brief (incompatibility) changelog
+ * =================================
+ *
+ * 2. None (only additions).
+ * 3. New `npy_intp *view_offset` argument for `resolve_descriptors`.
+ *    This replaces the `NPY_CAST_IS_VIEW` flag.  It can be set to 0 if the
+ *    operation is a view, and is pre-initialized to `NPY_MIN_INTP` indicating
+ *    that the operation is not a view.
+ */
+
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_EXPERIMENTAL_DTYPE_API_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_EXPERIMENTAL_DTYPE_API_H_
+
+#include <Python.h>
+#include "ndarraytypes.h"
+#include "_dtype_api.h"
+
+/*
+ * The contents of PyArrayMethodObject are currently opaque (is there a way
+ * good way to make them be `PyObject *`?)
+ */
+typedef struct PyArrayMethodObject_tag PyArrayMethodObject;
+
+/*
+ * There must be a better way?! -- Oh well, this is experimental
+ * (my issue with it, is that I cannot undef those helpers).
+ */
+#if defined(PY_ARRAY_UNIQUE_SYMBOL)
+    #define NPY_EXP_DTYPE_API_CONCAT_HELPER2(x, y) x ## y
+    #define NPY_EXP_DTYPE_API_CONCAT_HELPER(arg) NPY_EXP_DTYPE_API_CONCAT_HELPER2(arg, __experimental_dtype_api_table)
+    #define __experimental_dtype_api_table NPY_EXP_DTYPE_API_CONCAT_HELPER(PY_ARRAY_UNIQUE_SYMBOL)
+#else
+    #define __experimental_dtype_api_table __experimental_dtype_api_table
+#endif
+
+/* Support for correct multi-file projects: */
+#if defined(NO_IMPORT) || defined(NO_IMPORT_ARRAY)
+    extern void **__experimental_dtype_api_table;
+#else
+    /*
+     * Just a hack so I don't forget importing as much myself, I spend way too
+     * much time noticing it the first time around :).
+     */
+    static void
+    __not_imported(void)
+    {
+        printf("*****\nCritical error, dtype API not imported\n*****\n");
+    }
+
+    static void *__uninitialized_table[] = {
+            &__not_imported, &__not_imported, &__not_imported, &__not_imported,
+            &__not_imported, &__not_imported, &__not_imported, &__not_imported};
+
+    #if defined(PY_ARRAY_UNIQUE_SYMBOL)
+        void **__experimental_dtype_api_table = __uninitialized_table;
+    #else
+        static void **__experimental_dtype_api_table = __uninitialized_table;
+    #endif
+#endif
+
+
+typedef int _ufunc_addloop_fromspec_func(
+        PyObject *ufunc, PyArrayMethod_Spec *spec);
+/*
+ * The main ufunc registration function.  This adds a new implementation/loop
+ * to a ufunc.  It replaces `PyUFunc_RegisterLoopForType`.
+ */
+#define PyUFunc_AddLoopFromSpec \
+    (*(_ufunc_addloop_fromspec_func *)(__experimental_dtype_api_table[0]))
+
+
+/* Please see the NumPy definitions in `array_method.h` for details on these */
+typedef int translate_given_descrs_func(int nin, int nout,
+        PyArray_DTypeMeta *wrapped_dtypes[],
+        PyArray_Descr *given_descrs[], PyArray_Descr *new_descrs[]);
+typedef int translate_loop_descrs_func(int nin, int nout,
+        PyArray_DTypeMeta *new_dtypes[], PyArray_Descr *given_descrs[],
+        PyArray_Descr *original_descrs[], PyArray_Descr *loop_descrs[]);
+
+typedef int _ufunc_wrapping_loop_func(PyObject *ufunc_obj,
+        PyArray_DTypeMeta *new_dtypes[], PyArray_DTypeMeta *wrapped_dtypes[],
+        translate_given_descrs_func *translate_given_descrs,
+        translate_loop_descrs_func *translate_loop_descrs);
+#define PyUFunc_AddWrappingLoop \
+    (*(_ufunc_wrapping_loop_func *)(__experimental_dtype_api_table[7]))
+
+/*
+ * Type of the C promoter function, which must be wrapped into a
+ * PyCapsule with name "numpy._ufunc_promoter".
+ *
+ * Note that currently the output dtypes are always NULL unless they are
+ * also part of the signature.  This is an implementation detail and could
+ * change in the future.  However, in general promoters should not have a
+ * need for output dtypes.
+ * (There are potential use-cases, these are currently unsupported.)
+ */
+typedef int promoter_function(PyObject *ufunc,
+        PyArray_DTypeMeta *op_dtypes[], PyArray_DTypeMeta *signature[],
+        PyArray_DTypeMeta *new_op_dtypes[]);
+
+/*
+ * Function to register a promoter.
+ *
+ * @param ufunc The ufunc object to register the promoter with.
+ * @param DType_tuple A Python tuple containing DTypes or None matching the
+ *        number of inputs and outputs of the ufunc.
+ * @param promoter A PyCapsule with name "numpy._ufunc_promoter" containing
+ *        a pointer to a `promoter_function`.
+ */
+typedef int _ufunc_addpromoter_func(
+        PyObject *ufunc, PyObject *DType_tuple, PyObject *promoter);
+#define PyUFunc_AddPromoter \
+    (*(_ufunc_addpromoter_func *)(__experimental_dtype_api_table[1]))
+
+#define PyArrayDTypeMeta_Type \
+    (*(PyTypeObject *)__experimental_dtype_api_table[2])
+typedef int __dtypemeta_fromspec(
+        PyArray_DTypeMeta *DType, PyArrayDTypeMeta_Spec *dtype_spec);
+/*
+ * Finalize creation of a DTypeMeta.  You must ensure that the DTypeMeta is
+ * a proper subclass.  The DTypeMeta object has additional fields compared to
+ * a normal PyTypeObject!
+ * The only (easy) creation of a new DType is to create a static Type which
+ * inherits `PyArray_DescrType`, sets its type to `PyArrayDTypeMeta_Type` and
+ * uses `PyArray_DTypeMeta` defined above as the C-structure.
+ */
+#define PyArrayInitDTypeMeta_FromSpec \
+    ((__dtypemeta_fromspec *)(__experimental_dtype_api_table[3]))
+
+
+/*
+ * *************************************
+ *          WORKING WITH DTYPES
+ * *************************************
+ */
+
+typedef PyArray_DTypeMeta *__common_dtype(
+        PyArray_DTypeMeta *DType1, PyArray_DTypeMeta *DType2);
+#define PyArray_CommonDType \
+    ((__common_dtype *)(__experimental_dtype_api_table[4]))
+
+
+typedef PyArray_DTypeMeta *__promote_dtype_sequence(
+        npy_intp num, PyArray_DTypeMeta *DTypes[]);
+#define PyArray_PromoteDTypeSequence \
+    ((__promote_dtype_sequence *)(__experimental_dtype_api_table[5]))
+
+
+typedef PyArray_Descr *__get_default_descr(
+        PyArray_DTypeMeta *DType);
+#define _PyArray_GetDefaultDescr \
+    ((__get_default_descr *)(__experimental_dtype_api_table[6]))
+
+static inline PyArray_Descr *
+PyArray_GetDefaultDescr(PyArray_DTypeMeta *DType)
+{
+    if (DType->singleton != NULL) {
+        Py_INCREF(DType->singleton);
+        return DType->singleton;
+    }
+    return _PyArray_GetDefaultDescr(DType);
+}
+
+
+/*
+ * NumPy's builtin DTypes:
+ */
+#define PyArray_BoolDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[10])
+/* Integers */
+#define PyArray_ByteDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[11])
+#define PyArray_UByteDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[12])
+#define PyArray_ShortDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[13])
+#define PyArray_UShortDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[14])
+#define PyArray_IntDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[15])
+#define PyArray_UIntDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[16])
+#define PyArray_LongDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[17])
+#define PyArray_ULongDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[18])
+#define PyArray_LongLongDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[19])
+#define PyArray_ULongLongDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[20])
+/* Integer aliases */
+#define PyArray_Int8Type (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[21])
+#define PyArray_UInt8DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[22])
+#define PyArray_Int16DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[23])
+#define PyArray_UInt16DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[24])
+#define PyArray_Int32DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[25])
+#define PyArray_UInt32DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[26])
+#define PyArray_Int64DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[27])
+#define PyArray_UInt64DType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[28])
+#define PyArray_IntpDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[29])
+#define PyArray_UIntpDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[30])
+/* Floats */
+#define PyArray_HalfType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[31])
+#define PyArray_FloatDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[32])
+#define PyArray_DoubleDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[33])
+#define PyArray_LongDoubleDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[34])
+/* Complex */
+#define PyArray_CFloatDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[35])
+#define PyArray_CDoubleDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[36])
+#define PyArray_CLongDoubleDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[37])
+/* String/Bytes */
+#define PyArray_StringDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[38])
+#define PyArray_UnicodeDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[39])
+/* Datetime/Timedelta */
+#define PyArray_DatetimeDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[40])
+#define PyArray_TimedeltaDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[41])
+/* Object/Void */
+#define PyArray_ObjectDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[42])
+#define PyArray_VoidDType (*(PyArray_DTypeMeta *)__experimental_dtype_api_table[43])
+
+/*
+ * ********************************
+ *         Initialization
+ * ********************************
+ *
+ * Import the experimental API, the version must match the one defined in
+ * the header to ensure changes are taken into account. NumPy will further
+ * runtime-check this.
+ * You must call this function to use the symbols defined in this file.
+ */
+#if !defined(NO_IMPORT) && !defined(NO_IMPORT_ARRAY)
+
+static int
+import_experimental_dtype_api(int version)
+{
+    if (version != __EXPERIMENTAL_DTYPE_API_VERSION) {
+        PyErr_Format(PyExc_RuntimeError,
+                "DType API version %d did not match header version %d. Please "
+                "update the import statement and check for API changes.",
+                version, __EXPERIMENTAL_DTYPE_API_VERSION);
+        return -1;
+    }
+    if (__experimental_dtype_api_table != __uninitialized_table) {
+        /* already imported. */
+        return 0;
+    }
+
+    PyObject *multiarray = PyImport_ImportModule("numpy.core._multiarray_umath");
+    if (multiarray == NULL) {
+        return -1;
+    }
+
+    PyObject *api = PyObject_CallMethod(multiarray,
+        "_get_experimental_dtype_api", "i", version);
+    Py_DECREF(multiarray);
+    if (api == NULL) {
+        return -1;
+    }
+    __experimental_dtype_api_table = (void **)PyCapsule_GetPointer(api,
+            "experimental_dtype_api_table");
+    Py_DECREF(api);
+
+    if (__experimental_dtype_api_table == NULL) {
+        __experimental_dtype_api_table = __uninitialized_table;
+        return -1;
+    }
+    return 0;
+}
+
+#endif  /* !defined(NO_IMPORT) && !defined(NO_IMPORT_ARRAY) */
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_EXPERIMENTAL_DTYPE_API_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/halffloat.h

@@ -0,0 +1,70 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_HALFFLOAT_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_HALFFLOAT_H_
+
+#include <Python.h>
+#include <numpy/npy_math.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/*
+ * Half-precision routines
+ */
+
+/* Conversions */
+float npy_half_to_float(npy_half h);
+double npy_half_to_double(npy_half h);
+npy_half npy_float_to_half(float f);
+npy_half npy_double_to_half(double d);
+/* Comparisons */
+int npy_half_eq(npy_half h1, npy_half h2);
+int npy_half_ne(npy_half h1, npy_half h2);
+int npy_half_le(npy_half h1, npy_half h2);
+int npy_half_lt(npy_half h1, npy_half h2);
+int npy_half_ge(npy_half h1, npy_half h2);
+int npy_half_gt(npy_half h1, npy_half h2);
+/* faster *_nonan variants for when you know h1 and h2 are not NaN */
+int npy_half_eq_nonan(npy_half h1, npy_half h2);
+int npy_half_lt_nonan(npy_half h1, npy_half h2);
+int npy_half_le_nonan(npy_half h1, npy_half h2);
+/* Miscellaneous functions */
+int npy_half_iszero(npy_half h);
+int npy_half_isnan(npy_half h);
+int npy_half_isinf(npy_half h);
+int npy_half_isfinite(npy_half h);
+int npy_half_signbit(npy_half h);
+npy_half npy_half_copysign(npy_half x, npy_half y);
+npy_half npy_half_spacing(npy_half h);
+npy_half npy_half_nextafter(npy_half x, npy_half y);
+npy_half npy_half_divmod(npy_half x, npy_half y, npy_half *modulus);
+
+/*
+ * Half-precision constants
+ */
+
+#define NPY_HALF_ZERO   (0x0000u)
+#define NPY_HALF_PZERO  (0x0000u)
+#define NPY_HALF_NZERO  (0x8000u)
+#define NPY_HALF_ONE    (0x3c00u)
+#define NPY_HALF_NEGONE (0xbc00u)
+#define NPY_HALF_PINF   (0x7c00u)
+#define NPY_HALF_NINF   (0xfc00u)
+#define NPY_HALF_NAN    (0x7e00u)
+
+#define NPY_MAX_HALF    (0x7bffu)
+
+/*
+ * Bit-level conversions
+ */
+
+npy_uint16 npy_floatbits_to_halfbits(npy_uint32 f);
+npy_uint16 npy_doublebits_to_halfbits(npy_uint64 d);
+npy_uint32 npy_halfbits_to_floatbits(npy_uint16 h);
+npy_uint64 npy_halfbits_to_doublebits(npy_uint16 h);
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_HALFFLOAT_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/ndarrayobject.h

@@ -0,0 +1,251 @@
+/*
+ * DON'T INCLUDE THIS DIRECTLY.
+ */
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NDARRAYOBJECT_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NDARRAYOBJECT_H_
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include <Python.h>
+#include "ndarraytypes.h"
+
+/* Includes the "function" C-API -- these are all stored in a
+   list of pointers --- one for each file
+   The two lists are concatenated into one in multiarray.
+
+   They are available as import_array()
+*/
+
+#include "__multiarray_api.h"
+
+
+/* C-API that requires previous API to be defined */
+
+#define PyArray_DescrCheck(op) PyObject_TypeCheck(op, &PyArrayDescr_Type)
+
+#define PyArray_Check(op) PyObject_TypeCheck(op, &PyArray_Type)
+#define PyArray_CheckExact(op) (((PyObject*)(op))->ob_type == &PyArray_Type)
+
+#define PyArray_HasArrayInterfaceType(op, type, context, out)                 \
+        ((((out)=PyArray_FromStructInterface(op)) != Py_NotImplemented) ||    \
+         (((out)=PyArray_FromInterface(op)) != Py_NotImplemented) ||          \
+         (((out)=PyArray_FromArrayAttr(op, type, context)) !=                 \
+          Py_NotImplemented))
+
+#define PyArray_HasArrayInterface(op, out)                                    \
+        PyArray_HasArrayInterfaceType(op, NULL, NULL, out)
+
+#define PyArray_IsZeroDim(op) (PyArray_Check(op) && \
+                               (PyArray_NDIM((PyArrayObject *)op) == 0))
+
+#define PyArray_IsScalar(obj, cls)                                            \
+        (PyObject_TypeCheck(obj, &Py##cls##ArrType_Type))
+
+#define PyArray_CheckScalar(m) (PyArray_IsScalar(m, Generic) ||               \
+                                PyArray_IsZeroDim(m))
+#define PyArray_IsPythonNumber(obj)                                           \
+        (PyFloat_Check(obj) || PyComplex_Check(obj) ||                        \
+         PyLong_Check(obj) || PyBool_Check(obj))
+#define PyArray_IsIntegerScalar(obj) (PyLong_Check(obj)                       \
+              || PyArray_IsScalar((obj), Integer))
+#define PyArray_IsPythonScalar(obj)                                           \
+        (PyArray_IsPythonNumber(obj) || PyBytes_Check(obj) ||                 \
+         PyUnicode_Check(obj))
+
+#define PyArray_IsAnyScalar(obj)                                              \
+        (PyArray_IsScalar(obj, Generic) || PyArray_IsPythonScalar(obj))
+
+#define PyArray_CheckAnyScalar(obj) (PyArray_IsPythonScalar(obj) ||           \
+                                     PyArray_CheckScalar(obj))
+
+
+#define PyArray_GETCONTIGUOUS(m) (PyArray_ISCONTIGUOUS(m) ?                   \
+                                  Py_INCREF(m), (m) :                         \
+                                  (PyArrayObject *)(PyArray_Copy(m)))
+
+#define PyArray_SAMESHAPE(a1,a2) ((PyArray_NDIM(a1) == PyArray_NDIM(a2)) &&   \
+                                  PyArray_CompareLists(PyArray_DIMS(a1),      \
+                                                       PyArray_DIMS(a2),      \
+                                                       PyArray_NDIM(a1)))
+
+#define PyArray_SIZE(m) PyArray_MultiplyList(PyArray_DIMS(m), PyArray_NDIM(m))
+#define PyArray_NBYTES(m) (PyArray_ITEMSIZE(m) * PyArray_SIZE(m))
+#define PyArray_FROM_O(m) PyArray_FromAny(m, NULL, 0, 0, 0, NULL)
+
+#define PyArray_FROM_OF(m,flags) PyArray_CheckFromAny(m, NULL, 0, 0, flags,   \
+                                                      NULL)
+
+#define PyArray_FROM_OT(m,type) PyArray_FromAny(m,                            \
+                                PyArray_DescrFromType(type), 0, 0, 0, NULL)
+
+#define PyArray_FROM_OTF(m, type, flags) \
+        PyArray_FromAny(m, PyArray_DescrFromType(type), 0, 0, \
+                        (((flags) & NPY_ARRAY_ENSURECOPY) ? \
+                         ((flags) | NPY_ARRAY_DEFAULT) : (flags)), NULL)
+
+#define PyArray_FROMANY(m, type, min, max, flags) \
+        PyArray_FromAny(m, PyArray_DescrFromType(type), min, max, \
+                        (((flags) & NPY_ARRAY_ENSURECOPY) ? \
+                         (flags) | NPY_ARRAY_DEFAULT : (flags)), NULL)
+
+#define PyArray_ZEROS(m, dims, type, is_f_order) \
+        PyArray_Zeros(m, dims, PyArray_DescrFromType(type), is_f_order)
+
+#define PyArray_EMPTY(m, dims, type, is_f_order) \
+        PyArray_Empty(m, dims, PyArray_DescrFromType(type), is_f_order)
+
+#define PyArray_FILLWBYTE(obj, val) memset(PyArray_DATA(obj), val, \
+                                           PyArray_NBYTES(obj))
+#ifndef PYPY_VERSION
+#define PyArray_REFCOUNT(obj) (((PyObject *)(obj))->ob_refcnt)
+#define NPY_REFCOUNT PyArray_REFCOUNT
+#endif
+#define NPY_MAX_ELSIZE (2 * NPY_SIZEOF_LONGDOUBLE)
+
+#define PyArray_ContiguousFromAny(op, type, min_depth, max_depth) \
+        PyArray_FromAny(op, PyArray_DescrFromType(type), min_depth, \
+                              max_depth, NPY_ARRAY_DEFAULT, NULL)
+
+#define PyArray_EquivArrTypes(a1, a2) \
+        PyArray_EquivTypes(PyArray_DESCR(a1), PyArray_DESCR(a2))
+
+#define PyArray_EquivByteorders(b1, b2) \
+        (((b1) == (b2)) || (PyArray_ISNBO(b1) == PyArray_ISNBO(b2)))
+
+#define PyArray_SimpleNew(nd, dims, typenum) \
+        PyArray_New(&PyArray_Type, nd, dims, typenum, NULL, NULL, 0, 0, NULL)
+
+#define PyArray_SimpleNewFromData(nd, dims, typenum, data) \
+        PyArray_New(&PyArray_Type, nd, dims, typenum, NULL, \
+                    data, 0, NPY_ARRAY_CARRAY, NULL)
+
+#define PyArray_SimpleNewFromDescr(nd, dims, descr) \
+        PyArray_NewFromDescr(&PyArray_Type, descr, nd, dims, \
+                             NULL, NULL, 0, NULL)
+
+#define PyArray_ToScalar(data, arr) \
+        PyArray_Scalar(data, PyArray_DESCR(arr), (PyObject *)arr)
+
+
+/* These might be faster without the dereferencing of obj
+   going on inside -- of course an optimizing compiler should
+   inline the constants inside a for loop making it a moot point
+*/
+
+#define PyArray_GETPTR1(obj, i) ((void *)(PyArray_BYTES(obj) + \
+                                         (i)*PyArray_STRIDES(obj)[0]))
+
+#define PyArray_GETPTR2(obj, i, j) ((void *)(PyArray_BYTES(obj) + \
+                                            (i)*PyArray_STRIDES(obj)[0] + \
+                                            (j)*PyArray_STRIDES(obj)[1]))
+
+#define PyArray_GETPTR3(obj, i, j, k) ((void *)(PyArray_BYTES(obj) + \
+                                            (i)*PyArray_STRIDES(obj)[0] + \
+                                            (j)*PyArray_STRIDES(obj)[1] + \
+                                            (k)*PyArray_STRIDES(obj)[2]))
+
+#define PyArray_GETPTR4(obj, i, j, k, l) ((void *)(PyArray_BYTES(obj) + \
+                                            (i)*PyArray_STRIDES(obj)[0] + \
+                                            (j)*PyArray_STRIDES(obj)[1] + \
+                                            (k)*PyArray_STRIDES(obj)[2] + \
+                                            (l)*PyArray_STRIDES(obj)[3]))
+
+static inline void
+PyArray_DiscardWritebackIfCopy(PyArrayObject *arr)
+{
+    PyArrayObject_fields *fa = (PyArrayObject_fields *)arr;
+    if (fa && fa->base) {
+        if (fa->flags & NPY_ARRAY_WRITEBACKIFCOPY) {
+            PyArray_ENABLEFLAGS((PyArrayObject*)fa->base, NPY_ARRAY_WRITEABLE);
+            Py_DECREF(fa->base);
+            fa->base = NULL;
+            PyArray_CLEARFLAGS(arr, NPY_ARRAY_WRITEBACKIFCOPY);
+        }
+    }
+}
+
+#define PyArray_DESCR_REPLACE(descr) do { \
+                PyArray_Descr *_new_; \
+                _new_ = PyArray_DescrNew(descr); \
+                Py_XDECREF(descr); \
+                descr = _new_; \
+        } while(0)
+
+/* Copy should always return contiguous array */
+#define PyArray_Copy(obj) PyArray_NewCopy(obj, NPY_CORDER)
+
+#define PyArray_FromObject(op, type, min_depth, max_depth) \
+        PyArray_FromAny(op, PyArray_DescrFromType(type), min_depth, \
+                              max_depth, NPY_ARRAY_BEHAVED | \
+                                         NPY_ARRAY_ENSUREARRAY, NULL)
+
+#define PyArray_ContiguousFromObject(op, type, min_depth, max_depth) \
+        PyArray_FromAny(op, PyArray_DescrFromType(type), min_depth, \
+                              max_depth, NPY_ARRAY_DEFAULT | \
+                                         NPY_ARRAY_ENSUREARRAY, NULL)
+
+#define PyArray_CopyFromObject(op, type, min_depth, max_depth) \
+        PyArray_FromAny(op, PyArray_DescrFromType(type), min_depth, \
+                        max_depth, NPY_ARRAY_ENSURECOPY | \
+                                   NPY_ARRAY_DEFAULT | \
+                                   NPY_ARRAY_ENSUREARRAY, NULL)
+
+#define PyArray_Cast(mp, type_num)                                            \
+        PyArray_CastToType(mp, PyArray_DescrFromType(type_num), 0)
+
+#define PyArray_Take(ap, items, axis)                                         \
+        PyArray_TakeFrom(ap, items, axis, NULL, NPY_RAISE)
+
+#define PyArray_Put(ap, items, values)                                        \
+        PyArray_PutTo(ap, items, values, NPY_RAISE)
+
+/* Compatibility with old Numeric stuff -- don't use in new code */
+
+#define PyArray_FromDimsAndData(nd, d, type, data)                            \
+        PyArray_FromDimsAndDataAndDescr(nd, d, PyArray_DescrFromType(type),   \
+                                        data)
+
+
+/*
+   Check to see if this key in the dictionary is the "title"
+   entry of the tuple (i.e. a duplicate dictionary entry in the fields
+   dict).
+*/
+
+static inline int
+NPY_TITLE_KEY_check(PyObject *key, PyObject *value)
+{
+    PyObject *title;
+    if (PyTuple_Size(value) != 3) {
+        return 0;
+    }
+    title = PyTuple_GetItem(value, 2);
+    if (key == title) {
+        return 1;
+    }
+#ifdef PYPY_VERSION
+    /*
+     * On PyPy, dictionary keys do not always preserve object identity.
+     * Fall back to comparison by value.
+     */
+    if (PyUnicode_Check(title) && PyUnicode_Check(key)) {
+        return PyUnicode_Compare(title, key) == 0 ? 1 : 0;
+    }
+#endif
+    return 0;
+}
+
+/* Macro, for backward compat with "if NPY_TITLE_KEY(key, value) { ..." */
+#define NPY_TITLE_KEY(key, value) (NPY_TITLE_KEY_check((key), (value)))
+
+#define DEPRECATE(msg) PyErr_WarnEx(PyExc_DeprecationWarning,msg,1)
+#define DEPRECATE_FUTUREWARNING(msg) PyErr_WarnEx(PyExc_FutureWarning,msg,1)
+
+#ifdef __cplusplus
+}
+#endif
+
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NDARRAYOBJECT_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/ndarraytypes.h

@@ -0,0 +1,1945 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NDARRAYTYPES_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NDARRAYTYPES_H_
+
+#include "npy_common.h"
+#include "npy_endian.h"
+#include "npy_cpu.h"
+#include "utils.h"
+
+#define NPY_NO_EXPORT NPY_VISIBILITY_HIDDEN
+
+/* Only use thread if configured in config and python supports it */
+#if defined WITH_THREAD && !NPY_NO_SMP
+        #define NPY_ALLOW_THREADS 1
+#else
+        #define NPY_ALLOW_THREADS 0
+#endif
+
+#ifndef __has_extension
+#define __has_extension(x) 0
+#endif
+
+#if !defined(_NPY_NO_DEPRECATIONS) && \
+    ((defined(__GNUC__)&& __GNUC__ >= 6) || \
+     __has_extension(attribute_deprecated_with_message))
+#define NPY_ATTR_DEPRECATE(text) __attribute__ ((deprecated (text)))
+#else
+#define NPY_ATTR_DEPRECATE(text)
+#endif
+
+/*
+ * There are several places in the code where an array of dimensions
+ * is allocated statically.  This is the size of that static
+ * allocation.
+ *
+ * The array creation itself could have arbitrary dimensions but all
+ * the places where static allocation is used would need to be changed
+ * to dynamic (including inside of several structures)
+ */
+
+#define NPY_MAXDIMS 32
+#define NPY_MAXARGS 32
+
+/* Used for Converter Functions "O&" code in ParseTuple */
+#define NPY_FAIL 0
+#define NPY_SUCCEED 1
+
+
+enum NPY_TYPES {    NPY_BOOL=0,
+                    NPY_BYTE, NPY_UBYTE,
+                    NPY_SHORT, NPY_USHORT,
+                    NPY_INT, NPY_UINT,
+                    NPY_LONG, NPY_ULONG,
+                    NPY_LONGLONG, NPY_ULONGLONG,
+                    NPY_FLOAT, NPY_DOUBLE, NPY_LONGDOUBLE,
+                    NPY_CFLOAT, NPY_CDOUBLE, NPY_CLONGDOUBLE,
+                    NPY_OBJECT=17,
+                    NPY_STRING, NPY_UNICODE,
+                    NPY_VOID,
+                    /*
+                     * New 1.6 types appended, may be integrated
+                     * into the above in 2.0.
+                     */
+                    NPY_DATETIME, NPY_TIMEDELTA, NPY_HALF,
+
+                    NPY_NTYPES,
+                    NPY_NOTYPE,
+                    NPY_CHAR NPY_ATTR_DEPRECATE("Use NPY_STRING"),
+                    NPY_USERDEF=256,  /* leave room for characters */
+
+                    /* The number of types not including the new 1.6 types */
+                    NPY_NTYPES_ABI_COMPATIBLE=21
+};
+#if defined(_MSC_VER) && !defined(__clang__)
+#pragma deprecated(NPY_CHAR)
+#endif
+
+/* basetype array priority */
+#define NPY_PRIORITY 0.0
+
+/* default subtype priority */
+#define NPY_SUBTYPE_PRIORITY 1.0
+
+/* default scalar priority */
+#define NPY_SCALAR_PRIORITY -1000000.0
+
+/* How many floating point types are there (excluding half) */
+#define NPY_NUM_FLOATTYPE 3
+
+/*
+ * These characters correspond to the array type and the struct
+ * module
+ */
+
+enum NPY_TYPECHAR {
+        NPY_BOOLLTR = '?',
+        NPY_BYTELTR = 'b',
+        NPY_UBYTELTR = 'B',
+        NPY_SHORTLTR = 'h',
+        NPY_USHORTLTR = 'H',
+        NPY_INTLTR = 'i',
+        NPY_UINTLTR = 'I',
+        NPY_LONGLTR = 'l',
+        NPY_ULONGLTR = 'L',
+        NPY_LONGLONGLTR = 'q',
+        NPY_ULONGLONGLTR = 'Q',
+        NPY_HALFLTR = 'e',
+        NPY_FLOATLTR = 'f',
+        NPY_DOUBLELTR = 'd',
+        NPY_LONGDOUBLELTR = 'g',
+        NPY_CFLOATLTR = 'F',
+        NPY_CDOUBLELTR = 'D',
+        NPY_CLONGDOUBLELTR = 'G',
+        NPY_OBJECTLTR = 'O',
+        NPY_STRINGLTR = 'S',
+        NPY_STRINGLTR2 = 'a',
+        NPY_UNICODELTR = 'U',
+        NPY_VOIDLTR = 'V',
+        NPY_DATETIMELTR = 'M',
+        NPY_TIMEDELTALTR = 'm',
+        NPY_CHARLTR = 'c',
+
+        /*
+         * No Descriptor, just a define -- this let's
+         * Python users specify an array of integers
+         * large enough to hold a pointer on the
+         * platform
+         */
+        NPY_INTPLTR = 'p',
+        NPY_UINTPLTR = 'P',
+
+        /*
+         * These are for dtype 'kinds', not dtype 'typecodes'
+         * as the above are for.
+         */
+        NPY_GENBOOLLTR ='b',
+        NPY_SIGNEDLTR = 'i',
+        NPY_UNSIGNEDLTR = 'u',
+        NPY_FLOATINGLTR = 'f',
+        NPY_COMPLEXLTR = 'c'
+};
+
+/*
+ * Changing this may break Numpy API compatibility
+ * due to changing offsets in PyArray_ArrFuncs, so be
+ * careful. Here we have reused the mergesort slot for
+ * any kind of stable sort, the actual implementation will
+ * depend on the data type.
+ */
+typedef enum {
+        NPY_QUICKSORT=0,
+        NPY_HEAPSORT=1,
+        NPY_MERGESORT=2,
+        NPY_STABLESORT=2,
+} NPY_SORTKIND;
+#define NPY_NSORTS (NPY_STABLESORT + 1)
+
+
+typedef enum {
+        NPY_INTROSELECT=0
+} NPY_SELECTKIND;
+#define NPY_NSELECTS (NPY_INTROSELECT + 1)
+
+
+typedef enum {
+        NPY_SEARCHLEFT=0,
+        NPY_SEARCHRIGHT=1
+} NPY_SEARCHSIDE;
+#define NPY_NSEARCHSIDES (NPY_SEARCHRIGHT + 1)
+
+
+typedef enum {
+        NPY_NOSCALAR=-1,
+        NPY_BOOL_SCALAR,
+        NPY_INTPOS_SCALAR,
+        NPY_INTNEG_SCALAR,
+        NPY_FLOAT_SCALAR,
+        NPY_COMPLEX_SCALAR,
+        NPY_OBJECT_SCALAR
+} NPY_SCALARKIND;
+#define NPY_NSCALARKINDS (NPY_OBJECT_SCALAR + 1)
+
+/* For specifying array memory layout or iteration order */
+typedef enum {
+        /* Fortran order if inputs are all Fortran, C otherwise */
+        NPY_ANYORDER=-1,
+        /* C order */
+        NPY_CORDER=0,
+        /* Fortran order */
+        NPY_FORTRANORDER=1,
+        /* An order as close to the inputs as possible */
+        NPY_KEEPORDER=2
+} NPY_ORDER;
+
+/* For specifying allowed casting in operations which support it */
+typedef enum {
+        _NPY_ERROR_OCCURRED_IN_CAST = -1,
+        /* Only allow identical types */
+        NPY_NO_CASTING=0,
+        /* Allow identical and byte swapped types */
+        NPY_EQUIV_CASTING=1,
+        /* Only allow safe casts */
+        NPY_SAFE_CASTING=2,
+        /* Allow safe casts or casts within the same kind */
+        NPY_SAME_KIND_CASTING=3,
+        /* Allow any casts */
+        NPY_UNSAFE_CASTING=4,
+} NPY_CASTING;
+
+typedef enum {
+        NPY_CLIP=0,
+        NPY_WRAP=1,
+        NPY_RAISE=2
+} NPY_CLIPMODE;
+
+typedef enum {
+        NPY_VALID=0,
+        NPY_SAME=1,
+        NPY_FULL=2
+} NPY_CORRELATEMODE;
+
+/* The special not-a-time (NaT) value */
+#define NPY_DATETIME_NAT NPY_MIN_INT64
+
+/*
+ * Upper bound on the length of a DATETIME ISO 8601 string
+ *   YEAR: 21 (64-bit year)
+ *   MONTH: 3
+ *   DAY: 3
+ *   HOURS: 3
+ *   MINUTES: 3
+ *   SECONDS: 3
+ *   ATTOSECONDS: 1 + 3*6
+ *   TIMEZONE: 5
+ *   NULL TERMINATOR: 1
+ */
+#define NPY_DATETIME_MAX_ISO8601_STRLEN (21 + 3*5 + 1 + 3*6 + 6 + 1)
+
+/* The FR in the unit names stands for frequency */
+typedef enum {
+        /* Force signed enum type, must be -1 for code compatibility */
+        NPY_FR_ERROR = -1,      /* error or undetermined */
+
+        /* Start of valid units */
+        NPY_FR_Y = 0,           /* Years */
+        NPY_FR_M = 1,           /* Months */
+        NPY_FR_W = 2,           /* Weeks */
+        /* Gap where 1.6 NPY_FR_B (value 3) was */
+        NPY_FR_D = 4,           /* Days */
+        NPY_FR_h = 5,           /* hours */
+        NPY_FR_m = 6,           /* minutes */
+        NPY_FR_s = 7,           /* seconds */
+        NPY_FR_ms = 8,          /* milliseconds */
+        NPY_FR_us = 9,          /* microseconds */
+        NPY_FR_ns = 10,         /* nanoseconds */
+        NPY_FR_ps = 11,         /* picoseconds */
+        NPY_FR_fs = 12,         /* femtoseconds */
+        NPY_FR_as = 13,         /* attoseconds */
+        NPY_FR_GENERIC = 14     /* unbound units, can convert to anything */
+} NPY_DATETIMEUNIT;
+
+/*
+ * NOTE: With the NPY_FR_B gap for 1.6 ABI compatibility, NPY_DATETIME_NUMUNITS
+ * is technically one more than the actual number of units.
+ */
+#define NPY_DATETIME_NUMUNITS (NPY_FR_GENERIC + 1)
+#define NPY_DATETIME_DEFAULTUNIT NPY_FR_GENERIC
+
+/*
+ * Business day conventions for mapping invalid business
+ * days to valid business days.
+ */
+typedef enum {
+    /* Go forward in time to the following business day. */
+    NPY_BUSDAY_FORWARD,
+    NPY_BUSDAY_FOLLOWING = NPY_BUSDAY_FORWARD,
+    /* Go backward in time to the preceding business day. */
+    NPY_BUSDAY_BACKWARD,
+    NPY_BUSDAY_PRECEDING = NPY_BUSDAY_BACKWARD,
+    /*
+     * Go forward in time to the following business day, unless it
+     * crosses a month boundary, in which case go backward
+     */
+    NPY_BUSDAY_MODIFIEDFOLLOWING,
+    /*
+     * Go backward in time to the preceding business day, unless it
+     * crosses a month boundary, in which case go forward.
+     */
+    NPY_BUSDAY_MODIFIEDPRECEDING,
+    /* Produce a NaT for non-business days. */
+    NPY_BUSDAY_NAT,
+    /* Raise an exception for non-business days. */
+    NPY_BUSDAY_RAISE
+} NPY_BUSDAY_ROLL;
+
+/************************************************************
+ * NumPy Auxiliary Data for inner loops, sort functions, etc.
+ ************************************************************/
+
+/*
+ * When creating an auxiliary data struct, this should always appear
+ * as the first member, like this:
+ *
+ * typedef struct {
+ *     NpyAuxData base;
+ *     double constant;
+ * } constant_multiplier_aux_data;
+ */
+typedef struct NpyAuxData_tag NpyAuxData;
+
+/* Function pointers for freeing or cloning auxiliary data */
+typedef void (NpyAuxData_FreeFunc) (NpyAuxData *);
+typedef NpyAuxData *(NpyAuxData_CloneFunc) (NpyAuxData *);
+
+struct NpyAuxData_tag {
+    NpyAuxData_FreeFunc *free;
+    NpyAuxData_CloneFunc *clone;
+    /* To allow for a bit of expansion without breaking the ABI */
+    void *reserved[2];
+};
+
+/* Macros to use for freeing and cloning auxiliary data */
+#define NPY_AUXDATA_FREE(auxdata) \
+    do { \
+        if ((auxdata) != NULL) { \
+            (auxdata)->free(auxdata); \
+        } \
+    } while(0)
+#define NPY_AUXDATA_CLONE(auxdata) \
+    ((auxdata)->clone(auxdata))
+
+#define NPY_ERR(str) fprintf(stderr, #str); fflush(stderr);
+#define NPY_ERR2(str) fprintf(stderr, str); fflush(stderr);
+
+/*
+* Macros to define how array, and dimension/strides data is
+* allocated. These should be made private
+*/
+
+#define NPY_USE_PYMEM 1
+
+
+#if NPY_USE_PYMEM == 1
+/* use the Raw versions which are safe to call with the GIL released */
+#define PyArray_malloc PyMem_RawMalloc
+#define PyArray_free PyMem_RawFree
+#define PyArray_realloc PyMem_RawRealloc
+#else
+#define PyArray_malloc malloc
+#define PyArray_free free
+#define PyArray_realloc realloc
+#endif
+
+/* Dimensions and strides */
+#define PyDimMem_NEW(size)                                         \
+    ((npy_intp *)PyArray_malloc(size*sizeof(npy_intp)))
+
+#define PyDimMem_FREE(ptr) PyArray_free(ptr)
+
+#define PyDimMem_RENEW(ptr,size)                                   \
+        ((npy_intp *)PyArray_realloc(ptr,size*sizeof(npy_intp)))
+
+/* forward declaration */
+struct _PyArray_Descr;
+
+/* These must deal with unaligned and swapped data if necessary */
+typedef PyObject * (PyArray_GetItemFunc) (void *, void *);
+typedef int (PyArray_SetItemFunc)(PyObject *, void *, void *);
+
+typedef void (PyArray_CopySwapNFunc)(void *, npy_intp, void *, npy_intp,
+                                     npy_intp, int, void *);
+
+typedef void (PyArray_CopySwapFunc)(void *, void *, int, void *);
+typedef npy_bool (PyArray_NonzeroFunc)(void *, void *);
+
+
+/*
+ * These assume aligned and notswapped data -- a buffer will be used
+ * before or contiguous data will be obtained
+ */
+
+typedef int (PyArray_CompareFunc)(const void *, const void *, void *);
+typedef int (PyArray_ArgFunc)(void*, npy_intp, npy_intp*, void *);
+
+typedef void (PyArray_DotFunc)(void *, npy_intp, void *, npy_intp, void *,
+                               npy_intp, void *);
+
+typedef void (PyArray_VectorUnaryFunc)(void *, void *, npy_intp, void *,
+                                       void *);
+
+/*
+ * XXX the ignore argument should be removed next time the API version
+ * is bumped. It used to be the separator.
+ */
+typedef int (PyArray_ScanFunc)(FILE *fp, void *dptr,
+                               char *ignore, struct _PyArray_Descr *);
+typedef int (PyArray_FromStrFunc)(char *s, void *dptr, char **endptr,
+                                  struct _PyArray_Descr *);
+
+typedef int (PyArray_FillFunc)(void *, npy_intp, void *);
+
+typedef int (PyArray_SortFunc)(void *, npy_intp, void *);
+typedef int (PyArray_ArgSortFunc)(void *, npy_intp *, npy_intp, void *);
+typedef int (PyArray_PartitionFunc)(void *, npy_intp, npy_intp,
+                                    npy_intp *, npy_intp *,
+                                    void *);
+typedef int (PyArray_ArgPartitionFunc)(void *, npy_intp *, npy_intp, npy_intp,
+                                       npy_intp *, npy_intp *,
+                                       void *);
+
+typedef int (PyArray_FillWithScalarFunc)(void *, npy_intp, void *, void *);
+
+typedef int (PyArray_ScalarKindFunc)(void *);
+
+typedef void (PyArray_FastClipFunc)(void *in, npy_intp n_in, void *min,
+                                    void *max, void *out);
+typedef void (PyArray_FastPutmaskFunc)(void *in, void *mask, npy_intp n_in,
+                                       void *values, npy_intp nv);
+typedef int  (PyArray_FastTakeFunc)(void *dest, void *src, npy_intp *indarray,
+                                       npy_intp nindarray, npy_intp n_outer,
+                                       npy_intp m_middle, npy_intp nelem,
+                                       NPY_CLIPMODE clipmode);
+
+typedef struct {
+        npy_intp *ptr;
+        int len;
+} PyArray_Dims;
+
+typedef struct {
+        /*
+         * Functions to cast to most other standard types
+         * Can have some NULL entries. The types
+         * DATETIME, TIMEDELTA, and HALF go into the castdict
+         * even though they are built-in.
+         */
+        PyArray_VectorUnaryFunc *cast[NPY_NTYPES_ABI_COMPATIBLE];
+
+        /* The next four functions *cannot* be NULL */
+
+        /*
+         * Functions to get and set items with standard Python types
+         * -- not array scalars
+         */
+        PyArray_GetItemFunc *getitem;
+        PyArray_SetItemFunc *setitem;
+
+        /*
+         * Copy and/or swap data.  Memory areas may not overlap
+         * Use memmove first if they might
+         */
+        PyArray_CopySwapNFunc *copyswapn;
+        PyArray_CopySwapFunc *copyswap;
+
+        /*
+         * Function to compare items
+         * Can be NULL
+         */
+        PyArray_CompareFunc *compare;
+
+        /*
+         * Function to select largest
+         * Can be NULL
+         */
+        PyArray_ArgFunc *argmax;
+
+        /*
+         * Function to compute dot product
+         * Can be NULL
+         */
+        PyArray_DotFunc *dotfunc;
+
+        /*
+         * Function to scan an ASCII file and
+         * place a single value plus possible separator
+         * Can be NULL
+         */
+        PyArray_ScanFunc *scanfunc;
+
+        /*
+         * Function to read a single value from a string
+         * and adjust the pointer; Can be NULL
+         */
+        PyArray_FromStrFunc *fromstr;
+
+        /*
+         * Function to determine if data is zero or not
+         * If NULL a default version is
+         * used at Registration time.
+         */
+        PyArray_NonzeroFunc *nonzero;
+
+        /*
+         * Used for arange. Should return 0 on success
+         * and -1 on failure.
+         * Can be NULL.
+         */
+        PyArray_FillFunc *fill;
+
+        /*
+         * Function to fill arrays with scalar values
+         * Can be NULL
+         */
+        PyArray_FillWithScalarFunc *fillwithscalar;
+
+        /*
+         * Sorting functions
+         * Can be NULL
+         */
+        PyArray_SortFunc *sort[NPY_NSORTS];
+        PyArray_ArgSortFunc *argsort[NPY_NSORTS];
+
+        /*
+         * Dictionary of additional casting functions
+         * PyArray_VectorUnaryFuncs
+         * which can be populated to support casting
+         * to other registered types. Can be NULL
+         */
+        PyObject *castdict;
+
+        /*
+         * Functions useful for generalizing
+         * the casting rules.
+         * Can be NULL;
+         */
+        PyArray_ScalarKindFunc *scalarkind;
+        int **cancastscalarkindto;
+        int *cancastto;
+
+        PyArray_FastClipFunc *fastclip;
+        PyArray_FastPutmaskFunc *fastputmask;
+        PyArray_FastTakeFunc *fasttake;
+
+        /*
+         * Function to select smallest
+         * Can be NULL
+         */
+        PyArray_ArgFunc *argmin;
+
+} PyArray_ArrFuncs;
+
+/* The item must be reference counted when it is inserted or extracted. */
+#define NPY_ITEM_REFCOUNT   0x01
+/* Same as needing REFCOUNT */
+#define NPY_ITEM_HASOBJECT  0x01
+/* Convert to list for pickling */
+#define NPY_LIST_PICKLE     0x02
+/* The item is a POINTER  */
+#define NPY_ITEM_IS_POINTER 0x04
+/* memory needs to be initialized for this data-type */
+#define NPY_NEEDS_INIT      0x08
+/* operations need Python C-API so don't give-up thread. */
+#define NPY_NEEDS_PYAPI     0x10
+/* Use f.getitem when extracting elements of this data-type */
+#define NPY_USE_GETITEM     0x20
+/* Use f.setitem when setting creating 0-d array from this data-type.*/
+#define NPY_USE_SETITEM     0x40
+/* A sticky flag specifically for structured arrays */
+#define NPY_ALIGNED_STRUCT  0x80
+
+/*
+ *These are inherited for global data-type if any data-types in the
+ * field have them
+ */
+#define NPY_FROM_FIELDS    (NPY_NEEDS_INIT | NPY_LIST_PICKLE | \
+                            NPY_ITEM_REFCOUNT | NPY_NEEDS_PYAPI)
+
+#define NPY_OBJECT_DTYPE_FLAGS (NPY_LIST_PICKLE | NPY_USE_GETITEM | \
+                                NPY_ITEM_IS_POINTER | NPY_ITEM_REFCOUNT | \
+                                NPY_NEEDS_INIT | NPY_NEEDS_PYAPI)
+
+#define PyDataType_FLAGCHK(dtype, flag) \
+        (((dtype)->flags & (flag)) == (flag))
+
+#define PyDataType_REFCHK(dtype) \
+        PyDataType_FLAGCHK(dtype, NPY_ITEM_REFCOUNT)
+
+typedef struct _PyArray_Descr {
+        PyObject_HEAD
+        /*
+         * the type object representing an
+         * instance of this type -- should not
+         * be two type_numbers with the same type
+         * object.
+         */
+        PyTypeObject *typeobj;
+        /* kind for this type */
+        char kind;
+        /* unique-character representing this type */
+        char type;
+        /*
+         * '>' (big), '<' (little), '|'
+         * (not-applicable), or '=' (native).
+         */
+        char byteorder;
+        /* flags describing data type */
+        char flags;
+        /* number representing this type */
+        int type_num;
+        /* element size (itemsize) for this type */
+        int elsize;
+        /* alignment needed for this type */
+        int alignment;
+        /*
+         * Non-NULL if this type is
+         * is an array (C-contiguous)
+         * of some other type
+         */
+        struct _arr_descr *subarray;
+        /*
+         * The fields dictionary for this type
+         * For statically defined descr this
+         * is always Py_None
+         */
+        PyObject *fields;
+        /*
+         * An ordered tuple of field names or NULL
+         * if no fields are defined
+         */
+        PyObject *names;
+        /*
+         * a table of functions specific for each
+         * basic data descriptor
+         */
+        PyArray_ArrFuncs *f;
+        /* Metadata about this dtype */
+        PyObject *metadata;
+        /*
+         * Metadata specific to the C implementation
+         * of the particular dtype. This was added
+         * for NumPy 1.7.0.
+         */
+        NpyAuxData *c_metadata;
+        /* Cached hash value (-1 if not yet computed).
+         * This was added for NumPy 2.0.0.
+         */
+        npy_hash_t hash;
+} PyArray_Descr;
+
+typedef struct _arr_descr {
+        PyArray_Descr *base;
+        PyObject *shape;       /* a tuple */
+} PyArray_ArrayDescr;
+
+/*
+ * Memory handler structure for array data.
+ */
+/* The declaration of free differs from PyMemAllocatorEx */
+typedef struct {
+    void *ctx;
+    void* (*malloc) (void *ctx, size_t size);
+    void* (*calloc) (void *ctx, size_t nelem, size_t elsize);
+    void* (*realloc) (void *ctx, void *ptr, size_t new_size);
+    void (*free) (void *ctx, void *ptr, size_t size);
+    /*
+     * This is the end of the version=1 struct. Only add new fields after
+     * this line
+     */
+} PyDataMemAllocator;
+
+typedef struct {
+    char name[127];  /* multiple of 64 to keep the struct aligned */
+    uint8_t version; /* currently 1 */
+    PyDataMemAllocator allocator;
+} PyDataMem_Handler;
+
+
+/*
+ * The main array object structure.
+ *
+ * It has been recommended to use the inline functions defined below
+ * (PyArray_DATA and friends) to access fields here for a number of
+ * releases. Direct access to the members themselves is deprecated.
+ * To ensure that your code does not use deprecated access,
+ * #define NPY_NO_DEPRECATED_API NPY_1_7_API_VERSION
+ * (or NPY_1_8_API_VERSION or higher as required).
+ */
+/* This struct will be moved to a private header in a future release */
+typedef struct tagPyArrayObject_fields {
+    PyObject_HEAD
+    /* Pointer to the raw data buffer */
+    char *data;
+    /* The number of dimensions, also called 'ndim' */
+    int nd;
+    /* The size in each dimension, also called 'shape' */
+    npy_intp *dimensions;
+    /*
+     * Number of bytes to jump to get to the
+     * next element in each dimension
+     */
+    npy_intp *strides;
+    /*
+     * This object is decref'd upon
+     * deletion of array. Except in the
+     * case of WRITEBACKIFCOPY which has
+     * special handling.
+     *
+     * For views it points to the original
+     * array, collapsed so no chains of
+     * views occur.
+     *
+     * For creation from buffer object it
+     * points to an object that should be
+     * decref'd on deletion
+     *
+     * For WRITEBACKIFCOPY flag this is an
+     * array to-be-updated upon calling
+     * PyArray_ResolveWritebackIfCopy
+     */
+    PyObject *base;
+    /* Pointer to type structure */
+    PyArray_Descr *descr;
+    /* Flags describing array -- see below */
+    int flags;
+    /* For weak references */
+    PyObject *weakreflist;
+#if NPY_FEATURE_VERSION >= NPY_1_20_API_VERSION
+    void *_buffer_info;  /* private buffer info, tagged to allow warning */
+#endif
+    /*
+     * For malloc/calloc/realloc/free per object
+     */
+#if NPY_FEATURE_VERSION >= NPY_1_22_API_VERSION
+    PyObject *mem_handler;
+#endif
+} PyArrayObject_fields;
+
+/*
+ * To hide the implementation details, we only expose
+ * the Python struct HEAD.
+ */
+#if !defined(NPY_NO_DEPRECATED_API) || \
+    (NPY_NO_DEPRECATED_API < NPY_1_7_API_VERSION)
+/*
+ * Can't put this in npy_deprecated_api.h like the others.
+ * PyArrayObject field access is deprecated as of NumPy 1.7.
+ */
+typedef PyArrayObject_fields PyArrayObject;
+#else
+typedef struct tagPyArrayObject {
+        PyObject_HEAD
+} PyArrayObject;
+#endif
+
+/*
+ * Removed 2020-Nov-25, NumPy 1.20
+ * #define NPY_SIZEOF_PYARRAYOBJECT (sizeof(PyArrayObject_fields))
+ *
+ * The above macro was removed as it gave a false sense of a stable ABI
+ * with respect to the structures size.  If you require a runtime constant,
+ * you can use `PyArray_Type.tp_basicsize` instead.  Otherwise, please
+ * see the PyArrayObject documentation or ask the NumPy developers for
+ * information on how to correctly replace the macro in a way that is
+ * compatible with multiple NumPy versions.
+ */
+
+
+/* Array Flags Object */
+typedef struct PyArrayFlagsObject {
+        PyObject_HEAD
+        PyObject *arr;
+        int flags;
+} PyArrayFlagsObject;
+
+/* Mirrors buffer object to ptr */
+
+typedef struct {
+        PyObject_HEAD
+        PyObject *base;
+        void *ptr;
+        npy_intp len;
+        int flags;
+} PyArray_Chunk;
+
+typedef struct {
+    NPY_DATETIMEUNIT base;
+    int num;
+} PyArray_DatetimeMetaData;
+
+typedef struct {
+    NpyAuxData base;
+    PyArray_DatetimeMetaData meta;
+} PyArray_DatetimeDTypeMetaData;
+
+/*
+ * This structure contains an exploded view of a date-time value.
+ * NaT is represented by year == NPY_DATETIME_NAT.
+ */
+typedef struct {
+        npy_int64 year;
+        npy_int32 month, day, hour, min, sec, us, ps, as;
+} npy_datetimestruct;
+
+/* This is not used internally. */
+typedef struct {
+        npy_int64 day;
+        npy_int32 sec, us, ps, as;
+} npy_timedeltastruct;
+
+typedef int (PyArray_FinalizeFunc)(PyArrayObject *, PyObject *);
+
+/*
+ * Means c-style contiguous (last index varies the fastest). The data
+ * elements right after each other.
+ *
+ * This flag may be requested in constructor functions.
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_C_CONTIGUOUS    0x0001
+
+/*
+ * Set if array is a contiguous Fortran array: the first index varies
+ * the fastest in memory (strides array is reverse of C-contiguous
+ * array)
+ *
+ * This flag may be requested in constructor functions.
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_F_CONTIGUOUS    0x0002
+
+/*
+ * Note: all 0-d arrays are C_CONTIGUOUS and F_CONTIGUOUS. If a
+ * 1-d array is C_CONTIGUOUS it is also F_CONTIGUOUS. Arrays with
+ * more then one dimension can be C_CONTIGUOUS and F_CONTIGUOUS
+ * at the same time if they have either zero or one element.
+ * A higher dimensional array always has the same contiguity flags as
+ * `array.squeeze()`; dimensions with `array.shape[dimension] == 1` are
+ * effectively ignored when checking for contiguity.
+ */
+
+/*
+ * If set, the array owns the data: it will be free'd when the array
+ * is deleted.
+ *
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_OWNDATA         0x0004
+
+/*
+ * An array never has the next four set; they're only used as parameter
+ * flags to the various FromAny functions
+ *
+ * This flag may be requested in constructor functions.
+ */
+
+/* Cause a cast to occur regardless of whether or not it is safe. */
+#define NPY_ARRAY_FORCECAST       0x0010
+
+/*
+ * Always copy the array. Returned arrays are always CONTIGUOUS,
+ * ALIGNED, and WRITEABLE. See also: NPY_ARRAY_ENSURENOCOPY = 0x4000.
+ *
+ * This flag may be requested in constructor functions.
+ */
+#define NPY_ARRAY_ENSURECOPY      0x0020
+
+/*
+ * Make sure the returned array is a base-class ndarray
+ *
+ * This flag may be requested in constructor functions.
+ */
+#define NPY_ARRAY_ENSUREARRAY     0x0040
+
+/*
+ * Make sure that the strides are in units of the element size Needed
+ * for some operations with record-arrays.
+ *
+ * This flag may be requested in constructor functions.
+ */
+#define NPY_ARRAY_ELEMENTSTRIDES  0x0080
+
+/*
+ * Array data is aligned on the appropriate memory address for the type
+ * stored according to how the compiler would align things (e.g., an
+ * array of integers (4 bytes each) starts on a memory address that's
+ * a multiple of 4)
+ *
+ * This flag may be requested in constructor functions.
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_ALIGNED         0x0100
+
+/*
+ * Array data has the native endianness
+ *
+ * This flag may be requested in constructor functions.
+ */
+#define NPY_ARRAY_NOTSWAPPED      0x0200
+
+/*
+ * Array data is writeable
+ *
+ * This flag may be requested in constructor functions.
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_WRITEABLE       0x0400
+
+/*
+ * If this flag is set, then base contains a pointer to an array of
+ * the same size that should be updated with the current contents of
+ * this array when PyArray_ResolveWritebackIfCopy is called.
+ *
+ * This flag may be requested in constructor functions.
+ * This flag may be tested for in PyArray_FLAGS(arr).
+ */
+#define NPY_ARRAY_WRITEBACKIFCOPY 0x2000
+
+/*
+ * No copy may be made while converting from an object/array (result is a view)
+ *
+ * This flag may be requested in constructor functions.
+ */
+#define NPY_ARRAY_ENSURENOCOPY 0x4000
+
+/*
+ * NOTE: there are also internal flags defined in multiarray/arrayobject.h,
+ * which start at bit 31 and work down.
+ */
+
+#define NPY_ARRAY_BEHAVED      (NPY_ARRAY_ALIGNED | \
+                                NPY_ARRAY_WRITEABLE)
+#define NPY_ARRAY_BEHAVED_NS   (NPY_ARRAY_ALIGNED | \
+                                NPY_ARRAY_WRITEABLE | \
+                                NPY_ARRAY_NOTSWAPPED)
+#define NPY_ARRAY_CARRAY       (NPY_ARRAY_C_CONTIGUOUS | \
+                                NPY_ARRAY_BEHAVED)
+#define NPY_ARRAY_CARRAY_RO    (NPY_ARRAY_C_CONTIGUOUS | \
+                                NPY_ARRAY_ALIGNED)
+#define NPY_ARRAY_FARRAY       (NPY_ARRAY_F_CONTIGUOUS | \
+                                NPY_ARRAY_BEHAVED)
+#define NPY_ARRAY_FARRAY_RO    (NPY_ARRAY_F_CONTIGUOUS | \
+                                NPY_ARRAY_ALIGNED)
+#define NPY_ARRAY_DEFAULT      (NPY_ARRAY_CARRAY)
+#define NPY_ARRAY_IN_ARRAY     (NPY_ARRAY_CARRAY_RO)
+#define NPY_ARRAY_OUT_ARRAY    (NPY_ARRAY_CARRAY)
+#define NPY_ARRAY_INOUT_ARRAY  (NPY_ARRAY_CARRAY)
+#define NPY_ARRAY_INOUT_ARRAY2 (NPY_ARRAY_CARRAY | \
+                                NPY_ARRAY_WRITEBACKIFCOPY)
+#define NPY_ARRAY_IN_FARRAY    (NPY_ARRAY_FARRAY_RO)
+#define NPY_ARRAY_OUT_FARRAY   (NPY_ARRAY_FARRAY)
+#define NPY_ARRAY_INOUT_FARRAY (NPY_ARRAY_FARRAY)
+#define NPY_ARRAY_INOUT_FARRAY2 (NPY_ARRAY_FARRAY | \
+                                NPY_ARRAY_WRITEBACKIFCOPY)
+
+#define NPY_ARRAY_UPDATE_ALL   (NPY_ARRAY_C_CONTIGUOUS | \
+                                NPY_ARRAY_F_CONTIGUOUS | \
+                                NPY_ARRAY_ALIGNED)
+
+/* This flag is for the array interface, not PyArrayObject */
+#define NPY_ARR_HAS_DESCR  0x0800
+
+
+
+
+/*
+ * Size of internal buffers used for alignment Make BUFSIZE a multiple
+ * of sizeof(npy_cdouble) -- usually 16 so that ufunc buffers are aligned
+ */
+#define NPY_MIN_BUFSIZE ((int)sizeof(npy_cdouble))
+#define NPY_MAX_BUFSIZE (((int)sizeof(npy_cdouble))*1000000)
+#define NPY_BUFSIZE 8192
+/* buffer stress test size: */
+/*#define NPY_BUFSIZE 17*/
+
+#define PyArray_MAX(a,b) (((a)>(b))?(a):(b))
+#define PyArray_MIN(a,b) (((a)<(b))?(a):(b))
+#define PyArray_CLT(p,q) ((((p).real==(q).real) ? ((p).imag < (q).imag) : \
+                               ((p).real < (q).real)))
+#define PyArray_CGT(p,q) ((((p).real==(q).real) ? ((p).imag > (q).imag) : \
+                               ((p).real > (q).real)))
+#define PyArray_CLE(p,q) ((((p).real==(q).real) ? ((p).imag <= (q).imag) : \
+                               ((p).real <= (q).real)))
+#define PyArray_CGE(p,q) ((((p).real==(q).real) ? ((p).imag >= (q).imag) : \
+                               ((p).real >= (q).real)))
+#define PyArray_CEQ(p,q) (((p).real==(q).real) && ((p).imag == (q).imag))
+#define PyArray_CNE(p,q) (((p).real!=(q).real) || ((p).imag != (q).imag))
+
+/*
+ * C API: consists of Macros and functions.  The MACROS are defined
+ * here.
+ */
+
+
+#define PyArray_ISCONTIGUOUS(m) PyArray_CHKFLAGS((m), NPY_ARRAY_C_CONTIGUOUS)
+#define PyArray_ISWRITEABLE(m) PyArray_CHKFLAGS((m), NPY_ARRAY_WRITEABLE)
+#define PyArray_ISALIGNED(m) PyArray_CHKFLAGS((m), NPY_ARRAY_ALIGNED)
+
+#define PyArray_IS_C_CONTIGUOUS(m) PyArray_CHKFLAGS((m), NPY_ARRAY_C_CONTIGUOUS)
+#define PyArray_IS_F_CONTIGUOUS(m) PyArray_CHKFLAGS((m), NPY_ARRAY_F_CONTIGUOUS)
+
+/* the variable is used in some places, so always define it */
+#define NPY_BEGIN_THREADS_DEF PyThreadState *_save=NULL;
+#if NPY_ALLOW_THREADS
+#define NPY_BEGIN_ALLOW_THREADS Py_BEGIN_ALLOW_THREADS
+#define NPY_END_ALLOW_THREADS Py_END_ALLOW_THREADS
+#define NPY_BEGIN_THREADS do {_save = PyEval_SaveThread();} while (0);
+#define NPY_END_THREADS   do { if (_save) \
+                { PyEval_RestoreThread(_save); _save = NULL;} } while (0);
+#define NPY_BEGIN_THREADS_THRESHOLDED(loop_size) do { if ((loop_size) > 500) \
+                { _save = PyEval_SaveThread();} } while (0);
+
+#define NPY_BEGIN_THREADS_DESCR(dtype) \
+        do {if (!(PyDataType_FLAGCHK((dtype), NPY_NEEDS_PYAPI))) \
+                NPY_BEGIN_THREADS;} while (0);
+
+#define NPY_END_THREADS_DESCR(dtype) \
+        do {if (!(PyDataType_FLAGCHK((dtype), NPY_NEEDS_PYAPI))) \
+                NPY_END_THREADS; } while (0);
+
+#define NPY_ALLOW_C_API_DEF  PyGILState_STATE __save__;
+#define NPY_ALLOW_C_API      do {__save__ = PyGILState_Ensure();} while (0);
+#define NPY_DISABLE_C_API    do {PyGILState_Release(__save__);} while (0);
+#else
+#define NPY_BEGIN_ALLOW_THREADS
+#define NPY_END_ALLOW_THREADS
+#define NPY_BEGIN_THREADS
+#define NPY_END_THREADS
+#define NPY_BEGIN_THREADS_THRESHOLDED(loop_size)
+#define NPY_BEGIN_THREADS_DESCR(dtype)
+#define NPY_END_THREADS_DESCR(dtype)
+#define NPY_ALLOW_C_API_DEF
+#define NPY_ALLOW_C_API
+#define NPY_DISABLE_C_API
+#endif
+
+/**********************************
+ * The nditer object, added in 1.6
+ **********************************/
+
+/* The actual structure of the iterator is an internal detail */
+typedef struct NpyIter_InternalOnly NpyIter;
+
+/* Iterator function pointers that may be specialized */
+typedef int (NpyIter_IterNextFunc)(NpyIter *iter);
+typedef void (NpyIter_GetMultiIndexFunc)(NpyIter *iter,
+                                      npy_intp *outcoords);
+
+/*** Global flags that may be passed to the iterator constructors ***/
+
+/* Track an index representing C order */
+#define NPY_ITER_C_INDEX                    0x00000001
+/* Track an index representing Fortran order */
+#define NPY_ITER_F_INDEX                    0x00000002
+/* Track a multi-index */
+#define NPY_ITER_MULTI_INDEX                0x00000004
+/* User code external to the iterator does the 1-dimensional innermost loop */
+#define NPY_ITER_EXTERNAL_LOOP              0x00000008
+/* Convert all the operands to a common data type */
+#define NPY_ITER_COMMON_DTYPE               0x00000010
+/* Operands may hold references, requiring API access during iteration */
+#define NPY_ITER_REFS_OK                    0x00000020
+/* Zero-sized operands should be permitted, iteration checks IterSize for 0 */
+#define NPY_ITER_ZEROSIZE_OK                0x00000040
+/* Permits reductions (size-0 stride with dimension size > 1) */
+#define NPY_ITER_REDUCE_OK                  0x00000080
+/* Enables sub-range iteration */
+#define NPY_ITER_RANGED                     0x00000100
+/* Enables buffering */
+#define NPY_ITER_BUFFERED                   0x00000200
+/* When buffering is enabled, grows the inner loop if possible */
+#define NPY_ITER_GROWINNER                  0x00000400
+/* Delay allocation of buffers until first Reset* call */
+#define NPY_ITER_DELAY_BUFALLOC             0x00000800
+/* When NPY_KEEPORDER is specified, disable reversing negative-stride axes */
+#define NPY_ITER_DONT_NEGATE_STRIDES        0x00001000
+/*
+ * If output operands overlap with other operands (based on heuristics that
+ * has false positives but no false negatives), make temporary copies to
+ * eliminate overlap.
+ */
+#define NPY_ITER_COPY_IF_OVERLAP            0x00002000
+
+/*** Per-operand flags that may be passed to the iterator constructors ***/
+
+/* The operand will be read from and written to */
+#define NPY_ITER_READWRITE                  0x00010000
+/* The operand will only be read from */
+#define NPY_ITER_READONLY                   0x00020000
+/* The operand will only be written to */
+#define NPY_ITER_WRITEONLY                  0x00040000
+/* The operand's data must be in native byte order */
+#define NPY_ITER_NBO                        0x00080000
+/* The operand's data must be aligned */
+#define NPY_ITER_ALIGNED                    0x00100000
+/* The operand's data must be contiguous (within the inner loop) */
+#define NPY_ITER_CONTIG                     0x00200000
+/* The operand may be copied to satisfy requirements */
+#define NPY_ITER_COPY                       0x00400000
+/* The operand may be copied with WRITEBACKIFCOPY to satisfy requirements */
+#define NPY_ITER_UPDATEIFCOPY               0x00800000
+/* Allocate the operand if it is NULL */
+#define NPY_ITER_ALLOCATE                   0x01000000
+/* If an operand is allocated, don't use any subtype */
+#define NPY_ITER_NO_SUBTYPE                 0x02000000
+/* This is a virtual array slot, operand is NULL but temporary data is there */
+#define NPY_ITER_VIRTUAL                    0x04000000
+/* Require that the dimension match the iterator dimensions exactly */
+#define NPY_ITER_NO_BROADCAST               0x08000000
+/* A mask is being used on this array, affects buffer -> array copy */
+#define NPY_ITER_WRITEMASKED                0x10000000
+/* This array is the mask for all WRITEMASKED operands */
+#define NPY_ITER_ARRAYMASK                  0x20000000
+/* Assume iterator order data access for COPY_IF_OVERLAP */
+#define NPY_ITER_OVERLAP_ASSUME_ELEMENTWISE 0x40000000
+
+#define NPY_ITER_GLOBAL_FLAGS               0x0000ffff
+#define NPY_ITER_PER_OP_FLAGS               0xffff0000
+
+
+/*****************************
+ * Basic iterator object
+ *****************************/
+
+/* FWD declaration */
+typedef struct PyArrayIterObject_tag PyArrayIterObject;
+
+/*
+ * type of the function which translates a set of coordinates to a
+ * pointer to the data
+ */
+typedef char* (*npy_iter_get_dataptr_t)(
+        PyArrayIterObject* iter, const npy_intp*);
+
+struct PyArrayIterObject_tag {
+        PyObject_HEAD
+        int               nd_m1;            /* number of dimensions - 1 */
+        npy_intp          index, size;
+        npy_intp          coordinates[NPY_MAXDIMS];/* N-dimensional loop */
+        npy_intp          dims_m1[NPY_MAXDIMS];    /* ao->dimensions - 1 */
+        npy_intp          strides[NPY_MAXDIMS];    /* ao->strides or fake */
+        npy_intp          backstrides[NPY_MAXDIMS];/* how far to jump back */
+        npy_intp          factors[NPY_MAXDIMS];     /* shape factors */
+        PyArrayObject     *ao;
+        char              *dataptr;        /* pointer to current item*/
+        npy_bool          contiguous;
+
+        npy_intp          bounds[NPY_MAXDIMS][2];
+        npy_intp          limits[NPY_MAXDIMS][2];
+        npy_intp          limits_sizes[NPY_MAXDIMS];
+        npy_iter_get_dataptr_t translate;
+} ;
+
+
+/* Iterator API */
+#define PyArrayIter_Check(op) PyObject_TypeCheck((op), &PyArrayIter_Type)
+
+#define _PyAIT(it) ((PyArrayIterObject *)(it))
+#define PyArray_ITER_RESET(it) do { \
+        _PyAIT(it)->index = 0; \
+        _PyAIT(it)->dataptr = PyArray_BYTES(_PyAIT(it)->ao); \
+        memset(_PyAIT(it)->coordinates, 0, \
+               (_PyAIT(it)->nd_m1+1)*sizeof(npy_intp)); \
+} while (0)
+
+#define _PyArray_ITER_NEXT1(it) do { \
+        (it)->dataptr += _PyAIT(it)->strides[0]; \
+        (it)->coordinates[0]++; \
+} while (0)
+
+#define _PyArray_ITER_NEXT2(it) do { \
+        if ((it)->coordinates[1] < (it)->dims_m1[1]) { \
+                (it)->coordinates[1]++; \
+                (it)->dataptr += (it)->strides[1]; \
+        } \
+        else { \
+                (it)->coordinates[1] = 0; \
+                (it)->coordinates[0]++; \
+                (it)->dataptr += (it)->strides[0] - \
+                        (it)->backstrides[1]; \
+        } \
+} while (0)
+
+#define PyArray_ITER_NEXT(it) do { \
+        _PyAIT(it)->index++; \
+        if (_PyAIT(it)->nd_m1 == 0) { \
+                _PyArray_ITER_NEXT1(_PyAIT(it)); \
+        } \
+        else if (_PyAIT(it)->contiguous) \
+                _PyAIT(it)->dataptr += PyArray_DESCR(_PyAIT(it)->ao)->elsize; \
+        else if (_PyAIT(it)->nd_m1 == 1) { \
+                _PyArray_ITER_NEXT2(_PyAIT(it)); \
+        } \
+        else { \
+                int __npy_i; \
+                for (__npy_i=_PyAIT(it)->nd_m1; __npy_i >= 0; __npy_i--) { \
+                        if (_PyAIT(it)->coordinates[__npy_i] < \
+                            _PyAIT(it)->dims_m1[__npy_i]) { \
+                                _PyAIT(it)->coordinates[__npy_i]++; \
+                                _PyAIT(it)->dataptr += \
+                                        _PyAIT(it)->strides[__npy_i]; \
+                                break; \
+                        } \
+                        else { \
+                                _PyAIT(it)->coordinates[__npy_i] = 0; \
+                                _PyAIT(it)->dataptr -= \
+                                        _PyAIT(it)->backstrides[__npy_i]; \
+                        } \
+                } \
+        } \
+} while (0)
+
+#define PyArray_ITER_GOTO(it, destination) do { \
+        int __npy_i; \
+        _PyAIT(it)->index = 0; \
+        _PyAIT(it)->dataptr = PyArray_BYTES(_PyAIT(it)->ao); \
+        for (__npy_i = _PyAIT(it)->nd_m1; __npy_i>=0; __npy_i--) { \
+                if (destination[__npy_i] < 0) { \
+                        destination[__npy_i] += \
+                                _PyAIT(it)->dims_m1[__npy_i]+1; \
+                } \
+                _PyAIT(it)->dataptr += destination[__npy_i] * \
+                        _PyAIT(it)->strides[__npy_i]; \
+                _PyAIT(it)->coordinates[__npy_i] = \
+                        destination[__npy_i]; \
+                _PyAIT(it)->index += destination[__npy_i] * \
+                        ( __npy_i==_PyAIT(it)->nd_m1 ? 1 : \
+                          _PyAIT(it)->dims_m1[__npy_i+1]+1) ; \
+        } \
+} while (0)
+
+#define PyArray_ITER_GOTO1D(it, ind) do { \
+        int __npy_i; \
+        npy_intp __npy_ind = (npy_intp)(ind); \
+        if (__npy_ind < 0) __npy_ind += _PyAIT(it)->size; \
+        _PyAIT(it)->index = __npy_ind; \
+        if (_PyAIT(it)->nd_m1 == 0) { \
+                _PyAIT(it)->dataptr = PyArray_BYTES(_PyAIT(it)->ao) + \
+                        __npy_ind * _PyAIT(it)->strides[0]; \
+        } \
+        else if (_PyAIT(it)->contiguous) \
+                _PyAIT(it)->dataptr = PyArray_BYTES(_PyAIT(it)->ao) + \
+                        __npy_ind * PyArray_DESCR(_PyAIT(it)->ao)->elsize; \
+        else { \
+                _PyAIT(it)->dataptr = PyArray_BYTES(_PyAIT(it)->ao); \
+                for (__npy_i = 0; __npy_i<=_PyAIT(it)->nd_m1; \
+                     __npy_i++) { \
+                        _PyAIT(it)->coordinates[__npy_i] = \
+                                (__npy_ind / _PyAIT(it)->factors[__npy_i]); \
+                        _PyAIT(it)->dataptr += \
+                                (__npy_ind / _PyAIT(it)->factors[__npy_i]) \
+                                * _PyAIT(it)->strides[__npy_i]; \
+                        __npy_ind %= _PyAIT(it)->factors[__npy_i]; \
+                } \
+        } \
+} while (0)
+
+#define PyArray_ITER_DATA(it) ((void *)(_PyAIT(it)->dataptr))
+
+#define PyArray_ITER_NOTDONE(it) (_PyAIT(it)->index < _PyAIT(it)->size)
+
+
+/*
+ * Any object passed to PyArray_Broadcast must be binary compatible
+ * with this structure.
+ */
+
+typedef struct {
+        PyObject_HEAD
+        int                  numiter;                 /* number of iters */
+        npy_intp             size;                    /* broadcasted size */
+        npy_intp             index;                   /* current index */
+        int                  nd;                      /* number of dims */
+        npy_intp             dimensions[NPY_MAXDIMS]; /* dimensions */
+        PyArrayIterObject    *iters[NPY_MAXARGS];     /* iterators */
+} PyArrayMultiIterObject;
+
+#define _PyMIT(m) ((PyArrayMultiIterObject *)(m))
+#define PyArray_MultiIter_RESET(multi) do {                                   \
+        int __npy_mi;                                                         \
+        _PyMIT(multi)->index = 0;                                             \
+        for (__npy_mi=0; __npy_mi < _PyMIT(multi)->numiter;  __npy_mi++) {    \
+                PyArray_ITER_RESET(_PyMIT(multi)->iters[__npy_mi]);           \
+        }                                                                     \
+} while (0)
+
+#define PyArray_MultiIter_NEXT(multi) do {                                    \
+        int __npy_mi;                                                         \
+        _PyMIT(multi)->index++;                                               \
+        for (__npy_mi=0; __npy_mi < _PyMIT(multi)->numiter;   __npy_mi++) {   \
+                PyArray_ITER_NEXT(_PyMIT(multi)->iters[__npy_mi]);            \
+        }                                                                     \
+} while (0)
+
+#define PyArray_MultiIter_GOTO(multi, dest) do {                            \
+        int __npy_mi;                                                       \
+        for (__npy_mi=0; __npy_mi < _PyMIT(multi)->numiter; __npy_mi++) {   \
+                PyArray_ITER_GOTO(_PyMIT(multi)->iters[__npy_mi], dest);    \
+        }                                                                   \
+        _PyMIT(multi)->index = _PyMIT(multi)->iters[0]->index;              \
+} while (0)
+
+#define PyArray_MultiIter_GOTO1D(multi, ind) do {                          \
+        int __npy_mi;                                                      \
+        for (__npy_mi=0; __npy_mi < _PyMIT(multi)->numiter; __npy_mi++) {  \
+                PyArray_ITER_GOTO1D(_PyMIT(multi)->iters[__npy_mi], ind);  \
+        }                                                                  \
+        _PyMIT(multi)->index = _PyMIT(multi)->iters[0]->index;             \
+} while (0)
+
+#define PyArray_MultiIter_DATA(multi, i)                \
+        ((void *)(_PyMIT(multi)->iters[i]->dataptr))
+
+#define PyArray_MultiIter_NEXTi(multi, i)               \
+        PyArray_ITER_NEXT(_PyMIT(multi)->iters[i])
+
+#define PyArray_MultiIter_NOTDONE(multi)                \
+        (_PyMIT(multi)->index < _PyMIT(multi)->size)
+
+/*
+ * Store the information needed for fancy-indexing over an array. The
+ * fields are slightly unordered to keep consec, dataptr and subspace
+ * where they were originally.
+ */
+typedef struct {
+        PyObject_HEAD
+        /*
+         * Multi-iterator portion --- needs to be present in this
+         * order to work with PyArray_Broadcast
+         */
+
+        int                   numiter;                 /* number of index-array
+                                                          iterators */
+        npy_intp              size;                    /* size of broadcasted
+                                                          result */
+        npy_intp              index;                   /* current index */
+        int                   nd;                      /* number of dims */
+        npy_intp              dimensions[NPY_MAXDIMS]; /* dimensions */
+        NpyIter               *outer;                  /* index objects
+                                                          iterator */
+        void                  *unused[NPY_MAXDIMS - 2];
+        PyArrayObject         *array;
+        /* Flat iterator for the indexed array. For compatibility solely. */
+        PyArrayIterObject     *ait;
+
+        /*
+         * Subspace array. For binary compatibility (was an iterator,
+         * but only the check for NULL should be used).
+         */
+        PyArrayObject         *subspace;
+
+        /*
+         * if subspace iteration, then this is the array of axes in
+         * the underlying array represented by the index objects
+         */
+        int                   iteraxes[NPY_MAXDIMS];
+        npy_intp              fancy_strides[NPY_MAXDIMS];
+
+        /* pointer when all fancy indices are 0 */
+        char                  *baseoffset;
+
+        /*
+         * after binding consec denotes at which axis the fancy axes
+         * are inserted.
+         */
+        int                   consec;
+        char                  *dataptr;
+
+        int                   nd_fancy;
+        npy_intp              fancy_dims[NPY_MAXDIMS];
+
+        /*
+         * Whether the iterator (any of the iterators) requires API.  This is
+         * unused by NumPy itself; ArrayMethod flags are more precise.
+         */
+        int                   needs_api;
+
+        /*
+         * Extra op information.
+         */
+        PyArrayObject         *extra_op;
+        PyArray_Descr         *extra_op_dtype;         /* desired dtype */
+        npy_uint32            *extra_op_flags;         /* Iterator flags */
+
+        NpyIter               *extra_op_iter;
+        NpyIter_IterNextFunc  *extra_op_next;
+        char                  **extra_op_ptrs;
+
+        /*
+         * Information about the iteration state.
+         */
+        NpyIter_IterNextFunc  *outer_next;
+        char                  **outer_ptrs;
+        npy_intp              *outer_strides;
+
+        /*
+         * Information about the subspace iterator.
+         */
+        NpyIter               *subspace_iter;
+        NpyIter_IterNextFunc  *subspace_next;
+        char                  **subspace_ptrs;
+        npy_intp              *subspace_strides;
+
+        /* Count for the external loop (which ever it is) for API iteration */
+        npy_intp              iter_count;
+
+} PyArrayMapIterObject;
+
+enum {
+    NPY_NEIGHBORHOOD_ITER_ZERO_PADDING,
+    NPY_NEIGHBORHOOD_ITER_ONE_PADDING,
+    NPY_NEIGHBORHOOD_ITER_CONSTANT_PADDING,
+    NPY_NEIGHBORHOOD_ITER_CIRCULAR_PADDING,
+    NPY_NEIGHBORHOOD_ITER_MIRROR_PADDING
+};
+
+typedef struct {
+    PyObject_HEAD
+
+    /*
+     * PyArrayIterObject part: keep this in this exact order
+     */
+    int               nd_m1;            /* number of dimensions - 1 */
+    npy_intp          index, size;
+    npy_intp          coordinates[NPY_MAXDIMS];/* N-dimensional loop */
+    npy_intp          dims_m1[NPY_MAXDIMS];    /* ao->dimensions - 1 */
+    npy_intp          strides[NPY_MAXDIMS];    /* ao->strides or fake */
+    npy_intp          backstrides[NPY_MAXDIMS];/* how far to jump back */
+    npy_intp          factors[NPY_MAXDIMS];     /* shape factors */
+    PyArrayObject     *ao;
+    char              *dataptr;        /* pointer to current item*/
+    npy_bool          contiguous;
+
+    npy_intp          bounds[NPY_MAXDIMS][2];
+    npy_intp          limits[NPY_MAXDIMS][2];
+    npy_intp          limits_sizes[NPY_MAXDIMS];
+    npy_iter_get_dataptr_t translate;
+
+    /*
+     * New members
+     */
+    npy_intp nd;
+
+    /* Dimensions is the dimension of the array */
+    npy_intp dimensions[NPY_MAXDIMS];
+
+    /*
+     * Neighborhood points coordinates are computed relatively to the
+     * point pointed by _internal_iter
+     */
+    PyArrayIterObject* _internal_iter;
+    /*
+     * To keep a reference to the representation of the constant value
+     * for constant padding
+     */
+    char* constant;
+
+    int mode;
+} PyArrayNeighborhoodIterObject;
+
+/*
+ * Neighborhood iterator API
+ */
+
+/* General: those work for any mode */
+static inline int
+PyArrayNeighborhoodIter_Reset(PyArrayNeighborhoodIterObject* iter);
+static inline int
+PyArrayNeighborhoodIter_Next(PyArrayNeighborhoodIterObject* iter);
+#if 0
+static inline int
+PyArrayNeighborhoodIter_Next2D(PyArrayNeighborhoodIterObject* iter);
+#endif
+
+/*
+ * Include inline implementations - functions defined there are not
+ * considered public API
+ */
+#define NUMPY_CORE_INCLUDE_NUMPY__NEIGHBORHOOD_IMP_H_
+#include "_neighborhood_iterator_imp.h"
+#undef NUMPY_CORE_INCLUDE_NUMPY__NEIGHBORHOOD_IMP_H_
+
+
+
+/* The default array type */
+#define NPY_DEFAULT_TYPE NPY_DOUBLE
+
+/*
+ * All sorts of useful ways to look into a PyArrayObject. It is recommended
+ * to use PyArrayObject * objects instead of always casting from PyObject *,
+ * for improved type checking.
+ *
+ * In many cases here the macro versions of the accessors are deprecated,
+ * but can't be immediately changed to inline functions because the
+ * preexisting macros accept PyObject * and do automatic casts. Inline
+ * functions accepting PyArrayObject * provides for some compile-time
+ * checking of correctness when working with these objects in C.
+ */
+
+#define PyArray_ISONESEGMENT(m) (PyArray_CHKFLAGS(m, NPY_ARRAY_C_CONTIGUOUS) || \
+                                 PyArray_CHKFLAGS(m, NPY_ARRAY_F_CONTIGUOUS))
+
+#define PyArray_ISFORTRAN(m) (PyArray_CHKFLAGS(m, NPY_ARRAY_F_CONTIGUOUS) && \
+                             (!PyArray_CHKFLAGS(m, NPY_ARRAY_C_CONTIGUOUS)))
+
+#define PyArray_FORTRAN_IF(m) ((PyArray_CHKFLAGS(m, NPY_ARRAY_F_CONTIGUOUS) ? \
+                               NPY_ARRAY_F_CONTIGUOUS : 0))
+
+#if (defined(NPY_NO_DEPRECATED_API) && (NPY_1_7_API_VERSION <= NPY_NO_DEPRECATED_API))
+/*
+ * Changing access macros into functions, to allow for future hiding
+ * of the internal memory layout. This later hiding will allow the 2.x series
+ * to change the internal representation of arrays without affecting
+ * ABI compatibility.
+ */
+
+static inline int
+PyArray_NDIM(const PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->nd;
+}
+
+static inline void *
+PyArray_DATA(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->data;
+}
+
+static inline char *
+PyArray_BYTES(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->data;
+}
+
+static inline npy_intp *
+PyArray_DIMS(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->dimensions;
+}
+
+static inline npy_intp *
+PyArray_STRIDES(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->strides;
+}
+
+static inline npy_intp
+PyArray_DIM(const PyArrayObject *arr, int idim)
+{
+    return ((PyArrayObject_fields *)arr)->dimensions[idim];
+}
+
+static inline npy_intp
+PyArray_STRIDE(const PyArrayObject *arr, int istride)
+{
+    return ((PyArrayObject_fields *)arr)->strides[istride];
+}
+
+static inline NPY_RETURNS_BORROWED_REF PyObject *
+PyArray_BASE(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->base;
+}
+
+static inline NPY_RETURNS_BORROWED_REF PyArray_Descr *
+PyArray_DESCR(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->descr;
+}
+
+static inline int
+PyArray_FLAGS(const PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->flags;
+}
+
+static inline npy_intp
+PyArray_ITEMSIZE(const PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->descr->elsize;
+}
+
+static inline int
+PyArray_TYPE(const PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->descr->type_num;
+}
+
+static inline int
+PyArray_CHKFLAGS(const PyArrayObject *arr, int flags)
+{
+    return (PyArray_FLAGS(arr) & flags) == flags;
+}
+
+static inline PyObject *
+PyArray_GETITEM(const PyArrayObject *arr, const char *itemptr)
+{
+    return ((PyArrayObject_fields *)arr)->descr->f->getitem(
+                                        (void *)itemptr, (PyArrayObject *)arr);
+}
+
+/*
+ * SETITEM should only be used if it is known that the value is a scalar
+ * and of a type understood by the arrays dtype.
+ * Use `PyArray_Pack` if the value may be of a different dtype.
+ */
+static inline int
+PyArray_SETITEM(PyArrayObject *arr, char *itemptr, PyObject *v)
+{
+    return ((PyArrayObject_fields *)arr)->descr->f->setitem(v, itemptr, arr);
+}
+
+#else
+
+/* These macros are deprecated as of NumPy 1.7. */
+#define PyArray_NDIM(obj) (((PyArrayObject_fields *)(obj))->nd)
+#define PyArray_BYTES(obj) (((PyArrayObject_fields *)(obj))->data)
+#define PyArray_DATA(obj) ((void *)((PyArrayObject_fields *)(obj))->data)
+#define PyArray_DIMS(obj) (((PyArrayObject_fields *)(obj))->dimensions)
+#define PyArray_STRIDES(obj) (((PyArrayObject_fields *)(obj))->strides)
+#define PyArray_DIM(obj,n) (PyArray_DIMS(obj)[n])
+#define PyArray_STRIDE(obj,n) (PyArray_STRIDES(obj)[n])
+#define PyArray_BASE(obj) (((PyArrayObject_fields *)(obj))->base)
+#define PyArray_DESCR(obj) (((PyArrayObject_fields *)(obj))->descr)
+#define PyArray_FLAGS(obj) (((PyArrayObject_fields *)(obj))->flags)
+#define PyArray_CHKFLAGS(m, FLAGS) \
+        ((((PyArrayObject_fields *)(m))->flags & (FLAGS)) == (FLAGS))
+#define PyArray_ITEMSIZE(obj) \
+                    (((PyArrayObject_fields *)(obj))->descr->elsize)
+#define PyArray_TYPE(obj) \
+                    (((PyArrayObject_fields *)(obj))->descr->type_num)
+#define PyArray_GETITEM(obj,itemptr) \
+        PyArray_DESCR(obj)->f->getitem((char *)(itemptr), \
+                                     (PyArrayObject *)(obj))
+
+#define PyArray_SETITEM(obj,itemptr,v) \
+        PyArray_DESCR(obj)->f->setitem((PyObject *)(v), \
+                                     (char *)(itemptr), \
+                                     (PyArrayObject *)(obj))
+#endif
+
+static inline PyArray_Descr *
+PyArray_DTYPE(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->descr;
+}
+
+static inline npy_intp *
+PyArray_SHAPE(PyArrayObject *arr)
+{
+    return ((PyArrayObject_fields *)arr)->dimensions;
+}
+
+/*
+ * Enables the specified array flags. Does no checking,
+ * assumes you know what you're doing.
+ */
+static inline void
+PyArray_ENABLEFLAGS(PyArrayObject *arr, int flags)
+{
+    ((PyArrayObject_fields *)arr)->flags |= flags;
+}
+
+/*
+ * Clears the specified array flags. Does no checking,
+ * assumes you know what you're doing.
+ */
+static inline void
+PyArray_CLEARFLAGS(PyArrayObject *arr, int flags)
+{
+    ((PyArrayObject_fields *)arr)->flags &= ~flags;
+}
+
+#if NPY_FEATURE_VERSION >= NPY_1_22_API_VERSION
+    static inline NPY_RETURNS_BORROWED_REF PyObject *
+    PyArray_HANDLER(PyArrayObject *arr)
+    {
+        return ((PyArrayObject_fields *)arr)->mem_handler;
+    }
+#endif
+
+#define PyTypeNum_ISBOOL(type) ((type) == NPY_BOOL)
+
+#define PyTypeNum_ISUNSIGNED(type) (((type) == NPY_UBYTE) ||   \
+                                 ((type) == NPY_USHORT) ||     \
+                                 ((type) == NPY_UINT) ||       \
+                                 ((type) == NPY_ULONG) ||      \
+                                 ((type) == NPY_ULONGLONG))
+
+#define PyTypeNum_ISSIGNED(type) (((type) == NPY_BYTE) ||      \
+                               ((type) == NPY_SHORT) ||        \
+                               ((type) == NPY_INT) ||          \
+                               ((type) == NPY_LONG) ||         \
+                               ((type) == NPY_LONGLONG))
+
+#define PyTypeNum_ISINTEGER(type) (((type) >= NPY_BYTE) &&     \
+                                ((type) <= NPY_ULONGLONG))
+
+#define PyTypeNum_ISFLOAT(type) ((((type) >= NPY_FLOAT) && \
+                              ((type) <= NPY_LONGDOUBLE)) || \
+                              ((type) == NPY_HALF))
+
+#define PyTypeNum_ISNUMBER(type) (((type) <= NPY_CLONGDOUBLE) || \
+                                  ((type) == NPY_HALF))
+
+#define PyTypeNum_ISSTRING(type) (((type) == NPY_STRING) ||    \
+                                  ((type) == NPY_UNICODE))
+
+#define PyTypeNum_ISCOMPLEX(type) (((type) >= NPY_CFLOAT) &&   \
+                                ((type) <= NPY_CLONGDOUBLE))
+
+#define PyTypeNum_ISPYTHON(type) (((type) == NPY_LONG) ||      \
+                                  ((type) == NPY_DOUBLE) ||    \
+                                  ((type) == NPY_CDOUBLE) ||   \
+                                  ((type) == NPY_BOOL) ||      \
+                                  ((type) == NPY_OBJECT ))
+
+#define PyTypeNum_ISFLEXIBLE(type) (((type) >=NPY_STRING) &&  \
+                                    ((type) <=NPY_VOID))
+
+#define PyTypeNum_ISDATETIME(type) (((type) >=NPY_DATETIME) &&  \
+                                    ((type) <=NPY_TIMEDELTA))
+
+#define PyTypeNum_ISUSERDEF(type) (((type) >= NPY_USERDEF) && \
+                                   ((type) < NPY_USERDEF+     \
+                                    NPY_NUMUSERTYPES))
+
+#define PyTypeNum_ISEXTENDED(type) (PyTypeNum_ISFLEXIBLE(type) ||  \
+                                    PyTypeNum_ISUSERDEF(type))
+
+#define PyTypeNum_ISOBJECT(type) ((type) == NPY_OBJECT)
+
+
+#define PyDataType_ISBOOL(obj) PyTypeNum_ISBOOL(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISUNSIGNED(obj) PyTypeNum_ISUNSIGNED(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISSIGNED(obj) PyTypeNum_ISSIGNED(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISINTEGER(obj) PyTypeNum_ISINTEGER(((PyArray_Descr*)(obj))->type_num )
+#define PyDataType_ISFLOAT(obj) PyTypeNum_ISFLOAT(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISNUMBER(obj) PyTypeNum_ISNUMBER(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISSTRING(obj) PyTypeNum_ISSTRING(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISCOMPLEX(obj) PyTypeNum_ISCOMPLEX(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISPYTHON(obj) PyTypeNum_ISPYTHON(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISFLEXIBLE(obj) PyTypeNum_ISFLEXIBLE(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISDATETIME(obj) PyTypeNum_ISDATETIME(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISUSERDEF(obj) PyTypeNum_ISUSERDEF(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISEXTENDED(obj) PyTypeNum_ISEXTENDED(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_ISOBJECT(obj) PyTypeNum_ISOBJECT(((PyArray_Descr*)(obj))->type_num)
+#define PyDataType_HASFIELDS(obj) (((PyArray_Descr *)(obj))->names != NULL)
+#define PyDataType_HASSUBARRAY(dtype) ((dtype)->subarray != NULL)
+#define PyDataType_ISUNSIZED(dtype) ((dtype)->elsize == 0 && \
+                                      !PyDataType_HASFIELDS(dtype))
+#define PyDataType_MAKEUNSIZED(dtype) ((dtype)->elsize = 0)
+
+#define PyArray_ISBOOL(obj) PyTypeNum_ISBOOL(PyArray_TYPE(obj))
+#define PyArray_ISUNSIGNED(obj) PyTypeNum_ISUNSIGNED(PyArray_TYPE(obj))
+#define PyArray_ISSIGNED(obj) PyTypeNum_ISSIGNED(PyArray_TYPE(obj))
+#define PyArray_ISINTEGER(obj) PyTypeNum_ISINTEGER(PyArray_TYPE(obj))
+#define PyArray_ISFLOAT(obj) PyTypeNum_ISFLOAT(PyArray_TYPE(obj))
+#define PyArray_ISNUMBER(obj) PyTypeNum_ISNUMBER(PyArray_TYPE(obj))
+#define PyArray_ISSTRING(obj) PyTypeNum_ISSTRING(PyArray_TYPE(obj))
+#define PyArray_ISCOMPLEX(obj) PyTypeNum_ISCOMPLEX(PyArray_TYPE(obj))
+#define PyArray_ISPYTHON(obj) PyTypeNum_ISPYTHON(PyArray_TYPE(obj))
+#define PyArray_ISFLEXIBLE(obj) PyTypeNum_ISFLEXIBLE(PyArray_TYPE(obj))
+#define PyArray_ISDATETIME(obj) PyTypeNum_ISDATETIME(PyArray_TYPE(obj))
+#define PyArray_ISUSERDEF(obj) PyTypeNum_ISUSERDEF(PyArray_TYPE(obj))
+#define PyArray_ISEXTENDED(obj) PyTypeNum_ISEXTENDED(PyArray_TYPE(obj))
+#define PyArray_ISOBJECT(obj) PyTypeNum_ISOBJECT(PyArray_TYPE(obj))
+#define PyArray_HASFIELDS(obj) PyDataType_HASFIELDS(PyArray_DESCR(obj))
+
+    /*
+     * FIXME: This should check for a flag on the data-type that
+     * states whether or not it is variable length.  Because the
+     * ISFLEXIBLE check is hard-coded to the built-in data-types.
+     */
+#define PyArray_ISVARIABLE(obj) PyTypeNum_ISFLEXIBLE(PyArray_TYPE(obj))
+
+#define PyArray_SAFEALIGNEDCOPY(obj) (PyArray_ISALIGNED(obj) && !PyArray_ISVARIABLE(obj))
+
+
+#define NPY_LITTLE '<'
+#define NPY_BIG '>'
+#define NPY_NATIVE '='
+#define NPY_SWAP 's'
+#define NPY_IGNORE '|'
+
+#if NPY_BYTE_ORDER == NPY_BIG_ENDIAN
+#define NPY_NATBYTE NPY_BIG
+#define NPY_OPPBYTE NPY_LITTLE
+#else
+#define NPY_NATBYTE NPY_LITTLE
+#define NPY_OPPBYTE NPY_BIG
+#endif
+
+#define PyArray_ISNBO(arg) ((arg) != NPY_OPPBYTE)
+#define PyArray_IsNativeByteOrder PyArray_ISNBO
+#define PyArray_ISNOTSWAPPED(m) PyArray_ISNBO(PyArray_DESCR(m)->byteorder)
+#define PyArray_ISBYTESWAPPED(m) (!PyArray_ISNOTSWAPPED(m))
+
+#define PyArray_FLAGSWAP(m, flags) (PyArray_CHKFLAGS(m, flags) &&       \
+                                    PyArray_ISNOTSWAPPED(m))
+
+#define PyArray_ISCARRAY(m) PyArray_FLAGSWAP(m, NPY_ARRAY_CARRAY)
+#define PyArray_ISCARRAY_RO(m) PyArray_FLAGSWAP(m, NPY_ARRAY_CARRAY_RO)
+#define PyArray_ISFARRAY(m) PyArray_FLAGSWAP(m, NPY_ARRAY_FARRAY)
+#define PyArray_ISFARRAY_RO(m) PyArray_FLAGSWAP(m, NPY_ARRAY_FARRAY_RO)
+#define PyArray_ISBEHAVED(m) PyArray_FLAGSWAP(m, NPY_ARRAY_BEHAVED)
+#define PyArray_ISBEHAVED_RO(m) PyArray_FLAGSWAP(m, NPY_ARRAY_ALIGNED)
+
+
+#define PyDataType_ISNOTSWAPPED(d) PyArray_ISNBO(((PyArray_Descr *)(d))->byteorder)
+#define PyDataType_ISBYTESWAPPED(d) (!PyDataType_ISNOTSWAPPED(d))
+
+/************************************************************
+ * A struct used by PyArray_CreateSortedStridePerm, new in 1.7.
+ ************************************************************/
+
+typedef struct {
+    npy_intp perm, stride;
+} npy_stride_sort_item;
+
+/************************************************************
+ * This is the form of the struct that's stored in the
+ * PyCapsule returned by an array's __array_struct__ attribute. See
+ * https://docs.scipy.org/doc/numpy/reference/arrays.interface.html for the full
+ * documentation.
+ ************************************************************/
+typedef struct {
+    int two;              /*
+                           * contains the integer 2 as a sanity
+                           * check
+                           */
+
+    int nd;               /* number of dimensions */
+
+    char typekind;        /*
+                           * kind in array --- character code of
+                           * typestr
+                           */
+
+    int itemsize;         /* size of each element */
+
+    int flags;            /*
+                           * how should be data interpreted. Valid
+                           * flags are CONTIGUOUS (1), F_CONTIGUOUS (2),
+                           * ALIGNED (0x100), NOTSWAPPED (0x200), and
+                           * WRITEABLE (0x400).  ARR_HAS_DESCR (0x800)
+                           * states that arrdescr field is present in
+                           * structure
+                           */
+
+    npy_intp *shape;       /*
+                            * A length-nd array of shape
+                            * information
+                            */
+
+    npy_intp *strides;    /* A length-nd array of stride information */
+
+    void *data;           /* A pointer to the first element of the array */
+
+    PyObject *descr;      /*
+                           * A list of fields or NULL (ignored if flags
+                           * does not have ARR_HAS_DESCR flag set)
+                           */
+} PyArrayInterface;
+
+/*
+ * This is a function for hooking into the PyDataMem_NEW/FREE/RENEW functions.
+ * See the documentation for PyDataMem_SetEventHook.
+ */
+typedef void (PyDataMem_EventHookFunc)(void *inp, void *outp, size_t size,
+                                       void *user_data);
+
+
+/*
+ * PyArray_DTypeMeta related definitions.
+ *
+ * As of now, this API is preliminary and will be extended as necessary.
+ */
+#if defined(NPY_INTERNAL_BUILD) && NPY_INTERNAL_BUILD
+    /*
+     * The Structures defined in this block are currently considered
+     * private API and may change without warning!
+     * Part of this (at least the size) is expected to be public API without
+     * further modifications.
+     */
+    /* TODO: Make this definition public in the API, as soon as its settled */
+    NPY_NO_EXPORT extern PyTypeObject PyArrayDTypeMeta_Type;
+
+    /*
+     * While NumPy DTypes would not need to be heap types the plan is to
+     * make DTypes available in Python at which point they will be heap types.
+     * Since we also wish to add fields to the DType class, this looks like
+     * a typical instance definition, but with PyHeapTypeObject instead of
+     * only the PyObject_HEAD.
+     * This must only be exposed very extremely careful consideration, since
+     * it is a fairly complex construct which may be better to allow
+     * refactoring of.
+     */
+    typedef struct {
+        PyHeapTypeObject super;
+
+        /*
+         * Most DTypes will have a singleton default instance, for the
+         * parametric legacy DTypes (bytes, string, void, datetime) this
+         * may be a pointer to the *prototype* instance?
+         */
+        PyArray_Descr *singleton;
+        /* Copy of the legacy DTypes type number, usually invalid. */
+        int type_num;
+
+        /* The type object of the scalar instances (may be NULL?) */
+        PyTypeObject *scalar_type;
+        /*
+         * DType flags to signal legacy, parametric, or
+         * abstract.  But plenty of space for additional information/flags.
+         */
+        npy_uint64 flags;
+
+        /*
+         * Use indirection in order to allow a fixed size for this struct.
+         * A stable ABI size makes creating a static DType less painful
+         * while also ensuring flexibility for all opaque API (with one
+         * indirection due the pointer lookup).
+         */
+        void *dt_slots;
+        void *reserved[3];
+    } PyArray_DTypeMeta;
+
+#endif  /* NPY_INTERNAL_BUILD */
+
+
+/*
+ * Use the keyword NPY_DEPRECATED_INCLUDES to ensure that the header files
+ * npy_*_*_deprecated_api.h are only included from here and nowhere else.
+ */
+#ifdef NPY_DEPRECATED_INCLUDES
+#error "Do not use the reserved keyword NPY_DEPRECATED_INCLUDES."
+#endif
+#define NPY_DEPRECATED_INCLUDES
+#if !defined(NPY_NO_DEPRECATED_API) || \
+    (NPY_NO_DEPRECATED_API < NPY_1_7_API_VERSION)
+#include "npy_1_7_deprecated_api.h"
+#endif
+/*
+ * There is no file npy_1_8_deprecated_api.h since there are no additional
+ * deprecated API features in NumPy 1.8.
+ *
+ * Note to maintainers: insert code like the following in future NumPy
+ * versions.
+ *
+ * #if !defined(NPY_NO_DEPRECATED_API) || \
+ *     (NPY_NO_DEPRECATED_API < NPY_1_9_API_VERSION)
+ * #include "npy_1_9_deprecated_api.h"
+ * #endif
+ */
+#undef NPY_DEPRECATED_INCLUDES
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NDARRAYTYPES_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/noprefix.h

@@ -0,0 +1,211 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NOPREFIX_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NOPREFIX_H_
+
+/*
+ * You can directly include noprefix.h as a backward
+ * compatibility measure
+ */
+#ifndef NPY_NO_PREFIX
+#include "ndarrayobject.h"
+#include "npy_interrupt.h"
+#endif
+
+#define SIGSETJMP   NPY_SIGSETJMP
+#define SIGLONGJMP  NPY_SIGLONGJMP
+#define SIGJMP_BUF  NPY_SIGJMP_BUF
+
+#define MAX_DIMS NPY_MAXDIMS
+
+#define longlong    npy_longlong
+#define ulonglong   npy_ulonglong
+#define Bool        npy_bool
+#define longdouble  npy_longdouble
+#define byte        npy_byte
+
+#ifndef _BSD_SOURCE
+#define ushort      npy_ushort
+#define uint        npy_uint
+#define ulong       npy_ulong
+#endif
+
+#define ubyte       npy_ubyte
+#define ushort      npy_ushort
+#define uint        npy_uint
+#define ulong       npy_ulong
+#define cfloat      npy_cfloat
+#define cdouble     npy_cdouble
+#define clongdouble npy_clongdouble
+#define Int8        npy_int8
+#define UInt8       npy_uint8
+#define Int16       npy_int16
+#define UInt16      npy_uint16
+#define Int32       npy_int32
+#define UInt32      npy_uint32
+#define Int64       npy_int64
+#define UInt64      npy_uint64
+#define Int128      npy_int128
+#define UInt128     npy_uint128
+#define Int256      npy_int256
+#define UInt256     npy_uint256
+#define Float16     npy_float16
+#define Complex32   npy_complex32
+#define Float32     npy_float32
+#define Complex64   npy_complex64
+#define Float64     npy_float64
+#define Complex128  npy_complex128
+#define Float80     npy_float80
+#define Complex160  npy_complex160
+#define Float96     npy_float96
+#define Complex192  npy_complex192
+#define Float128    npy_float128
+#define Complex256  npy_complex256
+#define intp        npy_intp
+#define uintp       npy_uintp
+#define datetime    npy_datetime
+#define timedelta   npy_timedelta
+
+#define SIZEOF_LONGLONG         NPY_SIZEOF_LONGLONG
+#define SIZEOF_INTP             NPY_SIZEOF_INTP
+#define SIZEOF_UINTP            NPY_SIZEOF_UINTP
+#define SIZEOF_HALF             NPY_SIZEOF_HALF
+#define SIZEOF_LONGDOUBLE       NPY_SIZEOF_LONGDOUBLE
+#define SIZEOF_DATETIME         NPY_SIZEOF_DATETIME
+#define SIZEOF_TIMEDELTA        NPY_SIZEOF_TIMEDELTA
+
+#define LONGLONG_FMT NPY_LONGLONG_FMT
+#define ULONGLONG_FMT NPY_ULONGLONG_FMT
+#define LONGLONG_SUFFIX NPY_LONGLONG_SUFFIX
+#define ULONGLONG_SUFFIX NPY_ULONGLONG_SUFFIX
+
+#define MAX_INT8 127
+#define MIN_INT8 -128
+#define MAX_UINT8 255
+#define MAX_INT16 32767
+#define MIN_INT16 -32768
+#define MAX_UINT16 65535
+#define MAX_INT32 2147483647
+#define MIN_INT32 (-MAX_INT32 - 1)
+#define MAX_UINT32 4294967295U
+#define MAX_INT64 LONGLONG_SUFFIX(9223372036854775807)
+#define MIN_INT64 (-MAX_INT64 - LONGLONG_SUFFIX(1))
+#define MAX_UINT64 ULONGLONG_SUFFIX(18446744073709551615)
+#define MAX_INT128 LONGLONG_SUFFIX(85070591730234615865843651857942052864)
+#define MIN_INT128 (-MAX_INT128 - LONGLONG_SUFFIX(1))
+#define MAX_UINT128 ULONGLONG_SUFFIX(170141183460469231731687303715884105728)
+#define MAX_INT256 LONGLONG_SUFFIX(57896044618658097711785492504343953926634992332820282019728792003956564819967)
+#define MIN_INT256 (-MAX_INT256 - LONGLONG_SUFFIX(1))
+#define MAX_UINT256 ULONGLONG_SUFFIX(115792089237316195423570985008687907853269984665640564039457584007913129639935)
+
+#define MAX_BYTE NPY_MAX_BYTE
+#define MIN_BYTE NPY_MIN_BYTE
+#define MAX_UBYTE NPY_MAX_UBYTE
+#define MAX_SHORT NPY_MAX_SHORT
+#define MIN_SHORT NPY_MIN_SHORT
+#define MAX_USHORT NPY_MAX_USHORT
+#define MAX_INT   NPY_MAX_INT
+#define MIN_INT   NPY_MIN_INT
+#define MAX_UINT  NPY_MAX_UINT
+#define MAX_LONG  NPY_MAX_LONG
+#define MIN_LONG  NPY_MIN_LONG
+#define MAX_ULONG  NPY_MAX_ULONG
+#define MAX_LONGLONG NPY_MAX_LONGLONG
+#define MIN_LONGLONG NPY_MIN_LONGLONG
+#define MAX_ULONGLONG NPY_MAX_ULONGLONG
+#define MIN_DATETIME NPY_MIN_DATETIME
+#define MAX_DATETIME NPY_MAX_DATETIME
+#define MIN_TIMEDELTA NPY_MIN_TIMEDELTA
+#define MAX_TIMEDELTA NPY_MAX_TIMEDELTA
+
+#define BITSOF_BOOL       NPY_BITSOF_BOOL
+#define BITSOF_CHAR       NPY_BITSOF_CHAR
+#define BITSOF_SHORT      NPY_BITSOF_SHORT
+#define BITSOF_INT        NPY_BITSOF_INT
+#define BITSOF_LONG       NPY_BITSOF_LONG
+#define BITSOF_LONGLONG   NPY_BITSOF_LONGLONG
+#define BITSOF_HALF       NPY_BITSOF_HALF
+#define BITSOF_FLOAT      NPY_BITSOF_FLOAT
+#define BITSOF_DOUBLE     NPY_BITSOF_DOUBLE
+#define BITSOF_LONGDOUBLE NPY_BITSOF_LONGDOUBLE
+#define BITSOF_DATETIME   NPY_BITSOF_DATETIME
+#define BITSOF_TIMEDELTA   NPY_BITSOF_TIMEDELTA
+
+#define _pya_malloc PyArray_malloc
+#define _pya_free PyArray_free
+#define _pya_realloc PyArray_realloc
+
+#define BEGIN_THREADS_DEF NPY_BEGIN_THREADS_DEF
+#define BEGIN_THREADS     NPY_BEGIN_THREADS
+#define END_THREADS       NPY_END_THREADS
+#define ALLOW_C_API_DEF   NPY_ALLOW_C_API_DEF
+#define ALLOW_C_API       NPY_ALLOW_C_API
+#define DISABLE_C_API     NPY_DISABLE_C_API
+
+#define PY_FAIL NPY_FAIL
+#define PY_SUCCEED NPY_SUCCEED
+
+#ifndef TRUE
+#define TRUE NPY_TRUE
+#endif
+
+#ifndef FALSE
+#define FALSE NPY_FALSE
+#endif
+
+#define LONGDOUBLE_FMT NPY_LONGDOUBLE_FMT
+
+#define CONTIGUOUS         NPY_CONTIGUOUS
+#define C_CONTIGUOUS       NPY_C_CONTIGUOUS
+#define FORTRAN            NPY_FORTRAN
+#define F_CONTIGUOUS       NPY_F_CONTIGUOUS
+#define OWNDATA            NPY_OWNDATA
+#define FORCECAST          NPY_FORCECAST
+#define ENSURECOPY         NPY_ENSURECOPY
+#define ENSUREARRAY        NPY_ENSUREARRAY
+#define ELEMENTSTRIDES     NPY_ELEMENTSTRIDES
+#define ALIGNED            NPY_ALIGNED
+#define NOTSWAPPED         NPY_NOTSWAPPED
+#define WRITEABLE          NPY_WRITEABLE
+#define WRITEBACKIFCOPY    NPY_ARRAY_WRITEBACKIFCOPY
+#define ARR_HAS_DESCR      NPY_ARR_HAS_DESCR
+#define BEHAVED            NPY_BEHAVED
+#define BEHAVED_NS         NPY_BEHAVED_NS
+#define CARRAY             NPY_CARRAY
+#define CARRAY_RO          NPY_CARRAY_RO
+#define FARRAY             NPY_FARRAY
+#define FARRAY_RO          NPY_FARRAY_RO
+#define DEFAULT            NPY_DEFAULT
+#define IN_ARRAY           NPY_IN_ARRAY
+#define OUT_ARRAY          NPY_OUT_ARRAY
+#define INOUT_ARRAY        NPY_INOUT_ARRAY
+#define IN_FARRAY          NPY_IN_FARRAY
+#define OUT_FARRAY         NPY_OUT_FARRAY
+#define INOUT_FARRAY       NPY_INOUT_FARRAY
+#define UPDATE_ALL         NPY_UPDATE_ALL
+
+#define OWN_DATA          NPY_OWNDATA
+#define BEHAVED_FLAGS     NPY_BEHAVED
+#define BEHAVED_FLAGS_NS  NPY_BEHAVED_NS
+#define CARRAY_FLAGS_RO   NPY_CARRAY_RO
+#define CARRAY_FLAGS      NPY_CARRAY
+#define FARRAY_FLAGS      NPY_FARRAY
+#define FARRAY_FLAGS_RO   NPY_FARRAY_RO
+#define DEFAULT_FLAGS     NPY_DEFAULT
+#define UPDATE_ALL_FLAGS  NPY_UPDATE_ALL_FLAGS
+
+#ifndef MIN
+#define MIN PyArray_MIN
+#endif
+#ifndef MAX
+#define MAX PyArray_MAX
+#endif
+#define MAX_INTP NPY_MAX_INTP
+#define MIN_INTP NPY_MIN_INTP
+#define MAX_UINTP NPY_MAX_UINTP
+#define INTP_FMT NPY_INTP_FMT
+
+#ifndef PYPY_VERSION
+#define REFCOUNT PyArray_REFCOUNT
+#define MAX_ELSIZE NPY_MAX_ELSIZE
+#endif
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NOPREFIX_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/npy_1_7_deprecated_api.h

@@ -0,0 +1,124 @@
+#ifndef NPY_DEPRECATED_INCLUDES
+#error "Should never include npy_*_*_deprecated_api directly."
+#endif
+
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NPY_1_7_DEPRECATED_API_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NPY_1_7_DEPRECATED_API_H_
+
+/* Emit a warning if the user did not specifically request the old API */
+#ifndef NPY_NO_DEPRECATED_API
+#if defined(_WIN32)
+#define _WARN___STR2__(x) #x
+#define _WARN___STR1__(x) _WARN___STR2__(x)
+#define _WARN___LOC__ __FILE__ "(" _WARN___STR1__(__LINE__) ") : Warning Msg: "
+#pragma message(_WARN___LOC__"Using deprecated NumPy API, disable it with " \
+                         "#define NPY_NO_DEPRECATED_API NPY_1_7_API_VERSION")
+#else
+#warning "Using deprecated NumPy API, disable it with " \
+         "#define NPY_NO_DEPRECATED_API NPY_1_7_API_VERSION"
+#endif
+#endif
+
+/*
+ * This header exists to collect all dangerous/deprecated NumPy API
+ * as of NumPy 1.7.
+ *
+ * This is an attempt to remove bad API, the proliferation of macros,
+ * and namespace pollution currently produced by the NumPy headers.
+ */
+
+/* These array flags are deprecated as of NumPy 1.7 */
+#define NPY_CONTIGUOUS NPY_ARRAY_C_CONTIGUOUS
+#define NPY_FORTRAN NPY_ARRAY_F_CONTIGUOUS
+
+/*
+ * The consistent NPY_ARRAY_* names which don't pollute the NPY_*
+ * namespace were added in NumPy 1.7.
+ *
+ * These versions of the carray flags are deprecated, but
+ * probably should only be removed after two releases instead of one.
+ */
+#define NPY_C_CONTIGUOUS   NPY_ARRAY_C_CONTIGUOUS
+#define NPY_F_CONTIGUOUS   NPY_ARRAY_F_CONTIGUOUS
+#define NPY_OWNDATA        NPY_ARRAY_OWNDATA
+#define NPY_FORCECAST      NPY_ARRAY_FORCECAST
+#define NPY_ENSURECOPY     NPY_ARRAY_ENSURECOPY
+#define NPY_ENSUREARRAY    NPY_ARRAY_ENSUREARRAY
+#define NPY_ELEMENTSTRIDES NPY_ARRAY_ELEMENTSTRIDES
+#define NPY_ALIGNED        NPY_ARRAY_ALIGNED
+#define NPY_NOTSWAPPED     NPY_ARRAY_NOTSWAPPED
+#define NPY_WRITEABLE      NPY_ARRAY_WRITEABLE
+#define NPY_BEHAVED        NPY_ARRAY_BEHAVED
+#define NPY_BEHAVED_NS     NPY_ARRAY_BEHAVED_NS
+#define NPY_CARRAY         NPY_ARRAY_CARRAY
+#define NPY_CARRAY_RO      NPY_ARRAY_CARRAY_RO
+#define NPY_FARRAY         NPY_ARRAY_FARRAY
+#define NPY_FARRAY_RO      NPY_ARRAY_FARRAY_RO
+#define NPY_DEFAULT        NPY_ARRAY_DEFAULT
+#define NPY_IN_ARRAY       NPY_ARRAY_IN_ARRAY
+#define NPY_OUT_ARRAY      NPY_ARRAY_OUT_ARRAY
+#define NPY_INOUT_ARRAY    NPY_ARRAY_INOUT_ARRAY
+#define NPY_IN_FARRAY      NPY_ARRAY_IN_FARRAY
+#define NPY_OUT_FARRAY     NPY_ARRAY_OUT_FARRAY
+#define NPY_INOUT_FARRAY   NPY_ARRAY_INOUT_FARRAY
+#define NPY_UPDATE_ALL     NPY_ARRAY_UPDATE_ALL
+
+/* This way of accessing the default type is deprecated as of NumPy 1.7 */
+#define PyArray_DEFAULT NPY_DEFAULT_TYPE
+
+/* These DATETIME bits aren't used internally */
+#define PyDataType_GetDatetimeMetaData(descr)                                 \
+    ((descr->metadata == NULL) ? NULL :                                       \
+        ((PyArray_DatetimeMetaData *)(PyCapsule_GetPointer(                   \
+                PyDict_GetItemString(                                         \
+                    descr->metadata, NPY_METADATA_DTSTR), NULL))))
+
+/*
+ * Deprecated as of NumPy 1.7, this kind of shortcut doesn't
+ * belong in the public API.
+ */
+#define NPY_AO PyArrayObject
+
+/*
+ * Deprecated as of NumPy 1.7, an all-lowercase macro doesn't
+ * belong in the public API.
+ */
+#define fortran fortran_
+
+/*
+ * Deprecated as of NumPy 1.7, as it is a namespace-polluting
+ * macro.
+ */
+#define FORTRAN_IF PyArray_FORTRAN_IF
+
+/* Deprecated as of NumPy 1.7, datetime64 uses c_metadata instead */
+#define NPY_METADATA_DTSTR "__timeunit__"
+
+/*
+ * Deprecated as of NumPy 1.7.
+ * The reasoning:
+ *  - These are for datetime, but there's no datetime "namespace".
+ *  - They just turn NPY_STR_<x> into "<x>", which is just
+ *    making something simple be indirected.
+ */
+#define NPY_STR_Y "Y"
+#define NPY_STR_M "M"
+#define NPY_STR_W "W"
+#define NPY_STR_D "D"
+#define NPY_STR_h "h"
+#define NPY_STR_m "m"
+#define NPY_STR_s "s"
+#define NPY_STR_ms "ms"
+#define NPY_STR_us "us"
+#define NPY_STR_ns "ns"
+#define NPY_STR_ps "ps"
+#define NPY_STR_fs "fs"
+#define NPY_STR_as "as"
+
+/*
+ * The macros in old_defines.h are Deprecated as of NumPy 1.7 and will be
+ * removed in the next major release.
+ */
+#include "old_defines.h"
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NPY_1_7_DEPRECATED_API_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/npy_3kcompat.h

@@ -0,0 +1,595 @@
+/*
+ * This is a convenience header file providing compatibility utilities
+ * for supporting different minor versions of Python 3.
+ * It was originally used to support the transition from Python 2,
+ * hence the "3k" naming.
+ *
+ * If you want to use this for your own projects, it's recommended to make a
+ * copy of it. Although the stuff below is unlikely to change, we don't provide
+ * strong backwards compatibility guarantees at the moment.
+ */
+
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NPY_3KCOMPAT_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NPY_3KCOMPAT_H_
+
+#include <Python.h>
+#include <stdio.h>
+
+#ifndef NPY_PY3K
+#define NPY_PY3K 1
+#endif
+
+#include "numpy/npy_common.h"
+#include "numpy/ndarrayobject.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+/*
+ * PyInt -> PyLong
+ */
+
+
+/*
+ * This is a renamed copy of the Python non-limited API function _PyLong_AsInt. It is
+ * included here because it is missing from the PyPy API. It completes the PyLong_As*
+ * group of functions and can be useful in replacing PyInt_Check.
+ */
+static inline int
+Npy__PyLong_AsInt(PyObject *obj)
+{
+    int overflow;
+    long result = PyLong_AsLongAndOverflow(obj, &overflow);
+
+    /* INT_MAX and INT_MIN are defined in Python.h */
+    if (overflow || result > INT_MAX || result < INT_MIN) {
+        /* XXX: could be cute and give a different
+           message for overflow == -1 */
+        PyErr_SetString(PyExc_OverflowError,
+                        "Python int too large to convert to C int");
+        return -1;
+    }
+    return (int)result;
+}
+
+
+#if defined(NPY_PY3K)
+/* Return True only if the long fits in a C long */
+static inline int PyInt_Check(PyObject *op) {
+    int overflow = 0;
+    if (!PyLong_Check(op)) {
+        return 0;
+    }
+    PyLong_AsLongAndOverflow(op, &overflow);
+    return (overflow == 0);
+}
+
+
+#define PyInt_FromLong PyLong_FromLong
+#define PyInt_AsLong PyLong_AsLong
+#define PyInt_AS_LONG PyLong_AsLong
+#define PyInt_AsSsize_t PyLong_AsSsize_t
+#define PyNumber_Int PyNumber_Long
+
+/* NOTE:
+ *
+ * Since the PyLong type is very different from the fixed-range PyInt,
+ * we don't define PyInt_Type -> PyLong_Type.
+ */
+#endif /* NPY_PY3K */
+
+/* Py3 changes PySlice_GetIndicesEx' first argument's type to PyObject* */
+#ifdef NPY_PY3K
+#  define NpySlice_GetIndicesEx PySlice_GetIndicesEx
+#else
+#  define NpySlice_GetIndicesEx(op, nop, start, end, step, slicelength) \
+    PySlice_GetIndicesEx((PySliceObject *)op, nop, start, end, step, slicelength)
+#endif
+
+#if PY_VERSION_HEX < 0x030900a4
+    /* Introduced in https://github.com/python/cpython/commit/d2ec81a8c99796b51fb8c49b77a7fe369863226f */
+    #define Py_SET_TYPE(obj, type) ((Py_TYPE(obj) = (type)), (void)0)
+    /* Introduced in https://github.com/python/cpython/commit/b10dc3e7a11fcdb97e285882eba6da92594f90f9 */
+    #define Py_SET_SIZE(obj, size) ((Py_SIZE(obj) = (size)), (void)0)
+    /* Introduced in https://github.com/python/cpython/commit/c86a11221df7e37da389f9c6ce6e47ea22dc44ff */
+    #define Py_SET_REFCNT(obj, refcnt) ((Py_REFCNT(obj) = (refcnt)), (void)0)
+#endif
+
+
+#define Npy_EnterRecursiveCall(x) Py_EnterRecursiveCall(x)
+
+/*
+ * PyString -> PyBytes
+ */
+
+#if defined(NPY_PY3K)
+
+#define PyString_Type PyBytes_Type
+#define PyString_Check PyBytes_Check
+#define PyStringObject PyBytesObject
+#define PyString_FromString PyBytes_FromString
+#define PyString_FromStringAndSize PyBytes_FromStringAndSize
+#define PyString_AS_STRING PyBytes_AS_STRING
+#define PyString_AsStringAndSize PyBytes_AsStringAndSize
+#define PyString_FromFormat PyBytes_FromFormat
+#define PyString_Concat PyBytes_Concat
+#define PyString_ConcatAndDel PyBytes_ConcatAndDel
+#define PyString_AsString PyBytes_AsString
+#define PyString_GET_SIZE PyBytes_GET_SIZE
+#define PyString_Size PyBytes_Size
+
+#define PyUString_Type PyUnicode_Type
+#define PyUString_Check PyUnicode_Check
+#define PyUStringObject PyUnicodeObject
+#define PyUString_FromString PyUnicode_FromString
+#define PyUString_FromStringAndSize PyUnicode_FromStringAndSize
+#define PyUString_FromFormat PyUnicode_FromFormat
+#define PyUString_Concat PyUnicode_Concat2
+#define PyUString_ConcatAndDel PyUnicode_ConcatAndDel
+#define PyUString_GET_SIZE PyUnicode_GET_SIZE
+#define PyUString_Size PyUnicode_Size
+#define PyUString_InternFromString PyUnicode_InternFromString
+#define PyUString_Format PyUnicode_Format
+
+#define PyBaseString_Check(obj) (PyUnicode_Check(obj))
+
+#else
+
+#define PyBytes_Type PyString_Type
+#define PyBytes_Check PyString_Check
+#define PyBytesObject PyStringObject
+#define PyBytes_FromString PyString_FromString
+#define PyBytes_FromStringAndSize PyString_FromStringAndSize
+#define PyBytes_AS_STRING PyString_AS_STRING
+#define PyBytes_AsStringAndSize PyString_AsStringAndSize
+#define PyBytes_FromFormat PyString_FromFormat
+#define PyBytes_Concat PyString_Concat
+#define PyBytes_ConcatAndDel PyString_ConcatAndDel
+#define PyBytes_AsString PyString_AsString
+#define PyBytes_GET_SIZE PyString_GET_SIZE
+#define PyBytes_Size PyString_Size
+
+#define PyUString_Type PyString_Type
+#define PyUString_Check PyString_Check
+#define PyUStringObject PyStringObject
+#define PyUString_FromString PyString_FromString
+#define PyUString_FromStringAndSize PyString_FromStringAndSize
+#define PyUString_FromFormat PyString_FromFormat
+#define PyUString_Concat PyString_Concat
+#define PyUString_ConcatAndDel PyString_ConcatAndDel
+#define PyUString_GET_SIZE PyString_GET_SIZE
+#define PyUString_Size PyString_Size
+#define PyUString_InternFromString PyString_InternFromString
+#define PyUString_Format PyString_Format
+
+#define PyBaseString_Check(obj) (PyBytes_Check(obj) || PyUnicode_Check(obj))
+
+#endif /* NPY_PY3K */
+
+/*
+ * Macros to protect CRT calls against instant termination when passed an
+ * invalid parameter (https://bugs.python.org/issue23524).
+ */
+#if defined _MSC_VER && _MSC_VER >= 1900
+
+#include <stdlib.h>
+
+extern _invalid_parameter_handler _Py_silent_invalid_parameter_handler;
+#define NPY_BEGIN_SUPPRESS_IPH { _invalid_parameter_handler _Py_old_handler = \
+    _set_thread_local_invalid_parameter_handler(_Py_silent_invalid_parameter_handler);
+#define NPY_END_SUPPRESS_IPH _set_thread_local_invalid_parameter_handler(_Py_old_handler); }
+
+#else
+
+#define NPY_BEGIN_SUPPRESS_IPH
+#define NPY_END_SUPPRESS_IPH
+
+#endif /* _MSC_VER >= 1900 */
+
+
+static inline void
+PyUnicode_ConcatAndDel(PyObject **left, PyObject *right)
+{
+    Py_SETREF(*left, PyUnicode_Concat(*left, right));
+    Py_DECREF(right);
+}
+
+static inline void
+PyUnicode_Concat2(PyObject **left, PyObject *right)
+{
+    Py_SETREF(*left, PyUnicode_Concat(*left, right));
+}
+
+/*
+ * PyFile_* compatibility
+ */
+
+/*
+ * Get a FILE* handle to the file represented by the Python object
+ */
+static inline FILE*
+npy_PyFile_Dup2(PyObject *file, char *mode, npy_off_t *orig_pos)
+{
+    int fd, fd2, unbuf;
+    Py_ssize_t fd2_tmp;
+    PyObject *ret, *os, *io, *io_raw;
+    npy_off_t pos;
+    FILE *handle;
+
+    /* For Python 2 PyFileObject, use PyFile_AsFile */
+#if !defined(NPY_PY3K)
+    if (PyFile_Check(file)) {
+        return PyFile_AsFile(file);
+    }
+#endif
+
+    /* Flush first to ensure things end up in the file in the correct order */
+    ret = PyObject_CallMethod(file, "flush", "");
+    if (ret == NULL) {
+        return NULL;
+    }
+    Py_DECREF(ret);
+    fd = PyObject_AsFileDescriptor(file);
+    if (fd == -1) {
+        return NULL;
+    }
+
+    /*
+     * The handle needs to be dup'd because we have to call fclose
+     * at the end
+     */
+    os = PyImport_ImportModule("os");
+    if (os == NULL) {
+        return NULL;
+    }
+    ret = PyObject_CallMethod(os, "dup", "i", fd);
+    Py_DECREF(os);
+    if (ret == NULL) {
+        return NULL;
+    }
+    fd2_tmp = PyNumber_AsSsize_t(ret, PyExc_IOError);
+    Py_DECREF(ret);
+    if (fd2_tmp == -1 && PyErr_Occurred()) {
+        return NULL;
+    }
+    if (fd2_tmp < INT_MIN || fd2_tmp > INT_MAX) {
+        PyErr_SetString(PyExc_IOError,
+                        "Getting an 'int' from os.dup() failed");
+        return NULL;
+    }
+    fd2 = (int)fd2_tmp;
+
+    /* Convert to FILE* handle */
+#ifdef _WIN32
+    NPY_BEGIN_SUPPRESS_IPH
+    handle = _fdopen(fd2, mode);
+    NPY_END_SUPPRESS_IPH
+#else
+    handle = fdopen(fd2, mode);
+#endif
+    if (handle == NULL) {
+        PyErr_SetString(PyExc_IOError,
+                        "Getting a FILE* from a Python file object via "
+                        "_fdopen failed. If you built NumPy, you probably "
+                        "linked with the wrong debug/release runtime");
+        return NULL;
+    }
+
+    /* Record the original raw file handle position */
+    *orig_pos = npy_ftell(handle);
+    if (*orig_pos == -1) {
+        /* The io module is needed to determine if buffering is used */
+        io = PyImport_ImportModule("io");
+        if (io == NULL) {
+            fclose(handle);
+            return NULL;
+        }
+        /* File object instances of RawIOBase are unbuffered */
+        io_raw = PyObject_GetAttrString(io, "RawIOBase");
+        Py_DECREF(io);
+        if (io_raw == NULL) {
+            fclose(handle);
+            return NULL;
+        }
+        unbuf = PyObject_IsInstance(file, io_raw);
+        Py_DECREF(io_raw);
+        if (unbuf == 1) {
+            /* Succeed if the IO is unbuffered */
+            return handle;
+        }
+        else {
+            PyErr_SetString(PyExc_IOError, "obtaining file position failed");
+            fclose(handle);
+            return NULL;
+        }
+    }
+
+    /* Seek raw handle to the Python-side position */
+    ret = PyObject_CallMethod(file, "tell", "");
+    if (ret == NULL) {
+        fclose(handle);
+        return NULL;
+    }
+    pos = PyLong_AsLongLong(ret);
+    Py_DECREF(ret);
+    if (PyErr_Occurred()) {
+        fclose(handle);
+        return NULL;
+    }
+    if (npy_fseek(handle, pos, SEEK_SET) == -1) {
+        PyErr_SetString(PyExc_IOError, "seeking file failed");
+        fclose(handle);
+        return NULL;
+    }
+    return handle;
+}
+
+/*
+ * Close the dup-ed file handle, and seek the Python one to the current position
+ */
+static inline int
+npy_PyFile_DupClose2(PyObject *file, FILE* handle, npy_off_t orig_pos)
+{
+    int fd, unbuf;
+    PyObject *ret, *io, *io_raw;
+    npy_off_t position;
+
+    /* For Python 2 PyFileObject, do nothing */
+#if !defined(NPY_PY3K)
+    if (PyFile_Check(file)) {
+        return 0;
+    }
+#endif
+
+    position = npy_ftell(handle);
+
+    /* Close the FILE* handle */
+    fclose(handle);
+
+    /*
+     * Restore original file handle position, in order to not confuse
+     * Python-side data structures
+     */
+    fd = PyObject_AsFileDescriptor(file);
+    if (fd == -1) {
+        return -1;
+    }
+
+    if (npy_lseek(fd, orig_pos, SEEK_SET) == -1) {
+
+        /* The io module is needed to determine if buffering is used */
+        io = PyImport_ImportModule("io");
+        if (io == NULL) {
+            return -1;
+        }
+        /* File object instances of RawIOBase are unbuffered */
+        io_raw = PyObject_GetAttrString(io, "RawIOBase");
+        Py_DECREF(io);
+        if (io_raw == NULL) {
+            return -1;
+        }
+        unbuf = PyObject_IsInstance(file, io_raw);
+        Py_DECREF(io_raw);
+        if (unbuf == 1) {
+            /* Succeed if the IO is unbuffered */
+            return 0;
+        }
+        else {
+            PyErr_SetString(PyExc_IOError, "seeking file failed");
+            return -1;
+        }
+    }
+
+    if (position == -1) {
+        PyErr_SetString(PyExc_IOError, "obtaining file position failed");
+        return -1;
+    }
+
+    /* Seek Python-side handle to the FILE* handle position */
+    ret = PyObject_CallMethod(file, "seek", NPY_OFF_T_PYFMT "i", position, 0);
+    if (ret == NULL) {
+        return -1;
+    }
+    Py_DECREF(ret);
+    return 0;
+}
+
+static inline int
+npy_PyFile_Check(PyObject *file)
+{
+    int fd;
+    /* For Python 2, check if it is a PyFileObject */
+#if !defined(NPY_PY3K)
+    if (PyFile_Check(file)) {
+        return 1;
+    }
+#endif
+    fd = PyObject_AsFileDescriptor(file);
+    if (fd == -1) {
+        PyErr_Clear();
+        return 0;
+    }
+    return 1;
+}
+
+static inline PyObject*
+npy_PyFile_OpenFile(PyObject *filename, const char *mode)
+{
+    PyObject *open;
+    open = PyDict_GetItemString(PyEval_GetBuiltins(), "open");
+    if (open == NULL) {
+        return NULL;
+    }
+    return PyObject_CallFunction(open, "Os", filename, mode);
+}
+
+static inline int
+npy_PyFile_CloseFile(PyObject *file)
+{
+    PyObject *ret;
+
+    ret = PyObject_CallMethod(file, "close", NULL);
+    if (ret == NULL) {
+        return -1;
+    }
+    Py_DECREF(ret);
+    return 0;
+}
+
+
+/* This is a copy of _PyErr_ChainExceptions
+ */
+static inline void
+npy_PyErr_ChainExceptions(PyObject *exc, PyObject *val, PyObject *tb)
+{
+    if (exc == NULL)
+        return;
+
+    if (PyErr_Occurred()) {
+        /* only py3 supports this anyway */
+        #ifdef NPY_PY3K
+            PyObject *exc2, *val2, *tb2;
+            PyErr_Fetch(&exc2, &val2, &tb2);
+            PyErr_NormalizeException(&exc, &val, &tb);
+            if (tb != NULL) {
+                PyException_SetTraceback(val, tb);
+                Py_DECREF(tb);
+            }
+            Py_DECREF(exc);
+            PyErr_NormalizeException(&exc2, &val2, &tb2);
+            PyException_SetContext(val2, val);
+            PyErr_Restore(exc2, val2, tb2);
+        #endif
+    }
+    else {
+        PyErr_Restore(exc, val, tb);
+    }
+}
+
+
+/* This is a copy of _PyErr_ChainExceptions, with:
+ *  - a minimal implementation for python 2
+ *  - __cause__ used instead of __context__
+ */
+static inline void
+npy_PyErr_ChainExceptionsCause(PyObject *exc, PyObject *val, PyObject *tb)
+{
+    if (exc == NULL)
+        return;
+
+    if (PyErr_Occurred()) {
+        /* only py3 supports this anyway */
+        #ifdef NPY_PY3K
+            PyObject *exc2, *val2, *tb2;
+            PyErr_Fetch(&exc2, &val2, &tb2);
+            PyErr_NormalizeException(&exc, &val, &tb);
+            if (tb != NULL) {
+                PyException_SetTraceback(val, tb);
+                Py_DECREF(tb);
+            }
+            Py_DECREF(exc);
+            PyErr_NormalizeException(&exc2, &val2, &tb2);
+            PyException_SetCause(val2, val);
+            PyErr_Restore(exc2, val2, tb2);
+        #endif
+    }
+    else {
+        PyErr_Restore(exc, val, tb);
+    }
+}
+
+/*
+ * PyObject_Cmp
+ */
+#if defined(NPY_PY3K)
+static inline int
+PyObject_Cmp(PyObject *i1, PyObject *i2, int *cmp)
+{
+    int v;
+    v = PyObject_RichCompareBool(i1, i2, Py_LT);
+    if (v == 1) {
+        *cmp = -1;
+        return 1;
+    }
+    else if (v == -1) {
+        return -1;
+    }
+
+    v = PyObject_RichCompareBool(i1, i2, Py_GT);
+    if (v == 1) {
+        *cmp = 1;
+        return 1;
+    }
+    else if (v == -1) {
+        return -1;
+    }
+
+    v = PyObject_RichCompareBool(i1, i2, Py_EQ);
+    if (v == 1) {
+        *cmp = 0;
+        return 1;
+    }
+    else {
+        *cmp = 0;
+        return -1;
+    }
+}
+#endif
+
+/*
+ * PyCObject functions adapted to PyCapsules.
+ *
+ * The main job here is to get rid of the improved error handling
+ * of PyCapsules. It's a shame...
+ */
+static inline PyObject *
+NpyCapsule_FromVoidPtr(void *ptr, void (*dtor)(PyObject *))
+{
+    PyObject *ret = PyCapsule_New(ptr, NULL, dtor);
+    if (ret == NULL) {
+        PyErr_Clear();
+    }
+    return ret;
+}
+
+static inline PyObject *
+NpyCapsule_FromVoidPtrAndDesc(void *ptr, void* context, void (*dtor)(PyObject *))
+{
+    PyObject *ret = NpyCapsule_FromVoidPtr(ptr, dtor);
+    if (ret != NULL && PyCapsule_SetContext(ret, context) != 0) {
+        PyErr_Clear();
+        Py_DECREF(ret);
+        ret = NULL;
+    }
+    return ret;
+}
+
+static inline void *
+NpyCapsule_AsVoidPtr(PyObject *obj)
+{
+    void *ret = PyCapsule_GetPointer(obj, NULL);
+    if (ret == NULL) {
+        PyErr_Clear();
+    }
+    return ret;
+}
+
+static inline void *
+NpyCapsule_GetDesc(PyObject *obj)
+{
+    return PyCapsule_GetContext(obj);
+}
+
+static inline int
+NpyCapsule_Check(PyObject *ptr)
+{
+    return PyCapsule_CheckExact(ptr);
+}
+
+#ifdef __cplusplus
+}
+#endif
+
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NPY_3KCOMPAT_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/npy_common.h

@@ -0,0 +1,1086 @@
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NPY_COMMON_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NPY_COMMON_H_
+
+/* need Python.h for npy_intp, npy_uintp */
+#include <Python.h>
+
+/* numpconfig.h is auto-generated */
+#include "numpyconfig.h"
+#ifdef HAVE_NPY_CONFIG_H
+#include <npy_config.h>
+#endif
+
+/*
+ * using static inline modifiers when defining npy_math functions
+ * allows the compiler to make optimizations when possible
+ */
+#ifndef NPY_INLINE_MATH
+#if defined(NPY_INTERNAL_BUILD) && NPY_INTERNAL_BUILD
+    #define NPY_INLINE_MATH 1
+#else
+    #define NPY_INLINE_MATH 0
+#endif
+#endif
+
+/*
+ * gcc does not unroll even with -O3
+ * use with care, unrolling on modern cpus rarely speeds things up
+ */
+#ifdef HAVE_ATTRIBUTE_OPTIMIZE_UNROLL_LOOPS
+#define NPY_GCC_UNROLL_LOOPS \
+    __attribute__((optimize("unroll-loops")))
+#else
+#define NPY_GCC_UNROLL_LOOPS
+#endif
+
+/* highest gcc optimization level, enabled autovectorizer */
+#ifdef HAVE_ATTRIBUTE_OPTIMIZE_OPT_3
+#define NPY_GCC_OPT_3 __attribute__((optimize("O3")))
+#else
+#define NPY_GCC_OPT_3
+#endif
+
+/*
+ * mark an argument (starting from 1) that must not be NULL and is not checked
+ * DO NOT USE IF FUNCTION CHECKS FOR NULL!! the compiler will remove the check
+ */
+#ifdef HAVE_ATTRIBUTE_NONNULL
+#define NPY_GCC_NONNULL(n) __attribute__((nonnull(n)))
+#else
+#define NPY_GCC_NONNULL(n)
+#endif
+
+/*
+ * give a hint to the compiler which branch is more likely or unlikely
+ * to occur, e.g. rare error cases:
+ *
+ * if (NPY_UNLIKELY(failure == 0))
+ *    return NULL;
+ *
+ * the double !! is to cast the expression (e.g. NULL) to a boolean required by
+ * the intrinsic
+ */
+#ifdef HAVE___BUILTIN_EXPECT
+#define NPY_LIKELY(x) __builtin_expect(!!(x), 1)
+#define NPY_UNLIKELY(x) __builtin_expect(!!(x), 0)
+#else
+#define NPY_LIKELY(x) (x)
+#define NPY_UNLIKELY(x) (x)
+#endif
+
+#ifdef HAVE___BUILTIN_PREFETCH
+/* unlike _mm_prefetch also works on non-x86 */
+#define NPY_PREFETCH(x, rw, loc) __builtin_prefetch((x), (rw), (loc))
+#else
+#ifdef NPY_HAVE_SSE
+/* _MM_HINT_ET[01] (rw = 1) unsupported, only available in gcc >= 4.9 */
+#define NPY_PREFETCH(x, rw, loc) _mm_prefetch((x), loc == 0 ? _MM_HINT_NTA : \
+                                             (loc == 1 ? _MM_HINT_T2 : \
+                                              (loc == 2 ? _MM_HINT_T1 : \
+                                               (loc == 3 ? _MM_HINT_T0 : -1))))
+#else
+#define NPY_PREFETCH(x, rw,loc)
+#endif
+#endif
+
+/* `NPY_INLINE` kept for backwards compatibility; use `inline` instead */
+#if defined(_MSC_VER) && !defined(__clang__)
+    #define NPY_INLINE __inline
+/* clang included here to handle clang-cl on Windows */
+#elif defined(__GNUC__) || defined(__clang__)
+    #if defined(__STRICT_ANSI__)
+         #define NPY_INLINE __inline__
+    #else
+         #define NPY_INLINE inline
+    #endif
+#else
+    #define NPY_INLINE
+#endif
+
+#ifdef _MSC_VER
+    #define NPY_FINLINE static __forceinline
+#elif defined(__GNUC__)
+    #define NPY_FINLINE static inline __attribute__((always_inline))
+#else
+    #define NPY_FINLINE static
+#endif
+
+#if defined(_MSC_VER)
+    #define NPY_NOINLINE static __declspec(noinline)
+#elif defined(__GNUC__) || defined(__clang__)
+    #define NPY_NOINLINE static __attribute__((noinline))
+#else
+    #define NPY_NOINLINE static
+#endif
+
+#ifdef HAVE___THREAD
+    #define NPY_TLS __thread
+#else
+    #ifdef HAVE___DECLSPEC_THREAD_
+        #define NPY_TLS __declspec(thread)
+    #else
+        #define NPY_TLS
+    #endif
+#endif
+
+#ifdef WITH_CPYCHECKER_RETURNS_BORROWED_REF_ATTRIBUTE
+  #define NPY_RETURNS_BORROWED_REF \
+    __attribute__((cpychecker_returns_borrowed_ref))
+#else
+  #define NPY_RETURNS_BORROWED_REF
+#endif
+
+#ifdef WITH_CPYCHECKER_STEALS_REFERENCE_TO_ARG_ATTRIBUTE
+  #define NPY_STEALS_REF_TO_ARG(n) \
+   __attribute__((cpychecker_steals_reference_to_arg(n)))
+#else
+ #define NPY_STEALS_REF_TO_ARG(n)
+#endif
+
+/* 64 bit file position support, also on win-amd64. Issue gh-2256 */
+#if defined(_MSC_VER) && defined(_WIN64) && (_MSC_VER > 1400) || \
+    defined(__MINGW32__) || defined(__MINGW64__)
+    #include <io.h>
+
+    #define npy_fseek _fseeki64
+    #define npy_ftell _ftelli64
+    #define npy_lseek _lseeki64
+    #define npy_off_t npy_int64
+
+    #if NPY_SIZEOF_INT == 8
+        #define NPY_OFF_T_PYFMT "i"
+    #elif NPY_SIZEOF_LONG == 8
+        #define NPY_OFF_T_PYFMT "l"
+    #elif NPY_SIZEOF_LONGLONG == 8
+        #define NPY_OFF_T_PYFMT "L"
+    #else
+        #error Unsupported size for type off_t
+    #endif
+#else
+#ifdef HAVE_FSEEKO
+    #define npy_fseek fseeko
+#else
+    #define npy_fseek fseek
+#endif
+#ifdef HAVE_FTELLO
+    #define npy_ftell ftello
+#else
+    #define npy_ftell ftell
+#endif
+    #include <sys/types.h>
+    #ifndef _WIN32
+        #include <unistd.h>
+    #endif
+    #define npy_lseek lseek
+    #define npy_off_t off_t
+
+    #if NPY_SIZEOF_OFF_T == NPY_SIZEOF_SHORT
+        #define NPY_OFF_T_PYFMT "h"
+    #elif NPY_SIZEOF_OFF_T == NPY_SIZEOF_INT
+        #define NPY_OFF_T_PYFMT "i"
+    #elif NPY_SIZEOF_OFF_T == NPY_SIZEOF_LONG
+        #define NPY_OFF_T_PYFMT "l"
+    #elif NPY_SIZEOF_OFF_T == NPY_SIZEOF_LONGLONG
+        #define NPY_OFF_T_PYFMT "L"
+    #else
+        #error Unsupported size for type off_t
+    #endif
+#endif
+
+/* enums for detected endianness */
+enum {
+        NPY_CPU_UNKNOWN_ENDIAN,
+        NPY_CPU_LITTLE,
+        NPY_CPU_BIG
+};
+
+/*
+ * This is to typedef npy_intp to the appropriate pointer size for this
+ * platform.  Py_intptr_t, Py_uintptr_t are defined in pyport.h.
+ */
+typedef Py_intptr_t npy_intp;
+typedef Py_uintptr_t npy_uintp;
+
+/*
+ * Define sizes that were not defined in numpyconfig.h.
+ */
+#define NPY_SIZEOF_CHAR 1
+#define NPY_SIZEOF_BYTE 1
+#define NPY_SIZEOF_DATETIME 8
+#define NPY_SIZEOF_TIMEDELTA 8
+#define NPY_SIZEOF_INTP NPY_SIZEOF_PY_INTPTR_T
+#define NPY_SIZEOF_UINTP NPY_SIZEOF_PY_INTPTR_T
+#define NPY_SIZEOF_HALF 2
+#define NPY_SIZEOF_CFLOAT NPY_SIZEOF_COMPLEX_FLOAT
+#define NPY_SIZEOF_CDOUBLE NPY_SIZEOF_COMPLEX_DOUBLE
+#define NPY_SIZEOF_CLONGDOUBLE NPY_SIZEOF_COMPLEX_LONGDOUBLE
+
+#ifdef constchar
+#undef constchar
+#endif
+
+#define NPY_SSIZE_T_PYFMT "n"
+#define constchar char
+
+/* NPY_INTP_FMT Note:
+ *      Unlike the other NPY_*_FMT macros, which are used with PyOS_snprintf,
+ *      NPY_INTP_FMT is used with PyErr_Format and PyUnicode_FromFormat. Those
+ *      functions use different formatting codes that are portably specified
+ *      according to the Python documentation. See issue gh-2388.
+ */
+#if NPY_SIZEOF_PY_INTPTR_T == NPY_SIZEOF_INT
+        #define NPY_INTP NPY_INT
+        #define NPY_UINTP NPY_UINT
+        #define PyIntpArrType_Type PyIntArrType_Type
+        #define PyUIntpArrType_Type PyUIntArrType_Type
+        #define NPY_MAX_INTP NPY_MAX_INT
+        #define NPY_MIN_INTP NPY_MIN_INT
+        #define NPY_MAX_UINTP NPY_MAX_UINT
+        #define NPY_INTP_FMT "d"
+#elif NPY_SIZEOF_PY_INTPTR_T == NPY_SIZEOF_LONG
+        #define NPY_INTP NPY_LONG
+        #define NPY_UINTP NPY_ULONG
+        #define PyIntpArrType_Type PyLongArrType_Type
+        #define PyUIntpArrType_Type PyULongArrType_Type
+        #define NPY_MAX_INTP NPY_MAX_LONG
+        #define NPY_MIN_INTP NPY_MIN_LONG
+        #define NPY_MAX_UINTP NPY_MAX_ULONG
+        #define NPY_INTP_FMT "ld"
+#elif defined(PY_LONG_LONG) && (NPY_SIZEOF_PY_INTPTR_T == NPY_SIZEOF_LONGLONG)
+        #define NPY_INTP NPY_LONGLONG
+        #define NPY_UINTP NPY_ULONGLONG
+        #define PyIntpArrType_Type PyLongLongArrType_Type
+        #define PyUIntpArrType_Type PyULongLongArrType_Type
+        #define NPY_MAX_INTP NPY_MAX_LONGLONG
+        #define NPY_MIN_INTP NPY_MIN_LONGLONG
+        #define NPY_MAX_UINTP NPY_MAX_ULONGLONG
+        #define NPY_INTP_FMT "lld"
+#endif
+
+/*
+ * We can only use C99 formats for npy_int_p if it is the same as
+ * intp_t, hence the condition on HAVE_UNITPTR_T
+ */
+#if (NPY_USE_C99_FORMATS) == 1 \
+        && (defined HAVE_UINTPTR_T) \
+        && (defined HAVE_INTTYPES_H)
+        #include <inttypes.h>
+        #undef NPY_INTP_FMT
+        #define NPY_INTP_FMT PRIdPTR
+#endif
+
+
+/*
+ * Some platforms don't define bool, long long, or long double.
+ * Handle that here.
+ */
+#define NPY_BYTE_FMT "hhd"
+#define NPY_UBYTE_FMT "hhu"
+#define NPY_SHORT_FMT "hd"
+#define NPY_USHORT_FMT "hu"
+#define NPY_INT_FMT "d"
+#define NPY_UINT_FMT "u"
+#define NPY_LONG_FMT "ld"
+#define NPY_ULONG_FMT "lu"
+#define NPY_HALF_FMT "g"
+#define NPY_FLOAT_FMT "g"
+#define NPY_DOUBLE_FMT "g"
+
+
+#ifdef PY_LONG_LONG
+typedef PY_LONG_LONG npy_longlong;
+typedef unsigned PY_LONG_LONG npy_ulonglong;
+#  ifdef _MSC_VER
+#    define NPY_LONGLONG_FMT         "I64d"
+#    define NPY_ULONGLONG_FMT        "I64u"
+#  else
+#    define NPY_LONGLONG_FMT         "lld"
+#    define NPY_ULONGLONG_FMT        "llu"
+#  endif
+#  ifdef _MSC_VER
+#    define NPY_LONGLONG_SUFFIX(x)   (x##i64)
+#    define NPY_ULONGLONG_SUFFIX(x)  (x##Ui64)
+#  else
+#    define NPY_LONGLONG_SUFFIX(x)   (x##LL)
+#    define NPY_ULONGLONG_SUFFIX(x)  (x##ULL)
+#  endif
+#else
+typedef long npy_longlong;
+typedef unsigned long npy_ulonglong;
+#  define NPY_LONGLONG_SUFFIX(x)  (x##L)
+#  define NPY_ULONGLONG_SUFFIX(x) (x##UL)
+#endif
+
+
+typedef unsigned char npy_bool;
+#define NPY_FALSE 0
+#define NPY_TRUE 1
+/*
+ * `NPY_SIZEOF_LONGDOUBLE` isn't usually equal to sizeof(long double).
+ * In some certain cases, it may forced to be equal to sizeof(double)
+ * even against the compiler implementation and the same goes for
+ * `complex long double`.
+ *
+ * Therefore, avoid `long double`, use `npy_longdouble` instead,
+ * and when it comes to standard math functions make sure of using
+ * the double version when `NPY_SIZEOF_LONGDOUBLE` == `NPY_SIZEOF_DOUBLE`.
+ * For example:
+ *   npy_longdouble *ptr, x;
+ *   #if NPY_SIZEOF_LONGDOUBLE == NPY_SIZEOF_DOUBLE
+ *       npy_longdouble r = modf(x, ptr);
+ *   #else
+ *       npy_longdouble r = modfl(x, ptr);
+ *   #endif
+ *
+ * See https://github.com/numpy/numpy/issues/20348
+ */
+#if NPY_SIZEOF_LONGDOUBLE == NPY_SIZEOF_DOUBLE
+    #define NPY_LONGDOUBLE_FMT "g"
+    typedef double npy_longdouble;
+#else
+    #define NPY_LONGDOUBLE_FMT "Lg"
+    typedef long double npy_longdouble;
+#endif
+
+#ifndef Py_USING_UNICODE
+#error Must use Python with unicode enabled.
+#endif
+
+
+typedef signed char npy_byte;
+typedef unsigned char npy_ubyte;
+typedef unsigned short npy_ushort;
+typedef unsigned int npy_uint;
+typedef unsigned long npy_ulong;
+
+/* These are for completeness */
+typedef char npy_char;
+typedef short npy_short;
+typedef int npy_int;
+typedef long npy_long;
+typedef float npy_float;
+typedef double npy_double;
+
+typedef Py_hash_t npy_hash_t;
+#define NPY_SIZEOF_HASH_T NPY_SIZEOF_INTP
+
+/*
+ * Disabling C99 complex usage: a lot of C code in numpy/scipy rely on being
+ * able to do .real/.imag. Will have to convert code first.
+ */
+#if 0
+#if defined(NPY_USE_C99_COMPLEX) && defined(NPY_HAVE_COMPLEX_DOUBLE)
+typedef complex npy_cdouble;
+#else
+typedef struct { double real, imag; } npy_cdouble;
+#endif
+
+#if defined(NPY_USE_C99_COMPLEX) && defined(NPY_HAVE_COMPLEX_FLOAT)
+typedef complex float npy_cfloat;
+#else
+typedef struct { float real, imag; } npy_cfloat;
+#endif
+
+#if defined(NPY_USE_C99_COMPLEX) && defined(NPY_HAVE_COMPLEX_LONG_DOUBLE)
+typedef complex long double npy_clongdouble;
+#else
+typedef struct {npy_longdouble real, imag;} npy_clongdouble;
+#endif
+#endif
+#if NPY_SIZEOF_COMPLEX_DOUBLE != 2 * NPY_SIZEOF_DOUBLE
+#error npy_cdouble definition is not compatible with C99 complex definition ! \
+        Please contact NumPy maintainers and give detailed information about your \
+        compiler and platform
+#endif
+typedef struct { double real, imag; } npy_cdouble;
+
+#if NPY_SIZEOF_COMPLEX_FLOAT != 2 * NPY_SIZEOF_FLOAT
+#error npy_cfloat definition is not compatible with C99 complex definition ! \
+        Please contact NumPy maintainers and give detailed information about your \
+        compiler and platform
+#endif
+typedef struct { float real, imag; } npy_cfloat;
+
+#if NPY_SIZEOF_COMPLEX_LONGDOUBLE != 2 * NPY_SIZEOF_LONGDOUBLE
+#error npy_clongdouble definition is not compatible with C99 complex definition ! \
+        Please contact NumPy maintainers and give detailed information about your \
+        compiler and platform
+#endif
+typedef struct { npy_longdouble real, imag; } npy_clongdouble;
+
+/*
+ * numarray-style bit-width typedefs
+ */
+#define NPY_MAX_INT8 127
+#define NPY_MIN_INT8 -128
+#define NPY_MAX_UINT8 255
+#define NPY_MAX_INT16 32767
+#define NPY_MIN_INT16 -32768
+#define NPY_MAX_UINT16 65535
+#define NPY_MAX_INT32 2147483647
+#define NPY_MIN_INT32 (-NPY_MAX_INT32 - 1)
+#define NPY_MAX_UINT32 4294967295U
+#define NPY_MAX_INT64 NPY_LONGLONG_SUFFIX(9223372036854775807)
+#define NPY_MIN_INT64 (-NPY_MAX_INT64 - NPY_LONGLONG_SUFFIX(1))
+#define NPY_MAX_UINT64 NPY_ULONGLONG_SUFFIX(18446744073709551615)
+#define NPY_MAX_INT128 NPY_LONGLONG_SUFFIX(85070591730234615865843651857942052864)
+#define NPY_MIN_INT128 (-NPY_MAX_INT128 - NPY_LONGLONG_SUFFIX(1))
+#define NPY_MAX_UINT128 NPY_ULONGLONG_SUFFIX(170141183460469231731687303715884105728)
+#define NPY_MAX_INT256 NPY_LONGLONG_SUFFIX(57896044618658097711785492504343953926634992332820282019728792003956564819967)
+#define NPY_MIN_INT256 (-NPY_MAX_INT256 - NPY_LONGLONG_SUFFIX(1))
+#define NPY_MAX_UINT256 NPY_ULONGLONG_SUFFIX(115792089237316195423570985008687907853269984665640564039457584007913129639935)
+#define NPY_MIN_DATETIME NPY_MIN_INT64
+#define NPY_MAX_DATETIME NPY_MAX_INT64
+#define NPY_MIN_TIMEDELTA NPY_MIN_INT64
+#define NPY_MAX_TIMEDELTA NPY_MAX_INT64
+
+        /* Need to find the number of bits for each type and
+           make definitions accordingly.
+
+           C states that sizeof(char) == 1 by definition
+
+           So, just using the sizeof keyword won't help.
+
+           It also looks like Python itself uses sizeof(char) quite a
+           bit, which by definition should be 1 all the time.
+
+           Idea: Make Use of CHAR_BIT which should tell us how many
+           BITS per CHARACTER
+        */
+
+        /* Include platform definitions -- These are in the C89/90 standard */
+#include <limits.h>
+#define NPY_MAX_BYTE SCHAR_MAX
+#define NPY_MIN_BYTE SCHAR_MIN
+#define NPY_MAX_UBYTE UCHAR_MAX
+#define NPY_MAX_SHORT SHRT_MAX
+#define NPY_MIN_SHORT SHRT_MIN
+#define NPY_MAX_USHORT USHRT_MAX
+#define NPY_MAX_INT   INT_MAX
+#ifndef INT_MIN
+#define INT_MIN (-INT_MAX - 1)
+#endif
+#define NPY_MIN_INT   INT_MIN
+#define NPY_MAX_UINT  UINT_MAX
+#define NPY_MAX_LONG  LONG_MAX
+#define NPY_MIN_LONG  LONG_MIN
+#define NPY_MAX_ULONG  ULONG_MAX
+
+#define NPY_BITSOF_BOOL (sizeof(npy_bool) * CHAR_BIT)
+#define NPY_BITSOF_CHAR CHAR_BIT
+#define NPY_BITSOF_BYTE (NPY_SIZEOF_BYTE * CHAR_BIT)
+#define NPY_BITSOF_SHORT (NPY_SIZEOF_SHORT * CHAR_BIT)
+#define NPY_BITSOF_INT (NPY_SIZEOF_INT * CHAR_BIT)
+#define NPY_BITSOF_LONG (NPY_SIZEOF_LONG * CHAR_BIT)
+#define NPY_BITSOF_LONGLONG (NPY_SIZEOF_LONGLONG * CHAR_BIT)
+#define NPY_BITSOF_INTP (NPY_SIZEOF_INTP * CHAR_BIT)
+#define NPY_BITSOF_HALF (NPY_SIZEOF_HALF * CHAR_BIT)
+#define NPY_BITSOF_FLOAT (NPY_SIZEOF_FLOAT * CHAR_BIT)
+#define NPY_BITSOF_DOUBLE (NPY_SIZEOF_DOUBLE * CHAR_BIT)
+#define NPY_BITSOF_LONGDOUBLE (NPY_SIZEOF_LONGDOUBLE * CHAR_BIT)
+#define NPY_BITSOF_CFLOAT (NPY_SIZEOF_CFLOAT * CHAR_BIT)
+#define NPY_BITSOF_CDOUBLE (NPY_SIZEOF_CDOUBLE * CHAR_BIT)
+#define NPY_BITSOF_CLONGDOUBLE (NPY_SIZEOF_CLONGDOUBLE * CHAR_BIT)
+#define NPY_BITSOF_DATETIME (NPY_SIZEOF_DATETIME * CHAR_BIT)
+#define NPY_BITSOF_TIMEDELTA (NPY_SIZEOF_TIMEDELTA * CHAR_BIT)
+
+#if NPY_BITSOF_LONG == 8
+#define NPY_INT8 NPY_LONG
+#define NPY_UINT8 NPY_ULONG
+        typedef long npy_int8;
+        typedef unsigned long npy_uint8;
+#define PyInt8ScalarObject PyLongScalarObject
+#define PyInt8ArrType_Type PyLongArrType_Type
+#define PyUInt8ScalarObject PyULongScalarObject
+#define PyUInt8ArrType_Type PyULongArrType_Type
+#define NPY_INT8_FMT NPY_LONG_FMT
+#define NPY_UINT8_FMT NPY_ULONG_FMT
+#elif NPY_BITSOF_LONG == 16
+#define NPY_INT16 NPY_LONG
+#define NPY_UINT16 NPY_ULONG
+        typedef long npy_int16;
+        typedef unsigned long npy_uint16;
+#define PyInt16ScalarObject PyLongScalarObject
+#define PyInt16ArrType_Type PyLongArrType_Type
+#define PyUInt16ScalarObject PyULongScalarObject
+#define PyUInt16ArrType_Type PyULongArrType_Type
+#define NPY_INT16_FMT NPY_LONG_FMT
+#define NPY_UINT16_FMT NPY_ULONG_FMT
+#elif NPY_BITSOF_LONG == 32
+#define NPY_INT32 NPY_LONG
+#define NPY_UINT32 NPY_ULONG
+        typedef long npy_int32;
+        typedef unsigned long npy_uint32;
+        typedef unsigned long npy_ucs4;
+#define PyInt32ScalarObject PyLongScalarObject
+#define PyInt32ArrType_Type PyLongArrType_Type
+#define PyUInt32ScalarObject PyULongScalarObject
+#define PyUInt32ArrType_Type PyULongArrType_Type
+#define NPY_INT32_FMT NPY_LONG_FMT
+#define NPY_UINT32_FMT NPY_ULONG_FMT
+#elif NPY_BITSOF_LONG == 64
+#define NPY_INT64 NPY_LONG
+#define NPY_UINT64 NPY_ULONG
+        typedef long npy_int64;
+        typedef unsigned long npy_uint64;
+#define PyInt64ScalarObject PyLongScalarObject
+#define PyInt64ArrType_Type PyLongArrType_Type
+#define PyUInt64ScalarObject PyULongScalarObject
+#define PyUInt64ArrType_Type PyULongArrType_Type
+#define NPY_INT64_FMT NPY_LONG_FMT
+#define NPY_UINT64_FMT NPY_ULONG_FMT
+#define MyPyLong_FromInt64 PyLong_FromLong
+#define MyPyLong_AsInt64 PyLong_AsLong
+#elif NPY_BITSOF_LONG == 128
+#define NPY_INT128 NPY_LONG
+#define NPY_UINT128 NPY_ULONG
+        typedef long npy_int128;
+        typedef unsigned long npy_uint128;
+#define PyInt128ScalarObject PyLongScalarObject
+#define PyInt128ArrType_Type PyLongArrType_Type
+#define PyUInt128ScalarObject PyULongScalarObject
+#define PyUInt128ArrType_Type PyULongArrType_Type
+#define NPY_INT128_FMT NPY_LONG_FMT
+#define NPY_UINT128_FMT NPY_ULONG_FMT
+#endif
+
+#if NPY_BITSOF_LONGLONG == 8
+#  ifndef NPY_INT8
+#    define NPY_INT8 NPY_LONGLONG
+#    define NPY_UINT8 NPY_ULONGLONG
+        typedef npy_longlong npy_int8;
+        typedef npy_ulonglong npy_uint8;
+#    define PyInt8ScalarObject PyLongLongScalarObject
+#    define PyInt8ArrType_Type PyLongLongArrType_Type
+#    define PyUInt8ScalarObject PyULongLongScalarObject
+#    define PyUInt8ArrType_Type PyULongLongArrType_Type
+#define NPY_INT8_FMT NPY_LONGLONG_FMT
+#define NPY_UINT8_FMT NPY_ULONGLONG_FMT
+#  endif
+#  define NPY_MAX_LONGLONG NPY_MAX_INT8
+#  define NPY_MIN_LONGLONG NPY_MIN_INT8
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT8
+#elif NPY_BITSOF_LONGLONG == 16
+#  ifndef NPY_INT16
+#    define NPY_INT16 NPY_LONGLONG
+#    define NPY_UINT16 NPY_ULONGLONG
+        typedef npy_longlong npy_int16;
+        typedef npy_ulonglong npy_uint16;
+#    define PyInt16ScalarObject PyLongLongScalarObject
+#    define PyInt16ArrType_Type PyLongLongArrType_Type
+#    define PyUInt16ScalarObject PyULongLongScalarObject
+#    define PyUInt16ArrType_Type PyULongLongArrType_Type
+#define NPY_INT16_FMT NPY_LONGLONG_FMT
+#define NPY_UINT16_FMT NPY_ULONGLONG_FMT
+#  endif
+#  define NPY_MAX_LONGLONG NPY_MAX_INT16
+#  define NPY_MIN_LONGLONG NPY_MIN_INT16
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT16
+#elif NPY_BITSOF_LONGLONG == 32
+#  ifndef NPY_INT32
+#    define NPY_INT32 NPY_LONGLONG
+#    define NPY_UINT32 NPY_ULONGLONG
+        typedef npy_longlong npy_int32;
+        typedef npy_ulonglong npy_uint32;
+        typedef npy_ulonglong npy_ucs4;
+#    define PyInt32ScalarObject PyLongLongScalarObject
+#    define PyInt32ArrType_Type PyLongLongArrType_Type
+#    define PyUInt32ScalarObject PyULongLongScalarObject
+#    define PyUInt32ArrType_Type PyULongLongArrType_Type
+#define NPY_INT32_FMT NPY_LONGLONG_FMT
+#define NPY_UINT32_FMT NPY_ULONGLONG_FMT
+#  endif
+#  define NPY_MAX_LONGLONG NPY_MAX_INT32
+#  define NPY_MIN_LONGLONG NPY_MIN_INT32
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT32
+#elif NPY_BITSOF_LONGLONG == 64
+#  ifndef NPY_INT64
+#    define NPY_INT64 NPY_LONGLONG
+#    define NPY_UINT64 NPY_ULONGLONG
+        typedef npy_longlong npy_int64;
+        typedef npy_ulonglong npy_uint64;
+#    define PyInt64ScalarObject PyLongLongScalarObject
+#    define PyInt64ArrType_Type PyLongLongArrType_Type
+#    define PyUInt64ScalarObject PyULongLongScalarObject
+#    define PyUInt64ArrType_Type PyULongLongArrType_Type
+#define NPY_INT64_FMT NPY_LONGLONG_FMT
+#define NPY_UINT64_FMT NPY_ULONGLONG_FMT
+#    define MyPyLong_FromInt64 PyLong_FromLongLong
+#    define MyPyLong_AsInt64 PyLong_AsLongLong
+#  endif
+#  define NPY_MAX_LONGLONG NPY_MAX_INT64
+#  define NPY_MIN_LONGLONG NPY_MIN_INT64
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT64
+#elif NPY_BITSOF_LONGLONG == 128
+#  ifndef NPY_INT128
+#    define NPY_INT128 NPY_LONGLONG
+#    define NPY_UINT128 NPY_ULONGLONG
+        typedef npy_longlong npy_int128;
+        typedef npy_ulonglong npy_uint128;
+#    define PyInt128ScalarObject PyLongLongScalarObject
+#    define PyInt128ArrType_Type PyLongLongArrType_Type
+#    define PyUInt128ScalarObject PyULongLongScalarObject
+#    define PyUInt128ArrType_Type PyULongLongArrType_Type
+#define NPY_INT128_FMT NPY_LONGLONG_FMT
+#define NPY_UINT128_FMT NPY_ULONGLONG_FMT
+#  endif
+#  define NPY_MAX_LONGLONG NPY_MAX_INT128
+#  define NPY_MIN_LONGLONG NPY_MIN_INT128
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT128
+#elif NPY_BITSOF_LONGLONG == 256
+#  define NPY_INT256 NPY_LONGLONG
+#  define NPY_UINT256 NPY_ULONGLONG
+        typedef npy_longlong npy_int256;
+        typedef npy_ulonglong npy_uint256;
+#  define PyInt256ScalarObject PyLongLongScalarObject
+#  define PyInt256ArrType_Type PyLongLongArrType_Type
+#  define PyUInt256ScalarObject PyULongLongScalarObject
+#  define PyUInt256ArrType_Type PyULongLongArrType_Type
+#define NPY_INT256_FMT NPY_LONGLONG_FMT
+#define NPY_UINT256_FMT NPY_ULONGLONG_FMT
+#  define NPY_MAX_LONGLONG NPY_MAX_INT256
+#  define NPY_MIN_LONGLONG NPY_MIN_INT256
+#  define NPY_MAX_ULONGLONG NPY_MAX_UINT256
+#endif
+
+#if NPY_BITSOF_INT == 8
+#ifndef NPY_INT8
+#define NPY_INT8 NPY_INT
+#define NPY_UINT8 NPY_UINT
+        typedef int npy_int8;
+        typedef unsigned int npy_uint8;
+#    define PyInt8ScalarObject PyIntScalarObject
+#    define PyInt8ArrType_Type PyIntArrType_Type
+#    define PyUInt8ScalarObject PyUIntScalarObject
+#    define PyUInt8ArrType_Type PyUIntArrType_Type
+#define NPY_INT8_FMT NPY_INT_FMT
+#define NPY_UINT8_FMT NPY_UINT_FMT
+#endif
+#elif NPY_BITSOF_INT == 16
+#ifndef NPY_INT16
+#define NPY_INT16 NPY_INT
+#define NPY_UINT16 NPY_UINT
+        typedef int npy_int16;
+        typedef unsigned int npy_uint16;
+#    define PyInt16ScalarObject PyIntScalarObject
+#    define PyInt16ArrType_Type PyIntArrType_Type
+#    define PyUInt16ScalarObject PyIntUScalarObject
+#    define PyUInt16ArrType_Type PyIntUArrType_Type
+#define NPY_INT16_FMT NPY_INT_FMT
+#define NPY_UINT16_FMT NPY_UINT_FMT
+#endif
+#elif NPY_BITSOF_INT == 32
+#ifndef NPY_INT32
+#define NPY_INT32 NPY_INT
+#define NPY_UINT32 NPY_UINT
+        typedef int npy_int32;
+        typedef unsigned int npy_uint32;
+        typedef unsigned int npy_ucs4;
+#    define PyInt32ScalarObject PyIntScalarObject
+#    define PyInt32ArrType_Type PyIntArrType_Type
+#    define PyUInt32ScalarObject PyUIntScalarObject
+#    define PyUInt32ArrType_Type PyUIntArrType_Type
+#define NPY_INT32_FMT NPY_INT_FMT
+#define NPY_UINT32_FMT NPY_UINT_FMT
+#endif
+#elif NPY_BITSOF_INT == 64
+#ifndef NPY_INT64
+#define NPY_INT64 NPY_INT
+#define NPY_UINT64 NPY_UINT
+        typedef int npy_int64;
+        typedef unsigned int npy_uint64;
+#    define PyInt64ScalarObject PyIntScalarObject
+#    define PyInt64ArrType_Type PyIntArrType_Type
+#    define PyUInt64ScalarObject PyUIntScalarObject
+#    define PyUInt64ArrType_Type PyUIntArrType_Type
+#define NPY_INT64_FMT NPY_INT_FMT
+#define NPY_UINT64_FMT NPY_UINT_FMT
+#    define MyPyLong_FromInt64 PyLong_FromLong
+#    define MyPyLong_AsInt64 PyLong_AsLong
+#endif
+#elif NPY_BITSOF_INT == 128
+#ifndef NPY_INT128
+#define NPY_INT128 NPY_INT
+#define NPY_UINT128 NPY_UINT
+        typedef int npy_int128;
+        typedef unsigned int npy_uint128;
+#    define PyInt128ScalarObject PyIntScalarObject
+#    define PyInt128ArrType_Type PyIntArrType_Type
+#    define PyUInt128ScalarObject PyUIntScalarObject
+#    define PyUInt128ArrType_Type PyUIntArrType_Type
+#define NPY_INT128_FMT NPY_INT_FMT
+#define NPY_UINT128_FMT NPY_UINT_FMT
+#endif
+#endif
+
+#if NPY_BITSOF_SHORT == 8
+#ifndef NPY_INT8
+#define NPY_INT8 NPY_SHORT
+#define NPY_UINT8 NPY_USHORT
+        typedef short npy_int8;
+        typedef unsigned short npy_uint8;
+#    define PyInt8ScalarObject PyShortScalarObject
+#    define PyInt8ArrType_Type PyShortArrType_Type
+#    define PyUInt8ScalarObject PyUShortScalarObject
+#    define PyUInt8ArrType_Type PyUShortArrType_Type
+#define NPY_INT8_FMT NPY_SHORT_FMT
+#define NPY_UINT8_FMT NPY_USHORT_FMT
+#endif
+#elif NPY_BITSOF_SHORT == 16
+#ifndef NPY_INT16
+#define NPY_INT16 NPY_SHORT
+#define NPY_UINT16 NPY_USHORT
+        typedef short npy_int16;
+        typedef unsigned short npy_uint16;
+#    define PyInt16ScalarObject PyShortScalarObject
+#    define PyInt16ArrType_Type PyShortArrType_Type
+#    define PyUInt16ScalarObject PyUShortScalarObject
+#    define PyUInt16ArrType_Type PyUShortArrType_Type
+#define NPY_INT16_FMT NPY_SHORT_FMT
+#define NPY_UINT16_FMT NPY_USHORT_FMT
+#endif
+#elif NPY_BITSOF_SHORT == 32
+#ifndef NPY_INT32
+#define NPY_INT32 NPY_SHORT
+#define NPY_UINT32 NPY_USHORT
+        typedef short npy_int32;
+        typedef unsigned short npy_uint32;
+        typedef unsigned short npy_ucs4;
+#    define PyInt32ScalarObject PyShortScalarObject
+#    define PyInt32ArrType_Type PyShortArrType_Type
+#    define PyUInt32ScalarObject PyUShortScalarObject
+#    define PyUInt32ArrType_Type PyUShortArrType_Type
+#define NPY_INT32_FMT NPY_SHORT_FMT
+#define NPY_UINT32_FMT NPY_USHORT_FMT
+#endif
+#elif NPY_BITSOF_SHORT == 64
+#ifndef NPY_INT64
+#define NPY_INT64 NPY_SHORT
+#define NPY_UINT64 NPY_USHORT
+        typedef short npy_int64;
+        typedef unsigned short npy_uint64;
+#    define PyInt64ScalarObject PyShortScalarObject
+#    define PyInt64ArrType_Type PyShortArrType_Type
+#    define PyUInt64ScalarObject PyUShortScalarObject
+#    define PyUInt64ArrType_Type PyUShortArrType_Type
+#define NPY_INT64_FMT NPY_SHORT_FMT
+#define NPY_UINT64_FMT NPY_USHORT_FMT
+#    define MyPyLong_FromInt64 PyLong_FromLong
+#    define MyPyLong_AsInt64 PyLong_AsLong
+#endif
+#elif NPY_BITSOF_SHORT == 128
+#ifndef NPY_INT128
+#define NPY_INT128 NPY_SHORT
+#define NPY_UINT128 NPY_USHORT
+        typedef short npy_int128;
+        typedef unsigned short npy_uint128;
+#    define PyInt128ScalarObject PyShortScalarObject
+#    define PyInt128ArrType_Type PyShortArrType_Type
+#    define PyUInt128ScalarObject PyUShortScalarObject
+#    define PyUInt128ArrType_Type PyUShortArrType_Type
+#define NPY_INT128_FMT NPY_SHORT_FMT
+#define NPY_UINT128_FMT NPY_USHORT_FMT
+#endif
+#endif
+
+
+#if NPY_BITSOF_CHAR == 8
+#ifndef NPY_INT8
+#define NPY_INT8 NPY_BYTE
+#define NPY_UINT8 NPY_UBYTE
+        typedef signed char npy_int8;
+        typedef unsigned char npy_uint8;
+#    define PyInt8ScalarObject PyByteScalarObject
+#    define PyInt8ArrType_Type PyByteArrType_Type
+#    define PyUInt8ScalarObject PyUByteScalarObject
+#    define PyUInt8ArrType_Type PyUByteArrType_Type
+#define NPY_INT8_FMT NPY_BYTE_FMT
+#define NPY_UINT8_FMT NPY_UBYTE_FMT
+#endif
+#elif NPY_BITSOF_CHAR == 16
+#ifndef NPY_INT16
+#define NPY_INT16 NPY_BYTE
+#define NPY_UINT16 NPY_UBYTE
+        typedef signed char npy_int16;
+        typedef unsigned char npy_uint16;
+#    define PyInt16ScalarObject PyByteScalarObject
+#    define PyInt16ArrType_Type PyByteArrType_Type
+#    define PyUInt16ScalarObject PyUByteScalarObject
+#    define PyUInt16ArrType_Type PyUByteArrType_Type
+#define NPY_INT16_FMT NPY_BYTE_FMT
+#define NPY_UINT16_FMT NPY_UBYTE_FMT
+#endif
+#elif NPY_BITSOF_CHAR == 32
+#ifndef NPY_INT32
+#define NPY_INT32 NPY_BYTE
+#define NPY_UINT32 NPY_UBYTE
+        typedef signed char npy_int32;
+        typedef unsigned char npy_uint32;
+        typedef unsigned char npy_ucs4;
+#    define PyInt32ScalarObject PyByteScalarObject
+#    define PyInt32ArrType_Type PyByteArrType_Type
+#    define PyUInt32ScalarObject PyUByteScalarObject
+#    define PyUInt32ArrType_Type PyUByteArrType_Type
+#define NPY_INT32_FMT NPY_BYTE_FMT
+#define NPY_UINT32_FMT NPY_UBYTE_FMT
+#endif
+#elif NPY_BITSOF_CHAR == 64
+#ifndef NPY_INT64
+#define NPY_INT64 NPY_BYTE
+#define NPY_UINT64 NPY_UBYTE
+        typedef signed char npy_int64;
+        typedef unsigned char npy_uint64;
+#    define PyInt64ScalarObject PyByteScalarObject
+#    define PyInt64ArrType_Type PyByteArrType_Type
+#    define PyUInt64ScalarObject PyUByteScalarObject
+#    define PyUInt64ArrType_Type PyUByteArrType_Type
+#define NPY_INT64_FMT NPY_BYTE_FMT
+#define NPY_UINT64_FMT NPY_UBYTE_FMT
+#    define MyPyLong_FromInt64 PyLong_FromLong
+#    define MyPyLong_AsInt64 PyLong_AsLong
+#endif
+#elif NPY_BITSOF_CHAR == 128
+#ifndef NPY_INT128
+#define NPY_INT128 NPY_BYTE
+#define NPY_UINT128 NPY_UBYTE
+        typedef signed char npy_int128;
+        typedef unsigned char npy_uint128;
+#    define PyInt128ScalarObject PyByteScalarObject
+#    define PyInt128ArrType_Type PyByteArrType_Type
+#    define PyUInt128ScalarObject PyUByteScalarObject
+#    define PyUInt128ArrType_Type PyUByteArrType_Type
+#define NPY_INT128_FMT NPY_BYTE_FMT
+#define NPY_UINT128_FMT NPY_UBYTE_FMT
+#endif
+#endif
+
+
+
+#if NPY_BITSOF_DOUBLE == 32
+#ifndef NPY_FLOAT32
+#define NPY_FLOAT32 NPY_DOUBLE
+#define NPY_COMPLEX64 NPY_CDOUBLE
+        typedef double npy_float32;
+        typedef npy_cdouble npy_complex64;
+#    define PyFloat32ScalarObject PyDoubleScalarObject
+#    define PyComplex64ScalarObject PyCDoubleScalarObject
+#    define PyFloat32ArrType_Type PyDoubleArrType_Type
+#    define PyComplex64ArrType_Type PyCDoubleArrType_Type
+#define NPY_FLOAT32_FMT NPY_DOUBLE_FMT
+#define NPY_COMPLEX64_FMT NPY_CDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_DOUBLE == 64
+#ifndef NPY_FLOAT64
+#define NPY_FLOAT64 NPY_DOUBLE
+#define NPY_COMPLEX128 NPY_CDOUBLE
+        typedef double npy_float64;
+        typedef npy_cdouble npy_complex128;
+#    define PyFloat64ScalarObject PyDoubleScalarObject
+#    define PyComplex128ScalarObject PyCDoubleScalarObject
+#    define PyFloat64ArrType_Type PyDoubleArrType_Type
+#    define PyComplex128ArrType_Type PyCDoubleArrType_Type
+#define NPY_FLOAT64_FMT NPY_DOUBLE_FMT
+#define NPY_COMPLEX128_FMT NPY_CDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_DOUBLE == 80
+#ifndef NPY_FLOAT80
+#define NPY_FLOAT80 NPY_DOUBLE
+#define NPY_COMPLEX160 NPY_CDOUBLE
+        typedef double npy_float80;
+        typedef npy_cdouble npy_complex160;
+#    define PyFloat80ScalarObject PyDoubleScalarObject
+#    define PyComplex160ScalarObject PyCDoubleScalarObject
+#    define PyFloat80ArrType_Type PyDoubleArrType_Type
+#    define PyComplex160ArrType_Type PyCDoubleArrType_Type
+#define NPY_FLOAT80_FMT NPY_DOUBLE_FMT
+#define NPY_COMPLEX160_FMT NPY_CDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_DOUBLE == 96
+#ifndef NPY_FLOAT96
+#define NPY_FLOAT96 NPY_DOUBLE
+#define NPY_COMPLEX192 NPY_CDOUBLE
+        typedef double npy_float96;
+        typedef npy_cdouble npy_complex192;
+#    define PyFloat96ScalarObject PyDoubleScalarObject
+#    define PyComplex192ScalarObject PyCDoubleScalarObject
+#    define PyFloat96ArrType_Type PyDoubleArrType_Type
+#    define PyComplex192ArrType_Type PyCDoubleArrType_Type
+#define NPY_FLOAT96_FMT NPY_DOUBLE_FMT
+#define NPY_COMPLEX192_FMT NPY_CDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_DOUBLE == 128
+#ifndef NPY_FLOAT128
+#define NPY_FLOAT128 NPY_DOUBLE
+#define NPY_COMPLEX256 NPY_CDOUBLE
+        typedef double npy_float128;
+        typedef npy_cdouble npy_complex256;
+#    define PyFloat128ScalarObject PyDoubleScalarObject
+#    define PyComplex256ScalarObject PyCDoubleScalarObject
+#    define PyFloat128ArrType_Type PyDoubleArrType_Type
+#    define PyComplex256ArrType_Type PyCDoubleArrType_Type
+#define NPY_FLOAT128_FMT NPY_DOUBLE_FMT
+#define NPY_COMPLEX256_FMT NPY_CDOUBLE_FMT
+#endif
+#endif
+
+
+
+#if NPY_BITSOF_FLOAT == 32
+#ifndef NPY_FLOAT32
+#define NPY_FLOAT32 NPY_FLOAT
+#define NPY_COMPLEX64 NPY_CFLOAT
+        typedef float npy_float32;
+        typedef npy_cfloat npy_complex64;
+#    define PyFloat32ScalarObject PyFloatScalarObject
+#    define PyComplex64ScalarObject PyCFloatScalarObject
+#    define PyFloat32ArrType_Type PyFloatArrType_Type
+#    define PyComplex64ArrType_Type PyCFloatArrType_Type
+#define NPY_FLOAT32_FMT NPY_FLOAT_FMT
+#define NPY_COMPLEX64_FMT NPY_CFLOAT_FMT
+#endif
+#elif NPY_BITSOF_FLOAT == 64
+#ifndef NPY_FLOAT64
+#define NPY_FLOAT64 NPY_FLOAT
+#define NPY_COMPLEX128 NPY_CFLOAT
+        typedef float npy_float64;
+        typedef npy_cfloat npy_complex128;
+#    define PyFloat64ScalarObject PyFloatScalarObject
+#    define PyComplex128ScalarObject PyCFloatScalarObject
+#    define PyFloat64ArrType_Type PyFloatArrType_Type
+#    define PyComplex128ArrType_Type PyCFloatArrType_Type
+#define NPY_FLOAT64_FMT NPY_FLOAT_FMT
+#define NPY_COMPLEX128_FMT NPY_CFLOAT_FMT
+#endif
+#elif NPY_BITSOF_FLOAT == 80
+#ifndef NPY_FLOAT80
+#define NPY_FLOAT80 NPY_FLOAT
+#define NPY_COMPLEX160 NPY_CFLOAT
+        typedef float npy_float80;
+        typedef npy_cfloat npy_complex160;
+#    define PyFloat80ScalarObject PyFloatScalarObject
+#    define PyComplex160ScalarObject PyCFloatScalarObject
+#    define PyFloat80ArrType_Type PyFloatArrType_Type
+#    define PyComplex160ArrType_Type PyCFloatArrType_Type
+#define NPY_FLOAT80_FMT NPY_FLOAT_FMT
+#define NPY_COMPLEX160_FMT NPY_CFLOAT_FMT
+#endif
+#elif NPY_BITSOF_FLOAT == 96
+#ifndef NPY_FLOAT96
+#define NPY_FLOAT96 NPY_FLOAT
+#define NPY_COMPLEX192 NPY_CFLOAT
+        typedef float npy_float96;
+        typedef npy_cfloat npy_complex192;
+#    define PyFloat96ScalarObject PyFloatScalarObject
+#    define PyComplex192ScalarObject PyCFloatScalarObject
+#    define PyFloat96ArrType_Type PyFloatArrType_Type
+#    define PyComplex192ArrType_Type PyCFloatArrType_Type
+#define NPY_FLOAT96_FMT NPY_FLOAT_FMT
+#define NPY_COMPLEX192_FMT NPY_CFLOAT_FMT
+#endif
+#elif NPY_BITSOF_FLOAT == 128
+#ifndef NPY_FLOAT128
+#define NPY_FLOAT128 NPY_FLOAT
+#define NPY_COMPLEX256 NPY_CFLOAT
+        typedef float npy_float128;
+        typedef npy_cfloat npy_complex256;
+#    define PyFloat128ScalarObject PyFloatScalarObject
+#    define PyComplex256ScalarObject PyCFloatScalarObject
+#    define PyFloat128ArrType_Type PyFloatArrType_Type
+#    define PyComplex256ArrType_Type PyCFloatArrType_Type
+#define NPY_FLOAT128_FMT NPY_FLOAT_FMT
+#define NPY_COMPLEX256_FMT NPY_CFLOAT_FMT
+#endif
+#endif
+
+/* half/float16 isn't a floating-point type in C */
+#define NPY_FLOAT16 NPY_HALF
+typedef npy_uint16 npy_half;
+typedef npy_half npy_float16;
+
+#if NPY_BITSOF_LONGDOUBLE == 32
+#ifndef NPY_FLOAT32
+#define NPY_FLOAT32 NPY_LONGDOUBLE
+#define NPY_COMPLEX64 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float32;
+        typedef npy_clongdouble npy_complex64;
+#    define PyFloat32ScalarObject PyLongDoubleScalarObject
+#    define PyComplex64ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat32ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex64ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT32_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX64_FMT NPY_CLONGDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_LONGDOUBLE == 64
+#ifndef NPY_FLOAT64
+#define NPY_FLOAT64 NPY_LONGDOUBLE
+#define NPY_COMPLEX128 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float64;
+        typedef npy_clongdouble npy_complex128;
+#    define PyFloat64ScalarObject PyLongDoubleScalarObject
+#    define PyComplex128ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat64ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex128ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT64_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX128_FMT NPY_CLONGDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_LONGDOUBLE == 80
+#ifndef NPY_FLOAT80
+#define NPY_FLOAT80 NPY_LONGDOUBLE
+#define NPY_COMPLEX160 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float80;
+        typedef npy_clongdouble npy_complex160;
+#    define PyFloat80ScalarObject PyLongDoubleScalarObject
+#    define PyComplex160ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat80ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex160ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT80_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX160_FMT NPY_CLONGDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_LONGDOUBLE == 96
+#ifndef NPY_FLOAT96
+#define NPY_FLOAT96 NPY_LONGDOUBLE
+#define NPY_COMPLEX192 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float96;
+        typedef npy_clongdouble npy_complex192;
+#    define PyFloat96ScalarObject PyLongDoubleScalarObject
+#    define PyComplex192ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat96ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex192ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT96_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX192_FMT NPY_CLONGDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_LONGDOUBLE == 128
+#ifndef NPY_FLOAT128
+#define NPY_FLOAT128 NPY_LONGDOUBLE
+#define NPY_COMPLEX256 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float128;
+        typedef npy_clongdouble npy_complex256;
+#    define PyFloat128ScalarObject PyLongDoubleScalarObject
+#    define PyComplex256ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat128ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex256ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT128_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX256_FMT NPY_CLONGDOUBLE_FMT
+#endif
+#elif NPY_BITSOF_LONGDOUBLE == 256
+#define NPY_FLOAT256 NPY_LONGDOUBLE
+#define NPY_COMPLEX512 NPY_CLONGDOUBLE
+        typedef npy_longdouble npy_float256;
+        typedef npy_clongdouble npy_complex512;
+#    define PyFloat256ScalarObject PyLongDoubleScalarObject
+#    define PyComplex512ScalarObject PyCLongDoubleScalarObject
+#    define PyFloat256ArrType_Type PyLongDoubleArrType_Type
+#    define PyComplex512ArrType_Type PyCLongDoubleArrType_Type
+#define NPY_FLOAT256_FMT NPY_LONGDOUBLE_FMT
+#define NPY_COMPLEX512_FMT NPY_CLONGDOUBLE_FMT
+#endif
+
+/* datetime typedefs */
+typedef npy_int64 npy_timedelta;
+typedef npy_int64 npy_datetime;
+#define NPY_DATETIME_FMT NPY_INT64_FMT
+#define NPY_TIMEDELTA_FMT NPY_INT64_FMT
+
+/* End of typedefs for numarray style bit-width names */
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NPY_COMMON_H_ */

.venv/lib/python3.11/site-packages/numpy/core/include/numpy/npy_cpu.h

@@ -0,0 +1,129 @@
+/*
+ * This set (target) cpu specific macros:
+ *      - Possible values:
+ *              NPY_CPU_X86
+ *              NPY_CPU_AMD64
+ *              NPY_CPU_PPC
+ *              NPY_CPU_PPC64
+ *              NPY_CPU_PPC64LE
+ *              NPY_CPU_SPARC
+ *              NPY_CPU_S390
+ *              NPY_CPU_IA64
+ *              NPY_CPU_HPPA
+ *              NPY_CPU_ALPHA
+ *              NPY_CPU_ARMEL
+ *              NPY_CPU_ARMEB
+ *              NPY_CPU_SH_LE
+ *              NPY_CPU_SH_BE
+ *              NPY_CPU_ARCEL
+ *              NPY_CPU_ARCEB
+ *              NPY_CPU_RISCV64
+ *              NPY_CPU_LOONGARCH
+ *              NPY_CPU_WASM
+ */
+#ifndef NUMPY_CORE_INCLUDE_NUMPY_NPY_CPU_H_
+#define NUMPY_CORE_INCLUDE_NUMPY_NPY_CPU_H_
+
+#include "numpyconfig.h"
+
+#if defined( __i386__ ) || defined(i386) || defined(_M_IX86)
+    /*
+     * __i386__ is defined by gcc and Intel compiler on Linux,
+     * _M_IX86 by VS compiler,
+     * i386 by Sun compilers on opensolaris at least
+     */
+    #define NPY_CPU_X86
+#elif defined(__x86_64__) || defined(__amd64__) || defined(__x86_64) || defined(_M_AMD64)
+    /*
+     * both __x86_64__ and __amd64__ are defined by gcc
+     * __x86_64 defined by sun compiler on opensolaris at least
+     * _M_AMD64 defined by MS compiler
+     */
+    #define NPY_CPU_AMD64
+#elif defined(__powerpc64__) && defined(__LITTLE_ENDIAN__)
+    #define NPY_CPU_PPC64LE
+#elif defined(__powerpc64__) && defined(__BIG_ENDIAN__)
+    #define NPY_CPU_PPC64
+#elif defined(__ppc__) || defined(__powerpc__) || defined(_ARCH_PPC)
+    /*
+     * __ppc__ is defined by gcc, I remember having seen __powerpc__ once,
+     * but can't find it ATM
+     * _ARCH_PPC is used by at least gcc on AIX
+     * As __powerpc__ and _ARCH_PPC are also defined by PPC64 check
+     * for those specifically first before defaulting to ppc
+     */
+    #define NPY_CPU_PPC
+#elif defined(__sparc__) || defined(__sparc)
+    /* __sparc__ is defined by gcc and Forte (e.g. Sun) compilers */
+    #define NPY_CPU_SPARC
+#elif defined(__s390__)
+    #define NPY_CPU_S390
+#elif defined(__ia64)
+    #define NPY_CPU_IA64
+#elif defined(__hppa)
+    #define NPY_CPU_HPPA
+#elif defined(__alpha__)
+    #define NPY_CPU_ALPHA
+#elif defined(__arm__) || defined(__aarch64__) || defined(_M_ARM64)
+    /* _M_ARM64 is defined in MSVC for ARM64 compilation on Windows */
+    #if defined(__ARMEB__) || defined(__AARCH64EB__)
+        #if defined(__ARM_32BIT_STATE)
+            #define NPY_CPU_ARMEB_AARCH32
+        #elif defined(__ARM_64BIT_STATE)
+            #define NPY_CPU_ARMEB_AARCH64
+        #else
+            #define NPY_CPU_ARMEB
+        #endif
+    #elif defined(__ARMEL__) || defined(__AARCH64EL__) || defined(_M_ARM64)
+        #if defined(__ARM_32BIT_STATE)
+            #define NPY_CPU_ARMEL_AARCH32
+        #elif defined(__ARM_64BIT_STATE) || defined(_M_ARM64) || defined(__AARCH64EL__)
+            #define NPY_CPU_ARMEL_AARCH64
+        #else
+            #define NPY_CPU_ARMEL
+        #endif
+    #else
+        # error Unknown ARM CPU, please report this to numpy maintainers with \
+	information about your platform (OS, CPU and compiler)
+    #endif
+#elif defined(__sh__) && defined(__LITTLE_ENDIAN__)
+    #define NPY_CPU_SH_LE
+#elif defined(__sh__) && defined(__BIG_ENDIAN__)
+    #define NPY_CPU_SH_BE
+#elif defined(__MIPSEL__)
+    #define NPY_CPU_MIPSEL
+#elif defined(__MIPSEB__)
+    #define NPY_CPU_MIPSEB
+#elif defined(__or1k__)
+    #define NPY_CPU_OR1K
+#elif defined(__mc68000__)
+    #define NPY_CPU_M68K
+#elif defined(__arc__) && defined(__LITTLE_ENDIAN__)
+    #define NPY_CPU_ARCEL
+#elif defined(__arc__) && defined(__BIG_ENDIAN__)
+    #define NPY_CPU_ARCEB
+#elif defined(__riscv) && defined(__riscv_xlen) && __riscv_xlen == 64
+    #define NPY_CPU_RISCV64
+#elif defined(__loongarch__)
+    #define NPY_CPU_LOONGARCH
+#elif defined(__EMSCRIPTEN__)
+    /* __EMSCRIPTEN__ is defined by emscripten: an LLVM-to-Web compiler */
+    #define NPY_CPU_WASM
+#else
+    #error Unknown CPU, please report this to numpy maintainers with \
+    information about your platform (OS, CPU and compiler)
+#endif
+
+/*
+ * Except for the following architectures, memory access is limited to the natural
+ * alignment of data types otherwise it may lead to bus error or performance regression.
+ * For more details about unaligned access, see https://www.kernel.org/doc/Documentation/unaligned-memory-access.txt.
+*/
+#if defined(NPY_CPU_X86) || defined(NPY_CPU_AMD64) || defined(__aarch64__) || defined(__powerpc64__)
+    #define NPY_ALIGNMENT_REQUIRED 0
+#endif
+#ifndef NPY_ALIGNMENT_REQUIRED
+    #define NPY_ALIGNMENT_REQUIRED 1
+#endif
+
+#endif  /* NUMPY_CORE_INCLUDE_NUMPY_NPY_CPU_H_ */